diff options
Diffstat (limited to 'src')
152 files changed, 5085 insertions, 1044 deletions
diff --git a/src/Bindings/DeprecatedBindings.cpp b/src/Bindings/DeprecatedBindings.cpp index 408b1b84a..d51ba2da3 100644 --- a/src/Bindings/DeprecatedBindings.cpp +++ b/src/Bindings/DeprecatedBindings.cpp @@ -2,6 +2,7 @@ #include "Globals.h" // NOTE: MSVC stupidness requires this to be the same across all modules #include "DeprecatedBindings.h" +#undef TOLUA_TEMPLATE_BIND #include "tolua++/include/tolua++.h" #include "Plugin.h" @@ -20,47 +21,23 @@ #ifndef TOLUA_DISABLE_tolua_get_AllToLua_g_BlockLightValue static int tolua_get_AllToLua_g_BlockLightValue(lua_State* tolua_S) { - int tolua_index; + int BlockType; #ifndef TOLUA_RELEASE { tolua_Error tolua_err; if (!tolua_isnumber(tolua_S,2,0,&tolua_err)) + { tolua_error(tolua_S,"#vinvalid type in array indexing.",&tolua_err); + } } #endif - tolua_index = (int)tolua_tonumber(tolua_S,2,0); - #ifndef TOLUA_RELEASE - if (tolua_index<0) - tolua_error(tolua_S,"array indexing out of range.",NULL); - #endif - tolua_pushnumber(tolua_S,(lua_Number)cBlockInfo::GetLightValue(tolua_index)); - return 1; -} -#endif //#ifndef TOLUA_DISABLE - - - - - -/* set function: g_BlockLightValue */ -#ifndef TOLUA_DISABLE_tolua_set_AllToLua_g_BlockLightValue -static int tolua_set_AllToLua_g_BlockLightValue(lua_State* tolua_S) -{ - int tolua_index; - #ifndef TOLUA_RELEASE + BlockType = (int)tolua_tonumber(tolua_S, 2, 0); + if ((BlockType < 0) || (BlockType > E_BLOCK_MAX_TYPE_ID)) { - tolua_Error tolua_err; - if (!tolua_isnumber(tolua_S,2,0,&tolua_err)) - tolua_error(tolua_S,"#vinvalid type in array indexing.",&tolua_err); + tolua_error(tolua_S, "array indexing out of range.", NULL); } - #endif - tolua_index = (int)tolua_tonumber(tolua_S,2,0); - #ifndef TOLUA_RELEASE - if (tolua_index<0) - tolua_error(tolua_S,"array indexing out of range.",NULL); - #endif - cBlockInfo::Get(tolua_index).m_LightValue = ((unsigned char) tolua_tonumber(tolua_S,3,0)); - return 0; + tolua_pushnumber(tolua_S,(lua_Number)cBlockInfo::GetLightValue((BLOCKTYPE)BlockType)); + return 1; } #endif //#ifndef TOLUA_DISABLE @@ -72,7 +49,7 @@ static int tolua_set_AllToLua_g_BlockLightValue(lua_State* tolua_S) #ifndef TOLUA_DISABLE_tolua_get_AllToLua_g_BlockSpreadLightFalloff static int tolua_get_AllToLua_g_BlockSpreadLightFalloff(lua_State* tolua_S) { - int tolua_index; + int BlockType; #ifndef TOLUA_RELEASE { tolua_Error tolua_err; @@ -80,39 +57,13 @@ static int tolua_get_AllToLua_g_BlockSpreadLightFalloff(lua_State* tolua_S) tolua_error(tolua_S,"#vinvalid type in array indexing.",&tolua_err); } #endif - tolua_index = (int)tolua_tonumber(tolua_S,2,0); - #ifndef TOLUA_RELEASE - if (tolua_index<0) - tolua_error(tolua_S,"array indexing out of range.",NULL); - #endif - tolua_pushnumber(tolua_S,(lua_Number)cBlockInfo::GetSpreadLightFalloff(tolua_index)); - return 1; -} -#endif //#ifndef TOLUA_DISABLE - - - - - -/* set function: g_BlockSpreadLightFalloff */ -#ifndef TOLUA_DISABLE_tolua_set_AllToLua_g_BlockSpreadLightFalloff -static int tolua_set_AllToLua_g_BlockSpreadLightFalloff(lua_State* tolua_S) -{ - int tolua_index; - #ifndef TOLUA_RELEASE + BlockType = (int)tolua_tonumber(tolua_S, 2, 0); + if ((BlockType < 0) || (BlockType > E_BLOCK_MAX_TYPE_ID)) { - tolua_Error tolua_err; - if (!tolua_isnumber(tolua_S,2,0,&tolua_err)) - tolua_error(tolua_S,"#vinvalid type in array indexing.",&tolua_err); + tolua_error(tolua_S, "array indexing out of range.", NULL); } - #endif - tolua_index = (int)tolua_tonumber(tolua_S,2,0); - #ifndef TOLUA_RELEASE - if (tolua_index<0) - tolua_error(tolua_S,"array indexing out of range.",NULL); - #endif - cBlockInfo::Get(tolua_index).m_SpreadLightFalloff = ((unsigned char) tolua_tonumber(tolua_S,3,0)); - return 0; + tolua_pushnumber(tolua_S, (lua_Number)cBlockInfo::GetSpreadLightFalloff((BLOCKTYPE)BlockType)); + return 1; } #endif //#ifndef TOLUA_DISABLE @@ -124,7 +75,7 @@ static int tolua_set_AllToLua_g_BlockSpreadLightFalloff(lua_State* tolua_S) #ifndef TOLUA_DISABLE_tolua_get_AllToLua_g_BlockTransparent static int tolua_get_AllToLua_g_BlockTransparent(lua_State* tolua_S) { - int tolua_index; + int BlockType; #ifndef TOLUA_RELEASE { tolua_Error tolua_err; @@ -132,39 +83,13 @@ static int tolua_get_AllToLua_g_BlockTransparent(lua_State* tolua_S) tolua_error(tolua_S,"#vinvalid type in array indexing.",&tolua_err); } #endif - tolua_index = (int)tolua_tonumber(tolua_S,2,0); - #ifndef TOLUA_RELEASE - if (tolua_index<0) - tolua_error(tolua_S,"array indexing out of range.",NULL); - #endif - tolua_pushboolean(tolua_S, cBlockInfo::IsTransparent(tolua_index)); - return 1; -} -#endif //#ifndef TOLUA_DISABLE - - - - - -/* set function: g_BlockTransparent */ -#ifndef TOLUA_DISABLE_tolua_set_AllToLua_g_BlockTransparent -static int tolua_set_AllToLua_g_BlockTransparent(lua_State* tolua_S) -{ - int tolua_index; - #ifndef TOLUA_RELEASE + BlockType = (int)tolua_tonumber(tolua_S, 2, 0); + if ((BlockType < 0) || (BlockType > E_BLOCK_MAX_TYPE_ID)) { - tolua_Error tolua_err; - if (!tolua_isnumber(tolua_S,2,0,&tolua_err)) - tolua_error(tolua_S,"#vinvalid type in array indexing.",&tolua_err); + tolua_error(tolua_S, "array indexing out of range.", NULL); } - #endif - tolua_index = (int)tolua_tonumber(tolua_S,2,0); - #ifndef TOLUA_RELEASE - if (tolua_index<0) - tolua_error(tolua_S,"array indexing out of range.",NULL); - #endif - cBlockInfo::Get(tolua_index).m_Transparent = (tolua_toboolean(tolua_S,3,0) != 0); - return 0; + tolua_pushboolean(tolua_S, cBlockInfo::IsTransparent((BLOCKTYPE)BlockType)); + return 1; } #endif //#ifndef TOLUA_DISABLE @@ -176,7 +101,7 @@ static int tolua_set_AllToLua_g_BlockTransparent(lua_State* tolua_S) #ifndef TOLUA_DISABLE_tolua_get_AllToLua_g_BlockOneHitDig static int tolua_get_AllToLua_g_BlockOneHitDig(lua_State* tolua_S) { - int tolua_index; + int BlockType; #ifndef TOLUA_RELEASE { tolua_Error tolua_err; @@ -184,39 +109,13 @@ static int tolua_get_AllToLua_g_BlockOneHitDig(lua_State* tolua_S) tolua_error(tolua_S,"#vinvalid type in array indexing.",&tolua_err); } #endif - tolua_index = (int)tolua_tonumber(tolua_S,2,0); - #ifndef TOLUA_RELEASE - if (tolua_index<0) - tolua_error(tolua_S,"array indexing out of range.",NULL); - #endif - tolua_pushboolean(tolua_S,(bool)cBlockInfo::IsOneHitDig(tolua_index)); - return 1; -} -#endif //#ifndef TOLUA_DISABLE - - - - - -/* set function: g_BlockOneHitDig */ -#ifndef TOLUA_DISABLE_tolua_set_AllToLua_g_BlockOneHitDig -static int tolua_set_AllToLua_g_BlockOneHitDig(lua_State* tolua_S) -{ - int tolua_index; - #ifndef TOLUA_RELEASE + BlockType = (int)tolua_tonumber(tolua_S, 2, 0); + if ((BlockType < 0) || (BlockType > E_BLOCK_MAX_TYPE_ID)) { - tolua_Error tolua_err; - if (!tolua_isnumber(tolua_S,2,0,&tolua_err)) - tolua_error(tolua_S,"#vinvalid type in array indexing.",&tolua_err); + tolua_error(tolua_S, "array indexing out of range.", NULL); } - #endif - tolua_index = (int)tolua_tonumber(tolua_S,2,0); - #ifndef TOLUA_RELEASE - if (tolua_index<0) - tolua_error(tolua_S,"array indexing out of range.",NULL); - #endif - cBlockInfo::Get(tolua_index).m_OneHitDig = (tolua_toboolean(tolua_S,3,0) != 0); - return 0; + tolua_pushboolean(tolua_S, cBlockInfo::IsOneHitDig((BLOCKTYPE)BlockType)); + return 1; } #endif //#ifndef TOLUA_DISABLE @@ -228,7 +127,7 @@ static int tolua_set_AllToLua_g_BlockOneHitDig(lua_State* tolua_S) #ifndef TOLUA_DISABLE_tolua_get_AllToLua_g_BlockPistonBreakable static int tolua_get_AllToLua_g_BlockPistonBreakable(lua_State* tolua_S) { - int tolua_index; + int BlockType; #ifndef TOLUA_RELEASE { tolua_Error tolua_err; @@ -236,39 +135,13 @@ static int tolua_get_AllToLua_g_BlockPistonBreakable(lua_State* tolua_S) tolua_error(tolua_S,"#vinvalid type in array indexing.",&tolua_err); } #endif - tolua_index = (int)tolua_tonumber(tolua_S,2,0); - #ifndef TOLUA_RELEASE - if (tolua_index<0 || tolua_index>=256) - tolua_error(tolua_S,"array indexing out of range.",NULL); - #endif - tolua_pushboolean(tolua_S,(bool)cBlockInfo::IsPistonBreakable(tolua_index)); - return 1; -} -#endif //#ifndef TOLUA_DISABLE - - - - - -/* set function: g_BlockPistonBreakable */ -#ifndef TOLUA_DISABLE_tolua_set_AllToLua_g_BlockPistonBreakable -static int tolua_set_AllToLua_g_BlockPistonBreakable(lua_State* tolua_S) -{ - int tolua_index; - #ifndef TOLUA_RELEASE + BlockType = (int)tolua_tonumber(tolua_S, 2, 0); + if ((BlockType < 0) || (BlockType > E_BLOCK_MAX_TYPE_ID)) { - tolua_Error tolua_err; - if (!tolua_isnumber(tolua_S,2,0,&tolua_err)) - tolua_error(tolua_S,"#vinvalid type in array indexing.",&tolua_err); + tolua_error(tolua_S, "array indexing out of range.", NULL); } - #endif - tolua_index = (int)tolua_tonumber(tolua_S,2,0); - #ifndef TOLUA_RELEASE - if (tolua_index<0 || tolua_index>=256) - tolua_error(tolua_S,"array indexing out of range.",NULL); - #endif - cBlockInfo::Get(tolua_index).m_PistonBreakable = (tolua_toboolean(tolua_S,3,0) != 0); - return 0; + tolua_pushboolean(tolua_S, cBlockInfo::IsPistonBreakable((BLOCKTYPE)BlockType)); + return 1; } #endif //#ifndef TOLUA_DISABLE @@ -280,7 +153,7 @@ static int tolua_set_AllToLua_g_BlockPistonBreakable(lua_State* tolua_S) #ifndef TOLUA_DISABLE_tolua_get_AllToLua_g_BlockIsSnowable static int tolua_get_AllToLua_g_BlockIsSnowable(lua_State* tolua_S) { - int tolua_index; + int BlockType; #ifndef TOLUA_RELEASE { tolua_Error tolua_err; @@ -288,39 +161,13 @@ static int tolua_get_AllToLua_g_BlockIsSnowable(lua_State* tolua_S) tolua_error(tolua_S,"#vinvalid type in array indexing.",&tolua_err); } #endif - tolua_index = (int)tolua_tonumber(tolua_S,2,0); - #ifndef TOLUA_RELEASE - if (tolua_index<0 || tolua_index>=256) - tolua_error(tolua_S,"array indexing out of range.",NULL); - #endif - tolua_pushboolean(tolua_S,(bool)cBlockInfo::IsSnowable(tolua_index)); - return 1; -} -#endif //#ifndef TOLUA_DISABLE - - - - - -/* set function: g_BlockIsSnowable */ -#ifndef TOLUA_DISABLE_tolua_set_AllToLua_g_BlockIsSnowable -static int tolua_set_AllToLua_g_BlockIsSnowable(lua_State* tolua_S) -{ - int tolua_index; - #ifndef TOLUA_RELEASE + BlockType = (int)tolua_tonumber(tolua_S, 2, 0); + if ((BlockType < 0) || (BlockType > E_BLOCK_MAX_TYPE_ID)) { - tolua_Error tolua_err; - if (!tolua_isnumber(tolua_S,2,0,&tolua_err)) - tolua_error(tolua_S,"#vinvalid type in array indexing.",&tolua_err); + tolua_error(tolua_S, "array indexing out of range.", NULL); } - #endif - tolua_index = (int)tolua_tonumber(tolua_S,2,0); - #ifndef TOLUA_RELEASE - if (tolua_index<0 || tolua_index>=256) - tolua_error(tolua_S,"array indexing out of range.",NULL); - #endif - cBlockInfo::Get(tolua_index).m_IsSnowable = (tolua_toboolean(tolua_S,3,0) != 0); - return 0; + tolua_pushboolean(tolua_S, cBlockInfo::IsSnowable((BLOCKTYPE)BlockType)); + return 1; } #endif //#ifndef TOLUA_DISABLE @@ -332,7 +179,7 @@ static int tolua_set_AllToLua_g_BlockIsSnowable(lua_State* tolua_S) #ifndef TOLUA_DISABLE_tolua_get_AllToLua_g_BlockRequiresSpecialTool static int tolua_get_AllToLua_g_BlockRequiresSpecialTool(lua_State* tolua_S) { - int tolua_index; + int BlockType; #ifndef TOLUA_RELEASE { tolua_Error tolua_err; @@ -340,39 +187,13 @@ static int tolua_get_AllToLua_g_BlockRequiresSpecialTool(lua_State* tolua_S) tolua_error(tolua_S,"#vinvalid type in array indexing.",&tolua_err); } #endif - tolua_index = (int)tolua_tonumber(tolua_S,2,0); - #ifndef TOLUA_RELEASE - if (tolua_index<0 || tolua_index>=256) - tolua_error(tolua_S,"array indexing out of range.",NULL); - #endif - tolua_pushboolean(tolua_S,(bool)cBlockInfo::RequiresSpecialTool(tolua_index)); - return 1; -} -#endif //#ifndef TOLUA_DISABLE - - - - - -/* set function: g_BlockRequiresSpecialTool */ -#ifndef TOLUA_DISABLE_tolua_set_AllToLua_g_BlockRequiresSpecialTool -static int tolua_set_AllToLua_g_BlockRequiresSpecialTool(lua_State* tolua_S) -{ - int tolua_index; - #ifndef TOLUA_RELEASE + BlockType = (int)tolua_tonumber(tolua_S, 2, 0); + if ((BlockType < 0) || (BlockType > E_BLOCK_MAX_TYPE_ID)) { - tolua_Error tolua_err; - if (!tolua_isnumber(tolua_S,2,0,&tolua_err)) - tolua_error(tolua_S,"#vinvalid type in array indexing.",&tolua_err); + tolua_error(tolua_S, "array indexing out of range.", NULL); } - #endif - tolua_index = (int)tolua_tonumber(tolua_S,2,0); - #ifndef TOLUA_RELEASE - if (tolua_index<0 || tolua_index>=256) - tolua_error(tolua_S,"array indexing out of range.",NULL); - #endif - cBlockInfo::Get(tolua_index).m_RequiresSpecialTool = (tolua_toboolean(tolua_S,3,0) != 0); - return 0; + tolua_pushboolean(tolua_S, cBlockInfo::RequiresSpecialTool((BLOCKTYPE)BlockType)); + return 1; } #endif //#ifndef TOLUA_DISABLE @@ -384,7 +205,7 @@ static int tolua_set_AllToLua_g_BlockRequiresSpecialTool(lua_State* tolua_S) #ifndef TOLUA_DISABLE_tolua_get_AllToLua_g_BlockIsSolid static int tolua_get_AllToLua_g_BlockIsSolid(lua_State* tolua_S) { - int tolua_index; + int BlockType; #ifndef TOLUA_RELEASE { tolua_Error tolua_err; @@ -392,39 +213,13 @@ static int tolua_get_AllToLua_g_BlockIsSolid(lua_State* tolua_S) tolua_error(tolua_S,"#vinvalid type in array indexing.",&tolua_err); } #endif - tolua_index = (int)tolua_tonumber(tolua_S,2,0); - #ifndef TOLUA_RELEASE - if (tolua_index<0 || tolua_index>=256) - tolua_error(tolua_S,"array indexing out of range.",NULL); - #endif - tolua_pushboolean(tolua_S,(bool)cBlockInfo::IsSolid(tolua_index)); - return 1; -} -#endif //#ifndef TOLUA_DISABLE - - - - - -/* set function: g_BlockIsSolid */ -#ifndef TOLUA_DISABLE_tolua_set_AllToLua_g_BlockIsSolid -static int tolua_set_AllToLua_g_BlockIsSolid(lua_State* tolua_S) -{ - int tolua_index; - #ifndef TOLUA_RELEASE + BlockType = (int)tolua_tonumber(tolua_S, 2, 0); + if ((BlockType < 0) || (BlockType > E_BLOCK_MAX_TYPE_ID)) { - tolua_Error tolua_err; - if (!tolua_isnumber(tolua_S,2,0,&tolua_err)) - tolua_error(tolua_S,"#vinvalid type in array indexing.",&tolua_err); + tolua_error(tolua_S, "array indexing out of range.", NULL); } - #endif - tolua_index = (int)tolua_tonumber(tolua_S,2,0); - #ifndef TOLUA_RELEASE - if (tolua_index<0 || tolua_index>=256) - tolua_error(tolua_S,"array indexing out of range.",NULL); - #endif - cBlockInfo::Get(tolua_index).m_IsSolid = (tolua_toboolean(tolua_S,3,0) != 0); - return 0; + tolua_pushboolean(tolua_S, (bool)cBlockInfo::IsSolid((BLOCKTYPE)BlockType)); + return 1; } #endif //#ifndef TOLUA_DISABLE @@ -436,7 +231,7 @@ static int tolua_set_AllToLua_g_BlockIsSolid(lua_State* tolua_S) #ifndef TOLUA_DISABLE_tolua_get_AllToLua_g_BlockFullyOccupiesVoxel static int tolua_get_AllToLua_g_BlockFullyOccupiesVoxel(lua_State* tolua_S) { - int tolua_index; + int BlockType; #ifndef TOLUA_RELEASE { tolua_Error tolua_err; @@ -444,39 +239,13 @@ static int tolua_get_AllToLua_g_BlockFullyOccupiesVoxel(lua_State* tolua_S) tolua_error(tolua_S,"#vinvalid type in array indexing.",&tolua_err); } #endif - tolua_index = (int)tolua_tonumber(tolua_S,2,0); - #ifndef TOLUA_RELEASE - if (tolua_index<0 || tolua_index>=256) - tolua_error(tolua_S,"array indexing out of range.",NULL); - #endif - tolua_pushboolean(tolua_S,(bool)cBlockInfo::FullyOccupiesVoxel(tolua_index)); - return 1; -} -#endif //#ifndef TOLUA_DISABLE - - - - - -/* set function: g_BlockFullyOccupiesVoxel */ -#ifndef TOLUA_DISABLE_tolua_set_AllToLua_g_BlockFullyOccupiesVoxel -static int tolua_set_AllToLua_g_BlockFullyOccupiesVoxel(lua_State* tolua_S) -{ - int tolua_index; - #ifndef TOLUA_RELEASE + BlockType = (int)tolua_tonumber(tolua_S, 2, 0); + if ((BlockType < 0) || (BlockType > E_BLOCK_MAX_TYPE_ID)) { - tolua_Error tolua_err; - if (!tolua_isnumber(tolua_S,2,0,&tolua_err)) - tolua_error(tolua_S,"#vinvalid type in array indexing.",&tolua_err); + tolua_error(tolua_S, "array indexing out of range.", NULL); } - #endif - tolua_index = (int)tolua_tonumber(tolua_S,2,0); - #ifndef TOLUA_RELEASE - if (tolua_index<0 || tolua_index>=256) - tolua_error(tolua_S,"array indexing out of range.",NULL); - #endif - cBlockInfo::Get(tolua_index).m_FullyOccupiesVoxel = (tolua_toboolean(tolua_S,3,0) != 0); - return 0; + tolua_pushboolean(tolua_S, (bool)cBlockInfo::FullyOccupiesVoxel((BLOCKTYPE)BlockType)); + return 1; } #endif //#ifndef TOLUA_DISABLE @@ -488,15 +257,15 @@ void DeprecatedBindings::Bind(lua_State * tolua_S) { tolua_beginmodule(tolua_S, NULL); - tolua_array(tolua_S, "g_BlockLightValue", tolua_get_AllToLua_g_BlockLightValue, tolua_set_AllToLua_g_BlockLightValue); - tolua_array(tolua_S, "g_BlockSpreadLightFalloff", tolua_get_AllToLua_g_BlockSpreadLightFalloff, tolua_set_AllToLua_g_BlockSpreadLightFalloff); - tolua_array(tolua_S, "g_BlockTransparent", tolua_get_AllToLua_g_BlockTransparent, tolua_set_AllToLua_g_BlockTransparent); - tolua_array(tolua_S, "g_BlockOneHitDig", tolua_get_AllToLua_g_BlockOneHitDig, tolua_set_AllToLua_g_BlockOneHitDig); - tolua_array(tolua_S, "g_BlockPistonBreakable", tolua_get_AllToLua_g_BlockPistonBreakable, tolua_set_AllToLua_g_BlockPistonBreakable); - tolua_array(tolua_S, "g_BlockIsSnowable", tolua_get_AllToLua_g_BlockIsSnowable, tolua_set_AllToLua_g_BlockIsSnowable); - tolua_array(tolua_S, "g_BlockRequiresSpecialTool", tolua_get_AllToLua_g_BlockRequiresSpecialTool, tolua_set_AllToLua_g_BlockRequiresSpecialTool); - tolua_array(tolua_S, "g_BlockIsSolid", tolua_get_AllToLua_g_BlockIsSolid, tolua_set_AllToLua_g_BlockIsSolid); - tolua_array(tolua_S, "g_BlockFullyOccupiesVoxel", tolua_get_AllToLua_g_BlockFullyOccupiesVoxel, tolua_set_AllToLua_g_BlockFullyOccupiesVoxel); + tolua_array(tolua_S, "g_BlockLightValue", tolua_get_AllToLua_g_BlockLightValue, NULL); + tolua_array(tolua_S, "g_BlockSpreadLightFalloff", tolua_get_AllToLua_g_BlockSpreadLightFalloff, NULL); + tolua_array(tolua_S, "g_BlockTransparent", tolua_get_AllToLua_g_BlockTransparent, NULL); + tolua_array(tolua_S, "g_BlockOneHitDig", tolua_get_AllToLua_g_BlockOneHitDig, NULL); + tolua_array(tolua_S, "g_BlockPistonBreakable", tolua_get_AllToLua_g_BlockPistonBreakable, NULL); + tolua_array(tolua_S, "g_BlockIsSnowable", tolua_get_AllToLua_g_BlockIsSnowable, NULL); + tolua_array(tolua_S, "g_BlockRequiresSpecialTool", tolua_get_AllToLua_g_BlockRequiresSpecialTool, NULL); + tolua_array(tolua_S, "g_BlockIsSolid", tolua_get_AllToLua_g_BlockIsSolid, NULL); + tolua_array(tolua_S, "g_BlockFullyOccupiesVoxel", tolua_get_AllToLua_g_BlockFullyOccupiesVoxel, NULL); tolua_endmodule(tolua_S); } diff --git a/src/Bindings/LuaState.cpp b/src/Bindings/LuaState.cpp index 47380b8a7..a33459ad2 100644 --- a/src/Bindings/LuaState.cpp +++ b/src/Bindings/LuaState.cpp @@ -11,6 +11,7 @@ extern "C" #include "lua/src/lualib.h" } +#undef TOLUA_TEMPLATE_BIND #include "tolua++/include/tolua++.h" #include "Bindings.h" #include "ManualBindings.h" @@ -479,6 +480,18 @@ void cLuaState::Push(cEntity * a_Entity) +void cLuaState::Push(cProjectileEntity * a_ProjectileEntity) +{ + ASSERT(IsValid()); + + tolua_pushusertype(m_LuaState, a_ProjectileEntity, "cProjectileEntity"); + m_NumCurrentFunctionArgs += 1; +} + + + + + void cLuaState::Push(cMonster * a_Monster) { ASSERT(IsValid()); diff --git a/src/Bindings/LuaState.h b/src/Bindings/LuaState.h index f0047b362..b9ca2f29b 100644 --- a/src/Bindings/LuaState.h +++ b/src/Bindings/LuaState.h @@ -38,6 +38,7 @@ extern "C" class cWorld; class cPlayer; class cEntity; +class cProjectileEntity; class cMonster; class cItem; class cItems; @@ -183,6 +184,7 @@ public: void Push(cPlayer * a_Player); void Push(const cPlayer * a_Player); void Push(cEntity * a_Entity); + void Push(cProjectileEntity * a_ProjectileEntity); void Push(cMonster * a_Monster); void Push(cItem * a_Item); void Push(cItems * a_Items); diff --git a/src/Bindings/ManualBindings.cpp b/src/Bindings/ManualBindings.cpp index 20bbc48f2..92b410481 100644 --- a/src/Bindings/ManualBindings.cpp +++ b/src/Bindings/ManualBindings.cpp @@ -2,6 +2,7 @@ #include "Globals.h" // NOTE: MSVC stupidness requires this to be the same across all modules #include "ManualBindings.h" +#undef TOLUA_TEMPLATE_BIND #include "tolua++/include/tolua++.h" #include "Plugin.h" @@ -115,10 +116,44 @@ static int tolua_StringSplitAndTrim(lua_State * tolua_S) -static int tolua_LOG(lua_State* tolua_S) +/** Retrieves the log message from the first param on the Lua stack. +Can take either a string or a cCompositeChat. +*/ +static AString GetLogMessage(lua_State * tolua_S) { - const char* str = tolua_tocppstring(tolua_S,1,0); - cMCLogger::GetInstance()->LogSimple( str, 0 ); + tolua_Error err; + if (tolua_isusertype(tolua_S, 1, "cCompositeChat", false, &err)) + { + return ((cCompositeChat *)tolua_tousertype(tolua_S, 1, NULL))->ExtractText(); + } + else + { + size_t len = 0; + const char * str = lua_tolstring(tolua_S, 1, &len); + if (str != NULL) + { + return AString(str, len); + } + } + return ""; +} + + + + + +static int tolua_LOG(lua_State * tolua_S) +{ + // If the param is a cCompositeChat, read the log level from it: + cMCLogger::eLogLevel LogLevel = cMCLogger::llRegular; + tolua_Error err; + if (tolua_isusertype(tolua_S, 1, "cCompositeChat", false, &err)) + { + LogLevel = cCompositeChat::MessageTypeToLogLevel(((cCompositeChat *)tolua_tousertype(tolua_S, 1, NULL))->GetMessageType()); + } + + // Log the message: + cMCLogger::GetInstance()->LogSimple(GetLogMessage(tolua_S).c_str(), LogLevel); return 0; } @@ -126,10 +161,9 @@ static int tolua_LOG(lua_State* tolua_S) -static int tolua_LOGINFO(lua_State* tolua_S) +static int tolua_LOGINFO(lua_State * tolua_S) { - const char* str = tolua_tocppstring(tolua_S,1,0); - cMCLogger::GetInstance()->LogSimple( str, 1 ); + cMCLogger::GetInstance()->LogSimple(GetLogMessage(tolua_S).c_str(), cMCLogger::llInfo); return 0; } @@ -137,10 +171,9 @@ static int tolua_LOGINFO(lua_State* tolua_S) -static int tolua_LOGWARN(lua_State* tolua_S) +static int tolua_LOGWARN(lua_State * tolua_S) { - const char* str = tolua_tocppstring(tolua_S,1,0); - cMCLogger::GetInstance()->LogSimple( str, 2 ); + cMCLogger::GetInstance()->LogSimple(GetLogMessage(tolua_S).c_str(), cMCLogger::llWarning); return 0; } @@ -148,10 +181,9 @@ static int tolua_LOGWARN(lua_State* tolua_S) -static int tolua_LOGERROR(lua_State* tolua_S) +static int tolua_LOGERROR(lua_State * tolua_S) { - const char* str = tolua_tocppstring(tolua_S,1,0); - cMCLogger::GetInstance()->LogSimple( str, 3 ); + cMCLogger::GetInstance()->LogSimple(GetLogMessage(tolua_S).c_str(), cMCLogger::llError); return 0; } @@ -159,6 +191,50 @@ static int tolua_LOGERROR(lua_State* tolua_S) +static int tolua_Base64Encode(lua_State * tolua_S) +{ + cLuaState L(tolua_S); + if ( + !L.CheckParamString(1) || + !L.CheckParamEnd(2) + ) + { + return 0; + } + + AString Src; + L.GetStackValue(1, Src); + AString res = Base64Encode(Src); + L.Push(res); + return 1; +} + + + + + +static int tolua_Base64Decode(lua_State * tolua_S) +{ + cLuaState L(tolua_S); + if ( + !L.CheckParamString(1) || + !L.CheckParamEnd(2) + ) + { + return 0; + } + + AString Src; + L.GetStackValue(1, Src); + AString res = Base64Decode(Src); + L.Push(res); + return 1; +} + + + + + cPluginLua * GetLuaPlugin(lua_State * L) { // Get the plugin identification out of LuaState: @@ -2838,6 +2914,8 @@ void ManualBindings::Bind(lua_State * tolua_S) tolua_function(tolua_S, "LOGWARN", tolua_LOGWARN); tolua_function(tolua_S, "LOGWARNING", tolua_LOGWARN); tolua_function(tolua_S, "LOGERROR", tolua_LOGERROR); + tolua_function(tolua_S, "Base64Encode", tolua_Base64Encode); + tolua_function(tolua_S, "Base64Decode", tolua_Base64Decode); tolua_beginmodule(tolua_S, "cFile"); tolua_function(tolua_S, "GetFolderContents", tolua_cFile_GetFolderContents); diff --git a/src/Bindings/ManualBindings.h b/src/Bindings/ManualBindings.h index e6594947e..f38e26267 100644 --- a/src/Bindings/ManualBindings.h +++ b/src/Bindings/ManualBindings.h @@ -5,4 +5,4 @@ class ManualBindings { public: static void Bind( lua_State* tolua_S ); -};
\ No newline at end of file +}; diff --git a/src/Bindings/Plugin.h b/src/Bindings/Plugin.h index 057fa0304..df0bd4dcc 100644 --- a/src/Bindings/Plugin.h +++ b/src/Bindings/Plugin.h @@ -90,6 +90,8 @@ public: virtual bool OnPluginsLoaded (void) = 0; virtual bool OnPostCrafting (const cPlayer * a_Player, const cCraftingGrid * a_Grid, cCraftingRecipe * a_Recipe) = 0; virtual bool OnPreCrafting (const cPlayer * a_Player, const cCraftingGrid * a_Grid, cCraftingRecipe * a_Recipe) = 0; + virtual bool OnProjectileHitBlock (cProjectileEntity & a_Projectile) = 0; + virtual bool OnProjectileHitEntity (cProjectileEntity & a_Projectile, cEntity & a_HitEntity) = 0; virtual bool OnSpawnedEntity (cWorld & a_World, cEntity & a_Entity) = 0; virtual bool OnSpawnedMonster (cWorld & a_World, cMonster & a_Monster) = 0; virtual bool OnSpawningEntity (cWorld & a_World, cEntity & a_Entity) = 0; diff --git a/src/Bindings/PluginLua.cpp b/src/Bindings/PluginLua.cpp index 4f0e13f12..dcc816839 100644 --- a/src/Bindings/PluginLua.cpp +++ b/src/Bindings/PluginLua.cpp @@ -5,7 +5,11 @@ #include "Globals.h" // NOTE: MSVC stupidness requires this to be the same across all modules +#ifdef __APPLE__ +#define LUA_USE_MACOSX +#else #define LUA_USE_POSIX +#endif #include "PluginLua.h" #include "../CommandOutput.h" @@ -14,6 +18,7 @@ extern "C" #include "lua/src/lualib.h" } +#undef TOLUA_TEMPLATE_BIND #include "tolua++/include/tolua++.h" @@ -1108,6 +1113,46 @@ bool cPluginLua::OnPreCrafting(const cPlayer * a_Player, const cCraftingGrid * a +bool cPluginLua::OnProjectileHitBlock(cProjectileEntity & a_Projectile) +{ + cCSLock Lock(m_CriticalSection); + bool res = false; + cLuaRefs & Refs = m_HookMap[cPluginManager::HOOK_PROJECTILE_HIT_BLOCK]; + for (cLuaRefs::iterator itr = Refs.begin(), end = Refs.end(); itr != end; ++itr) + { + m_LuaState.Call((int)(**itr), &a_Projectile, cLuaState::Return, res); + if (res) + { + return true; + } + } + return false; +} + + + + + +bool cPluginLua::OnProjectileHitEntity(cProjectileEntity & a_Projectile, cEntity & a_HitEntity) +{ + cCSLock Lock(m_CriticalSection); + bool res = false; + cLuaRefs & Refs = m_HookMap[cPluginManager::HOOK_PROJECTILE_HIT_ENTITY]; + for (cLuaRefs::iterator itr = Refs.begin(), end = Refs.end(); itr != end; ++itr) + { + m_LuaState.Call((int)(**itr), &a_Projectile, &a_HitEntity, cLuaState::Return, res); + if (res) + { + return true; + } + } + return false; +} + + + + + bool cPluginLua::OnSpawnedEntity(cWorld & a_World, cEntity & a_Entity) { cCSLock Lock(m_CriticalSection); diff --git a/src/Bindings/PluginLua.h b/src/Bindings/PluginLua.h index f51056186..59542d23a 100644 --- a/src/Bindings/PluginLua.h +++ b/src/Bindings/PluginLua.h @@ -113,6 +113,8 @@ public: virtual bool OnPluginsLoaded (void) override; virtual bool OnPostCrafting (const cPlayer * a_Player, const cCraftingGrid * a_Grid, cCraftingRecipe * a_Recipe) override; virtual bool OnPreCrafting (const cPlayer * a_Player, const cCraftingGrid * a_Grid, cCraftingRecipe * a_Recipe) override; + virtual bool OnProjectileHitBlock (cProjectileEntity & a_Projectile) override; + virtual bool OnProjectileHitEntity (cProjectileEntity & a_Projectile, cEntity & a_HitEntity) override; virtual bool OnSpawnedEntity (cWorld & a_World, cEntity & a_Entity) override; virtual bool OnSpawnedMonster (cWorld & a_World, cMonster & a_Monster) override; virtual bool OnSpawningEntity (cWorld & a_World, cEntity & a_Entity) override; diff --git a/src/Bindings/PluginManager.cpp b/src/Bindings/PluginManager.cpp index 7d346c522..6a5356c0b 100644 --- a/src/Bindings/PluginManager.cpp +++ b/src/Bindings/PluginManager.cpp @@ -1154,6 +1154,48 @@ bool cPluginManager::CallHookPreCrafting(const cPlayer * a_Player, const cCrafti +bool cPluginManager::CallHookProjectileHitBlock(cProjectileEntity & a_Projectile) +{ + HookMap::iterator Plugins = m_Hooks.find(HOOK_PROJECTILE_HIT_BLOCK); + if (Plugins == m_Hooks.end()) + { + return false; + } + for (PluginList::iterator itr = Plugins->second.begin(); itr != Plugins->second.end(); ++itr) + { + if ((*itr)->OnProjectileHitBlock(a_Projectile)) + { + return true; + } + } + return false; +} + + + + + +bool cPluginManager::CallHookProjectileHitEntity(cProjectileEntity & a_Projectile, cEntity & a_HitEntity) +{ + HookMap::iterator Plugins = m_Hooks.find(HOOK_PROJECTILE_HIT_ENTITY); + if (Plugins == m_Hooks.end()) + { + return false; + } + for (PluginList::iterator itr = Plugins->second.begin(); itr != Plugins->second.end(); ++itr) + { + if ((*itr)->OnProjectileHitEntity(a_Projectile, a_HitEntity)) + { + return true; + } + } + return false; +} + + + + + bool cPluginManager::CallHookSpawnedEntity(cWorld & a_World, cEntity & a_Entity) { HookMap::iterator Plugins = m_Hooks.find(HOOK_SPAWNED_ENTITY); diff --git a/src/Bindings/PluginManager.h b/src/Bindings/PluginManager.h index 03f19e831..512bc1351 100644 --- a/src/Bindings/PluginManager.h +++ b/src/Bindings/PluginManager.h @@ -18,6 +18,9 @@ class cChunkDesc; // fwd: Entities/Entity.h class cEntity; +// fwd: Entities/ProjectileEntity.h +class cProjectileEntity; + // fwd: Mobs/Monster.h class cMonster; @@ -102,6 +105,8 @@ public: // tolua_export HOOK_PLUGINS_LOADED, HOOK_POST_CRAFTING, HOOK_PRE_CRAFTING, + HOOK_PROJECTILE_HIT_BLOCK, + HOOK_PROJECTILE_HIT_ENTITY, HOOK_SPAWNED_ENTITY, HOOK_SPAWNED_MONSTER, HOOK_SPAWNING_ENTITY, @@ -128,6 +133,8 @@ public: // tolua_export class cCommandEnumCallback { public: + virtual ~cCommandEnumCallback() {} + /** Called for each command; return true to abort enumeration For console commands, a_Permission is not used (set to empty string) */ @@ -199,6 +206,8 @@ public: // tolua_export bool CallHookPluginsLoaded (void); bool CallHookPostCrafting (const cPlayer * a_Player, const cCraftingGrid * a_Grid, cCraftingRecipe * a_Recipe); bool CallHookPreCrafting (const cPlayer * a_Player, const cCraftingGrid * a_Grid, cCraftingRecipe * a_Recipe); + bool CallHookProjectileHitBlock (cProjectileEntity & a_Projectile); + bool CallHookProjectileHitEntity (cProjectileEntity & a_Projectile, cEntity & a_HitEntity); bool CallHookSpawnedEntity (cWorld & a_World, cEntity & a_Entity); bool CallHookSpawnedMonster (cWorld & a_World, cMonster & a_Monster); bool CallHookSpawningEntity (cWorld & a_World, cEntity & a_Entity); diff --git a/src/Bindings/WebPlugin.cpp b/src/Bindings/WebPlugin.cpp index 3b71d553c..bf45405ba 100644 --- a/src/Bindings/WebPlugin.cpp +++ b/src/Bindings/WebPlugin.cpp @@ -110,4 +110,4 @@ AString cWebPlugin::SafeString( const AString & a_String ) RetVal.push_back( c ); } return RetVal; -}
\ No newline at end of file +} diff --git a/src/Bindings/lua5.1.dll b/src/Bindings/lua51.dll Binary files differindex 515cf8b30..515cf8b30 100644 --- a/src/Bindings/lua5.1.dll +++ b/src/Bindings/lua51.dll diff --git a/src/BlockArea.cpp b/src/BlockArea.cpp index f6d54e41c..40cca8882 100644 --- a/src/BlockArea.cpp +++ b/src/BlockArea.cpp @@ -54,7 +54,7 @@ template<typename Combinator> void InternalMergeBlocks( /// Combinator used for cBlockArea::msOverwrite merging -static void MergeCombinatorOverwrite(BLOCKTYPE & a_DstType, BLOCKTYPE a_SrcType, NIBBLETYPE & a_DstMeta, NIBBLETYPE a_SrcMeta) +static inline void MergeCombinatorOverwrite(BLOCKTYPE & a_DstType, BLOCKTYPE a_SrcType, NIBBLETYPE & a_DstMeta, NIBBLETYPE a_SrcMeta) { a_DstType = a_SrcType; a_DstMeta = a_SrcMeta; @@ -65,7 +65,7 @@ static void MergeCombinatorOverwrite(BLOCKTYPE & a_DstType, BLOCKTYPE a_SrcType, /// Combinator used for cBlockArea::msFillAir merging -static void MergeCombinatorFillAir(BLOCKTYPE & a_DstType, BLOCKTYPE a_SrcType, NIBBLETYPE & a_DstMeta, NIBBLETYPE a_SrcMeta) +static inline void MergeCombinatorFillAir(BLOCKTYPE & a_DstType, BLOCKTYPE a_SrcType, NIBBLETYPE & a_DstMeta, NIBBLETYPE a_SrcMeta) { if (a_DstType == E_BLOCK_AIR) { @@ -80,7 +80,7 @@ static void MergeCombinatorFillAir(BLOCKTYPE & a_DstType, BLOCKTYPE a_SrcType, N /// Combinator used for cBlockArea::msImprint merging -static void MergeCombinatorImprint(BLOCKTYPE & a_DstType, BLOCKTYPE a_SrcType, NIBBLETYPE & a_DstMeta, NIBBLETYPE a_SrcMeta) +static inline void MergeCombinatorImprint(BLOCKTYPE & a_DstType, BLOCKTYPE a_SrcType, NIBBLETYPE & a_DstMeta, NIBBLETYPE a_SrcMeta) { if (a_SrcType != E_BLOCK_AIR) { @@ -95,7 +95,7 @@ static void MergeCombinatorImprint(BLOCKTYPE & a_DstType, BLOCKTYPE a_SrcType, N /// Combinator used for cBlockArea::msLake merging -static void MergeCombinatorLake(BLOCKTYPE & a_DstType, BLOCKTYPE a_SrcType, NIBBLETYPE & a_DstMeta, NIBBLETYPE a_SrcMeta) +static inline void MergeCombinatorLake(BLOCKTYPE & a_DstType, BLOCKTYPE a_SrcType, NIBBLETYPE & a_DstMeta, NIBBLETYPE a_SrcMeta) { // Sponge is the NOP block if (a_SrcType == E_BLOCK_SPONGE) @@ -158,6 +158,55 @@ static void MergeCombinatorLake(BLOCKTYPE & a_DstType, BLOCKTYPE a_SrcType, NIBB +/** Combinator used for cBlockArea::msSpongePrint merging */ +static inline void MergeCombinatorSpongePrint(BLOCKTYPE & a_DstType, BLOCKTYPE a_SrcType, NIBBLETYPE & a_DstMeta, NIBBLETYPE a_SrcMeta) +{ + // Sponge overwrites nothing, everything else overwrites anything + if (a_SrcType != E_BLOCK_SPONGE) + { + a_DstType = a_SrcType; + a_DstMeta = a_SrcMeta; + } +} + + + + + +/** Combinator used for cBlockArea::msDifference merging */ +static inline void MergeCombinatorDifference(BLOCKTYPE & a_DstType, BLOCKTYPE a_SrcType, NIBBLETYPE & a_DstMeta, NIBBLETYPE a_SrcMeta) +{ + if ((a_DstType == a_SrcType) && (a_DstMeta == a_SrcMeta)) + { + a_DstType = E_BLOCK_AIR; + a_DstMeta = 0; + } + else + { + a_DstType = a_SrcType; + a_DstMeta = a_SrcMeta; + } +} + + + + + +/** Combinator used for cBlockArea::msMask merging */ +static inline void MergeCombinatorMask(BLOCKTYPE & a_DstType, BLOCKTYPE a_SrcType, NIBBLETYPE & a_DstMeta, NIBBLETYPE a_SrcMeta) +{ + // If the blocks are the same, keep the dest; otherwise replace with air + if ((a_SrcType != a_DstType) || (a_SrcMeta != a_DstMeta)) + { + a_DstType = E_BLOCK_AIR; + a_DstMeta = 0; + } +} + + + + + /////////////////////////////////////////////////////////////////////////////////////////////////////////////////////// // cBlockArea: @@ -481,7 +530,7 @@ void cBlockArea::DumpToRawFile(const AString & a_FileName) f.Write(&SizeX, 4); f.Write(&SizeY, 4); f.Write(&SizeZ, 4); - unsigned char DataTypes = GetDataTypes(); + unsigned char DataTypes = (unsigned char)GetDataTypes(); f.Write(&DataTypes, 1); int NumBlocks = GetBlockCount(); if (HasBlockTypes()) @@ -680,6 +729,51 @@ void cBlockArea::Merge(const cBlockArea & a_Src, int a_RelX, int a_RelY, int a_R break; } // case msLake + case msSpongePrint: + { + InternalMergeBlocks( + m_BlockTypes, a_Src.GetBlockTypes(), + DstMetas, SrcMetas, + SizeX, SizeY, SizeZ, + SrcOffX, SrcOffY, SrcOffZ, + DstOffX, DstOffY, DstOffZ, + a_Src.GetSizeX(), a_Src.GetSizeY(), a_Src.GetSizeZ(), + m_Size.x, m_Size.y, m_Size.z, + MergeCombinatorSpongePrint + ); + break; + } // case msSpongePrint + + case msDifference: + { + InternalMergeBlocks( + m_BlockTypes, a_Src.GetBlockTypes(), + DstMetas, SrcMetas, + SizeX, SizeY, SizeZ, + SrcOffX, SrcOffY, SrcOffZ, + DstOffX, DstOffY, DstOffZ, + a_Src.GetSizeX(), a_Src.GetSizeY(), a_Src.GetSizeZ(), + m_Size.x, m_Size.y, m_Size.z, + MergeCombinatorDifference + ); + break; + } // case msDifference + + case msMask: + { + InternalMergeBlocks( + m_BlockTypes, a_Src.GetBlockTypes(), + DstMetas, SrcMetas, + SizeX, SizeY, SizeZ, + SrcOffX, SrcOffY, SrcOffZ, + DstOffX, DstOffY, DstOffZ, + a_Src.GetSizeX(), a_Src.GetSizeY(), a_Src.GetSizeZ(), + m_Size.x, m_Size.y, m_Size.z, + MergeCombinatorMask + ); + break; + } // case msMask + default: { LOGWARNING("Unknown block area merge strategy: %d", a_Strategy); diff --git a/src/BlockArea.h b/src/BlockArea.h index d28325d7d..c48175b8c 100644 --- a/src/BlockArea.h +++ b/src/BlockArea.h @@ -51,6 +51,9 @@ public: msFillAir, msImprint, msLake, + msSpongePrint, + msDifference, + msMask, } ; cBlockArea(void); @@ -127,8 +130,8 @@ public: - msFillAir overwrites only those blocks that were air - msImprint overwrites with only those blocks that are non-air - Special strategies: - msLake (evaluate top-down, first match wins): + Special strategies (evaluate top-down, first match wins): + msLake: | area block | | | this | Src | result | +----------+--------+--------+ @@ -143,6 +146,22 @@ public: | mycelium | stone | stone | ... and mycelium | A | stone | A | ... but nothing else | A | * | A | Everything else is left as it is + + msSpongePrint: + Used for most generators, it allows carving out air pockets, too, and uses the Sponge as the NOP block + | area block | | + | this | Src | result | + +----------+--------+--------+ + | A | sponge | A | Sponge is the NOP block + | * | B | B | Everything else overwrites anything + + msMask: + Combines two areas, the blocks that are the same are kept, differing ones are reset to air + | area block | | + | this | Src | result | + +------+-------+--------+ + | A | A | A | Same blocks are kept + | A | non-A | air | Everything else is replaced with air */ void Merge(const cBlockArea & a_Src, int a_RelX, int a_RelY, int a_RelZ, eMergeStrategy a_Strategy); diff --git a/src/BlockEntities/CommandBlockEntity.cpp b/src/BlockEntities/CommandBlockEntity.cpp index d395997a6..96ca0ac37 100644 --- a/src/BlockEntities/CommandBlockEntity.cpp +++ b/src/BlockEntities/CommandBlockEntity.cpp @@ -160,7 +160,7 @@ bool cCommandBlockEntity::LoadFromJson(const Json::Value & a_Value) m_Command = a_Value.get("Command", "").asString(); m_LastOutput = a_Value.get("LastOutput", "").asString(); - m_Result = a_Value.get("SuccessCount", 0).asInt(); + m_Result = (NIBBLETYPE)a_Value.get("SuccessCount", 0).asInt(); return true; } diff --git a/src/BlockInfo.cpp b/src/BlockInfo.cpp index 7d438ba3e..6fb5aa5b3 100644 --- a/src/BlockInfo.cpp +++ b/src/BlockInfo.cpp @@ -365,7 +365,7 @@ void cBlockInfo::Initialize(void) ms_Info[E_BLOCK_WOODEN_SLAB ].m_IsSolid = false; - // Torch placeable blocks: + // Blocks that fully occupy their voxel - used as a guide for torch placeable blocks, amongst other things: ms_Info[E_BLOCK_NEW_LOG ].m_FullyOccupiesVoxel = true; ms_Info[E_BLOCK_BEDROCK ].m_FullyOccupiesVoxel = true; ms_Info[E_BLOCK_BLOCK_OF_COAL ].m_FullyOccupiesVoxel = true; @@ -397,6 +397,7 @@ void cBlockInfo::Initialize(void) ms_Info[E_BLOCK_HAY_BALE ].m_FullyOccupiesVoxel = true; ms_Info[E_BLOCK_HUGE_BROWN_MUSHROOM ].m_FullyOccupiesVoxel = true; ms_Info[E_BLOCK_HUGE_RED_MUSHROOM ].m_FullyOccupiesVoxel = true; + ms_Info[E_BLOCK_ICE ].m_FullyOccupiesVoxel = true; ms_Info[E_BLOCK_IRON_BLOCK ].m_FullyOccupiesVoxel = true; ms_Info[E_BLOCK_IRON_ORE ].m_FullyOccupiesVoxel = true; ms_Info[E_BLOCK_JACK_O_LANTERN ].m_FullyOccupiesVoxel = true; diff --git a/src/BlockTracer.h b/src/BlockTracer.h index 40d80da1a..a18c8df4d 100644 --- a/src/BlockTracer.h +++ b/src/BlockTracer.h @@ -28,6 +28,9 @@ public: class cCallbacks abstract { public: + // Force a virtual destructor in descendants: + virtual ~cCallbacks() {} + /** Called on each block encountered along the path, including the first block (path start) When this callback returns true, the tracing is aborted. */ diff --git a/src/Blocks/BlockAnvil.h b/src/Blocks/BlockAnvil.h index 9f5f84be0..93a796ef7 100644 --- a/src/Blocks/BlockAnvil.h +++ b/src/Blocks/BlockAnvil.h @@ -18,11 +18,13 @@ public: { } + virtual void ConvertToPickups(cItems & a_Pickups, NIBBLETYPE a_BlockMeta) override { a_Pickups.push_back(cItem(E_BLOCK_ANVIL, 1, a_BlockMeta >> 2)); } + virtual bool GetPlacementBlockTypeMeta( cChunkInterface & a_ChunkInterface, cPlayer * a_Player, int a_BlockX, int a_BlockY, int a_BlockZ, eBlockFace a_BlockFace, @@ -31,27 +33,23 @@ public: ) override { a_BlockType = m_BlockType; - - int Direction = (int)floor(a_Player->GetYaw() * 4.0 / 360.0 + 0.5) & 0x3; - int RawMeta = a_BlockMeta >> 2; - - Direction++; - Direction %= 4; + NIBBLETYPE HighBits = a_BlockMeta & 0x0c; // Only highest two bits are preserved + int Direction = (int)floor(a_Player->GetYaw() * 4.0 / 360.0 + 1.5) & 0x3; switch (Direction) { - case 0: a_BlockMeta = 0x2 | RawMeta << 2; break; - case 1: a_BlockMeta = 0x3 | RawMeta << 2; break; - case 2: a_BlockMeta = 0x0 | RawMeta << 2; break; - case 3: a_BlockMeta = 0x1 | RawMeta << 2; break; + case 0: a_BlockMeta = 0x2 | HighBits; break; + case 1: a_BlockMeta = 0x3 | HighBits; break; + case 2: a_BlockMeta = 0x0 | HighBits; break; + case 3: a_BlockMeta = 0x1 | HighBits; break; default: { return false; } } - return true; } + virtual bool IsUseable() override { return true; diff --git a/src/Blocks/BlockBed.h b/src/Blocks/BlockBed.h index 6daa94730..92804aaac 100644 --- a/src/Blocks/BlockBed.h +++ b/src/Blocks/BlockBed.h @@ -4,7 +4,7 @@ #include "BlockHandler.h" #include "ChunkInterface.h" #include "WorldInterface.h" -#include "MetaRotater.h" +#include "MetaRotator.h" #include "../Entities/Player.h" @@ -12,11 +12,11 @@ class cBlockBedHandler : - public cMetaRotater<cBlockHandler, 0x3, 0x02, 0x03, 0x00, 0x01, true> + public cMetaRotator<cBlockHandler, 0x3, 0x02, 0x03, 0x00, 0x01, true> { public: cBlockBedHandler(BLOCKTYPE a_BlockType) - : cMetaRotater<cBlockHandler, 0x3, 0x02, 0x03, 0x00, 0x01,true>(a_BlockType) + : cMetaRotator<cBlockHandler, 0x3, 0x02, 0x03, 0x00, 0x01,true>(a_BlockType) { } diff --git a/src/Blocks/BlockButton.h b/src/Blocks/BlockButton.h index 740cbe3c4..4b2f6f618 100644 --- a/src/Blocks/BlockButton.h +++ b/src/Blocks/BlockButton.h @@ -2,17 +2,17 @@ #include "BlockHandler.h" #include "Chunk.h" -#include "MetaRotater.h" +#include "MetaRotator.h" class cBlockButtonHandler : - public cMetaRotater<cBlockHandler, 0x07, 0x04, 0x01, 0x03, 0x02, true> + public cMetaRotator<cBlockHandler, 0x07, 0x04, 0x01, 0x03, 0x02, true> { public: cBlockButtonHandler(BLOCKTYPE a_BlockType) - : cMetaRotater<cBlockHandler, 0x07, 0x04, 0x01, 0x03, 0x02, true>(a_BlockType) + : cMetaRotator<cBlockHandler, 0x07, 0x04, 0x01, 0x03, 0x02, true>(a_BlockType) { } diff --git a/src/Blocks/BlockCauldron.h b/src/Blocks/BlockCauldron.h index 2e1032d2b..41b79b6c3 100644 --- a/src/Blocks/BlockCauldron.h +++ b/src/Blocks/BlockCauldron.h @@ -23,7 +23,7 @@ public: virtual void OnUse(cChunkInterface & a_ChunkInterface, cWorldInterface & a_WorldInterface, cPlayer * a_Player, int a_BlockX, int a_BlockY, int a_BlockZ, eBlockFace a_BlockFace, int a_CursorX, int a_CursorY, int a_CursorZ) override { - char Meta = a_ChunkInterface.GetBlockMeta(a_BlockX, a_BlockY, a_BlockZ); + NIBBLETYPE Meta = a_ChunkInterface.GetBlockMeta(a_BlockX, a_BlockY, a_BlockZ); switch (a_Player->GetEquippedItem().m_ItemType) { case E_ITEM_WATER_BUCKET: diff --git a/src/Blocks/BlockChest.h b/src/Blocks/BlockChest.h index 30588d8fc..a1ded4c26 100644 --- a/src/Blocks/BlockChest.h +++ b/src/Blocks/BlockChest.h @@ -4,18 +4,18 @@ #include "BlockEntity.h" #include "../BlockArea.h" #include "../Entities/Player.h" -#include "MetaRotater.h" +#include "MetaRotator.h" class cBlockChestHandler : - public cMetaRotater<cBlockEntityHandler, 0x07, 0x04, 0x01, 0x03, 0x02, true> + public cMetaRotator<cBlockEntityHandler, 0x07, 0x02, 0x05, 0x03, 0x04> { public: cBlockChestHandler(BLOCKTYPE a_BlockType) - : cMetaRotater<cBlockEntityHandler, 0x07, 0x04, 0x01, 0x03, 0x02, true>(a_BlockType) + : cMetaRotator<cBlockEntityHandler, 0x07, 0x02, 0x05, 0x03, 0x04>(a_BlockType) { } diff --git a/src/Blocks/BlockComparator.h b/src/Blocks/BlockComparator.h index e570ff302..4dd05366d 100644 --- a/src/Blocks/BlockComparator.h +++ b/src/Blocks/BlockComparator.h @@ -3,18 +3,18 @@ #include "BlockHandler.h" #include "BlockRedstoneRepeater.h" -#include "MetaRotater.h" +#include "MetaRotator.h" class cBlockComparatorHandler : - public cMetaRotater<cBlockHandler, 0x03, 0x00, 0x01, 0x02, 0x03, true> + public cMetaRotator<cBlockHandler, 0x03, 0x00, 0x01, 0x02, 0x03, true> { public: cBlockComparatorHandler(BLOCKTYPE a_BlockType) - : cMetaRotater<cBlockHandler, 0x03, 0x00, 0x01, 0x02, 0x03, true>(a_BlockType) + : cMetaRotator<cBlockHandler, 0x03, 0x00, 0x01, 0x02, 0x03, true>(a_BlockType) { } diff --git a/src/Blocks/BlockCrops.h b/src/Blocks/BlockCrops.h index ffc2b3f8b..8606cf3f3 100644 --- a/src/Blocks/BlockCrops.h +++ b/src/Blocks/BlockCrops.h @@ -2,7 +2,7 @@ #pragma once #include "BlockHandler.h" -#include "../MersenneTwister.h" +#include "../FastRandom.h" @@ -21,7 +21,7 @@ public: virtual void ConvertToPickups(cItems & a_Pickups, NIBBLETYPE a_Meta) override { - MTRand rand; + cFastRandom rand; if (a_Meta == 0x7) { @@ -31,18 +31,18 @@ public: case E_BLOCK_CROPS: { a_Pickups.push_back(cItem(E_ITEM_WHEAT, 1, 0)); - a_Pickups.push_back(cItem(E_ITEM_SEEDS, 1 + (int)(rand.randInt(2) + rand.randInt(2)) / 2, 0)); // [1 .. 3] with high preference of 2 + a_Pickups.push_back(cItem(E_ITEM_SEEDS, (char)(1 + (rand.NextInt(3) + rand.NextInt(3)) / 2), 0)); // [1 .. 3] with high preference of 2 break; } case E_BLOCK_CARROTS: { - a_Pickups.push_back(cItem(E_ITEM_CARROT, 1 + (int)(rand.randInt(2) + rand.randInt(2)) / 2, 0)); // [1 .. 3] with high preference of 2 + a_Pickups.push_back(cItem(E_ITEM_CARROT, (char)(1 + (rand.NextInt(3) + rand.NextInt(3)) / 2), 0)); // [1 .. 3] with high preference of 2 break; } case E_BLOCK_POTATOES: { - a_Pickups.push_back(cItem(E_ITEM_POTATO, 1 + (int)(rand.randInt(2) + rand.randInt(2)) / 2, 0)); // [1 .. 3] with high preference of 2 - if (rand.randInt(20) == 0) + a_Pickups.push_back(cItem(E_ITEM_POTATO, (char)(1 + (rand.NextInt(3) + rand.NextInt(3)) / 2), 0)); // [1 .. 3] with high preference of 2 + if (rand.NextInt(21) == 0) { // With a 5% chance, drop a poisonous potato as well a_Pickups.push_back(cItem(E_ITEM_POISONOUS_POTATO, 1, 0)); diff --git a/src/Blocks/BlockDirt.h b/src/Blocks/BlockDirt.h index a1ab74257..aa24b8668 100644 --- a/src/Blocks/BlockDirt.h +++ b/src/Blocks/BlockDirt.h @@ -2,7 +2,7 @@ #pragma once #include "BlockHandler.h" -#include "../MersenneTwister.h" +#include "../FastRandom.h" @@ -44,12 +44,12 @@ public: } // Grass spreads to adjacent dirt blocks: - MTRand rand; // TODO: Replace with cFastRandom + cFastRandom rand; for (int i = 0; i < 2; i++) // Pick two blocks to grow to { - int OfsX = rand.randInt(2) - 1; // [-1 .. 1] - int OfsY = rand.randInt(4) - 3; // [-3 .. 1] - int OfsZ = rand.randInt(2) - 1; // [-1 .. 1] + int OfsX = rand.NextInt(3, a_RelX) - 1; // [-1 .. 1] + int OfsY = rand.NextInt(5, a_RelY) - 3; // [-3 .. 1] + int OfsZ = rand.NextInt(3, a_RelZ) - 1; // [-1 .. 1] BLOCKTYPE DestBlock; NIBBLETYPE DestMeta; diff --git a/src/Blocks/BlockDoor.cpp b/src/Blocks/BlockDoor.cpp index 4e38ef334..479c68153 100644 --- a/src/Blocks/BlockDoor.cpp +++ b/src/Blocks/BlockDoor.cpp @@ -110,3 +110,87 @@ const char * cBlockDoorHandler::GetStepSound(void) + +NIBBLETYPE cBlockDoorHandler::MetaRotateCCW(NIBBLETYPE a_Meta) +{ + if (a_Meta & 0x08) + { + return a_Meta; + } + else + { + return super::MetaRotateCCW(a_Meta); + } +} + + + +NIBBLETYPE cBlockDoorHandler::MetaRotateCW(NIBBLETYPE a_Meta) +{ + if (a_Meta & 0x08) + { + return a_Meta; + } + else + { + return super::MetaRotateCW(a_Meta); + } +} + + + +NIBBLETYPE cBlockDoorHandler::MetaMirrorXY(NIBBLETYPE a_Meta) +{ + // Top bit (0x08) contains door panel type (Top/Bottom panel) Only Bottom panels contain position data + // Return a_Meta if panel is a top panel (0x08 bit is set to 1) + + // Note: Currently, you can not properly mirror the hinges on a double door. The orientation of the door is stored + // in only the bottom tile while the hinge position is in the top tile. This function only operates on one tile at a time, + // so the function can only see either the hinge position or orientation, but not both, at any given time. The class itself + // needs extra datamembers. + if (a_Meta & 0x08) return a_Meta; + + // Holds open/closed meta data. 0x0C == 1100. + NIBBLETYPE OtherMeta = a_Meta & 0x0C; + + // Mirrors according to a table. 0x03 == 0011. + switch (a_Meta & 0x03) + { + case 0x03: return 0x01 + OtherMeta; // South -> North + case 0x01: return 0x03 + OtherMeta; // North -> South + } + + // Not Facing North or South; No change. + return a_Meta; +} + + + +NIBBLETYPE cBlockDoorHandler::MetaMirrorYZ(NIBBLETYPE a_Meta) +{ + // Top bit (0x08) contains door panel type (Top/Bottom panel) Only Bottom panels contain position data + // Return a_Meta if panel is a top panel (0x08 bit is set to 1) + + // Note: Currently, you can not properly mirror the hinges on a double door. The orientation of the door is stored + // in only the bottom tile while the hinge position is in the top tile. This function only operates on one tile at a time, + // so the function can only see either the hinge position or orientation, but not both, at any given time.The class itself + // needs extra datamembers. + + if (a_Meta & 0x08) return a_Meta; + + // Holds open/closed meta data. 0x0C == 1100. + NIBBLETYPE OtherMeta = a_Meta & 0x0C; + + // Mirrors according to a table. 0x03 == 0011. + switch (a_Meta & 0x03) + { + case 0x00: return 0x02 + OtherMeta; // West -> East + case 0x02: return 0x00 + OtherMeta; // East -> West + } + + // Not Facing North or South; No change. + return a_Meta; +} + + + diff --git a/src/Blocks/BlockDoor.h b/src/Blocks/BlockDoor.h index 981774c17..797fe484c 100644 --- a/src/Blocks/BlockDoor.h +++ b/src/Blocks/BlockDoor.h @@ -4,15 +4,15 @@ #include "BlockHandler.h" #include "../Entities/Player.h" #include "Chunk.h" -#include "MetaRotater.h" +#include "MetaRotator.h" class cBlockDoorHandler : - public cMetaRotater<cBlockHandler, 0x03, 0x01, 0x02, 0x03, 0x00, true> + public cMetaRotator<cBlockHandler, 0x03, 0x01, 0x02, 0x03, 0x00, true> { - typedef cMetaRotater<cBlockHandler, 0x03, 0x01, 0x02, 0x03, 0x00, true> super; + typedef cMetaRotator<cBlockHandler, 0x03, 0x01, 0x02, 0x03, 0x00, true> super; public: cBlockDoorHandler(BLOCKTYPE a_BlockType); @@ -21,6 +21,10 @@ public: virtual void OnCancelRightClick(cChunkInterface & a_ChunkInterface, cWorldInterface & a_WorldInterface, cPlayer * a_Player, int a_BlockX, int a_BlockY, int a_BlockZ, eBlockFace a_BlockFace) override; virtual const char * GetStepSound(void) override; + virtual NIBBLETYPE MetaRotateCCW(NIBBLETYPE a_Meta) override; + virtual NIBBLETYPE MetaRotateCW(NIBBLETYPE a_Meta) override; + virtual NIBBLETYPE MetaMirrorXY(NIBBLETYPE a_Meta) override; + virtual NIBBLETYPE MetaMirrorYZ(NIBBLETYPE a_Meta) override; virtual bool GetPlacementBlockTypeMeta( cChunkInterface & a_ChunkInterface, cPlayer * a_Player, @@ -142,14 +146,14 @@ public: static void ChangeDoor(cChunkInterface & a_ChunkInterface, int a_X, int a_Y, int a_Z) { NIBBLETYPE OldMetaData = a_ChunkInterface.GetBlockMeta(a_X, a_Y, a_Z); - + a_ChunkInterface.SetBlockMeta(a_X, a_Y, a_Z, ChangeStateMetaData(OldMetaData)); - + if (OldMetaData & 8) { // Current block is top of the door BLOCKTYPE BottomBlock = a_ChunkInterface.GetBlock(a_X, a_Y - 1, a_Z); - NIBBLETYPE BottomMeta = a_ChunkInterface.GetBlockMeta(a_X, a_Y - 1, a_Z); + NIBBLETYPE BottomMeta = a_ChunkInterface.GetBlockMeta(a_X, a_Y - 1, a_Z); if (IsDoor(BottomBlock) && !(BottomMeta & 8)) { @@ -168,62 +172,6 @@ public: } } } - - - virtual NIBBLETYPE MetaRotateCCW(NIBBLETYPE a_Meta) override - { - if (a_Meta & 0x08) - { - return a_Meta; - } - else - { - return super::MetaRotateCCW(a_Meta); - } - } - - - - virtual NIBBLETYPE MetaRotateCW(NIBBLETYPE a_Meta) override - { - if (a_Meta & 0x08) - { - return a_Meta; - } - else - { - return super::MetaRotateCW(a_Meta); - } - } - - - - virtual NIBBLETYPE MetaMirrorXY(NIBBLETYPE a_Meta) override - { - if (a_Meta & 0x08) - { - return a_Meta; - } - else - { - return super::MetaMirrorXY(a_Meta); - } - } - - - - virtual NIBBLETYPE MetaMirrorYZ(NIBBLETYPE a_Meta) override - { - if (a_Meta & 0x08) - { - return a_Meta; - } - else - { - return super::MetaMirrorYZ(a_Meta); - } - } - } ; diff --git a/src/Blocks/BlockDropSpenser.h b/src/Blocks/BlockDropSpenser.h index 7e0ad0e55..88b61a418 100644 --- a/src/Blocks/BlockDropSpenser.h +++ b/src/Blocks/BlockDropSpenser.h @@ -6,18 +6,18 @@ #pragma once #include "../Piston.h" -#include "MetaRotater.h" +#include "MetaRotator.h" class cBlockDropSpenserHandler : - public cMetaRotater<cBlockEntityHandler, 0x07, 0x02, 0x05, 0x03, 0x04> + public cMetaRotator<cBlockEntityHandler, 0x07, 0x02, 0x05, 0x03, 0x04> { public: cBlockDropSpenserHandler(BLOCKTYPE a_BlockType) : - cMetaRotater<cBlockEntityHandler, 0x07, 0x02, 0x05, 0x03, 0x04>(a_BlockType) + cMetaRotator<cBlockEntityHandler, 0x07, 0x02, 0x05, 0x03, 0x04>(a_BlockType) { } diff --git a/src/Blocks/BlockEnderchest.h b/src/Blocks/BlockEnderchest.h index 97cf484fb..67955f8ce 100644 --- a/src/Blocks/BlockEnderchest.h +++ b/src/Blocks/BlockEnderchest.h @@ -2,17 +2,17 @@ #pragma once #include "BlockEntity.h" -#include "MetaRotater.h" +#include "MetaRotator.h" class cBlockEnderchestHandler : - public cMetaRotater<cBlockEntityHandler, 0x07, 0x02, 0x05, 0x03, 0x04> + public cMetaRotator<cBlockEntityHandler, 0x07, 0x02, 0x05, 0x03, 0x04> { public: cBlockEnderchestHandler(BLOCKTYPE a_BlockType) - : cMetaRotater<cBlockEntityHandler, 0x07, 0x02, 0x05, 0x03, 0x04>(a_BlockType) + : cMetaRotator<cBlockEntityHandler, 0x07, 0x02, 0x05, 0x03, 0x04>(a_BlockType) { } diff --git a/src/Blocks/BlockFenceGate.h b/src/Blocks/BlockFenceGate.h index e3162bbd6..e202c6610 100644 --- a/src/Blocks/BlockFenceGate.h +++ b/src/Blocks/BlockFenceGate.h @@ -2,17 +2,17 @@ #pragma once #include "BlockHandler.h" -#include "MetaRotater.h" +#include "MetaRotator.h" class cBlockFenceGateHandler : - public cMetaRotater<cBlockHandler, 0x03, 0x02, 0x03, 0x00, 0x01, true> + public cMetaRotator<cBlockHandler, 0x03, 0x02, 0x03, 0x00, 0x01, true> { public: cBlockFenceGateHandler(BLOCKTYPE a_BlockType) : - cMetaRotater<cBlockHandler, 0x03, 0x02, 0x03, 0x00, 0x01, true>(a_BlockType) + cMetaRotator<cBlockHandler, 0x03, 0x02, 0x03, 0x00, 0x01, true>(a_BlockType) { } diff --git a/src/Blocks/BlockFire.h b/src/Blocks/BlockFire.h index a25b87858..c8f158e7e 100644 --- a/src/Blocks/BlockFire.h +++ b/src/Blocks/BlockFire.h @@ -17,25 +17,27 @@ public: } /// Portal boundary and direction variables - int XZP, XZM, Dir; // For wont of a better name... + // 2014_03_30 _X: What are these used for? Why do we need extra variables? + int XZP, XZM; + NIBBLETYPE Dir; virtual void OnPlaced(cChunkInterface & a_ChunkInterface, cWorldInterface & a_WorldInterface, int a_BlockX, int a_BlockY, int a_BlockZ, BLOCKTYPE a_BlockType, NIBBLETYPE a_BlockMeta) override { /* PORTAL FINDING ALGORITH ======================= - -Get clicked base block - -Trace upwards to find first obsidian block; aborts if anything other than obsidian or air is encountered. - Uses this value as a reference (the 'ceiling') - -For both directions (if one fails, try the other), BASE (clicked) block: - -Go in one direction, only stop if a non obsidian block is encountered (abort) OR a portal border is encountered (FindObsidianCeiling returns -1) - -If a border was encountered, go the other direction and repeat above - -Write borders to XZP and XZM, write direction portal faces to Dir - -Loop through boundary variables, and fill with portal blocks based on Dir with meta from Dir + - Get clicked base block + - Trace upwards to find first obsidian block; aborts if anything other than obsidian or air is encountered. + Uses this value as a reference (the 'ceiling') + - For both directions (if one fails, try the other), BASE (clicked) block: + - Go in one direction, only stop if a non obsidian block is encountered (abort) OR a portal border is encountered (FindObsidianCeiling returns -1) + - If a border was encountered, go the other direction and repeat above + - Write borders to XZP and XZM, write direction portal faces to Dir + - Loop through boundary variables, and fill with portal blocks based on Dir with meta from Dir */ a_BlockY--; // Because we want the block below the fire - FindAndSetPortalFrame(a_BlockX, a_BlockY, a_BlockZ, a_ChunkInterface, a_WorldInterface); // Brought to you by Aperture Science + FindAndSetPortalFrame(a_BlockX, a_BlockY, a_BlockZ, a_ChunkInterface, a_WorldInterface); } virtual void OnDigging(cChunkInterface & a_ChunkInterface, cWorldInterface & a_WorldInterface, cPlayer * a_Player, int a_BlockX, int a_BlockY, int a_BlockZ) override diff --git a/src/Blocks/BlockFluid.h b/src/Blocks/BlockFluid.h index 37885e4de..d486d642d 100644 --- a/src/Blocks/BlockFluid.h +++ b/src/Blocks/BlockFluid.h @@ -93,6 +93,7 @@ public: // Check if it's fuel: BLOCKTYPE BlockType; if ( + ((a_RelY + y < 0) || (a_RelY + y > cChunkDef::Height)) || !a_Chunk.UnboundedRelGetBlockType(a_RelX + x, a_RelY + y, a_RelZ + z, BlockType) || !cFireSimulator::IsFuel(BlockType) ) @@ -119,6 +120,7 @@ public: for (size_t i = 0; i < ARRAYCOUNT(CrossCoords); i++) { if ( + ((RelY + CrossCoords[i].y >= 0) && (RelY + CrossCoords[i].y <= cChunkDef::Height)) && a_Chunk.UnboundedRelGetBlockType(RelX + CrossCoords[i].x, RelY + CrossCoords[i].y, RelZ + CrossCoords[i].z, BlockType) && (BlockType == E_BLOCK_AIR) ) diff --git a/src/Blocks/BlockFurnace.h b/src/Blocks/BlockFurnace.h index 27ef2689f..a7a807957 100644 --- a/src/Blocks/BlockFurnace.h +++ b/src/Blocks/BlockFurnace.h @@ -4,17 +4,17 @@ #include "BlockEntity.h" #include "../World.h" #include "../Piston.h" - +#include "MetaRotator.h" class cBlockFurnaceHandler : - public cBlockEntityHandler + public cMetaRotator<cBlockEntityHandler, 0x07, 0x02, 0x05, 0x03, 0x04> { public: - cBlockFurnaceHandler(BLOCKTYPE a_BlockType) : - cBlockEntityHandler(a_BlockType) + cBlockFurnaceHandler(BLOCKTYPE a_BlockType) + : cMetaRotator<cBlockEntityHandler, 0x07, 0x02, 0x05, 0x03, 0x04>(a_BlockType) { } diff --git a/src/Blocks/BlockHandler.cpp b/src/Blocks/BlockHandler.cpp index 09e00e77d..4a29ff628 100644 --- a/src/Blocks/BlockHandler.cpp +++ b/src/Blocks/BlockHandler.cpp @@ -42,6 +42,7 @@ #include "BlockIce.h" #include "BlockLadder.h" #include "BlockLeaves.h" +#include "BlockLilypad.h" #include "BlockNewLeaves.h" #include "BlockLever.h" #include "BlockMelon.h" @@ -144,6 +145,7 @@ cBlockHandler * cBlockHandler::CreateBlockHandler(BLOCKTYPE a_BlockType) case E_BLOCK_LAPIS_ORE: return new cBlockOreHandler (a_BlockType); case E_BLOCK_LAVA: return new cBlockLavaHandler (a_BlockType); case E_BLOCK_LEAVES: return new cBlockLeavesHandler (a_BlockType); + case E_BLOCK_LILY_PAD: return new cBlockLilypadHandler (a_BlockType); case E_BLOCK_LIT_FURNACE: return new cBlockFurnaceHandler (a_BlockType); case E_BLOCK_LOG: return new cBlockSidewaysHandler (a_BlockType); case E_BLOCK_MELON: return new cBlockMelonHandler (a_BlockType); diff --git a/src/Blocks/BlockHopper.h b/src/Blocks/BlockHopper.h index 59b84aa0e..a882bb077 100644 --- a/src/Blocks/BlockHopper.h +++ b/src/Blocks/BlockHopper.h @@ -3,16 +3,16 @@ // Declares the cBlockHopperHandler class representing the handler for the Hopper block - +#include "MetaRotator.h" class cBlockHopperHandler : - public cBlockEntityHandler + public cMetaRotator<cBlockEntityHandler, 0x07, 0x02, 0x05, 0x03, 0x04> { public: cBlockHopperHandler(BLOCKTYPE a_BlockType) - : cBlockEntityHandler(a_BlockType) + : cMetaRotator<cBlockEntityHandler, 0x07, 0x02, 0x05, 0x03, 0x04>(a_BlockType) { } @@ -39,6 +39,21 @@ public: } return true; } + + + virtual NIBBLETYPE MetaMirrorXZ(NIBBLETYPE a_Meta) override + { + // Bit 0x08 is a flag. Lowest three bits are position. 0x08 == 1000 + NIBBLETYPE OtherMeta = a_Meta & 0x08; + // Mirrors defined by by a table. (Source, mincraft.gamepedia.com) 0x07 == 0111 + switch (a_Meta & 0x07) + { + case 0x00: return 0x01 + OtherMeta; // Down -> Up + case 0x01: return 0x00 + OtherMeta; // Up -> Down + } + // Not Facing Up or Down; No change. + return a_Meta; + } } ; diff --git a/src/Blocks/BlockLadder.h b/src/Blocks/BlockLadder.h index a3e9edc6b..a605edf3f 100644 --- a/src/Blocks/BlockLadder.h +++ b/src/Blocks/BlockLadder.h @@ -9,11 +9,11 @@ class cBlockLadderHandler : - public cBlockHandler + public cMetaRotator<cBlockHandler, 0x07, 0x02, 0x05, 0x03, 0x04> { public: cBlockLadderHandler(BLOCKTYPE a_BlockType) - : cBlockHandler(a_BlockType) + : cMetaRotator<cBlockHandler, 0x07, 0x02, 0x05, 0x03, 0x04>(a_BlockType) { } diff --git a/src/Blocks/BlockLeaves.h b/src/Blocks/BlockLeaves.h index a6d3373c1..8af14686e 100644 --- a/src/Blocks/BlockLeaves.h +++ b/src/Blocks/BlockLeaves.h @@ -1,6 +1,6 @@ #pragma once #include "BlockHandler.h" -#include "../MersenneTwister.h" +#include "../FastRandom.h" #include "../World.h" #include "../BlockArea.h" @@ -37,16 +37,18 @@ public: virtual void ConvertToPickups(cItems & a_Pickups, NIBBLETYPE a_BlockMeta) override { - MTRand rand; + cFastRandom rand; // Only the first 2 bits contain the display information, the others are for growing - if (rand.randInt(5) == 0) + if (rand.NextInt(6) == 0) { a_Pickups.push_back(cItem(E_BLOCK_SAPLING, 1, a_BlockMeta & 3)); } - if ((a_BlockMeta & 3) == E_META_SAPLING_APPLE) + + // 1 % chance of dropping an apple, if the leaves' type is Apple Leaves + if ((a_BlockMeta & 3) == E_META_LEAVES_APPLE) { - if (rand.rand(100) == 0) + if (rand.NextInt(101) == 0) { a_Pickups.push_back(cItem(E_ITEM_RED_APPLE, 1, 0)); } @@ -58,11 +60,10 @@ public: { cBlockHandler::OnDestroyed(a_ChunkInterface, a_WorldInterface, a_BlockX, a_BlockY, a_BlockZ); - //0.5% chance of dropping an apple + // 0.5% chance of dropping an apple, if the leaves' type is Apple Leaves: NIBBLETYPE Meta = a_ChunkInterface.GetBlockMeta(a_BlockX, a_BlockY, a_BlockZ); - //check if Oak (0x1 and 0x2 bit not set) - MTRand rand; - if(!(Meta & 3) && rand.randInt(200) == 100) + cFastRandom rand; + if (((Meta & 3) == E_META_LEAVES_APPLE) && (rand.NextInt(201) == 100)) { cItems Drops; Drops.push_back(cItem(E_ITEM_RED_APPLE, 1, 0)); diff --git a/src/Blocks/BlockLever.h b/src/Blocks/BlockLever.h index ef6e102cd..ad2ae29e5 100644 --- a/src/Blocks/BlockLever.h +++ b/src/Blocks/BlockLever.h @@ -1,17 +1,18 @@ #pragma once #include "BlockHandler.h" - +#include "MetaRotator.h" class cBlockLeverHandler : - public cBlockHandler + public cMetaRotator<cBlockHandler, 0x07, 0x04, 0x02, 0x03, 0x01, false> { + typedef cMetaRotator<cBlockHandler, 0x07, 0x04, 0x02, 0x03, 0x01, false> super; public: cBlockLeverHandler(BLOCKTYPE a_BlockType) - : cBlockHandler(a_BlockType) + : cMetaRotator<cBlockHandler, 0x07, 0x04, 0x02, 0x03, 0x01, false>(a_BlockType) { } @@ -104,6 +105,36 @@ public: return (a_RelY > 0) && cBlockInfo::IsSolid(BlockIsOn); } + + + virtual NIBBLETYPE MetaRotateCCW(NIBBLETYPE a_Meta) override + { + switch (a_Meta) + { + case 0x00: return 0x07; // Ceiling rotation + case 0x07: return 0x00; + + case 0x05: return 0x06; // Ground rotation + case 0x06: return 0x05; + + default: return super::MetaRotateCCW(a_Meta); // Wall Rotation + } + } + + + virtual NIBBLETYPE MetaRotateCW(NIBBLETYPE a_Meta) override + { + switch (a_Meta) + { + case 0x00: return 0x07; // Ceiling rotation + case 0x07: return 0x00; + + case 0x05: return 0x06; // Ground rotation + case 0x06: return 0x05; + + default: return super::MetaRotateCCW(a_Meta); // Wall Rotation + } + } } ; diff --git a/src/Blocks/BlockLilypad.h b/src/Blocks/BlockLilypad.h new file mode 100644 index 000000000..2dd4ec768 --- /dev/null +++ b/src/Blocks/BlockLilypad.h @@ -0,0 +1,28 @@ + +#pragma once + +#include "BlockHandler.h" +#include "Entities/Pickup.h" + + + + +class cBlockLilypadHandler : + public cBlockHandler +{ +public: + cBlockLilypadHandler(BLOCKTYPE a_BlockType) + : cBlockHandler(a_BlockType) + { + } + + virtual void ConvertToPickups(cItems & a_Pickups, NIBBLETYPE a_BlockMeta) override + { + // Reset meta to zero + a_Pickups.push_back(cItem(E_BLOCK_LILY_PAD, 1, 0)); + } +}; + + + + diff --git a/src/Blocks/BlockMobHead.h b/src/Blocks/BlockMobHead.h index 6aa01f986..acd1c88fb 100644 --- a/src/Blocks/BlockMobHead.h +++ b/src/Blocks/BlockMobHead.h @@ -22,14 +22,99 @@ public: a_Pickups.push_back(cItem(E_ITEM_HEAD, 1, 0)); } - bool TrySpawnWither(cChunkInterface & a_ChunkInterface, int a_BlockX, int a_BlockY, int a_BlockZ) + bool TrySpawnWither(cChunkInterface & a_ChunkInterface, cWorld * a_World, int a_BlockX, int a_BlockY, int a_BlockZ) { if (a_BlockY < 2) { return false; } + + class cCallback : public cMobHeadCallback + { + bool m_IsWither; + + virtual bool Item (cMobHeadEntity * a_MobHeadEntity) + { + m_IsWither = (a_MobHeadEntity->GetType() == SKULL_TYPE_WITHER); + + return false; + } + + public: + cCallback () : m_IsWither(false) {} + + bool IsWither(void) const { return m_IsWither; } + + void Reset(void) { m_IsWither = false; } + } CallbackA, CallbackB; + + a_World->DoWithMobHeadAt(a_BlockX, a_BlockY, a_BlockZ, CallbackA); + + if (!CallbackA.IsWither()) + { + return false; + } + + CallbackA.Reset(); + + BLOCKTYPE BlockY1 = a_ChunkInterface.GetBlock(a_BlockX, a_BlockY - 1, a_BlockZ); + BLOCKTYPE BlockY2 = a_ChunkInterface.GetBlock(a_BlockX, a_BlockY - 2, a_BlockZ); + + if ((BlockY1 != E_BLOCK_SOULSAND) || (BlockY2 != E_BLOCK_SOULSAND)) + { + return false; + } + + a_World->DoWithMobHeadAt(a_BlockX - 1, a_BlockY, a_BlockZ, CallbackA); + a_World->DoWithMobHeadAt(a_BlockX + 1, a_BlockY, a_BlockZ, CallbackB); + + BLOCKTYPE Block1 = a_ChunkInterface.GetBlock(a_BlockX - 1, a_BlockY - 1, a_BlockZ); + BLOCKTYPE Block2 = a_ChunkInterface.GetBlock(a_BlockX + 1, a_BlockY - 1, a_BlockZ); + + if ((Block1 == E_BLOCK_SOULSAND) && (Block2 == E_BLOCK_SOULSAND) && CallbackA.IsWither() && CallbackB.IsWither()) + { + a_ChunkInterface.FastSetBlock(a_BlockX, a_BlockY - 1, a_BlockZ, E_BLOCK_AIR, 0); + a_ChunkInterface.FastSetBlock(a_BlockX + 1, a_BlockY - 1, a_BlockZ, E_BLOCK_AIR, 0); + a_ChunkInterface.FastSetBlock(a_BlockX - 1, a_BlockY - 1, a_BlockZ, E_BLOCK_AIR, 0); + a_ChunkInterface.FastSetBlock(a_BlockX, a_BlockY - 2, a_BlockZ, E_BLOCK_AIR, 0); + + // Block entities + a_World->SetBlock(a_BlockX + 1, a_BlockY, a_BlockZ, E_BLOCK_AIR, 0); + a_World->SetBlock(a_BlockX, a_BlockY, a_BlockZ, E_BLOCK_AIR, 0); + a_World->SetBlock(a_BlockX - 1, a_BlockY, a_BlockZ, E_BLOCK_AIR, 0); + + // Spawn the wither: + a_World->SpawnMob(a_BlockX + 0.5, a_BlockY - 2, a_BlockZ + 0.5, cMonster::mtWither); + + return true; + } + + CallbackA.Reset(); + CallbackB.Reset(); - // TODO 2014-03-24 xdot + a_World->DoWithMobHeadAt(a_BlockX, a_BlockY, a_BlockZ - 1, CallbackA); + a_World->DoWithMobHeadAt(a_BlockX, a_BlockY, a_BlockZ + 1, CallbackB); + + Block1 = a_ChunkInterface.GetBlock(a_BlockX, a_BlockY - 1, a_BlockZ - 1); + Block2 = a_ChunkInterface.GetBlock(a_BlockX, a_BlockY - 1, a_BlockZ + 1); + + if ((Block1 == E_BLOCK_SOULSAND) && (Block2 == E_BLOCK_SOULSAND) && CallbackA.IsWither() && CallbackB.IsWither()) + { + a_ChunkInterface.FastSetBlock(a_BlockX, a_BlockY - 1, a_BlockZ, E_BLOCK_AIR, 0); + a_ChunkInterface.FastSetBlock(a_BlockX, a_BlockY - 1, a_BlockZ + 1, E_BLOCK_AIR, 0); + a_ChunkInterface.FastSetBlock(a_BlockX, a_BlockY - 1, a_BlockZ - 1, E_BLOCK_AIR, 0); + a_ChunkInterface.FastSetBlock(a_BlockX, a_BlockY - 2, a_BlockZ, E_BLOCK_AIR, 0); + + // Block entities + a_World->SetBlock(a_BlockX, a_BlockY, a_BlockZ + 1, E_BLOCK_AIR, 0); + a_World->SetBlock(a_BlockX, a_BlockY, a_BlockZ, E_BLOCK_AIR, 0); + a_World->SetBlock(a_BlockX, a_BlockY, a_BlockZ - 1, E_BLOCK_AIR, 0); + + // Spawn the wither: + a_World->SpawnMob(a_BlockX + 0.5, a_BlockY - 2, a_BlockZ + 0.5, cMonster::mtWither); + + return true; + } return false; } @@ -62,20 +147,37 @@ public: } public: - cCallback (cPlayer * a_Player, NIBBLETYPE a_OldBlockMeta, NIBBLETYPE a_NewBlockMeta) : - m_Player(a_Player), + cCallback (cPlayer * a_CBPlayer, NIBBLETYPE a_OldBlockMeta, NIBBLETYPE a_NewBlockMeta) : + m_Player(a_CBPlayer), m_OldBlockMeta(a_OldBlockMeta), m_NewBlockMeta(a_NewBlockMeta) {} }; cCallback Callback(a_Player, a_BlockMeta, static_cast<NIBBLETYPE>(a_BlockFace)); - a_BlockMeta = a_BlockFace; + a_BlockMeta = (NIBBLETYPE)a_BlockFace; cWorld * World = (cWorld *) &a_WorldInterface; World->DoWithMobHeadAt(a_BlockX, a_BlockY, a_BlockZ, Callback); a_ChunkInterface.SetBlockMeta(a_BlockX, a_BlockY, a_BlockZ, a_BlockMeta); - TrySpawnWither(a_ChunkInterface, a_BlockX, a_BlockY, a_BlockZ); + if (a_BlockMeta == SKULL_TYPE_WITHER) + { + static const Vector3i Coords[] = + { + Vector3i( 0, 0, 0), + Vector3i( 1, 0, 0), + Vector3i(-1, 0, 0), + Vector3i( 0, 0, 1), + Vector3i( 0, 0, -1), + }; + for (size_t i = 0; i < ARRAYCOUNT(Coords); ++i) + { + if (TrySpawnWither(a_ChunkInterface, World, a_BlockX + Coords[i].x, a_BlockY, a_BlockZ + Coords[i].z)) + { + break; + } + } // for i - Coords[] + } } } ; diff --git a/src/Blocks/BlockNetherWart.h b/src/Blocks/BlockNetherWart.h index 923180e19..812cf906f 100644 --- a/src/Blocks/BlockNetherWart.h +++ b/src/Blocks/BlockNetherWart.h @@ -2,14 +2,13 @@ #pragma once #include "BlockHandler.h" -#include "../MersenneTwister.h" +#include "../FastRandom.h" #include "../World.h" -/// Common class that takes care of carrots, potatoes and wheat class cBlockNetherWartHandler : public cBlockHandler { @@ -22,12 +21,12 @@ public: virtual void ConvertToPickups(cItems & a_Pickups, NIBBLETYPE a_Meta) override { - MTRand rand; + cFastRandom rand; if (a_Meta == 0x7) { - // Is fully grown, drop the entire produce: - a_Pickups.push_back(cItem(E_ITEM_NETHER_WART, 1 + (int)(rand.randInt(2) + rand.randInt(2)) / 2, 0)); + // Fully grown, drop the entire produce: + a_Pickups.push_back(cItem(E_ITEM_NETHER_WART, (char)(1 + (rand.NextInt(3) + rand.NextInt(3))) / 2, 0)); } else { @@ -35,18 +34,20 @@ public: } } + virtual void OnUpdate(cChunkInterface & cChunkInterface, cWorldInterface & a_WorldInterface, cBlockPluginInterface & a_PluginInterface, cChunk & a_Chunk, int a_RelX, int a_RelY, int a_RelZ) override { - NIBBLETYPE Meta = a_Chunk.GetMeta (a_RelX, a_RelY, a_RelZ); - + NIBBLETYPE Meta = a_Chunk.GetMeta(a_RelX, a_RelY, a_RelZ); if (Meta < 7) { a_Chunk.FastSetBlock(a_RelX, a_RelY, a_RelZ, E_BLOCK_NETHER_WART, ++Meta); } } + virtual bool CanBeAt(cChunkInterface & a_ChunkInterface, int a_RelX, int a_RelY, int a_RelZ, const cChunk & a_Chunk) override { + // Needs to be placed on top of a Soulsand block: return ((a_RelY > 0) && (a_Chunk.GetBlock(a_RelX, a_RelY - 1, a_RelZ) == E_BLOCK_SOULSAND)); } } ; diff --git a/src/Blocks/BlockPluginInterface.h b/src/Blocks/BlockPluginInterface.h index 7428c9a7a..3a36c40b1 100644 --- a/src/Blocks/BlockPluginInterface.h +++ b/src/Blocks/BlockPluginInterface.h @@ -1,8 +1,14 @@ #pragma once +/** This interface is used to decouple block handlers from the cPluginManager dependancy through cWorld. +The block handlers call this interface, which is then implemented by the specific classes that +the caller provides. +*/ class cBlockPluginInterface { public: + virtual ~cBlockPluginInterface() {} + virtual bool CallHookBlockToPickups(cEntity * a_Digger, int a_BlockX, int a_BlockY, int a_BlockZ, BLOCKTYPE a_BlockType, NIBBLETYPE a_BlockMeta, cItems & a_Pickups) = 0; }; diff --git a/src/Blocks/BlockPumpkin.h b/src/Blocks/BlockPumpkin.h index 349f52605..ac2b9817a 100644 --- a/src/Blocks/BlockPumpkin.h +++ b/src/Blocks/BlockPumpkin.h @@ -1,16 +1,16 @@ #pragma once #include "BlockHandler.h" - +#include "MetaRotator.h" class cBlockPumpkinHandler : - public cBlockHandler + public cMetaRotator<cBlockHandler, 0x07, 0x02, 0x03, 0x00, 0x01, false> { public: cBlockPumpkinHandler(BLOCKTYPE a_BlockType) - : cBlockHandler(a_BlockType) + : cMetaRotator<cBlockHandler, 0x07, 0x02, 0x03, 0x00, 0x01, false>(a_BlockType) { } diff --git a/src/Blocks/BlockRail.h b/src/Blocks/BlockRail.h index 07e9814cd..ad78d290a 100644 --- a/src/Blocks/BlockRail.h +++ b/src/Blocks/BlockRail.h @@ -431,9 +431,145 @@ public: } break; } + default: break; } return true; } + + + virtual NIBBLETYPE MetaRotateCCW(NIBBLETYPE a_Meta) override + { + // Bit 0x08 is a flag when a_Meta is in the range 0x00--0x05 and 0x0A--0x0F. + // Bit 0x08 specifies direction when a_Meta is in the range 0x06-0x09. + if ((a_Meta < 0x06) || (a_Meta > 0x09)) + { + // Save powered rail flag. + NIBBLETYPE OtherMeta = a_Meta & 0x08; + // Rotates according to table; 0x07 == 0111. + // Rails can either be flat (North/South) or Ascending (Asc. East) + switch (a_Meta & 0x07) + { + case 0x00: return 0x01 + OtherMeta; // North/South -> East/West + case 0x01: return 0x00 + OtherMeta; // East/West -> North/South + + case 0x02: return 0x04 + OtherMeta; // Asc. East -> Asc. North + case 0x04: return 0x03 + OtherMeta; // Asc. North -> Asc. West + case 0x03: return 0x05 + OtherMeta; // Asc. West -> Asc. South + case 0x05: return 0x02 + OtherMeta; // Asc. South -> Asc. East + } + } + else + { + switch (a_Meta) + { + // Corner Directions + case 0x06: return 0x09; // Northwest Cnr. -> Southwest Cnr. + case 0x07: return 0x06; // Northeast Cnr. -> Northwest Cnr. + case 0x08: return 0x07; // Southeast Cnr. -> Northeast Cnr. + case 0x09: return 0x08; // Southwest Cnr. -> Southeast Cnr. + } + } + // To avoid a compiler warning; + return a_Meta; + } + + + virtual NIBBLETYPE MetaRotateCW(NIBBLETYPE a_Meta) override + { + // Bit 0x08 is a flag for value in the range 0x00--0x05 and specifies direction for values withint 0x006--0x09. + if ((a_Meta < 0x06) || (a_Meta > 0x09)) + { + // Save powered rail flag. + NIBBLETYPE OtherMeta = a_Meta & 0x08; + // Rotates according to table; 0x07 == 0111. + // Rails can either be flat (North/South) or Ascending (Asc. East) + switch (a_Meta & 0x07) + { + case 0x00: return 0x01 + OtherMeta; // North/South -> East/West + case 0x01: return 0x00 + OtherMeta; // East/West -> North/South + + case 0x02: return 0x05 + OtherMeta; // Asc. East -> Asc. South + case 0x05: return 0x03 + OtherMeta; // Asc. South -> Asc. West + case 0x03: return 0x04 + OtherMeta; // Asc. West -> Asc. North + case 0x04: return 0x02 + OtherMeta; // Asc. North -> Asc. East + } + } + else + { + switch (a_Meta) + { + // Corner Directions + case 0x06: return 0x07; // Northwest Cnr. -> Northeast Cnr. + case 0x07: return 0x08; // Northeast Cnr. -> Southeast Cnr. + case 0x08: return 0x09; // Southeast Cnr. -> Southwest Cnr. + case 0x09: return 0x06; // Southwest Cnr. -> Northwest Cnr. + } + } + // To avoid a compiler warning; + return a_Meta; + } + + + virtual NIBBLETYPE MetaMirrorXY(NIBBLETYPE a_Meta) override + { + // Bit 0x08 is a flag for value in the range 0x00--0x05 and specifies direction for values withint 0x006--0x09. + if ((a_Meta < 0x06) || (a_Meta > 0x09)) + { + // Save powered rail flag. + NIBBLETYPE OtherMeta = a_Meta & 0x08; + // Mirrors according to table; 0x07 == 0111. + // Rails can either be flat (North/South) or Ascending (Asc. East) + switch (a_Meta & 0x07) + { + case 0x05: return 0x04 + OtherMeta; // Asc. South -> Asc. North + case 0x04: return 0x05 + OtherMeta; // Asc. North -> Asc. South + } + } + else + { + switch (a_Meta) + { + // Corner Directions + case 0x06: return 0x09; // Northwest Cnr. -> Southwest Cnr. + case 0x07: return 0x08; // Northeast Cnr. -> Southeast Cnr. + case 0x08: return 0x07; // Southeast Cnr. -> Northeast Cnr. + case 0x09: return 0x06; // Southwest Cnr. -> Northwest Cnr. + } + } + // To avoid a compiler warning; + return a_Meta; + } + + + virtual NIBBLETYPE MetaMirrorYZ(NIBBLETYPE a_Meta) override + { + // Bit 0x08 is a flag for value in the range 0x00--0x05 and specifies direction for values withint 0x006--0x09. + if ((a_Meta < 0x06) || (a_Meta > 0x09)) + { + // Save powered rail flag. + NIBBLETYPE OtherMeta = a_Meta & 0x08; + // Mirrors according to table; 0x07 == 0111. + // Rails can either be flat (North/South) or Ascending (Asc. East) + switch (a_Meta & 0x07) + { + case 0x02: return 0x03 + OtherMeta; // Asc. East -> Asc. West + case 0x03: return 0x02 + OtherMeta; // Asc. West -> Asc. East + } + } + else + { + switch (a_Meta) + { + // Corner Directions + case 0x06: return 0x07; // Northwest Cnr. -> Northeast Cnr. + case 0x07: return 0x06; // Northeast Cnr. -> Northwest Cnr. + case 0x08: return 0x09; // Southeast Cnr. -> Southwest Cnr. + case 0x09: return 0x08; // Southwest Cnr. -> Southeast Cnr. + } + } + // To avoid a compiler warning; + return a_Meta; + } } ; diff --git a/src/Blocks/BlockRedstoneRepeater.h b/src/Blocks/BlockRedstoneRepeater.h index 1e2a86949..fe6cd21b9 100644 --- a/src/Blocks/BlockRedstoneRepeater.h +++ b/src/Blocks/BlockRedstoneRepeater.h @@ -3,17 +3,17 @@ #include "BlockHandler.h" #include "Chunk.h" - +#include "MetaRotator.h" class cBlockRedstoneRepeaterHandler : - public cBlockHandler + public cMetaRotator<cBlockHandler, 0x03, 0x00, 0x01, 0x02, 0x03, true> { public: cBlockRedstoneRepeaterHandler(BLOCKTYPE a_BlockType) - : cBlockHandler(a_BlockType) + : cMetaRotator<cBlockHandler, 0x03, 0x00, 0x01, 0x02, 0x03, true>(a_BlockType) { } diff --git a/src/Blocks/BlockSign.h b/src/Blocks/BlockSign.h index cd0c02a40..9d6fede21 100644 --- a/src/Blocks/BlockSign.h +++ b/src/Blocks/BlockSign.h @@ -31,7 +31,7 @@ public: } - static char RotationToMetaData(double a_Rotation) + static NIBBLETYPE RotationToMetaData(double a_Rotation) { a_Rotation += 180 + (180 / 16); // So it's not aligned with axis if (a_Rotation > 360) @@ -45,7 +45,7 @@ public: } - static char DirectionToMetaData(eBlockFace a_Direction) + static NIBBLETYPE DirectionToMetaData(eBlockFace a_Direction) { switch (a_Direction) { @@ -71,6 +71,37 @@ public: { a_Player->GetClientHandle()->SendEditSign(a_BlockX, a_BlockY, a_BlockZ); } + + + virtual NIBBLETYPE MetaRotateCW(NIBBLETYPE a_Meta) override + { + return (++a_Meta) & 0x0F; + } + + + virtual NIBBLETYPE MetaRotateCCW(NIBBLETYPE a_Meta) override + { + return (--a_Meta) & 0x0F; + } + + virtual NIBBLETYPE MetaMirrorXY(NIBBLETYPE a_Meta) override + { + // Mirrors signs over the XY plane (North-South Mirroring) + + // There are 16 meta values which correspond to different directions. + // These values are equated to angles on a circle; 0x08 = 180 degrees. + return (a_Meta < 0x08) ? 0x08 + a_Meta : 0x08 - a_Meta; + } + + + virtual NIBBLETYPE MetaMirrorYZ(NIBBLETYPE a_Meta) override + { + // Mirrors signs over the YZ plane (East-West Mirroring) + + // There are 16 meta values which correspond to different directions. + // These values are equated to angles on a circle; 0x10 = 360 degrees. + return 0x10 - a_Meta; + } } ; diff --git a/src/Blocks/BlockSlab.h b/src/Blocks/BlockSlab.h index 7cd2c97b2..76f5ed0e7 100644 --- a/src/Blocks/BlockSlab.h +++ b/src/Blocks/BlockSlab.h @@ -11,8 +11,7 @@ #include "BlockHandler.h" #include "../Items/ItemHandler.h" - - +#include "Root.h" @@ -40,41 +39,9 @@ public: ) override { a_BlockType = m_BlockType; - BLOCKTYPE Type = (BLOCKTYPE) (a_Player->GetEquippedItem().m_ItemType); NIBBLETYPE Meta = (NIBBLETYPE) a_Player->GetEquippedItem().m_ItemDamage; - // HandlePlaceBlock wants a cItemHandler pointer thing, so let's give it one - cItemHandler * ItemHandler = cItemHandler::GetItemHandler(GetDoubleSlabType(Type)); - - // Check if the block at the coordinates is a slab. Eligibility for combining has already been processed in ClientHandle - if (IsAnySlabType(a_ChunkInterface.GetBlock(a_BlockX, a_BlockY, a_BlockZ))) - { - // Call the function in ClientHandle that places a block when the client sends the packet, - // so that plugins may interfere with the placement. - - if ((a_BlockFace == BLOCK_FACE_TOP) || (a_BlockFace == BLOCK_FACE_BOTTOM)) - { - // Top and bottom faces need no parameter modification - a_Player->GetClientHandle()->HandlePlaceBlock(a_BlockX, a_BlockY, a_BlockZ, a_BlockFace, a_CursorX, a_CursorY, a_CursorZ, *ItemHandler); - } - else - { - // The other faces need to distinguish between top and bottom cursor positions - if (a_CursorY > 7) - { - // Edit the call to use BLOCK_FACE_BOTTOM, otherwise it places incorrectly - a_Player->GetClientHandle()->HandlePlaceBlock(a_BlockX, a_BlockY, a_BlockZ, BLOCK_FACE_TOP, a_CursorX, a_CursorY, a_CursorZ, *ItemHandler); - } - else - { - // Edit the call to use BLOCK_FACE_TOP, otherwise it places incorrectly - a_Player->GetClientHandle()->HandlePlaceBlock(a_BlockX, a_BlockY, a_BlockZ, BLOCK_FACE_BOTTOM, a_CursorX, a_CursorY, a_CursorZ, *ItemHandler); - } - } - return false; // Cancel the event, because dblslabs were already placed, nothing else needed - } - - // Place the single-slab with correct metas: + // Set the correct metadata based on player equipped item (i.e. a_BlockMeta not initialised yet) switch (a_BlockFace) { case BLOCK_FACE_TOP: @@ -105,7 +72,16 @@ public: a_BlockMeta = Meta & 0x7; break; } } + case BLOCK_FACE_NONE: return false; } // switch (a_BlockFace) + + // Check if the block at the coordinates is a single slab. Eligibility for combining has already been processed in ClientHandle + // Changed to-be-placed to a double slab if we are clicking on a single slab, as opposed to placing one for the first time + if (IsAnySlabType(a_ChunkInterface.GetBlock(a_BlockX, a_BlockY, a_BlockZ))) + { + a_BlockType = GetDoubleSlabType(m_BlockType); + } + return true; } @@ -184,6 +160,15 @@ public: ASSERT(!"Unhandled double slab type!"); return ""; } + + + virtual NIBBLETYPE MetaMirrorXZ(NIBBLETYPE a_Meta) override + { + NIBBLETYPE OtherMeta = a_Meta & 0x07; // Contains unrelated meta data. + + // 8th bit is up/down. 1 right-side-up, 0 is up-side-down. + return (a_Meta & 0x08) ? 0x00 + OtherMeta : 0x01 + OtherMeta; + } } ; diff --git a/src/Blocks/BlockStairs.h b/src/Blocks/BlockStairs.h index ea8405597..09ff254a6 100644 --- a/src/Blocks/BlockStairs.h +++ b/src/Blocks/BlockStairs.h @@ -2,17 +2,17 @@ #pragma once #include "BlockHandler.h" -#include "MetaRotater.h" +#include "MetaRotator.h" class cBlockStairsHandler : - public cMetaRotater<cBlockHandler, 0x03, 0x03, 0x00, 0x02, 0x01, true> + public cMetaRotator<cBlockHandler, 0x03, 0x03, 0x00, 0x02, 0x01, true> { public: cBlockStairsHandler(BLOCKTYPE a_BlockType) : - cMetaRotater<cBlockHandler, 0x03, 0x03, 0x00, 0x02, 0x01, true>(a_BlockType) + cMetaRotator<cBlockHandler, 0x03, 0x03, 0x00, 0x02, 0x01, true>(a_BlockType) { } @@ -30,9 +30,7 @@ public: UNUSED(a_BlockY); UNUSED(a_BlockZ); UNUSED(a_CursorX); - UNUSED(a_CursorY); UNUSED(a_CursorZ); - UNUSED(a_BlockMeta); a_BlockType = m_BlockType; a_BlockMeta = RotationToMetaData(a_Player->GetYaw()); switch (a_BlockFace) @@ -51,10 +49,12 @@ public: } break; } + case BLOCK_FACE_NONE: return false; } return true; } + virtual const char * GetStepSound(void) override { if ( diff --git a/src/Blocks/BlockStems.h b/src/Blocks/BlockStems.h index 705436345..b726a0901 100644 --- a/src/Blocks/BlockStems.h +++ b/src/Blocks/BlockStems.h @@ -17,9 +17,10 @@ public: { } + virtual void ConvertToPickups(cItems & a_Pickups, NIBBLETYPE a_BlockMeta) override { - int ItemType = (m_BlockType == E_BLOCK_MELON_STEM) ? E_ITEM_MELON_SEEDS : E_ITEM_PUMPKIN_SEEDS; + short ItemType = (m_BlockType == E_BLOCK_MELON_STEM) ? E_ITEM_MELON_SEEDS : E_ITEM_PUMPKIN_SEEDS; a_Pickups.push_back(cItem(ItemType, 1, 0)); } diff --git a/src/Blocks/BlockTorch.h b/src/Blocks/BlockTorch.h index d32c77629..8ddec8de1 100644 --- a/src/Blocks/BlockTorch.h +++ b/src/Blocks/BlockTorch.h @@ -2,17 +2,17 @@ #include "BlockHandler.h" #include "../Chunk.h" -#include "MetaRotater.h" +#include "MetaRotator.h" class cBlockTorchHandler : - public cMetaRotater<cBlockHandler, 0x7, 0x4, 0x1, 0x3, 0x2> + public cMetaRotator<cBlockHandler, 0x7, 0x4, 0x1, 0x3, 0x2> { public: cBlockTorchHandler(BLOCKTYPE a_BlockType) - : cMetaRotater<cBlockHandler, 0x7, 0x4, 0x1, 0x3, 0x2>(a_BlockType) + : cMetaRotator<cBlockHandler, 0x7, 0x4, 0x1, 0x3, 0x2>(a_BlockType) { } diff --git a/src/Blocks/BlockTrapdoor.h b/src/Blocks/BlockTrapdoor.h index 9bae92c4d..6a36ab874 100644 --- a/src/Blocks/BlockTrapdoor.h +++ b/src/Blocks/BlockTrapdoor.h @@ -2,17 +2,17 @@ #pragma once #include "BlockHandler.h" - +#include "MetaRotator.h" class cBlockTrapdoorHandler : - public cBlockHandler + public cMetaRotator<cBlockHandler, 0x03, 0x01, 0x02, 0x00, 0x03, false> { public: cBlockTrapdoorHandler(BLOCKTYPE a_BlockType) - : cBlockHandler(a_BlockType) + : cMetaRotator<cBlockHandler, 0x03, 0x01, 0x02, 0x00, 0x03, false>(a_BlockType) { } diff --git a/src/Blocks/BlockVine.h b/src/Blocks/BlockVine.h index d096c81a8..7bb9dc484 100644 --- a/src/Blocks/BlockVine.h +++ b/src/Blocks/BlockVine.h @@ -1,7 +1,7 @@ #pragma once #include "BlockHandler.h" -#include "MetaRotater.h" +#include "MetaRotator.h" @@ -83,7 +83,7 @@ public: static const struct { int x, z; - int Bit; + NIBBLETYPE Bit; } Coords[] = { { 0, 1, 1}, // south, ZP @@ -91,7 +91,7 @@ public: { 0, -1, 4}, // north, ZM { 1, 0, 8}, // east, XP } ; - int res = 0; + NIBBLETYPE res = 0; for (size_t i = 0; i < ARRAYCOUNT(Coords); i++) { BLOCKTYPE BlockType; @@ -197,14 +197,14 @@ public: virtual NIBBLETYPE MetaMirrorXY(NIBBLETYPE a_Meta) override { // Bits 2 and 4 stay, bits 1 and 3 swap - return ((a_Meta & 0x0a) | ((a_Meta & 0x01) << 2) | ((a_Meta & 0x04) >> 2)); + return (NIBBLETYPE)((a_Meta & 0x0a) | ((a_Meta & 0x01) << 2) | ((a_Meta & 0x04) >> 2)); } virtual NIBBLETYPE MetaMirrorYZ(NIBBLETYPE a_Meta) override { // Bits 1 and 3 stay, bits 2 and 4 swap - return ((a_Meta & 0x05) | ((a_Meta & 0x02) << 2) | ((a_Meta & 0x08) >> 2)); + return (NIBBLETYPE)((a_Meta & 0x05) | ((a_Meta & 0x02) << 2) | ((a_Meta & 0x08) >> 2)); } } ; diff --git a/src/Blocks/BroadcastInterface.h b/src/Blocks/BroadcastInterface.h index 01966ffbd..b1b450690 100644 --- a/src/Blocks/BroadcastInterface.h +++ b/src/Blocks/BroadcastInterface.h @@ -4,7 +4,8 @@ class cBroadcastInterface { public: - + virtual ~cBroadcastInterface() {} + virtual void BroadcastUseBed (const cEntity & a_Entity, int a_BlockX, int a_BlockY, int a_BlockZ ) = 0; virtual void BroadcastSoundEffect(const AString & a_SoundName, int a_SrcX, int a_SrcY, int a_SrcZ, float a_Volume, float a_Pitch, const cClientHandle * a_Exclude = NULL) = 0; virtual void BroadcastEntityAnimation(const cEntity & a_Entity, char a_Animation, const cClientHandle * a_Exclude = NULL) = 0; diff --git a/src/Blocks/MetaRotater.h b/src/Blocks/MetaRotator.h index dde88e6db..899c583e1 100644 --- a/src/Blocks/MetaRotater.h +++ b/src/Blocks/MetaRotator.h @@ -1,4 +1,4 @@ -// MetaRotater.h +// MetaRotator.h // Provides a mixin for rotations and reflections @@ -21,15 +21,15 @@ Inherit from this class providing your base class as Base, the BitMask for the d */ template<class Base, NIBBLETYPE BitMask, NIBBLETYPE North, NIBBLETYPE East, NIBBLETYPE South, NIBBLETYPE West, bool AssertIfNotMatched = false> -class cMetaRotater : public Base +class cMetaRotator : public Base { public: - cMetaRotater(BLOCKTYPE a_BlockType) : + cMetaRotator(BLOCKTYPE a_BlockType) : Base(a_BlockType) {} - virtual ~cMetaRotater() {} + virtual ~cMetaRotator() {} virtual NIBBLETYPE MetaRotateCCW(NIBBLETYPE a_Meta) override; virtual NIBBLETYPE MetaRotateCW(NIBBLETYPE a_Meta) override; @@ -42,7 +42,7 @@ public: template<class Base, NIBBLETYPE BitMask, NIBBLETYPE North, NIBBLETYPE East, NIBBLETYPE South, NIBBLETYPE West, bool AssertIfNotMatched> -NIBBLETYPE cMetaRotater<Base, BitMask, North, East, South, West, AssertIfNotMatched>::MetaRotateCW(NIBBLETYPE a_Meta) +NIBBLETYPE cMetaRotator<Base, BitMask, North, East, South, West, AssertIfNotMatched>::MetaRotateCW(NIBBLETYPE a_Meta) { NIBBLETYPE OtherMeta = a_Meta & (~BitMask); switch (a_Meta & BitMask) @@ -64,7 +64,7 @@ NIBBLETYPE cMetaRotater<Base, BitMask, North, East, South, West, AssertIfNotMatc template<class Base, NIBBLETYPE BitMask, NIBBLETYPE North, NIBBLETYPE East, NIBBLETYPE South, NIBBLETYPE West, bool AssertIfNotMatched> -NIBBLETYPE cMetaRotater<Base, BitMask, North, East, South, West, AssertIfNotMatched>::MetaRotateCCW(NIBBLETYPE a_Meta) +NIBBLETYPE cMetaRotator<Base, BitMask, North, East, South, West, AssertIfNotMatched>::MetaRotateCCW(NIBBLETYPE a_Meta) { NIBBLETYPE OtherMeta = a_Meta & (~BitMask); switch (a_Meta & BitMask) @@ -86,7 +86,7 @@ NIBBLETYPE cMetaRotater<Base, BitMask, North, East, South, West, AssertIfNotMatc template<class Base, NIBBLETYPE BitMask, NIBBLETYPE North, NIBBLETYPE East, NIBBLETYPE South, NIBBLETYPE West, bool AssertIfNotMatched> -NIBBLETYPE cMetaRotater<Base, BitMask, North, East, South, West, AssertIfNotMatched>::MetaMirrorXY(NIBBLETYPE a_Meta) +NIBBLETYPE cMetaRotator<Base, BitMask, North, East, South, West, AssertIfNotMatched>::MetaMirrorXY(NIBBLETYPE a_Meta) { NIBBLETYPE OtherMeta = a_Meta & (~BitMask); switch (a_Meta & BitMask) @@ -103,7 +103,7 @@ NIBBLETYPE cMetaRotater<Base, BitMask, North, East, South, West, AssertIfNotMatc template<class Base, NIBBLETYPE BitMask, NIBBLETYPE North, NIBBLETYPE East, NIBBLETYPE South, NIBBLETYPE West, bool AssertIfNotMatched> -NIBBLETYPE cMetaRotater<Base, BitMask, North, East, South, West, AssertIfNotMatched>::MetaMirrorYZ(NIBBLETYPE a_Meta) +NIBBLETYPE cMetaRotator<Base, BitMask, North, East, South, West, AssertIfNotMatched>::MetaMirrorYZ(NIBBLETYPE a_Meta) { NIBBLETYPE OtherMeta = a_Meta & (~BitMask); switch (a_Meta & BitMask) diff --git a/src/Blocks/WorldInterface.h b/src/Blocks/WorldInterface.h index 580339d32..bfbb053d9 100644 --- a/src/Blocks/WorldInterface.h +++ b/src/Blocks/WorldInterface.h @@ -9,7 +9,8 @@ class cItems; class cWorldInterface { public: - + virtual ~cWorldInterface() {} + virtual Int64 GetTimeOfDay(void) const = 0; virtual Int64 GetWorldAge(void) const = 0; diff --git a/src/CMakeLists.txt b/src/CMakeLists.txt index 448dc4b70..30e9dbfd4 100644 --- a/src/CMakeLists.txt +++ b/src/CMakeLists.txt @@ -6,14 +6,14 @@ include_directories (SYSTEM "${PROJECT_SOURCE_DIR}/../lib/jsoncpp/include") include_directories (SYSTEM "${PROJECT_SOURCE_DIR}/../lib/polarssl/include") set(FOLDERS OSSupport HTTPServer Items Blocks Protocol Generating) -set(FOLDERS ${FOLDERS} WorldStorage Mobs Entities Simulator UI BlockEntities) +set(FOLDERS ${FOLDERS} WorldStorage Mobs Entities Simulator UI BlockEntities Generating/Prefabs) if (NOT MSVC) - #Bindings needs to reference other folders so are done here + # Bindings need to reference other folders, so they are done here instead - #lib dependecies are not included + # lib dependencies are not included set(BINDING_DEPENDECIES tolua @@ -104,7 +104,6 @@ if (NOT MSVC) Bindings/PluginLua Bindings/PluginManager Bindings/WebPlugin - Bindings/WebPlugin ) target_link_libraries(Bindings lua sqlite tolualib) @@ -138,6 +137,7 @@ if (NOT MSVC) else () + # MSVC-specific handling: Put all files into one project, separate by the folders: # Generate the Bindings if they don't exist: if (NOT EXISTS "${PROJECT_SOURCE_DIR}/Bindings/Bindings.cpp") @@ -149,6 +149,14 @@ else () ) endif() + # Get all files in this folder: + file(GLOB_RECURSE SOURCE + "*.cpp" + "*.h" + "*.pkg" + ) + source_group("" FILES ${SOURCE}) + # Add all subfolders as solution-folders: list(APPEND FOLDERS "Resources") list(APPEND FOLDERS "Bindings") @@ -159,23 +167,16 @@ else () "${PATH}/*.rc" "${PATH}/*.pkg" ) - source_group("${PATH}" FILES ${FOLDER_FILES}) + string(REPLACE "/" "\\" PROJECT_PATH ${PATH}) + source_group("${PROJECT_PATH}" FILES ${FOLDER_FILES}) endfunction(includefolder) foreach(folder ${FOLDERS}) includefolder(${folder}) endforeach(folder) - file(GLOB_RECURSE SOURCE - "*.cpp" - "*.h" - "*.pkg" - ) - include_directories("${PROJECT_SOURCE_DIR}") - source_group("" FILES ${SOURCE}) - # Precompiled headers (1st part) SET_SOURCE_FILES_PROPERTIES( Globals.cpp PROPERTIES COMPILE_FLAGS "/Yc\"Globals.h\"" @@ -231,7 +232,7 @@ endif () if (NOT MSVC) target_link_libraries(${EXECUTABLE} OSSupport HTTPServer Bindings Items Blocks) - target_link_libraries(${EXECUTABLE} Protocol Generating WorldStorage) + target_link_libraries(${EXECUTABLE} Protocol Generating Generating_Prefabs WorldStorage) target_link_libraries(${EXECUTABLE} Mobs Entities Simulator UI BlockEntities) endif () if (WIN32) diff --git a/src/Chunk.cpp b/src/Chunk.cpp index bd4cb9937..22b33c595 100644 --- a/src/Chunk.cpp +++ b/src/Chunk.cpp @@ -884,7 +884,7 @@ void cChunk::ApplyWeatherToTop() FastSetBlock(X, Height, Z, E_BLOCK_SNOW, TopMeta - 1); } } - else if (cBlockInfo::IsSnowable(TopBlock)) + else if (cBlockInfo::IsSnowable(TopBlock) && (Height + 1 < cChunkDef::Height)) { SetBlock(X, Height + 1, Z, E_BLOCK_SNOW, 0); } diff --git a/src/ClientHandle.cpp b/src/ClientHandle.cpp index 46c10ae82..5876e55c7 100644 --- a/src/ClientHandle.cpp +++ b/src/ClientHandle.cpp @@ -941,6 +941,8 @@ void cClientHandle::HandleRightClick(int a_BlockX, int a_BlockY, int a_BlockZ, e } return; } + + m_NumBlockChangeInteractionsThisTick++; if (!CheckBlockInteractionsRate()) { @@ -960,7 +962,7 @@ void cClientHandle::HandleRightClick(int a_BlockX, int a_BlockY, int a_BlockZ, e ); // Let's send the current world block to the client, so that it can immediately "let the user know" that they haven't placed the block - if (a_BlockFace > -1) + if (a_BlockFace != BLOCK_FACE_NONE) { AddFaceDirection(a_BlockX, a_BlockY, a_BlockZ, a_BlockFace); World->SendBlockTo(a_BlockX, a_BlockY, a_BlockZ, m_Player); @@ -988,7 +990,7 @@ void cClientHandle::HandleRightClick(int a_BlockX, int a_BlockY, int a_BlockZ, e cItemHandler * ItemHandler = cItemHandler::GetItemHandler(Equipped.m_ItemType); - if (ItemHandler->IsPlaceable() && (a_BlockFace > -1)) + if (ItemHandler->IsPlaceable() && (a_BlockFace != BLOCK_FACE_NONE)) { HandlePlaceBlock(a_BlockX, a_BlockY, a_BlockZ, a_BlockFace, a_CursorX, a_CursorY, a_CursorZ, *ItemHandler); } @@ -1026,6 +1028,7 @@ void cClientHandle::HandleRightClick(int a_BlockX, int a_BlockY, int a_BlockZ, e void cClientHandle::HandlePlaceBlock(int a_BlockX, int a_BlockY, int a_BlockZ, eBlockFace a_BlockFace, int a_CursorX, int a_CursorY, int a_CursorZ, cItemHandler & a_ItemHandler) { + BLOCKTYPE EquippedBlock = (BLOCKTYPE)(m_Player->GetEquippedItem().m_ItemType); if (a_BlockFace < 0) { // Clicked in air @@ -1036,7 +1039,6 @@ void cClientHandle::HandlePlaceBlock(int a_BlockX, int a_BlockY, int a_BlockZ, e BLOCKTYPE ClickedBlock; NIBBLETYPE ClickedBlockMeta; - BLOCKTYPE EquippedBlock = (BLOCKTYPE)(m_Player->GetEquippedItem().m_ItemType); NIBBLETYPE EquippedBlockDamage = (NIBBLETYPE)(m_Player->GetEquippedItem().m_ItemDamage); if ((a_BlockY < 0) || (a_BlockY >= cChunkDef::Height)) @@ -1053,8 +1055,8 @@ void cClientHandle::HandlePlaceBlock(int a_BlockX, int a_BlockY, int a_BlockZ, e cBlockSlabHandler::IsAnySlabType(EquippedBlock) && // Is the player placing another slab? ((ClickedBlockMeta & 0x07) == EquippedBlockDamage) && // Is it the same slab type? ( - (a_BlockFace == BLOCK_FACE_TOP) || // Clicking the top of a bottom slab - (a_BlockFace == BLOCK_FACE_BOTTOM) // Clicking the bottom of a top slab + (a_BlockFace == BLOCK_FACE_TOP) || // Clicking the top of a bottom slab + (a_BlockFace == BLOCK_FACE_BOTTOM) // Clicking the bottom of a top slab ) ) { @@ -1062,7 +1064,7 @@ void cClientHandle::HandlePlaceBlock(int a_BlockX, int a_BlockY, int a_BlockZ, e // If clicked top face and slab occupies the top voxel, we want a slab to be placed above it (therefore increment Y) // Else if clicked bottom face and slab occupies the bottom voxel, decrement Y for the same reason // Don't touch coordinates if anything else because a dblslab opportunity is present - if((ClickedBlockMeta & 0x08) && (a_BlockFace == BLOCK_FACE_TOP)) + if ((ClickedBlockMeta & 0x08) && (a_BlockFace == BLOCK_FACE_TOP)) { ++a_BlockY; } @@ -1138,7 +1140,7 @@ void cClientHandle::HandlePlaceBlock(int a_BlockX, int a_BlockY, int a_BlockZ, e // The actual block placement: World->SetBlock(a_BlockX, a_BlockY, a_BlockZ, BlockType, BlockMeta); - if (m_Player->GetGameMode() != gmCreative) + if (!m_Player->IsGameModeCreative()) { m_Player->GetInventory().RemoveOneEquippedItem(); } @@ -1530,7 +1532,7 @@ void cClientHandle::HandleTabCompletion(const AString & a_Text) -void cClientHandle::SendData(const char * a_Data, int a_Size) +void cClientHandle::SendData(const char * a_Data, size_t a_Size) { if (m_HasSentDC) { @@ -1545,7 +1547,7 @@ void cClientHandle::SendData(const char * a_Data, int a_Size) if (m_OutgoingDataOverflow.empty()) { // No queued overflow data; if this packet fits into the ringbuffer, put it in, otherwise put it in the overflow buffer: - int CanFit = m_OutgoingData.GetFreeSpace(); + size_t CanFit = m_OutgoingData.GetFreeSpace(); if (CanFit > a_Size) { CanFit = a_Size; @@ -1606,10 +1608,8 @@ void cClientHandle::MoveToWorld(cWorld & a_World, bool a_SendRespawnPacket) m_Protocol->SendUnloadChunk(itr->m_ChunkX, itr->m_ChunkZ); } // for itr - Chunks[] - // Do NOT stream new chunks, the new world runs its own tick thread and may deadlock - // Instead, the chunks will be streamed when the client is moved to the new world's Tick list, - // by setting state to csAuthenticated - m_State = csAuthenticated; + // StreamChunks() called in cPlayer::MoveToWorld() after new world has been set + // Meanwhile here, we set last streamed values to bogus ones so everything is resent m_LastStreamedChunkX = 0x7fffffff; m_LastStreamedChunkZ = 0x7fffffff; m_HasSentPlayerChunk = false; @@ -2633,7 +2633,7 @@ void cClientHandle::PacketError(unsigned char a_PacketType) -void cClientHandle::DataReceived(const char * a_Data, int a_Size) +void cClientHandle::DataReceived(const char * a_Data, size_t a_Size) { // Data is received from the client, store it in the buffer to be processed by the Tick thread: m_TimeSinceLastPacket = 0; diff --git a/src/ClientHandle.h b/src/ClientHandle.h index 8366caa16..0c367ec7d 100644 --- a/src/ClientHandle.h +++ b/src/ClientHandle.h @@ -225,15 +225,15 @@ public: */ bool HandleLogin(int a_ProtocolVersion, const AString & a_Username); - void SendData(const char * a_Data, int a_Size); + void SendData(const char * a_Data, size_t a_Size); /** Called when the player moves into a different world; queues sreaming the new chunks */ void MoveToWorld(cWorld & a_World, bool a_SendRespawnPacket); +private: + /** Handles the block placing packet when it is a real block placement (not block-using, item-using or eating) */ void HandlePlaceBlock(int a_BlockX, int a_BlockY, int a_BlockZ, eBlockFace a_BlockFace, int a_CursorX, int a_CursorY, int a_CursorZ, cItemHandler & a_ItemHandler); - -private: /** The type used for storing the names of registered plugin channels. */ typedef std::set<AString> cChannels; @@ -362,7 +362,7 @@ private: void HandleCommandBlockMessage(const char * a_Data, unsigned int a_Length); // cSocketThreads::cCallback overrides: - virtual void DataReceived (const char * a_Data, int a_Size) override; // Data is received from the client + virtual void DataReceived (const char * a_Data, size_t a_Size) override; // Data is received from the client virtual void GetOutgoingData(AString & a_Data) override; // Data can be sent to client virtual void SocketClosed (void) override; // The socket has been closed for any reason }; // tolua_export diff --git a/src/CompositeChat.cpp b/src/CompositeChat.cpp index a917ee70f..c70ef1070 100644 --- a/src/CompositeChat.cpp +++ b/src/CompositeChat.cpp @@ -112,8 +112,8 @@ cCompositeChat::cCompositeChat(void) : -cCompositeChat::cCompositeChat(const AString & a_ParseText) : - m_MessageType(mtCustom) +cCompositeChat::cCompositeChat(const AString & a_ParseText, eMessageType a_MessageType) : + m_MessageType(a_MessageType) { ParseText(a_ParseText); } @@ -314,6 +314,58 @@ void cCompositeChat::UnderlineUrls(void) +AString cCompositeChat::ExtractText(void) const +{ + AString Msg; + for (cParts::const_iterator itr = m_Parts.begin(), end = m_Parts.end(); itr != end; ++itr) + { + switch ((*itr)->m_PartType) + { + case ptText: + case ptClientTranslated: + case ptRunCommand: + case ptSuggestCommand: + { + Msg.append((*itr)->m_Text); + break; + } + case ptUrl: + { + Msg.append(((cUrlPart *)(*itr))->m_Url); + break; + } + } // switch (PartType) + } // for itr - m_Parts[] + return Msg; +} + + + + + +cMCLogger::eLogLevel cCompositeChat::MessageTypeToLogLevel(eMessageType a_MessageType) +{ + switch (a_MessageType) + { + case mtCustom: return cMCLogger::llRegular; + case mtFailure: return cMCLogger::llWarning; + case mtInformation: return cMCLogger::llInfo; + case mtSuccess: return cMCLogger::llRegular; + case mtWarning: return cMCLogger::llWarning; + case mtFatal: return cMCLogger::llError; + case mtDeath: return cMCLogger::llRegular; + case mtPrivateMessage: return cMCLogger::llRegular; + case mtJoin: return cMCLogger::llRegular; + case mtLeave: return cMCLogger::llRegular; + } + ASSERT(!"Unhandled MessageType"); + return cMCLogger::llError; +} + + + + + void cCompositeChat::AddStyle(AString & a_Style, const AString & a_AddStyle) { if (a_AddStyle.empty()) diff --git a/src/CompositeChat.h b/src/CompositeChat.h index 27319490d..5b9c5f612 100644 --- a/src/CompositeChat.h +++ b/src/CompositeChat.h @@ -117,7 +117,7 @@ public: /** Creates a new chat message and parses the text into parts. Recognizes "http:" and "https:" links and @color-codes. Uses ParseText() for the actual parsing. */ - cCompositeChat(const AString & a_ParseText); + cCompositeChat(const AString & a_ParseText, eMessageType a_MessageType = mtCustom); ~cCompositeChat(); @@ -164,10 +164,19 @@ public: /** Returns the message type set previously by SetMessageType(). */ eMessageType GetMessageType(void) const { return m_MessageType; } + /** Returns the text from the parts that comprises the human-readable data. + Used for older protocols that don't support composite chat + and for console-logging. */ + AString ExtractText(void) const; + // tolua_end const cParts & GetParts(void) const { return m_Parts; } + /** Converts the MessageType to a LogLevel value. + Used by the logging bindings when logging a cCompositeChat object. */ + static cMCLogger::eLogLevel MessageTypeToLogLevel(eMessageType a_MessageType); + protected: /** All the parts that */ cParts m_Parts; diff --git a/src/Endianness.h b/src/Endianness.h index 86eb369f5..6a2593077 100644 --- a/src/Endianness.h +++ b/src/Endianness.h @@ -1,12 +1,14 @@ #pragma once +#define ntohll(x) ((((UInt64)ntohl((u_long)x)) << 32) + ntohl(x >> 32)) + // Changes endianness -inline unsigned long long HostToNetwork8(const void* a_Value ) +inline UInt64 HostToNetwork8(const void * a_Value) { unsigned long long __HostToNetwork8; memcpy( &__HostToNetwork8, a_Value, sizeof( __HostToNetwork8 ) ); @@ -18,7 +20,7 @@ inline unsigned long long HostToNetwork8(const void* a_Value ) -inline unsigned int HostToNetwork4(const void* a_Value ) +inline UInt32 HostToNetwork4(const void* a_Value ) { unsigned int __HostToNetwork4; memcpy( &__HostToNetwork4, a_Value, sizeof( __HostToNetwork4 ) ); @@ -30,11 +32,10 @@ inline unsigned int HostToNetwork4(const void* a_Value ) -inline double NetworkToHostDouble8(const void* a_Value ) +inline double NetworkToHostDouble8(const void * a_Value) { -#define ntohll(x) ((((unsigned long long)ntohl((u_long)x)) << 32) + ntohl(x >> 32)) - unsigned long long buf = 0;//(*(unsigned long long*)a_Value); - memcpy( &buf, a_Value, 8 ); + UInt64 buf = 0; + memcpy(&buf, a_Value, 8); buf = ntohll(buf); double x; memcpy(&x, &buf, sizeof(double)); @@ -45,23 +46,25 @@ inline double NetworkToHostDouble8(const void* a_Value ) -inline long long NetworkToHostLong8(const void * a_Value ) +inline Int64 NetworkToHostLong8(const void * a_Value) { - unsigned long long buf = *(unsigned long long*)a_Value; + UInt64 buf; + memcpy(&buf, &a_Value, 8); buf = ntohll(buf); - return *reinterpret_cast<long long *>(&buf); + return *reinterpret_cast<Int64 *>(&buf); } -inline float NetworkToHostFloat4(const void* a_Value ) +inline float NetworkToHostFloat4(const void * a_Value) { - u_long buf = *(u_long*)a_Value; - buf = ntohl( buf ); - float x = 0; - memcpy( &x, &buf, sizeof(float) ); + UInt32 buf; + float x; + memcpy(&buf, &a_Value, 4); + buf = ntohl(buf); + memcpy(&x, &buf, sizeof(float)); return x; } diff --git a/src/Entities/Boat.cpp b/src/Entities/Boat.cpp index 94b24c5af..921252253 100644 --- a/src/Entities/Boat.cpp +++ b/src/Entities/Boat.cpp @@ -122,5 +122,3 @@ void cBoat::HandleSpeedFromAttachee(float a_Forward, float a_Sideways) AddSpeed(ToAddSpeed); } - -
\ No newline at end of file diff --git a/src/Entities/Effects.h b/src/Entities/Effects.h index e7611847d..baf3302fb 100644 --- a/src/Entities/Effects.h +++ b/src/Entities/Effects.h @@ -27,4 +27,4 @@ enum ENUM_ENTITY_EFFECT E_EFFECT_ABSORPTION = 22, E_EFFECT_SATURATION = 23, } ; -// tolua_end
\ No newline at end of file +// tolua_end diff --git a/src/Entities/Entity.h b/src/Entities/Entity.h index e41f74b09..6e3f8292b 100644 --- a/src/Entities/Entity.h +++ b/src/Entities/Entity.h @@ -159,7 +159,7 @@ public: cWorld * GetWorld(void) const { return m_World; } - double GetHeadYaw (void) const { return m_HeadYaw; } + double GetHeadYaw (void) const { return m_HeadYaw; } // In degrees double GetHeight (void) const { return m_Height; } double GetMass (void) const { return m_Mass; } const Vector3d & GetPosition (void) const { return m_Pos; } @@ -167,9 +167,9 @@ public: double GetPosY (void) const { return m_Pos.y; } double GetPosZ (void) const { return m_Pos.z; } const Vector3d & GetRot (void) const { return m_Rot; } // OBSOLETE, use individual GetYaw(), GetPitch, GetRoll() components - double GetYaw (void) const { return m_Rot.x; } - double GetPitch (void) const { return m_Rot.y; } - double GetRoll (void) const { return m_Rot.z; } + double GetYaw (void) const { return m_Rot.x; } // In degrees, [-180, +180) + double GetPitch (void) const { return m_Rot.y; } // In degrees, [-180, +180), but normal client clips to [-90, +90] + double GetRoll (void) const { return m_Rot.z; } // In degrees, unused in current client Vector3d GetLookVector(void) const; const Vector3d & GetSpeed (void) const { return m_Speed; } double GetSpeedX (void) const { return m_Speed.x; } @@ -189,9 +189,9 @@ public: void SetPosition(double a_PosX, double a_PosY, double a_PosZ); void SetPosition(const Vector3d & a_Pos) { SetPosition(a_Pos.x, a_Pos.y, a_Pos.z); } void SetRot (const Vector3f & a_Rot); // OBSOLETE, use individual SetYaw(), SetPitch(), SetRoll() components - void SetYaw (double a_Yaw); - void SetPitch (double a_Pitch); - void SetRoll (double a_Roll); + void SetYaw (double a_Yaw); // In degrees, normalizes to [-180, +180) + void SetPitch (double a_Pitch); // In degrees, normalizes to [-180, +180) + void SetRoll (double a_Roll); // In degrees, normalizes to [-180, +180) void SetSpeed (double a_SpeedX, double a_SpeedY, double a_SpeedZ); void SetSpeed (const Vector3d & a_Speed) { SetSpeed(a_Speed.x, a_Speed.y, a_Speed.z); } void SetSpeedX (double a_SpeedX); diff --git a/src/Entities/ExpOrb.h b/src/Entities/ExpOrb.h index c1150bd03..e76274ac9 100644 --- a/src/Entities/ExpOrb.h +++ b/src/Entities/ExpOrb.h @@ -42,4 +42,4 @@ protected: /** The number of ticks that the entity has existed / timer between collect and destroy; in msec */ float m_Timer; -} ; // tolua_export
\ No newline at end of file +} ; // tolua_export diff --git a/src/Entities/Floater.h b/src/Entities/Floater.h index f3b51d77b..547d503f1 100644 --- a/src/Entities/Floater.h +++ b/src/Entities/Floater.h @@ -43,4 +43,4 @@ protected: // Entity IDs int m_PlayerID; int m_AttachedMobID; -} ; // tolua_export
\ No newline at end of file +} ; // tolua_export diff --git a/src/Entities/Player.cpp b/src/Entities/Player.cpp index 863aaa799..646aad50f 100644 --- a/src/Entities/Player.cpp +++ b/src/Entities/Player.cpp @@ -1489,6 +1489,7 @@ bool cPlayer::MoveToWorld(const char * a_WorldName) // Add player to all the necessary parts of the new world SetWorld(World); + m_ClientHandle->StreamChunks(); World->AddEntity(this); World->AddPlayer(this); diff --git a/src/Entities/ProjectileEntity.cpp b/src/Entities/ProjectileEntity.cpp index f4ab825f2..a9735a53c 100644 --- a/src/Entities/ProjectileEntity.cpp +++ b/src/Entities/ProjectileEntity.cpp @@ -4,6 +4,7 @@ // Implements the cProjectileEntity class representing the common base class for projectiles, as well as individual projectile types #include "Globals.h" +#include "../Bindings/PluginManager.h" #include "ProjectileEntity.h" #include "../ClientHandle.h" #include "Player.h" @@ -66,6 +67,11 @@ protected: eBlockFace Face; if (bb.CalcLineIntersection(Line1, Line2, LineCoeff, Face)) { + if (cPluginManager::Get()->CallHookProjectileHitBlock(*m_Projectile)) + { + return false; + } + Vector3d Intersection = Line1 + m_Projectile->GetSpeed() * LineCoeff; m_Projectile->OnHitSolidBlock(Intersection, Face); return true; @@ -147,7 +153,11 @@ public: } // TODO: Some entities don't interact with the projectiles (pickups, falling blocks) - // TODO: Allow plugins to interfere about which entities can be hit + if (cPluginManager::Get()->CallHookProjectileHitEntity(*m_Projectile, *a_Entity)) + { + // A plugin disagreed. + return false; + } if (LineCoeff < m_MinCoeff) { diff --git a/src/ForEachChunkProvider.h b/src/ForEachChunkProvider.h index 6017173ee..7a6e8c5c6 100644 --- a/src/ForEachChunkProvider.h +++ b/src/ForEachChunkProvider.h @@ -24,6 +24,8 @@ class cBlockArea; class cForEachChunkProvider { public: + virtual ~cForEachChunkProvider() {} + /** Calls the callback for each chunk in the specified range. */ virtual bool ForEachChunkInRect(int a_MinChunkX, int a_MaxChunkX, int a_MinChunkZ, int a_MaxChunkZ, cChunkDataCallback & a_Callback) = 0; diff --git a/src/Generating/ComposableGenerator.cpp b/src/Generating/ComposableGenerator.cpp index 6c00b5905..2e886336f 100644 --- a/src/Generating/ComposableGenerator.cpp +++ b/src/Generating/ComposableGenerator.cpp @@ -21,6 +21,7 @@ #include "DistortedHeightmap.h" #include "EndGen.h" #include "MineShafts.h" +#include "NetherFortGen.h" #include "Noise3DGenerator.h" #include "POCPieceGenerator.h" #include "Ravines.h" @@ -191,9 +192,11 @@ void cComposableGenerator::DoGenerate(int a_ChunkX, int a_ChunkZ, cChunkDesc & a m_HeightGen->GenHeightMap(a_ChunkX, a_ChunkZ, a_ChunkDesc.GetHeightMap()); } + bool ShouldUpdateHeightmap = false; if (a_ChunkDesc.IsUsingDefaultComposition()) { m_CompositionGen->ComposeTerrain(a_ChunkDesc); + ShouldUpdateHeightmap = true; } if (a_ChunkDesc.IsUsingDefaultFinish()) @@ -202,6 +205,12 @@ void cComposableGenerator::DoGenerate(int a_ChunkX, int a_ChunkZ, cChunkDesc & a { (*itr)->GenFinish(a_ChunkDesc); } // for itr - m_FinishGens[] + ShouldUpdateHeightmap = true; + } + + if (ShouldUpdateHeightmap) + { + a_ChunkDesc.UpdateHeightmap(); } } @@ -349,7 +358,7 @@ void cComposableGenerator::InitFinishGens(cIniFile & a_IniFile) int ChanceCrossing = a_IniFile.GetValueSetI("Generator", "MineShaftsChanceCrossing", 200); int ChanceStaircase = a_IniFile.GetValueSetI("Generator", "MineShaftsChanceStaircase", 200); m_FinishGens.push_back(new cStructGenMineShafts( - Seed, GridSize, MaxSystemSize, + Seed, GridSize, MaxSystemSize, ChanceCorridor, ChanceCrossing, ChanceStaircase )); } @@ -361,6 +370,12 @@ void cComposableGenerator::InitFinishGens(cIniFile & a_IniFile) { m_FinishGens.push_back(new cFinishGenNetherClumpFoliage(Seed)); } + else if (NoCaseCompare(*itr, "NetherForts") == 0) + { + int GridSize = a_IniFile.GetValueSetI("Generator", "NetherFortsGridSize", 512); + int MaxDepth = a_IniFile.GetValueSetI("Generator", "NetherFortsMaxDepth", 12); + m_FinishGens.push_back(new cNetherFortGen(Seed, GridSize, MaxDepth)); + } else if (NoCaseCompare(*itr, "OreNests") == 0) { m_FinishGens.push_back(new cStructGenOreNests(Seed)); diff --git a/src/Generating/MineShafts.cpp b/src/Generating/MineShafts.cpp index 28dc37567..231295c3f 100644 --- a/src/Generating/MineShafts.cpp +++ b/src/Generating/MineShafts.cpp @@ -1340,7 +1340,7 @@ void cStructGenMineShafts::GetMineShaftSystemsForChunk( BaseX -= NEIGHBORHOOD_SIZE / 2; BaseZ -= NEIGHBORHOOD_SIZE / 2; - // Walk the cache, move each cave system that we want into a_Caves: + // Walk the cache, move each cave system that we want into a_Mineshafts: int StartX = BaseX * m_GridSize; int EndX = (BaseX + NEIGHBORHOOD_SIZE + 1) * m_GridSize; int StartZ = BaseZ * m_GridSize; diff --git a/src/Generating/NetherFortGen.cpp b/src/Generating/NetherFortGen.cpp new file mode 100644 index 000000000..02779a8a3 --- /dev/null +++ b/src/Generating/NetherFortGen.cpp @@ -0,0 +1,275 @@ + +// NetherFortGen.cpp + +// Implements the cNetherFortGen class representing the nether fortress generator + +#include "Globals.h" +#include "NetherFortGen.h" +#include "Prefabs/NetherFortPrefabs.h" + + + + + +static const int NEIGHBORHOOD_SIZE = 3; + + + + + +/////////////////////////////////////////////////////////////////////////////////////////////////////////////////////// +// cNetherFortGen::cNetherFort: + +class cNetherFortGen::cNetherFort +{ +public: + cNetherFortGen & m_ParentGen; + int m_BlockX, m_BlockZ; + int m_GridSize; + int m_Seed; + cPlacedPieces m_Pieces; + + + cNetherFort(cNetherFortGen & a_ParentGen, int a_BlockX, int a_BlockZ, int a_GridSize, int a_MaxDepth, int a_Seed) : + m_ParentGen(a_ParentGen), + m_BlockX(a_BlockX), + m_BlockZ(a_BlockZ), + m_GridSize(a_GridSize), + m_Seed(a_Seed) + { + // TODO: Proper Y-coord placement + int BlockY = 64; + + // Generate pieces: + for (int i = 0; m_Pieces.size() < (size_t)(a_MaxDepth * a_MaxDepth / 8 + a_MaxDepth); i++) + { + cBFSPieceGenerator pg(m_ParentGen, a_Seed + i); + pg.PlacePieces(a_BlockX, BlockY, a_BlockZ, a_MaxDepth, m_Pieces); + } + } + + + ~cNetherFort() + { + cPieceGenerator::FreePieces(m_Pieces); + } + + + /** Carves the system into the chunk data */ + void ProcessChunk(cChunkDesc & a_Chunk) + { + for (cPlacedPieces::const_iterator itr = m_Pieces.begin(), end = m_Pieces.end(); itr != end; ++itr) + { + const cPrefab & Prefab = (const cPrefab &)((*itr)->GetPiece()); + Prefab.Draw(a_Chunk, *itr); + } // for itr - m_PlacedPieces[] + } +}; + + + + + +/////////////////////////////////////////////////////////////////////////////////////////////////////////////////////// +// cNetherFortGen: + +cNetherFortGen::cNetherFortGen(int a_Seed, int a_GridSize, int a_MaxDepth) : + m_Seed(a_Seed), + m_Noise(a_Seed), + m_GridSize(a_GridSize), + m_MaxDepth(a_MaxDepth) +{ + // Initialize the prefabs: + for (size_t i = 0; i < g_NetherFortPrefabs1Count; i++) + { + cPrefab * Prefab = new cPrefab(g_NetherFortPrefabs1[i]); + m_AllPieces.push_back(Prefab); + if (Prefab->HasConnectorType(0)) + { + m_OuterPieces.push_back(Prefab); + } + if (Prefab->HasConnectorType(1)) + { + m_InnerPieces.push_back(Prefab); + } + } + + // Initialize the starting piece prefabs: + for (size_t i = 0; i < g_NetherFortStartingPrefabs1Count; i++) + { + m_StartingPieces.push_back(new cPrefab(g_NetherFortStartingPrefabs1[i])); + } + + // DEBUG: Try one round of placement: + cPlacedPieces Pieces; + cBFSPieceGenerator pg(*this, a_Seed); + pg.PlacePieces(0, 64, 0, a_MaxDepth, Pieces); +} + + + + + +cNetherFortGen::~cNetherFortGen() +{ + ClearCache(); + for (cPieces::iterator itr = m_AllPieces.begin(), end = m_AllPieces.end(); itr != end; ++itr) + { + delete *itr; + } // for itr - m_AllPieces[] + m_AllPieces.clear(); +} + + + + + +void cNetherFortGen::ClearCache(void) +{ + // TODO +} + + + + + +void cNetherFortGen::GetFortsForChunk(int a_ChunkX, int a_ChunkZ, cNetherForts & a_Forts) +{ + int BaseX = a_ChunkX * cChunkDef::Width / m_GridSize; + int BaseZ = a_ChunkZ * cChunkDef::Width / m_GridSize; + if (BaseX < 0) + { + --BaseX; + } + if (BaseZ < 0) + { + --BaseZ; + } + BaseX -= NEIGHBORHOOD_SIZE / 2; + BaseZ -= NEIGHBORHOOD_SIZE / 2; + + // Walk the cache, move each cave system that we want into a_Forts: + int StartX = BaseX * m_GridSize; + int EndX = (BaseX + NEIGHBORHOOD_SIZE + 1) * m_GridSize; + int StartZ = BaseZ * m_GridSize; + int EndZ = (BaseZ + NEIGHBORHOOD_SIZE + 1) * m_GridSize; + for (cNetherForts::iterator itr = m_Cache.begin(), end = m_Cache.end(); itr != end;) + { + if ( + ((*itr)->m_BlockX >= StartX) && ((*itr)->m_BlockX < EndX) && + ((*itr)->m_BlockZ >= StartZ) && ((*itr)->m_BlockZ < EndZ) + ) + { + // want + a_Forts.push_back(*itr); + itr = m_Cache.erase(itr); + } + else + { + // don't want + ++itr; + } + } // for itr - m_Cache[] + + // Create those forts that haven't been in the cache: + for (int x = 0; x < NEIGHBORHOOD_SIZE; x++) + { + int RealX = (BaseX + x) * m_GridSize; + for (int z = 0; z < NEIGHBORHOOD_SIZE; z++) + { + int RealZ = (BaseZ + z) * m_GridSize; + bool Found = false; + for (cNetherForts::const_iterator itr = a_Forts.begin(), end = a_Forts.end(); itr != end; ++itr) + { + if (((*itr)->m_BlockX == RealX) && ((*itr)->m_BlockZ == RealZ)) + { + Found = true; + break; + } + } // for itr - a_Mineshafts + if (!Found) + { + a_Forts.push_back(new cNetherFort(*this, RealX, RealZ, m_GridSize, m_MaxDepth, m_Seed)); + } + } // for z + } // for x + + // Copy a_Forts into m_Cache to the beginning: + cNetherForts FortsCopy (a_Forts); + m_Cache.splice(m_Cache.begin(), FortsCopy, FortsCopy.begin(), FortsCopy.end()); + + // Trim the cache if it's too long: + if (m_Cache.size() > 100) + { + cNetherForts::iterator itr = m_Cache.begin(); + std::advance(itr, 100); + for (cNetherForts::iterator end = m_Cache.end(); itr != end; ++itr) + { + delete *itr; + } + itr = m_Cache.begin(); + std::advance(itr, 100); + m_Cache.erase(itr, m_Cache.end()); + } +} + + + + + +void cNetherFortGen::GenFinish(cChunkDesc & a_ChunkDesc) +{ + int ChunkX = a_ChunkDesc.GetChunkX(); + int ChunkZ = a_ChunkDesc.GetChunkZ(); + cNetherForts Forts; + GetFortsForChunk(ChunkX, ChunkZ, Forts); + for (cNetherForts::const_iterator itr = Forts.begin(); itr != Forts.end(); ++itr) + { + (*itr)->ProcessChunk(a_ChunkDesc); + } // for itr - Forts[] +} + + + + + +cPieces cNetherFortGen::GetPiecesWithConnector(int a_ConnectorType) +{ + switch (a_ConnectorType) + { + case 0: return m_OuterPieces; + case 1: return m_InnerPieces; + default: return cPieces(); + } +} + + + + + +cPieces cNetherFortGen::GetStartingPieces(void) +{ + return m_StartingPieces; +} + + + + + +void cNetherFortGen::PiecePlaced(const cPiece & a_Piece) +{ + UNUSED(a_Piece); +} + + + + + +void cNetherFortGen::Reset(void) +{ + // Nothing needed +} + + + + diff --git a/src/Generating/NetherFortGen.h b/src/Generating/NetherFortGen.h new file mode 100644 index 000000000..10ba01396 --- /dev/null +++ b/src/Generating/NetherFortGen.h @@ -0,0 +1,86 @@ + +// NetherFortGen.h + +// Declares the cNetherFortGen class representing the nether fortress generator + + + + + +#pragma once + +#include "ComposableGenerator.h" +#include "PieceGenerator.h" + + + + + +class cNetherFortGen : + public cFinishGen, + public cPiecePool +{ +public: + cNetherFortGen(int a_Seed, int a_GridSize, int a_MaxDepth); + + virtual ~cNetherFortGen(); + +protected: + class cNetherFort; // fwd: NetherFortGen.cpp + typedef std::list<cNetherFort *> cNetherForts; + + + /** The seed used for generating*/ + int m_Seed; + + /** The noise used for generating */ + cNoise m_Noise; + + /** Average spacing between the fortresses*/ + int m_GridSize; + + /** Maximum depth of the piece-generator tree */ + int m_MaxDepth; + + /** Cache of the most recently used systems. MoveToFront used. */ + cNetherForts m_Cache; + + /** All the pieces that are allowed for building. + This is the list that's used for memory allocation and deallocation for the pieces. */ + cPieces m_AllPieces; + + /** The pieces that are used as starting pieces. + This list is not shared and the pieces need deallocation. */ + cPieces m_StartingPieces; + + /** The pieces that have an "outer" connector. + The pieces are copies out of m_AllPieces and shouldn't be ever delete-d. */ + cPieces m_OuterPieces; + + /** The pieces that have an "inner" connector. + The pieces are copies out of m_AllPieces and shouldn't be ever delete-d. */ + cPieces m_InnerPieces; + + + /** Clears everything from the cache. + Also invalidates the forst returned by GetFortsForChunk(). */ + void ClearCache(void); + + /** Returns all forts that *may* intersect the given chunk. + The returned forts live within m_Cache.They are valid until the next call + to this function (which may delete some of the pointers). */ + void GetFortsForChunk(int a_ChunkX, int a_ChunkZ, cNetherForts & a_Forts); + + // cFinishGen overrides: + virtual void GenFinish(cChunkDesc & a_ChunkDesc) override; + + // cPiecePool overrides: + virtual cPieces GetPiecesWithConnector(int a_ConnectorType) override; + virtual cPieces GetStartingPieces(void) override; + virtual void PiecePlaced(const cPiece & a_Piece) override; + virtual void Reset(void) override; +} ; + + + + diff --git a/src/Generating/Prefab.cpp b/src/Generating/Prefab.cpp index 1af1faec1..131b6acb2 100644 --- a/src/Generating/Prefab.cpp +++ b/src/Generating/Prefab.cpp @@ -15,6 +15,92 @@ uses a prefabricate in a cBlockArea for drawing itself. +#ifdef SELF_TEST + +// Create one static prefab to test the parser: +static const cPrefab::sDef g_TestPrefabDef = +{ + // Size: + 7, 6, 7, // SizeX = 7, SizeY = 6, SizeZ = 7 + + // Block definitions: + ".: 0: 0\n" /* 0 */ + "a:112: 0\n" /* netherbrick */ + "b:113: 0\n" /* netherbrickfence */, + + // Block data: + // Level 1 + "aaaaaaa" + "aaaaaaa" + "aaaaaaa" + "aaaaaaa" + "aaaaaaa" + "aaaaaaa" + "aaaaaaa" + + // Level 2 + "aa...aa" + "a.....a" + "......." + "......." + "......." + "a.....a" + "aa...aa" + + // Level 3 + "aa...aa" + "a.....a" + "......." + "......." + "......." + "a.....a" + "aa...aa" + + // Level 4 + "aa...aa" + "a.....a" + "......." + "......." + "......." + "a.....a" + "aa...aa" + + // Level 5 + "aabbbaa" + "a.....a" + "b.....b" + "b.....b" + "b.....b" + "a.....a" + "aabbbaa" + + // Level 6 + "aaaaaaa" + "a.....a" + "a.....a" + "a.....a" + "a.....a" + "a.....a" + "aaaaaaa", + + // Connections: + "0: 0, 3, 2: 4\n" + "0: 2, 3, 0: 2\n", + + // AllowedRotations: + 7, /* 1, 2, 3 CCW rotations */ + + // Merge strategy: + cBlockArea::msImprint +}; + +static cPrefab g_TestPrefab(g_TestPrefabDef); +#endif + + + + + cPrefab::cPrefab(const cPrefab::sDef & a_Def) : m_Size(a_Def.m_SizeX, a_Def.m_SizeY, a_Def.m_SizeZ), m_HitBox(0, 0, 0, a_Def.m_SizeX - 1, a_Def.m_SizeY - 1, a_Def.m_SizeZ - 1), @@ -86,10 +172,13 @@ bool cPrefab::HasConnectorType(int a_ConnectorType) const void cPrefab::ParseCharMap(CharMap & a_CharMapOut, const char * a_CharMapDef) { + ASSERT(a_CharMapDef != NULL); + // Initialize the charmap to all-invalid values: for (size_t i = 0; i < ARRAYCOUNT(a_CharMapOut); i++) { - a_CharMapOut[i] = -1; + a_CharMapOut[i].m_BlockType = 0; + a_CharMapOut[i].m_BlockMeta = 16; // Mark unassigned entries with a meta that is impossible otherwise } // Process the lines in the definition: @@ -104,15 +193,15 @@ void cPrefab::ParseCharMap(CharMap & a_CharMapOut, const char * a_CharMapDef) continue; } unsigned char Src = (unsigned char)CharDef[0][0]; - BLOCKTYPE BlockType = (BLOCKTYPE)atoi(CharDef[1].c_str()); + ASSERT(a_CharMapOut[Src].m_BlockMeta == 16); // This letter has not been assigned yet? + a_CharMapOut[Src].m_BlockType = (BLOCKTYPE)atoi(CharDef[1].c_str()); NIBBLETYPE BlockMeta = 0; if ((NumElements >= 3) && !CharDef[2].empty()) { BlockMeta = (NIBBLETYPE)atoi(CharDef[2].c_str()); ASSERT((BlockMeta >= 0) && (BlockMeta <= 15)); } - ASSERT(a_CharMapOut[Src] == -1); // Any duplicates letter-wise? - a_CharMapOut[Src] = (BlockType << 4) | BlockMeta; + a_CharMapOut[Src].m_BlockMeta = BlockMeta; } // for itr - Lines[] } @@ -130,11 +219,9 @@ void cPrefab::ParseBlockImage(const CharMap & a_CharMap, const char * a_BlockIma const unsigned char * BlockImage = (const unsigned char *)a_BlockImage + y * m_Size.x * m_Size.z + z * m_Size.x; for (int x = 0; x < m_Size.x; x++) { - int MappedValue = a_CharMap[BlockImage[x]]; - ASSERT(MappedValue != -1); // Using a letter not defined in the CharMap? - BLOCKTYPE BlockType = MappedValue >> 4; - NIBBLETYPE BlockMeta = MappedValue & 0x0f; - m_BlockArea[0].SetRelBlockTypeMeta(x, y, z, BlockType, BlockMeta); + const sBlockTypeDef & MappedValue = a_CharMap[BlockImage[x]]; + ASSERT(MappedValue.m_BlockMeta != 16); // Using a letter not defined in the CharMap? + m_BlockArea[0].SetRelBlockTypeMeta(x, y, z, MappedValue.m_BlockType, MappedValue.m_BlockMeta); } } } @@ -146,6 +233,8 @@ void cPrefab::ParseBlockImage(const CharMap & a_CharMap, const char * a_BlockIma void cPrefab::ParseConnectors(const char * a_ConnectorsDef) { + ASSERT(a_ConnectorsDef != NULL); + AStringVector Lines = StringSplitAndTrim(a_ConnectorsDef, "\n"); for (AStringVector::const_iterator itr = Lines.begin(), end = Lines.end(); itr != end; ++itr) { diff --git a/src/Generating/Prefab.h b/src/Generating/Prefab.h index 0b254c03b..04c4f09da 100644 --- a/src/Generating/Prefab.h +++ b/src/Generating/Prefab.h @@ -53,8 +53,15 @@ public: bool HasConnectorType(int a_ConnectorType) const; protected: + /** Packs complete definition of a single block, for per-letter assignment. */ + struct sBlockTypeDef + { + BLOCKTYPE m_BlockType; + NIBBLETYPE m_BlockMeta; + }; + /** Maps letters in the sDef::m_Image onto a number, BlockType * 16 | BlockMeta */ - typedef int CharMap[256]; + typedef sBlockTypeDef CharMap[256]; /** The cBlockArea that contains the block definitions for the prefab. diff --git a/src/Generating/Prefabs/CMakeLists.txt b/src/Generating/Prefabs/CMakeLists.txt new file mode 100644 index 000000000..1e60447e7 --- /dev/null +++ b/src/Generating/Prefabs/CMakeLists.txt @@ -0,0 +1,13 @@ + +cmake_minimum_required (VERSION 2.6) +project (MCServer) + +include_directories ("${PROJECT_SOURCE_DIR}/../../") + +file(GLOB SOURCE + "*.cpp" +) + +add_library(Generating_Prefabs ${SOURCE}) + +target_link_libraries(Generating_Prefabs OSSupport iniFile Blocks) diff --git a/src/Generating/Prefabs/NetherFortPrefabs.cpp b/src/Generating/Prefabs/NetherFortPrefabs.cpp new file mode 100644 index 000000000..5e8685e32 --- /dev/null +++ b/src/Generating/Prefabs/NetherFortPrefabs.cpp @@ -0,0 +1,2758 @@ + +// NetherFortPrefabs.cpp + +// Defines all the prefabs for nether forts + +#include "Globals.h" +#include "NetherFortPrefabs.h" + + + + + +/* +The nether fortress has two types of connectors, Outer and Inner. Outer is Type 0, Inner is Type 1. +*/ + + + + + +const cPrefab::sDef g_NetherFortPrefabs1[] = +{ + /////////////////////////////////////////////////////////////////////////////////////////////////////////////////////// + // BalconyCorridor: + // The data has been exported from gallery Nether, area index 37, ID 288 + { + // Size: + 13, 7, 9, // SizeX = 13, SizeY = 7, SizeZ = 9 + + // Block definitions: + "a:112: 0\n" /* netherbrick */ + "b: 19: 0\n" /* sponge */ + "c:114: 4\n" /* netherbrickstairs */ + "d:114: 7\n" /* netherbrickstairs */ + "e:114: 5\n" /* netherbrickstairs */ + "f: 44: 6\n" /* step */ + "g:113: 0\n" /* netherbrickfence */ + "h:114: 2\n" /* netherbrickstairs */ + "i:114: 3\n" /* netherbrickstairs */ + "j:114: 0\n" /* netherbrickstairs */ + "k:114: 1\n" /* netherbrickstairs */ + ".: 0: 0\n" /* air */, + + // Block data: + // Level 1 + "aaaaaaaaaaaaa" + "aaaaaaaaaaaaa" + "aaaaaaaaaaaaa" + "aaaaaaaaaaaaa" + "aaaaaaaaaaaaa" + "bbbbaaaaabbbb" + "bbbbbbbbbbbbb" + "bbbbbbbbbbbbb" + "bbbbbbbbbbbbb" + + // Level 2 + "aaaaaaaaaaaaa" + "aaaaaaaaaaaaa" + "aaaaaaaaaaaaa" + "aaaaaaaaaaaaa" + "aaaa.aaa.aaaa" + "bbcdaaaaadebb" + "bbbcdddddebbb" + "bbbbbbbbbbbbb" + "bbbbbbbbbbbbb" + + // Level 3 + "aaaaaaaaaaaaa" + "............." + "............." + "............." + "aaaa.fff.aaaa" + "bbaaaaaaaaabb" + "bbaaaaaaaaabb" + "bbaaaaaaaaabb" + "bbaaaaaaaaabb" + + // Level 4 + "agagagagagaga" + "............." + "............." + "............." + "agaa.....aaga" + "bbaaa...aaabb" + "bbg.......gbb" + "bbg.......gbb" + "bbgggggggggbb" + + // Level 5 + "agagagagagaga" + "............." + "............." + "............." + "agaa.....aaga" + "bbaaa...aaabb" + "bb.........bb" + "bb.........bb" + "bb.........bb" + + // Level 6 + "agagagagagaga" + "............." + "............." + "............." + "agaa.....aaga" + "bbaaa...aaabb" + "bb.........bb" + "bb.........bb" + "bb.........bb" + + // Level 7 + "hhhhhhhhhhhhh" + "aaaaaaaaaaaaa" + "aaaaaaaaaaaaa" + "aaaaaaaaaaaaa" + "iijaaaaaaaiii" + "bbjiiiiiiikbb" + "bbbbbbbbbbbbb" + "bbbbbbbbbbbbb" + "bbbbbbbbbbbbb", + + // Connections: + "1: 0, 2, 2: 4\n" /* Type 1, BLOCK_FACE_XM */ + "1: 12, 2, 2: 5\n" /* Type 1, BLOCK_FACE_XP */, + + // AllowedRotations: + 7, /* 1, 2, 3 CCW rotations */ + + // Merge strategy: + cBlockArea::msSpongePrint, + }, // BalconyCorridor + + + /////////////////////////////////////////////////////////////////////////////////////////////////////////////////////// + // BalconyTee2: + // The data has been exported from gallery Nether, area index 38, ID 289 + { + // Size: + 13, 7, 11, // SizeX = 13, SizeY = 7, SizeZ = 11 + + // Block definitions: + "a: 19: 0\n" /* sponge */ + "b:112: 0\n" /* netherbrick */ + "c:114: 4\n" /* netherbrickstairs */ + "d:114: 7\n" /* netherbrickstairs */ + "e:114: 5\n" /* netherbrickstairs */ + "f: 44: 6\n" /* step */ + "g:113: 0\n" /* netherbrickfence */ + "h:114: 0\n" /* netherbrickstairs */ + "i:114: 1\n" /* netherbrickstairs */ + "j:114: 2\n" /* netherbrickstairs */ + "k:114: 3\n" /* netherbrickstairs */ + ".: 0: 0\n" /* air */, + + // Block data: + // Level 1 + "aaaabbbbbaaaa" + "aaaabbbbbaaaa" + "bbbbbbbbbbbbb" + "bbbbbbbbbbbbb" + "bbbbbbbbbbbbb" + "bbbbbbbbbbbbb" + "bbbbbbbbbbbbb" + "aaaabbbbbaaaa" + "aaaaaaaaaaaaa" + "aaaaaaaaaaaaa" + "aaaaaaaaaaaaa" + + // Level 2 + "aaaabbbbbaaaa" + "aaaabbbbbaaaa" + "bbbbbbbbbbbbb" + "bbbbbbbbbbbbb" + "bbbbbbbbbbbbb" + "bbbbbbbbbbbbb" + "bbbb.bbb.bbbb" + "aacdbbbbbdeaa" + "aaacdddddeaaa" + "aaaaaaaaaaaaa" + "aaaaaaaaaaaaa" + + // Level 3 + "aaaab...baaaa" + "aaaab...baaaa" + "bbbbb...bbbbb" + "............." + "............." + "............." + "bbbb.fff.bbbb" + "aabbbbbbbbbaa" + "aabbbbbbbbbaa" + "aabbbbbbbbbaa" + "aabbbbbbbbbaa" + + // Level 4 + "aaaab...baaaa" + "aaaag...gaaaa" + "bgbgb...bgbgb" + "............." + "............." + "............." + "bgbb.....bbgb" + "aabbb...bbbaa" + "aag.......gaa" + "aag.......gaa" + "aagggggggggaa" + + // Level 5 + "aaaab...baaaa" + "aaaag...gaaaa" + "bgbgb...bgbgb" + "............." + "............." + "............." + "bgbb.....bbgb" + "aabbb...bbbaa" + "aa.........aa" + "aa.........aa" + "aa.........aa" + + // Level 6 + "aaaab...baaaa" + "aaaag...gaaaa" + "bgbgb...bgbgb" + "............." + "............." + "............." + "bgbb.....bbgb" + "aabbb...bbbaa" + "aa.........aa" + "aa.........aa" + "aa.........aa" + + // Level 7 + "aaaahbbbiaaaa" + "aaaahbbbiaaaa" + "jjjjjbbbjjjjj" + "bbbbbbbbbbbbb" + "bbbbbbbbbbbbb" + "bbbbbbbbbbbbb" + "kkhbbbbbbbkkk" + "aahkkkkkkkiaa" + "aaaaaaaaaaaaa" + "aaaaaaaaaaaaa" + "aaaaaaaaaaaaa", + + // Connections: + "1: 0, 2, 4: 4\n" /* Type 1, BLOCK_FACE_XM */ + "1: 12, 2, 4: 5\n" /* Type 1, BLOCK_FACE_XP */ + "1: 6, 2, 0: 2\n" /* Type 1, BLOCK_FACE_ZM */, + + // AllowedRotations: + 7, /* 1, 2, 3 CCW rotations */ + + // Merge strategy: + cBlockArea::msSpongePrint, + }, // BalconyTee2 + + + /////////////////////////////////////////////////////////////////////////////////////////////////////////////////////// + // BlazePlatform + // The data has been exported from gallery Nether, area index 26, ID 276 + { + // Size: + 10, 7, 7, // SizeX = 10, SizeY = 7, SizeZ = 7 + + // Block definitions: + ".: 0: 0\n" /* air */ + "a:112: 0\n" /* netherbrick */ + "b: 52: 0\n" /* mobspawner */ + "c:113: 0\n" /* netherbrickfence */, + + // Block data: + // Level 1 + ".........." + "aaaaaaaaaa" + "aaaaaaaaaa" + "aaaaaaaaaa" + "aaaaaaaaaa" + "aaaaaaaaaa" + ".........." + + // Level 2 + ".........." + "aaaaaaaaaa" + "..aaaaaaaa" + "..aaaaaaaa" + "..aaaaaaaa" + "aaaaaaaaaa" + ".........." + + // Level 3 + "....aaaaaa" + "aaaaaaaaaa" + "...aaaaaaa" + "...aaaaaaa" + "...aaaaaaa" + "aaaaaaaaaa" + "....aaaaaa" + + // Level 4 + "....aaaaaa" + "..aaa....a" + ".........a" + "......b..a" + ".........a" + "..aaa....a" + "....aaaaaa" + + // Level 5 + "....cccccc" + "...cc....c" + ".........c" + ".........c" + ".........c" + "...cc....c" + "....cccccc" + + // Level 6 + ".........." + ".........c" + ".........c" + ".........c" + ".........c" + ".........c" + ".........." + + // Level 7 + ".........." + ".........." + ".........c" + ".........c" + ".........c" + ".........." + "..........", + + // Connections: + "0: 0, 1, 3: 4\n" /* Type 0, BLOCK_FACE_XM */, + + // AllowedRotations: + 7, /* 1, 2, 3 CCW rotations */ + + // Merge strategy: + cBlockArea::msSpongePrint, + }, // BlazePlatform + + + /////////////////////////////////////////////////////////////////////////////////////////////////////////////////////// + // BlazePlatformOverhang: + // The data has been exported from gallery Nether, area index 20, ID 162 + { + // Size: + 14, 9, 7, // SizeX = 14, SizeY = 9, SizeZ = 7 + + // Block definitions: + ".: 0: 0\n" /* air */ + "a:112: 0\n" /* netherbrick */ + "b:114: 5\n" /* netherbrickstairs */ + "c: 44:14\n" /* step */ + "d:114: 6\n" /* netherbrickstairs */ + "e:114: 7\n" /* netherbrickstairs */ + "f:114: 0\n" /* netherbrickstairs */ + "g:114: 4\n" /* netherbrickstairs */ + "h:113: 0\n" /* netherbrickfence */ + "i: 52: 0\n" /* mobspawner */ + "m: 19: 0\n" /* sponge */, + + // Block data: + // Level 1 + "mmmmmmmmmmmmmm" + "mmmmmmmmmmmmmm" + "aammmmmmmmmmmm" + "aammmmmmmmmmmm" + "aammmmmmmmmmmm" + "mmmmmmmmmmmmmm" + "mmmmmmmmmmmmmm" + + // Level 2 + "mmmmmmmmmmmmmm" + "mmmmmmmmmmmmmm" + "aabcmmmmmmmmmm" + "aabcmmmmmmmmmm" + "aabcmmmmmmmmmm" + "mmmmmmmmmmmmmm" + "mmmmmmmmmmmmmm" + + // Level 3 + "mmmmmmmmmmmmmm" + "mmmmmmmmmmmmmm" + "aaaaabmmmmmmmm" + "aaaaabmmmmmmmm" + "aaaaabmmmmmmmm" + "mmmmmmmmmmmmmm" + "mmmmmmmmmmmmmm" + + // Level 4 + "mmmmmmmmmmmmmm" + "dddddddmmmmmmm" + "aaaaaabmmmmmmm" + "aaaaaabmmmmmmm" + "aaaaaabmmmmmmm" + "eeeeeeemmmmmmm" + "mmmmmmmmmmmmmm" + + // Level 5 + "mmmmmmmmmmmmmm" + "aaaaaaadmmmmmm" + "aaaaaaabmmmmmm" + "aaaaaaabmmmmmm" + "aaaaaaabmmmmmm" + "aaaaaaaemmmmmm" + "mmmmmmmmmmmmmm" + + // Level 6 + "mmmmmmmmmmmmmm" + "aaaaaaaabddddm" + "......faaaaabm" + "......faaaaabm" + "......faaaaabm" + "aaaaaaaaabeebm" + "mmmmmmmmmmmmmm" + + // Level 7 + "mmmmmmmmgdddbm" + "......aaaaaaad" + ".......faaaaab" + ".......faaaaab" + ".......faaaaab" + "......aaaaaaae" + "mmmmmmmmgeeebm" + + // Level 8 + "mmmmmmmmaaaaam" + "......haa...aa" + ".............a" + "..........i..a" + ".............a" + "......haa...aa" + "mmmmmmmmaaaaam" + + // Level 9 + "mmmmmmmmhhhhhm" + "......hhh...hh" + ".............h" + ".............h" + ".............h" + "......hhh...hh" + "mmmmmmmmhhhhhm", + + // Connections: + "0: 0, 5, 3: 4\n" /* Type 0, BLOCK_FACE_XM */, + + // AllowedRotations: + 7, /* 1, 2, 3 CCW rotations */ + + // Merge strategy: + cBlockArea::msSpongePrint, + }, // BlazePlatformOverhang + + + /////////////////////////////////////////////////////////////////////////////////////////////////////////////////////// + // BridgeCrossing: + // The data has been exported from gallery Nether, area index 17, ID 159 + { + // Size: + 15, 8, 15, // SizeX = 15, SizeY = 8, SizeZ = 15 + + // Block definitions: + ".: 0: 0\n" /* air */ + "a:112: 0\n" /* netherbrick */ + "b:114: 7\n" /* netherbrickstairs */ + "c:114: 5\n" /* netherbrickstairs */ + "d:114: 4\n" /* netherbrickstairs */ + "e:114: 6\n" /* netherbrickstairs */ + "f: 44:14\n" /* step */ + "m: 19: 0\n" /* sponge */, + + // Block data: + // Level 1 + "mmmmmmaaammmmmm" + "mmmmmmaaammmmmm" + "mmmmmmmmmmmmmmm" + "mmmmmmmmmmmmmmm" + "mmmmmmmmmmmmmmm" + "mmmmmmmmmmmmmmm" + "aammmmmmmmmmmaa" + "aammmmmmmmmmmaa" + "aammmmmmmmmmmaa" + "mmmmmmmmmmmmmmm" + "mmmmmmmmmmmmmmm" + "mmmmmmmmmmmmmmm" + "mmmmmmmmmmmmmmm" + "mmmmmmaaammmmmm" + "mmmmmmaaammmmmm" + + // Level 2 + "mmmmmmaaammmmmm" + "mmmmmmaaammmmmm" + "mmmmmmbbbmmmmmm" + "mmmmmmmmmmmmmmm" + "mmmmmmmmmmmmmmm" + "mmmmmmmmmmmmmmm" + "aacmmmmmmmmmdaa" + "aacmmmmmmmmmdaa" + "aacmmmmmmmmmdaa" + "mmmmmmmmmmmmmmm" + "mmmmmmmmmmmmmmm" + "mmmmmmmmmmmmmmm" + "mmmmmmeeemmmmmm" + "mmmmmmaaammmmmm" + "mmmmmmaaammmmmm" + + // Level 3 + "mmmmmmaaammmmmm" + "mmmmmmaaammmmmm" + "mmmmmmaaammmmmm" + "mmmmmmbbbmmmmmm" + "mmmmmmfffmmmmmm" + "mmmmmmmmmmmmmmm" + "aaacfmmmmmfdaaa" + "aaacfmmmmmfdaaa" + "aaacfmmmmmfdaaa" + "mmmmmmmmmmmmmmm" + "mmmmmmfffmmmmmm" + "mmmmmmeeemmmmmm" + "mmmmmmaaammmmmm" + "mmmmmmaaammmmmm" + "mmmmmmaaammmmmm" + + // Level 4 + "mmmmmdaaacmmmmm" + "mmmmmdaaacmmmmm" + "mmmmmdaaacmmmmm" + "mmmmmdaaacmmmmm" + "mmmmmdaaacmmmmm" + "eeeeeeaaaeeeeee" + "aaaaaaaaaaaaaaa" + "aaaaaaaaaaaaaaa" + "aaaaaaaaaaaaaaa" + "bbbbbdaaacbbbbb" + "mmmmmdaaacmmmmm" + "mmmmmdaaacmmmmm" + "mmmmmdaaacmmmmm" + "mmmmmdaaacmmmmm" + "mmmmmdaaacmmmmm" + + // Level 5 + "mmmmmaaaaammmmm" + "mmmmmaaaaammmmm" + "mmmmmaaaaammmmm" + "mmmmmaaaaammmmm" + "mmmmmaaaaammmmm" + "aaaaaaaaaaaaaaa" + "aaaaaaaaaaaaaaa" + "aaaaaaaaaaaaaaa" + "aaaaaaaaaaaaaaa" + "aaaaaaaaaaaaaaa" + "mmmmmaaaaammmmm" + "mmmmmaaaaammmmm" + "mmmmmaaaaammmmm" + "mmmmmaaaaammmmm" + "mmmmmaaaaammmmm" + + // Level 6 + "mmmmma...ammmmm" + "mmmmma...ammmmm" + "mmmmma...ammmmm" + "mmmmma...ammmmm" + "mmmmma...ammmmm" + "aaaaaa...aaaaaa" + "..............." + "..............." + "..............." + "aaaaaa...aaaaaa" + "mmmmma...ammmmm" + "mmmmma...ammmmm" + "mmmmma...ammmmm" + "mmmmma...ammmmm" + "mmmmma...ammmmm" + + // Level 7 + "mmmmmm...mmmmmm" + "mmmmmm...mmmmmm" + "mmmmmm...mmmmmm" + "mmmmmm...mmmmmm" + "mmmmmm...mmmmmm" + "mmmmmm...mmmmmm" + "..............." + "..............." + "..............." + "mmmmmm...mmmmmm" + "mmmmmm...mmmmmm" + "mmmmmm...mmmmmm" + "mmmmmm...mmmmmm" + "mmmmmm...mmmmmm" + "mmmmmm...mmmmmm" + + // Level 8 + "mmmmmm...mmmmmm" + "mmmmmm...mmmmmm" + "mmmmmm...mmmmmm" + "mmmmmm...mmmmmm" + "mmmmmm...mmmmmm" + "mmmmmm...mmmmmm" + "..............." + "..............." + "..............." + "mmmmmm...mmmmmm" + "mmmmmm...mmmmmm" + "mmmmmm...mmmmmm" + "mmmmmm...mmmmmm" + "mmmmmm...mmmmmm" + "mmmmmm...mmmmmm", + + // Connections: + "0: 0, 5, 7: 4\n" /* Type 0, BLOCK_FACE_XM */ + "0: 7, 5, 0: 2\n" /* Type 0, BLOCK_FACE_ZM */ + "0: 14, 5, 7: 5\n" /* Type 0, BLOCK_FACE_XP */ + "0: 7, 5, 14: 3\n" /* Type 0, BLOCK_FACE_ZP */, + + // AllowedRotations: + 7, /* 1, 2, 3 CCW rotations */ + + // Merge strategy: + cBlockArea::msSpongePrint, + }, // BridgeCrossing + + + /////////////////////////////////////////////////////////////////////////////////////////////////////////////////////// + // BridgeCrumble1: + // The data has been exported from gallery Nether, area index 19, ID 161 + { + // Size: + 9, 6, 5, // SizeX = 9, SizeY = 6, SizeZ = 5 + + // Block definitions: + ".: 19: 0\n" /* sponge */ + "a:112: 0\n" /* netherbrick */ + "b:114: 5\n" /* netherbrickstairs */ + "c: 44:14\n" /* step */ + "d:114: 6\n" /* netherbrickstairs */ + "e:114: 7\n" /* netherbrickstairs */, + + // Block data: + // Level 1 + "........." + "aa......." + "aa......." + "aa......." + "........." + + // Level 2 + "........." + "aab......" + "aab......" + "aab......" + "........." + + // Level 3 + "........." + "aaabc...." + "aaabc...." + "aaabc...." + "........." + + // Level 4 + "ddddddd.." + "aaaaaaaa." + "aaaaaaaaa" + "aaaaaaa.." + "eeeee...." + + // Level 5 + "aaaaaaaaa" + "aaaaa...." + "aaaaaa..." + "aaaaaa..." + "aaaaaaaa." + + // Level 6 + "aaaaaa..." + "........." + "........." + "........." + "aaaaaaa..", + + // Connections: + "0: 0, 5, 2: 4\n" /* Type 0, BLOCK_FACE_XM */, + + // AllowedRotations: + 7, /* 1, 2, 3 CCW rotations */ + + // Merge strategy: + cBlockArea::msSpongePrint, + }, // BridgeCrumble1 + + + /////////////////////////////////////////////////////////////////////////////////////////////////////////////////////// + // BridgeCrumble2 + // The data has been exported from gallery Nether, area index 18, ID 160 + { + // Size: + 13, 6, 5, // SizeX = 13, SizeY = 6, SizeZ = 5 + + // Block definitions: + ".: 19: 0\n" /* sponge */ + "a:112: 0\n" /* netherbrick */ + "b:114: 5\n" /* netherbrickstairs */ + "c: 44:14\n" /* step */ + "d:114: 6\n" /* netherbrickstairs */ + "e:114: 7\n" /* netherbrickstairs */, + + // Block data: + // Level 1 + "............." + "aa..........." + "aa..........." + "aa..........." + "............." + + // Level 2 + "............." + "aab.........." + "aab.........." + "aab.........." + "............." + + // Level 3 + "............." + "aaabc........" + "aaabc........" + "aaabc........" + "............." + + // Level 4 + "ddddddddd...." + "aaaaaaaaaaaaa" + "aaaaaaaaa...." + "aaaaaaaaaaaa." + "eeeeeeeee...." + + // Level 5 + "aaaaaaaaaaaa." + "aaaaaaaaaa..." + "aaaaaaaaaaa.." + "aaaaaaaaa...." + "aaaaaaaaaaaaa" + + // Level 6 + "aaaaaaaaa...." + "............." + "............." + "............." + "aaaaaaaaaa...", + + // Connections: + "0: 0, 5, 2: 4\n" /* Type 0, BLOCK_FACE_XM */, + + // AllowedRotations: + 7, /* 1, 2, 3 CCW rotations */ + + // Merge strategy: + cBlockArea::msSpongePrint, + }, // BridgeCrumble2 + + + /////////////////////////////////////////////////////////////////////////////////////////////////////////////////////// + // BridgeSegment: + // The data has been exported from gallery Nether, area index 16, ID 158 + { + // Size: + 15, 8, 5, // SizeX = 15, SizeY = 8, SizeZ = 5 + + // Block definitions: + ".: 0: 0\n" /* air */ + "a:112: 0\n" /* netherbrick */ + "b:114: 5\n" /* netherbrickstairs */ + "c:114: 4\n" /* netherbrickstairs */ + "d: 44:14\n" /* step */ + "e:114: 6\n" /* netherbrickstairs */ + "f:114: 7\n" /* netherbrickstairs */ + "m: 19: 0\n" /* sponge */, + + // Block data: + // Level 1 + "mmmmmmmmmmmmmmm" + "aammmmmmmmmmmaa" + "aammmmmmmmmmmaa" + "aammmmmmmmmmmaa" + "mmmmmmmmmmmmmmm" + + // Level 2 + "mmmmmmmmmmmmmmm" + "aabmmmmmmmmmcaa" + "aabmmmmmmmmmcaa" + "aabmmmmmmmmmcaa" + "mmmmmmmmmmmmmmm" + + // Level 3 + "mmmmmmmmmmmmmmm" + "aaabdmmmmmdcaaa" + "aaabdmmmmmdcaaa" + "aaabdmmmmmdcaaa" + "mmmmmmmmmmmmmmm" + + // Level 4 + "eeeeeeeeeeeeeee" + "aaaaaaaaaaaaaaa" + "aaaaaaaaaaaaaaa" + "aaaaaaaaaaaaaaa" + "fffffffffffffff" + + // Level 5 + "aaaaaaaaaaaaaaa" + "aaaaaaaaaaaaaaa" + "aaaaaaaaaaaaaaa" + "aaaaaaaaaaaaaaa" + "aaaaaaaaaaaaaaa" + + // Level 6 + "aaaaaaaaaaaaaaa" + "..............." + "..............." + "..............." + "aaaaaaaaaaaaaaa" + + // Level 7 + "mmmmmmmmmmmmmmm" + "..............." + "..............." + "..............." + "mmmmmmmmmmmmmmm" + + // Level 8 + "mmmmmmmmmmmmmmm" + "..............." + "..............." + "..............." + "mmmmmmmmmmmmmmm", + + // Connections: + "0: 0, 5, 2: 4\n" /* Type 0, BLOCK_FACE_XM */ + "0: 14, 5, 2: 5\n" /* Type 0, BLOCK_FACE_XP */, + + // AllowedRotations: + 7, /* 1, 2, 3 CCW rotations */ + + // Merge strategy: + cBlockArea::msSpongePrint, + }, // BridgeSegment + + + // BridgeTee: + // The data has been exported from gallery Nether, area index 39, ID 290 + { + // Size: + 15, 8, 10, // SizeX = 15, SizeY = 8, SizeZ = 10 + + // Block definitions: + ".: 0: 0\n" /* air */ + "a:112: 0\n" /* netherbrick */ + "b:114: 5\n" /* netherbrickstairs */ + "c:114: 4\n" /* netherbrickstairs */ + "d:114: 6\n" /* netherbrickstairs */ + "e: 44:14\n" /* step */ + "f:114: 7\n" /* netherbrickstairs */ + "m: 19: 0\n" /* sponge */, + + // Block data: + // Level 1 + "mmmmmmmmmmmmmmm" + "aammmmmmmmmmmaa" + "aammmmmmmmmmmaa" + "aammmmmmmmmmmaa" + "mmmmmmmmmmmmmmm" + "mmmmmmmmmmmmmmm" + "mmmmmmmmmmmmmmm" + "mmmmmmmmmmmmmmm" + "mmmmmmaaammmmmm" + "mmmmmmaaammmmmm" + + // Level 2 + "mmmmmmmmmmmmmmm" + "aabmmmmmmmmmcaa" + "aabmmmmmmmmmcaa" + "aabmmmmmmmmmcaa" + "mmmmmmmmmmmmmmm" + "mmmmmmmmmmmmmmm" + "mmmmmmmmmmmmmmm" + "mmmmmmdddmmmmmm" + "mmmmmmaaammmmmm" + "mmmmmmaaammmmmm" + + // Level 3 + "mmmmmmmmmmmmmmm" + "aaabemmmmmecaaa" + "aaabemmmmmecaaa" + "aaabemmmmmecaaa" + "mmmmmmmmmmmmmmm" + "mmmmmmeeemmmmmm" + "mmmmmmdddmmmmmm" + "mmmmmmaaammmmmm" + "mmmmmmaaammmmmm" + "mmmmmmaaammmmmm" + + // Level 4 + "ddddddddddddddd" + "aaaaaaaaaaaaaaa" + "aaaaaaaaaaaaaaa" + "aaaaaaaaaaaaaaa" + "fffffcaaabfffff" + "mmmmmcaaabmmmmm" + "mmmmmcaaabmmmmm" + "mmmmmcaaabmmmmm" + "mmmmmcaaabmmmmm" + "mmmmmcaaabmmmmm" + + // Level 5 + "aaaaaaaaaaaaaaa" + "aaaaaaaaaaaaaaa" + "aaaaaaaaaaaaaaa" + "aaaaaaaaaaaaaaa" + "aaaaaaaaaaaaaaa" + "mmmmmaaaaammmmm" + "mmmmmaaaaammmmm" + "mmmmmaaaaammmmm" + "mmmmmaaaaammmmm" + "mmmmmaaaaammmmm" + + // Level 6 + "aaaaaaaaaaaaaaa" + "..............." + "..............." + "..............." + "aaaaaa...aaaaaa" + "mmmmma...ammmmm" + "mmmmma...ammmmm" + "mmmmma...ammmmm" + "mmmmma...ammmmm" + "mmmmma...ammmmm" + + // Level 7 + "mmmmmmmmmmmmmmm" + "..............." + "..............." + "..............." + "mmmmmm...mmmmmm" + "mmmmmm...mmmmmm" + "mmmmmm...mmmmmm" + "mmmmmm...mmmmmm" + "mmmmmm...mmmmmm" + "mmmmmm...mmmmmm" + + // Level 8 + "mmmmmmmmmmmmmmm" + "..............." + "..............." + "..............." + "mmmmmm...mmmmmm" + "mmmmmm...mmmmmm" + "mmmmmm...mmmmmm" + "mmmmmm...mmmmmm" + "mmmmmm...mmmmmm" + "mmmmmm...mmmmmm", + + // Connections: + "0: 0, 5, 2: 4\n" /* Type 0, BLOCK_FACE_XM */ + "0: 14, 5, 2: 5\n" /* Type 0, BLOCK_FACE_XP */ + "0: 7, 5, 9: 3\n" /* Type 0, BLOCK_FACE_ZP */, + + // AllowedRotations: + 7, /* 1, 2, 3 CCW rotations */ + + // Merge strategy: + cBlockArea::msSpongePrint, + }, // BridgeTee + + + // Corridor11: + // The data has been exported from gallery Nether, area index 36, ID 287 + { + // Size: + 11, 6, 5, // SizeX = 11, SizeY = 6, SizeZ = 5 + + // Block definitions: + ".: 0: 0\n" /* air */ + "a:112: 0\n" /* netherbrick */ + "b:113: 0\n" /* netherbrickfence */ + "c:114: 2\n" /* netherbrickstairs */ + "d:114: 3\n" /* netherbrickstairs */, + + // Block data: + // Level 1 + "aaaaaaaaaaa" + "aaaaaaaaaaa" + "aaaaaaaaaaa" + "aaaaaaaaaaa" + "aaaaaaaaaaa" + + // Level 2 + "aaaaaaaaaaa" + "..........." + "..........." + "..........." + "aaaaaaaaaaa" + + // Level 3 + "abababababa" + "..........." + "..........." + "..........." + "abababababa" + + // Level 4 + "abababababa" + "..........." + "..........." + "..........." + "abababababa" + + // Level 5 + "abababababa" + "..........." + "..........." + "..........." + "abababababa" + + // Level 6 + "ccccccccccc" + "aaaaaaaaaaa" + "aaaaaaaaaaa" + "aaaaaaaaaaa" + "ddddddddddd", + + // Connections: + "1: 0, 1, 2: 4\n" /* Type 1, BLOCK_FACE_XM */ + "1: 10, 1, 2: 5\n" /* Type 1, BLOCK_FACE_XP */, + + // AllowedRotations: + 7, /* 1, 2, 3 CCW rotations */ + + // Merge strategy: + cBlockArea::msSpongePrint, + }, // Corridor11 + + + /////////////////////////////////////////////////////////////////////////////////////////////////////////////////////// + // Corridor13: + // The data has been exported from gallery Nether, area index 35, ID 286 + { + // Size: + 13, 6, 5, // SizeX = 13, SizeY = 6, SizeZ = 5 + + // Block definitions: + "a:112: 0\n" /* netherbrick */ + ".: 0: 0\n" /* air */ + "c:113: 0\n" /* netherbrickfence */ + "d:114: 2\n" /* netherbrickstairs */ + "e:114: 3\n" /* netherbrickstairs */, + + // Block data: + // Level 1 + "aaaaaaaaaaaaa" + "aaaaaaaaaaaaa" + "aaaaaaaaaaaaa" + "aaaaaaaaaaaaa" + "aaaaaaaaaaaaa" + + // Level 2 + "aaaaaaaaaaaaa" + "............." + "............." + "............." + "aaaaaaaaaaaaa" + + // Level 3 + "acacacacacaca" + "............." + "............." + "............." + "acacacacacaca" + + // Level 4 + "acacacacacaca" + "............." + "............." + "............." + "acacacacacaca" + + // Level 5 + "acacacacacaca" + "............." + "............." + "............." + "acacacacacaca" + + // Level 6 + "ddddddddddddd" + "aaaaaaaaaaaaa" + "aaaaaaaaaaaaa" + "aaaaaaaaaaaaa" + "eeeeeeeeeeeee", + + // Connections: + "1: 0, 1, 2: 4\n" /* Type 1, BLOCK_FACE_XM */ + "1: 12, 1, 2: 5\n" /* Type 1, BLOCK_FACE_XP */, + + // AllowedRotations: + 7, /* 1, 2, 3 CCW rotations */ + + // Merge strategy: + cBlockArea::msSpongePrint, + }, // Corridor13 + + + // CorridorCorner5: + // The data has been exported from gallery Nether, area index 10, ID 40 + { + // Size: + 11, 6, 11, // SizeX = 11, SizeY = 6, SizeZ = 11 + + // Block definitions: + ".: 0: 0\n" /* air */ + "a:112: 0\n" /* netherbrick */ + "b:113: 0\n" /* netherbrickfence */ + "c:114: 2\n" /* netherbrickstairs */ + "d:114: 0\n" /* netherbrickstairs */ + "e:114: 3\n" /* netherbrickstairs */ + "f:114: 1\n" /* netherbrickstairs */ + "m: 19: 0\n" /* sponge */, + + // Block data: + // Level 1 + "aaaaaaaaaaa" + "aaaaaaaaaaa" + "aaaaaaaaaaa" + "aaaaaaaaaaa" + "aaaaaaaaaaa" + "aaaaammmmmm" + "aaaaammmmmm" + "aaaaammmmmm" + "aaaaammmmmm" + "aaaaammmmmm" + "aaaaammmmmm" + + // Level 2 + "aaaaaaaaaaa" + "a.........." + "a.........." + "a.........." + "a...aaaaaaa" + "a...ammmmmm" + "a...ammmmmm" + "a...ammmmmm" + "a...ammmmmm" + "a...ammmmmm" + "a...ammmmmm" + + // Level 3 + "abababababa" + "b.........." + "a.........." + "b.........." + "a...abababa" + "b...bmmmmmm" + "a...ammmmmm" + "b...bmmmmmm" + "a...ammmmmm" + "b...bmmmmmm" + "a...ammmmmm" + + // Level 4 + "abababababa" + "b.........." + "a.........." + "b.........." + "a...abababa" + "b...bmmmmmm" + "a...ammmmmm" + "b...bmmmmmm" + "a...ammmmmm" + "b...bmmmmmm" + "a...ammmmmm" + + // Level 5 + "abababababa" + "b.........." + "a.........." + "b.........." + "a...abababa" + "b...bmmmmmm" + "a...ammmmmm" + "b...bmmmmmm" + "a...ammmmmm" + "b...bmmmmmm" + "a...ammmmmm" + + // Level 6 + "ccccccccccc" + "daaaaaaaaaa" + "daaaaaaaaaa" + "daaaaaaaaaa" + "daaaeeeeeee" + "daaafmmmmmm" + "daaafmmmmmm" + "daaafmmmmmm" + "daaafmmmmmm" + "daaafmmmmmm" + "daaafmmmmmm", + + // Connections: + "1: 10, 1, 2: 5\n" /* Type 1, BLOCK_FACE_XP */ + "1: 2, 1, 10: 3\n" /* Type 1, BLOCK_FACE_ZP */, + + // AllowedRotations: + 7, /* 1, 2, 3 CCW rotations */ + + // Merge strategy: + cBlockArea::msSpongePrint, + }, // CorridorCorner5 + + + // CorridorCorner5: + // The data has been exported from gallery Nether, area index 10, ID 40 + { + // Size: + 11, 6, 11, // SizeX = 11, SizeY = 6, SizeZ = 11 + + // Block definitions: + ".: 0: 0\n" /* air */ + "a:112: 0\n" /* netherbrick */ + "b:113: 0\n" /* netherbrickfence */ + "c:114: 2\n" /* netherbrickstairs */ + "d:114: 0\n" /* netherbrickstairs */ + "e:114: 3\n" /* netherbrickstairs */ + "f:114: 1\n" /* netherbrickstairs */ + "g: 54: 5\n" /* chest */ + "m: 19: 0\n" /* sponge */, + + // Block data: + // Level 1 + "aaaaaaaaaaa" + "aaaaaaaaaaa" + "aaaaaaaaaaa" + "aaaaaaaaaaa" + "aaaaaaaaaaa" + "aaaaammmmmm" + "aaaaammmmmm" + "aaaaammmmmm" + "aaaaammmmmm" + "aaaaammmmmm" + "aaaaammmmmm" + + // Level 2 + "aaaaaaaaaaa" + "ag........." + "a.........." + "a.........." + "a...aaaaaaa" + "a...ammmmmm" + "a...ammmmmm" + "a...ammmmmm" + "a...ammmmmm" + "a...ammmmmm" + "a...ammmmmm" + + // Level 3 + "abababababa" + "b.........." + "a.........." + "b.........." + "a...abababa" + "b...bmmmmmm" + "a...ammmmmm" + "b...bmmmmmm" + "a...ammmmmm" + "b...bmmmmmm" + "a...ammmmmm" + + // Level 4 + "abababababa" + "b.........." + "a.........." + "b.........." + "a...abababa" + "b...bmmmmmm" + "a...ammmmmm" + "b...bmmmmmm" + "a...ammmmmm" + "b...bmmmmmm" + "a...ammmmmm" + + // Level 5 + "abababababa" + "b.........." + "a.........." + "b.........." + "a...abababa" + "b...bmmmmmm" + "a...ammmmmm" + "b...bmmmmmm" + "a...ammmmmm" + "b...bmmmmmm" + "a...ammmmmm" + + // Level 6 + "ccccccccccc" + "daaaaaaaaaa" + "daaaaaaaaaa" + "daaaaaaaaaa" + "daaaeeeeeee" + "daaafmmmmmm" + "daaafmmmmmm" + "daaafmmmmmm" + "daaafmmmmmm" + "daaafmmmmmm" + "daaafmmmmmm", + + // Connections: + "1: 10, 1, 2: 5\n" /* Type 1, BLOCK_FACE_XP */ + "1: 2, 1, 10: 3\n" /* Type 1, BLOCK_FACE_ZP */, + + // AllowedRotations: + 7, /* 1, 2, 3 CCW rotations */ + + // Merge strategy: + cBlockArea::msSpongePrint, + }, // CorridorCorner5Chest + + + /////////////////////////////////////////////////////////////////////////////////////////////////////////////////////// + // CorridorStairs: + // The data has been exported from gallery Nether, area index 12, ID 42 + { + // Size: + 9, 13, 5, // SizeX = 9, SizeY = 13, SizeZ = 5 + + // Block definitions: + ".: 0: 0\n" /* air */ + "a:112: 0\n" /* netherbrick */ + "b:114: 0\n" /* netherbrickstairs */ + "c:113: 0\n" /* netherbrickfence */ + "d:114: 2\n" /* netherbrickstairs */ + "e:114: 3\n" /* netherbrickstairs */ + "f: 19: 0\n" /* sponge */, + + // Block data: + // Level 1 + "aaaaaaaaa" + "aaaaaaaaa" + "aaaaaaaaa" + "aaaaaaaaa" + "aaaaaaaaa" + + // Level 2 + "aaaaaaaaa" + ".baaaaaaa" + ".baaaaaaa" + ".baaaaaaa" + "aaaaaaaaa" + + // Level 3 + "acaaaaaaa" + "..baaaaaa" + "..baaaaaa" + "..baaaaaa" + "acaaaaaaa" + + // Level 4 + "acaaaaaaa" + "...baaaaa" + "...baaaaa" + "...baaaaa" + "acaaaaaaa" + + // Level 5 + "acacaaaaa" + "....baaaa" + "....baaaa" + "....baaaa" + "acacaaaaa" + + // Level 6 + "aaacaaaaa" + ".....baaa" + ".....baaa" + ".....baaa" + "aaacaaaaa" + + // Level 7 + "daacacaaa" + "a.....baa" + "a.....baa" + "a.....baa" + "eaacacaaa" + + // Level 8 + "fdaaacaaa" + "fa.....ba" + "fa.....ba" + "fa.....ba" + "feaaacaaa" + + // Level 9 + "ffdaacaca" + "ffa......" + "ffa......" + "ffa......" + "ffeaacaca" + + // Level 10 + "fffdaaaca" + "fffa....." + "fffa....." + "fffa....." + "fffeaaaca" + + // Level 11 + "ffffdaaca" + "ffffa...." + "ffffa...." + "ffffa...." + "ffffeaaca" + + // Level 12 + "fffffdaaa" + "fffffa..." + "fffffa..." + "fffffa..." + "fffffeaaa" + + // Level 13 + "ffffffddd" + "ffffffaaa" + "ffffffaaa" + "ffffffaaa" + "ffffffeee", + + // Connections: + "1: 0, 1, 2: 4\n" /* Type 1, BLOCK_FACE_XM */ + "1: 8, 8, 2: 5\n" /* Type 1, BLOCK_FACE_XP */, + + // AllowedRotations: + 7, /* 1, 2, 3 CCW rotations */ + + // Merge strategy: + cBlockArea::msSpongePrint, + }, // CorridorStairs + + + // LavaStaircase: + // The data has been exported from gallery Nether, area index 28, ID 278 + { + // Size: + 15, 11, 15, // SizeX = 15, SizeY = 11, SizeZ = 15 + + // Block definitions: + ".: 0: 0\n" /* air */ + "a:112: 0\n" /* netherbrick */ + "b:113: 0\n" /* netherbrickfence */ + "c: 11: 0\n" /* lava */, + + // Block data: + // Level 1 + "aaaaaaaaaaaaaaa" + "aaaaaaaaaaaaaaa" + "aaaaaaaaaaaaaaa" + "aaaaaaaaaaaaaaa" + "aaaaaaaaaaaaaaa" + "aaaaaaaaaaaaaaa" + "aaaaaaaaaaaaaaa" + "aaaaaaaaaaaaaaa" + "aaaaaaaaaaaaaaa" + "aaaaaaaaaaaaaaa" + "aaaaaaaaaaaaaaa" + "aaaaaaaaaaaaaaa" + "aaaaaaaaaaaaaaa" + "aaaaaaaaaaaaaaa" + "aaaaaaaaaaaaaaa" + + // Level 2 + "aaaaaaaa...aaaa" + "aaaaa.........a" + "aaaaa.........a" + "aaaaab........a" + "accca...aaaa..a" + "accca...acca..a" + "acccaaaaacca..a" + "acccccccccca..a" + "acccaaaaacca..a" + "accca...acca..a" + "accca...aaaa..a" + "aaaaab........a" + "aaaaa.........a" + "aaaaa.........a" + "aaaaaaaa...aaaa" + + // Level 3 + "aaaaaaaa...aaaa" + "aaaa..........a" + "aaaa..........a" + "aaaabb........a" + "aaaa..........a" + "a.............a" + "a.............a" + "a.............a" + "a.............a" + "a.............a" + "aaaa..........a" + "aaaabb........a" + "aaaa..........a" + "aaaa..........a" + "aaaaaaaa...aaaa" + + // Level 4 + "aaaaaaaa...aaaa" + "a.............a" + "a.............a" + "a..bb.........a" + "aaaa..........a" + "aaaa..........a" + "a.............a" + "a.............a" + "a.............a" + "aaaa..........a" + "aaaa..........a" + "a..bb.........a" + "a.............a" + "a.............a" + "aaaaaaaa...aaaa" + + // Level 5 + "aaaaaaaabbbaaaa" + "a.............a" + "a.............a" + "a..b..........a" + "a..b..........a" + "aaaa..........a" + "aaaa..........a" + "a.............a" + "aaaa..........a" + "aaaa..........a" + "a..b..........a" + "a..b..........a" + "a.............a" + "a.............a" + "aaaaaaaabbbaaaa" + + // Level 6 + "aaaaaaaaaaaaaaa" + "a.............a" + "a.............a" + "a.............a" + "a..b..........a" + "a..b..........a" + "aaaa..........a" + "aaaa..........a" + "aaaa..........a" + "a..b..........a" + "a..b..........a" + "a.............a" + "a.............a" + "a.............a" + "aaaaaaaaaaaaaaa" + + // Level 7 + "aaaaaaaaaaaaaaa" + "a.............a" + "a.............a" + "a.............a" + "a.............a" + "a..b..........a" + "...b..........a" + "...b..........a" + "...b..........a" + "a..b..........a" + "a.............a" + "a.............a" + "a.............a" + "a.............a" + "aaaaaaaaaaaaaaa" + + // Level 8 + "aababababababaa" + "a.............a" + "b.............b" + "a.............a" + "b.............b" + "a.............a" + "..............b" + "..............a" + "..............b" + "a.............a" + "b.............b" + "a.............a" + "b.............b" + "a.............a" + "aababababababaa" + + // Level 9 + "aababababababaa" + "a.............a" + "b.............b" + "a.............a" + "b.............b" + "a.............a" + "..............b" + "..............a" + "..............b" + "a.............a" + "b.............b" + "a.............a" + "b.............b" + "a.............a" + "aababababababaa" + + // Level 10 + "aababababababaa" + "a.............a" + "b.............b" + "a.............a" + "b.............b" + "a.............a" + "..............b" + "..............a" + "..............b" + "a.............a" + "b.............b" + "a.............a" + "b.............b" + "a.............a" + "aababababababaa" + + // Level 11 + "aaaaaaaaaaaaaaa" + "aaaaaaaaaaaaaaa" + "aaaaaaaaaaaaaaa" + "aaaaaaaaaaaaaaa" + "aaaaaaaaaaaaaaa" + "aaaaaaaaaaaaaaa" + "aaaaaaaaaaaaaaa" + "aaaaaaaaaaaaaaa" + "aaaaaaaaaaaaaaa" + "aaaaaaaaaaaaaaa" + "aaaaaaaaaaaaaaa" + "aaaaaaaaaaaaaaa" + "aaaaaaaaaaaaaaa" + "aaaaaaaaaaaaaaa" + "aaaaaaaaaaaaaaa", + + // Connections: + "1: 0, 6, 7: 4\n" /* Type 1, BLOCK_FACE_XM */ + "0: 9, 1, 0: 2\n" /* Type 0, BLOCK_FACE_ZM */ + "0: 9, 1, 14: 3\n" /* Type 0, BLOCK_FACE_ZP */, + + // AllowedRotations: + 7, /* 1, 2, 3 CCW rotations */ + + // Merge strategy: + cBlockArea::msSpongePrint, + }, // LavaStaircase + + + // LavaStaircaseBig: + // The data has been exported from gallery Nether, area index 31, ID 282 + { + // Size: + 12, 15, 15, // SizeX = 12, SizeY = 15, SizeZ = 15 + + // Block definitions: + ".: 0: 0\n" /* air */ + "a:112: 0\n" /* netherbrick */ + "b: 10: 0\n" /* lava */ + "c:113: 0\n" /* netherbrickfence */, + + // Block data: + // Level 1 + "aaaaaaaaaaaa" + "aaaaaaaaaaaa" + "aaaaaaaaaaaa" + "aaaaaaaaaaaa" + "aaaaaaaaaaaa" + "aaaaaaaaaaaa" + "aaaaaaaaaaaa" + "aaaaaaaaaaaa" + "aaaaaaaaaaaa" + "aaaaaaaaaaaa" + "aaaaaaaaaaaa" + "aaaaaaaaaaaa" + "aaaaaaaaaaaa" + "aaaaaaaaaaaa" + "aaaaaaaaaaaa" + + // Level 2 + "aaaaaaaaaaaa" + "aaaaaaaaaaaa" + "aaaaaaaaaaaa" + "aaaaaaaaaaaa" + "abbbbbaaaaaa" + "abbbbbbaaaaa" + "abbbbbba...." + "abbbbbba...." + "abbbbbba...." + "abbbbbbaaaaa" + "abbbbb.aaaaa" + "aaaaaaaaaaaa" + "aaaaaaaaaaaa" + "aaaaaaaaaaaa" + "aaaaaaaaaaaa" + + // Level 3 + "aaaaaaaaaaaa" + "aaaaaaaaaaaa" + "aaaaaaaaaaaa" + "aaaaaaaaaaaa" + "abbbbbaaaaaa" + "abbbbbba...a" + "abbbbbba...." + "abbbbbba...." + "abbbbbba...." + "abbbbbba...a" + "abbbbb.aaaaa" + "aaaaaaaaaaaa" + "aaaaaaaaaaaa" + "aaaaaaaaaaaa" + "aaaaaaaaaaaa" + + // Level 4 + "aaaaaaaaaaaa" + "aaaaaaaaaaaa" + "aaaaaaaaaaaa" + "aaaaaaaaaaaa" + "abbbbbaa...a" + "abbbbbba...a" + "abbbbbba...." + "abbbbbba...." + "abbbbbba...." + "abbbbbba...a" + "abbbbbaa...a" + "aaaaaaaaaaaa" + "aaaaaaaaaaaa" + "aaaaaaaaaaaa" + "aaaaaaaaaaaa" + + // Level 5 + "aaaaaaaaaaaa" + "aaaaa......a" + "aaaaa......a" + "aaaaacc....a" + "a.....cc...a" + "a......c...a" + "a......c...." + "a......c...." + "a......c...." + "a......c...a" + "a.....cc...a" + "aaaaacc....a" + "aaaaa......a" + "aaaaa......a" + "aaaaaaaaaaaa" + + // Level 6 + "aaaaaaaaaaaa" + "aaaa.......a" + "aaaa.......a" + "aaaacc.....a" + "aaaa.......a" + "a..........a" + "a..........a" + "a..........a" + "a..........a" + "a..........a" + "aaaa.......a" + "aaaacc.....a" + "aaaa.......a" + "aaaa.......a" + "aaaaaaaaaaaa" + + // Level 7 + "aaaaaaaaaaaa" + "a..........a" + "a..........a" + "a..cc......a" + "aaaa.......a" + "aaaa.......a" + "a..........a" + "a..........a" + "a..........a" + "aaaa.......a" + "aaaa.......a" + "a..cc......a" + "a..........a" + "a..........a" + "aaaaaaaaaaaa" + + // Level 8 + "aaaaaaaaaaaa" + "a..........a" + "a..........a" + "a..c.......a" + "a..c.......a" + "aaaa.......a" + "aaaa.......a" + "a..........a" + "aaaa.......a" + "aaaa.......a" + "a..c.......a" + "a..c.......a" + "a..........a" + "a..........a" + "aaaaaaaaaaaa" + + // Level 9 + "aaaaaaaaaaaa" + "a..........a" + "a..........a" + "a..........a" + "a..c.......a" + "a..c.......a" + "aaaa.......a" + "aaaa.......a" + "aaaa.......a" + "a..c.......a" + "a..c.......a" + "a..........a" + "a..........a" + "a..........a" + "aaaaaaaaaaaa" + + // Level 10 + "aaaaaaaaaaaa" + "a..........a" + "a..........a" + "a..........a" + "a..........a" + "a..c.......a" + "...c.......a" + "...c.......a" + "...c.......a" + "a..c.......a" + "a..........a" + "a..........a" + "a..........a" + "a..........a" + "aaaaaaaaaaaa" + + // Level 11 + "aaaaaaaaaaaa" + "a..........a" + "a..........a" + "a..........a" + "a..........a" + "a..........a" + "...........a" + "...........a" + "...........a" + "a..........a" + "a..........a" + "a..........a" + "a..........a" + "a..........a" + "aaaaaaaaaaaa" + + // Level 12 + "aaaaaaaaaaaa" + "a..........a" + "a..........a" + "a..........a" + "a..........a" + "a..........a" + "...........a" + "...........a" + "...........a" + "a..........a" + "a..........a" + "a..........a" + "a..........a" + "a..........a" + "aaaaaaaaaaaa" + + // Level 13 + "aaaaaaaaaaaa" + "a..........a" + "a..........a" + "a..........a" + "a..........a" + "a..........a" + "...........a" + "...........a" + "...........a" + "a..........a" + "a..........a" + "a..........a" + "a..........a" + "a..........a" + "aaaaaaaaaaaa" + + // Level 14 + "aaaaaaaaaaaa" + "aaaaaaaaaaaa" + "aaaaaaaaaaaa" + "aaaaaaaaaaaa" + "aaaaaaaaaaaa" + "aaaaaaaaaaaa" + "aaaaaaaaaaaa" + "aaaaaaaaaaaa" + "aaaaaaaaaaaa" + "aaaaaaaaaaaa" + "aaaaaaaaaaaa" + "aaaaaaaaaaaa" + "aaaaaaaaaaaa" + "aaaaaaaaaaaa" + "aaaaaaaaaaaa" + + // Level 15 + "aaaaaaaaaaaa" + "abbbbbbbbbba" + "abbbbbbbbbba" + "abbbbbbbbbba" + "abbbbbbbbbba" + "abbbbbbbbbba" + "abbbbbbbbbba" + "abbbbbbbbbba" + "abbbbbbbbbba" + "abbbbbbbbbba" + "abbbbbbbbbba" + "abbbbbbbbbba" + "abbbbbbbbbba" + "abbbbbbbbbba" + "aaaaaaaaaaaa", + + // Connections: + "1: 0, 9, 7: 4\n" /* Type 1, BLOCK_FACE_XM */ + "1: 11, 1, 7: 5\n" /* Type 1, BLOCK_FACE_XP */, + + // AllowedRotations: + 7, /* 1, 2, 3 CCW rotations */ + + // Merge strategy: + cBlockArea::msSpongePrint, + }, // LavaStaircaseBig + + + // MidStaircase: + // The data has been exported from gallery Nether, area index 23, ID 165 + { + // Size: + 13, 8, 13, // SizeX = 13, SizeY = 8, SizeZ = 13 + + // Block definitions: + ".: 0: 0\n" /* air */ + "a:112: 0\n" /* netherbrick */ + "b: 88: 0\n" /* soulsand */ + "c:115: 7\n" /* netherwartblock */ + "d:114: 3\n" /* netherbrickstairs */ + "e:114: 0\n" /* netherbrickstairs */ + "f:114: 1\n" /* netherbrickstairs */ + "g:114: 2\n" /* netherbrickstairs */ + "h: 10: 0\n" /* lava */ + "i:113: 0\n" /* netherbrickfence */, + + // Block data: + // Level 1 + "aaaaaaaaaaaaa" + "aaaaaaaaaaaaa" + "aaaaaaaaaaaaa" + "aaaabbbbbaaaa" + "aaaabbbbbaaaa" + "aaaaaaaaaaaaa" + "aaaaaaaaaaaaa" + "aaaaaaaaaaaaa" + "aaaabbbbbaaaa" + "aaaabbbbbaaaa" + "aaaaaaaaaaaaa" + "aaaaaaaaaaaaa" + "aaaaaaaaaaaaa" + + // Level 2 + "aaaaaaaaaaaaa" + "aaaaaaaaaaaaa" + "aaaaaaaaaaaaa" + "aaaacccccaaaa" + "addecccccfdda" + "...eaaaaad..." + "...eaaaaa...." + "...eaaaaag..." + "agggcccccfgga" + "aaaacccccaaaa" + "aaaaaaaaaaaaa" + "aaaaaaaaaaaaa" + "aaaaaaaaaaaaa" + + // Level 3 + "aaaaaaaaaaaaa" + "aha.......aha" + "aaa.......aaa" + "a...........a" + "a...........a" + "....eaaaa...." + "....eaaaa...." + "....eaaaa...." + "a...........a" + "a...........a" + "aaa.......aaa" + "aha.......aha" + "aaaaaaaaaaaaa" + + // Level 4 + "aaaiiaaaiiaaa" + "a...........a" + "a...........a" + "a...........a" + "a...........a" + ".....eaaa...." + ".....eaaa...." + ".....eaaa...." + "a...........a" + "a...........a" + "a...........a" + "a...........a" + "aaaiiaaaiiaaa" + + // Level 5 + "aaaiiaaaiiaaa" + "a...........a" + "a...........a" + "a...........a" + "a...........a" + "......eaa...." + "......eaa...." + "......eaa...." + "a...........a" + "a...........a" + "a...........a" + "a...........a" + "aaaiiaaaiiaaa" + + // Level 6 + "aaaaaaaaaaaaa" + "a...........a" + "a...........a" + "a...........a" + "a...........a" + "a......ea...a" + "a......ea...a" + "a......ea...a" + "a...........a" + "a...........a" + "a...........a" + "a...........a" + "aaaaaaaaaaaaa" + + // Level 7 + "aaaaaaaaaaaaa" + "aaaaaaaaaaaaa" + "aaaaaaaaaaaaa" + "aaaaaaaaaaaaa" + "aaaaaaaaaaaaa" + "aaaa....eaaaa" + "aaaa....eaaaa" + "aaaa....eaaaa" + "aaaaaaaaaaaaa" + "aaaaaaaaaaaaa" + "aaaaaaaaaaaaa" + "aaaaaaaaaaaaa" + "aaaaaaaaaaaaa" + + // Level 8 + "iaiaiaiaiaiai" + "a...........a" + "i...........i" + "a...........a" + "i...........i" + "a............" + "i............" + "a............" + "i...........i" + "a...........a" + "i...........i" + "a...........a" + "iaiaiaiaiaiai", + + // Connections: + "1: 0, 1, 6: 4\n" /* Type 1, BLOCK_FACE_XM */ + "1: 12, 1, 6: 5\n" /* Type 1, BLOCK_FACE_XP */ + "1: 12, 7, 6: 5\n" /* Type 1, BLOCK_FACE_XP */, + + // AllowedRotations: + 7, /* 1, 2, 3 CCW rotations */ + + // Merge strategy: + cBlockArea::msSpongePrint, + }, // MidStaircase + + + // StairsToOpen1: + // The data has been exported from gallery Nether, area index 27, ID 277 + { + // Size: + 7, 10, 7, // SizeX = 7, SizeY = 10, SizeZ = 7 + + // Block definitions: + ".: 0: 0\n" /* air */ + "a:112: 0\n" /* netherbrick */ + "b:113: 0\n" /* netherbrickfence */ + "m: 19: 0\n" /* sponge */, + + // Block data: + // Level 1 + "aaaaaaa" + "aaaaaaa" + "aaaaaaa" + "aaaaaaa" + "aaaaaaa" + "aaaaaaa" + "aaaaaaa" + + // Level 2 + "aa...aa" + "a.....a" + "a.....a" + "a.....a" + "a.....a" + "aaaaaaa" + "aaaaaaa" + + // Level 3 + "aa...aa" + "a.....a" + "b.....b" + "a.....a" + "b.....b" + "a.aaaaa" + "aabaaba" + + // Level 4 + "aa...aa" + "a.....a" + "b.....b" + "a.....a" + "b.....b" + "a..aaaa" + "aabaaba" + + // Level 5 + "aabbbaa" + "a.....a" + "b.....b" + "a.....a" + "b.....b" + "a...aaa" + "aabaaba" + + // Level 6 + "aaaaaaa" + "a.....a" + "a.....a" + "a.....a" + "a.....a" + "a....aa" + "aaaaaaa" + + // Level 7 + "aaaaaaa" + "aaaaaaa" + "aaaaaaa" + "aaaaaaa" + "aaaaaaa" + "a.....a" + "aaaaaaa" + + // Level 8 + "aaaaaaa" + "a.....a" + "a......" + "a......" + "a......" + "a.....a" + "aaaaaaa" + + // Level 9 + "mmmmmmm" + "m.....m" + "m......" + "m......" + "m......" + "m.....m" + "mmmmmmm" + + // Level 10 + "mmmmmmm" + "m.....m" + "m......" + "m......" + "m......" + "m.....m" + "mmmmmmm", + + // Connections: + "0: 3, 1, 0: 2\n" /* Type 0, BLOCK_FACE_ZM */ + "0: 6, 7, 3: 5\n" /* Type 0, BLOCK_FACE_XP */, + + // AllowedRotations: + 7, /* 1, 2, 3 CCW rotations */ + + // Merge strategy: + cBlockArea::msSpongePrint, + }, // StairsToOpen1 + + + // StairsToOpen2: + // The data has been exported from gallery Nether, area index 8, ID 35 + { + // Size: + 7, 10, 7, // SizeX = 7, SizeY = 10, SizeZ = 7 + + // Block definitions: + ".: 0: 0\n" /* air */ + "a:112: 0\n" /* netherbrick */ + "b:113: 0\n" /* netherbrickfence */ + "m: 19: 0\n" /* sponge */, + + // Block data: + // Level 1 + "aaaaaaa" + "aaaaaaa" + "aaaaaaa" + "aaaaaaa" + "aaaaaaa" + "aaaaaaa" + "aaaaaaa" + + // Level 2 + "aa...aa" + "a.....a" + "a.....a" + "a.....a" + "a.....a" + "aaaaaaa" + "aaaaaaa" + + // Level 3 + "aa...aa" + "a.....a" + "b.....b" + "a.....a" + "b.....b" + "a.aaaaa" + "aabaaba" + + // Level 4 + "aa...aa" + "a.....a" + "b.....b" + "a.....a" + "b.....b" + "a..aaaa" + "aabaaba" + + // Level 5 + "aabbbaa" + "a.....a" + "b.....b" + "a.....a" + "b.....b" + "a...aaa" + "aabaaba" + + // Level 6 + "aaaaaaa" + "a.....a" + "a.....a" + "a.....a" + "a.....a" + "a....aa" + "aaaaaaa" + + // Level 7 + "aaaaaaa" + "aaaaaaa" + "aaaaaaa" + "aaaaaaa" + "aaaaaaa" + "a.....a" + "aaaaaaa" + + // Level 8 + "aaaaaaa" + "a.....a" + "......a" + "......a" + "......a" + "a.....a" + "aaaaaaa" + + // Level 9 + "mmmmmmm" + "m.....m" + "......m" + "......m" + "......m" + "m.....m" + "mmmmmmm" + + // Level 10 + "mmmmmmm" + "m.....m" + "......m" + "......m" + "......m" + "m.....m" + "mmmmmmm", + + // Connections: + "0: 3, 1, 0: 2\n" /* Type 0, BLOCK_FACE_ZM */ + "0: 0, 7, 3: 4\n" /* Type 0, BLOCK_FACE_XM */, + + // AllowedRotations: + 7, /* 1, 2, 3 CCW rotations */ + + // Merge strategy: + cBlockArea::msSpongePrint, + }, // StairsToOpen2 + + + // Tee2x4: + // The data has been exported from gallery Nether, area index 40, ID 291 + { + // Size: + 13, 6, 7, // SizeX = 13, SizeY = 6, SizeZ = 7 + + // Block definitions: + ".: 0: 0\n" /* air */ + "a:112: 0\n" /* netherbrick */ + "b:113: 0\n" /* netherbrickfence */ + "c:114: 0\n" /* netherbrickstairs */ + "d:114: 1\n" /* netherbrickstairs */ + "e:114: 2\n" /* netherbrickstairs */ + "f:114: 3\n" /* netherbrickstairs */ + "m: 19: 0\n" /* sponge */, + + // Block data: + // Level 1 + "mmmmaaaaammmm" + "mmmmaaaaammmm" + "aaaaaaaaaaaaa" + "aaaaaaaaaaaaa" + "aaaaaaaaaaaaa" + "aaaaaaaaaaaaa" + "aaaaaaaaaaaaa" + + // Level 2 + "mmmma...ammmm" + "mmmma...ammmm" + "aaaaa...aaaaa" + "............." + "............." + "............." + "aaaaaaaaaaaaa" + + // Level 3 + "mmmma...ammmm" + "mmmmb...bmmmm" + "ababa...ababa" + "............." + "............." + "............." + "ababababababa" + + // Level 4 + "mmmma...ammmm" + "mmmmb...bmmmm" + "ababa...ababa" + "............." + "............." + "............." + "ababababababa" + + // Level 5 + "mmmma...ammmm" + "mmmmb...bmmmm" + "ababa...ababa" + "............." + "............." + "............." + "ababababababa" + + // Level 6 + "mmmmcaaadmmmm" + "mmmmcaaadmmmm" + "eeeecaaadeeee" + "aaaaaaaaaaaaa" + "aaaaaaaaaaaaa" + "aaaaaaaaaaaaa" + "fffffffffffff", + + // Connections: + "1: 0, 1, 4: 4\n" /* Type 1, BLOCK_FACE_XM */ + "1: 6, 1, 0: 2\n" /* Type 1, BLOCK_FACE_ZM */ + "1: 12, 1, 4: 5\n" /* Type 1, BLOCK_FACE_XP */, + + // AllowedRotations: + 7, /* 1, 2, 3 CCW rotations */ + + // Merge strategy: + cBlockArea::msSpongePrint, + }, // Tee2x4 + + + // Tee4x4: + // The data has been exported from gallery Nether, area index 41, ID 292 + { + // Size: + 13, 6, 9, // SizeX = 13, SizeY = 6, SizeZ = 9 + + // Block definitions: + ".: 0: 0\n" /* air */ + "a:112: 0\n" /* netherbrick */ + "b:113: 0\n" /* netherbrickfence */ + "c:114: 0\n" /* netherbrickstairs */ + "d:114: 1\n" /* netherbrickstairs */ + "e:114: 2\n" /* netherbrickstairs */ + "f:114: 3\n" /* netherbrickstairs */ + "m: 19: 0\n" /* sponge */, + + // Block data: + // Level 1 + "mmmmaaaaammmm" + "mmmmaaaaammmm" + "mmmmaaaaammmm" + "mmmmaaaaammmm" + "aaaaaaaaaaaaa" + "aaaaaaaaaaaaa" + "aaaaaaaaaaaaa" + "aaaaaaaaaaaaa" + "aaaaaaaaaaaaa" + + // Level 2 + "mmmma...ammmm" + "mmmma...ammmm" + "mmmma...ammmm" + "mmmma...ammmm" + "aaaaa...aaaaa" + "............." + "............." + "............." + "aaaaaaaaaaaaa" + + // Level 3 + "mmmma...ammmm" + "mmmmb...bmmmm" + "mmmma...ammmm" + "mmmmb...bmmmm" + "ababa...ababa" + "............." + "............." + "............." + "ababababababa" + + // Level 4 + "mmmma...ammmm" + "mmmmb...bmmmm" + "mmmma...ammmm" + "mmmmb...bmmmm" + "ababa...ababa" + "............." + "............." + "............." + "ababababababa" + + // Level 5 + "mmmma...ammmm" + "mmmmb...bmmmm" + "mmmma...ammmm" + "mmmmb...bmmmm" + "ababa...ababa" + "............." + "............." + "............." + "ababababababa" + + // Level 6 + "mmmmcaaadmmmm" + "mmmmcaaadmmmm" + "mmmmcaaadmmmm" + "mmmmcaaadmmmm" + "eeeecaaadeeee" + "aaaaaaaaaaaaa" + "aaaaaaaaaaaaa" + "aaaaaaaaaaaaa" + "fffffffffffff", + + // Connections: + "1: 0, 1, 6: 4\n" /* Type 1, BLOCK_FACE_XM */ + "1: 12, 1, 6: 5\n" /* Type 1, BLOCK_FACE_XP */ + "1: 6, 1, 0: 2\n" /* Type 1, BLOCK_FACE_ZM */, + + // AllowedRotations: + 7, /* 1, 2, 3 CCW rotations */ + + // Merge strategy: + cBlockArea::msSpongePrint, + }, // Tee4x4 + + // Turret: + // The data has been exported from gallery Nether, area index 7, ID 34 + { + // Size: + 7, 6, 7, // SizeX = 7, SizeY = 6, SizeZ = 7 + + // Block definitions: + ".: 0: 0\n" /* air */ + "a:112: 0\n" /* netherbrick */ + "b:113: 0\n" /* netherbrickfence */, + + // Block data: + // Level 1 + "aaaaaaa" + "aaaaaaa" + "aaaaaaa" + "aaaaaaa" + "aaaaaaa" + "aaaaaaa" + "aaaaaaa" + + // Level 2 + "aa...aa" + "a.....a" + "......." + "......." + "......." + "a.....a" + "aa...aa" + + // Level 3 + "aa...aa" + "a.....a" + "......." + "......." + "......." + "a.....a" + "aa...aa" + + // Level 4 + "aa...aa" + "a.....a" + "......." + "......." + "......." + "a.....a" + "aa...aa" + + // Level 5 + "aabbbaa" + "a.....a" + "b.....b" + "b.....b" + "b.....b" + "a.....a" + "aabbbaa" + + // Level 6 + "aaaaaaa" + "a.....a" + "a.....a" + "a.....a" + "a.....a" + "a.....a" + "aaaaaaa", + + // Connections: + "0: 0, 1, 3: 4\n" /* Type 0, BLOCK_FACE_XM */ + "0: 3, 1, 0: 2\n" /* Type 0, BLOCK_FACE_ZM */ + "0: 6, 1, 3: 5\n" /* Type 0, BLOCK_FACE_XP */ + "0: 3, 1, 6: 3\n" /* Type 0, BLOCK_FACE_ZP */, + + // AllowedRotations: + 7, /* 1, 2, 3 CCW rotations */ + + // Merge strategy: + cBlockArea::msSpongePrint, + }, // Turret + +} ; // g_NetherFortPrefabs1 + + + + + +const cPrefab::sDef g_NetherFortStartingPrefabs1[] = +{ + /////////////////////////////////////////////////////////////////////////////////////////////////////////////////////// + // CentralRoom: + // The data has been exported from gallery Nether, area index 22, ID 164 + { + // Size: + 13, 9, 13, // SizeX = 13, SizeY = 9, SizeZ = 13 + + // Block definitions: + "a:112: 0\n" /* netherbrick */ + "b: 0: 0\n" /* air */ + "c: 10: 0\n" /* lava */ + "d:113: 0\n" /* netherbrickfence */, + + // Block data: + // Level 1 + "aaaaaaaaaaaaa" + "aaaaaaaaaaaaa" + "aaaaaaaaaaaaa" + "aaaaaaaaaaaaa" + "aaaaaaaaaaaaa" + "aaaaaaaaaaaaa" + "aaaaaaaaaaaaa" + "aaaaaaaaaaaaa" + "aaaaaaaaaaaaa" + "aaaaaaaaaaaaa" + "aaaaaaaaaaaaa" + "aaaaaaaaaaaaa" + "aaaaaaaaaaaaa" + + // Level 2 + "aaaaabbbaaaaa" + "aaaaabbbaaaaa" + "aabbbbbbbbbaa" + "aabbbbbbbbbaa" + "aabbbbbbbbbaa" + "aabbbaaabbbaa" + "aabbbacabbbaa" + "aabbbaaabbbaa" + "aabbbbbbbbbaa" + "aabbbbbbbbbaa" + "aabbbbbbbbbaa" + "aaaaabbbaaaaa" + "aaaaabbbaaaaa" + + // Level 3 + "aaaaabbbaaaaa" + "aaadabbbadaaa" + "aabbbbbbbbbaa" + "adbbbbbbbbbda" + "aabbbbbbbbbaa" + "adbbbbbbbbbda" + "aabbbbbbbbbaa" + "adbbbbbbbbbda" + "aabbbbbbbbbaa" + "adbbbbbbbbbda" + "aabbbbbbbbbaa" + "aaadabbbadaaa" + "aaaaabbbaaaaa" + + // Level 4 + "aaaaabbbaaaaa" + "aaadabbbadaaa" + "aabbbbbbbbbaa" + "adbbbbbbbbbda" + "aabbbbbbbbbaa" + "adbbbbbbbbbda" + "aabbbbbbbbbaa" + "adbbbbbbbbbda" + "aabbbbbbbbbaa" + "adbbbbbbbbbda" + "aabbbbbbbbbaa" + "aaadabbbadaaa" + "aaaaabbbaaaaa" + + // Level 5 + "adadadddadada" + "daaaabbbaaaad" + "aabbbbbbbbbaa" + "dabbbbbbbbbad" + "aabbbbbbbbbaa" + "dabbbbbbbbbad" + "aabbbbbbbbbaa" + "dabbbbbbbbbad" + "aabbbbbbbbbaa" + "dabbbbbbbbbad" + "aabbbbbbbbbaa" + "daaaabbbaaaad" + "adadabbbadada" + + // Level 6 + "adadaaaaadada" + "daaaaaaaaaaad" + "aabbbbbbbbbaa" + "dabbbbbbbbbad" + "aabbbbbbbbbaa" + "dabbbbbbbbbad" + "aabbbbbbbbbaa" + "dabbbbbbbbbad" + "aabbbbbbbbbaa" + "dabbbbbbbbbad" + "aabbbbbbbbbaa" + "daaaaaaaaaaad" + "adadaaaaadada" + + // Level 7 + "aaaaaaaaaaaaa" + "aaaaaaaaaaaaa" + "aaaaaaaaaaaaa" + "aaaaaaaaaaaaa" + "aaaaaaaaaaaaa" + "aaaaaaaaaaaaa" + "aaaaaaaaaaaaa" + "aaaaaaaaaaaaa" + "aaaaaaaaaaaaa" + "aaaaaaaaaaaaa" + "aaaaaaaaaaaaa" + "aaaaaaaaaaaaa" + "aaaaaaaaaaaaa" + + // Level 8 + "aaaaaaaaaaaaa" + "aaaaaaaaaaaaa" + "aaaaaaaaaaaaa" + "aaaaaaaaaaaaa" + "aaaaaaaaaaaaa" + "aaaaaaaaaaaaa" + "aaaaaaaaaaaaa" + "aaaaaaaaaaaaa" + "aaaaaaaaaaaaa" + "aaaaaaaaaaaaa" + "aaaaaaaaaaaaa" + "aaaaaaaaaaaaa" + "aaaaaaaaaaaaa" + + // Level 9 + "dadadadadadad" + "abbbbbbbbbbba" + "dbbbbbbbbbbbd" + "abbbbbbbbbbba" + "dbbbbbbbbbbbd" + "abbbbbbbbbbba" + "dbbbbbbbbbbbd" + "abbbbbbbbbbba" + "dbbbbbbbbbbbd" + "abbbbbbbbbbba" + "dbbbbbbbbbbbd" + "abbbbbbbbbbba" + "dadadadadadad", + + // Connections: + "0: 6, 1, 0: 2\n" /* Type 0, BLOCK_FACE_ZM */ + "1: 6, 1, 12: 3\n" /* Type 1, BLOCK_FACE_ZP */, + + // AllowedRotations: + 7, /* 1, 2, 3 CCW rotations */ + + // Merge strategy: + cBlockArea::msSpongePrint, + }, +} ; // g_NetherFortStartingPrefabs1 + +const size_t g_NetherFortPrefabs1Count = ARRAYCOUNT(g_NetherFortPrefabs1); +const size_t g_NetherFortStartingPrefabs1Count = ARRAYCOUNT(g_NetherFortStartingPrefabs1); + + + + diff --git a/src/Generating/Prefabs/NetherFortPrefabs.h b/src/Generating/Prefabs/NetherFortPrefabs.h new file mode 100644 index 000000000..37a91689d --- /dev/null +++ b/src/Generating/Prefabs/NetherFortPrefabs.h @@ -0,0 +1,15 @@ + +// NetherFortPrefabs.h + +// Declares the data used for nether fortress prefabs + +#include "../Prefab.h" + + + + + +extern const cPrefab::sDef g_NetherFortPrefabs1[]; +extern const cPrefab::sDef g_NetherFortStartingPrefabs1[]; +extern const size_t g_NetherFortPrefabs1Count; +extern const size_t g_NetherFortStartingPrefabs1Count; diff --git a/src/Globals.h b/src/Globals.h index 3e62832b7..26a0d87a9 100644 --- a/src/Globals.h +++ b/src/Globals.h @@ -29,6 +29,9 @@ // Disabling this warning, because we know what we're doing when we're doing this: #pragma warning(disable: 4355) // 'this' used in initializer list + + // Disabled because it's useless: + #pragma warning(disable: 4512) // 'class': assignment operator could not be generated - reported for each class that has a reference-type member // 2014_01_06 xoft: Disabled this warning because MSVC is stupid and reports it in obviously wrong places // #pragma warning(3 : 4244) // Conversion from 'type1' to 'type2', possible loss of data @@ -264,11 +267,17 @@ template class SizeChecker<UInt16, 2>; #define assert_test(x) ( !!(x) || (assert(!#x), exit(1), 0)) #endif -/// A generic interface used mainly in ForEach() functions + + + + +/** A generic interface used mainly in ForEach() functions */ template <typename Type> class cItemCallback { public: - /// Called for each item in the internal list; return true to stop the loop, or false to continue enumerating + virtual ~cItemCallback() {} + + /** Called for each item in the internal list; return true to stop the loop, or false to continue enumerating */ virtual bool Item(Type * a_Type) = 0; } ; diff --git a/src/Group.cpp b/src/Group.cpp index 5f1f25782..9c2467144 100644 --- a/src/Group.cpp +++ b/src/Group.cpp @@ -38,4 +38,4 @@ void cGroup::InheritFrom( cGroup* a_Group ) void cGroup::ClearPermission() { m_Permissions.clear(); -}
\ No newline at end of file +} diff --git a/src/HTTPServer/EnvelopeParser.cpp b/src/HTTPServer/EnvelopeParser.cpp index 8dbe05f14..fd4f3836d 100644 --- a/src/HTTPServer/EnvelopeParser.cpp +++ b/src/HTTPServer/EnvelopeParser.cpp @@ -20,7 +20,7 @@ cEnvelopeParser::cEnvelopeParser(cCallbacks & a_Callbacks) : -int cEnvelopeParser::Parse(const char * a_Data, int a_Size) +size_t cEnvelopeParser::Parse(const char * a_Data, size_t a_Size) { if (!m_IsInHeaders) { @@ -55,7 +55,7 @@ int cEnvelopeParser::Parse(const char * a_Data, int a_Size) { // An error has occurred m_IsInHeaders = false; - return -1; + return AString::npos; } Last = idxCRLF + 2; idxCRLF = m_IncomingData.find("\r\n", idxCRLF + 2); diff --git a/src/HTTPServer/EnvelopeParser.h b/src/HTTPServer/EnvelopeParser.h index 6430fbebf..e96d80abe 100644 --- a/src/HTTPServer/EnvelopeParser.h +++ b/src/HTTPServer/EnvelopeParser.h @@ -19,7 +19,10 @@ public: class cCallbacks { public: - /// Called when a full header line is parsed + // Force a virtual destructor in descendants: + virtual ~cCallbacks() {} + + /** Called when a full header line is parsed */ virtual void OnHeaderLine(const AString & a_Key, const AString & a_Value) = 0; } ; @@ -27,40 +30,41 @@ public: cEnvelopeParser(cCallbacks & a_Callbacks); /** Parses the incoming data. - Returns the number of bytes consumed from the input. The bytes not consumed are not part of the envelope header + Returns the number of bytes consumed from the input. The bytes not consumed are not part of the envelope header. + Returns AString::npos on error */ - int Parse(const char * a_Data, int a_Size); + size_t Parse(const char * a_Data, size_t a_Size); - /// Makes the parser forget everything parsed so far, so that it can be reused for parsing another datastream + /** Makes the parser forget everything parsed so far, so that it can be reused for parsing another datastream */ void Reset(void); - /// Returns true if more input is expected for the envelope header + /** Returns true if more input is expected for the envelope header */ bool IsInHeaders(void) const { return m_IsInHeaders; } - /// Sets the IsInHeaders flag; used by cMultipartParser to simplify the parser initial conditions + /** Sets the IsInHeaders flag; used by cMultipartParser to simplify the parser initial conditions */ void SetIsInHeaders(bool a_IsInHeaders) { m_IsInHeaders = a_IsInHeaders; } public: - /// Callbacks to call for the various events + /** Callbacks to call for the various events */ cCallbacks & m_Callbacks; - /// Set to true while the parser is still parsing the envelope headers. Once set to true, the parser will not consume any more data. + /** Set to true while the parser is still parsing the envelope headers. Once set to true, the parser will not consume any more data. */ bool m_IsInHeaders; - /// Buffer for the incoming data until it is parsed + /** Buffer for the incoming data until it is parsed */ AString m_IncomingData; - /// Holds the last parsed key; used for line-wrapped values + /** Holds the last parsed key; used for line-wrapped values */ AString m_LastKey; - /// Holds the last parsed value; used for line-wrapped values + /** Holds the last parsed value; used for line-wrapped values */ AString m_LastValue; - /// Notifies the callback of the key/value stored in m_LastKey/m_LastValue, then erases them + /** Notifies the callback of the key/value stored in m_LastKey/m_LastValue, then erases them */ void NotifyLast(void); - /// Parses one line of header data. Returns true if successful + /** Parses one line of header data. Returns true if successful */ bool ParseLine(const char * a_Data, size_t a_Size); } ; diff --git a/src/HTTPServer/HTTPConnection.cpp b/src/HTTPServer/HTTPConnection.cpp index 78b7ce4d9..44a3d3f88 100644 --- a/src/HTTPServer/HTTPConnection.cpp +++ b/src/HTTPServer/HTTPConnection.cpp @@ -67,10 +67,10 @@ void cHTTPConnection::Send(const cHTTPResponse & a_Response) -void cHTTPConnection::Send(const void * a_Data, int a_Size) +void cHTTPConnection::Send(const void * a_Data, size_t a_Size) { ASSERT(m_State == wcsSendingResp); - AppendPrintf(m_OutgoingData, "%x\r\n", a_Size); + AppendPrintf(m_OutgoingData, SIZE_T_FMT "\r\n", a_Size); m_OutgoingData.append((const char *)a_Data, a_Size); m_OutgoingData.append("\r\n"); m_HTTPServer.NotifyConnectionWrite(*this); @@ -144,7 +144,7 @@ void cHTTPConnection::Terminate(void) -void cHTTPConnection::DataReceived(const char * a_Data, int a_Size) +void cHTTPConnection::DataReceived(const char * a_Data, size_t a_Size) { switch (m_State) { @@ -155,8 +155,8 @@ void cHTTPConnection::DataReceived(const char * a_Data, int a_Size) m_CurrentRequest = new cHTTPRequest; } - int BytesConsumed = m_CurrentRequest->ParseHeaders(a_Data, a_Size); - if (BytesConsumed < 0) + size_t BytesConsumed = m_CurrentRequest->ParseHeaders(a_Data, a_Size); + if (BytesConsumed == AString::npos) { delete m_CurrentRequest; m_CurrentRequest = NULL; @@ -174,7 +174,7 @@ void cHTTPConnection::DataReceived(const char * a_Data, int a_Size) m_State = wcsRecvBody; m_HTTPServer.NewRequest(*this, *m_CurrentRequest); m_CurrentRequestBodyRemaining = m_CurrentRequest->GetContentLength(); - if (m_CurrentRequestBodyRemaining < 0) + if (m_CurrentRequestBodyRemaining == AString::npos) { // The body length was not specified in the request, assume zero m_CurrentRequestBodyRemaining = 0; @@ -197,7 +197,7 @@ void cHTTPConnection::DataReceived(const char * a_Data, int a_Size) ASSERT(m_CurrentRequest != NULL); if (m_CurrentRequestBodyRemaining > 0) { - int BytesToConsume = std::min(m_CurrentRequestBodyRemaining, a_Size); + size_t BytesToConsume = std::min(m_CurrentRequestBodyRemaining, (size_t)a_Size); m_HTTPServer.RequestBody(*this, *m_CurrentRequest, a_Data, BytesToConsume); m_CurrentRequestBodyRemaining -= BytesToConsume; } diff --git a/src/HTTPServer/HTTPConnection.h b/src/HTTPServer/HTTPConnection.h index 5b8103554..fc11f1ba6 100644 --- a/src/HTTPServer/HTTPConnection.h +++ b/src/HTTPServer/HTTPConnection.h @@ -51,7 +51,7 @@ public: void Send(const cHTTPResponse & a_Response); /** Sends the data as the response (may be called multiple times) */ - void Send(const void * a_Data, int a_Size); + void Send(const void * a_Data, size_t a_Size); /** Sends the data as the response (may be called multiple times) */ void Send(const AString & a_Data) { Send(a_Data.data(), a_Data.size()); } @@ -87,11 +87,11 @@ protected: /** Number of bytes that remain to read for the complete body of the message to be received. Valid only in wcsRecvBody */ - int m_CurrentRequestBodyRemaining; + size_t m_CurrentRequestBodyRemaining; // cSocketThreads::cCallback overrides: - virtual void DataReceived (const char * a_Data, int a_Size) override; // Data is received from the client + virtual void DataReceived (const char * a_Data, size_t a_Size) override; // Data is received from the client virtual void GetOutgoingData(AString & a_Data) override; // Data can be sent to client virtual void SocketClosed (void) override; // The socket has been closed for any reason } ; diff --git a/src/HTTPServer/HTTPFormParser.cpp b/src/HTTPServer/HTTPFormParser.cpp index e661ea6f9..9ddfb82f1 100644 --- a/src/HTTPServer/HTTPFormParser.cpp +++ b/src/HTTPServer/HTTPFormParser.cpp @@ -52,7 +52,7 @@ cHTTPFormParser::cHTTPFormParser(cHTTPRequest & a_Request, cCallbacks & a_Callba -cHTTPFormParser::cHTTPFormParser(eKind a_Kind, const char * a_Data, int a_Size, cCallbacks & a_Callbacks) : +cHTTPFormParser::cHTTPFormParser(eKind a_Kind, const char * a_Data, size_t a_Size, cCallbacks & a_Callbacks) : m_Callbacks(a_Callbacks), m_Kind(a_Kind), m_IsValid(true) @@ -64,7 +64,7 @@ cHTTPFormParser::cHTTPFormParser(eKind a_Kind, const char * a_Data, int a_Size, -void cHTTPFormParser::Parse(const char * a_Data, int a_Size) +void cHTTPFormParser::Parse(const char * a_Data, size_t a_Size) { if (!m_IsValid) { @@ -243,7 +243,7 @@ void cHTTPFormParser::OnPartHeader(const AString & a_Key, const AString & a_Valu -void cHTTPFormParser::OnPartData(const char * a_Data, int a_Size) +void cHTTPFormParser::OnPartData(const char * a_Data, size_t a_Size) { if (m_CurrentPartName.empty()) { diff --git a/src/HTTPServer/HTTPFormParser.h b/src/HTTPServer/HTTPFormParser.h index a554ca5a4..edc6d2471 100644 --- a/src/HTTPServer/HTTPFormParser.h +++ b/src/HTTPServer/HTTPFormParser.h @@ -36,11 +36,14 @@ public: class cCallbacks { public: + // Force a virtual destructor in descendants: + virtual ~cCallbacks() {} + /// Called when a new file part is encountered in the form data virtual void OnFileStart(cHTTPFormParser & a_Parser, const AString & a_FileName) = 0; /// Called when more file data has come for the current file in the form data - virtual void OnFileData(cHTTPFormParser & a_Parser, const char * a_Data, int a_Size) = 0; + virtual void OnFileData(cHTTPFormParser & a_Parser, const char * a_Data, size_t a_Size) = 0; /// Called when the current file part has ended in the form data virtual void OnFileEnd(cHTTPFormParser & a_Parser) = 0; @@ -51,10 +54,10 @@ public: cHTTPFormParser(cHTTPRequest & a_Request, cCallbacks & a_Callbacks); /// Creates a parser with the specified content type that reads data from a string - cHTTPFormParser(eKind a_Kind, const char * a_Data, int a_Size, cCallbacks & a_Callbacks); + cHTTPFormParser(eKind a_Kind, const char * a_Data, size_t a_Size, cCallbacks & a_Callbacks); /// Adds more data into the parser, as the request body is received - void Parse(const char * a_Data, int a_Size); + void Parse(const char * a_Data, size_t a_Size); /** Notifies that there's no more data incoming and the parser should finish its parsing. Returns true if parsing successful @@ -103,7 +106,7 @@ protected: // cMultipartParser::cCallbacks overrides: virtual void OnPartStart (void) override; virtual void OnPartHeader(const AString & a_Key, const AString & a_Value) override; - virtual void OnPartData (const char * a_Data, int a_Size) override; + virtual void OnPartData (const char * a_Data, size_t a_Size) override; virtual void OnPartEnd (void) override; } ; diff --git a/src/HTTPServer/HTTPMessage.cpp b/src/HTTPServer/HTTPMessage.cpp index 98627eb8e..4a3611050 100644 --- a/src/HTTPServer/HTTPMessage.cpp +++ b/src/HTTPServer/HTTPMessage.cpp @@ -25,7 +25,7 @@ cHTTPMessage::cHTTPMessage(eKind a_Kind) : m_Kind(a_Kind), - m_ContentLength(-1) + m_ContentLength(AString::npos) { } @@ -81,23 +81,23 @@ cHTTPRequest::cHTTPRequest(void) : -int cHTTPRequest::ParseHeaders(const char * a_Data, int a_Size) +size_t cHTTPRequest::ParseHeaders(const char * a_Data, size_t a_Size) { if (!m_IsValid) { - return -1; + return AString::npos; } if (m_Method.empty()) { // The first line hasn't been processed yet - int res = ParseRequestLine(a_Data, a_Size); - if ((res < 0) || (res == a_Size)) + size_t res = ParseRequestLine(a_Data, a_Size); + if ((res == AString::npos) || (res == a_Size)) { return res; } - int res2 = m_EnvelopeParser.Parse(a_Data + res, a_Size - res); - if (res2 < 0) + size_t res2 = m_EnvelopeParser.Parse(a_Data + res, a_Size - res); + if (res2 == AString::npos) { m_IsValid = false; return res2; @@ -107,8 +107,8 @@ int cHTTPRequest::ParseHeaders(const char * a_Data, int a_Size) if (m_EnvelopeParser.IsInHeaders()) { - int res = m_EnvelopeParser.Parse(a_Data, a_Size); - if (res < 0) + size_t res = m_EnvelopeParser.Parse(a_Data, a_Size); + if (res == AString::npos) { m_IsValid = false; } @@ -138,7 +138,7 @@ AString cHTTPRequest::GetBareURL(void) const -int cHTTPRequest::ParseRequestLine(const char * a_Data, int a_Size) +size_t cHTTPRequest::ParseRequestLine(const char * a_Data, size_t a_Size) { m_IncomingHeaderData.append(a_Data, a_Size); size_t IdxEnd = m_IncomingHeaderData.size(); @@ -158,7 +158,7 @@ int cHTTPRequest::ParseRequestLine(const char * a_Data, int a_Size) if (LineStart >= IdxEnd) { m_IsValid = false; - return -1; + return AString::npos; } int NumSpaces = 0; @@ -186,7 +186,7 @@ int cHTTPRequest::ParseRequestLine(const char * a_Data, int a_Size) { // Too many spaces in the request m_IsValid = false; - return -1; + return AString::npos; } } NumSpaces += 1; @@ -198,13 +198,13 @@ int cHTTPRequest::ParseRequestLine(const char * a_Data, int a_Size) { // LF too early, without a CR, without two preceeding spaces or too soon after the second space m_IsValid = false; - return -1; + return AString::npos; } // Check that there's HTTP/version at the end if (strncmp(a_Data + URLEnd + 1, "HTTP/1.", 7) != 0) { m_IsValid = false; - return -1; + return AString::npos; } m_Method = m_IncomingHeaderData.substr(LineStart, MethodEnd - LineStart); m_URL = m_IncomingHeaderData.substr(MethodEnd + 1, URLEnd - MethodEnd - 1); diff --git a/src/HTTPServer/HTTPMessage.h b/src/HTTPServer/HTTPMessage.h index ab3338db7..dab942136 100644 --- a/src/HTTPServer/HTTPMessage.h +++ b/src/HTTPServer/HTTPMessage.h @@ -39,10 +39,10 @@ public: void AddHeader(const AString & a_Key, const AString & a_Value); void SetContentType (const AString & a_ContentType) { m_ContentType = a_ContentType; } - void SetContentLength(int a_ContentLength) { m_ContentLength = a_ContentLength; } + void SetContentLength(size_t a_ContentLength) { m_ContentLength = a_ContentLength; } const AString & GetContentType (void) const { return m_ContentType; } - int GetContentLength(void) const { return m_ContentLength; } + size_t GetContentLength(void) const { return m_ContentLength; } protected: typedef std::map<AString, AString> cNameValueMap; @@ -54,8 +54,10 @@ protected: /** Type of the content; parsed by AddHeader(), set directly by SetContentLength() */ AString m_ContentType; - /** Length of the content that is to be received. -1 when the object is created, parsed by AddHeader() or set directly by SetContentLength() */ - int m_ContentLength; + /** Length of the content that is to be received. + AString::npos when the object is created. + Parsed by AddHeader() or set directly by SetContentLength() */ + size_t m_ContentLength; } ; @@ -72,12 +74,12 @@ public: cHTTPRequest(void); /** Parses the request line and then headers from the received data. - Returns the number of bytes consumed or a negative number for error + Returns the number of bytes consumed or AString::npos number for error */ - int ParseHeaders(const char * a_Data, int a_Size); + size_t ParseHeaders(const char * a_Data, size_t a_Size); /** Returns true if the request did contain a Content-Length header */ - bool HasReceivedContentLength(void) const { return (m_ContentLength >= 0); } + bool HasReceivedContentLength(void) const { return (m_ContentLength != AString::npos); } /** Returns the method used in the request */ const AString & GetMethod(void) const { return m_Method; } @@ -145,7 +147,7 @@ protected: /** Parses the incoming data for the first line (RequestLine) Returns the number of bytes consumed, or -1 for an error */ - int ParseRequestLine(const char * a_Data, int a_Size); + size_t ParseRequestLine(const char * a_Data, size_t a_Size); // cEnvelopeParser::cCallbacks overrides: virtual void OnHeaderLine(const AString & a_Key, const AString & a_Value) override; diff --git a/src/HTTPServer/HTTPServer.cpp b/src/HTTPServer/HTTPServer.cpp index 4e9195a00..eaf8405a3 100644 --- a/src/HTTPServer/HTTPServer.cpp +++ b/src/HTTPServer/HTTPServer.cpp @@ -38,7 +38,7 @@ class cDebugCallbacks : } - virtual void OnRequestBody(cHTTPConnection & a_Connection, cHTTPRequest & a_Request, const char * a_Data, int a_Size) override + virtual void OnRequestBody(cHTTPConnection & a_Connection, cHTTPRequest & a_Request, const char * a_Data, size_t a_Size) override { UNUSED(a_Connection); @@ -100,7 +100,7 @@ class cDebugCallbacks : } - virtual void OnFileData(cHTTPFormParser & a_Parser, const char * a_Data, int a_Size) override + virtual void OnFileData(cHTTPFormParser & a_Parser, const char * a_Data, size_t a_Size) override { // TODO } @@ -242,7 +242,7 @@ void cHTTPServer::NewRequest(cHTTPConnection & a_Connection, cHTTPRequest & a_Re -void cHTTPServer::RequestBody(cHTTPConnection & a_Connection, cHTTPRequest & a_Request, const char * a_Data, int a_Size) +void cHTTPServer::RequestBody(cHTTPConnection & a_Connection, cHTTPRequest & a_Request, const char * a_Data, size_t a_Size) { m_Callbacks->OnRequestBody(a_Connection, a_Request, a_Data, a_Size); } diff --git a/src/HTTPServer/HTTPServer.h b/src/HTTPServer/HTTPServer.h index 24baf8c95..8eff7d879 100644 --- a/src/HTTPServer/HTTPServer.h +++ b/src/HTTPServer/HTTPServer.h @@ -37,20 +37,23 @@ public: class cCallbacks { public: + virtual ~cCallbacks() {} + /** Called when a new request arrives over a connection and its headers have been parsed. The request body needn't have arrived yet. */ virtual void OnRequestBegun(cHTTPConnection & a_Connection, cHTTPRequest & a_Request) = 0; - /// Called when another part of request body has arrived. - virtual void OnRequestBody(cHTTPConnection & a_Connection, cHTTPRequest & a_Request, const char * a_Data, int a_Size) = 0; + /** Called when another part of request body has arrived. + May be called multiple times for a single request. */ + virtual void OnRequestBody(cHTTPConnection & a_Connection, cHTTPRequest & a_Request, const char * a_Data, size_t a_Size) = 0; /// Called when the request body has been fully received in previous calls to OnRequestBody() virtual void OnRequestFinished(cHTTPConnection & a_Connection, cHTTPRequest & a_Request) = 0; } ; cHTTPServer(void); - ~cHTTPServer(); + virtual ~cHTTPServer(); /// Initializes the server on the specified ports bool Initialize(const AString & a_PortsIPv4, const AString & a_PortsIPv6); @@ -88,8 +91,9 @@ protected: /// Called by cHTTPConnection when it finishes parsing the request header void NewRequest(cHTTPConnection & a_Connection, cHTTPRequest & a_Request); - /// Called by cHTTPConenction when it receives more data for the request body - void RequestBody(cHTTPConnection & a_Connection, cHTTPRequest & a_Request, const char * a_Data, int a_Size); + /** Called by cHTTPConenction when it receives more data for the request body. + May be called multiple times for a single request. */ + void RequestBody(cHTTPConnection & a_Connection, cHTTPRequest & a_Request, const char * a_Data, size_t a_Size); /// Called by cHTTPConnection when it detects that the request has finished (all of its body has been received) void RequestFinished(cHTTPConnection & a_Connection, cHTTPRequest & a_Request); diff --git a/src/HTTPServer/MultipartParser.cpp b/src/HTTPServer/MultipartParser.cpp index 14c2c00fa..309495dd7 100644 --- a/src/HTTPServer/MultipartParser.cpp +++ b/src/HTTPServer/MultipartParser.cpp @@ -97,8 +97,6 @@ cMultipartParser::cMultipartParser(const AString & a_ContentType, cCallbacks & a m_EnvelopeParser(*this), m_HasHadData(false) { - static AString s_Multipart = "multipart/"; - // Check that the content type is multipart: AString ContentType(a_ContentType); if (strncmp(ContentType.c_str(), "multipart/", 10) != 0) @@ -146,7 +144,7 @@ cMultipartParser::cMultipartParser(const AString & a_ContentType, cCallbacks & a -void cMultipartParser::Parse(const char * a_Data, int a_Size) +void cMultipartParser::Parse(const char * a_Data, size_t a_Size) { // Skip parsing if invalid if (!m_IsValid) @@ -160,8 +158,8 @@ void cMultipartParser::Parse(const char * a_Data, int a_Size) { if (m_EnvelopeParser.IsInHeaders()) { - int BytesConsumed = m_EnvelopeParser.Parse(m_IncomingData.data(), m_IncomingData.size()); - if (BytesConsumed < 0) + size_t BytesConsumed = m_EnvelopeParser.Parse(m_IncomingData.data(), m_IncomingData.size()); + if (BytesConsumed == AString::npos) { m_IsValid = false; return; diff --git a/src/HTTPServer/MultipartParser.h b/src/HTTPServer/MultipartParser.h index d853929ed..ad76ad650 100644 --- a/src/HTTPServer/MultipartParser.h +++ b/src/HTTPServer/MultipartParser.h @@ -22,50 +22,53 @@ public: class cCallbacks { public: - /// Called when a new part starts + // Force a virtual destructor in descendants: + virtual ~cCallbacks() {} + + /** Called when a new part starts */ virtual void OnPartStart(void) = 0; - /// Called when a complete header line is received for a part + /** Called when a complete header line is received for a part */ virtual void OnPartHeader(const AString & a_Key, const AString & a_Value) = 0; - /// Called when body for a part is received - virtual void OnPartData(const char * a_Data, int a_Size) = 0; + /** Called when body for a part is received */ + virtual void OnPartData(const char * a_Data, size_t a_Size) = 0; - /// Called when the current part ends + /** Called when the current part ends */ virtual void OnPartEnd(void) = 0; } ; - /// Creates the parser, expects to find the boundary in a_ContentType + /** Creates the parser, expects to find the boundary in a_ContentType */ cMultipartParser(const AString & a_ContentType, cCallbacks & a_Callbacks); - /// Parses more incoming data - void Parse(const char * a_Data, int a_Size); + /** Parses more incoming data */ + void Parse(const char * a_Data, size_t a_Size); protected: - /// The callbacks to call for various parsing events + /** The callbacks to call for various parsing events */ cCallbacks & m_Callbacks; - /// True if the data parsed so far is valid; if false, further parsing is skipped + /** True if the data parsed so far is valid; if false, further parsing is skipped */ bool m_IsValid; - /// Parser for each part's envelope + /** Parser for each part's envelope */ cEnvelopeParser m_EnvelopeParser; - /// Buffer for the incoming data until it is parsed + /** Buffer for the incoming data until it is parsed */ AString m_IncomingData; - /// The boundary, excluding both the initial "--" and the terminating CRLF + /** The boundary, excluding both the initial "--" and the terminating CRLF */ AString m_Boundary; - /// Set to true if some data for the current part has already been signalized to m_Callbacks. Used for proper CRLF inserting. + /** Set to true if some data for the current part has already been signalized to m_Callbacks. Used for proper CRLF inserting. */ bool m_HasHadData; - /// Parse one line of incoming data. The CRLF has already been stripped from a_Data / a_Size - void ParseLine(const char * a_Data, int a_Size); + /** Parse one line of incoming data. The CRLF has already been stripped from a_Data / a_Size */ + void ParseLine(const char * a_Data, size_t a_Size); - /// Parse one line of incoming data in the headers section of a part. The CRLF has already been stripped from a_Data / a_Size - void ParseHeaderLine(const char * a_Data, int a_Size); + /** Parse one line of incoming data in the headers section of a part. The CRLF has already been stripped from a_Data / a_Size */ + void ParseHeaderLine(const char * a_Data, size_t a_Size); // cEnvelopeParser overrides: virtual void OnHeaderLine(const AString & a_Key, const AString & a_Value) override; diff --git a/src/HTTPServer/NameValueParser.cpp b/src/HTTPServer/NameValueParser.cpp index 9ea8594ae..3f6c17dda 100644 --- a/src/HTTPServer/NameValueParser.cpp +++ b/src/HTTPServer/NameValueParser.cpp @@ -24,7 +24,7 @@ public: // Now try parsing char-by-char, to debug transitions across datachunk boundaries: cNameValueParser Parser2; - for (int i = 0; i < sizeof(Data) - 1; i++) + for (size_t i = 0; i < sizeof(Data) - 1; i++) { Parser2.Parse(Data + i, 1); } @@ -82,7 +82,7 @@ cNameValueParser::cNameValueParser(bool a_AllowsKeyOnly) : -cNameValueParser::cNameValueParser(const char * a_Data, int a_Size, bool a_AllowsKeyOnly) : +cNameValueParser::cNameValueParser(const char * a_Data, size_t a_Size, bool a_AllowsKeyOnly) : m_State(psKeySpace), m_AllowsKeyOnly(a_AllowsKeyOnly) { @@ -93,12 +93,12 @@ cNameValueParser::cNameValueParser(const char * a_Data, int a_Size, bool a_Allow -void cNameValueParser::Parse(const char * a_Data, int a_Size) +void cNameValueParser::Parse(const char * a_Data, size_t a_Size) { ASSERT(m_State != psFinished); // Calling Parse() after Finish() is wrong! int Last = 0; - for (int i = 0; i < a_Size;) + for (size_t i = 0; i < a_Size;) { switch (m_State) { diff --git a/src/HTTPServer/NameValueParser.h b/src/HTTPServer/NameValueParser.h index 07dc0b942..9794614fa 100644 --- a/src/HTTPServer/NameValueParser.h +++ b/src/HTTPServer/NameValueParser.h @@ -21,10 +21,10 @@ public: cNameValueParser(bool a_AllowsKeyOnly = true); /// Creates an empty parser, then parses the data given. Doesn't call Finish(), so more data can be parsed later - cNameValueParser(const char * a_Data, int a_Size, bool a_AllowsKeyOnly = true); + cNameValueParser(const char * a_Data, size_t a_Size, bool a_AllowsKeyOnly = true); /// Parses the data given - void Parse(const char * a_Data, int a_Size); + void Parse(const char * a_Data, size_t a_Size); /// Notifies the parser that no more data will be coming. Returns true if the parser state is valid bool Finish(void); diff --git a/src/Inventory.h b/src/Inventory.h index fd2089a13..1ad7c4776 100644 --- a/src/Inventory.h +++ b/src/Inventory.h @@ -52,6 +52,8 @@ public: cInventory(cPlayer & a_Owner); + virtual ~cInventory() {} + // tolua_begin /// Removes all items from the entire inventory diff --git a/src/Item.h b/src/Item.h index 4bdfb12dd..910ecb382 100644 --- a/src/Item.h +++ b/src/Item.h @@ -209,7 +209,7 @@ public: void Add (const cItem & a_Item) {push_back(a_Item); } void Delete(int a_Idx); void Clear (void) {clear(); } - int Size (void) {return size(); } + size_t Size (void) {return size(); } void Set (int a_Idx, short a_ItemType, char a_ItemCount, short a_ItemDamage); void Add (short a_ItemType, char a_ItemCount, short a_ItemDamage) diff --git a/src/ItemGrid.h b/src/ItemGrid.h index b344e3daf..c34d5e9e2 100644 --- a/src/ItemGrid.h +++ b/src/ItemGrid.h @@ -20,11 +20,13 @@ class cItemGrid public: // tolua_end - /// This class is used as a callback for when a slot changes + /** This class is used as a callback for when a slot changes */ class cListener { public: - /// Called whenever a slot changes + virtual ~cListener() {} + + /** Called whenever a slot changes */ virtual void OnSlotChanged(cItemGrid * a_ItemGrid, int a_SlotNum) = 0; } ; typedef std::vector<cListener *> cListeners; @@ -38,12 +40,12 @@ public: int GetHeight (void) const { return m_Height; } int GetNumSlots(void) const { return m_NumSlots; } - /// Converts XY coords into slot number; returns -1 on invalid coords + /** Converts XY coords into slot number; returns -1 on invalid coords */ int GetSlotNum(int a_X, int a_Y) const; // tolua_end - /// Converts slot number into XY coords; sets coords to -1 on invalid slot number. Exported in ManualBindings.cpp + /** Converts slot number into XY coords; sets coords to -1 on invalid slot number. Exported in ManualBindings.cpp */ void GetSlotCoords(int a_SlotNum, int & a_X, int & a_Y) const; // tolua_begin @@ -62,16 +64,16 @@ public: void EmptySlot(int a_X, int a_Y); void EmptySlot(int a_SlotNum); - /// Returns true if the specified slot is empty or the slot doesn't exist + /** Returns true if the specified slot is empty or the slot doesn't exist */ bool IsSlotEmpty(int a_SlotNum) const; - /// Returns true if the specified slot is empty or the slot doesn't exist + /** Returns true if the specified slot is empty or the slot doesn't exist */ bool IsSlotEmpty(int a_X, int a_Y) const; - /// Sets all items as empty + /** Sets all items as empty */ void Clear(void); - /// Returns number of items out of a_ItemStack that can fit in the storage + /** Returns number of items out of a_ItemStack that can fit in the storage */ int HowManyCanFit(const cItem & a_ItemStack, bool a_AllowNewStacks = true); /** Adds as many items out of a_ItemStack as can fit. @@ -117,37 +119,37 @@ public: */ cItem RemoveOneItem(int a_X, int a_Y); - /// Returns the number of items of type a_Item that are stored + /** Returns the number of items of type a_Item that are stored */ int HowManyItems(const cItem & a_Item); - /// Returns true if there are at least as many items of type a_ItemStack as in a_ItemStack + /** Returns true if there are at least as many items of type a_ItemStack as in a_ItemStack */ bool HasItems(const cItem & a_ItemStack); - /// Returns the index of the first empty slot; -1 if all full + /** Returns the index of the first empty slot; -1 if all full */ int GetFirstEmptySlot(void) const; - /// Returns the index of the first non-empty slot; -1 if all empty + /** Returns the index of the first non-empty slot; -1 if all empty */ int GetFirstUsedSlot(void) const; - /// Returns the index of the last empty slot; -1 if all full + /** Returns the index of the last empty slot; -1 if all full */ int GetLastEmptySlot(void) const; - /// Returns the index of the last used slot; -1 if all empty + /** Returns the index of the last used slot; -1 if all empty */ int GetLastUsedSlot(void) const; - /// Returns the index of the first empty slot following a_StartFrom (a_StartFrom is not checked) + /** Returns the index of the first empty slot following a_StartFrom (a_StartFrom is not checked) */ int GetNextEmptySlot(int a_StartFrom) const; - /// Returns the index of the first used slot following a_StartFrom (a_StartFrom is not checked) + /** Returns the index of the first used slot following a_StartFrom (a_StartFrom is not checked) */ int GetNextUsedSlot(int a_StartFrom) const; - /// Copies the contents into a cItems object; preserves the original a_Items contents + /** Copies the contents into a cItems object; preserves the original a_Items contents */ void CopyToItems(cItems & a_Items) const; - /// Adds the specified damage to the specified item; returns true if the item broke (but the item is left intact) + /** Adds the specified damage to the specified item; returns true if the item broke (but the item is left intact) */ bool DamageItem(int a_SlotNum, short a_Amount); - /// Adds the specified damage to the specified item; returns true if the item broke (but the item is left intact) + /** Adds the specified damage to the specified item; returns true if the item broke (but the item is left intact) */ bool DamageItem(int a_X, int a_Y, short a_Amount); // tolua_end @@ -159,10 +161,10 @@ public: */ void GenerateRandomLootWithBooks(const cLootProbab * a_LootProbabs, size_t a_CountLootProbabs, int a_NumSlots, int a_Seed); - /// Adds a callback that gets called whenever a slot changes. Must not be called from within the listener callback! + /** Adds a callback that gets called whenever a slot changes. Must not be called from within the listener callback! */ void AddListener(cListener & a_Listener); - /// Removes a slot-change-callback. Must not be called from within the listener callback! + /** Removes a slot-change-callback. Must not be called from within the listener callback! */ void RemoveListener(cListener & a_Listener); // tolua_begin @@ -177,7 +179,7 @@ protected: cCriticalSection m_CSListeners; ///< CS that guards the m_Listeners against multi-thread access bool m_IsInTriggerListeners; ///< Set to true while TriggerListeners is running, to detect attempts to manipulate listener list while triggerring - /// Calls all m_Listeners for the specified slot number + /** Calls all m_Listeners for the specified slot number */ void TriggerListeners(int a_SlotNum); /** Adds up to a_Num items out of a_ItemStack, as many as can fit, in specified slot diff --git a/src/Items/ItemBoat.h b/src/Items/ItemBoat.h index a28ec8e22..42f4ffc8f 100644 --- a/src/Items/ItemBoat.h +++ b/src/Items/ItemBoat.h @@ -39,12 +39,20 @@ public: public cBlockTracer::cCallbacks { public: - Vector3d Pos; - virtual bool OnNextBlock(int a_BlockX, int a_BlockY, int a_BlockZ, BLOCKTYPE a_BlockType, NIBBLETYPE a_BlockMeta, char a_EntryFace) override + Vector3d m_Pos; + bool m_HasFound; + + cCallbacks(void) : + m_HasFound(false) { - if (a_BlockType != E_BLOCK_AIR) + } + + virtual bool OnNextBlock(int a_CBBlockX, int a_CBBlockY, int a_CBBlockZ, BLOCKTYPE a_CBBlockType, NIBBLETYPE a_CBBlockMeta, char a_CBEntryFace) override + { + if (a_CBBlockType != E_BLOCK_AIR) { - Pos = Vector3d(a_BlockX, a_BlockY, a_BlockZ); + m_Pos.Set(a_CBBlockX, a_CBBlockY, a_CBBlockZ); + m_HasFound = true; return true; } return false; @@ -57,15 +65,15 @@ public: Tracer.Trace(Start.x, Start.y, Start.z, End.x, End.y, End.z); - double x = Callbacks.Pos.x; - double y = Callbacks.Pos.y; - double z = Callbacks.Pos.z; - - if ((x == 0) && (y == 0) && (z == 0)) + if (!Callbacks.m_HasFound) { return false; } + double x = Callbacks.m_Pos.x; + double y = Callbacks.m_Pos.y; + double z = Callbacks.m_Pos.z; + cBoat * Boat = new cBoat(x + 0.5, y + 1, z + 0.5); Boat->Initialize(a_World); diff --git a/src/Items/ItemBucket.h b/src/Items/ItemBucket.h index 72cb8fa0a..68c89dd85 100644 --- a/src/Items/ItemBucket.h +++ b/src/Items/ItemBucket.h @@ -172,12 +172,12 @@ public: virtual bool OnNextBlock(int a_BlockX, int a_BlockY, int a_BlockZ, BLOCKTYPE a_BlockType, NIBBLETYPE a_BlockMeta, char a_EntryFace) override { - if (a_BlockMeta != 0) // Even if it was a water block it would not be a source. - { - return false; - } if (IsBlockWater(a_BlockType) || IsBlockLava(a_BlockType)) { + if (a_BlockMeta != 0) // GetBlockFromTrace is called for scooping up fluids; the hit block should be a source + { + return false; + } m_HasHitFluid = true; m_Pos.Set(a_BlockX, a_BlockY, a_BlockZ); return true; diff --git a/src/Items/ItemEmptyMap.h b/src/Items/ItemEmptyMap.h index f0b1e1424..953673382 100644 --- a/src/Items/ItemEmptyMap.h +++ b/src/Items/ItemEmptyMap.h @@ -55,7 +55,7 @@ public: return true; } - a_Player->GetInventory().AddItem(cItem(E_ITEM_MAP, 1, NewMap->GetID()), true, true); + a_Player->GetInventory().AddItem(cItem(E_ITEM_MAP, 1, (short)(NewMap->GetID() & 0x7fff)), true, true); return true; } diff --git a/src/Items/ItemFishingRod.h b/src/Items/ItemFishingRod.h index 15acbd9fe..0431b88b7 100644 --- a/src/Items/ItemFishingRod.h +++ b/src/Items/ItemFishingRod.h @@ -123,7 +123,7 @@ public: } case 2: { - Drops.Add(cItem(E_ITEM_FISHING_ROD, 1, a_World->GetTickRandomNumber(50))); // Fishing rod with durability. TODO: Enchantments on it + Drops.Add(cItem(E_ITEM_FISHING_ROD, 1, (short)a_World->GetTickRandomNumber(50))); // Fishing rod with durability. TODO: Enchantments on it break; } case 3: @@ -152,7 +152,7 @@ public: } else if (Junk <= 4) { - Drops.Add(cItem(E_ITEM_BOW, 1, a_World->GetTickRandomNumber(64))); + Drops.Add(cItem(E_ITEM_BOW, 1, (short)a_World->GetTickRandomNumber(64))); } else if (Junk <= 9) { diff --git a/src/Items/ItemHandler.cpp b/src/Items/ItemHandler.cpp index 454fabdd7..1e77717e3 100644 --- a/src/Items/ItemHandler.cpp +++ b/src/Items/ItemHandler.cpp @@ -27,6 +27,7 @@ #include "ItemHoe.h" #include "ItemLeaves.h" #include "ItemLighter.h" +#include "ItemLilypad.h" #include "ItemMap.h" #include "ItemMinecart.h" #include "ItemNetherWart.h" @@ -115,6 +116,7 @@ cItemHandler *cItemHandler::CreateItemHandler(int a_ItemType) case E_ITEM_FISHING_ROD: return new cItemFishingRodHandler(a_ItemType); case E_ITEM_FLINT_AND_STEEL: return new cItemLighterHandler(a_ItemType); case E_ITEM_FLOWER_POT: return new cItemFlowerPotHandler(a_ItemType); + case E_BLOCK_LILY_PAD: return new cItemLilypadHandler(a_ItemType); case E_ITEM_MAP: return new cItemMapHandler(); case E_ITEM_ITEM_FRAME: return new cItemItemFrameHandler(a_ItemType); case E_ITEM_NETHER_WART: return new cItemNetherWartHandler(a_ItemType); @@ -504,13 +506,13 @@ bool cItemHandler::GetPlacementBlockTypeMeta( { ASSERT(m_ItemType < 256); // Items with IDs above 255 should all be handled by specific handlers - if (m_ItemType > 256) + if (m_ItemType >= 256) { - LOGERROR("%s: Item %d has no valid block!", __FUNCTION__, m_ItemType); + LOGERROR("%s: Item %d is not eligible for direct block placement!", __FUNCTION__, m_ItemType); return false; } - cBlockHandler * BlockH = BlockHandler(m_ItemType); + cBlockHandler * BlockH = BlockHandler((BLOCKTYPE)m_ItemType); cChunkInterface ChunkInterface(a_World->GetChunkMap()); return BlockH->GetPlacementBlockTypeMeta( ChunkInterface, a_Player, diff --git a/src/Items/ItemLilypad.h b/src/Items/ItemLilypad.h new file mode 100644 index 000000000..8fc1d8543 --- /dev/null +++ b/src/Items/ItemLilypad.h @@ -0,0 +1,110 @@ +#pragma once + +#include "ItemHandler.h" +#include "../Entities/Player.h" +#include "Vector3.h" +#include "../LineBlockTracer.h" +#include "BlockInfo.h" + + + + + +class cItemLilypadHandler : + public cItemHandler +{ + typedef cItemHandler super; + +public: + cItemLilypadHandler(int a_ItemType): + super(a_ItemType) + { + + } + + + virtual bool IsPlaceable(void) override + { + return false; // Set as not placeable so OnItemUse is called + } + + + virtual bool OnItemUse(cWorld * a_World, cPlayer * a_Player, const cItem & a_Item, int a_BlockX, int a_BlockY, int a_BlockZ, eBlockFace a_BlockFace) override + { + if (a_BlockFace > BLOCK_FACE_NONE) + { + // Clicked on the side of a submerged block; vanilla allows placement, so should we + AddFaceDirection(a_BlockX, a_BlockY, a_BlockZ, a_BlockFace); + a_World->SetBlock(a_BlockX, a_BlockY, a_BlockZ, E_BLOCK_LILY_PAD, 0); + if (!a_Player->IsGameModeCreative()) + { + a_Player->GetInventory().RemoveOneEquippedItem(); + } + return true; + } + + class cCallbacks : + public cBlockTracer::cCallbacks + { + public: + cCallbacks(cWorld * a_CBWorld) : + m_HasHitFluid(false), + m_World(a_CBWorld) + { + } + + virtual bool OnNextBlock(int a_CBBlockX, int a_CBBlockY, int a_CBBlockZ, BLOCKTYPE a_CBBlockType, NIBBLETYPE a_CBBlockMeta, char a_CBEntryFace) override + { + if (IsBlockWater(a_CBBlockType)) + { + if ((a_CBBlockMeta != 0) || (a_CBEntryFace == BLOCK_FACE_NONE)) // The hit block should be a source. The FACE_NONE check is clicking whilst submerged + { + return false; + } + AddFaceDirection(a_CBBlockX, a_CBBlockY, a_CBBlockZ, BLOCK_FACE_YP); // Always place pad at top of water block + BLOCKTYPE Block = m_World->GetBlock(a_CBBlockX, a_CBBlockY, a_CBBlockZ); + if ( + !IsBlockWater(Block) && + cBlockInfo::FullyOccupiesVoxel(Block) + ) + { + // Can't place lilypad on air/in another block! + return true; + } + m_HasHitFluid = true; + m_Pos.Set(a_CBBlockX, a_CBBlockY, a_CBBlockZ); + return true; + } + return false; + } + + Vector3i m_Pos; + bool m_HasHitFluid; + cWorld * m_World; + + }; + + cCallbacks Callbacks(a_World); + cLineBlockTracer Tracer(*a_Player->GetWorld(), Callbacks); + Vector3d Start(a_Player->GetEyePosition() + a_Player->GetLookVector()); + Vector3d End(a_Player->GetEyePosition() + a_Player->GetLookVector() * 5); + + Tracer.Trace(Start.x, Start.y, Start.z, End.x, End.y, End.z); + + if (Callbacks.m_HasHitFluid) + { + a_World->SetBlock(Callbacks.m_Pos.x, Callbacks.m_Pos.y, Callbacks.m_Pos.z, E_BLOCK_LILY_PAD, 0); + if (!a_Player->IsGameModeCreative()) + { + a_Player->GetInventory().RemoveOneEquippedItem(); + } + return true; + } + + return false; + } +}; + + + + diff --git a/src/Items/ItemMap.h b/src/Items/ItemMap.h index e8ff9da88..056fe0fe7 100644 --- a/src/Items/ItemMap.h +++ b/src/Items/ItemMap.h @@ -29,7 +29,7 @@ public: virtual void OnUpdate(cWorld * a_World, cPlayer * a_Player, const cItem & a_Item) { - cMap * Map = a_World->GetMapManager().GetMapData(a_Item.m_ItemDamage); + cMap * Map = a_World->GetMapManager().GetMapData((unsigned)a_Item.m_ItemDamage); if (Map == NULL) { diff --git a/src/Items/ItemMinecart.h b/src/Items/ItemMinecart.h index bcaa5635a..25500aeb9 100644 --- a/src/Items/ItemMinecart.h +++ b/src/Items/ItemMinecart.h @@ -1,4 +1,3 @@ - // ItemMinecart.h // Declares the various minecart ItemHandlers @@ -72,6 +71,11 @@ public: } } // switch (m_ItemType) Minecart->Initialize(a_World); + + if (!a_Player->IsGameModeCreative()) + { + a_Player->GetInventory().RemoveOneEquippedItem(); + } return true; } diff --git a/src/LightingThread.h b/src/LightingThread.h index 198f27248..770ae809f 100644 --- a/src/LightingThread.h +++ b/src/LightingThread.h @@ -160,14 +160,12 @@ protected: inline void PropagateLight( NIBBLETYPE * a_Light, - int a_SrcIdx, int a_DstIdx, + unsigned int a_SrcIdx, unsigned int a_DstIdx, int & a_NumSeedsOut, unsigned char * a_IsSeedOut, unsigned int * a_SeedIdxOut ) { - ASSERT(a_SrcIdx >= 0); - ASSERT(a_SrcIdx < (int)ARRAYCOUNT(m_SkyLight)); - ASSERT(a_DstIdx >= 0); - ASSERT(a_DstIdx < (int)ARRAYCOUNT(m_BlockTypes)); + ASSERT(a_SrcIdx < ARRAYCOUNT(m_SkyLight)); + ASSERT(a_DstIdx < ARRAYCOUNT(m_BlockTypes)); if (a_Light[a_SrcIdx] <= a_Light[a_DstIdx] + cBlockInfo::GetSpreadLightFalloff(m_BlockTypes[a_DstIdx])) { diff --git a/src/MCLogger.cpp b/src/MCLogger.cpp index 4f3e5dc0f..80fa7b173 100644 --- a/src/MCLogger.cpp +++ b/src/MCLogger.cpp @@ -93,25 +93,30 @@ void cMCLogger::InitLog(const AString & a_FileName) -void cMCLogger::LogSimple(const char* a_Text, int a_LogType /* = 0 */ ) +void cMCLogger::LogSimple(const char * a_Text, eLogLevel a_LogLevel) { - switch( a_LogType ) + switch (a_LogLevel) { - case 0: + case llRegular: + { LOG("%s", a_Text); break; - case 1: + } + case llInfo: + { LOGINFO("%s", a_Text); break; - case 2: + } + case llWarning: + { LOGWARN("%s", a_Text); break; - case 3: + } + case llError: + { LOGERROR("%s", a_Text); break; - default: - LOG("(#%d#: %s", a_LogType, a_Text); - break; + } } } diff --git a/src/MCLogger.h b/src/MCLogger.h index 996e60329..c0150c124 100644 --- a/src/MCLogger.h +++ b/src/MCLogger.h @@ -10,25 +10,36 @@ class cLog; -class cMCLogger // tolua_export -{ // tolua_export -public: // tolua_export - /// Creates a logger with the default filename, "logs/LOG_<timestamp>.log" +// tolua_begin +class cMCLogger +{ +public: + enum eLogLevel + { + llRegular, + llInfo, + llWarning, + llError, + }; + // tolua_end + + /** Creates a logger with the default filename, "logs/LOG_<timestamp>.log" */ cMCLogger(void); - /// Creates a logger with the specified filename inside "logs" folder + /** Creates a logger with the specified filename inside "logs" folder */ cMCLogger(const AString & a_FileName); // tolua_export ~cMCLogger(); // tolua_export - void Log(const char* a_Format, va_list a_ArgList) FORMATSTRING(2, 0); - void Info(const char* a_Format, va_list a_ArgList) FORMATSTRING(2, 0); - void Warn(const char* a_Format, va_list a_ArgList) FORMATSTRING(2, 0); - void Error(const char* a_Format, va_list a_ArgList) FORMATSTRING(2, 0); + void Log (const char * a_Format, va_list a_ArgList) FORMATSTRING(2, 0); + void Info (const char * a_Format, va_list a_ArgList) FORMATSTRING(2, 0); + void Warn (const char * a_Format, va_list a_ArgList) FORMATSTRING(2, 0); + void Error(const char * a_Format, va_list a_ArgList) FORMATSTRING(2, 0); - void LogSimple(const char* a_Text, int a_LogType = 0 ); // tolua_export + /** Logs the simple text message at the specified log level. */ + void LogSimple(const char * a_Text, eLogLevel a_LogLevel = llRegular); // tolua_export - static cMCLogger* GetInstance(); + static cMCLogger * GetInstance(); private: enum eColorScheme { diff --git a/src/MobSpawner.cpp b/src/MobSpawner.cpp index a0d0f5c54..05da5d01c 100644 --- a/src/MobSpawner.cpp +++ b/src/MobSpawner.cpp @@ -129,6 +129,11 @@ bool cMobSpawner::CanSpawnHere(cChunk * a_Chunk, int a_RelX, int a_RelY, int a_R BLOCKTYPE TargetBlock = E_BLOCK_AIR; if (m_AllowedTypes.find(a_MobType) != m_AllowedTypes.end() && a_Chunk->UnboundedRelGetBlockType(a_RelX, a_RelY, a_RelZ, TargetBlock)) { + if ((a_RelY + 1 > cChunkDef::Height) || (a_RelY - 1 < 0)) + { + return false; + } + NIBBLETYPE BlockLight = a_Chunk->GetBlockLight(a_RelX, a_RelY, a_RelZ); NIBBLETYPE SkyLight = a_Chunk->GetSkyLight(a_RelX, a_RelY, a_RelZ); BLOCKTYPE BlockAbove = a_Chunk->GetBlock(a_RelX, a_RelY + 1, a_RelZ); @@ -200,7 +205,7 @@ bool cMobSpawner::CanSpawnHere(cChunk * a_Chunk, int a_RelX, int a_RelY, int a_R case cMonster::mtSpider: { bool CanSpawn = true; - bool HaveFloor = false; + bool HasFloor = false; for (int x = 0; x < 2; ++x) { for(int z = 0; z < 2; ++z) @@ -211,8 +216,8 @@ bool cMobSpawner::CanSpawnHere(cChunk * a_Chunk, int a_RelX, int a_RelY, int a_R { return false; } - HaveFloor = ( - HaveFloor || + HasFloor = ( + HasFloor || ( a_Chunk->UnboundedRelGetBlockType(a_RelX + x, a_RelY - 1, a_RelZ + z, TargetBlock) && !cBlockInfo::IsTransparent(TargetBlock) @@ -220,7 +225,7 @@ bool cMobSpawner::CanSpawnHere(cChunk * a_Chunk, int a_RelX, int a_RelY, int a_R ); } } - return CanSpawn && HaveFloor && (SkyLight <= 7) && (BlockLight <= 7); + return CanSpawn && HasFloor && (SkyLight <= 7) && (BlockLight <= 7); } case cMonster::mtCreeper: diff --git a/src/Mobs/Blaze.cpp b/src/Mobs/Blaze.cpp index ac42cf40b..84ff8929b 100644 --- a/src/Mobs/Blaze.cpp +++ b/src/Mobs/Blaze.cpp @@ -53,4 +53,4 @@ void cBlaze::Attack(float a_Dt) m_AttackInterval = 0.0; // ToDo: Shoot 3 fireballs instead of 1. } -}
\ No newline at end of file +} diff --git a/src/Mobs/Blaze.h b/src/Mobs/Blaze.h index cdb3a1306..5970451c7 100644 --- a/src/Mobs/Blaze.h +++ b/src/Mobs/Blaze.h @@ -20,7 +20,3 @@ public: virtual void GetDrops(cItems & a_Drops, cEntity * a_Killer = NULL) override; virtual void Attack(float a_Dt) override; } ; - - - - diff --git a/src/Mobs/Monster.cpp b/src/Mobs/Monster.cpp index d3e0f1c26..aa6071515 100644 --- a/src/Mobs/Monster.cpp +++ b/src/Mobs/Monster.cpp @@ -111,9 +111,9 @@ void cMonster::SpawnOn(cClientHandle & a_Client) void cMonster::TickPathFinding() { - int PosX = (int)floor(GetPosX()); - int PosY = (int)floor(GetPosY()); - int PosZ = (int)floor(GetPosZ()); + const int PosX = (int)floor(GetPosX()); + const int PosY = (int)floor(GetPosY()); + const int PosZ = (int)floor(GetPosZ()); m_FinalDestination.y = (double)FindFirstNonAirBlockPosition(m_FinalDestination.x, m_FinalDestination.z); @@ -130,14 +130,16 @@ void cMonster::TickPathFinding() { 0, 1}, { 0,-1}, } ; + + if ((PosY - 1 < 0) || (PosY + 2 > cChunkDef::Height) /* PosY + 1 will never be true if PosY + 2 is not */) + { + // Too low/high, can't really do anything + FinishPathFinding(); + return; + } for (size_t i = 0; i < ARRAYCOUNT(gCrossCoords); i++) { - if ((gCrossCoords[i].x + PosX == PosX) && (gCrossCoords[i].z + PosZ == PosZ)) - { - continue; - } - if (IsCoordinateInTraversedList(Vector3i(gCrossCoords[i].x + PosX, PosY, gCrossCoords[i].z + PosZ))) { continue; diff --git a/src/Mobs/Skeleton.cpp b/src/Mobs/Skeleton.cpp index 47fcdbb26..1685f40c5 100644 --- a/src/Mobs/Skeleton.cpp +++ b/src/Mobs/Skeleton.cpp @@ -88,4 +88,4 @@ void cSkeleton::Attack(float a_Dt) m_World->BroadcastSpawnEntity(*Arrow); m_AttackInterval = 0.0; } -}
\ No newline at end of file +} diff --git a/src/Mobs/Wither.cpp b/src/Mobs/Wither.cpp index 0e42194ac..8f5d28b68 100644 --- a/src/Mobs/Wither.cpp +++ b/src/Mobs/Wither.cpp @@ -13,8 +13,27 @@ cWither::cWither(void) : m_InvulnerableTicks(220) { SetMaxHealth(300); +} + + + + + +bool cWither::IsArmored(void) const +{ + return GetHealth() <= (GetMaxHealth() / 2); +} + + + + +bool cWither::Initialize(cWorld * a_World) +{ + // Set health before BroadcastSpawnEntity() SetHealth(GetMaxHealth() / 3); + + return super::Initialize(a_World); } @@ -33,6 +52,11 @@ void cWither::DoTakeDamage(TakeDamageInfo & a_TDI) return; } + if (IsArmored() && (a_TDI.DamageType == dtRangedAttack)) + { + return; + } + super::DoTakeDamage(a_TDI); } @@ -60,6 +84,8 @@ void cWither::Tick(float a_Dt, cChunk & a_Chunk) Heal(10); } } + + m_World->BroadcastEntityMetadata(*this); } diff --git a/src/Mobs/Wither.h b/src/Mobs/Wither.h index d09e3607a..bc78bfaad 100644 --- a/src/Mobs/Wither.h +++ b/src/Mobs/Wither.h @@ -20,8 +20,12 @@ public: unsigned int GetNumInvulnerableTicks(void) const { return m_InvulnerableTicks; } void SetNumInvulnerableTicks(unsigned int a_Ticks) { m_InvulnerableTicks = a_Ticks; } + + /** Returns whether the wither is invulnerable to arrows. */ + bool IsArmored(void) const; // cEntity overrides + virtual bool Initialize(cWorld * a_World) override; virtual void GetDrops(cItems & a_Drops, cEntity * a_Killer = NULL) override; virtual void DoTakeDamage(TakeDamageInfo & a_TDI) override; virtual void Tick(float a_Dt, cChunk & a_Chunk) override; diff --git a/src/Noise.cpp b/src/Noise.cpp index a97ea70c6..32922c8f3 100644 --- a/src/Noise.cpp +++ b/src/Noise.cpp @@ -425,7 +425,7 @@ void cCubicCell3D::Move(int a_NewFloorX, int a_NewFloorY, int a_NewFloorZ) /////////////////////////////////////////////////////////////////////////////////////////////////////////////////////// // cNoise: -cNoise::cNoise(unsigned int a_Seed) : +cNoise::cNoise(int a_Seed) : m_Seed(a_Seed) { } diff --git a/src/Noise.h b/src/Noise.h index ea72c64e9..62004503f 100644 --- a/src/Noise.h +++ b/src/Noise.h @@ -25,7 +25,7 @@ class cNoise { public: - cNoise(unsigned int a_Seed); + cNoise(int a_Seed); cNoise(const cNoise & a_Noise); // The following functions, if not marked INLINE, are about 20 % slower @@ -47,14 +47,14 @@ public: NOISE_DATATYPE CubicNoise3D (NOISE_DATATYPE a_X, NOISE_DATATYPE a_Y, NOISE_DATATYPE a_Z) const; - void SetSeed(unsigned int a_Seed) { m_Seed = a_Seed; } + void SetSeed(int a_Seed) { m_Seed = a_Seed; } INLINE static NOISE_DATATYPE CubicInterpolate (NOISE_DATATYPE a_A, NOISE_DATATYPE a_B, NOISE_DATATYPE a_C, NOISE_DATATYPE a_D, NOISE_DATATYPE a_Pct); INLINE static NOISE_DATATYPE CosineInterpolate(NOISE_DATATYPE a_A, NOISE_DATATYPE a_B, NOISE_DATATYPE a_Pct); INLINE static NOISE_DATATYPE LinearInterpolate(NOISE_DATATYPE a_A, NOISE_DATATYPE a_B, NOISE_DATATYPE a_Pct); private: - unsigned int m_Seed; + int m_Seed; } ; diff --git a/src/OSSupport/Errors.cpp b/src/OSSupport/Errors.cpp index 2e05f1df1..6072b6ac6 100644 --- a/src/OSSupport/Errors.cpp +++ b/src/OSSupport/Errors.cpp @@ -22,7 +22,7 @@ AString GetOSErrorString( int a_ErrNo ) // According to http://linux.die.net/man/3/strerror_r there are two versions of strerror_r(): - #if ( _GNU_SOURCE ) && !defined(ANDROID_NDK) // GNU version of strerror_r() + #if !defined(__APPLE__) && ( _GNU_SOURCE ) && !defined(ANDROID_NDK) // GNU version of strerror_r() char * res = strerror_r( errno, buffer, ARRAYCOUNT(buffer) ); if( res != NULL ) diff --git a/src/OSSupport/File.cpp b/src/OSSupport/File.cpp index 17070030f..7f0f0ad2f 100644 --- a/src/OSSupport/File.cpp +++ b/src/OSSupport/File.cpp @@ -152,7 +152,7 @@ int cFile::Read (void * iBuffer, int iNumBytes) return -1; } - return fread(iBuffer, 1, iNumBytes, m_File); // fread() returns the portion of Count parameter actually read, so we need to send iNumBytes as Count + return (int)fread(iBuffer, 1, (size_t)iNumBytes, m_File); // fread() returns the portion of Count parameter actually read, so we need to send iNumBytes as Count } @@ -168,7 +168,7 @@ int cFile::Write(const void * iBuffer, int iNumBytes) return -1; } - int res = fwrite(iBuffer, 1, iNumBytes, m_File); // fwrite() returns the portion of Count parameter actually written, so we need to send iNumBytes as Count + int res = (int)fwrite(iBuffer, 1, (size_t)iNumBytes, m_File); // fwrite() returns the portion of Count parameter actually written, so we need to send iNumBytes as Count return res; } @@ -189,7 +189,7 @@ int cFile::Seek (int iPosition) { return -1; } - return ftell(m_File); + return (int)ftell(m_File); } @@ -206,7 +206,7 @@ int cFile::Tell (void) const return -1; } - return ftell(m_File); + return (int)ftell(m_File); } @@ -222,7 +222,7 @@ int cFile::GetSize(void) const return -1; } - int CurPos = ftell(m_File); + int CurPos = Tell(); if (CurPos < 0) { return -1; @@ -231,8 +231,8 @@ int cFile::GetSize(void) const { return -1; } - int res = ftell(m_File); - if (fseek(m_File, CurPos, SEEK_SET) != 0) + int res = Tell(); + if (fseek(m_File, (long)CurPos, SEEK_SET) != 0) { return -1; } @@ -255,7 +255,7 @@ int cFile::ReadRestOfFile(AString & a_Contents) int DataSize = GetSize() - Tell(); // HACK: This depends on the internal knowledge that AString's data() function returns the internal buffer directly - a_Contents.assign(DataSize, '\0'); + a_Contents.assign((size_t)DataSize, '\0'); return Read((void *)a_Contents.data(), DataSize); } @@ -350,7 +350,7 @@ int cFile::GetSize(const AString & a_FileName) struct stat st; if (stat(a_FileName.c_str(), &st) == 0) { - return st.st_size; + return (int)st.st_size; } return -1; } @@ -456,7 +456,7 @@ int cFile::Printf(const char * a_Fmt, ...) va_start(args, a_Fmt); AppendVPrintf(buf, a_Fmt, args); va_end(args); - return Write(buf.c_str(), buf.length()); + return Write(buf.c_str(), (int)buf.length()); } diff --git a/src/OSSupport/GZipFile.cpp b/src/OSSupport/GZipFile.cpp index b13e519e0..7a8433f4f 100644 --- a/src/OSSupport/GZipFile.cpp +++ b/src/OSSupport/GZipFile.cpp @@ -78,7 +78,7 @@ int cGZipFile::ReadRestOfFile(AString & a_Contents) while ((NumBytesRead = gzread(m_File, Buffer, sizeof(Buffer))) > 0) { TotalBytes += NumBytesRead; - a_Contents.append(Buffer, NumBytesRead); + a_Contents.append(Buffer, (size_t)NumBytesRead); } // NumBytesRead is < 0 on error return (NumBytesRead >= 0) ? TotalBytes : NumBytesRead; @@ -102,7 +102,7 @@ bool cGZipFile::Write(const char * a_Contents, int a_Size) return false; } - return (gzwrite(m_File, a_Contents, a_Size) != 0); + return (gzwrite(m_File, a_Contents, (unsigned int)a_Size) != 0); } diff --git a/src/OSSupport/ListenThread.h b/src/OSSupport/ListenThread.h index 4e337d814..b2d806c82 100644 --- a/src/OSSupport/ListenThread.h +++ b/src/OSSupport/ListenThread.h @@ -29,43 +29,45 @@ class cListenThread : typedef cIsThread super; public: - /// Used as the callback for connection events + /** Used as the callback for connection events */ class cCallback { public: - /// This callback is called whenever a socket connection is accepted + virtual ~cCallback() {} + + /** This callback is called whenever a socket connection is accepted */ virtual void OnConnectionAccepted(cSocket & a_Socket) = 0; } ; cListenThread(cCallback & a_Callback, cSocket::eFamily a_Family, const AString & a_ServiceName = ""); ~cListenThread(); - /// Creates all the sockets, returns trus if successful, false if not. + /** Creates all the sockets, returns trus if successful, false if not. */ bool Initialize(const AString & a_PortsString); bool Start(void); void Stop(void); - /// Call before Initialize() to set the "reuse" flag on the sockets + /** Call before Initialize() to set the "reuse" flag on the sockets */ void SetReuseAddr(bool a_Reuse = true); protected: typedef std::vector<cSocket> cSockets; - /// The callback which to notify of incoming connections + /** The callback which to notify of incoming connections */ cCallback & m_Callback; - /// Socket address family to use + /** Socket address family to use */ cSocket::eFamily m_Family; - /// Sockets that are being monitored + /** Sockets that are being monitored */ cSockets m_Sockets; - /// If set to true, the SO_REUSEADDR socket option is set to true + /** If set to true, the SO_REUSEADDR socket option is set to true */ bool m_ShouldReuseAddr; - /// Name of the service that's listening on the ports; for logging purposes only + /** Name of the service that's listening on the ports; for logging purposes only */ AString m_ServiceName; diff --git a/src/OSSupport/Sleep.h b/src/OSSupport/Sleep.h index 5298c15da..0ec0adf9d 100644 --- a/src/OSSupport/Sleep.h +++ b/src/OSSupport/Sleep.h @@ -4,4 +4,4 @@ class cSleep { public: static void MilliSleep( unsigned int a_MilliSeconds ); -};
\ No newline at end of file +}; diff --git a/src/OSSupport/SocketThreads.h b/src/OSSupport/SocketThreads.h index b2eb5950f..679e374e1 100644 --- a/src/OSSupport/SocketThreads.h +++ b/src/OSSupport/SocketThreads.h @@ -64,7 +64,7 @@ public: virtual ~cCallback() {} /** Called when data is received from the remote party */ - virtual void DataReceived(const char * a_Data, int a_Size) = 0; + virtual void DataReceived(const char * a_Data, size_t a_Size) = 0; /** Called when data can be sent to remote party The function is supposed to *set* outgoing data to a_Data (overwrite) */ diff --git a/src/OSSupport/Thread.h b/src/OSSupport/Thread.h index 3c9316424..4153b2427 100644 --- a/src/OSSupport/Thread.h +++ b/src/OSSupport/Thread.h @@ -23,4 +23,4 @@ private: cEvent* m_StopEvent; AString m_ThreadName; -};
\ No newline at end of file +}; diff --git a/src/Protocol/ChunkDataSerializer.cpp b/src/Protocol/ChunkDataSerializer.cpp index 78318a5ee..ebe61631b 100644 --- a/src/Protocol/ChunkDataSerializer.cpp +++ b/src/Protocol/ChunkDataSerializer.cpp @@ -105,7 +105,7 @@ void cChunkDataSerializer::Serialize29(AString & a_Data) a_Data.append((const char *)&BitMap1, sizeof(short)); a_Data.append((const char *)&BitMap2, sizeof(short)); - Int32 CompressedSizeBE = htonl(CompressedSize); + UInt32 CompressedSizeBE = htonl((UInt32)CompressedSize); a_Data.append((const char *)&CompressedSizeBE, sizeof(CompressedSizeBE)); Int32 UnusedInt32 = 0; @@ -163,7 +163,7 @@ void cChunkDataSerializer::Serialize39(AString & a_Data) a_Data.append((const char *)&BitMap1, sizeof(short)); a_Data.append((const char *)&BitMap2, sizeof(short)); - Int32 CompressedSizeBE = htonl(CompressedSize); + UInt32 CompressedSizeBE = htonl((UInt32)CompressedSize); a_Data.append((const char *)&CompressedSizeBE, sizeof(CompressedSizeBE)); // Unlike 29, 39 doesn't have the "unused" int diff --git a/src/Protocol/Protocol.h b/src/Protocol/Protocol.h index d3383bf0d..ae06f2f9e 100644 --- a/src/Protocol/Protocol.h +++ b/src/Protocol/Protocol.h @@ -132,7 +132,7 @@ protected: cCriticalSection m_CSPacket; //< Each SendXYZ() function must acquire this CS in order to send the whole packet at once /// A generic data-sending routine, all outgoing packet data needs to be routed through this so that descendants may override it - virtual void SendData(const char * a_Data, int a_Size) = 0; + virtual void SendData(const char * a_Data, size_t a_Size) = 0; /// Called after writing each packet, enables descendants to flush their buffers virtual void Flush(void) {}; @@ -143,10 +143,15 @@ protected: SendData((const char *)&a_Value, 1); } + void WriteChar(char a_Value) + { + SendData(&a_Value, 1); + } + void WriteShort(short a_Value) { - a_Value = htons(a_Value); - SendData((const char *)&a_Value, 2); + u_short Value = htons((u_short)a_Value); + SendData((const char *)&Value, 2); } /* @@ -159,8 +164,8 @@ protected: void WriteInt(int a_Value) { - a_Value = htonl(a_Value); - SendData((const char *)&a_Value, 4); + u_long Value = htonl((u_long)a_Value); + SendData((const char *)&Value, 4); } void WriteUInt(unsigned int a_Value) @@ -171,19 +176,19 @@ protected: void WriteInt64 (Int64 a_Value) { - a_Value = HostToNetwork8(&a_Value); - SendData((const char *)&a_Value, 8); + UInt64 Value = HostToNetwork8(&a_Value); + SendData((const char *)Value, 8); } void WriteFloat (float a_Value) { - unsigned int val = HostToNetwork4(&a_Value); + UInt32 val = HostToNetwork4(&a_Value); SendData((const char *)&val, 4); } void WriteDouble(double a_Value) { - unsigned long long val = HostToNetwork8(&a_Value); + UInt64 val = HostToNetwork8(&a_Value); SendData((const char *)&val, 8); } @@ -191,7 +196,7 @@ protected: { AString UTF16; UTF8ToRawBEUTF16(a_Value.c_str(), a_Value.length(), UTF16); - WriteShort((unsigned short)(UTF16.size() / 2)); + WriteShort((short)(UTF16.size() / 2)); SendData(UTF16.data(), UTF16.size()); } @@ -211,7 +216,7 @@ protected: { // A 32-bit integer can be encoded by at most 5 bytes: unsigned char b[5]; - int idx = 0; + size_t idx = 0; do { b[idx] = (a_Value & 0x7f) | ((a_Value > 0x7f) ? 0x80 : 0x00); @@ -224,7 +229,7 @@ protected: void WriteVarUTF8String(const AString & a_String) { - WriteVarInt(a_String.size()); + WriteVarInt((UInt32)a_String.size()); SendData(a_String.data(), a_String.size()); } } ; diff --git a/src/Protocol/Protocol125.cpp b/src/Protocol/Protocol125.cpp index 69f4934d8..bf946ef19 100644 --- a/src/Protocol/Protocol125.cpp +++ b/src/Protocol/Protocol125.cpp @@ -161,8 +161,8 @@ void cProtocol125::SendBlockAction(int a_BlockX, int a_BlockY, int a_BlockZ, cha WriteInt (a_BlockX); WriteShort((short)a_BlockY); WriteInt (a_BlockZ); - WriteByte (a_Byte1); - WriteByte (a_Byte2); + WriteChar (a_Byte1); + WriteChar (a_Byte2); Flush(); } @@ -209,12 +209,12 @@ void cProtocol125::SendBlockChanges(int a_ChunkX, int a_ChunkZ, const sSetBlockV WriteByte (PACKET_MULTI_BLOCK); WriteInt (a_ChunkX); WriteInt (a_ChunkZ); - WriteShort((unsigned short)a_Changes.size()); - WriteUInt (sizeof(int) * a_Changes.size()); + WriteShort((short)a_Changes.size()); + WriteUInt ((UInt32)(4 * a_Changes.size())); for (sSetBlockVector::const_iterator itr = a_Changes.begin(), end = a_Changes.end(); itr != end; ++itr) { - unsigned int Coords = itr->y | (itr->z << 8) | (itr->x << 12); - unsigned int Blocks = itr->BlockMeta | (itr->BlockType << 4); + UInt32 Coords = ((UInt32)itr->y) | ((UInt32)(itr->z << 8)) | ((UInt32)(itr->x << 12)); + UInt32 Blocks = ((UInt32)itr->BlockMeta) | ((UInt32)(itr->BlockType << 4)); WriteUInt(Coords << 16 | Blocks); } Flush(); @@ -239,32 +239,11 @@ void cProtocol125::SendChat(const AString & a_Message) void cProtocol125::SendChat(const cCompositeChat & a_Message) { // This version doesn't support composite messages, just extract each part's text and use it: - AString Msg; - const cCompositeChat::cParts & Parts = a_Message.GetParts(); - for (cCompositeChat::cParts::const_iterator itr = Parts.begin(), end = Parts.end(); itr != end; ++itr) - { - switch ((*itr)->m_PartType) - { - case cCompositeChat::ptText: - case cCompositeChat::ptClientTranslated: - case cCompositeChat::ptRunCommand: - case cCompositeChat::ptSuggestCommand: - { - Msg.append((*itr)->m_Text); - break; - } - case cCompositeChat::ptUrl: - { - Msg.append(((cCompositeChat::cUrlPart *)(*itr))->m_Url); - break; - } - } // switch (PartType) - } // for itr - Parts[] // Send the message: cCSLock Lock(m_CSPacket); WriteByte (PACKET_CHAT); - WriteString(Msg); + WriteString(a_Message.ExtractText()); Flush(); } @@ -346,8 +325,8 @@ void cProtocol125::SendEntityEffect(const cEntity & a_Entity, int a_EffectID, in cCSLock Lock(m_CSPacket); WriteByte (PACKET_ENTITY_EFFECT); WriteInt (a_Entity.GetUniqueID()); - WriteByte (a_EffectID); - WriteByte (a_Amplifier); + WriteByte ((Byte)a_EffectID); + WriteByte ((Byte)a_Amplifier); WriteShort(a_Duration); Flush(); } @@ -378,7 +357,7 @@ void cProtocol125::SendEntityHeadLook(const cEntity & a_Entity) cCSLock Lock(m_CSPacket); WriteByte(PACKET_ENT_HEAD_LOOK); WriteInt (a_Entity.GetUniqueID()); - WriteByte((char)((a_Entity.GetHeadYaw() / 360.f) * 256)); + WriteChar((char)((a_Entity.GetHeadYaw() / 360.f) * 256)); Flush(); } @@ -393,8 +372,8 @@ void cProtocol125::SendEntityLook(const cEntity & a_Entity) cCSLock Lock(m_CSPacket); WriteByte(PACKET_ENT_LOOK); WriteInt (a_Entity.GetUniqueID()); - WriteByte((char)((a_Entity.GetYaw() / 360.f) * 256)); - WriteByte((char)((a_Entity.GetPitch() / 360.f) * 256)); + WriteChar((char)((a_Entity.GetYaw() / 360.f) * 256)); + WriteChar((char)((a_Entity.GetPitch() / 360.f) * 256)); Flush(); } @@ -442,9 +421,9 @@ void cProtocol125::SendEntityRelMove(const cEntity & a_Entity, char a_RelX, char cCSLock Lock(m_CSPacket); WriteByte(PACKET_ENT_REL_MOVE); WriteInt (a_Entity.GetUniqueID()); - WriteByte(a_RelX); - WriteByte(a_RelY); - WriteByte(a_RelZ); + WriteChar(a_RelX); + WriteChar(a_RelY); + WriteChar(a_RelZ); Flush(); } @@ -459,11 +438,11 @@ void cProtocol125::SendEntityRelMoveLook(const cEntity & a_Entity, char a_RelX, cCSLock Lock(m_CSPacket); WriteByte(PACKET_ENT_REL_MOVE_LOOK); WriteInt (a_Entity.GetUniqueID()); - WriteByte(a_RelX); - WriteByte(a_RelY); - WriteByte(a_RelZ); - WriteByte((char)((a_Entity.GetYaw() / 360.f) * 256)); - WriteByte((char)((a_Entity.GetPitch() / 360.f) * 256)); + WriteChar(a_RelX); + WriteChar(a_RelY); + WriteChar(a_RelZ); + WriteChar((char)((a_Entity.GetYaw() / 360.f) * 256)); + WriteChar((char)((a_Entity.GetPitch() / 360.f) * 256)); Flush(); } @@ -476,7 +455,7 @@ void cProtocol125::SendEntityStatus(const cEntity & a_Entity, char a_Status) cCSLock Lock(m_CSPacket); WriteByte(PACKET_ENT_STATUS); WriteInt (a_Entity.GetUniqueID()); - WriteByte(a_Status); + WriteChar(a_Status); Flush(); } @@ -509,7 +488,7 @@ void cProtocol125::SendExplosion(double a_BlockX, double a_BlockY, double a_Bloc WriteDouble (a_BlockY); WriteDouble (a_BlockZ); WriteFloat (a_Radius); - WriteInt (a_BlocksAffected.size()); + WriteInt ((Int32)a_BlocksAffected.size()); int BlockX = (int)a_BlockX; int BlockY = (int)a_BlockY; int BlockZ = (int)a_BlockZ; @@ -534,7 +513,7 @@ void cProtocol125::SendGameMode(eGameMode a_GameMode) cCSLock Lock(m_CSPacket); WriteByte(PACKET_CHANGE_GAME_STATE); WriteByte(3); - WriteByte((char)a_GameMode); + WriteChar((char)a_GameMode); Flush(); } @@ -559,7 +538,7 @@ void cProtocol125::SendHealth(void) cCSLock Lock(m_CSPacket); WriteByte (PACKET_UPDATE_HEALTH); WriteShort((short)m_Client->GetPlayer()->GetHealth()); - WriteShort(m_Client->GetPlayer()->GetFoodLevel()); + WriteShort((short)m_Client->GetPlayer()->GetFoodLevel()); WriteFloat((float)m_Client->GetPlayer()->GetFoodSaturationLevel()); Flush(); } @@ -572,7 +551,7 @@ void cProtocol125::SendInventorySlot(char a_WindowID, short a_SlotNum, const cIt { cCSLock Lock(m_CSPacket); WriteByte (PACKET_INVENTORY_SLOT); - WriteByte (a_WindowID); + WriteChar (a_WindowID); WriteShort(a_SlotNum); WriteItem (a_Item); Flush(); @@ -621,17 +600,14 @@ void cProtocol125::SendMapColumn(int a_ID, int a_X, int a_Y, const Byte * a_Colo WriteByte (PACKET_ITEM_DATA); WriteShort(E_ITEM_MAP); - WriteShort(a_ID); - WriteShort(3 + a_Length); + WriteShort((short)a_ID); + WriteShort((short)(3 + a_Length)); WriteByte(0); - WriteByte(a_X); - WriteByte(a_Y); + WriteChar((char)a_X); + WriteChar((char)a_Y); - for (unsigned int i = 0; i < a_Length; ++i) - { - WriteByte(a_Colors[i]); - } + SendData((const char *)a_Colors, a_Length); Flush(); } @@ -646,16 +622,16 @@ void cProtocol125::SendMapDecorators(int a_ID, const cMapDecoratorList & a_Decor WriteByte (PACKET_ITEM_DATA); WriteShort(E_ITEM_MAP); - WriteShort(a_ID); - WriteShort(1 + (3 * a_Decorators.size())); + WriteShort((short)a_ID); + WriteShort((short)(1 + (3 * a_Decorators.size()))); WriteByte(1); for (cMapDecoratorList::const_iterator it = a_Decorators.begin(); it != a_Decorators.end(); ++it) { - WriteByte((it->GetType() << 4) | (it->GetRot() & 0xf)); - WriteByte(it->GetPixelX()); - WriteByte(it->GetPixelZ()); + WriteByte((Byte)(it->GetType() << 4) | (it->GetRot() & 0xf)); + WriteByte((Byte)it->GetPixelX()); + WriteByte((Byte)it->GetPixelZ()); } Flush(); @@ -672,7 +648,7 @@ void cProtocol125::SendPickupSpawn(const cPickup & a_Pickup) WriteByte (PACKET_PICKUP_SPAWN); WriteInt (a_Pickup.GetUniqueID()); WriteShort (a_Pickup.GetItem().m_ItemType); - WriteByte (a_Pickup.GetItem().m_ItemCount); + WriteChar (a_Pickup.GetItem().m_ItemCount); WriteShort (a_Pickup.GetItem().m_ItemDamage); WriteVectorI((Vector3i)(a_Pickup.GetPosition() * 32)); WriteByte ((char)(a_Pickup.GetSpeed().x * 8)); @@ -690,7 +666,7 @@ void cProtocol125::SendEntityAnimation(const cEntity & a_Entity, char a_Animatio cCSLock Lock(m_CSPacket); WriteByte(PACKET_ANIMATION); WriteInt (a_Entity.GetUniqueID()); - WriteByte(a_Animation); + WriteChar(a_Animation); Flush(); } @@ -784,8 +760,8 @@ void cProtocol125::SendPlayerSpawn(const cPlayer & a_Player) WriteInt ((int)(a_Player.GetPosX() * 32)); WriteInt ((int)(a_Player.GetPosY() * 32)); WriteInt ((int)(a_Player.GetPosZ() * 32)); - WriteByte ((char)((a_Player.GetYaw() / 360.f) * 256)); - WriteByte ((char)((a_Player.GetPitch() / 360.f) * 256)); + WriteChar ((char)((a_Player.GetYaw() / 360.f) * 256)); + WriteChar ((char)((a_Player.GetPitch() / 360.f) * 256)); WriteShort (HeldItem.IsEmpty() ? 0 : HeldItem.m_ItemType); Flush(); } @@ -811,9 +787,9 @@ void cProtocol125::SendPluginMessage(const AString & a_Channel, const AString & void cProtocol125::SendRemoveEntityEffect(const cEntity & a_Entity, int a_EffectID) { cCSLock Lock(m_CSPacket); - WriteByte (PACKET_REMOVE_ENTITY_EFFECT); - WriteInt (a_Entity.GetUniqueID()); - WriteByte (a_EffectID); + WriteByte(PACKET_REMOVE_ENTITY_EFFECT); + WriteInt (a_Entity.GetUniqueID()); + WriteChar((char)a_EffectID); Flush(); } @@ -827,7 +803,7 @@ void cProtocol125::SendRespawn(void) WriteByte (PACKET_RESPAWN); WriteInt ((int)(m_Client->GetPlayer()->GetWorld()->GetDimension())); WriteByte (2); // TODO: Difficulty; 2 = Normal - WriteByte ((char)m_Client->GetPlayer()->GetGameMode()); + WriteChar ((char)m_Client->GetPlayer()->GetGameMode()); WriteShort (256); // Current world height WriteString("default"); } @@ -858,7 +834,7 @@ void cProtocol125::SendExperienceOrb(const cExpOrb & a_ExpOrb) WriteInt((int) a_ExpOrb.GetPosX()); WriteInt((int) a_ExpOrb.GetPosY()); WriteInt((int) a_ExpOrb.GetPosZ()); - WriteShort(a_ExpOrb.GetReward()); + WriteShort((short)a_ExpOrb.GetReward()); Flush(); } @@ -899,7 +875,7 @@ void cProtocol125::SendSpawnMob(const cMonster & a_Mob) cCSLock Lock(m_CSPacket); WriteByte (PACKET_SPAWN_MOB); WriteInt (a_Mob.GetUniqueID()); - WriteByte (a_Mob.GetMobType()); + WriteByte ((Byte)a_Mob.GetMobType()); WriteVectorI((Vector3i)(a_Mob.GetPosition() * 32)); WriteByte (0); WriteByte (0); @@ -924,7 +900,7 @@ void cProtocol125::SendSpawnObject(const cEntity & a_Entity, char a_ObjectType, cCSLock Lock(m_CSPacket); WriteByte(PACKET_SPAWN_OBJECT); WriteInt (a_Entity.GetUniqueID()); - WriteByte(a_ObjectType); + WriteChar(a_ObjectType); WriteInt ((int)(a_Entity.GetPosX() * 32)); WriteInt ((int)(a_Entity.GetPosY() * 32)); WriteInt ((int)(a_Entity.GetPosZ() * 32)); @@ -949,7 +925,7 @@ void cProtocol125::SendSpawnVehicle(const cEntity & a_Vehicle, char a_VehicleTyp cCSLock Lock(m_CSPacket); WriteByte (PACKET_SPAWN_OBJECT); WriteInt (a_Vehicle.GetUniqueID()); - WriteByte (a_VehicleType); + WriteChar (a_VehicleType); WriteInt ((int)(a_Vehicle.GetPosX() * 32)); WriteInt ((int)(a_Vehicle.GetPosY() * 32)); WriteInt ((int)(a_Vehicle.GetPosZ() * 32)); @@ -987,8 +963,8 @@ void cProtocol125::SendTeleportEntity(const cEntity & a_Entity) WriteInt ((int)(floor(a_Entity.GetPosX() * 32))); WriteInt ((int)(floor(a_Entity.GetPosY() * 32))); WriteInt ((int)(floor(a_Entity.GetPosZ() * 32))); - WriteByte ((char)((a_Entity.GetYaw() / 360.f) * 256)); - WriteByte ((char)((a_Entity.GetPitch() / 360.f) * 256)); + WriteChar ((char)((a_Entity.GetYaw() / 360.f) * 256)); + WriteChar ((char)((a_Entity.GetPitch() / 360.f) * 256)); Flush(); } @@ -1063,7 +1039,7 @@ void cProtocol125::SendUseBed(const cEntity & a_Entity, int a_BlockX, int a_Bloc WriteInt (a_Entity.GetUniqueID()); WriteByte(0); // Unknown byte only 0 has been observed WriteInt (a_BlockX); - WriteByte(a_BlockY); + WriteByte((Byte)a_BlockY); WriteInt (a_BlockZ); Flush(); } @@ -1107,7 +1083,7 @@ void cProtocol125::SendWholeInventory(const cWindow & a_Window) cCSLock Lock(m_CSPacket); cItems Slots; a_Window.GetSlots(*(m_Client->GetPlayer()), Slots); - SendWindowSlots(a_Window.GetWindowID(), Slots.size(), &(Slots[0])); + SendWindowSlots(a_Window.GetWindowID(), (int)Slots.size(), &(Slots[0])); } @@ -1124,7 +1100,7 @@ void cProtocol125::SendWindowClose(const cWindow & a_Window) cCSLock Lock(m_CSPacket); WriteByte(PACKET_WINDOW_CLOSE); - WriteByte(a_Window.GetWindowID()); + WriteChar(a_Window.GetWindowID()); Flush(); } @@ -1141,10 +1117,10 @@ void cProtocol125::SendWindowOpen(const cWindow & a_Window) } cCSLock Lock(m_CSPacket); WriteByte (PACKET_WINDOW_OPEN); - WriteByte (a_Window.GetWindowID()); - WriteByte (a_Window.GetWindowType()); + WriteChar (a_Window.GetWindowID()); + WriteByte ((Byte)a_Window.GetWindowType()); WriteString(a_Window.GetWindowTitle()); - WriteByte (a_Window.GetNumNonInventorySlots()); + WriteByte ((Byte)a_Window.GetNumNonInventorySlots()); Flush(); } @@ -1156,7 +1132,7 @@ void cProtocol125::SendWindowProperty(const cWindow & a_Window, short a_Property { cCSLock Lock(m_CSPacket); WriteByte (PACKET_WINDOW_PROPERTY); - WriteByte (a_Window.GetWindowID()); + WriteChar (a_Window.GetWindowID()); WriteShort(a_Property); WriteShort(a_Value); Flush(); @@ -1177,7 +1153,7 @@ AString cProtocol125::GetAuthServerID(void) -void cProtocol125::SendData(const char * a_Data, int a_Size) +void cProtocol125::SendData(const char * a_Data, size_t a_Size) { m_Client->SendData(a_Data, a_Size); } @@ -1548,7 +1524,7 @@ int cProtocol125::ParsePluginMessage(void) HANDLE_PACKET_READ(ReadBEUTF16String16, AString, ChannelName); HANDLE_PACKET_READ(ReadBEShort, short, Length); AString Data; - if (!m_ReceivedData.ReadString(Data, Length)) + if (!m_ReceivedData.ReadString(Data, (size_t)Length)) { m_ReceivedData.CheckValid(); return PARSE_INCOMPLETE; @@ -1709,7 +1685,7 @@ void cProtocol125::SendPreChunk(int a_ChunkX, int a_ChunkZ, bool a_ShouldLoad) void cProtocol125::SendWindowSlots(char a_WindowID, int a_NumItems, const cItem * a_Items) { WriteByte (PACKET_INVENTORY_WHOLE); - WriteByte (a_WindowID); + WriteChar (a_WindowID); WriteShort((short)a_NumItems); for (int j = 0; j < a_NumItems; j++) @@ -1739,7 +1715,7 @@ void cProtocol125::WriteItem(const cItem & a_Item) return; } - WriteByte (a_Item.m_ItemCount); + WriteChar (a_Item.m_ItemCount); WriteShort(a_Item.m_ItemDamage); if (cItem::IsEnchantable(a_Item.m_ItemType)) @@ -1786,7 +1762,7 @@ int cProtocol125::ParseItem(cItem & a_Item) } // TODO: Enchantment not implemented yet! - if (!m_ReceivedData.SkipRead(EnchantNumBytes)) + if (!m_ReceivedData.SkipRead((size_t)EnchantNumBytes)) { return PARSE_INCOMPLETE; } @@ -1871,7 +1847,7 @@ void cProtocol125::WriteMobMetadata(const cMonster & a_Mob) case cMonster::mtCreeper: { WriteByte(0x10); - WriteByte(((const cCreeper &)a_Mob).IsBlowing() ? 1 : -1); // Blowing up? + WriteChar(((const cCreeper &)a_Mob).IsBlowing() ? 1 : -1); // Blowing up? WriteByte(0x11); WriteByte(((const cCreeper &)a_Mob).IsCharged() ? 1 : 0); // Lightning-charged? break; @@ -1941,9 +1917,9 @@ void cProtocol125::WriteMobMetadata(const cMonster & a_Mob) WriteByte(0x10); Byte SheepMetadata = 0; - SheepMetadata = ((const cSheep &)a_Mob).GetFurColor(); // Fur colour + SheepMetadata = (Byte)((const cSheep &)a_Mob).GetFurColor(); - if (((const cSheep &)a_Mob).IsSheared()) // Is sheared? + if (((const cSheep &)a_Mob).IsSheared()) { SheepMetadata |= 0x16; } @@ -1972,17 +1948,25 @@ void cProtocol125::WriteMobMetadata(const cMonster & a_Mob) WriteByte(((const cWitch &)a_Mob).IsAngry() ? 1 : 0); // Aggravated? Doesn't seem to do anything break; } + case cMonster::mtWither: + { + WriteByte(0x54); // Int at index 20 + WriteInt((Int32)((const cWither &)a_Mob).GetNumInvulnerableTicks()); + WriteByte(0x66); // Float at index 6 + WriteFloat((float)(a_Mob.GetHealth())); + break; + } case cMonster::mtSlime: case cMonster::mtMagmaCube: { WriteByte(0x10); if (a_Mob.GetMobType() == cMonster::mtSlime) { - WriteByte(((const cSlime &)a_Mob).GetSize()); // Size of slime - HEWGE, meh, cute BABBY SLIME + WriteByte((Byte)((const cSlime &)a_Mob).GetSize()); // Size of slime - HEWGE, meh, cute BABBY SLIME } else { - WriteByte(((const cMagmaCube &)a_Mob).GetSize()); // Size of slime - HEWGE, meh, cute BABBY SLIME + WriteByte((Byte)((const cMagmaCube &)a_Mob).GetSize()); // Size of slime - HEWGE, meh, cute BABBY SLIME } break; } @@ -2021,7 +2005,7 @@ void cProtocol125::WriteMobMetadata(const cMonster & a_Mob) WriteInt(Flags); WriteByte(0x13); - WriteByte(((const cHorse &)a_Mob).GetHorseType()); // Type of horse (donkey, chestnut, etc.) + WriteByte((Byte)((const cHorse &)a_Mob).GetHorseType()); // Type of horse (donkey, chestnut, etc.) WriteByte(0x54); int Appearance = 0; @@ -2033,6 +2017,10 @@ void cProtocol125::WriteMobMetadata(const cMonster & a_Mob) WriteInt(((const cHorse &)a_Mob).GetHorseArmour()); // Horshey armour break; } + default: + { + break; + } } } diff --git a/src/Protocol/Protocol125.h b/src/Protocol/Protocol125.h index aca24c03a..08d3ebbe9 100644 --- a/src/Protocol/Protocol125.h +++ b/src/Protocol/Protocol125.h @@ -125,7 +125,7 @@ protected: AString m_Username; ///< Stored in ParseHandshake(), compared to Login username - virtual void SendData(const char * a_Data, int a_Size) override; + virtual void SendData(const char * a_Data, size_t a_Size) override; /// Sends the Handshake packet void SendHandshake(const AString & a_ConnectionHash); diff --git a/src/Protocol/Protocol132.cpp b/src/Protocol/Protocol132.cpp index be9c503ed..ce5942a5c 100644 --- a/src/Protocol/Protocol132.cpp +++ b/src/Protocol/Protocol132.cpp @@ -115,7 +115,7 @@ void cProtocol132::DataReceived(const char * a_Data, size_t a_Size) Byte Decrypted[512]; while (a_Size > 0) { - int NumBytes = (a_Size > (int)sizeof(Decrypted)) ? (int)sizeof(Decrypted) : a_Size; + size_t NumBytes = (a_Size > sizeof(Decrypted)) ? sizeof(Decrypted) : a_Size; m_Decryptor.ProcessData(Decrypted, (Byte *)a_Data, NumBytes); super::DataReceived((const char *)Decrypted, NumBytes); a_Size -= NumBytes; @@ -139,8 +139,8 @@ void cProtocol132::SendBlockAction(int a_BlockX, int a_BlockY, int a_BlockZ, cha WriteInt (a_BlockX); WriteShort((short)a_BlockY); WriteInt (a_BlockZ); - WriteByte (a_Byte1); - WriteByte (a_Byte2); + WriteChar (a_Byte1); + WriteChar (a_Byte2); WriteShort(a_BlockType); Flush(); } @@ -157,7 +157,7 @@ void cProtocol132::SendBlockBreakAnim(int a_entityID, int a_BlockX, int a_BlockY WriteInt (a_BlockX); WriteInt (a_BlockY); WriteInt (a_BlockZ); - WriteByte (stage); + WriteChar (stage); Flush(); } @@ -259,7 +259,7 @@ void cProtocol132::SendLogin(const cPlayer & a_Player, const cWorld & a_World) WriteByte (PACKET_LOGIN); WriteInt (a_Player.GetUniqueID()); // EntityID of the player WriteString("default"); // Level type - WriteByte ((int)a_Player.GetGameMode()); + WriteByte ((Byte)a_Player.GetGameMode()); WriteByte ((Byte)(a_World.GetDimension())); WriteByte (2); // TODO: Difficulty WriteByte (0); // Unused, used to be world height @@ -283,8 +283,8 @@ void cProtocol132::SendPlayerSpawn(const cPlayer & a_Player) WriteInt ((int)(a_Player.GetPosX() * 32)); WriteInt ((int)(a_Player.GetPosY() * 32)); WriteInt ((int)(a_Player.GetPosZ() * 32)); - WriteByte ((char)((a_Player.GetYaw() / 360.f) * 256)); - WriteByte ((char)((a_Player.GetPitch() / 360.f) * 256)); + WriteChar ((char)((a_Player.GetYaw() / 360.f) * 256)); + WriteChar ((char)((a_Player.GetPitch() / 360.f) * 256)); WriteShort (HeldItem.IsEmpty() ? 0 : HeldItem.m_ItemType); // Player metadata: just use a default metadata value, since the client doesn't like starting without any metadata: WriteByte (0); // Index 0, byte (flags) @@ -306,7 +306,7 @@ void cProtocol132::SendSoundEffect(const AString & a_SoundName, int a_SrcX, int WriteInt (a_SrcY); WriteInt (a_SrcZ); WriteFloat (a_Volume); - WriteByte ((char)(a_Pitch * 63.0f)); + WriteChar ((char)(a_Pitch * 63.0f)); Flush(); } @@ -320,7 +320,7 @@ void cProtocol132::SendSoundParticleEffect(int a_EffectID, int a_SrcX, int a_Src WriteByte(PACKET_SOUND_PARTICLE_EFFECT); WriteInt (a_EffectID); WriteInt (a_SrcX); - WriteByte(a_SrcY); + WriteByte((Byte)a_SrcY); WriteInt (a_SrcZ); WriteInt (a_Data); Flush(); @@ -335,7 +335,7 @@ void cProtocol132::SendSpawnMob(const cMonster & a_Mob) cCSLock Lock(m_CSPacket); WriteByte (PACKET_SPAWN_MOB); WriteInt (a_Mob.GetUniqueID()); - WriteByte (a_Mob.GetMobType()); + WriteByte ((Byte)a_Mob.GetMobType()); WriteVectorI((Vector3i)(a_Mob.GetPosition() * 32)); WriteByte ((Byte)((a_Mob.GetYaw() / 360.f) * 256)); WriteByte ((Byte)((a_Mob.GetPitch() / 360.f) * 256)); @@ -411,12 +411,12 @@ void cProtocol132::SendWholeInventory(const cWindow & a_Window) const cInventory & Inventory = m_Client->GetPlayer()->GetInventory(); int BaseOffset = a_Window.GetNumSlots() - (cInventory::invNumSlots - cInventory::invInventoryOffset); // Number of non-inventory slots char WindowID = a_Window.GetWindowID(); - for (int i = 0; i < cInventory::invInventoryCount; i++) + for (short i = 0; i < cInventory::invInventoryCount; i++) { SendInventorySlot(WindowID, BaseOffset + i, Inventory.GetInventorySlot(i)); } // for i - Inventory[] BaseOffset += cInventory::invInventoryCount; - for (int i = 0; i < cInventory::invHotbarCount; i++) + for (short i = 0; i < cInventory::invHotbarCount; i++) { SendInventorySlot(WindowID, BaseOffset + i, Inventory.GetHotbarSlot(i)); } // for i - Hotbar[] @@ -527,21 +527,30 @@ int cProtocol132::ParseClientStatuses(void) int cProtocol132::ParseEncryptionKeyResponse(void) { + // Read the encryption key: HANDLE_PACKET_READ(ReadBEShort, short, EncKeyLength); + if (EncKeyLength > MAX_ENC_LEN) + { + LOGD("Too long encryption key"); + m_Client->Kick("Hacked client"); + return PARSE_OK; + } AString EncKey; - if (!m_ReceivedData.ReadString(EncKey, EncKeyLength)) + if (!m_ReceivedData.ReadString(EncKey, (size_t)EncKeyLength)) { return PARSE_INCOMPLETE; } + + // Read the encryption nonce: HANDLE_PACKET_READ(ReadBEShort, short, EncNonceLength); AString EncNonce; - if (!m_ReceivedData.ReadString(EncNonce, EncNonceLength)) + if (!m_ReceivedData.ReadString(EncNonce, (size_t)EncNonceLength)) { return PARSE_INCOMPLETE; } - if ((EncKeyLength > MAX_ENC_LEN) || (EncNonceLength > MAX_ENC_LEN)) + if (EncNonceLength > MAX_ENC_LEN) { - LOGD("Too long encryption"); + LOGD("Too long encryption nonce"); m_Client->Kick("Hacked client"); return PARSE_OK; } @@ -605,7 +614,7 @@ int cProtocol132::ParseTabCompletion(void) -void cProtocol132::SendData(const char * a_Data, int a_Size) +void cProtocol132::SendData(const char * a_Data, size_t a_Size) { m_DataToSend.append(a_Data, a_Size); } @@ -623,23 +632,23 @@ void cProtocol132::Flush(void) LOGD("Flushing empty"); return; } - const char * a_Data = m_DataToSend.data(); - int a_Size = m_DataToSend.size(); + const char * Data = m_DataToSend.data(); + size_t Size = m_DataToSend.size(); if (m_IsEncrypted) { Byte Encrypted[8192]; // Larger buffer, we may be sending lots of data (chunks) - while (a_Size > 0) + while (Size > 0) { - int NumBytes = (a_Size > (int)sizeof(Encrypted)) ? (int)sizeof(Encrypted) : a_Size; - m_Encryptor.ProcessData(Encrypted, (Byte *)a_Data, NumBytes); + size_t NumBytes = (Size > sizeof(Encrypted)) ? sizeof(Encrypted) : Size; + m_Encryptor.ProcessData(Encrypted, (Byte *)Data, NumBytes); super::SendData((const char *)Encrypted, NumBytes); - a_Size -= NumBytes; - a_Data += NumBytes; + Size -= NumBytes; + Data += NumBytes; } } else { - super::SendData(a_Data, a_Size); + super::SendData(Data, Size); } m_DataToSend.clear(); } @@ -665,7 +674,7 @@ void cProtocol132::WriteItem(const cItem & a_Item) } WriteShort(ItemType); - WriteByte (a_Item.m_ItemCount); + WriteChar (a_Item.m_ItemCount); WriteShort(a_Item.m_ItemDamage); if (a_Item.m_Enchantments.IsEmpty()) @@ -681,7 +690,7 @@ void cProtocol132::WriteItem(const cItem & a_Item) Writer.Finish(); AString Compressed; CompressStringGZIP(Writer.GetResult().data(), Writer.GetResult().size(), Compressed); - WriteShort(Compressed.size()); + WriteShort((short)Compressed.size()); SendData(Compressed.data(), Compressed.size()); } @@ -717,8 +726,8 @@ int cProtocol132::ParseItem(cItem & a_Item) // Read the metadata AString Metadata; - Metadata.resize(MetadataLength); - if (!m_ReceivedData.ReadBuf((void *)Metadata.data(), MetadataLength)) + Metadata.resize((size_t)MetadataLength); + if (!m_ReceivedData.ReadBuf((void *)Metadata.data(), (size_t)MetadataLength)) { return PARSE_INCOMPLETE; } diff --git a/src/Protocol/Protocol132.h b/src/Protocol/Protocol132.h index 0702fbf5a..b280c8a41 100644 --- a/src/Protocol/Protocol132.h +++ b/src/Protocol/Protocol132.h @@ -87,7 +87,7 @@ protected: /// The ServerID used for session authentication; set in StartEncryption(), used in GetAuthServerID() AString m_AuthServerID; - virtual void SendData(const char * a_Data, int a_Size) override; + virtual void SendData(const char * a_Data, size_t a_Size) override; // DEBUG: virtual void Flush(void) override; diff --git a/src/Protocol/Protocol14x.cpp b/src/Protocol/Protocol14x.cpp index 232b2718e..f694af1eb 100644 --- a/src/Protocol/Protocol14x.cpp +++ b/src/Protocol/Protocol14x.cpp @@ -103,9 +103,9 @@ void cProtocol142::SendPickupSpawn(const cPickup & a_Pickup) WriteInt (a_Pickup.GetUniqueID()); WriteItem (a_Pickup.GetItem()); WriteVectorI((Vector3i)(a_Pickup.GetPosition() * 32)); - WriteByte ((char)(a_Pickup.GetSpeed().x * 8)); - WriteByte ((char)(a_Pickup.GetSpeed().y * 8)); - WriteByte ((char)(a_Pickup.GetSpeed().z * 8)); + WriteChar ((char)(a_Pickup.GetSpeed().x * 8)); + WriteChar ((char)(a_Pickup.GetSpeed().y * 8)); + WriteChar ((char)(a_Pickup.GetSpeed().z * 8)); Flush(); } @@ -119,7 +119,7 @@ void cProtocol142::SendSoundParticleEffect(int a_EffectID, int a_SrcX, int a_Src WriteByte(PACKET_SOUND_PARTICLE_EFFECT); WriteInt (a_EffectID); WriteInt (a_SrcX); - WriteByte(a_SrcY); + WriteByte((Byte)a_SrcY); WriteInt (a_SrcZ); WriteInt (a_Data); WriteBool(0); @@ -218,7 +218,7 @@ void cProtocol146::SendSpawnObject(const cEntity & a_Entity, char a_ObjectType, cCSLock Lock(m_CSPacket); WriteByte(PACKET_SPAWN_OBJECT); WriteInt (a_Entity.GetUniqueID()); - WriteByte(a_ObjectType); + WriteChar(a_ObjectType); WriteInt ((int)(a_Entity.GetPosX() * 32)); WriteInt ((int)(a_Entity.GetPosY() * 32)); WriteInt ((int)(a_Entity.GetPosZ() * 32)); @@ -243,7 +243,7 @@ void cProtocol146::SendSpawnVehicle(const cEntity & a_Vehicle, char a_VehicleTyp cCSLock Lock(m_CSPacket); WriteByte (PACKET_SPAWN_OBJECT); WriteInt (a_Vehicle.GetUniqueID()); - WriteByte (a_VehicleType); + WriteChar (a_VehicleType); WriteInt ((int)(a_Vehicle.GetPosX() * 32)); WriteInt ((int)(a_Vehicle.GetPosY() * 32)); WriteInt ((int)(a_Vehicle.GetPosZ() * 32)); diff --git a/src/Protocol/Protocol16x.cpp b/src/Protocol/Protocol16x.cpp index ecb24254f..bf7d9a0b1 100644 --- a/src/Protocol/Protocol16x.cpp +++ b/src/Protocol/Protocol16x.cpp @@ -119,7 +119,7 @@ void cProtocol161::SendHealth(void) cCSLock Lock(m_CSPacket); WriteByte (PACKET_UPDATE_HEALTH); WriteFloat((float)m_Client->GetPlayer()->GetHealth()); - WriteShort(m_Client->GetPlayer()->GetFoodLevel()); + WriteShort((short)m_Client->GetPlayer()->GetFoodLevel()); WriteFloat((float)m_Client->GetPlayer()->GetFoodSaturationLevel()); Flush(); } @@ -163,10 +163,10 @@ void cProtocol161::SendWindowOpen(const cWindow & a_Window) } cCSLock Lock(m_CSPacket); WriteByte (PACKET_WINDOW_OPEN); - WriteByte (a_Window.GetWindowID()); - WriteByte (a_Window.GetWindowType()); + WriteChar (a_Window.GetWindowID()); + WriteByte ((Byte)a_Window.GetWindowType()); WriteString(a_Window.GetWindowTitle()); - WriteByte (a_Window.GetNumNonInventorySlots()); + WriteByte ((Byte)a_Window.GetNumNonInventorySlots()); WriteByte (1); // Use title if (a_Window.GetWindowType() == cWindow::wtAnimalChest) { diff --git a/src/Protocol/Protocol17x.cpp b/src/Protocol/Protocol17x.cpp index 721ed349e..a4319df37 100644 --- a/src/Protocol/Protocol17x.cpp +++ b/src/Protocol/Protocol17x.cpp @@ -1236,7 +1236,7 @@ void cProtocol172::SendWindowProperty(const cWindow & a_Window, short a_Property -void cProtocol172::AddReceivedData(const char * a_Data, int a_Size) +void cProtocol172::AddReceivedData(const char * a_Data, size_t a_Size) { // Write the incoming data into the comm log file: if (g_ShouldLogCommIn) @@ -1258,7 +1258,7 @@ void cProtocol172::AddReceivedData(const char * a_Data, int a_Size) AString Hex; CreateHexDump(Hex, a_Data, a_Size, 16); m_CommLogFile.Printf("Incoming data: %d (0x%x) bytes: \n%s\n", - a_Size, a_Size, Hex.c_str() + (unsigned)a_Size, (unsigned)a_Size, Hex.c_str() ); m_CommLogFile.Flush(); } @@ -1988,14 +1988,14 @@ void cProtocol172::WritePacket(cByteBuffer & a_Packet) -void cProtocol172::SendData(const char * a_Data, int a_Size) +void cProtocol172::SendData(const char * a_Data, size_t a_Size) { if (m_IsEncrypted) { Byte Encrypted[8192]; // Larger buffer, we may be sending lots of data (chunks) while (a_Size > 0) { - size_t NumBytes = ((size_t)a_Size > sizeof(Encrypted)) ? sizeof(Encrypted) : (size_t)a_Size; + size_t NumBytes = (a_Size > sizeof(Encrypted)) ? sizeof(Encrypted) : a_Size; m_Encryptor.ProcessData(Encrypted, (Byte *)a_Data, NumBytes); m_Client->SendData((const char *)Encrypted, NumBytes); a_Size -= NumBytes; @@ -2535,6 +2535,7 @@ void cProtocol172::cPacketizer::WriteEntityMetadata(const cEntity & a_Entity) WriteByte(Frame.GetRotation()); break; } + default: break; } } @@ -2659,6 +2660,15 @@ void cProtocol172::cPacketizer::WriteMobMetadata(const cMonster & a_Mob) WriteByte(((const cWitch &)a_Mob).IsAngry() ? 1 : 0); break; } + + case cMonster::mtWither: + { + WriteByte(0x54); // Int at index 20 + WriteInt(((const cWither &)a_Mob).GetNumInvulnerableTicks()); + WriteByte(0x66); // Float at index 6 + WriteFloat((float)(a_Mob.GetHealth())); + break; + } case cMonster::mtSlime: { diff --git a/src/Protocol/Protocol17x.h b/src/Protocol/Protocol17x.h index 41163009e..91186b270 100644 --- a/src/Protocol/Protocol17x.h +++ b/src/Protocol/Protocol17x.h @@ -196,7 +196,7 @@ protected: m_Out.WriteVarUTF8String(a_Value); } - void WriteBuf(const char * a_Data, int a_Size) + void WriteBuf(const char * a_Data, size_t a_Size) { m_Out.Write(a_Data, a_Size); } @@ -243,7 +243,7 @@ protected: /** Adds the received (unencrypted) data to m_ReceivedData, parses complete packets */ - void AddReceivedData(const char * a_Data, int a_Size); + void AddReceivedData(const char * a_Data, size_t a_Size); /** Reads and handles the packet. The packet length and type have already been read. Returns true if the packet was understood, false if it was an unknown packet @@ -287,7 +287,7 @@ protected: void WritePacket(cByteBuffer & a_Packet); /** Sends the data to the client, encrypting them if needed. */ - virtual void SendData(const char * a_Data, int a_Size) override; + virtual void SendData(const char * a_Data, size_t a_Size) override; void SendCompass(const cWorld & a_World); diff --git a/src/Protocol/ProtocolRecognizer.cpp b/src/Protocol/ProtocolRecognizer.cpp index 3b9003e60..3f7d7b254 100644 --- a/src/Protocol/ProtocolRecognizer.cpp +++ b/src/Protocol/ProtocolRecognizer.cpp @@ -794,7 +794,7 @@ AString cProtocolRecognizer::GetAuthServerID(void) -void cProtocolRecognizer::SendData(const char * a_Data, int a_Size) +void cProtocolRecognizer::SendData(const char * a_Data, size_t a_Size) { // This is used only when handling the server ping m_Client->SendData(a_Data, a_Size); @@ -854,7 +854,7 @@ bool cProtocolRecognizer::TryRecognizeProtocol(void) // This must be a lengthed protocol, try if it has the entire initial handshake packet: m_Buffer.ResetRead(); UInt32 PacketLen; - UInt32 ReadSoFar = m_Buffer.GetReadableSpace(); + UInt32 ReadSoFar = (UInt32)m_Buffer.GetReadableSpace(); if (!m_Buffer.ReadVarInt(PacketLen)) { // Not enough bytes for the packet length, keep waiting @@ -931,7 +931,7 @@ bool cProtocolRecognizer::TryRecognizeLengthlessProtocol(void) bool cProtocolRecognizer::TryRecognizeLengthedProtocol(UInt32 a_PacketLengthRemaining) { UInt32 PacketType; - UInt32 NumBytesRead = m_Buffer.GetReadableSpace(); + UInt32 NumBytesRead = (UInt32)m_Buffer.GetReadableSpace(); if (!m_Buffer.ReadVarInt(PacketType)) { return false; @@ -962,7 +962,7 @@ bool cProtocolRecognizer::TryRecognizeLengthedProtocol(UInt32 a_PacketLengthRema m_Buffer.ReadBEShort(ServerPort); m_Buffer.ReadVarInt(NextState); m_Buffer.CommitRead(); - m_Protocol = new cProtocol172(m_Client, ServerAddress, ServerPort, NextState); + m_Protocol = new cProtocol172(m_Client, ServerAddress, (UInt16)ServerPort, NextState); return true; } } diff --git a/src/Protocol/ProtocolRecognizer.h b/src/Protocol/ProtocolRecognizer.h index d7fb8fad2..072d7c2d2 100644 --- a/src/Protocol/ProtocolRecognizer.h +++ b/src/Protocol/ProtocolRecognizer.h @@ -133,7 +133,7 @@ public: virtual AString GetAuthServerID(void) override; - virtual void SendData(const char * a_Data, int a_Size) override; + virtual void SendData(const char * a_Data, size_t a_Size) override; protected: cProtocol * m_Protocol; //< The recognized protocol diff --git a/src/RCONServer.cpp b/src/RCONServer.cpp index 72f2d9ba9..d7083ff2b 100644 --- a/src/RCONServer.cpp +++ b/src/RCONServer.cpp @@ -169,7 +169,7 @@ cRCONServer::cConnection::cConnection(cRCONServer & a_RCONServer, cSocket & a_So -void cRCONServer::cConnection::DataReceived(const char * a_Data, int a_Size) +void cRCONServer::cConnection::DataReceived(const char * a_Data, size_t a_Size) { // Append data to the buffer: m_Buffer.append(a_Data, a_Size); diff --git a/src/RCONServer.h b/src/RCONServer.h index 0e89800a2..b964852ab 100644 --- a/src/RCONServer.h +++ b/src/RCONServer.h @@ -29,7 +29,7 @@ class cRCONServer : { public: cRCONServer(cServer & a_Server); - ~cRCONServer(); + virtual ~cRCONServer(); void Initialize(cIniFile & a_IniFile); @@ -65,7 +65,7 @@ protected: // cSocketThreads::cCallback overrides: - virtual void DataReceived(const char * a_Data, int a_Size) override; + virtual void DataReceived(const char * a_Data, size_t a_Size) override; virtual void GetOutgoingData(AString & a_Data) override; virtual void SocketClosed(void) override; diff --git a/src/Root.cpp b/src/Root.cpp index 3555afb45..ba4398b35 100644 --- a/src/Root.cpp +++ b/src/Root.cpp @@ -304,6 +304,7 @@ void cRoot::LoadWorlds(cIniFile & IniFile) { if (IniFile.GetKeyComment("Worlds", 0) != " World=secondworld") { + IniFile.DeleteKeyComment("Worlds", 0); IniFile.AddKeyComment("Worlds", " World=secondworld"); } } diff --git a/src/Simulator/FluidSimulator.cpp b/src/Simulator/FluidSimulator.cpp index 61c93ed73..7779573d7 100644 --- a/src/Simulator/FluidSimulator.cpp +++ b/src/Simulator/FluidSimulator.cpp @@ -36,6 +36,7 @@ bool cFluidSimulator::CanWashAway(BLOCKTYPE a_BlockType) case E_BLOCK_COBWEB: case E_BLOCK_CROPS: case E_BLOCK_DEAD_BUSH: + case E_BLOCK_LILY_PAD: case E_BLOCK_RAIL: case E_BLOCK_REDSTONE_TORCH_OFF: case E_BLOCK_REDSTONE_TORCH_ON: diff --git a/src/StringCompression.cpp b/src/StringCompression.cpp index 5b9a3bb0a..2a85649a1 100644 --- a/src/StringCompression.cpp +++ b/src/StringCompression.cpp @@ -53,7 +53,7 @@ int UncompressString(const char * a_Data, int a_Length, AString & a_Uncompressed -int CompressStringGZIP(const char * a_Data, int a_Length, AString & a_Compressed) +int CompressStringGZIP(const char * a_Data, size_t a_Length, AString & a_Compressed) { // Compress a_Data into a_Compressed using GZIP; return Z_XXX error constants same as zlib's compress2() @@ -83,6 +83,7 @@ int CompressStringGZIP(const char * a_Data, int a_Length, AString & a_Compressed { // Some data has been compressed. Consume the buffer and continue compressing a_Compressed.append(Buffer, sizeof(Buffer) - strm.avail_out); + strm.next_out = (Bytef *)Buffer; strm.avail_out = sizeof(Buffer); if (strm.avail_in == 0) { @@ -116,7 +117,7 @@ int CompressStringGZIP(const char * a_Data, int a_Length, AString & a_Compressed -extern int UncompressStringGZIP(const char * a_Data, int a_Length, AString & a_Uncompressed) +extern int UncompressStringGZIP(const char * a_Data, size_t a_Length, AString & a_Uncompressed) { // Uncompresses a_Data into a_Uncompressed using GZIP; returns Z_OK for success or Z_XXX error constants same as zlib @@ -139,13 +140,14 @@ extern int UncompressStringGZIP(const char * a_Data, int a_Length, AString & a_U for (;;) { - res = inflate(&strm, Z_FINISH); + res = inflate(&strm, Z_NO_FLUSH); switch (res) { case Z_OK: { // Some data has been uncompressed. Consume the buffer and continue uncompressing a_Uncompressed.append(Buffer, sizeof(Buffer) - strm.avail_out); + strm.next_out = (Bytef *)Buffer; strm.avail_out = sizeof(Buffer); if (strm.avail_in == 0) { diff --git a/src/StringCompression.h b/src/StringCompression.h index 3f4e12d2d..c3a9eca91 100644 --- a/src/StringCompression.h +++ b/src/StringCompression.h @@ -16,10 +16,10 @@ extern int CompressString(const char * a_Data, int a_Length, AString & a_Compres extern int UncompressString(const char * a_Data, int a_Length, AString & a_Uncompressed, int a_UncompressedSize); /// Compresses a_Data into a_Compressed using GZIP; returns Z_OK for success or Z_XXX error constants same as zlib -extern int CompressStringGZIP(const char * a_Data, int a_Length, AString & a_Compressed); +extern int CompressStringGZIP(const char * a_Data, size_t a_Length, AString & a_Compressed); /// Uncompresses a_Data into a_Uncompressed using GZIP; returns Z_OK for success or Z_XXX error constants same as zlib -extern int UncompressStringGZIP(const char * a_Data, int a_Length, AString & a_Uncompressed); +extern int UncompressStringGZIP(const char * a_Data, size_t a_Length, AString & a_Uncompressed); diff --git a/src/StringUtils.cpp b/src/StringUtils.cpp index ad622d707..33b04505f 100644 --- a/src/StringUtils.cpp +++ b/src/StringUtils.cpp @@ -531,32 +531,32 @@ AString & UTF8ToRawBEUTF16(const char * a_UTF8, size_t a_UTF8Length, AString & a format binary data this way: 00001234: 31 32 33 34 35 36 37 38 39 30 61 62 63 64 65 66 1234567890abcdef */ -AString & CreateHexDump(AString & a_Out, const void * a_Data, int a_Size, int a_LineLength) +AString & CreateHexDump(AString & a_Out, const void * a_Data, size_t a_Size, size_t a_BytesPerLine) { - ASSERT(a_LineLength <= 120); // Due to using a fixed size line buffer; increase line[]'s size to lift this max + ASSERT(a_BytesPerLine <= 120); // Due to using a fixed size line buffer; increase line[]'s size to lift this max char line[512]; char * p; char * q; - a_Out.reserve(a_Size / a_LineLength * (18 + 6 * a_LineLength)); - for (int i = 0; i < a_Size; i += a_LineLength) + a_Out.reserve(a_Size / a_BytesPerLine * (18 + 6 * a_BytesPerLine)); + for (size_t i = 0; i < a_Size; i += a_BytesPerLine) { - int k = a_Size - i; - if (k > a_LineLength) + size_t k = a_Size - i; + if (k > a_BytesPerLine) { - k = a_LineLength; + k = a_BytesPerLine; } #ifdef _MSC_VER // MSVC provides a "secure" version of sprintf() - int Count = sprintf_s(line, sizeof(line), "%08x:", i); + int Count = sprintf_s(line, sizeof(line), "%08x:", (unsigned)i); #else - int Count = sprintf(line, "%08x:", i); + int Count = sprintf(line, "%08x:", (unsigned)i); #endif // Remove the terminating NULL / leftover garbage in line, after the sprintf-ed value memset(line + Count, 32, sizeof(line) - Count); p = line + 10; - q = p + 2 + a_LineLength * 3 + 1; - for (int j = 0; j < k; j++) + q = p + 2 + a_BytesPerLine * 3 + 1; + for (size_t j = 0; j < k; j++) { unsigned char c = ((unsigned char *)a_Data)[i + j]; p[0] = HEX(c >> 4); diff --git a/src/StringUtils.h b/src/StringUtils.h index 4feff7553..b69e47d3c 100644 --- a/src/StringUtils.h +++ b/src/StringUtils.h @@ -64,7 +64,7 @@ extern AString & RawBEToUTF8(const char * a_RawData, int a_NumShorts, AString & extern AString & UTF8ToRawBEUTF16(const char * a_UTF8, size_t a_UTF8Length, AString & a_UTF16); /// Creates a nicely formatted HEX dump of the given memory block. Max a_BytesPerLine is 120 -extern AString & CreateHexDump(AString & a_Out, const void * a_Data, int a_Size, int a_BytesPerLine); +extern AString & CreateHexDump(AString & a_Out, const void * a_Data, size_t a_Size, size_t a_BytesPerLine); /// Returns a copy of a_Message with all quotes and backslashes escaped by a backslash extern AString EscapeString(const AString & a_Message); // tolua_export @@ -79,10 +79,10 @@ extern AString URLDecode(const AString & a_String); // Cannot export to Lua aut extern AString ReplaceAllCharOccurrences(const AString & a_String, char a_From, char a_To); // Needn't export to Lua, since Lua doesn't have chars anyway /// Decodes a Base64-encoded string into the raw data -extern AString Base64Decode(const AString & a_Base64String); +extern AString Base64Decode(const AString & a_Base64String); // Exported manually due to embedded NULs and extra parameter /// Encodes a string into Base64 -extern AString Base64Encode(const AString & a_Input); +extern AString Base64Encode(const AString & a_Input); // Exported manually due to embedded NULs and extra parameter /// Reads two bytes from the specified memory location and interprets them as BigEndian short extern short GetBEShort(const char * a_Mem); diff --git a/src/UI/WindowOwner.h b/src/UI/WindowOwner.h index d41abf66d..e3c73edc4 100644 --- a/src/UI/WindowOwner.h +++ b/src/UI/WindowOwner.h @@ -33,6 +33,10 @@ public: { } + virtual ~cWindowOwner() + { + } + void CloseWindow(void) { m_Window = NULL; diff --git a/src/WebAdmin.cpp b/src/WebAdmin.cpp index 402cd3035..cd141f7eb 100644 --- a/src/WebAdmin.cpp +++ b/src/WebAdmin.cpp @@ -490,7 +490,7 @@ void cWebAdmin::OnRequestBegun(cHTTPConnection & a_Connection, cHTTPRequest & a_ -void cWebAdmin::OnRequestBody(cHTTPConnection & a_Connection, cHTTPRequest & a_Request, const char * a_Data, int a_Size) +void cWebAdmin::OnRequestBody(cHTTPConnection & a_Connection, cHTTPRequest & a_Request, const char * a_Data, size_t a_Size) { UNUSED(a_Connection); cRequestData * Data = (cRequestData *)(a_Request.GetUserData()); @@ -537,7 +537,7 @@ void cWebAdmin::OnRequestFinished(cHTTPConnection & a_Connection, cHTTPRequest & /////////////////////////////////////////////////////////////////////////////////////////////////////////////////////// // cWebAdmin::cWebadminRequestData -void cWebAdmin::cWebadminRequestData::OnBody(const char * a_Data, int a_Size) +void cWebAdmin::cWebadminRequestData::OnBody(const char * a_Data, size_t a_Size) { m_Form.Parse(a_Data, a_Size); } diff --git a/src/WebAdmin.h b/src/WebAdmin.h index a2a07a543..d5e45828f 100644 --- a/src/WebAdmin.h +++ b/src/WebAdmin.h @@ -151,7 +151,7 @@ protected: virtual ~cRequestData() {} // Force a virtual destructor in all descendants /** Called when a new chunk of body data is received */ - virtual void OnBody(const char * a_Data, int a_Size) = 0; + virtual void OnBody(const char * a_Data, size_t a_Size) = 0; } ; /** The body handler for requests in the "/webadmin" and "/~webadmin" paths */ @@ -169,14 +169,14 @@ protected: } // cRequestData overrides: - virtual void OnBody(const char * a_Data, int a_Size) override; + virtual void OnBody(const char * a_Data, size_t a_Size) override; // cHTTPFormParser::cCallbacks overrides. Files are ignored: - virtual void OnFileStart(cHTTPFormParser &, const AString & a_FileName) override + virtual void OnFileStart(cHTTPFormParser &, const AString & a_FileName) override { UNUSED(a_FileName); } - virtual void OnFileData(cHTTPFormParser &, const char * a_Data, int a_Size) override + virtual void OnFileData(cHTTPFormParser &, const char * a_Data, size_t a_Size) override { UNUSED(a_Data); UNUSED(a_Size); @@ -216,7 +216,7 @@ protected: // cHTTPServer::cCallbacks overrides: virtual void OnRequestBegun (cHTTPConnection & a_Connection, cHTTPRequest & a_Request) override; - virtual void OnRequestBody (cHTTPConnection & a_Connection, cHTTPRequest & a_Request, const char * a_Data, int a_Size) override; + virtual void OnRequestBody (cHTTPConnection & a_Connection, cHTTPRequest & a_Request, const char * a_Data, size_t a_Size) override; virtual void OnRequestFinished(cHTTPConnection & a_Connection, cHTTPRequest & a_Request) override; } ; // tolua_export diff --git a/src/World.h b/src/World.h index bb2eb0b21..b3ee94a27 100644 --- a/src/World.h +++ b/src/World.h @@ -646,9 +646,9 @@ public: // Various queues length queries (cannot be const, they lock their CS): inline int GetGeneratorQueueLength (void) { return m_Generator.GetQueueLength(); } // tolua_export - inline int GetLightingQueueLength (void) { return m_Lighting.GetQueueLength(); } // tolua_export - inline int GetStorageLoadQueueLength(void) { return m_Storage.GetLoadQueueLength(); } // tolua_export - inline int GetStorageSaveQueueLength(void) { return m_Storage.GetSaveQueueLength(); } // tolua_export + inline size_t GetLightingQueueLength (void) { return m_Lighting.GetQueueLength(); } // tolua_export + inline size_t GetStorageLoadQueueLength(void) { return m_Storage.GetLoadQueueLength(); } // tolua_export + inline size_t GetStorageSaveQueueLength(void) { return m_Storage.GetSaveQueueLength(); } // tolua_export void InitializeSpawn(void); diff --git a/src/WorldStorage/FastNBT.h b/src/WorldStorage/FastNBT.h index 1b8b09c21..5e5af3ca3 100644 --- a/src/WorldStorage/FastNBT.h +++ b/src/WorldStorage/FastNBT.h @@ -122,33 +122,33 @@ public: int GetRoot(void) const {return 0; } /** Returns the first child of the specified tag, or -1 if none / not applicable. */ - int GetFirstChild (int a_Tag) const { return m_Tags[a_Tag].m_FirstChild; } + int GetFirstChild (int a_Tag) const { return m_Tags[(size_t)a_Tag].m_FirstChild; } /** Returns the last child of the specified tag, or -1 if none / not applicable. */ - int GetLastChild (int a_Tag) const { return m_Tags[a_Tag].m_LastChild; } + int GetLastChild (int a_Tag) const { return m_Tags[(size_t)a_Tag].m_LastChild; } /** Returns the next sibling of the specified tag, or -1 if none. */ - int GetNextSibling(int a_Tag) const { return m_Tags[a_Tag].m_NextSibling; } + int GetNextSibling(int a_Tag) const { return m_Tags[(size_t)a_Tag].m_NextSibling; } /** Returns the previous sibling of the specified tag, or -1 if none. */ - int GetPrevSibling(int a_Tag) const { return m_Tags[a_Tag].m_PrevSibling; } + int GetPrevSibling(int a_Tag) const { return m_Tags[(size_t)a_Tag].m_PrevSibling; } /** Returns the length of the tag's data, in bytes. Not valid for Compound or List tags! */ int GetDataLength (int a_Tag) const { - ASSERT(m_Tags[a_Tag].m_Type != TAG_List); - ASSERT(m_Tags[a_Tag].m_Type != TAG_Compound); - return m_Tags[a_Tag].m_DataLength; + ASSERT(m_Tags[(size_t)a_Tag].m_Type != TAG_List); + ASSERT(m_Tags[(size_t)a_Tag].m_Type != TAG_Compound); + return m_Tags[(size_t)a_Tag].m_DataLength; } /** Returns the data stored in this tag. Not valid for Compound or List tags! */ const char * GetData(int a_Tag) const { - ASSERT(m_Tags[a_Tag].m_Type != TAG_List); - ASSERT(m_Tags[a_Tag].m_Type != TAG_Compound); - return m_Data + m_Tags[a_Tag].m_DataStart; + ASSERT(m_Tags[(size_t)a_Tag].m_Type != TAG_List); + ASSERT(m_Tags[(size_t)a_Tag].m_Type != TAG_Compound); + return m_Data + m_Tags[(size_t)a_Tag].m_DataStart; } /** Returns the direct child tag of the specified name, or -1 if no such tag. */ @@ -163,47 +163,47 @@ public: /** Returns the child tag of the specified path (Name1\Name2\Name3...), or -1 if no such tag. */ int FindTagByPath(int a_Tag, const AString & a_Path) const; - eTagType GetType(int a_Tag) const { return m_Tags[a_Tag].m_Type; } + eTagType GetType(int a_Tag) const { return m_Tags[(size_t)a_Tag].m_Type; } /** Returns the children type for a List tag; undefined on other tags. If list empty, returns TAG_End. */ eTagType GetChildrenType(int a_Tag) const { - ASSERT(m_Tags[a_Tag].m_Type == TAG_List); - return (m_Tags[a_Tag].m_FirstChild < 0) ? TAG_End : m_Tags[m_Tags[a_Tag].m_FirstChild].m_Type; + ASSERT(m_Tags[(size_t)a_Tag].m_Type == TAG_List); + return (m_Tags[(size_t)a_Tag].m_FirstChild < 0) ? TAG_End : m_Tags[(size_t)m_Tags[(size_t)a_Tag].m_FirstChild].m_Type; } /** Returns the value stored in a Byte tag. Not valid for any other tag type. */ inline unsigned char GetByte(int a_Tag) const { - ASSERT(m_Tags[a_Tag].m_Type == TAG_Byte); - return (unsigned char)(m_Data[m_Tags[a_Tag].m_DataStart]); + ASSERT(m_Tags[(size_t)a_Tag].m_Type == TAG_Byte); + return (unsigned char)(m_Data[(size_t)m_Tags[(size_t)a_Tag].m_DataStart]); } /** Returns the value stored in a Short tag. Not valid for any other tag type. */ inline Int16 GetShort(int a_Tag) const { - ASSERT(m_Tags[a_Tag].m_Type == TAG_Short); - return GetBEShort(m_Data + m_Tags[a_Tag].m_DataStart); + ASSERT(m_Tags[(size_t)a_Tag].m_Type == TAG_Short); + return GetBEShort(m_Data + m_Tags[(size_t)a_Tag].m_DataStart); } /** Returns the value stored in an Int tag. Not valid for any other tag type. */ inline Int32 GetInt(int a_Tag) const { - ASSERT(m_Tags[a_Tag].m_Type == TAG_Int); - return GetBEInt(m_Data + m_Tags[a_Tag].m_DataStart); + ASSERT(m_Tags[(size_t)a_Tag].m_Type == TAG_Int); + return GetBEInt(m_Data + m_Tags[(size_t)a_Tag].m_DataStart); } /** Returns the value stored in a Long tag. Not valid for any other tag type. */ inline Int64 GetLong(int a_Tag) const { - ASSERT(m_Tags[a_Tag].m_Type == TAG_Long); - return NetworkToHostLong8(m_Data + m_Tags[a_Tag].m_DataStart); + ASSERT(m_Tags[(size_t)a_Tag].m_Type == TAG_Long); + return NetworkToHostLong8(m_Data + m_Tags[(size_t)a_Tag].m_DataStart); } /** Returns the value stored in a Float tag. Not valid for any other tag type. */ inline float GetFloat(int a_Tag) const { - ASSERT(m_Tags[a_Tag].m_Type == TAG_Float); + ASSERT(m_Tags[(size_t)a_Tag].m_Type == TAG_Float); // Cause a compile-time error if sizeof(float) != 4 // If your platform produces a compiler error here, you'll need to add code that manually decodes 32-bit floats @@ -212,7 +212,7 @@ public: UNUSED(Check1); UNUSED(Check2); - Int32 i = GetBEInt(m_Data + m_Tags[a_Tag].m_DataStart); + Int32 i = GetBEInt(m_Data + m_Tags[(size_t)a_Tag].m_DataStart); float f; memcpy(&f, &i, sizeof(f)); return f; @@ -228,16 +228,16 @@ public: UNUSED(Check1); UNUSED(Check2); - ASSERT(m_Tags[a_Tag].m_Type == TAG_Double); - return NetworkToHostDouble8(m_Data + m_Tags[a_Tag].m_DataStart); + ASSERT(m_Tags[(size_t)a_Tag].m_Type == TAG_Double); + return NetworkToHostDouble8(m_Data + m_Tags[(size_t)a_Tag].m_DataStart); } /** Returns the value stored in a String tag. Not valid for any other tag type. */ inline AString GetString(int a_Tag) const { - ASSERT(m_Tags[a_Tag].m_Type == TAG_String); + ASSERT(m_Tags[(size_t)a_Tag].m_Type == TAG_String); AString res; - res.assign(m_Data + m_Tags[a_Tag].m_DataStart, m_Tags[a_Tag].m_DataLength); + res.assign(m_Data + m_Tags[(size_t)a_Tag].m_DataStart, m_Tags[(size_t)a_Tag].m_DataLength); return res; } @@ -245,7 +245,7 @@ public: inline AString GetName(int a_Tag) const { AString res; - res.assign(m_Data + m_Tags[a_Tag].m_NameStart, m_Tags[a_Tag].m_NameLength); + res.assign(m_Data + m_Tags[(size_t)a_Tag].m_NameStart, m_Tags[(size_t)a_Tag].m_NameLength); return res; } diff --git a/src/WorldStorage/FireworksSerializer.h b/src/WorldStorage/FireworksSerializer.h index 5b87bafdb..cbc544a14 100644 --- a/src/WorldStorage/FireworksSerializer.h +++ b/src/WorldStorage/FireworksSerializer.h @@ -89,4 +89,4 @@ public: short m_FlightTimeInTicks; std::vector<int> m_Colours; std::vector<int> m_FadeColours; -};
\ No newline at end of file +}; diff --git a/src/WorldStorage/SchematicFileSerializer.cpp b/src/WorldStorage/SchematicFileSerializer.cpp index d8531d965..9d594a084 100644 --- a/src/WorldStorage/SchematicFileSerializer.cpp +++ b/src/WorldStorage/SchematicFileSerializer.cpp @@ -14,6 +14,39 @@ +#ifdef SELF_TEST + +static class cSchematicStringSelfTest +{ +public: + cSchematicStringSelfTest(void) + { + cBlockArea ba; + ba.Create(21, 256, 21); + ba.RelLine(0, 0, 0, 9, 8, 7, cBlockArea::baTypes | cBlockArea::baMetas, E_BLOCK_WOODEN_STAIRS, 1); + AString Schematic; + if (!cSchematicFileSerializer::SaveToSchematicString(ba, Schematic)) + { + assert_test(!"Schematic failed to save!"); + } + cBlockArea ba2; + if (!cSchematicFileSerializer::LoadFromSchematicString(ba2, Schematic)) + { + assert_test(!"Schematic failed to load!"); + } + } +} g_SelfTest; + +#endif + + + + + + +/////////////////////////////////////////////////////////////////////////////////////////////////////////////////////// +// cSchematicFileSerializer: + bool cSchematicFileSerializer::LoadFromSchematicFile(cBlockArea & a_BlockArea, const AString & a_FileName) { // Un-GZip the contents: |