summaryrefslogtreecommitdiffstats
path: root/src/core (follow)
Commit message (Collapse)AuthorAgeFilesLines
* Merge pull request #9138 from liamwhite/hbl-stacktraceliamwhite2022-10-282-2/+2
|\ | | | | arm_interface: curb infinite recursion in stacktrace generation
| * arm_interface: curb infinite recursion in stacktrace generationLiam2022-10-272-2/+2
| |
* | Merge pull request #9115 from vonchenplus/game_name_by_languagebunnei2022-10-272-12/+37
|\ \ | | | | | | file_sys: Priority display of game titles in the current language
| * | file_sys: Priority display of game titles in the current languageFengChen2022-10-242-12/+37
| | |
* | | Merge pull request #9134 from lioncash/initliamwhite2022-10-272-2/+2
|\ \ \ | |_|/ |/| | audio_in/out_system: Pass Initialize members by value where applicable
| * | audio_in/out_system: Pass Initialize members by value where applicableLioncash2022-10-262-2/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | applet_resource_user_id isn't actually modified and is just assigned to a member variable, so this doesn't need to be a mutable reference. Similarly, the device name itself isn't modified and is only moved. We pass by value here, since we can still perform the move, but eliminate a sneaky set of calls that can unintentionally destroy the original string. Given how nested the calls are, it's good to get rid of this potential vector for a use-after-move bug.
* | | Merge pull request #9125 from liamwhite/dummy-schedulerbunnei2022-10-265-26/+76
|\ \ \ | |/ / |/| | kernel: refactor dummy thread wakeups
| * | kernel: refactor dummy thread wakeupsLiam2022-10-255-26/+76
| |/
* | concepts: Use the std::contiguous_iterator conceptMorph2022-10-261-1/+1
| | | | | | | | | | | | This also covers std::span, which does not have a const iterator. Also renames IsSTLContainer to IsContiguousContainer to explicitly convey its semantics.
* | Merge pull request #9113 from german77/peer_pressureliamwhite2022-10-258-12/+26
|\ \ | | | | | | service: nfp: Allow amiibos without keys
| * | core: hid: Add handheld to nfc devicesgerman772022-10-221-0/+1
| | |
| * | service: nfp: Allow amiibos without keysNarr the Reg2022-10-223-1/+18
| | |
| * | service: nfp: remove unnecessary includeNarr the Reg2022-10-225-11/+7
| | |
* | | Merge pull request #9107 from german77/gidoly_rulesliamwhite2022-10-253-43/+11
|\ \ \ | | | | | | | | input_common: cache vibration tests
| * | | input_common: cache vibration testsgerman772022-10-213-43/+11
| |/ /
* | | Merge pull request #9119 from liamwhite/shutdown-barrierliamwhite2022-10-256-7/+26
|\ \ \ | | | | | | | | core: barrier service thread shutdown
| * | | core: barrier service thread shutdownLiam2022-10-236-7/+26
| | |/ | |/|
* | | Merge pull request #9122 from liamwhite/burnt-chickenFernando S2022-10-242-4/+4
|\ \ \ | | | | | | | | nvdrv: fix container destruction order
| * | | nvdrv: fix container destruction orderLiam2022-10-242-4/+4
| |/ /
* | | general: Resolve -Wunused-lambda-capture and C5233Morph2022-10-222-23/+18
| | |
* | | ipc_helpers: Ignore GCC compiler warnings only on GCCMorph2022-10-221-2/+2
| | | | | | | | | | | | Clang and ICC for whatever reason also defines __GNUC__. Exclude them from this check.
* | | general: Enforce C4800 everywhere except in video_coreMorph2022-10-226-25/+26
| | |
* | | CMakeLists: Remove all redundant warningsMorph2022-10-221-6/+1
|/ / | | | | | | These are already explicitly or implicitly set in src/CMakeLists.txt
* | Merge pull request #9106 from lioncash/copy-errliamwhite2022-10-211-2/+3
|\ \ | | | | | | hid/npad: Fix copy size in GetSupportedNpadIdTypes
| * | hid/npad: Fix copy size in GetSupportedNpadIdTypesLioncash2022-10-211-2/+3
| |/ | | | | | | | | | | | | | | Previously this was passing the size of the vector into memcpy rather than the size in bytes to copy, which would result in a partial read. Thankfully, this function isn't used yet, so this gets rid of a bug before it's able to do anything.
* | k_session_request: Add missing override specifierLioncash2022-10-211-1/+1
| |
* | k_session_request: Turn C-style array into std::arrayLioncash2022-10-211-1/+3
| | | | | | | | | | Makes for stronger typing and allows tooling bounds checks provided by the standard library for debugging purposes.
* | k_session_request: Simplify constructor initializationLioncash2022-10-211-14/+11
|/
* Merge pull request #9078 from liamwhite/session-requestliamwhite2022-10-2117-200/+608
|\ | | | | kernel: Session request cleanup
| * kernel: remove most SessionRequestManager handling from KServerSessionLiam2022-10-196-138/+119
| |
| * kernel: add KSessionRequestLiam2022-10-1913-62/+489
| |
* | Merge pull request #9096 from Kelebek1/audio_15bunnei2022-10-202-0/+42
|\ \ | |/ |/| [audio_core] Update for firmware 15.0.0
| * Update audio_core for firmware 15.0.0Kelebek12022-10-192-0/+42
| |
* | Merge pull request #9082 from Morph1984/futureliamwhite2022-10-192-9/+53
|\ \ | | | | | | savedata_factory: Detect future save data paths
| * | savedata_factory: Detect future save data pathsMorph2022-10-172-9/+53
| | | | | | | | | | | | Enable compatibility for new account/device save paths planned on a future implementation.
* | | Merge pull request #9083 from liamwhite/take-a-chance-on-meliamwhite2022-10-191-10/+17
|\ \ \ | | | | | | | | kernel: fix slab heap ABA
| * | | kernel: fix slab heap ABALiam2022-10-171-10/+17
| |/ /
* | | Merge pull request #9071 from bunnei/mp-mmliamwhite2022-10-1936-1230/+2431
|\ \ \ | | | | | | | | Kernel Multiprocess (Part 1) - Persist memory & core timing
| * | | core: hle: kernel: Migrate ProcessState to enum class.bunnei2022-10-192-17/+17
| | | |
| * | | core: Initialize: Add missing braces.bunnei2022-10-191-2/+4
| | | |
| * | | core: core_timing: Re-initialize if single/multicore state changes.bunnei2022-10-193-14/+36
| | | |
| * | | core: core_timing: Remove unused IsHostTiming.bunnei2022-10-191-5/+0
| | | |
| * | | core: hle: kernel: Use result macros for new/changed code.bunnei2022-10-199-128/+110
| | | |
| * | | core: Partially persist emulation state across game boots.bunnei2022-10-194-52/+59
| | | |
| * | | core: hle: kernel: Fix InitializePreemption order.bunnei2022-10-191-1/+1
| | | |
| * | | core: hle: kernel: k_process: Improve management of page table & cleanup.bunnei2022-10-197-60/+92
| | | |
| * | | core: hle: kernel: k_interrupt_manager: HandleInterrupt should not depend on current process.bunnei2022-10-191-12/+9
| | | |
| * | | core: hle: kernel: Remove junk.bunnei2022-10-191-9/+0
| | | |
| * | | core: hle: kernel: k_page_table: Impl. LockForUn/MapDeviceAddressSpace, cleanup.bunnei2022-10-193-545/+624
| | | |
| * | | core: hle: kernel: Integration application memory block slab manager.bunnei2022-10-193-3/+44
| | | |
| * | | core: hle: kernel: k_page_table: Update, and integrate with new KMemoryBlockManager/SlabManager.bunnei2022-10-192-251/+393
| | | |
| * | | core: hle: kernel: k_memory_block: Update.bunnei2022-10-192-119/+391
| | | |
| * | | core: hle: kernel: k_memory_block_manager: Update.bunnei2022-10-192-174/+380
| | | |
| * | | core: hle: kernel: k_thread: Implement thread termination DPC.bunnei2022-10-195-1/+99
| | | |
| * | | core: hle: kernel: Add KDynamicResourceManager.bunnei2022-10-192-0/+59
| | | |
| * | | core: hle: kernel: Add KDynamicSlabHeap.bunnei2022-10-192-0/+123
| | | |
| * | | core: hle: kernel: Add KDynamicPageManager.bunnei2022-10-192-0/+137
| | | |
| * | | core: hle: kernel: k_process: Change Status -> State.bunnei2022-10-193-37/+27
| | | |
| * | | core: hle: kernel: svc_types: Add SystemThreadPriorityHighest and ProcessState.bunnei2022-10-191-0/+13
| | | |
| * | | core: device_memory: Templatize GetPointer(..).bunnei2022-10-199-19/+21
| | | |
| * | | core: hle: result: Add GetInnerValue and Includes methods.bunnei2022-10-191-0/+8
| | | |
| * | | core: hle: kernel: svc_common: Add WaitInfinite & cleanup.bunnei2022-10-191-2/+5
| | |/ | |/|
* | | Merge pull request #9084 from vonchenplus/dma_copyFernando S2022-10-191-4/+8
|\ \ \ | |/ / |/| | video_core: implement 1D copies based on VMM 'kind'
| * | video_core: Implement memory manager page kindFengChen2022-10-171-4/+8
| | |
* | | Merge pull request #9087 from Morph1984/oncebunnei2022-10-181-0/+2
|\ \ \ | | | | | | | | general: Add missing pragma once
| * | | general: Add missing pragma onceMorph2022-10-171-0/+2
| | |/ | |/|
* / | general: Fix spelling of "unknown"Morph2022-10-163-13/+13
|/ /
* | Merge pull request #9061 from liamwhite/writable-eventliamwhite2022-10-1434-224/+143
|\ \ | | | | | | kernel: remove KWritableEvent
| * | kernel: remove KWritableEventLiam2022-10-1334-224/+143
| | |
* | | Merge pull request #9055 from liamwhite/hblliamwhite2022-10-1415-55/+572
|\ \ \ | |_|/ |/| | Preliminary support for nx-hbloader
| * | k_server_session: preliminary support for userspace server sessionsLiam2022-10-129-49/+346
| | |
| * | Add implementation of svcCreateSessionLiam2022-10-122-1/+103
| | |
| * | general: preliminary support for hblLiam2022-10-126-6/+124
| | |
* | | Merge pull request #9032 from liamwhite/stub-friendsliamwhite2022-10-141-1/+12
|\ \ \ | | | | | | | | IFriendService: stub CheckFriendListAvailability
| * | | IFriendService: stub CheckFriendListAvailabilityLiam2022-10-081-1/+12
| | | |
* | | | result: enforce reference check specializationLiam2022-10-131-4/+3
| | | |
* | | | Merge pull request #9034 from liamwhite/result-macrosbunnei2022-10-131-6/+114
|\ \ \ \ | |_|_|/ |/| | | kernel: add expanded result macros
| * | | kernel: add expanded result macrosLiam2022-10-081-6/+114
| |/ /
* | | Merge pull request #9040 from liamwhite/woe-thirty-twobunnei2022-10-131-0/+4
|\ \ \ | | | | | | | | core_timing: use high-precision sleeps on non-Windows targets
| * | | core_timing: use high-precision sleeps on non-Windows targetsLiam2022-10-091-0/+4
| |/ /
* | | Merge pull request #9047 from german77/steam-aspectbunnei2022-10-122-0/+3
|\ \ \ | |_|/ |/| | yuzu: Add 16:10 aspect ratio
| * | yuzu: Add 16:10 aspect ratioNarr the Reg2022-10-102-0/+3
| | |
* | | Merge pull request #9043 from german77/vector_dataliamwhite2022-10-091-2/+8
|\ \ \ | | | | | | | | input_common: have an unique vector in callback status
| * | | input_common: have an unique vector in callback statusgerman772022-10-091-2/+8
| | |/ | |/|
* / | fsp_srv: stub GetCacheStorageSizeLiam2022-10-082-1/+14
|/ /
* | nfp_types: silence -Wtype-limitsLiam2022-10-071-1/+1
| |
* | Merge pull request #6142 from lat9nq/prog_meta_ref_bind_addressbunnei2022-10-072-15/+51
|\ \ | | | | | | program_metadata: Avoid reference binding to misaligned address
| * | program_metadata: Unpack FileAccessHeader and FileAccessControllat9nq2022-02-132-15/+51
| | | | | | | | | | | | | | | | | | Avoids a reference binding to a misaligned addresses. Unpacking one requires unpacking the other, otherwise there'll be a misaligned address on the leftover one.
* | | General: address feedbackFernando Sahmkow2022-10-0618-128/+131
| | |
* | | general: rework usages of UNREACHABLE macroLiam2022-10-062-12/+12
| | |
* | | nvdisp: End system frame after requesting to swap buffersMorph2022-10-061-1/+1
| | | | | | | | | | | | Fixes frametime reporting
* | | address_space: Address feedbackMorph2022-10-061-4/+4
| | |
* | | general: Format licenses as per SPDX guidelinesMorph2022-10-0614-56/+42
| | |
* | | NvHostChannels: improve hack for supporting multiple channels.Fernando Sahmkow2022-10-062-2/+11
| | |
* | | Address Feedback from bylaws.Fernando Sahmkow2022-10-062-6/+2
| | |
* | | Nvflinger: correct duplication.Fernando Sahmkow2022-10-064-5/+5
| | |
* | | Core: Fix get nvmap object random crashVonChenPlus2022-10-0612-35/+66
| | |
* | | NvDec: Fix regressions.Fernando Sahmkow2022-10-066-5/+31
| | |
* | | General: Fix compilation for GCCLiam White2022-10-069-23/+39
| | |
* | | NVDRV: Further improvements.Fernando Sahmkow2022-10-0613-127/+256
| | |
* | | MemoryManager: Fix errors popping out.Fernando Sahmkow2022-10-062-0/+10
| | |
* | | VideoCore: Refactor fencing system.Fernando Sahmkow2022-10-063-15/+8
| | |
* | | MemoryManager: initial multi paging system implementation.Fernando Sahmkow2022-10-063-20/+36
| | |
* | | NVDRV: Further refactors and eliminate old code.Fernando Sahmkow2022-10-0612-148/+8
| | |
* | | NVDRV: Refactor Host1xFernando Sahmkow2022-10-069-65/+63
| | |
* | | VideoCore: Refactor syncing.Fernando Sahmkow2022-10-067-12/+53
| | |
* | | Texture cache: Fix the remaining issues with memory mnagement and unmapping.Fernando Sahmkow2022-10-061-0/+3
| | |
* | | VideoCore: Extra Fixes.Fernando Sahmkow2022-10-061-1/+3
| | |
* | | NVDRV: Remake ASGPUFernando Sahmkow2022-10-062-235/+388
| | |
* | | NVDRV: Update copyright notices.Fernando Sahmkow2022-10-064-7/+13
| | |
* | | NvHostCtrl: Fix merge of nvflinger.Fernando Sahmkow2022-10-061-1/+2
| | |
* | | NVHOST_CTRl: Implement missing method and fix some stuffs.Fernando Sahmkow2022-10-062-6/+29
| | |
* | | VideoCore: implement channels on gpu caches.Fernando Sahmkow2022-10-066-30/+65
| | |
* | | NVASGPU: Fix Remap.Fernando Sahmkow2022-10-061-0/+8
| | |
* | | NVDRV: Fix clearing when destroying.Fernando Sahmkow2022-10-063-14/+9
| | |
* | | NVMAP: Fix the Free return parameters.Fernando Sahmkow2022-10-063-15/+18
| | |
* | | NVDRV: Fix Open/Close and make sure each device is correctly created.Fernando Sahmkow2022-10-0614-199/+291
| | |
* | | NVDRV: Implement new NvMapFernando Sahmkow2022-10-0618-277/+307
| | |
* | | NVDRV: Refactor and add new NvMap.Fernando Sahmkow2022-10-0619-40/+550
| | |
* | | NVDRV: Cleanup.Fernando Sahmkow2022-10-064-32/+40
| | |
* | | NVDRV: Implement QueryEvent.Fernando Sahmkow2022-10-0610-40/+133
| | |
* | | NvHost: Remake Ctrl Implementation.Fernando Sahmkow2022-10-066-169/+311
| | |
* | | NvHost: Try a different approach to blocking.Fernando Sahmkow2022-10-062-10/+7
| | |
* | | NvHost: Fix some regressions and correct signaling on timeout.Fernando Sahmkow2022-10-061-25/+19
| | |
* | | Merge pull request #9013 from liamwhite/spinning-a-yarnbunnei2022-10-067-8/+8
|\ \ \ | | | | | | | | common: remove "yuzu:" prefix from thread names
| * | | common: remove "yuzu:" prefix from thread namesLiam2022-10-047-8/+8
| | | |
* | | | service: nfp: Fix errors to pass unit testingNarr the Reg2022-10-046-42/+112
|/ / /
* | | Merge pull request #8955 from german77/amiibo-rewritebunnei2022-10-0218-1308/+1930
|\ \ \ | | | | | | | | core: nfp: Rewrite implementation to remove direct access from the frontend
| * | | service: mii: Copy only valid name bytesgerman772022-10-021-3/+18
| | | |
| * | | service: nfp: Implement mount target and open application area errors, minor fixesNarr the Reg2022-10-025-19/+124
| | | |
| * | | nfp: Multiple fixes against HWgerman772022-10-029-62/+163
| | | |
| * | | service: nfp: address commentsgerman772022-10-024-20/+22
| | | |
| * | | service: nfp: Rewrite and implement applet callsgerman772022-10-0213-1263/+1542
| | | |
| * | | core: hid: Add nfc support to emulated controllergerman772022-10-024-3/+123
| | | |
* | | | Merge pull request #8992 from Morph1984/vi-vsync-eventbunnei2022-10-026-29/+66
|\ \ \ \ | | | | | | | | | | service: vi: Retrieve vsync event once per display
| * | | | service: vi: Retrieve vsync event once per displayMorph2022-09-265-14/+42
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The display vsync event can only be retrieved once per display. Returns VI::ResultPermissionDenied if we attempt to retrieve the vsync event for the same display. Prevents games such as .hack//G.U. Last Recode from consuming all the handles in the handle table by spamming vsync event retrievals and allows it to go in game.
| * | | | service: vi: Move VI results into its own fileMorph2022-09-262-16/+25
| | |_|/ | |/| |
* | | | Merge pull request #8876 from FearlessTobi/multiplayer-part3bunnei2022-10-019-119/+949
|\ \ \ \ | | | | | | | | | | ldn: Implement "local wireless" networked multiplayer
| * | | | Address some review commentsFearlessTobi2022-09-205-50/+36
| | | | |
| * | | | yuzu: Multiple room UI improvementsgerman772022-09-103-1/+13
| | | | |
| * | | | ldn: Initial implementationFearlessTobi2022-09-096-117/+949
| | | | |
* | | | | Fix "controller.colors_state.right" being "left"Zwip-Zwap Zapony2022-10-011-1/+1
| |_|/ / |/| | |
* | | | Merge pull request #8934 from german77/palma_releasebunnei2022-09-297-33/+842
|\ \ \ \ | | | | | | | | | | service: hid: Partially implement palma controller
| * | | | service: hid: Partially implement palma controllerNarr the Reg2022-09-257-33/+842
| | |/ / | |/| |
* | | | Merge pull request #8940 from german77/silencebunnei2022-09-281-1/+2
|\ \ \ \ | | | | | | | | | | yuzu: Silence some clang warnings
| * | | | yuzu: Silence some clang warningsNarr the Reg2022-09-211-1/+2
| |/ / /
* | | | core/loader: Return nullptr if file is nullptrMerry2022-09-251-0/+4
| | | |
* | | | Merge pull request #8945 from Tachi107/typosMorph2022-09-242-3/+3
|\ \ \ \ | | | | | | | | | | chore: fix some typos
| * | | | chore: fix some typosAndrea Pappacoda2022-09-232-3/+3
| |/ / / | | | | | | | | | | | | Fix some typos reported by Lintian
* / / / sockets: Make fd member variable protectedLioncash2022-09-222-6/+17
|/ / / | | | | | | | | | | | | Other things shouldn't be able to directly mess around with the descriptor
* | | Merge pull request #8915 from vonchenplus/opus_multi_streambunnei2022-09-182-1/+38
|\ \ \ | | | | | | | | core: implement HwOpus GetWorkBufferSizeForMultiStreamEx
| * | | core: implement HwOpus GetWorkBufferSizeForMultiStreamExFengChen2022-09-162-1/+38
| | | |
* | | | Merge pull request #8827 from german77/amiibo_releasebunnei2022-09-1711-282/+1369
|\ \ \ \ | | | | | | | | | | core: nfp: Implement amiibo encryption
| * | | | core: nfp: Remove magic numbersgerman772022-09-073-105/+103
| | | | |
| * | | | core: nfp: Workaround for lack of multiple nfp interfacesgerman772022-09-071-1/+3
| | | | |
| * | | | core: nfp: Correct date and amiibo nameNarr the Reg2022-09-074-18/+36
| | | | |
| * | | | core: nfp: Implement Convert and RecreateApplicationArea, accuracy fixesNarr the Reg2022-09-0710-257/+356
| | | | |
| * | | | core: nfp: Implement amiibo encryptiongerman772022-09-076-256/+1226
| | |/ / | |/| |
* | | | Merge pull request #8650 from Kelebek1/vsyncbunnei2022-09-173-33/+67
|\ \ \ \ | | | | | | | | | | [Coretiming/NVNFlinger] Improve multi-core vsync timing, and core timing accuracy
| * | | | core_timing: Sleep in discrete intervals, yield during spinMorph2022-08-021-12/+13
| | | | |
| * | | | Add missing looping event schedule signalKelebek12022-08-021-5/+9
| | | | |
| * | | | Make coretiming waiting more accurateKelebek12022-08-021-11/+27
| | | | |
| * | | | Rework multi-core vsyncKelebek12022-08-022-17/+30
| | | | |
* | | | | Merge pull request #8869 from SachinVin/cmakeMorph2022-09-161-6/+0
|\ \ \ \ \ | | | | | | | | | | | | core/CMakeLists.txt: Remove duplicate files.
| * | | | | core/CMakeLists.txt: Remove duplicate files.SachinVin2022-09-081-6/+0
| | |/ / / | |/| | |
* | | | | Merge pull request #8911 from lioncash/cexpr-stringMorph2022-09-162-4/+3
|\ \ \ \ \ | | | | | | | | | | | | audio_device: Make AudioDeviceName constructor constexpr
| * | | | | audio_device: Mark member functions as const where applicableLioncash2022-09-151-2/+2
| | | | | | | | | | | | | | | | | | | | | | | | These member functions don't modify any internal state.
| * | | | | audio_device: Make AudioDeviceName constructor constexprLioncash2022-09-151-2/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | These are used as read-only arrays, so we can make the data read-only and available at compile-time. Now constructing an AudioDevice no longer needs to initialize some tables
* | | | | | Remove pause callbacks from coretimingKelebek12022-09-133-24/+0
|/ / / / /
* | | | | Merge pull request #8842 from Kelebek1/AudOutbunnei2022-09-102-1/+8
|\ \ \ \ \ | |_|_|/ / |/| | | | [audio_core] Rework audio output
| * | | | Don't stall with nvdecKelebek12022-09-041-1/+6
| | | | |
| * | | | Rework audio output, connecting AudioOut into coretiming to fix desync during heavy loads.Kelebek12022-09-021-0/+2
| | | | |
* | | | | Merge pull request #8863 from german77/triggersbunnei2022-09-101-0/+15
|\ \ \ \ \ | | | | | | | | | | | | core: hid: Fix GC triggers overwriting ZL and ZR buttons
| * | | | | core: hid: Fix GC triggers overwritting ZL and ZR buttonsNarr the Reg2022-09-051-0/+15
| | | | | |
* | | | | | Merge pull request #8864 from german77/toggle_analogbunnei2022-09-101-0/+3
|\ \ \ \ \ \ | |_|_|/ / / |/| | | | | input_common: Add support for analog toggle
| * | | | | input_common: Add support for analog toggleNarr the Reg2022-09-061-0/+3
| |/ / / /
* | | | | Merge pull request #8855 from german77/plsliamwhite2022-09-046-26/+27
|\ \ \ \ \ | | | | | | | | | | | | core: ns: Implement pl:s service
| * | | | | core: ns: Implement pl:s serviceNarr the Reg2022-09-036-26/+27
| |/ / / /
* | | | | Merge pull request #8822 from FearlessTobi/multiplayer-fixesbunnei2022-09-028-271/+34
|\ \ \ \ \ | |/ / / / |/| | | | network: Fixes and improvements to the room feature
| * | | | Address review commentsFearlessTobi2022-09-021-13/+6
| | | | |
| * | | | core/ldn_types: Minor corrections and additionsFearlessTobi2022-08-271-1/+16
| | | | |
| * | | | core/socket_proxy: Correct broadcast behaviorFearlessTobi2022-08-271-1/+7
| | | | | | | | | | | | | | | | | | | | | | | | | Broadcasts should only be sent when the broadcast IP is used. They should also only be received when SO_BROADCAST is enabled.
| * | | | yuzu: Display current game version in multiplayer roomFearlessTobi2022-08-271-0/+9
| | | | | | | | | | | | | | | | | | | | Makes it easier for users to recognize connection errors caused by different game versions.
| * | | | core/bsd: Correctly unbind methods in destructorFearlessTobi2022-08-271-1/+5
| | | | | | | | | | | | | | | | | | | | Prevents yuzu from crashing when the BSD service is created a second time.
| * | | | core/acc: Make CheckAvailability use LOG_DEBUGFearlessTobi2022-08-271-1/+1
| | | | | | | | | | | | | | | | | | | | Previously it was spamming the logs in certain multiplayer games like Puyo Puyo Tetris.
| * | | | yuzu_room: Remove dependency on coreFearlessTobi2022-08-273-264/+0
| |/ / /
* / / / Demote services from warning/info to debug to reduce log spam:Kelebek12022-09-015-16/+16
|/ / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | GetCurrentFocusState SetClockSpeed EnableSixAxisSensorUnalteredPassthrough IsSixAxisSensorUnalteredPassthroughEnabled Get, GetOld SetAndWait, SetAndWaitOld IocParam IocFree
* | | Merge pull request #8566 from german77/galaxybunnei2022-08-272-1/+35
|\ \ \ | | | | | | | | core: hid: Add fallback for dualjoycon and pro controllers
| * | | core: hid: Add fallback for dualjoycon and pro controllersgerman772022-07-112-1/+35
| | | |
* | | | Merge pull request #8812 from Kelebek1/autobunnei2022-08-241-6/+21
|\ \ \ \ | | | | | | | | | | [Audio] Implement AudRenU:RequestUpdateAuto
| * | | | Implement AudRenU:RequestUpdateAuto, and use C descriptors when B reports as empty.Kelebek12022-08-241-6/+21
| | | | |
* | | | | Merge pull request #8804 from vonchenplus/speed_up_idirectory_servicesbunnei2022-08-231-1/+2
|\ \ \ \ \ | | | | | | | | | | | | core:filesystem: speed up IDirectory service
| * | | | | core:filesystem: speed up IDirectory servicevonchenplus2022-08-231-1/+2
| | | | | |
* | | | | | hid: core: Add missing function table namesgerman772022-08-221-0/+6
|/ / / / /
* | | | | Merge pull request #8799 from liamwhite/where-did-the-padding-goliamwhite2022-08-212-3/+3
|\ \ \ \ \ | | | | | | | | | | | | core/file_sys: fix alignment of BuildId
| * | | | | core/file_sys: fix alignment of BuildIdLiam2022-08-212-3/+3
| | | | | |
* | | | | | Merge pull request #8660 from Tachi107/findmodules-pkg-configliamwhite2022-08-211-1/+1
|\ \ \ \ \ \ | | | | | | | | | | | | | | build: simplify find modules
| * | | | | | build(externals): rename Findopus to FindOpusAndrea Pappacoda2022-08-011-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This better matches upstream's FindOpus.cmake file, and it will make using upstream's FindOpus.cmake file easier.
* | | | | | | Merge pull request #8784 from Docteh/nosnekliamwhite2022-08-216-47/+50
|\ \ \ \ \ \ \ | |_|/ / / / / |/| | | | | | code: dodge PAGE_SIZE #define
| * | | | | | code: dodge PAGE_SIZE #defineKyle Kienapfel2022-08-206-47/+50
| | |/ / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Some header files, specifically for OSX and Musl libc define PAGE_SIZE to be a number This is great except in yuzu we're using PAGE_SIZE as a variable Specific example `static constexpr u64 PAGE_SIZE = u64(1) << PAGE_BITS;` PAGE_SIZE PAGE_BITS PAGE_MASK are all similar variables. Simply deleted the underscores, and then added YUZU_ prefix Might be worth noting that there are multiple uses in different classes/namespaces This list may not be exhaustive Core::Memory 12 bits (4096) QueryCacheBase 12 bits ShaderCache 14 bits (16384) TextureCache 20 bits (1048576, or 1MB) Fixes #8779
* | | | | | Merge pull request #8790 from liamwhite/too-many-ways-to-name-a-byte-stringbunnei2022-08-212-11/+7
|\ \ \ \ \ \ | | | | | | | | | | | | | | core/file_sys: fix BuildId padding in patch loading
| * | | | | | core/file_sys: fix BuildId paddingLiam2022-08-192-11/+7
| |/ / / / /
* / / / / / core: implement clkrst servicevonchenplus2022-08-202-0/+184
|/ / / / /
* | | | | core/socket_proxy: Final nitsFearlessTobi2022-08-151-8/+7
| | | | |
* | | | | core: network: Address review commentsgerman772022-08-152-30/+29
| | | | |
* | | | | internal_network: Fix mingw compilationFearlessTobi2022-08-151-4/+5
| | | | | | | | | | | | | | | | | | | | Apparently, "interface" is a reserved keyword on this compiler.
* | | | | core, yuzu: Address first part of review commentsFearlessTobi2022-08-156-18/+16
| | | | |
* | | | | core/socket_proxy: Fix compilationFearlessTobi2022-08-151-1/+1
| | | | |
* | | | | Make copyright headers SPDX-compliantFearlessTobi2022-08-152-6/+4
| | | | |
* | | | | core, network: Add ability to proxy socket packetsFearlessTobi2022-08-1512-272/+783
| | | | |
* | | | | Merge pull request #8755 from Morph1984/delimit-ipsbunnei2022-08-121-1/+2
|\ \ \ \ \ | | | | | | | | | | | | ips_layer: Delimit parsed hex value string
| * | | | | ips_layer: Delimit parsed hex value stringMorph2022-08-121-1/+2
| | | | | | | | | | | | | | | | | | | | | | | | Delimits the hex value string on spaces, slashes, carriage returns or newlines, allowing for comments to be added in-line.
* | | | | | Merge pull request #8745 from merryhime/null-fastmem-arenaliamwhite2022-08-122-7/+11
|\ \ \ \ \ \ | | | | | | | | | | | | | | arm_dynarmic: Fix nullptr fastmem arenas
| * | | | | | arm_dynarmic: Fix nullptr fastmem arenasMerry2022-08-092-7/+11
| | | | | | | | | | | | | | | | | | | | | | | | | | | | Unable to enable fastmem of exclusive access without a valid fastmem arena.
* | | | | | | Merge pull request #8731 from FearlessTobi/better-ldnliamwhite2022-08-126-57/+711
|\ \ \ \ \ \ \ | |_|/ / / / / |/| | | | | | ldn: Add better stubs and more data types
| * | | | | | core: ldn: Address review comments part 2german772022-08-122-334/+297
| | | | | | |
| * | | | | | core: ldn: Address review commentsNarr the Reg2022-08-084-56/+46
| | | | | | |
| * | | | | | ldn: Add better stubs and more data typesFearlessTobi2022-08-076-72/+773
| | |_|_|/ / | |/| | | | | | | | | | | | | | | | | | | | | | Co-Authored-By: Narr the Reg <5944268+german77@users.noreply.github.com> Co-Authored-By: Morph <39850852+Morph1984@users.noreply.github.com>
* | | | | | Merge pull request #8722 from german77/ds4_goes_brrrbunnei2022-08-101-0/+4
|\ \ \ \ \ \ | | | | | | | | | | | | | | hid: core: Delay the stop vibration command when testing
| * | | | | | hid: core: Delay the stop vibration command when testingNarr the Reg2022-08-061-0/+4
| |/ / / / /
* | | | | | Merge pull request #8724 from german77/no_alphabunnei2022-08-104-25/+97
|\ \ \ \ \ \ | | | | | | | | | | | | | | hid: core: Properly emulate controller color and battery level
| * | | | | | hid: core: Properly emulate controller color and battery levelNarr the Reg2022-08-084-25/+97
| |/ / / / /
* | | | | | Merge pull request #8729 from merryhime/cp15-barriersbunnei2022-08-102-4/+29
|\ \ \ \ \ \ | |_|/ / / / |/| | | | | arm_dynarmic_cp15: Implement CP15DMB/CP15DSB/CP15ISB
| * | | | | arm_dynarmic_cp15: Implement CP15DMB/CP15DSB/CP15ISBMerry2022-08-072-4/+29
| |/ / / /
* | | | | core/arm: fix build errorLiam2022-08-082-2/+10
| | | | |
* | | | | Merge pull request #8637 from liamwhite/bad-interruptsbunnei2022-08-0813-152/+64
|\ \ \ \ \ | | | | | | | | | | | | kernel: unlayer CPU interrupt handling
| * | | | | kernel: unlayer CPU interrupt handlingLiam2022-07-2513-152/+64
| | | | | |
* | | | | | Merge pull request #8240 from liamwhite/count-cyclesMorph2022-08-082-8/+22
|\ \ \ \ \ \ | |_|/ / / / |/| | | | | core/arm: re-enable cycle counting
| * | | | | core/arm: increase minimum_run_cyclesLiam2022-06-222-2/+2
| | | | | |
| * | | | | core/arm: re-enable cycle countingmerry2022-06-222-6/+20
| | | | | |
* | | | | | core/loader: remove ELF loaderLiam2022-08-015-313/+0
| | | | | |
* | | | | | Properly write out the command buffer when serving close requestNikita Strygin2022-07-311-2/+5
| |_|/ / / |/| | | |
* | | | | Revert Coretiming PRs 8531 and 7454 (#8591)Maide2022-07-282-109/+67
| | | | |
* | | | | Merge pull request #8636 from german77/irs_cluster_releaseliamwhite2022-07-275-6/+321
|\ \ \ \ \ | | | | | | | | | | | | service: irs: Implement clustering processor
| * | | | | Address commentsNarr the Reg2022-07-251-16/+16
| | | | | |
| * | | | | fix compiler errorsgerman772022-07-242-12/+14
| | | | | |
| * | | | | service: irs: Implement clustering processorgerman772022-07-245-6/+319
| | | | | |
* | | | | | Merge pull request #8633 from Morph1984/optional-keysliamwhite2022-07-272-0/+8
|\ \ \ \ \ \ | | | | | | | | | | | | | | applet/swkbd: Implement optional symbol keys
| * | | | | | applet/swkbd: Implement optional symbol keysMorph2022-07-242-0/+8
| | | | | | | | | | | | | | | | | | | | | | | | | | | | These are only used in the numeric keyboard, and correspond to the keys to the left and right of the "0" key on the numeric keyboard.
* | | | | | | chore: make yuzu REUSE compliantAndrea Pappacoda2022-07-2724-69/+49
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | [REUSE] is a specification that aims at making file copyright information consistent, so that it can be both human and machine readable. It basically requires that all files have a header containing copyright and licensing information. When this isn't possible, like when dealing with binary assets, generated files or embedded third-party dependencies, it is permitted to insert copyright information in the `.reuse/dep5` file. Oh, and it also requires that all the licenses used in the project are present in the `LICENSES` folder, that's why the diff is so huge. This can be done automatically with `reuse download --all`. The `reuse` tool also contains a handy subcommand that analyzes the project and tells whether or not the project is (still) compliant, `reuse lint`. Following REUSE has a few advantages over the current approach: - Copyright information is easy to access for users / downstream - Files like `dist/license.md` do not need to exist anymore, as `.reuse/dep5` is used instead - `reuse lint` makes it easy to ensure that copyright information of files like binary assets / images is always accurate and up to date To add copyright information of files that didn't have it I looked up who committed what and when, for each file. As yuzu contributors do not have to sign a CLA or similar I couldn't assume that copyright ownership was of the "yuzu Emulator Project", so I used the name and/or email of the commit author instead. [REUSE]: https://reuse.software Follow-up to 01cf05bc75b1e47beb08937439f3ed9339e7b254
* | | | | | | network, yuzu: Make copyright headers SPDX-compliantFearlessTobi2022-07-252-6/+4
| | | | | | |
* | | | | | | network: Move global state into a seperate classFearlessTobi2022-07-254-10/+34
| | | | | | | | | | | | | | | | | | | | | | | | | | | | Co-Authored-By: Narr the Reg <5944268+german77@users.noreply.github.com>
* | | | | | | common: multiplayer: Use GameInfo typegerman772022-07-251-4/+4
| | | | | | |
* | | | | | | Address second part of review commentsFearlessTobi2022-07-251-3/+2
| | | | | | |
* | | | | | | Address first part of review commentsFearlessTobi2022-07-251-5/+5
| | | | | | |
* | | | | | | core: Fix -Wunused-variableFearlessTobi2022-07-251-1/+3
| | | | | | |
* | | | | | | common, core: fix -Wmissing-field-initializersFearlessTobi2022-07-251-3/+3
| | | | | | |
* | | | | | | yuzu: Add ui files for multiplayer roomsFearlessTobi2022-07-2514-19/+298
| |_|_|/ / / |/| | | | |
* | | | | | Merge pull request #8549 from liamwhite/kscheduler-scMorph2022-07-2513-602/+605
|\ \ \ \ \ \ | |_|/ / / / |/| | | | | kernel: use KScheduler from Mesosphere
| * | | | | kernel: Ensure all uses of disable_count are balancedLiam2022-07-153-10/+21
| | | | | |
| * | | | | kernel: be more careful about initialization path for HLE threadsLiam2022-07-152-1/+8
| | | | | |
| * | | | | kernel: fix single-core preemption pointsLiam2022-07-156-40/+28
| | | | | |
| * | | | | kernel: fix issues with single core modeLiam2022-07-159-189/+225
| | | | | |
| * | | | | kernel: use KScheduler from mesosphereLiam2022-07-1512-602/+563
| | | | | |
* | | | | | yuzu: Add webcam support and rebase to latest masterNarr the Reg2022-07-243-4/+4
| | | | | |
* | | | | | service: irs: Move to IRS namespace and minor fixesgerman772022-07-2419-76/+70
| | | | | |
* | | | | | service: irs: Split processors and implement ImageTransferProcessorgerman772022-07-2418-291/+1091
| | | | | |
* | | | | | core: hid: Add cammera supportgerman772022-07-246-3/+423
| |/ / / / |/| | | |
* | | | | Project AndioKelebek12022-07-2218-764/+923
| | | | |
* | | | | Merge pull request #8598 from Link4565/recv-dontwaitbunnei2022-07-221-1/+19
|\ \ \ \ \ | | | | | | | | | | | | Enable the use of MSG_DONTWAIT flag on RecvImpl
| * | | | | Enable the use of MSG_DONTWAIT flag on RecvImplLink45652022-07-161-1/+19
| | | | | |
* | | | | | implement resume messageGus Caplan2022-07-182-0/+5
| | | | | |
* | | | | | Merge pull request #8569 from merryhime/watchpointsmerry2022-07-174-8/+3
|\ \ \ \ \ \ | | | | | | | | | | | | | | dynarmic: Abort watchpoints ASAP
| * | | | | | dynarmic: Abort watchpoints ASAPMerry2022-07-154-8/+3
| | |/ / / / | |/| | | |
* | | | | | Merge pull request #8508 from yuzu-emu/mc-speed-limitbunnei2022-07-171-3/+15
|\ \ \ \ \ \ | | | | | | | | | | | | | | hle: service: nvflinger: Factor speed limit into frame time calculation.
| * | | | | | hle: service: nvflinger: Fix implicit conversion.bunnei2022-07-171-1/+4
| | | | | | |
| * | | | | | yuzu: settings: Remove framerate cap and merge unlocked framerate setting.bunnei2022-07-171-8/+10
| | | | | | | | | | | | | | | | | | | | | | | | | | | | - These were all somewhat redundant.
| * | | | | | hle: service: nvflinger: Factor speed limit into frame time calculation.bunnei2022-07-171-1/+8
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | - This allows the %-based "Limit Speed Percent" setting to work with MC emulation. - This is already supported for SC emulation.
* | | | | | | Merge pull request #8544 from german77/14dot0bunnei2022-07-178-29/+45
|\ \ \ \ \ \ \ | |/ / / / / / |/| | | | | | service: Update some services to 14.0.0+
| * | | | | | service: fatal: Add function tablegerman772022-07-141-1/+7
| | | | | | |
| * | | | | | service: btdrv,bcat,btm: Update service tables to 14.0.0german772022-07-143-4/+13
| | | | | | |
| * | | | | | service am: Update service tables to 14.0.0german772022-07-141-0/+3
| | | | | | |
| * | | | | | service: ac: Replace intances of ProfileData with UserDatagerman772022-07-143-24/+22
| | | | | | |
* | | | | | | Merge pull request #8594 from liamwhite/skip-wpbunnei2022-07-162-6/+6
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | core/arm: skip watchpoint checks when reading instructions
| * | | | | | | core/arm: skip watchpoint checks when reading instructionsLiam2022-07-162-6/+6
| | |_|/ / / / | |/| | | | |
* | | | | | | Merge pull request #8511 from german77/hbmenubunnei2022-07-169-83/+222
|\ \ \ \ \ \ \ | |/ / / / / / |/| | | | | | service: ptm: Add TS, nifm: Stub GetInternetConnectionStatus
| * | | | | | service: nifm: Stub GetInternetConnectionStatusgerman772022-06-291-1/+41
| | | | | | |
| * | | | | | service: ptm: Rewrite PSM and add TSgerman772022-06-298-82/+181
| | | | | | |
* | | | | | | Merge pull request #8588 from merryhime/IBinder-vdestructMorph2022-07-151-0/+1
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | nvflinger: Polymorphic destructor requried for abstract class IBinder
| * | | | | | | nvflinger: Polymorphic destructor requried for abstract class IBinderMerry2022-07-151-0/+1
| | |_|/ / / / | |/| | | | |
* / | | | | | KCodeMemory: Mark virtual methods as overrideMerry2022-07-151-3/+3
|/ / / / / /
* | | | | | Merge pull request #8510 from german77/vibrationliamwhite2022-07-151-2/+2
|\ \ \ \ \ \ | |_|/ / / / |/| | | | | input_common: sdl: lower vibration frequency and use it's own unique thread
| * | | | | input_common: sdl: lower vibration frequency and use it's own unique threadgerman772022-06-291-2/+2
| |/ / / /
* | | | | Merge pull request #8559 from liamwhite/waiter-listbunnei2022-07-111-3/+9
|\ \ \ \ \ | |_|_|/ / |/| | | | kernel: fix usage of waiter_list in Finalize
| * | | | kernel: fix usage of waiter_list in FinalizeLiam2022-07-101-3/+9
| | | | |
* | | | | PRKelebek12022-07-105-11/+9
| | | | |
* | | | | Rework CoreTimingKelebek12022-07-1010-76/+140
| | | | |
* | | | | Merge pull request #8531 from FernandoS27/core-timing-fix-regliamwhite2022-07-102-12/+2
|\ \ \ \ \ | |/ / / / |/| | | | Core timing: use only one thread.
| * | | | Core timing: use only one thread.Fernando Sahmkow2022-07-022-12/+2
| | | | |
* | | | | Merge pull request #8501 from liamwhite/backtrace-againMai2022-07-085-15/+51
|\ \ \ \ \ | | | | | | | | | | | | core/arm: better support for backtrace generation
| * | | | | core/arm: better support for backtrace generationLiam2022-06-255-15/+51
| | | | | |
* | | | | | Merge pull request #8502 from liamwhite/end-waitliamwhite2022-07-072-4/+5
|\ \ \ \ \ \ | | | | | | | | | | | | | | kernel: clean up waiting implementation
| * | | | | | kernel: clean up waiting implementationLiam2022-06-252-4/+5
| |/ / / / /
* | | | | | Merge pull request #8492 from german77/no_more_errorsFernando S2022-07-075-40/+76
|\ \ \ \ \ \ | | | | | | | | | | | | | | service: hid: Correct some mistakes and add more validations
| * | | | | | service: hid: Correct some mistakes and add more validationsNarr the Reg2022-06-295-40/+76
| | |_|/ / / | |/| | | |
* | | | | | Merge pull request #8532 from liamwhite/fiber-supplementsliamwhite2022-07-066-62/+36
|\ \ \ \ \ \ | | | | | | | | | | | | | | common/fiber: make fibers easier to use
| * | | | | | common/fiber: make fibers easier to useLiam2022-07-026-62/+36
| | | | | | |
* | | | | | | Merge pull request #8521 from lat9nq/gdbstub-in-boundsMorph2022-07-051-2/+6
|\ \ \ \ \ \ \ | |_|_|_|/ / / |/| | | | | | gdbstub_arch: Directly access SP register
| * | | | | | gdbstub_arch: Directly access SP registerlat9nq2022-06-301-2/+6
| | |/ / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Currently to access the SP register, RegRead and RegWrite rely on a out-of-bounds array access to reach the next element in a struct. As of writing only git versions of GCC catch this error. Specify the SP register when we want to access it in these functions.
* | | | | | Merge pull request #8523 from liamwhite/sc-oopsieFernando S2022-07-012-1/+8
|\ \ \ \ \ \ | | | | | | | | | | | | | | cpu_manager: properly check idle on return from preemption
| * | | | | | cpu_manager: properly check idle on return from preemptionLiam2022-06-302-1/+8
| | |/ / / / | |/| | | |
* | | | | | Merge pull request #8490 from liamwhite/read-code-stopMorph2022-07-014-24/+64
|\ \ \ \ \ \ | |/ / / / / |/| | | | | dynarmic: Stop ReadCode callbacks to unmapped addresses
| * | | | | dynarmic: Stop ReadCode callbacks to unmapped addressesLiam2022-06-224-24/+64
| | |_|/ / | |/| | |
* | | | | Merge pull request #7454 from FernandoS27/new-core-timingFernando S2022-06-302-60/+113
|\ \ \ \ \ | |_|/ / / |/| | | | Core: Remake Core Timing
| * | | | Adress Feedback.Fernando Sahmkow2022-06-302-18/+29
| | | | |
| * | | | Address feedback.Fernando Sahmkow2022-06-281-13/+13
| | | | |
| * | | | Core: Protect each event from race conditions within it.Fernando Sahmkow2022-06-282-0/+2
| | | | |
| * | | | Core: add missing include.Fernando Sahmkow2022-06-281-0/+1
| | | | |
| * | | | Core/Common: Corrections to core timing and add critical priority.Fernando Sahmkow2022-06-281-1/+1
| | | | |
| * | | | Core: Reimplement Core Timing.Fernando Sahmkow2022-06-282-54/+93
| | | | |
* | | | | Merge pull request #8512 from german77/nnResultMorph2022-06-29134-1186/+1146
|\ \ \ \ \ | |/ / / / |/| | | | Replace multiple names with a better name
| * | | | core: kernel: Replace instances of KPageLinkedList with KPageGroupgerman772022-06-2711-64/+63
| | | | |
| * | | | core: Replace all instances of ResultCode with Resultgerman772022-06-27133-1155/+1116
| | | | |
* | | | | Merge pull request #8504 from comex/mesosphere-current-processbunnei2022-06-271-0/+24
|\ \ \ \ \ | |/ / / / |/| | | | Support `InfoType_MesosphereCurrentProcess`
| * | | | Re-add missing `case` and braces, and trim whitespacecomex2022-06-261-1/+3
| | | | |
| * | | | Update src/core/hle/kernel/svc.cppcomex2022-06-261-6/+14
| | | | | | | | | | | | | | | Co-authored-by: liamwhite <liamwhite@users.noreply.github.com>
| * | | | Support InfoType_MesosphereCurrentProcesscomex2022-06-261-0/+14
| | | | |
* | | | | Merge pull request #8475 from liamwhite/x18bunnei2022-06-2613-52/+69
|\ \ \ \ \ | |/ / / / |/| | | | kernel: make current thread pointer thread local
| * | | | kernel: make current thread pointer thread localLiam2022-06-2313-52/+69
| | |/ / | |/| |
* / | | gdbstub: fix register pokesLiam2022-06-251-0/+1
|/ / /
* | | Merge pull request #8491 from Morph1984/extra-assertbunnei2022-06-221-1/+0
|\ \ \ | | | | | | | | KPageTable: Remove extraneous assert
| * | | KPageTable: Remove extraneous assertMorph2022-06-221-1/+0
| |/ / | | | | | | | | | Since start is always 0 and VAddr is unsigned, we can safely remove this assert.
* | | Merge pull request #8483 from liamwhite/fire-emblem-three-semaphoresbunnei2022-06-223-0/+22
|\ \ \ | |/ / |/| | kernel: wait for threads to stop on pause
| * | kernel: wait for threads to stop on pauseLiam2022-06-183-0/+22
| | |
* | | Merge pull request #8432 from liamwhite/watchpointbunnei2022-06-2217-54/+507
|\ \ \ | | | | | | | | core/debugger: memory breakpoint support
| * | | core/debugger: memory breakpoint supportLiam2022-06-1617-54/+507
| | | |
* | | | Merge pull request #8468 from liamwhite/dispatch-trackingbunnei2022-06-224-14/+7
|\ \ \ \ | | | | | | | | | | kernel: fix some uses of disable_count
| * | | | kernel: fix some uses of disable_countLiam2022-06-164-14/+7
| |/ / /
* | / / service: am: Stub PerformSystemButtonPressingIfInFocusNarr the Reg2022-06-202-1/+24
| |/ / |/| | | | | | | | Used by Ring Fit Adventure
* | | core: fix initialization in single core, sync GPU modeLiam2022-06-172-0/+8
| | |
* | | Implement ExitProcess svcNikita Strygin2022-06-161-1/+2
|/ / | | | | | | | | | | | | Currently this just stops all the emulation This works under assumption that only application will try to use ExitProcess, with services not touching it If application exits - it quite makes sense to end the emulation
* | Merge pull request #8457 from liamwhite/kprocess-suspendFernando S2022-06-1612-212/+199
|\ \ | | | | | | kernel: implement KProcess suspension
| * | kernel: implement KProcess suspensionLiam2022-06-1412-212/+199
| | |
* | | Merge pull request #8317 from german77/notifabunnei2022-06-152-8/+172
|\ \ \ | | | | | | | | service: notifa: Implement most part of this service
| * | | service: notifa: Implement most part of this servicegerman772022-05-092-8/+172
| | | | | | | | | | | | | | | | | | | | Implements partially RegisterAlarmSetting, UpdateAlarmSetting, LoadApplicationParameter, DeleteAlarmSetting. Needed for Fitness `Boxing 2: Rhythm & Exercise` and `Ring Fit Adventure`.
* | | | Merge pull request #8464 from liamwhite/break-debugMai2022-06-151-0/+7
|\ \ \ \ | | | | | | | | | | kernel: notify debugger on break SVC
| * | | | kernel: notify debugger on break SVCLiam2022-06-151-0/+7
| | |/ / | |/| |
* | | | Merge pull request #8383 from Morph1984/shadow-of-the-pastMai2022-06-151-5/+0
|\ \ \ \ | | | | | | | | | | yuzu: Make variable shadowing a compile-time error
| * | | | CMakeLists: Make variable shadowing a compile-time errorMorph2022-06-141-5/+0
| | | | | | | | | | | | | | | | | | | | Now that the entire project is free of variable shadowing, we can enforce this as a compile time error to prevent any further introduction of this logic bug.
* | | | | core: centralize profile scope for DynarmicLiam2022-06-153-7/+2
| |/ / / |/| | |
* | | | kernel: fix passthrough of local captures in lambdaLiam2022-06-141-1/+3
| | | |
* | | | general: fix compilation on MinGW GCC 12Liam2022-06-141-5/+4
| | | |
* | | | general: fix compilation on GCC 12Liam2022-06-141-1/+1
| | | |
* | | | kernel: ensure class token lambda exit is unreachableLiam2022-06-141-0/+1
| | | |
* | | | kernel: fix inconsistency in AutoObjectTraits macro definitionsLiam2022-06-141-4/+7
| | | |
* | | | common: Change semantics of UNREACHABLE to unconditionally crashLiam2022-06-1435-59/+52
| | | |
* | | | Merge pull request #8388 from liamwhite/simpler-pausebunnei2022-06-143-95/+36
|\ \ \ \ | |/ / / |/| | | CpuManager: simplify pausing
| * | | CpuManager: simplify pausingLiam2022-06-093-95/+36
| | | |
* | | | Merge pull request #8446 from liamwhite/cmd-gdbMorph2022-06-137-7/+70
|\ \ \ \ | | | | | | | | | | core/debugger: support operation in yuzu-cmd
| * | | | core/debugger: fix a number of shutdown deadlocksLiam2022-06-107-7/+70
| |/ / /
* | | | Merge pull request #8454 from liamwhite/inaddr-anyMorph2022-06-131-1/+1
|\ \ \ \ | | | | | | | | | | core/debugger: allow remote connections
| * | | | core/debugger: allow remote connectionsLiam2022-06-121-1/+1
| | | | |
* | | | | Merge pull request #8443 from liamwhite/code-membunnei2022-06-133-26/+118
|\ \ \ \ \ | |/ / / / |/| | | | kernel: fix KCodeMemory initialization
| * | | | kernel: fix KCodeMemory initializationLiam2022-06-093-26/+118
| |/ / /
* | | | gdbstub_arch: Add missing virtual destructorLioncash2022-06-121-0/+1
| | | | | | | | | | | | | | | | | | | | The class is used polymorphically, so it's undefined behavior to delete instances of GDBStubA64 and GDBStubA32 from the base class pointer.
* | | | service: hid: Fix gesture regressionNarr the Reg2022-06-102-4/+3
|/ / /
* | | Merge pull request #8428 from bunnei/nvflinger-fix-timingbunnei2022-06-083-31/+3
|\ \ \ | | | | | | | | Follow-up fixes for NVFlinger rewrite (Part 3)
| * | | hle: service: nvflinger: buffer_queue_consumer: Always free released buffers.bunnei2022-06-063-31/+3
| | | |
* | | | core/debugger: fix asio write usageLiam2022-06-071-2/+2
| | | |
* | | | core/debugger: fix crash due to incorrect lambda captureLiam2022-06-071-8/+9
| | | |
* | | | Merge pull request #8426 from liamwhite/elfbunnei2022-06-063-263/+37
|\ \ \ \ | |/ / / |/| | | common: consolidate ELF structure definitions
| * | | common: consolidate ELF structure definitionsLiam2022-06-053-263/+37
| | | |
* | | | Merge pull request #8419 from liamwhite/library-listMai M2022-06-061-22/+28
|\ \ \ \ | | | | | | | | | | gdbstub: add missing library list query
| * | | | gdbstub: add missing library list commandLiam2022-06-041-22/+28
| |/ / /
* | | | Merge pull request #8395 from german77/ir_stubbunnei2022-06-042-21/+460
|\ \ \ \ | |/ / / |/| | | service: hid: Improve stub of IRS
| * | | service: hid: Improve stub of IRSNarr the Reg2022-05-312-21/+460
| | | |
* | | | Merge pull request #8410 from liamwhite/thread-namesMai M2022-06-024-14/+172
|\ \ \ \ | | | | | | | | | | gdbstub: Support reading guest thread names
| * | | | core/debugger: Support reading guest thread namesLiam2022-06-024-14/+172
| | | | |
* | | | | Merge pull request #8409 from liamwhite/tdesc-fixMai M2022-06-022-10/+87
|\ \ \ \ \ | |/ / / / |/| | | | gdbstub: fix target descriptions
| * | | | gdbstub: fix target descriptionsLiam2022-06-022-10/+87
| | | | |
* | | | | Merge pull request #8402 from liamwhite/better-stepMorph2022-06-0213-122/+239
|\ \ \ \ \ | |/ / / / |/| | | | core/debugger: Improved stepping mechanism and misc fixes
| * | | | core/debugger: Improved stepping mechanism and misc fixesLiam2022-06-0113-122/+239
| | | | |
* | | | | Merge pull request #8404 from Morph1984/virtualliamwhite2022-06-013-2/+6
|\ \ \ \ \ | | | | | | | | | | | | core/debugger: Define defaulted virtual destructors
| * | | | | core/debugger: Define defaulted virtual destructorsMorph2022-06-013-2/+6
| |/ / / / | | | | | | | | | | | | | | | Resolves an MSVC warning where a virtual destructor is not defined in the base class with virtual functions.
* / / / / gdbstub: Explicitly cast return type to u8Morph2022-06-011-2/+2
|/ / / / | | | | | | | | | | | | Otherwise, the addition promotes the returned value to an int instead of keeping it as a u8.
* / / / core/debugger: Implement new GDB stub debuggerLiam2022-06-0119-26/+1422
|/ / /
* | | Merge pull request #8368 from german77/seventimesbunnei2022-05-306-368/+643
|\ \ \ | | | | | | | | Service: hid: Several improvements and implementations
| * | | service: hid: Implement ResetIsSixAxisSensorDeviceNewlyAssignedgerman772022-05-275-6/+125
| | | | | | | | | | | | | | | | Needed by Nintendo Switch Sports
| * | | service: hid: Implement LoadSixAxisSensorCalibrationParameter and GetSixAxisSensorIcInformationgerman772022-05-275-3/+136
| | | | | | | | | | | | | | | | Needed by Nintendo Switch Sports
| * | | service: hid: Implement EnableSixAxisSensorUnalteredPassthrough and IsSixAxisSensorUnalteredPassthroughEnabledgerman772022-05-274-2/+88
| | | | | | | | | | | | | | | | Needed by Nintendo Switch Sports
| * | | service: hid: Add error handling to sixaxis functionsgerman772022-05-273-31/+55
| | | |
| * | | service: hid: Refractor sixaxis functionsgerman772022-05-272-185/+88
| | | |
| * | | service: hid: Implement MergeSingleJoyAsDualJoy according to REgerman772022-05-274-65/+57
| | | |
| * | | service: hid: Add error handling to setNpadAssignment and variantsgerman772022-05-273-23/+27
| | | |
| * | | service: hid: Quick RE fixes and commentsgerman772022-05-274-54/+68
| | | |
* | | | Merge pull request #8332 from Morph1984/reduce_exec_sizebunnei2022-05-291-4/+3
|\ \ \ \ | | | | | | | | | | general: Use smaller array types where applicable
| * | | | time_zone_manager: Use s8 for month length tablesMorph2022-05-131-4/+3
| | | | | | | | | | | | | | | | | | | | Using this smaller type saves 512 bytes in the compiled executable.
* | | | | Merge pull request #8374 from german77/asnycvibrationsbunnei2022-05-281-5/+29
|\ \ \ \ \ | | | | | | | | | | | | input_common: Make vibration request async
| * | | | | input_common: Make vibration request asyncNarr the Reg2022-05-231-5/+29
| | |/ / / | |/| | |
* / | | | input_common: touch: Rewrite touch driver to support multiple touch pointsgerman772022-05-233-5/+20
|/ / / /
* / / / general: Avoid ambiguous format_to compilation errorsLioncash2022-05-141-1/+1
|/ / / | | | | | | | | | | | | | | | | | | Ensures that we're using the fmt version of format_to. These are also the only three outliers. All of the other formatters we have are properly qualified.
* | | service: hid: Fix motion refresh rateNarr the Reg2022-05-062-2/+6
| | |
* | | service: hid: Disable correctly motion inputgerman772022-05-061-50/+41
|/ /
* | hle/result: Update std::expected replacement messageMorph2022-05-031-1/+1
| | | | | | | | std::expected is included in C++23
* | hle/result: Add ResultRange overload in ResultValMorph2022-05-031-1/+3
| | | | | | | | Also marks the implicit conversion operator as constexpr instead of consteval as the constructor is not constant evaluated.
* | Merge pull request #8272 from german77/stick_rangebunnei2022-05-031-2/+2
|\ \ | | | | | | yuzu: config: Improve analog stick mapping
| * | yuzu: Config allow to delete single axis directions when buttons are mapped to a stickNarr the Reg2022-04-271-2/+2
| | |
* | | hle/result: Implement ResultRangeMorph2022-05-031-0/+42
| | | | | | | | | | | | | | | | | | A ResultRange defines an inclusive range of error descriptions within an error module. This can be used to check whether the description of a given ResultCode falls within the range. The conversion function returns a ResultCode with its description set to description_start.
* | | Merge pull request #8274 from german77/firmwareMorph2022-04-292-1/+21
|\ \ \ | | | | | | | | service: hid: Stub IsFirmwareUpdateNeededForNotification
| * | | service: hid: Stub IsFirmwareUpdateNeededForNotificationgerman772022-04-272-1/+21
| |/ / | | | | | | | | | Used in Fitness Boxing 2: Rhythm & Exercise (0100073011382000)
* | | chore: add missing SPDX tagsAndrea Pappacoda2022-04-283-25/+8
| | | | | | | | | | | | Follow-up to 99ceb03a1cfcf35968cab589ea188a8c406cda52
* | | Merge pull request #8229 from german77/reinterpret2bunnei2022-04-2722-386/+429
|\ \ \ | |/ / |/| | service: hid: Access shared memory directly
| * | service: hid: Ensure all structs are initializedNarr the Reg2022-04-2416-104/+105
| | |
| * | service: hid: Access shared memory directlyNarr the Reg2022-04-2321-305/+347
| | |
* | | Merge pull request #8261 from liamwhite/jit-cleanupMai M2022-04-253-132/+225
|\ \ \ | | | | | | | | service: jit: document and clean up
| * | | service: jit: document and clean upLiam2022-04-253-132/+225
| |/ /
* | | Merge pull request #8260 from Morph1984/c4146Mai M2022-04-251-1/+1
|\ \ \ | | | | | | | | kernel: svc: Replace -1ULL with 0xFFFFFFFFFFFFFFFF
| * | | kernel: svc: Replace -1ULL with 0xFFFFFFFFFFFFFFFFMorph2022-04-241-1/+1
| |/ / | | | | | | | | | Resolves the C4146 compiler warning on MSVC.
* / / Remove unused PrepareReschedule functionMerry2022-04-247-20/+0
|/ /
* | general: Convert source file copyright comments over to SPDXMorph2022-04-23708-2224/+1427
| | | | | | | | | | This formats all copyright comments according to SPDX formatting guidelines. Additionally, this resolves the remaining GPLv2 only licensed files by relicensing them to GPLv2.0-or-later.
* | Merge pull request #7976 from BytesGalore/masterbunnei2022-04-231-1/+2
|\ \ | | | | | | loader: log the type of mismatching file-extension
| * | loader: log the type of mismatching file-extensionBytesGalore2022-03-031-1/+2
| | |
* | | Merge pull request #8222 from german77/sixaxis_testbunnei2022-04-226-99/+363
|\ \ \ | | | | | | | | service: hid: Improve accuracy of sixaxis functions
| * | | service: hid: Improve accuracy of sixaxis functionsNarr the Reg2022-04-186-99/+363
| | | |
* | | | core/arm: separate backtrace collectionLiam2022-04-216-90/+98
|/ / /
* | | Merge pull request #6558 from german77/ringcon2Fernando S2022-04-1616-26/+1748
|\ \ \ | | | | | | | | hidbus: Implement hidbus and ringcon
| * | | yuzu: Add custom ringcon configurationgerman772022-04-167-64/+133
| | | |
| * | | hidbus: Implement hidbus and ringcongerman772022-04-1614-26/+1679
| | | |
* | | | Merge pull request #8188 from merryhime/jit-race-page-table-changedbunnei2022-04-164-57/+84
|\ \ \ \ | |/ / / |/| | | dynarmic: Fix race when switching page tables
| * | | dynarmic: Fix race when switching page tablesmerry2022-04-104-57/+84
| | | |
* | | | Merge pull request #8172 from bunnei/kernel-mutexFernando S2022-04-1611-87/+43
|\ \ \ \ | | | | | | | | | | hle: kernel: Use std::mutex instead of spin locks for most kernel locking.
| * | | | core: hle: kernel: k_thread: Rework dummy thread waiting.bunnei2022-04-122-28/+21
| | | | |
| * | | | core: hle: service: Allocate a service thread.bunnei2022-04-121-1/+2
| | | | |
| * | | | hle: kernel: k_spin_lock: Remove unused ThreadPause.bunnei2022-04-121-28/+0
| | | | |
| * | | | hle: kernel: Use std::mutex instead of spin locks for most kernel locking.bunnei2022-04-129-30/+20
| | | | |
* | | | | Merge pull request #8202 from merryhime/fix-single-coreFernando S2022-04-132-2/+2
|\ \ \ \ \ | | | | | | | | | | | | dynarmic: Fix single core mode
| * | | | | dynarmic: Fix single core modemerry2022-04-132-2/+2
| | | | | | | | | | | | | | | | | | | | | | | | Regression introduced in a5d040df3d. Closes #8201.
* | | | | | service: jit: Implement the JIT serviceLiam2022-04-135-9/+784
|/ / / / /
* | | | | Merge pull request #8165 from bunnei/ensure-session-port-cleanupbunnei2022-04-128-25/+53
|\ \ \ \ \ | | | | | | | | | | | | Kernel: Track open references to KServerPort and KServerSession.
| * | | | | hle: kernel: Unify and integrate reference tracking for KServerPort/KServerSession.bunnei2022-04-086-13/+46
| | | | | | | | | | | | | | | | | | | | | | | | - These are not managed elsewhere, and need to be tracked and closed on emulation shutdown.
| * | | | | hle: kernel: k_server_port: Release ref-counted host emulation members on Destroy.bunnei2022-04-081-0/+3
| | | | | |
| * | | | | hle: kernel: k_auto_object: Move unregister with kernel to after Destroy.bunnei2022-04-081-3/+2
| | | | | | | | | | | | | | | | | | | | | | | | - Destructor is no longer invoked, so our object counting was off.
| * | | | | hle: service: sm: Remove manual tracking of KServerPorts.bunnei2022-04-082-8/+1
| | | | | |
| * | | | | hle: kernel: hle_ipc: HasSessionRequestHandler: Check if domain handler is expired rather than locking.bunnei2022-04-081-1/+1
| | | | | |
* | | | | | Merge pull request #8178 from tech-ticks/skyline-icache-fixbunnei2022-04-124-15/+34
|\ \ \ \ \ \ | |_|/ / / / |/| | | | | hle: kernel: Invalidate entire icache in UnmapProcessMemory and UnmapCodeMemory (fixes #8174)
| * | | | | hle: kernel: Invalidate entire icache in UnmapProcessMemory and UnmapCodeMemory (fixes #8174)tech-ticks2022-04-094-15/+34
| | | | | |
* | | | | | Merge pull request #8157 from lat9nq/kernel-racesbunnei2022-04-127-13/+15
|\ \ \ \ \ \ | | | | | | | | | | | | | | kernel: Fix some data races
| * | | | | | k_system_control: Fix data racelat9nq2022-04-061-3/+3
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | `return distribution(gen)` is a data race between a read and a write in two threads, reported by TSan. Remove static random number generators so they aren't using the same generator.
| * | | | | | k_auto_object: Fix data racelat9nq2022-04-041-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Change the memory order to acqure-release when we decrement the reference count. Prevents a race with line 89 reported by TSan.
| * | | | | | k_thread: Fix data racelat9nq2022-04-042-3/+4
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | TSan reports a data race between writing at cpp:1162 and reading at h:262. Make the thread_state atomic to prevent this.
| * | | | | | k_process: Fix data racelat9nq2022-04-041-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | TSan reported a race between thread 36 and thread 34, a read at :225 and a write at :225 respectively. Make total_proces_running_time_ticks atomic to avoid this race.
| * | | | | | kernel: Fix current_process racelat9nq2022-04-041-4/+4
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | TSan reported a race at :258 and :803, so make current_process an atomic pointer.
| * | | | | | k_scheduler_lock: Fix data racelat9nq2022-04-041-1/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | TSan reports a race between the main thread and T37 during IsLockedByCurrentThread and when it's set at the end of Lock(), respectively. Set owner_thread to an atomic pointer to fix it. Co-authored-by: bunnei <bunneidev@gmail.com>
* | | | | | | service: sfdnsres: add missing includes for some BSDs after 82d46a974ad4Jan Beich2022-04-121-0/+4
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | src/core/hle/service/sockets/sfdnsres.cpp: In function 'Service::Sockets::NetDbError Service::Sockets::AddrInfoErrorToNetDbError(s32)': src/core/hle/service/sockets/sfdnsres.cpp:66:10: error: 'EAI_NODATA' was not declared in this scope; did you mean 'EAI_NONAME'? 66 | case EAI_NODATA: | ^~~~~~~~~~ | EAI_NONAME src/core/hle/service/sockets/sfdnsres.cpp: In function 'std::vector<unsigned char> Service::Sockets::SerializeAddrInfo(const addrinfo*, s32, std::string_view)': src/core/hle/service/sockets/sfdnsres.cpp:127:53: error: 'sockaddr_in' does not name a type; did you mean 'SockAddrIn'? 127 | const auto addr = *reinterpret_cast<sockaddr_in*>(current->ai_addr); | ^~~~~~~~~~~ | SockAddrIn src/core/hle/service/sockets/sfdnsres.cpp:127:64: error: expected '>' before '*' token 127 | const auto addr = *reinterpret_cast<sockaddr_in*>(current->ai_addr); | ^ src/core/hle/service/sockets/sfdnsres.cpp:127:64: error: expected '(' before '*' token 127 | const auto addr = *reinterpret_cast<sockaddr_in*>(current->ai_addr); | ^ | ( src/core/hle/service/sockets/sfdnsres.cpp:127:65: error: expected primary-expression before '>' token 127 | const auto addr = *reinterpret_cast<sockaddr_in*>(current->ai_addr); | ^ src/core/hle/service/sockets/sfdnsres.cpp:127:84: error: expected ')' before ';' token 127 | const auto addr = *reinterpret_cast<sockaddr_in*>(current->ai_addr); | ^ | ) src/core/hle/service/sockets/sfdnsres.cpp:148:53: error: 'sockaddr_in6' does not name a type; did you mean 'SockAddrIn6'? 148 | const auto addr = *reinterpret_cast<sockaddr_in6*>(current->ai_addr); | ^~~~~~~~~~~~ | SockAddrIn6 src/core/hle/service/sockets/sfdnsres.cpp:148:65: error: expected '>' before '*' token 148 | const auto addr = *reinterpret_cast<sockaddr_in6*>(current->ai_addr); | ^ src/core/hle/service/sockets/sfdnsres.cpp:148:65: error: expected '(' before '*' token 148 | const auto addr = *reinterpret_cast<sockaddr_in6*>(current->ai_addr); | ^ | ( src/core/hle/service/sockets/sfdnsres.cpp:148:66: error: expected primary-expression before '>' token 148 | const auto addr = *reinterpret_cast<sockaddr_in6*>(current->ai_addr); | ^ src/core/hle/service/sockets/sfdnsres.cpp:148:85: error: expected ')' before ';' token 148 | const auto addr = *reinterpret_cast<sockaddr_in6*>(current->ai_addr); | ^ | )
* | | | | | | Merge pull request #8180 from liamwhite/symbolsFernando S2022-04-114-129/+231
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | core: extract symbol reading
| * | | | | | | core: extract symbol readingLiam2022-04-094-129/+231
| | |_|_|/ / / | |/| | | | |
* | | | | | | Merge pull request #8171 from tech-ticks/skyline-improvementsFernando S2022-04-107-30/+245
|\ \ \ \ \ \ \ | |/ / / / / / |/| | | | | | Improvements for game modding with Skyline, DNS resolution
| * | | | | | service: sfdnsres: Implement DNS address resolutiontech-ticks2022-04-082-5/+197
| | | | | | |
| * | | | | | service: bsd: Add keepalive socket optiontech-ticks2022-04-074-0/+10
| | | | | | |
| * | | | | | patch_manager: Apply layered exefs patches from 'atmosphere' SD directorytech-ticks2022-04-071-25/+38
| | |/ / / / | |/| | | |
* | | | | | Merge pull request #8138 from german77/data-no-racebunnei2022-04-086-176/+256
|\ \ \ \ \ \ | |_|_|/ / / |/| | | | | core: hid: Reduce the amount of data races
| * | | | | core: hid: Fix double lock on softlock and forced updatesNarr the Reg2022-04-081-2/+12
| | | | | |
| * | | | | core: hid: Replace lock_guard with scoped_lockNarr the Reg2022-04-073-44/+44
| | | | | |
| * | | | | core: hid: Reduce the amount of dataracesgerman772022-04-076-176/+246
| | | | | |
* | | | | | Merge pull request #8169 from merryhime/scoped_lockbunnei2022-04-0811-50/+50
|\ \ \ \ \ \ | | | | | | | | | | | | | | Replace lock_guard with scoped_lock
| * | | | | | core/hle: Standardize scoped_lock initializersMerry2022-04-075-23/+23
| | | | | | |
| * | | | | | core: Replace lock_guard with scoped_lockMerry2022-04-072-14/+14
| | | | | | |
| * | | | | | core/hle: Replace lock_guard with scoped_lockMerry2022-04-074-13/+13
| | | | | | |
* | | | | | | Merge pull request #8167 from Tachi107/patch-1merry2022-04-071-2/+0
|\ \ \ \ \ \ \ | |/ / / / / / |/| | | | | | fix: remove #pragma once in .cpp file
| * | | | | | fix: remove #pragma once in .cpp fileAndrea Pappacoda2022-04-071-2/+0
| |/ / / / /
* | | | | | Merge pull request #8148 from merryhime/interruptsFernando S2022-04-076-45/+42
|\ \ \ \ \ \ | |/ / / / / |/| | | | | dynarmic: Better interrupts
| * | | | | arm_dynarmic: Use HaltReason for svc calls and reschedulesmerry2022-04-034-27/+19
| | | | | |
| * | | | | dynarmic: Better interruptsmerry2022-04-036-22/+27
| | | | | |
* | | | | | Merge pull request #8164 from liamwhite/jit-stubbunnei2022-04-076-1/+86
|\ \ \ \ \ \ | | | | | | | | | | | | | | service: jit: stub JIT service
| * | | | | | service: jit: stub JIT serviceLiam2022-04-076-1/+86
| | |/ / / / | |/| | | |
* | | | | | Merge pull request #8122 from bunnei/improve-thread-usagebunnei2022-04-0613-27/+74
|\ \ \ \ \ \ | |/ / / / / |/| | | | | Improve usage of service host threads
| * | | | | hle: service: nvdrv: Create a service thread where appropriate.Morph2022-04-021-1/+1
| | | | | |
| * | | | | hle: service: vi: Create a service thread where appropriate.bunnei2022-04-021-1/+2
| | | | | |
| * | | | | hle: service: bsd: Create a service thread where appropriate.bunnei2022-04-021-1/+2
| | | | | |
| * | | | | hle: service: filesystem: Create a service thread where appropriate.bunnei2022-04-021-5/+8
| | | | | |
| * | | | | hle: service: audio: Create a service thread where appropriate.bunnei2022-04-022-4/+6
| | | | | |
| * | | | | hle: service: Add option for service interfaces to create or use the default thread.bunnei2022-04-025-11/+29
| | | | | |
| * | | | | hle: kernel: Create a default thread for services that do not need their own host thread.bunnei2022-04-022-4/+26
| |/ / / /
* | | | | service: hid: Partially revert #8123german772022-04-061-0/+4
| | | | |
* | | | | Merge pull request #8137 from bunnei/improve-nvflinger-2bunnei2022-04-069-91/+99
|\ \ \ \ \ | | | | | | | | | | | | Follow-up fixes for NVFlinger rewrite (Part 2)
| * | | | | hle: service: nvflinger: buffer_queue_producer: Cleanup & fixes.bunnei2022-04-022-61/+42
| | | | | |
| * | | | | hle: service: nvflinger: consumer_base: Cleanup & fixes.bunnei2022-04-022-15/+17
| | | | | |
| * | | | | hle: service: nvflinger: buffer_queue_producer: Cleanup & add GetReleasedBuffers.bunnei2022-04-022-10/+38
| | | | | |
| * | | | | hle: service: nvflinger: buffer_queue_core: Cleanup & fixes.bunnei2022-04-022-3/+0
| | | | | |
| * | | | | hle: service: nvflinger: Use correct logger namespace.bunnei2022-04-021-2/+2
| |/ / / /
* | | | | Merge pull request #8100 from Morph1984/registered-crashbunnei2022-04-061-2/+4
|\ \ \ \ \ | | | | | | | | | | | | registered_cache: Prevent nullptr dereference when accumulating files
| * | | | | registered_cache: Prevent nullptr dereference when accumulating filesMorph2022-03-271-2/+4
| | | | | | | | | | | | | | | | | | | | | | | | For whatever reason, nca_file/dir can be nullptr in the list of files/dirs. I have not determined the cause of this yet, so add a nullptr check for these prior to dereferencing them.
* | | | | | dynarmic: Print stack trace on unrecognised instruction or other exceptionmerry2022-04-052-0/+4
| | | | | |
* | | | | | Merge pull request #8089 from merryhime/paranoiabunnei2022-04-042-44/+56
|\ \ \ \ \ \ | |_|_|/ / / |/| | | | | configuration: Add Paranoid CPU accuracy level
| * | | | | configuration: Add Paranoid CPU accuracy levelmerry2022-03-262-44/+56
| | | | | | | | | | | | | | | | | | | | | | | | Disables most optimizations for the paranoid.
* | | | | | Merge pull request #8135 from Morph1984/websession-hackbunnei2022-04-031-0/+8
|\ \ \ \ \ \ | | | | | | | | | | | | | | applets/web: Keep foreground (websession) web applet open
| * | | | | | applets/web: Keep foreground (websession) web applet openMorph2022-04-021-0/+8
| | |_|/ / / | |/| | | | | | | | | | | | | | | | This is a hack to keep the foreground (websession) web applet open in games using these such as Super Mario 3D All-Stars.
* | | | | | Merge pull request #8123 from german77/bombslingerbunnei2022-04-033-66/+69
|\ \ \ \ \ \ | | | | | | | | | | | | | | service: hid: Remove inaccurate behavior on initialization
| * | | | | | service: npad: Default initialize shared memorygerman772022-04-031-48/+48
| | | | | | |
| * | | | | | service: hid: Remove inaccurate behavior on initializationgerman772022-03-313-18/+21
| | | | | | |
* | | | | | | fix: typosAndrea Pappacoda2022-04-022-7/+7
| |/ / / / / |/| | | | |
* | | | | | Merge pull request #8116 from ameerj/nvhost_ctrl_bad_paramFernando S2022-04-011-1/+1
|\ \ \ \ \ \ | | | | | | | | | | | | | | nvhost_ctrl: Only mark EventState::Busy as BadParameter
| * | | | | | nvhost_ctrl: Only mark EventState::Busy as BadParameterameerj2022-03-291-1/+1
| |/ / / / / | | | | | | | | | | | | | | | | | | Fixes an svc break in Kirby and the Forgotten Land with async GPU enabled.
* | | | | | Merge pull request #8120 from german77/signalbunnei2022-03-311-0/+4
|\ \ \ \ \ \ | | | | | | | | | | | | | | service: hid: Signal event on AcquireNpadStyleSetUpdateEventHandle
| * | | | | | service: hid: Signal event on AcquireNpadStyleSetUpdateEventHandleNarr the Reg2022-03-311-0/+4
| | | | | | |
* | | | | | | Merge pull request #8090 from bunnei/fix-skylinebunnei2022-03-315-54/+241
|\ \ \ \ \ \ \ | |_|/ / / / / |/| | | | | | Kernel Memory Updates (Part 7): Various fixes to code memory (Skyline support)
| * | | | | | hle: kernel: k_page_table: Fix implementations of LockForCodeMemory & UnlockForCodeMemory.bunnei2022-03-261-48/+12
| | | | | | |
| * | | | | | hle: kernel: k_page_table: Implement LockMemoryAndOpen & UnlockMemory.bunnei2022-03-262-0/+124
| | | | | | |
| * | | | | | hle: kernel: svc: MapProcessMemory: Fix usage of KPageLinkedList to use physical address space.bunnei2022-03-261-2/+5
| | | | | | |
| * | | | | | hle: kernel: svc: CreateCodeMemory: Remove log of 'out' host pointer.bunnei2022-03-261-2/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | - This does not seem terribly useful and is inconsistent with other usage.
| * | | | | | hle: kernel: k_code_memory: Fix usage of KPageLinkedList to use physical address space.bunnei2022-03-261-1/+2
| | | | | | |
| * | | | | | hle: kernel: k_page_table: Implement MakeAndOpenPageGroup & MakePageGroup.bunnei2022-03-262-0/+83
| | | | | | |
| * | | | | | hle: kernel: k_page_table: Add IsHeapPhysicalAddress method.bunnei2022-03-261-0/+8
| | | | | | |
| * | | | | | hle: kernel: k_page_linked_list: Add Empty method.bunnei2022-03-261-0/+4
| | | | | | |
| * | | | | | hle: kernel: svc: UnmapProcessCodeMemory: Fix inverted alignment check.bunnei2022-03-261-1/+1
| | |/ / / / | |/| | | |
* | | | | | arm_dynarmic_64: Invalidate on all coresmerry2022-03-271-2/+4
| |_|/ / / |/| | | |
* | | | | Merge pull request #8088 from bunnei/fixup-nvflingerFernando S2022-03-279-547/+136
|\ \ \ \ \ | | | | | | | | | | | | Follow-up fixes for NVFlinger rewrite
| * | | | | hle: service: nvflinger: buffer_queue: Remove AutoLock and fix free buffer tracking.bunnei2022-03-265-181/+130
| | | | | |
| * | | | | hle: service: nvflinger: buffer_queue_consumer: Use scoped_lock instead of unique_lock.bunnei2022-03-261-2/+2
| | | | | |
| * | | | | hle: service: nvflinger: consumer_base: Use scoped_lock instead of unique_lock.bunnei2022-03-261-4/+4
| | | | | |
| * | | | | hle: service: nvflinger: Remove unused BufferQueue.bunnei2022-03-262-360/+0
| | | | | |
* | | | | | Revert "Memory GPU <-> CPU: reduce infighting in the texture cache by adding CPU Cached memory."bunnei2022-03-261-1/+1
| |/ / / / |/| | | |
* | | | | Merge pull request #8041 from Morph1984/inline-swkbdbunnei2022-03-263-166/+415
|\ \ \ \ \ | |/ / / / |/| | | | applets/swkbd: Add support for an updated inline software keyboard
| * | | | applets/swkbd: Split software keyboard initializationMorph2022-03-222-160/+349
| | | | | | | | | | | | | | | | | | | | | | | | | Since the CalcArg struct has been updated with a new size and fields, we have to split the initialization of the keyboard into multiple functions. This also adds support for parsing the new CalcArg struct used by updated versions of Monster Hunter Rise.
| * | | | applets/swkbd: Add new inline software keyboard typesMorph2022-03-221-6/+66
| |/ / / | | | | | | | | | | | | These were added in newer firmware versions.
* | | | Memory: Don't protect reads on Normal accuracy.Fernando Sahmkow2022-03-251-1/+1
| | | |
* | | | hle: nvflinger: ConsumerBase: Mark ctor as explicit.bunnei2022-03-251-1/+1
| | | |
* | | | hle: vi: NativeWindow: Fix trivially copyable issues.bunnei2022-03-251-4/+4
| | | |
* | | | hle: nvdrv: nvdata: buffer_queue_producer: Minor cleanup.bunnei2022-03-251-11/+11
| | | |
* | | | hle: nvdrv: nvdata: Cleanup NvFence static assert.bunnei2022-03-251-1/+1
| | | |
* | | | hle: nvflinger: Remove unused unordered_map include.bunnei2022-03-251-1/+0
| | | |
* | | | hle: nvflinger: buffer_queue_consumer: AcquireBuffer: Fix typo.bunnei2022-03-251-1/+1
| | | |
* | | | hle: nvflinger: Merge Rect with Common::Rectangle.bunnei2022-03-255-85/+9
| | | |
* | | | hle: nvflinger: buffer_queue_core: Declare default dtor.bunnei2022-03-252-0/+3
| | | |
* | | | hle: nvflinger: buffer_queue_producer: DequeueBuffer: Remove unnecessary lock.bunnei2022-03-251-3/+1
| | | |
* | | | hle: nvflinger: consumer_base: StillTracking: Should be const.bunnei2022-03-252-2/+3
| | | |
* | | | hle: nvflinger: graphic_buffer_producer: Remove unnecessary pragma pack.bunnei2022-03-251-2/+0
| | | |
* | | | hle: nvflinger: parcel: Reserve token size.bunnei2022-03-251-1/+2
| | | |
* | | | hle: nvflinger: buffer_queue_core: StillTracking: Take const reference.bunnei2022-03-254-7/+7
| | | |
* | | | hle: nvflinger: buffer_queue_core: Cleanup locking.bunnei2022-03-251-2/+2
| | | |
* | | | hle: nvflinger: Use std::chrono for present_ns.bunnei2022-03-257-25/+30
| | | |
* | | | hle: nvflinger: Migrate android namespace -> Service::android.bunnei2022-03-2529-61/+58
| | | |
* | | | hle: nvflinger: BufferQueueProducer: Handle SetPreallocatedBuffer with empty buffer.bunnei2022-03-251-7/+10
| | | | | | | | | | | | | | | | - Used by Naruto Ultimate Ninja Storm.
* | | | hle: vi: Integrate new NVFlinger and HosBinderDriverServer service.bunnei2022-03-2516-723/+285
| | | |
* | | | hle: nvflinger: Add implementation for HosBinderDriverServer service.bunnei2022-03-253-0/+75
| | | |
* | | | hle: nvflinger: Add implementation for BufferQueueProducer class.bunnei2022-03-253-2/+1021
| | | |
* | | | hle: nvflinger: Add implementation for BufferQueueCore class.bunnei2022-03-253-0/+235
| | | |
* | | | hle: nvflinger: Add implementation for BufferQueueConsumer class.bunnei2022-03-253-0/+263
| | | |
* | | | hle: nvflinger: Add implementation for QueueBufferInput and QueueBufferOutput structs.bunnei2022-03-253-0/+100
| | | |
* | | | hle: nvflinger: Add implementation for BufferItemConsumer class.bunnei2022-03-253-0/+87
| | | |
* | | | hle: nvflinger: Add implementation for ConsumerBase class.bunnei2022-03-253-0/+190
| | | |
* | | | hle: nvflinger: Add implementation for BufferSlot class.bunnei2022-03-252-0/+40
| | | |
* | | | hle: nvflinger: Add implementation for BufferItem class.bunnei2022-03-252-0/+47
| | | |
* | | | hle: nvflinger: Move implementation for Parcel to its own header.bunnei2022-03-252-0/+172
| | | |
* | | | hle: nvflinger: Add android buffer queue definitions to its own header.bunnei2022-03-252-0/+22
| | | |
* | | | hle: nvflinger: Add IBinder interface.bunnei2022-03-252-0/+43
| | | |
* | | | hle: nvflinger: Add IConsumerListener interface.bunnei2022-03-252-0/+27
| | | |
* | | | hle: nvflinger: Add ProducerListener interface.bunnei2022-03-252-0/+17
| | | |
* | | | hle: nvflinger: Add android window enumerations to its own header.bunnei2022-03-252-0/+54
| | | |
* | | | hle: nvflinger: Add android Status flags to its own header.bunnei2022-03-251-0/+28
| | | |
* | | | hle: nvflinger: Move BufferTransformFlags to its own header.bunnei2022-03-253-1/+27
| | | |
* | | | hle: nvdrv: Rename Fence to NvFence to avoid naming conflicts.bunnei2022-03-254-17/+13
| | | |
* | | | hle: nvflinger: Move PixelFormat to its own header.bunnei2022-03-255-10/+31
| | | |
* | | | hle: nvflinger: Add implementation for GraphicBuffer class.bunnei2022-03-252-0/+101
| | | |
* | | | hle: nvflinger: Add implementation for Fence class.bunnei2022-03-252-0/+34
| | | |
* | | | hle: nvflinger: Add implementation for Rect class.bunnei2022-03-252-0/+76
| | | |
* | | | Merge pull request #8031 from Morph1984/cleanup-mii-pleasebunnei2022-03-2318-572/+642
|\ \ \ \ | | | | | | | | | | applets: Cleanup MiiEdit applet implementation
| * | | | applets/mii: Remove unused includeMorph2022-03-221-1/+0
| | | | |
| * | | | applets/mii: Remove frontend parametersMorph2022-03-222-17/+4
| | | | | | | | | | | | | | | | | | | | These are unused for now as we do not support a frontend implementation.
| * | | | applets/mii: Cleanup MiiEdit applet implementationMorph2022-03-222-44/+85
| | | | | | | | | | | | | | | | | | | | This also enables proper support for MiiEdit applets which are used in games with firmware versions prior to 10.2.0 by handling the 2 different versions of applet inputs and outputs.
| * | | | applets/mii: Cleanup MiiEdit applet typesMorph2022-03-221-23/+44
| | | | |
| * | | | applets/mii: Move MiiEdit applet types into its own fileMorph2022-03-224-54/+70
| | | | |
| * | | | service: Move mii enums and structs into its own fileMorph2022-03-227-308/+312
| | | | | | | | | | | | | | | | | | | | Moves these into types.h, since other files also make use of these types.
| * | | | applets: Rename Mii to MiiEditMorph2022-03-227-45/+47
| |/ / /
* / / / Revert "dynarmic: Reduce size of code caches"bunnei2022-03-232-4/+4
|/ / /
* | | Merge pull request #8048 from ameerj/include-purgebunnei2022-03-2241-52/+13
|\ \ \ | | | | | | | | general: Reduce unused includes across the project
| * | | general: Fix clang/gcc build errorsameerj2022-03-202-4/+5
| | | |
| * | | common: Reduce unused includesameerj2022-03-194-0/+6
| | | |
| * | | core: Reduce unused includesameerj2022-03-1938-54/+8
| | | |
* | | | Merge pull request #8040 from Morph1984/handle-tablebunnei2022-03-202-30/+12
|\ \ \ \ | |/ / / |/| | | KHandleTable: Optimize table entry layout
| * | | KHandleTable: Optimize table entry layoutMorph2022-03-182-30/+12
| | | | | | | | | | | | | | | | Since the handle type is not being used, we can reduce the amount of space each entry takes up by 4 bytes.
* | | | Merge pull request #8028 from v1993/patch-9bunnei2022-03-191-2/+2
|\ \ \ \ | | | | | | | | | | bsd: Allow inexact match for address length in AcceptImpl
| * | | | bsd: Allow inexact match for address length in AcceptImplValeri2022-03-151-2/+2
| |/ / / | | | | | | | | Minecraft passes in zero for length, but this should account for all possible cases
* | | | general: Reduce core.h includesameerj2022-03-184-7/+23
| | | |
* | | | Merge pull request #7964 from german77/miiiibunnei2022-03-177-5/+270
|\ \ \ \ | | | | | | | | | | applet: mii: Simple implementation of mii applet
| * | | | applet: mii: Simple implementation of mii appletgerman772022-03-017-5/+270
| | | | |
* | | | | core: hle: kernel: init_slab_setup: Move CalculateSlabHeapGapSize to global namespace.bunnei2022-03-151-6/+6
| | | | |
* | | | | core: hle: kernel: Allocate dummy threads on host thread storage.bunnei2022-03-152-8/+6
| | | | | | | | | | | | | | | | | | | | - Fixes a crash where on subsequent boots, long-lived host threads would have their dummy threads freed.
* | | | | core: hle: kernel: Downgrade dangling objects warning to debug.bunnei2022-03-151-2/+2
| | | | | | | | | | | | | | | | | | | | - It is not impossible to leak kernel objects, so this is not really any issue anymore (albeit, still interesting).
* | | | | core: hle: kernel: Make object list container global and ensure it is reset on each emulation session.bunnei2022-03-151-7/+9
| | | | |
* | | | | core: hle: kernel: Remove server session tracking.bunnei2022-03-154-37/+1
| | | | | | | | | | | | | | | | | | | | - These are now allocated/managed by emulated memory, so we do not need to track and free them on shutdown.
* | | | | core: hle: kernel: k_process: Remove handle table finalize, reset page table.bunnei2022-03-151-3/+3
| | | | |
* | | | | core: hle: kernel: k_process: Implement thread local storage accurately.bunnei2022-03-153-111/+99
| | | | |
* | | | | core: hle: kernel: k_page_table: Add implementations of MapPages, UnmapPages, and FindFreeArea for TLS.bunnei2022-03-152-2/+141
| | | | |
* | | | | core: hle: kernel: k_slab_heap: Refresh to use guest allocations.bunnei2022-03-152-125/+107
| | | | |
* | | | | core: hle: kernel: Update init_slab_heap, use device memory, and add KThreadLocalPage and KPageBuffer.bunnei2022-03-154-55/+92
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | - Refreshes our slab initialization code to latest known behavior. - Moves all guest kernel slabs into emulated device memory. - Adds KThreadLocalPage and KPageBuffer, which we will use for accurate TLS management.
* | | | | core: hle: kernel: k_page_buffer: Add KThreadLocalPage primitive.bunnei2022-03-153-0/+179
| | | | |
* | | | | core: hle: kernel: k_page_buffer: Add KPageBuffer primitive.bunnei2022-03-152-0/+35
| | | | |
* | | | | core: hle: kernel: k_thread: Ensure host Fiber is freed.bunnei2022-03-151-0/+3
| | | | |
* | | | | core: hle: kernel: k_server_session: Ensure SessionRequestManager is freed.bunnei2022-03-151-0/+3
| | | | |
* | | | | core: hle: service: kernel_helpers: Use system resource limit.bunnei2022-03-151-10/+1
| | | | |
* | | | | core: hle: service: sm: Fix KPort reference count.bunnei2022-03-151-0/+2
| | | | |
* | | | | core: hle: kernel: k_thread: Update to reflect tree changes.bunnei2022-03-151-3/+3
| | | | |
* | | | | core: hle: kernel: Use weak_ptr where possible for SessionRequestHandler and SessionRequestManager.bunnei2022-03-157-14/+25
| | | | |
* | | | | core: hle: kernel: k_memory_layout: Update kernel slab memory sizes.bunnei2022-03-151-3/+3
| | | | |
* | | | | core: hle: kernel: svc_types: Add ThreadLocalRegionSize.bunnei2022-03-151-0/+2
| | | | |
* | | | | core: hle: kernel: k_condition_variable: Update to reflect tree changes.bunnei2022-03-151-1/+1
| | | | |
* | | | | core: hle: kernel: k_address_arbiter: Update to reflect tree changes.bunnei2022-03-151-3/+3
| |/ / / |/| | |
* | | | dynarmic: Reduce size of code cachesMerry2022-03-132-4/+4
| | | |
* | | | hle: service: ldr: Use deterministic addresses when mapping NROs.bunnei2022-03-092-24/+62
| | | | | | | | | | | | | | | | | | | | - Instead of randomization, choose in-order addresses for where to map NROs into memory. - This results in predictable behavior when debugging and consistent behavior when reproducing issues.
* | | | Merge pull request #7986 from lat9nq/vk-callbackbunnei2022-03-082-2/+13
|\ \ \ \ | | | | | | | | | | core, video_core: Fix two crashes when failing to create the emulated GPU instance
| * | | | emu_window: Create a way to Cancel the exit of a Scopedlat9nq2022-03-081-1/+10
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | If a GraphicsContext is destroyed before its Scoped is destroyed, this causes a crash as the Scoped tries to call a method in the destroyed context on exit. Add a way to Cancel the call when we know that calling the GraphicsContext will not work.
| * | | | core: Don't shutdown a null GPUlat9nq2022-03-071-1/+3
| | |/ / | |/| | | | | | | | | | | | | | | | | | | | | | When CreateGPU fails, yuzu would try and shutdown the GPU instance regardless of whether any instance was actually created. Check for nullptr before calling its methods to prevent a crash.
* / | | hle: kernel: KPageTable: Improve implementations of MapCodeMemory and UnmapCodeMemory.bunnei2022-03-082-47/+116
|/ / / | | | | | | | | | | | | - This makes these functions more accurate to the real HOS implementations. - Fixes memory access issues in Super Smash Bros. Ultimate that occur when un/mapping NROs.
* | | Merge pull request #7956 from bunnei/improve-mem-managerbunnei2022-03-0315-376/+848
|\ \ \ | | | | | | | | Kernel Memory Updates (Part 4): Revamp KMemoryManager & other fixes
| * | | hle: kernel: Re-create memory layout at initialization.bunnei2022-02-281-41/+43
| | | | | | | | | | | | | | | | - As this can only be derived once.
| * | | hle: kernel: Remove unused pool locals.bunnei2022-02-281-2/+0
| | | |
| * | | hle: kernel: k_memory_manager: Rework for latest kernel behavior.bunnei2022-02-286-173/+548
| | | | | | | | | | | | | | | | | | | | | | | | - Updates the KMemoryManager implementation against latest documentation. - Reworks KMemoryLayout to be accessed throughout the kernel. - Fixes an issue with pool sizes being incorrectly reported.
| * | | hle: kernel: k_page_heap: GetPhysicalAddr can be const.bunnei2022-02-271-2/+1
| | | |
| * | | hle: kernel: k_page_heap: Remove superfluous consexpr.bunnei2022-02-272-4/+4
| | | |
| * | | hle: kernel: k_page_heap: Various updates and improvements.bunnei2022-02-272-155/+192
| | | | | | | | | | | | | | | | | | | | - KPageHeap tracks physical addresses, not virtual addresses. - Various updates and improvements to match latest documentation for this type.
| * | | hle: kernel: Add initial_process.h header.bunnei2022-02-272-0/+24
| | | |
| * | | hle: kernel: board: nx: Add k_memory_layout.h header.bunnei2022-02-272-0/+14
| | | |
| * | | hle: kernel: k_system_control: Add GetRealMemorySize and update GetKernelPhysicalBaseAddress.bunnei2022-02-272-1/+12
| | | |
| * | | hle: kernel: k_memory_layout: Add GetPhysicalLinearRegion.bunnei2022-02-271-0/+4
| | | |
| * | | hle: kernel: k_memory_region_types: Update for new regions.bunnei2022-02-271-1/+9
| |/ /
* / / dynarmic: Inline exclusive memory accessesmerry2022-02-276-6/+31
|/ / | | | | | | | | | | | | | | | | | | | | | | | | | | | | Inlines implementation of exclusive instructions into JITted code, improving performance of applications relying heavily on these instructions. We also fastmem these instructions for additional speed, with support for appropriate recompilation on fastmem failure. An unsafe optimization to disable the intercore global_monitor is also provided, should one wish to rely solely on cmpxchg semantics for safety. See also: merryhime/dynarmic#664
* | Merge pull request #7932 from bunnei/extended-mem-layoutbunnei2022-02-2614-55/+69
|\ \ | | | | | | Add extended memory layout (6GB) support and improve KResourceLimit management
| * | hle: kernel: KSystemControl: Use 6GB memory layout when "use_extended_memory_layout" setting is enabled.bunnei2022-02-211-20/+4
| | | | | | | | | | | | - This uses a larger 6GB DRAM memory layout, which is useful for some mods that require more memory.
| * | core: device_memory: Use memory size reported by KSystemControl.bunnei2022-02-213-7/+5
| | | | | | | | | | | | - That way, we can consolidate the memory layout to one place.
| * | core: hle: kernel: Remove resource limit hack for PhysicalMemory.bunnei2022-02-211-7/+0
| | | | | | | | | | | | - With prior changes, we now report the correct amount of physical memory available to the emulated process.
| * | core: hle: kernel: KProcess: Pass in KResourceLimit on process creation.bunnei2022-02-214-9/+30
| | | | | | | | | | | | - This allows us to have a resource limit per process, rather than use the global system resource limit.
| * | core: hle: kernel: KEvent: Pass in owner KProcess on event creation.bunnei2022-02-214-12/+8
| | | | | | | | | | | | - This is necessary to ensure resource limits are freed from the right process.
| * | core: hle: kernel: KResourceLimit: Add a helper function for creating a KResourceLimit for a process.bunnei2022-02-212-0/+22
| | |
* | | service: am: Update enum names to match documentationNarr the Reg2022-02-224-16/+51
|/ /
* | Merge pull request #7919 from bunnei/phys-mem-updatesbunnei2022-02-211-125/+430
|\ \ | | | | | | core: hle: kernel: KPageTable: Improve Un/MapPhysicalMemory.
| * | fixup! core: hle: kernel: KPageTable: Improve Un/MapPhysicalMemory.bunnei2022-02-191-22/+2
| | |
| * | core: hle: kernel: KPageTable: Improve Un/MapPhysicalMemory.bunnei2022-02-191-107/+432
| | | | | | | | | | | | - Improves the implementations of MapPhysicalMemory and UnmapPhysicalMemory to more closely reflect latest HOS.
* | | Merge pull request #7920 from bunnei/fix-unmap-pagesbunnei2022-02-211-3/+2
|\ \ \ | | | | | | | | core: hle: kernel: KPageTable: Fix UnmapPages.
| * | | core: hle: kernel: KPageTable: Fix UnmapPages.bunnei2022-02-191-3/+2
| |/ / | | | | | | | | | - Fixes a logic bug in KPageTable::UnmapPages.
* | | Merge pull request #7867 from german77/amiibobunnei2022-02-194-249/+926
|\ \ \ | |/ / |/| | nfp: Improve amiibo support
| * | nfp: Allow files without password datagerman772022-02-132-9/+24
| | |
| * | nfp: Separate nfc tag from amiibo dataNarr the Reg2022-02-103-44/+76
| | |
| * | nfp: Address compiler issuesgerman772022-02-091-25/+26
| | |
| * | nfp: Validate amiibo filesNarr the Reg2022-02-082-41/+145
| | |
| * | nfp: Improve implementationgerman772022-02-084-189/+672
| | |
| * | nfp: Move IUser class to header and add missing enum and structsgerman772022-02-072-257/+299
| | |
| * | nfp: Sort functions by command numbergerman772022-02-071-79/+79
| | |
* | | Merge pull request #7866 from xerpi/svc-OutputDebugString32-CreateCodeMemory32-ControlCodeMemory32Mai M2022-02-172-4/+40
|\ \ \ | | | | | | | | kernel: svc: Add OutputDebugString32, CreateCodeMemory32, ControlCodeMemory32
| * | | kernel: svc: Add OutputDebugString32, CreateCodeMemory32, ControlCodeMemory32Sergi Granell2022-02-152-4/+40
| | | | | | | | | | | | | | | | | | | | Very straightforward, they are just wrappers to the 64-bit version of the SVC.
* | | | Merge pull request #7878 from german77/mnppbunnei2022-02-174-0/+69
|\ \ \ \ | | | | | | | | | | service/mnpp: Stub mnpp_app
| * | | | service/mnpp: Stub mnpp_appNarr the Reg2022-02-114-0/+69
| | |/ / | |/| | | | | | | | | | Used in Super Nintendo Entertainment System™ - Nintendo Switch Online
* | | | Merge pull request #7899 from Kelebek1/testMorph2022-02-161-9/+9
|\ \ \ \ | |_|/ / |/| | | file_sys: Dump patched exefs rather than base
| * | | Dump patched exefs rather than baseKelebek12022-02-151-9/+9
| | |/ | |/|
* | | Merge pull request #7871 from german77/svc2bunnei2022-02-151-77/+77
|\ \ \ | |/ / |/| | svc: Set unique names for function tables
| * | svc: Set unique names for function tablesNarr the Reg2022-02-091-77/+77
| |/
* | hid: Stub IsUsbFullKeyControllerEnabledlat9nq2022-02-122-1/+12
| | | | | | | | | | | | Used by Splatoon 2, when opening the inventory from a LAN battle lobby. Reference: https://switchbrew.org/wiki/HID_services
* | Merge pull request #7852 from Morph1984/new-uuidbunnei2022-02-1116-66/+65
|\ \ | | | | | | common: Revise and fix the UUID implementation
| * | general: Rename NewUUID to UUID, and remove the previous UUID implMorph2022-02-0521-125/+121
| | | | | | | | | | | | This completes the removal of the old UUID implementation.
| * | profile: Migrate to the new UUID implementationMorph2022-02-059-108/+111
| | |
| * | hle: ipc_helpers: Ignore -Wclass-memaccessMorph2022-02-051-0/+8
| | | | | | | | | | | | This warning is triggered by GCC when copying into non-trivially default constructible types, as it uses the more restrictive std::is_trivial (which includes std::is_trivially_default_constructible) to determine whether memcpy is safe instead of std::is_trivially_copyable.
| * | service: Migrate to the new UUID implementationMorph2022-02-059-45/+36
| | |
| * | input/hid: Migrate to the new UUID implementationMorph2022-02-053-15/+16
| | |
* | | hle: kernel: KCodeMemory: Remove unused QueryMemory.bunnei2022-02-091-1/+0
| | |
* | | hle: kernel: KCodeMemory: Correct m_page_group number of pages.bunnei2022-02-091-2/+3
| |/ |/| | | Credits to @xerpi for finding this issue and pointing it out on #7519.
* | Merge pull request #7847 from tech-ticks/masterMorph2022-02-062-1/+46
|\ \ | |/ |/| service: pm: Implement AtmosphereGetProcessInfo
| * service: pm: Implement AtmosphereGetProcessInfotech-ticks2022-02-042-1/+46
| |
* | Merge pull request #7839 from german77/batterybunnei2022-02-051-1/+1
|\ \ | |/ |/| yuzu: ui: Improve battery symbols
| * yuzu: ui: Improve battery symbolsNarr the Reg2022-02-021-1/+1
| |
* | Merge pull request #7835 from bunnei/page-table-lockbunnei2022-02-032-34/+46
|\ \ | | | | | | hle: kernel: KPageTable: Migrate locks to KScopedLightLock.
| * | hle: kernel: KPageTable: Migrate locks to KScopedLightLock.bunnei2022-02-022-34/+46
| |/ | | | | | | - More accurately reflects real kernel behavior by using guest locks.
* | general: Replace NonCopyable struct with equivalentsLioncash2022-02-029-105/+159
| |
* | general: Move deleted copy/move constructor/assignment operators to public interfaceLioncash2022-02-027-11/+9
|/ | | | | | | | This allows for better compiler errors, where the compiler will state a copy or move couldn't occur due to the relevant function being deleted. Previously a compiler would warn about the relevant function not being accessible (which, while true, isn't as informative as it could be).
* svc: Add 32 bit SynchronizePreemptionStateNarr the Reg2022-02-011-1/+1
| | | | Used by Espgaluda II
* Merge pull request #7787 from bunnei/scheduler-deadlock-fixMorph2022-01-292-23/+24
|\ | | | | hle: kernel: KScheduler: Fix deadlock with core waiting for a thread lock that has migrated.
| * hle: kernel: KScheduler: Fix deadlock with core waiting for a thread lock that has migrated.bunnei2022-01-272-23/+24
| | | | | | | | | | | | | | | | - Previously, it was possible for a thread migration to occur from core A to core B. - Next, core B waits on a guest lock that must be released by a thread queued for core A. - Meanwhile, core A is still waiting on the core B's current thread lock - resulting in a deadlock. - Fix this by try-locking the thread lock. - Fixes softlocks in FF8 and Pokemon Legends Arceus.
* | Merge pull request #7770 from german77/motion-thresholdbunnei2022-01-282-2/+3
|\ \ | |/ |/| input_common: Add option to configure gyro threshold
| * input_common: Add option to configure gyro thresholdgerman772022-01-242-2/+3
| |
* | Merge pull request #7762 from bunnei/un-map-improvebunnei2022-01-273-111/+108
|\ \ | | | | | | Kernel Memory Updates (Part 4): Improve Un/MapPages, and more.
| * | core: hle: kernel: KPageTable: Various improvements to MapPages and UnmapPages.bunnei2022-01-231-22/+25
| | |
| * | core: hle: kernel: KPageTable: MapProcessCode: Various cleanup.bunnei2022-01-231-11/+12
| | |
| * | core: hle: kernel: KPageTable: ReserveTransferMemory: Various cleanup.bunnei2022-01-231-6/+6
| | |
| * | core: hle: kernel: KPageTable: ResetTransferMemory: Various cleanup.bunnei2022-01-231-6/+5
| | |
| * | core: hle: kernel: KPageTable: SetMemoryAttribute: Various cleanup.bunnei2022-01-231-2/+3
| | |
| * | core: hle: kernel: KPageTable: Assert valid address on GetPhysicalAddr.bunnei2022-01-221-1/+3
| | |
| * | core: hle: kernel: KPageTable: Operate: Assert lock ownership.bunnei2022-01-221-2/+2
| | |
| * | core: hle: kernel: KPageTable: SetHeapSize: Cleanup & take physical memory lock.bunnei2022-01-221-4/+7
| | |
| * | core: hle: kernel: Refactor Un/MapPhysicalMemory to remove unnecessary methods.bunnei2022-01-222-50/+39
| | |
| * | core: hle: kernel: Rename Un/Map to Un/MapMeory.bunnei2022-01-223-7/+6
| |/
* | Merge pull request #7771 from lioncash/assertMorph2022-01-251-2/+0
|\ \ | | | | | | kernel/k_affinity_mask: Remove duplicated assert
| * | kernel/k_affinity_mask: Remove duplicated assertLioncash2022-01-241-2/+0
| |/ | | | | | | This is already checked inside GetCoreBit()
* / hle: kernel: KThread: Improve Increment/Decrement RunningThreadCount.bunnei2022-01-233-24/+21
|/ | | | - Previously implementation was incorrect, and would occasionally underflow.
* Merge pull request #7737 from bunnei/fix-dummy-thread-leakbunnei2022-01-228-38/+118
|\ | | | | Various fixes to HLE service thread management
| * hle: kernel: KThread: Ensure host (dummy) threads block on locking.bunnei2022-01-224-0/+89
| | | | | | | | | | - But do not enter the priority queue, as otherwise they will be scheduled. - Allows dummy threads to use guest synchronization primitives.
| * hle: kernel: Remove redundant tracking of dummy threads.bunnei2022-01-211-9/+3
| | | | | | | | - These are already tracked by kernel's registered_objects member.
| * hle: kernel: KThread: DummyThread can be waited, ensure wait_queue is not nullptr.bunnei2022-01-211-6/+6
| |
| * hle: kernel: KThread: Decrease DummyThread priority to ensure it is never scheduled.bunnei2022-01-213-2/+5
| |
| * hle: kernel: service_thread: Ensure dummy thread is closed & destroyed on thread exit.bunnei2022-01-211-0/+5
| |
| * hle: kernel: KServerSession: Remove hack for CompleteSyncRequest.bunnei2022-01-211-11/+0
| | | | | | | | - This does not appear to be necessary anymore.
| * hle: kernel: KServerSession: Simplify CompleteSyncRequest EndWait.bunnei2022-01-212-12/+2
| | | | | | | | | | - Considering is_thread_waiting is never set, so we can remove IsThreadWaiting. - KThread::EndWait will take the scheduler lock, so we can remove the redundant lock.
| * hle: kernel: KThread: Ensure dummy threads never call EndWait.bunnei2022-01-211-0/+5
| | | | | | | | - These are only used by host threads for locking and will never have a wait_queue.
| * hle: kernel: KScheduler: Ensure dummy threads are never scheduled.bunnei2022-01-211-0/+5
| | | | | | | | - These are only used by host threads for locking.
| * hle: kernel: KThread: Rename thread_type_for_debugging -> thread_type.bunnei2022-01-212-4/+4
| | | | | | | | - This will be used to ensure that we do not schedule dummy threads.
* | Merge pull request #7752 from Morph1984/SetCpuOverclockEnabledbunnei2022-01-221-1/+13
|\ \ | | | | | | service: apm: Stub ISession SetCpuOverclockEnabled
| * | service: apm: Stub ISession SetCpuOverclockEnabledMorph2022-01-211-1/+13
| | | | | | | | | | | | | | | | | | Since we don't currently support CPU overclocking within the emulated system, this can be stubbed for now, like APM IsCpuOverclockEnabled. - Used by Gravity Rider Zero
* | | service/wlan: Update function tablesLioncash2022-01-211-1/+1
| | |
* | | service/usb: Update function tablesLioncash2022-01-211-27/+15
| | |
* | | service/set: Update function tablesLioncash2022-01-211-0/+2
| | |
* | | service/ns: Update function tablesLioncash2022-01-211-0/+6
| | |
* | | service/nim: Update unknown function table entriesLioncash2022-01-211-0/+6
| | |
* | | service/friend: Update unknown function table entriesLioncash2022-01-211-6/+6
| | |
* | | service/filsystem: Update fsp-srv function tableLioncash2022-01-211-0/+3
| | |
* | | service/btm: Update function tablesLioncash2022-01-211-0/+30
| | |
* | | service/audio: Update audctl unknown function namesLioncash2022-01-211-8/+8
| | |
* | | service/am: Update omm function tablesLioncash2022-01-211-0/+1
| | |
* | | service/acc: Update unknown function namesLioncash2022-01-212-4/+4
| |/ |/| | | | | Switchbrew has the function names now.
* | Merge pull request #7710 from german77/just-shake-itbunnei2022-01-211-1/+1
|\ \ | |/ |/| core/hid: Increment shake force
| * core/hid: Increment shake forceNarr the Reg2022-01-141-1/+1
| | | | | | With the current settings 2p mode in pokemon let's go wasn't showing up. By making the shake more violent we can make it appear without any effort using the keyboard
* | Merge pull request #7726 from german77/clampMorph2022-01-191-1/+2
|\ \ | | | | | | service/hid: Initialize applet_resource on SetNpadAnalogStickUseCenterClamp
| * | service/hid: Initialize applet_resource on SetNpadAnalogStickUseCenterClampgerman772022-01-191-1/+2
| | |
* | | Merge pull request #7701 from bunnei/clear-mem-pagesbunnei2022-01-195-16/+34
|\ \ \ | |/ / |/| | Kernel Memory Updates (Part 3): Clear KMemoryManager pages & other fixes
| * | hle: kernel: k_memory_manager: Clear pages on allocation & free.bunnei2022-01-155-16/+34
| | | | | | | | | | | | | | | - Heap pages should be zero'd. - Also explicitly passed along heap allocation option.
* | | Merge pull request #7712 from bunnei/fix-thread-exitbunnei2022-01-1810-38/+177
|\ \ \ | | | | | | | | Accurately implement thread exit
| * | | core: hle: kernel: KThread: Integrate with KWorkerTask and implement DoWorkerTaskImpl.bunnei2022-01-152-2/+28
| | | | | | | | | | | | | | | | | | | | | | | | - This is used to terminate a thread asynchronously after it has been exited. - This fixes a crash that can occur in Pokemon Sword/Shield because a thread is incorrectly closed on svcExitThread, then, the thread is destroyed on svcCloseHandle while it is still scheduled. - Instead, we now wait for the thread to no longer be scheduled on all cores before destroying it from KWorkerTaskManager, which is accurate to HOS behavior.
| * | | core: hle: kernel: KProcess: Integrate with KWorkerTask and add unimplemented DoWorkerTaskImpl.bunnei2022-01-152-3/+9
| | | |
| * | | core: hle: kernel: KThread: Replace Suspend with UpdateState & various updates.bunnei2022-01-152-33/+26
| | | | | | | | | | | | | | | | - This makes our implementations of these more closely match HOS.
| * | | core: hle: kernel: Instantiate a kernel instance of KWorkerTaskManager.bunnei2022-01-152-0/+18
| | | |
| * | | core: hle: kernel: Add KWorkerTask and KWorkerTaskManager.bunnei2022-01-154-0/+96
| | | | | | | | | | | | | | | | - These primitives are used to dispatch asynchronous kernel tasks from KThread and KProcess.
* | | | Merge pull request #7732 from v1993/patch-7bunnei2022-01-181-2/+0
|\ \ \ \ | | | | | | | | | | kernel: remove no-op code
| * | | | hle: remove no-op codeValeri2022-01-171-2/+0
| | | | | | | | | | | | | | | Found by static analysis with PVS-Studio. Nobody seems to really know what was it doing there.
* | | | | Merge pull request #7728 from v1993/patch-4Mai M2022-01-171-1/+1
|\ \ \ \ \ | | | | | | | | | | | | hid: fix std::transform call
| * | | | | hid: fix std::transform callValeri2022-01-171-1/+1
| |/ / / / | | | | | | | | | | Found by static analysis with PVS-Studio.
* / / / / Correct assignment source for rotationsValeri2022-01-171-1/+1
|/ / / / | | | | | | | | Found by static analysis with PVS-Studio
* | | | Merge pull request #7711 from bunnei/fix-service-thread-race-v2bunnei2022-01-151-12/+11
|\ \ \ \ | |_|/ / |/| | | hle: kernel: Fix service_threads access to be thread safe V2.
| * | | hle: kernel: Fix service_threads access to be thread safe V2.bunnei2022-01-151-12/+11
| |/ / | | | | | | | | | | | | | | | - PR #7699 attempted to fix CreateServiceThread and ReleaseServiceThread to be thread safe, but inadvertently introduced a possible dead-lock. - With this PR, we use a worker thread to manage the service thread list, allowing it only to be accessed by a single thread, and guaranteeing threads will not destroy themselves. - Fixes a rare crash in Pokemon Sword/Shield, I've now run this game for ~12 hours non-stop and am quite confident this is a good solution for this issue.
* | | Merge pull request #7707 from german77/slow-updatebunnei2022-01-151-1/+2
|\ \ \ | |/ / |/| | service/hid: Decrease motion update rate
| * | service/hid: Decrease motion update rateNarr the Reg2022-01-131-1/+2
| |/ | | | | Motion stops working in Mario Tennis in swing mode if the update rate is too fast even when HW it updates at the same speed. 10ms it's the minimum period that the game needs to start working again.
* | Merge pull request #7699 from bunnei/fix-service-thread-raceMai M2022-01-141-7/+27
|\ \ | | | | | | hle: kernel: Fix service_threads access to be thread safe.
| * | hle: kernel: Fix service_threads access to be thread safe.bunnei2022-01-141-7/+27
| | | | | | | | | | | | | | | - CreateServiceThread and ReleaseServiceThread can be accessed by different threads, uses a lock to make this thread safe. - Fixes a rare crash in Pokemon Sword/Shield that can occur when a new service thread is being created while an old one is being destroyed.
* | | Merge pull request #7698 from bunnei/mem-code-memory-updatesMai M2022-01-146-81/+107
|\ \ \ | |/ / |/| | Kernel Memory Updates (Part 2): SetProcessMemoryPermission, update permissions, and other minor changes.
| * | hle: kernel: k_page_table: Update SetProcessMemoryPermission.bunnei2022-01-126-45/+68
| | |
| * | hle: service: ldr: UnmapCodeMemory BSS only when set.bunnei2022-01-121-3/+7
| | |
| * | hle: kernel: k_page_table: ReadAndWrite -> UserReadWrite.bunnei2022-01-123-18/+18
| | |
| * | hle: kernel: k_page_table: Rename *ProcessCodeMemory -> *CodeMemory.bunnei2022-01-124-20/+19
| |/
* | Merge pull request #7700 from german77/no-gyrobunnei2022-01-141-1/+1
|\ \ | |/ |/| core/hid: Reduce gyro threshold even more
| * core/hid: Reduce gyro threshold even moreNarr the Reg2022-01-121-1/+1
| |
* | Merge pull request #7684 from bunnei/set-mem-perm-attrbunnei2022-01-125-160/+211
|\ \ | | | | | | Kernel Memory Updates (Part 1): SetMemoryAttribute, and other minor changes.
| * | core: hle: kernel: svc: Updates to SetMemoryAttribute and SetMemoryPermission.bunnei2022-01-083-45/+46
| | |
| * | core: hle: kernel: k_page_table: Update CheckMemoryState.bunnei2022-01-084-116/+166
| | |
* | | Merge pull request #7633 from german77/hotkeysbunnei2022-01-113-1/+75
|\ \ \ | |_|/ |/| | yuzu: Add controller hotkeys
| * | yuzu: Add controller hotkeysgerman772022-01-072-0/+29
| | |
| * | core/hid: Add home and screenshot button supportgerman772022-01-073-1/+46
| | |
* | | Merge pull request #7682 from german77/udp_fixbunnei2022-01-081-2/+6
|\ \ \ | |_|/ |/| | input_common: Fix UDP controller mappings
| * | yuzu: Use pad parameter to choose the correct controllergerman772022-01-071-2/+6
| |/
* / core/hid: Set minimum gyro thresholdgerman772022-01-071-0/+1
|/
* Merge pull request #7636 from vonchenplus/buffer_queue_querybunnei2022-01-043-3/+9
|\ | | | | core:hle:service:nvflinger Implement few type in bufferqueue query method
| * Remove invalid assertion statementFeng Chen2021-12-281-3/+0
| |
| * Implement few type in bufferqueue query methodFeng Chen2021-12-282-0/+9
| |
* | gpu: Add shut down method to synchronize threads before destructionameerj2022-01-041-0/+2
| |
* | Revert "Merge pull request #7668 from ameerj/fence-stop-token"ameerj2022-01-041-2/+1
| | | | | | | | | | This reverts commit e7733544779f2706d108682dd027d44e7fa5ff4b, reversing changes made to abbbdc2bc027ed7af236625ae8427a46df63f7e7.
* | Merge pull request #7668 from ameerj/fence-stop-tokenbunnei2022-01-041-1/+2
|\ \ | | | | | | gpu: Use std::stop_token in WaitFence for VSync thread
| * | gpu: Use std::stop_token in WaitFence for VSync threadameerj2022-01-031-1/+2
| | | | | | | | | | | | Fixes a hang that may occur when stopping emulation and the VSync thread is blocked on the syncpoint condition variable.
* | | Merge pull request #7664 from german77/fallbackbunnei2022-01-042-4/+36
|\ \ \ | |/ / |/| | core/hid: Add fallback to fullkey controllers
| * | core/hid: Add fallback to fullkey controllersgerman772022-01-022-4/+36
| | |
* | | Merge pull request #7648 from bunnei/thread-pinningFernando S2022-01-0310-14/+140
|\ \ \ | |/ / |/| | core: hle: kernel: Implement thread pinning.
| * | core: hle: kernel: Implement thread pinning.bunnei2021-12-3110-14/+140
| | | | | | | | | | | | | | | - We largely had the mechanics in place for thread pinning, this change hooks these up. - Validated with tests https://github.com/Atmosphere-NX/Atmosphere/blob/master/tests/TestSvc/source/test_thread_pinning.cpp.
* | | Merge pull request #7647 from german77/toadbunnei2021-12-313-13/+19
|\ \ \ | |/ / |/| | core/hid: Fix controller type validation
| * | core/hid: Fix controller type validationgerman772021-12-303-13/+19
| | |
* | | core: hle: kernel: Updated implementation of svcSetHeapSize.bunnei2021-12-286-83/+141
| |/ |/| | | | | | | - Updates our svcSetHeapSize with latest HOS, furthermore allowing heap size to properly be extended/shrunk. - Validated with tests https://github.com/Atmosphere-NX/Atmosphere/blob/master/tests/TestSvc/source/test_set_heap_size.cpp.
* | Merge pull request #7621 from bunnei/set-mem-permbunnei2021-12-284-1/+67
|\ \ | |/ |/| core: hle: kernel: Implement SetMemoryPermission.
| * core: hle: kernel: Implement SetMemoryPermission.bunnei2021-12-234-1/+67
| | | | | | | | - Not seen in any games yet, but validated with kernel tests.
* | core: hle: kernel: KThread: X18 should be a cryptographically random number.bunnei2021-12-231-0/+2
|/ | | | | - This was added with firmware 11.0.0 (https://switchbrew.org/wiki/11.0.0). - X18 is OR'd by kernel with 1, to make sure it is odd.
* hle: kernel: svc: GetInfo: Fix error checking with IdleTickCount.bunnei2021-12-221-14/+9
| | | | | - Enforce tha the supplied handle is invalid, not valid. - This gets Witcher 3 booting.
* Merge pull request #7481 from german77/gyro-biasbunnei2021-12-216-20/+32
|\ | | | | service/hid: Improve console motion accuracy
| * service/hid: Improve console motion accuracyNarr the Reg2021-12-136-20/+32
| |
* | Merge pull request #7597 from bunnei/remove-global-lockbunnei2021-12-208-58/+1
|\ \ | | | | | | core: hle: Remove global HLE lock.
| * | core: hle: Remove global HLE lock.bunnei2021-12-188-58/+1
| | | | | | | | | | | | | | | - This was added early on as a hack to protect against some concurrency issues. - It's not clear that this serves any purpose anymore, and if it does, individual components should be fixed rather than using a global recursive mutex.
* | | kernel: Manually destroy the current process during shut downameerj2021-12-191-1/+4
| | | | | | | | | | | | Avoids a memory leak.
* | | Merge pull request #7593 from german77/brrr_testMorph2021-12-185-23/+19
|\ \ \ | | | | | | | | core/hid: Cancel any vibration after the test
| * | | core/hid: Cancel any vibration after the testNarr the Reg2021-12-165-23/+19
| |/ /
* / / core: loader: kip: Minimal changes to fix KIP loading.bunnei2021-12-181-1/+7
|/ / | | | | | | - Allows us to boot KIP (kernal apps), useful for testing the kernel.
* | core/hid: Fix faulty analog triggersNarr the Reg2021-12-151-2/+2
| |
* | common/input: Avoid numerous large copies of CallbackStatusLioncash2021-12-146-92/+118
| | | | | | | | | | | | | | | | | | CallbackStatus instances aren't the cheapest things to copy around (relative to everything else), given that they're currently 520 bytes in size and are currently copied numerous times when callbacks are invoked. Instead, we can pass the status by const reference to avoid all the copying.
* | Remove erroneous #pragma onceValeri2021-12-131-2/+0
| |
* | Merge pull request #7462 from bunnei/kernel-improve-schedulingbunnei2021-12-1332-634/+895
|\ \ | | | | | | Kernel: Improve threading & scheduling V3
| * | hle: kernel k_scheduler: EnableScheduling: Remove redundant GetCurrentThreadPointer calls.bunnei2021-12-071-3/+5
| | |
| * | hle: kernel k_process: Remove unnecessary .at usage with thread pinning methods.bunnei2021-12-071-3/+3
| | |
| * | hle: kernel: Remove unnecessary virtual specifier on NotifyAvailable.bunnei2021-12-071-2/+2
| | |
| * | hle: kernel: Remove unnecessary virtual specifier on EndWait.bunnei2021-12-071-1/+1
| | |
| * | hle: kernel: k_light_condition_variable: Revert unnecessary license comment changes.bunnei2021-12-071-1/+1
| | |
| * | hle: kernel: k_condition_variable: Revert unnecessary style changes.bunnei2021-12-071-2/+2
| | |
| * | hle: kernel: Remove unnecessary virtual specifier on CancelWait.bunnei2021-12-076-14/+14
| | |
| * | hle: kernel: service_thread: Force stop threads on destruction.bunnei2021-12-071-1/+7
| | |
| * | hle: kernel: k_light_lock: Implement CancelWait.bunnei2021-12-071-5/+10
| | | | | | | | | | | | - Fixes a crash in Megadimension Neptunia VII.
| * | hle: kernel: service_thread: Use std::jthread.bunnei2021-12-071-18/+19
| | | | | | | | | | | | - Fixes a potential deadlock on service thread shutdown.
| * | hle: kernel: k_thread: Skip reschedule on DisableDispatch with SC.bunnei2021-12-071-0/+5
| | |
| * | hle: kernel: k_thread: Rename sleeping_queue -> wait_queue.bunnei2021-12-072-17/+13
| | |
| * | hle: kernel: svc: Fix deadlock that can occur with single core.bunnei2021-12-071-10/+8
| | |
| * | hle: kernel: k_thread: Treat dummy threads as a special type.bunnei2021-12-072-1/+4
| | |
| * | hle: kernel: fix timing on thread preemptionFernandoS272021-12-071-4/+2
| | |
| * | hle: kernel: fix scheduling ops from HLE host thread.FernandoS272021-12-071-3/+3
| | |
| * | hle: kernel: Add a flag for indicating that the kernel is currently shutting down.bunnei2021-12-076-0/+49
| | |
| * | hle: kernel: KSynchronizationObject: Fix variable shadowing.bunnei2021-12-071-8/+8
| | |
| * | hle: kernel: Cleanup to match coding style.bunnei2021-12-076-26/+21
| | |
| * | hle: kernel: KProcess: Improvements for thread pinning.bunnei2021-12-072-8/+26
| | |
| * | hle: kernel: KThreadQueue: Remove deprecated code.bunnei2021-12-071-63/+0
| | |
| * | hle: kernel: KConditionVariable: Various updates & simplifications.bunnei2021-12-072-121/+65
| | |
| * | hle: kernel: KThread: Migrate to updated KThreadQueue (part 2).bunnei2021-12-071-29/+19
| | |
| * | hle: kernel: KThread: Migrate to updated KThreadQueue (part 1).bunnei2021-12-073-60/+71
| | |
| * | hle: kernel: KConditionVariable: Migrate to updated KThreadQueue.bunnei2021-12-071-12/+55
| | |
| * | hle: kernel: KServerSession: Migrate to updated KThreadQueue.bunnei2021-12-072-5/+11
| | |
| * | hle: kernel: KLightConditionVariable: Migrate to updated KThreadQueue.bunnei2021-12-073-54/+87
| | |
| * | hle: kernel: KLightLock: Migrate to updated KThreadQueue.bunnei2021-12-072-35/+36
| | |
| * | hle: kernel: KAddressArbiter: Migrate to updated KThreadQueue.bunnei2021-12-071-43/+39
| | |
| * | hle: kernel: KThread: Remove tracking of sync object from threads.bunnei2021-12-076-41/+21
| | |
| * | hle: kernel: Update KThreadQueue and migrate KSynchronizationObject.bunnei2021-12-078-75/+251
| | |
| * | core: hle: kernel: Disable dispatch count tracking on single core.bunnei2021-12-073-5/+14
| | | | | | | | | | | | - This would have limited value, and would be a mess to handle properly.
| * | core: hle: kernel: k_thread: Mark KScopedDisableDispatch as nodiscard.bunnei2021-12-071-1/+1
| | |
| * | core: cpu_manager: Use invalid core_id on init and simplify shutdown.bunnei2021-12-071-7/+3
| | |
| * | core: hle: kernel: k_auto_object: Add GetName method.bunnei2021-12-071-0/+4
| | | | | | | | | | | | - Useful purely for debugging.
| * | core: hle: kernel: DisableDispatch on suspend threads.bunnei2021-12-071-0/+3
| | |
| * | core: hle: kernel: k_scheduler: Improve DisableScheduling and EnableScheduling.bunnei2021-12-071-14/+9
| | |
| * | core: cpu_manager: Use KScopedDisableDispatch.bunnei2021-12-071-7/+8
| | |
| * | core: hle: kernel: Use CurrentPhysicalCoreIndex as appropriate.bunnei2021-12-071-6/+2
| | |
| * | core: hle: kernel: k_scheduler: Remove unnecessary MakeCurrentProcess.bunnei2021-12-071-5/+0
| | |
| * | core: hle: kernel: k_scheduler: Improve ScheduleImpl.bunnei2021-12-071-6/+7
| | |
| * | core: hle: kernel: k_scheduler: Improve Unload.bunnei2021-12-071-17/+29
| | |
| * | core: hle: kernel: k_process: DisableDispatch on main thread.bunnei2021-12-071-0/+1
| | |
| * | core: hle: kernel: k_handle_table: Use KScopedDisableDispatch as necessary.bunnei2021-12-072-0/+8
| | |
| * | core: hle: kernel: k_thread: Add KScopedDisableDispatch.bunnei2021-12-072-1/+47
| | |
| * | core: hle: kernel: Ensure idle threads are closed before destroying scheduler.bunnei2021-12-073-24/+22
| | |
| * | core: hle: kernel: Reflect non-emulated threads as core 3.bunnei2021-12-077-14/+17
| | |
* | | Merge pull request #7519 from itsmeft24/masterbunnei2021-12-0912-6/+611
|\ \ \ | | | | | | | | kernel: svc: Implement ProcessMemory and CodeMemory SVCs
| * | | Update k_code_memory.hitsmeft242021-12-071-6/+6
| | | |
| * | | make KCodeMemory::GetSourceAddress constitsmeft242021-12-071-1/+1
| | | | | | | | | | | | Co-authored-by: Mai M. <mathew1800@gmail.com>
| * | | fix formattingitsmeft242021-12-061-1/+6
| | | |
| * | | move private members below public membersitsmeft242021-12-061-10/+11
| | | |
| * | | fix formattingitsmeft242021-12-061-4/+1
| | | |
| * | | fix formattingitsmeft242021-12-061-1/+1
| | | | | | | | | | | | Co-authored-by: Mai M. <mathew1800@gmail.com>
| * | | fix formattingitsmeft242021-12-062-2/+2
| | | |
| * | | Remove unnecessary includesitsmeft242021-12-062-50/+13
| | | |
| * | | Add copyright noticeitsmeft242021-12-052-0/+8
| | | |
| * | | Add KCodeMemory to CMakeLists.txtitsmeft242021-12-051-0/+2
| | | |
| * | | kernel: svc: Implement Map/UnmapProcessMemory and Create/ControlCodeMemoryitsmeft242021-12-0511-7/+636
| | | | | | | | | | | | | | | | Used by Skyline modding framework
* | | | Merge pull request #7525 from german77/notifabunnei2021-12-084-0/+75
|\ \ \ \ | | | | | | | | | | service/notif: Add notif:a and stub ListAlarmSettings, Initialize
| * | | | service/notif: Add notif:a and stub ListAlarmSettings,Initializegerman772021-12-064-0/+75
| | | | | | | | | | | | | | | | | | | | Used by ring fit adventure 1.2.0
* | | | | Merge pull request #7521 from german77/dual_single_joyconsbunnei2021-12-085-38/+174
|\ \ \ \ \ | |_|_|_|/ |/| | | | service/hid: Implement SetNpadJoyAssignmentMode
| * | | | service/hid: Implement SetNpadJoyAssignmentModegerman772021-12-055-38/+174
| |/ / /
* | | | Merge pull request #7488 from vonchenplus/support_multiple_videos_playingbunnei2021-12-086-8/+29
|\ \ \ \ | |_|_|/ |/| | | Support multiple videos playing
| * | | Address feedbackFeng Chen2021-12-044-13/+22
| | | |
| * | | Support multiple videos playingFeng Chen2021-12-024-9/+21
| | | |
* | | | Merge pull request #7524 from german77/hid_stubbunnei2021-12-062-2/+35
|\ \ \ \ | | | | | | | | | | service/hid: Stub SetNpadCaptureButtonAssignment and ClearNpadCaptureButtonAssignment
| * | | | service/hid: Stub SetNpadCaptureButtonAssignment and ClearNpadCaptureButtonAssignmentgerman772021-12-062-2/+35
| | |/ / | |/| | | | | | | | | | Used by ring fit adventure 1.2.0
* | | | loader: Support loading subsdk{8,9}jam1garner2021-12-061-2/+3
| | | |
* | | | general: Add missing copyright noticesameerj2021-12-051-0/+4
|/ / /
* | / core/hid: Add missing controller typegerman772021-12-051-0/+2
| |/ |/|
* | core/hid: Ensure only valid npad are connectedgerman772021-12-056-18/+83
| |
* | Merge pull request #7489 from Morph1984/steady-clockbunnei2021-12-042-4/+4
|\ \ | | | | | | general: Replace high_resolution_clock with steady_clock
| * | general: Replace high_resolution_clock with steady_clockMorph2021-12-022-4/+4
| |/ | | | | | | On some OSes, high_resolution_clock is an alias to system_clock and is not monotonic in nature. Replace this with steady_clock.
* / service: am: ISelfController: Stub SaveCurrentScreenshotMorph2021-12-033-2/+15
|/ | | | - Used by Disney Magical World 2: Enchanted Edition
* service: friend: Implement GetCompletionEventMorph2021-11-301-2/+21
| | | | - Used by Super Bomberman R Online
* input_interpreter: Make use of NpadButton instead of a u64Morph2021-11-302-9/+9
| | | | Allows us to be more explicit with the representation of button states and use the provided bit manipulation operators
* npad: Return NpadButton in GetAndResetPressStateMorph2021-11-303-7/+6
| | | | We were previously truncating this to a u32 as there were no known buttons that used the full 64 bits of this type. Fix this now that we know they are used.
* core: hid: hid_types: Add "All" to NpadButtonMorph2021-11-301-0/+2
| | | | This represents a bitmask for all pressed buttons
* core: hid: hid_core: Add (Enable/DIsable)AllControllerConfigurationMorph2021-11-292-0/+32
|
* general: Fix handheld typoMorph2021-11-291-1/+1
|
* core: hid: Mark constructors as explicitMorph2021-11-292-2/+2
|
* core: hid: Cleanup and amend documentationMorph2021-11-294-69/+76
|
* Merge pull request #7438 from german77/homebrew2bunnei2021-11-286-2/+146
|\ | | | | Core: Stub services and functions needed for checkpoint
| * core/ns: Implement GetReadOnlyApplicationControlDataInterfaceNarr the Reg2021-11-282-1/+26
| | | | | | | | Used in checkpoint homebrew
| * core/pdm: Stub QueryPlayStatisticsByApplicationIdAndUserAccountIdNarr the Reg2021-11-284-0/+107
| | | | | | | | Used in checkpoint homebrew
| * core/hid: Stub GetUniquePadsFromNpadNarr the Reg2021-11-271-1/+13
| | | | | | | | Used in checkpoint homebrew
* | settings: Add debug setting to enable all controllersgerman772021-11-282-0/+24
|/
* config: Remove vibration configurationgerman772021-11-271-2/+3
|
* input_common: Fully implement UDP controllersNarr the Reg2021-11-261-2/+4
|
* service/hid: Finish converting LIFO objects and address some nitsNarr the Reg2021-11-2514-95/+50
|
* bootmanager: Use cross-platform keyboard inputgerman772021-11-251-1/+1
|
* kraken: Address comments from reviewgerman772021-11-253-6/+6
| | | | Fix compiler bug
* core/hid: Improve accuary of mouse implementationgerman772021-11-2510-38/+61
|
* core/hid: Fully implement native mousegerman772021-11-256-60/+170
|
* input_common: Allow keyboard to be backwards compatiblegerman772021-11-251-6/+22
|
* core/hid: Improve accuracy of the keyboard implementationgerman772021-11-255-136/+303
|
* core/hid: Fix keyboard alignmentgerman772021-11-252-12/+14
|
* core/hid: Remove usage of native types, fix a couple of errors with motiongerman772021-11-259-419/+613
|
* service/hid: Remove includes of core.h and settings.hgerman772021-11-2525-54/+58
|
* service/hid: Add support for new controllersgerman772021-11-252-2/+31
|
* settings: Fix controller preview not displaying the correct controllergerman772021-11-251-2/+2
|
* core/hid: Rename NpadType to NpadStyleIndexgerman772021-11-257-114/+125
|
* config: Cleanup and documentationgerman772021-11-251-1/+5
|
* core/hid: Prevent Emulated controller from flapping with multiple inputs devicesgerman772021-11-252-13/+61
|
* core/hid: Fully emulate motion from buttongerman772021-11-254-36/+70
|
* second commit lion reviewgerman772021-11-2515-16/+44
|
* settings: Fix Debug controller type optionsgerman772021-11-253-6/+12
|
* kraken: Address comments from reviewgerman772021-11-2512-154/+178
| | | | start lion review
* input_common: Revert deleted TAS functionsgerman772021-11-251-22/+22
|
* core/hid: Explain better what a temporary value doesgerman772021-11-252-24/+28
|
* core/hid: Update structs to 13.1.0german772021-11-2512-50/+107
|
* core/hid: Add TAS inputgerman772021-11-252-0/+81
|
* input_common: Add multiple vibration curvesgerman772021-11-251-1/+9
|
* core/hid: Rework battery mappingsgerman772021-11-255-32/+63
|
* input_common: Add manual update options to input devicesgerman772021-11-251-0/+9
|
* service/hid: Fix memory allocated incorrectlygerman772021-11-255-7/+7
|
* settings: Fix mouse and keyboard mappingsgerman772021-11-253-11/+19
|
* Morph review first wavegerman772021-11-2522-135/+116
|
* service/hid: Match shared memory closer to HWgerman772021-11-252-26/+75
|
* yuzu: Fix loading input profilesgerman772021-11-251-0/+2
|
* kraken: Address comments from reviewgerman772021-11-2511-51/+47
| | | | review fixes
* service/hid: Use ring buffer for gesturesgerman772021-11-252-79/+52
|
* service/hid: Fix gesture inputgerman772021-11-255-88/+129
|
* configuration: Migrate controller settings to emulated controllergerman772021-11-255-15/+33
|
* core/hid: Fix rumble too strong at 1%german772021-11-251-12/+22
|
* core/hid: Only signal when neededgerman772021-11-254-128/+145
|
* hid: Fix controller connection/disconnectiongerman772021-11-257-56/+151
|
* core/hid: Documment some filesgerman772021-11-254-52/+265
|
* kraken: Fix errors from rebase and format filesgerman772021-11-252-2/+5
|
* core/hid: Add output devicesgerman772021-11-255-69/+126
|
* core: Update input interpretergerman772021-11-252-51/+18
|
* core/frontend: Update appletsgerman772021-11-252-10/+15
|
* core: Remove frontend/inputgerman772021-11-251-217/+0
|
* service/hid: Rewrite npad to use ring lifo and the emulated controllergerman772021-11-252-890/+605
|
* service/hid: Update console sixaxis to the emulated consolegerman772021-11-252-28/+26
|
* service/hid: Update mouse and keyboard to use ring lifo and the emulated devicegerman772021-11-254-158/+71
|
* service/hid: Update touch and gestures to use ring lifo and the emulated consolegerman772021-11-254-370/+191
|
* service/hid: Update debug pad, xpad, stubbed and controller base to use ring lifo and the emulated controllergerman772021-11-257-166/+80
|
* service/hid: Use remove duplicated code, update namesgerman772021-11-252-64/+30
|
* service/hid: Create ring LIFOgerman772021-11-252-1/+55
|
* settings: Cleanup settingsgerman772021-11-254-5/+4
|
* core/emu_window: Remove touch inputgerman772021-11-252-113/+15
|
* core: Register HIDgerman772021-11-252-3/+21
|
* core/hid: Add emulated controllersgerman772021-11-259-0/+2025
|
* core/hid: Move motion_input, create input converter and hid_typesgerman772021-11-256-0/+1164
|
* core/hid: Move input_interpreter to hidgerman772021-11-253-3/+3
|
* Merge pull request #7394 from Morph1984/svc-SetMemoryPermissionbunnei2021-11-225-12/+64
|\ | | | | kernel: svc: Implement SetProcessMemoryPermission
| * kernel: svc: Move all IsValid functions to an anonymous namespaceMorph2021-11-211-3/+15
| |
| * kernel: svc: Implement SetProcessMemoryPermissionMorph2021-11-211-1/+41
| | | | | | | | - Used by Skyline modding framework
| * kernel: KPageTable: Rename SetCodeMemoryPermission to SetProcessMemoryPermissionMorph2021-11-214-8/+8
| |
* | arm: dynarmic: Cleanup icache op handlingjam1garner2021-11-221-10/+9
| |
* | arm: dynarmic: Implement icache op handling for 'ic iallu' instructionjam1garner2021-11-221-0/+3
| |
* | arm: dynarmic: Implement icache op handling for 'ic ivau' instructionjam1garner2021-11-221-0/+18
| |
* | Merge pull request #7389 from ameerj/screenshot-1xbunnei2021-11-212-11/+7
|\ \ | | | | | | Fix screenshot dimensions when at 1x scale
| * | Fix screenshot dimensions when at 1x scaleameerj2021-11-202-11/+7
| |/ | | | | | | | | | | | | This was regressed by ART. Prior to ART, the screenshots were saved at the title's framebuffer resolution. A misunderstanding of the existing logic led to screenshot dimensions becoming dependent on the host render window size. This changes the behavior to match how it was prior to ART at 1x, with screenshots now always being the title's framebuffer dimensions scaled by the resolution scaling factor.
* | Merge pull request #7359 from heinermann/kthread_crashbunnei2021-11-211-8/+14
|\ \ | | | | | | Fix crash on exit due to static scoped dummy threads
| * | Fix crash on exit due to static scoped dummy threadsAdam Heinermann2021-11-181-8/+14
| |/
* | service: pm: Implement AtmosphereGetProcessIdMorph2021-11-211-0/+24
| | | | | | | | - Used by Skyline modding framework
* | service: pm: Add all relevant result codesMorph2021-11-211-3/+8
| |
* | service: pm: Rename title id to program idMorph2021-11-211-6/+6
|/
* bootmanager: Fix screenshot resolution factor usageameerj2021-11-162-10/+7
| | | | Fixes screenshots at non integer scaling
* Settings: eliminate rescaling_factor.Fernando Sahmkow2021-11-163-29/+12
|
* program_metadata: Add default ThreadInfo kernel capabilityOatmealDome2021-11-111-1/+4
|
* applets/swkbd: Fix text check message encodingMorph2021-11-081-7/+15
| | | | The text check message can be encoded in UTF-8.
* applets/swkbd: Skip text checking if the text has been confirmedMorph2021-11-084-13/+21
| | | | | | | Confirm means that the text has already been checked by the application to be correct, but is asking the user for confirmation. The confirmation text itself seems to be corrupted though, this needs to be investigated. Fixes the software keyboard in Famicom Detective Club: The Missing Heir
* service/pctl: Stub EndFreeCommunicationNarr the Reg2021-11-051-1/+8
| | | - Used by Just Dance 2022
* Merge pull request #7279 from Morph1984/system-get-program-idMorph2021-11-0522-53/+44
|\ | | | | general: Get the current process program id directly from the system
| * general: Get the current process program id directly from the systemMorph2021-11-0418-50/+38
| | | | | | | | This allows us to avoid including KProcess' header file in files that only need to get the current process' program id.
| * general: Rename GetTitleID to GetProgramIDMorph2021-11-0421-39/+42
| |
* | Merge pull request #7289 from ameerj/perf-stat-shutdownMorph2021-11-051-1/+1
|\ \ | | | | | | core: Reorder perf_stats destruction order on Shutdown
| * | core: Reorder perf_stats destruction order on Shutdownameerj2021-11-051-1/+1
| |/ | | | | | | Avoids the gpu_core using perf_stats after it's been freed.
* | Merge pull request #7287 from Morph1984/stub-aocFernando S2021-11-052-0/+29
|\ \ | |/ |/| service: aoc: Stub more 13.x functions used by Animal Crossing
| * service: aoc: Stub NotifyUnmountAddOnContentMorph2021-11-042-1/+9
| | | | | | | | Used by Animal Crossing: New Horizons v2.0.0 DLC
| * service: aoc: Stub NotifyMountAddOnContent and NotifyMountAddOnContentMorph2021-11-042-0/+21
| | | | | | | | Used by Animal Crossing: New Horizons v2.0.0 DLC
* | Merge pull request #7282 from ameerj/core-includesbunnei2021-11-04134-219/+8
|\ \ | |/ |/| core: Reduce unused header includes
| * core: Fix transitive include build errorsameerj2021-11-045-0/+9
| |
| * core: Remove unused includesameerj2021-11-04133-221/+1
| |
* | service/acc: Rename Unknown160 to InitializeApplicationInfoV2german772021-11-043-3/+3
| |
* | service: acc: Stub acc:u0 '160'Morph2021-11-043-0/+9
|/ | | | | | - Used by Animal Crossing: New Horizons v2.0.0 Since the name is currently unknown, '160' is used as a placeholder.
* svc: Correct WaitSynchronization num_handles param typeMorph2021-11-032-4/+4
| | | | num_handles is a s32
* general: Remove MakeResult helpersMorph2021-11-0213-69/+48
| | | | This is made obsolete by the presence of implicit constructors.
* hle/result: Amend ResultVal documentationMorph2021-11-021-12/+10
| | | | This amends the documentation slightly to reflect the updated interface.
* hle/result: Reimplement ResultVal using Common::ExpectedMorph2021-11-021-117/+63
| | | | | Common::Expected effectively provides the same functions as ResultVal, so we can implement it with this. This can be replaced with std::expected with minimal effort should it be standardized in the C++ Standard Template Library.
* Merge pull request #7227 from vonchenplus/fix_memory_leak_v2bunnei2021-11-026-24/+54
|\ | | | | Fix memory leak v2
| * Fix dangling kernel objects when exitingFeng Chen2021-10-272-11/+13
| |
| * Revert PR7009Feng Chen2021-10-272-15/+5
| |
| * Fix memory leakFeng Chen2021-10-274-0/+38
| |
* | Merge pull request #7244 from Morph1984/application-lang-pt-brbunnei2021-10-304-3/+30
|\ \ | | | | | | file_sys/ns: Add Brazilian Portuguese to the list of ApplicationLanguage
| * | file_sys: control_metadata: Add BrazilianPortugueseMorph2021-10-292-2/+4
| | |
| * | ns: language: Add BrazilianPortuguese to ApplicationLanguageMorph2021-10-292-1/+26
| | | | | | | | | | | | It seems that Nintendo finally filled that last empty spot in ApplicationLanguage for a total of 16 supported languages.
* | | Merge pull request #7240 from Morph1984/resultval-remove-cvbunnei2021-10-301-2/+2
|\ \ \ | | | | | | | | hle/result: Remove cv-qualifiers from Arg in MakeResult
| * | | hle/result: Remove cv-qualifiers from Arg in MakeResultMorph2021-10-281-2/+2
| | |/ | |/| | | | | | | This removes the const qualification for types when MakeResult(arg) is used in a const member function, allowing for automatic deduction and removing the need to manually specify the non-const type as the template argument.
* | | hle/result: Declare copy/move constructor/assignment as noexceptMorph2021-10-281-3/+3
| | | | | | | | | | | | While we're at it, we can also declare these copy/move constructor/assignment as noexcept.
* | | hle/result: Add move assignment operator in ResultValMorph2021-10-281-0/+20
| |/ |/| | | | | ResultVal was missing a move assignment operator, add it.
* | Merge pull request #7193 from FernandoS27/idleMorph2021-10-252-0/+22
|\ \ | |/ |/| SVC: Implement svcInfo:IdleTickCount
| * SVC: Implement svcInfo:IdleTickCountFernando Sahmkow2021-10-162-0/+22
| | | | | | | | Used by the Witcher 3
* | Merge pull request #7218 from bylaws/aswdqdsamAmeer J2021-10-252-21/+9
|\ \ | | | | | | Fixup channel submit IOCTL syncpoint parameters
| * | Fixup channel submit IOCTL syncpoint parametersBilly Laws2021-10-242-21/+9
| | | | | | | | | | | | | | | | | | The current arguments worked by happenstance as games only ever submit one syncpoint and request one fence back, if a game were to do something other than this then the arguments would've been parsed entirely wrong.
* | | Fixed ARM_Dynamic_64 StepAndrew Strelsky2021-10-241-1/+1
|/ /
* | Merge pull request #7198 from ameerj/settings-chronobunnei2021-10-192-8/+10
|\ \ | | | | | | settings: Remove std::chrono usage
| * | settings: Remove std::chrono usageameerj2021-10-172-8/+10
| |/ | | | | | | Alleviates the dependency on chrono for all files that include settings.h
* | Merge pull request #7173 from Morph1984/invalidate-unmapbunnei2021-10-171-0/+2
|\ \ | |/ |/| KPageTable: Perform ranged invalidation when unmapping code memory
| * KPageTable: Perform ranged invalidation when unmapping code memoryMorph2021-10-131-0/+2
| | | | | | | | Co-Authored-By: Fernando S. <1731197+FernandoS27@users.noreply.github.com>
* | Merge pull request #7187 from FernandoS27/boy-i-say-boybunnei2021-10-164-0/+51
|\ \ | | | | | | NVHost_Ctrl: Force wait if the gpu falls behind too long.
| * | NvHost/Core: Address Feedback.Fernando Sahmkow2021-10-163-19/+27
| | |
| * | Suspend temporallyFernandoS272021-10-163-1/+31
| | |
| * | NVHost_Ctrl: Force wait if the gpu falls behind too long.FernandoS272021-10-162-0/+13
| | |
* | | service/vi: Stub IHOSBinderDriver::TransactParcel GetBufferHistory (#7184)Feng Chen2021-10-161-1/+11
|/ /
* | core: Move ResultStatus outside of SystemMorph2021-10-152-43/+45
| | | | | | | | Allows it to be a forward declaration in other header files.
* | core: Remove static system instanceMorph2021-10-152-28/+5
|/
* Merge pull request #7110 from vonchenplus/fix_extract_offline_romefs_errorMorph2021-10-111-0/+10
|\ | | | | applets/web: Fallback to loader to get the manual romfs if none is found
| * applets/web: Fallback to loader to get the manual romfs if none is foundFeng Chen2021-10-111-0/+10
| |
* | kernel: hle_ipc: Foward declare KAutoObjectMorph2021-10-072-1/+2
| |
* | service: Reduce header include overheadMorph2021-10-0730-38/+10
| |
* | Merge pull request #7118 from ameerj/vc-gpu-implFernando S2021-10-065-52/+36
|\ \ | | | | | | gpu: Migrate implementation to the cpp file
| * | nvflinger: Use jthread and stop_token for VSync threadameerj2021-10-032-32/+8
| | | | | | | | | | | | Avoids a destruction data race that may occur on the vsync thread
| * | nvhost_ctrl: Refactor usage of gpu.LockSync()ameerj2021-10-031-15/+15
| | | | | | | | | | | | This seems to only be used to protect a later gpu function call. So we can move the lock into that call instead.
| * | gpu: Migrate implementation to the cpp fileameerj2021-10-032-5/+13
| | |
* | | Merge pull request #7115 from ameerj/log-compilebunnei2021-10-054-0/+6
|\ \ \ | | | | | | | | common/logging: Reduce dependent header include overhead
| * | | common/logging: Reduce scope of fmt includeameerj2021-10-022-0/+3
| | | |
| * | | common/logging: Move Log::Entry declaration to a separate headerameerj2021-10-022-0/+3
| |/ / | | | | | | | | | This reduces the load of requiring to include std::chrono in all files which include log.h
* | | Merge pull request #7103 from Morph1984/service-ctx-eventbunnei2021-10-0526-271/+367
|\ \ \ | | | | | | | | service: Replace all service event creation with ServiceContext::CreateEvent
| * | | service: Replace service event creation with ServiceContext::CreateEventMorph2021-10-0226-271/+367
| | | | | | | | | | | | | | | | The service context helps to manage all created events and allows us to close them upon destruction.
* | | | Merge pull request #7107 from astrelsky/iob_fixbunnei2021-10-041-1/+5
|\ \ \ \ | | | | | | | | | | prevent access violation from iob in Memory::IsValidVirtualAddress
| * | | | prevent access violation from iob in Memory::IsValidVirtualAddressAndrew Strelsky2021-09-301-1/+5
| | | | |
* | | | | Merge pull request #7091 from vonchenplus/fix_memroy_leakAmeer J2021-10-046-9/+114
|\ \ \ \ \ | | | | | | | | | | | | core: Fix memory leak
| * | | | | Fix KShareMemory object leakFeng Chen2021-09-295-3/+106
| | | | | |
| * | | | | Fix KScopedAutoObject object leak when SendSyncRequestFeng Chen2021-09-251-6/+8
| | |_|_|/ | |/| | |
* | | | | Merge pull request #7113 from Morph1984/no-log-ip-addrbunnei2021-10-031-2/+0
|\ \ \ \ \ | | | | | | | | | | | | network: Do not log IP address
| * | | | | network: Do not log IP addressMorph2021-10-021-2/+0
| | |_|/ / | |/| | | | | | | | | | | | | Logging this may be a privacy concern for some users.
* | | | | service: am: Make use of Exit to exit the currently running applicationMorph2021-10-021-2/+2
| | | | | | | | | | | | | | | | | | | | This also moves the call to the end to ensure services are properly destructed on exit.
* | | | | core: Add Exit and ExitCallbackMorph2021-10-022-0/+25
|/ / / / | | | | | | | | | | | | This allows ISelfController::Exit to stop the currently running application. This is typically used by homebrew to exit back to the homebrew menu after calling consoleExit with libnx.
* | | | Merge pull request #7102 from Morph1984/remove-boxcatbunnei2021-10-026-735/+1
|\ \ \ \ | |_|_|/ |/| | | Remove Boxcat BCAT backend
| * | | service: bcat: Remove BoxCat BCAT implementationMorph2021-09-294-631/+0
| | | | | | | | | | | | | | | | | | | | The current implementation of BoxCat as it stands is non-functional due to the reliance on a server providing BCAT files. This implementation will eventually be replaced with one that allows the use of local BCAT files dumped from a Nintendo Switch.
| * | | externals: Remove libzipMorph2021-09-291-1/+1
| | | |
| * | | file_sys: Remove vfs_libzipMorph2021-09-293-103/+0
| | |/ | |/|
* / | style: Remove extra space preceding the :: operatorMorph2021-09-296-7/+7
|/ /
* | Merge pull request #7018 from lat9nq/splat-stubsMorph2021-09-292-26/+67
|\ \ | | | | | | audin_u: stub Start, RegisterBufferEvent, AppendAudioInBufferAuto
| * | audin_u: Return a buffer event in RegisterBufferEventlat9nq2021-09-152-2/+12
| | | | | | | | | | | | Co-authored-by: Morph <39850852+Morph1984@users.noreply.github.com>
| * | audin_u: stub Start, RegisterBufferEvent, AppendAudioInBufferAutolat9nq2021-09-152-26/+57
| | | | | | | | | | | | | | | | | | This also moves IAudioIn's definition to the header. Required for Splatoon 2 LAN play.
* | | service/es: Update to 13.0.0german772021-09-271-0/+6
| | |
* | | service/npns: Update to 13.0.0german772021-09-271-0/+1
| | |
* | | service/vi: Update to 13.0.0german772021-09-272-0/+2
| | |
* | | service/am: Update to 13.0.0german772021-09-271-0/+4
| | |
* | | service/audio: Update to 13.0.0german772021-09-272-1/+10
| | |
* | | service/hid: Update to 13.0.0german772021-09-272-0/+10
| | |
* | | service/btdrv: Update to 13.0.0german772021-09-271-0/+4
| | |
* | | service/usb: Update to 13.0.0german772021-09-271-3/+3
| | |
* | | Merge pull request #7078 from ameerj/vc-jthread-fixesMorph2021-09-261-1/+1
|\ \ \ | | | | | | | | video_core: Fix jthread related hangs when stopping emulation
| * | | video_core: Fix jthread related hangs when stopping emulationameerj2021-09-241-1/+1
| | |/ | |/| | | | | | | jthread on some compilers is more picky when it comes to the order in which objects are destroyed.
* | | service: bsd: Stub ReadMorph2021-09-251-6/+5
| | | | | | | | | | | | - Used by Diablo II: Resurrected
* | | service: bsd: Implement ReadMorph2021-09-242-1/+15
| | | | | | | | | | | | - Used by Diablo II: Resurrected
* | | general: Update style to clang-format-12ameerj2021-09-244-27/+19
| | |
* | | core/profile_select: Avoid uninitialized read in SelectProfile()Lioncash2021-09-231-1/+2
| | | | | | | | | | | | | | | The default constructor of UUID doesn't initialize its data members, so we need to directly initialize it to be invalid.
* | | common/uuid: Add validity checking functions to interfaceLioncash2021-09-223-7/+7
|/ / | | | | | | | | Given we have a function to invalidate, we should also have ones to query the validity. Also makes the code more straightforward to read.
* | Merge pull request #7019 from ameerj/videocore-jthreadbunnei2021-09-191-5/+1
|\ \ | | | | | | videocore: Use std::jthread for worker threads
| * | gpu: Use std::jthread for async gpu threadameerj2021-09-161-5/+1
| |/
* | Merge pull request #7020 from Moonlacer/remove_audio_stretchingbunnei2021-09-181-2/+0
|\ \ | | | | | | Remove audio stretching
| * | remove-audio-stretching-settingMoonlacer2021-09-161-2/+0
| | |
* | | Merge pull request #7015 from german77/NotGoodForTerrabunnei2021-09-171-1/+14
|\ \ \ | | | | | | | | ngct: Stub Match
| * | | ngct: Stub MatchNarr the Reg2021-09-151-1/+14
| | |/ | |/| | | | Needed for Cruis'n Blast
* / | vfs: Partially implement GetFileTimeStampRawMorph2021-09-148-1/+83
|/ / | | | | | | Gets rid of homebrew warnings using this func
* | Merge pull request #7009 from ameerj/main_process_cleanupbunnei2021-09-141-3/+12
|\ \ | |/ |/| core: Destroy main_process during shutdown
| * core: Destroy main_process during shutdownameerj2021-09-141-3/+12
| | | | | | | | The main_process was never being cleaned up, causing a noticeable memory leak after subsequent launches. This change cleans up the memory during Core Shutdown, mitigating the leak.
* | FS: Mark recursive CreateDirectory as inaccurate and temporaryMorph2021-09-121-0/+5
|/
* Merge pull request #6975 from ogniK5377/acc-async-ctxMorph2021-09-124-19/+154
|\ | | | | account: EnsureTokenIdCacheAsync
| * Mark is_complete as atomicChloe Marcec2021-09-082-4/+5
| |
| * Addressed issuesChloe Marcec2021-09-083-15/+14
| |
| * address name shadowing with systemChloe Marcec2021-09-061-2/+2
| |
| * account: EnsureTokenIdCacheAsyncChloe Marcec2021-09-064-19/+154
| | | | | | | | Closes #2547, #6946
* | Merge pull request #6974 from ogniK5377/fs-recursive-createdirMorph2021-09-121-8/+13
|\ \ | | | | | | FS: Recursively create directories for CreateDirectory
| * | Addressed issuesChloe2021-09-081-1/+1
| | | | | | | | | Co-authored-by: Mai M. <mathew1800@gmail.com>
| * | FS: Recursively create directories for CreateDirectoryChloe Marcec2021-09-061-8/+13
| | | | | | | | | | | | | | | | | | Originally we only created the parent directory, this caused issues for creating directories which also contained subdirectories, eg `/Folder1/Folder2` This allows the ultimate mod manager homebrew to at least boot
* | | Merge pull request #6992 from german77/brainsMorph2021-09-125-3/+44
|\ \ \ | | | | | | | | hid/am: Stub SetTouchScreenConfiguration and implement GetNotificationStorageChannelEvent
| * | | am: Implement GetNotificationStorageChannelEventgerman772021-09-102-2/+16
| | | |
| * | | hid: Stub SetTouchScreenConfigurationgerman772021-09-103-1/+28
| | | |
* | | | Merge pull request #6987 from Morph1984/common-errorMorph2021-09-123-2/+5
|\ \ \ \ | | | | | | | | | | common: Move error handling functions out of common_funcs
| * | | | kernel: Add missing <functional> includeMorph2021-09-111-0/+1
| | | | |
| * | | | file_sys/kernel_executable: Add missing <string> includeMorph2021-09-111-0/+1
| | | | |
| * | | | common: Move error handling to error.cpp/hMorph2021-09-111-2/+3
| | | | | | | | | | | | | | | | | | | | This allows us to avoid implicitly including <string> every time common_funcs.h is included.
* | | | | Merge pull request #6986 from Morph1984/version-updateMorph2021-09-121-5/+12
|\ \ \ \ \ | |/ / / / |/| | | | api_version: Update and add AtmosphereTargetFirmware
| * | | | api_version: Update and add AtmosphereTargetFirmwareMorph2021-09-101-5/+12
| |/ / /
* | | | Merge pull request #6846 from ameerj/nvdec-gpu-decodeFernando S2021-09-111-2/+14
|\ \ \ \ | | | | | | | | | | nvdec: Add GPU video decoding for all capable drivers and platforms
| * | | | configure_graphics: Add GPU nvdec decoding as an optionameerj2021-08-161-2/+14
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Some system configurations may see visual regressions or lower performance using GPU decoding compared to CPU decoding. This setting provides the option for users to specify their decoding preference. Co-Authored-By: yzct12345 <87620833+yzct12345@users.noreply.github.com>
* | | | | Merge pull request #6981 from ameerj/nvflinger-hb-formatFernando S2021-09-113-7/+8
|\ \ \ \ \ | |_|/ / / |/| | | | nvflinger: Use external surface format for framebuffer creation
| * | | | nvflinger: Use external surface format for framebuffer creationameerj2021-09-073-7/+8
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The format member the IGBPBuffer may not always specify the correct desired format. Using the external format member ensures a valid format is provided when creating the framebuffer. Fixes homebrew using the wrong framebuffer format.
* | | | | Merge pull request #6971 from bunnei/buffer-queue-keventAmeer J2021-09-083-14/+24
|\ \ \ \ \ | |/ / / / |/| | | | core: hle: service: buffer_queue: Improve management of KEvent.
| * | | | core: hle: service: buffer_queue: Improve management of KEvent.bunnei2021-09-053-14/+24
| | |_|/ | |/| |
* | | | Merge pull request #6965 from bunnei/cpu_manager_jthreadbunnei2021-09-062-18/+13
|\ \ \ \ | |/ / / |/| | | core: cpu_manager: Use jthread.
| * | | core: cpu_manager: Use jthread.bunnei2021-09-042-18/+13
| | |/ | |/|
* / | core: hle: service: nvflinger/vi: Improve management of KEvent.bunnei2021-09-044-16/+30
|/ /
* | Merge pull request #6905 from Morph1984/nifm-miscbunnei2021-08-292-137/+147
|\ \ | | | | | | nifm/network_interface: Cleanup and populate fields in GetCurrentNetworkProfile
| * | service: nifm: Populate fields in GetCurrentNetworkProfileMorph2021-08-271-29/+37
| | | | | | | | | | | | Populates the current_address, subnet_mask, and gateway fields from the selected network interface.
| * | service: nifm: Cleanup GetCurrentIpConfigInfoMorph2021-08-271-26/+21
| | |
| * | network_interface: Cleanup codeMorph2021-08-271-76/+83
| | |
| * | network_interface: Replace default return value with std::nulloptMorph2021-08-271-6/+6
| | |
* | | ngct: Stub NGCT:U servicegerman772021-08-274-0/+70
|/ /
* | Revert "kernel: Various improvements to scheduler"bunnei2021-08-2623-224/+140
| |
* | logging: Fix log filter during initializationameerj2021-08-242-7/+10
| | | | | | | | | | | | The log filter was being ignored on initialization due to the logging instance being initialized before the config instance, so the log filter was set to its default value. This fixes that oversight, along with using descriptive exceptions instead of abort() calls.
* | Merge pull request #6878 from BreadFish64/optimize-GetHostThreadIDAmeer J2021-08-241-10/+13
|\ \ | | | | | | kernel: Optimize GetHostThreadID
| * | kernel: Optimize GetHostThreadIDBreadFish642021-08-161-10/+13
| |/
* | Merge pull request #6869 from yzct12345/shiny-logs-in-the-fireplacebunnei2021-08-232-4/+14
|\ \ | | | | | | logging: Simplify and make thread-safe
| * | logging: Simplify and make thread-safeyzct123452021-08-132-4/+14
| |/ | | | | | | | | | | | | | | | | This simplifies the logging system. This also fixes some lost messages on startup. The simplification is simple. I removed unused functions and moved most things in the .h to the .cpp. I replaced the unnecessary linked list with its contents laid out as three member variables. Anything that went through the linked list now directly accesses the backends. Generic functions are replaced with those for each specific use case and there aren't many. This change increases coupling but we gain back more KISS and encapsulation. With those changes it was easy to make it thread-safe. I just removed the mutex and turned a boolean atomic. I was planning to use this thread-safety in my next PR about stacktraces. It was actually async-signal-safety at first but I ended up using a different approach. Anyway getting rid of the linked list is important for that because have the list of backends constantly changing complicates things.
* | applet_error: Fix 64-bit error code conversionMorph2021-08-191-6/+25
| |
* | Fix crash in logging in CreateStrayLayerValeri2021-08-191-1/+1
| | | | | | It was trying to log value of layer_id which is specifically known not to exist, potentially leading to segfault. Log display_id instead.
* | Fix check is thread current in GetThreadContextValeri2021-08-191-1/+1
| | | | | | Misplaced break made it only check for the first core.
* | Merge pull request #6832 from bunnei/scheduler-improvementsbunnei2021-08-1923-140/+224
|\ \ | | | | | | kernel: Various improvements to scheduler
| * | core: hle: kernel: Disable dispatch count tracking on single core.bunnei2021-08-143-5/+12
| | | | | | | | | | | | - This would have limited value, and would be a mess to handle properly.
| * | core: hle: kernel: k_thread: Mark KScopedDisableDispatch as nodiscard.bunnei2021-08-071-1/+1
| | |
| * | core: cpu_manager: Use invalid core_id on init and simplify shutdown.bunnei2021-08-071-7/+3
| | |
| * | core: hle: service: buffer_queue: Improve management of KEvent.bunnei2021-08-073-14/+24
| | |
| * | core: hle: kernel: k_auto_object: Add GetName method.bunnei2021-08-071-0/+4
| | | | | | | | | | | | - Useful purely for debugging.
| * | core: hle: service: nvflinger/vi: Improve management of KEvent.bunnei2021-08-074-16/+30
| | |
| * | core: hle: kernel: DisableDispatch on suspend threads.bunnei2021-08-071-0/+3
| | |
| * | core: hle: kernel: k_scheduler: Improve DisableScheduling and EnableScheduling.bunnei2021-08-071-14/+9
| | |
| * | core: cpu_manager: Use KScopedDisableDispatch.bunnei2021-08-071-7/+8
| | |
| * | core: hle: kernel: Use CurrentPhysicalCoreIndex as appropriate.bunnei2021-08-071-6/+2
| | |
| * | core: hle: kernel: k_scheduler: Remove unnecessary MakeCurrentProcess.bunnei2021-08-071-5/+0
| | |
| * | core: hle: kernel: k_scheduler: Improve ScheduleImpl.bunnei2021-08-071-6/+7
| | |
| * | core: hle: kernel: k_scheduler: Improve Unload.bunnei2021-08-071-17/+29
| | |
| * | core: hle: kernel: k_process: DisableDispatch on main thread.bunnei2021-08-071-0/+1
| | |
| * | core: hle: kernel: k_handle_table: Use KScopedDisableDispatch as necessary.bunnei2021-08-072-0/+8
| | |
| * | core: hle: kernel: k_thread: Add KScopedDisableDispatch.bunnei2021-08-072-1/+47
| | |
| * | core: hle: kernel: Ensure idle threads are closed before destroying scheduler.bunnei2021-08-073-24/+22
| | |
| * | core: hle: kernel: Reflect non-emulated threads as core 3.bunnei2021-08-077-13/+15
| | |
| * | core: cpu_manager: Use jthread.bunnei2021-08-072-18/+13
| | |
* | | network_interface: correct formattingSönke Holz2021-08-161-1/+1
| | |
* | | network_interface: fix mingw-w64 buildspholz2021-08-161-1/+1
| | |
* | | network: retrieve subnet mask and gateway infoSönke Holz2021-08-165-24/+137
| | |
* | | network: don't use reinterpret_cast in GetAvailableNetworkInterfacesspholz2021-08-131-7/+4
| | |
* | | network: fix mingw-w64 buildSönke Holz2021-08-131-4/+4
| | | | | | | | | | | | The header "combaseapi.h" of mingw-w64 defines "interface" as "struct".
* | | network: don't use assert to check if no network interfaces are returnedSönke Holz2021-08-131-2/+4
| | |
* | | network: use Common::BitCast instead of std::bit_castSönke Holz2021-08-131-2/+3
| | |
* | | network: narrow down scope of "result" in win32 code forSönke Holz2021-08-131-4/+5
| | | | | | | | | | | | GetAvailableNetworkInterfaces
* | | network: use explicit bool conversions in GetAvailableNetworkInterfacesSönke Holz2021-08-131-1/+1
| | |
* | | network: initialize ip_addr in GetHostIPv4Address()Sönke Holz2021-08-131-1/+1
| | |
* | | nifm: use operator*() instead of .value() to get value of std::optionalSönke Holz2021-08-131-2/+2
| | |
* | | nifm: treat a missing host IP address as a non-critical errorSönke Holz2021-08-131-2/+2
| | |
* | | Merge branch 'yuzu-emu:master' into fix-lan-playspholz2021-08-122-491/+163
|\ \ \ | | |/ | |/|
| * | Merge pull request #6823 from yzct12345/memory-cleanupbunnei2021-08-102-491/+163
| |\ \ | | |/ | |/| memory: Clean up code
| | * memory: Address lioncash's reviewyzct123452021-08-071-52/+6
| | |
| | * memory: Dedup Read and Write and fix logging bugsyzct123452021-08-071-129/+115
| | |
| | * memory: Clean up CopyBlock tooyzct123452021-08-051-36/+15
| | |
| | * memory: Address lioncash's reviewyzct123452021-08-052-7/+8
| | |
| | * memory: Clean up codeyzct123452021-08-052-329/+81
| | |
* | | network: correct formatting in network.cpp and network_interface.cppSönke Holz2021-08-122-8/+6
| | |
* | | configuration: add option to select network interfacespholz2021-08-126-37/+187
| | | | | | | | | | | | This commit renames the "Services" tab to "Network" and adds a combobox that allows the user to select the network interface that yuzu should use. This new setting is now used to get the local IP address in Network::GetHostIPv4Address. This prevents yuzu from selecting the wrong network interface and thus using the wrong IP address. The return type of Network::GetHostIPv4Adress has also been changed.
* | | Merge branch 'yuzu-emu:master' into fix-lan-playspholz2021-08-072-99/+4
|\| |
| * | Merge pull request #6799 from ameerj/vp9-fixesbunnei2021-08-072-99/+4
| |\ \ | | |/ | |/| nvdec: Fix VP9 reference frame refreshes
| | * nvhost_nvdec_common: Remove BufferMapameerj2021-08-072-76/+0
| | | | | | | | | | | | This was mainly used to keep track of mapped buffers for later unmapping. Since unmap is no longer implemented, this no longer seves a valuable purpose.
| | * nvhost_nvdec_common: Stub UnmapBuffer Ioctlameerj2021-08-071-23/+4
| | | | | | | | | | | | Skip unmapping nvdec buffers to avoid breaking the continuity of the VP9 reference frame addresses, and the risk of invalidating data before the async GPU thread is done with it.
* | | network: GetAndLogLastError: ignore Errno::AGAINSönke Holz2021-08-071-1/+5
| | | | | | | | | | | | If non-blocking sockets are used, they generate a lot of Errno::AGAIN errors when they didn't receive any data. These errors shouldn't be logged.
* | | network: GetCurrentIpConfigInfo: return host IP addressSönke Holz2021-08-071-1/+4
| | | | | | | | | | | | Service::NIFM::IGeneralService::GetCurrentIpConfigInfo currently hardcodes 192.168.1.100 as the IP address, which prevents LAN play from working correctly.
* | | network: fix fcntl cmdsSönke Holz2021-08-061-2/+2
|/ / | | | | | | F_SETFL/F_GETFL are the correct commands to set a socket to be non-blocking
* | applet_swkbd: Include the null terminator in the buffer size calculationMorph2021-08-051-2/+4
| | | | | | | | Some games may interpret the read string as a null-terminated string instead of just reading the string up to buffer_size.
* | network: fix ternary operator in Socket::SendTospholz2021-08-021-1/+1
| |
* | service: set: Correct copy amount in GetAvailableLanguageCodesMorph2021-08-011-1/+2
|/
* hle: api_version: Update HOS version to 12.1.0Morph2021-07-311-7/+7
| | | | Keeps us up to date with reporting the system version.
* Merge pull request #6752 from Morph1984/pt-brbunnei2021-07-303-10/+14
|\ | | | | service: ns, set: Add PT_BR (Brazilian Portuguese)
| * service: set: Correct 4.0.0 max_entries to 0x40 (64) instead of 17Morph2021-07-301-8/+8
| |
| * service: ns, set: Add PT_BR (Brazilian Portuguese)Morph2021-07-303-2/+6
| |
* | applet_swkbd: Correct string buffer size calculationMorph2021-07-301-2/+2
|/ | | | The buffer size here does not include the initial 8 bytes.
* Merge pull request #6751 from Morph1984/languagecodeAmeer J2021-07-292-42/+2
|\ | | | | service: ns: Map ZH_TW and ZH_CN to Traditional/Simplified Chinese
| * service: ns: Remove unused ns_language headerMorph2021-07-271-42/+0
| |
| * service: ns: Map ZH_TW and ZH_CN to Traditional/Simplified ChineseMorph2021-07-271-0/+2
| |
* | Merge pull request #6742 from Morph1984/uuidbunnei2021-07-292-14/+14
|\ \ | |/ |/| common: uuid: Return a lower-case hex string in Format
| * common: uuid: Return a lower-case hex string in FormatMorph2021-07-272-14/+14
| |
* | Merge pull request #6696 from ameerj/speed-limit-renamebunnei2021-07-276-26/+26
|\ \ | | | | | | general: Rename "Frame Limit" references to "Speed Limit"
| * | general: Rename "Frame Limit" references to "Speed Limit"ameerj2021-07-246-26/+26
| | | | | | | | | | | | | | | This setting is best referred to as a speed limit, as it involves the limits of all timing based aspects of the emulator, not only framerate. This allows us to differentiate it from the fps unlocker setting.
* | | Merge pull request #6697 from ameerj/fps-capbunnei2021-07-261-5/+6
|\ \ \ | |_|/ |/| | config, nvflinger: Add FPS cap setting
| * | config, nvflinger: Add FPS cap settingameerj2021-07-241-5/+6
| |/ | | | | | | Allows finer tuning of the FPS limit.
* | Merge pull request #6585 from ameerj/hadesbunnei2021-07-252-3/+2
|\ \ | | | | | | Shader Decompiler Rewrite
| * | cmake: Remove shader cache versionReinUsesLisp2021-07-231-1/+0
| | |
| * | general: Add setting shader_backendlat9nq2021-07-231-2/+2
| |/ | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | GLASM is getting good enough that we can move it out of advanced graphics settings. This removes the setting `use_assembly_shaders`, opting for a enum class `shader_backend`. This comes with the benefits that it is extensible for additional shader backends besides GLSL and GLASM, and this will work better with a QComboBox. Qt removes the related assembly shader setting from the Advanced Graphics section and places it as a new QComboBox in the API Settings group. This will replace the Vulkan device selector when OpenGL is selected. Additionally, mark all of the custom anisotropic filtering settings as "WILL BREAK THINGS", as that is the case with a select few games.
* | Merge pull request #6551 from bunnei/improve-kernel-objbunnei2021-07-2421-88/+327
|\ \ | |/ |/| Improve management of kernel objects
| * hle: service: kernel_helpers: Remove unnecessary pragma once.bunnei2021-07-211-2/+0
| |
| * hle: kernel: svc: Remove part of ExitProcess.bunnei2021-07-211-5/+0
| | | | | | | | - ExitProcess is not actually implemented either way, and this needs more work before we implement.
| * hle: service: nvdrv: Remove unused kernel reference.bunnei2021-07-211-1/+0
| |
| * hle: service: hid: npad: Remove unused kernel reference.bunnei2021-07-211-1/+0
| |
| * hle: kernel: Track and release server sessions, and protect methods with locks.bunnei2021-07-214-13/+82
| |
| * hle: kernel: KProcess: Change process termination assert to a warning.bunnei2021-07-211-1/+1
| | | | | | | | - Since we do not implement multiprocess right now, this should not be a crashing assert.
| * hle: kernel: Ensure current running process is closed.bunnei2021-07-211-5/+6
| |
| * hle: kernel: Ensure global handle table is finalized before closing.bunnei2021-07-211-0/+1
| |
| * kernel: svc: ConnectToNamedPort: Close extra reference to port.bunnei2021-07-211-0/+1
| |
| * hle: service: sm: Refactor to better manage ports.bunnei2021-07-214-45/+47
| |
| * hle: kernel: k_process: Close the handle table on shutdown.bunnei2021-07-211-0/+3
| |
| * hle: kernel: k_process: Close main thread reference after it is inserted into handle table.bunnei2021-07-211-0/+3
| |
| * hle: kernel: Ensure global handle table is initialized.bunnei2021-07-211-0/+1
| |
| * hle: service: Add a helper module for managing kernel objects.bunnei2021-07-2110-20/+146
| |
| * hle: kernel: Provide methods for tracking dangling kernel objects.bunnei2021-07-214-2/+43
| |
* | applet_controller: Add preliminary support for version 8Morph2021-07-202-3/+33
|/ | | | Version 8 adds support for key remapping introduced in FW 11.0, we will not be implementing this for now.
* file_sys: Support load game collection (#6582)Feng Chen2021-07-2012-83/+116
| | | Adds support for loading games with multiple programs embedded within such as the Dragon Quest 1+2+3 Collection
* Merge pull request #6525 from ameerj/nvdec-fixesFernando S2021-07-151-45/+40
|\ | | | | nvdec: Fix Submit Ioctl data source, vic frame dimension computations
| * nvhost_nvdec_common: Read Submit ioctl data from object addrameerj2021-07-151-8/+2
| | | | | | | | Fixes Mario Golf intro video decoding.
| * nvhost_nvdec_common: Fix {Slice/Write}Vectors returnameerj2021-07-151-37/+38
| | | | | | | | Plus some minor cleanup for consistency.
* | applets/web: Resolve Nintendo CDN URLsMorph2021-07-151-0/+13
| | | | | | | | This fixes the hint videos in New Super Mario Bros. U Deluxe
* | service: Append service name prefix to common filenamesMorph2021-07-1441-56/+56
| |
* | applets: Append applet_ prefix to backend appletsMorph2021-07-1419-33/+33
| |
* | Merge pull request #6599 from german77/disable_rumbleAmeer J2021-07-131-0/+5
|\ \ | | | | | | npad: Disable vibration check if disabled
| * | npad: Disable vibration check if disabledgerman772021-07-111-0/+5
| | |
* | | Merge pull request #6615 from ReinUsesLisp/httplib-debug-warningsbunnei2021-07-131-0/+3
|\ \ \ | | | | | | | | boxcat,web_service: Silence -Wmaybe-uninitialized when including httplib.h
| * | | boxcat: Silence -Wmaybe-uninitialized in httplib.hReinUsesLisp2021-07-121-0/+3
| |/ /
* / / content_archive: Remove unnecessary include to <ranges>ReinUsesLisp2021-07-121-1/+0
|/ / | | | | | | Fixes build issues on clang.
* | settings, arm_dynarmic, yuzu qt: Move CPU debugging optionlat9nq2021-07-082-2/+2
| | | | | | | | | | | | Decouples the CPU debugging mode from the enumeration to its own boolean. After this, it moves the CPU Debugging tab over to a sub tab underneath the Debug tab in the configuration UI.
* | arm_dynarmic_64: Re-add fastmem_address_space_bits to Auto settinglat9nq2021-07-081-0/+1
| |
* | arm_dynarmic{32,64}: Fixes from test buildlat9nq2021-07-082-18/+5
| | | | | | | | | | Now sets optimizations regardless of the Settings. Drops unsafe fastmem optimization.
* | core,common,yuzu qt: Add CPU accuracy option 'Auto'lat9nq2021-07-082-8/+36
| | | | | | | | | | | | | | The current CPU accuracy settings in yuzu are fairly polarized and require more than common knowledge to know what the optimal settings for yuzu would be. This adds a curated option called 'Auto' that applies a few at the moment known-good unsafe optimizations to Dynarmic.
* | Merge pull request #6539 from lat9nq/default-settingAmeer J2021-07-0811-20/+23
|\ \ | | | | | | general: Move most settings' defaults and labels into their definition
| * | general: Code formatting improvementslat9nq2021-07-081-2/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Slight improvements to readability. Dropped suggestions for string_view (settings.h:101), pass by value (settings.h:82), reverting double to a float (config.cpp:316), and other smaller ones, some out of scope. Addresses review feedback. Co-authored-by: Ameer J <52414509+ameerj@users.noreply.github.com>
| * | core, input_common: Miscellaneous fixeslat9nq2021-06-292-4/+6
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | bcat: Fix settings access telemetry_session: Fix settings accesses So this is what I get for testing with the web service disabled. touch_from_button: Fix settings access for clang
| * | general: Make most settings a BasicSettinglat9nq2021-06-2810-16/+17
| |/ | | | | | | | | | | | | | | | | | | | | Creates a new BasicSettings class in common/settings, and forces setting a default and label for each setting that uses it in common/settings. Moves defaults and labels from both frontends into common settings. Creates a helper function in each frontend to facillitate reading the settings now with the new default and label properties. Settings::Setting is also now a subclass of Settings::BasicSetting. Also adds documentation for both Setting and BasicSetting.
* | Merge pull request #6567 from Kelebek1/Audio2bunnei2021-07-071-1/+1
|\ \ | | | | | | [audren] Report 2 channels active rather than 1
| * | Report 2 channels active. Fixes Tales of Vesperia's mono channel audio.Kelebek12021-07-061-1/+1
| | |
* | | CMakeLists: Treat -Wsign-compare as an error on GCC/ClangMorph2021-07-061-2/+0
|/ / | | | | | | Treats (un)signed comparison mismatches as errors to be consistent with MSVC
* | Merge pull request #6537 from Morph1984/warningsbunnei2021-07-061-6/+3
|\ \ | | | | | | general: Enforce multiple warnings in MSVC
| * | core: Enforce C4242Morph2021-06-281-6/+3
| | |
* | | service: mii: Retrieve the correct default miis.Morph2021-07-041-2/+3
| | | | | | | | | | | | We were including the first 2 default miis which are not meant to be shown in games. With this change, we properly retrieve the 6 default miis shown in games, with 3 of each gender.
* | | Merge pull request #6498 from Kelebek1/Audiobunnei2021-07-031-5/+7
|\ \ \ | | | | | | | | [audio_core] Decouple audio update and processing, and process at variable rate
| * | | Fix XC2/VOEZ crashing, add audio looping and a few misc fixesKelebek12021-07-011-1/+1
| | | |
| * | | Decouple audio processing and run at variable rateKelebek12021-06-271-4/+6
| |/ / | | | | | | | | | | | | | | | Currently, processing of audio samples is called from AudioRenderer's Update method, using a fixed 4 buffers to process the given samples. Games call Update at variable rates, depending on framerate and/or sample count, which causes inconsistency in audio processing. From what I've seen, 60 FPS games update every ~0.004s, but 30 FPS/160 sample games update somewhere between 0.02 and 0.04, 5-10x slower. Not enough samples get fed to the backend, leading to a lot of audio skipping. This PR seeks to address this by de-coupling the audio consumption and the audio update. Update remains the same without calling for buffer queuing, and the consume now schedules itself to run based on the sample rate and count.
* | | patch_manager: Do not apply LayeredFS mods when dumpingMorph2021-06-282-3/+6
| | | | | | | | | | | | We should not apply any mods when dumping a game's RomFS.
* | | filesystem: Open a read-only directory for SDMC modsMorph2021-06-283-19/+25
| | | | | | | | | | | | This prevents mod files from being locked due to the read-only share flag in Windows.
* | | core: Simplify SDMC mod loadinglat9nq2021-06-283-21/+10
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | If someone else wants to support other mod formats in the SDMC directory, that can be added later. For now, just allow RomFS modding here and force people to do other types of mods the old way. Addresses review comments. Co-authored-by: LC <mathew1800@gmail.com>
* | | core: Support LayeredFS mod from SDMC directorylat9nq2021-06-285-2/+47
|/ / | | | | | | | | | | Enables loading a mod directly from `[yuzu data directory]/sdmc/atmosphere/contents/[title_id]`. For use with some homebrew mod managers.
* | Merge pull request #6526 from bunnei/doom-updatebunnei2021-06-265-8/+60
|\ \ | |/ |/| services: Misc. minor changes for latest SDK update.
| * hle: service: hwopus: OpenHardwareOpusDecoderEx: Remove unused buffer size.bunnei2021-06-261-1/+30
| |
| * hle: hle_helpers: Skip data payload offset checks on TIPC requests.bunnei2021-06-251-2/+6
| | | | | | | | - TIPC does not use this.
| * hle: service: hwopus: Implement GetWorkBufferSizeEx and OpenHardwareOpusDecoderEx.bunnei2021-06-252-5/+15
| | | | | | | | - This is used by the latest update of Doom Eternal.
| * hle: service: aoc: Stub GetAddOnContentListChangedEventWithProcessId.bunnei2021-06-252-1/+10
| | | | | | | | - This is used by the latest update of Doom Eternal.
* | Merge pull request #6519 from Wunkolo/mem-size-literalbunnei2021-06-259-62/+83
|\ \ | |/ |/| common: Replace common_sizes into user-literals
| * common: Replace common_sizes into user-literalsWunkolo2021-06-249-62/+83
| | | | | | | | | | | | | | | | | | | | | | | | | | Removes common_sizes.h in favor of having `_KiB`, `_MiB`, `_GiB`, etc user-literals within literals.h. To keep the global namespace clean, users will have to use: ``` using namespace Common::Literals; ``` to access these literals.
* | Merge pull request #6522 from Morph1984/pragmabunnei2021-06-243-0/+6
|\ \ | | | | | | general: Add missing #pragma once directives
| * | general: Add missing #pragma once directivesMorph2021-06-243-0/+6
| | |
* | | Add missing includes (#6521)Chloe2021-06-241-0/+2
|/ / | | | | | | | | * Add missing includes * Add array
* | Merge pull request #6517 from lioncash/fmtlibbunnei2021-06-244-9/+13
|\ \ | |/ |/| externals: Update fmt to 8.0.0
| * General: Resolve fmt specifiers to adhere to 8.0.0 API where applicableLioncash2021-06-234-9/+13
| | | | | | | | Also removes some deprecated API usages.
* | Merge pull request #6504 from Kelebek1/samples-playedbunnei2021-06-231-1/+9
|\ \ | |/ |/| [audout] Implement GetAudioOutPlayedSampleCount
| * Implement audout GetAudioOutPlayedSampleCountKelebek12021-06-221-1/+9
| | | | | | | | Used in Ninja Gaiden games.
* | Merge pull request #6510 from ReinUsesLisp/npad-data-raceMai M2021-06-232-0/+8
|\ \ | | | | | | npad: Fix data race when updating devices
| * | npad: Fix data race when updating devicesRodrigo Locatti2021-06-222-0/+8
| | | | | | | | | | | | | | | Add a lock to avoid data races. This reduces the number of -fsanitize=thread errors significantly.
* | | Merge pull request #6493 from Morph1984/fs-nodiscardbunnei2021-06-232-8/+3
|\ \ \ | | | | | | | | common: fs: Miscellaneous changes
| * | | vfs_real: Fix Mode to FileAccessMode conversionMorph2021-06-221-6/+1
| | | | | | | | | | | | | | | | These enforce requiring the file to exist prior to opening.
| * | | common: fs: Remove [[nodiscard]] attribute on Remove* functionsMorph2021-06-221-2/+2
| | | | | | | | | | | | | | | | | | | | | | | | There are a lot of scenarios where we don't particularly care whether or not the removal operation and just simply attempt a removal. As such, removing the [[nodiscard]] attribute is best for these functions.
* | | | Merge pull request #6472 from Morph1984/splbunnei2021-06-239-78/+493
|\ \ \ \ | | | | | | | | | | service: spl: Implement general SPL service
| * | | | spl: Mark the other functions as unimplementedMorph2021-06-161-5/+30
| | | | |
| * | | | spl: Implement spl::GetConfigMorph2021-06-162-1/+90
| | | | |
| * | | | hle: api_version: Add HLE API version constantsMorph2021-06-163-33/+54
| | | | |
| * | | | spl: Add the general SPL interfaceMorph2021-06-164-45/+64
| | | | |
| * | | | spl: Add SPL typesMorph2021-06-162-0/+231
| | | | |
| * | | | spl: Add SPL result codesMorph2021-06-162-0/+30
| | | | |
* | | | | Merge pull request #6483 from Morph1984/get-tz-filebunnei2021-06-221-1/+1
|\ \ \ \ \ | |_|/ / / |/| | | | service: time: Use GetFileRelative to get files within subdirectories
| * | | | service: time: Use GetFileRelative to get files within subdirectoriesMorph2021-06-181-1/+1
| | |_|/ | |/| | | | | | | | | | The timezone info file can be within subdirectories (such as Asia/Tokyo), use GetFileRelative instead of GetFile to get files within subdirectories.
* | | | Merge pull request #6511 from ReinUsesLisp/core-is-powered-data-raceMai M2021-06-221-2/+3
|\ \ \ \ | | | | | | | | | | core: Make is_powered_on atomic
| * | | | core: Make is_powered_on atomicRodrigo Locatti2021-06-221-2/+3
| | |_|/ | |/| | | | | | | | | | Fixes potential data races when shutting down.
* | | | Merge pull request #6481 from Morph1984/missing-peak-setbunnei2021-06-221-0/+1
|\ \ \ \ | |/ / / |/| | | kernel: Fix missing peak set in KResourceLimit::SetLimitValue
| * | | kernel: Fix missing peak set in KResourceLimit::SetLimitValueMorph2021-06-181-0/+1
| |/ /
* | | Merge pull request #6499 from FernandoS27/we-were-on-a-breakbunnei2021-06-211-0/+3
|\ \ \ | | | | | | | | Update dynarmic and add new unsafe CPU option.
| * | | Update dynarmic and add new unsafe CPU option.Fernando Sahmkow2021-06-201-0/+3
| |/ /
* / / nvflinger: Add toggle to disable buffer swap interval limitsameerj2021-06-171-0/+3
|/ / | | | | | | | | Enabling this setting will allow some titles to present more frames to the screen as they become available in the nvflinger buffer queue.
* | Merge pull request #6464 from ameerj/disable-astcbunnei2021-06-161-0/+1
|\ \ | | | | | | textures: Add a toggle for GPU Accelerated ASTC decoder
| * | configure_graphics: Add Accelerate ASTC decoding settingameerj2021-06-161-0/+1
| |/
* / fsp_srv: Fix filesystem access loggingMorph2021-06-164-34/+38
|/ | | | | | | | This introduces a new setting Enable FS Access Log which saves the filesystem access log to sdmc:/FsAccessLog.txt If this setting is not enabled, this will indicate to FS to not call OutputAccessLogToSdCard. Fixes softlocks during loading in Xenoblade Chronicles 2 when certain DLC is enabled.
* lm: Demote guest logs to LOG_DEBUGameerj2021-06-151-27/+20
| | | | Guest logs are not very useful, as they are intended for use by the game developers during development. As such, they provide little meaning to be logged by yuzu and tend to overwhelm the log output at times.
* general: Remove extraneous includesMorph2021-06-133-3/+0
|
* Merge pull request #6452 from german77/sixaxis_firmware_stubMorph2021-06-132-1/+23
|\ | | | | hid: Stub IsFirmwareUpdateAvailableForSixAxisSensor
| * hid: Stub IsFirmwareUpdateAvailableForSixAxisSensorgerman772021-06-112-1/+23
| |
* | Merge pull request #6422 from FernandoS27/i-am-the-senateMai M2021-06-115-10/+45
|\ \ | |/ |/| Implement/Port Fastmem from Citra to Yuzu
| * General: Add settings for fastmem and disabling adress space check.FernandoS272021-06-113-6/+21
| |
| * core: Make use of fastmemMarkus Wick2021-06-115-8/+28
| |
* | Merge pull request #6443 from Morph1984/k-light-condition-variablebunnei2021-06-114-37/+43
|\ \ | |/ |/| kernel: KLightConditionVariable: Update implementation to 12.x
| * kernel: Unconditionally set thread state when appropriateMorph2021-06-112-23/+12
| |
| * kernel: KLightConditionVariable: Update implementation to 12.xMorph2021-06-112-14/+31
| | | | | | | | Updates the implementation of KLightConditionVariable to FW 12.x
* | Merge pull request #6445 from degasus/fix_ubsnbunnei2021-06-111-1/+3
|\ \ | |/ |/| Fix GCC undefined behavior sanitizer.
| * Fix GCC undefined behavior sanitizer.Markus Wick2021-06-101-1/+3
| | | | | | | | | | | | | | | | | | * Wrong alignment in u64 LOG_DEBUG -> memcpy. * Huge shift exponent in stride calculation for linear buffer, unused result -> skipped. * Large shift in buffer cache if word = 0, skip checking for set bits. Non of those were critical, so this should not change any behavior. At least with the assumption, that the last one used masking behavior, which always yield continuous_bits = 0.
* | hle: service: sm: Remove redundant session reservation, etc.bunnei2021-06-102-18/+13
|/ | | | - We were double-reserving, causing us to run out of sessions in Pokemon Sword & Shield.
* hle: service: Increase arbitrary max sessions limit.bunnei2021-06-101-4/+1
| | | - Pokemon Sword/Shield are still hitting this for some reason, causing an svcBreak.
* hle: kernel: KClientPort: Add an assert for session count.bunnei2021-06-101-0/+3
| | | | - Prevents us from over decrementing num_sessions.
* hle: service: sm: Fix GetService setup of session & port.bunnei2021-06-102-5/+5
|
* hle: service: Use correct size for ServerSessionCountMax.bunnei2021-06-101-4/+6
|
* hle: kernel: KServerSession: Fix client disconnected.bunnei2021-06-103-9/+8
| | | | | - Prevents a cloned session's handler from being overwritten by another disconnected session. - Fixes session handler nullptr asserts with Pokemon Sword & Shield.
* kernel: svc: Add missing error check to CancelSynchronization.bunnei2021-06-101-2/+2
| | | | - Avoids a potential crash if the handle is invalid, and also makes this code accurate to real kernel behavior.
* hle: service: Increase arbitrary max sessions limit.bunnei2021-06-091-1/+1
| | | - Pokemon Sword/Shield are still hitting this for some reason, causing an svcBreak.
* hle: kernel: KServerSession: Work-around scenario where session is closed too early.bunnei2021-06-081-7/+24
|
* hle: kernel: hle_ipc: Ensure SessionRequestHandler is valid.bunnei2021-06-083-5/+26
|
* hle: kernel: Remove service thread manager and use weak_ptr.bunnei2021-06-083-18/+8
| | | | | - We no longer need to queue up service threads to be destroyed. - Fixes a race condition where a thread could be destroyed too early, which caused a crash in Pokemon Sword/Shield.
* Merge pull request #6414 from bunnei/fix-service-threadsbunnei2021-06-0721-87/+101
|\ | | | | hle: kernel: Refactor to allocate a ServiceThread per service handler.
| * hle: kernel: KServerSession: Use ASSERT_MSG where appropriate.bunnei2021-06-071-1/+1
| |
| * hle: kernel: k_server_session: Return service thread by strong pointer.bunnei2021-06-072-4/+4
| |
| * hle: kernel: k_server_session: Ensure service thread is valid before dereference.bunnei2021-06-071-1/+3
| |
| * hle: kernel: hle_ipc: Use default destructor for SessionRequestManager.bunnei2021-06-071-1/+1
| |
| * hle: kernel: KAutoObjectWithListContainer: Use boost::instrusive::rbtree.bunnei2021-06-0711-22/+26
| | | | | | | | - Fixes some crashes introduced by our common intrusive red/black tree impl.
| * hle: kernel: Refactor to allocate a ServiceThread per service handler.bunnei2021-06-0513-67/+75
| | | | | | | | | | | | - Previously, we would allocate a thread per session, which adds new threads on CloneCurrentObject. - This results in race conditions with N sessions queuing requests to the same service interface. - Fixes Pokken Tournament DX crashes/softlocks, which were regressed by #6347.
* | result: Add [[nodiscard]] specifiers where applicableLioncash2021-06-051-20/+20
|/ | | | | | The result code classes are used quite extensively throughout both the kernel and service HLE code. We can mark these member functions as [[nodiscard]] to prevent a few logic bugs from slipping through.
* Merge pull request #6389 from german77/Analog_button_fixbunnei2021-06-041-0/+15
|\ | | | | input_common: Analog button, use time based position
| * input_common: Analog button, use time based position instead of frequent updatesgerman772021-05-301-0/+15
| |
* | fsp-srv: Replace one last instance of RESULT_SUCCESSMorph2021-06-031-1/+1
| |
* | fspsrv: Implement DisableAutoSaveDataCreation (#6355)Chloe2021-06-036-2/+25
| | | | | | - Used by Mii Edit
* | general: Replace RESULT_UNKNOWN with ResultUnknownMorph2021-06-0213-45/+45
| | | | | | | | Transition to PascalCase for result names.
* | general: Replace RESULT_SUCCESS with ResultSuccessMorph2021-06-02111-931/+928
| | | | | | | | Transition to PascalCase for result names.
* | common_funcs: Move R_ macros to result.hLioncash2021-05-311-0/+25
| | | | | | | | | | | | These macros all interact with the result code type, so they should ideally be within this file as well, so all the common_funcs machinery doesn't need to be pulled in just to use them.
* | Merge pull request #6385 from degasus/save_memory_accessbunnei2021-05-313-33/+70
|\ \ | | | | | | core/memory: Check our memory fallbacks for out-of-bound behavior.
| * | core/memory: Check our memory fallbacks for out-of-bound behavior.Markus Wick2021-05-291-4/+39
| | | | | | | | | | | | | | | | | | This makes it by far harder to crash yuzu. Also implement the 48bit masking of AARCH64 while touching this code.
| * | core/arm_interface: Improve the performance of memory fallbacks.Markus Wick2021-05-292-29/+31
| | | | | | | | | | | | | | | We just create one memory subsystem. This is a constant all the time. So there is no need to call the non-inlined parent.Memory() helper on every callback.
* | | Merge pull request #6377 from lioncash/pointbunnei2021-05-303-39/+17
|\ \ \ | | | | | | | | common: Extract Point struct into common
| * | | touchscreen: Make use of common point structLioncash2021-05-282-10/+10
| | | |
| * | | common: Extract point into a common structLioncash2021-05-281-29/+7
| | | | | | | | | | | | | | | | | | | | This is generic enough that it can be moved into the Common class for reuse.
* | | | Merge pull request #6387 from lioncash/class-tokenbunnei2021-05-301-43/+36
|\ \ \ \ | | | | | | | | | | k_class_token: Use variable templates where applicable
| * | | | k_class_token: Use variable templates where applicableLioncash2021-05-291-43/+36
| |/ / / | | | | | | | | | | | | Same behavior, less code.
* | | | Merge pull request #6374 from Morph1984/swkbd-textcheck-encodingMai M2021-05-301-10/+15
|\ \ \ \ | | | | | | | | | | applets/swkbd: Only read the text check message on Failure/Confirm
| * | | | applets/swkbd: Make use of std::move where applicableMorph2021-05-281-8/+8
| | | | | | | | | | | | | | | | | | | | Avoids redundant string copies
| * | | | applets/swkbd: Only read the text check message on Failure/ConfirmMorph2021-05-281-2/+7
| |/ / / | | | | | | | | | | | | | | | | | | | | Applications may leave this region of memory uninitialized when the text check result is not either Failure or Confirm. Attempting to read uninitialized memory may cause an exception within the UTF16 to UTF8 string converter. Fix this by only reading the text check message on Failure or Confirm.
* | | | Merge pull request #6364 from german77/stub-lp2pMai M2021-05-301-0/+141
|\ \ \ \ | |_|_|/ |/| | | | | | | | | | | | | | | | | | | ldn: Add and stub lp2p:sys lp2p:app INetworkServiceMonitor INetworkService Mario Kart Live: Home Circuit needs lp2p:sys lp2p:app INetworkServiceMonitor INetworkService to be able to progress. Note: The game still fails to boot from unimplemented LDN and BSD services.
| * | | ldn: Add and stub lp2p:sys lp2p:app INetworkServiceMonitor INetworkServicegerman772021-05-261-0/+141
| | | |
* | | | Merge pull request #6379 from degasus/update_dynarmicbunnei2021-05-296-11/+11
|\ \ \ \ | | | | | | | | | | externals: Update dynarmic.
| * | | | externals: Update dynarmic.Markus Wick2021-05-296-11/+11
| | |_|/ | |/| | | | | | | | | | The new version supports fastmem on a64.
* | | | Merge pull request #6384 from lioncash/virtualbunnei2021-05-2915-53/+48
|\ \ \ \ | | | | | | | | | | kernel: Add missing override specifiers
| * | | | kernel: Add missing override specifiersLioncash2021-05-2915-53/+48
| | |_|/ | |/| | | | | | | | | | | | | | | | | | | | | | | | | | Over the course of the kernel refactoring a tiny bit of missing overrides slipped through review, so we can add these. While we're at it, we can remove redundant virtual keywords where applicable as well.
* | | | Merge pull request #6382 from lioncash/nullbunnei2021-05-291-5/+5
|\ \ \ \ | | | | | | | | | | k_thread: Move dereference after null check in Initialize()
| * | | | k_thread: Move dereference after null check in Initialize()Lioncash2021-05-291-5/+5
| |/ / / | | | | | | | | | | | | Prevents a -Wnonnull warning on GCC.
* | | | Merge pull request #6373 from bunnei/use-slabheap-tlsbunnei2021-05-292-11/+191
|\ \ \ \ | | | | | | | | | | hle: kernel: KSlabHeap: Allow host or guest allocations.
| * | | | hle: kernel: KSlabHeap: Allow host or guest allocations.bunnei2021-05-292-11/+191
| | | | | | | | | | | | | | | | | | | | | | | | | - Use host allocations for kernel memory, as this is not properly emulated yet. - Use guest allocations for TLS, as this needs to be backed by DeviceMemory.
* | | | | Fix two GCC 11 warnings: Unneeded copies.Markus Wick2021-05-291-1/+1
| |_|/ / |/| | | | | | | | | | | | | | | std::move created an unneeded copy. iterating without reference also created copies.
* | | | Merge pull request #6371 from degasus/drop_ExceptionalExitbunnei2021-05-296-18/+42
|\ \ \ \ | |/ / / |/| | | core/arm_interface: Call SVC after end of dynarmic block.
| * | | core/arm_interface: Call SVC after end of dynarmic block.Markus Wick2021-05-276-18/+42
| |/ / | | | | | | | | | | | | | | | So we can modify all of dynarmic states within SVC without ExceptionalExit. Especially as the ExceptionalExit hack is dropped on upstream dynarmic.
* | | Merge pull request #6356 from ogniK5377/ApplyNpadSystemCommonPolicybunnei2021-05-281-1/+10
|\ \ \ | |/ / |/| | hid: ApplyNpadSystemCommonPolicy
| * | hid: ApplyNpadSystemCommonPolicyChloe Marcec2021-05-241-1/+10
| | | | | | | | | | | | We already do this specifically for homebrew, so we can keep it stubbed out for the time being
* | | core/arm: Drop ChangeProcessorID.Markus Wick2021-05-265-12/+0
| |/ |/| | | | | | | | | This code was used to switch the CPU ID on thread switches. However since "hle: kernel: multicore: Replace n-JITs impl. with 4 JITs.", the CPU ID is not a constant. This has been dead code since this rewrite, and dropped in dynarmic as well. So there is no need to keep it.
* | Merge pull request #6331 from lioncash/gestureMorph2021-05-262-67/+79
|\ \ | | | | | | hid/gesture: Simplify point related code
| * | hid/gesture: Factor out last gesture retrieval into its own functionLioncash2021-05-182-14/+23
| | | | | | | | | | | | Deduplicates a commonly repeated expression.
| * | hid/gesture: Ensure all ID arrays are initializedLioncash2021-05-181-4/+4
| | | | | | | | | | | | Makes for deterministic initial state.
| * | hid/gesture: Make Point a templateLioncash2021-05-182-38/+46
| | | | | | | | | | | | | | | We can now use this in a generic context to reuse it with the finger position.
| * | hid/gesture: Replace x,y members of GestureState with a PointLioncash2021-05-182-6/+4
| | | | | | | | | | | | Simplifies assignments.
| * | hid/gesture: Add default comparators to PointLioncash2021-05-182-10/+7
| | | | | | | | | | | | Simplifies some comparisons.
| * | hid/gesture: Rename Points to PointLioncash2021-05-181-5/+5
| | | | | | | | | | | | This only represents a single point
* | | common: fs: Rework the Common Filesystem interface to make use of std::filesystem (#6270)Morph2021-05-2631-340/+387
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * common: fs: fs_types: Create filesystem types Contains various filesystem types used by the Common::FS library * common: fs: fs_util: Add std::string to std::u8string conversion utility * common: fs: path_util: Add utlity functions for paths Contains various utility functions for getting or manipulating filesystem paths used by the Common::FS library * common: fs: file: Rewrite the IOFile implementation * common: fs: Reimplement Common::FS library using std::filesystem * common: fs: fs_paths: Add fs_paths to replace common_paths * common: fs: path_util: Add the rest of the path functions * common: Remove the previous Common::FS implementation * general: Remove unused fs includes * string_util: Remove unused function and include * nvidia_flags: Migrate to the new Common::FS library * settings: Migrate to the new Common::FS library * logging: backend: Migrate to the new Common::FS library * core: Migrate to the new Common::FS library * perf_stats: Migrate to the new Common::FS library * reporter: Migrate to the new Common::FS library * telemetry_session: Migrate to the new Common::FS library * key_manager: Migrate to the new Common::FS library * bis_factory: Migrate to the new Common::FS library * registered_cache: Migrate to the new Common::FS library * xts_archive: Migrate to the new Common::FS library * service: acc: Migrate to the new Common::FS library * applets/profile: Migrate to the new Common::FS library * applets/web: Migrate to the new Common::FS library * service: filesystem: Migrate to the new Common::FS library * loader: Migrate to the new Common::FS library * gl_shader_disk_cache: Migrate to the new Common::FS library * nsight_aftermath_tracker: Migrate to the new Common::FS library * vulkan_library: Migrate to the new Common::FS library * configure_debug: Migrate to the new Common::FS library * game_list_worker: Migrate to the new Common::FS library * config: Migrate to the new Common::FS library * configure_filesystem: Migrate to the new Common::FS library * configure_per_game_addons: Migrate to the new Common::FS library * configure_profile_manager: Migrate to the new Common::FS library * configure_ui: Migrate to the new Common::FS library * input_profiles: Migrate to the new Common::FS library * yuzu_cmd: config: Migrate to the new Common::FS library * yuzu_cmd: Migrate to the new Common::FS library * vfs_real: Migrate to the new Common::FS library * vfs: Migrate to the new Common::FS library * vfs_libzip: Migrate to the new Common::FS library * service: bcat: Migrate to the new Common::FS library * yuzu: main: Migrate to the new Common::FS library * vfs_real: Delete the contents of an existing file in CreateFile Current usages of CreateFile expect to delete the contents of an existing file, retain this behavior for now. * input_profiles: Don't iterate the input profile dir if it does not exist Silences an error produced in the log if the directory does not exist. * game_list_worker: Skip parsing file if the returned VfsFile is nullptr Prevents crashes in GetLoader when the virtual file is nullptr * common: fs: Validate paths for path length * service: filesystem: Open the mod load directory as read only
* | | kernel: process_capability: Add MapRegion capabilityMorph2021-05-252-0/+12
| |/ |/| | | | | - Used by nx-hbloader
* | hle: kernel: service_thread: Take reference to KServerSession on service request.bunnei2021-05-211-9/+5
| |
* | hle: kernel: k_port: Use AcceptSession to ensure SessionList state is correct.bunnei2021-05-211-1/+1
| | | | | | | | - Fixes a use-after-free, work-around until we fixup session/port management.
* | hle: kernel: Use host memory allocations for KSlabMemory.bunnei2021-05-214-174/+20
| | | | | | | | - There are some issues with the current workaround, we will just use host memory until we have a complete kernel memory implementation.
* | Revert "WORKAROUND: Do not use slab heap while we track down issues with resource management."bunnei2021-05-211-2/+2
| | | | | | | | This reverts commit f2c26443f85a3c3fd43137509368ba5c7ab80ee7.
* | hle: kernel: hle_ipc: Simplify incoming/outgoing move/copy/domain objects.bunnei2021-05-213-62/+17
| |
* | hle: kernel: Implement CloneCurrentObject and improve session management.bunnei2021-05-2113-99/+184
| |
* | Revert "WORKAROUND: temp. disable session resource limits while we work out issues"bunnei2021-05-214-11/+11
| | | | | | | | This reverts commit fc086f93b2165b5c210cb7dcd6c18ebe17f1fd7b.
* | Merge pull request #6320 from Morph1984/get-pidbunnei2021-05-212-9/+14
|\ \ | | | | | | hle_ipc: Add a getter for PID
| * | hle_ipc: unsigned -> u32Morph2021-05-161-7/+7
| | | | | | | | | | | | This is more concise and consistent with the rest of the codebase.
| * | hle_ipc: Add a getter for PIDMorph2021-05-162-2/+7
| | |
* | | Merge pull request #6321 from lat9nq/per-game-cpubunnei2021-05-213-11/+11
|\ \ \ | | | | | | | | configuration: Add CPU tab to game properties and slight per-game settings rework
| * | | general: Demote custom_rtc to regular settinglat9nq2021-05-171-1/+1
| | | |
| * | | general: Make CPU accuracy and related a Settings::Settinglat9nq2021-05-162-10/+10
| | | | | | | | | | | | | | | | | | | | Required to make CPU accuracy and unsafe settings available to use as a per-game setting.
* | | | Merge pull request #6317 from ameerj/fps-fixbunnei2021-05-194-11/+14
|\ \ \ \ | | | | | | | | | | perf_stats: Rework FPS counter to be more accurate
| * | | | perf_stats: Rework FPS counter to be more accurateameerj2021-05-164-11/+14
| |/ / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The FPS counter was based on metrics in the nvdisp swapbuffers call. This metric would be accurate if the gpu thread/renderer were synchronous with the nvdisp service, but that's no longer the case. This commit moves the frame counting responsibility onto the concrete renderers after their frame draw calls. Resulting in more meaningful metrics. The displayed FPS is now made up of the average framerate between the previous and most recent update, in order to avoid distracting FPS counter updates when framerate is oscillating between close values. The status bar update frequency was also changed from 2 seconds to 500ms.
* | | / KTransferMemory: Return size instead of size * PageSize in GetSize()Morph2021-05-181-1/+1
| |_|/ |/| | | | | | | | size is already the size in bytes. We do not need to multiply it by the page size
* | | Merge pull request #6319 from Morph1984/no-install-basebunnei2021-05-172-0/+8
|\ \ \ | | | | | | | | main: Prevent installing base titles into NAND
| * | | main: Prevent installing base titles into NANDMorph2021-05-162-0/+8
| | |/ | |/| | | | | | | Many users have been installing their base titles into NAND instead of adding them into the games list. This prevents users from installing any base titles and warns the user about the action.
* | | Merge pull request #6284 from ameerj/shantae-fixbunnei2021-05-162-5/+35
|\ \ \ | | | | | | | | nvflinger: Create layers when they are queried but not found
| * | | nvflinger: Create layers when they are queried but not foundameerj2021-05-062-5/+35
| | | | | | | | | | | | | | | | Fixes Shantae softlock on boot.
* | | | Merge pull request #6296 from lioncash/shadow-errorbunnei2021-05-1699-279/+304
|\ \ \ \ | | | | | | | | | | core: Make variable shadowing a compile-time error
| * | | | core: Make variable shadowing a compile-time errorLioncash2021-05-1699-279/+304
| | |/ / | |/| | | | | | | | | | | | | | | | | | Now that we have most of core free of shadowing, we can enable the warning as an error to catch anything that may be remaining and also eliminate this class of logic bug entirely.
* | | | Merge pull request #6307 from Morph1984/fix-response-push-sizebunnei2021-05-162-2/+2
|\ \ \ \ | |/ / / |/| | | nifm, ssl: Fix incorrect response sizes
| * | | nifm, ssl: Fix incorrect response sizesMorph2021-05-162-2/+2
| | |/ | |/|
* | | Merge pull request #6299 from bunnei/ipc-improvementsbunnei2021-05-1618-219/+353
|\ \ \ | |/ / |/| | Various improvements to IPC and session management
| * | hle: kernel: hle_ipc: Fix outgoing IPC response size calculation.bunnei2021-05-113-1/+15
| | |
| * | WORKAROUND: temp. disable session resource limits while we work out issuesbunnei2021-05-114-11/+11
| | |
| * | WORKAROUND: Do not use slab heap while we track down issues with resource management.bunnei2021-05-111-2/+2
| | |
| * | audrenbunnei2021-05-112-25/+16
| | |
| * | core: hle: ipc_helpers: Fix cast on raw_data_size calculation.bunnei2021-05-111-1/+1
| | |
| * | hle: service: sm: Add TIPC support.bunnei2021-05-112-41/+66
| | | | | | | | | | | | - Fixes our error checking of names as well.
| * | hle: kernel: hle_ipc: Improve IPC code and add initial support for TIPC.bunnei2021-05-112-81/+57
| | | | | | | | | | | | | | | - Fixes our move handles implementation to actually move objects. - Simplifies the traditional IPC path.
| * | hle: service: sm: GetService: Reserve session resource when we create a KSession.bunnei2021-05-111-0/+7
| | |
| * | hle: service: Add support for dispatching TIPC requests.bunnei2021-05-112-1/+52
| | |
| * | hle: service: Implement IPC::CommandType::Close.bunnei2021-05-113-11/+15
| | | | | | | | | | | | - This was not actually closing sessions before.
| * | hle: service: sm: Use RegisterNamedService to register the service.bunnei2021-05-111-1/+1
| | |
| * | hle: service: sm: Improve Initialize implementation.bunnei2021-05-112-0/+3
| | |
| * | hle: kernel: svc: Update ConnectToNamedPort to use new CreateNamedServicePort interface.bunnei2021-05-111-4/+3
| | |
| * | hle: kernel: Implement named service ports using service interface factory.bunnei2021-05-114-22/+30
| | | | | | | | | | | | - This allows us to create a new interface each time ConnectToNamedPort is called, removing the assumption that these are static.
| * | hle: kernel: KSession: Improve implementation of CloneCurrentObject.bunnei2021-05-111-2/+10
| | |
| * | hle: service: sm: Increase point buffer size.bunnei2021-05-111-1/+1
| | |
| * | hle: ipc_helpers: Reserve session resource when we create a KSession.bunnei2021-05-111-0/+5
| | |
| * | hle: kernel: KClientPort: Cleanup comment format.bunnei2021-05-111-1/+1
| | |
| * | hle: ipc: Add declarations for TIPC.bunnei2021-05-111-1/+16
| | |
| * | hle: kernel: Further cleanup and add TIPC helpers.bunnei2021-05-112-4/+12
| | |
| * | hle: ipc_helpers: Update IPC response generation for TIPC.bunnei2021-05-112-19/+39
| | |
* | | ssl: Stub Import(Client/Server)PkiMorph2021-05-131-2/+40
| | | | | | | | | | | | - Used in JUMP FORCE Deluxe Edition
* | | Merge pull request #6267 from german77/gestureRewriteMorph2021-05-122-76/+340
|\ \ \ | |/ / |/| | hid: Improve hardware accuracy of gestures
| * | hid: Improve hardware accuracy of gesturesgerman772021-05-052-76/+340
| | |
* | | Merge pull request #6291 from lioncash/kern-shadowbunnei2021-05-1040-140/+138
|\ \ \ | | | | | | | | kernel: Eliminate variable shadowing
| * | | kernel: Eliminate variable shadowingLioncash2021-05-0840-140/+138
| | | | | | | | | | | | | | | | | | | | Now that the large kernel refactor is merged, we can eliminate the remaining variable shadowing cases.
* | | | kernel: Delete unused filesgerman772021-05-092-151/+0
|/ / /
* | | Merge pull request #6266 from bunnei/kautoobject-refactorbunnei2021-05-08170-2799/+4752
|\ \ \ | | | | | | | | Kernel Rework: Migrate kernel objects to KAutoObject
| * | | hle: kernel: KPageTable: CanContain should not be constexpr.bunnei2021-05-062-2/+2
| | | |
| * | | hle: kernel: Move slab resource counts to Kernel.bunnei2021-05-064-33/+52
| | | |
| * | | fixup! hle: kernel: Migrate KSharedMemory to KAutoObject.bunnei2021-05-061-2/+2
| | | |
| * | | fixup! hle: kernel: Migrate more of KThread to KAutoObject.bunnei2021-05-061-1/+1
| | | |
| * | | fixup! hle: kernel: Ensure all kernel objects with KAutoObject are properly created.bunnei2021-05-061-2/+0
| | | |
| * | | fixup! hle: kernel: Ensure all kernel objects with KAutoObject are properly created.bunnei2021-05-061-2/+0
| | | |
| * | | kernel: svc: Remove unused RetrieveResourceLimitValue function.bunnei2021-05-061-32/+0
| | | |
| * | | hle: kernel: Fix un/sign mismatch errors with NUM_CPU_CORES.bunnei2021-05-061-3/+3
| | | |
| * | | fixup! hle: kernel: Add initial impl. of slab setup.bunnei2021-05-061-6/+2
| | | |
| * | | fixup! hle: kernel: Migrate to KHandleTable.bunnei2021-05-061-0/+3
| | | |
| * | | fixup! hle: kernel: Migrate more of KThread to KAutoObject.bunnei2021-05-061-7/+0
| | | |
| * | | fixup! hle: kernel: Migrate KReadableEvent and KWritableEvent to KAutoObject.bunnei2021-05-062-2/+2
| | | |
| * | | fixup! hle: kernel: Migrate to KHandleTable.bunnei2021-05-061-1/+1
| | | |
| * | | fixup! hle: kernel: Add initial impl. of KLinkedList.bunnei2021-05-061-12/+12
| | | |
| * | | fixup! hle: kernel: Migrate to KHandleTable.bunnei2021-05-061-1/+1
| | | |
| * | | fixup! hle: kernel: Migrate KPort, KClientPort, and KServerPort to KAutoObject.bunnei2021-05-061-1/+1
| | | |
| * | | fixup! hle: kernel: Migrate KSession, KClientSession, and KServerSession to KAutoObject.bunnei2021-05-063-22/+28
| | | |
| * | | fixup! hle: kernel: Migrate KSession, KClientSession, and KServerSession to KAutoObject.bunnei2021-05-061-1/+1
| | | |
| * | | fixup! hle: kernel: Migrate KPort, KClientPort, and KServerPort to KAutoObject.bunnei2021-05-061-1/+1
| | | |
| * | | fixup! hle: kernel: Migrate to KHandleTable.bunnei2021-05-061-60/+58
| | | |
| * | | fixup! hle: kernel: Add initial impl. of KAutoObjectWithListContainer.bunnei2021-05-061-11/+9
| | | |
| * | | fixup! hle: kernel: Add initial impl. of KAutoObjectWithListContainer.bunnei2021-05-061-9/+2
| | | |
| * | | fixup! hle: kernel: Add initial impl. of KAutoObject.bunnei2021-05-061-46/+46
| | | |
| * | | fixup! hle: kernel: Add initial impl. of KAutoObject.bunnei2021-05-061-1/+1
| | | |
| * | | fixup! hle: kernel: Add initial impl. of slab setup.bunnei2021-05-061-8/+8
| | | |
| * | | common: Rename NON_COPYABLE/NON_MOVABLE with YUZU_ prefix.bunnei2021-05-064-9/+9
| | | |
| * | | fixup! hle: kernel: Rename Process to KProcess.bunnei2021-05-061-1/+1
| | | |
| * | | fixup! hle: kernel: Migrate to KHandleTable.bunnei2021-05-061-1/+1
| | | |
| * | | fixup! hle: kernel: Improve MapSharedMemory and implement UnmapSharedMemory.bunnei2021-05-061-3/+3
| | | |
| * | | hle: kernel: svc: ConnectToNamedPort: Use KHandleTable::Reserve.bunnei2021-05-061-3/+8
| | | |
| * | | hle: kernel: Migrate to KHandleTable.bunnei2021-05-0620-377/+498
| | | |
| * | | hle: kernel: KClassToken: Ensure class tokens are correct.bunnei2021-05-061-1/+127
| | | |
| * | | hle: kernel: Improve MapSharedMemory and implement UnmapSharedMemory.bunnei2021-05-0610-95/+210
| | | |
| * | | hle: kernel: Rename Process to KProcess.bunnei2021-05-0676-240/+242
| | | |
| * | | hle: kernel: Remove deprecated Object class.bunnei2021-05-0637-407/+15
| | | |
| * | | hle: kernel: Do not shutdown twice on emulator close.bunnei2021-05-061-3/+1
| | | |
| * | | hle: kernel: Cleanup shutdown of persistent kernel objects.bunnei2021-05-061-14/+12
| | | |
| * | | hle: kernel: Migrate KPort, KClientPort, and KServerPort to KAutoObject.bunnei2021-05-0622-166/+444
| | | |
| * | | hle: kernel: Migrate KServerPort to KAutoObject.bunnei2021-05-068-52/+67
| | | |
| * | | hle: kernel: Migrate KClientPort to KAutoObject.bunnei2021-05-0618-63/+92
| | | |
| * | | hle: kernel: HandleTable: Remove deprecated APIs.bunnei2021-05-065-106/+23
| | | |
| * | | hle: kernel: Migrate KResourceLimit to KAutoObject.bunnei2021-05-0613-122/+197
| | | |
| * | | hle: kernel: svc: Migrate WaitSynchronization.bunnei2021-05-062-47/+78
| | | |
| * | | hle: kernel: svc: Use new handle table API for Process.bunnei2021-05-062-16/+17
| | | |
| * | | hle: kernel: Migrate KTransferMemory to KAutoObject.bunnei2021-05-0612-68/+209
| | | |
| * | | hle: kernel: Migrate KSession, KClientSession, and KServerSession to KAutoObject.bunnei2021-05-0631-356/+412
| | | |
| * | | hle: kernel: svc: Migrate GetThreadContext, GetThreadCoreMask.bunnei2021-05-061-2/+59
| | | |
| * | | hle: kernel: svc: Migrate GetProcessId, CancelSynchronization, SetThreadActivity.bunnei2021-05-061-13/+67
| | | |
| * | | hle: kernel: KThread: Remove incorrect resource release.bunnei2021-05-061-2/+1
| | | |
| * | | hle: kernel: svc_results: Update naming..bunnei2021-05-068-42/+43
| | | |
| * | | hle: kernel: KThread: Add missing resource hint release.bunnei2021-05-061-1/+1
| | | |
| * | | hle: kernel: Migrate KReadableEvent and KWritableEvent to KAutoObject.bunnei2021-05-0635-200/+215
| | | |
| * | | hle: ipc_helpers: Add methods for copy/move references.bunnei2021-05-061-2/+24
| | | |
| * | | hle: kernel: Move slab heaps to their own container.bunnei2021-05-062-10/+16
| | | |
| * | | hle: kernel: Refactor several threads/events/sharedmemory to use slab heaps.bunnei2021-05-0611-59/+53
| | | |
| * | | hle: kernel: Move slab heap management to KernelCore.bunnei2021-05-067-64/+106
| | | |
| * | | hle: kernel: Ensure all kernel objects with KAutoObject are properly created.bunnei2021-05-0620-0/+55
| | | |
| * | | hle: kernel: Use unique_ptr for suspend and dummy threads.bunnei2021-05-061-8/+8
| | | |
| * | | hle: kernel: Migrate KEvent to KAutoObject.bunnei2021-05-0637-266/+269
| | | |
| * | | hle: kernel: Migrate KSharedMemory to KAutoObject.bunnei2021-05-0616-114/+128
| | | |
| * | | hle: kernel: Migrate KProcess to KAutoObject.bunnei2021-05-0613-57/+79
| | | |
| * | | hle: kernel: Refactor IPC interfaces to not use std::shared_ptr.bunnei2021-05-0628-59/+65
| | | |
| * | | hle: kernel: Migrate more of KThread to KAutoObject.bunnei2021-05-0617-289/+444
| | | |
| * | | hle: kernel: svc: Migrate GetThreadPriority, StartThread, and ExitThread.bunnei2021-05-061-21/+12
| | | |
| * | | hle: kernel: svc: Migrate CreateThread.bunnei2021-05-061-14/+21
| | | |
| * | | hle: kernel: Migrate idle threads.bunnei2021-05-062-13/+9
| | | |
| * | | hle: kernel: Migrate KThread to KAutoObject.bunnei2021-05-062-109/+91
| | | |
| * | | hle: kernel: Add initial impl. of slab setup.bunnei2021-05-063-0/+227
| | | |
| * | | hle: kernel: Refactor out various KThread std::shared_ptr usage.bunnei2021-05-0610-58/+30
| | | |
| * | | core: Defer CoreTiming initialization.bunnei2021-05-061-1/+1
| | | |
| * | | core: memory: Add a work-around to allocate and access kernel memory regions by vaddr.bunnei2021-05-063-1/+46
| | | |
| * | | hle: kernel: Add initial impl. of KLinkedList.bunnei2021-05-062-0/+234
| | | |
| * | | hle: kernel: Add initial impl. of KSlabAllocated.bunnei2021-05-062-0/+153
| | | |
| * | | hle: kernel: Add initial impl. of KAutoObjectWithListContainer.bunnei2021-05-063-0/+109
| | | |
| * | | hle: kernel: Add initial impl. of KAutoObject.bunnei2021-05-063-0/+306
| | |/ | |/|
* | | Merge pull request #6287 from lioncash/ldr-copybunnei2021-05-071-5/+3
|\ \ \ | |/ / |/| | ldr: Simplify memory copy within LoadNro()
| * | ldr: Simplify memory copy within LoadNro()Lioncash2021-05-071-5/+3
| | | | | | | | | | | | | | | | | | | | | | | | We can use the dedicated memory function for performing copies instead of reading into a temporary buffer and then immediately writing it back out to memory. Eliminates a bit of heap memory churn.
* | | Merge pull request #6279 from ogniK5377/nvhost-profbunnei2021-05-061-3/+14
|\ \ \ | |/ / |/| | nvdrv: /dev/nvhost-prof-gpu for production
| * | Update src/core/hle/service/nvdrv/interface.cppbunnei2021-05-061-1/+1
| | | | | | | | | Co-authored-by: Ameer J <52414509+ameerj@users.noreply.github.com>
| * | nvdrv: /dev/nvhost-prof-gpu for productionChloe Marcec2021-05-031-3/+14
| | | | | | | | | | | | | | | While we're at it, we can fix the is_initialized error code. This fixes the crashes on Shante
* | | service: Remove unused class variablesLioncash2021-05-053-7/+4
| |/ |/| | | | | Prevents some warnings from occurring.
* | service: Resolve cases of member field shadowingLioncash2021-05-0460-117/+119
| | | | | | | | | | Now all that remains is for kernel code to be 'shadow-free' and then -Wshadow can be turned into an error.
* | Merge pull request #6278 from lioncash/misc-shadowbunnei2021-05-0410-25/+27
|\ \ | |/ |/| core: Resolve misc straggler cases of variable shadowing
| * core: Resolve misc cases of variable shadowingLioncash2021-05-0310-25/+27
| | | | | | | | | | | | | | | | | | Resolves shadowing warnings that aren't in a particularly large subsection of core. Brings us closer to turning -Wshadow into an error. All that remains now is for cases in the kernel (left untouched for now since a big change by bunnei is pending), and a few left over in the service code (will be tackled next).
* | hid: Fix touch not initializing properly if disabledgerman772021-05-032-2/+10
|/
* Merge pull request #6269 from lioncash/file-shadowbunnei2021-05-0321-114/+132
|\ | | | | file_sys: Resolve cases of variable shadowing
| * file_sys: Resolve cases of variable shadowingLioncash2021-05-0221-114/+132
| | | | | | | | Brings us closer to enabling -Wshadow as an error in the core code.
* | Merge pull request #6265 from Morph1984/snap-save-fixbunnei2021-05-022-2/+8
|\ \ | |/ |/| service: filesystem: Return proper error codes for CreateFile
| * service: filesystem: Return proper error codes for CreateFileMorph2021-05-012-2/+8
| | | | | | | | | | | | This improves the accuracy of CreateFile by returning the correct error codes on certain conditions (parent directory does not exist, path already exists). This fixes saving and the loading of existing saves in New Pokemon Snap
* | Disable touch if setting is not enabledgerman772021-05-012-2/+2
|/
* Merge pull request #6257 from Morph1984/fix-use-after-free-webappletbunnei2021-04-302-6/+7
|\ | | | | applets/web: Fix a use-after-free when passing in the URL string
| * applets/web: Fix a use-after-free when passing in the URL stringMorph2021-04-282-6/+7
| | | | | | | | | | | | The URL string was being deleted before being used, leading to a use-after-free occurring when it is used afterwards. Fix this by taking the string by const ref to extend its lifetime, ensuring it doesn't get deleted before use.
* | Merge pull request #6226 from german77/sevensixbunnei2021-04-309-15/+212
|\ \ | |/ |/| hid: Implement SevenSixAxis and ConsoleSixAxisSensor
| * address commentsgerman772021-04-272-5/+5
| |
| * hid: Implement SevenSixAxis and ConsoleSixAxisSensorgerman772021-04-249-15/+212
| |
* | loader: Resolve instances of variable shadowingLioncash2021-04-2719-169/+257
| | | | | | | | | | Eliminates variable shadowing cases across all the loaders to bring us closer to enabling variable shadowing as an error in core.
* | service: Eliminate cases of member shadowingLioncash2021-04-2615-76/+81
| | | | | | | | | | Resolves a few localized instances of member variable shadowing. Brings us a little closer to turning shadowing warnings into errors.
* | nvhost_vic: Fix device closureameerj2021-04-252-10/+8
| | | | | | | | | | | | Implements the OnClose method of the nvhost_vic device, and removes the remnants of an older implementation. Also cleans up some of the surrounding code.
* | Merge pull request #6234 from Morph1984/stub-amMat M2021-04-242-1/+10
|\ \ | | | | | | ICommonStateGetter: Stub SetRequestExitToLibraryAppletAtExecuteNextProgramEnabled
| * | ICommonStateGetter: Stub SetRequestExitToLibraryAppletAtExecuteNextProgramEnabledMorph2021-04-242-1/+10
| | | | | | | | | | | | - Used by Pixel Game Maker Series Werewolf Princess Kaguya
* | | Merge pull request #6235 from german77/ectx_awMat M2021-04-244-0/+49
|\ \ \ | | | | | | | | glue: Add ectx:aw service placeholder
| * | | glue: Add ectx:aw placeholdergerman772021-04-244-0/+49
| | |/ | |/|
* | | Merge pull request #6230 from Morph1984/default-resource-sizebunnei2021-04-243-4/+8
|\ \ \ | | | | | | | | program_metadata: Set a default resource size when a NPDM is not present
| * | | program_metadata: Set a default resource size when a NPDM is not presentMorph2021-04-233-4/+8
| | | | | | | | | | | | | | | | Sets a default size of 0x1FE00000 bytes (510 MiB) for the system_resource_size when a NPDM is not present.
* | | | Merge pull request #6227 from lioncash/metabunnei2021-04-241-0/+6
|\ \ \ \ | | | | | | | | | | program_metadata: Explicitly specify copy/move operators/functions
| * | | | program_metadata: Explicitly specify copy/move functionsLioncash2021-04-231-0/+6
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The generation of the copy assignment operators are deprecated on being generated when a user-provided destructor is present. We can explicitly specify that we desire this behavior to keep the class forward compatible with future standards.
* | | | | Merge pull request #6228 from lioncash/semibunnei2021-04-241-6/+7
|\ \ \ \ \ | |_|_|_|/ |/| | | | lm: Resolve -Wextra-semi warning
| * | | | lm: Make use of insert_or_assign() in Log()Lioncash2021-04-231-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | Avoids unnecessary default construction of an entry in cases where no entry exists before overwriting the created entry.
| * | | | lm: Prevent redundant map lookups in Log()Lioncash2021-04-231-4/+5
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | We can perform the lookup and then do the contains check by checking the end iterator. The benefit of this is that if we *do* find an entry, then we aren't hashing into the map again to find it. We can also get rid of an unused std::vector temporary while we're at it.
| * | | | lm: Resolve -Wextra-semi warningLioncash2021-04-231-1/+1
| |/ / / | | | | | | | | | | | | Resolves a trivial warning with clang.
* | | | Merge pull request #6229 from lioncash/unused-varbunnei2021-04-242-6/+0
|\ \ \ \ | | | | | | | | | | acc/lbl: Remove unused variables
| * | | | acc/lbl: Remove unused variablesLioncash2021-04-232-6/+0
| |/ / /
* | | | Merge pull request #6231 from lioncash/aesbunnei2021-04-232-9/+5
|\ \ \ \ | |_|/ / |/| | | aes_util: Make use of std::span
| * | | aes_util: Make use of std::spanLioncash2021-04-232-9/+5
| |/ / | | | | | | | | | | | | Allows us to simplify the interface quite a bit as it will handle contiguous sequences for us.
* | | Merge pull request #6232 from lioncash/alias2bunnei2021-04-232-24/+27
|\ \ \ | |_|/ |/| | emu_window: unsigned -> u32
| * | emu_window: Return pair from ClipToTouchScreen() instead of tupleLioncash2021-04-232-5/+8
| | | | | | | | | | | | | | | This is only a 2-tuple, so it can be converted over to the std::pair class.
| * | emu_window: unsigned -> u32Lioncash2021-04-232-21/+21
| |/ | | | | | | This is more concise and consistent with the rest of the codebase.
* / service: hid: Get transfer memory for InitializeSevenSixAxisSensorMorph2021-04-221-1/+38
|/
* Merge pull request #6214 from Morph1984/time-fix-kirby-clashbunnei2021-04-211-3/+5
|\ | | | | time: Fix GetClockSnapshotFromSystemClockContext
| * time: Write buffer before pushing RESULT_SUCCESS in GetClockSnapshotMorph2021-04-191-1/+2
| |
| * time: Fix GetClockSnapshotFromSystemClockContextMorph2021-04-191-2/+3
| | | | | | | | | | | | This removes an incorrect alignment usage and corrects the positions of the popped parameters. - Fixes Super Kirby Clash crashing on boot
* | Merge pull request #6217 from Morph1984/consistent-writebuffersbunnei2021-04-203-5/+12
|\ \ | | | | | | general: Write buffers before pushing raw arguments
| * | general: Write buffers before pushing raw argumentsMorph2021-04-193-5/+12
| |/ | | | | | | For consistency with the rest of the service implementations
* | Merge pull request #6215 from lioncash/duplicatebunnei2021-04-202-2/+1
|\ \ | | | | | | npad: Remove duplicated class member variable
| * | npad: Remove duplicated class member variableLioncash2021-04-192-2/+1
| |/ | | | | | | | | | | ControllerBase already has a System reference that can be accessed from this class, so we can get rid of this to make the class layout a little more straightforward.
* | arp: Use type alias for issue functionLioncash2021-04-191-4/+4
| | | | | | | | Reduces some verbosity and centralizes the function details in one spot.
* | arp: Prevent uninitialized read of launch member variableLioncash2021-04-191-1/+1
|/ | | | | | | | | If anything happened to call arp functions in the wrong order and called IRegistrar's Issue function before SetApplicationLaunchProperty, we'd read from an uninitialized ApplicationLaunchProperty instance. Instead, we can always initialize it so if this does happen, then the outcome of doing such a thing is at least consistently reproducible.
* applets: Send focus state change message on applet state changeMorph2021-04-1710-22/+56
| | | | Fixes the softlock after the controller applet exits in Mario Kart 8 Deluxe.
* applets: Make the applet mode a protected property of AppletMorph2021-04-1714-22/+20
|
* Merge pull request #6125 from ogniK5377/nvdec-close-devbunnei2021-04-171-6/+4
|\ | | | | nvdrv: Cleanup CDMA Processor on device closure
| * nvdrv: Cleanup CDMA Processor on device closureChloe Marcec2021-03-301-6/+4
| | | | | | | | Brings us a step closer to unifying all channels to share a common interface.
* | input_interpreter: Fix button hold being interpreted incorrectly on initMorph2021-04-152-1/+17
| | | | | | | | We reset all the button states to 0 except the first index (which has all the buttons as pressed) to prevent a button hold being interpreted as a button that was pressed once on the first poll.
* | applets/swkbd: Implement the Default Software Keyboard frontendMorph2021-04-152-2/+236
| |
* | applets/swkbd: Implement the Normal and Inline Software Keyboard AppletMorph2021-04-154-13/+1488
| |
* | ILibraryAppletCreator: Implement CreateHandleStorageMorph2021-04-152-6/+64
| | | | | | | | Used by Monster Hunter Generations Ultimate
* | hle_ipc: Add helper functions to get copy/move handlesMorph2021-04-152-2/+16
| |
* | ILibraryAppletAccessor: Demote from ERROR to DEBUG for null storage logsMorph2021-04-151-2/+2
| | | | | | | | Avoids unnecessary console spam when the inline software keyboard is used.
* | applets: Pass in the LibraryAppletMode each applet's constructorMorph2021-04-1513-33/+58
| |
* | applets: Remove the previous software keyboard applet implementationMorph2021-04-154-280/+7
| |
* | Merge pull request #6196 from bunnei/asserts-settingbunnei2021-04-1545-461/+53
|\ \ | | | | | | core: settings: Add setting for debug assertions and disable by default.
| * | common: Move settings to common from core.bunnei2021-04-1545-462/+53
| | | | | | | | | | | | - Removes a dependency on core and input_common from common.
| * | core: settings: Add setting for debug assertions and disable by default.bunnei2021-04-151-0/+1
| | | | | | | | | | | | | | | | | | - This is a developer-only setting and no longer needs to be enabled by default. - Also adds "use_auto_stub" setting to SDL frontend while we are here. - Supersedes #1340.
* | | k_resource_limit: Minor cleanup of member variables/headersameerj2021-04-144-21/+13
| | |
* | | Merge pull request #6185 from ameerj/process-reslimitbunnei2021-04-142-38/+27
|\ \ \ | |/ / |/| | kernel/process: Replace process resource limit instance with the kernel's resource limit
| * | kernel/process: Replace process resource limit instance with the kernel's resource limitameerj2021-04-122-38/+27
| | | | | | | | | | | | This commit addresses the inaccurate behavior of kernel processes creating their own resource limit, rather than utilizing the kernel's system-wide resource limit instance.
* | | k_thread: Remove [[nodiscard]] attribute from ClearWaitCancelled()Lioncash2021-04-121-1/+1
| | | | | | | | | | | | | | | This function has a void return value, so this attribute doesn't apply to it.
* | | Merge pull request #6135 from Morph1984/borderless-windowed-fullscreenbunnei2021-04-121-0/+1
|\ \ \ | |/ / |/| | configure_graphics: Add Borderless Windowed fullscreen mode
| * | configure_graphics: Add Borderless Windowed fullscreen modeMorph2021-04-061-0/+1
| | | | | | | | | | | | | | | | | | The borderless windowed fullscreen mode solves several issues with the presentation of the overlay dialogs and on-screen keyboard in exclusive fullscreen mode, and also has other benefits such as smoother gameplay, lower latency and a significant reduction in screen tearing. Co-authored-by: Its-Rei <kupfel@gmail.com>
* | | Merge pull request #6170 from Morph1984/more-time-fixesbunnei2021-04-116-21/+38
|\ \ \ | | | | | | | | service: time: Setup the network clock with the local clock context
| * | | service: time: Setup the network clock with the local clock contextMorph2021-04-086-21/+38
| | | | | | | | | | | | | | | | Setting the network time allows some time based events using the network clock to not reset.
* | | | Merge pull request #6167 from Morph1984/time-fixbunnei2021-04-111-3/+8
|\ \ \ \ | | | | | | | | | | service: time: Fix CalculateStandardUserSystemClockDifferenceByUser
| * | | | service: time: Fix CalculateStandardUserSystemClockDifferenceByUserMorph2021-04-081-3/+8
| | | | | | | | | | | | | | | | | | | | CalculateStandardUserSystemClockDifferenceByUser passes in the ClockSnapshots through 2 input buffers and not as raw arguments. Fix this by reading the 2 input buffers instead of popping raw arguments.
* | | | | Merge pull request #6112 from ogniK5377/pctlbunnei2021-04-116-31/+254
|\ \ \ \ \ | | | | | | | | | | | | pctl: Rework how pctl works to be more accurate
| * | | | | Addressed issuesChloe Marcec2021-03-302-21/+22
| | | | | |
| * | | | | pctl: Rework how pctl works to be more accurateChloe Marcec2021-03-266-31/+253
| | | | | | | | | | | | | | | | | | | | | | | | Introduces the usage of compatibilities to allow it the module to be closer to how it works on hardware.
* | | | | | Merge pull request #6172 from degasus/cmake_opusbunnei2021-04-101-1/+1
|\ \ \ \ \ \ | | | | | | | | | | | | | | externals: Search for shared opus installation.
| * | | | | | externals: Search for shared opus installation.Markus Wick2021-04-081-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | We had used conan for opus before, but there was a bug in the AVX detection. However we still had the Findopus.cmake file within the repository, but not used. This patch reenables the Findopus helper and prefer the system wide installation of opus.
* | | | | | | Merge pull request #6099 from bunnei/derive-membunnei2021-04-1024-173/+2095
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | Kernel Rework: Derive memory regions from board layout.
| * | | | | | | hle: kernel: Breakup InitializeMemoryLayout.bunnei2021-03-241-3/+7
| | | | | | | |
| * | | | | | | hle: kernel: k_memory_region_type: Minor code cleanup.bunnei2021-03-241-13/+12
| | | | | | | |
| * | | | | | | hle: kernel: k_memory_region: Minor code cleanup.bunnei2021-03-241-7/+5
| | | | | | | |
| * | | | | | | hle: kernel: k_memory_layout: Use pair instead of tuple.bunnei2021-03-241-2/+4
| | | | | | | |
| * | | | | | | hle: kernel: k_system_control: Remove unnecessary inline.bunnei2021-03-241-4/+4
| | | | | | | |
| * | | | | | | common: common_sizes: Move sizes to the Common namespace.bunnei2021-03-244-45/+46
| | | | | | | |
| * | | | | | | hle: kernel: Merge KMemoryRegionAttr and KMemoryRegionType.bunnei2021-03-212-11/+9
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | - Fixes clang errors with mixed enum arithmetic.
| * | | | | | | hle: kernel: Remove unused variable.bunnei2021-03-211-1/+0
| | | | | | | |
| * | | | | | | hle: kernel: k_memory_region_type: Remove extra ".bunnei2021-03-211-1/+1
| | | | | | | |
| * | | | | | | hle: kernel: k_memory_layout: Move KMemoryRegionAllocator out of global.bunnei2021-03-213-35/+47
| | | | | | | |
| * | | | | | | hle: kernel: k_memory_layout: Derive memory regions based on board layout.bunnei2021-03-216-56/+1033
| | | | | | | |
| * | | | | | | common: common_sizes: Move Invalid to Size_* prefix and add missing values.bunnei2021-03-211-14/+14
| | | | | | | |
| * | | | | | | hle: kernel: k_memory_region: Refactor to simplify code.bunnei2021-03-212-83/+89
| | | | | | | |
| * | | | | | | hle: kernel: board: k_system_control: Extend to include memory region sizes.bunnei2021-03-212-1/+125
| | | | | | | |
| * | | | | | | hle: kernel: board: Add secure_monitor module.bunnei2021-03-212-0/+27
| | | | | | | |
| * | | | | | | common: Move common sizes to their own header for code reuse.bunnei2021-03-211-13/+1
| | | | | | | |
| * | | | | | | hle: kernel: k_address_space_info: Cleanup.bunnei2021-03-211-9/+9
| | | | | | | |
| * | | | | | | hle: kernel: Add k_trace module.bunnei2021-03-212-0/+13
| | | | | | | |
| * | | | | | | hle: kernel: KSystemControl: Update to reflect board-specific behavior.bunnei2021-03-214-10/+41
| | | | | | | |
| * | | | | | | hle: kernel: KMemoryManager: Add CalculateManagementOverheadSize.bunnei2021-03-212-0/+26
| | | | | | | |
| * | | | | | | hle: kernel: KMemoryManager: Add aliases.bunnei2021-03-211-0/+4
| | | | | | | |
| * | | | | | | hle: kernel: Add architecture and board specific memory regions.bunnei2021-03-212-0/+72
| | | | | | | |
| * | | | | | | hle: kernel: KMemoryRegion: Derive region values.bunnei2021-03-211-0/+327
| | | | | | | |
| * | | | | | | hle: kernel: Migrate some code from Common::SpinLock to KSpinLock.bunnei2021-03-215-25/+25
| | | | | | | |
| * | | | | | | hle: kernel: Add initial KMemoryRegionType module.bunnei2021-03-213-18/+41
| | | | | | | |
| * | | | | | | hle: kernel: Move KMemoryRegion to its own module and update.bunnei2021-03-214-31/+322
| | | | | | | |
* | | | | | | | Merge pull request #6171 from german77/servicesbunnei2021-04-1030-97/+137
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | service: Update service function tables and use proper names
| * | | | | | | | wlan: Update to 12.xgerman772021-04-091-0/+7
| | | | | | | | |
| * | | | | | | | usb: Use proper namesgerman772021-04-091-21/+21
| | | | | | | | |
| * | | | | | | | ITimeZoneService: Update to 12.xgerman772021-04-091-0/+1
| | | | | | | | |
| * | | | | | | | spl: Update to 12.xgerman772021-04-091-0/+3
| | | | | | | | |
| * | | | | | | | sfdnsres: Use proper namesgerman772021-04-091-2/+2
| | | | | | | | |
| * | | | | | | | nsd: Update to 12.xgerman772021-04-091-0/+1
| | | | | | | | |
| * | | | | | | | ethc: Update to 12.xgerman772021-04-091-0/+1
| | | | | | | | |
| * | | | | | | | sm: Use proper names, update to 12.xgerman772021-04-091-4/+5
| | | | | | | | |
| * | | | | | | | set_sys: Update to 12.xgerman772021-04-091-0/+6
| | | | | | | | |
| * | | | | | | | pctl_module: Update to 12.xgerman772021-04-091-0/+3
| | | | | | | | |
| * | | | | | | | pcie: Use proper namesgerman772021-04-091-1/+1
| | | | | | | | |
| * | | | | | | | olsc: Update to 12.xgerman772021-04-091-0/+1
| | | | | | | | |
| * | | | | | | | pl_u: Update to 12.xgerman772021-04-091-0/+4
| | | | | | | | |
| * | | | | | | | ldr: Use proper namesgerman772021-04-091-16/+16
| | | | | | | | |
| * | | | | | | | arp: Use proper names, update to 12.xgerman772021-04-092-3/+10
| | | | | | | | |
| * | | | | | | | caps_u: Update to 12.xgerman772021-04-091-0/+1
| | | | | | | | |
| * | | | | | | | caps_a: Update to 12.xgerman772021-04-091-0/+1
| | | | | | | | |
| * | | | | | | | bpc: Use proper namesgerman772021-04-091-2/+2
| | | | | | | | |
| * | | | | | | | bcat_module: Update to 12.xgerman772021-04-091-0/+2
| | | | | | | | |
| * | | | | | | | codecctl: Use proper namesgerman772021-04-091-13/+13
| | | | | | | | |
| * | | | | | | | audren_u: Use proper namesgerman772021-04-092-4/+4
| | | | | | | | |
| * | | | | | | | audren_a: Use proper namesgerman772021-04-091-6/+6
| | | | | | | | |
| * | | | | | | | audrec_u: Use proper names, update to 12.xgerman772021-04-091-3/+4
| | | | | | | | |
| * | | | | | | | audrec_a: Use proper namesgerman772021-04-091-2/+2
| | | | | | | | |
| * | | | | | | | audout_u: Use proper namesgerman772021-04-091-3/+3
| | | | | | | | |
| * | | | | | | | audout_a: Use proper namesgerman772021-04-091-6/+6
| | | | | | | | |
| * | | | | | | | audin_u: Use proper namesgerman772021-04-091-7/+7
| | | | | | | | |
| * | | | | | | | audin_a: Use proper namesgerman772021-04-091-4/+4
| | | | | | | | |
* | | | | | | | | Merge pull request #6156 from lioncash/lock-discardbunnei2021-04-103-9/+12
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | kernel: Mark lock helper classes as [[nodiscard]]
| * | | | | | | | | Amend bizarre clang-format suggestionsLioncash2021-04-073-5/+5
| | | | | | | | | |
| * | | | | | | | | k_scoped_scheduler_lock_and_sleep: Mark class as [[nodiscard]]Lioncash2021-04-071-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Prevents logic bugs from slipping through.
| * | | | | | | | | k_scoped_lock: delete copy and move assignment operatorsLioncash2021-04-071-2/+5
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | If we delete the copy and move constructor, we should also be deleting the copy and move assignment operators (and even if this were intended, it would be pretty odd to not document why it's done this way).
| * | | | | | | | | k_scoped_lock: Mark class as [[nodiscard]]Lioncash2021-04-071-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Prevents logic bugs of the kind described in the previous commit from slipping through.
| * | | | | | | | | k_scheduler: Mark KScopedSchedulerLock as [[nodiscard]]Lioncash2021-04-071-1/+1
| | |_|_|_|_|_|/ / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Prevents logic bugs like: KScopedSchedulerLock{kernel}; instead of: KScopedSchedulerLock lk{kernel}; from slipping through.
* | | | | | | | | Merge pull request #6113 from german77/playhistorybunnei2021-04-101-1/+13
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | Friend: Stub GetPlayHistoryRegistrationKey
| * | | | | | | | | Friend: Stub GetPlayHistoryRegistrationKeygerman772021-03-271-1/+13
| | |_|_|_|/ / / / | |/| | | | | | |
* | | | | | | | | Merge pull request #6158 from german77/hidServiceTablesbunnei2021-04-102-0/+85
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | hid: Update service function tables
| * | | | | | | | | hid: Update service function tablesgerman772021-04-072-0/+85
| | |/ / / / / / / | |/| | | | | | |
* | | | | | | | | Merge pull request #6162 from degasus/no_spin_loopsbunnei2021-04-091-1/+1
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | video_core: Avoid spin loops.
| * | | | | | | | | video_core/gpu_thread: Implement a ShutDown method.Markus Wick2021-04-071-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This was implicitly done by `is_powered_on = false`, however the explicit method allows us to block until the GPU is actually gone. This should fix a race condition while removing the other subsystems while the GPU is still active.
* | | | | | | | | | ns: Update to 12.xMorph2021-04-091-3/+38
| | | | | | | | | |
* | | | | | | | | | aoc_u: Update to 12.xMorph2021-04-091-0/+2
| | | | | | | | | |
* | | | | | | | | | nim: Update to 12.xMorph2021-04-091-44/+55
| | | | | | | | | |
* | | | | | | | | | npns: Update to 12.xMorph2021-04-091-0/+3
| | | | | | | | | |
* | | | | | | | | | bgtc: Update to 12.x and implement OpenTaskServiceMorph2021-04-092-1/+34
| | | | | | | | | |
* | | | | | | | | | vi: Update to 12.xMorph2021-04-091-0/+8
| | | | | | | | | |
* | | | | | | | | | erpt: Update to 12.xMorph2021-04-091-1/+6
| | | | | | | | | |
* | | | | | | | | | btm: Update to 12.xMorph2021-04-091-0/+1
| | | | | | | | | |
* | | | | | | | | | btdrv: Update to 12.xMorph2021-04-091-0/+19
| | | | | | | | | |
* | | | | | | | | | Merge pull request #6168 from Morph1984/stub-SetNpadAnalogStickUseCenterClampbunnei2021-04-094-1/+29
|\ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | service: hid: Stub SetAnalogStickUseCenterClamp
| * | | | | | | | | | service: hid: Stub SetAnalogStickUseCenterClampMorph2021-04-084-1/+29
| | |_|_|_|_|_|_|/ / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | - Used by eBASEBALLパワフルプロ野球2020
* | | | | | | | | | Merge pull request #6155 from ameerj/kernel-12-rescntbunnei2021-04-091-2/+2
|\ \ \ \ \ \ \ \ \ \ | |_|_|_|_|/ / / / / |/| | | | | | | | | kernel: Increase event and session counts
| * | | | | | | | | kernel: Increase event and session countsameerj2021-04-071-2/+2
| | |_|/ / / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | 12.x increased the number of available sessions and event resource counts
* | | | | | | | | Merge pull request #6157 from Morph1984/am-update-12.xbunnei2021-04-091-0/+22
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | service: am: Update service function tables
| * | | | | | | | | ISelfController: Update to 11.xMorph2021-04-071-0/+1
| | | | | | | | | |
| * | | | | | | | | IApplicationFunctions: Update to 11.xMorph2021-04-071-0/+6
| | | | | | | | | |
| * | | | | | | | | IDebugFunctions: Update to 12.xMorph2021-04-071-0/+2
| | | | | | | | | |
| * | | | | | | | | ICommonStateGetter: Update to 12.xMorph2021-04-071-0/+9
| | | | | | | | | |
| * | | | | | | | | IGlobalStateController: Update to 12.xMorph2021-04-071-0/+1
| | | | | | | | | |
| * | | | | | | | | IHomeMenuFunctions: Update to 12.xMorph2021-04-071-0/+3
| |/ / / / / / / /
* | | | | | | | | Merge pull request #6062 from ameerj/auto-stubbunnei2021-04-092-0/+7
|\ \ \ \ \ \ \ \ \ | |_|_|_|_|_|/ / / |/| | | | | | | | service: Add a toggle for auto stub fallback
| * | | | | | | | configuration: Add auto stub toggle that resets on bootameerj2021-03-302-4/+7
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Auto-stub is an experimental debugging feature that may cause unforseen bugs. This adds a toggle to only allow auto-stubbing unimplemented functions when explicitly enabled when yuzu is launched.
| * | | | | | | | service: Auto stub fallbackameerj2021-03-301-0/+4
| | |_|_|_|_|_|/ | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | For simple services we can implement an automatic stub fallback to help with compatibility until a proper implementation is done. Co-Authored-By: Chloe <25727384+ognik5377@users.noreply.github.com>
* | | | | | | | Merge pull request #6145 from lat9nq/nvhost_empty_memcpybunnei2021-04-081-6/+11
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | nvhost_nvdec_common: Avoid memcpy with null pointers
| * | | | | | | | nvhost_nvdec_common: Avoid memcpy with null pointerslat9nq2021-04-051-6/+11
| | |/ / / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Avoid sending null pointer to memcpy as reported by Undefined Behavious Sanitizer. Co-authored-by: LC <mathew1800@gmail.com>
* | | | | | | | Merge pull request #6154 from lioncash/svcrange2bunnei2021-04-081-0/+132
|\ \ \ \ \ \ \ \ | |_|_|/ / / / / |/| | | | | | | svc: Expand SVC tables
| * | | | | | | svc: Expand SVC tablesLioncash2021-04-071-0/+132
| |/ / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | 12.x expanded the range of SVC entries from 0x7F to 0xBF (with all new entries being unused), so we can expand it to also match.
* | | | | | | Merge pull request #6160 from Morph1984/fs-update-12.xbunnei2021-04-082-6/+15
|\ \ \ \ \ \ \ | |_|_|_|_|_|/ |/| | | | | | service: fs: Update service function tables
| * | | | | | IFile: Update to 12.xMorph2021-04-071-3/+7
| | | | | | |
| * | | | | | fsp-srv: Update to 12.xMorph2021-04-072-3/+8
| |/ / / / /
* | | | | | Merge pull request #6143 from lat9nq/nvhost_null_memcpybunnei2021-04-081-1/+7
|\ \ \ \ \ \ | | | | | | | | | | | | | | nvhost_ctrl_gpu: Avoid sending null pointer to memcpy
| * | | | | | nvhost_ctrl_gpu: Avoid sending null pointer to memcpylat9nq2021-04-051-1/+7
| |/ / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Undefined Behaviour Sanitizer reports a null pointer is being sent to memcpy, thought it's "guaranteed to never be null". Guard it with an if statement, and log when the action has been averted.
* | | | | | Merge pull request #6159 from Morph1984/acc-update-12.xbunnei2021-04-073-36/+45
|\ \ \ \ \ \ | |_|_|/ / / |/| | | | | service: acc: Update service function tables
| * | | | | dauth_o: Update to 11.xMorph2021-04-071-6/+11
| | | | | |
| * | | | | acc_u1: Update to 12.xMorph2021-04-071-13/+15
| | | | | |
| * | | | | acc_su: Update to 12.xMorph2021-04-071-17/+19
| |/ / / /
* | | | | Merge pull request #6153 from lioncash/svcrangebunnei2021-04-072-6/+1
|\ \ \ \ \ | | | | | | | | | | | | process_capability: Handle extended SVC range
| * | | | | process_capability: Handle extended SVC rangeLioncash2021-04-072-6/+1
| |/ / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | 12.x extended the range of SVC IDs, so we need to expand the range of bits that need to be tested. The upside of this is that we can eliminate a range check, given the whole range is used.
* / / / / hwopus: Update to 12.xMorph2021-04-071-0/+4
|/ / / /
* | | | Merge pull request #6132 from MerryMage/code_sizebunnei2021-04-032-0/+8
|\ \ \ \ | | | | | | | | | | arm_dynarmic: Increase size of code cache
| * | | | arm_dynarmic: Increase size of code cacheMerryMage2021-04-022-0/+8
| | | | |
* | | | | Merge pull request #6131 from german77/rightjoyconSLSRMorph2021-04-021-2/+6
|\ \ \ \ \ | |/ / / / |/| | | | HID: Fix SL and SR buttons for right joycon
| * | | | HID: Fix SL and SR buttons for right joycongerman772021-04-021-2/+6
| | |/ / | |/| |
* | | | Merge pull request #6106 from MerryMage/nullptr-jitbunnei2021-04-014-53/+26
|\ \ \ \ | | | | | | | | | | [test] arm_dynarmic: Always have a 'valid' jit instance
| * | | | arm_dynarmic: Always have a 'valid' jit instanceMerryMage2021-03-244-53/+26
| | | | |
* | | | | ISelfController: Stub SetAlbumImageTakenNotificationEnabledMorph2021-03-302-1/+17
| |_|/ / |/| | | | | | | | | | | | | | | This service call sets an internal flag whether a notification is shown when an image is captured. Currently we do not support capturing images via the capture button, so this can be stubbed for now.
* | | | Merge pull request #6109 from german77/gestureIDbunnei2021-03-302-3/+13
|\ \ \ \ | | | | | | | | | | HID: Initialize correctly the gesture finger_id and filter invalid inputs
| * | | | HID: Initialize correctly the gesture finger_id and filter invalid resultsNarr the Reg2021-03-262-3/+13
| | |/ / | |/| |
* | | | Merge pull request #6102 from ogniK5377/fd-passbunnei2021-03-2920-78/+161
|\ \ \ \ | | | | | | | | | | nvdrv: Pass device fd and handle device create methods for device opening and closing
| * | | | nvdrv: Pass device fd and handle device create methods for device opening and closingChloe Marcec2021-03-2520-78/+161
| |/ / / | | | | | | | | | | | | We pass the fd to the ioctl as well as alert the device when it's opened or closed to allow for fd unique actions to take place
* | | | Merge pull request #6115 from bunnei/fix-kernel-initbunnei2021-03-281-1/+1
|\ \ \ \ | | | | | | | | | | hle: kernel: Initialize preemption task after schedulers.
| * | | | hle: kernel: Initialize preemption task after schedulers.bunnei2021-03-271-1/+1
| |/ / / | | | | | | | | | | | | - Fixes a startup crash that occurs if CoreTiming tries to preempt before kernel initialization completes.
* / / / service: friend: Change logging class from ACC to FriendMorph2021-03-271-11/+12
|/ / /
* | | Merge pull request #6101 from ogniK5377/alloc-as-exbunnei2021-03-252-27/+49
|\ \ \ | |/ / |/| | nvdrv: Change InitializeEx to AllocAsEx
| * | nvdrv: Change InitializeEx to AllocAsExChloe Marcec2021-03-222-27/+49
| |/ | | | | | | Wee also report the correct "big page size" now in GetVARegions & fix up the struct for IoctlAllocAsEx
* / core: arm_dynarmic: Ensure JIT state is saved/restored on page table changes.bunnei2021-03-212-0/+10
|/ | | | - We re-create the JIT here without preserving any state.
* Merge pull request #6052 from Morph1984/vi-getindirectlayerimagemapbunnei2021-03-201-1/+27
|\ | | | | IApplicationDisplayService: Stub GetIndirectLayerImageMap
| * IApplicationDisplayService: Stub GetIndirectLayerImageMapMorph2021-03-171-1/+27
| | | | | | | | Used by games invoking the inline software keyboard such as GNOSIA
* | Merge pull request #6056 from zkitX/spl-updatesbunnei2021-03-183-9/+178
|\ \ | |/ |/| service: Refactor spl
| * Fix casing on DeallocateAesKeySlotzkitx2021-03-111-3/+3
| |
| * Update SPL to fit N's service refactor (4.0.0+) which split into new services.zkitx2021-03-113-9/+178
| |
* | Merge pull request #6070 from Morph1984/sysver-11.0.1bunnei2021-03-171-5/+5
|\ \ | | | | | | system_version: Update to 11.0.1
| * | system_version: Update to 11.0.1Morph2021-03-141-5/+5
| | |
* | | bsd: Avoid writing empty buffersMorph2021-03-161-2/+6
| | | | | | | | | | | | Silences log spam on empty buffer writes
* | | Merge pull request #6069 from Morph1984/ngWordbunnei2021-03-151-2/+2
|\ \ \ | |/ / |/| | system_archive: Update NgWord archive version
| * | system_archive: Update NgWord archive versionMorph2021-03-141-2/+2
| | |
* | | Merge pull request #6054 from Morph1984/time-GetClockSnapshotbunnei2021-03-141-0/+2
|\ \ \ | |/ / |/| | time: Assign the current time point to the ClockSnapshot
| * | time: Assign the current time point to the ClockSnapshotMorph2021-03-101-0/+2
| |/ | | | | | | Fixes the timer in Super Smash Bros Ultimate's Spirit Board.
* / time: Fix CalculateSpanBetween implementationMorph2021-03-101-3/+9
|/ | | | | | CalculateSpanBetween passes in the ClockSnapshots through 2 input buffers and not as raw arguments. Fix this by reading the 2 input buffers instead of popping raw arguments. Partially fixes Super Smash Bros. Ultimate's Spirit Board
* common: Fiber: use a reference for YieldTo.bunnei2021-03-072-12/+7
| | | | - Fixes another small leak.
* hle: kernel: KThread: Rework dummy threads & fix memory leak.bunnei2021-03-066-36/+65
| | | | | - Dummy threads are created on thread local storage for all host threads. - Fixes a leak by removing creation of fibers, which are not applicable here.
* Revert "core: Switch to unique_ptr for usage of Common::Fiber."bunnei2021-03-067-31/+29
|
* Merge pull request #6034 from Morph1984/mbedtlsbunnei2021-03-061-2/+0
|\ | | | | externals: Update mbedtls to 2.16.9
| * aes_util: Remove malformed mbedtls_cipher_finish function callMorph2021-03-051-2/+0
| |
* | Merge pull request #6006 from bunnei/fiber-unique-ptrbunnei2021-03-057-29/+31
|\ \ | |/ |/| core: Switch to unique_ptr for usage of Common::Fiber.
| * core: Switch to unique_ptr for usage of Common::Fiber.bunnei2021-02-277-29/+31
| | | | | | | | | | - With using unique_ptr instead of shared_ptr, we have more explicit ownership of the context. - Fixes a memory leak due to circular reference of the shared pointer.
* | Merge pull request #5815 from comex/net-error-reformbunnei2021-03-032-95/+84
|\ \ | | | | | | Network error handling reform
| * | [network] Error handling reformcomex2021-02-282-95/+84
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | `network.cpp` has several error paths which either: - report "Unhandled host socket error=n" and return `SUCCESS`, or - switch on a few possible errors, log them, and translate them to Errno; the same switch statement is copied and pasted in multiple places in the code Convert these paths to use a helper function `GetAndLogLastError`, which is roughly the equivalent of one of the switch statements, but: - handling more cases (both ones that were already in `Errno`, and a few more I added), and - using OS functions to convert the error to a string when logging, so it'll describe the error even if it's not one of the ones in the switch statement. - To handle this, refactor the logic in `GetLastErrorMsg` to expose a new function `NativeErrorToString` which takes the error number explicitly as an argument. And improve the Windows version a bit. Also, add a test which exercises two random error paths.
* | | core: Shutdown: Move kernel cleanup to later in shutdown.bunnei2021-03-021-12/+1
|/ / | | | | | | - Fixes a shutdown crash due to a race condition with GPU still accessing memory.
* | Merge pull request #6007 from bunnei/ldn-errorbunnei2021-02-281-1/+1
|\ \ | | | | | | core: hle: ldn: Error out on call to Initialization.
| * | core: hle: ldn: Error out on call to Initialization.bunnei2021-02-271-1/+1
| |/ | | | | | | - Since we do not emulate LDN, returning an error here makes more sense.
* | Merge pull request #5276 from german77/gesturesMorph2021-02-282-11/+240
|\ \ | |/ |/| HID: Implement gestures
| * Implements touch, pan, pinch and rotation gesturesgerman2021-02-282-11/+240
| |
* | Merge pull request #5953 from bunnei/memory-refactor-1bunnei2021-02-2752-1211/+1433
|\ \ | | | | | | Kernel Rework: Memory updates and refactoring (Part 1)
| * | hle: kernel: Migrate PageHeap/PageTable to KPageHeap/KPageTable.bunnei2021-02-1923-146/+130
| | |
| * | hle: kernel: Migrate MemoryManager to KMemoryManager.bunnei2021-02-198-47/+48
| | |
| * | hle: kernel: Migrate PageLinkedList to KPageLinkedList.bunnei2021-02-198-38/+41
| | |
| * | hle: kernel: Migrate to KMemoryBlock, KMemoryBlockManager, and others.bunnei2021-02-1918-476/+479
| | |
| * | hle: kernel: Migrate SlabHeap to KSlabHeap.bunnei2021-02-194-22/+21
| | |
| * | hle: kernel: Migrate MemoryLayout to KMemoryLayout.bunnei2021-02-195-31/+30
| | |
| * | hle: kernel: Migrate AddressSpaceInfo to KAddressSpaceInfo.bunnei2021-02-194-59/+54
| | |
| * | hle: kernel: memory_manager: Rename AllocateContinuous to AllocateContinuous.bunnei2021-02-192-4/+28
| | |
| * | hle: kernel: KSystemControl does not belong in Memory namespace.bunnei2021-02-197-31/+38
| | |
| * | hle: kernel: memory: PageHeap: Migrate to KPageBitmap class.bunnei2021-02-194-197/+23
| | |
| * | hle: kernel: Add KPageBitmap class.bunnei2021-02-192-0/+280
| | |
| * | hle: kernel: system_control: Add function GenerateRandomU64.bunnei2021-02-192-3/+5
| | |
| * | hle: kernel: Add KSpinLock implementation.bunnei2021-02-193-0/+89
| | |
| * | core: memory: Add templated GetPointer methods.bunnei2021-02-191-0/+10
| | |
| * | hle: kernel: Rename SharedMemory to KSharedMemory.bunnei2021-02-1913-54/+54
| | |
* | | Merge pull request #5944 from Morph1984/gc-vibrationsbunnei2021-02-272-3/+130
|\ \ \ | | | | | | | | hid: Implement GameCube Controller Vibrations
| * | | hid: Implement GameCube Controller VibrationsMorph2021-02-212-3/+130
| | | | | | | | | | | | | | | | Implements both SendVibrationGcErmCommand and GetActualVibrationGcErmCommand, and modifies GetVibrationDeviceInfo to account for additional controllers.
* | | | acc: Stub GetNintendoAccountUserResourceCacheForApplicationMorph2021-02-211-1/+17
|/ / / | | | | | | | | | | | | | | | | | | | | | | | | | | | This command returns a Nintendo Account ID and writes 2 output buffers. The first output buffer is a NasUserBaseForApplication and the second output buffer is currently empty. Used by: - Pokken Tournament DX - Super Smash Bros. Ultimate - Super Nintendo Entertainment System - Nintendo Switch Online - Mario Kart 8 Deluxe
* / / kernel: Fix resource release exception on exitameerj2021-02-214-2/+16
|/ / | | | | | | | | After rewriting the resource limit, objects releasing reserved resources require a live kernel instance. This commit fixes exceptions that occur due to the kernel being destroyed before some objects released their resources, allowing for a graceful exit.
* | Merge pull request #4973 from ameerj/nvdec-optbunnei2021-02-192-3/+7
|\ \ | | | | | | nvdec: Reuse allocated buffers and general cleanup
| * | Address PR feedbackameerj2021-02-132-4/+2
| | | | | | | | | | | | Co-Authored-By: LC <712067+lioncash@users.noreply.github.com>
| * | nvdec cleanupameerj2021-02-131-1/+7
| | |
* | | core: core_timing_util: Optimize core timing math.bunnei2021-02-153-98/+48
| | | | | | | | | | | | - Avoids a lot of unnecessary 128-bit math for imperceptible accuracy.
* | | Merge pull request #5939 from Morph1984/web_typesLC2021-02-151-0/+1
|\ \ \ | | | | | | | | core/CMakeLists: Add web_types.h
| * | | core/CMakeLists: Add web_types.hMorph2021-02-151-0/+1
| | | |
* | | | Merge pull request #4940 from german77/nativeGCbunnei2021-02-153-1/+89
|\ \ \ \ | |/ / / |/| | | HID: Implement GC controller in game
| * | | hid: Implement GC controllergerman2021-02-083-1/+89
| | |/ | |/|
* | | hle: service: ldn: IUserLocalCommunicationService: Improve the stub.bunnei2021-02-141-5/+29
| | |
* | | hle: service: ldn: IUserLocalCommunicationService: Indicate that LDN is disabled.bunnei2021-02-143-3/+19
| | | | | | | | | | | | - Fixes crash on Pokemon Sword/Shield when pressing 'Y'.
* | | hle: service: am: IStorageAccessor: Fix out of bounds error handling.bunnei2021-02-141-6/+7
| |/ |/|
* | kernel: More accurately reserve and release resourcesameerj2021-02-136-14/+42
| |
* | kernel: KScopedReservation implementationameerj2021-02-136-26/+152
| | | | | | | | This implements KScopedReservation, allowing resource limit reservations to be more HW accurate, and release upon failure without requiring too many conditionals.
* | kernel: Unify result codes (#5890)Chloe2021-02-1321-256/+223
| | | | | | | | | | | | | | | | | | * kernel: Unify result codes Drop the usage of ERR_NAME convention in kernel for ResultName. Removed seperation between svc_results.h & errors.h as we mainly include both most of the time anyways. * oops * rename errors to svc_results
* | Merge pull request #5902 from lioncash/core-warnbunnei2021-02-123-4/+7
|\ \ | | | | | | core: Silence various warnings on Clang 12
| * | bsd: Remove usage of optional emplace() with no argumentsLioncash2021-02-091-2/+4
| | | | | | | | | | | | Clang 12 currently falls over in the face of this.
| * | am/controller: Remove [[fallthrough]] from unreachable pathLioncash2021-02-091-1/+2
| | | | | | | | | | | | | | | Prevents warnings on clang 12. This path is reachable on other variations of the build that disable the unreachable macro.
| * | nfp: Correct uninitialized size being used within GetTagInfo()Lioncash2021-02-091-1/+1
| |/ | | | | | | | | We were previously the name of the object being initialized within its own initializer, which results in uninitialized data being read.
* | Merge pull request #5869 from german77/mousePanningbunnei2021-02-111-2/+3
|\ \ | | | | | | input_common: Add mouse panning
| * | Add mouse panninggerman2021-02-081-2/+3
| | |
* | | software_keyboard: Implement Finalize request commandMorph2021-02-111-0/+4
| | |
* | | core: Add -fsized-dealloction as a Clang flaglat9nq2021-02-101-0/+2
| | | | | | | | | | | | Prevents a operator delete error when compiling with Clang 11.
* | | Merge pull request #5892 from german77/backupbunnei2021-02-091-1/+12
|\ \ \ | | | | | | | | olsc: Stub GetSaveDataBackupSetting
| * | | olsc: Stub GetSaveDataBackupSettinggerman2021-02-081-1/+12
| | | |
* | | | Merge pull request #5868 from german77/HandheldFixbunnei2021-02-081-0/+1
|\ \ \ \ | |_|_|/ |/| | | Prevent over scheduling audio events and add motion update unschedule event
| * | | Prevent over scheduling audio events and terminate properly the motion update eventgerman2021-02-021-0/+1
| | | |
* | | | Merge pull request #5339 from german77/interactivebunnei2021-02-081-0/+11
|\ \ \ \ | |_|/ / |/| | | Settings: Make settings controller image change with controller input
| * | | Make settings controller image change with controller inputgerman2021-02-061-0/+11
| | | |
* | | | Merge pull request #5872 from lioncash/svc-errorChloe2021-02-081-59/+188
|\ \ \ \ | | | | | | | | | | svc: Provide more detailed error logs for svc functions
| * | | | svc: Provide more detailed error logs for svc functionsLioncash2021-02-061-59/+188
| | | | | | | | | | | | | | | | | | | | | | | | | Allows SVC calls to have much more informative information during error cases. This also doesn't hide control flow returns from the reader.
* | | | | Merge pull request #5887 from ogniK5377/lm-fixbunnei2021-02-071-7/+9
|\ \ \ \ \ | | | | | | | | | | | | lm: Fix ReadLeb128
| * | | | | lm: Fix ReadLeb128Chloe Marcec2021-02-071-7/+9
| | |_|_|/ | |/| | | | | | | | | | | | | | | | | | | | | | | Fixes assertion on Bloodstained Ritual of the Night. We would over read sometimes, this is fixed by checking if the top bit is set in the first iteration. We also lock the loop off to be only the max size of the type we can fit. Finally we changed an incorrect print of "DEBUG" to "TRACE" to reflect the proper log severity
* | | | | Merge pull request #5878 from aleasto/masterMorph2021-02-071-2/+7
|\ \ \ \ \ | |/ / / / |/| | | | pl_u: Fix read out of bounds
| * | | | pl_u: Fix read out of boundsAlessandro Astone2021-02-061-2/+7
| | | | |
* | | | | Merge pull request #5871 from lioncash/address-arbbunnei2021-02-061-54/+30
|\ \ \ \ \ | |_|_|/ / |/| | | | k_address_arbiter: Minor cleanup
| * | | | k_address_arbiter: Unfold R_UNLESS macrosLioncash2021-02-061-5/+8
| | | | | | | | | | | | | | | | | | | | | | | | | Allows for more descriptive error messages and also doesn't hide control-path exit returns from the reader.
| * | | | k_address_arbiter: Remove unnecessary usages of std::addressofLioncash2021-02-061-10/+10
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This is a useful function in a generic context or with types that overload unary operator&. However, primitives and pointers will never do this, so we can opt for a more straightforward syntax.
| * | | | k_address_arbiter: Remove dead codeLioncash2021-02-061-40/+13
| | |/ / | |/| | | | | | | | | | | | | | This code is never used, so we can remove it. It's in version control, so it can always be brought back when needed.
* | | | Merge pull request #5326 from german77/hidUpdate1bunnei2021-02-0610-168/+406
|\ \ \ \ | |/ / / |/| | | HID: Update the HID service to match more closely to switchbrew part 1
| * | | Add footer types and address commentsgerman2021-02-047-58/+106
| | | |
| * | | Fix npad struct to match switchbrewgerman2021-02-043-105/+134
| | | |
| * | | Adds missing controller types and propertiesgerman2021-02-049-30/+191
| | | |
* | | | Merge pull request #5862 from bunnei/keventbunnei2021-02-0660-563/+726
|\ \ \ \ | | | | | | | | | | Kernel Rework: Refactor KEvent/KReadableEvent/KWritableEvent
| * | | | hle: kernel: Drop R_UNLESS_NOLOG in favor of expanded if-statement.bunnei2021-02-052-3/+11
| | | | |
| * | | | hle: kernel: KAddressArbiter: Remove noisy error log.bunnei2021-02-051-1/+1
| | | | |
| * | | | hle: kernel: svc: Cleanup KEvent/KReadableEvent/KWritableEvent SVCs.bunnei2021-02-055-69/+89
| | | | |
| * | | | hle: kernel: Reimplement KReadableEvent and KWritableEvent.bunnei2021-02-0538-298/+341
| | | | |
| * | | | hle: kernel: Implement KEvent.bunnei2021-02-053-0/+91
| | | | |
| * | | | hle: kernel: KAddressArbiter: Use R_UNLESS_NOLOG where applicable.bunnei2021-02-051-1/+1
| | | | |
| * | | | hle: kernel: Rename WritableEvent to KWritableEvent.bunnei2021-02-0544-101/+101
| | | | |
| * | | | hle: kernel: Rename ReadableEvent to KReadableEvent.bunnei2021-02-0540-76/+77
| | | | |
* | | | | Merge pull request #5875 from lioncash/identifierbunnei2021-02-061-9/+9
|\ \ \ \ \ | |/ / / / |/| | | | k_priority_queue: Minor cleanup
| * | | | k_priority_queue: Unfold several declval usagesLioncash2021-02-041-5/+5
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Given these are only used as function existence checks, we can simplify some usages of declval, given they aren't particularly useful here. Reduces a few template instantiations, which at most reduces compile times a tiny bit.
| * | | | k_priority_queue: Simplify affinity mask type aliasLioncash2021-02-041-2/+2
| | | | | | | | | | | | | | | | | | | | | | | | | We can make use of the _t variants of the templates to cut down on a little bit of verbosity.
| * | | | k_priority_queue: Resolved reserved identifierLioncash2021-02-041-2/+2
| |/ / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | An identifier containing a starting underscore followed by a capital letter is reserved by the standard. It's trivial to avoid this by moving the underscore to the end of the identifier. While the likelihood of clashing here being minimal, we can turn a "should not break" scenario into a definitive "will not break" one, so why not?.
* | | | Merge pull request #5867 from Morph1984/am-GetHealthWarningDisappearedSystemEventbunnei2021-02-052-1/+14
|\ \ \ \ | |_|/ / |/| | | IApplicationFunctions: Implement GetHealthWarningDisappearedSystemEvent
| * | | IApplicationFunctions: Implement GetHealthWarningDisappearedSystemEventMorph2021-02-022-1/+14
| | | |
* | | | Merge pull request #5876 from lioncash/truncationbunnei2021-02-041-1/+1
|\ \ \ \ | | | | | | | | | | k_affinity_mask: Avoid implicit truncation to bool
| * | | | k_affinity_mask: Avoid implicit truncation to boolLioncash2021-02-041-1/+1
| | |/ / | |/| | | | | | | | | | | | | | This can cause compiler warnings. Instead, we can explicitly add a boolean expression around it to naturally turn the result into a bool.
* / | | key_manager: Create the keys directory if it does not existMorph2021-02-041-0/+5
|/ / /
* | | Merge pull request #5848 from ogniK5377/k-resourcelimitbunnei2021-02-0313-230/+343
|\ \ \ | | | | | | | | kernel: Rewrite resource limit to be more accurate
| * | | Simplify limitableresource namesChloe Marcec2021-02-036-36/+29
| | | |
| * | | Compile errorChloe Marcec2021-02-021-1/+1
| | | |
| * | | Address issuesChloe Marcec2021-02-023-19/+15
| | | |
| * | | fix compile errorChloe Marcec2021-01-301-1/+1
| | | |
| * | | cleanup commentingChloe Marcec2021-01-301-2/+2
| | | |
| * | | Drop m_ from lockChloe Marcec2021-01-302-9/+9
| | | |
| * | | Move to GetGlobalTimeNs, fix GetTotalPhysicalMemoryAvailableChloe Marcec2021-01-303-9/+7
| | | |
| * | | kernel: Rewrite resource limit to be more accurateChloe Marcec2021-01-3013-231/+357
| | | | | | | | | | | | | | | | Matches closer to hardware
* | | | Merge pull request #5842 from german77/userfixbunnei2021-02-031-2/+8
|\ \ \ \ | | | | | | | | | | acc: Fix error when second user is selected
| * | | | Fix user changing to 0 if validgerman2021-01-291-2/+8
| | | | |
* | | | | settings: Log the cache, config, and mod load directoriesMorph2021-02-021-0/+3
| |_|/ / |/| | |
* | | | Merge pull request #5861 from german77/HandheldFixbunnei2021-02-021-2/+11
|\ \ \ \ | | |_|/ | |/| | hid: Only update motion for npad and prevent over scheduling events
| * | | Only update motion for npad and prevent over scheduling eventsgerman2021-02-011-2/+11
| | | |
* | | | arm_dynarmic_32: Print out CPSR.T on exceptionMerryMage2021-02-012-2/+7
| | | |
* | | | Merge pull request #5859 from Morph1984/nifmbunnei2021-02-011-2/+157
|\ \ \ \ | | | | | | | | | | nifm: Stub GetCurrentNetworkProfile and GetCurrentIpConfigInfo
| * | | | nifm: Stub GetCurrentIpConfigInfoMorph2021-01-311-1/+29
| | | | | | | | | | | | | | | | | | | | - Used by Lets Sing 12
| * | | | nifm: Stub GetCurrentNetworkProfileMorph2021-01-311-1/+41
| | | | | | | | | | | | | | | | | | | | | | | | | - Used by Minecraft Bedrock Edition - Used by Bloons TD 5
| * | | | nifm: Add several structsMorph2021-01-311-0/+87
| | | | |
* | | | | Merge pull request #5856 from Morph1984/nifm-fix-getappletinfo-stubAmeer J2021-02-011-1/+5
|\ \ \ \ \ | | | | | | | | | | | | nifm: Fix GetAppletInfo stub
| * | | | | nifm: Fix GetAppletInfo stubMorph2021-01-311-1/+5
| | | | | |
* | | | | | Merge pull request #5858 from Morph1984/IsGamePlayRecordingSupported-stubbunnei2021-02-012-1/+12
|\ \ \ \ \ \ | | | | | | | | | | | | | | am/IApplicationFunctions: Stub IsGamePlayRecordingSupported
| * | | | | | am/IApplicationFunctions: Stub IsGamePlayRecordingSupportedMorph2021-01-312-1/+12
| | | | | | | | | | | | | | | | | | | | | | | | | | | | Used by RetroArch
* | | | | | | prepo: Stub GetTransmissionStatusMorph2021-01-311-1/+11
| | | | | | |
* | | | | | | prepo: Stub RequestImmediateTransmissionMorph2021-01-311-1/+8
| |_|/ / / / |/| | | | | | | | | | | | | | | | | - Used by Animal Crossing: New Horizons
* | | | | | bsd: Fix EventFd stubMorph2021-01-311-3/+3
|/ / / / /
* | | | | Merge pull request #5855 from Morph1984/bsd-fix-getsockopt-stubbunnei2021-01-311-1/+5
|\ \ \ \ \ | |/ / / / |/| | | | bsd: Fix GetSockOpt stub
| * | | | bsd: Fix GetSockOpt stubMorph2021-01-311-1/+5
| | | | |
* | | | | Merge pull request #5851 from ameerj/pop-inv-stubMorph2021-01-312-1/+10
|\ \ \ \ \ | |/ / / / |/| | | | am: Stub TryPopFromFriendInvitationStorageChannel
| * | | | am: Stub TryPopFromFriendInvitationStorageChannelameerj2021-01-312-1/+10
| | |_|/ | |/| | | | | | | | | | Used by Family Feud
* / | | bsd: Stub EventFdameerj2021-01-312-1/+12
|/ / / | | | | | | | | | Used by Family Feud
* | | Merge pull request #5779 from bunnei/kthread-rewritebunnei2021-01-3064-1909/+2933
|\ \ \ | | | | | | | | Rewrite KThread to be more accurate
| * | | hle: kernel: KLightLock: Fix several bugs.bunnei2021-01-291-3/+3
| | | |
| * | | arm: dynarmic: Reintroduce JIT checks on SaveContext/LoadContext.bunnei2021-01-292-0/+12
| | | |
| * | | hle: kernel: KThread: Release thread resource on thread exit.bunnei2021-01-291-0/+1
| | | |
| * | | yuzu: debugger: Ignore HLE threads.bunnei2021-01-292-7/+13
| | | |
| * | | hle: kernel: process: Add state lock.bunnei2021-01-293-6/+15
| | | |
| * | | hle: kernel: threading: Fix bug with host thread naming.bunnei2021-01-291-3/+2
| | | |
| * | | hle: kernel: k_scheduler_lock: Cleanup.bunnei2021-01-291-3/+3
| | | |
| * | | core: arm: Remove unnecessary JIT checks.bunnei2021-01-292-24/+0
| | | |
| * | | hle: kernel: Allocate a dummy KThread for each host thread, and use it for scheduling.bunnei2021-01-297-41/+45
| | | |
| * | | hle: kernel: k_scheduler: Use atomics for current_thread, etc.bunnei2021-01-292-26/+28
| | | |
| * | | hle: kernel: k_scheduler: Fix for single core mode.bunnei2021-01-291-1/+2
| | | |
| * | | kernel: Fix build errors.bunnei2021-01-292-4/+9
| | | |
| * | | core: cpu_manager: Remove unused variable.bunnei2021-01-291-1/+0
| | | |
| * | | hle: kernel: KScheduler: Introduce thread context_guard.bunnei2021-01-292-3/+16
| | | |
| * | | hle: kernel: Recode implementation of KThread to be more accurate.bunnei2021-01-2913-769/+1554
| | | |
| * | | kernel: svc_types: Add ThreadActivity.bunnei2021-01-291-0/+5
| | | |
| * | | kernel: KSchedulerPriorityQueue: Lowest priority should be LowestThreadPriority.bunnei2021-01-291-1/+1
| | | |
| * | | kernel: k_light_lock: Simplify EmuThreadHandle implementation.bunnei2021-01-295-51/+33
| | | |
| * | | hle: kernel: TimeManager: Simplify to not rely on previous EmuThreadHandle implementation.bunnei2021-01-296-69/+25
| | | |
| * | | core: hle: kernel: object: Implement Finalize() virtual method.bunnei2021-01-2915-6/+29
| | | |
| * | | core: hle: kernel: svc_results: Populate with several missing error codes.bunnei2021-01-291-0/+3
| | | |
| * | | core: hle: kernel: Implement KLightLock.bunnei2021-01-293-0/+173
| | | |
| * | | core: hle: kernel: Implement KThreadQueue.bunnei2021-01-292-0/+82
| | | |
| * | | hle: kernel: KThread: Clean up thread priorities.bunnei2021-01-299-75/+41
| | | |
| * | | hle: kernel: KThread: Reorganize thread priority defaults.bunnei2021-01-299-31/+31
| | | |
| * | | hle: kernel: KThread: Fix ThreadType definition.bunnei2021-01-295-11/+12
| | | |
| * | | hle: kernel: Move single core "phantom mode" out of KThread.bunnei2021-01-294-16/+31
| | | | | | | | | | | | | | | | - This is a workaround that does not belong in a kernel primitive.
| * | | hle: kernel: KThread: Remove thread types that do not exist.bunnei2021-01-295-45/+28
| | | |
| * | | arm: arm_dynarmic: Skip calls when JIT is invalid.bunnei2021-01-292-0/+24
| | | | | | | | | | | | | | | | - This can happen if called from an idle or suspension thread.
| * | | core: hle: kernel: Rename Thread to KThread.bunnei2021-01-2943-255/+254
| | | |
* | | | Merge pull request #5838 from german77/prepostubMorph2021-01-301-1/+10
|\ \ \ \ | | | | | | | | | | prepo: Stub GetSystemSessionId
| * | | | Stub GetSystemSessionIdgerman2021-01-301-1/+10
| | |_|/ | |/| |
* | | | Merge pull request #5809 from ogniK5377/FlushAudioOutBuffersbunnei2021-01-291-1/+9
|\ \ \ \ | |_|/ / |/| | | audout: FlushAudioOutBuffers
| * | | audout: FlushAudioOutBuffersChloe Marcec2021-01-241-1/+9
| | | | | | | | | | | | | | | | Fixes Devil May Cry
* | | | Merge pull request #5837 from german77/socketstubbunnei2021-01-292-1/+17
|\ \ \ \ | | | | | | | | | | sockets: Stub GetSockOpt
| * | | | Stub GetSockOptgerman2021-01-282-1/+17
| | |/ / | |/| |
* | | | Merge pull request #5840 from Morph1984/prepo-fixLC2021-01-283-24/+70
|\ \ \ \ | | | | | | | | | | prepo: Fix BufferDescriptorX invalid buffer index errors and add New variants of SaveReport
| * | | | prepo: Fix BufferDescriptorX invalid buffer errors and add "New" variants of SaveReportMorph2021-01-281-24/+42
| | | | | | | | | | | | | | | | | | | | The second input buffer could be optional when prepo/srepo is called, test for the availability of the second buffer prior to reading from it.
| * | | | hle_ipc: Add Can(Read, Write)BufferMorph2021-01-282-0/+28
| |/ / / | | | | | | | | | | | | Allows us to test whether a buffer can be read from or written to memory
* | | | hid: Add static_assert for Parameter sizeMorph2021-01-281-15/+19
| | | |
* | | | npad: Remove unused device handle parameterMorph2021-01-273-11/+9
|/ / /
* | | Merge pull request #5812 from german77/StubSixaxisFusionbunnei2021-01-274-3/+104
|\ \ \ | | | | | | | | HID: Stub Set/Get/Reset SixaxisSensorFusionParameters
| * | | Stub Set/Get/Reset SixaxisSensorFusionParametersgerman2021-01-244-3/+104
| |/ /
* | | Merge pull request #5810 from ogniK5377/stereo-visionbunnei2021-01-273-7/+60
|\ \ \ | | | | | | | | hle: Implement remaining services for Stereo Vision
| * | | hle: Implement remaining services for Stereo VisionChloe Marcec2021-01-243-7/+60
| |/ / | | | | | | | | | Used by Zelda Breath of the Wild, Super Mario Odyssey and Nintendo Labo
* | | Merge pull request #5824 from ogniK5377/IPsmSessionbunnei2021-01-261-1/+112
|\ \ \ | | | | | | | | psm: IPsmSession
| * | | Omit system referenceChloe Marcec2021-01-251-2/+1
| | | |
| * | | psm: IPsmSessionChloe Marcec2021-01-251-2/+114
| | | | | | | | | | | | | | | | Used by homebrew menu
* | | | Merge pull request #5774 from ogniK5377/mii-raw-randombunnei2021-01-264-2274/+1657
|\ \ \ \ | | | | | | | | | | mii: Fix BuildRandomStoreData & Cleanup raw_data
| * | | | mii: Fix BuildRandomStoreData & Cleanup raw_dataChloe Marcec2021-01-204-2274/+1657
| | | | | | | | | | | | | | | | | | | | | | | | | Cleaned up mii raw data to reflect the underlying values instead of just a chunk of bytes. Fixed BuildRandomStoreData not actually generating random miis properly. "values" should be a u32, not a u8.
* | | | | Merge pull request #5771 from ogniK5377/lm-reworkbunnei2021-01-258-345/+288
|\ \ \ \ \ | |_|/ / / |/| | | | lm: Recode LM service
| * | | | Print Process ID and Thread ID as hexChloe Marcec2021-01-241-2/+2
| | | | |
| * | | | Clamp string reads to buffer sizeChloe Marcec2021-01-231-3/+5
| | | | |
| * | | | Mark DestinationToString as staticChloe Marcec2021-01-201-1/+1
| | | | |
| * | | | Mark LogPacketHeaderEntry hash as noexceptChloe Marcec2021-01-201-1/+1
| | | | |
| * | | | lm: Recode LM serviceChloe Marcec2021-01-208-345/+286
| |/ / / | | | | | | | | | | | | Rework the service to spit out to logs instead of a seperate file as well as fix any crashes caused by lm.
* | | | Merge pull request #5799 from ogniK5377/event-register-unregisterbunnei2021-01-251-1/+7
|\ \ \ \ | | | | | | | | | | nvdrv: Unregister already registered events
| * | | | Simplify conditionChloe Marcec2021-01-231-2/+1
| | | | |
| * | | | nvdrv: Unregister already registered eventsChloe Marcec2021-01-231-1/+8
| | | | |
* | | | | Merge pull request #5151 from comex/xx-vfsbunnei2021-01-241-4/+10
|\ \ \ \ \ | |_|_|/ / |/| | | | vfs_real: When moving files or directories, don't assume file opening will succeed
| * | | | vfs_real: When moving files or directories, don't assume file opening will succeedcomex2021-01-231-4/+10
| |/ / / | | | | | | | | | | | | | | | | | | | | | | | | Found this via a warning, but it's a substantive fix. Since this is only for a cache, it should be safe to silently drop the entry if opening fails. I think.
* | | | Merge pull request #5806 from bunnei/am-stubbunnei2021-01-241-1/+8
|\ \ \ \ | |/ / / |/| | | hle: service: am: Stub ILibraryAppletAccessor::PresetLibraryAppletGpuTimeSliceZero.
| * | | hle: service: am: Stub ILibraryAppletAccessor::PresetLibraryAppletGpuTimeSliceZero.bunnei2021-01-211-1/+8
| |/ / | | | | | | | | | - Used by Monster Hunter Rise demo.
* | | Merge pull request #5776 from ogniK5377/lblbunnei2021-01-231-22/+261
|\ \ \ | | | | | | | | lbl: Implement most of lbl
| * | | lbl: Implement most of lblChloe Marcec2021-01-201-22/+261
| |/ / | | | | | | | | | Pretty basic service, only thing left to do is handle setting applying once set:sys is implemented
* | | Merge pull request #5765 from ogniK5377/StoreSaveDataThumbnail-stubbunnei2021-01-235-6/+66
|\ \ \ | | | | | | | | acc: Stub StoreSaveDataThumbnail
| * | | acc: Stub StoreSaveDataThumbnailChloe Marcec2021-01-195-6/+66
| |/ / | | | | | | | | | Fixes ACA NEOGEO METAL SLUG hanging on boot.
* | | Merge pull request #5270 from german77/multiTouchbunnei2021-01-215-55/+167
|\ \ \ | |/ / |/| | HID: Add multitouch support
| * | Always initialize keyboard inputgerman2021-01-153-12/+8
| | |
| * | Add mutitouch support for touch screensgerman2021-01-154-42/+56
| | |
| * | Allow to return up to 16 touch inputs per enginegerman2021-01-154-61/+84
| | |
| * | Allow all touch inputs at the same time and remove config options that are not longer necesarygerman2021-01-152-11/+20
| | |
| * | Add multitouch supportgerman2021-01-152-23/+93
| | |
* | | npad: Add check for HANDHELD_INDEX in UpdateControllerAt()Morph2021-01-181-1/+1
| | |
* | | Merge pull request #5360 from ReinUsesLisp/enforce-memclass-accessbunnei2021-01-1714-181/+192
|\ \ \ | |_|/ |/| | core: Silence Wclass-memaccess warnings and enforce it
| * | core/cmake: Enforce Wclass-memaccessReinUsesLisp2021-01-151-0/+1
| | | | | | | | | | | | Treat -Wclass-memaccess as an error.
| * | core: Silence Wclass-memaccess warningsReinUsesLisp2021-01-1513-181/+191
| | | | | | | | | | | | | | | This requires making several types trivial and properly initialize them whenever they are called.
* | | input_interpreter: Mark two member functions as constLioncash2021-01-161-4/+4
| | | | | | | | | | | | | | | | | | These aren't stateful functions, so we can make use of const. While we're at, we can resolve some -Wdocumentation warnings.
* | | input_interpreter: Add method to check for a button press stateMorph2021-01-162-0/+25
| | | | | | | | | | | | This allows to check for continuous input for the duration of a button press/hold
* | | Merge pull request #5358 from ReinUsesLisp/rename-insert-paddingLC2021-01-153-19/+19
|\| | | |/ |/| common/common_funcs: Rename INSERT_UNION_PADDING_{BYTES,WORDS} to _NOINIT
| * common/common_funcs: Rename INSERT_UNION_PADDING_{BYTES,WORDS} to _NOINITReinUsesLisp2021-01-153-19/+19
| | | | | | | | INSERT_PADDING_BYTES_NOINIT is more descriptive of the underlying behavior.
* | common/bit_util: Replace CLZ/CTZ operations with standardized onesLioncash2021-01-154-8/+12
|/ | | | Makes for less code that we need to maintain.
* core/cmake: Remove Werror flags already defined code-base wideReinUsesLisp2021-01-151-2/+0
|
* hle: kernel: thread: Preserve thread wait reason for debugging only.bunnei2021-01-117-1/+34
| | | | - This is decoupled from core functionality and used for debugging only.
* hle: kernel: k_scheduler_lock: Fix shadowing errors.bunnei2021-01-111-1/+1
|
* core: arm: arm_interface: Fix shadowing errors.bunnei2021-01-111-3/+4
|
* core: hle: Add missing calls to MicroProfileOnThreadExit.bunnei2021-01-112-0/+5
|
* core: hle: Integrate new KConditionVariable and KAddressArbiter implementations.bunnei2021-01-1114-1177/+503
|
* core: hle: kernel: Update KAddressArbiter.bunnei2021-01-113-0/+437
|
* core: hle: kernel: Update KConditionVariable.bunnei2021-01-114-0/+413
|
* core: hle: kernel: Begin moving common SVC defintions to its own header.bunnei2021-01-112-0/+14
|
* hle: kernel: Remove unnecessary AddressArbiter definition.bunnei2021-01-111-1/+0
|
* hle: kernel: k_scheduler: Cleanup OnThreadPriorityChanged.bunnei2021-01-112-6/+3
|
* hle: kernel: Rename thread "status" to "state".bunnei2021-01-111-2/+2
|
* hle: kernel: thread: Replace ThreadStatus/ThreadSchedStatus with a single ThreadState.bunnei2021-01-1111-127/+97
| | | | - This is how the real kernel works, and is more accurate and simpler.
* core: hle: kernel: Add some useful functions for checking kernel addresses.bunnei2021-01-111-0/+19
|
* core: hle: kernel: svc_types: Add type definitions for KAddressArbiter.bunnei2021-01-111-0/+12
|
* core: hle: kernel: Update KSynchronizationObject.bunnei2021-01-1131-603/+379
|
* core: hle: kernel: Begin moving common SVC results to its own header.bunnei2021-01-112-0/+21
|
* hle: service: nfp: Remove incorrect signaling behavior in GetDeviceState.bunnei2021-01-111-6/+0
|
* Merge pull request #5312 from german77/overclockenabledbunnei2021-01-102-1/+10
|\ | | | | apm: Stub IsCpuOverclockEnabled
| * Stub IsCpuOverclockEnabledgerman2021-01-082-1/+10
| |
* | file_sys/registered_cache: Silence virtual functions without override warningsReinUsesLisp2021-01-091-4/+4
| |
* | core: Silence unhandled enum in switch warningsReinUsesLisp2021-01-092-10/+5
|/
* fix for nvdec disabled, cleanup host1xameerj2021-01-071-11/+14
|
* nvdec syncpt incorporationameerj2021-01-077-20/+43
| | | | laying the groundwork for async gpu, although this does not fully implement async nvdec operations
* core: Enforce C4715 (not all control paths return a value)ReinUsesLisp2021-01-051-0/+2
|
* core: Silence warnings when compiling without assertsReinUsesLisp2021-01-055-8/+11
|
* buffer_queue: Protect queue_sequence list access with a mutexameerj2021-01-042-13/+21
| | | | fixes a data race as this is an unprotected variable manipulated by multiple threads
* main: Resolve error string not displayingLioncash2021-01-032-0/+5
| | | | | | | | | During the transition to make the error dialog translatable, I accidentally got rid of the conversion to ResultStatus, which prevented operator<< from being invoked during formatting. This adds a function to directly retrieve the result status string instead so that it displays again.
* Merge pull request #5278 from MerryMage/cpuopt_unsafe_inaccurate_nanbunnei2021-01-033-0/+7
|\ | | | | dynarmic: Add Unsafe_InaccurateNaN optimization
| * dynarmic: Add Unsafe_InaccurateNaN optimizationMerryMage2021-01-023-0/+7
| |
* | hle: service: nvflinger: buffer_queue: Do not reset id/layer_id on Connect.bunnei2021-01-031-2/+0
| | | | | | | | - This behavior is a mistake, fixes Katana Zero.
* | general: Fix various spelling errorsMorph2021-01-026-20/+20
|/
* memory: Remove MemoryHookMerryMage2021-01-012-64/+0
|
* Merge pull request #5249 from ReinUsesLisp/lock-free-pagesbunnei2021-01-014-124/+67
|\ | | | | core/memory: Read and write page table atomically
| * core/memory: Read and write page table atomicallyReinUsesLisp2020-12-304-124/+67
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Squash attributes into the pointer's integer, making them an uintptr_t pair containing 2 bits at the bottom and then the pointer. These bits are currently unused thanks to alignment requirements. Configure Dynarmic to mask out these bits on pointer reads. While we are at it, remove some unused attributes carried over from Citra. Read/Write and other hot functions use a two step unpacking process that is less readable to stop MSVC from emitting an extra AND instruction in the hot path: mov rdi,rcx shr rdx,0Ch mov r8,qword ptr [rax+8] mov rax,qword ptr [r8+rdx*8] mov rdx,rax -and al,3 and rdx,0FFFFFFFFFFFFFFFCh je Core::Memory::Memory::Impl::Read<unsigned char> mov rax,qword ptr [vaddr] movzx eax,byte ptr [rdx+rax]
* | Merge pull request #5208 from bunnei/service-threadsbunnei2020-12-3148-677/+499
|\ \ | | | | | | Service threads
| * | hle: kernel: service_thread: Make thread naming more consistent.bunnei2020-12-301-1/+1
| | |
| * | hle: kernel: Manage service threads on another thread.bunnei2020-12-301-9/+20
| | | | | | | | | | | | - This is to allow service threads to defer destruction of themselves.
| * | hle: kernel: Manage host thread IDs using TLS.bunnei2020-12-301-46/+31
| | | | | | | | | | | | - Avoids the need to have a large map of host to guest thread IDs.
| * | hle: kernel: Move ServiceThread ownership to KernelCore.bunnei2020-12-294-5/+48
| | | | | | | | | | | | - Fixes a circular dependency which prevented threads from being released on shutdown.
| * | hle: kernel: service_thread: Add thread name and take weak_ptr of ServerSession.bunnei2020-12-293-11/+22
| | |
| * | hle: service: Acquire and release a lock on requests.bunnei2020-12-295-25/+35
| | | | | | | | | | | | - This makes it such that we can safely access service members from CoreTiming thread.
| * | core: Do not reset device_memory on shutdown.bunnei2020-12-291-1/+0
| | | | | | | | | | | | - This will be reset on initialization.
| * | core: hle: kernel: Clear process list on boot.bunnei2020-12-291-2/+2
| | |
| * | hle: service: vi: Refactor to grab buffer only once.bunnei2020-12-291-15/+4
| | |
| * | service: nvflinger: Improve synchronization for BufferQueue.bunnei2020-12-295-19/+72
| | | | | | | | | | | | | | | - Use proper mechanisms for blocking on DequeueBuffer. - Ensure service thread terminates on emulation Shutdown.
| * | hle: service: Ensure system is powered on before writing IPC result.bunnei2020-12-291-1/+5
| | |
| * | core: kernel: Clear process list earlier.bunnei2020-12-291-2/+2
| | |
| * | core: settings: Untangle multicore from asynchronous GPU.bunnei2020-12-293-9/+1
| | | | | | | | | | | | - Now that GPU is always threaded, we can support multicore with synchronous GPU.
| * | hle: kernel: hle_ipc: Remove SleepClientThread.bunnei2020-12-292-54/+0
| | | | | | | | | | | | - This was kind of hacky, and no longer is necessary with service threads.
| * | hle: service: bsd: Update to work with service threads, removing SleepClientThread.bunnei2020-12-294-250/+45
| | |
| * | hle: service: nvdrv: Revert #4981 to remove usage of SleepClientThread.bunnei2020-12-2923-211/+83
| | | | | | | | | | | | - Note, this always processes the ioctl right away, which fixes BotW 1.0.0 issues.
| * | hle: kernel: service_thread: Add parameter for thread pool size.bunnei2020-12-293-7/+7
| | |
| * | hle: service: nvflinger: Refactor locking and interfaces.bunnei2020-12-293-45/+31
| | |
| * | hle: service: vi: Remove usage of SleepClientThread.bunnei2020-12-291-34/+43
| | |
| * | core: hle: server_session: Use separate threads for each service connection.bunnei2020-12-296-23/+140
| | |
* | | service/pcie: Fix invalid initialization argumentReinUsesLisp2020-12-301-1/+1
| | |
* | | Merge pull request #5247 from comex/xx-conceptsbunnei2020-12-301-3/+5
|\ \ \ | | | | | | | | k_priority_queue: Fix concepts use
| * | | k_priority_queue: Fix concepts usecomex2020-12-291-3/+5
| |/ / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | - For `std::same_as`, add missing include of `<concepts>`. - For `std::convertible_to`, create a replacement in `common/concepts.h` and use that instead. This would also be found in `<concepts>`, but unlike `std::same_as`, `std::convertible_to` is not yet implemented in libc++, LLVM's STL implementation - not even in master. (In fact, `std::same_as` is the *only* concept currently implemented. For some reason.)
* | | Merge pull request #5246 from comex/xx-includebunnei2020-12-301-0/+1
|\ \ \ | |_|/ |/| | Add missing include of "core/hle/kernel/kernel.h"
| * | Add missing include of "core/hle/kernel/kernel.h"comex2020-12-291-0/+1
| |/ | | | | | | This is needed as the header invokes methods on KernelCore.
* / svc: demote SleepThread log to LOG_TRACEameerj2020-12-291-1/+1
|/ | | | This log is called often, and introduces a lot of noise when debug logging is enabled, making it difficult to see other debug logs.
* core: memory: Ensure thread safe access when pages are rasterizer cached (#5206)bunnei2020-12-251-12/+40
| | | * core: memory: Ensure thread safe access when pages are rasterizer cached.
* Merge pull request #5042 from Morph1984/project-aetherbunnei2020-12-2217-658/+842
|\ | | | | Project Aether: Reimplementation of the Web Browser Applet
| * applets/web: Implement the online web browser appletMorph2020-12-184-3/+28
| |
| * main, applets/web: Re-add progress dialog for RomFS extractionMorph2020-12-184-40/+52
| |
| * pl_u, applets/web: Decrypt shared fonts to TTF filesMorph2020-12-183-18/+117
| |
| * ns_vm: Stub NeedsUpdateVulnerabilityMorph2020-12-181-1/+10
| | | | | | | | This is used to force system updates on launching the web browser. We do not care about system updates so this can be set to false.
| * frontend/input_interpreter: Add InputInterpreter APIMorph2020-12-183-0/+167
| | | | | | | | | | | | The InputInterpreter class interfaces with HID to retrieve button press states. Input is intended to be polled every 50ms so that a button is considered to be held down after 400ms has elapsed since the initial button press and subsequent repeated presses occur every 50ms. Co-authored-by: Chloe <25727384+ogniK5377@users.noreply.github.com>
| * controllers/npad: Make press_state atomicMorph2020-12-182-2/+3
| |
| * applets/web: Implement the default web browser applet frontendMorph2020-12-183-1/+24
| |
| * applets/web: Implement the offline browser applet backendMorph2020-12-182-13/+143
| |
| * applets/web: Initial implementation of the web browser appletMorph2020-12-183-2/+428
| |
| * applets: Remove the previous web browser applet implementationMorph2020-12-188-745/+37
| |
* | Merge pull request #5131 from bunnei/scheduler-rewritebunnei2020-12-2135-1465/+2111
|\ \ | | | | | | Rewrite Kernel scheduler based on Atmosphere
| * | hle: kernel: Process: Various style fixes based on code review feedback.bunnei2020-12-061-2/+2
| | |
| * | core: cpu_manager: Fix a typo in PreemptSingleCore, which broke many games.bunnei2020-12-061-21/+26
| | | | | | | | | | | | - We were reload'ing the old current scheduler, which may have changed.
| * | hle: kernel: Thread: Various style fixes based on code review feedback.bunnei2020-12-061-22/+25
| | |
| * | hle: kernel: KScopedSchedulerLockAndSleep: Various style fixes based on code review feedback.bunnei2020-12-061-6/+6
| | |
| * | hle: kernel: KScopedLock: Various style fixes based on code review feedback.bunnei2020-12-061-6/+8
| | |
| * | hle: kernel: KAbstractSchedulerLock: Various style fixes based on code review feedback.bunnei2020-12-061-9/+7
| | |
| * | hle: kernel: KScheduler: Various style fixes based on code review feedback.bunnei2020-12-062-50/+41
| | |
| * | hle: kernel: KPriorityQueue: Various style fixes based on code review feedback.bunnei2020-12-061-29/+36
| | |
| * | hle: kernel: KAffinityMask: Various style fixes based on code review feedback.bunnei2020-12-061-17/+13
| | |
| * | hle: kernel: GlobalSchedulerContext: Various style fixes based on code review feedback.bunnei2020-12-062-5/+10
| | |
| * | hle: kernel: Use C++ style comments in KScheduler, etc.bunnei2020-12-064-152/+136
| | |
| * | kernel: KScopedSchedulerLockAndSleep: Remove unused ctor.bunnei2020-12-061-13/+7
| | |
| * | kernel: time_manager: Add missing lock guards.bunnei2020-12-061-3/+10
| | |
| * | hle: kernel: Migrate to KScopedSchedulerLock.bunnei2020-12-0615-48/+92
| | |
| * | hle: kernel: Separate KScopedSchedulerLockAndSleep from k_scheduler.bunnei2020-12-0611-69/+72
| | |
| * | hle: kernel: Separate KScheduler from GlobalSchedulerContext class.bunnei2020-12-065-118/+140
| | |
| * | hle: kernel: Rewrite scheduler implementation based on Mesopshere.bunnei2020-12-0625-1220/+1212
| | |
| * | hle: kernel: physical_core: Clear exclusive state after each run.bunnei2020-12-063-0/+7
| | | | | | | | | | | | - This is closer to pre-multicore behavior, and works a bit better.
| * | hle: kernel: Port KAbstractSchedulerLock from Mesosphere.bunnei2020-12-062-0/+77
| | |
| * | hle: kernel: svc: Remove reschedule on svcBreak.bunnei2020-12-061-5/+0
| | | | | | | | | | | | - This breaks things, and is unnecessary, since emulation will be done at this point.
| * | hle: kernel: process: Add schedule count tracking, to be used for yield impl.bunnei2020-12-061-0/+13
| | |
| * | hle: kernel: svc: Remove unnecessary hack in svcSleep.bunnei2020-12-061-7/+0
| | |
| * | common: Port KPriorityQueue from Mesosphere.bunnei2020-12-062-0/+444
| | |
| * | hle: kernel: Port KAffinityMask from Mesosphere.bunnei2020-12-066-14/+78
| | |
* | | Merge pull request #5201 from ameerj/bufferq-refactorbunnei2020-12-213-70/+63
|\ \ \ | | | | | | | | vi/buffer_queue: Buffer queue management refactor
| * | | buffer_queue: better use of std::arrayameerj2020-12-181-59/+46
| | | |
| * | | Overwrite slots instead of queuing them, add disconnect signalameerj2020-12-173-27/+33
| | | | | | | | | | | | | | | | Fix for Katana Zero and Yoshi's Crafted World
* | | | yuzu: Remove gdbstub configurationFearlessTobi2020-12-191-2/+0
| |_|/ |/| | | | | | | | | | | The gdbstub itself was removed with https://github.com/yuzu-emu/yuzu/pull/5028. This PR just removes the remaining gdb configuration code from the emulator and the UI.
* | | system_archive: Add + and - buttons to the Nintendo Extended OSS fontMorph2020-12-182-315/+343
| | |
* | | system_archive: Update Nintendo Extended OSS fontMorph2020-12-172-182/+347
|/ / | | | | | | Co-authored-by: Its-Rei <kupfel@gmail.com>
* | Merge pull request #5190 from Morph1984/validate_device_handlebunnei2020-12-162-0/+45
|\ \ | | | | | | controllers/npad: Validate device handles before use
| * | controllers/npad: Validate device handles before useMorph2020-12-122-0/+45
| | | | | | | | | | | | Some games such as NEKOPARA Vol. 3 send invalid device handles when calling InitializeVibrationDevice. Introduce a check to validate the device handle before use.
* | | Merge pull request #5119 from Morph1984/fs-opendatastoragewithprogramindexbunnei2020-12-1510-10/+147
|\ \ \ | | | | | | | | fsp_srv: Implement OpenDataStorageWithProgramIndex
| * | | fsp_srv: Implement OpenDataStorageWithProgramIndexMorph2020-12-086-1/+83
| | | | | | | | | | | | | | | | - Used by RollerCoaster Tycoon 3: Complete Edition
| * | | file_sys: Consolidate common Title ID operationsMorph2020-12-084-9/+64
| | | |
* | | | Merge pull request #5168 from Morph1984/aoc-PurchaseEventManagerbunnei2020-12-152-2/+76
|\ \ \ \ | |_|/ / |/| | | aoc_u: Stub IPurchaseEventManager and its service commands
| * | | IPurchaseEventManager: Implement GetPurchasedEventReadableHandleMorph2020-12-081-1/+14
| | | | | | | | | | | | | | | | | | | | - Used by Pokémon Café Mix - Used by DOOM: Eternal
| * | | IPurchaseEventManager: Stub Set(Default)DeliveryTargetMorph2020-12-081-2/+27
| | | | | | | | | | | | | | | | | | | | - Used by Pokémon Café Mix - Used by DOOM: Eternal
| * | | aoc_u: Stub Create(Permanent)EcPurchasedEventManagerMorph2020-12-082-2/+38
| |/ / | | | | | | | | | | | | - Used by Pokémon Café Mix - Used by DOOM: Eternal
* | | Merge pull request #5183 from lioncash/alias2bunnei2020-12-1228-136/+142
|\ \ \ | | | | | | | | vfs: Use existing type aliases consistently
| * | | vfs: Use existing type aliases consistentlyLioncash2020-12-1028-136/+142
| | | | | | | | | | | | | | | | | | | | Makes use of the VirtualDir and VirtualFile aliases across the board instead of having a few isolated places that don't use it.
* | | | Merge pull request #5187 from Morph1984/revert-stdfsbunnei2020-12-121-6/+2
|\ \ \ \ | | | | | | | | | | fs: Revert all std::filesystem changes
| * | | | Revert "Merge pull request #5176 from Morph1984/fix-createfile"Morph2020-12-121-6/+2
| | | | | | | | | | | | | | | | | | | | | | | | | This reverts commit 6d6115475b4edccdf1bb4e96ecc3d3b1be319e76, reversing changes made to 5fe55b16a11d9ec607fb8a3fdddc77a4393cd96a.
* | | | | Merge pull request #5172 from lioncash/svc-widebunnei2020-12-121-35/+25
|\ \ \ \ \ | |/ / / / |/| | | | svc: Remove unnecessary casts
| * | | | svc: Remove unnecessary castsLioncash2020-12-081-35/+25
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Simplifies and removes some casts. In all cases, these were generally widening from a 32-bit unsigned type to a 64-bit unsigned type, so no information would be lost from the conversion.
* | | | | Merge pull request #5123 from Morph1984/nim-IsLargeResourceAvailablebunnei2020-12-101-1/+13
|\ \ \ \ \ | |_|/ / / |/| | | | nim: Stub IsLargeResourceAvailable
| * | | | nim: Stub IsLargeResourceAvailableMorph2020-12-041-1/+13
| | | | | | | | | | | | | | | | | | | | - Used by Immortals Fenyx Rising
* | | | | vfs_real: Fix CreateFile for files without a file extensionMorph2020-12-091-2/+6
| | | | |
* | | | | Merge pull request #5142 from comex/xx-poll-eventsRodrigo Locatti2020-12-096-71/+82
|\ \ \ \ \ | | | | | | | | | | | | network, sockets: Replace `POLL_IN`, `POLL_OUT`, etc. constants with an `enum class PollEvents`
| * | | | | network, sockets: Replace `POLL_IN`, `POLL_OUT`, etc. constants with an `enum class PollEvents`comex2020-12-076-71/+82
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Actually, two enum classes, since for some reason there are two separate yet identical `PollFD` types used in the codebase. I get that one is ABI-compatible with the Switch while the other is an abstract type used for the host, but why not use `WSAPOLLFD` directly for the latter? Anyway, why make this change? Because on Apple platforms, `POLL_IN`, `POLL_OUT`, etc. (with an underscore) are defined as macros in <sys/signal.h>. (This is inherited from FreeBSD.) So defining a variable with the same name causes a compile error. I could just rename the variables, but while I was at it I thought I might as well switch to an enum for stronger typing. Also, change the type used for values copied directly to/from the `events` and `revents` fields of the host *native* `pollfd`/`WSASPOLLFD`, from `u32` to `short`, as `short` is the correct canonical type on both Unix and Windows.
* | | | | | Merge pull request #5166 from lioncash/log-castbunnei2020-12-0925-96/+90
|\ \ \ \ \ \ | | | | | | | | | | | | | | core: Remove unnecessary enum casts in log calls
| * | | | | | core: Remove unnecessary enum casts in log callsLioncash2020-12-0825-96/+90
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Follows the video core PR. fmt doesn't require casts for enum classes anymore, so we can remove quite a few casts.
* | | | | | | Merge pull request #5135 from Morph1984/applets-shadowbunnei2020-12-091-1/+1
|\ \ \ \ \ \ \ | |_|_|_|/ / / |/| | | | | | applets: Resolve variable shadowing
| * | | | | | applets: Resolve variable shadowingMorph2020-12-051-1/+1
| | |_|_|_|/ | |/| | | |
* | | | | | Merge pull request #5167 from lioncash/doc-memorybunnei2020-12-081-2/+0
|\ \ \ \ \ \ | |_|_|_|_|/ |/| | | | | memory: Resolve -Wdocumentation warning for Write()
| * | | | | memory: Resolve -Wdocumentation warning for Write()Lioncash2020-12-081-2/+0
| | |/ / / | |/| | | | | | | | | | | | | | | | | | Write() doesn't return anything, so the @returns tag shouldn't be present.
* | | | | Merge pull request #5165 from lioncash/copy-controllerMorph2020-12-081-12/+11
|\ \ \ \ \ | | | | | | | | | | | | controller: Avoid unnecessary copies in ConfigurationComplete()
| * | | | | controller: Use std::move within ConvertToFrontendParameters()Lioncash2020-12-081-3/+3
| | | | | | | | | | | | | | | | | | | | | | | | Avoids unnecessary copies.
| * | | | | controller: Avoid unnecessary copies in ConfigurationComplete()Lioncash2020-12-081-9/+8
| |/ / / / | | | | | | | | | | | | | | | | | | | | Avoids unnecessary 1072 byte copies when querying info about controllers.
* | | | | Merge pull request #5020 from german77/AnalogfromButtonFixMorph2020-12-081-0/+2
|\ \ \ \ \ | |/ / / / |/| | | | Disable analog joystick from buttons by default
| * | | | Disable analog joystick from buttons by defaultgerman2020-12-081-0/+2
| | | | |
* | | | | Merge pull request #5153 from comex/xx-unixbunnei2020-12-082-5/+5
|\ \ \ \ \ | | | | | | | | | | | | CMakeLists,network: Create YUZU_UNIX macro to replace __unix__
| * | | | | CMakeLists,network: Create YUZU_UNIX macro to replace __unix__comex2020-12-072-5/+5
| | |/ / / | |/| | | | | | | | | | | | | __unix__ is not predefined on Apple platforms even though they are Unix.
* | | | | Merge pull request #5148 from comex/xx-unused-fieldsbunnei2020-12-072-3/+3
|\ \ \ \ \ | | | | | | | | | | | | core: Mark unused fields as [[maybe_unused]]
| * | | | | core: Mark unused fields as [[maybe_unused]]comex2020-12-072-3/+3
| |/ / / /
* | | | | Merge pull request #5154 from comex/xx-ipcbunnei2020-12-072-34/+37
|\ \ \ \ \ | | | | | | | | | | | | hle: Type check ResponseBuilder::Push arguments, and fix use in vi.cpp
| * | | | | hle: Type check ResponseBuilder::Push arguments, and fix use in vi.cppcomex2020-12-072-34/+37
| |/ / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | - Add a type check so that calling Push with an invalid type produces a compile error rather than a linker error. - vi.cpp was calling Push with a variable of type `std::size_t`. There's no explicit overload for `size_t`, but there is one for `u64`, which on most platforms is the same type as `size_t`. On macOS, however, it isn't: both types are 64 bits, but `size_t` is `unsigned long` and `u64` is `unsigned long long`. Regardless, it makes more sense to explicitly use `u64` here instead of `size_t`.
* | | | | Merge pull request #5147 from comex/xx-purevirtLC2020-12-071-33/+0
|\ \ \ \ \ | | | | | | | | | | | | nvdrv: Remove useless re-declaration of pure virtual methods that were already declared in the superclass
| * | | | | nvdrv: Remove useless re-declaration of pure virtual methods that were already declared in the superclasscomex2020-12-071-33/+0
| |/ / / /
* | | | | Merge pull request #5150 from comex/xx-boxcatLC2020-12-071-1/+1
|\ \ \ \ \ | | | | | | | | | | | | boxcat: Avoid unnecessary object copy
| * | | | | boxcat: Avoid unnecessary object copycomex2020-12-071-1/+1
| |/ / / /
* | | | | Merge pull request #5136 from lioncash/video-shadow3LC2020-12-072-9/+9
|\ \ \ \ \ | |_|_|/ / |/| | | | video_core: Resolve more variable shadowing scenarios pt.3
| * | | | video_core: Resolve more variable shadowing scenarios pt.3Lioncash2020-12-052-9/+9
| |/ / / | | | | | | | | | | | | | | | | Cleans out the rest of the occurrences of variable shadowing and makes any further occurrences of shadowing compiler errors.
* / / / Fix "explicitly defaulted but implicitly deleted" warningcomex2020-12-071-1/+1
|/ / / | | | | | | | | | | | | | | | | | | | | | | | | | | | `PhysicalCore`'s move assignment operator was declared as `= default`, but was implicitly deleted because `PhysicalCore` has fields of reference type. Switch to explicitly deleting it to avoid a Clang warning. The move *constructor* is still defaulted, and is required to exist due to the use of `std::vector<PhysicalCore>`.
* | / system_version: Update to 11.0.0Chloe Marcec2020-12-051-6/+6
| |/ |/|
* | Merge pull request #4996 from bunnei/use-4jitsbunnei2020-12-0424-141/+194
|\ \ | | | | | | Kernel: Refactor to use 4-instances of Dynarmic & various cleanups and improvements
| * | kernel: scheduler: Minor cleanup to remove duplicated code.bunnei2020-11-292-46/+14
| | |
| * | kernel: time_manager: Protect access with a mutex.bunnei2020-11-292-1/+5
| | |
| * | hle: kernel: thread: Remove unused "Running" state.bunnei2020-11-292-6/+0
| | |
| * | core: arm: Implement InvalidateCacheRange for CPU cache invalidation.bunnei2020-11-2912-16/+56
| | |
| * | hle: kernel: time_manager: Avoid a crash on process exit.bunnei2020-11-291-1/+4
| | |
| * | hle: kernel: AddressArbiter: Remove unused code.bunnei2020-11-292-9/+0
| | |
| * | hle: kernel: SynchronizationObject: Use atomic_bool for is_signaled.bunnei2020-11-291-1/+2
| | |
| * | common: fiber: Use boost::context instead of native fibers on Windows.bunnei2020-11-291-1/+1
| | |
| * | hle: kernel: multicore: Replace n-JITs impl. with 4 JITs.bunnei2020-11-2915-72/+124
| | |
* | | Merge pull request #5000 from lioncash/audio-errorbunnei2020-12-032-5/+5
|\ \ \ | | | | | | | | audio_core: Make shadowing and unused parameters errors
| * | | audio_core: Make shadowing and unused parameters errorsLioncash2020-12-032-5/+5
| | | | | | | | | | | | | | | | Moves the audio code closer to enabling warnings as errors in general.
* | | | Merge pull request #4937 from german77/multiUDPbunnei2020-12-011-3/+1
|\ \ \ \ | | | | | | | | | | InputCommon: Add multiple udp server support
| * | | | Add multiple udp server supportgerman2020-11-261-3/+1
| | | | |
* | | | | Merge pull request #4939 from german77/MouseInputbunnei2020-11-301-2/+7
|\ \ \ \ \ | |_|_|/ / |/| | | | InputCommon: Implement full mouse support
| * | | | Implement full mouse supportgerman2020-11-261-2/+7
| | | | |
* | | | | Merge pull request #4998 from Morph1984/bioshock-patchbunnei2020-11-291-2/+4
|\ \ \ \ \ | | | | | | | | | | | | hid: Check if applet_resource exists in InitializeVibrationDevice
| * | | | | hid: Check if applet_resource exists in InitializeVibrationDeviceMorph2020-11-251-2/+4
| | |_|/ / | |/| | |
* | | | | Add missing types to NpadCommunicationModegerman2020-11-291-0/+2
| | | | |
* | | | | Merge pull request #5021 from german77/StubCommunicationModebunnei2020-11-294-2/+50
|\ \ \ \ \ | | | | | | | | | | | | HID: Stub set and get NpadCommunicationMode
| * | | | | Stub set and get NpadCommunicationModegerman2020-11-274-2/+50
| | |_|_|/ | |/| | |
* | | | | Merge pull request #5011 from lioncash/file-str2bunnei2020-11-281-12/+22
|\ \ \ \ \ | | | | | | | | | | | | core: Reduce string copies in GetGameFileFromPath()
| * | | | | core: Reduce string copies in GetGameFileFromPath()Lioncash2020-11-261-12/+22
| |/ / / / | | | | | | | | | | | | | | | | | | | | Eliminates some minor string churn where applicable. Also eliminates an unnecessary vector copy.
* | | | | core: Eliminate remaining usages of the global system instanceLioncash2020-11-2712-1558/+16
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Removes all remaining usages of the global system instance. After this, migration can begin to migrate to being constructed and managed entirely by the various frontends.
* | | | | savedata_factory: Eliminate usage of the global system instanceLioncash2020-11-273-12/+20
| | | | | | | | | | | | | | | | | | | | Now there's only two meaningful instances left in core.
* | | | | service: Eliminate usages of the global system instanceLioncash2020-11-27219-897/+1207
|/ / / / | | | | | | | | | | | | | | | | Completely removes all usages of the global system instance within the services code by passing in the using system instance to the services.
* | | | Merge pull request #4975 from comex/invalid-syncpoint-idbunnei2020-11-261-2/+2
|\ \ \ \ | | | | | | | | | | nvdrv, video_core: Don't index out of bounds when given invalid syncpoint ID
| * | | | nvdrv, video_core: Don't index out of bounds when given invalid syncpoint IDcomex2020-11-241-2/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | - Use .at() instead of raw indexing when dealing with untrusted indices. - For the special case of WaitFence with syncpoint id UINT32_MAX, instead of crashing, log an error and ignore. This is what I get when running Super Mario Maker 2.
* | | | | Merge pull request #4981 from ogniK5377/ioctl-ctrlbunnei2020-11-2624-91/+214
|\ \ \ \ \ | |_|_|_|/ |/| | | | nvservices: Reintroducee IoctlCtrl
| * | | | nvservices: Reintroducee IoctlCtrlChloe Marcec2020-11-2424-91/+214
| | | | | | | | | | | | | | | | | | | | Fixes regression caused by #4907 which caused games like Breath of the Wild 1.0.0 not to boot.
* | | | | Merge pull request #4976 from comex/poll-eventsRodrigo Locatti2020-11-261-2/+2
|\ \ \ \ \ | |_|_|/ / |/| | | | Overhaul EmuWindow::PollEvents to fix yuzu-cmd calling SDL_PollEvents off main thread
| * | | | Overhaul EmuWindow::PollEvents to fix yuzu-cmd calling SDL_PollEvents off main threadcomex2020-11-231-2/+2
| | |/ / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | EmuWindow::PollEvents was called from the GPU thread (or the CPU thread in sync-GPU mode) when swapping buffers. It had three implementations: - In GRenderWindow, it didn't actually poll events, just set a flag and emit a signal to indicate that a frame was displayed. - In EmuWindow_SDL2_Hide, it did nothing. - In EmuWindow_SDL2, it did call SDL_PollEvents, but this is wrong because SDL_PollEvents is supposed to be called on the thread that set up video - in this case, the main thread, which was sleeping in a busyloop (regardless of whether sync-GPU was enabled). On macOS this causes a crash. To fix this: - Rename EmuWindow::PollEvents to OnFrameDisplayed, and give it a default implementation that does nothing. - In EmuWindow_SDL2, do not override OnFrameDisplayed, but instead have the main thread call SDL_WaitEvent in a loop.
* | | | Merge pull request #4978 from bunnei/shutdown-crashbunnei2020-11-251-7/+17
|\ \ \ \ | | | | | | | | | | core: cpu_manager: Fix shutdown crash when closing before emulation starts.
| * | | | core: cpu_manager: Fix shutdown crash when closing before emulation starts.bunnei2020-11-251-7/+17
| | | | |
* | | | | service: am: Implement ExecuteProgram and required stubs.bunnei2020-11-252-3/+34
| | | | | | | | | | | | | | | | | | | | - This is used by Super Mario 3D All-Stars.
* | | | | core: loader: Implement support for loading indexed programs.bunnei2020-11-2512-26/+74
|/ / / /
* | | | hle: services: Fix a crash with improper NVFlinger lifetime management. (#4977)bunnei2020-11-2417-100/+104
| | | | | | | | | | | | | | | | | | | | | | | | * hle: services: Fix a crash with improper NVFlinger lifetime management. - This crash would happen when attempting to shutdown yuzu early on in boot.
* | | | Merge pull request #4942 from lioncash/systemRodrigo Locatti2020-11-242-96/+81
|\ \ \ \ | | | | | | | | | | core: Make use of [[nodiscard]] with the System class
| * | | | core: Remove unused private Init function for the System classLioncash2020-11-182-16/+4
| | | | | | | | | | | | | | | | | | | | This isn't used, so it can be removed.
| * | | | core: Make use of [[nodiscard]] with the System classLioncash2020-11-182-81/+78
| | |_|/ | |/| | | | | | | | | | | | | | Given this is a central class, we should flag cases where the return value of some functions not being used is likely a bug.
* | | | Merge pull request #4972 from lioncash/unused4Rodrigo Locatti2020-11-241-1/+1
|\ \ \ \ | |_|_|/ |/| | | svc: Remove unnecessary [[maybe_unused]] tag
| * | | svc: Remove unnecessary [[maybe_unused]] tagLioncash2020-11-231-1/+1
| |/ / | | | | | | | | | | | | The parameter is used in this function, so this suppression isn't necessary.
* | | Fix warnings in core/frontend/input.h with [[maybe_unused]]bunnei2020-11-241-1/+3
| | | | | | | | | Fixes build break due to #4927
* | | Merge pull request #4927 from lioncash/input-errorbunnei2020-11-241-1/+1
|\ \ \ | |_|/ |/| | input_common: Treat warnings as errors
| * | input_common: Treat warnings as errorsLioncash2020-11-221-1/+1
| | | | | | | | | | | | | | | Migrates over warnings as errors for input common to match how the common library treats warnings as errors.
* | | Merge pull request #4451 from slashiee/extended-loggingbunnei2020-11-231-0/+1
|\ \ \ | |/ / |/| | logging/settings: Increase maximum log size to 100 MB and add extended logging option
| * | logging/settings: Increase maximum log size to 100 MB and add extended logging optionM&M2020-08-251-0/+1
| | | | | | | | | | | | | | | The extended logging option is automatically disabled on boot but can be enabled afterwards, allowing the log file to go up to 1 GB during that session. This commit also fixes a few errors that are present in the general debug menu.
* | | Merge pull request #4944 from lioncash/system-rembunnei2020-11-2222-126/+209
|\ \ \ | | | | | | | | patch_manager: Remove usages of the global system instance
| * | | patch_manager: Remove usages of the global system instanceLioncash2020-11-1822-126/+209
| | |/ | |/| | | | | | | | | | | | | | | | With this, only 19 usages of the global system instance remain within the core library. We're almost there.
* | | Merge pull request #4907 from ogniK5377/nvdrv-cleanupbunnei2020-11-2126-898/+1220
|\ \ \ | | | | | | | | core: Make nvservices more standardized
| * | | Addressed issuesChloe Marcec2020-11-1010-17/+86
| | | |
| * | | core: Make nvservices more standardizedChloe Marcec2020-11-1026-903/+1156
| | | |
* | | | olsc: Move member initialization to after member functions.bunnei2020-11-201-2/+2
| | | |
* | | | hle: service: Stub OLSC Initialize and SetSaveDataBackupSettingEnabled functions.bunnei2020-11-194-0/+89
| |/ / |/| | | | | | | | - Used by Animal Cross: New Horizons v1.6.0 update, minimal stub gets this update working.
* | | hid: Reimplement Begin/EndPermitVibrationSessionMorph2020-11-163-5/+17
| | | | | | | | | | | | Upon further investigation, these commands allow temporary vibrations even when the "Controller Vibration" system setting is disabled. As a result, vibrations are allowed when either the system setting or this flag is set to true. Therefore, we can only block vibrations when both flags are set to false.
* | | controllers/npad: Load input devices on initMorph2020-11-161-0/+2
| | |
* | | general: Fix compiler warnings on linux and miscellaneous changesMorph2020-11-162-8/+11
| | |
* | | controllers/npad: Remove the old vibration filterMorph2020-11-163-50/+64
| | | | | | | | | | | | Previously we used a vibration filter that filters out amplitudes close to each other. It turns out there are cases where this results into vibrations that are too inaccurate. Remove this and move the 100Hz vibration filter (Only allowing a maximum of 100 vibrations per second) from sdl_impl to npad when enable_accurate_vibrations is set to false.
* | | hid: Implement InitializeVibrationDevice and IsVibrationDeviceMountedMorph2020-11-163-12/+66
| | |
* | | input_common: Add VibrationDevice and VibrationDeviceFactoryMorph2020-11-164-33/+34
| | | | | | | | | | | | | | | | | | A vibration device is an input device that returns an unsigned byte as status. It represents whether the vibration device supports vibration or not. If the status returns 1, it supports vibration. Otherwise, it does not support vibration.
* | | configure_input: Add per-player vibrationMorph2020-11-162-2/+12
| | | | | | | | | | | | | | | | | | | | | Allows for enabling and modifying vibration and vibration strength per player. Also adds a toggle for enabling/disabling accurate vibrations. Co-authored-by: Its-Rei <kupfel@gmail.com>
* | | settings: Remove global vibration strength modifierMorph2020-11-163-5/+1
| | | | | | | | | | | | This will be replaced in favor of per-player vibration strength modifiers.
* | | hid: Mark Begin/EndPermitVibrationSession as stubsMorph2020-11-163-18/+4
| | | | | | | | | | | | The implementation of these commands seem incomplete and causes rumble in Super Mario Party to stop working since only EndPermitVibrationSession is called. Thus, these are better off being marked as a stub until this can be investigated more thoroughly.
* | | controllers/npad: Send an empty vibration on destruction/deactivationMorph2020-11-163-22/+38
| | | | | | | | | | | | This stops all controllers from continuously vibrating when emulation is stopped.
* | | hid: Stub IsVibrationDeviceMountedMorph2020-11-162-1/+23
| | | | | | | | | | | | - Used in Super Mario Odyssey
* | | controllers/npad: Add heuristics to reduce rumble state changesMorph2020-11-162-6/+47
| | | | | | | | | | | | | | | Sending too many state changes in a short period of time can cause massive performance issues. As a result, we have to use several heuristics to reduce the number of state changes to minimize/eliminate this performance impact while maintaining the quality of these vibrations as much as possible.
* | | configure_input: Hook up the vibration percentage spinboxMorph2020-11-163-1/+4
| | | | | | | | | | | | | | | This allows setting the vibration strength percentage anywhere from 1% to 100%. Also hooks up the remaining motion button and checkbox in the Controller Applet.
* | | controllers/npad: Stop games from vibrating incorrect controllersMorph2020-11-161-0/+10
| | | | | | | | | | | | Fixes vibration in 1-2 Switch and potentially other games where they would vibrate both players' joycons at the same time.
* | | hid: Fix controller rumble based on new researchMorph2020-11-163-43/+69
| | | | | | | | | | | | | | | This fixes the issue where rumble is only sent to the first controller. Now, individual controllers can receive their own rumble commands.
* | | hid: Pop a struct of parameters instead of popping individual parametersMorph2020-11-161-103/+237
| | | | | | | | | | | | | | | Some parameters need to be doubleword aligned due to the presence of the applet_resource_user_id. Previously, this value was invalid in many commands where it was not doubleword aligned when popped.
* | | hid: Reorder all HID commandsMorph2020-11-165-217/+232
| | | | | | | | | | | | Reorders all HID commands in command id order.
* | | hid: Implement GetVibrationDeviceInfoMorph2020-11-162-3/+39
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The first u32 describes the vibration device type which is a Linear Resonant Actuator used in Nintendo Switch controller hardware. The second u32 describes the vibration device position, in this case distinguishing between left and right vibration actuators. Pro Controllers have 2 LRAs each that can vibrate independently of each other, which means they have 2 distinct vibration device handles to distinguish between the two actuators. Similarly for joycons, the left joycon can be distinguished from the right joycon through the vibration device handle since each joycon has 1 LRA.
* | | hid: Stub InitializeVibrationDeviceMorph2020-11-161-3/+11
| | |
* | | controllers/npad: Rename NPadType to NpadStyleSetMorph2020-11-163-9/+9
| | | | | | | | | | | | This more accurately represents the underlying type and avoids confusion with NpadType
* | | controllers/npad: Add DeviceHandle structMorph2020-11-161-27/+50
| | | | | | | | | | | | A DeviceHandle describes a vibration device or six-axis sensor based on the npad type, npad id, and device index/position
* | | settings: Preparation for per-game input settingsMorph2020-11-1611-41/+89
| | |
* | | controllers/npad: Connect a controller on init if none are connectedMorph2020-11-161-0/+13
| | |
* | | Merge pull request #4895 from Morph1984/cave-story-plus-applet-fixbunnei2020-11-132-26/+80
|\ \ \ | | | | | | | | applets/controller: Introduce additional checks for mode and caller
| * | | applets: Rename LibraryAppletVersion to ControllerAppletVersionMorph2020-11-082-15/+15
| | | |
| * | | applets/controller: Pop normal data for StrapGuide and FirmwareUpdateMorph2020-11-082-6/+19
| | | |
| * | | applets/controller: Introduce additional checks for mode and callerMorph2020-11-082-5/+39
| | | | | | | | | | | | | | | | | | | | Some games like Cave Story+ set invalid values in the ControllerPrivateArg's mode and caller fields. Use other fields to determine the appropriate mode and caller should either or both fields be invalid.
| * | | applets/controller: Add ControllerUpdateFirmwareArg structMorph2020-11-081-0/+7
| | | |
* | | | Merge pull request #4901 from bunnei/caps-stubbunnei2020-11-102-9/+17
|\ \ \ \ | |_|/ / |/| | | hle: service: caps_u: Stub GetAlbumFileList3AaeAruid.
| * | | hle: service: caps_u: Stub GetAlbumFileList3AaeAruid.bunnei2020-11-072-9/+17
| | | | | | | | | | | | | | | | | | | | | | | | - This works similiar to GetAlbumContentsFileListForApplication. - Since we do not implement the album, this should be safe to stub for now. - Used by Super Smash Bros. Ultimate (newer updates) in World of Light.
* | | | Merge pull request #4909 from lioncash/interruptRodrigo Locatti2020-11-091-2/+2
|\ \ \ \ | | | | | | | | | | cpu_interrupt_handler: Mark move contructor/assignment as deleted
| * | | | cpu_interrupt_handler: Mark move contructor/assignment as deletedLioncash2020-11-081-2/+2
| | |/ / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | The interrupt handler contains a std::atomic_bool, which isn't copyable or movable, so the special move member functions will always be deleted, despite being defaulted. This can resolve warnings on clang and GCC.
* / | | ipc_helpers: Remove usage of the global system instanceLioncash2020-11-0816-7/+23
|/ / / | | | | | | | | | | | | | | | | | | | | | | | | Resolves numerous deprecation warnings throughout the codebase due to inclusion of this header. Now building core should be significantly less noisy (and also relying on less global state). This also uncovered quite a few modules that were relying on indirect includes, which have also been fixed.
* | | Merge pull request #4903 from bunnei/remove-gpu-integritybunnei2020-11-081-1/+0
|\ \ \ | | | | | | | | video_core: dma_pusher: Remove integrity check on command lists.
| * | | video_core: dma_pusher: Remove integrity check on command lists.bunnei2020-11-071-1/+0
| | | | | | | | | | | | | | | | - This seems to cause softlocks in Breath of the Wild.
* | | | Merge pull request #4906 from lat9nq/log-cpu-accuracyLC2020-11-071-0/+1
|\ \ \ \ | |/ / / |/| | | settings: log value of CPU_Accuracy
| * | | settings: log value of CPU_Accuracylat9nq2020-11-071-0/+1
| |/ /
* | | Merge pull request #4888 from lioncash/unicorn-removebunnei2020-11-078-412/+15
|\ \ \ | |/ / |/| | core: Remove usage of unicorn
| * | core: Remove usage of unicornLioncash2020-11-048-412/+15
| | | | | | | | | | | | | | | | | | | | | | | | Unicorn long-since lost most of its use, due to dynarmic gaining support for handling most instructions. At this point any further issues encountered should be used to make dynarmic better. This also allows us to remove our dependency on Python.
* | | settings: Simplify initializer of resolution factorLioncash2020-11-061-1/+1
| | | | | | | | | | | | | | | This can use a braced initializer to accomplish the same thing with less code.
* | | Merge pull request #4889 from lioncash/setting-globalbunnei2020-11-052-10/+21
|\ \ \ | | | | | | | | core/settings: Move configuring_global behind an API
| * | | core/settings: Move configuring_global behind an APILioncash2020-11-042-10/+21
| |/ / | | | | | | | | | | | | | | | Rather than have directly modified global state here, we can make it an implementation detail and have an interface that changes are queried through.
* | | Merge pull request #4858 from lioncash/initializerbunnei2020-11-042-2/+14
|\ \ \ | | | | | | | | General: Resolve a few missing initializer warnings
| * | | General: Resolve a few missing initializer warningsLioncash2020-10-302-2/+14
| | | | | | | | | | | | | | | | Resolves a few -Wmissing-initializer warnings.
* | | | Merge pull request #4869 from bunnei/improve-gpu-syncChloe2020-11-0411-64/+299
|\ \ \ \ | |_|/ / |/| | | Improvements to GPU synchronization & various refactoring
| * | | fixup! hle service: nvdrv: nvhost_gpu: Update to use SyncpointManager and other improvements.bunnei2020-11-012-3/+11
| | | |
| * | | core: Initialize GPU before services.bunnei2020-11-011-4/+6
| | | |
| * | | hle service: nvdrv: nvhost_gpu: Update to use SyncpointManager and other improvements.bunnei2020-11-013-46/+106
| | | | | | | | | | | | | | | | | | | | - Refactor so that SubmitGPFIFO and KickoffPB use shared functionality. - Implement add_wait and add_increment flags.
| * | | service: hle: nvflinger: Fix potential shutdown crash when GPU is destroyed.bunnei2020-11-011-0/+4
| | | |
| * | | hle service: nvdrv: nvhost_ctrl: Update to use SyncpointManager.bunnei2020-11-013-9/+31
| | | |
| * | | hle service: nvdrv: Update to instantiate SyncpointManager.bunnei2020-11-012-5/+18
| | | |
| * | | hle: service: nvdrv: Implement SyncpointManager, to manage syncpoints.bunnei2020-11-014-1/+127
| | | |
* | | | Merge pull request #4878 from bunnei/unload-nrrbunnei2020-11-031-1/+15
|\ \ \ \ | |/ / / |/| | | hle: service: ldr: Implement UnloadNrr.
| * | | hle: service: ldr: Implement UnloadNrr.bunnei2020-10-311-1/+15
| | | | | | | | | | | | | | | | - Used by Final Fantasy X/X-2 HD Remaster.
* | | | Rename to align with switchbrew and remove gpu function (#4714)Levi Behunin2020-11-012-16/+10
|/ / / | | | | | | | | | | | | * Rename to align with switchbrew * Rename to align with switchbrew and remove gpu function that checks if clearing should be done.
* | | video_core: unbreak -Werror in NVDEC with ClangJan Beich2020-10-301-1/+1
| | | | | | | | | | | | | | | | | | src/core/hle/service/nvdrv/devices/nvhost_nvdec_common.cpp:41:15: error: unused variable 'OutOfMemory' [-Werror,-Wunused-const-variable] constexpr u32 OutOfMemory{static_cast<u32>(-12)}; ^
* | | kernel/process: Add missing <ctime> includeMorph2020-10-291-0/+1
| | | | | | | | | | | | Fixes compilation on MSVC
* | | Merge pull request #4835 from lat9nq/rng-default-timebunnei2020-10-291-1/+1
|\ \ \ | |/ / |/| | kernel: Use the current time as the default RNG seed
| * | kernel: Use the current time as the default RNG seedlat9nq2020-10-271-1/+1
| | | | | | | | | | | | Use the current time, not zero, as the default RNG seed.
* | | Merge pull request #4846 from lioncash/service-fnbunnei2020-10-285-1/+7
|\ \ \ | | | | | | | | service: Update function tables
| * | | service: Update function tablesLioncash2020-10-285-1/+7
| | | | | | | | | | | | | | | | Updates function tables according to info on SwitchBrew.
* | | | hle/kernel: Remove unused registered_core_threads to fix data racesReinUsesLisp2020-10-271-5/+0
|/ / / | | | | | | | | | | | | This member was only used on asserts and it triggered data races. Remove it to fix them.
* | | Merge pull request #4729 from ameerj/nvdec-prodbunnei2020-10-2712-288/+475
|\ \ \ | | | | | | | | video_core: NVDEC Implementation
| * | | video_core: NVDEC Implementationameerj2020-10-2712-288/+475
| |/ / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This commit aims to implement the NVDEC (Nvidia Decoder) functionality, with video frame decoding being handled by the FFmpeg library. The process begins with Ioctl commands being sent to the NVDEC and VIC (Video Image Composer) emulated devices. These allocate the necessary GPU buffers for the frame data, along with providing information on the incoming video data. A Submit command then signals the GPU to process and decode the frame data. To decode the frame, the respective codec's header must be manually composed from the information provided by NVDEC, then sent with the raw frame data to the ffmpeg library. Currently, H264 and VP9 are supported, with VP9 having some minor artifacting issues related mainly to the reference frame composition in its uncompressed header. Async GPU is not properly implemented at the moment. Co-Authored-By: David <25727384+ogniK5377@users.noreply.github.com>
* | | Merge pull request #4832 from bunnei/cpu-manager-microprofile-fixbunnei2020-10-271-0/+2
|\ \ \ | | | | | | | | core: cpu_manager: Add missing call to MicroProfileOnThreadExit().
| * | | core: cpu_manager: Add missing call to MicroProfileOnThreadExit().bunnei2020-10-271-0/+2
| |/ / | | | | | | | | | - Fixes an occasional crash when trying to launch subsequent games.
* | | Merge pull request #4833 from bunnei/timezonemanager-explicitbunnei2020-10-271-1/+1
|\ \ \ | | | | | | | | hle: services: TimeZoneContentManager: This can be made explicit.
| * | | hle: services: TimeZoneContentManager: This can be made explicit.bunnei2020-10-271-1/+1
| |/ /
* | | Merge pull request #4834 from lioncash/copy-fnbunnei2020-10-272-3/+3
|\ \ \ | |/ / |/| | controller: Pass ControllerParameters by reference in ReconfigureControllers()
| * | controller: Pass ControllerParameters by reference in ReconfigureControllers()Lioncash2020-10-272-3/+3
| | | | | | | | | | | | Prevents unnecessary copies and heap reallocations from occurring.
* | | Merge pull request #4828 from lioncash/lockguardRodrigo Locatti2020-10-251-1/+1
|\| | | | | | | | general: Use template deduction guides for lock_guard
| * | general: Use template deduction guides for lock_guardLioncash2020-10-251-1/+1
| | | | | | | | | | | | Same behavior, less code.
* | | Merge pull request #4792 from bunnei/rtc-fixbunnei2020-10-238-189/+324
|\ \ \ | |/ / |/| | service: time: Update current time with changes to RTC setting.
| * | service: time: Update current time with changes to RTC setting.bunnei2020-10-138-189/+324
| | | | | | | | | | | | - This can be used to advance time, e.g. for Pokemon Sword/Shield pokejobs.
* | | core: Fix clang build pt.3Lioncash2020-10-223-14/+4
| | | | | | | | | | | | Should finally resolve building with clang.
* | | core: Fix clang build pt.2Lioncash2020-10-211-2/+5
| | | | | | | | | | | | Resolves the clang build issue in a more unintrusive way.
* | | Revert "core: Fix clang build"bunnei2020-10-2183-667/+483
| | |
* | | kernel: Fix build with recent compiler flag changesLioncash2020-10-211-4/+8
| | | | | | | | | | | | | | | This slipped through the cracks due to another change being merged before the compiler flag changes.
* | | Merge pull request #4796 from lioncash/clangLC2020-10-2183-483/+667
|\ \ \ | | | | | | | | core: Fix clang build
| * | | core: Fix clang buildLioncash2020-10-1883-483/+667
| | | | | | | | | | | | | | | | | | | | | | | | | | | | Recent changes to the build system that made more warnings be flagged as errors caused building via clang to break. Fixes #4795
* | | | Merge pull request #4390 from ogniK5377/get-applet-inf-stubbunnei2020-10-211-1/+11
|\ \ \ \ | | | | | | | | | | nifm: GetAppletInfo stub
| * | | | Added remaining paramsDavid Marcec2020-10-201-1/+4
| | | | |
| * | | | nifm: GetAppletInfo stubDavid Marcec2020-10-201-1/+8
| | | | | | | | | | | | | | | | | | | | Fixes crash for Catherine Full Body
* | | | | Merge pull request #4788 from ReinUsesLisp/lockfree-host-threadbunnei2020-10-201-28/+38
|\ \ \ \ \ | |/ / / / |/| | | | kernel: Implement host thread register methods without locking
| * | | | kernel: Implement host thread register methods without lockingReinUsesLisp2020-10-131-28/+38
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Locks on GetCurrentHostThreadID were causing performance issues according to Visual Studio's profiler. It was consuming twice the time as arm_interface.Run(). The cost was not in the function itself but in the lockinig it required. Reimplement these functions using atomics and static storage instead of an unordered_map. This is a side effect to avoid locking and using linked lists for reads. Replace unordered_map with a linear search.
* | | | | Merge pull request #4785 from Morph1984/fs-hadesbunnei2020-10-201-2/+3
|\ \ \ \ \ | | | | | | | | | | | | filesystem: Fix CreateDirectory and DeleteFile
| * | | | | filesystem: Fix CreateDirectory and DeleteFileMorph2020-10-131-2/+3
| |/ / / / | | | | | | | | | | | | | | | | | | | | | | | | | Add a check if dir is nullptr (does not exist) Fixes save game creation in Hades
* | | | | Merge pull request #4802 from lioncash/bcatbunnei2020-10-191-7/+7
|\ \ \ \ \ | | | | | | | | | | | | core: Add boxcat sources with target_sources
| * | | | | core: Add boxcat sources with target_sourcesLioncash2020-10-181-7/+7
| | | | | | | | | | | | | | | | | | | | | | | | Same behavior, minus a script variable.
* | | | | | Merge pull request #4783 from bunnei/nvdrv-freespacebunnei2020-10-182-0/+25
|\ \ \ \ \ \ | |/ / / / / |/| | | | | hle: service: nvdrv: Implement nvhost_as_gpu::FreeSpace.
| * | | | | hle: service: nvdrv: Implement nvhost_as_gpu::FreeSpace.bunnei2020-10-132-0/+25
| | |_|/ / | |/| | | | | | | | | | | | | - This is used by Super Mario 3D All-Stars.
* | | | | Merge pull request #4801 from lioncash/missing-boundbunnei2020-10-181-1/+1
|\ \ \ \ \ | | | | | | | | | | | | mii/manager: Make use of unused lower bound in GetRandomValue()
| * | | | | mii/manager: Make use of unused lower bound in GetRandomValue()Lioncash2020-10-171-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Previously, the lower bound wasn't being used and zero was being used as the lower bound every time this function was called. This affects the outcome of some of the randomized entries a little bit, for example, the lower-bound for beard and mustache flags was supposed to be 1, not 0. Aside from these cases, the bug didn't affect anything else.
* | | | | | service: bcat: Check client connection before interacting with socket.bunnei2020-10-171-0/+10
|/ / / / / | | | | | | | | | | | | | | | - Fixes a crash when BCAT service is offline.
* | | | | Merge pull request #4784 from bunnei/cancelbufferbunnei2020-10-163-14/+53
|\ \ \ \ \ | | | | | | | | | | | | hle: service: vi: Implement BufferQueue::CancelBuffer.
| * | | | | hle: service: vi: Implement BufferQueue::CancelBuffer.bunnei2020-10-143-14/+53
| | |_|/ / | |/| | | | | | | | | | | | | - This is used by Super Mario 3D All-Stars.
* / | | | service: acc: Stub IManagerForApplication::StoreOpenContext.bunnei2020-10-151-1/+7
|/ / / / | | | | | | | | | | | | - Used by Super Mario 3D All-Stars.
* | / / core/CMakeLists: Make some warnings errorsLioncash2020-10-1328-132/+133
| |/ / |/| | | | | | | | | | | | | | | | | | | | | | | Makes our error coverage a little more consistent across the board by applying it to Linux side of things as well. This also makes it more consistent with the warning settings in other libraries in the project. This also updates httplib to 0.7.9, as there are several warning cleanups made that allow us to enable several warnings as errors.
* | | Merge pull request #3929 from FearlessTobi/ticket-keysbunnei2020-10-132-32/+30
|\ \ \ | |/ / |/| | file_sys/nsp: Make SetTicketKeys actually do something
| * | file_sys/nsp: Make SetTicketKeys actually do somethingFearlessTobi2020-07-182-32/+30
| | | | | | | | | | | | | | | Previously, the method wasn't modifying any class state and therefore not having any effects when called. Since this has been the case for a very long time now, I'm not sure if we couldn't just remove this method altogether.
* | | Merge pull request #4736 from Morph1984/home-button-input-protection-stubbunnei2020-10-074-2/+50
|\ \ \ | | | | | | | | hid: Stub HomeButtonInputProtection service commands
| * | | hid: Stub HomeButtonInputProtection service commandsMorph2020-09-304-2/+50
| | | | | | | | | | | | | | | | - Used in 1-2 Switch. Given that we do not emulate the functionality of the home button yet, we can stub this for now.
* | | | Merge pull request #4710 from Morph1984/fix-integrated-updatesbunnei2020-10-071-3/+22
|\ \ \ \ | | | | | | | | | | submission_package: Fix updates integrated into cartridge images.
| * | | | submission_package: Fix updates integrated into cartridge images.Morph2020-09-241-3/+22
| | | | |
* | | | | Merge pull request #4737 from Morph1984/setshimlibraryversion-stubbunnei2020-10-075-4/+38
|\ \ \ \ \ | | | | | | | | | | | | capsrv: Stub 3 variants of SetShimLibraryVersion
| * | | | | caps_c: Stub SetShimLibraryVersionMorph2020-09-302-1/+18
| | | | | | | | | | | | | | | | | | | | | | | | - Used by caps_su SetShimLibraryVersion
| * | | | | caps_u: Stub SetShimLibraryVersionMorph2020-09-302-2/+14
| | | | | | | | | | | | | | | | | | | | | | | | - Used in Super Smash Bros. Ultimate
| * | | | | caps_su: Properly stub SetShimLibraryVersionMorph2020-09-301-1/+6
| | |/ / / | |/| | |
* | | | | Merge pull request #4742 from german77/InputFilterbunnei2020-10-061-49/+58
|\ \ \ \ \ | | | | | | | | | | | | HID: Only use inputs corresponding to controller type
| * | | | | Only use inputs corresponding to controller typegerman2020-10-021-49/+58
| | | | | |
* | | | | | Merge pull request #4734 from german77/motionfusionbunnei2020-10-022-1/+15
|\ \ \ \ \ \ | |/ / / / / |/| | | | | HID: Add Stub for EnableSixAxisSensorFusion
| * | | | | Stubbed EnableSixAxisSensorFusiongerman2020-09-302-1/+15
| | | | | |
* | | | | | Merge pull request #4291 from german77/ImplementControllerRumbleDavid2020-09-304-13/+25
|\ \ \ \ \ \ | | | | | | | | | | | | | | input_common: First implementation of controller rumble
| * | | | | | First implementation of controller rumblegerman2020-09-294-13/+25
| | | | | | |
* | | | | | | Merge pull request #4726 from lioncash/appletDavid2020-09-304-6/+15
|\ \ \ \ \ \ \ | |_|_|/ / / / |/| | | | | | frontend/controller: Eliminate dependency on the global system instance
| * | | | | | core: Mark GetInstance() as deprecatedLioncash2020-09-261-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This way it's obvious that this function shouldn't be used in any future code.
| * | | | | | frontend/controller: Eliminate dependency on the global system instanceLioncash2020-09-263-5/+14
| |/ / / / /
* | | | | | Merge pull request #4705 from german77/SplitMotionPollerbunnei2020-09-305-76/+157
|\ \ \ \ \ \ | |_|/ / / / |/| | | | | HID: Use different timing for motion
| * | | | | Use different timing for motiongerman2020-09-245-76/+157
| | | | | |
* | | | | | Merge pull request #1703 from DarkLordZach/nvdec-ioctlbunnei2020-09-304-3/+256
|\ \ \ \ \ \ | |_|/ / / / |/| | | | | nvdrv: Stub nvdec/vic ioctls to bypass nvdec movies
| * | | | | service: nvhost_vic: Ignore Submit commands.bunnei2020-06-052-1/+18
| | | | | |
| * | | | | nvdrv: Stub nvdec/vic ioctls to bypass nvdec moviesZach Hilman2020-06-054-3/+239
| | | | | |
* | | | | | Merge pull request #4717 from lioncash/debugLC2020-09-251-0/+17
|\ \ \ \ \ \ | |_|_|/ / / |/| | | | | service: Restore "unused" function
| * | | | | service: Restore "unused" functionLioncash2020-09-251-0/+17
| | | | | | | | | | | | | | | | | | | | | | | | Turns out this function is actually used, but within a trace log.
* | | | | | Merge pull request #4678 from Morph1984/LoadOpenContext-partial-implbunnei2020-09-243-1/+13
|\ \ \ \ \ \ | |_|_|/ / / |/| | | | | acc: Partially implement LoadOpenContext
| * | | | | acc: Stub LoadOpenContextMorph2020-09-213-1/+13
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This is used in multiple games such as: - Clubhouse Games: 51 Worldwide Classics - Grandia HD Collection - XCOM 2 Collection - Baldur's Gate 1/2 - Dr Kawashima's Brain Training - Super Mario 3D All-Stars
* | | | | | memory: Resolve a -Wdocumentation warningLioncash2020-09-231-1/+1
| |/ / / / |/| | | | | | | | | | | | | | memory doesn't exist as a parameter any more.
* | | | | General: Make use of std::nullopt where applicableLioncash2020-09-2210-27/+31
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Allows some implementations to avoid completely zeroing out the internal buffer of the optional, and instead only set the validity byte within the structure. This also makes it consistent how we return empty optionals.
* | | | | ips_layer: Eliminate a redundant copy in Parse()Lioncash2020-09-221-2/+4
| | | | | | | | | | | | | | | | | | | | Prevents unnecessary copying of the line being parsed.
* | | | | Merge pull request #4675 from Morph1984/fix-boot-multicontentbunnei2020-09-221-5/+5
|\ \ \ \ \ | |/ / / / |/| | | | submission_package: Account for multi-content NSPs
| * | | | submission_package: Account for multi-content NSPsMorph2020-09-181-5/+5
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Previously we assumed a submission package can only contain one Program NCA with a single TitleID. However, Super Mario 3D All-Stars contains four Program NCAs, each with their unique TitleIDs. This accounts for the existence of multi-content games such as this one. - Fixes booting Super Mario 3D All-Stars from the games list.
* | | | | Merge pull request #4683 from Morph1984/NpadHandheldActivationMode-implbunnei2020-09-203-5/+28
|\ \ \ \ \ | | | | | | | | | | | | hid: Implement Get/SetNpadHandheldActivationMode
| * | | | | hid: Implement Get/SetNpadHandheldActivationModeMorph2020-09-183-5/+28
| |/ / / / | | | | | | | | | | | | | | | - Used in Clubhouse Games: 51 Worldwide Classics
* | | | | Merge pull request #4643 from FearlessTobi/decrease-pad-update-intervalbunnei2020-09-191-1/+1
|\ \ \ \ \ | | | | | | | | | | | | Test: Decrease pad_update_ns
| * | | | | Test: Decrease pad_update_nsFearlessTobi2020-09-101-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | There have been reports of quite heavy input lag in the past. Compared to Citra for example, our pad_update_ns value is very high. So let's decrease it and see if it helps with this problem.
* | | | | | am: Stub GetPreviousProgramIndexMorph2020-09-182-1/+11
| | | | | | | | | | | | | | | | | | | | | | | | - Used in Super Mario 3D All-Stars
* | | | | | Merge pull request #4670 from lioncash/initializerRodrigo Locatti2020-09-171-2/+2
|\ \ \ \ \ \ | | | | | | | | | | | | | | arm_dynarmic_cp15: Initialize member variables
| * | | | | | arm_dynarmic_cp15: Initialize member variablesLioncash2020-09-171-2/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Ensures that the member variables are always initialized to a deterministic value on creation.
* | | | | | | Merge pull request #4665 from lioncash/sm-kernelRodrigo Locatti2020-09-173-9/+11
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | service/sm: Eliminate dependency on the global system instance
| * | | | | | | service/sm: Slightly more efficient string name validationLioncash2020-09-171-2/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | We can check the end of the string first for null-termination, rather than the beginning of the string.
| * | | | | | | service/sm: Eliminate dependency on the global system instanceLioncash2020-09-173-7/+9
| |/ / / / / /
* | | | | | | Merge pull request #4666 from lioncash/unused-funcRodrigo Locatti2020-09-171-22/+0
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | service: Remove unused funcation
| * | | | | | | service: Remove unused funcationLioncash2020-09-171-22/+0
| |/ / / / / / | | | | | | | | | | | | | | | | | | | | | This is now completely unused, so it can be removed.
* | | | | | | Merge pull request #4671 from lioncash/nfp-copyRodrigo Locatti2020-09-171-10/+13
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | command_generator/nfp: Eliminate unnecessary copies
| * | | | | | | nfp: Eliminate two unnecessary copiesLioncash2020-09-171-10/+13
| |/ / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | GetAmiiboBuffer() returns by const reference, so we can use a reference instead of taking the returned buffer by value.
* | | | | | | Merge pull request #4594 from german77/MotionHIDbunnei2020-09-176-19/+203
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | hid/configuration: Implement motion controls to HID
| * | | | | | | configure_input: Hook up the motion button and checkboxMorph2020-09-052-1/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This allows toggling motion on or off, and allows access to the motion configuration. Also changes the [waiting] text for motion buttons to Shake! as this is how motion is connected to a player.
| * | | | | | | Add cemu hook changes related to PR #4609german2020-09-051-2/+1
| | | | | | | |
| * | | | | | | Remove RealMotionDevicegerman2020-09-053-28/+16
| | | | | | | |
| * | | | | | | controllers/npad: Simplify motion entry assignmentMorph2020-09-051-29/+18
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Simplifies the motion assignment in the Dual Joycon entry and assigns index 1 of the motion entry (Motion 2) for the right joycon.
| * | | | | | | Include HID and configuration changes related to motiongerman2020-09-055-15/+222
| | | | | | | |
* | | | | | | | control_metadata: Resolve typo in Portuguese language nameLioncash2020-09-171-1/+1
| |/ / / / / / |/| | | | | | | | | | | | | | | | | | | | This isn't used anywhere, so this is a trivial fix.
* | | | | | | file_sys/romfs_factory: Eliminate usage of the global system accessorLioncash2020-09-175-34/+49
| | | | | | |
* | | | | | | file_sys/bis_factory: Eliminate usage of the global system accessorLioncash2020-09-175-11/+11
| | | | | | |
* | | | | | | loader/nso: Remove unnecessary [[maybe_unused]]Lioncash2020-09-171-2/+1
| | | | | | |
* | | | | | | core/loader: Remove dependencies on the global system instanceLioncash2020-09-1620-45/+85
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Now all that remains is: 18 instances in file_sys code 14 instances in GDB stub code (this can be tossed wholesale) 4 instances in HLE code 2 instances in settings code.
* | | | | | | Merge pull request #4658 from lioncash/copy3Rodrigo Locatti2020-09-162-44/+43
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | nca_patch: Reduce stack usage size within SearchBucketEntry()
| * | | | | | | nca_patch: Significantly reduce the stack usage size within SearchBucketEntry()Lioncash2020-09-151-4/+4
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Previously this function was using ~16KB of stack (16528 bytes), which was caused by the function arguments being taken by value rather than by reference. We can make this significantly lighter on the stack by taking them by reference.
| * | | | | | | nca_patch: Make SearchBucketEntry() internally linkedLioncash2020-09-152-44/+43
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This is only used internally and doesn't depend on any class state, so we can make it fully internal.
* | | | | | | | cheat_engine: Convert ExtractName into a non-template functionLioncash2020-09-151-19/+17
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | We don't need to create two separate instantiations of the same code, we can simply make the character template argument a regular function parameter.
* | | | | | | | cheat_engine: Remove unnecessary system argument to CheatParser's Parse functionLioncash2020-09-153-15/+9
|/ / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | This isn't used within the function at all in any implementations, so we can remove it entirely.
* | | | | | | patch_manager: Resolve implicit truncations in FormatTitleVersion()Lioncash2020-09-151-3/+4
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | We make it explicit that we're truncating arithmetic here to resolve compiler warnings (even if the sizes weren't u32/u64 arithmetic generally promotes to int :<)
* | | | | | | patch_manager: Make use of type aliasesLioncash2020-09-152-69/+79
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | We can use these to avoid typing the same type redundantly. This way, if these ever change, only a single location needs to be modified.
* | | | | | | patch_manager: Make a few functions internally linkedLioncash2020-09-152-15/+12
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | These functions are only used within this translation unit, so we can make them internally linked.
* | | | | | | crypto/key_manager: Remove dependency on the global system accessorLioncash2020-09-142-5/+8
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | We can supply the content provider as an argument instead of hardcoding a global accessor in the implementation.
* | | | | | | kernel: Remove all dependencies on the global system instanceLioncash2020-09-145-11/+20
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | With this, the kernel finally doesn't depend directly on the global system instance anymore.
* | | | | | | Merge pull request #4636 from lioncash/kernel-hlebunnei2020-09-143-7/+5
|\ \ \ \ \ \ \ | |_|_|/ / / / |/| | | | | | service: Remove two usages of the global system accessor
| * | | | | | service: Remove two usages of the global system accessorLioncash2020-09-073-7/+5
| | | | | | | | | | | | | | | | | | | | | | | | | | | | Removes more instances of reliance on global state.
* | | | | | | Merge pull request #4323 from ReinUsesLisp/no-spinbunnei2020-09-121-1/+1
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | kernel/scheduler: Use std::mutex instead of spin lock
| * | | | | | | kernel/scheduler: Use std::mutex instead of spin lockReinUsesLisp2020-07-131-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Profiling shows that this is a highly contested mutex, causing dimishing results compared to a OS lock. std::mutex implementations can spin for a while before falling back to an OS lock. This avoids wasting precious CPU cycles in a no-op.
* | | | | | | | Merge pull request #4634 from lioncash/blockingbunnei2020-09-123-19/+19
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | bsd: Resolve a few warnings
| * | | | | | | | bsd: Resolve unused value within SendToImplLioncash2020-09-071-0/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Previously the address provided to SendToImpl would never be propagated to SendTo(). This fixes that.
| * | | | | | | | bsd: Resolve sign comparison warningsLioncash2020-09-071-3/+3
| | | | | | | | |
| * | | | | | | | sockets_translate: Make use of designated initializersLioncash2020-09-071-12/+12
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Same behavior, less typing.
| * | | | | | | | blocking_worker: Make use of templated lambdaLioncash2020-09-071-3/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | We can simplify this a little by explicitly specifying the typename for the lambda function.
| * | | | | | | | blocking_worker: Resolve -Wdocumentation warningLioncash2020-09-071-1/+1
| | |/ / / / / / | |/| | | | | |
* | | | | | | | Merge pull request #4310 from ogniK5377/apollo-1-prodbunnei2020-09-111-72/+77
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | audio_core: Apollo Part 1, AudioRenderer refactor
| * | | | | | | | audio_core: Apollo Part 1, AudioRenderer refactorDavid Marcec2020-07-251-72/+77
| | | | | | | | |
* | | | | | | | | Merge pull request #4597 from Morph1984/mjolnir-p2bunnei2020-09-119-131/+548
|\ \ \ \ \ \ \ \ \ | |_|_|_|_|/ / / / |/| | | | | | | | Project Mjölnir: Part 2 - Controller Applet
| * | | | | | | | applets/controller: Resolve several compiler warningsMorph2020-09-041-1/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Resolves -Wsign-compare and -Wunused-variable
| * | | | | | | | Address feedbackMorph2020-09-043-0/+9
| | | | | | | | |
| * | | | | | | | applets/controller: Set min_players to have a minimum value of 1.Morph2020-09-041-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | - Some games like Shipped have a minimum requirement of 0 connected players and is undesired behavior. We must require a minimum of 1 player connected regardless of what games may ask.
| * | | | | | | | applets/controller: Modify heuristic to account for certain gamesMorph2020-09-041-7/+12
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Now left and right joycons have the same priority (meaning both needs to be supported by the game). Explanation of the new heuristic: Assign left joycons to even player indices and right joycons to odd player indices. We do this since Captain Toad Treasure Tracker expects a left joycon for Player 1 and a right Joycon for Player 2 in 2 Player Assist mode.
| * | | | | | | | applets/controller: Implement fallback applet for the SDL frontendMorph2020-09-043-90/+34
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Implement the fallback applet for the SDL frontend, connecting only the minimum amount of players required.
| * | | | | | | | applets/controller: Implement "Explain Text"Morph2020-09-043-16/+29
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | "Explain Text" is additional text that is shown for each player in the controller applet.
| * | | | | | | | Project Mjölnir: Part 2 - Controller AppletMorph2020-09-049-42/+487
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Co-authored-by: Its-Rei <kupfel@gmail.com>
* | | | | | | | | Merge pull request #4633 from ReinUsesLisp/gpu-initRodrigo Locatti2020-09-101-1/+0
|\ \ \ \ \ \ \ \ \ | |_|_|/ / / / / / |/| | | | | | | | video_core: Remove all Core::System references in renderer
| * | | | | | | | video_core: Remove all Core::System references in rendererReinUsesLisp2020-09-061-1/+0
| |/ / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Now that the GPU is initialized when video backends are initialized, it's no longer needed to query components once the game is running: it can be done when yuzu is booting. This allows us to pass components between constructors and in the process remove all Core::System references in the video backend.
* | | | | | | | Merge pull request #4397 from ReinUsesLisp/bsdbunnei2020-09-0610-56/+1387
|\ \ \ \ \ \ \ \ | |_|_|_|/ / / / |/| | | | | | | services: Implement most of bsd:s and GetCurrentIpAddress from nifm
| * | | | | | | service/bsd: Handle Poll with no entries accuratelyReinUsesLisp2020-07-281-0/+5
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Testing shows that Poll called with zero entries returns -1 and signals an errno of zero.
| * | | | | | | services/bsd: Implement most of bsd:sReinUsesLisp2020-07-285-55/+911
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This implements: Socket, Poll, Accept, Bind, Connect, GetPeerName, GetSockName, Listen, Fcntl, SetSockOpt, Shutdown, Recv, RecvFrom, Send, SendTo, Write, and Close The implementation was done referencing: SwIPC, switchbrew, testing with libnx and inspecting its code, general information about bsd sockets online, and analysing official software. Not everything from these service calls is implemented, but everything that is not implemented will be logged in some way.
| * | | | | | | service/sockets: Add worker pool abstractionReinUsesLisp2020-07-281-0/+30
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Manage worker threads with an easy to use abstraction. We can expand this to support thread deletion in the future.
| * | | | | | | service/sockets: Add worker abstraction to execute blocking calls asynchronouslyReinUsesLisp2020-07-282-0/+133
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This abstraction allows executing blocking functions (like recvfrom on a socket configured for blocking) without blocking the service thread. It is intended to be used with SleepClientThread.
| * | | | | | | service/sockets: Add translate functionsReinUsesLisp2020-07-283-0/+215
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | These functions translate from Network enumerations/structures to guest enumerations/structures and viceversa.
| * | | | | | | service/sockets: Add enumerations and structuresReinUsesLisp2020-07-282-0/+81
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Add guest enumerations and structures used in socket services
| * | | | | | | services/nifm: Implement GetCurrentIpAddressReinUsesLisp2020-07-281-1/+12
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This is trivially implemented using the Network abstraction - Used by ftpd
* | | | | | | | hid: Implement MergeSingleJoyasDualJoyMorph2020-09-043-5/+24
| |/ / / / / / |/| | | | | | | | | | | | | | | | | | | | - Used in multiple games such as Super Mario Odyssey.
* | | | | | | Merge pull request #4590 from ReinUsesLisp/tsan-schedbunnei2020-09-031-2/+6
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | hle/scheduler: Fix data race in is_context_switch_pending
| * | | | | | | hle/scheduler: Fix data race in is_context_switch_pendingReinUsesLisp2020-08-261-2/+6
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | As reported by tsan, SelectThreads could write to is_context_switch_pending holding a mutex while SwitchToCurrent reads it without holding any. It is assumed that the author didn't want an atomic here, so the code is reordered so that whenever is_context_switch_pending is read inside SwitchToContext, the mutex is locked.
* | | | | | | | file_sys/patch_manager: Add missing includeReinUsesLisp2020-09-031-0/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Fixes build issues
* | | | | | | | Merge pull request #4568 from lioncash/fspbunnei2020-09-031-3/+13
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | fsp_srv: Resolve -Wmaybe_uninitialized warning in OpenSaveDataFileSystem()
| * | | | | | | | fsp_srv: Resolve -Wunused-but-set-variable warningLioncash2020-08-231-1/+8
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | We can just log out the parameters in the meantime.
| * | | | | | | | fsp_srv: Resolve -Wmaybe_uninitialized warning in OpenSaveDataFileSystem()Lioncash2020-08-231-2/+5
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Initialize id to a deterministic value and also mark the unreachable cases in the switch with UNREACHABLE().
* | | | | | | | | Merge pull request #4564 from lioncash/file-includebunnei2020-09-0327-37/+66
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | file_sys: Replace inclusions with forward declarations where applicable
| * | | | | | | | | file_sys: Replace inclusions with forward declarations where applicableLioncash2020-08-2327-37/+66
| |/ / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | Same behavior, minus unnecessary inclusions where not necessary.
* | | | | | | | | Merge pull request #4382 from FearlessTobi/port-udp-configbunnei2020-09-014-3/+23
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | yuzu: Add motion and touch configuration from Citra
| * | | | | | | | | Address second batch of reviewsFearlessTobi2020-08-301-0/+1
| | | | | | | | | |
| * | | | | | | | | yuzu: Add motion and touch configurationFearlessTobi2020-08-293-3/+22
| | | | | | | | | |
* | | | | | | | | | Merge pull request #4589 from ReinUsesLisp/tsan-hostbunnei2020-09-011-1/+2
|\ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | hle/kernel: Fix data race in GetCurrentHostThreadID
| * | | | | | | | | | hle/kernel: Fix data race in GetCurrentHostThreadIDReinUsesLisp2020-08-261-1/+2
| | |_|/ / / / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | As reported by tsan, host_thread_ids could be read while any of the RegisterHostThread variants were called. To fix this, lock the register mutex when yuzu is running in multicore mode and GetCurrentHostThreadID is called.
* | | | | | | | | | Merge pull request #4461 from comex/thread-namesLC2020-08-311-1/+1
|\ \ \ \ \ \ \ \ \ \ | |_|/ / / / / / / / |/| | | | | | | | | Fix thread naming on Linux, which limits names to 15 bytes.
| * | | | | | | | | Fix thread naming on Linux, which limits names to 15 bytes.comex2020-08-061-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | - In `SetCurrentThreadName`, when on Linux, truncate to 15 bytes, as (at least on glibc) `pthread_set_name_np` will otherwise return `ERANGE` and do nothing. - Also, add logging in case `pthread_set_name_np` returns an error anyway. This is Linux-specific, as the Apple and BSD versions of `pthread_set_name_np return `void`. - Change the name for CPU threads in multi-core mode from "yuzu:CoreCPUThread_N" (19 bytes) to "yuzu:CPUCore_N" (14 bytes) so it fits into the Linux limit. Some other thread names are also cut off, but I didn't bother addressing them as you can guess them from the truncated versions. For a CPU thread, truncation means you can't see which core it is!
* | | | | | | | | | Merge pull request #4586 from yuzu-emu/tsan-cpu-interruptbunnei2020-08-282-5/+4
|\ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | cpu_interrupt_handler: Make is_interrupted an atomic
| * | | | | | | | | | cpu_interrupt_handler: Misc style changesReinUsesLisp2020-08-262-5/+3
| | | | | | | | | | |
| * | | | | | | | | | cpu_interrupt_handler: Make is_interrupted an atomicReinUsesLisp2020-08-262-2/+3
| | |/ / / / / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | Fixes a race condition detected from tsan
* | | | | | | | | | controllers/npad: Fix inconsistencies with controller connection statusesMorph2020-08-261-1/+7
| | | | | | | | | |
* | | | | | | | | | controllers/npad: Fix LibNX controller connection statusesMorph2020-08-261-1/+9
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This allows homebrew applications to be able to properly detect connected controllers.
* | | | | | | | | | controllers/npad: Fix LedPattern for P1-4Morph2020-08-261-3/+3
| | | | | | | | | |
* | | | | | | | | | Project Mjölnir: Part 1Morph2020-08-265-510/+117
|/ / / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Co-authored-by: James Rowe <jroweboy@gmail.com> Co-authored-by: Its-Rei <kupfel@gmail.com>
* | | | | | | | | Merge pull request #4563 from lioncash/rcachebunnei2020-08-251-17/+16
|\ \ \ \ \ \ \ \ \ | |_|_|_|_|_|_|_|/ |/| | | | | | | | registered_cache: Make use of designated initializers
| * | | | | | | | registered_cache: Make use of ends_with for string suffix checkingLioncash2020-08-231-2/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Simplifies code.
| * | | | | | | | registered_cache: Make use of designated initializersLioncash2020-08-231-15/+15
| | |/ / / / / / | |/| | | | | | | | | | | | | | | | | | | | | | Removes the need for comments to indicate the fields being assigned.
* | | | | | | | Merge pull request #4562 from lioncash/loopbunnei2020-08-241-16/+13
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | cpu_manager: Make use of ranged for where applicable
| * | | | | | | | cpu_manager: Make use of ranged for where applicableLioncash2020-08-231-16/+13
| |/ / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | We can simplify a few loops by making use of ranged for.
* | | | | | | | Merge pull request #4561 from lioncash/key-constexprbunnei2020-08-242-75/+82
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | key_manager: Make data arrays constexpr
| * | | | | | | | key_manager: Make data arrays constexprLioncash2020-08-232-75/+82
| |/ / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | We can convert these maps into constexpr arrays to eliminate some runtime static constructors.
* | | | | | | | Merge pull request #4549 from lioncash/filesbunnei2020-08-241-32/+48
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | vfs_real: Avoid redundant map lookups
| * | | | | | | | vfs_real: Resolve sign conversion warningsLioncash2020-08-181-2/+2
| | | | | | | | |
| * | | | | | | | vfs_real: Avoid redundant map lookupsLioncash2020-08-181-30/+46
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Avoids some trivially avoidable map lookups by keeping the result of find operations around and querying them.
* | | | | | | | | Merge pull request #4560 from lioncash/convertbunnei2020-08-233-8/+6
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | core_timing: Resolve sign conversion warning
| * | | | | | | | | core_timing: Remove unused headerLioncash2020-08-233-2/+2
| | | | | | | | | |
| * | | | | | | | | core_timing: Move clock initializer into constructor initializer listLioncash2020-08-231-4/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Same behavior, minus unnecessary zeroing out of the pointer.
| * | | | | | | | | core_timing: Resolve sign conversion warningLioncash2020-08-231-2/+2
| | |/ / / / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This constant is only ever assigned to downcount, which is a s64, not a u64.
* | | | | | | | | Merge pull request #4541 from MerryMage/yolobunnei2020-08-223-3/+29
|\ \ \ \ \ \ \ \ \ | |/ / / / / / / / |/| | | | | | | | dynarmic: Add unsafe optimizations
| * | | | | | | | dynarmic: Add unsafe optimizationsMerryMage2020-08-163-3/+29
| | | | | | | | |
* | | | | | | | | common/telemetry: Migrate namespace into the Common namespaceLioncash2020-08-183-8/+11
| |/ / / / / / / |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Migrates the Telemetry namespace into the Common namespace to make the code consistent with the rest of our common code.
* | | | | | | | Merge pull request #4535 from lioncash/fileutilbunnei2020-08-1820-320/+398
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | common/fileutil: Convert namespace to Common::FS
| * | | | | | | | common/fileutil: Convert namespace to Common::FSLioncash2020-08-1620-320/+398
| |/ / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Migrates a remaining common file over to the Common namespace, making it consistent with the rest of common files. This also allows for high-traffic FS related code to alias the filesystem function namespace as namespace FS = Common::FS; for more concise typing.
* | | | | | | | Merge pull request #4494 from lioncash/transcodebunnei2020-08-172-3/+3
|\ \ \ \ \ \ \ \ | |/ / / / / / / |/| | | | | | | aes_util: Make use of non-template variant of Transcode
| * | | | | | | partition_data_manager: Eliminate magic valueLioncash2020-08-061-2/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | We can use sizeof to make it obvious at the call site where the value is coming from.
| * | | | | | | aes_util: Make use of non-template variant of TranscodeLioncash2020-08-061-1/+1
| |/ / / / / / | | | | | | | | | | | | | | | | | | | | | Same behavior, less template instantiations.
* | | | | | | Merge pull request #4526 from lioncash/core-semibunnei2020-08-153-7/+12
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | core: Resolve several -Wextra-semi warnings
| * | | | | | | core: Resolve several -Wextra-semi warningsLioncash2020-08-143-7/+12
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | We can amend one of the cascade macros to require semicolons in order to compile. In other cases, we can just remove the superfluous semicolons.
* | | | | | | | Merge pull request #4527 from lioncash/pessimizing2bunnei2020-08-151-2/+1
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | software_keyboard: Resolve a pessimizing move warning
| * | | | | | | | software_keyboard: Resolve a pessimizing move warningLioncash2020-08-141-2/+1
| |/ / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | A std::vector created in place like this is already an rvalue and doesn't need to be moved.
* | | | | | | | Merge pull request #4492 from lioncash/linkagebunnei2020-08-152-15/+11
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | system_control: Make functions internally linked where applicable
| * | | | | | | | system_control: Make functions internally linked where applicableLioncash2020-08-052-15/+11
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | These functions are only ever used internally as implementation details for GenerateRandomRange(), so these can be given internal linkage.
* | | | | | | | | Merge pull request #4463 from lioncash/lockdiscardbunnei2020-08-152-3/+3
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | kernel/scheduler: Mark SchedulerLock constructor as nodiscard
| * | | | | | | | | emu_window: Mark Scoped constructor and Acquire() as nodiscardLioncash2020-08-141-2/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Ensures that callers make use of the constructor, preventing bugs from silently occurring.
| * | | | | | | | | kernel/scheduler: Mark SchedulerLock constructor as nodiscardLioncash2020-08-141-1/+1
| | |/ / / / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Allows the compiler to warn about cases where the constructor is used but then immediately discarded, which is a potential cause of locking/unlocking bugs.
* / | | | | | | | time_zone_content_manager: Collapse auto and default caseLioncash2020-08-141-3/+1
|/ / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | Prevents a useless self-assignment from occurring.
* | | | | | | | Merge pull request #4495 from lioncash/convRodrigo Locatti2020-08-141-1/+1
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | cheat_engine: Resolve implicit bool->u64 conversion
| * | | | | | | | cheat_engine: Resolve implicit bool->u64 conversionLioncash2020-08-061-1/+1
| | |/ / / / / / | |/| | | | | | | | | | | | | | | | | | | | | | We can just return zero here.
* | | | | | | | Merge pull request #4511 from lioncash/build2LC2020-08-137-43/+52
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | General: Tidy up clang-format warnings part 2
| * | | | | | | | General: Tidy up clang-format warnings part 2Lioncash2020-08-137-43/+52
| | | | | | | | |
* | | | | | | | | Merge pull request #4497 from lioncash/freezer-algbunnei2020-08-122-16/+22
|\ \ \ \ \ \ \ \ \ | |/ / / / / / / / |/| | | | | | | | freezer: Make use of std::erase_if
| * | | | | | | | freezer: Move entry finding to its own functionLioncash2020-08-062-12/+21
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Cleans up the callsites in other functions.
| * | | | | | | | freezer: Take address values by valueLioncash2020-08-061-3/+3
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | VAddr will always be 64-bit, so there's no need to take a trivial primitive alias by reference.
| * | | | | | | | freezer: Make use of std::erase_ifLioncash2020-08-061-4/+1
| |/ / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | With C++20 we can simplify the erasing idiom.
* | | | | | | | Merge pull request #4496 from lioncash/ce-desigbunnei2020-08-101-6/+18
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | cheat_engine: Make use of designated initializers
| * | | | | | | | cheat_engine: Make use of designated initializersLioncash2020-08-061-6/+18
| |/ / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | Same behavior, but makes the member being assigned obvious.
* | | | | | | | Merge pull request #4491 from lioncash/unused-varsbunnei2020-08-102-18/+11
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | kernel: Remove unused variables
| * | | | | | | | kernel: Remove unused variablesLioncash2020-08-052-18/+11
| | |/ / / / / / | |/| | | | | | | | | | | | | | | | | | | | | | Resolves a few compiler warnings.
* | | | | | | | Merge pull request #4488 from lioncash/filebunnei2020-08-094-41/+41
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | vfs_vector: Make creation of array vfs files less verbose
| * | | | | | | | vfs_vector: Make creation of array vfs files less verboseLioncash2020-08-054-41/+41
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | We can add a helper function to make creation of these files nicer. While we're at it, we can eliminate an unnecessary std::array copy in the constructor. This makes the overhead on some of these functions way less intensive, given some arrays were quite large. e.g. The timezone location names are 9633 bytes in size.
* | | | | | | | | Merge pull request #4457 from ogniK5377/SetScreenShotPermissionbunnei2020-08-072-1/+12
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | am: Unstub SetScreenShotPermission
| * | | | | | | | | am: Unstub SetScreenShotPermissionDavid Marcec2020-07-312-1/+12
| | | | | | | | | |
* | | | | | | | | | common/concepts: Rename IsBaseOf to DerivedFromLioncash2020-08-072-2/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This makes it more inline with its currently unavailable standardized analogue std::derived_from. While we're at it, we can also make the template match the requirements of the standardized variant as well.
* | | | | | | | | | Merge pull request #4483 from lioncash/constexpr-hexbunnei2020-08-072-98/+118
|\ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | partition_data_manager: Make data arrays constexpr
| * | | | | | | | | | partition_data_manager: Update master key hashesLioncash2020-08-061-5/+5
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Fills in some hashes that were previously unhandled.
| * | | | | | | | | | partition_data_manager: Make data arrays constexprLioncash2020-08-062-98/+118
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Previously the constructor for all of these would run at program startup, consuming time before the application can enter main(). This is also particularly dangerous, given the logging system wouldn't have been initialized properly yet, yet the program would use the logs to signify an error. To rectify this, we can replace the literals with constexpr functions that perform the conversion at compile-time, completely eliminating the runtime cost of initializing these arrays.
* | | | | | | | | | | Merge pull request #4490 from lioncash/arbiterbunnei2020-08-072-2/+3
|\ \ \ \ \ \ \ \ \ \ \ | |_|_|_|_|/ / / / / / |/| | | | | | | | | | address_arbiter/scheduler: Resolve sign conversion warnings
| * | | | | | | | | | scheduler: Resolve sign conversion warningLioncash2020-08-051-1/+2
| | | | | | | | | | |
| * | | | | | | | | | address_arbiter: Resolve sign conversion warningLioncash2020-08-051-1/+1
| | |_|_|/ / / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | Makes our type conversion explicit.
* | | | | | | | | | Merge pull request #4489 from lioncash/typesafebunnei2020-08-061-0/+4
|\ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | ipc_helpers: Only allow trivially copyable objects with PushRaw() and PopRaw()
| * | | | | | | | | | ipc_helpers: Only allow trivially copyable objects with PushRaw() and PopRaw()Lioncash2020-08-051-0/+4
| |/ / / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | It's undefined behavior to use non-trivially copyable objects with std::memcpy, so we can add asserts to catch usages of these at compile-time.
* | | | | | | | | | Merge pull request #4484 from lioncash/aesutilbunnei2020-08-067-27/+36
|\ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | aes_util: Allow SetIV() to be non-allocating
| * | | | | | | | | | aes_util: Allow SetIV to be non-allocatingLioncash2020-08-037-27/+36
| | |/ / / / / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | In a few places, the data to be set as the IV is already within an array. We shouldn't require this data to be heap-allocated if it doesn't need to be. This allows certain callers to reduce heap churn.
* | | | | | | | | | Merge pull request #4475 from lioncash/bqueuebunnei2020-08-051-10/+11
|\ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | buffer_queue: Make use of designated initializers/std::nullopt where applicable
| * | | | | | | | | | buffer_queue: Make use of std::nulloptLioncash2020-08-031-5/+6
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Allows compilers to eliminate unnecessary zeroing out of the optional's buffer.
| * | | | | | | | | | buffer_queue: Make use of designated initializersLioncash2020-08-031-5/+5
| | |_|_|_|/ / / / / | |/| | | | | | | |
* | | | | | | | | | Merge pull request #4444 from lioncash/volatilebunnei2020-08-051-6/+4
|\ \ \ \ \ \ \ \ \ \ | |_|_|/ / / / / / / |/| | | | | | | | | common/atomic_ops: Don't cast away volatile from pointers
| * | | | | | | | | common/atomic_ops: Don't cast away volatile from pointersLioncash2020-07-281-6/+4
| |/ / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | Preserves the volatility of the pointers being casted.
* | | | | | | | | Merge pull request #4466 from ogniK5377/loader-type-safebunnei2020-08-051-18/+34
|\ \ \ \ \ \ \ \ \ | |_|_|_|/ / / / / |/| | | | | | | | loader: Make IdentifyFile typesafe
| * | | | | | | | Place in anonymous namespaceDavid Marcec2020-08-031-0/+4
| | | | | | | | |
| * | | | | | | | loader: Make IdentifyFile typesafeDavid Marcec2020-08-031-20/+32
| | |/ / / / / / | |/| | | | | | | | | | | | | | | | | | | | | | Relies on #4465 for concept.h Common::IsBaseOf
* | | | | | | | Merge pull request #4476 from lioncash/tzbunnei2020-08-051-17/+25
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | time_zone_binary: Make use of designated initializers
| * | | | | | | | time_zone_binary: Make use of designated initializersLioncash2020-08-031-17/+25
| |/ / / / / / /
* | | | | | | | Merge pull request #4401 from ogniK5377/GetIndirectLayerImageRequiredMemoryInfobunnei2020-08-051-1/+19
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | vi: IApplicationDisplayService:GetIndirectLayerImageRequiredMemoryInfo
| * | | | | | | | vi: IApplicationDisplayService:GetIndirectLayerImageRequiredMemoryInfoDavid Marcec2020-07-211-1/+19
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Needed for dark souls and monster hunter
* | | | | | | | | Merge pull request #4430 from bunnei/new-gpu-vmmbunnei2020-08-054-93/+227
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | hle: nvdrv: Rewrite of GPU memory management.
| * | | | | | | | | Update src/core/hle/service/nvdrv/devices/nvmap.cppbunnei2020-07-281-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Co-authored-by: LC <mathew1800@gmail.com>
| * | | | | | | | | hle: nvdrv: Rewrite of GPU memory management.bunnei2020-07-264-93/+227
| | | | | | | | | |
* | | | | | | | | | Merge pull request #4472 from lioncash/const-getbunnei2020-08-042-15/+16
|\ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | perf_stats: Mark GetMeanFrametime() as const
| * | | | | | | | | | perf_stats: Make use of designated initializersLioncash2020-08-031-6/+7
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Same behavior, but allows us to avoid a now-unnecessary zero initialization.
| * | | | | | | | | | perf_stats: Mark GetMeanFrametime() as constLioncash2020-08-032-9/+9
| | |_|_|/ / / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The general pattern is to mark mutexes as mutable when it comes to matters of constness, given the mutex acts as a transient member of a data structure.
* | | | | | | | | | Merge pull request #4470 from lioncash/qualifierDavid2020-08-041-2/+2
|\ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | patch_manager: Resolve -Wignored-qualifier warnings
| * | | | | | | | | | patch_manager: Resolve -Wignored-qualifier warningsLioncash2020-08-031-2/+2
| |/ / / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Top level const will always be ignored in this case, so it can be removed.
* | | | | | | | | | Merge pull request #4481 from lioncash/cpp-depDavid2020-08-043-21/+21
|\ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | yuzu: Resolve C++20 deprecation warnings related to lambda captures
| * | | | | | | | | | yuzu: Resolve C++20 deprecation warnings related to lambda capturesLioncash2020-08-033-21/+21
| | |_|_|/ / / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | C++20 deprecates capturing the this pointer via the '=' capture. Instead, we replace it or extend the capture specification.
* | | | | | | | | | Merge pull request #4474 from lioncash/hle-profileDavid2020-08-041-17/+26
|\ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | profile_manager: Make use of designated initializers
| * | | | | | | | | | profile_manager: Make use of std::nulloptLioncash2020-08-031-4/+4
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Allows some implementations to completely avoid unnecessarily zeroing out the internal buffer.
| * | | | | | | | | | profile_manager: Make use of designated initializersLioncash2020-08-031-13/+22
| | |/ / / / / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | More compact code.
* | | | | | | | | | Merge pull request #4473 from lioncash/cheat-desigbunnei2020-08-041-105/+121
|\ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | dmnt_cheat_vm: Make use of designated initializers
| * | | | | | | | | | dmnt_cheat_vm: Make use of designated initializersLioncash2020-08-031-105/+121
| |/ / / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Allows for more compact code.
* | | | | | | | | | Merge pull request #4456 from Morph1984/stub-really-long-fs-funcbunnei2020-08-047-63/+120
|\ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | fsp-srv: Stub Read/WriteSaveDataFileSystemExtraDataWithMaskBySaveDataAttribute
| * | | | | | | | | | minor nitsMorph2020-07-311-1/+3
| | | | | | | | | | |
| * | | | | | | | | | fsp-srv: Stub Read/WriteSaveDataFileSystemExtraDataWithMaskBySaveDataAttributeMorph2020-07-302-23/+56
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Stub these 2 service commands required for Animal Crossing: New Horizons Update 1.4.0
| * | | | | | | | | | fs: Rename SaveDataDescriptor to SaveDataAttributeMorph2020-07-305-41/+63
| | |_|_|_|/ / / / / | |/| | | | | | | |
* | | | | | | | | | Merge pull request #4482 from lioncash/ldr-signbunnei2020-08-031-3/+2
|\ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | service/ldr: Resolve sign mismatch warnings
| * | | | | | | | | | service/ldr: Resolve sign mismatch warningsLioncash2020-08-031-3/+2
| | |_|/ / / / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | We were performing an int < size_t comparison. We can just correct the type of the induction variable.
* | | | | | | | | | Merge pull request #4468 from lioncash/regcachebunnei2020-08-031-10/+15
|\ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | registered_cache: Resolve -Wmaybe_uninitialized warnings
| * | | | | | | | | | registered_cache: Resolve -Wmaybe_uninitialized warningsLioncash2020-08-031-10/+15
| | |_|/ / / / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | While we're at it, we can avoid a redundant map lookup.
* | | | | | | | | | Merge pull request #4471 from ogniK5377/sm-getservice-conceptbunnei2020-08-031-3/+2
|\ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | sm: Make use of IsBaseOf for GetService
| * | | | | | | | | | sm: Make use of IsBaseOf for GetServiceDavid Marcec2020-08-031-3/+2
| | |/ / / / / / / / | |/| | | | | | | |
* | | | | | | | | | Merge pull request #4467 from lioncash/modebunnei2020-08-032-18/+21
|\ \ \ \ \ \ \ \ \ \ | |/ / / / / / / / / |/| | | | | | | | | file_sys/mode: Make use of DECLARE_ENUM_FLAG_OPERATORS with Mode
| * | | | | | | | | file_sys/mode: Make use of DECLARE_ENUM_FLAG_OPERATORS with ModeLioncash2020-08-032-18/+21
| |/ / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | Same behavior, minus a hand-rolled operator.
* | | | | | | | | ipc: Allow all trivially copyable objects to be passed directly into WriteBuffer (#4465)David2020-08-039-30/+30
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * ipc: Allow all trivially copyable objects to be passed directly into WriteBuffer With the support of C++20, we can use concepts to deduce if a type is an STL container or not. * More agressive concept for stl containers * Add -fconcepts * Move to common namespace * Add Common::IsBaseOf
* | | | | | | | | Merge pull request #4439 from lioncash/cpuDavid2020-08-031-3/+3
|\ \ \ \ \ \ \ \ \ | |_|/ / / / / / / |/| | | | | | | | cpu_manager: Remove redundant std::function declarations
| * | | | | | | | cpu_manager: Remove redundant std::function declarationsLioncash2020-07-281-3/+3
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | We can just return the function directly. Making for less reading.
* | | | | | | | | xts_archive: Check if the file is nullptr prior to parsingMorph2020-07-291-5/+9
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Fixes an access violation where the file no longer exists at the specified path while being parsed.
* | | | | | | | | registered_cache: Add support for removing folder ncasMorph2020-07-292-53/+54
| | | | | | | | |
* | | | | | | | | Merge pull request #4442 from lioncash/devicemembunnei2020-07-283-11/+4
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | device_memory: Remove unused system member
| * | | | | | | | | device_memory: Remove unused system memberLioncash2020-07-283-11/+4
| |/ / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | This isn't used by anything in particular, so it can be removed.
* | / / / / / / / configure_graphics: Remove Force 30 FPS modeMorph2020-07-282-2/+0
| |/ / / / / / / |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The introduction of multicore rendered this setting non-functional as timing code was changed. This removes the setting entirely.
* | | | | | | | core_timing: Make use of uintptr_t to represent user_dataLioncash2020-07-2813-38/+46
|/ / / / / / / | | | | | | | | | | | | | | | | | | | | | Makes the interface future-proofed for supporting other platforms in the event we ever support platforms with differing pointer sizes. This way, we have a type in place that is always guaranteed to be able to represent a pointer exactly.
* | | | | | | remove unused variable;CrazyMax2020-07-271-1/+0
| | | | | | |
* | | | | | | nvflinger: Mark interface functions with return values as [[nodiscard]]Lioncash2020-07-261-16/+14
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Not using the return value of these functions are undeniably the source of a bug. This way we allow compilers to loudly make any future misuses evident.
* | | | | | | nvflinger: Use return value of Lock()Lioncash2020-07-263-4/+4
|/ / / / / / | | | | | | | | | | | | | | | | | | | | | | | | comex reported in #4424 that we were incorrectly discarding the return value of Lock() which is correct.
* | | | | | Merge pull request #4350 from ogniK5377/hid-update-connectedbunnei2020-07-252-33/+37
|\ \ \ \ \ \ | | | | | | | | | | | | | | hid: Only update keyboard & debug pad inputs if enabled
| * | | | | | hid: Only update keyboard & debug pad inputs if enabledDavid Marcec2020-07-162-33/+37
| | | | | | | | | | | | | | | | | | | | | | | | | | | | Previously we would ignore this setting and would update the states regardless of the user setting
* | | | | | | Merge pull request #4380 from ogniK5377/swkbd-inline-1bunnei2020-07-252-13/+49
|\ \ \ \ \ \ \ | |_|_|/ / / / |/| | | | | | swkbd: Return result for Calc request for inlined swkbd
| * | | | | | Address issuesDavid Marcec2020-07-201-2/+2
| | | | | | |
| * | | | | | swkbd: Return result for Calc request for inlined swkbdDavid Marcec2020-07-192-13/+49
| | | | | | | | | | | | | | | | | | | | | | | | | | | | Fixes random swkbd popups in monster hunter
* | | | | | | network: add missing include for BSDsJan Beich2020-07-231-0/+2
| |_|/ / / / |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | src/core/network/network.cpp:112:28: error: use of undeclared identifier 'SHUT_RD' constexpr int SD_RECEIVE = SHUT_RD; ^ src/core/network/network.cpp:113:25: error: use of undeclared identifier 'SHUT_WR' constexpr int SD_SEND = SHUT_WR; ^ src/core/network/network.cpp:114:25: error: use of undeclared identifier 'SHUT_RDWR' constexpr int SD_BOTH = SHUT_RDWR; ^ src/core/network/network.cpp:120:37: error: unknown type name 'in_addr'; did you mean 'in_addr_t'? constexpr IPv4Address TranslateIPv4(in_addr addr) { ^~~~~~~ in_addr_t /usr/include/netdb.h:66:20: note: 'in_addr_t' declared here typedef __uint32_t in_addr_t; ^ src/core/network/network.cpp:121:27: error: member reference base type 'in_addr_t' (aka 'unsigned int') is not a structure or union const u32 bytes = addr.s_addr; ~~~~^~~~~~~ src/core/network/network.cpp:121:15: error: variables defined in a constexpr function must be initialized const u32 bytes = addr.s_addr; ^ src/core/network/network.cpp:126:10: error: incomplete result type 'sockaddr' in function definition sockaddr TranslateFromSockAddrIn(SockAddrIn input) { ^ /usr/include/netdb.h:142:9: note: forward declaration of 'sockaddr' struct sockaddr *ai_addr; /* binary address */ ^ src/core/network/network.cpp:127:5: error: unknown type name 'sockaddr_in'; did you mean 'sockaddr'? sockaddr_in result; ^~~~~~~~~~~ sockaddr /usr/include/netdb.h:142:9: note: 'sockaddr' declared here struct sockaddr *ai_addr; /* binary address */ ^ src/core/network/network.cpp:127:17: error: variable has incomplete type 'sockaddr' sockaddr_in result; ^ /usr/include/netdb.h:142:9: note: forward declaration of 'sockaddr' struct sockaddr *ai_addr; /* binary address */ ^ src/core/network/network.cpp:131:29: error: use of undeclared identifier 'AF_INET' result.sin_family = AF_INET; ^ src/core/network/network.cpp:135:29: error: use of undeclared identifier 'AF_INET' result.sin_family = AF_INET; ^ src/core/network/network.cpp:139:23: error: use of undeclared identifier 'htons' result.sin_port = htons(input.portno); ^ src/core/network/network.cpp:143:14: error: variable has incomplete type 'sockaddr' sockaddr addr; ^ /usr/include/netdb.h:142:9: note: forward declaration of 'sockaddr' struct sockaddr *ai_addr; /* binary address */ ^ src/core/network/network.cpp:156:1: error: unknown type name 'linger' linger MakeLinger(bool enable, u32 linger_value) { ^ src/core/network/network.cpp:157:5: error: unknown type name 'linger' linger value; ^ src/core/network/network.cpp:185:16: error: use of undeclared identifier 'AF_INET' return AF_INET; ^ src/core/network/network.cpp:195:16: error: use of undeclared identifier 'SOCK_STREAM' return SOCK_STREAM; ^ src/core/network/network.cpp:197:16: error: use of undeclared identifier 'SOCK_DGRAM' return SOCK_DGRAM; ^ src/core/network/network.cpp:207:16: error: use of undeclared identifier 'IPPROTO_TCP' return IPPROTO_TCP; ^ fatal error: too many errors emitted, stopping now [-ferror-limit=]
* | | | | | Merge pull request #4306 from ReinUsesLisp/bsd-networkDavid2020-07-215-0/+840
|\ \ \ \ \ \ | |/ / / / / |/| | | | | core/network: Add network abstraction
| * | | | | core/network: Add network abstractionReinUsesLisp2020-07-195-0/+840
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This commit adds a network abstraction designed to implement bsd:s but at the same time work as a generic abstraction to implement any networking code we have to use from core. This is implemented on top of BSD sockets on Unix systems and winsock on Windows. The code is designed around winsocks having compatibility definitions to support both BSD and Windows sockets.
* | | | | | Merge pull request #4348 from lioncash/nanobunnei2020-07-1813-71/+80
|\ \ \ \ \ \ | | | | | | | | | | | | | | core_timing: Make usage of nanoseconds more consistent in the interface
| * | | | | | core_timing: Remove unused data memberLioncash2020-07-161-2/+0
| | | | | | | | | | | | | | | | | | | | | | | | | | | | Shrinks the size of the CoreTiming class by 8 bytes.
| * | | | | | core_timing: Make TimedCallback take std::chrono::nanosecondsLioncash2020-07-1613-44/+45
| | | | | | | | | | | | | | | | | | | | | | | | | | | | Enforces our desired time units directly with a concrete type.
| * | | | | | core_timing: Make use of std::chrono with ScheduleEventLioncash2020-07-1610-32/+42
| | | | | | |
* | | | | | | Merge pull request #4345 from Morph1984/fix-createfilebunnei2020-07-181-0/+4
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | filesystem: Create subdirectories prior to creating a file
| * | | | | | | Add comment to clarify the nullptr checkMorph2020-07-161-0/+1
| | | | | | | |
| * | | | | | | filesystem: Create subdirectories prior to creating a fileMorph2020-07-161-0/+3
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | If subdirectories exist in the given path parameter and don't exist in the real filesystem create them prior to creating the files within. This fixes the softlocks upon save creation in The Legend of Zelda: Breath of the Wild
* | | | | | | | Merge pull request #4273 from ogniK5377/async-shaders-prodbunnei2020-07-183-0/+5
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | video_core: Add asynchronous shader decompilation and compilation
| * | | | | | | | Drop settings namespaceDavid Marcec2020-07-171-2/+1
| | | | | | | | |
| * | | | | | | | Rebase for per game settingsDavid Marcec2020-07-173-0/+6
| | |_|/ / / / / | |/| | | | | |
* | | | | | | | Merge pull request #4365 from lioncash/miibunnei2020-07-181-53/+54
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | mii/manager: Make use of designated initializers
| * | | | | | | | mii/manager: Make use of designated initializersLioncash2020-07-171-53/+54
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Allows returning the structure in a more concise manner.
* | | | | | | | | Merge pull request #4366 from lioncash/mii-signbunnei2020-07-181-3/+3
|\ \ \ \ \ \ \ \ \ | |_|_|_|_|_|_|_|/ |/| | | | | | | | mii/manager: Resolve sign mismatch warnings
| * | | | | | | | mii/manager: Resolve sign mismatch warningsLioncash2020-07-171-3/+3
| |/ / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Previously the loop termination condition was testing variables of different signedness.
* | | | | | | | Merge pull request #4344 from VolcaEM/c3bunnei2020-07-172-1/+42
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | dmnt_cheat_vm: Implement opcode 0xC3 (ReadWriteStaticRegister)
| * | | | | | | | clang-formatVolcaEM2020-07-151-1/+2
| | | | | | | | |
| * | | | | | | | dmnt_cheat_vm: Implement opcode 0xC3 (ReadWriteStaticRegister)VolcaEM2020-07-152-1/+41
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This was based on Atmosphére's DMNT Cheat VM: - https://github.com/Atmosphere-NX/Atmosphere/blob/master/stratosphere/dmnt/source/cheat/impl/dmnt_cheat_vm.hpp - https://github.com/Atmosphere-NX/Atmosphere/blob/master/stratosphere/dmnt/source/cheat/impl/dmnt_cheat_vm.cpp From Atmosphére's documentation: "Code type 0xC3 reads or writes a static register with a given register" There are now only two remaining opcodes to implement (PauseProcess and BreakProcess) This is untested because I don't have any experience in testing cheats on yuzu
* | | | | | | | | Merge pull request #4309 from Morph1984/fix-romfs-bugbunnei2020-07-174-10/+10
|\ \ \ \ \ \ \ \ \ | |_|_|/ / / / / / |/| | | | | | | | fs: Fix RomFS building when zero byte files are present
| * | | | | | | | fs: Fix RomFS building when zero byte files are presentMorph2020-07-124-10/+10
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | When zero byte files are present, the key (offset) for that file is identical to the file right after. A std::map isn't able to fit key-value pairs with identical keys (offsets), therefore, the solution is to use std::multimap which permits multiple entries with the same key. This most prominently fixes Pokemon Sword and Shield weather with any RomFS mod applied.
* | | | | | | | | Merge pull request #4347 from lioncash/loggingDavid2020-07-171-38/+39
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | settings: Make use of std::string_view over std::string for logging
| * | | | | | | | | settings: Resolve a sign conversion warning within GetTimeZoneString()Lioncash2020-07-151-5/+5
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | A sign conversion warning was occurring due to an int < size_t comparison.
| * | | | | | | | | settings: Make use of std::string_view over std::string for loggingLioncash2020-07-151-33/+34
| | |_|_|_|/ / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | In all usages of LogSetting(), string literals are provided. std::string_view is better suited here, as we won't churn a bunch of string allocations every time the settings are logged out. While we're at it, we can fold LogSetting() into LogSettings(), given it's only ever used there.
* | | | | | | | | Merge pull request #4371 from lioncash/cmake2David2020-07-171-0/+1
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | core/CMakeLists: Add missing physical_memory.h header file
| * | | | | | | | | core/CMakeLists: Add missing physical_memory.h header fileLioncash2020-07-171-0/+1
| | |_|_|/ / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | Allows this header file to show up in IDE CMake generators.
* | | | | | | | | Merge pull request #4357 from lioncash/unused4David2020-07-173-7/+2
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | kernel: Remove unused variables
| * | | | | | | | | kernel: Remove unused variablesLioncash2020-07-163-7/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Resolves some compiler warnings in the Linux build.
* | | | | | | | | | Merge pull request #4358 from lioncash/unused5David2020-07-171-2/+0
|\ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | kernel/thread: Remove unimplemented function prototype
| * | | | | | | | | | kernel/thread: Remove unimplemented function prototypeLioncash2020-07-161-2/+0
| |/ / / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This isn't used, so it can be removed.
* | / / / / / / / / constants: Add missing <array> includeLioncash2020-07-171-0/+1
| |/ / / / / / / / |/| | | | | | | | | | | | | | | | | | | | | | | | | | Eliminates reliance on an indirect include.
* | | | | | | | | Merge pull request #4292 from bunnei/mii-rewritebunnei2020-07-179-914/+3270
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | hle: service: mii: Rewrite service to properly support creation of random and default miis.
| * | | | | | | | | hle: service: mii: Rewrite service to properly support creation of random and default miis.bunnei2020-07-129-914/+3270
| | | | | | | | | |
* | | | | | | | | | Merge pull request #4327 from lioncash/desig2Rodrigo Locatti2020-07-162-58/+38
|\ \ \ \ \ \ \ \ \ \ | |_|/ / / / / / / / |/| | | | | | | | | address_space_info: Make use of designated initializers
| * | | | | | | | | address_space_info: Use type alias to simplify codeLioncash2020-07-131-14/+13
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | We can define an alias for the index arrays and then just reuse it to make the code nicer to read.
| * | | | | | | | | address_space_info: Make use of designated initializersLioncash2020-07-132-46/+27
| | |_|_|_|_|_|/ / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | We can alter the structure so that we can use designated initializers in the array, eliminating the comments that indicate their field names.
* | | | | | | | | kernel: Add missing includeLioncash2020-07-161-0/+1
| | | | | | | | |
* | | | | | | | | cpu_manager: Mark function getters as staticLioncash2020-07-164-10/+11
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | All these do are return std::function instances of static functions, so these can be used without an instance of the CPU manager.
* | | | | | | | | cpu_manager: Remove unused preemption_count variableLioncash2020-07-161-1/+0
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Shrinks the data structure by 8 bytes.
* | | | | | | | | cpu_manager: Add missing includesLioncash2020-07-161-0/+3
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Previously this header was relying on indirect inclusions that are no longer satisfied.
* | | | | | | | | Merge pull request #4337 from lat9nq/fix-per-game-asyncbunnei2020-07-162-0/+8
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | main: Set async gpu properly after loading per-game setting
| * | | | | | | | | clang-formatlat9nq2020-07-141-2/+1
| | | | | | | | | |
| * | | | | | | | | settings: Move settings sanitization to its own functionlat9nq2020-07-142-0/+9
| |/ / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | Creates a new function that can be expanded later to fix other settings that are known to cause emulation errors across executables.
* | | | | | | | | Merge pull request #4346 from lioncash/threadDavid2020-07-167-35/+26
|\ \ \ \ \ \ \ \ \ | |_|_|_|_|_|_|/ / |/| | | | | | | | kernel/handle_table: Remove usages of the global system instance
| * | | | | | | | kernel/process: Move name and system context to the bottom of the member listLioncash2020-07-151-6/+6
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | These aren't directly important or commonly used within the process, so we can move these to the bottom to allow everything else to be more likely to be within a cache line.
| * | | | | | | | kernel/handle_table: Remove usages of the global system instanceLioncash2020-07-154-8/+15
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Removes even more usages of the global system instance, trimming away more dependencies on global variables and making them explicit in the interface.
| * | | | | | | | kernel/thread: Remove global GetCurrentThread()Lioncash2020-07-153-23/+7
| | |_|/ / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This is only used in one place, so we can fold it into the calling code, eliminating a place for the global system instance to be used.
* | | | | | | | Merge pull request #4249 from Morph1984/delete-update-aoc-on-overwriteDavid2020-07-162-10/+92
|\ \ \ \ \ \ \ \ | |_|_|_|_|_|/ / |/| | | | | | | registered_cache: Remove previous update/dlc if it exists on install
| * | | | | | | Check for empty section0 and CNMT prior to installMorph2020-07-161-3/+19
| | | | | | | |
| * | | | | | | clang formatMorph2020-07-151-3/+3
| | | | | | | |
| * | | | | | | Use proper install result when overwriting filesMorph2020-07-151-1/+1
| | | | | | | |
| * | | | | | | Remove global system instance and address feedbackMorph2020-07-152-14/+10
| | | | | | | |
| * | | | | | | registered_cache: Remove previous update/dlc if it exists on installMorph2020-07-152-13/+83
| |/ / / / / / | | | | | | | | | | | | | | | | | | | | | - This checks for and removes old updates or dlc based on title id. If a content meta nca exists within the registered cache, it will attempt to remove all the ncas associated with the content meta before installing a new update/dlc
* | | | | | | Merge pull request #4328 from lioncash/unused-var3bunnei2020-07-161-2/+0
|\ \ \ \ \ \ \ | |/ / / / / / |/| | | | | | memory_layout: Remove unused data member
| * | | | | | memory_layout: Remove unused data memberLioncash2020-07-131-2/+0
| |/ / / / / | | | | | | | | | | | | | | | | | | | | | | | | This isn't used, so it can be removed entirely, shrinking the structure size by 8 bytes.
* | | | | | Merge pull request #4294 from MerryMage/cpu-opt-settingsbunnei2020-07-143-11/+71
|\ \ \ \ \ \ | | | | | | | | | | | | | | configuration: Add settings to enable/disable specific CPU optimizations
| * | | | | | configure_cpu: Show/Hide debugging optionsMerryMage2020-07-113-46/+57
| | | | | | |
| * | | | | | configuration: Add settings to enable/disable specific CPU optimizationsMerryMage2020-07-113-11/+60
| | |_|_|/ / | |/| | | |
* | | | | | Merge pull request #4282 from Morph1984/fs-sizebunnei2020-07-143-40/+16
|\ \ \ \ \ \ | |_|/ / / / |/| | | | | filesystem: Set various NAND partition sizes to their defaults
| * | | | | bis_factory: Set User NAND free space to be 1 MiB less than total.Morph2020-07-101-1/+3
| | | | | |
| * | | | | sdmc_factory: Set the SDMC total size to 1 TiBMorph2020-07-101-1/+3
| | | | | | | | | | | | | | | | | | | | | | | | We should not be limited by the SDMC's partition size, set this to 1 TiB. Hardware is limited to the max allowed by the MBR partition table which is 2 TiB.
| * | | | | bis_factory: Use hardware default NAND partition sizesMorph2020-07-101-10/+11
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Sets the total space of user and system partitions to their hardware defaults. Furthermore, return the total space as free space for the user partition to prevent it from reaching zero. Some games like Bioshock 2 check for the available free space prior to save creation, and we should not be limited by arbitrary limits.
| * | | | | settings: Remove storage size optionsMorph2020-07-101-29/+0
| | | | | |
* | | | | | Merge pull request #4265 from Morph1984/file-renameFernando Sahmkow2020-07-121-10/+17
|\ \ \ \ \ \ | |_|_|_|/ / |/| | | | | vfs_real: Fix MoveFile
| * | | | | vfs_real: Fix MoveFileMorph2020-07-101-10/+17
| |/ / / / | | | | | | | | | | | | | | | | | | | | | | | | | The file wasn't closed prior to being renamed / moved, throwing an error that states "The process cannot access the file because it is being used by another process." Fix this by closing the file prior to a rename / move operation. Fixes saving in Luigi's Mansion 3 and KATANA KAMI: A Way of the Samurai Story.
* | | | | Merge pull request #4275 from CrazyMax/desired_languagebunnei2020-07-121-1/+13
|\ \ \ \ \ | |_|/ / / |/| | | | AM: fix GetDesiredLanguage:
| * | | | AM: fix GetDesiredLanguage:CrazyMax2020-07-081-1/+13
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | try to get a control metadata from application update when is failed to get from the basic version. Tested on Kirby Star Allies
* | | | | Merge pull request #4203 from VolcaEM/servicesbunnei2020-07-1126-154/+282
|\ \ \ \ \ | |_|_|/ / |/| | | | service: Update function tables
| * | | | Rename two functions in NSVolcaEM2020-07-021-2/+2
| | | | | | | | | | | | | | | | | | | | - Rename "GetShellEvent" to "GetShellEventHandle" - Rename "LaunchApplicationFromHost" to "LaunchApplication"
| * | | | Rename GetApplicationArea2 to GetApplicationAreaSizeVolcaEM2020-07-021-2/+2
| | | | |
| * | | | Remove duplicate functionsVolcaEM2020-06-291-2/+0
| | | | |
| * | | | Use decimal instead of hexadecimalVolcaEM2020-06-291-3/+5
| | | | | | | | | | | | | | | Co-authored-by: David <25727384+ogniK5377@users.noreply.github.com>
| * | | | Fix typoVolcaEM2020-06-291-1/+1
| | | | |
| * | | | Clang-formatVolcaEM2020-06-291-1/+1
| | | | |
| * | | | service: Update function tablesVolcaEM2020-06-2927-157/+285
| | | | |
* | | | | KeyManager: Prevent writing of invalid keysMorph2020-07-101-4/+8
| |_|/ / |/| | | | | | | | | | | If the keys are zero, don't write them to the autogenerated file.
* | | | configuration: implement per-game configurations (#4098)lat9nq2020-07-1012-103/+190
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * Switch game settings to use a pointer In order to add full per-game settings, we need to be able to tell yuzu to switch to using either the global or game configuration. Using a pointer makes it easier to switch. * configuration: add new UI without changing existing funcitonality The new UI also adds General, System, Graphics, Advanced Graphics, and Audio tabs, but as yet they do nothing. This commit keeps yuzu to the same functionality as originally branched. * configuration: Rename files These weren't included in the last commit. Now they are. * configuration: setup global configuration checkbox Global config checkbox now enables/disables the appropriate tabs in the game properties dialog. The use global configuration setting is now saved to the config, defaulting to true. This also addresses some changes requested in the PR. * configuration: swap to per-game config memory for properties dialog Does not set memory going in-game. Swaps to game values when opening the properties dialog, then swaps back when closing it. Uses a `memcpy` to swap. Also implements saving config files, limited to certain groups of configurations so as to not risk setting unsafe configurations. * configuration: change config interfaces to use config-specific pointers When a game is booted, we need to be able to open the configuration dialogs without changing the settings pointer in the game's emualtion. A new pointer specific to just the configuration dialogs can be used to separate changes to just those config dialogs without affecting the emulation. * configuration: boot a game using per-game settings Swaps values where needed to boot a game. * configuration: user correct config during emulation Creates a new pointer specifically for modifying the configuration while emulation is in progress. Both the regular configuration dialog and the game properties dialog now use the pointer Settings::config_values to focus edits to the correct struct. * settings: split Settings::values into two different structs By splitting the settings into two mutually exclusive structs, it becomes easier, as a developer, to determine how to use the Settings structs after per-game configurations is merged. Other benefits include only duplicating the required settings in memory. * settings: move use_docked_mode to Controls group `use_docked_mode` is set in the input settings and cannot be accessed from the system settings. Grouping it with system settings causes it to be saved with per-game settings, which may make transferring configs more difficult later on, especially since docked mode cannot be set from within the game properties dialog. * configuration: Fix the other yuzu executables and a regression In main.cpp, we have to get the title ID before the ROM is loaded, else the renderer will reflect only the global settings and now the user's game specific settings. * settings: use a template to duplicate memory for each setting Replaces the type of each variable in the Settings::Values struct with a new class that allows basic data reading and writing. The new struct Settings::Setting duplicates the data in memory and can manage global overrides per each setting. * configuration: correct add-ons config and swap settings when apropriate Any add-ons interaction happens directly through the global values struct. Swapping bewteen structs now also includes copying the necessary global configs that cannot be changed nor saved in per-game settings. General and System config menus now update based on whether it is viewing the global or per-game settings. * settings: restore old values struct No longer needed with the Settings::Setting class template. * configuration: implement hierarchical game properties dialog This sets the apropriate global or local data in each setting. * clang format * clang format take 2 can the docker container save this? * address comments and style issues * config: read and write settings with global awareness Adds new functions to read and write settings while keeping the global state in focus. Files now generated per-game are much smaller since often they only need address the global state. * settings: restore global state when necessary Upon closing a game or the game properties dialog, we need to restore all global settings to the original global state so that we can properly open the configuration dialog or boot a different game. * configuration: guard setting values incorrectly This disables setting values while a game is running if the setting is overwritten by a per game setting. * config: don't write local settings in the global config Simple guards to prevent writing the wrong settings in the wrong files. * configuration: add comments, assume less, and clang format No longer assumes that a disabled UI element means the global state is turned off, instead opting to directly answer that question. Still however assumes a game is running if it is in that state. * configuration: fix a logic error Should not be negated * restore settings' global state regardless of accept/cancel Fixes loading a properties dialog and causing the global config dialog to show local settings. * fix more logic errors Fixed the frame limit would set the global setting from the game properties dialog. Also strengthened the Settings::Setting member variables and simplified the logic in config reading (ReadSettingGlobal). * fix another logic error In my efforts to guard RestoreGlobalState, I accidentally negated the IsPowered condition. * configure_audio: set toggle_stretched_audio to tristate * fixed custom rtc and rng seed overwriting the global value * clang format * rebased * clang format take 4 * address my own review Basically revert unintended changes * settings: literal instead of casting "No need to cast, use 1U instead" Thanks, Morph! Co-authored-by: Morph <39850852+Morph1984@users.noreply.github.com> * Revert "settings: literal instead of casting " This reverts commit 95e992a87c898f3e882ffdb415bb0ef9f80f613f. * main: fix status buttons reporting wrong settings after stop emulation * settings: Log UseDockedMode in the Controls group This should have happened when use_docked_mode was moved over to the controls group internally. This just reflects this in the log. * main: load settings if the file has a title id In other words, don't exit if the loader has trouble getting a title id. * use a zero * settings: initalize resolution factor with constructor instead of casting * Revert "settings: initalize resolution factor with constructor instead of casting" This reverts commit 54c35ecb46a29953842614620f9b7de1aa9d5dc8. * configure_graphics: guard device selector when Vulkan is global Prevents the user from editing the device selector if Vulkan is the global renderer backend. Also resets the vulkan_device variable when the users switches back-and-forth between global and Vulkan. * address reviewer concerns Changes function variables to const wherever they don't need to be changed. Sets Settings::Setting to final as it should not be inherited from. Sets ConfigurationShared::use_global_text to static. Co-Authored-By: VolcaEM <volcaem@users.noreply.github.com> * main: load per-game settings after LoadROM This prevents `Restart Emulation` from restoring the global settings *after* the per-game settings were applied. Thanks to BSoDGamingYT for finding this bug. * Revert "main: load per-game settings after LoadROM" This reverts commit 9d0d48c52d2dcf3bfb1806cc8fa7d5a271a8a804. * main: only restore global settings when necessary Loading the per-game settings cannot happen after the ROM is loaded, so we have to specify when to restore the global state. Again thanks to BSoD for finding the bug. * configuration_shared: address reviewer concerns except operator overrides Dropping operator override usage in next commit. Co-Authored-By: LC <lioncash@users.noreply.github.com> * settings: Drop operator overrides from Setting template Requires using GetValue and SetValue explicitly. Also reverts a change that broke title ID formatting in the game properties dialog. * complete rebase * configuration_shared: translate "Use global configuration" Uses ConfigurePerGame to do so, since its usage, at least as of now, corresponds with ConfigurationShared. * configure_per_game: address reviewer concern As far as I understand, it prevents the program from unnecessarily copying strings. Co-Authored-By: LC <lioncash@users.noreply.github.com> Co-authored-by: Morph <39850852+Morph1984@users.noreply.github.com> Co-authored-by: VolcaEM <volcaem@users.noreply.github.com> Co-authored-by: LC <lioncash@users.noreply.github.com>
* | | | Merge pull request #4248 from Morph1984/CreateManagedDisplaySeparableLayerbunnei2020-07-102-1/+20
|\ \ \ \ | | | | | | | | | | AM/ISelfController: Stub CreateManagedDisplaySeparableLayer
| * | | | AM/ISelfController: Stub CreateManagedDisplaySeparableLayerMorph2020-07-052-1/+20
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Stub this by sending 1 layer id instead of 2 as yuzu does not support multiple layers per display. No adverse side effects have been observed. - Used by Animal Crossing: New Horizons Update 1.3.0
* | | | | Merge pull request #4202 from ReinUsesLisp/scoped-lockbunnei2020-07-092-15/+12
|\ \ \ \ \ | |_|_|/ / |/| | | | core_timing,scheduler: Use std::scoped_lock when possible
| * | | | core_timing,scheduler: Use std::scoped_lock when possibleReinUsesLisp2020-06-292-15/+12
| | | | | | | | | | | | | | | | | | | | | | | | | Simplifies the cognitive load of procedures using locks and makes locks safe against exceptions.
* | | | | Merge pull request #4243 from CrazyMax/display_versionbunnei2020-07-081-4/+16
|\ \ \ \ \ | | | | | | | | | | | | AM: fix GetDisplayVersion
| * | | | | GetDisplayVersion should return a null-terminated version string.CrazyMax2020-07-071-4/+16
| | |/ / / | |/| | | | | | | | | | | | | also, in case of failed to get of the basic version, we will try get it from application update.
* | | | | Merge pull request #4245 from MerryMage/page-table-racebunnei2020-07-081-2/+5
|\ \ \ \ \ | | | | | | | | | | | | memory: Race-condition in pagetables.
| * | | | | memory: Set page-table pointers before setting attribute = MemoryMerryMage2020-07-051-2/+5
| |/ / / /
* / / / / cpu_interrupt_handler: Remove #pragma once from .cpp fileMerryMage2020-07-071-2/+0
|/ / / /
* | | | Merge pull request #4218 from ogniK5377/opus-externalRodrigo Locatti2020-07-041-1/+1
|\ \ \ \ | | | | | | | | | | externals: Track opus as submodule instead of using conan
| * | | | externals: Track opus as submodule instead of using conanDavid Marcec2020-07-011-1/+1
| | | | | | | | | | | | | | | | | | | | Supersedes #4068 see for details.
* | | | | Merge pull request #3924 from ogniK5377/GetKeyCodeMapbunnei2020-07-032-2/+72
|\ \ \ \ \ | | | | | | | | | | | | Implement GetKeyCodeMap & GetKeyCodeMap2
| * | | | | Move GetKeyCodeMapImpl to an anonymous namespaceDavid Marcec2020-06-241-19/+19
| | | | | |
| * | | | | Fixed logging outputDavid Marcec2020-06-241-1/+1
| | | | | |
| * | | | | Implement GetKeyCodeMap & GetKeyCodeMap2David Marcec2020-06-242-2/+72
| | | | | | | | | | | | | | | | | | | | | | | | Closes #3919
* | | | | | Merge pull request #4193 from ogniK5377/GetIndirectLayerConsumerHandle-stubbunnei2020-07-031-1/+13
|\ \ \ \ \ \ | | | | | | | | | | | | | | am: Stub GetIndirectLayerConsumerHandle
| * | | | | | am: Stub GetIndirectLayerConsumerHandleDavid Marcec2020-06-281-1/+13
| | | | | | | | | | | | | | | | | | | | | | | | | | | | Needed by Monster Hunter Generations Ultimate
* | | | | | | Merge pull request #4192 from ogniK5377/acc-ListOpenContextStoredUsers-stubbunnei2020-07-035-4/+14
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | acc: ListOpenContextStoredUsers partial stub
| * | | | | | | acc: ListOpenContextStoredUsers partial stubDavid Marcec2020-06-285-4/+14
| |/ / / / / / | | | | | | | | | | | | | | | | | | | | | Needed by Baldur's Gate 1/2
* | | | | | | key_manager: Correct casing of instance()Lioncash2020-07-019-9/+9
| | | | | | | | | | | | | | | | | | | | | | | | | | | | Our codebase uppercases member function names.
* | | | | | | key_manager: Delete move operationsLioncash2020-07-011-0/+3
| | | | | | | | | | | | | | | | | | | | | | | | | | | | Prevents the singleton from being moved from.
* | | | | | | key_manager: Make use of canonical deleted operator=Lioncash2020-07-011-2/+2
| |_|/ / / / |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | operator= typically returns a reference, it's not void. While we're at it, we can correct the parameter formatting to adhere to the codebase.
* | | | | | Merge pull request #3967 from FearlessTobi/keys-singletonDavid2020-07-0112-20/+26
|\ \ \ \ \ \ | | | | | | | | | | | | | | crypto: Make KeyManager a singleton class
| * | | | | | crypto: Make KeyManager a singleton classFearlessTobi2020-05-2012-20/+26
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Previously, we were reading the keys everytime a KeyManager object was created, causing yuzu to reread the keys file multiple hundreds of times when loading the game list. With this change, it is only loaded once. On my system, this decreased game list loading times by a factor of 20.
* | | | | | | Merge pull request #4153 from ogniK5377/prepo-multibufbunnei2020-07-011-1/+6
|\ \ \ \ \ \ \ | |_|_|_|/ / / |/| | | | | | prepo: : Don't read extra buffer from report unless passed
| * | | | | | prepo: : Don't read extra buffer from report unless passedDavid Marcec2020-06-241-1/+6
| | | | | | | | | | | | | | | | | | | | | | | | | | | | Prepo doesn't always pass a secondary buffer, we assume it always does which leads to a bad read.
* | | | | | | Merge pull request #3955 from FernandoS27/prometheus-2bbunnei2020-06-2879-1983/+3502
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | Remake Kernel Scheduling, CPU Management & Boot Management (Prometheus)
| * | | | | | | Core/Common: Address Feedback.Fernando Sahmkow2020-06-2816-45/+44
| | | | | | | |
| * | | | | | | NvFlinger: Clang Format.Fernando Sahmkow2020-06-271-1/+1
| | | | | | | |
| * | | | | | | SVC: Implement 32-bits wrappers and update Dynarmic.Fernando Sahmkow2020-06-274-34/+282
| | | | | | | |
| * | | | | | | SVC: Add GetCurrentProcessorNumber32, CreateTransferMemory32, SetMemoryAttribute32Fernando Sahmkow2020-06-272-6/+39
| | | | | | | |
| * | | | | | | ARM: Update Dynarmic and Setup A32 according to latest interface.Fernando Sahmkow2020-06-278-93/+174
| | | | | | | |
| * | | | | | | SVC: Add GetThreadPriority32 & SetThreadPriority32Fernando Sahmkow2020-06-272-2/+30
| | | | | | | |
| * | | | | | | ArmDynarmic32: Setup CNTPCT correctlyFernando Sahmkow2020-06-271-1/+1
| | | | | | | |
| * | | | | | | Audio: Correct buffer release for host timing.Fernando Sahmkow2020-06-271-0/+5
| | | | | | | |
| * | | | | | | Common/Kernel: Corrections and small bug fixing.Fernando Sahmkow2020-06-271-2/+2
| | | | | | | |
| * | | | | | | Services/NvFlinger: Do vSync in a sepparate thread on Multicore.Fernando Sahmkow2020-06-274-5/+69
| | | | | | | |
| * | | | | | | ARMDynarmicInterface: Correct GCC Build Errors.Fernando Sahmkow2020-06-272-6/+6
| | | | | | | |
| * | | | | | | Kernel: Correct Host Context on Threads and Scheduler.Fernando Sahmkow2020-06-274-11/+11
| | | | | | | |
| * | | | | | | Clang Format.Fernando Sahmkow2020-06-277-18/+15
| | | | | | | |
| * | | | | | | ARMInterface/Externals: Update dynarmic and fit to latest version.Fernando Sahmkow2020-06-271-7/+7
| | | | | | | |
| * | | | | | | ARMInterface: Correct rebase errors.Fernando Sahmkow2020-06-273-5/+5
| | | | | | | |
| * | | | | | | CoreTiming: Correct rebase bugs and other miscellaneous things.Fernando Sahmkow2020-06-271-0/+2
| | | | | | | |
| * | | | | | | Core: Split Microprofile Dynarmic timing per CoreFernando Sahmkow2020-06-271-3/+12
| | | | | | | |
| * | | | | | | General: Tune the priority of main emulation threads so they have higher priority than less important helper threads.Fernando Sahmkow2020-06-272-0/+2
| | | | | | | |
| * | | | | | | Dynarmic Interface: don't clear cache if JIT has not been created.Fernando Sahmkow2020-06-272-0/+6
| | | | | | | |
| * | | | | | | General: Correct rebase, sync gpu and context management.Fernando Sahmkow2020-06-273-18/+3
| | | | | | | |
| * | | | | | | CoreTiming/CycleTimer: Correct Idling.Fernando Sahmkow2020-06-271-2/+5
| | | | | | | |
| * | | | | | | SingleCore: Correct ticks reset to be on preemption.Fernando Sahmkow2020-06-271-1/+1
| | | | | | | |
| * | | | | | | General: Cleanup legacy code.Fernando Sahmkow2020-06-2717-739/+6
| | | | | | | |
| * | | | | | | Kernel/svcBreak: Implement CacheInvalidation for Singlecore and correct svcBreak.Fernando Sahmkow2020-06-272-3/+13
| | | | | | | |
| * | | | | | | Bootmanager/CPU_Manager: Correct shader caches and sync GPU on OpenGL.Fernando Sahmkow2020-06-271-6/+9
| | | | | | | |
| * | | | | | | HLE_IPC: Correct HLE Event behavior on timeout.Fernando Sahmkow2020-06-273-1/+19
| | | | | | | |
| * | | | | | | SingleCore: Improve Cycle timing Behavior and replace mutex in global scheduler for spinlock.Fernando Sahmkow2020-06-273-2/+4
| | | | | | | |
| * | | | | | | FrameLimiting: Enable frame limiting for single core.Fernando Sahmkow2020-06-272-1/+2
| | | | | | | |
| * | | | | | | SingleCore: Use Cycle Timing instead of Host Timing.Fernando Sahmkow2020-06-2715-80/+152
| | | | | | | |
| * | | | | | | Scheduler: Correct Reload/UnloadFernando Sahmkow2020-06-272-3/+5
| | | | | | | |
| * | | | | | | Thread: Release the ARM Interface on exitting.Fernando Sahmkow2020-06-273-1/+8
| | | | | | | |
| * | | | | | | General: Move ARM_Interface into Threads.Fernando Sahmkow2020-06-2718-170/+136
| | | | | | | |
| * | | | | | | Core: Refactor ARM Interface.Fernando Sahmkow2020-06-2710-42/+69
| | | | | | | |
| * | | | | | | X64 Clock: Reduce accuracy to be less or equal to guest accuracy.Fernando Sahmkow2020-06-271-0/+3
| | | | | | | |
| * | | | | | | ARM/WaitTree: Better track the CallStack for each thread.Fernando Sahmkow2020-06-272-0/+60
| | | | | | | |
| * | | | | | | SVC/ARM: Correct svcSendSyncRequest and cache ticks on arm interface.Fernando Sahmkow2020-06-273-5/+20
| | | | | | | |
| * | | | | | | SingleCore: Move Host Timing from a sepparate thread to main cpu thread.Fernando Sahmkow2020-06-277-10/+48
| | | | | | | |
| * | | | | | | GUI: Make multicore only work with Async and add GUI for multicore.Fernando Sahmkow2020-06-273-2/+34
| | | | | | | |
| * | | | | | | ARM: Addapt to new Exclusive Monitor Interface.Fernando Sahmkow2020-06-275-31/+24
| | | | | | | |
| * | | | | | | CPU_Manager: Correct stopping on SingleCore.Fernando Sahmkow2020-06-271-3/+8
| | | | | | | |
| * | | | | | | Scheduler: Correct yielding interaction with SetThreadActivity.Fernando Sahmkow2020-06-271-0/+15
| | | | | | | |
| * | | | | | | General: Fix microprofile on dynarmic/svc, fix wait tree showing which threads were running.Fernando Sahmkow2020-06-2710-11/+77
| | | | | | | |
| * | | | | | | General: Fix Stop functionFernando Sahmkow2020-06-273-3/+21
| | | | | | | |
| * | | | | | | Kernel: Rewind on SVC change.Fernando Sahmkow2020-06-273-5/+16
| | | | | | | |
| * | | | | | | Kernel: Preempt Single core on redudant yields.Fernando Sahmkow2020-06-276-21/+42
| | | | | | | |
| * | | | | | | CPU_Manager: Unload/Reload threads on preemption on SingleCoreFernando Sahmkow2020-06-274-7/+64
| | | | | | | |
| * | | | | | | Synchronization: Correct wide Assertion.Fernando Sahmkow2020-06-271-2/+4
| | | | | | | |
| * | | | | | | General: Initial Setup for Single Core.Fernando Sahmkow2020-06-276-34/+215
| | | | | | | |
| * | | | | | | Scheduler: Set last running time on thread.Fernando Sahmkow2020-06-272-4/+2
| | | | | | | |
| * | | | | | | Kernel: Corrections to TimeManager, Scheduler and Mutex.Fernando Sahmkow2020-06-273-5/+5
| | | | | | | |
| * | | | | | | Kernel: Fixes, corrections and asserts to scheduler and different svcs.Fernando Sahmkow2020-06-278-38/+38
| | | | | | | |
| * | | | | | | Scheduler: Correct yields.Fernando Sahmkow2020-06-272-7/+25
| | | | | | | |
| * | | | | | | Mutex: Revert workaround due to poor exclusive memory.Fernando Sahmkow2020-06-271-9/+2
| | | | | | | |
| * | | | | | | ARM/Memory: Correct Exclusive Monitor and Implement Exclusive Memory Writes.Fernando Sahmkow2020-06-279-24/+236
| | | | | | | |
| * | | | | | | SVC: WaitSynchronization add Termination Pending Result.Fernando Sahmkow2020-06-272-1/+5
| | | | | | | |
| * | | | | | | Scheduler: Remove arm_interface lock and a few corrections.Fernando Sahmkow2020-06-272-17/+3
| | | | | | | |
| * | | | | | | SVC: Correct SetThreadActivity.Fernando Sahmkow2020-06-274-38/+59
| | | | | | | |
| * | | | | | | SCC: Small corrections to CancelSynchronizationFernando Sahmkow2020-06-273-2/+14
| | | | | | | |
| * | | | | | | Scheduler: Correct locking for hle threads.Fernando Sahmkow2020-06-271-1/+2
| | | | | | | |
| * | | | | | | Scheduler: Fix HLE Threads on guardFernando Sahmkow2020-06-271-4/+6
| | | | | | | |
| * | | | | | | Scheduler: Protect on closed threads.Fernando Sahmkow2020-06-271-7/+17
| | | | | | | |
| * | | | | | | Scheduler: Correct assert.Fernando Sahmkow2020-06-271-4/+2
| | | | | | | |
| * | | | | | | Core: Correct rebase.Fernando Sahmkow2020-06-272-18/+11
| | | | | | | |
| * | | | | | | Scheduler: Release old thread fiber before trying to switch to the next thread fiber.Fernando Sahmkow2020-06-272-11/+35
| | | | | | | |
| * | | | | | | NVDRV: Remove frame limiting as Host Timing already takes care.Fernando Sahmkow2020-06-271-1/+0
| | | | | | | |
| * | | | | | | Mutex: Correct Result writting to clear exclusivity.Fernando Sahmkow2020-06-271-3/+11
| | | | | | | |
| * | | | | | | SVC: Correct svcWaitForAddress and svcSignalToAddress.Fernando Sahmkow2020-06-274-68/+161
| | | | | | | |
| * | | | | | | Scheduler: Correct Select Threads Step 2.Fernando Sahmkow2020-06-271-0/+1
| | | | | | | |
| * | | | | | | Kernel: Corrections to Scheduling.Fernando Sahmkow2020-06-275-19/+23
| | | | | | | |
| * | | | | | | Kernel: Correct Signal on Thread Death and Setup Sync Objects on Thread for DebuggingFernando Sahmkow2020-06-273-15/+17
| | | | | | | |
| * | | | | | | Core: Correct HLE Event Callbacks and other issues.Fernando Sahmkow2020-06-275-37/+39
| | | | | | | |
| * | | | | | | Process: Protect TLS region and Modules.Fernando Sahmkow2020-06-271-0/+4
| | | | | | | |
| * | | | | | | General: Add AssertsFernando Sahmkow2020-06-274-0/+24
| | | | | | | |
| * | | | | | | General: Add better safety for JIT use.Fernando Sahmkow2020-06-275-7/+39
| | | | | | | |
| * | | | | | | SVC: Correct races on physical core switching.Fernando Sahmkow2020-06-272-10/+10
| | | | | | | |
| * | | | | | | NVFlinger: Lock race condition between CPU, Host Timing, VSync.Fernando Sahmkow2020-06-273-0/+11
| | | | | | | |
| * | | | | | | SVC: Add locks to the memory management.Fernando Sahmkow2020-06-271-0/+21
| | | | | | | |
| * | | | | | | SVC: Correct WaitSynchronization, WaitProcessWideKey, SignalProcessWideKey.Fernando Sahmkow2020-06-279-33/+84
| | | | | | | |
| * | | | | | | SVC: Cleanup old methods.Fernando Sahmkow2020-06-271-13/+9
| | | | | | | |
| * | | | | | | CPU_Manager: Reconfigre guest threads for dynamrmic downsidesFernando Sahmkow2020-06-273-1/+7
| | | | | | | |
| * | | | | | | SVC: Correct SendSyncRequest.Fernando Sahmkow2020-06-278-54/+116
| | | | | | | |
| * | | | | | | SVC: Correct ArbitrateUnlockFernando Sahmkow2020-06-273-33/+37
| | | | | | | |
| * | | | | | | SVC: Correct SignalEvent, ClearEvent, ResetSignal, WaitSynchronization, CancelSynchronization, ArbitrateLockFernando Sahmkow2020-06-278-90/+134
| | | | | | | |
| * | | | | | | SVC: Remove global HLE Lock.Fernando Sahmkow2020-06-271-3/+0
| | | | | | | |
| * | | | | | | SVC: Correct GetThreadPriority, SetThreadPriority, GetThreadCoreMask, SetThreadCoreMask, GetCurrentProcessorNumberFernando Sahmkow2020-06-275-15/+26
| | | | | | | |
| * | | | | | | SVC: Correct CreateThread, StartThread, ExitThread, SleepThread.Fernando Sahmkow2020-06-273-37/+31
| | | | | | | |
| * | | | | | | HostTiming: Pause the hardware clock on pause.Fernando Sahmkow2020-06-273-1/+8
| | | | | | | |
| * | | | | | | General: Setup yuzu threads' microprofile, naming and registry.Fernando Sahmkow2020-06-272-3/+7
| | | | | | | |
| * | | | | | | CPU_Manager: remove debugging code.Fernando Sahmkow2020-06-271-8/+4
| | | | | | | |
| * | | | | | | General: Recover Prometheus project from harddrive failure Fernando Sahmkow2020-06-2748-696/+1216
| | |_|/ / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This commit: Implements CPU Interrupts, Replaces Cycle Timing for Host Timing, Reworks the Kernel's Scheduler, Introduce Idle State and Suspended State, Recreates the bootmanager, Initializes Multicore system.
* | | | | | | ldr: Cleanup NRO & NRR structsDavid Marcec2020-06-281-8/+8
| | | | | | |
* | | | | | | Merge pull request #4026 from VolcaEM/ldrDavid2020-06-281-38/+73
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | ldr: Update NRR/NRO structs
| * | | | | | | Move SHA256Hash to its original positionVolcaEM2020-06-181-2/+2
| | | | | | | | | | | | | | | | | | | | | | | | It's not needed to have it in its previous position anymore
| * | | | | | | Remove unnecessary pragmasVolcaEM2020-06-161-8/+0
| | | | | | | |
| * | | | | | | Revert IsValidNRO refactor but make it more readableVolcaEM2020-06-161-26/+13
| | | | | | | |
| * | | | | | | Update assert stringVolcaEM2020-06-161-1/+1
| | | | | | | |
| * | | | | | | Clang-format againVolcaEM2020-06-141-2/+2
| | | | | | | |
| * | | | | | | Use consistent variable namesVolcaEM2020-06-141-4/+4
| | | | | | | |
| * | | | | | | Clang-formatVolcaEM2020-06-141-1/+2
| | | | | | | |
| * | | | | | | Make assert strings consistentVolcaEM2020-06-141-3/+3
| | | | | | | |
| * | | | | | | Attempt to fix crashes in SSBU and refactor IsValidNROVolcaEM2020-06-141-36/+59
| | | | | | | |
| * | | | | | | Address review commentsVolcaEM2020-06-021-4/+4
| | | | | | | |
| * | | | | | | Add comment to nrr_kindVolcaEM2020-05-311-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | According to Atmosphére (https://github.com/Atmosphere-NX/Atmosphere/blob/c7026b90940a1d88f9c10a6d98263bf22e654fa5/libraries/libstratosphere/include/stratosphere/ro/ro_types.hpp), nrr_kind (Atmosphére calls it "type") is 7.0.0+
| * | | | | | | ldr: Update NRR/NRO structs VolcaEM2020-05-311-40/+72
| | |_|_|_|/ / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This was based on Switchbrew pages: https://switchbrew.org/wiki/NRR https://switchbrew.org/wiki/NRO
* | | | | | | Merge pull request #4184 from VolcaEM/patch-9David2020-06-281-0/+3
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | grc: Update function table
| * | | | | | | Oops (fix typo)VolcaEM2020-06-271-1/+1
| | | | | | | |
| * | | | | | | grc: Update function tableVolcaEM2020-06-271-0/+3
| | | | | | | | | | | | | | | | | | | | | | | | This was based on Switchbrew page: https://switchbrew.org/wiki/GRC_services
* | | | | | | | Merge pull request #4185 from VolcaEM/patch-10David2020-06-281-0/+1
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | lbl: Update function table
| * | | | | | | | lbl: Update function tableVolcaEM2020-06-271-0/+1
| |/ / / / / / / | | | | | | | | | | | | | | | | This was based on Switchbrew page: https://switchbrew.org/wiki/Backlight_services
* | | | | | | | Merge pull request #4186 from VolcaEM/patch-11David2020-06-281-0/+1
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | ldn: Update function table
| * | | | | | | | ldn: Update function tableVolcaEM2020-06-271-0/+1
| |/ / / / / / / | | | | | | | | | | | | | | | | This was based on Switchbrew page: https://switchbrew.org/wiki/LDN_services
* | | | | | | | Merge pull request #4187 from VolcaEM/patch-12David2020-06-281-0/+6
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | mig: Update function table
| * | | | | | | | mig: Update function tableVolcaEM2020-06-271-0/+6
| |/ / / / / / / | | | | | | | | | | | | | | | | This was based on Switchbrew page: https://switchbrew.org/wiki/Migration_services
* | | | | | | | Merge pull request #4188 from VolcaEM/patch-13David2020-06-281-16/+16
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | mm: Update function table
| * | | | | | | | mm: Update function tableVolcaEM2020-06-271-16/+16
| |/ / / / / / / | | | | | | | | | | | | | | | | This was based on Switchbrew page: https://switchbrew.org/wiki/Display_services
* | | | | | | | Merge pull request #4189 from VolcaEM/patch-14David2020-06-281-10/+10
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | ncm: Update function table
| * | | | | | | | ncm: Update function tableVolcaEM2020-06-271-10/+10
| |/ / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This was based on Switchbrew page: https://switchbrew.org/wiki/NCM_services ILocationResolver's 16, 17, 18 and 19 have unofficial names
* | | | | | | | Merge pull request #4190 from VolcaEM/patch-15David2020-06-281-3/+3
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | nfc: Update function table
| * | | | | | | | nfc: Update function tableVolcaEM2020-06-271-3/+3
| |/ / / / / / / | | | | | | | | | | | | | | | | This was based on Switchbrew page: https://switchbrew.org/wiki/NFC_services
* | | | | | | | Merge pull request #4183 from VolcaEM/patch-8David2020-06-281-0/+6
|\ \ \ \ \ \ \ \ | |_|_|/ / / / / |/| | | | | | | friend: Update function table
| * | | | | | | friend: Update function tableVolcaEM2020-06-271-0/+6
| |/ / / / / /
* | | | | | | Merge pull request #3396 from FernandoS27/prometheus-1David2020-06-275-0/+386
|\ \ \ \ \ \ \ | |/ / / / / / |/| | | | | | Implement SpinLocks, Fibers and a Host Timer
| * | | | | | Host Timing: Correct clang format.Fernando Sahmkow2020-06-181-1/+0
| | | | | | |
| * | | | | | HostTiming: Correct rebase and implement AddTicks.Fernando Sahmkow2020-06-182-1/+19
| | | | | | |
| * | | | | | Core/HostTiming: Allow events to be advanced manually.Fernando Sahmkow2020-06-182-26/+41
| | | | | | |
| * | | | | | Common/Tests: Address FeedbackFernando Sahmkow2020-06-184-7/+19
| | | | | | |
| * | | | | | Common/Tests: Clang Format.Fernando Sahmkow2020-06-182-4/+6
| | | | | | |
| * | | | | | Common: Refactor & Document Wall clock.Fernando Sahmkow2020-06-181-2/+1
| | | | | | |
| * | | | | | Common: Implement WallClock Interface and implement a native clock for x64Fernando Sahmkow2020-06-182-14/+11
| | | | | | |
| * | | | | | Tests: Add base tests to host timingFernando Sahmkow2020-06-182-41/+90
| | | | | | |
| * | | | | | Core: Implement a Host Timer.Fernando Sahmkow2020-06-185-0/+295
| | | | | | |
* | | | | | | Merge pull request #4164 from Kewlan/mute-audio-hotkeybunnei2020-06-272-0/+10
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | hotkeys: Add a "Mute Audio" hotkey
| * | | | | | | Add a "Mute Audio" hotkeyKewlan2020-06-262-0/+10
| | | | | | | |
* | | | | | | | Merge pull request #4158 from Morph1984/capsbunnei2020-06-2714-57/+69
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | caps: Use enum classes and check struct sizes on compile time
| * | | | | | | | caps_u: Fix GetAlbumContentsFileListForApplication stubMorph2020-06-261-9/+15
| | | | | | | | |
| * | | | | | | | caps: Use enum classes and check struct sizes on compile timeMorph2020-06-261-34/+40
| | | | | | | | |
| * | | | | | | | caps: Update copyright headersMorph2020-06-2614-14/+14
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Updated to "yuzu Emulator Project"
* | | | | | | | | Merge pull request #4152 from ogniK5377/ipc-errbunnei2020-06-271-25/+22
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | Mark invalid IPC buffers as ASSERT_OR_EXECUTE_MSG
| * | | | | | | | | Mark invalid IPC buffers as ASSERT_OR_EXECUTE_MSGDavid Marcec2020-06-241-25/+22
| | |_|_|_|/ / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | Previously if applications would send faulty buffers(example homebrew) it would lead to us returning uninitalized data. Switching from ASSERT_MSG to ASSERT_OR_EXECUTE_MSG allows us to have a fail safe to prevent crashes but also continue execution without introducing undefined behavior
* | | | | | | | | Merge pull request #4154 from ogniK5377/swkbd-nullptrbunnei2020-06-271-1/+1
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | Prevent nullptr dereference on swkbd error case
| * | | | | | | | | Prevent nullptr dereference on swkbd error caseDavid Marcec2020-06-241-1/+1
| |/ / / / / / / /
* | | | | | | | | Merge pull request #4178 from VolcaEM/patch-6David2020-06-271-4/+43
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | es: Update function table
| * | | | | | | | | Use better names for "Unknown"sVolcaEM2020-06-271-39/+39
| | | | | | | | | |
| * | | | | | | | | Update function namesVolcaEM2020-06-271-4/+4
| | | | | | | | | |
| * | | | | | | | | es: Update function tableVolcaEM2020-06-271-2/+41
| | |/ / / / / / / | |/| | | | | | | | | | | | | | | | This was based on Switchbrew page: https://switchbrew.org/wiki/ETicket_services
* | | | | | | | | btm: Give better names for unknown functionsDavid Marcec2020-06-271-5/+5
| | | | | | | | |
* | | | | | | | | btdrv: Update function table (#4174)VolcaEM2020-06-271-83/+84
| | | | | | | | | | | | | | | | | | | | | | | | | | | * btdrv: Update function table
* | | | | | | | | bpc: Update function tables (#4173)VolcaEM2020-06-271-7/+13
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * bpc: Update function tables This was based on Switchbrew page: https://switchbrew.org/wiki/PCV_services
* | | | | | | | | bcat: Update function tables and add missing classes (#4172)VolcaEM2020-06-272-0/+5
| | | | | | | | | | | | | | | | | | | | | | | | | | | * bcat: Update function tables and add missing classes
* | | | | | | | | am: Update function tables and add missing classes (#4169)VolcaEM2020-06-273-17/+19
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * am: Update function tables and add missing classes * Remove comments (1/5) * Remove comments (2/5) * Remove comments (3/5) * Remove comments (4/5) * Remove comments (5/5) * Remove unused classes (1/2) * Remove unused classes (2/2)
* | | | | | | | | aoc: Update function table (#4170)VolcaEM2020-06-271-0/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * aoc: Update function table * Remove comments
* | | | | | | | | Merge pull request #4177 from VolcaEM/patch-5LC2020-06-271-71/+76
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | btm: Update function tables
| * | | | | | | | | btm: Update function tablesVolcaEM2020-06-271-71/+76
| |/ / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This was based on Switchbrew page: https://switchbrew.org/wiki/BTM_services "No comment" edition
* / / / / / / / / eupld: Update function tableVolcaEM2020-06-271-0/+1
|/ / / / / / / / | | | | | | | | | | | | | | | | This was based on Switchbrew page: https://switchbrew.org/wiki/Error_Upload_services
* | | | | | | | Merge pull request #4159 from ogniK5377/mem-manager-dumb-assertbunnei2020-06-261-1/+0
|\ \ \ \ \ \ \ \ | |_|/ / / / / / |/| | | | | | | memory_manager: Remove useless assertion
| * | | | | | | memory_manager: Remove useless assertionDavid Marcec2020-06-251-1/+0
| |/ / / / / / | | | | | | | | | | | | | | | | | | | | | num_pages is an std::size_t. It will always be >= 0
* | | | | | | Merge pull request #4141 from Morph1984/SevenSixAxisSensorDavid2020-06-252-21/+85
|\ \ \ \ \ \ \ | |/ / / / / / |/| | | | | | hid: Stub a series of "SevenSixAxisSensor" service commands
| * | | | | | hid: Stub a series of "SevenSixAxisSensor" service commandsMorph2020-06-242-21/+85
| | |_|_|/ / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | - Used by Captain Toad: Treasure Tracker Update 1.3.0 While we're at it, fix the input parameters for SetIsPalmaAllConnectable and SetPalmaBoostMode
* | | | | | Merge pull request #4138 from Morph1984/GyroscopeZeroDriftModebunnei2020-06-244-6/+56
|\ \ \ \ \ \ | | | | | | | | | | | | | | hid: Implement Get/ResetGyroscopeZeroDriftMode
| * | | | | | hid: Implement Get/ResetGyroscopeZeroDriftModeMorph2020-06-214-6/+56
| |/ / / / / | | | | | | | | | | | | | | | | | | - Used by Captain Toad Treasure Tracker
* | | | | | Merge pull request #4128 from lioncash/move2bunnei2020-06-241-2/+2
|\ \ \ \ \ \ | | | | | | | | | | | | | | software_keyboard: Eliminate trivial redundant copies
| * | | | | | software_keyboard: Eliminate trivial redundant copiesLioncash2020-06-201-2/+2
| | |/ / / / | |/| | | | | | | | | | | | | | | | We can just make use of moves here to get rid of two redundant copies
* | | | | | lm: Silence no return value warningMorph2020-06-231-1/+2
| | | | | |
* | | | | | account: Update function tables and add missing classes (#4145)VolcaEM2020-06-225-42/+384
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * account: Update function tables and add missing classes * clang-format * Add missing "public" * Add missing public again * Add missing final
* | | | | | arm_dynarmic_64: Log the instruction when an exception is raisedMorph2020-06-221-2/+2
| | | | | |
* | | | | | arm_dynarmic_32: Log under Core_ARM instead of HW_GPUMorph2020-06-221-1/+1
| |/ / / / |/| | | |
* | | | | Merge pull request #4099 from MerryMage/macOS-buildbunnei2020-06-202-3/+3
|\ \ \ \ \ | | | | | | | | | | | | Fix compilation on macOS
| * | | | | memory_manager: Explicitly specifcy std::min<size_t>MerryMage2020-06-181-2/+2
| | | | | |
| * | | | | shared_font: Service::NS::EncryptSharedFont takes a size_t&MerryMage2020-06-181-1/+1
| | | | | |
* | | | | | Merge pull request #4113 from ogniK5377/boxcat-disablebunnei2020-06-201-2/+2
|\ \ \ \ \ \ | | | | | | | | | | | | | | Fix compilation when not building with boxcat
| * | | | | | Fix compilation when not building with boxcatDavid Marcec2020-06-191-2/+2
| | |/ / / / | |/| | | | | | | | | | | | | | | | Fixes compilation when trying to build without boxcat enabled
* / | | | | mii_model: Remove redundant std::moveMerryMage2020-06-191-1/+1
|/ / / / / | | | | | | | | | | | | | | | Named return value optimization automatically applies here.
* / / / / arm_dynarmic_32: Fix implicit conversion error in SetTPIDR_EL0ReinUsesLisp2020-06-181-1/+1
|/ / / / | | | | | | | | | | | | On MSVC builds we treat conversion warnings as errors.
* | | | arm_dynarmic_cp15: Implement CNTPCTMerryMage2020-06-171-0/+13
| | | |
* | | | arm_dynarmic_cp15: Update CP15MerryMage2020-06-174-142/+73
| | | |
* | | | arm_dynarmic_32: InterpreterFallback should never happenMerryMage2020-06-171-2/+3
| | | |
* | | | Merge pull request #3966 from Morph1984/hide-internal-resolution-uibunnei2020-06-161-1/+1
|\ \ \ \ | | | | | | | | | | yuzu/frontend: Remove internal resolution option
| * | | | yuzu/frontend: Remove internal resolution optionMorph2020-06-061-1/+1
| | | | |
* | | | | Merge pull request #4070 from ogniK5377/GetTPCMasks-fixbunnei2020-06-152-21/+22
|\ \ \ \ \ | | | | | | | | | | | | nvdrv: Fix GetTPCMasks for ioctl3
| * | | | | nvdrv: Fix GetTPCMasks for ioctl3David Marcec2020-06-102-21/+22
| | |_|_|/ | |/| | | | | | | | | | | | | Fixes animal crossing svcBreak on launch
* | | | | Merge pull request #4069 from ogniK5377/total-phys-membunnei2020-06-141-2/+4
|\ \ \ \ \ | | | | | | | | | | | | kernel: Account for system resource size for memory usage
| * | | | | kernel: Account for system resource size for memory usageDavid Marcec2020-06-101-2/+4
| |/ / / / | | | | | | | | | | | | | | | GetTotalPhysicalMemoryAvailableWithoutSystemResource & GetTotalPhysicalMemoryUsedWithoutSystemResource seem to subtract the resource size from the usage.
* | | | | Merge pull request #4010 from ogniK5377/reserve-always-breakbunnei2020-06-131-5/+1
|\ \ \ \ \ | |/ / / / |/| | | | kernel: ResourceLimit::Reserve remove useless while loop
| * | | | kernel: ResourceLimit::Reserve remove useless while loopDavid Marcec2020-05-291-5/+1
| | |/ / | |/| | | | | | | | | | Timeout is a u64, it will always be >= 0
* | | | Merge pull request #4044 from ogniK5377/handle-not-signalled-errbunnei2020-06-041-1/+1
|\ \ \ \ | | | | | | | | | | Downgrade "handle not signaled" error to trace
| * | | | Downgrade "handle not signaled" error to traceDavid Marcec2020-06-041-1/+1
| | |/ / | |/| | | | | | | | | | clogs logs quite a bit
* | | | Merge pull request #4009 from ogniK5377/macro-jit-prodbunnei2020-06-041-0/+1
|\ \ \ \ | |/ / / |/| | | video_core: Implement Macro JIT
| * | | Implement macro JITDavid Marcec2020-05-301-0/+1
| |/ /
* | | Clang-formatVolcaEM2020-06-011-2/+1
| | |
* | | hid: Stub GetXpadIDsVolcaEM2020-06-012-1/+14
|/ / | | | | Allows Minecraft: Nintendo Switch Edition (a.k.a. old Minecraft) to boot and go ingame
* | Merge pull request #4002 from lat9nq/fix-nix-mod-directoriesbunnei2020-05-292-8/+31
|\ \ | | | | | | patch_manager: Add support for case-sensitivity on Linux
| * | Make copying directory string more conciselat9nq2020-05-281-2/+1
| | |
| * | Address requested changeslat9nq2020-05-282-4/+4
| | |
| * | *nix systems can read any-case patch directorieslat9nq2020-05-282-8/+32
| | | | | | | | | | | | | | | | | | Changes many patch_manager functions to use a case-less variant of GetSubdirectory. Fixes patches not showing up on *nix systems when patch directories are named with odd cases, i.e. `exeFS'.
* | | Merge pull request #3964 from ReinUsesLisp/arb-integrationbunnei2020-05-243-0/+3
|\ \ \ | | | | | | | | renderer_opengl: Add assembly program code paths
| * | | yuzu: Add frontend settings for assembly shadersReinUsesLisp2020-05-193-0/+3
| | | | | | | | | | | | | | | | | | | | Add settings for assembly shaders. Currently hidden to avoid users from accidentally enabled them.
* | | | clang-formatVolcaEM2020-05-211-1/+2
| | | |
* | | | nifm: correct assert in CreateTemporaryNetworkProfileVolcaEM2020-05-211-1/+1
| |/ / |/| | | | | | | | | | | | | | | | | | | | | | | This has been wrong since https://github.com/yuzu-emu/yuzu/commit/0432af5ad1ec34f02071f6fdc5fc78149b059f18 I haven't found a game that called this function (and I haven't tried this on a real Switch), and because of this I haven't been able to check if the number in assert OR the string in the assert is wrong, but one of the two is wrong: NetworkProfileData is 0x18E, while SfNetworkProfileData is 0x17C, according to Switchbrew Switchbrew doesn't officially say that NetworkProfileData's size is 0x18E but it's possible to calculate its size since Switchbrew provides the size and the offset of all the components of NetworkProfileData (which isn't currently implemented in yuzu, alongside SfNetworkProfileData) NetworkProfileData documentation: https://switchbrew.org/wiki/Network_Interface_services#NetworkProfileData SfNetworkProfileData documentation: https://switchbrew.org/wiki/Network_Interface_services#SfNetworkProfileData Since I trust ogniK's work on reversing NIFM, I'd assume this was just a typo in the string
* | | Merge pull request #3946 from ogniK5377/sysverdat-10-0-2bunnei2020-05-211-7/+7
|\ \ \ | | | | | | | | file_sys: Update SystemVersion archive to version 10.0.2
| * | | file_sys: Update SystemVersion archive to version 10.0.2David Marcec2020-05-161-7/+7
| | | |
* | | | Merge pull request #3926 from ogniK5377/keyboard-statesbunnei2020-05-191-3/+4
|\ \ \ \ | |_|/ / |/| | | hid: Clear keyboard states & fix logic issue
| * | | hid: Clear keyboard states & fix logic issueDavid Marcec2020-05-121-3/+4
| | | | | | | | | | | | | | | | Previously we never cleared the states of the entries and the key would stay held down, also looping over the key bytes for each key lead to setting every bit for the key state instead of the key we wanted
* | | | Merge pull request #3665 from bunnei/device-savebunnei2020-05-165-4/+49
|\ \ \ \ | | | | | | | | | | FS: Improve emulation of device saves
| * | | | service: fsp_srv: Stub implementation of OpenMultiCommitManager.bunnei2020-05-112-1/+38
| | | | |
| * | | | file_sys: savefata_factory: Update to support DeviceSaveData.bunnei2020-05-111-3/+6
| | | | |
| * | | | file_sys: control_metadata: Expose device_save_data_size.bunnei2020-05-112-0/+5
| |/ / /
* | / / nv_flinger: Use enum for pixel format instead of u32David Marcec2020-05-162-3/+11
| |/ / |/| |
* | | frontend: Set minimum window size to 640x360 instead of 1280x720 (#3413)Morph2020-05-152-1/+6
| | |
* | | time_zone: Use std::chrono::seconds for strong typing.bunnei2020-05-131-1/+1
| | |
* | | hle: service: time_zone_manager: Use current time zone setting.bunnei2020-05-112-3/+32
| | |
* | | core: settings: Add a setting for time zone.bunnei2020-05-112-0/+20
| | |
* | | Stub SendKeyboardLockKeyEventDavid Marcec2020-05-112-1/+11
|/ / | | | | | | Needed for Puchikon 4 SmileBASIC 1.0.0
* | Replace externals with Conan (#3735)James Rowe2020-05-083-4/+5
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * Remove git submodules that will be loaded through conan * Move custom Find modules to their own folder * Use conan for downloading missing external dependencies * CI: Change the yuzu source folder user to the user that the containers run on * Attempt to remove dirty mingw build hack * Install conan on the msvc build * Only set release build type when using not using multi config generator * Re-add qt bundled to workaround an issue with conan qt not downloading prebuilt binaries * Add workaround for submodules that use legacy CMAKE variables * Re-add USE_BUNDLED_QT on the msvc build bot
* | Merge pull request #3879 from lioncash/global2bunnei2020-05-083-10/+16
|\ \ | |/ |/| hle_ipc: Eliminate core memory globals
| * hle_ipc: Eliminate core memory globalsLioncash2020-05-033-10/+16
| | | | | | | | | | We can just pass the required instances into the constructor of the request, eliminating all usages of the global system accessor.
* | Merge pull request #3881 from lioncash/mem-warningbunnei2020-05-0511-23/+11
|\ \ | | | | | | kernel/memory: Resolve several compiler warnings
| * | kernel/memory: Remove #pragma once within cpp fileLioncash2020-05-031-2/+0
| | | | | | | | | | | | This isn't necessary in a cpp file and will cause warnings on clang.
| * | kernel/memory: Remove unused includesLioncash2020-05-037-8/+1
| | | | | | | | | | | | | | | Prevents header churn and needing to recompile these files if these headers are ever changed in the future.
| * | kernel/memory: Remove unused variables in memory_block_managerLioncash2020-05-031-3/+0
| | | | | | | | | | | | Prevents unused variable warnings.
| * | kernel/memory: Make use of std::array consistently in address_space_infoLioncash2020-05-031-6/+6
| | | | | | | | | | | | | | | This allows tuning standard library implementations to enable or disable range checks at runtime, which is nicer for debugging.
| * | kernel/memory: Resolve -Wshadow warningsLioncash2020-05-031-4/+4
| |/ | | | | | | Prevents variable name clashing.
* | Merge pull request #3880 from lioncash/encodingbunnei2020-05-056-12/+12
|\ \ | | | | | | kernel/memory: Amend potential encoding warnings
| * | kernel/memory: Amend potential encoding warningsLioncash2020-05-036-12/+12
| |/ | | | | | | | | | | | | While èis generally representable in some language encodings, in some it isn't and will result in compilation warnings occurring. To remain friendly with other language's codepages on Windows, we normalize it to an ASCII e.
* | Merge pull request #3843 from ogniK5377/GetPopFromGeneralChannelEventbunnei2020-05-043-4/+20
|\ \ | | | | | | am: IHomeMenuFunctions:GetPopFromGeneralChannelEvent
| * | am: IHomeMenuFunctions:GetPopFromGeneralChannelEventDavid Marcec2020-05-013-4/+20
| | | | | | | | | | | | QLaunch 1.0.0
* | | Merge pull request #3822 from ogniK5377/GetAccountIdbunnei2020-05-041-5/+8
|\ \ \ | |_|/ |/| | acc: Return a unique value per account for GetAccountId
| * | acc: Return a unique value per account for GetAccountIdDavid Marcec2020-04-291-5/+8
| | |
* | | settings: Add anisotropic filtering level to the yuzu configuration log (#3875)Morph2020-05-031-0/+1
| | |
* | | Merge pull request #3871 from lioncash/semibunnei2020-05-031-4/+6
|\ \ \ | | | | | | | | readable_event: Remove unnecessary semicolon in Signal()
| * | | readable_event: Remove unnecessary semicolon in Signal()Lioncash2020-05-021-4/+6
| | | | | | | | | | | | | | | | | | | | | | | | | | | | Resolves a -Wextra-semi warning. While we're at it, we can invert the branch to form a guard clause, unindenting all of the contained code.
* | | | Merge pull request #3824 from ogniK5377/GetDisplayVersionbunnei2020-05-031-3/+14
|\ \ \ \ | |/ / / |/| | | am: Properly implement GetDisplayVersion
| * | | Update src/core/hle/service/am/am.cppbunnei2020-05-031-1/+1
| | | | | | | | | | | | Co-authored-by: Mat M. <mathew1800@gmail.com>
| * | | am: Properly implement GetDisplayVersionDavid Marcec2020-04-291-3/+14
| |/ / | | | | | | | | | Properly implement IApplicationFunctions::GetDisplayVersion
* | | Merge pull request #3811 from ogniK5377/audin-initbunnei2020-05-022-5/+94
|\ \ \ | | | | | | | | audin:u: ListAudioIns, OpenAudioIn, ListAudioInsAuto, OpenAudioInAuto, ListAudioInsAutoFiltered, OpenAudioInProtocolSpecified
| * | | marked stubsDavid Marcec2020-04-281-4/+5
| | | |
| * | | Audin:u ListAudioIns, OpenAudioIn, ListAudioInsAuto, OpenAudioInAuto, ListAudioInsAutoFiltered, OpenAudioInProtocolSpecifiedDavid Marcec2020-04-282-5/+93
| | | | | | | | | | | | | | | | Closes #2874
* | | | Merge pull request #3819 from ogniK5377/err-log2bunnei2020-05-027-0/+51
|\ \ \ \ | | | | | | | | | | kernel: Don't fail silently
| * | | | kernel: Don't fail silentlyDavid Marcec2020-04-297-0/+51
| | |/ / | |/| |
* | | | Merge pull request #3833 from qwell/caps_su-32-stubbunnei2020-05-022-1/+13
|\ \ \ \ | | | | | | | | | | Add stub for caps:su SetShimLibraryVersion
| * | | | caps:su Stub out SetShimLibraryVersionJason Parker2020-04-302-1/+13
| | | | | | | | | | | | | | | | | | | | Used by Animal Crossing: New Horizons when trying to take a picture.
* | | | | Merge pull request #3821 from ogniK5377/InitializeApplicationInfo-fixbunnei2020-05-022-22/+15
|\ \ \ \ \ | | | | | | | | | | | | acc: Fix InitializeApplicationInfo
| * | | | | acc: Fix InitializeApplicationInfoDavid Marcec2020-04-292-22/+15
| | |/ / / | |/| | | | | | | | | | | | | We're not suppose to pop a u64, should just read the sent pid and check that
* | | | | Merge pull request #3812 from ogniK5377/lisst-qualified-usersbunnei2020-05-025-3/+15
|\ \ \ \ \ | | | | | | | | | | | | account: ListQualifiedUsers
| * | | | | Updated comment to reflect ListQualifiedUsers betterDavid Marcec2020-04-281-1/+3
| | | | | |
| * | | | | account: ListQualifiedUsersDavid Marcec2020-04-285-3/+13
| | |_|/ / | |/| | | | | | | | | | | | | Closes #2844
* | | | | nvdrv: Fix GetGpuTime stack corruptionDavid Marcec2020-05-011-2/+3
| |_|_|/ |/| | | | | | | | | | | IoctlGetGpuTime should be 16 bytes, not 8.
* | | | Merge pull request #3823 from ogniK5377/setvrmodeMat M2020-04-302-16/+6
|\ \ \ \ | | | | | | | | | | am: IsVrModeEnabled & SetVrModeEnabled fixes
| * | | | am: IsVrModeEnabled & SetVrModeEnabled fixesDavid Marcec2020-04-292-16/+6
| | |/ / | |/| | | | | | | | | | | | | | Return the proper state of vr mode for IsVrModeEnabled We should not return an error for SetVrModeEnabled. When VR Mode is turned on, it signals to lbl to turn vr mode on, not return an error code
* | | | Merge pull request #3830 from ogniK5377/GetFriendInvitationStorageChannelEventMat M2020-04-302-1/+14
|\ \ \ \ | | | | | | | | | | am: GetFriendInvitationStorageChannelEvent
| * | | | am: GetFriendInvitationStorageChannelEventDavid Marcec2020-04-302-1/+14
| |/ / / | | | | | | | | | | | | Closes #3829
* | | | Merge pull request #3835 from ogniK5377/GetFreeSpaceSize-GetTotalSpaceSizeMat M2020-04-301-2/+2
|\ \ \ \ | | | | | | | | | | fs-srv: GetFreeSpaceSize & GetTotalSpaceSize
| * | | | fs-srv: GetFreeSpaceSize & GetTotalSpaceSizeDavid Marcec2020-04-301-2/+2
| |/ / / | | | | | | | | | | | | | | | | | | | | Closes #3533 Turns out the functions were already implemented but just never added
* | | | Merge pull request #3832 from ogniK5377/nim-eca-CreateServerInterfaceMat M2020-04-301-1/+69
|\ \ \ \ | | | | | | | | | | nim: CreateServerInterface, CreateAccessorInterface, CreateAsyncInterface
| * | | | nim: CreateServerInterface, CreateAccessorInterface, CreateAsyncInterfaceDavid Marcec2020-04-301-1/+69
| |/ / / | | | | | | | | | | | | Closes #3026
* | | | Merge pull request #3831 from ogniK5377/caps-su-namesMat M2020-04-301-0/+3
|\ \ \ \ | | |_|/ | |/| | caps: Add missing service names to caps:su
| * | | caps: Add missing service names to caps:suDavid Marcec2020-04-301-0/+3
| |/ / | | | | | | | | | SetShimLibraryVersion, SaveScreenShotEx1 & SaveScreenShotEx2 were missing
* / / psm: Mark as debug instead of warningDavid Marcec2020-04-291-7/+14
|/ / | | | | | | No point to emulate battery life. However options are broken out if we ever want to add a setting for it
* | Merge pull request #3818 from ogniK5377/err-logMat M2020-04-294-3/+27
|\ \ | | | | | | Don't fail silently for vi, sm, set and ns services
| * | Don't fail silently for vi, sm, set and ns servicesDavid Marcec2020-04-294-3/+27
| | |
* | | Merge pull request #3783 from lioncash/pointerMat M2020-04-294-8/+15
|\ \ \ | |/ / |/| | physical_core: Make use of std::make_unique instead of std::make_shared in ctor
| * | physical_core: Make use of std::make_unique instead of std::make_shared in ctorLioncash2020-04-244-8/+15
| | | | | | | | | | | | | | | | | | | | | We can also allow unicorn to be constructed in 32-bit mode or 64-bit mode to satisfy the need for both interpreter instances. Allows this code to compile successfully of non x86-64 architectures.
* | | kernel: Bad GetInfo ids should not be marked as stubsDavid Marcec2020-04-281-2/+2
| | | | | | | | | | | | As we currently match hardware and don't return a successful result, these should be marked as errors instead of warnings and as stubs.
* | | style: Change AMs & Glues error codes to be dec instead of hexDavid Marcec2020-04-282-7/+7
| |/ |/| | | | | Consistency for the rest of the error codes in the codebase
* | Merge pull request #3785 from ogniK5377/set-buffer-count-unitbunnei2020-04-271-1/+9
|\ \ | | | | | | vi: Don't let uninitialized data pass as a response for SetBufferCount
| * | vi: Don't let uninitialized data pass as a response for SetBufferCountDavid Marcec2020-04-241-1/+9
| | | | | | | | | | | | Currently SetBufferCount doesn't write to the out buffer which then contains uninitialized data. This leads to non-zero data which leads to responding with different error codes
* | | Merge pull request #3797 from slashiee/hid-stubMat M2020-04-272-1/+13
|\ \ \ | | | | | | | | services: hid: Stub StopSevenSixAxisSensor.
| * | | services: hid: Stub StopSevenSixAxisSensor.M&M2020-04-262-1/+13
| | | | | | | | | | | | | | | | - Used by The Legend of Zelda: Breath of the Wild v1.6.0
* | | | Merge pull request #3742 from FernandoS27/command-listbunnei2020-04-271-0/+1
|\ \ \ \ | | | | | | | | | | Optimize GPU Command Lists and Introduce Fast GPU Time Option
| * | | | GPU: Add Fast GPU Time Option.Fernando Sahmkow2020-04-231-0/+1
| | | | |
* | | | | Merge pull request #3744 from lioncash/table2bunnei2020-04-2619-7/+108
|\ \ \ \ \ | |_|/ / / |/| | | | service: Update function tables
| * | | | service: Update function tablesLioncash2020-04-2019-7/+108
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Keeps the service function tables up to date. Updated based off information on SwitchBrew.
* | | | | Merge pull request #3780 from lioncash/processbunnei2020-04-251-2/+138
|\ \ \ \ \ | |_|_|/ / |/| | | | svc: Re-add MapProcessCodeMemory/UnmapProcessCodeMemory
| * | | | svc: Re-add MapProcessCodeMemory/UnmapProcessCodeMemoryLioncash2020-04-241-2/+138
| | |_|/ | |/| | | | | | | | | | These were lost in the re-implementation of the virtual memory manager.
* | | | Merge pull request #3777 from lioncash/warnRodrigo Locatti2020-04-241-2/+2
|\ \ \ \ | | | | | | | | | | page_table: Remove unused captures
| * | | | page_table: Remove unused capturesLioncash2020-04-231-2/+2
| |/ / / | | | | | | | | | | | | | | | | | | | | Any time the lambda function is called, the permission being used in the capture would be passed in as an argument to the lambda, so the capture is unnecessary.
* | | | Merge pull request #3778 from lioncash/unused-varRodrigo Locatti2020-04-241-3/+0
|\ \ \ \ | | | | | | | | | | svc: Remove unused variable
| * | | | svc: Remove unused variableLioncash2020-04-231-3/+0
| |/ / / | | | | | | | | | | | | Since the VMM refactor, this is no longer used or needed.
* / / / shared_memory: Amend doxygen referenceLioncash2020-04-242-5/+5
|/ / / | | | | | | | | | | | | | | | Amends the parameter to match the documentation reference. Resolves a -Wdocumentation warning with clang.
* | / kernel: memory: Improve implementation of device shared memory. (#3707)bunnei2020-04-235-3/+105
| |/ |/| | | | | | | | | | | * kernel: memory: Improve implementation of device shared memory. * fixup! kernel: memory: Improve implementation of device shared memory. * fixup! kernel: memory: Improve implementation of device shared memory.
* | Merge pull request #3730 from lioncash/timebunnei2020-04-231-24/+26
|\ \ | | | | | | service/time: Remove reliance on the global system accessor
| * | service/time: Remove reliance on the global system accessorLioncash2020-04-191-24/+26
| | | | | | | | | | | | | | | Eliminates usages of the global system accessor and instead passes the existing system instance into the interfaces.
* | | Merge pull request #3697 from lioncash/declarationsbunnei2020-04-233-10/+5
|\ \ \ | | | | | | | | CMakeLists: Enable -Wmissing-declarations on Linux builds
| * | | General: Resolve warnings related to missing declarationsLioncash2020-04-173-10/+5
| | | |
* | | | Merge pull request #3677 from FernandoS27/better-syncbunnei2020-04-233-4/+33
|\ \ \ \ | | | | | | | | | | Introduce Predictive Flushing and Improve ASYNC GPU
| * | | | Correct Linux Compile Error.Fernando Sahmkow2020-04-222-7/+10
| | | | |
| * | | | UI: Replasce accurate GPU option for GPU Accuracy LevelFernando Sahmkow2020-04-223-4/+30
| | | | |
* | | | | Merge pull request #3725 from MerryMage/fpcrbunnei2020-04-231-2/+1
|\ \ \ \ \ | | | | | | | | | | | | thread: FPCR.FZ is likely not 1 (and FPCR.RMode = TieAway and FPCR.DN = 0)
| * | | | | thread: FPCR.FZ is likely not 1MerryMage2020-04-191-2/+1
| | | | | |
* | | | | | Merge pull request #3699 from FearlessTobi/port-5185bunnei2020-04-221-4/+3
|\ \ \ \ \ \ | |_|/ / / / |/| | | | | Port citra-emu/citra#5185: "gdbstub: Fix some gdbstub jankiness"
| * | | | | gdbstub: Fix some gdbstub jankinessMerryMage2020-04-171-4/+3
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | 1. Ensure that register information available to gdbstub is most up-to-date. 2. There's no reason to check for current_thread == thread when emitting a trap. Doing this results in random hangs whenever a step happens upon a thread switch.
* | | | | | Merge pull request #3745 from bunnei/fix-homebrew-loadbunnei2020-04-225-12/+35
|\ \ \ \ \ \ | | | | | | | | | | | | | | Fix process memory initialization for ELF and NRO
| * | | | | | loader: nro: Fix process initialization using ProgramMetadata default.bunnei2020-04-212-11/+14
| | | | | | |
| * | | | | | loader: elf: Fix process initialization using ProgramMetadata default.bunnei2020-04-211-0/+5
| | | | | | |
| * | | | | | file_sys: program_metadata: Add a helper function for generating reasonable default metadata.bunnei2020-04-212-1/+16
| | |_|_|_|/ | |/| | | | | | | | | | | | | | | | - We need this for homebrew process initialization.
* | | | | | Merge pull request #3698 from lioncash/warningbunnei2020-04-212-3/+4
|\ \ \ \ \ \ | | | | | | | | | | | | | | General: Resolve minor assorted warnings
| * | | | | | key_manager: Resolve missing field initializer warningLioncash2020-04-171-1/+2
| | | | | | |
| * | | | | | time_zone_manager: Resolve sign conversion warningsLioncash2020-04-171-2/+2
| | |_|_|/ / | |/| | | | | | | | | | | | | | | | | | | | | | ttis and ats will never exceed the length of INT32_MAX in our case, so this is safe.
* | | | | | Merge pull request #3724 from bunnei/fix-unicornbunnei2020-04-211-0/+11
|\ \ \ \ \ \ | | | | | | | | | | | | | | core: arm_unicorn: Fix interpret fallback by temporarily mapping instruction page.
| * | | | | | core: arm_unicorn: Fix interpret fallback by temporarily mapping instruction page.bunnei2020-04-191-0/+11
| | | | | | |
* | | | | | | audio_renderer: Preliminary BehaviorInfo (#3736)David2020-04-211-2/+7
| |_|/ / / / |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * audio_renderer: Preliminary BehaviorInfo * clang format * Fixed IsRevisionSupported * fixed IsValidRevision * Fixed logic error & spelling errors & crash * Addressed issues
* | | | | | Merge pull request #3739 from MerryMage/disable_cpu_optMat M2020-04-202-2/+9
|\ \ \ \ \ \ | | | | | | | | | | | | | | dynarmic: Add option to disable CPU JIT optimizations
| * | | | | | dynarmic: Add option to disable CPU JIT optimizationsMerryMage2020-04-202-2/+9
| | |_|_|_|/ | |/| | | |
* | | | | | npad: Lower log level for VibrateController to DebugFearlessTobi2020-04-201-1/+1
| | | | | |
* | | | | | audren: Lower log level for RequestUpdateImpl to DebugFearlessTobi2020-04-201-1/+1
| | | | | |
* | | | | | Merge pull request #3712 from lioncash/removebunnei2020-04-202-3/+0
|\ \ \ \ \ \ | | | | | | | | | | | | | | service: Remove unused RequestParser instances
| * | | | | | service: Remove unused RequestParser instancesLioncash2020-04-182-3/+0
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | These aren't used, so they should be removed to reduce compilation warnings.
* | | | | | | Merge pull request #3709 from lioncash/ambunnei2020-04-201-2/+2
|\ \ \ \ \ \ \ | |_|/ / / / / |/| | | | | | am: Resolve ineffective moves
| * | | | | | am: Resolve ineffective movesLioncash2020-04-181-2/+2
| |/ / / / / | | | | | | | | | | | | | | | | | | | | | | | | Previously const objects were being std::moved, which results in no move actually occurring. This resolves that.
* | | | | | Merge pull request #3696 from lioncash/cast-sizebunnei2020-04-192-21/+23
|\ \ \ \ \ \ | |_|/ / / / |/| | | | | hle_ipc: Remove std::size_t casts where applicable
| * | | | | hle_ipc: Remove std::size_t casts where applicableLioncash2020-04-172-21/+23
| | |/ / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | These were added in the change that enabled -Wextra on linux builds so as not to introduce interface changes in the same change as a build-system flag addition. Now that the flags are enabled, we can freely change the interface to make these unnecessary.
* | | | | Merge pull request #3710 from lioncash/nsobunnei2020-04-181-1/+1
|\ \ \ \ \ | | | | | | | | | | | | loader/nso: Resolve moves not occurring in DecompressSegment
| * | | | | loader/nso: Resolve moves not occurring in DecompressSegmentLioncash2020-04-181-1/+1
| | |/ / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Given the std::vector was const, an automatic move out of the function could not occur. We can allow automatic return value optimizations to occur by making the buffer non-const.
* | | | | Merge pull request #3715 from bunnei/fix-impl-fallthroughMat M2020-04-181-0/+2
|\ \ \ \ \ | | | | | | | | | | | | service: hid: npad: Fix implicit fallthrough errors.
| * | | | | service: hid: npad: Fix implicit fallthrough errors.bunnei2020-04-181-0/+2
| |/ / / /
* | | | | Merge pull request #3713 from lioncash/timebunnei2020-04-185-4/+5
|\ \ \ \ \ | | | | | | | | | | | | service/time: Minor changes
| * | | | | time/system_clock_core: Remove unnecessary initializerLioncash2020-04-181-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | This is already initialized within the class body.
| * | | | | service/time: Mark IsStandardNetworkSystemClockAccuracySufficient as constLioncash2020-04-181-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | This doesn't modify internal member state.
| * | | | | service/time: Add virtual destructors where applicableLioncash2020-04-183-2/+3
| |/ / / / | | | | | | | | | | | | | | | | | | | | | | | | | Many of these implementations are used to implement a polymorphic interface. While not directly used polymorphically, this prevents virtual destruction from ever becoming an issue.
* / / / / memory/slab_heap: Make use of static_cast over reinterpret_castLioncash2020-04-181-2/+2
|/ / / / | | | | | | | | | | | | | | | | Casting from void* with static_cast is permitted by the standard, so we can just make use of that instead.
* | | | core: hle: Address various feedback & code cleanup.bunnei2020-04-1711-251/+153
| | | | | | | | | | | | | | | | - Should be no functional changes.
* | | | core: device_memory: Remove incorrect usage of constexpr.bunnei2020-04-171-2/+6
| | | |
* | | | memory: Add copyright notice for Atmosphere where applicable.bunnei2020-04-176-0/+18
| | | |
* | | | kernel: Remove old VMManager class.bunnei2020-04-173-1973/+0
| | | |
* | | | loader: nso: Fix loader size and arguments.bunnei2020-04-173-25/+47
| | | |
* | | | loader: elf/kip/nro: Updates for new VMM.bunnei2020-04-173-5/+7
| | | |
* | | | service: ldr: Updates for new VMM.bunnei2020-04-171-150/+215
| | | | | | | | | | | | | | | | - Includes removing some service impls. that are untested.
* | | | kernel: memory: page_table: Simplify GetPhysicalAddr impl.bunnei2020-04-174-19/+6
| | | |
* | | | kernel: svc: Updates for new VMM.bunnei2020-04-171-488/+116
| | | | | | | | | | | | | | | | - Includes removing some SVC impls. that are untested.
* | | | core: memory: Fix memory access on page boundaries.bunnei2020-04-171-6/+39
| | | | | | | | | | | | | | | | - Fixes Super Smash Bros. Ultimate.
* | | | core: memory: Updates for new VMM.bunnei2020-04-172-114/+53
| | | |
* | | | core: gdbstub: Updates for new VMM.bunnei2020-04-171-2/+2
| | | |
* | | | core: reporter: Updates for new VMM.bunnei2020-04-171-3/+5
| | | |
* | | | memory: cheat_engine: Updates for new VMM.bunnei2020-04-171-5/+8
| | | |
* | | | kernel: process: Updates for new VMM.bunnei2020-04-172-79/+151
| | | |
* | | | service: pl_u: Update for new shared memory layout.bunnei2020-04-171-7/+5
| | | |
* | | | service: time: Update for new shared memory layout.bunnei2020-04-171-3/+2
| | | |
* | | | service: hid: Update for new shared memory layout.bunnei2020-04-171-3/+2
| | | |
* | | | service: irs: Update for new shared memory layout.bunnei2020-04-171-3/+3
| | | |
* | | | kernel: resource_limit: Reserve physical memory.bunnei2020-04-171-1/+6
| | | |
* | | | kernel: Initialize memory layout for new VMM.bunnei2020-04-172-0/+159
| | | |
* | | | core: system: Rename GetDeviceManager -> DeviceManager.bunnei2020-04-173-7/+7
| | | | | | | | | | | | | | | | - More consistent with other system components.
* | | | kernel: transfer_memory: Refactor for new VMM.bunnei2020-04-172-130/+16
| | | |
* | | | core: Construct/Destruct DeviceMemory on Init/Shutdown.bunnei2020-04-171-4/+7
| | | |
* | | | kernel: shared_memory: Refactor for new VMM.bunnei2020-04-172-220/+58
| | | |
* | | | core: device_memory: Update to use VirtualBuffer class.bunnei2020-04-172-39/+12
| | | |
* | | | kernel: errors: Add ERR_OUT_OF_RESOURCES.bunnei2020-04-171-0/+1
| | | |
* | | | kernel: process_capability: Update to use Memory::PageTable.bunnei2020-04-172-23/+25
| | | |
* | | | kernel: memory: Add PageTable class, to manage process address space.bunnei2020-04-173-0/+1510
| | | |
* | | | kernel: memory: Add MemoryLayout class, to build physical memory layout.bunnei2020-04-172-0/+74
| | | |
* | | | kernel: memory: Add MemoryManager class, to manage page heaps.bunnei2020-04-173-0/+276
| | | |
* | | | kernel: memory: Add MemoryBlockManager class, to manage memory blocks.bunnei2020-04-173-0/+256
| | | |
* | | | kernel: memory: Add PageHeap class, to manage a heap of pages.bunnei2020-04-173-0/+483
| | | |
* | | | kernel: memory: Add PageLinkedList class, to manage a list of pages.bunnei2020-04-172-0/+94
| | | |
* | | | kernel: memory: Add system_control code, which will be used for ASLR support.bunnei2020-04-173-0/+61
| | | |
* | | | physical_memory: Add missing include for <vector>.bunnei2020-04-171-0/+2
| | | |
* | | | kernel: memory: Add MemoryBlock class, for managing memory blocks and their state.bunnei2020-04-172-0/+316
| | | |
* | | | kernel: memory: Add memory_types.h, for things that are commonly used in memory code.bunnei2020-04-172-0/+19
| | | |
* | | | kernel: memory: Add SlabHeap class, for managing memory heaps.bunnei2020-04-172-0/+162
| | | | | | | | | | | | | | | | - This will be used for TLS pages, among other things.
* | | | kernel: memory: Add AddressSpaceInfo class, for managing the memory address space.bunnei2020-04-173-0/+166
| | | |
* | | | core: device_manager: Add a simple class to manage device RAM.bunnei2020-04-175-1/+118
| | | |
* | | | dynarmic: Enable strict alignment checks.bunnei2020-04-171-1/+4
| | | | | | | | | | | | | | | | - Also add a missing include.
* | | | core: memory: Move to Core::Memory namespace.bunnei2020-04-1733-80/+81
| | | | | | | | | | | | | | | | - helpful to disambiguate Kernel::Memory namespace.
* | | | core: kernel: Add svc_types header to include SVC-specific types.bunnei2020-04-173-0/+70
| | | |
* | | | core: kernel: Move SVC to its own namesapce.bunnei2020-04-175-9/+9
| | | |
* | | | kernel: resource_limit: Improvements to implementation.bunnei2020-04-172-12/+50
| | | |
* | | | loader: nso: Fix loading of static objects to be properly sized and aligned.bunnei2020-04-171-19/+9
| | | |
* | | | process: SetupMainThread: Zero out argument on process start.bunnei2020-04-171-0/+2
| | | |
* | | | arm_interface: Ensure ThreadContext is zero'd out.bunnei2020-04-171-16/+16
| |/ / |/| |
* | | Merge pull request #3671 from lioncash/switchbunnei2020-04-171-0/+2
|\ \ \ | |/ / |/| | kernel/thread: Resolve -Wswitch warnings
| * | kernel/thread: Resolve -Wswitch warningsLioncash2020-04-151-0/+2
| | |
* | | Merge pull request #3673 from lioncash/extrabunnei2020-04-1713-43/+54
|\ \ \ | | | | | | | | CMakeLists: Specify -Wextra on linux builds
| * | | CMakeLists: Specify -Wextra on linux buildsLioncash2020-04-1613-43/+54
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Allows reporting more cases where logic errors may exist, such as implicit fallthrough cases, etc. We currently ignore unused parameters, since we currently have many cases where this is intentional (virtual interfaces). While we're at it, we can also tidy up any existing code that causes warnings. This also uncovered a few bugs as well.
* | | | externals: Move LibreSSL linking to httplib.Markus Wick2020-04-161-5/+2
| | | | | | | | | | | | | | | | | | | | | | | | Neither core nor web_services use OpenSSL nor LibreSSL. However they need to link them as it's a requirement of httplib. So let's declare this within httplib instead of core and web_services.
* | | | Merge pull request #3659 from bunnei/time-calc-standard-userRodrigo Locatti2020-04-163-1/+25
|\ \ \ \ | |/ / / |/| | | service: time: Implement CalculateStandardUserSystemClockDifferenceByUser.
| * | | service: time: Implement CalculateStandardUserSystemClockDifferenceByUser.bunnei2020-04-153-1/+25
| | |/ | |/| | | | | | | - Used by Animal Crossing: New Horizons.
* | | CMakeLists: Make -Wreorder a compile-time errorLioncash2020-04-151-1/+1
| |/ |/| | | | | | | | | This can result in silent logic bugs within code, and given the amount of times these kind of warnings are caused, they should be flagged at compile-time so no new code is submitted with them.
* | Merge pull request #3660 from bunnei/friend-blocked-usersZach Hilman2020-04-141-1/+10
|\ \ | | | | | | service: friend: Stub IFriendService::GetBlockedUserListIds.
| * | service: friend: Stub IFriendService::GetBlockedUserListIds.bunnei2020-04-141-1/+10
| |/ | | | | | | - This is safe to stub, as there should be no adverse consequences from reporting no blocked users.
* / file_sys: patch_manager: Return early when there are no layers to apply.bunnei2020-04-141-0/+6
|/
* Merge pull request #3606 from ReinUsesLisp/nvflingerbunnei2020-04-123-10/+44
|\ | | | | service/vi: Partially implement BufferQueue disconnect
| * service/vi: Partially implement BufferQueue disconnectReinUsesLisp2020-04-103-10/+44
| |
* | Merge pull request #3635 from FernandoS27/buffer-freeRodrigo Locatti2020-04-112-9/+33
|\ \ | | | | | | Buffer queue: Correct behavior of free buffer.
| * | Buffer queue: Correct behavior of free buffer.Fernando Sahmkow2020-04-102-9/+33
| |/ | | | | | | | | | | This corrects the behavior of free buffer after witnessing it in an unrelated hardware test. I haven't found any games affected by it but in name of better accuracy we'll correct such behavior.
* | Merge pull request #3594 from ReinUsesLisp/vk-instancebunnei2020-04-111-5/+36
|\ \ | |/ |/| yuzu: Drop SDL2 and Qt frontend Vulkan requirements
| * yuzu: Drop SDL2 and Qt frontend Vulkan requirementsReinUsesLisp2020-04-071-5/+36
| | | | | | | | Create Vulkan instances and surfaces from the Vulkan backend.
* | Merge pull request #3610 from FernandoS27/gpu-cachesRodrigo Locatti2020-04-092-6/+199
|\ \ | |/ |/| Refactor all the GPU Caches to use VAddr for cache addressing
| * Memory: Address Feedback.Fernando Sahmkow2020-04-081-0/+68
| |
| * Buffer Cache: Use vAddr instead of physical memory.Fernando Sahmkow2020-04-062-0/+125
| |
| * GPU: Setup Flush/Invalidate to use VAddr instead of CacheAddrFernando Sahmkow2020-04-061-6/+6
| |
* | file_sys: fix LayeredFS error when loading some games made with… (#3602)enler2020-04-071-1/+2
|/ | | * fix LayeredFS error when loading some games made with the Unity
* Merge pull request #3563 from bunnei/fix-ldr-memstateFernando Sahmkow2020-04-031-5/+15
|\ | | | | services: ldr: Fix MemoryState for read/write regions of NROs.
| * services: ldr: Fix MemoryState for read/write regions of NROs.bunnei2020-03-261-5/+15
| | | | | | | | - Fixes #3541, used by Final Fantasy VIII Remastered.
* | Merge pull request #3552 from jroweboy/single-contextRodrigo Locatti2020-04-025-75/+34
|\ \ | | | | | | Refactor Context management (Fixes renderdoc on opengl issues)
| * | Address review and fix broken yuzu-tester buildJames Rowe2020-03-262-2/+4
| | |
| * | Frontend/GPU: Refactor context managementJames Rowe2020-03-255-75/+32
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Changes the GraphicsContext to be managed by the GPU core. This eliminates the need for the frontends to fool around with tricky MakeCurrent/DoneCurrent calls that are dependent on the settings (such as async gpu option). This also refactors out the need to use QWidget::fromWindowContainer as that caused issues with focus and input handling. Now we use a regular QWidget and just access the native windowHandle() directly. Another change is removing the debug tool setting in FrameMailbox. Instead of trying to block the frontend until a new frame is ready, the core will now take over presentation and draw directly to the window if the renderer detects that its hooked by NSight or RenderDoc Lastly, since it was in the way, I removed ScopeAcquireWindowContext and replaced it with a simple subclass in GraphicsContext that achieves the same result
* | | capsrv: Split Capture services into individual files and stub GetAlbumContentsFileListForApplication (#3571)Morph2020-04-0115-151/+536
| | | | | | | | | | | | | | | | | | | | | * Organize capture services into individual files * Stub GetAlbumContentsFileListForApplication * Address feedback
* | | Merge pull request #3568 from bunnei/time-calcspanbunnei2020-03-293-1/+31
|\ \ \ | | | | | | | | services: time: Implement CalculateSpanBetween.
| * | | services: time: Implement CalculateSpanBetween.bunnei2020-03-273-1/+31
| | |/ | |/| | | | | | | - Used by Super Smash Bros. Ultimate.
* | | Merge pull request #3562 from perillamint/vrsvcbunnei2020-03-282-3/+42
|\ \ \ | | | | | | | | am: Implement VR related APIs
| * | | am: Implement VR related APIsperillamint2020-03-272-3/+42
| |/ / | | | | | | | | | | | | | | | Implement (and stub) VR related APIs in AM sysmodule. This fixes issue #2938
* / / services: hid: Stub InitializeSevenSixAxisSensor.bunnei2020-03-272-1/+9
|/ / | | | | | | - Used by Super Smash Bros. Ultimate v7.0.0.
* | Merge pull request #3524 from FearlessTobi/port-5106bunnei2020-03-243-1/+17
|\ \ | |/ |/| Port citra-emu/citra#5106: "gdbstub: Ensure gdbstub doesn't drop packets crucial to initialization"
| * gdbstub: small logic bug fix with defer_startGauvain "GovanifY" Roussel-Tarbouriech2020-03-171-2/+4
| |
| * gdbstub: Ensure gdbstub doesn't drop packets crucial to initializationGauvain "GovanifY" Roussel-Tarbouriech2020-03-173-2/+16
| |
* | sm/controller: Increase PointerBufferSizeFearlessTobi2020-03-231-1/+1
| | | | | | | | | | | | | | This increases the PointerBufferSize as a lager one is required by some services. This change is still not hw-accurate, but it is proven to work in Ryujinx. Instead of using a hardcoded size, we should figure out the specific values for each service in the future. Some of them can be taken from Atmosphere: https://github.com/Atmosphere-NX/Atmosphere/search?q=PointerBufferSize.
* | Merge pull request #3477 from FearlessTobi/webapplet-shitbunnei2020-03-221-0/+6
|\ \ | | | | | | core/web_browser: Allow WebApplet to exit gracefully when an error occurs
| * | core/web_browser: Allow WebApplet to exit gracefully when an error occursFearlessTobi2020-03-221-0/+6
| | | | | | | | | | | | | | | | | | | | | | | | Currently, yuzu just freezes when an error occurs while Initializing the WebApplet. From a user perspective, this obviously isn't great as the game just softlocks. With this change, yuzu will call the Finalize method, so to the game it seems like as the user just exited the WebApplet normally. This works around https://github.com/yuzu-emu/yuzu/issues/2852.
* | | set: implement GetRegionCodeDan2020-03-194-1/+12
| | |
* | | Merge pull request #3527 from FearlessTobi/output-modebunnei2020-03-191-0/+1
|\ \ \ | | | | | | | | yuzu: Save sound output mode and set it to Stereo by default
| * | | yuzu: Save sound output mode and set it to Stereo by defaultFearlessTobi2020-03-171-0/+1
| | |/ | |/|
* / | time_zone_content_manager: Fix out of bounds readReinUsesLisp2020-03-181-1/+1
|/ / | | | | | | | | | | | | There were cases where raw_data didn't contain enough space to hold the zero terminator. This was caught with -fsanitize=address.
* | Merge pull request #3497 from FernandoS27/microprogfile-extendbunnei2020-03-121-2/+2
|\ \ | | | | | | Small corrections and features to microprofile
| * | NVFlinger: Do the microprofile Flip after processing a valid frame.Fernando Sahmkow2020-03-121-2/+2
| | |
* | | framebuffer_layout.h: drop the use of enum for screen dimensions.Vitor Kiguchi2020-03-112-10/+10
|/ / | | | | | | +clang format
* | Merge pull request #3301 from ReinUsesLisp/state-trackerRodrigo Locatti2020-03-091-0/+1
|\ \ | | | | | | video_core: Remove gl_state and use a state tracker based on dirty flags
| * | video_core: Reintroduce dirty flags infrastructureReinUsesLisp2020-02-281-0/+1
| |/
* | Merge pull request #3452 from Morph1984/anisotropic-filteringbunnei2020-03-081-0/+1
|\ \ | | | | | | frontend/Graphics: Add "Advanced" graphics tab and experimental Anisotropic Filtering support
| * | Create an "Advanced" tab in the graphics configuration tab and add anisotropic filtering levels.Morph2020-02-281-0/+1
| |/
* | core: hle: Implement separate A32/A64 SVC interfaces.bunnei2020-03-032-107/+380
| |
* | core: Implement separate A32/A64 ARM interfaces.bunnei2020-03-0320-120/+452
| |
* | core: loader: Remove check for 32-bit.bunnei2020-03-031-6/+0
| |
* | core: dynarmic: Add CP15 from Citra.bunnei2020-03-033-0/+234
| |
* | Merge pull request #3464 from FernandoS27/jit-fixbunnei2020-03-032-4/+19
|\ \ | |/ |/| ARM_Interface: Cache the JITs instead of deleting/recreating.
| * ARM_Interface: Cache the JITs instead of deleting/recreating.Fernando Sahmkow2020-02-262-4/+19
| | | | | | | | | | | | This was a bug inherited from citra which was fixed by then at some time. This commit corrects such bug and ensures JITs are correctly recycled.
* | Merge pull request #3430 from bunnei/split-presenterbunnei2020-02-2810-28/+32
|\ \ | | | | | | Port citra-emu/citra#4940: "Split Presentation thread from Render thread"
| * | renderer_opengl: Move Frame/FrameMailbox to OpenGL namespace.bunnei2020-02-271-41/+0
| | |
| * | core: frontend: Refactor scope_acquire_window_context to scope_acquire_context.bunnei2020-02-265-25/+28
| | |
| * | frontend: sdl2: emu_window: Implement separate presentation thread.bunnei2020-02-261-3/+0
| | |
| * | renderer_opengl: Add texture mailbox support for presenter thread.bunnei2020-02-261-0/+1
| | |
| * | core: frontend: emu_window: Add TextureMailbox class.bunnei2020-02-261-0/+41
| | |
| * | core: settings: Add setting to enable vsync, which is on by default.bunnei2020-02-263-0/+3
| |/
* | AM/ICommonStateGetter: Stub SetLcdBacklighOffEnabled (#3454)Morph2020-02-272-2/+14
| | | | | | | | | | | | | | | | | | * Stub SetLcdBacklighOffEnabled Used by Super Smash Bros. Ultimate We require backlight services to be implemented to turn on/off the backlight. * Address feedback
* | Merge pull request #3431 from CJBok/npad-fixbunnei2020-02-261-5/+5
|\ \ | |/ |/| InputCommon: analog_from_button get direction implementation
| * analog_from_button get direction implementationCJBok2020-02-181-5/+5
| |
* | Scheduler: Inline global scheduler in Scheduler Lock.Fernando Sahmkow2020-02-221-4/+2
| |
* | Kernel: Correct pending feedback.Fernando Sahmkow2020-02-221-3/+4
| |
* | System: Expose Host thread registering routines from kernel.Fernando Sahmkow2020-02-222-0/+14
| |
* | Kernel: Address Feedback.Fernando Sahmkow2020-02-226-30/+47
| |
* | Kernel: Implement Scheduler locksFernando Sahmkow2020-02-222-0/+89
| |
* | Kernel: Implement Time Manager.Fernando Sahmkow2020-02-225-1/+98
| |
* | Kernel: Rename ThreadCallbackHandleTable and Setup Thread Ids on Kernel.Fernando Sahmkow2020-02-225-24/+107
| |
* | Kernel: Make global scheduler depend on KernelCoreFernando Sahmkow2020-02-224-8/+24
| |
* | httplib compatibilityBrian Clinkenbeard2020-02-191-3/+4
|/
* Merge pull request #3412 from Morph1984/aspect-ratiobunnei2020-02-183-3/+34
|\ | | | | GUI: Add aspect ratio dropdown
| * Add 4:3 aspect ratio and address feedbackMorph2020-02-142-10/+13
| |
| * Address feedbackMorph2020-02-142-18/+26
| |
| * Use enumeration instead of magic numbersMorph2020-02-142-5/+11
| |
| * Add following aspect ratios: 16:9, 21:9, Stretch to WindowMorph2020-02-142-2/+16
| | | | | | | | Available as a drop down within the configure graphics tab.
* | Merge pull request #3420 from namkazt/master2bunnei2020-02-172-0/+20
|\ \ | | | | | | nvhost_gpu: implement ChannelSetTimeslice
| * | nvhost_gpu: implement ChannelSetTimeslicenamkazy2020-02-162-0/+20
| | |
* | | IUserLocalCommunicationService: add function Initialize2Nguyen Dac Nam2020-02-161-1/+9
| | |
* | | HLE: correct function name of IUserLocalCommunicationServiceNguyen Dac Nam2020-02-161-1/+1
|/ / | | | | | | 402: function name should be Initialize2 (7.0.0+) not SetOperationMode Follow by: https://switchbrew.org/wiki/LDN_services#IUserLocalCommunicationService
* | Merge pull request #3401 from FernandoS27/synchronizationbunnei2020-02-1440-202/+402
|\ \ | | | | | | Set of refactors for Kernel Synchronization and Hardware Constants
| * | Core: Correct compilition in GCCFernando Sahmkow2020-02-141-0/+2
| | |
| * | Core: Address FeedbackFernando Sahmkow2020-02-146-24/+50
| | |
| * | Core: Set all hardware emulation constants in a single file.Fernando Sahmkow2020-02-1217-53/+88
| | |
| * | Kernel: Refactor synchronization to better match REFernando Sahmkow2020-02-1123-80/+212
| | |
| * | Kernel: Change WaitObject to Synchronization object. In order to better reflect RE.Fernando Sahmkow2020-02-1120-73/+78
| | |
* | | Merge pull request #3400 from makigumo/patch-1bunnei2020-02-141-2/+4
|\ \ \ | |_|/ |/| | update hwopus DecodeInterleaved for FW 7.0.0+
| * | update hwopus DecodeInterleaved for FW 7.0.0+makigumo2020-02-111-2/+4
| |/ | | | | | | trivial change, see https://switchbrew.org/wiki/Audio_services#IHardwareOpusDecoder
* | address_arbiter: Collapse loops in InsertThread() and RemoveThread()Lioncash2020-02-121-19/+17
| | | | | | | | | | Same behavior, but without the need to explicitly loop through everything manually.
* | address_arbiter: Simplify GetThreadsWaitingOnAddress()Lioncash2020-02-122-10/+9
| | | | | | | | | | Simplifies the overall function and also allows for it to become a const-qualified member function.
* | Merge pull request #3403 from lioncash/debugbunnei2020-02-121-2/+2
|\ \ | | | | | | bcat/backend: Prevent fmt exception in debug log within NullBackend::Clear()
| * | bcat/backend: Make formatting of passphrase consistent in NullBackend::SetPassphrase()Lioncash2020-02-121-1/+1
| | | | | | | | | | | | | | | Aligns the '=' to be consistent with the rest of the logs within this source file.
| * | bcat/backend: Prevent fmt exception in debug log within NullBackend::Clear()Lioncash2020-02-121-1/+1
| |/ | | | | | | | | A formatting specifier within Clear wasn't being used, which will cause fmt to throw an exception. This fixes that.
* / kernel/thread: Remove trivial usages of the global system accessorLioncash2020-02-121-2/+2
|/ | | | | We can just use the kernel member variable directly instead of going through the system to obtain the same thing.
* hle: services: Use std::shared_ptr instead of copy by value.bunnei2020-02-089-50/+52
|
* Merge pull request #3381 from bunnei/ipc-fixbunnei2020-02-072-23/+57
|\ | | | | hle: services: Fix prepo IPC, and add better error checking.
| * services: prepo: Fix IPC interface with SaveReport/SaveReportWithUser.bunnei2020-02-061-15/+15
| |
| * hle_ipc: Add error checking to read/write buffer access.bunnei2020-02-061-8/+42
| |
* | kernel: transfer_memory: Properly reserve and reset memory region.bunnei2020-02-065-40/+116
| |
* | wait_object: Make wait behavior only require one object to signal.Zach Hilman2020-02-061-11/+2
| | | | | | | | - This was holdover from citra.
* | am: Correct IPC object count mismatch.bunnei2020-02-061-6/+4
| |
* | services: am: Clear events on PopOutData and PopInteractiveOutData.bunnei2020-02-061-0/+2
| |
* | am: Refactor IStorage interface.bunnei2020-02-067-43/+81
| |
* | applets: software_keyboard: Signal state change on end of interactive session.bunnei2020-02-061-0/+1
| |
* | applets: software_keyboard: Minor cleanup.bunnei2020-02-061-2/+2
|/
* Merge pull request #3337 from ReinUsesLisp/vulkan-stagedbunnei2020-02-034-2/+30
|\ | | | | yuzu: Implement Vulkan frontend
| * yuzu: Implement Vulkan frontendReinUsesLisp2020-01-291-0/+7
| | | | | | | | | | Adds a Qt and SDL2 frontend for Vulkan. It also finishes the missing bits on Vulkan initialization.
| * settings: Add settings for graphics backendReinUsesLisp2020-01-292-1/+20
| |
| * core: Only wait for idle on gpu_core when it was initializedReinUsesLisp2020-01-291-1/+3
| | | | | | | | This fixes crashes when a Vulkan device fails to initialize.
* | Merge pull request #3284 from CJBok/hid-fixbunnei2020-02-012-13/+36
|\ \ | | | | | | hid: Fix analog sticks directional states
| * | Moved analog direction logic to sdl_implCJBok2020-01-152-9/+32
| | |
| * | Corrected directional states sensitivityCJBok2020-01-141-9/+9
| | |
| * | hid: Fix analog sticks directional statesCJBok2020-01-091-12/+12
| | |
* | | Merge pull request #3364 from lioncash/threadbunnei2020-01-312-2/+4
|\ \ \ | | | | | | | | core/arm: Remove usage of global GetCurrentThread()
| * | | core/arm: Remove usage of global GetCurrentThread()Lioncash2020-01-312-2/+4
| | | | | | | | | | | | | | | | | | | | Now both CPU backends go through their referenced system instance to obtain the current thread.
* | | | Merge pull request #3363 from lioncash/unique_ptrbunnei2020-01-314-17/+17
|\ \ \ \ | | | | | | | | | | kernel/physical_core: Make use of std::unique_ptr instead of std::shared_ptr
| * | | | kernel/physical_core: Make use of std::unique_ptrLioncash2020-01-312-4/+10
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | shared_ptr was used in 2d1984c20c75e03ec79eeb3806b12efa1679b977 due to a misunderstanding of how the language generates move constructors and move assignment operators. If a destructor is user-provided, then the compiler won't generate the move constructor and move assignment operators by default--they must be explicitly opted into. The reason for the compilation errors is due to the fact that the language will fall back to attempting to use the copy constructor/copy assignment operators if the respective move constructor or move assignment operator is unavailable. Given that we explicitly opt into them now, the the move constructor and move assignment operators will be generated as expected.
| * | | | core/cpu_manager: Remove unused includesLioncash2020-01-311-2/+0
| | | | | | | | | | | | | | | | | | | | | | | | | Nothing from these headers are used within this source file, so we can remove them.
| * | | | kernel/physical_core: Remove unused kernel reference member variableLioncash2020-01-313-11/+7
| |/ / / | | | | | | | | | | | | | | | | | | | | | | | | This isn't used within the class, so it can be removed to simplify the overall interface. While we're in the same area, we can simplify a unique_ptr reset() call.
* / / / Revert "system_archive: Fix Korean and Chinese fonts"bunnei2020-01-315-880167/+27164
|/ / /
* | | Merge pull request #3353 from FernandoS27/ariesbunnei2020-01-3124-515/+541
|\ \ \ | | | | | | | | System: Refactor CPU Core management and move ARMInterface and Schedulers to Kernel
| * | | System: Address FeedbackFernando Sahmkow2020-01-2711-24/+30
| | | |
| * | | System: Correct PrepareReschedule.Fernando Sahmkow2020-01-261-1/+1
| | | |
| * | | Kernel: Remove a few global instances from the kernel.Fernando Sahmkow2020-01-262-2/+2
| | | |
| * | | Core: Refactor CpuCoreManager to CpuManager and Cpu to Core Manager.Fernando Sahmkow2020-01-2615-128/+115
| | | | | | | | | | | | | | | | This commit instends on better naming the new purpose of this classes.
| * | | ArmInterface: Delegate Exclusive monitor factory to exclusive monitor interfasce.Fernando Sahmkow2020-01-263-16/+24
| | | |
| * | | Core: Refactor CPU Management.Fernando Sahmkow2020-01-2510-224/+168
| | | | | | | | | | | | | | | | This commit moves ARM Interface and Scheduler handling into the kernel.
| * | | Kernel: Implement Physical Core.Fernando Sahmkow2020-01-242-0/+81
| | | |
* | | | Merge pull request #3151 from FearlessTobi/fix-koreanbunnei2020-01-305-27164/+880167
|\ \ \ \ | |_|_|/ |/| | | system_archive: Fix Korean and Chinese fonts
| * | | Disable clang-format for font filesFearlessTobi2020-01-243-0/+6
| | | |
| * | | system_archive: Fix Chinese fontFearlessTobi2020-01-192-13582/+694524
| | | | | | | | | | | | | | | | Adds the proper OSS font for the Chinese language.
| * | | system_archive: Fix Korean fontFearlessTobi2020-01-192-13582/+185637
| | | | | | | | | | | | | | | | Fixes Korean fonts when using Open-source system archives.
* | | | bsd: Stub several more functions.bunnei2020-01-252-4/+48
| | | | | | | | | | | | | | | | - Required for Little Town Hero to boot further.
* | | | Merge pull request #3340 from SciresM/pmdxbunnei2020-01-242-3/+10
|\ \ \ \ | |_|/ / |/| | | loader: provide default arguments (zero byte) to NSOs
| * | | loader: provide default arguments (zero byte) to NSOsMichael Scire2020-01-232-3/+10
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Certain newer unity games (Terraria, Pokemon Mystery Dungeon) require that the argument region be populated. Failure to do so results in an integer underflow in argument count, and eventually an unmapped read at 0x800000000. Providing this default fixes this. Note that the behavior of official software is as yet unverified, arguments-wise.
* | | | Input: UDP Client to provide motion and touch controlsfearlessTobi2020-01-231-0/+3
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | An implementation of the cemuhook motion/touch protocol, this adds the ability for users to connect several different devices to citra to send direct motion and touch data to citra. Co-Authored-By: jroweboy <jroweboy@gmail.com>
* | | | service: time: Implement ToPosixTimeWithMyRule.bunnei2020-01-234-1/+34
|/ / / | | | | | | | | | - Used by Pokemon Mystery Dungeon.
* | | time: Fix month off-by-one error.bunnei2020-01-201-2/+2
| | | | | | | | | | | | - Fixes timestamp in ZLA and Astral Chain saves.
* | | Merge pull request #3271 from bunnei/time-rewritebunnei2020-01-2043-534/+3665
|\ \ \ | |/ / |/| | service: time: Rewrite implementation of glue services.
| * | service: time: Implement GetStandardLocalSystemClock.bunnei2020-01-053-1/+9
| | |
| * | time: Remove overflow error checking (currently breaks ADO builds).bunnei2020-01-042-18/+2
| | |
| * | service: time: Implement GetClockSnapshotFromSystemClockContext.bunnei2020-01-043-3/+27
| | |
| * | service: time: Implement IsStandardNetworkSystemClockAccuracySufficient.bunnei2020-01-045-1/+51
| | |
| * | system_archive: Add a basic HLE implementation for time zone binary.bunnei2020-01-044-1/+675
| | |
| * | service: time: Rewrite implementation of glue services.bunnei2020-01-0435-444/+2834
| | |
| * | core: Initialize several structs that make use of Common::UUID.bunnei2020-01-045-100/+101
| | |
* | | core/memory: Create a special MapMemoryRegion for physical memory.Markus Wick2020-01-184-4/+31
| | | | | | | | | | | | This allows us to create a fastmem arena within the memory.cpp helpers.
* | | core/hle: Simplify PhysicalMemory usage in vm_manager.Markus Wick2020-01-181-23/+11
| | |
* | | core/loaders: Simplify PhysicalMemory usage.Markus Wick2020-01-183-8/+12
| | | | | | | | | | | | | | | It is currently a std::vector, however we might want to replace it with a more fancy allocator. So we can't use the C++ iterators any more.
* | | core/kernel: Fix GetTotalPhysicalMemoryUsed.Markus Wick2020-01-111-2/+2
| |/ |/| | | | | | | | | | | | | | | module._memory was already moved over to a new shared_ptr. So code_memory_size was not increased at all. This lowers the heap space and so saves a bit of memory, usually between 50 to 100 MB. This fixes a regression of c0a01f3adc466d07fc27020048e82cca60988970
* | Merge pull request #3272 from bunnei/vi-close-layerbunnei2020-01-075-11/+48
|\ \ | | | | | | service: vi: Implement CloseLayer.
| * | service: vi: Implement CloseLayer.bunnei2020-01-045-11/+48
| |/ | | | | | | - Needed for Undertale.
* | Merge pull request #3261 from degasus/page_tablebunnei2020-01-062-9/+17
|\ \ | | | | | | core/memory + arm/dynarmic: Use a global offset within our arm page table.
| * | core/memory + arm/dynarmic: Use a global offset within our arm page table.Markus Wick2020-01-012-9/+17
| | | | | | | | | | | | | | | | | | This saves us two x64 instructions per load/store instruction. TODO: Clean up our memory code. We can use this optimization here as well.
* | | Merge pull request #3257 from degasus/no_busy_loopsbunnei2020-01-061-1/+1
|\ \ \ | | | | | | | | video_core: Block in WaitFence.
| * | | video_core: Block in WaitFence.Markus Wick2019-12-301-1/+1
| |/ / | | | | | | | | | | | | | | | | | | This function is called rarely and blocks quite often for a long time. So don't waste power and let the CPU sleep. This might also increase the performance as the other cores might be allowed to clock higher.
* | | Merge pull request #2945 from FernandoS27/fix-bcatbunnei2020-01-051-3/+17
|\ \ \ | |_|/ |/| | nifm: Only return that there's an internet connection when there's a BCATServer
| * | nifm: Only return that there's an internet connection when there's a BCATServerFernando Sahmkow2019-11-071-3/+17
| | | | | | | | | | | | | | | This helps games that need internet for other purposes boot as the rest of our internet infrastructure is incomplete.
* | | Merge pull request #3247 from FernandoS27/remap-fixbunnei2020-01-032-3/+5
|\ \ \ | | | | | | | | NvServices: Correct Ioctl Remap.
| * | | NvServices: Correct Ioctl Remap.Fernando Sahmkow2019-12-252-3/+5
| | |/ | |/| | | | | | | | | | This commit corrects a padding value in Ioctl Remap that was actually an offset to the mapping address.
* / | yuzu: Remove Maxwell debuggerReinUsesLisp2020-01-032-14/+0
|/ / | | | | | | | | This was carried from Citra and wasn't really used on yuzu. It also adds some runtime overhead. This commit removes it from yuzu's codebase.
* | Merge pull request #3214 from lioncash/svc-funcbunnei2019-12-132-9/+6
|\ \ | | | | | | kernel/svc: Amend function signature of SignalProcessWideKey
| * | kernel/svc: Correct function signature of SignalProcessWideKeyLioncash2019-12-112-9/+6
| | | | | | | | | | | | | | | This function doesn't actually return a result code, so we can amend the signature of it to match.
* | | Kernel: Correct behavior of Address Arbiter threads. (#3165)Fernando Sahmkow2019-12-113-24/+67
|/ / | | | | | | | | | | | | | | | | | | | | * Kernel: Correct behavior of Address Arbiter threads. This corrects arbitration threads to behave just like in Horizon OS. They are added into a container and released according to what priority they had when added. Horizon OS does not reorder them if their priority changes. * Kernel: Address Feedback.
* | Merge pull request #3201 from lioncash/dumpbunnei2019-12-112-2/+24
|\ \ | | | | | | kernel/svc: Provide implementations for svcDumpInfo/svcDumpInfoNew
| * | kernel/svc: Provide implementations for svcDumpInfo/svcDumpInfoNewLioncash2019-12-082-2/+24
| | | | | | | | | | | | | | | | | | | | | | | | | | | These are fairly trivial to implement, we can just do nothing. This also provides a spot for us to potentially dump out any relevant info in the future (e.g. for debugging purposes with homebrew, etc). While we're at it, we can also correct the names of both of these supervisor calls.
* | | kernel: Remove unnecessary includesLioncash2019-12-0815-11/+17
|/ / | | | | | | | | | | Over the course of the changes to the kernel code, a few includes are no longer necessary, particularly with the change over to std::shared_ptr from Boost's intrusive_ptr.
* | CpuCore: Clear exclusive state after doing a run in dynarmic.Fernando Sahmkow2019-12-052-1/+2
| | | | | | | | | | | | This commit corrects an error in which a Core could remain with an exclusive state after running, leaving space for possible race conditions between changing cores.
* | telemetry_session: Report renderer backendReinUsesLisp2019-12-021-0/+1
| | | | | | | | We only have OpenGL as an option for now. Hardcode the entry.
* | telemetry_session: Use temporary to avoid writing the same enumReinUsesLisp2019-12-021-16/+11
| |
* | kernel: Implement a more accurate IPC dispatch.bunnei2019-11-2819-167/+246
| |
* | Merge pull request #3169 from lioncash/memorybunnei2019-11-2838-674/+1241
|\ \ | | | | | | core/memory: Deglobalize memory management code
| * | core/memory; Migrate over SetCurrentPageTable() to the Memory classLioncash2019-11-273-26/+34
| | | | | | | | | | | | | | | | | | | | | Now that literally every other API function is converted over to the Memory class, we can just move the file-local page table into the Memory implementation class, finally getting rid of global state within the memory code.
| * | core/memory: Migrate over GetPointerFromVMA() to the Memory classLioncash2019-11-271-36/+36
| | | | | | | | | | | | | | | | | | | | | | | | Now that everything else is migrated over, this is essentially just code relocation and conversion of a global accessor to the class member variable. All that remains is to migrate over the page table.
| * | core/memory: Migrate over Write{8, 16, 32, 64, Block} to the Memory classLioncash2019-11-2714-153/+298
| | | | | | | | | | | | | | | | | | | | | | | | | | | The Write functions are used slightly less than the Read functions, which make these a bit nicer to move over. The only adjustments we really need to make here are to Dynarmic's exclusive monitor instance. We need to keep a reference to the currently active memory instance to perform exclusive read/write operations.
| * | core/memory: Migrate over Read{8, 16, 32, 64, Block} to the Memory classLioncash2019-11-2717-167/+292
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | With all of the trivial parts of the memory interface moved over, we can get right into moving over the bits that are used. Note that this does require the use of GetInstance from the global system instance to be used within hle_ipc.cpp and the gdbstub. This is fine for the time being, as they both already rely on the global system instance in other functions. These will be removed in a change directed at both of these respectively. For now, it's sufficient, as it still accomplishes the goal of de-globalizing the memory code.
| * | core/memory: Migrate over ZeroBlock() and CopyBlock() to the Memory classLioncash2019-11-272-91/+161
| | | | | | | | | | | | | | | These currently aren't used anywhere in the codebase, so these are very trivial to move over to the Memory class.
| * | core/memory: Migrate over RasterizerMarkRegionCached() to the Memory classLioncash2019-11-272-68/+77
| | | | | | | | | | | | | | | This is only used within the accelerated rasterizer in two places, so this is also a very trivial migration.
| * | core/memory: Migrate over ReadCString() to the Memory classLioncash2019-11-273-18/+40
| | | | | | | | | | | | | | | This only had one usage spot, so this is fairly straightforward to convert over.
| * | core/memory: Migrate over GetPointer()Lioncash2019-11-273-18/+45
| | | | | | | | | | | | | | | With all of the interfaces ready for migration, it's trivial to migrate over GetPointer().
| * | core: Prepare various classes for memory read/write migrationLioncash2019-11-2717-41/+66
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Amends a few interfaces to be able to handle the migration over to the new Memory class by passing the class by reference as a function parameter where necessary. Notably, within the filesystem services, this eliminates two ReadBlock() calls by using the helper functions of HLERequestContext to do that for us.
| * | core/memory: Move memory read/write implementation functions into an anonymous namespaceLioncash2019-11-271-97/+98
| | | | | | | | | | | | | | | | | | These will eventually be migrated into the main Memory class, but for now, we put them in an anonymous namespace, so that the other functions that use them, can be migrated over separately.
| * | core/memory: Migrate over address checking functions to the new Memory classLioncash2019-11-276-39/+70
| | | | | | | | | | | | | | | | | | | | | | | | | | | A fairly straightforward migration. These member functions can just be mostly moved verbatim with minor changes. We already have the necessary plumbing in places that they're used. IsKernelVirtualAddress() can remain a non-member function, since it doesn't rely on class state in any form.
| * | core/memory: Migrate over memory mapping functions to the new Memory classLioncash2019-11-275-121/+172
| | | | | | | | | | | | | | | | | | Migrates all of the direct mapping facilities over to the new memory class. In the process, this also obsoletes the need for memory_setup.h, so we can remove it entirely from the project.
| * | core/memory: Introduce skeleton of Memory classLioncash2019-11-274-3/+56
| | | | | | | | | | | | | | | | | | | | | | | | | | | Currently, the main memory management code is one of the remaining places where we have global state. The next series of changes will aim to rectify this. This change simply introduces the main skeleton of the class that will contain all the necessary state.
* | | Merge pull request #3171 from lioncash/internal-linkbunnei2019-11-282-6/+5
|\ \ \ | | | | | | | | filesys/romfs: Make ProcessFile and ProcessDirectory internally linked
| * | | filesys/romfs: Remove unused includesLioncash2019-11-272-4/+2
| | | | | | | | | | | | | | | | | | | | These inclusions aren't used at all within the public interface, so they can be removed.
| * | | filesys/romfs: Make ProcessFile and ProcessDirectory internally linkedLioncash2019-11-271-2/+3
| | | | | | | | | | | | | | | | | | | | These functions aren't used outside of this file, so we can place them within an anonymous namespace.
* | | | patch_manager: Adds check for disabled cheats to prevent them from being enabled (#3178)Morph2019-11-281-5/+11
| | | | | | | | | | | | | | | | | | | | | | | | * Adds check for disabled cheats to prevent them from being added to the CheatList * Address feedback
* | | | Merge pull request #3170 from lioncash/enumbunnei2019-11-282-3/+3
|\ \ \ \ | |_|/ / |/| | | file_sys/directory: Make EntryType an enum class
| * | | file_sys/directory: Make EntryType an enum classLioncash2019-11-272-3/+3
| |/ / | | | | | | | | | | | | This can trivially be an enum class rather than a regular enum, making it more strongly typed.
* / / core_timing: Use better reference tracking for EventType. (#3159)bunnei2019-11-2714-82/+71
|/ / | | | | | | | | | | | | * core_timing: Use better reference tracking for EventType. - Moves ownership of the event to the caller, ensuring we don't fire events for destroyed objects. - Removes need for unique names - we won't be using this for save states anyways.
* | kernel: Fix reference management for client/server session.bunnei2019-11-263-20/+18
| | | | | | | | - Fixes shutdown crash and crash in Pokemon SwSh.
* | Merge pull request #3094 from lioncash/tablesbunnei2019-11-2533-7/+192
|\ \ | | | | | | service: Update function tables
| * | service: Update function tablesLioncash2019-11-1233-7/+192
| |/ | | | | | | | | | | Keeps the function tables up to date. Updated based off information from Switchbrew.
* | kernel: Replace usage of boost::intrusive_ptr with std::shared_ptr for kernel objects. (#3154)bunnei2019-11-2570-364/+365
| | | | | | | | | | | | * kernel: Replace usage of boost::intrusive_ptr with std::shared_ptr for kernel objects. - See https://github.com/citra-emu/citra/pull/4710 for details.
* | Update svc.cppbunnei2019-11-231-0/+1
| |
* | svc: GetSystemTick should return cntpct_el0, not core ticks.bunnei2019-11-231-1/+3
| |
* | Merge pull request #3114 from FernandoS27/cond-varbunnei2019-11-235-22/+74
|\ \ | | | | | | Kernel: Correct behavior of Condition Variables to be more similar to real hardware.
| * | Kernel: Optimize condition variable threads management.Fernando Sahmkow2019-11-214-24/+21
| | |
| * | Kernel: Correct SignalProcessWideKeyFernando Sahmkow2019-11-211-6/+2
| | | | | | | | | | | | When the target is 0, all threads must be processed.
| * | Kernel: Correct behavior of Condition Variables to be more similar to real hardware.Fernando Sahmkow2019-11-215-15/+74
| | | | | | | | | | | | | | | | | | | | | This commit ensures cond var threads act exactly as they do in the real console. The original implementation uses an RBTree and the behavior of cond var threads is that at the same priority level they act like a FIFO.
* | | Merge pull request #3130 from FernandoS27/cancel-syncbunnei2019-11-233-2/+19
|\ \ \ | | | | | | | | Kernel: Correct Cancel Synchronization.
| * | | Kernel: Correct Cancel Synchronization.Fernando Sahmkow2019-11-163-2/+19
| | | | | | | | | | | | | | | | | | | | | | | | This commit corrects the behavior of cancel synchronization when the thread is running/ready and ensures the next wait is cancelled as it's suppose to.
* | | | Merge pull request #3112 from lioncash/skipbunnei2019-11-211-8/+16
|\ \ \ \ | | | | | | | | | | service/am: Remove unnecessary Skip calls
| * | | | service/am: Remove unnecessary Skip callsLioncash2019-11-141-8/+16
| |/ / / | | | | | | | | | | | | | | | | We can simplify these by wrapping the necessary members in structs and then simply reading out the whole struct.
* | | | Merge pull request #3111 from lioncash/querybunnei2019-11-212-5/+14
|\ \ \ \ | |_|/ / |/| | | am: Stub QueryApplicationPlayStatistics
| * | | am: Stub QueryApplicationPlayStatisticsLioncash2019-11-142-5/+14
| |/ / | | | | | | | | | | | | | | | | | | | | | Maintains implementation parity between QueryApplicationPlayStatistics and QueryApplicationPlayStatisticsByUid. These function the same behaviorally underneath the hood, with the only difference being that one allows specifying a UID.
* | | Merge pull request #3091 from lioncash/core-conversionbunnei2019-11-1535-170/+182
|\ \ \ | |/ / |/| | core: Make most implicit type conversion warnings errors on MSVC
| * | externals: Update httplibLioncash2019-11-121-1/+1
| | | | | | | | | | | | | | | | | | | | | Since the introduction of this library, numerous improvements have been made. Notably, many of the warnings we would get by simply including the library header have now been fixed. This makes it much easier to make conversion warning an error.
| * | service: Resolve sign conversion errorsLioncash2019-11-1215-58/+55
| | | | | | | | | | | | | | | These are fairly trivial to resolve and most of the changes entail using RESULT_UNKNOWN over ResultCode(-1).
| * | perf_stats: Resolve implicit int to double conversion errorLioncash2019-11-121-1/+1
| | | | | | | | | | | | | | | We simply need to turn the literal argument to std::accumulate into a double, rather than an int.
| * | loader; Resolve sign conversion/truncation errorsLioncash2019-11-123-6/+6
| | |
| * | gdbstub: Resolve sign conversion errorsLioncash2019-11-121-1/+2
| | |
| * | kernel: Resolve sign conversion warningsLioncash2019-11-124-72/+60
| | | | | | | | | | | | | | | | | | | | | | | | | | | Uncovered a bug within Thread's SetCoreAndAffinityMask() where an unsigned variable (ideal_core) was being compared against "< 0", which would always be a false condition. We can also get rid of an unused function (GetNextProcessorId) which contained a sign mismatch warning.
| * | file_sys: Resolve sign conversion warningsLioncash2019-11-124-12/+10
| | | | | | | | | | | | Resolves a few trivial sign conversion/mismatch errors.
| * | result: Add default error code for the ResultCode(-1) caseLioncash2019-11-121-1/+9
| | | | | | | | | | | | | | | Will be used to reduce the overall duplication of the same magic value all over the codebase in following changes.
| * | crypto: Resolve sign-conversion warningsLioncash2019-11-122-11/+12
| | |
| * | result: Resolve sign-coversion warningsLioncash2019-11-121-1/+1
| | | | | | | | | | | | | | | The constructor was implicitly using signed->unsigned conversions to produce 0xFFFFFFFF. We can just specify this explicitly with UINT32_MAX.
| * | arm_unicorn: Resolve sign conversion warningsLioncash2019-11-123-8/+10
| | | | | | | | | | | | | | | While we're at it, this also resolves a type truncation warning as well, given the code was truncating from a 64-bit value to a 32-bit one.
| * | CMakeLists: Make most implicit type conversion warnings errors on MSVCLioncash2019-11-121-0/+17
| |/ | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Quite frequently there have been cases where code has been merged into the core that produces warning. In order to prevent this from occurring, we can make the compiler flag these cases and allow our CI to flag down any code that would generate these warnings. This is beneficial given silent conversions from signed/unsigned can result in logic bugs. This forces one writing changes to be explicit about when signedness conversions are desirable, rather than leaving it up to readers' interpretation. Currently the codebase isn't in a state where it will build successfully with this change applied, but this will be addressed in subsequent follow-up changes. This set of changes will focus on making it build properly with these changes for MSVC as a starting point for basic coverage.
* | Merge pull request #3089 from SciresM/play_statisticsbunnei2019-11-142-0/+10
|\ \ | | | | | | Implement stub for IApplicationFunctions::QueryApplicationPlayStatisticsByUid
| * | Implement stub for QueryApplicationPlayStatisticsByUidMichael Scire2019-11-112-0/+10
| |/
* | Merge pull request #3093 from lioncash/mbedtlsbunnei2019-11-147-12/+12
|\ \ | | | | | | core: Migrate off deprecated mbedtls functions
| * | core: Migrate off deprecated mbedtls functionsLioncash2019-11-127-12/+12
| |/ | | | | | | | | These functions are marked for deprecation and it's recommended that the *_ret variants be used instead.
* | Merge pull request #3092 from lioncash/utilbunnei2019-11-141-11/+15
|\ \ | | | | | | key_manager: Make use of IOFile in WriteKeyToFile()
| * | key_manager: Make use of IOFile in WriteKeyToFile()Lioncash2019-11-121-11/+15
| |/ | | | | | | | | | | | | | | | | This properly handles unicode-based paths on Windows, while opening a raw stream doesn't out-of-the-box. Prevents file creation from potentially failing on Windows PCs that make use of unicode characters in their save paths (e.g. writing to a user's AppData folder, where the user has a name with non-ASCII characters).
* / xts_archive: Remove redundant std::string constructorLioncash2019-11-131-2/+1
|/ | | | | We can just call the .data() member of path instead of constructing a completely new string.
* Merge pull request #3062 from bunnei/event-improvebunnei2019-11-0623-87/+53
|\ | | | | kernel: Improve events
| * kernel: readable_event: Signal only once.bunnei2019-11-031-2/+4
| |
| * kernel: events: Remove ResetType::Automatic.bunnei2019-11-0323-84/+48
| | | | | | | | | | | | | | | | - This does not actually seem to exist in the real kernel - games reset these automatically. # Conflicts: # src/core/hle/service/am/applets/applets.cpp # src/core/hle/service/filesystem/fsp_srv.cpp
| * kernel: readable_event: Initialize members.bunnei2019-11-031-1/+1
| |
* | Merge pull request #2859 from Morph1984/hidDavid2019-11-062-92/+126
|\ \ | | | | | | hid: Stub SetNpadJoyAssignmentModeSingle and GetNpadHandheldActivationMode
| * | hid: Stub SetNpadJoyAssignmentModeSingle and reorganize service commandsMorph2019-10-072-92/+126
| | |
* | | common_func: Use std::array for INSERT_PADDING_* macros.bunnei2019-11-045-38/+39
| | | | | | | | | | | | - Zero initialization here is useful for determinism.
* | | core/am: Stub InitializeApplicationCopyrightFrameBuffer, SetApplicationCopyrightImage and SetApplicationCopyrightVisibilityFearlessTobi2019-11-032-3/+31
| |/ |/| | | | | These commands require Screenshots to be implemented anyway, so they are safe to stub for now.
* | Merge pull request #3038 from lioncash/docsRodrigo Locatti2019-10-302-91/+73
|\ \ | | | | | | kernel/scheduler: Minor changes
| * | scheduler: Mark parameter of AskForReselectionOrMarkRedundant() as constLioncash2019-10-282-5/+5
| | | | | | | | | | | | This is only compared against, so it can be made const.
| * | scheduler: Silence sign conversion warningsLioncash2019-10-281-5/+5
| | |
| * | scheduler: Initialize class members directly where applicableLioncash2019-10-282-6/+4
| | | | | | | | | | | | Reduces the overall amount of code.
| * | scheduler: Amend documentation commentsLioncash2019-10-282-75/+59
| | | | | | | | | | | | | | | Adjusts the formatting of a few of the comments an ensures they get recognized as proper Doxygen comments.
* | | Merge pull request #3007 from DarkLordZach/fsc-regressbunnei2019-10-301-0/+12
|\ \ \ | |/ / |/| | savedata_factory: Automatically create certain savedata
| * | savedata_factory: Automatically create certain savedataZach Hilman2019-10-221-0/+12
| | | | | | | | | | | | | | | After further hardware investigation, it appears that some games, perhaps those more lazily coded, will not call EnsureSaveData, meaning that they expect the normal (current) save to be automatically made. Additionally, some games do not create a cache or temporary save before use. In these 3 specific instances, the save is created automatically for the game if it doesn't exist.
* | | Merge pull request #2971 from FernandoS27/new-scheduler-v2David2019-10-2817-431/+1014
|\ \ \ | | | | | | | | Kernel: Implement a New Thread Scheduler V2
| * | | Kernel Thread: Cleanup THREADPROCESSORID_DONT_UPDATE.Fernando Sahmkow2019-10-152-4/+1
| | | |
| * | | Kernel: Address Feedback 2Fernando Sahmkow2019-10-152-9/+6
| | | |
| * | | Kernel: Clang FormatFernando Sahmkow2019-10-152-5/+5
| | | |
| * | | Kernel: Reverse global accessor removal.Fernando Sahmkow2019-10-154-23/+9
| | | |
| * | | Kernel: Address Feedback.Fernando Sahmkow2019-10-156-67/+98
| | | |
| * | | Kernel Scheduler: Make sure the global scheduler shutdowns correctly.Fernando Sahmkow2019-10-156-0/+24
| | | |
| * | | Kernel_Thread: Eliminate most global accessors.Fernando Sahmkow2019-10-151-11/+11
| | | |
| * | | KernelSVC: Assert that condition variable address is aligned to 4 bytes.Fernando Sahmkow2019-10-151-0/+4
| | | |
| * | | Kernel: Correct Paused schedulingFernando Sahmkow2019-10-151-3/+1
| | | |
| * | | Kernel: Corrections to Wait Objects clearing in which a thread could still be signalled after a timeout or a cancel.Fernando Sahmkow2019-10-153-3/+4
| | | |
| * | | Kernel: Correct redundant yields to only advance time forward.Fernando Sahmkow2019-10-151-3/+5
| | | |
| * | | Kernel: Corrections to ModifyByWaitingCountAndSignalToAddressIfEqualFernando Sahmkow2019-10-151-5/+13
| | | |
| * | | Kernel: Correct Results in Condition Variables and MutexesFernando Sahmkow2019-10-153-24/+17
| | | |
| * | | Kernel: Clang FormatFernando Sahmkow2019-10-152-2/+3
| | | |
| * | | Kernel: Remove global system accessor from WaitObjectFernando Sahmkow2019-10-154-2/+17
| | | |
| * | | Scheduler: Implement Yield Count and Core migration on Thread Preemption.Fernando Sahmkow2019-10-152-5/+85
| | | |
| * | | Scheduler: Corrections to YieldAndBalanceLoad and Yield bombing protection.Fernando Sahmkow2019-10-152-8/+8
| | | |
| * | | Kernel: Initial implementation of thread preemption.Fernando Sahmkow2019-10-153-0/+30
| | | |
| * | | Scheduler: Add protections for Yield bombingFernando Sahmkow2019-10-155-24/+31
| | | | | | | | | | | | | | | | | | | | | | | | In case of redundant yields, the scheduler will now idle the core for it's timeslice, in order to avoid continuously yielding the same thing over and over.
| * | | Kernel: Style and CorrectionsFernando Sahmkow2019-10-1512-96/+137
| | | |
| * | | Correct PrepareRescheduleFernando Sahmkow2019-10-156-38/+29
| | | |
| * | | Comment and reorganize the schedulerFernando Sahmkow2019-10-152-98/+104
| | | |
| * | | Add PrepareReschedule where required.Fernando Sahmkow2019-10-153-16/+18
| | | |
| * | | Correct compiling errors and addapt to the new interface.Fernando Sahmkow2019-10-152-23/+14
| | | |
| * | | Correct Supervisor Calls to work with the new scheduler,Fernando Sahmkow2019-10-151-26/+41
| | | |
| * | | Redesign CPU Cores to work with the new schedulerFernando Sahmkow2019-10-152-13/+12
| | | |
| * | | Add interfacing to the Global SchedulerFernando Sahmkow2019-10-154-0/+34
| | | |
| * | | Addapt thread class to the new SchedulerFernando Sahmkow2019-10-152-60/+237
| | | |
| * | | Implement a new Core SchedulerFernando Sahmkow2019-10-152-258/+411
| | | |
* | | | Merge pull request #2991 from lioncash/npadbunnei2019-10-232-51/+23
|\ \ \ \ | |_|/ / |/| | | hid/npad: Minor cleanup
| * | | hid/npad: Fix incorrect connection boolean value in ConnectAllDisconnectedControllers()Lioncash2019-10-181-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | We should be setting the connection state to true, otherwise we aren't actually making the controllers connected like the function name indicates.
| * | | hid/npad: Add missing break in default caseLioncash2019-10-181-0/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | While not an issue, it does prevent fallthrough from occurring if anything is ever added after this case (unlikely to occur, but this turns a trivial "should not cause issues" into a definite "won't cause issues).
| * | | hid/npad: Replace std::for_each with ranged for loopsLioncash2019-10-181-13/+12
| | | | | | | | | | | | | | | | | | | | | | | | Performs the same behavior, but is built into the core language itself. No functional change.
| * | | hid/npad: Remove redundant non-const variant of IsControllerSupported()Lioncash2019-10-182-34/+5
| | | | | | | | | | | | | | | | | | | | | | | | The const qualified variant can also be called in non-const contexts, so we can remove the non-const variant to eliminate a bit of code duplication.
| * | | hid/npad: Move function declarationsLioncash2019-10-181-5/+6
| | | | | | | | | | | | | | | | | | | | Clearly separate these from the variable declarations to make them more visible.
* | | | core: Fix clang-format errors.bunnei2019-10-191-9/+10
| | | |
* | | | Fix null pointer deref.Nicolae-Andrei Cociorba2019-10-181-10/+12
| | | |
* | | | Merge pull request #2992 from lioncash/dmntbunnei2019-10-181-2/+2
|\ \ \ \ | | | | | | | | | | dmnt_cheat_vm: Correct register Restore and ClearRegs behavior
| * | | | dmnt_cheat_vm: Correct register Restore and ClearRegs behaviorLioncash2019-10-181-2/+2
| |/ / / | | | | | | | | | | | | | | | | Previously these were performing the same behavior as the Save and ClearSaved opcode types.
* | | | Merge pull request #2989 from lioncash/apmRodrigo Locatti2019-10-182-16/+36
|\ \ \ \ | | | | | | | | | | service/apm/controller: Minor interface changes
| * | | | apm/controller: Make SetPerformanceConfiguration() use an array of pairs over a mapLioncash2019-10-171-14/+34
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | While a map is an OK way to do lookups (and usually recommended in most cases), this is a map that lives for the entire duration of the program and only deallocates its contents when the program terminates. Given the total size of the map is quite small, we can simply use a std::array of pairs and utilize std::find_if to perform the same behavior without loss of performance. This eliminates a static constructor and places the data into the read-only segment. While we're at it, we can also handle malformed inputs instead of directly dereferencing the resulting iterator.
| * | | | apm/controller: Make GetCurrentPerformanceMode() a const member functionLioncash2019-10-172-2/+2
| |/ / / | | | | | | | | | | | | This doesn't modify instance state, so it can be made const qualified.
* | | | core/core: Resolve -Wreorder warningsLioncash2019-10-171-2/+2
| | | | | | | | | | | | | | | | | | | | Amends the initializer lists to be ordered in the same manner that they're declared within the class.
* | | | core/memory/cheat_engine: Resolve -Wreorder warningsLioncash2019-10-171-4/+3
|/ / / | | | | | | | | | | | | Amends the initializer lists to be ordered in the same manner that they're declared within the class.
* | | Merge pull request #2912 from FernandoS27/async-fixesbunnei2019-10-166-28/+29
|\ \ \ | | | | | | | | General fixes to Async GPU
| * | | NvFlinger: Remove leftover from corrections and clang format.Fernando Sahmkow2019-10-051-4/+0
| | | |
| * | | Core: Wait for GPU to be idle before shutting down.Fernando Sahmkow2019-10-051-0/+2
| | | |
| * | | Nvdrv: Correct Event setup in NvdrvFernando Sahmkow2019-10-052-23/+14
| | | | | | | | | | | | | | | | Events are supposed to be cleared on quering. This fixes that issue.
| * | | NVFlinger: Reverse the change that only signaled events on buffer acquire.Fernando Sahmkow2019-10-052-20/+1
| | | | | | | | | | | | | | | | | | | | This has been hardware tested and it seems that NVFlinger will still signal even if there are no buffers to present.
| * | | Nvdrv: Do framelimiting only in the CPU ThreadFernando Sahmkow2019-10-051-0/+4
| | | |
| * | | NvFlinger: Don't swap buffers if a frame is missing and always trigger event in sync gpu.Fernando Sahmkow2019-10-051-1/+3
| | | |
| * | | GPU_Async: Correct fences, display events and more.Fernando Sahmkow2019-10-052-2/+21
| | | | | | | | | | | | | | | | | | | | | | | | | | | | This commit uses guest fences on vSync event instead of an articial fake fence we had. It also corrects to keep signaling display events while loading the game as the OS is suppose to send buffers to vSync during that time.
| * | | Nvdrv: Correct Async regression and avoid signaling empty buffer vsyncsFernando Sahmkow2019-10-052-3/+9
| | | |
* | | | Merge pull request #2972 from lioncash/systembunnei2019-10-159-33/+63
|\ \ \ \ | |_|/ / |/| | | {bcat, gpu, nvflinger}: Remove trivial usages of the global system accessor
| * | | bcat: Remove use of global system accessorsLioncash2019-10-156-29/+55
| | | | | | | | | | | | | | | | | | | | Removes all uses of the global system accessor within the BCAT interface.
| * | | nvflinger/buffer_queue: Remove use of a global system accessorLioncash2019-10-123-4/+8
| | | |
* | | | Merge pull request #2965 from FernandoS27/fair-core-timingbunnei2019-10-156-38/+94
|\ \ \ \ | | | | | | | | | | Core Timing: Rework Core Timing to run all cores evenly.
| * | | | Core_Timing: Address Remaining feedback.Fernando Sahmkow2019-10-121-5/+4
| | | | |
| * | | | Core_Timing: Address Feedback and suppress warnings.Fernando Sahmkow2019-10-115-13/+12
| | | | |
| * | | | Core Timing: Correct Idle and remove lefting pragmaFernando Sahmkow2019-10-091-2/+1
| | | | |
| * | | | Core Timing: General corrections and added tests.Fernando Sahmkow2019-10-092-4/+12
| | | | |
| * | | | Core Timing: Rework Core Timing to run all cores evenly.Fernando Sahmkow2019-10-096-38/+89
| |/ / /
* | | | Merge pull request #2897 from DarkLordZach/oss-ext-fonts-1bunnei2019-10-1418-123/+73480
|\ \ \ \ | | | | | | | | | | pl_u: Move open source font archives and fix NAND error
| * | | | pl_u: Fix mismatched rebase size error in font encryptionZach Hilman2019-10-133-19/+17
| | | | |
| * | | | pl_u: Use kernel physical memoryZach Hilman2019-10-132-4/+8
| | | | |
| * | | | pl_u: Remove excess static qualifierZach Hilman2019-10-131-1/+1
| | | | |
| * | | | pl_u: Use OSS system archives if real archives don't existZach Hilman2019-10-132-112/+48
| | | | |
| * | | | system_archive: Synthesize shared fonts system archivesZach Hilman2019-10-133-5/+101
| | | | |
| * | | | externals: Move OSS font data to file_sys in coreZach Hilman2019-10-1313-1/+73324
| |/ / /
* | | | Merge pull request #2930 from DarkLordZach/gamecard-partitionsbunnei2019-10-144-26/+128
|\ \ \ \ | |/ / / |/| | | file_sys: Add code to access raw gamecard partitions and lazily load them
| * | | card_image: Implement system update commands in XCIZach Hilman2019-10-132-3/+37
| | | |
| * | | card_image: Add accessors for raw partitions in XCIZach Hilman2019-09-232-0/+36
| | | |
| * | | card_image: Lazily load partitions in XCIZach Hilman2019-09-232-26/+41
| | | |
| * | | pfs: Provide accessors for file sizes and offsetsZach Hilman2019-09-232-0/+17
| | | |
* | | | Merge pull request #2921 from FreddyFunk/compiler-warnings-corebunnei2019-10-091-6/+6
|\ \ \ \ | | | | | | | | | | Services::ES fix casting warnings
| * | | | Services::ES fix casting warningsFreddyFunk2019-09-291-6/+6
| |/ / /
* | | | Merge pull request #2654 from DarkLordZach/lm-log-rewritebunnei2019-10-0910-159/+367
|\ \ \ \ | | | | | | | | | | lm: Rewrite logger to use core reporting services
| * | | | lm: Flush manager output on core shutdownZach Hilman2019-09-225-11/+15
| | | | |
| * | | | lm: Rename Initialize to Log and implement with manager/reporterZach Hilman2019-09-221-140/+22
| | | | | | | | | | | | | | | Allows saving and clearer output of data.
| * | | | lm: Implement manager class to output to reporterZach Hilman2019-09-222-0/+233
| | | | |
| * | | | core: Add LM::Manager to systemZach Hilman2019-09-226-19/+39
| | | | | | | | | | | | | | | Allows centralized control over logging mechanisms.
| * | | | reporter: Add log output for packaged lm log dataZach Hilman2019-09-222-0/+69
| |/ / / | | | | | | | | Takes the vector from head to tail of log data and saves it.
* | | / hid: Implement DeactivateNpadMorph2019-10-072-1/+13
| |_|/ |/| | | | | | | | Makes use of the already existing DeactivateController function.
* | | Merge pull request #2951 from lioncash/globalZach Hilman2019-10-0718-65/+87
|\ \ \ | | | | | | | | core: Remove Core::CurrentProcess()
| * | | core/core: Remove unused headerLioncash2019-10-061-1/+0
| | | | | | | | | | | | | | | | This isn't used anywhere in either the cpp or header file.
| * | | core: Remove Core::CurrentProcess()Lioncash2019-10-065-13/+11
| | | | | | | | | | | | | | | | | | | | | | | | This only encourages the use of the global system instance (which will be phased out long-term). Instead, we use the direct system function call directly to remove the appealing but discouraged short-hand.
| * | | hle/service: Replace global system instance calls with instance-based onesLioncash2019-10-0614-51/+76
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Migrates the HLE service code off the use of directly accessing the global system instance where trivially able to do so. This removes all usages of Core::CurrentProcess from the service code, only 8 occurrences of this function exist elsewhere. There's still quite a bit of "System::GetInstance()" being used, however this was able to replace a few instances.
* | | | bcat/module: Silence truncation warningsLioncash2019-10-061-3/+3
| | | | | | | | | | | | | | | | | | | | We need to perform explicit casts here, otherwise we're implicitly truncating a 64-bit type to a 32-bit one.
* | | | bcat: Take std::function instance by value in NullBackend's constructorLioncash2019-10-062-2/+2
| | | | | | | | | | | | | | | | | | | | Without this, the std::move within the constructor initializer list won't be able to actually perform a move.
* | | | bcat: In-class initialize ProgressServiceBackend's impl memberLioncash2019-10-062-2/+2
| | | | | | | | | | | | | | | | Allows us to remove a constructor initializer list.
* | | | bcat: Make ProgressServiceBackend's constructor take a std::string_viewLioncash2019-10-062-3/+7
| | | | | | | | | | | | | | | | | | | | Given the string is appended to another, we can make it a view so a redundant full copy of the string isn't made.
* | | | bcat: Make ProgressServiceBackend's GetEvent() constLioncash2019-10-062-2/+2
| | | | | | | | | | | | | | | | | | | | This member function doesn't modify internal member state, so it can be marked const.
* | | | boxcat: Silence an unused variable warningLioncash2019-10-061-1/+2
|/ / / | | | | | | | | | | | | | | | On parse errors, we can log out the explanatory string indicating what the parsing error was, rather than just ignoring the variable and returning an overly broad error code.
* | | audio/audout_u: Change formatting for old clang-format versionsReinUsesLisp2019-10-051-1/+1
| | |
* | | service/nvdrv: Silence -WswitchReinUsesLisp2019-10-054-4/+10
| | |
* | | service/nfp: Silence -Wunused and -WswitchReinUsesLisp2019-10-051-4/+5
| | |
* | | service/hid: Silence -Wunused and -WswitchReinUsesLisp2019-10-0515-23/+18
| | |
* | | service/am: Silence -WreorderReinUsesLisp2019-10-051-2/+1
| | |
* | | service/hid: Remove unused system referenceReinUsesLisp2019-10-052-2/+1
| | |
* | | service/friend: Remove unused fieldReinUsesLisp2019-10-051-1/+0
| | |
* | | service/filesystem: Silence -Wunused-variableReinUsesLisp2019-10-051-1/+1
| | |
* | | service/bcat: Silence -Wreorder and -WunusedReinUsesLisp2019-10-052-2/+2
| | |
* | | service/audio: Silence -WunusedReinUsesLisp2019-10-051-1/+1
| | |
* | | service/apm: Silence -Wunused and -WreorderReinUsesLisp2019-10-052-4/+5
| |/ |/|
* | Merge pull request #2936 from VPeruS/use-isallzeroarraybunnei2019-10-041-1/+1
|\ \ | | | | | | [crypto] Use IsAllZeroArray helper function
| * | [crypto] Use IsAllZeroArray helper functionvperus2019-10-021-1/+1
| | |
* | | Merge pull request #2539 from DarkLordZach/bcatDavid2019-10-0326-40/+1636
|\ \ \ | |/ / |/| | bcat: Implement BCAT service and connect to yuzu Boxcat server
| * | qt: Add service dialogZach Hilman2019-10-021-6/+5
| | |
| * | boxcat: Use updated game-asset API URL and tagsZach Hilman2019-10-011-6/+6
| | |
| * | bcat: Add FSC accessors for BCAT dataZach Hilman2019-10-0110-31/+51
| | | | | | | | | Ports BCAT to use FSC interface
| * | boxcat: Implement events global fieldZach Hilman2019-09-303-12/+14
| | |
| * | bcat: Implement DeliveryCacheProgressImpl structureZach Hilman2019-09-306-88/+314
| | | | | | | | | Huge thanks to lioncash for re-ing this for me.
| * | boxcat: Use Etag header names for file digestZach Hilman2019-09-302-24/+21
| | |
| * | boxcat: Add downloading and client for launch parameter dataZach Hilman2019-09-302-16/+77
| | |
| * | bcat: Add backend function for BCAT Indirect (launch parameter)Zach Hilman2019-09-302-0/+11
| | | | | | | | | | | | Returns the data that should be returned by PopLaunchParameter kind=ApplicationSpecific.
| * | bcat: Expose CreateBackendFromSettings helper functionZach Hilman2019-09-302-2/+2
| | |
| * | am: Unstub PopLaunchParameter and add bcat connection for app-specific dataZach Hilman2019-09-302-16/+52
| | | | | | | | | | | | Previously we were simply returning the account-preselect structure all times but if passed with a different mode the game expects application-specific data. This also adds a hook for BCAT into this allowing us to send the launch parameter through bcat,
| * | bcat: Implement cmd 90201 ClearDeliveryCacheStorageZach Hilman2019-09-301-1/+23
| | | | | | | | | | | | Takes a title ID and simply deletes all the data for that title ID's bcat. Invokes the respective backend command.
| * | bcat: Implement cmd 30100 SetPassphraseZach Hilman2019-09-301-1/+33
| | | | | | | | | | | | Takes a title ID and passphrase (0x40 byte string) and passes it to the backend.
| * | bcat: Implement cmd RequestSyncDeliveryCache and variantZach Hilman2019-09-301-2/+70
| | | | | | | | | | | | Variant also supports only updating a single directory. These just both invoke backend commands.
| * | bcat: Implement IDeliveryCacheProgressService commandsZach Hilman2019-09-301-0/+131
| | | | | | | | | | | | Used to query completion status and events for the current delivery task.
| * | bcat: Implement IDeliveryCacheFileService commandsZach Hilman2019-09-301-0/+117
| | | | | | | | | | | | Used to read the contents of files and access their metadata.
| * | bcat: Implement IDeliveryCacheDirectoryService commandsZach Hilman2019-09-301-0/+99
| | | | | | | | | | | | Used to list and get directories at the root level.
| * | bcat: Implement IDeliveryCacheStorageService commandsZach Hilman2019-09-301-0/+58
| | | | | | | | | | | | Used to create subclasses to manage files and directories and to list directories.
| * | bcat: Add commands to create IDeliveryCacheStorageServiceZach Hilman2019-09-303-2/+32
| | | | | | | | | | | | Used to access contents of download.
| * | module: Create BCAT backend based upon Settings value on constructionZach Hilman2019-09-303-1/+36
| | |
| * | bcat: Add BCAT backend for Boxcat serviceZach Hilman2019-09-302-0/+407
| | | | | | | | | | | | Downloads content from yuzu servers and unpacks it into the temporary directory provided. Fully supports all Backend features except passphrase.
| * | bcat: Add backend class to generify the functions of BCATZach Hilman2019-09-302-0/+100
| | | | | | | | | | | | Provides the most abstract simplified functions of BCAT as functions. Also includes a NullBackend class which is just a no-op.
| * | settings: Add option to set BCAT backendZach Hilman2019-09-302-0/+6
| | |
| * | nifm: Signal to applications that internet access is availableZach Hilman2019-09-301-3/+10
| | |
| * | core/loader: Track the NSO build ID of the current processZach Hilman2019-09-303-0/+14
| | |
| * | applets: Add accessor for AppletFrontendSetZach Hilman2019-09-302-0/+6
| | | | | | | | | | | | Allows other services to call applets without using LLE.
| * | filesystem: Add getter for BCAT temporary directoryZach Hilman2019-09-303-0/+16
| | |
| * | vfs: Add function to extract ZIP file into virtual filesystemZach Hilman2019-09-302-0/+96
| | |
| * | Revert "arm_dynarmic: Check if jit is nullptr when preparing reschedule"bunnei2019-09-301-3/+0
| | |
| * | Merge pull request #2574 from DarkLordZach/dynarmic-jit-nullptrbunnei2019-09-301-0/+3
| |\ \ | | |/ | |/| arm_dynarmic: Check if jit is nullptr when preparing reschedule
| | * arm_dynarmic: Check if jit is nullptr when preparing rescheduleZach Hilman2019-06-101-0/+3
| | | | | | | | | | | | Prevents crash with multiprocess loading.
* | | Signal styleset changes at a better timeDavid Marcec2019-09-241-8/+2
|/ / | | | | | | We should signal when a net controller is added and our event should be manual, not automatic.
* | Merge pull request #2683 from DarkLordZach/lock-exitDavid2019-09-226-7/+48
|\ \ | | | | | | am: Implement exit locking and self exit commands
| * | qt: Prompt user for confirmation if exit lock is activeZach Hilman2019-09-221-1/+1
| | |
| * | am: Implement ISelfController ExitLock commandsZach Hilman2019-09-221-2/+6
| | |
| * | am: Implement ISelfController ExitZach Hilman2019-09-224-4/+20
| | | | | | | | | | | | Closes the current application.
| * | am: Add RequestExit event to AppletMessageQueueZach Hilman2019-09-222-0/+6
| | | | | | | | | | | | Tested against libnx, signals to games to begin cleanup.
| * | core: Track system exit lock statusZach Hilman2019-09-222-0/+15
| | | | | | | | | | | | Used to determine if yuzu should confirm before pausing or stopping a game.
* | | Merge pull request #2876 from ogniK5377/AcquireNpadStyleSetUpdateEventHandle-fixZach Hilman2019-09-223-11/+18
|\ \ \ | | | | | | | | AcquireNpadStyleSetUpdateEventHandle should have a separate event for each controller type
| * | | removed commentDavid Marcec2019-09-221-1/+0
| | | |
| * | | RebasedDavid Marcec2019-09-223-11/+19
| | | |
* | | | Merge pull request #2895 from FearlessTobi/debug-logsDavid2019-09-221-7/+7
|\ \ \ \ | | | | | | | | | | service/acc: Lower log severity from INFO to DEBUG
| * | | | service/acc: Lower log severity from INFO to DEBUGFearlessTobi2019-09-221-7/+7
| | | | | | | | | | | | | | | | | | | | According to ogniK, this should have always been Debug and not Info.
* | | | | Merge pull request #2873 from ogniK5377/new-ioctlsFernando Sahmkow2019-09-2224-73/+153
|\ \ \ \ \ | |_|/ / / |/| | | | Initial implementation of Ioctl2 & Ioctl3
| * | | | server side clang format fix2David Marcec2019-09-221-18/+18
| | | | |
| * | | | Use clang-format provided by build serverDavid Marcec2019-09-221-20/+18
| | | | |
| * | | | disable clang-format tempDavid Marcec2019-09-201-0/+2
| | | | |
| * | | | Initial implementation of Ioctl2 & Ioctl3David Marcec2019-09-1924-63/+143
| | | | | | | | | | | | | | | | | | | | Purpose of Ioctl2 and Ioctl3 is to prevent the passing of raw pointers through ioctls
* | | | | Merge pull request #2884 from ogniK5377/deglobal-sys-servicesFernando Sahmkow2019-09-2264-212/+291
|\ \ \ \ \ | | | | | | | | | | | | Remove usage of System::CurrentInterface() from most services
| * | | | | removed unneeded semicolonDavid Marcec2019-09-221-1/+1
| | | | | |
| * | | | | Removed reference to core timing to nvflinger and used system insteadDavid Marcec2019-09-221-1/+1
| | | | | |
| * | | | | marked controller constructors as explicitDavid Marcec2019-09-228-8/+8
| | | | | |
| * | | | | RebaseDavid Marcec2019-09-2225-62/+75
| | | | | |
| * | | | | RebaseDavid Marcec2019-09-225-20/+21
| | | | | |
| * | | | | Deglobalize System: ViDavid Marcec2019-09-223-8/+8
| | | | | |
| * | | | | Deglobalize System: TimeDavid Marcec2019-09-224-14/+21
| | | | | |
| * | | | | RebaseDavid Marcec2019-09-222-8/+12
| | | | | |
| * | | | | Deglobalize System: NvFlingerDavid Marcec2019-09-222-6/+7
| | | | | |
| * | | | | RebaseDavid Marcec2019-09-224-8/+12
| | | | | |
| * | | | | Deglobalize System: NimDavid Marcec2019-09-222-7/+12
| | | | | |
| * | | | | Deglobalize System: NifmDavid Marcec2019-09-222-13/+23
| | | | | |
| * | | | | Deglobalize System: NFPDavid Marcec2019-09-224-14/+16
| | | | | |
| * | | | | Deglobalize System: LDRDavid Marcec2019-09-222-6/+7
| | | | | |
| * | | | | Deglobalize System: IRSDavid Marcec2019-09-223-5/+6
| | | | | |
| * | | | | Deglobalize System: HidDavid Marcec2019-09-2220-37/+44
| | | | | |
| * | | | | Deglobalize System: FriendDavid Marcec2019-09-224-22/+24
| | | | | |
| * | | | | Deglobalize System: FatalDavid Marcec2019-09-226-20/+29
| | | | | |
| * | | | | Deglobalize System: BtmDavid Marcec2019-09-222-7/+13
| | | | | |
| * | | | | Deglobalize System: BtdrvDavid Marcec2019-09-222-5/+9
| | | | | |
| * | | | | Deglobalize System: AocDavid Marcec2019-09-222-11/+13
| | | | | |
| * | | | | Deglobalize System: AmDavid Marcec2019-09-221-1/+1
| | | | | |
* | | | | | Revert "Merge pull request #2709 from DarkLordZach/oss-ext-fonts-1"David Marcec2019-09-2218-73477/+123
|/ / / / / | | | | | | | | | | | | | | | | | | | | This reverts commit fa1c60c33ef88c6cd0b72da46842dc9098db712d, reversing changes made to e34899067b60a69bca02761bd1290c6824bb559a.
* | | | | Merge pull request #2535 from DarkLordZach/cheat-v2David2019-09-2213-760/+1960
|\ \ \ \ \ | | | | | | | | | | | | cheat_engine: Use Atmosphere's Cheat VM and fix cheat crash
| * | | | | dmnt_cheat_vm: Default initialize structure valuesZach Hilman2019-09-223-89/+88
| | | | | |
| * | | | | dmnt_cheat_vm: Make Cheat VM compliant to code styleZach Hilman2019-09-224-870/+862
| | | | | |
| * | | | | core: Initialize cheats after load to avoid VMManager crashZach Hilman2019-09-221-0/+5
| | | | | | | | | | | | | | | | | | This used to occur due to the VMManager being nullptr at the time cheats were registered (during load, but before it was done). This is bypassed by not accessing the VMManager for offset data until load is complete,
| * | | | | core: Update RegisterCheatList for new VMZach Hilman2019-09-222-11/+16
| | | | | |
| * | | | | patch_manager: Update cheat parsing for new VMZach Hilman2019-09-222-15/+20
| | | | | |
| * | | | | nso: Pass build ID directlyZach Hilman2019-09-221-2/+1
| | | | | | | | | | | | | | | | | | As opposed to converting to string and then back to hex array
| * | | | | cheat_engine: Move to memory and strip VMZach Hilman2019-09-225-728/+325
| | | | | | | | | | | | | | | | | | This is to go with the Atmosphere VM port, now it just contains the callbacks needed for the interface between DmntCheatVm and yuzu, along with the cheat parsers.
| * | | | | memory: Port Atmosphere's DmntCheatVmZach Hilman2019-09-223-0/+1598
| | | | | | | | | | | | | | | | | | This was done because the current VM contained many inaccuracies and this also allows cheats to have identical behavior between hardware and yuzu.
* | | | | | Merge pull request #2709 from DarkLordZach/oss-ext-fonts-1David2019-09-2218-123/+73477
|\ \ \ \ \ \ | |_|_|_|/ / |/| | | | | system_archive: Move shared font data to system_archive and fix extended font data
| * | | | | pl_u: Use kernel physical memoryZach Hilman2019-09-222-4/+8
| | | | | |
| * | | | | pl_u: Remove excess static qualifierZach Hilman2019-09-221-1/+1
| | | | | |
| * | | | | pl_u: Use OSS system archives if real archives don't existZach Hilman2019-09-223-111/+42
| | | | | |
| * | | | | system_archive: Synthesize shared fonts system archivesZach Hilman2019-09-223-5/+101
| | | | | |
| * | | | | pl_u: Expose method to encrypt TTF to BFTTFZach Hilman2019-09-222-14/+14
| | | | | |
| * | | | | externals: Move OSS font data to file_sys in coreZach Hilman2019-09-2213-1/+73324
| | |_|/ / | |/| | |
* | | | | Merge pull request #2612 from DarkLordZach/prepo-newDavid2019-09-225-30/+99
|\ \ \ \ \ | |_|/ / / |/| | | | prepo: Implement New, System, and Non-User variants of SaveReport
| * | | | prepo: Remove system global accessorsZach Hilman2019-09-223-15/+18
| | | | |
| * | | | prepo: Implement SaveReport New and System variantsZach Hilman2019-09-221-15/+71
| | | | |
| * | | | reporter: Differentiate between Old, New, and System play reportsZach Hilman2019-09-222-5/+15
| |/ / /
* | | | configure_debug: Move reporting option to loggingZach Hilman2019-09-229-18/+19
| | | |
* | | | filesystem: Add const qualification to various accessorsZach Hilman2019-09-219-80/+91
| | | |
* | | | core: Store FileSystemController in coreZach Hilman2019-09-212-0/+32
| | | |
* | | | settings: Add options for managing gamecard emulationZach Hilman2019-09-211-2/+3
| | | |
* | | | settings: Add options for setting storage sizesZach Hilman2019-09-211-0/+29
| | | |
* | | | yuzu: Port old usages of Filesystem namespace to FilesystemControllerZach Hilman2019-09-2112-31/+78
| | | |
* | | | settings: Update LogSettings to show NAND/SDMC paths from FileUtilZach Hilman2019-09-211-2/+3
| | | |
* | | | card_image: Add accessors for gamecard certificateZach Hilman2019-09-212-0/+9
| | | | | | | | | | | | | | | | Used by fsp-srv/IDeviceOperator
* | | | card_image: Add functions to query gamecard update partitionZach Hilman2019-09-212-0/+24
| | | | | | | | | | | | | | | | Includes version and meta title ID, used by fsp-srv/IDeviceOperator
* | | | content_archive: Add accessors for Rights ID and SDK VersionZach Hilman2019-09-212-0/+10
| | | |
* | | | partition_data_manager: Add accessor for decrypted PRODINFO partitionZach Hilman2019-09-212-0/+5
| | | |
* | | | services: Pass FileSystemController as reference to services that need itZach Hilman2019-09-2111-20/+47
| | | |
* | | | am: Unstub IApplicationFunctions EnsureSaveData (20)Zach Hilman2019-09-211-8/+14
| | | | | | | | | | | | Creates a default save data for the application given a user ID.
* | | | filesystem: Pass Size Getter functions to IFileSystem for sizesZach Hilman2019-09-213-20/+31
| | | |
* | | | sdmc_factory: Add SD Card size gettersZach Hilman2019-09-212-0/+12
| | | |
* | | | bis_factory: Add getters for NAND partition sizesZach Hilman2019-09-212-0/+38
| | | |
* | | | filesystem: Add FileSystemController to deglobalize FS servicesZach Hilman2019-09-212-58/+359
| | | |
* | | | submisson_package: Fix edge case with improperly sized filenamesZach Hilman2019-09-211-1/+2
| | | | | | | | | | | | Prevents a crash if the filename is less than 9 characters long.
* | | | sdmc_factory: Add accessor for SDMC Album directoryZach Hilman2019-09-212-0/+6
| | | |
* | | | sdmc_factory: Add accessor for SDMC PlaceholderCacheZach Hilman2019-09-212-1/+10
| | | |
* | | | sdmc_factory: Add accessor for content directoryZach Hilman2019-09-212-0/+7
| | | |
* | | | savedata_factory: Implement savedata creation and don't create dir on openZach Hilman2019-09-212-26/+40
| | | | | | | | | | | | Matches hardware behavior and eliminates some nasty behavior we were doing that wasn't hw-accurate at all.
* | | | patch_manager: Add short-circuit edge-case to GetPatchVersionNamesZach Hilman2019-09-211-0/+2
| | | | | | | | | | | | If title ID is 0, there are no add ons, prevents wasting time looking for them.
* | | | patch_manager: Add error checking to load dir to prevent crashesZach Hilman2019-09-211-0/+15
| | | | | | | | | | | | Prevents a crash if the load dir would be nullptr, instead logs an error and returns appropriately.
* | | | registered_cache: Process *.cnmt.nca filesZach Hilman2019-09-211-16/+23
| | | | | | | | | | | | Needed to use the RegisteredCache/PlaceholderCache on gamecards.
* | | | registered_cache: Implement PlaceholderCache to manage placeholder and installing contentZach Hilman2019-09-212-0/+175
| | | |
* | | | bis_factory: Fix mod loader edge-case with homebrew title IDsZach Hilman2019-09-211-1/+1
| | | | | | | | | | | | Fixes a bug where homebrew that has a title ID with the update bit set can cause issues with the PatchManager
* | | | bis_factory: Add accessors for BIS placeholder cachesZach Hilman2019-09-212-1/+20
| | | |
* | | | bis_factory: Add accessor for NAND Image DirectoryZach Hilman2019-09-212-0/+6
| | | |
* | | | bis_factory: Add accessors for BIS content directoriesZach Hilman2019-09-212-0/+11
| | | |
* | | | bis_factory: Add accessors for BIS partitionsZach Hilman2019-09-212-0/+61
|/ / /
* | | Merge pull request #2806 from FearlessTobi/port-4882David2019-09-214-10/+84
|\ \ \ | | | | | | | | Port citra-emu/citra#4882: "Add frametime logging for tracking performance over time"
| * | | Address review commentsFearlessTobi2019-09-102-6/+9
| | | |
| * | | Add frametime logging for tracking performance over timefearlessTobi2019-09-104-10/+81
| | | | | | | | | | | | | | | | Co-Authored-By: jroweboy <jroweboy@gmail.com>
* | | | Merge pull request #2872 from FernandoS27/mem-gpu-optDavid2019-09-211-2/+7
|\ \ \ \ | | | | | | | | | | Core/Memory: Only FlushAndInvalidate GPU if the page is marked as RasterizerCachedMemory
| * | | | Core/Memory: Only FlushAndInvalidate GPU if the page is marked as RasterizerCachedMemoryFernando Sahmkow2019-09-191-2/+7
| | |/ / | |/| | | | | | | | | | | | | | This commit avoids Invalidating and Flushing the GPU if the page is not marked as a RasterizerCache Page.
* | | | Merge pull request #2576 from DarkLordZach/nsp-fix-1David2019-09-212-14/+39
|\ \ \ \ | | | | | | | | | | nsp: Fix various errors with loading and processing of extracted NSPs
| * | | | nsp: Correct status codes for extracted NSPsZach Hilman2019-06-102-13/+17
| | | | | | | | | | | | | | | | | | | | Avoids all extracted NSPs being marked as error file type because they don't have program NCAs.
| * | | | nsp: Use title ID from NPDM metadata for extracted type NSPsZach Hilman2019-06-102-1/+22
| | |_|/ | |/| | | | | | | | | | Avoids 0 being used as title ID for all extracted NSPs.
* | | | Mark KickOffPb & SubmitGPFIFO as traceDavid Marcec2019-09-211-4/+4
| |/ / |/| | | | | | | | These functions are not stubbed and are called fairly often. Due to the nature of how often they're called, we should keep them marked as LOG_TRACE instead of LOG_DEBUG or LOG_WARNING
* | | Merge pull request #2667 from DarkLordZach/profile-editorbunnei2019-09-145-10/+130
|\ \ \ | |_|/ |/| | acc: Implement IProfileEditor interface and 'Store'/'StoreWithImage' commands
| * | acc_su: Implement GetProfileEditor (205)Zach Hilman2019-07-033-1/+13
| | | | | | | | | Takes a UUID of a user and provides and interface that allows RW access to user data/settings.
| * | acc: Implement IProfileEditor-specific commands 'Store' and 'StoreWithImage'Zach Hilman2019-07-031-1/+73
| | | | | | | | | Verified with IDA
| * | profile_manager: Add setter for ProfileBase and ProfileDataZach Hilman2019-07-032-0/+13
| | | | | | | | | Needed by IProfileEditor 'Store' and 'StoreWithImage'
| * | acc: Add IProfileCommon for IProfile and IProfileEditorZach Hilman2019-07-031-8/+31
| | | | | | | | | Since 2/3 of the commands are shared, this is likely how its done on HW.
* | | Merge pull request #2847 from VelocityRa/nro-nacp-fixDavid2019-09-092-0/+10
|\ \ \ | | | | | | | | nro/ui: Show "Developer" field in Properties
| * | | nro: Implement ReadControlDataNick Renieris2019-09-072-0/+10
| | | | | | | | | | | | | | | | | | | | | | | | With this, the "Developer" field in the Properties for homebrew is now populated. Signed-off-by: Nick Renieris <velocityra@gmail.com>
* | | | Merge pull request #2716 from lioncash/hle-globalDavid2019-09-0917-97/+143
|\ \ \ \ | | | | | | | | | | service/am: Remove usages of global system accessors
| * | | | service/am: Remove usages of global system accessorsLioncash2019-09-0517-97/+143
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Avoids the use of global accessors, removing the reliance on global state. This also makes dependencies explicit in the interface, as opposed to being hidden
* | | | | Merge pull request #2763 from lioncash/map-physDavid2019-09-092-39/+41
|\ \ \ \ \ | | | | | | | | | | | | kernel/vm_manager: Minor cleanup
| * | | | | kernel/vm_manager: Correct doxygen comment parameter tags for MapPhysicalMemory/UnmapPhysicalMemoryLioncash2019-09-051-4/+4
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Corrects the parameter names within the doxygen comments so that they resolve properly.
| * | | | | kernel/vm_manager: Move variables closer to usage spots in MapPhysicalMemory/UnmapPhysicalMemoryLioncash2019-09-051-16/+10
| | | | | | | | | | | | | | | | | | | | | | | | Narrows the scope of variables down to where they're only necessary.
| * | | | | kernel/vm_manager: Correct behavior in failure case of UnmapPhysicalMemory()Lioncash2019-08-301-0/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | If an unmapping operation fails, we shouldn't be decrementing the amount of memory mapped and returning that the operation was successful. We should actually be returning the error code in this case.
| * | | | | kernel/vm_manager: Reserve memory ahead of time for slow path in MergeAdjacentVMALioncash2019-08-301-1/+4
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Avoids potentially expensive (depending on the size of the memory block) allocations by reserving the necessary memory before performing both insertions. This avoids scenarios where the second insert may cause a reallocation to occur.
| * | | | | kernel/vm_manager: std::move shared_ptr instance in MergeAdjacentVMALioncash2019-08-301-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | Avoids an unnecessary atomic reference count increment and decrement.
| * | | | | kernel/vm_manager: Deduplicate iterator creation in MergeAdjacentVMALioncash2019-08-301-7/+10
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Avoids needing to read the same long sequence of code in both code paths. Also makes it slightly nicer to read and debug, as the locals will be able to be shown in the debugger.
| * | | | | kernel/vm_manager: Simplify some std::vector constructor callsLioncash2019-08-301-2/+2
| | | | | | | | | | | | | | | | | | | | | | | | Same behavior, one less magic constant to read.
| * | | | | kernel/vm_manager: Simplify some assertion messagesLioncash2019-08-301-10/+10
| | |/ / / | |/| | | | | | | | | | | | | | | | | | Assertions already log out the function name, so there's no need to manually include the function name in the assertion strings.
* | | | | Merge pull request #2418 from DarkLordZach/srv-esDavid2019-09-053-51/+536
|\ \ \ \ \ | | | | | | | | | | | | es: Implement various ticket accessor commands from IEticketService
| * | | | | key_manager: Convert Ticket union to std::variantZach Hilman2019-07-083-57/+88
| | | | | |
| * | | | | es: Populate/synthesize tickets on constructionZach Hilman2019-07-083-15/+17
| | | | | |
| * | | | | key_manager: Add structure for Ticket parsingZach Hilman2019-07-083-44/+194
| | | | | |
| * | | | | es: Implement ETicket GetPersonalizedTicketData (17)Zach Hilman2019-07-081-1/+21
| | | | | | | | | | | | | | | | | | Copies the raw personal ticket data into the buffer provided.
| * | | | | es: Implement ETicket GetCommonTicketData (16)Zach Hilman2019-07-081-1/+20
| | | | | | | | | | | | | | | | | | Copies the raw common ticket data for the specified rights ID into the buffer provided.
| * | | | | es: Implement ETicket GetPersonalizedTicketSize (15)Zach Hilman2019-07-081-1/+17
| | | | | | | | | | | | | | | | | | Returns the size of the buffer needed to hold the personal ticket associated with the rights ID.
| * | | | | es: Implement ETicket GetCommonTicketSize (14)Zach Hilman2019-07-081-1/+17
| | | | | | | | | | | | | | | | | | Returns the size of the buffer needed to hold the common ticket associated with the rights ID.
| * | | | | es: Implement ETicket ListPersonalizedTicket (12)Zach Hilman2019-07-081-1/+24
| | | | | | | | | | | | | | | | | | Returns an application-specific number of entries of personal tickets, starting at offset 0.
| * | | | | es: Implement ETicket ListCommonTicket (11)Zach Hilman2019-07-081-1/+24
| | | | | | | | | | | | | | | | | | Returns an application specified count of entries of common tickets, starting at offset 0.
| * | | | | es: Implement ETicket CountPersonalizedTicket (10)Zach Hilman2019-07-081-1/+12
| | | | | | | | | | | | | | | | | | Returns the number of personalized (console/user-unique) tickets in the KeyManager.
| * | | | | es: Implement ETicket CountCommonTicket (9)Zach Hilman2019-07-081-1/+12
| | | | | | | | | | | | | | | | | | Returns the number of common (non-console-unique) tickets in the KeyManager.
| * | | | | es: Implement ETicket GetTitleKey (8)Zach Hilman2019-07-081-1/+27
| | | | | | | | | | | | | | | | | | Takes a rights ID as input and returns the associated title key, if it exists.
| * | | | | es: Implement ETicket ImportTicket (1)Zach Hilman2019-07-081-1/+45
| | | | | | | | | | | | | | | | | | Takes a ticket and certificate and installs it to the KeyManager.
| * | | | | key_manager: Add accessors/helpers for ticket managementZach Hilman2019-07-082-14/+100
| | | | | |
| * | | | | key_manager: Add equality operator for RSAKeyPairZach Hilman2019-07-081-0/+7
| | | | | |
* | | | | | Merge pull request #2707 from DarkLordZach/oss-miimodelDavid2019-09-054-1/+63
|\ \ \ \ \ \ | |_|_|/ / / |/| | | | | system_archive: Add open-source reimplementation of MiiModel data
| * | | | | system_archive: Add open-source reimplementation of MiiModel dataZach Hilman2019-07-104-1/+63
| | | | | |
* | | | | | Merge pull request #2834 from Morph1984/audrenu_QueryAudioDeviceInputEventDavid2019-09-051-1/+15
|\ \ \ \ \ \ | | | | | | | | | | | | | | audren_u: Stub IAudioDevice::QueryAudioDeviceInputEvent
| * | | | | | Add Kernel::EventPair audio_input_device_switch_event;Morph19842019-09-041-0/+1
| | | | | | |
| * | | | | | audren_u: Stub IAudioDevice::QueryAudioDeviceInputEventMorph19842019-09-041-1/+14
| | |_|/ / / | |/| | | |
* | | | | | Merge pull request #2836 from Morph1984/hid_vibrationDavid2019-09-054-2/+32
|\ \ \ \ \ \ | | | | | | | | | | | | | | hid: Implement PermitVibration and IsVibrationPermitted
| * | | | | | dittoMorph19842019-09-041-1/+1
| | | | | | | | | | | | | | | | | | | | | Co-Authored-By: David <25727384+ogniK5377@users.noreply.github.com>
| * | | | | | IsVibrationEnabled() as a const member funcMorph19842019-09-041-1/+1
| | | | | | |
| * | | | | | clang-formatMorph19842019-09-041-2/+2
| | | | | | |
| * | | | | | Update npad.hMorph19842019-09-041-0/+1
| | | | | | |
| * | | | | | Update npad.cppMorph19842019-09-041-0/+6
| | | | | | |
| * | | | | | Update hid.hMorph19842019-09-041-0/+2
| | | | | | |
| * | | | | | Update hid.cppMorph19842019-09-041-2/+23
| |/ / / / /
* | | | | | Merge pull request #2818 from MysticExile/fmtDavid2019-09-052-2/+2
|\ \ \ \ \ \ | | | | | | | | | | | | | | externals: update fmt to 6.0.0
| * | | | | | Fix clang-formatEthan2019-09-041-1/+1
| | | | | | |
| * | | | | | accommodate for fmt updateEthan2019-08-292-2/+2
| |/ / / / /
* | | | | | AM: Stub IApplicationFunctions::GetGpuErrorDetectedSystemEvent (#2827)mailwl2019-09-042-0/+16
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * AM: Implement IApplicationFunctions::GetGpuErrorDetectedSystemEvent * Remove unneeded event clear * Fix event name
* | | | | | Merge pull request #2829 from Morph1984/audiobunnei2019-09-041-2/+15
|\ \ \ \ \ \ | | | | | | | | | | | | | | service/audio/audren_u: Stub IAudioDevice::GetAudioDeviceOutputVolume
| * | | | | | remove <f32>Morph19842019-09-041-1/+1
| | | | | | | | | | | | | | | | | | | | | We can remove this since its already a f32 value
| * | | | | | explicitly represent 1 as a float (1.0f instead of 1)Morph19842019-09-041-1/+1
| | | | | | |
| * | | | | | Change u32 -> f32Morph19842019-09-041-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Volume is a f32 value. (SwIPC describes it as a u32, but it is actually f32 as corroborated by switchbrew docs and SetAudioDeviceOutputVolume) ```cpp const f32 volume = rp.Pop<f32>(); ```
| * | | | | | service/audio/audren_u: Stub IAudioDevice::GetAudioDeviceOutputVolumeMorph19842019-09-031-2/+15
| |/ / / / /
* | | | | | Merge pull request #2708 from DarkLordZach/mii-db-source-crashDavid2019-09-041-0/+4
|\ \ \ \ \ \ | | | | | | | | | | | | | | mii: Handle logging of unknown database source
| * | | | | | mii: Handle logging of unknown database sourceZach Hilman2019-07-101-0/+4
| | |/ / / / | |/| | | |
* | | | | | Merge pull request #2793 from ReinUsesLisp/bgr565bunnei2019-09-041-1/+1
|\ \ \ \ \ \ | |_|/ / / / |/| | | | | renderer_opengl: Implement RGB565 framebuffer format
| * | | | | gpu: Change optional<reference_wrapper<T>> to T* for FramebufferConfigReinUsesLisp2019-08-211-1/+1
| | | | | |
* | | | | | Merge pull request #2748 from FernandoS27/align-memorybunnei2019-08-2114-37/+59
|\ \ \ \ \ \ | |/ / / / / |/| | | | | VM_Manager: Align allocated host physical memory to 256bytes
| * | | | | Kernel: Address FeedbackFernando Sahmkow2019-07-192-3/+9
| | | | | |
| * | | | | VM_Manager: Align allocated memory to 256bytesFernando Sahmkow2019-07-1914-36/+52
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This commit ensures that all backing memory allocated for the Guest CPU is aligned to 256 bytes. This due to how gpu memory works and the heavy constraints it has in the alignment of physical memory.
* | | | | | Merge pull request #2747 from lioncash/audiobunnei2019-08-187-108/+179
|\ \ \ \ \ \ | | | | | | | | | | | | | | service/audren_u: Unstub ListAudioDeviceName
| * | | | | | service/audren_u: Handle audio USB output revision queries in ListAudioDeviceName()Lioncash2019-07-192-16/+45
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Audio devices use the supplied revision information in order to determine if USB audio output is able to be supported. In this case, we can only really handle using this revision information in ListAudioDeviceName(), where it checks if USB audio output is supported before supplying it as a device name. A few other scenarios exist where the revision info is checked, such as: - Early exiting from SetAudioDeviceOutputVolume if USB audio is attempted to be set when that device is unsupported. - Early exiting and returning 0.0f in GetAudioDeviceOutputVolume when USB output volume is queried and it's an unsupported device. - Falling back to AHUB headphones in GetActiveAudioDeviceName when the device type is USB output, but is unsupported based off the revision info. In order for these changes to also be implemented, a few other changes to the interface need to be made. Given we now properly handle everything about ListAudioDeviceName(), we no longer need to describe it as a stubbed function.
| * | | | | | service/audren_u: Move revision testing code out of AudRenULioncash2019-07-192-63/+63
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The revision querying facilities are used by more than just audren. e.g. audio devices can use this to test whether or not USB audio output is supported. This will be used within the following change.
| * | | | | | service/audio: Remove global system accessorsLioncash2019-07-197-34/+54
| | | | | | | | | | | | | | | | | | | | | | | | | | | | Trims out the lingering reliance on global state out of the audio code.
| * | | | | | service/audren_u: Remove unnecessary return value from GetActiveAudioDeviceName()Lioncash2019-07-191-2/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | This service function only ever returns a result and nothing more.
| * | | | | | service/audren_u: Report proper device namesLioncash2019-07-191-6/+29
| |/ / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | AudioDevice and AudioInterface aren't valid device names on the Switch. We should also be returning consistent names in GetActiveAudioDeviceName(). While we're at it, we can also handle proper name output in ListAudioDeviceName, by returning all the available devices on the Switch.
* | | | | | Merge pull request #2592 from FernandoS27/sync1bunnei2019-07-2635-170/+627
|\ \ \ \ \ \ | |/ / / / / |/| | | | | Implement GPU Synchronization Mechanisms & Correct NVFlinger
| * | | | | NVServices: Correct delayed responses.Fernando Sahmkow2019-07-051-24/+19
| | | | | |
| * | | | | Nv_Host_Ctrl: Correct difference calculationFernando Sahmkow2019-07-051-5/+7
| | | | | |
| * | | | | NVServices: Address FeedbackFernando Sahmkow2019-07-058-21/+38
| | | | | |
| * | | | | NVServices: Styling, define constructors as explicit and correctionsFernando Sahmkow2019-07-0520-41/+49
| | | | | |
| * | | | | NVFlinger: Correct GCC compile errorFernando Sahmkow2019-07-056-17/+16
| | | | | |
| * | | | | NVServices: Make NVEvents Automatic according to documentation.Fernando Sahmkow2019-07-052-4/+7
| | | | | |
| * | | | | NVServices: Correct CtrlEventWaitSync to block the ipc until timeout.Fernando Sahmkow2019-07-0523-31/+104
| | | | | |
| * | | | | GPU: Correct Interrupts to interrupt on syncpt/value instead of event, mirroring hardwareFernando Sahmkow2019-07-057-19/+22
| | | | | |
| * | | | | nvflinger: Make the force 30 fps still force 30 fpsFernando Sahmkow2019-07-051-1/+1
| | | | | |
| * | | | | nv_services: Fixes to event liberation.Fernando Sahmkow2019-07-051-6/+14
| | | | | |
| * | | | | nvflinger: Acquire buffers in the same order as they were queued.Fernando Sahmkow2019-07-052-3/+11
| | | | | |
| * | | | | nv_services: Deglobalize NvServicesFernando Sahmkow2019-07-0523-51/+65
| | | | | |
| * | | | | nv_host_ctrl: Make Sync GPU variant always return synced result.Fernando Sahmkow2019-07-051-0/+5
| | | | | |
| * | | | | nvhost_ctrl: Corrections to event handlingFernando Sahmkow2019-07-052-8/+12
| | | | | |
| * | | | | Gpu: Mark areas as protected.Fernando Sahmkow2019-07-051-0/+6
| | | | | |
| * | | | | nv_services: Stub CtrlEventSignalFernando Sahmkow2019-07-052-12/+34
| | | | | |
| * | | | | Gpu: Implement Hardware Interrupt Manager and manage GPU interruptsFernando Sahmkow2019-07-058-9/+69
| | | | | |
| * | | | | nv_services: Implement NvQueryEvent, NvCtrlEventWait, NvEventRegister, NvEventUnregisterFernando Sahmkow2019-07-057-17/+192
| | | | | |
| * | | | | nv_services: Create GPU channels correctlyFernando Sahmkow2019-07-052-2/+5
| | | | | |
| * | | | | video_core: Implement GPU side SyncpointsFernando Sahmkow2019-07-053-7/+33
| | | | | |
| * | | | | nv_services: Correct buffer queue fencing and GPFifo fencingFernando Sahmkow2019-07-058-57/+70
| | | | | |
| * | | | | nvflinger: Implement swap intervalsFernando Sahmkow2019-07-055-8/+21
| | | | | |
* | | | | | Merge pull request #2687 from lioncash/tls-processbunnei2019-07-183-14/+30
|\ \ \ \ \ \ | | | | | | | | | | | | | | kernel/process: Allocate the process' TLS region during initialization
| * | | | | | kernel/process: Allocate the process' TLS region during initializationLioncash2019-07-073-3/+14
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Prior to execution within a process beginning, the process establishes its own TLS region for uses (as far as I can tell) related to exception handling. Now that TLS creation was decoupled from threads themselves, we can add this behavior to our Process class. This is also good, as it allows us to remove a stub within svcGetInfo, namely querying the address of that region.
| * | | | | | kernel/process: Move main thread stack allocation to its own functionLioncash2019-07-072-12/+17
| | |_|/ / / | |/| | | | | | | | | | | | | | | | Keeps this particular set of behavior isolated to its own function.
* | | | | | Kernel: Downgrade WaitForAddress and SignalToAddress messages to Trace.Fernando Sahmkow2019-07-181-4/+4
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This messages were originally set as warnning since few games used these svcs and it was needed for debugging. This is no longer the case.
* | | | | | Merge pull request #2726 from lioncash/accessRodrigo Locatti2019-07-172-7/+6
|\ \ \ \ \ \ | | | | | | | | | | | | | | core: Remove CurrentArmInterface() global accessor
| * | | | | | core: Remove CurrentArmInterface() global accessorLioncash2019-07-132-7/+6
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Replaces the final usage of the global accessor function and removes it. Removes one more enabler of global state.
* | | | | | | Merge pull request #2690 from SciresM/physmem_fixesFernando Sahmkow2019-07-148-41/+477
|\ \ \ \ \ \ \ | |/ / / / / / |/| | | | | | Implement MapPhysicalMemory/UnmapPhysicalMemory
| * | | | | | Remove unicorn mappings/unmappingsMichael Scire2019-07-121-19/+0
| | | | | | |
| * | | | | | Prevent merging of device mapped memory blocks.Michael Scire2019-07-091-0/+5
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This sets the DeviceMapped attribute for GPU-mapped memory blocks, and prevents merging device mapped blocks. This prevents memory mapped from the gpu from having its backing address changed by block coalesce.
| * | | | | | Remove unused member function declarationMichael Scire2019-07-071-9/+0
| | | | | | |
| * | | | | | physmem: add helpers, cleanup logic.Michael Scire2019-07-072-171/+170
| | | | | | |
| * | | | | | clang-format fixesMichael Scire2019-07-072-3/+3
| | | | | | |
| * | | | | | address review commentaryMichael Scire2019-07-075-36/+42
| | | | | | |
| * | | | | | Implement MapPhysicalMemory/UnmapPhysicalMemoryMichael Scire2019-07-078-21/+475
| |/ / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This implements svcMapPhysicalMemory/svcUnmapPhysicalMemory for Yuzu, which can be used to map memory at a desired address by games since 3.0.0. It also properly parses SystemResourceSize from NPDM, and makes information available via svcGetInfo. This is needed for games like Super Smash Bros. and Diablo 3 -- this PR's implementation does not run into the "ASCII reads" issue mentioned in the comments of #2626, which was caused by the following bugs in Yuzu's memory management that this PR also addresses: * Yuzu's memory coalescing does not properly merge blocks. This results in a polluted address space/svcQueryMemory results that would be impossible to replicate on hardware, which can lead to game code making the wrong assumptions about memory layout. * This implements better merging for AllocatedMemoryBlocks. * Yuzu's implementation of svcMirrorMemory unprotected the entire virtual memory range containing the range being mirrored. This could lead to games attempting to map data at that unprotected range/attempting to access that range after yuzu improperly unmapped it. * This PR fixes it by simply calling ReprotectRange instead of Reprotect.
* | | | | | Clang formatDavid Marcec2019-07-121-2/+4
| | | | | |
* | | | | | "AudioRenderer" thread should have a unique nameDavid Marcec2019-07-122-4/+4
| | | | | | | | | | | | | | | | | | | | | | | | Creating multiple "AudioRenderer" threads cause the previous thread to be overwritten. The thread will name be renamed to AudioRenderer-InstanceX, where X is the current instance number.
* | | | | | Merge pull request #2717 from SciresM/unmirror_memorybunnei2019-07-112-7/+34
|\ \ \ \ \ \ | | | | | | | | | | | | | | Restore memory perms on svcUnmapMemory/UnloadNro
| * | | | | | Restore memory perms on svcUnmapMemory/UnloadNroMichael Scire2019-07-112-7/+34
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Prior to PR, Yuzu did not restore memory to RW- on unmap of mirrored memory or unloading of NRO. (In fact, in the NRO case, the memory was unmapped instead of reprotected to --- on Load, so it was actually lost entirely...) This PR addresses that, and restores memory to RW- as it should. This fixes a crash in Super Smash Bros when creating a World of Light save for the first time, and possibly other games/circumstances.
* | | | | | | Merge pull request #2723 from lioncash/membunnei2019-07-1110-67/+6
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | core/arm: Remove obsolete Unicorn memory mapping
| * | | | | | | yuzu: Remove setting for using UnicornLioncash2019-07-114-16/+6
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The JIT is mature enough that this setting can be removed, falling back to Unicorn only on unsupported architectures. Any missing features from Unicorn (of which there are extremely few), are mostly developer-oriented, which most users don't care about. Features should be coordinated with the JIT, not the interpreter, anyhow.
| * | | | | | | core/arm: Remove obsolete Unicorn memory mappingLioncash2019-07-116-51/+0
| |/ / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This was initially necessary when AArch64 JIT emulation was in its infancy and all memory-related instructions weren't implemented. Given the JIT now has all of these facilities implemented, we can remove these functions from the CPU interface.
* | | | | | | service/am: Implement IsAutoSleepDisabledLioncash2019-07-112-1/+10
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This simply queries whether or not auto-sleep facilities are disabled and has no special handling. It's a basic getter function.
* | | | | | | service/am: Implement SetAutoSleepDisabledLioncash2019-07-112-1/+23
|/ / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Provides a basic implementation of SetAutoSleepDisabled. Until idle handling is implemented, this is about the best we can do. In the meantime, provide a rough documenting of specifics that occur when this function is called on actual hardware.
* | | | | | Merge pull request #2700 from ogniK5377/GetFriendListbunnei2019-07-101-1/+34
|\ \ \ \ \ \ | | | | | | | | | | | | | | IFriendService::GetFriendList
| * | | | | | IFriendService::GetFriendListDavid Marcec2019-07-091-1/+34
| | |_|/ / / | |/| | | | | | | | | | | | | | | | We don't have any friends implemented in Yuzu yet so it doesn't make sense to return any friends. For now we'll be returning 0 friends however the information provided will allow a proper implementation of this cmd when needed.
* | | | | | Merge pull request #2611 from DarkLordZach/pm-info-cmdbunnei2019-07-103-16/+116
|\ \ \ \ \ \ | | | | | | | | | | | | | | pm: Implement various pm commands for finding process and title IDs
| * | | | | | pm: Implement pm:shell and pm:dmnt GetApplicationPidZach Hilman2019-06-273-7/+33
| | | | | | | | | | | | | | | | | | | | | | | | | | | | Returns the process ID of the current application or 0 if no app is running.
| * | | | | | pm: Implement pm:dmnt GetTitlePidZach Hilman2019-06-271-7/+36
| | | | | | | | | | | | | | | | | | | | | | | | | | | | Takes a title ID and searches for a matching process, returning error if it doesn't exist, otherwise the process ID.
| * | | | | | pm: Implement pm:info GetTitleIdZach Hilman2019-06-271-2/+47
| | | | | | | | | | | | | | | | | | | | | | | | | | | | Searches the process list for a process with the specified ID, returning the title ID if it exists.
* | | | | | | Merge pull request #2650 from DarkLordZach/mii-iface-verbunnei2019-07-101-1/+15
|\ \ \ \ \ \ \ | |_|/ / / / / |/| | | | | | mii: Implement IDatabaseService SetInterfaceVersion
| * | | | | | mii: Implement IDatabaseService SetInterfaceVersionZach Hilman2019-07-071-1/+15
| | | | | | | | | | | | | | | | | | | | | Appears to set a member variable used to affect the API that games access, and the method used to store data.
* | | | | | | Merge pull request #2657 from ogniK5377/npad-assignmentsZach Hilman2019-07-086-3/+100
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | hid:StartLrAssignmentMode, hid:StopLrAssignmentMode, hid:SwapNpadAssignment
| * | | | | | | addressed issuesDavid Marcec2019-07-081-6/+7
| | | | | | | |
| * | | | | | | hid:StartLrAssignmentMode, hid:StopLrAssignmentMode, hid:SwapNpadAssignmentDavid Marcec2019-07-016-3/+99
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | StartLrAssignmentMode and StopLrAssignmentMode don't require any implementation as it's just used for showing the screen of changing the controller orientation if the user wishes to do so. Ever since #1634 this has not been needed as users can specify the controller orientation from the config and swap at any time. We store a private member just in case this gets used for anything extra in the future
* | | | | | | | Merge pull request #2651 from DarkLordZach/apm-boost-mode-1bunnei2019-07-0814-57/+258
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | apm: Initial implementation of performance config and boost mode
| * | | | | | | | am: Implement SetCpuBoostMode in terms of APMZach Hilman2019-06-295-13/+26
| | | | | | | | |
| * | | | | | | | core: Keep instance of APM ControllerZach Hilman2019-06-292-0/+20
| | | | | | | | |
| * | | | | | | | apm: Implement SetCpuBoostModeZach Hilman2019-06-292-0/+14
| | | | | | | | |
| * | | | | | | | apm: Add getters for performance config and modeZach Hilman2019-06-292-33/+49
| | | | | | | | |
| * | | | | | | | apm: Add apm:am serviceZach Hilman2019-06-292-11/+9
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | 8.0.0+ identical version of apm
| * | | | | | | | apm: Add Controller class to manage speed data and applicationZach Hilman2019-06-293-0/+140
| | |_|/ / / / / | |/| | | | | |
* | | | | | | | Merge pull request #2642 from DarkLordZach/fsp-log-2bunnei2019-07-089-28/+99
|\ \ \ \ \ \ \ \ | |_|_|_|/ / / / |/| | | | | | | fsp-srv: Implement Access Logging Functionality
| * | | | | | | fsp-srv: Implement GetAccessLogVersionInfoZach Hilman2019-06-292-3/+14
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Returns some misc. data about logging to help the game determine if it should log.
| * | | | | | | reporter: Add report class for filesystem access logsZach Hilman2019-06-292-0/+25
| | | | | | | |
| * | | | | | | fsp-srv: Implement OutputAccessLogToSdCardZach Hilman2019-06-297-27/+62
| |/ / / / / / | | | | | | | | | | | | | | | | | | | | | Allows games to log data to the SD.
* | | | | | | Merge pull request #2674 from lioncash/reporterZach Hilman2019-07-072-15/+35
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | core/reporter: Minor changes
| * | | | | | | core/reporter: Allow moves into SaveToFile()Lioncash2019-07-051-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Taking the json instance as a constant reference, makes all moves into the parameter non-functional, resulting in copies. Taking it by value allows moves to function.
| * | | | | | | core/reporter: Add missing includes and forward declarationsLioncash2019-07-052-1/+9
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Adds missing inclusions to prevent potential compilation issues.
| * | | | | | | core/reporter: Remove unnecessary namespace qualifiersLioncash2019-07-052-3/+3
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The Reporter class is part of the Core namespace, so the System class doesn't need to be qualified.
| * | | | | | | core/reporter: Remove pessimizing move in GetHLERequestContextData()Lioncash2019-07-051-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This can inhibit copy-elision, so we can remove this redundant move.
| * | | | | | | core/reporter: Make bracing consistentLioncash2019-07-051-8/+18
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Makes all control statements braced, regardless of their size, making code more uniform.
| * | | | | | | core/reporter: Return in error case in SaveToFile()Lioncash2019-07-051-1/+3
| | |_|_|/ / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | If the path couldn't be created, then we shouldn't be attempting to save the file.
* | | | | | | Merge pull request #2677 from lioncash/assertZach Hilman2019-07-075-43/+48
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | kernel/vm_manager: Handle stack/TLS IO region placement a little better
| * | | | | | | memory: Remove unused includesLioncash2019-07-061-2/+0
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | These aren't used within the central memory management code, so they can be removed.
| * | | | | | | memory: Remove unused PageTable forward declarationLioncash2019-07-061-4/+0
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This isn't used by anything in the header file, so it can be removed.
| * | | | | | | kernel/vm_manager: Rename 'new map' to 'stack'Lioncash2019-07-063-37/+37
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Provides a more accurate name for the memory region and also disambiguates between the map and new map regions of memory, making it easier to understand.
| * | | | | | | kernel/vm_manager: Handle stack/TLS IO region placement betterLioncash2019-07-061-2/+13
| |/ / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Handles the placement of the stack a little nicer compared to the previous code, which was off in a few ways. e.g. The stack (new map) region, shouldn't be the width of the entire address space if the size of the region calculation ends up being zero. It should be placed at the same location as the TLS IO region and also have the same size. In the event the TLS IO region contains a size of zero, we should also be doing the same thing. This fixes our memory layout a little bit and also resolves some cases where assertions can trigger due to the memory layout being incorrect.
* | | | | | | clang-format fixesMichael Scire2019-07-061-4/+5
| | | | | | |
* | | | | | | am: Implement GetAccumulatedSuspendedTickValueMichael Scire2019-07-062-7/+19
|/ / / / / /
* | | | | | Merge pull request #2669 from FearlessTobi/move-cpujit-settingZach Hilman2019-07-044-5/+5
|\ \ \ \ \ \ | | | | | | | | | | | | | | yuzu: Move CPU Jit setting to Debug tab
| * | | | | | yuzu: Remove CPU Jit setting from the UIfearlessTobi2019-07-044-5/+5
| | | | | | | | | | | | | | | | | | | | | | | | | | | | A normal user shouldn't change this, as it will slow down the emulation and can lead to bugs or crashes. The renaming is done in order to prevent users from leaving this on without a way to turn it off from the UI.
* | | | | | | Merge pull request #2555 from lioncash/tlsZach Hilman2019-07-046-81/+148
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | kernel/process: Decouple TLS handling from threads
| * | | | | | | kernel/process: Default initialize all member variablesLioncash2019-07-041-2/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Ensures a Process instance is always created with a deterministic initial state.
| * | | | | | | kernel/process: Decouple TLS handling from threadsLioncash2019-07-044-66/+97
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Extracts out all of the thread local storage management from thread instances themselves and makes the owning process handle the management of the memory. This brings the memory management slightly more in line with how the kernel handles these allocations. Furthermore, this also makes the TLS page management a little more readable compared to the lingering implementation that was carried over from Citra.
| * | | | | | | kernel/vm_manager: Add overload of FindFreeRegion() that operates on a boundaryLioncash2019-07-042-13/+49
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This will be necessary for making our TLS slot management slightly more straightforward. This can also be utilized for other purposes in the future. We can implement the existing simpler overload in terms of this one anyways, we just pass the beginning and end of the ASLR region as the boundaries.
* | | | | | | | Merge pull request #2658 from ogniK5377/QueryAudioDeviceOutputEventbunnei2019-07-041-3/+16
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | IAudioDevice::QueryAudioDeviceOutputEvent
| * | | | | | | | IAudioDevice::QueryAudioDeviceOutputEventDavid Marcec2019-07-011-3/+16
| | |_|_|/ / / / | |/| | | | | | | | | | | | | | | | | | | | | | The event should only be signaled when an output audio device gets changed. Example, Speaker to USB headset. We don't identify different devices internally yet so there's no need to signal the event yet.
* | | | | | | | Merge pull request #2638 from DarkLordZach/quest-flagbunnei2019-07-043-1/+11
|\ \ \ \ \ \ \ \ | |_|/ / / / / / |/| | | | | | | set: Implement GetQuestFlag with config option
| * | | | | | | set: Implement GetQuestFlagZach Hilman2019-06-292-1/+10
| | | | | | | | | | | | | | | | | | | | | | | | Simply returns a true/false value indicating if the system is a kiosk system. This has been mapped to a config option for the purposes of yuzu.
| * | | | | | | settings: Add config option for kiosk (quest) modeZach Hilman2019-06-291-0/+1
| | |_|_|/ / / | |/| | | | |
* | | | | | | Merge pull request #2613 from ogniK5377/InitalizeApplicationInfoZach Hilman2019-07-045-6/+110
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | Implemented InitializeApplicationInfo & InitializeApplicationInfoRestricted
| * | | | | | | Added errors.h to cmakelistDavid Marcec2019-06-281-0/+1
| | | | | | | |
| * | | | | | | Addressed issuesDavid Marcec2019-06-282-17/+12
| | | | | | | |
| * | | | | | | Implemented InitializeApplicationInfo & InitializeApplicationInfoRestrictedDavid Marcec2019-06-274-6/+114
| | |_|_|/ / / | |/| | | | | | | | | | | | | | | | | | | InitializeApplicationInfoRestricted will need further implementation as it's checking for other user requirements about the game. As we're emulating, we're assuming the user owns the game so we skip these checks currently, implementation will need to be added further on
* | | | | | | Merge pull request #2608 from ogniK5377/Time_GetSharedMemoryNativeHandleZach Hilman2019-07-048-28/+260
|\ \ \ \ \ \ \ | |_|_|_|/ / / |/| | | | | | Implement Time::GetSharedMemoryNativeHandle
| * | | | | | Addressed issuesDavid Marcec2019-06-265-37/+53
| | | | | | |
| * | | | | | Implement Time::GetSharedMemoryNativeHandleDavid Marcec2019-06-258-29/+245
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This PR attempts to implement the shared memory provided by GetSharedMemoryNativeHandle. There is still more work to be done however that requires a rehaul of the current time module to handle clock contexts. This PR is mainly to get the basic functionality of the SharedMemory working and allow the use of addition to it whilst things get improved on. Things to note: Memory Barriers are used in the SharedMemory and a better solution would need to be done to implement this. Currently in this PR I’m faking the memory barriers as everything is sync and single threaded. They work by incrementing the counter and just populate the two data slots. On data reading, it will read the last added data. Specific values in the shared memory would need to be updated periodically. This isn't included in this PR since we don't actively do this yet. In a later PR when time is refactored this should be done. Finally, as we don't handle clock contexts. When time is refactored, we will need to update the shared memory for specific contexts. This PR does this already however since the contexts are all identical and not separated. We're just updating the same values for each context which in this case is empty. Tiime:SetStandardUserSystemClockAutomaticCorrectionEnabled, Time:IsStandardUserSystemClockAutomaticCorrectionEnabled are also partially implemented in this PR. The reason the implementation is partial is because once again, a lack of clock contexts. This will be improved on in a future PR. This PR closes issue #2556
* | | | | | | Merge pull request #2604 from ogniK5377/INotificationServicebunnei2019-07-035-1/+130
|\ \ \ \ \ \ \ | |_|_|_|_|/ / |/| | | | | | Implemented INotificationService
| * | | | | | Attemp clang format fix?David Marcec2019-06-281-1/+0
| | | | | | | | | | | | | | | | | | | | | | | | | | | | Seems to be an issue with clang format
| * | | | | | Addressed issuesDavid Marcec2019-06-282-13/+13
| | | | | | |
| * | | | | | SizedNotificationInfo should be 0x10 bytes, user_uuid is incorrect, this should be the users account idDavid Marcec2019-06-251-1/+3
| | | | | | |
| * | | | | | fixed spelling errors and fixed issue with Pop not returning the SizedNotificationInfoDavid Marcec2019-06-251-6/+8
| | | | | | |
| * | | | | | Implemented INotificationServiceDavid Marcec2019-06-245-1/+127
| |/ / / / /
* | | | | | file_sys: Rename other ContentRecordType membersBakugo2019-07-025-7/+8
| | | | | |
* | | | | | file_sys/registered_cache: Improve missing metadata errorBakugo2019-07-011-2/+2
| | | | | | | | | | | | | | | | | | | | | | | | This can happen when installing NSPs too, not just XCIs.
* | | | | | file_sys/submission_package: Don't warn about missing DeltaFragment NCAsBakugo2019-07-011-4/+7
| | | | | | | | | | | | | | | | | | | | | | | | DeltaFragments are not useful to us and are often not included in patch NSPs.
* | | | | | file_sys/registered_cache: Ignore DeltaFragment NCAs during installationBakugo2019-07-011-0/+3
| | | | | | | | | | | | | | | | | | | | | | | | DeltaFragments are only used to download and apply partial patches on a real console, and are not useful to us at all. Most patch NSPs do not include them, and when they do, it's a waste of space to install them.
* | | | | | file_sys: Rename ContentRecordType::Patch to DeltaFragmentBakugo2019-07-011-1/+1
| |_|_|/ / |/| | | | | | | | | | | | | | Avoids potential confusion, since patches and DeltaFragments are not the same thing. Actual full patches are listed under the Program type.
* | | | | Merge pull request #2583 from FernandoS27/core-timing-safebunnei2019-06-303-49/+14
|\ \ \ \ \ | |_|_|/ / |/| | | | Core_Timing: Make core_timing threadsafe by default.
| * | | | Core_Timing: Make core_timing threadsafe by default.Fernando Sahmkow2019-06-163-49/+14
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The old implementation had faulty Threadsafe methods where events could be missing. This implementation unifies unsafe/safe methods and makes core timing thread safe overall.
* | | | | Merge pull request #2533 from DarkLordZach/memory-frozenbunnei2019-06-284-0/+274
|\ \ \ \ \ | |_|_|/ / |/| | | | memory: Add class to manage and enforce memory freezing
| * | | | freezer: Update documentationZach Hilman2019-06-211-1/+8
| | | | |
| * | | | core: Move Freezer class to tools namespaceZach Hilman2019-06-214-17/+17
| | | | |
| * | | | freezer: Add documentation for methodsZach Hilman2019-06-212-30/+49
| | | | |
| * | | | memory: Add class to manage and enforce memory freezingZach Hilman2019-06-214-0/+248
| | | | |
* | | | | Merge pull request #2548 from DarkLordZach/applet-shopnbunnei2019-06-2617-120/+879
|\ \ \ \ \ | | | | | | | | | | | | applets: Implement backend and default frontend for Parental Controls and EShop (ShopN) applets
| * | | | | applets: Pass current process title ID to appletsZach Hilman2019-06-2511-41/+59
| | | | | | | | | | | | | | | | | | | | | | | | Avoids using system accessor to get current process in applet code.
| * | | | | general_frontend: Add documentation for parental controls and ecommerce appletsZach Hilman2019-06-254-20/+48
| | | | | |
| * | | | | web_browser: Only delete temporary directory if it was createdZach Hilman2019-06-251-1/+3
| | | | | | | | | | | | | | | | | | | | | | | | Prevents crashes with ShopN applet occasionally.
| * | | | | web_browser: Take ECommerce applet frontend optionally in constructorZach Hilman2019-06-251-1/+6
| | | | | | | | | | | | | | | | | | If it is needed but wasn't passed (or passed nullptr), the Shop handling code will alert and throw an error.
| * | | | | frontend: Add base class and default impl for ECommerce applet frontendZach Hilman2019-06-252-0/+102
| | | | | |
| * | | | | web_browser: Use function tables for execute and initializeZach Hilman2019-06-252-7/+285
| | | | | | | | | | | | | | | | | | Allows easy handling of multiple shim types, as they have enough in common to be the same backend but not enough to share init/exec.
| * | | | | web_browser: Correct structures and properly parse TLVs/ShimKindZach Hilman2019-06-252-61/+168
| | | | | | | | | | | | | | | | | | Much, much more HW-accurate and allows us to easily support all of the different web 'shim' types.
| * | | | | applets: Track ECommerce and Parental Control applet frontendsZach Hilman2019-06-252-7/+29
| | | | | |
| * | | | | web_browser: Rename OpenPage to OpenPageLocalZach Hilman2019-06-252-7/+7
| | | | | | | | | | | | | | | | | | This is more representative of what actually occurs, as web does support remote URLs which wouldn't need a romfs callback. This paves for easy future support of this with a call like 'OpenPageRemote' or similar.
| * | | | | frontend: Add base class and default impl of parent controls applet frontendZach Hilman2019-06-252-1/+52
| | | | | |
| * | | | | applets: Implement Auth applet backendZach Hilman2019-06-252-0/+146
| | |_|/ / | |/| | | | | | | | This is responsible for parental controls and supports verifying, changing, and registering PIN codes.
* | | | | glue: Correct missing bytes in ApplicationLaunchParameterZach Hilman2019-06-267-37/+71
| | | | |
* | | | | core: Keep track of ARPManager and register current application on bootZach Hilman2019-06-252-0/+76
| | | | |
* | | | | glue: Implement arp:w and arp:r servicesZach Hilman2019-06-253-2/+330
| | | | | | | | | | | | | | | | | | | | These keep track of running process' launch properties and control properties and allows for issuing and reading them by process and title ID.
* | | | | glue: Add errors for glue/arp servicesZach Hilman2019-06-254-2/+65
| | | | |
* | | | | glue: Add scaffolding for bgtc:t and bgtc:sc servicesZach Hilman2019-06-252-0/+73
| | | | |
* | | | | arp: Move to glue servicesZach Hilman2019-06-252-91/+0
| | | | | | | | | | | | | | | | | | | | Glue is the name of the sysmodule that contains both arp and bgtc.
* | | | | glue: Add manager to keep track of application registryZach Hilman2019-06-253-0/+121
| | | | | | | | | | | | | | | | | | | | Manages mapping between title IDs and application launch and control properties.
* | | | | registered_cache: Add getter to determine source slot in content provider unionZach Hilman2019-06-252-0/+17
| | | | | | | | | | | | | | | | | | | | Used to determine StorageId source for application data.
* | | | | patch_manager: Add getter for title versionZach Hilman2019-06-252-2/+14
|/ / / /
* | | | Update reporter.cppThomas May2019-06-221-5/+5
| | | |
* | | | Merge pull request #2602 from lioncash/castbunnei2019-06-211-3/+3
|\ \ \ \ | | | | | | | | | | service/acc: Silence truncation warnings
| * | | | service/acc: Silence truncation warningsLioncash2019-06-211-3/+3
| |/ / / | | | | | | | | | | | | | | | | The sanitizing function ensures that the returned type is always the correct type. This eliminates warnings without extra casts.
* | | | Merge pull request #2575 from DarkLordZach/process-id-typesbunnei2019-06-215-9/+27
|\ \ \ \ | | | | | | | | | | kernel: Differentiate kernel and user processes when picking ID
| * | | | kernel: Differentiate kernel and user processes when picking IDZach Hilman2019-06-105-9/+27
| | |_|/ | |/| | | | | | | | | | This allows kernel internal type processes to be assigned IDs in the KIP range while userland processes are assigned in the user range.
* | | | Merge pull request #2546 from DarkLordZach/kipsbunnei2019-06-2110-119/+521
|\ \ \ \ | | | | | | | | | | loader, file_sys: Add support for parsing and loading KIP (Kernel Internal Process) files
| * | | | kernel_executable: Optimize BLZ decompressionZach Hilman2019-06-072-10/+13
| | | | |
| * | | | game_list: Accept *.kip as a file extension of executablesZach Hilman2019-06-051-1/+1
| | | | |
| * | | | loader: Add recognition for KIP file typeZach Hilman2019-06-052-0/+11
| | | | |
| * | | | loader: Add KIP and INI file parser-specific errorsZach Hilman2019-06-052-1/+9
| | | | |
| * | | | loader: Add AppLoader_KIP for KIP filesZach Hilman2019-06-053-0/+135
| | | | |
| * | | | program_metadata: Add function to load meta from raw parametersZach Hilman2019-06-052-0/+20
| | | | | | | | | | | | | | | | | | | | Needed for KIP loading as KIPs do not have an NPDM but do have the essential parts of the data within.
| * | | | partition_data_manager: Remove KIP processing and use FileSysZach Hilman2019-06-051-118/+13
| | | | | | | | | | | | | | | | | | | | Previously, this TU contained the necessary headers to parse KIP/INI but now it should just use the FileSys class.
| * | | | file_sys: Add classes to parse KIP1 and INI1 filesZach Hilman2019-06-053-0/+330
| | | | |
* | | | | Merge pull request #2482 from DarkLordZach/prepobunnei2019-06-2130-53/+796
|\ \ \ \ \ | |_|_|/ / |/| | | | core: Add detailed local reporting feature for development
| * | | | loader: Move NSO module tracking to AppLoaderZach Hilman2019-05-2621-70/+135
| | | | | | | | | | | | | | | Also cleanup of general stuff
| * | | | prepo: Save reports from PlayReport serviceZach Hilman2019-05-251-2/+23
| | | | | | | | | | | | | | | | | | | | Logs a lot of seemingly innocuous telemetry games generate.
| * | | | fatal: Save report on fatal:u callZach Hilman2019-05-251-21/+5
| | | | | | | | | | | | | | | | | | | | Matches offical behavior with creport and replaces old log/text based report system.
| * | | | service: Save report on unimplemented function callZach Hilman2019-05-251-0/+3
| | | | |
| * | | | applets/error: Save report on error appletZach Hilman2019-05-251-5/+14
| | | | | | | | | | | | | | | | | | | | This matches official behavior with the erpt/eclct/eupld service chain.
| * | | | applets: Save report on stubbed appletZach Hilman2019-05-254-15/+49
| | | | | | | | | | | | | | | | | | | | This also reworks the applet data storage to be peekable.
| * | | | svc: Save report on call to svcBreakZach Hilman2019-05-251-1/+7
| | | | |
| * | | | core: Add Reporter class to take/save reportsZach Hilman2019-05-255-1/+416
| | | | |
| * | | | settings: Add 'Reporting Services' config optionZach Hilman2019-05-251-0/+1
| | | | | | | | | | | | | | | | | | | | Full enable/disable for all reports.
| * | | | arm_interface: Expand backtrace generationZach Hilman2019-05-252-7/+194
| | | | | | | | | | | | | | | | | | | | Returns results as a vector of entries for further processing. Logs addresses, offsets, and mangled name.
| * | | | core: Track load offsets of NSO modulesZach Hilman2019-05-253-0/+18
| | | | | | | | | | | | | | | | | | | | Needed for backtrace decomposition
* | | | | Merge pull request #2596 from FernandoS27/revert-2590bunnei2019-06-201-1/+1
|\ \ \ \ \ | | | | | | | | | | | | Revert PR 2590.
| * | | | | Revert PR 2590.Fernando Sahmkow2019-06-201-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Even though it has been proven that IAudioRenderer:SystemEvent is actually an automatic event. The current implementation of such event is all thought to be manual. Thus it's implementation needs to be corrected when doing such change. As it is right now this PR introduced a series of regressions on softlocks on multiple games. Therefore, this pr reverts such change until a correct implementation is made.
* | | | | | Merge pull request #2595 from jonsn0w/patch-1Hexagon122019-06-201-2/+2
|\ \ \ \ \ \ | |/ / / / / |/| | | | | Update content_archive.cpp
| * | | | | Update content_archive.cppjonsn0w2019-06-201-2/+2
| | | | | | | | | | | | | | | | | | log clutter in debug logs when theres really no need
* | | | | | Merge pull request #2591 from lioncash/recordbunnei2019-06-204-398/+0
|\ \ \ \ \ \ | | | | | | | | | | | | | | core: Remove unused CiTrace source files
| * | | | | | core: Remove unused CiTrace source filesLioncash2019-06-184-398/+0
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | These source files have been unused for the entire lifecycle of the project. They're a hold-over from Citra and only add to the build time of the project, so they can be removed. There's also likely no way this would ever work in yuzu in its current form without revamping quite a bit of it, given how different the GPU on the Switch is compared to the 3DS.
* | | | | | | Merge pull request #2590 from lioncash/eventbunnei2019-06-201-1/+1
|\ \ \ \ \ \ \ | |_|/ / / / / |/| | | | | | service/audio/audren_u: Correct event reset type for the system event
| * | | | | | service/audio/audren_u: Correct event reset type for the system eventLioncash2019-06-181-1/+1
| |/ / / / / | | | | | | | | | | | | | | | | | | | | | | | | This is actually an auto-reset event in the audio service itself, not a manual one.
* | | | | | Addressed issuesDavid Marcec2019-06-174-9/+14
| | | | | |
* | | | | | Signalled accumulated_suspended_tick_changed_event on creation based on REDavid Marcec2019-06-161-0/+1
| | | | | |
* | | | | | CleanupDavid Marcec2019-06-1611-29/+38
| | | | | |
* | | | | | Impl'd IsUserAccountSwitchLocked, SetAudioOutVolume, GetAudioOutVolume & Partial impl of GetAccumulatedSuspendedTickChangedEventDavid Marcec2019-06-168-8/+79
| | | | | | | | | | | | | | | | | | | | | | | | IPC-100 was changed to InitializeApplicationInfoOld instead of InitializeApplicationInfo. IPC-150 makes an indentical call to IPC-100 however does extra processing. They should not have the same name as it's quite confusing to debug.
* | | | | | Merge pull request #2581 from lioncash/hexZach Hilman2019-06-159-28/+33
|\ \ \ \ \ \ | | | | | | | | | | | | | | common/hex_util: Combine HexVectorToString() and HexArrayToString()
| * | | | | | common/hex_util: Combine HexVectorToString() and HexArrayToString()Lioncash2019-06-129-28/+33
| | |_|_|_|/ | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | These can be generified together by using a concept type to designate them. This also has the benefit of not making copies of potentially very large arrays.
* | | | | | Merge pull request #2582 from lioncash/reservedbunnei2019-06-141-1/+0
|\ \ \ \ \ \ | | | | | | | | | | | | | | file_sys/ips_layer: Remove unnecessary reserve() call
| * | | | | | file_sys/ips_layer: Remove unnecessary reserve() callLioncash2019-06-131-1/+0
| |/ / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Given 'replace' is assigned to on the following line, this isn't necessary, given the underlying data is going to be overwritten entirely.
* | | | | | Merge pull request #2580 from lioncash/redundantZach Hilman2019-06-131-3/+1
|\ \ \ \ \ \ | | | | | | | | | | | | | | kernel/vm_manager: Remove redundant Reset call in destructor
| * | | | | | kernel/vm_manager: Remove redundant Reset call in destructorLioncash2019-06-121-3/+1
| |/ / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This is performing more work than would otherwise be necessary during VMManager's destruction. All we actually want to occur in this scenario is for any allocated memory to be freed, which will happen automatically as the VMManager instance goes out of scope. Anything else being done is simply unnecessary work.
* | | | | | Merge pull request #2577 from lioncash/fsZach Hilman2019-06-131-17/+29
|\ \ \ \ \ \ | |/ / / / / |/| | | | | file_sys/card_image: Minor cleanup
| * | | | | file_sys/card_image: Remove obsolete TODOLioncash2019-06-121-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | We already support Rev 1+.
| * | | | | file_sys/card_image: Deduplicate casts within AddNCAFromPartition()Lioncash2019-06-111-3/+6
| | | | | | | | | | | | | | | | | | | | | | | | Makes for nicer reading.
| * | | | | file_sys/card_image: Make bracing consistentLioncash2019-06-111-4/+8
| | | | | | | | | | | | | | | | | | | | | | | | Makes for more consistent reading.
| * | | | | file_sys/card_image: Assign collapsed NCA contents directly to ncas memberLioncash2019-06-111-3/+1
| | | | | | | | | | | | | | | | | | | | | | | | Same thing, significantly less noisy.
| * | | | | file_sys/card_image: Deduplicate type castLioncash2019-06-111-4/+6
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Same thing, less duplication. We can also std::move raw into the PartitionFilesystem constructor.
| * | | | | file_sys/card_image: Get rid of a magic numberLioncash2019-06-111-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | We can just use the size of the array to dehardcode it.
| * | | | | file_sys/card_image: Use std::array deduction guidesLioncash2019-06-111-1/+6
| | |_|_|/ | |/| | | | | | | | | | | | | Same thing, less code.
* / | | | file_sys/nca_metadata: Update CNMT structuresLioncash2019-06-111-2/+7
|/ / / / | | | | | | | | | | | | | | | | Names a few more entries in relevant structures. Information based off SwitchBrew and my own RE.
* | | | Merge pull request #2571 from lioncash/refZach Hilman2019-06-102-2/+2
|\ \ \ \ | | | | | | | | | | kernel/process: Make Create()'s name parameter be taken by value
| * | | | kernel/process: Make Create()'s name parameter be taken by valueLioncash2019-06-102-2/+2
| |/ / / | | | | | | | | | | | | | | | | Makes the interface more flexible in terms of how Create() may be called, while still allowing the parameter itself to be moved into.
* | | | kernel/svc: Implement TotalMemoryUsedWithoutMmHeap/TotalMemoryAvailableWithoutMmHeapLioncash2019-06-103-2/+42
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Given we don't currently implement the personal heap yet, the existing memory querying functions are essentially doing what the memory querying types introduced in 6.0.0 do. So, we can build the necessary machinery over the top of those and just use them as part of info types.
* | | | kernel/svc: Amend naming for TotalMemoryUsage in svcGetInfo()Lioncash2019-06-103-6/+6
| | | | | | | | | | | | | | | | | | | | Disambiguates and makes the name a little more consistent with TotalPhysicalMemoryUsed.
* | | | kernel/svc: Remove duplicate enum entry in svcGetInfo()Lioncash2019-06-101-2/+1
|/ / /
* | | constants: Extract backup JPEG used by account servicesZach Hilman2019-06-074-16/+40
| | |
* | | Merge pull request #2514 from ReinUsesLisp/opengl-compatZach Hilman2019-06-072-2/+0
|\ \ \ | | | | | | | | video_core: Drop OpenGL core in favor of OpenGL compatibility
| * | | rasterizer_opengl: Remove OpenGL core profileReinUsesLisp2019-05-302-2/+0
| | | |
* | | | Merge pull request #2549 from lioncash/headerZach Hilman2019-06-061-1/+0
|\ \ \ \ | | | | | | | | | | kernel/process: Remove unused boost header include
| * | | | kernel/process: Remove unused boost header includeLioncash2019-06-051-1/+0
| | |_|/ | |/| | | | | | | | | | | | | | Boost headers typically include a lot of other headers, so removing this can prevent a bit of unnecessary compiler churn when building.
* | | | Merge pull request #2551 from lioncash/dtorbunnei2019-06-061-9/+9
|\ \ \ \ | | | | | | | | | | service/ns: Add missing override specifiers
| * | | | service/ns: Add missing override specifiersLioncash2019-06-051-9/+9
| | | | |
* | | | | Merge pull request #2419 from DarkLordZach/srv-lr-ifacebunnei2019-06-061-3/+77
|\ \ \ \ \ | |/ / / / |/| | | | lr: Add command handler skeletons for Open*LocationResolver
| * | | | ncm: Implement LR OpenAddOnContentLocationResolver (2)Zach Hilman2019-05-271-24/+21
| | | | | | | | | | | | | | | Returns an object of type IAddOnContentLocationResolver for the provided StorageId.
| * | | | ncm: Implement LR OpenRegisteredLocationResolver (1)Zach Hilman2019-05-271-0/+27
| | | | | | | | | | | | | | | Returns an object of type IRegisteredLocationResolver for the StorageId.
| * | | | ncm: Implement LR OpenLocationResolver (0)Zach Hilman2019-05-271-0/+50
| | | | | | | | | | | | | | | Returns an object of type ILocationResolver with the provided StorageId.
* | | | | Merge pull request #2526 from lioncash/globalZach Hilman2019-06-057-66/+97
|\ \ \ \ \ | | | | | | | | | | | | core/telemetry_session: Remove usages of the global system accessor
| * | | | | core/core: Remove unnecessary includesLioncash2019-05-293-13/+37
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The contents of these includes aren't used anywhere in this translation unit.
| * | | | | core/loader: Remove LoadKernelSystemModeLioncash2019-05-293-21/+0
| | | | | | | | | | | | | | | | | | | | | | | | This is a hold-over from Citra and doesn't apply to yuzu.
| * | | | | core/telemetry_session: Remove unnecessary web service nulling out in destructorLioncash2019-05-291-2/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This will automatically occur when the backend instance goes out of scope at the end of the destructor's execution.
| * | | | | core/telemetry_session: Remove usages of the global system accessorLioncash2019-05-293-30/+54
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Makes the dependency explicit in the TelemetrySession's interface instead of making it a hidden dependency. This also revealed a hidden issue with the way the telemetry session was being initialized. It was attempting to retrieve the app loader and log out title-specific information. However, this isn't always guaranteed to be possible. During the initialization phase, everything is being constructed. It doesn't mean an actual title has been selected. This is what the Load() function is for. This potentially results in dead code paths involving the app loader. Instead, we explicitly add this information when we know the app loader instance is available.
| * | | | | core/telemetry_session: Explicitly delete copy and move constructorsLioncash2019-05-291-1/+7
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | NonCopyable is misleading here. It also makes the class non-moveable as well, so we can be explicit about this.
| * | | | | core/telemetry_session: Remove unused includeLioncash2019-05-291-1/+0
| |/ / / /
* | | | | Merge pull request #2545 from lioncash/timingZach Hilman2019-06-055-76/+34
|\ \ \ \ \ | | | | | | | | | | | | core/core_timing_util: Use std::chrono types for specifying time units
| * | | | | core/core_timing_util: Amend casing of cyclesTo* functionsLioncash2019-06-053-6/+6
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Makes the casing consistent with all of our general function naming conventions.
| * | | | | core/core_timing_util: Use std::chrono types for specifying time unitsLioncash2019-06-055-34/+39
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Makes the interface more type-safe and consistent in terms of return values.
| * | | | | core/core_timing_utils: Simplify overload setLioncash2019-06-052-49/+2
| | |/ / / | |/| | | | | | | | | | | | | | | | | | Removes unused overloads, simplifying the overall interface, deduplicating some code.
* | | | | Merge pull request #2510 from SciresM/desired_languageZach Hilman2019-06-0510-402/+1081
|\ \ \ \ \ | | | | | | | | | | | | Implement/Fix IApplicationFunctions::GetDesiredLanguage
| * | | | | Fix bitmask logic inversionMichael Scire2019-05-231-2/+1
| | | | | |
| * | | | | fix introduced clang-format errorsMichael Scire2019-05-231-3/+2
| | | | | |
| * | | | | Address review commentsMichael Scire2019-05-236-47/+120
| | | | | |
| * | | | | clang-format fixesMichael Scire2019-05-234-31/+32
| | | | | |
| * | | | | Implement IApplicationFunctions::GetDesiredLanguageMichael Scire2019-05-239-403/+1010
| | | | | |
* | | | | | yuzu/bootmanager: Treat the resolution factor as a u32Lioncash2019-06-032-13/+21
| |/ / / / |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Treating it as a u16 can result in a sign-conversion warning when performing arithmetic with it, as u16 promotes to an int when aritmetic is performed on it, not unsigned int. This also makes the interface more uniform, as the layout interface now operates on u32 across the board.
* | | | | Merge pull request #1931 from DarkLordZach/mii-database-1bunnei2019-05-3011-111/+1059
|\ \ \ \ \ | |_|_|/ / |/| | | | mii: Implement MiiManager backend and several mii service commands
| * | | | mii_manager: Fix incorrect loop condition in mii UUID generation codeZach Hilman2019-04-253-2/+3
| | | | |
| * | | | profile_select: Port Service::Account::UUID to Common::UUIDZach Hilman2019-04-255-13/+12
| | | | |
| * | | | mii: Implement Delete and Destroy fileZach Hilman2019-04-253-8/+116
| | | | |
| * | | | mii: Implement IsUpdated command (IPC 0)Zach Hilman2019-04-253-9/+34
| | | | |
| * | | | mii_manager: Cleanup and optimizationZach Hilman2019-04-253-36/+50
| | | | |
| * | | | mii: Implement IDatabaseService commands using MiiManagerZach Hilman2019-04-252-15/+244
| | | | | | | | | | | | | | | Since the MiiManager was designed around the IPC interface, this is quite easy. Only functions that were clearly defined were implemented.
| * | | | mii: Add MiiManager class to manage Mii databaseZach Hilman2019-04-252-0/+622
| | | | | | | | | | | | | | | Provides serialization/deserialization to the database in system save files, accessors for database state and proper handling of both major Mii formats (MiiInfo and MiiStoreData)
| * | | | common: Extract UUID to its own classZach Hilman2019-04-253-78/+28
| | | | | | | | | | | | | | | Since the Mii database uses UUIDs very similar to the Accounts database, it makes no sense to not share code between them.
* | | | | Merge pull request #2518 from ReinUsesLisp/sdl2-windowbunnei2019-05-291-2/+1
|\ \ \ \ \ | | | | | | | | | | | | yuzu_cmd: Split emu_window OpenGL implementation into its own file
| * | | | | emu_window: Pass OnMinimalClientAreaChangeRequest argument by copyReinUsesLisp2019-05-261-2/+1
| | |/ / / | |/| | | | | | | | | | | | | | | | | | There's no performance improvement in passing an unsigned pair by reference.
* | | | | Merge pull request #2519 from lioncash/signbunnei2019-05-272-5/+5
|\ \ \ \ \ | |_|_|/ / |/| | | | loader/nso, core/core_timing_util: Silence sign-comparison warning
| * | | | core_timing_util: Silence sign-comparison warningsLioncash2019-05-251-4/+4
| | | | | | | | | | | | | | | | | | | | | | | | | We can just make the conversion explicit instead of implicit here to silence -Wsign-compare warnings.
| * | | | loader/nso: Silence sign-comparison warningLioncash2019-05-251-1/+1
| | |_|/ | |/| | | | | | | | | | | | | | This was previously performing a size_t == int comparison. Silences a -Wsign-compare warning.
* | | | Merge pull request #2509 from lioncash/aocbunnei2019-05-261-19/+50
|\ \ \ \ | |/ / / |/| | | service/aoc_u: Minor cleanup
| * | | service/aoc: Avoid allocating and discarding dataLioncash2019-05-231-8/+8
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Previously, the code was accumulating data into a std::vector and then tossing all of it away if a setting was disabled. Instead, we can just check if it's disabled and do no work at all if possible. If it's enabled, then we can append to the vector and allocate. Unlikely to impact usage much, but it is slightly less sloppy with resources.
| * | | service/aoc: Remove unnecessary includesLioncash2019-05-231-2/+0
| | | | | | | | | | | | | | | | | | | | Removes two header dependencies related to file handling that aren't actually used within the source file.
| * | | service/aoc: Pop all passed values where applicableLioncash2019-05-231-12/+45
| |/ / | | | | | | | | | | | | | | | A few of the aoc service stubs/implementations weren't fully popping all of the parameters passed to them. This ensures that all parameters are popped and, at minimum, logged out.
* | | Merge pull request #2489 from FearlessTobi/port-4716bunnei2019-05-254-9/+10
|\ \ \ | |/ / |/| | Port citra-emu/citra#4716: "HLE/IPC: HLEContext can memorize the client thread and use it for SleepClientThread"
| * | Address review commentTobias2019-05-191-1/+1
| | | | | | | | | Co-Authored-By: Mat M. <mathew1800@gmail.com>
| * | HLE/IPC: HLEContext can memorize the client thread and use it for SleepClientThreadWeiyi Wang2019-05-184-9/+10
| | | | | | | | | | | | This reduces the boilerplate that services have to write out the current thread explicitly. Using current thread instead of client thread is also semantically incorrect, and will be a problem when we implement multicore (at which time there will be multiple current threads)
* | | Merge pull request #2410 from lioncash/affinitybunnei2019-05-192-42/+58
|\ \ \ | | | | | | | | kernel/svc: Reorganize and fix up the initial handling of svcSetThreadCoreMask()
| * | | kernel/svc: Make svcCreateThread/svcStartThread/svcSleepThread/svcExitThread calls show up in the debug logLioncash2019-04-291-4/+4
| | | | | | | | | | | | | | | | | | | | | | | | These are actually quite important indicators of thread lifetimes, so they should be going into the debug log, rather than being treated as misc info and delegated to the trace log.
| * | | kernel/svc: Reorganize svcSetThreadCoreMask()Lioncash2019-04-291-32/+39
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Makes the code much nicer to follow in terms of behavior and control flow. It also fixes a few bugs in the implementation. Notably, the thread's owner process shouldn't be accessed in order to retrieve the core mask or ideal core. This should be done through the current running process. The only reason this bug wasn't encountered yet is because we currently only support running one process, and thus every owner process will be the current process. We also weren't checking against the process' CPU core mask to see if an allowed core is specified or not. With this out of the way, it'll be less noisy to implement proper handling of the affinity flags internally within the kernel thread instances.
| * | | kernel/thread: Update thread processor ID flagsLioncash2019-04-292-7/+16
| | | | | | | | | | | | | | | | Adds the missing flags to the enum and documents them.
* | | | Merge pull request #2439 from lioncash/audrenHexagon122019-05-192-51/+299
|\ \ \ \ | | | | | | | | | | service/audren_u: Get rid of magic values within GetAudioRendererWorkBufferSize
| * | | | service/audren_u: Handle variadic command buffers in GetWorkBufferSize()Lioncash2019-05-012-17/+93
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Also introduced in REV5 was a variable-size audio command buffer. This also affects how the size of the work buffer should be determined, so we can add handling for this as well. Thankfully, no other alterations were made to how the work buffer size is calculated in 7.0.0-8.0.0. There were indeed changes made to to how some of the actual audio commands are generated though (particularly in REV7), however they don't apply here.
| * | | | service/audren_u: Handle version 2 of performance frame info in GetWorkBufferSize()Lioncash2019-05-012-6/+13
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Introduced in REV5. This is trivial to add support for, now that everything isn't a mess of random magic constant values. All this is, is a change in data type sizes as far as this function cares.
| * | | | service/audren_u: Clean up work buffer calculationsLioncash2019-05-011-49/+214
| | |_|/ | |/| | | | | | | | | | | | | | | | | | "Unmagics" quite a few magic constants within this code, making it much easier to understand. Particularly given this factors out specific sections into their own self-contained lambda functions.
* | | | Merge pull request #2463 from lioncash/setHexagon122019-05-191-34/+22
|\ \ \ \ | | | | | | | | | | service/set: Correct and simplify behavior related to copying language codes
| * | | | service/set: Correct and simplify behavior related to copying language codesLioncash2019-05-101-34/+22
| | |_|/ | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This corrects cases where it was possible to write more entries into the write buffer than were requested. Now, we check the size of the buffer before actually writing into them. We were also returning the wrong value for GetAvailableLanguageCodeCount2(). This was previously returning 64, but only 17 should have been returned. 64 entries is the size of the static array used in MakeLanguageCode() within the service binary itself, but isn't the actual total number of language codes present.
* | | | Merge pull request #2487 from lioncash/service-returnHexagon122019-05-191-0/+2
|\ \ \ \ | | | | | | | | | | service/am: Add missing return in error case for IStorageAccessor's Read/Write()
| * | | | service/am: Add missing return in error case for IStorageAccessor's Read()/Write().Lioncash2019-05-191-0/+2
| |/ / / | | | | | | | | | | | | | | | | Previously this would fall through and return successfully, despite being an out of bounds read or write.
* | | | Merge pull request #2490 from lioncash/floatHexagon122019-05-191-1/+1
|\ \ \ \ | | | | | | | | | | ipc_helpers: Amend floating-point type in Pop<double> specialization
| * | | | ipc_helpers: Amend floating-point type in Pop<double> specializationLioncash2019-05-191-1/+1
| |/ / / | | | | | | | | | | | | | | | | Currently, this overload isn't used, so this wasn't actually hit in any code, only the float overload is used.
* | | | Merge pull request #2486 from lioncash/resetnameSebastian Valle2019-05-1918-31/+32
|\ \ \ \ | | | | | | | | | | core/kernel/object: Rename ResetType enum members for clarity
| * | | | core/kernel/object: Rename ResetType enum membersLioncash2019-05-1818-31/+32
| |/ / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Renames the members to more accurately indicate what they signify. "OneShot" and "Sticky" are kind of ambiguous identifiers for the reset types, and can be kind of misleading. Automatic and Manual communicate the kind of reset type in a clearer manner. Either the event is automatically reset, or it isn't and must be manually cleared. The "OneShot" and "Sticky" terminology is just a hold-over from Citra where the kernel had a third type of event reset type known as "Pulse". Given the Switch kernel only has two forms of event reset types, we don't need to keep the old terminology around anymore.
* / / / kernel/svc: Mark GetThreadList() and UnmapProcessCodeMemory() as internally linkedLioncash2019-05-191-4/+4
|/ / / | | | | | | | | | | | | | | | These are only used from within this translation unit, so they don't need to have external linkage. They were intended to be marked with this anyways to be consistent with the other service functions.
* | | Merge pull request #2437 from lioncash/audctlbunnei2019-05-091-2/+2
|\ \ \ | | | | | | | | service/audctl: Update documentation comments to be relative to 8.0.0
| * | | service/audctl: Update documentation comments to be relative to 8.0.0Lioncash2019-04-281-2/+2
| |/ / | | | | | | | | | The state of these service calls are still the same in version 8.0.0.
* | | Merge pull request #2445 from FearlessTobi/port-4749bunnei2019-05-092-9/+9
|\ \ \ | | | | | | | | Port citra-emu/citra#4749: "web_service: Misc fixes"
| * | | core/telemetry_session: Only create the backend when we really need itzhupengfei2019-05-042-9/+9
| | | | | | | | | | | | | | | | The backend is not used until we decide to submit the testcase/telemetry, and creating it early prevents users from updating the credentials properly while the games are running.
* | | | Merge pull request #2453 from lioncash/enumbunnei2019-05-091-9/+0
|\ \ \ \ | | | | | | | | | | core/memory: Remove unused FlushMode enum
| * | | | core/memory: Remove unused FlushMode enumLioncash2019-05-071-9/+0
| |/ / / | | | | | | | | | | | | | | | | Recent changes to memory-related code resulted in this being unused, so we can remove it.
* / / / core/frontend/emu_window: Make GraphicsContext's destructor virtualLioncash2019-05-042-0/+4
|/ / / | | | | | | | | | | | | This class is used in a polymorphic context, so destruction of the context will lead to undefined behavior if the destructor isn't virtual.
* | | loader/nso: Remove left-in debug pragmaLioncash2019-05-011-2/+0
| | | | | | | | | | | | Unintentionally introduced in 552d5071fa171165e4054392d8bb6bf2ecc924e2
* | | Merge pull request #2412 from lioncash/systembunnei2019-04-293-7/+11
|\ \ \ | |/ / |/| | kernel/vm_manager: Remove usages of global system accessors
| * | kernel/vm_manager: Remove usages of global system accessorsLioncash2019-04-173-7/+11
| | | | | | | | | | | | | | | Makes the dependency on the system instance explicit within VMManager's interface.
* | | Merge pull request #2416 from lioncash/waitbunnei2019-04-256-44/+50
|\ \ \ | | | | | | | | kernel/svc: Clean up wait synchronization related functionality
| * | | kernel/thread: Unify wait synchronization typesLioncash2019-04-176-38/+34
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This is a holdover from Citra, where the 3DS has both WaitSynchronization1 and WaitSynchronizationN. The switch only has one form of wait synchronizing (literally WaitSynchonization). This allows us to throw out code that doesn't apply at all to the Switch kernel. Because of this unnecessary dichotomy within the wait synchronization utilities, we were also neglecting to properly handle waiting on multiple objects. While we're at it, we can also scrub out any lingering references to WaitSynchronization1/WaitSynchronizationN in comments, and change them to WaitSynchronization (or remove them if the mention no longer applies).
| * | | kernel/svc: Migrate svcCancelSynchronization behavior to a thread functionLioncash2019-04-173-7/+17
| |/ / | | | | | | | | | | | | | | | | | | The actual behavior of this function is slightly more complex than what we're currently doing within the supervisor call. To avoid dumping most of this behavior in the supervisor call itself, we can migrate this to another function.
* | | Merge pull request #2424 from FernandoS27/compatbunnei2019-04-252-0/+2
|\ \ \ | | | | | | | | Allow picking a Compatibility Profile for OpenGL.
| * | | Allow picking a Compatibility Profile for OpenGL.Fernando Sahmkow2019-04-202-0/+2
| | | | | | | | | | | | | | | | | | | | | | | | This option allows picking the compatibility profile since a lot of bugs are fixed in it. We devs will use this option to easierly debug current problems in our Core implementation.:wq
* | | | Merge pull request #2228 from DarkLordZach/applet-manager-p1bunnei2019-04-2521-112/+653
|\ \ \ \ | | | | | | | | | | applets: Add AppletManager and implement PhotoViewer and Error applets
| * | | | web_browser: Make OpenPage non-constZach Hilman2019-04-1710-18/+23
| | | | |
| * | | | main: Add GMainWindow hooks for Error displayZach Hilman2019-04-172-3/+3
| | | | |
| * | | | general_backend: Move StubApplet and add backend PhotoViewerZach Hilman2019-04-172-1/+102
| | | | |
| * | | | general_frontend: Add frontend scaffold for PhotoViewer appletZach Hilman2019-04-172-0/+55
| | | | |
| * | | | frontend: Add frontend receiver for Error appletZach Hilman2019-04-173-2/+79
| | | | |
| * | | | applets: Add Error appletZach Hilman2019-04-173-24/+224
| | | | | | | | | | | | | | | Responsible for displaying error codes and messages
| * | | | applets: Port current applets to take frontend in constructorZach Hilman2019-04-176-14/+16
| | | | | | | | | | | | | | | As opposed to using Core::System::GetInstance()
| * | | | web_browser: Make OpenPage constZach Hilman2019-04-172-3/+3
| | | | |
| * | | | core: Remove specific applets in favor of AppletManagerZach Hilman2019-04-172-47/+32
| | | | |
| * | | | am: Delegate applet creation to AppletManagerZach Hilman2019-04-171-24/+3
| | | | |
| * | | | applets: Add AppletManager class to control lifetimeZach Hilman2019-04-172-0/+137
| | |/ / | |/| |
* | | | Merge pull request #2420 from lioncash/audctlbunnei2019-04-232-2/+32
|\ \ \ \ | |_|/ / |/| | | service/audctl: Implement GetTargetVolumeMin() and GetTargetVolumeMax()
| * | | service/audctl: Implement GetTargetVolumeMin() and GetTargetVolumeMax()Lioncash2019-04-182-2/+32
| | | | | | | | | | | | | | | | | | | | These two service functions are literally hardcoded to always return these values without any other error checking.
* | | | Merge pull request #2415 from lioncash/constbunnei2019-04-202-2/+2
|\ \ \ \ | | | | | | | | | | kernel/wait_object: Make GetHighestPriorityReadyThread() a const member function
| * | | | kernel/wait_object: Make GetHighestPriorityReadyThread() a const member functionLioncash2019-04-172-2/+2
| | |/ / | |/| | | | | | | | | | | | | | This doesn't actually modify internal state of a wait object, so it can be const qualified.
* | | | Merge pull request #2421 from lioncash/svc-callbunnei2019-04-201-1/+1
|\ \ \ \ | | | | | | | | | | kernel/svc: Name supervisor call 0x36
| * | | | kernel/svc: Name supervisor call 0x36Lioncash2019-04-191-1/+1
| | |/ / | |/| | | | | | | | | | | | | | This call was added to the SVC handlers in the 8.0.0 kernel, so we can finally give it a name.
* | | | Merge pull request #2374 from lioncash/pagetablebunnei2019-04-2029-163/+206
|\ \ \ \ | |/ / / |/| | | core: Reorganize boot order
| * | | core/core: Move process execution start to System's Load()Lioncash2019-04-1220-107/+144
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This gives us significantly more control over where in the initialization process we start execution of the main process. Previously we were running the main process before the CPU or GPU threads were initialized (not good). This amends execution to start after all of our threads are properly set up.
| * | | core/process: Remove unideal page table setting from LoadFromMetadata()Lioncash2019-04-121-5/+0
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Initially required due to the split codepath with how the initial main process instance was initialized. We used to initialize the process like: Init() { main_process = Process::Create(...); kernel.MakeCurrentProcess(main_process.get()); } Load() { const auto load_result = loader.Load(*kernel.GetCurrentProcess()); if (load_result != Loader::ResultStatus::Success) { // Handle error here. } ... } which presented a problem. Setting a created process as the main process would set the page table for that process as the main page table. This is fine... until we get to the part that the page table can have its size changed in the Load() function via NPDM metadata, which can dictate either a 32-bit, 36-bit, or 39-bit usable address space. Now that we have full control over the process' creation in load, we can simply set the initial process as the main process after all the loading is done, reflecting the potential page table changes without any special-casing behavior. We can also remove the cache flushing within LoadModule(), as execution wouldn't have even begun yet during all usages of this function, now that we have the initialization order cleaned up.
| * | | core/core: Move main process creation into Load()Lioncash2019-04-121-4/+3
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Now that we have dependencies on the initialization order, we can move the creation of the main process to a more sensible area: where we actually load in the executable data. This allows localizing the creation and loading of the process in one location, making the initialization of the process much nicer to trace.
| * | | video_core/gpu: Create threads separately from initializationLioncash2019-04-121-11/+4
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Like with CPU emulation, we generally don't want to fire off the threads immediately after the relevant classes are initialized, we want to do this after all necessary data is done loading first. This splits the thread creation into its own interface member function to allow controlling when these threads in particular get created.
| * | | core/cpu_core_manager: Create threads separately from initialization.Lioncash2019-04-1211-39/+58
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Our initialization process is a little wonky than one would expect when it comes to code flow. We initialize the CPU last, as opposed to hardware, where the CPU obviously needs to be first, otherwise nothing else would work, and we have code that adds checks to get around this. For example, in the page table setting code, we check to see if the system is turned on before we even notify the CPU instances of a page table switch. This results in dead code (at the moment), because the only time a page table switch will occur is when the system is *not* running, preventing the emulated CPU instances from being notified of a page table switch in a convenient manner (technically the code path could be taken, but we don't emulate the process creation svc handlers yet). This moves the threads creation into its own member function of the core manager and restores a little order (and predictability) to our initialization process. Previously, in the multi-threaded cases, we'd kick off several threads before even the main kernel process was created and ready to execute (gross!). Now the initialization process is like so: Initialization: 1. Timers 2. CPU 3. Kernel 4. Filesystem stuff (kind of gross, but can be amended trivially) 5. Applet stuff (ditto in terms of being kind of gross) 6. Main process (will be moved into the loading step in a following change) 7. Telemetry (this should be initialized last in the future). 8. Services (4 and 5 should ideally be alongside this). 9. GDB (gross. Uses namespace scope state. Needs to be refactored into a class or booted altogether). 10. Renderer 11. GPU (will also have its threads created in a separate step in a following change). Which... isn't *ideal* per-se, however getting rid of the wonky intertwining of CPU state initialization out of this mix gets rid of most of the footguns when it comes to our initialization process.
* | | | Merge pull request #2397 from lioncash/thread-unusedbunnei2019-04-183-18/+17
|\ \ \ \ | |_|/ / |/| | | kernel/thread: Remove unused guest_handle member variable
| * | | svc: Specify handle value in thread's nameLioncash2019-04-152-2/+10
| | | | | | | | | | | | | | | | Allows the handle to be seen alongside the entry point.
| * | | kernel/thread: Remove unused guest_handle member variableLioncash2019-04-143-16/+7
| | |/ | |/| | | | | | | | | | | | | This member variable is entirely unused. It was only set but never actually utilized. Given that, we can remove it to get rid of noise in the thread interface.
* | | Merge pull request #2382 from lioncash/tablebunnei2019-04-1627-57/+262
|\ \ \ | | | | | | | | service: Update service function tables
| * | | service: Update service function tablesLioncash2019-04-1127-57/+262
| | | | | | | | | | | | | | | | Updates function tables based off information from SwitchBrew.
* | | | Merge pull request #2393 from lioncash/svcbunnei2019-04-164-2/+274
|\ \ \ \ | | | | | | | | | | kernel/svc: Implement svcMapProcessCodeMemory/svcUnmapProcessCodeMemory
| * | | | kernel/svc: Implement svcUnmapProcessCodeMemoryLioncash2019-04-133-1/+143
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Essentially performs the inverse of svcMapProcessCodeMemory. This unmaps the aliasing region first, then restores the general traits of the aliased memory. What this entails, is: - Restoring Read/Write permissions to the VMA. - Restoring its memory state to reflect it as a general heap memory region. - Clearing the memory attributes on the region.
| * | | | kernel/svc: Implement svcMapProcessCodeMemoryLioncash2019-04-134-1/+131
| | |_|/ | |/| | | | | | | | | | | | | | This is utilized for mapping code modules into memory. Notably, the ldr service would call this in order to map objects into memory.
* | | | kernel/thread: Remove BoostPriority()Lioncash2019-04-152-11/+0
| |_|/ |/| | | | | | | | | | | This is a holdover from Citra that currently remains unused, so it can be removed from the Thread interface.
* | | Merge pull request #2378 from lioncash/robunnei2019-04-141-65/+85
|\ \ \ | | | | | | | | ldr: Minor amendments to IPC-related parameters
| * | | ldr: Mark IsValidNROHash() as a const member functionLioncash2019-04-101-5/+4
| | | | | | | | | | | | | | | | This doesn't modify instance state, so it can be made const.
| * | | ldr: Amend parameters for LoadNro/UnloadNro LoadNrr/UnloadNrrLioncash2019-04-101-60/+81
| | |/ | |/| | | | | | | | | | The initial two words indicate a process ID. Also UnloadNro only specifies one address, not two.
* | | Merge pull request #2357 from zarroboogs/force-30fps-modebunnei2019-04-142-6/+11
|\ \ \ | | | | | | | | Add a toggle to force 30FPS mode
| * | | added a toggle to force 30fps modezarroboogs2019-04-092-6/+11
| | | |
* | | | Merge pull request #2381 from lioncash/fsbunnei2019-04-141-8/+7
|\ \ \ \ | | | | | | | | | | fsp_srv: Minor cleanup related changes
| * | | | fsp_srv: Remove unnecessary parameter popping in IDirectory's Read()Lioncash2019-04-101-4/+1
| | | | | | | | | | | | | | | | | | | | | | | | | IDirectory's Read() function doesn't take any input parameters. It only uses the output parameters that we already provide.
| * | | | fsp_srv: Log out option values in IFile's Read and Write functionsLioncash2019-04-101-4/+6
| | |/ / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | These indicate options that alter how a read/write is performed. Currently we don't need to handle these, as the only one that seems to be used is for writes, but all the custom options ever seem to do is immediate flushing, which we already do by default.
* | | | Merge pull request #2017 from jroweboy/glwidgetbunnei2019-04-141-9/+30
|\ \ \ \ | |_|_|/ |/| | | Frontend: Migrate to QOpenGLWindow and support shared contexts
| * | | QT Frontend: Migrate to QOpenGLWindowJames Rowe2019-01-221-9/+30
| | | |
* | | | Merge pull request #2360 from lioncash/svc-globalbunnei2019-04-128-364/+413
|\ \ \ \ | | | | | | | | | | kernel/svc: Deglobalize the supervisor call handlers
| * | | | kernel/svc: Deglobalize the supervisor call handlersLioncash2019-04-088-364/+413
| | |_|/ | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Adjusts the interface of the wrappers to take a system reference, which allows accessing a system instance without using the global accessors. This also allows getting rid of all global accessors within the supervisor call handling code. While this does make the wrappers themselves slightly more noisy, this will be further cleaned up in a follow-up. This eliminates the global system accessors in the current code while preserving the existing interface.
* | | | Merge pull request #2388 from lioncash/constexprbunnei2019-04-1210-10/+10
|\ \ \ \ | | | | | | | | | | kernel: Make handle type declarations constexpr
| * | | | kernel: Make handle type declarations constexprLioncash2019-04-1110-10/+10
| | |_|/ | |/| | | | | | | | | | | | | | | | | | | | | | Some objects declare their handle type as const, while others declare it as constexpr. This makes the const ones constexpr for consistency, and prevent unexpected compilation errors if these happen to be attempted to be used within a constexpr context.
* / | | kernel/server_session: Remove obsolete TODOsLioncash2019-04-101-7/+2
|/ / / | | | | | | | | | These are holdovers from Citra.
* | | Merge pull request #1957 from DarkLordZach/title-providerbunnei2019-04-1015-187/+362
|\ \ \ | | | | | | | | file_sys: Provide generic interface for accessing game data
| * | | patch_manager: Dump NSO name with build IDZach Hilman2019-03-284-9/+11
| | | |
| * | | game_list: Register content with ContentProviderZach Hilman2019-03-271-2/+3
| | | |
| * | | core: Port current uses of RegisteredCache to ContentProviderZach Hilman2019-03-278-27/+32
| | | |
| * | | core: Store system-wide ContentProvider for the emulatorZach Hilman2019-03-272-0/+40
| | | |
| * | | file_sys: Create ContentProvider interface and default implementationsZach Hilman2019-03-272-152/+279
| | | |
* | | | kernel/process: Set page table when page table resizes occur.Lioncash2019-04-091-0/+2
| |/ / |/| | | | | | | | | | | | | | | | | | | | | | | We need to ensure dynarmic gets a valid pointer if the page table is resized (the relevant pointers would be invalidated in this scenario). In this scenario, the page table can be resized depending on what kind of address space is specified within the NPDM metadata (if it's present).
* | | Merge pull request #2361 from lioncash/pagetablebunnei2019-04-077-18/+3
|\ \ \ | | | | | | | | core/memory: Minor simplifications to page table management
| * | | core/memory: Remove GetCurrentPageTable()Lioncash2019-04-072-6/+1
| | | | | | | | | | | | | | | | | | | | Now that nothing actually touches the internal page table aside from the memory subsystem itself, we can remove the accessor to it.
| * | | arm/arm_dynarmic: Remove unnecessary current_page_table memberLioncash2019-04-072-8/+0
| | | | | | | | | | | | | | | | | | | | Given the page table will always be guaranteed to be that of whatever the current process is, we no longer need to keep this around.
| * | | kernel: Handle page table switching within MakeCurrentProcess()Lioncash2019-04-073-4/+2
| | | | | | | | | | | | | | | | | | | | Centralizes the page table switching to one spot, rather than making calling code deal with it everywhere.
* | | | Merge pull request #2356 from lioncash/pairbunnei2019-04-076-18/+15
|\ \ \ \ | | | | | | | | | | kernel/{server_port, server_session}: Return pairs instead of tuples from pair creation functions
| * | | | kernel/server_session: Return a std::pair from CreateSessionPair()Lioncash2019-04-064-11/+8
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Keeps the return type consistent with the function name. While we're at it, we can also reduce the amount of boilerplate involved with handling these by using structured bindings.
| * | | | kernel/server_port: Return a std::pair from CreatePortPair()Lioncash2019-04-062-7/+7
| |/ / / | | | | | | | | | | | | Returns the same type that the function name describes.
* / / / core/memory: Remove unused enum constantsLioncash2019-04-071-10/+0
|/ / / | | | | | | | | | These are holdovers from Citra and can be removed.
* | | Merge pull request #2325 from lioncash/namebunnei2019-04-061-0/+4
|\ \ \ | | | | | | | | kernel/server_session: Provide a GetName() override
| * | | kernel/server_session: Provide a GetName() overrideLioncash2019-04-031-0/+4
| | | | | | | | | | | | | | | | | | | | | | | | Given server sessions can be given a name, we should allow retrieving it instead of using the default implementation of GetName(), which would just return "[UNKNOWN KERNEL OBJECT]".
* | | | Merge pull request #2240 from FearlessTobi/port-4651bunnei2019-04-063-4/+5
|\ \ \ \ | | | | | | | | | | Port citra-emu/citra#4651: "gdbstub: Fix some bugs in IsMemoryBreak() and ServeBreak. Add workaround to let watchpoints break into GDB."
| * | | | gdbstub: Fix some bugs in IsMemoryBreak() and ServeBreak. Add workaround to let watchpoints break into GDB. (#4651)Dimitri A2019-03-153-4/+5
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * gdbstub: fix IsMemoryBreak() returning false while connected to client As a result, the only existing codepath for a memory watchpoint hit to break into GDB (InterpeterMainLoop, GDB_BP_CHECK, ARMul_State::RecordBreak) is finally taken, which exposes incorrect logic* in both RecordBreak and ServeBreak. * a blank BreakpointAddress structure is passed, which sets r15 (PC) to NULL * gdbstub: DynCom: default-initialize two members/vars used in conditionals * gdbstub: DynCom: don't record memory watchpoint hits via RecordBreak() For now, instead check for GDBStub::IsMemoryBreak() in InterpreterMainLoop and ServeBreak. Fixes PC being set to a stale/unhit breakpoint address (often zero) when a memory watchpoint (rwatch, watch, awatch) is handled in ServeBreak() and generates a GDB trap. Reasons for removing a call to RecordBreak() for memory watchpoints: * The``breakpoint_data`` we pass is typed Execute or None. It describes the predicted next code breakpoint hit relative to PC; * GDBStub::IsMemoryBreak() returns true if a recent Read/Write operation hit a watchpoint. It doesn't specify which in return, nor does it trace it anywhere. Thus, the only data we could give RecordBreak() is a placeholder BreakpointAddress at offset NULL and type Access. I found the idea silly, compared to simply relying on GDBStub::IsMemoryBreak(). There is currently no measure in the code that remembers the addresses (and types) of any watchpoints that were hit by an instruction, in order to send them to GDB as "extended stop information." I'm considering an implementation for this. * gdbstub: Change an ASSERT to DEBUG_ASSERT I have never seen the (Reg[15] == last_bkpt.address) assert fail in practice, even after several weeks of (locally) developping various branches around GDB. Only leave it inside Debug builds.
* | | | | Merge pull request #2340 from lioncash/viewbunnei2019-04-061-1/+3
|\ \ \ \ \ | | | | | | | | | | | | file_sys/fsmitm_romfsbuild: Utilize a string_view in romfs_calc_path_hash
| * | | | | file_sys/fsmitm_romfsbuild: Utilize a string_view in romfs_calc_path_hash()Lioncash2019-04-051-1/+3
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The given string instance doesn't need to be copied entirely, we can just use a view instead.
* | | | | | Merge pull request #2334 from lioncash/overridebunnei2019-04-0613-23/+9
|\ \ \ \ \ \ | | | | | | | | | | | | | | core: Add missing override specifiers where applicable
| * | | | | | core: Add missing override specifiers where applicableLioncash2019-04-0413-23/+9
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Applies the override specifier where applicable. In the case of destructors that are defaulted in their definition, they can simply be removed. This also removes the unnecessary inclusions being done in audin_u and audrec_u, given their close proximity.
* | | | | | | Merge pull request #2341 from lioncash/comparebunnei2019-04-062-11/+0
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | file_sys/nca_metadata: Remove unnecessary comparison operators for TitleType
| * | | | | | | file_sys/nca_metadata: Remove unnecessary comparison operators for TitleTypeLioncash2019-04-052-11/+0
| | |/ / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | enum class elements from the same enum can already be compared against one another without the need for explicitly defined comparison operators.
* | | | | | | Merge pull request #2339 from lioncash/rankbunnei2019-04-065-17/+29
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | service/fsp_srv: Update SaveDataInfo and SaveDataDescriptor structs
| * | | | | | | service/fsp_srv: Don't pass SaveDataDescriptor instances by value.Lioncash2019-04-054-6/+6
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Passing around a 64 byte data struct by value is kind of wasteful, instead pass a reference to the struct.
| * | | | | | | service/fsp_srv: Remove unnecessary unknown member in OpenSaveDataFileSystemLioncash2019-04-051-7/+8
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The unknown member here is actually padding due to being passed as a struct. We can do the same, and remove the need to pop a padding word.
| * | | | | | | service/fsp_srv: Update SaveDataInfo and SaveDataDescriptor structsLioncash2019-04-053-4/+15
| | |/ / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | I realized that I updated the documentation on SwitchBrew a while ago, but never actually updated the structs within yuzu.
* | | | | | | Merge pull request #2343 from lioncash/todobunnei2019-04-062-15/+14
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | file_sys/program_metadata: Remove obsolete TODOs
| * | | | | | | file_sys/program_metadata: Remove obsolete TODOsLioncash2019-04-052-15/+14
| | |/ / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | BitField has been trivially copyable since e99a14862841841d74be8d0ea9426c2d23546b5e, so we can eliminate these TODO comments and use ReadObject() directly instead of memcpying the data.
* | | | | | | Merge pull request #2329 from lioncash/sanitizebunnei2019-04-061-0/+14
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | kernel/svc: Properly sanitize mutex address in WaitProcessWideKeyAtomic
| * | | | | | | kernel/svc: Properly sanitize mutex address in WaitProcessWideKeyAtomicLioncash2019-04-041-0/+14
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | We need to be checking whether or not the given address is within the kernel address space or if the given address isn't word-aligned and bail in these scenarios instead of trashing any kernel state.
* | | | | | | | Merge pull request #2344 from lioncash/resultbunnei2019-04-061-4/+0
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | hle/result: Remove unnecessary bitfield entry for ResultCode
| * | | | | | | | hle/result: Remove unnecessary bitfield entry for ResultCodeLioncash2019-04-051-4/+0
| | |/ / / / / / | |/| | | | | | | | | | | | | | | | | | | | | | This is a hold over from the 3DS error codes in Citra.
* | | | | | | | Merge pull request #2338 from lioncash/fsbunnei2019-04-051-5/+8
|\ \ \ \ \ \ \ \ | |/ / / / / / / |/| | | | | | | filesystem: Use a std::string_view in OpenFile()
| * | | | | | | filesystem: Use a std::string_view in OpenFile()Lioncash2019-04-051-5/+8
| | |/ / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Rather than make a full copy of the path, we can just use a string view and truncate the viewed portion of the string instead of creating a totally new truncated string.
* | | | | | | Merge pull request #2292 from lioncash/nacpbunnei2019-04-052-12/+24
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | file_sys/control_metadata: Amend naming of members
| * | | | | | | file_sys/control_metadata: Amend naming of membersLioncash2019-04-042-12/+24
| | |_|_|_|/ / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Quite a bit of these were out of sync with Switchbrew (and in some cases entirely wrong). While we're at it, also expand the section of named members. A segment within the control metadata is used to specify maximum values for the user, device, and cache storage max sizes and journal sizes. These appear to be generally used by the am service (e.g. in CreateCacheStorage, etc).
* | | | | | | hle/service: Resolve unused variable warningsLioncash2019-04-048-62/+58
| |/ / / / / |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | In several places, we have request parsers where there's nothing to really parse, simply because the HLE function in question operates on buffers. In these cases we can just remove these instances altogether. In the other cases, we can retrieve the relevant members from the parser and at least log them out, giving them some use.
* | | | | | Merge pull request #2328 from lioncash/transferbunnei2019-04-043-17/+37
|\ \ \ \ \ \ | | | | | | | | | | | | | | service/am: Correct behavior of CreateTransferMemoryStorage()
| * | | | | | service/am: Correct behavior of CreateTransferMemoryStorage()Lioncash2019-04-031-6/+6
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | For whatever reason, shared memory was being used here instead of transfer memory, which (quite clearly) will not work based off the name of the function. This corrects this wonky usage of shared memory.
| * | | | | | kernel/transfer_memory: Add accessors to data and sizesLioncash2019-04-032-11/+31
| | |/ / / / | |/| | | | | | | | | | | | | | | | Also amend erroneous use of size_t. We should be using u64 here.
* | | | | | Merge pull request #2093 from FreddyFunk/disk-cache-better-compressionbunnei2019-04-042-11/+8
|\ \ \ \ \ \ | | | | | | | | | | | | | | Better LZ4 compression utilization for the disk based shader cache and the yuzu build system
| * | | | | | Addressed feedbackunknown2019-03-291-4/+4
| | | | | | |
| * | | | | | core: Do not link LZ4 to core. Use common/data_compression for nso segment decompression instead.unknown2019-03-292-11/+8
| | | | | | |
* | | | | | | Merge pull request #2324 from lioncash/enum-unusedbunnei2019-04-042-2/+0
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | kernel/object: Remove unused handle type entry
| * | | | | | | kernel/object: Remove unused handle type entryLioncash2019-04-032-2/+0
| | |_|_|_|/ / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The AddressArbiter type isn't actually used, given the arbiter itself isn't a direct kernel object (or object that implements the wait object facilities). Given this, we can remove the enum entry entirely.
* | | | | | | Merge pull request #2294 from lioncash/fatalbunnei2019-04-032-36/+63
|\ \ \ \ \ \ \ | |_|_|/ / / / |/| | | | | | service/am: Implement EnterFatalSection/LeaveFatalSection
| * | | | | | service/am: Implement EnterFatalSection and LeaveFatalSectionLioncash2019-03-262-2/+29
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | These functions act in tandem similar to how a lock or mutex require a balanced lock()/unlock() sequence. EnterFatalSection simply increments a counter for how many times it has been called, while LeaveFatalSection ensures that a previous call to EnterFatalSection has occured. If a previous call has occurred (the counter is not zero), then the counter gets decremented as one would expect. If a previous call has not occurred (the counter is zero), then an error code is returned.
| * | | | | | service/am: Sort ISelfController's member functions according to table orderLioncash2019-03-262-36/+36
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Makes the declaration order of the handling functions consistent with the handler table itself.
* | | | | | | Merge pull request #2305 from lioncash/sharedbunnei2019-04-033-5/+18
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | kernel/shared_memory: Sanitize supplied size when unmapping
| * | | | | | | kernel/shared_memory: Remove unused core/memory.h includeLioncash2019-03-291-1/+0
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Nothing from this header is used, so we can remove this include, getting rid of a dependency on it.
| * | | | | | | kernel/shared_memory: Sanitize supplied size when unmappingLioncash2019-03-293-4/+18
| | |_|/ / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The kernel makes sure that the given size to unmap is always the same size as the entire region managed by the shared memory instance, otherwise it returns an error code signifying an invalid size. This is similarly done for transfer memory (which we already check for).
* | | | | | | Merge pull request #2314 from lioncash/constbunnei2019-04-0311-18/+18
|\ \ \ \ \ \ \ | |_|_|/ / / / |/| | | | | | kernel/thread: Minor interface cleanup
| * | | | | | kernel/thread: Make AllWaitObjectsReady() a const qualified member functionLioncash2019-04-022-2/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Now that ShouldWait() is a const qualified member function, this one can be made const qualified as well, since it can handle passing a const qualified this pointer to ShouldWait().
| * | | | | | kernel/wait_object: Make ShouldWait() take thread members by pointer-to-constLioncash2019-04-0211-11/+11
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Given this is intended as a querying function, it doesn't make sense to allow the implementer to modify the state of the given thread.
| * | | | | | kernel/thread: Avoid sign conversion within GetCommandBufferAddress()Lioncash2019-04-011-2/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Previously this was performing a u64 + int sign conversion. When dealing with addresses, we should generally be keeping the arithmetic in the same signedness type. This also gets rid of the static lifetime of the constant, as there's no need to make a trivial type like this potentially live for the entire duration of the program.
| * | | | | | kernel/thread: Make parameter of GetWaitObjectIndex() const qualifiedLioncash2019-04-012-3/+3
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The pointed to member is never actually modified, so it can be made const.
* | | | | | | Merge pull request #2270 from lioncash/plistbunnei2019-04-037-2/+123
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | kernel/svc: Implement svcGetProcessList and svcGetThreadList
| * | | | | | | kernel/svc: Implement svcGetThreadListLioncash2019-04-024-1/+70
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Similarly like svcGetProcessList, this retrieves the list of threads from the current process. In the kernel itself, a process instance maintains a list of threads, which are used within this function. Threads are registered to a process' thread list at thread initialization, and unregistered from the list upon thread destruction (if said thread has a non-null owning process). We assert on the debug event case, as we currently don't implement kernel debug objects.
| * | | | | | | kernel/svc: Implement svcGetProcessListLioncash2019-04-024-1/+53
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This service function simply copies out a specified number of kernel process IDs, while simultaneously reporting the total number of processes.
* | | | | | | | Merge pull request #2313 from lioncash/reslimitbunnei2019-04-023-14/+6
|\ \ \ \ \ \ \ \ | |/ / / / / / / |/| | | | | | | kernel/resource_limit: Remove the name member from resource limits
| * | | | | | | kernel/resource_limit: Remove the name member from resource limitsLioncash2019-04-013-14/+6
| |/ / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This doesn't really provide any benefit to the resource limit interface. There's no way for callers to any of the service functions for resource limits to provide a custom name, so all created instances of resource limits other than the system resource limit would have a name of "Unknown". The system resource limit itself is already trivially identifiable from its limit values, so there's no real need to take up space in the object to identify one object meaningfully out of N total objects.
* | | | | | | process: Fix up compilationReinUsesLisp2019-04-021-1/+1
| | | | | | |
* | | | | | | Merge pull request #2281 from lioncash/memorybunnei2019-04-025-7/+8
|\ \ \ \ \ \ \ | |/ / / / / / |/| | | | | | kernel/codeset: Make CodeSet's memory data member a regular std::vector
| * | | | | | kernel/codeset: Make CodeSet's memory data member a regular std::vectorLioncash2019-03-225-7/+8
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The use of a shared_ptr is an implementation detail of the VMManager itself when mapping memory. Because of that, we shouldn't require all users of the CodeSet to have to allocate the shared_ptr ahead of time. It's intended that CodeSet simply pass in the required direct data, and that the memory manager takes care of it from that point on. This means we just do the shared pointer allocation in a single place, when loading modules, as opposed to in each loader.
* | | | | | | Merge pull request #2301 from FearlessTobi/remove-amiibo-settingbunnei2019-04-013-3/+1
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | core/yuzu: Remove enable_nfc setting
| * | | | | | | core/yuzu: Remove enable_nfc settingfearlessTobi2019-03-293-3/+1
| | |_|/ / / / | |/| | | | | | | | | | | | | | | | | | | This was initially added to prevent problems from stubbed/not implemented NFC services, but as we never encountered such and as it's only used in a deprecated function anyway, I guess we can just remove it to prevent more clutter of the settings.
* | | | | | | general: Use deducation guides for std::lock_guard and std::unique_lockLioncash2019-04-016-14/+14
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Since C++17, the introduction of deduction guides for locking facilities means that we no longer need to hardcode the mutex type into the locks themselves, making it easier to switch mutex types, should it ever be necessary in the future.
* | | | | | | Merge pull request #2304 from lioncash/memsizebunnei2019-03-313-9/+28
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | kernel/process: Report total physical memory used to svcGetInfo slightly better
| * | | | | | | kernel/process: Report total physical memory used to svcGetInfoLioncash2019-03-293-4/+11
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Reports the (mostly) correct size through svcGetInfo now for queries to total used physical memory. This still doesn't correctly handle memory allocated via svcMapPhysicalMemory, however, we don't currently handle that case anyways.
| * | | | | | | kernel/process: Store the total size of the code memory loadedLioncash2019-03-292-0/+5
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This will be necessary to properly report the used memory size in svcGetInfo.
| * | | | | | | kernel/process: Store the main thread stack size to a data memberLioncash2019-03-282-4/+7
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This will be necessary in order to properly report memory usage within svcGetInfo.
| * | | | | | | kernel/process: Make Run's stack size parameter a u64Lioncash2019-03-282-2/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This will make operating with the process-related SVC commands much nicer in the future (the parameter representing the stack size in svcStartProcess is a 64-bit value).
| * | | | | | | kernel/process: Ensure that given stack size is always page-alignedLioncash2019-03-281-0/+4
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The kernel always makes sure that the given stack size is aligned to page boundaries.
* | | | | | | | Merge pull request #2308 from lioncash/deductionbunnei2019-03-313-12/+12
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | kernel/scheduler: Minor tidying up
| * | | | | | | | kernel/scheduler: Remove unused parameter to AddThread()Lioncash2019-03-303-4/+4
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This was made unused in b404fcdf1443b91ac9994c05ad1fe039fcd9675e, but the parameter itself wasn't removed.
| * | | | | | | | kernel/scheduler: Use deduction guides on mutex locksLioncash2019-03-301-8/+8
| | |_|_|/ / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Since C++17, we no longer need to explicitly specify the type of the mutex within the lock_guard. The type system can now deduce these with deduction guides.
* | | | | | | | service/fatal: Mark local variables as const where applicableLioncash2019-03-301-6/+6
| | | | | | | |
* | | | | | | | service/fatal: Remove unnecessary semicolonLioncash2019-03-301-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Resolves a -Wextra-semi warning.
* | | | | | | | service/fatal: Name FatalInfo structure membersLioncash2019-03-301-31/+44
|/ / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Based off RE, most of these structure members are register values, which makes, sense given this service is used to convey fatal errors. One member indicates the program entry point address, one is a set of bit flags used to determine which registers to print, and one member indicates the architecture type. The only member that still isn't determined is the final member within the data structure.
* | | | | | | Merge pull request #2266 from FernandoS27/arbitrationbunnei2019-03-295-14/+18
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | Kernel: Fixes to Arbitration and SignalProcessWideKey Management
| * | | | | | | Fix small bug that kept a thread as a condvar thread after being signalled.Fernando Sahmkow2019-03-202-6/+8
| | | | | | | |
| * | | | | | | Add CondVar Thread State.Fernando Sahmkow2019-03-204-4/+6
| | | | | | | |
| * | | | | | | Small fixes to address_arbiter to better match the IDB.Fernando Sahmkow2019-03-202-5/+5
| | | | | | | |
* | | | | | | | Merge pull request #2265 from FernandoS27/multilevelqueuebunnei2019-03-292-19/+27
|\ \ \ \ \ \ \ \ | |_|/ / / / / / |/| | | | | | | Replace old Thread Queue for a new Multi Level Queue
| * | | | | | | Fixes and corrections on formatting.Fernando Sahmkow2019-03-271-6/+9
| | | | | | | |
| * | | | | | | Use MultiLevelQueue instead of old ThreadQueueListFernando Sahmkow2019-03-272-19/+24
| | |/ / / / / | |/| | | | |
* | | | | | | Merge pull request #2284 from lioncash/heap-allocbunnei2019-03-283-59/+81
|\ \ \ \ \ \ \ | |/ / / / / / |/| | | | | | kernel/vm_manager: Unify heap allocation/freeing functions
| * | | | | | kernel/vm_manager: Handle shrinking of the heap size within SetHeapSize()Lioncash2019-03-242-24/+46
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | One behavior that we weren't handling properly in our heap allocation process was the ability for the heap to be shrunk down in size if a larger size was previously requested. This adds the basic behavior to do so and also gets rid of HeapFree, as it's no longer necessary now that we have allocations and deallocations going through the same API function. While we're at it, fully document the behavior that this function performs.
| * | | | | | kernel/vm_manager: Rename HeapAllocate to SetHeapSizeLioncash2019-03-243-4/+3
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Makes it more obvious that this function is intending to stand in for the actual supervisor call itself, and not acting as a general heap allocation function. Also the following change will merge the freeing behavior of HeapFree into this function, so leaving it as HeapAllocate would be misleading.
| * | | | | | kernel/vm_manager: Handle case of identical calls to HeapAllocateLioncash2019-03-241-0/+5
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | In cases where HeapAllocate is called with the same size of the current heap, we can simply do nothing and return successfully. This avoids doing work where we otherwise don't have to. This is also what the kernel itself does in this scenario.
| * | | | | | kernel/vm_manager: Remove unused class variablesLioncash2019-03-241-3/+0
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Over time these have fallen out of use due to refactoring, so these can be removed.
| * | | | | | kernel/vm_manager: Remove unnecessary heap_used data memberLioncash2019-03-243-13/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This isn't required anymore, as all the kernel ever queries is the size of the current heap, not the total usage of it.
| * | | | | | kernel/vm_manager: Tidy up heap allocation codeLioncash2019-03-243-27/+37
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Another holdover from citra that can be tossed out is the notion of the heap needing to be allocated in different addresses. On the switch, the base address of the heap will always be managed by the memory allocator in the kernel, so this doesn't need to be specified in the function's interface itself. The heap on the switch is always allocated with read/write permissions, so we don't need to add specifying the memory permissions as part of the heap allocation itself either. This also corrects the error code returned from within the function. If the size of the heap is larger than the entire heap region, then the kernel will report an out of memory condition.
* | | | | | | Merge pull request #2285 from lioncash/unused-structbunnei2019-03-261-8/+0
|\ \ \ \ \ \ \ | |_|_|_|/ / / |/| | | | | | kernel/process: Remove unused AddressMapping struct
| * | | | | | kernel/process: Remove unused AddressMapping structLioncash2019-03-241-8/+0
| | | | | | | | | | | | | | | | | | | | | | | | | | | | Another leftover from citra that's now no longer necessary.
* | | | | | | Merge pull request #2287 from lioncash/coretiming-cbbunnei2019-03-266-11/+11
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | core/core_timing: Make callback parameters consistent
| * | | | | | | core/core_timing: Make callback parameters consistentLioncash2019-03-246-11/+11
| |/ / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | In some cases, our callbacks were using s64 as a parameter, and in other cases, they were using an int, which is inconsistent. To make all callbacks consistent, we can just use an s64 as the type for late cycles, given it gets rid of the need to cast internally. While we're at it, also resolve some signed/unsigned conversions that were occurring related to the callback registration.
* | | | | | | Merge pull request #2286 from lioncash/fwdbunnei2019-03-261-3/+0
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | kernel/kernel: Remove unnecessary forward declaration
| * | | | | | | kernel/kernel: Remove unnecessary forward declarationLioncash2019-03-241-3/+0
| |/ / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | This is no longer necessary, as ResultVal isn't used anywhere in the header.
* / / / / / / core/cheat_engine: Make MemoryReadImpl and MemoryWriteImpl internally linkedLioncash2019-03-241-0/+2
|/ / / / / / | | | | | | | | | | | | | | | | | | | | | | | | These don't need to be visible outside of the translation unit, so they can be enclosed within an anonymous namespace.
* | | | | | Merge pull request #2232 from lioncash/transfer-memorybunnei2019-03-246-6/+282
|\ \ \ \ \ \ | |/ / / / / |/| | | | | core/hle/kernel: Split transfer memory handling out into its own class
| * | | | | core/hle/kernel/svc: Implement svcUnmapTransferMemoryLioncash2019-03-131-1/+48
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Similarly, like svcMapTransferMemory, we can also implement svcUnmapTransferMemory fairly trivially as well.
| * | | | | core/hle/kernel/svc: Implement svcMapTransferMemoryLioncash2019-03-131-1/+57
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Now that transfer memory handling is separated from shared memory, we can implement svcMapTransferMemory pretty trivially.
| * | | | | core/hle/kernel: Split transfer memory handling out into its own classLioncash2019-03-136-4/+177
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Within the kernel, shared memory and transfer memory facilities exist as completely different kernel objects. They also have different validity checking as well. Therefore, we shouldn't be treating the two as the same kind of memory. They also differ in terms of their behavioral aspect as well. Shared memory is intended for sharing memory between processes, while transfer memory is intended to be for transferring memory to other processes. This breaks out the handling for transfer memory into its own class and treats it as its own kernel object. This is also important when we consider resource limits as well. Particularly because transfer memory is limited by the resource limit value set for it. While we currently don't handle resource limit testing against objects yet (but we do allow setting them), this will make implementing that behavior much easier in the future, as we don't need to distinguish between shared memory and transfer memory allocations in the same place.
* | | | | | Merge pull request #2221 from DarkLordZach/firmware-versionbunnei2019-03-237-3/+154
|\ \ \ \ \ \ | | | | | | | | | | | | | | set_sys: Implement GetFirmwareVersion(2) for libnx hosversion
| * | | | | | set_sys: Move constants to anonymous namespaceZach Hilman2019-03-111-1/+1
| | | | | | |
| * | | | | | set_sys: Use official nintendo version stringZach Hilman2019-03-114-19/+25
| | | | | | |
| * | | | | | system_version: Correct sizes on VectorVfsFile constructionZach Hilman2019-03-111-4/+4
| | | | | | |
| * | | | | | set_sys: Use correct error codes in GetFirmwareVersion*Zach Hilman2019-03-111-21/+41
| | | | | | |
| * | | | | | set_sys: Implement GetFirmwareVersion(2) for libnx hosversionZach Hilman2019-03-106-3/+128
| | | | | | | | | | | | | | | | | | | | | Uses the synthesized system archive 9 (SystemVersion) and reports v5.1.0-0.0
* | | | | | | Merge pull request #2280 from lioncash/nsobunnei2019-03-233-73/+92
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | loader/nso: Minor refactoring
| * | | | | | | loader/nso: Place translation unit specific functions into an anonymous namespaceLioncash2019-03-221-20/+21
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Makes it impossible to indirectly violate the ODR in some other translation unit due to these existing.
| * | | | | | | loader/nso: Clean up use of magic constantsLioncash2019-03-221-4/+6
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Now that the NSO header has the proper size, we can just use sizeof on it instead of having magic constants.
| * | | | | | | file_sys/patch_manager: Deduplicate NSO headerLioncash2019-03-223-64/+65
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This source file was utilizing its own version of the NSO header. Instead of keeping this around, we can have the patch manager also use the version of the header that we have defined in loader/nso.h
| * | | | | | | loader/nso: Fix definition of the NSO header structLioncash2019-03-221-3/+15
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The total struct itself is 0x100 (256) bytes in size, so we should be providing that amount of data. Without the data, this can result in omitted data from the final loaded NSO file.
| * | | | | | | file_sys/patch_manager: Remove two magic valuesLioncash2019-03-221-2/+5
| | |_|_|/ / / | |/| | | | | | | | | | | | | | | | | | | These correspond to the NSOBuildHeader.
* | | | | | | Merge pull request #2279 from lioncash/cheat-globalbunnei2019-03-226-48/+57
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | file_sys/cheat_engine: Remove use of global system accessors
| * | | | | | | file_sys/cheat_engine: Silence truncation and sign-conversion warningsLioncash2019-03-222-5/+6
| | | | | | | |
| * | | | | | | file_sys/cheat_engine: Remove use of global system accessorsLioncash2019-03-226-43/+51
| |/ / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | Instead, pass in the core timing instance and make the dependency explicit in the interface.
* | | | | | | Merge pull request #2256 from bunnei/gpu-vmmbunnei2019-03-222-13/+5
|\ \ \ \ \ \ \ | |/ / / / / / |/| | | | | | gpu: Rewrite MemoryManager based on the VMManager implementation.
| * | | | | | memory: Check that core is powered on before attempting to use GPU.bunnei2019-03-211-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | - GPU will be released on shutdown, before pages are unmapped. - On subsequent runs, current_page_table will be not nullptr, but GPU might not be valid yet.
| * | | | | | gpu: Rewrite virtual memory manager using PageTable.bunnei2019-03-211-10/+2
| | | | | | |
| * | | | | | gpu: Move GPUVAddr definition to common_types.bunnei2019-03-211-2/+2
| | | | | | |
* | | | | | | Merge pull request #2234 from lioncash/mutexbunnei2019-03-225-29/+62
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | core/hle/kernel: Make Mutex a per-process class.
| * | | | | | | core/hle/kernel/mutex: Remove usages of global system accessorsLioncash2019-03-151-11/+15
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Removes the use of global system accessors, and instead uses the explicit interface provided.
| * | | | | | | core/hle/kernel: Make Mutex a per-process class.Lioncash2019-03-155-18/+47
| | |_|_|_|/ / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Makes it an instantiable class like it is in the actual kernel. This will also allow removing reliance on global accessors in a following change, now that we can encapsulate a reference to the system instance in the class.
* | | | | | | Merge pull request #2274 from lioncash/includebunnei2019-03-221-3/+0
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | core/memory: Remove unnecessary includes
| * | | | | | | core/memory: Remove unnecessary includesLioncash2019-03-211-3/+0
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | In 93da8e0abfcdcc6e3cb5488a0db12373429f1377, the page table construct was moved to the common library (which utilized these inclusions). Since the move, nothing requires these headers to be included within the memory header.
* | | | | | | | Merge pull request #2275 from lioncash/memflagsbunnei2019-03-224-22/+20
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | kernel/vm_manager: Amend flag value for code data
| * | | | | | | | kernel/vm_manager: Rename CodeStatic/CodeMutable to Code and CodeData respectivelyLioncash2019-03-214-22/+20
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Makes it more evident that one is for actual code and one is for actual data. Mutable and static are less than ideal terms here, because read-only data is technically not mutable, but we were mapping it with that label.
| * | | | | | | | kernel/vm_manager: Amend flag values for CodeMutableLioncash2019-03-211-1/+1
| |/ / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This should actually be using the data flags, rather than the code flags.
* | | | | | | | Merge pull request #2276 from lioncash/ambunnei2019-03-221-1/+15
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | service/am: Add function table for IDebugFunctions
| * | | | | | | | service/am: Add function table for IDebugFunctionsLioncash2019-03-211-1/+15
| |/ / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | We already have the service related stuff set up for this, however, it's missing the function table.
* | | | | | | | Merge pull request #1933 from DarkLordZach/cheat-enginebunnei2019-03-2210-0/+813
|\ \ \ \ \ \ \ \ | |/ / / / / / / |/| | | | | | | file_sys: Implement parser and interpreter for game memory cheats
| * | | | | | | vm_manager: Remove cheat-specific ranges from VMManagerZach Hilman2019-03-0510-77/+56
| | | | | | | |
| * | | | | | | core: Add support for registering and controlling ownership of CheatEngineZach Hilman2019-03-052-0/+13
| | | | | | | |
| * | | | | | | cheat_engine: Add parser and interpreter for game cheatsZach Hilman2019-03-053-0/+715
| | | | | | | |
| * | | | | | | loader/nso: Set main code region in VMManagerZach Hilman2019-03-053-2/+21
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | For rom directories (and by extension, XCI/NSP/NAX/NCA) this is for the NSO with name 'main', for regular NSOs, this is the NSO.
| * | | | | | | vm_manager: Add support for storing and getting main code regionZach Hilman2019-03-052-0/+28
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Used as root for one region of cheats, set by loader
| * | | | | | | patch_manager: Display cheats in game list add-onsZach Hilman2019-03-051-0/+2
| | | | | | | |
| * | | | | | | patch_manager: Add support for loading cheats listsZach Hilman2019-03-052-0/+56
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Uses load/<title_id>/<mod_name>/cheats as root dir, file name is all upper or lower hex first 8 bytes build ID.
| * | | | | | | controllers/npad: Add accessor for current press stateZach Hilman2019-03-051-0/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Allows frontend/features to access pressed buttons conveniently as possible
* | | | | | | | Merge pull request #2090 from FearlessTobi/port-4599bunnei2019-03-216-96/+96
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | Port citra-emu/citra#4244 and citra-emu/citra#4599: Changes to BitField
| * | | | | | | | remove all occurance of specifying endianness inside BitFieldWeiyi Wang2019-02-066-96/+96
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This commit it automatically generated by command in zsh: sed -i -- 's/BitField<\(.*\)_le>/BitField<\1>/g' **/*(D.) BitField is now aware to endianness and default to little endian. It expects a value representation type without storage specification for its template parameter.
* | | | | | | | | Merge pull request #2262 from lioncash/enumbunnei2019-03-212-2/+15
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | file_sys/content_archive: Amend name of Data_Unknown5 enum entry
| * | | | | | | | | file_sys/content_archive: Amend name of Data_Unknown5 enum entryLioncash2019-03-192-2/+15
| | |_|_|_|_|_|/ / | |/| | | | | | | | | | | | | | | | | | | | | | | | | While we're at it, give each entry some documentation.
* | | | | | | | | Merge pull request #2268 from lioncash/codesetbunnei2019-03-218-45/+111
|\ \ \ \ \ \ \ \ \ | |_|_|_|_|/ / / / |/| | | | | | | | core/kernel: Migrate CodeSet to its own source files
| * | | | | | | | kernel/process: Make MapSegment lambda reference parameter constLioncash2019-03-201-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The segment itself isn't actually modified.
| * | | | | | | | kernel: Move CodeSet structure to its own source filesLioncash2019-03-208-44/+110
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Given this is utilized by the loaders, this allows avoiding inclusion of the kernel process definitions where avoidable. This also keeps the loading format for all executable data separate from the kernel objects.
* | | | | | | | | Merge pull request #2267 from FernandoS27/fix-2238bunnei2019-03-211-1/+2
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | Fix crash caused by #2238.
| * | | | | | | | | Fix crash caused by 2238.Fernando Sahmkow2019-03-201-1/+2
| | |/ / / / / / / | |/| | | | | | |
* | | | | | | | | Merge pull request #2224 from lioncash/opusbunnei2019-03-211-34/+48
|\ \ \ \ \ \ \ \ \ | |_|/ / / / / / / |/| | | | | | | | hwopus: Leverage multistream API for decoding regular Opus packets
| * | | | | | | | hwopus: Leverage multistream API for decoding regular Opus packetsLioncash2019-03-111-34/+48
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | After doing a little more reading up on the Opus codec, it turns out that the multistream API that is part of libopus can handle regular packets. Regular packets are just a degenerate case of multistream Opus packets, and all that's necessary is to pass the number of streams as 1 and provide a basic channel mapping, then everything works fine for that case. This allows us to get rid of the need to use both APIs in the future when implementing multistream variants in a follow-up PR, greatly simplifying the code that needs to be written.
* | | | | | | | | loader: Remove Linker classLioncash2019-03-203-185/+0
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Given the class is now currently unused, it can be removed.
* | | | | | | | | loader: Remove Linker inheritance from NRO and NSO loadersLioncash2019-03-202-4/+4
| |/ / / / / / / |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Neither the NRO or NSO loaders actually make use of the functions or members provided by the Linker interface, so we can just remove the inheritance altogether.
* | | | | | | | Merge pull request #2258 from lioncash/ambunnei2019-03-192-13/+73
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | service/am: Supply remaining missing IAudioController functions
| * | | | | | | | service/am: Add basic implementation of ChangeMainAppletMasterVolumeLioncash2019-03-182-1/+29
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | All this does is supply a new volume level and a fade time in nanoseconds for the volume transition to occur within.
| * | | | | | | | service/am: Unstub SetTransparentVolumeRate()Lioncash2019-03-182-1/+17
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Like the other volume setter, this mainly just sets a data member within the service, nothing too special.
| * | | | | | | | service/am: Unstub SetExpectedMasterVolume()Lioncash2019-03-182-11/+27
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This function passes in the desired main applet and library applet volume levels. We can then just pass those values back within the relevant volume getter functions, allowing us to unstub those as well. The initial values for the library and main applet volumes differ. The main applet volume is 0.25 by default, while the library applet volume is initialized to 1.0 by default in the services themselves.
* | | | | | | | | fsp_srv: Unstub SetCurrentProcessLioncash2019-03-182-1/+5
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This just acts as a basic setter for a given PID value and performs no further checking, so we can just store the passed in value.
* | | | | | | | | Merge pull request #2238 from lioncash/threadbunnei2019-03-182-21/+41
|\ \ \ \ \ \ \ \ \ | |/ / / / / / / / |/| | | | | | | | kernel/thread: Amend conditional test and assignment within UpdatePriority()
| * | | | | | | | kernel/thread: Expand documentation of nominal_priority and current_priorityLioncash2019-03-162-3/+11
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Aims to disambiguate why each priority instance exists a little bit. While we're at it, also add an explanatory comment to UpdatePriority().
| * | | | | | | | kernel/thread: Make bracing consistent within UpdatePriority()Lioncash2019-03-161-2/+4
| | | | | | | | |
| * | | | | | | | kernel/thread: Amend condition within UpdatePriority()Lioncash2019-03-161-3/+3
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This condition was checking against the nominal thread priority, whereas the kernel itself checks against the current priority instead. We were also assigning the nominal priority, when we should be assigning current_priority, which takes priority inheritance into account. This can lead to the incorrect priority being assigned to a thread. Given we recursively update the relevant threads, we don't need to go through the whole mutex waiter list. This matches what the kernel does as well (only accessing the first entry within the waiting list).
| * | | | | | | | kernel/thread: Maintain priority ordering of added mutex waiting threadsLioncash2019-03-161-14/+24
| | |_|_|_|_|/ / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The kernel keeps the internal waiting list ordered by priority. This is trivial to do with std::find_if followed by an insertion.
* | | | | | | | Merge pull request #2252 from bunnei/move-page-tablebunnei2019-03-1711-219/+91
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | core: Move PageTable struct into Common.
| * | | | | | | | core: Move PageTable struct into Common.bunnei2019-03-1711-219/+91
| | | | | | | | |
* | | | | | | | | Merge pull request #2249 from lioncash/ipcbunnei2019-03-171-0/+30
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | ipc_helpers: Allow pushing and popping floating-point values
| * | | | | | | | | ipc_helpers: Allow pushing and popping floating-point valuesLioncash2019-03-161-0/+30
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Certain values that are passed through the IPC buffer are actually floating point values, not solely integral values.
* | | | | | | | | | Merge pull request #2245 from lioncash/unused-defbunnei2019-03-171-6/+0
|\ \ \ \ \ \ \ \ \ \ | |_|/ / / / / / / / |/| | | | | | | | | kernel/thread: Actually remove the definition of ExitCurrentThread()
| * | | | | | | | | kernel/thread: Actually remove the definition of ExitCurrentThread()Lioncash2019-03-161-6/+0
| |/ / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This was intended to be removed in 51d7f6bffcc0498a47abc7de27bf0906fc523dae, but I guess I forgot to actually save the file like a dingus.
* | | | | | | | | Merge pull request #2243 from bunnei/mem-simplify-cachebunnei2019-03-172-66/+21
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | memory: Simplify rasterizer cache operations.
| * | | | | | | | | memory: Simplify rasterizer cache operations.bunnei2019-03-162-66/+21
| | | | | | | | | |
* | | | | | | | | | Merge pull request #2129 from FernandoS27/cntpctbunnei2019-03-173-2/+12
|\ \ \ \ \ \ \ \ \ \ | |_|/ / / / / / / / |/| | | | | | | | | Correct CNTPCT from using CPU Cycles to using Clock Cycles
| * | | | | | | | | Corrections, documenting and fixes.Fernando Sahmkow2019-02-162-4/+3
| | | | | | | | | |
| * | | | | | | | | Use u128 on Clock Cycles calculation.Fernando Sahmkow2019-02-163-6/+6
| | | | | | | | | |
| * | | | | | | | | Correct CNTPCT to use Clock Cycles instead of Cpu Cycles.Fernando Sahmkow2019-02-163-2/+13
| | | | | | | | | |
* | | | | | | | | | Merge pull request #2242 from lioncash/thread-fnbunnei2019-03-164-33/+31
|\ \ \ \ \ \ \ \ \ \ | |_|/ / / / / / / / |/| | | | | | | | | kernel/thread: Remove WaitCurrentThread_Sleep() and ExitCurrentThread()
| * | | | | | | | | kernel/thread: Move thread exiting logic from ExitCurrentThread to svcExitThreadLioncash2019-03-162-8/+7
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Puts the operation on global state in the same places as the rest of the svc calls.
| * | | | | | | | | kernel/thread: Migrate WaitCurrentThread_Sleep into the Thread interfaceLioncash2019-03-164-25/+24
| | |/ / / / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Rather than make a global accessor for this sort of thing. We can make it a part of the thread interface itself. This allows getting rid of a hidden global accessor in the kernel code.
* | | | | | | | | gpu: Use host address for caching instead of guest address.bunnei2019-03-152-6/+10
| |_|_|_|_|/ / / |/| | | | | | |
* | | | | | | | Merge pull request #2230 from lioncash/globalbunnei2019-03-152-8/+9
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | kernel/process: Remove use of global system accessors
| * | | | | | | | kernel/process: Remove use of global system accessorsLioncash2019-03-132-8/+9
| |/ / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Now that we pass in a reference to the system instance, we can utilize it to eliminate the global accessors in Process-related code.
* | | | | | | | Merge pull request #2226 from lioncash/privatebunnei2019-03-134-14/+36
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | kernel/server_port: Make data members private
| * | | | | | | | kernel/server_port: Make data members privateLioncash2019-03-114-14/+36
| | |_|/ / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | With this, all kernel objects finally have all of their data members behind an interface, making it nicer to reason about interactions with other code (as external code no longer has the freedom to totally alter internals and potentially messing up invariants).
* | | | | | | | Merge pull request #2223 from lioncash/errorbunnei2019-03-133-19/+5
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | core/hle/result: Tidy up the base error code result header.
| * | | | | | | | core/hle/result: Remove now-unnecessary manually defined copy assignment operatorLioncash2019-03-101-5/+0
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Previously this was required, as BitField wasn't trivially copyable. BitField has since been made trivially copyable, so now this isn't required anymore.
| * | | | | | | | core/hle/result: Amend error in comment description for ResultCodeLioncash2019-03-101-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Gets rid of another holdover from Citra, and describes the OS on the Switch instead.
| * | | | | | | | core/hle/result: Remove now-unused constructor for ResultCodeLioncash2019-03-101-10/+0
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Now that the final stray ErrorDescription member was relocated, we can finally remove it and its relevant constructor in the ResultCode union.
| * | | | | | | | core/hle/result: Relocate IPC error code to ipc_helpersLioncash2019-03-103-3/+4
| |/ / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Relocates the error code to where it's most related, similar to how all the other error codes are. Previously we were including a non-generic error in the main result code header.
* | | | | | | | Merge pull request #2166 from lioncash/vi-init-servicebunnei2019-03-139-40/+146
|\ \ \ \ \ \ \ \ | |_|/ / / / / / |/| | | | | | | service/vi: Unstub GetDisplayService
| * | | | | | | service/vi: Unstub GetDisplayServiceLioncash2019-02-275-11/+49
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This function is also supposed to check its given policy type with the permission of the service itself. This implements the necessary machinery to unstub these functions. Policy::User seems to just be basic access (which is probably why vi:u is restricted to that policy), while the other policy seems to be for extended abilities regarding which displays can be managed and queried, so this is assumed to be for a background compositor (which I've named, appropriately, Policy::Compositor).
| * | | | | | | core/ipc_helper: Allow popping all signed value types with RequestParserLioncash2019-02-271-0/+15
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | There's no real reason this shouldn't be allowed, given some values sent via a request can be signed. This also makes it less annoying to work with popping enum values, given an enum class with no type specifier will work out of the box now. It's also kind of an oversight to allow popping s64 values, but nothing else.
| * | | | | | | service/vi: Remove use of a module classLioncash2019-02-268-46/+99
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This didn't really provide much benefit here, especially since the subsequent change requires that the behavior for each service's GetDisplayService differs in a minor detail. This also arguably makes the services nicer to read, since it gets rid of an indirection in the class hierarchy.
* | | | | | | | Merge pull request #2211 from lioncash/arbiterbunnei2019-03-128-64/+80
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | kernel: Make the address arbiter instance per-process
| * | | | | | | | kernel: Make the address arbiter instance per-processLioncash2019-03-087-27/+34
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Now that we have the address arbiter extracted to its own class, we can fix an innaccuracy with the kernel. Said inaccuracy being that there isn't only one address arbiter. Each process instance contains its own AddressArbiter instance in the actual kernel. This fixes that and gets rid of another long-standing issue that could arise when attempting to create more than one process.
| * | | | | | | | kernel/svc: Move address arbiter signaling behind a unified API functionLioncash2019-03-083-22/+26
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Similar to how WaitForAddress was isolated to its own function, we can also move the necessary conditional checking into the address arbiter class itself, allowing us to hide the implementation details of it from public use.
| * | | | | | | | kernel/svc: Move address arbiter waiting behind a unified API functionLioncash2019-03-083-19/+24
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Rather than let the service call itself work out which function is the proper one to call, we can make that a behavior of the arbiter itself, so we don't need to directly expose those implementation details.
* | | | | | | | | service/service: Remove unncessary calls to c_str()Lioncash2019-03-101-4/+3
| |_|/ / / / / / |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | These can just be passed regularly, now that we use fmt instead of our old logging system. While we're at it, make the parameters to MakeFunctionString std::string_views.
* | | | | | | | Merge pull request #2207 from lioncash/hwopusbunnei2019-03-101-69/+107
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | service/audio/hwopus: Move decoder state to its own class
| * | | | | | | | service/audio/hwopus: Move decoder state to its own classLioncash2019-03-071-50/+85
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Moves the non-multistream specific state to its own class. This will be necessary to support the multistream variants of opus decoding.
| * | | | | | | | service/audio/hwopus: Provide a name for the second word of OpusPacketHeaderLioncash2019-03-071-2/+4
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This indicates the entropy coder's final range.
| * | | | | | | | service/audio/hwopus: Move Opus packet header out of the IHardwareOpusDecoderManagerLioncash2019-03-071-17/+17
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This will be utilized by more than just that class in the future. This also renames it from OpusHeader to OpusPacketHeader to be more specific about what kind of header it is.
| * | | | | | | | service/audio/hwopus: Enclose internals in an anonymous namespaceLioncash2019-03-071-2/+3
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Makes it impossible to violate the ODR, as well as providing a place for future changes.
* | | | | | | | | Merge pull request #2193 from lioncash/globalbunnei2019-03-105-17/+23
|\ \ \ \ \ \ \ \ \ | |_|_|_|_|_|_|/ / |/| | | | | | | | kernel/scheduler: Pass in system instance in constructor
| * | | | | | | | kernel/scheduler: Pass in system instance in constructorLioncash2019-03-045-17/+23
| | |_|_|_|_|/ / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Avoids directly relying on the global system instance and instead makes an arbitrary system instance an explicit dependency on construction. This also allows removing dependencies on some global accessor functions as well.
* | | | | | | | clang fixHexagon122019-03-091-1/+2
| | | | | | | |
* | | | | | | | Log 2 new setting valuesHexagon122019-03-091-0/+2
| | | | | | | |
* | | | | | | | Merge pull request #2210 from lioncash/optionalbunnei2019-03-084-47/+47
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | kernel/hle_ipc: Convert std::shared_ptr IPC header instances to std::optional
| * | | | | | | | kernel/hle_ipc: Convert std::shared_ptr IPC header instances to std::optionalLioncash2019-03-084-47/+47
| | |_|/ / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | There's no real need to use a shared lifetime here, since we don't actually expose them to anything else. This is also kind of an unnecessary use of the heap given the objects themselves are so small; small enough, in fact that changing over to optionals actually reduces the overall size of the HLERequestContext struct (818 bytes to 808 bytes).
* | | | | | | | Merge pull request #2195 from lioncash/shared-globalbunnei2019-03-071-3/+2
|\ \ \ \ \ \ \ \ | |/ / / / / / / |/| | | | | | | kernel/shared_memory: Get rid of the use of global accessor functions within Create()
| * | | | | | | kernel/shared_memory: Get rid of the use of global accessor functions within Create()Lioncash2019-03-041-3/+2
| |/ / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Given we already pass in a reference to the kernel that the shared memory instance is created under, we can just use that to check the current process, rather than using the global accessor functions. This allows removing direct dependency on the system instance entirely.
* | | | | | | Merge pull request #2202 from lioncash/port-privbunnei2019-03-076-36/+78
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | kernel/client_session, kernel/server_session: Make data members private
| * | | | | | | kernel/server_session: Make data members privateLioncash2019-03-065-32/+73
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Makes it much nicer to locally reason about server session behavior, as part of its functionality isn't placed around other classes.
| * | | | | | | kernel/client_session: Make data members privateLioncash2019-03-061-4/+5
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | These can be made private, as they aren't accessed in contexts that require them to be public.
* | | | | | | | Merge pull request #2206 from lioncash/audio-stopbunnei2019-03-071-1/+3
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | service/audio/audout_u: Only actually stop the audio stream in StopAudioOut if the stream is playing
| * | | | | | | | service/audio/audout_u: Only actually stop the audio stream in StopAudioOut if the stream is playingLioncash2019-03-071-1/+3
| | |_|/ / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The service itself only does further actions if the stream is playing. If the stream is already stopped, then it just exits successfully.
* | | | | | | | Merge pull request #2055 from bunnei/gpu-threadbunnei2019-03-078-22/+22
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | Asynchronous GPU command processing
| * | | | | | | | gpu: Refactor a/synchronous implementations into their own classes.bunnei2019-03-071-2/+7
| | | | | | | | |
| * | | | | | | | gpu: Move command processing to another thread.bunnei2019-03-072-5/+5
| | | | | | | | |
| * | | | | | | | gpu: Refactor command and swap buffers interface for asynch.bunnei2019-03-073-14/+4
| | | | | | | | |
| * | | | | | | | gpu: Refactor to take RendererBase instead of RasterizerInterface.bunnei2019-03-071-1/+1
| | | | | | | | |
| * | | | | | | | settings: Add new graphics setting for use_asynchronous_gpu_emulation.bunnei2019-03-072-0/+3
| | | | | | | | |
| * | | | | | | | core: Set is_powered_on before GPU is initialized.bunnei2019-03-071-1/+3
| |/ / / / / / /
* | | | | | | | Merge pull request #2197 from lioncash/includebunnei2019-03-076-8/+12
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | core/hle/ipc: Remove unnecessary includes
| * | | | | | | | core/hle/ipc: Remove unnecessary includesLioncash2019-03-056-8/+12
| | |/ / / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Removes a few inclusion dependencies from the headers or replaces existing ones with ones that don't indirectly include the required headers. This allows removing an inclusion of core/memory.h, meaning that if the memory header is ever changed in the future, it won't result in rebuilding the entirety of the HLE services (as the IPC headers are used quite ubiquitously throughout the HLE service implementations).
* | | | | | | | Merge pull request #2190 from lioncash/ogl-globalbunnei2019-03-072-11/+7
|\ \ \ \ \ \ \ \ | |_|/ / / / / / |/| | | | | | | core: Remove the global telemetry accessor function
| * | | | | | | core/core: Remove the global telemetry accessor functionLioncash2019-03-041-4/+0
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | With all usages converted off of it, this function can be removed.
| * | | | | | | core/core: Replace direct usage of the global system telemetry accessor from Shutdown()Lioncash2019-03-041-7/+7
| | |/ / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | The telemetry instance is actually a member of the class itself, so we can access it directly instead of going through the global accessor.
* | | | | | | Merge pull request #2199 from lioncash/arbiterbunnei2019-03-066-112/+184
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | kernel/address_arbiter: Convert the address arbiter into a class
| * | | | | | | kernel/address_arbiter: Pass in system instance to constructorLioncash2019-03-055-23/+42
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Allows getting rid of reliance on the global accessor functions and instead operating on the provided system instance.
| * | | | | | | kernel/address_arbiter: Minor tidying upLioncash2019-03-051-18/+18
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | - Invert conditions into guard clases where applicable. - Mark std::vector parameter of WakeThreads as const
| * | | | | | | kernel/address_arbiter: Convert the address arbiter into a classLioncash2019-03-055-82/+135
| | |/ / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Places all of the functions for address arbiter operation into a class. This will be necessary for future deglobalizing efforts related to both the memory and system itself.
* | | | | | | hle/service/audio/audout_u: Correct lack of return in failure case of AppendAudioOutBufferImpl()Lioncash2019-03-061-0/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Previously we were overwriting the error case with a success code further down (which is definitely not what we should be doing here).
* | | | | | | Merge pull request #2194 from lioncash/membunnei2019-03-063-30/+66
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | svc: Move memory range checking functions to the VMManager class
| * | | | | | | vm_manager: Use range helpers in HeapAlloc() and HeapFree()Lioncash2019-03-041-4/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Significantly tidies up two guard conditionals.
| * | | | | | | vm_manager: Provide address range checking functions for other memory regionsLioncash2019-03-042-4/+35
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Makes the interface uniform when it comes to checking various memory regions.
| * | | | | | | svc: Migrate address range checking functions to VMManagerLioncash2019-03-043-23/+30
| | |/ / / / / | |/| | | | | | | | | | | | | | | | | | | Provides a bit of a more proper interface for these functions.
* | | | | | | Merge pull request #2200 from lioncash/audiobunnei2019-03-064-10/+21
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | hle/service/audio: Extract audio error codes to a header
| * | | | | | | hle/service/audio: Extract audio error codes to a headerLioncash2019-03-054-10/+21
| | |/ / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Places all error codes in an easily includable header. This also corrects the unsupported error code (I accidentally used the hex value when I meant to use the decimal one).
* / | | | | | kernel/thread: Remove obsolete TODO in Create()Lioncash2019-03-051-2/+0
|/ / / / / / | | | | | | | | | | | | | | | | | | This is a TODO carried over from Citra that doesn't apply here.
* / / / / / Memory: don't lock hle mutex in memory read/writeWeiyi Wang2019-03-021-6/+0
|/ / / / / | | | | | | | | | | | | | | | The comment already invalidates itself: neither MMIO nor rasterizer cache belongsHLE kernel state. This mutex has a too large scope if MMIO or cache is included, which is prone to dead lock when multiple thread acquires these resource at the same time. If necessary, each MMIO component or rasterizer should have their own lock.
* | | | | Merge pull request #2180 from lioncash/audrenbunnei2019-03-011-1/+12
|\ \ \ \ \ | | | | | | | | | | | | service/audio: Provide an implementation of ExecuteAudioRendererRendering
| * | | | | service/audio: Provide an implementation of ExecuteAudioRendererRenderingLioncash2019-03-011-1/+12
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This service function appears to do nothing noteworthy on the switch. All it does at the moment is either return an error code or abort the system. Given we obviously don't want to kill the system, we just opt for always returning the error code.
* | | | | | service/audio/audren_u: Implement OpenAudioRendererAutoLioncash2019-03-012-7/+20
|/ / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This currently has the same behavior as the regular OpenAudioRenderer API function, so we can just move the code within OpenAudioRenderer to an internal function that both service functions call.
* | | | | Merge pull request #2174 from lioncash/fwdbunnei2019-02-281-1/+1
|\ \ \ \ \ | | | | | | | | | | | | service/hid: Amend forward declaration of ServiceManager
| * | | | | service/hid: Amend forward declaration of ServiceManagerLioncash2019-02-271-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The SM namespace is within the Service namespace, so this was forward declaring a type that didn't exist.
* | | | | | Speed up memory page mapping (#2141)Annomatg2019-02-271-6/+11
|/ / / / / | | | | | | | | | | | | | | | - Memory::MapPages total samplecount was reduced from 4.6% to 1.06%. - From main menu into the game from 1.03% to 0.35%
* | | | | Merge pull request #2169 from lioncash/namingbunnei2019-02-271-13/+13
|\ \ \ \ \ | | | | | | | | | | | | audio_core/audio_renderer: Provide names for some parameters of AudioRendererParameter
| * | | | | audio_core/audio_renderer: Name previously unknown parameters of AudioRendererParameterLioncash2019-02-271-13/+13
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Provides names for previously unknown entries (aside from the two u8 that appear to be padding bytes, and a single word that also appears to be reserved or padding). This will be useful in subsequent changes when unstubbing behavior related to the audio renderer services.
* | | | | | Merge pull request #2170 from lioncash/emu-windowbunnei2019-02-272-2/+2
|\ \ \ \ \ \ | | | | | | | | | | | | | | core/frontend/emu_window: Make ClipToTouchScreen a const member function
| * | | | | | core/frontend/emu_window: Make ClipToTouchScreen a const member functionLioncash2019-02-272-2/+2
| |/ / / / / | | | | | | | | | | | | | | | | | | | | | | | | This member function doesn't modify instance state, so it can have the const specifier applied to it.
* | | | | | Merge pull request #2161 from lioncash/handle-tablebunnei2019-02-276-19/+63
|\ \ \ \ \ \ | | | | | | | | | | | | | | kernel/handle_table: Allow process capabilities to limit the handle table size
| * | | | | | kernel/handle_table: Make local variables as const where applicableLioncash2019-02-251-4/+5
| | | | | | | | | | | | | | | | | | | | | | | | | | | | Makes immutable state explicit.
| * | | | | | kernel/handle_table: Allow process capabilities to limit the handle table sizeLioncash2019-02-256-10/+54
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The kernel allows restricting the total size of the handle table through the process capability descriptors. Until now, this functionality wasn't hooked up. With this, the process handle tables become properly restricted. In the case of metadata-less executables, the handle table will assume the maximum size is requested, preserving the behavior that existed before these changes.
| * | | | | | kernel/handle-table: In-class initialize data membersLioncash2019-02-252-3/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | Directly initializes members where applicable.
| * | | | | | kernel/handle_table: Resolve truncation warningsLioncash2019-02-251-2/+2
| | |/ / / / | |/| | | | | | | | | | | | | | | | | | | | | | Avoids implicit truncation warnings from u32 -> u16 (the truncation is desirable behavior here).
* | | | | | common/math_util: Move contents into the Common namespaceLioncash2019-02-277-13/+13
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | These types are within the common library, so they should be within the Common namespace.
* | | | | | common/vector_math: Move Vec[x] types into the Common namespaceLioncash2019-02-271-1/+1
| |/ / / / |/| | | | | | | | | | | | | | | | | | | These types are within the common library, so they should be using the Common namespace.
* | | | | Merge pull request #2156 from FreddyFunk/patch-1bunnei2019-02-261-1/+1
|\ \ \ \ \ | | | | | | | | | | | | file_sys/vfs_vector: Fix ignored offset on Write
| * | | | | file_sys/vfs_vector: Fix ignored offset on WriteFrederic L2019-02-251-1/+1
| | | | | |
* | | | | | service/vi: Update IManagerDisplayService's function tableLioncash2019-02-251-0/+1
| |/ / / / |/| | | | | | | | | | | | | | Amends it to add the 7.0.0+ CreateStrayLayer function.
* | | | | service/nvflinger: Store BufferQueue instances as regular data membersLioncash2019-02-227-36/+39
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The NVFlinger service is already passed into services that need to guarantee its lifetime, so the BufferQueue instances will already live as long as they're needed. Making them std::shared_ptr instances in this case is unnecessary.
* | | | | service/vi/vi_layer: Convert Layer struct into a classLioncash2019-02-216-10/+43
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Like the previous changes made to the Display struct, this prepares the Layer struct for changes to its interface. Given Layer will be given more invariants in the future, we convert it into a class to better signify that.
* | | | | service/nvflinger: Move display specifics over to vi_displayLioncash2019-02-214-35/+141
|/ / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | With the display and layer structures relocated to the vi service, we can begin giving these a proper interface before beginning to properly support the display types. This converts the display struct into a class and provides it with the necessary functions to preserve behavior within the NVFlinger class.
* | | | Merge pull request #2130 from lioncash/system_enginebunnei2019-02-211-1/+1
|\ \ \ \ | | | | | | | | | | video_core: Remove usages of System::GetInstance() within the engines
| * | | | video_core: Remove usages of System::GetInstance() within the enginesLioncash2019-02-161-1/+1
| |/ / / | | | | | | | | | | | | | | | | Avoids the use of the global accessor in favor of explicitly making the system a dependency within the interface.
* | | | Fixes Unicode Key File Directories (#2120)Jungy2019-02-211-1/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * Fixes Unicode Key File Directories Adds code so that when loading a file it converts to UTF16 first, to ensure the files can be opened. Code borrowed from FileUtil::Exists. * Update src/core/crypto/key_manager.cpp Co-Authored-By: Jungorend <Jungorend@users.noreply.github.com> * Update src/core/crypto/key_manager.cpp Co-Authored-By: Jungorend <Jungorend@users.noreply.github.com> * Using FileUtil instead to be cleaner. * Update src/core/crypto/key_manager.cpp Co-Authored-By: Jungorend <Jungorend@users.noreply.github.com>
* | | | service/nvflinger: Relocate definitions of Layer and Display to the vi serviceLioncash2019-02-207-57/+123
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | These are more closely related to the vi service as opposed to the intermediary nvflinger. This also places them in their relevant subfolder, as future changes to these will likely result in subclassing to represent various displays and services, as they're done within the service itself on hardware. The reasoning for prefixing the display and layer source files is to avoid potential clashing if two files with the same name are compiled (e.g. if 'display.cpp/.h' or 'layer.cpp/.h' is added to another service at any point), which MSVC will actually warn against. This prevents that case from occurring. This also presently coverts the std::array introduced within f45c25aabacc70861723a7ca1096a677bd987487 back to a std::vector to allow the forward declaration of the Display type. Forward declaring a type within a std::vector is allowed since the introduction of N4510 (http://www.open-std.org/jtc1/sc22/wg21/docs/papers/2015/n4510.html) by Zhihao Yuan.
* | | | address_arbiter: Use nested namespaces where applicableLioncash2019-02-162-8/+4
|/ / / | | | | | | | | | | | | | | | A fairly trivial change. Other sections of the codebase use nested namespaces instead of separate namespaces here. This one must have just been overlooked.
* | | core_timing: Convert core timing into a classLioncash2019-02-1643-289/+404
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Gets rid of the largest set of mutable global state within the core. This also paves a way for eliminating usages of GetInstance() on the System class as a follow-up. Note that no behavioral changes have been made, and this simply extracts the functionality into a class. This also has the benefit of making dependencies on the core timing functionality explicit within the relevant interfaces.
* | | Merge pull request #2115 from lioncash/localbunnei2019-02-141-3/+3
|\ \ \ | | | | | | | | core_timing: Make EmptyTimedCallback a local variable
| * | | core_timing: Make EmptyTimedCallback a local variableLioncash2019-02-131-3/+3
| | | | | | | | | | | | | | | | | | | | Given this is only used in one place, it can be moved closest to its usage site.
* | | | threadsafe_queue: Remove NeedSize template parameterLioncash2019-02-131-2/+2
|/ / / | | | | | | | | | | | | | | | The necessity of this parameter is dubious at best, and in 2019 probably offers completely negligible savings as opposed to just leaving this enabled. This removes it and simplifies the overall interface.
* | | core_timing: Rename CoreTiming namespace to Core::TimingLioncash2019-02-1229-73/+69
| | | | | | | | | | | | | | | | | | Places all of the timing-related functionality under the existing Core namespace to keep things consistent, rather than having the timing utilities sitting in its own completely separate namespace.
* | | nvdisp_disp0: change drawing message log level from Warning to TraceTobias2019-02-081-3/+3
| | | | | | | | | | | | | | | This is a leftover from the early yuzu days. We shouldn't log every time when we are drawing by default, so let's change the log level to Trace.
* | | Merge pull request #2091 from FearlessTobi/port-4603bunnei2019-02-071-4/+10
|\ \ \ | | | | | | | | Port citra-emu/citra#4603: "gdbstub: only let Execute breakpoints write/restore BKPT opcodes into target memory"
| * | | gdbstub: only let Execute breakpoints write/restore BKPT opcodes into target memoryDimitri ALBORA2019-02-061-4/+10
| | | |
* | | | gl_shader_cache: Link loading screen with disk shader cache loadReinUsesLisp2019-02-071-2/+0
| | | |
* | | | gl_shader_disk_cache: Pass core system as argument and guard against games without title idsReinUsesLisp2019-02-071-1/+1
| | | |
* | | | settings: Hide shader cache behind a settingReinUsesLisp2019-02-072-0/+3
| | | |
* | | | rasterizer_interface: Add disk cache entry for the rasterizerReinUsesLisp2019-02-071-0/+3
|/ / /
* | | service/nvflinger,service/vi: Handle failure cases with exposed APILioncash2019-02-064-47/+133
| | | | | | | | | | | | | | | | | | | | | Converts many of the Find* functions to return a std::optional<T> as opposed to returning the raw return values directly. This allows removing a few assertions and handles error cases like the service itself does.
* | | service/nvflinger: Mark FindVsyncEvent() as a const member functionLioncash2019-02-052-2/+2
| | | | | | | | | | | | | | | This member function doesn't actually modify instance state, so it can be marked as a const member function.
* | | service/nvflinger: Rename GetVsyncEvent() to FindVsyncEvent()Lioncash2019-02-053-3/+3
|/ / | | | | | | | | This was missed within #2075. Renames the member function to make it consistent with the rest of the Find* functions.
* | Merge pull request #2073 from lioncash/opusbunnei2019-02-011-42/+75
|\ \ | | | | | | hwopus: Implement DecodeInterleaved (the newest variant)
| * | hwopus: Implement DecodeInterleavedLioncash2019-01-301-4/+35
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This functions almost identically to DecodeInterleavedWithPerfOld, however this function also has the ability to reset the decoder context. This is documented as a potentially desirable thing in the libopus manual in some circumstances as it says for the OPUS_RESET_STATE ctl: "This should be called when switching streams in order to prevent the back to back decoding from giving different result from one at a time decoding."
| * | hwopus: Deduplicate the decoding code within DecodeInterleavedOld and DecodeInterleavedWithPerfOldLioncash2019-01-301-19/+14
| | | | | | | | | | | | Keeps the logic in one spot for use by both functions.
| * | hwopus: Replace std::optional<std::reference_wrapper<u64>> with u64*Lioncash2019-01-301-9/+6
| | | | | | | | | | | | | | | This doesn't really offer anything over the use of a direct pointer, so we can just use that instead.
| * | hwopus: Mark local variables as const where applicableLioncash2019-01-301-8/+16
| | | | | | | | | | | | Makes non-mutable state more explicit.
| * | hwopus: Fill in the rest of the unknown service function namesLioncash2019-01-301-9/+11
| | | | | | | | | | | | Filled in via information provided by SwitchBrew.
* | | kernel: Remove the Timer classLioncash2019-02-017-229/+0
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | A holdover from citra, the Horizon kernel on the switch has no prominent kernel object that functions as a timer. At least not to the degree of sophistication that this class provided. As such, this can be removed entirely. This class also wasn't used at all in any meaningful way within the core, so this was just code sitting around doing nothing. This also allows removing a few things from the main KernelCore class that allows it to use slightly less resources overall (though very minor and not anything really noticeable).
* | | Merge pull request #2072 from lioncash/servicebunnei2019-01-3112-153/+281
|\ \ \ | | | | | | | | service: Update function tables
| * | | service/ns: Update function tablesLioncash2019-01-301-14/+20
| | | | | | | | | | | | | | | | Updates function tables based off information provided by SwitchBrew
| * | | service/ncm: Update function tablesLioncash2019-01-301-4/+4
| | | | | | | | | | | | | | | | Updates function tables based off information provided by SwitchBrew
| * | | service/audio: Update function tablesLioncash2019-01-304-8/+23
| | | | | | | | | | | | | | | | Updates function tables based off information provided by SwitchBrew.
| * | | service/am/applet_ae: Update function tablesLioncash2019-01-301-1/+2
| | | | | | | | | | | | | | | | Updates function tables based off information provided by SwitchBrew.
| * | | service/fsp-srv: Update function tablesLioncash2019-01-302-17/+25
| | | | | | | | | | | | | | | | Updates function tables based off information provided by SwitchBrew.
| * | | service/btm: Update function tablesLioncash2019-01-301-55/+97
| | | | | | | | | | | | | | | | Updates function tables based off information provided by SwitchBrew
| * | | service/btdrv: Update function tablesLioncash2019-01-301-46/+101
| | | | | | | | | | | | | | | | Updates function tables based off information provided by SwitchBrew.
| * | | service/psc: Update function tablesLioncash2019-01-301-8/+9
| | | | | | | | | | | | | | | | | | | | Updates the function tables based off information on SwitchBrew. Gets rid of a swath of unknown names.
* | | | Merge pull request #2077 from lioncash/virtbunnei2019-01-315-15/+3
|\ \ \ \ | | | | | | | | | | kernel/wait_object: Devirtualize functions related to manipulating the thread list directly
| * | | | kernel/wait_object: Devirtualize functions related to manipulating the thread list directlyLioncash2019-01-301-3/+3
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | No inheritors of the WaitObject class actually make use of their own implementations of these functions, so they can be made non-virtual. It's also kind of sketchy to allow overriding how the threads get added to the list anyways, given the kernel itself on the actual hardware doesn't seem to customize based off this.
| * | | | kernel/timer: Remove unnecessary WakeupAllWaitingThreads() overrideLioncash2019-01-302-6/+0
| | | | | | | | | | | | | | | | | | | | | | | | | This implementation just calls the base class variant of the function, so this isn't necessary.
| * | | | kernel/readable_event: Remove unnecessary WakeupAllWaitingThreads() overrideLioncash2019-01-302-6/+0
| | |/ / | |/| | | | | | | | | | This just calls the base variant of the function, so it can be removed.
* | | | service/nvflinger: Make FindBufferQueueId() a const member functionLioncash2019-01-302-2/+26
| | | | | | | | | | | | | | | | | | | | This member function doesn't actually modify instance state, so it can be const-qualified.
* | | | service/nvflinger: Rename Get prefix on function to FindLioncash2019-01-303-23/+23
|/ / / | | | | | | | | | | | | This more accurately describes what the function is actually attempting to do (it's not a simple trivial getter).
* | | nvflinger: Add the Null displayLioncash2019-01-301-1/+2
| | | | | | | | | | | | | | | | | | | | | In addition to the default, external, EDID, and internal displays, there's also a null display provided as well, which as the name suggests, does nothing but discard all commands given to it. This is provided for completeness.
* | | nvflinger: Change log message in OpenDisplay to be a debug log instead of a warningLioncash2019-01-301-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | Opening a display isn't really a thing to warn about. It's an expected thing, so this can be a debug log. This also alters the string to indicate the display name better. Opening "Default" display reads a little nicer compared to Opening display Default.
* | | nvflinger: Remove unnecessary header inclusionsLioncash2019-01-301-2/+0
| | |
* | | nvflinger: Mark locals const where applicableLioncash2019-01-301-11/+11
| | | | | | | | | | | | Makes non-mutable state more explicit.
* | | nvflinger: Use a std::array for the available displays instead of std::vectorLioncash2019-01-302-7/+7
|/ / | | | | | | | | The built-in set of displays is fixed, so we can utilize an array instead of a vector here.
* | hle/ipc_helpers: Fix clang-format warningsLioncash2019-01-301-1/+0
| |
* | hle/ipc_helpers: Allow pushing signed valuesLioncash2019-01-291-0/+22
| | | | | | | | | | This is kind of a large hole in the API, given we allow popping signed values. This fixes that.
* | service/pm: Implement SetMaintenanceBoot()Lioncash2019-01-281-1/+10
| | | | | | | | | | | | | | This quite literally functions as a basic setter. No other error checking or anything (since there's nothing to really check against). With this, it completes the pm:bm interface in terms of functionality.
* | service/pm: Tidy up functionality related to SystemBootModeLioncash2019-01-282-2/+9
| | | | | | | | Just minor tidying of interfaces.
* | service/vi: Remove stubbed notifier from SetLayerVisibilityLioncash2019-01-281-2/+3
| | | | | | | | | | | | | | | | | | | | This appears to be a vestigial API function that's only kept around for compatibility's sake, given the function only returns a success error code and exits. Since that's the case, we can remove the stubbed notification from the log, since doing nothing is technically the correct behavior in this case.
* | kernel/svc: Log out uncaught C++ exceptions from svcBreakLioncash2019-01-271-0/+4
| | | | | | | | | | | | | | | | | | | | Looking into the implementation of the C++ standard facilities that seem to be within all modules, it appears that they use 7 as a break reason to indicate an uncaught C++ exception. This was primarily found via the third last function called within Horizon's equivalent of libcxxabi's demangling_terminate_handler(), which passes the value 0x80000007 to svcBreak.
* | Merge pull request #2054 from bunnei/scope-context-refactorbunnei2019-01-243-0/+43
|\ \ | | | | | | frontend: Refactor ScopeAcquireWindowContext out of renderer_opengl.
| * | frontend: Refactor ScopeAcquireWindowContext out of renderer_opengl.bunnei2019-01-243-0/+43
| |/
* / citra_qt: Log settings on launchzhupengfei2019-01-222-0/+30
|/
* Merge pull request #2025 from DarkLordZach/loader-banner-logobunnei2019-01-2011-0/+77
|\ | | | | loader: Add getters for application banner and logo
| * loader: Propagate NCA logo section to ReadBanner and ReadLogoZach Hilman2019-01-159-0/+61
| |
| * content_archive: Add getter for logo section of NCAZach Hilman2019-01-152-0/+16
| |
* | Merge pull request #2031 from lioncash/privbunnei2019-01-195-18/+29
|\ \ | | | | | | yuzu/web_browser: Minor cleanup
| * | core/frontend/applets/web_browser: Include missing headersLioncash2019-01-171-2/+8
| | | | | | | | | | | | Gets rid of a few indirect inclusions.
| * | core/frontend/applets/web_browser: Make OpenPage() non-constLioncash2019-01-175-16/+21
| |/ | | | | | | | | | | | | | | This is a function that definitely doesn't always have a non-modifying behavior across all implementations, so this should be made non-const. This gets rid of the need to mark data members as mutable to work around the fact mutating data members needs to occur.
* / file_sys/directory: Remove unused DirectoryBackend classLioncash2019-01-181-23/+0
|/ | | | This isn't used at all, so we can just get rid of it.
* Merge pull request #1959 from DarkLordZach/custom-rtcbunnei2019-01-103-7/+21
|\ | | | | settings: Add support for setting the RTC manually
| * settings: Fix comment structureZach Hilman2019-01-081-4/+5
| |
| * settings: Use std::chrono::seconds instead of s64 for RTCZach Hilman2019-01-083-11/+10
| |
| * time: Use custom RTC settings if applicable for gameZach Hilman2019-01-081-6/+10
| |
| * core: Set custom RTC differential on game bootZach Hilman2019-01-081-0/+7
| |
| * settings: Add custom RTC settingsZach Hilman2019-01-081-0/+3
| | | | | | Stored as signed seconds since epoch.
* | Merge pull request #1939 from DarkLordZach/web-appletbunnei2019-01-1020-586/+1012
|\ \ | |/ |/| applets: Implement HLE web browser applet (LibAppletOff)
| * travis: Use correct package for linux Qt5WebEngineZach Hilman2018-12-292-3/+2
| |
| * web_browser: Add bounds checking to applet interfaceZach Hilman2018-12-297-134/+139
| |
| * core: Add getter and setter for WebBrowserApplet frontendZach Hilman2018-12-284-2/+22
| |
| * frontend: Add frontend responder for web browserZach Hilman2018-12-282-0/+52
| |
| * applets: Implement LibAppletOff (Web) appletZach Hilman2018-12-284-0/+234
| |
| * loader: Add accessor for Manual RomFSZach Hilman2018-12-285-0/+30
| |
| * hid: Make Hid service accessible and add GetPressStateZach Hilman2018-12-284-459/+540
| |
| * romfs: Add SingleDiscard extraction typeZach Hilman2018-12-282-2/+6
| | | | | | | | Needed for manual RomFS extraction, as Full generates an extra directory and Truncated generates variable results.
| * am: Add size parameter to am:IStorage loggingZach Hilman2018-12-281-4/+4
| |
* | Merge pull request #1989 from lioncash/setbunnei2019-01-071-39/+58
|\ \ | | | | | | service/vi: Unstub IApplicationDisplayService's SetLayerScalingMode
| * | service/vi: Correct scaling mode conversionsLioncash2019-01-051-15/+13
| | | | | | | | | | | | | | | | | | | | | | | | | | | These values are not equivalent, based off RE. The internal value is put into a lookup table with the following values: [3, 0, 1, 2, 4] So the values absolutely do not map 1:1 like the comment was indicating.
| * | service/vi: Factor out scaling mode conversions from the IPC function itselfLioncash2019-01-051-17/+21
| | | | | | | | | | | | | | | | | | Avoids entangling the IPC buffer appending with the actual operation of converting the scaling values over. This also inserts the proper error handling for invalid scaling values.
| * | service/vi: Unstub IApplicationDisplayService' SetLayerScalingMode()Lioncash2019-01-051-21/+38
| | | | | | | | | | | | | | | | | | | | | | | | This appears to only check if the scaling mode can actually be handled, rather than actually setting the scaling mode for the layer. This implements the same error handling performed on the passed in values.
* | | Merge pull request #1988 from lioncash/resbunnei2019-01-051-12/+8
|\ \ \ | | | | | | | | service/vi: Correct reported dimensions from IApplicationDisplayService's GetDisplayResolution()
| * | | service/vi: Correct reported dimensions from IApplicationDisplayService's GetDisplayResolution()Lioncash2019-01-051-12/+8
| |/ / | | | | | | | | | | | | | | | Within the actual service, it makes no distinguishing between docked and undocked modes. This will always return the constants values reporting 1280x720 as the dimensions.
* | | Merge pull request #1981 from ogniK5377/open-app-area-createbunnei2019-01-051-4/+4
|\ \ \ | | | | | | | | Return no application area when games try to open an application area
| * | | Return no application area when games try to open an application areaDavid Marcec2019-01-041-4/+4
| | | | | | | | | | | | | | | | This will prompt CreateApplicationArea
* | | | Merge pull request #1980 from ogniK5377/applet-msg-updatebunnei2019-01-051-1/+10
|\ \ \ \ | |_|/ / |/| | | Proper no message handling for AM::PopMessage
| * | | Proper no message handling for AM::PopMessageDavid Marcec2019-01-041-1/+10
| |/ / | | | | | | | | | When we have no messages, we should be returning an error code.
* | | Removed pulse event typeDavid Marcec2019-01-043-7/+0
| | | | | | | | | | | | Pulse is considered a hack and nothing should be using it. We should completely remove it
* | | Merge pull request #1975 from lioncash/vibunnei2019-01-041-4/+15
|\ \ \ | | | | | | | | service/vi: Minor updates and corrections to the DisplayInfo struct
| * | | service/vi: Correct initial width and height valuesLioncash2019-01-021-2/+2
| | | | | | | | | | | | | | | | | | | | Based off RE, it appears that almost all display types seem to use 1920x1080 except for a few (null display, edid display).
| * | | service/vi: Document unknown DisplayInfo struct membersLioncash2019-01-021-2/+13
| | | | | | | | | | | | | | | | | | | | | | | | It appears that the two members indicate whether a display has a bounded number of layers (and if set, the second member indicates the total number of layers).
* | | | Fixed botw deadlock(and possibly 30 fps games rendering too fast? needs testing to confirm)David Marcec2019-01-031-1/+1
| |/ / |/| | | | | | | | Upon investigating the issue with #1878, I found that games are the ones who handle the vsync event resetting and not us.
* | | Merge pull request #1976 from lioncash/displaybunnei2019-01-031-4/+17
|\ \ \ | | | | | | | | service/vi: Implement OpenDefaultDisplay in terms of OpenDisplay
| * | | service/vi: Implement OpenDefaultDisplay in terms of OpenDisplayLioncash2019-01-031-4/+17
| |/ / | | | | | | | | | | | | | | | Internally within the vi services, this is essentially all that OpenDefaultDisplay does, so it's trivial to just do the same, and forward the default display string into the function.
* | | service/vi: Implement SetDisplayEnabled()Lioncash2019-01-031-1/+10
| | | | | | | | | | | | | | | | | | | | | This IPC command is simply a stub inside the actual service itself, and just returns a successful error code regardless of input. This is likely only retained in the service interface to not break older code that relied upon it succeeding in some way.
* | | Merge pull request #1977 from lioncash/vi-logbunnei2019-01-031-63/+74
|\ \ \ | | | | | | | | service/vi: Log more information where applicable
| * | | service/vi: Log more information where applicableLioncash2019-01-031-63/+74
| |/ / | | | | | | | | | | | | | | | In many cases, we didn't bother to log out any of the popped data members. This logs them out to the console within the logging call to provide more contextual information.
* / / core/kernel: Remove unnecessary inclusionsLioncash2019-01-0116-16/+22
|/ / | | | | | | Gets rid of a few unnecessary header dependencies in some source files.
* | Merge pull request #1966 from lioncash/backtracebunnei2018-12-312-7/+8
|\ \ | | | | | | arm_interface: Minor cleanup
| * | arm_interface: Make include path relative for arm_interface.hLioncash2018-12-311-1/+1
| | | | | | | | | | | | Makes it consistent with the rest of the includes.
| * | arm_interface: Make LogBacktrace() a const member functionLioncash2018-12-312-2/+2
| | | | | | | | | | | | This function doesn't modify instance state, so it can be made const.
| * | arm_interface: Mark variables as const where applicable in LogBacktrace()Lioncash2018-12-311-3/+4
| | | | | | | | | | | | | | | Two of these variables have fixed values, so we can make that immediately obvious from the get-go.
| * | arm_interface: Remove unnecessary semicolonLioncash2018-12-311-1/+1
| | | | | | | | | | | | | | | Namespaces don't require the use of a semicolon. Silences a -Wextra-semi warning.
* | | kernel/svc: Correct misleading error message within CreateThread()Lioncash2018-12-311-2/+3
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This is a bounds check to ensure that the thread priority is within the valid range of 0-64. If it exceeds 64, that doesn't necessarily mean that an actual priority of 64 was expected (it actually means whoever called the function screwed up their math). Instead clarify the message to indicate the allowed range of thread priorities.
* | | kernel/svc: Sanitize core number and thread priorities in CreateThread()Lioncash2018-12-311-6/+17
| | | | | | | | | | | | | | | | | | Now that we handle the kernel capability descriptors we can correct CreateThread to properly check against the core and priority masks like the actual kernel does.
* | | kernel/process: Rename GetAllowedProcessorMask() and GetAllowedThreadPriorityMask()Lioncash2018-12-312-11/+11
| | | | | | | | | | | | Makes them consistent with their kernel capability counterparts.
* | | kernel/svc: Simplify thread core ID sanitizing in CreateThreadLioncash2018-12-311-7/+1
|/ / | | | | | | | | Rather than use a switch here, this can be collapsed into a simple range check, which is a little easier on the eyes.
* | Merge pull request #1956 from lioncash/process-threadSebastian Valle2018-12-315-57/+51
|\ \ | | | | | | kernel/process: Start the main thread using the specified ideal core
| * | kernel/process: Start the main thread using the specified ideal coreLioncash2018-12-281-2/+2
| | | | | | | | | | | | | | | This matches kernel behavior in that processes are started using their specified ideal core, rather than always starting on core 0.
| * | kernel: Rename 'default' CPU core to 'ideal' coreLioncash2018-12-284-21/+21
| | | | | | | | | | | | | | | | | | This makes the naming more closely match its meaning. It's just a preferred core, not a required default core. This also makes the usages of this term consistent across the thread and process implementations.
| * | kernel/thread: Move process thread initialization into process.cppLioncash2018-12-283-36/+30
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This function isn't a general purpose function that should be exposed to everything, given it's specific to initializing the main thread for a Process instance. Given that, it's a tad bit more sensible to place this within process.cpp, which keeps it visible only to the code that actually needs it.
* | | Merge pull request #1847 from ogniK5377/backtrace-breakbunnei2018-12-306-1/+41
|\ \ \ | | | | | | | | Print backtrace on svcBreak
| * | | Moved log backtrace to arm_interface.cpp. Added printing of error code to fatalDavid Marcec2018-12-294-18/+36
| | | |
| * | | Moved backtrace to ArmInterfaceDavid Marcec2018-12-198-47/+20
| | | |
| * | | Moved backtrace to ArmInterfaceDavid Marcec2018-12-036-14/+39
| | | | | | | | | | | | | | | | Added to both dynarmic and unicorn
| * | | Print backtrace on svcBreakDavid Marcec2018-12-033-0/+24
| | | | | | | | | | | | | | | | When we get an svcBreak we get a backtrace now
* | | | service/time: Minor cleanup to GetClockSnapshot()Lioncash2018-12-301-7/+9
| | | | | | | | | | | | | | | | Moves some variables closer to their actual usage sites.
* | | | service/time: Fill in some structures and remove padding where not necessaryLioncash2018-12-302-7/+9
| |_|/ |/| |
* | | Merge pull request #1954 from lioncash/npdmbunnei2018-12-281-3/+7
|\ \ \ | | | | | | | | file_sys/program_metadata: Print out more descriptive address space descriptions
| * | | file_sys/program_metadata: Print out more descriptive address space descriptionsLioncash2018-12-281-3/+7
| | |/ | |/| | | | | | | | | | | | | | | | Provides extra information that makes it easier to tell if an executable being run is using a 36-bit address space or a 39-bit address space. While we don't support AArch32 executables yet, this also puts in distinguishing information for the 32-bit address space types as well.
* / | kernel/process: Remove most allocation functions from Process' interfaceLioncash2018-12-284-49/+35
|/ / | | | | | | | | | | | | | | | | | | | | | | | | | | | | In all cases that these functions are needed, the VMManager can just be retrieved and used instead of providing the same functions in Process' interface. This also makes it a little nicer dependency-wise, since it gets rid of cases where the VMManager interface was being used, and then switched over to using the interface for a Process instance. Instead, it makes all accesses uniform and uses the VMManager instance for all necessary tasks. All the basic memory mapping functions did was forward to the Process' VMManager instance anyways.
* | Merge pull request #1928 from lioncash/capsbunnei2018-12-2712-125/+670
|\ \ | | | | | | kernel: Handle kernel capability descriptors
| * | kernel/process: Hook up the process capability parser to the process itselfLioncash2018-12-217-122/+44
| | | | | | | | | | | | | | | While we're at it, we can also toss out the leftover capability parsing from Citra.
| * | kernel/process_capability: Handle debug capability flagsLioncash2018-12-212-1/+18
| | |
| * | kernel/process_capability: Handle handle table capability flagsLioncash2018-12-212-1/+11
| | | | | | | | | | | | | | | This just specifies the handle table size. There's also a section of reserved bits that are checked against.
| * | kernel/process_capability: Handle kernel version capability flagsLioncash2018-12-212-1/+18
| | |
| * | kernel/process_capability: Handle program capability flagsLioncash2018-12-213-2/+29
| | |
| * | kernel/process_capability: Handle interrupt capability flagsLioncash2018-12-211-1/+21
| | | | | | | | | | | | | | | | | | Similar to the service capability flags, however, we currently don't emulate the GIC, so this currently handles all interrupts as being valid for the time being.
| * | kernel/process_capability: Handle syscall capability flagsLioncash2018-12-212-1/+29
| | |
| * | kernel/process_capability: Handle the priority mask and core mask flagsLioncash2018-12-212-1/+40
| | | | | | | | | | | | | | | | | | Handles the priority mask and core mask flags to allow building up the masks to determine the usable thread priorities and cores for a kernel process instance.
| * | kernel/process: Introduce process capability parsing skeletonLioncash2018-12-215-3/+468
| | | | | | | | | | | | | | | | | | | | | We've had the old kernel capability parser from Citra, however, this is unused code and doesn't actually map to how the kernel on the Switch does it. This introduces the basic functional skeleton for parsing process capabilities.
* | | Merge pull request #1929 from bunnei/fix-hidbunnei2018-12-271-44/+163
|\ \ \ | | | | | | | | hid: Fix SetNpadJoyHoldType and improve logging.
| * | | hid: Fix SetNpadJoyHoldType and improve logging.bunnei2018-12-211-44/+163
| | | |
* | | | Merge pull request #1945 from bunnei/fix-hid-horizbunnei2018-12-271-46/+0
|\ \ \ \ | | | | | | | | | | npad: Remove code to invert input in horizontal mode.
| * | | | npad: Remove code to invert input in horizontal mode.bunnei2018-12-261-46/+0
| | | | | | | | | | | | | | | | | | | | | | | | | - This was incorrect, the game appears to handle this for us. - Fixes horizontal mode with Puyo Puyo Tetris and Super Mario Odyssey.
* | | | | Merge pull request #1949 from lioncash/unmapbunnei2018-12-271-0/+1
|\ \ \ \ \ | | | | | | | | | | | | kernel/vm_manager: Reset region attributes when unmapping a VMA
| * | | | | kernel/vm_manager: Reset region attributes when unmapping a VMALioncash2018-12-271-0/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Like the other members related to memory regions, the attributes need to be reset back to their defaults as well.
* | | | | | am: Implement GetSaveDataSize and ExtendSaveDataZach Hilman2018-12-275-5/+50
| | | | | | | | | | | | | | | | | | These functions come in a pair and are needed by Smash Ultimate, Minecraft, and Skyrim, amongst others.
* | | | | | filesystem: Populate save data sizes from control dataZach Hilman2018-12-272-0/+53
| | | | | |
* | | | | | savedata_factory: Partially implement IVFC save sizes using filesZach Hilman2018-12-272-0/+38
| | | | | | | | | | | | | | | | | | This stores a file in the save directory called '.yuzu_save_size' which stores the two save sizes (normal area and journaled area) sequentially as u64s.
* | | | | | loader: Add accessor for game control dataZach Hilman2018-12-275-9/+14
| | | | | |
* | | | | | control_metadata: Update NACP fields with latest Switchbrew dataZach Hilman2018-12-272-6/+29
| | | | | |
* | | | | | control_metadata: Use value member instead of unique_ptr to store structZach Hilman2018-12-272-10/+13
| | | | | | | | | | | | | | | | | | Serves no actual purpose in this instance besides making NACP's copy assignment deleted, which is not intended behavior.
* | | | | | vfs: Add reinterpret_casts to WriteArray and ObjectZach Hilman2018-12-271-2/+2
|/ / / / / | | | | | | | | | | Allows these functions to compile when T is not u8.
* | | | | Merge pull request #1849 from encounter/svcSetThreadActivitybunnei2018-12-264-6/+72
|\ \ \ \ \ | |/ / / / |/| | | | svc: Implement SetThreadActivity (thread suspension)
| * | | | svc: Implement SetThreadActivity (thread suspension)Luke Street2018-12-044-6/+72
| | | | |
* | | | | Merge pull request #1886 from FearlessTobi/port-4164bunnei2018-12-232-0/+22
|\ \ \ \ \ | | | | | | | | | | | | Port citra-emu/citra#4164: "citra_qt, video_core: Screenshot functionality"
| * | | | | yuzu, video_core: Screenshot functionalityzhupengfei2018-12-182-0/+22
| | | | | | | | | | | | | | | | | | | | | | | | Allows capturing screenshot at the current internal resolution (native for software renderer), but a setting is available to capture it in other resolutions. The screenshot is saved to a single PNG in the current layout.
* | | | | | Merge pull request #1781 from DarkLordZach/applet-profile-selectbunnei2018-12-238-0/+197
|\ \ \ \ \ \ | | | | | | | | | | | | | | am: Implement HLE profile selector applet
| * | | | | | applets: Correct event ResetTypes from OneShot to StickyZach Hilman2018-12-034-13/+5
| | | | | | | | | | | | | | | | | | | | | | | | | | | | Fixes bugs relating to signalling in software keyboard.
| * | | | | | qt: Implement GUI dialog frontend for ProfileSelectorZach Hilman2018-12-031-0/+2
| | | | | | | | | | | | | | | | | | | | | Presents profiles in a list, similar to switch.
| * | | | | | am: Use ProfileSelect appletZach Hilman2018-12-031-0/+4
| | | | | | |
| * | | | | | applets: Implement ProfileSelect appletZach Hilman2018-12-032-0/+130
| | | | | | | | | | | | | | | | | | | | | Allows the player to select an emulated profile.
| * | | | | | core: Add getter/setter for ProfileSelector in SystemZach Hilman2018-12-032-0/+16
| | | | | | |
| * | | | | | frontend: Add frontend applet for ProfileSelectZach Hilman2018-12-033-0/+48
| | | | | | | | | | | | | | | | | | | | | Responsible for selecting a profile and firing callback upon completion.
| * | | | | | software_keyboard: Signal state changed event upon constructionZach Hilman2018-12-031-1/+6
| | | | | | | | | | | | | | | | | | | | | Previously, ILibraryAppletAccessor would signal upon creation of any applet, but this is incorrect. A flag inside of the applet code determines whether or not creation should signal state change and swkbd happens to be one of these applets.
* | | | | | | Merge pull request #1921 from ogniK5377/no-unitbunnei2018-12-213-0/+3
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | Fixed uninitialized memory due to missing returns in canary
| * | | | | | | Fixed uninitialized memory due to missing returns in canaryDavid Marcec2018-12-193-0/+3
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Functions which are suppose to crash on non canary builds usually don't return anything which lead to uninitialized memory being used.
* | | | | | | | Merge pull request #1925 from lioncash/pidbunnei2018-12-217-28/+59
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | kernel/{process, thread}: Amend behavior related to IDs
| * | | | | | | | kernel/svc: Handle thread handles within GetProcessIdLioncash2018-12-191-10/+23
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | If a thread handle is passed to svcGetProcessId, the kernel attempts to access the process ID via the thread's instance's owning process. Technically, this function should also be handling the kernel debug objects as well, however we currently don't handle those kernel objects yet, so I've left a note via a comment about it to remind myself when implementing it in the future.
| * | | | | | | | kernel/kernel: Use correct initial PID for userland Process instancesLioncash2018-12-192-4/+14
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Starts the process ID counter off at 81, which is what the kernel itself checks against internally when creating processes. It's actually supposed to panic if the PID is less than 81 for a userland process.
| * | | | | | | | kernel/svc: Correct output parameter for svcGetThreadIdLioncash2018-12-191-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The service call uses a 64-bit value, just like svcGetProcessId. This amends the function signature accordingly.
| * | | | | | | | kernel/thread: Make thread_id a 64-bit valueLioncash2018-12-194-7/+7
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The kernel uses a 64-bit value for the thread ID, so we shouldn't be using a 32-bit value.
| * | | | | | | | kernel/svc: Correct output parameter for svcGetProcessIdLioncash2018-12-192-2/+10
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | svcGetProcessId's out parameter is a pointer to a 64-bit value, not a 32-bit one.
| * | | | | | | | kernel/process: Make process_id a 64-bit valueLioncash2018-12-193-6/+6
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | In the actual kernel, this is a 64-bit value, so we shouldn't be using a 32-bit type to handle it.
* | | | | | | | | Merge pull request #1914 from lioncash/idbunnei2018-12-211-2/+5
|\ \ \ \ \ \ \ \ \ | |_|_|_|_|_|/ / / |/| | | | | | | | service/am: Unstub GetAppletResourceUserId
| * | | | | | | | service/am: Unstub GetAppletResourceUserIdLioncash2018-12-181-2/+5
| |/ / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This is supposed to return the current process' ID. (0 indicates an invalid ID for both process IDs and ARU IDs).
* | | | | | | | Merge pull request #1923 from ogniK5377/nfp-device-listbunnei2018-12-191-2/+2
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | Device handle should not be a random id, instead it's the current npad id
| * | | | | | | | Device handle should not be a random id, instead it's the current npad idDavid Marcec2018-12-191-2/+2
| | |/ / / / / / | |/| | | | | | | | | | | | | | | | | | | | | | Found during hardware testing
* | | | | | | | Merge pull request #1915 from lioncash/smbunnei2018-12-191-4/+5
|\ \ \ \ \ \ \ \ | |_|_|_|_|_|/ / |/| | | | | | | service/sm: Improve debug log for RegisterService
| * | | | | | | service/sm: Improve debug log for RegisterServiceLioncash2018-12-191-4/+5
| | |/ / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Now it also indicates the name and max session count. This also gives a name to the unknown bool. This indicates if the created port is supposed to be using light handles or regular handles internally. This is passed to the respective svcCreatePort parameter internally.
* | | | | | | Merge pull request #1907 from lioncash/attributebunnei2018-12-193-14/+279
|\ \ \ \ \ \ \ | |_|/ / / / / |/| | | | | | kernel/svc: Implement svcSetMemoryAttribute
| * | | | | | svc: Implement svcSetMemoryAttributeLioncash2018-12-191-5/+46
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | With all the basic backing functionality implemented, we can now unstub svcSetMemoryAttribute.
| * | | | | | vm_manager: Add member function for setting memory attributes across an address rangeLioncash2018-12-192-0/+41
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This puts the backing functionality for svcSetMemoryAttribute in place, which will be utilized in a following change.
| * | | | | | vm_manager: Add member function for checking a memory range adheres to certain attributes, permissions and statesLioncash2018-12-192-0/+100
| | | | | | |
| * | | | | | vm_manager: Rename meminfo_state to stateLioncash2018-12-162-10/+9
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This is shorter and more concise. This also removes the now-innaccurate comment, as it's not returned wholesale to svcQueryMemory anymore.
| * | | | | | vm_manager: Add backing functionality for memory attributesLioncash2018-12-162-1/+85
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Adds the barebones enumeration constants and functions in place to handle memory attributes, while also essentially leaving the attribute itself non-functional.
* | | | | | | Merge pull request #1913 from MerryMage/default-fpcrbunnei2018-12-181-0/+3
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | kernel/thread: Set default fpcr
| * | | | | | | kernel/thread: Set default fpcrMerryMage2018-12-181-0/+3
| | |/ / / / / | |/| | | | |
* | | | | | | Merge pull request #1918 from MerryMage/cntfrqbunnei2018-12-181-0/+1
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | arm_dynarmic: Set CNTFRQ value
| * | | | | | | arm_dynarmic: Set CNTFRQ valueMerryMage2018-12-181-0/+1
| |/ / / / / /
* | | | | | | Merge pull request #1889 from DarkLordZach/swkbd-state-changedbunnei2018-12-183-6/+4
|\ \ \ \ \ \ \ | |/ / / / / / |/| | | | | | applets: Correct usage of SignalStateChanged event
| * | | | | | applets: Correct usage of SignalStateChanged eventZach Hilman2018-12-103-6/+4
| | |_|/ / / | |/| | | | | | | | | | | | | | | | This was causing some games (most notably Pokemon Quest) to softlock due to an event being fired when not supposed to. This also removes a hack wherein we were firing the state changed event when the game retrieves it, which is incorrect.
* | | | | | Merge pull request #1905 from bunnei/ignore-empty-gpu-listsbunnei2018-12-151-0/+4
|\ \ \ \ \ \ | | | | | | | | | | | | | | nvhost_gpu: Skip empty GPU command lists.
| * | | | | | nvhost_gpu: Skip empty GPU command lists.bunnei2018-12-151-0/+4
| | | | | | |
* | | | | | | Merge pull request #1901 from jschmer/ServiceLeakbunnei2018-12-152-10/+12
|\ \ \ \ \ \ \ | |_|_|/ / / / |/| | | | | | Fix Service object leak on emulation stop
| * | | | | | Fix Service object leak on emulation stopJens Schmer2018-12-132-10/+12
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Services created with the ServiceFramework base class install themselves as HleHandlers with an owning shared_ptr in the ServerPort ServiceFrameworkBase::port member variable, creating a cyclic ownership between ServiceFrameworkBase and the ServerPort, preventing deletion of the service objects. Fix that by removing the ServiceFrameworkBase::port member because that was only used to detect multiple attempts at installing a port. Instead store a flag if the port was already installed to achieve the same functionality.
* | | | | | | Merge pull request #1732 from DarkLordZach/yield-typesbunnei2018-12-154-9/+165
|\ \ \ \ \ \ \ | |_|/ / / / / |/| | | | | | svc: Implement yield types 0 and -1
| * | | | | | svc: Avoid incorrect fast yield conditionZach Hilman2018-12-051-6/+1
| | | | | | |
| * | | | | | scheduler: Avoid manual Reschedule callZach Hilman2018-12-042-11/+11
| | | | | | | | | | | | | | | | | | | | | This will automatically occur anyway when PrepareReschedule is called
| * | | | | | scheduler: Only work steal higher priority threads from other coresZach Hilman2018-12-033-35/+24
| | | | | | |
| * | | | | | svc: Avoid performance-degrading unnecessary rescheduleZach Hilman2018-12-022-8/+6
| | | | | | |
| * | | | | | scheduler: Add explanations for YieldWith and WithoutLoadBalancingZach Hilman2018-11-225-77/+139
| | | | | | |
| * | | | | | svc: Implement yield types 0 and -1Zach Hilman2018-11-195-2/+114
| | | | | | |
* | | | | | | Merge pull request #1899 from lioncash/statebunnei2018-12-147-84/+188
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | vm_manager/svc: Modify MemoryState enum, and correct error handling for svcQueryMemory
| * | | | | | | svc: Enable svcQueryProcessMemoryLioncash2018-12-122-1/+6
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | svcQueryProcessMemory is trivial to implement, given all the behavior necessary for it is present, it just needs a handler for it.
| * | | | | | | svc: Write out the complete MemoryInfo structure in QueryProcessMemoryLioncash2018-12-121-0/+3
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | In the previous change, the memory writing was moved into the service function itself, however it still had a problem, in that the entire MemoryInfo structure wasn't being written out, only the first 32 bytes of it were being written out. We still need to write out the trailing two reference count members and zero out the padding bits. Not doing this can result in wrong behavior in userland code in the following scenario: MemoryInfo info; // Put on the stack, not quaranteed to be zeroed out. svcQueryMemory(&info, ...); if (info.device_refcount == ...) // Whoops, uninitialized read. This can also cause the wrong thing to happen if the user code uses std::memcmp to compare the struct, with another one (questionable, but allowed), as the padding bits are not guaranteed to be a deterministic value. Note that the kernel itself also fully zeroes out the structure before writing it out including the padding bits.
| * | | | | | | svc: Handle memory writing explicitly within QueryProcessMemoryLioncash2018-12-122-26/+22
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Moves the memory writes directly into QueryProcessMemory instead of letting the wrapper function do it. It would be inaccurate to allow the handler to do it because there's cases where memory shouldn't even be written to. For example, if the given process handle is invalid. HOWEVER, if the memory writing is within the wrapper, then we have no control over if these memory writes occur, meaning in an error case, 68 bytes of memory randomly get trashed with zeroes, 64 of those being written to wherever the memory info address points to, and the remaining 4 being written wherever the page info address points to. One solution in this case would be to just conditionally check within the handler itself, but this is kind of smelly, given the handler shouldn't be performing conditional behavior itself, it's a behavior of the managed function. In other words, if you remove the handler from the equation entirely, does the function still retain its proper behavior? In this case, no. Now, we don't potentially trash memory from this function if an invalid query is performed.
| * | | | | | | vm_manager: Correct ordering of last two struct members of MemoryInfoLioncash2018-12-121-2/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | These should be swapped.
| * | | | | | | vm_manager: Amend the returned values for invalid memory queries in QueryMemory()Lioncash2018-12-122-4/+7
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The kernel returns a memory info instance with the base address set to the end of the address space, and the size of said block as 0 - address_space_end, it doesn't set both of said members to zero.
| * | | | | | | vm_manager: Migrate memory querying to the VMManager interfaceLioncash2018-12-124-18/+33
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Gets rid of the need to directly access the managed VMAs outside of the memory manager itself just for querying memory.
| * | | | | | | vm_manager: Migrate MemoryInfo and PageInfo to vm_manager.hLioncash2018-12-123-17/+16
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Gets the two structures out of an unrelated header and places them with the rest of the memory management code. This also corrects the structures. PageInfo appears to only contain a 32-bit flags member, and the extra padding word in MemoryInfo isn't necessary.
| * | | | | | | vm_manager: Amend MemoryState enum membersLioncash2018-12-125-28/+111
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Amends the MemoryState enum to use the same values like the actual kernel does. Also provides the necessary operators to operate on them. This will be necessary in the future for implementing svcSetMemoryAttribute, as memory block state is checked before applying the attribute.
* | | | | | | | Merge pull request #1900 from lioncash/wrapperbunnei2018-12-141-1/+1
|\ \ \ \ \ \ \ \ | |_|_|/ / / / / |/| | | | | | | svc_wrap: Correct register index for a wrapper specialization
| * | | | | | | svc_wrap: Correct register index for a wrapper specializationLioncash2018-12-121-1/+1
| |/ / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This would result in svcSetMemoryAttribute getting the wrong value for its third parameter. This is currently fine, given the service function is stubbed, however this will be unstubbed in a future change, so this needs to change.
* | | | | | | Fix Process object leak on emulation stopJens Schmer2018-12-123-13/+12
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The Process object kept itself alive indefinitely because its handle_table contains a SharedMemory object which owns a reference to the same Process object, creating a circular ownership scenario. Break that up by storing only a non-owning pointer in the SharedMemory object.
* | | | | | | Merge pull request #1891 from DarkLordZach/istorage-getsizeMat M2018-12-121-2/+15
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | fsp_srv: Implement IStorage::GetSize
| * | | | | | | fsp_srv: Implement IStorage::GetSizeZach Hilman2018-12-101-2/+15
| | |_|/ / / / | |/| | | | | | | | | | | | | | | | | | | Takes no input and returns the size as a u64. Needed by Katamari Damacy Reroll to boot.
* | | | | | | patch_manager: Prevent use of a dangling pointer within PatchRomFSLioncash2018-12-111-4/+3
| |/ / / / / |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | fmt::format() returns a std::string instance by value, so calling .c_str() on it here is equivalent to doing: auto* ptr = std::string{}.c_str(); The data being pointed to isn't guaranteed to actually be valid anymore after that expression ends. Instead, we can just take the string as is, and provide the necessary formatting parameters.
* | | | | | Merge pull request #1846 from lioncash/dirbunnei2018-12-111-2/+2
|\ \ \ \ \ \ | | | | | | | | | | | | | | file_sys/directory: Amend path buffer size for directory entries
| * | | | | | file_sys/directory: Amend path buffer size for directory entriesLioncash2018-12-031-2/+2
| | |_|_|_|/ | |/| | | | | | | | | | | | | | | | | | | | | | The path buffer is actually 0x301 (769) characters in length, with the extra character being intended for the null-terminator.
* | | | | | Merge pull request #1819 from DarkLordZach/disable-addonsbunnei2018-12-1111-14/+102
|\ \ \ \ \ \ | | | | | | | | | | | | | | patch_manager: Add support for disabling patches
| * | | | | | loader: Add support for reading the name of game's developerZach Hilman2018-12-035-0/+26
| | | | | | |
| * | | | | | aoc_u: Obey disabled add-ons list when listing DLCZach Hilman2018-12-031-0/+12
| | | | | | |
| * | | | | | patch_manager: Obey disabled add-ons list when patching gameZach Hilman2018-12-032-11/+50
| | | | | | |
| * | | | | | core: Make GetGameFileFromPath function externally accessibleZach Hilman2018-12-032-3/+9
| | | | | | |
| * | | | | | settings: Store list of disabled add-ons per title IDZach Hilman2018-12-031-0/+5
| | |_|_|/ / | |/| | | |
* | | | | | Merge pull request #1887 from FearlessTobi/port-4476bunnei2018-12-111-8/+4
|\ \ \ \ \ \ | | | | | | | | | | | | | | Port citra-emu/citra#4476: "web_service: move telemetry condition from TelemetrySession constructor to destructor"
| * | | | | | web_service: move telemetry condition from TelemetrySession constructor to destructorfearlessTobi2018-12-081-8/+4
| | | | | | | | | | | | | | | | | | | | | | | | | | | | Fixes an issue where Testcases couldn't be sent when Telemetry was disabled, because both things are tied closely together in the backend.
* | | | | | | Merge pull request #1883 from lioncash/log-fspbunnei2018-12-111-1/+10
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | service/fsp_srv: Correct returned value in GetGlobalAccessLogMode()
| * | | | | | | service/fsp_srv: Correct returned value in GetGlobalAccessLogMode()Lioncash2018-12-101-1/+10
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Based off RE, the backing code only ever seems to use 0-2 as the range of values 1 being a generic log enable, with 2 indicating logging should go to the SD card. These are used as a set of flags internally. Given we only care about receiving the log in general, we can just always signify that we want logging in general.
* | | | | | | | Merge pull request #1885 from lioncash/data_idbunnei2018-12-111-1/+3
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | file_sys/save_data_factory: Update SaveDataSpaceId enum
| * | | | | | | | file_sys/save_data_factory: Update SaveDataSpaceId enumLioncash2018-12-081-1/+3
| |/ / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Amends it with missing values deduced from RE (ProperSystem being from SwitchBrew for naming) (SdCardUser wasn't that difficult to discern given it's used alongside SdCardSystem when creating the save data indexer, based off the usage of the string "saveDataIxrDbSd" nearby).
* | | | | | | | Merge pull request #1872 from lioncash/proc-infoHexagon122018-12-101-0/+1
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | kernel/process: Set ideal core from metadata
| * | | | | | | | kernel/process: Set ideal core from metadataLioncash2018-12-051-0/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | A very trivial change. If metadata is available, the process should use it to retrieve the desired core for the process to run on.
* | | | | | | | | Merge pull request #1880 from DarkLordZach/cache-storageHexagon122018-12-101-1/+7
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | savedata_factory: Add CacheStorage and delete TemporaryStorage on boot
| * | | | | | | | | savedata_factory: Add support for CacheStorageZach Hilman2018-12-071-0/+2
| | | | | | | | | |
| * | | | | | | | | savedata_factory: Delete TemporaryStorage on startupZach Hilman2018-12-071-1/+5
| | |_|_|_|_|/ / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | Mimics hardware behavior.
* | | | | | | | | Merge pull request #1876 from lioncash/vmabunnei2018-12-105-28/+41
|\ \ \ \ \ \ \ \ \ | |_|_|_|/ / / / / |/| | | | | | | | vm_manager: Make vma_map private
| * | | | | | | | memory: Convert ASSERT into a DEBUG_ASSERT within GetPointerFromVMA()Lioncash2018-12-061-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Given memory should always be expected to be valid during normal execution, this should be a debug assertion, rather than a check in regular builds.
| * | | | | | | | vm_manager: Make vma_map privateLioncash2018-12-065-28/+41
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This was only ever public so that code could check whether or not a handle was valid or not. Instead of exposing the object directly and allowing external code to potentially mess with the map contents, we just provide a member function that allows checking whether or not a handle is valid. This makes all member variables of the VMManager class private except for the page table.
* | | | | | | | | Merge pull request #1864 from lioncash/nrrbunnei2018-12-081-4/+5
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | service/ldr: Amend layouts of NRO and NRR headers
| * | | | | | | | | service/ldr: Amend layout of the NRO headerLioncash2018-12-051-3/+3
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The first word is just a padding byte, it's not an actual entry instruction. Also renames the rest of the entries according to SwitchBrew.
| * | | | | | | | | service/ldr: Corrent padding within the NRR header layoutLioncash2018-12-051-1/+2
| | |_|/ / / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The padding after the magic signature value should be 12 bytes rather than 28 bytes. The other 16 should be placed after the title ID pattern.
* | | | | | | | | Merge pull request #1874 from lioncash/bindingsbunnei2018-12-082-19/+8
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | hle/service, hle/sm: Minor cleanup
| * | | | | | | | | hle/service: Replace log + UNIMPLEMENTED with UNIMPLEMENTED_MSGLioncash2018-12-061-2/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Combines the two into one, shortening the amount of code here.
| * | | | | | | | | hle/service: Remove unnecessary using declarationsLioncash2018-12-061-5/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Only one usage of the specified objects made use of the lack of namespacing. Given the low usage, we can just remove these.
| * | | | | | | | | hle/service, hle/sm: Compress usages of MakeResult()Lioncash2018-12-062-3/+3
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | These auto-deduce the result based off its arguments, so there's no need to do that work for the compiler, plus, the function return value itself already indicates what we're returning.
| * | | | | | | | | hle/service, hle/sm: Use structured bindings where applicableLioncash2018-12-062-9/+3
| | |/ / / / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Gets rid of the need to keep the variables separate from their actual initialization spots.
* | | | | | | | | Merge pull request #1873 from lioncash/constbunnei2018-12-0810-10/+10
|\ \ \ \ \ \ \ \ \ | |_|_|/ / / / / / |/| | | | | | | | loaders: Make GetFileType() a const qualified member function
| * | | | | | | | loaders: Make GetFileType() a const qualified member functionLioncash2018-12-0510-10/+10
| | |/ / / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | No implementations actually modify instance state (and it would be questionable to do that in the first place given the name), so we can make this a const member function.
* | | | | | | | Merge pull request #1875 from DarkLordZach/oss-ngword2bunnei2018-12-063-1/+41
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | system_archive: Implement open source NgWord2
| * | | | | | | | system_archive: Implement open source NgWord2Zach Hilman2018-12-063-1/+41
| | |_|/ / / / / | |/| | | | | |
* | | | | | | | Merge pull request #1861 from lioncash/resetbunnei2018-12-066-11/+101
|\ \ \ \ \ \ \ \ | |/ / / / / / / |/| | | | | | | kernel/svc: Correct behavior of svcResetSignal()
| * | | | | | | kernel/svc: Correct behavior of svcResetSignal()Lioncash2018-12-051-4/+11
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | While partially correct, this service call allows the retrieved event to be null, as it also uses the same handle to check if it was referring to a Process instance. The previous two changes put the necessary machinery in place to allow for this, so we can simply call those member functions here and be done with it.
| * | | | | | | kernel/process: Make Process a WaitObjectLioncash2018-12-053-6/+68
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Process instances can be waited upon for state changes. This is also utilized by svcResetSignal, which will be modified in an upcoming change. This simply puts all of the WaitObject related machinery in place.
| * | | | | | | kernel/readable_event: Add member function for enforcing a strict reset contractLioncash2018-12-052-1/+22
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | svcResetSignal relies on the event instance to have already been signaled before attempting to reset it. If this isn't the case, then an error code has to be returned.
* | | | | | | | Merge pull request #1867 from lioncash/allocbunnei2018-12-062-4/+3
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | system_archive: Use a regular function pointer instead of std::function for the file-scope system archive array
| * | | | | | | | ng_word: Deduplicate use of a constant valueLioncash2018-12-051-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | We've already given the constant to the vector itself, so we don't need to re-hardcode it in the array.
| * | | | | | | | system_archive: Use a regular function pointer instead of std::function for file-scope system archive arrayLioncash2018-12-051-3/+2
| | |/ / / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This allows the array to be constexpr. std::function is also allowed to allocate memory, which makes its constructor non-trivial, we definitely don't want to have all of these execute at runtime, taking up time before the application can actually load.
* | | | | | | | Merge pull request #1866 from lioncash/cachebunnei2018-12-061-8/+2
|\ \ \ \ \ \ \ \ | |_|_|/ / / / / |/| | | | | | | service/ldr: Deduplicate instruction cache clearing code in LoadNro()
| * | | | | | | service/ldr: Deduplicate instruction cache clearing code in LoadNro()Lioncash2018-12-051-8/+2
| |/ / / / / / | | | | | | | | | | | | | | | | | | | | | We don't need to specify all of the ARM interfaces explicitly.
* / / / / / / Call shrink_to_fit after page-table vector resizing to cause crt to actually lower vector capacity. For 36-bit titles saves 800MB of commit.heapo2018-12-051-0/+8
|/ / / / / /
* | | | | | Merge pull request #1704 from DarkLordZach/oss-sysarchivebunnei2018-12-058-1/+227
|\ \ \ \ \ \ | |/ / / / / |/| | | | | file_sys: Implement open source system archives
| * | | | | file_sys: Implement system archive synthesizer for NgWord (806)Zach Hilman2018-11-235-6/+61
| | | | | |
| * | | | | fsp_srv: Add support for using open source archive if not found in NANDZach Hilman2018-11-161-0/+10
| | | | | |
| * | | | | file_sys: Add framework for synthesizing open source archivesZach Hilman2018-11-163-0/+109
| | | | | |
| * | | | | vfs_vector: Add VFS backend for std::arrayZach Hilman2018-11-161-0/+52
| | | | | | | | | | | | | | | | | | | | | | | | Allows using constexpr/static const data with VFS.
* | | | | | Merge pull request #1838 from lioncash/dedupbunnei2018-12-051-27/+26
|\ \ \ \ \ \ | | | | | | | | | | | | | | file_sys/registered_cache: Eliminate variable shadowing
| * | | | | | file_sys/registered_cache: Eliminate variable shadowingLioncash2018-12-021-27/+26
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Also inverts if statements where applicable to allow unindenting code a little bit.
* | | | | | | Merge pull request #1836 from lioncash/unusedbunnei2018-12-051-1/+0
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | crypto/key_manager: Remove unused variable in GetTicketblob()
| * | | | | | | crypto/key_manager: Remove unused variable in GetTicketblob()Lioncash2018-12-021-1/+0
| |/ / / / / /
* | | | | | | kernel/svc: Remove unused header inclusionLioncash2018-12-041-1/+0
| | | | | | |
* | | | | | | kernel/svc: Implement svcSignalEvent()Lioncash2018-12-041-1/+16
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This function simply does a handle table lookup for a writable event instance identified by the given handle value. If a writable event cannot be found for the given handle, then an invalid handle error is returned. If a writable event is found, then it simply signals the event, as one would expect.
* | | | | | | kernel/svc: Implement svcCreateEvent()Lioncash2018-12-042-1/+42
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | svcCreateEvent operates by creating both a readable and writable event and then attempts to add both to the current process' handle table. If adding either of the events to the handle table fails, then the relevant error from the handle table is returned. If adding the readable event after the writable event to the table fails, then the writable event is removed from the handle table and the relevant error from the handle table is returned. Note that since we do not currently test resource limits, we don't check the resource limit table yet.
* | | | | | | Merge pull request #1845 from lioncash/nrobunnei2018-12-045-19/+23
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | loader/{nro, nso}: Remove dependency on the System class
| * | | | | | | loader/nso: Remove dependency on the System classLioncash2018-12-033-8/+11
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Similar to the NRO changes, we can also pass the process explicitly as a parameter from Load instead of indirecting through the System class.
| * | | | | | | loader/nro: Make the static LoadNro function internally linkedLioncash2018-12-032-7/+5
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This simply acts as a forwarding function for the Load() function, so this doesn't need to be directly exposed.
| * | | | | | | loader/nro: Remove dependency on the System classLioncash2018-12-032-10/+13
| | |_|_|/ / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Load() is already given the process instance as a parameter, so instead of coupling the class to the System class, we can just forward that parameter to LoadNro()
* | | | | | | Merge pull request #1853 from lioncash/eventbunnei2018-12-045-10/+19
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | kernel/object: Amend handle types to distinguish between readable and writable events
| * | | | | | | kernel/object: Amend handle types to distinguish between readable and writable eventsLioncash2018-12-045-10/+19
| | |_|_|_|_|/ | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Two kernel object should absolutely never have the same handle ID type. This can cause incorrect behavior when it comes to retrieving object types from the handle table. In this case it allows converting a WritableEvent into a ReadableEvent and vice-versa, which is undefined behavior, since the object types are not the same. This also corrects ClearEvent() to check both kernel types like the kernel itself does.
* | | | | | | kernel/handle_table: Amend reference to CTR-OS in Create()Lioncash2018-12-041-2/+3
| | | | | | | | | | | | | | | | | | | | | | | | | | | | Another hold-over from Citra.
* | | | | | | kernel/svc: Implement the resource limit svcGetInfo optionLioncash2018-12-044-9/+34
|/ / / / / / | | | | | | | | | | | | | | | | | | | | | | | | Allows a process to register the resource limit as part of its handle table.
* | | | | | [Kernel::CreateThread] Match format specifiers to LOG_TRACE's argumentsV.Kalyuzhny2018-12-041-1/+1
| | | | | |
* | | | | | Merge pull request #1840 from lioncash/infobunnei2018-12-041-50/+100
|\ \ \ \ \ \ | |_|_|_|/ / |/| | | | | svc: Reorganize svcGetInfo, handle more error cases for existing implemented info categories
| * | | | | svc: Use the current process' handle table for retrieving the process instance to act uponLioncash2018-12-021-1/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The kernel uses the handle table of the current process to retrieve the process that should be used to retrieve certain information. To someone not familiar with the kernel, this might raise the question of "Ok, sounds nice, but doesn't this make it impossible to retrieve information about the current process?". No, it doesn't, because HandleTable instances in the kernel have the notion of a "pseudo-handle", where certain values allow the kernel to lookup objects outside of a given handle table. Currently, there's only a pseudo-handle for the current process (0xFFFF8001) and a pseudo-handle for the current thread (0xFFFF8000), so to retrieve the current process, one would just pass 0xFFFF8001 into svcGetInfo. The lookup itself in the handle table would be something like: template <typename T> T* Lookup(Handle handle) { if (handle == PSEUDO_HANDLE_CURRENT_PROCESS) { return CurrentProcess(); } if (handle == PSUEDO_HANDLE_CURRENT_THREAD) { return CurrentThread(); } return static_cast<T*>(&objects[handle]); } which, as is shown, allows accessing the current process or current thread, even if those two objects aren't actually within the HandleTable instance.
| * | | | | svc: Reorganize svcGetInfo, handle more error cases for existing implemented info categoriesLioncash2018-12-021-50/+99
| | |/ / / | |/| | | | | | | | | | | | | | | | | | | | | | | Our implementation of svcGetInfo was slightly incorrect in that we weren't doing proper error checking everywhere. Instead, reorganize it to be similar to how the kernel seems to do it.
* | | | | Merge pull request #1835 from lioncash/cache-globalbunnei2018-12-036-31/+17
|\ \ \ \ \ | | | | | | | | | | | | filesystem: De-globalize registered_cache_union
| * | | | | filesystem: De-globalize registered_cache_unionLioncash2018-12-026-31/+17
| |/ / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | We can just return a new instance of this when it's requested. This only ever holds pointers to the existing registed caches, so it's not a large object. Plus, this also gets rid of the need to keep around a separate member function just to properly clear out the union. Gets rid of one of five globals in the filesystem code.
* | | | | Merge pull request #1803 from DarkLordZach/k-able-eventbunnei2018-12-0333-236/+397
|\ \ \ \ \ | | | | | | | | | | | | kernel: Divide Event into ReadableEvent and WritableEvent
| * | | | | hle_ipc: Refactor SleepClientThread to avoid ReadableEventZach Hilman2018-11-299-14/+14
| | | | | |
| * | | | | kernel/event: Reference ReadableEvent from WritableEventZach Hilman2018-11-2930-311/+169
| | | | | |
| * | | | | core: Port all current usages of Event to Readable/WritableEventZach Hilman2018-11-2925-153/+274
| | | | | |
| * | | | | hle_ipc: Use event pair for SleepClientThreadZach Hilman2018-11-292-19/+22
| | | | | |
| * | | | | kernel: Add named event tableZach Hilman2018-11-292-0/+30
| | | | | | | | | | | | | | | | | | | | | | | | Used to store ReadableEvents of all events on the system.
| * | | | | kernel: Divide Event into ReadableEvent and WritableEventZach Hilman2018-11-296-61/+210
| | | | | | | | | | | | | | | | | | | | | | | | More hardware accurate. On the actual system, there is a differentiation between the signaler and signalee, they form a client/server relationship much like ServerPort and ClientPort.
| * | | | | kernel/object: Add descriptions to ResetTypesZach Hilman2018-11-291-3/+3
| | | | | |
* | | | | | Merge pull request #1833 from lioncash/cleanbunnei2018-12-035-5/+97
|\ \ \ \ \ \ | | | | | | | | | | | | | | service/fsp_srv: Implement CleanDirectoryRecursively
| * | | | | | file_sys: Override missing mutating functions to be stubbed out for ReadOnlyVfsDirectory by defaultLioncash2018-12-012-0/+25
| | | | | | | | | | | | | | | | | | | | | | | | | | | | Ensures that read only indeed means read only.
| * | | | | | service/fsp_srv: Implement CleanDirectoryRecursivelyLioncash2018-12-015-5/+72
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This is the same behavior-wise as DeleteDirectoryRecursively, with the only difference being that it doesn't delete the top level directory in the hierarchy, so given: root_dir/ - some_dir/ - File.txt - OtherFile.txt The end result is just: root_dir/
* | | | | | | Merge pull request #1839 from lioncash/initbunnei2018-12-031-2/+2
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | service/audio/audout_u: Amend constructor initialization list order
| * | | | | | | service/audio/audout_u: Amend constructor initialization list orderLioncash2018-12-021-2/+2
| | |_|/ / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | Orders the constructor initializer list the same way the members of the class are declared. Prevents -Wreorder warnings
* | | | | | | Merge pull request #1841 from ogniK5377/npad-mode-fixbunnei2018-12-031-2/+3
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | Fixed crash with SetNpadMode
| * | | | | | | Fixed crash with SetNpadModeDavid Marcec2018-12-021-2/+3
| | |_|_|/ / / | |/| | | | | | | | | | | | | | | | | | | fixed crash due to handheld
* | | | | | | service/usb: Update function tableLioncash2018-12-021-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Updates the function table for IClientEpSession based off information provided by SwitchBrew.
* | | | | | | service/erpt: Update function tableLioncash2018-12-021-5/+7
|/ / / / / / | | | | | | | | | | | | | | | | | | | | | | | | Updates the function table according to information provided by SwitchBrew.
* | | | | | Merge pull request #1830 from Subv/vi_ubbunnei2018-12-021-0/+2
|\ \ \ \ \ \ | |/ / / / / |/| | | | | Services/VI: Dereferencing an uninitialized std::optional is undefined behavior.
| * | | | | Services/VI: Dereferencing an uninitialized std::optional is undefined behavior.Subv2018-11-301-0/+2
| | |/ / / | |/| | | | | | | | | | | | | Assert that it is not empty before using it in the DequeueBuffer wait callback.
* | | | | Fix debug buildLioncash2018-12-011-1/+1
| |/ / / |/| | | | | | | | | | | | | | | A non-existent parameter was left in some formatting calls (the logging macro for which only does anything meaningful on debug builds)
* | | | service/set: Convert GetLanguageCode over to using PushEnum()Lioncash2018-11-301-1/+1
| | | | | | | | | | | | | | | | | | | | This code was around prior to the introduction of PushEnum, so convert it over so we don't need to cast here.
* | | | service/set: Implement MakeLanguageCodeLioncash2018-11-302-1/+19
|/ / / | | | | | | | | | This function simply converts a given index into a language code.
* | | Merge pull request #1801 from ogniK5377/log-before-executebunnei2018-11-2951-390/+860
|\ \ \ | | | | | | | | Changed logging to be "Log before execution", Added more error logging, all services/svc should now log on some level
| * | | Added comment on Main memory size for more clarityDavid Marcec2018-11-271-0/+1
| | | |
| * | | Made svcSetHeapSize and svcCreateSharedMemory more readableDavid Marcec2018-11-271-4/+4
| | | |
| * | | Reworked svcs slightly, improved error messages in AM and fsp_srvDavid Marcec2018-11-273-20/+30
| | | |
| * | | Fixed hwopus compile errorDavid Marcec2018-11-261-1/+1
| | | |
| * | | Improved error messages in AM, HwOpus and NvMapDavid Marcec2018-11-263-26/+39
| | | |
| * | | Improved error messages for SVCsDavid Marcec2018-11-261-76/+170
| | | |
| * | | Changed logging to be "Log before execution", Added more error logging, all services should now log on some levelDavid Marcec2018-11-2651-374/+726
| | | |
* | | | Merge pull request #1817 from DarkLordZach/npad-idx-fixbunnei2018-11-281-2/+2
|\ \ \ \ | | | | | | | | | | npad: Use NPadIdToIndex to prevent invalid array access
| * | | | npad: Use NPadIdToIndex to prevent invalid array accessZach Hilman2018-11-281-2/+2
| | | | |
* | | | | Merge pull request #1792 from bunnei/dma-pusherbunnei2018-11-281-5/+10
|\ \ \ \ \ | | | | | | | | | | | | gpu: Rewrite GPU command list processing with DmaPusher class.
| * | | | | dma_pushbuffer: Optimize to avoid loop and copy on Push.bunnei2018-11-281-8/+6
| | | | | |
| * | | | | gpu: Rewrite GPU command list processing with DmaPusher class.bunnei2018-11-271-3/+10
| | | | | | | | | | | | | | | | | | | | | | | | - More accurate impl., fixes Undertale (among other games).
* | | | | | Merge pull request #1814 from lioncash/ptrbunnei2018-11-282-28/+26
|\ \ \ \ \ \ | | | | | | | | | | | | | | file_sys/registered_cache: Use regular const references instead of std::shared_ptr for InstallEntry()
| * | | | | | file_sys/registered_cache: Remove unused <map> includeLioncash2018-11-271-1/+0
| | | | | | |
| * | | | | | file_sys/registered_cache: Use regular const references instead of std::shared_ptr for InstallEntry()Lioncash2018-11-272-27/+26
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | These parameters don't need to utilize a shared lifecycle directly in the interface. Instead, the caller should provide a regular reference for the function to use. This also allows the type system to flag attempts to pass nullptr and makes it more generic, since it can now be used in contexts where a shared_ptr isn't being used (in other words, we don't constrain the usage of the interface to a particular mode of memory management).
* | | | | | | npad: Fix copy/paste error with LED position assignmentsZach Hilman2018-11-271-3/+3
| | | | | | |
* | | | | | | Merge pull request #1802 from DarkLordZach/user-data-storagebunnei2018-11-273-17/+19
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | profile_manager: Save and load ProfileData from disk
| * | | | | | | profile_manager: Save and load ProfileData from diskZach Hilman2018-11-263-17/+19
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The ProfileData is a 0x80-sized structure that stores various pieces of miscellaneous data for the account.
* | | | | | | | control_metadata: Correct typo in language name (Portugese -> Portuguese)Lioncash2018-11-271-7/+17
| |/ / / / / / |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | While we're at it, organize the array linearly, since clang formats the array elements quite wide length-wise with the addition of the missing 'u'. Technically also fixes patch lookup and icon lookup with Portuguese, though I doubt anyone has actually run into this issue.
* | | | | | | Merge pull request #1804 from lioncash/castbunnei2018-11-271-1/+1
|\ \ \ \ \ \ \ | |_|/ / / / / |/| | | | | | gdbstub: Silence value truncation warning within FpuWrite()
| * | | | | | gdbstub: Silence value truncation warning within FpuWrite()Lioncash2018-11-271-1/+1
| | |/ / / / | |/| | | | | | | | | | | | | | | | | | | | | | Previously this would cause an implicit truncation warning about assigning a u64 value to a u32 value without an explicit cast.
* | | | | | svc: Implement svcSetResourceLimitLimitValue()Lioncash2018-11-271-1/+36
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The opposite of the getter functions, this function sets the limit value for a particular ResourceLimit resource category, with the restriction that the new limit value must be equal to or greater than the current resource value. If this is violated, then ERR_INVALID_STATE is returned. e.g. Assume: current[Events] = 10; limit[Events] = 20; a call to this service function lowering the limit value to 10 would be fine, however, attempting to lower it to 9 in this case would cause an invalid state error.
* | | | | | svc: Implement svcGetResourceLimitCurrentValue()Lioncash2018-11-271-16/+49
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This kernel service function is essentially the exact same as svcGetResourceLimitLimitValue(), with the only difference being that it retrieves the current value for a given resource category using the provided resource limit handle, rather than retrieving the limiting value of that resource limit instance. Given these are exactly the same and only differ on returned values, we can extract the existing code for svcGetResourceLimitLimitValue() to handle both values.
* | | | | | svc: Implement svcGetResourceLimitLimitValue()Lioncash2018-11-272-2/+33
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This kernel service function retrieves the maximum allowable value for a provided resource category for a given resource limit instance. Given we already have the functionality added to the resource limit instance itself, it's sufficient to just hook it up. The error scenarios for this are: 1. If an invalid resource category type is provided, then ERR_INVALID_ENUM is returned. 2. If an invalid handle is provided, then ERR_INVALID_HANDLE is returned (bad thing goes in, bad thing goes out, as one would expect). If neither of the above error cases occur, then the out parameter is provided with the maximum limit value for the given category and success is returned.
* | | | | | svc: Implement svcCreateResourceLimit()Lioncash2018-11-272-1/+27
|/ / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This function simply creates a ResourceLimit instance and attempts to create a handle for it within the current process' handle table. If the kernal fails to either create the ResourceLimit instance or create a handle for the ResourceLimit instance, it returns a failure code (OUT_OF_RESOURCE, and HANDLE_TABLE_FULL respectively). Finally, it exits by providing the output parameter with the handle value for the ResourceLimit instance and returning that it was successful. Note: We do not return OUT_OF_RESOURCE because, if yuzu runs out of available memory, then new will currently throw. We *could* allocate the kernel instance with std::nothrow, however this would be inconsistent with how all other kernel objects are currently allocated.
* | | | | Merge pull request #1793 from lioncash/refbunnei2018-11-262-2/+2
|\ \ \ \ \ | |_|/ / / |/| | | | service/sm: Take std::string by const reference in UnregisterService
| * | | | service/sm: Take std::string by const reference in UnregisterServiceLioncash2018-11-242-2/+2
| |/ / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | Avoids the need to create a copy of the std::string instance (potentially allocating). The only reason RegisterService takes its argument by value is because it's std::moved internally.
* | | | svc: Return ERR_INVALID_ENUM_VALUE from svcGetInfoLuke Street2018-11-251-1/+2
| | | |
* | | | Merge pull request #1791 from bunnei/nvdrv-stubbunnei2018-11-252-2/+18
|\ \ \ \ | |/ / / |/| | | nvdrv: Implement/stub DumpGraphicsMemoryInfo and GetStatus.
| * | | nvdrv: Implement/stub DumpGraphicsMemoryInfo and GetStatus.bunnei2018-11-242-2/+18
| | | | | | | | | | | | | | | | - Used by Undertale.
* | | | Merge pull request #1641 from DarkLordZach/sm-register-unregisterbunnei2018-11-242-2/+55
|\ \ \ \ | | | | | | | | | | sm: Implement RegisterService and UnregisterService
| * | | | sm: Implement RegisterService and UnregisterServiceZach Hilman2018-11-042-2/+55
| | | | | | | | | | | | | | | These are needed by Edizon to boot. They are used to see if a user is using SX OS, as SX OS registers a custom service called 'tx' and attempting to register a service of the same name lets the application know if it is present.
* | | | | Merge pull request #1731 from DarkLordZach/change-dir-crashbunnei2018-11-242-0/+6
|\ \ \ \ \ | | | | | | | | | | | | filesystem: Clear registered union paths on factory creation
| * | | | | filesystem: Clear registered union paths on factory creationZach Hilman2018-11-192-0/+6
| | |_|_|/ | |/| | |
* | | | | Merge pull request #1692 from Hedges/GDBCleanbunnei2018-11-241-37/+86
|\ \ \ \ \ | | | | | | | | | | | | GDBStub Improvements
| * | | | | GDBStub improvements:Hedges2018-11-131-37/+86
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | - Add FPU support - Fix access to TLS Fix clang-format.
* | | | | | Merge pull request #1708 from ogniK5377/res-scalebunnei2018-11-242-13/+31
|\ \ \ \ \ \ | | | | | | | | | | | | | | Report resolution scaling support for vi and am
| * | | | | | Removed hard coded values for width and heightDavid Marcec2018-11-191-2/+4
| | | | | | |
| * | | | | | Report resolution scaling support for vi and amDavid Marcec2018-11-162-13/+29
| | | | | | | | | | | | | | | | | | | | | | | | | | | | Specifying an internal resolution in yuzu now will report the scaled changes to vi and am.
* | | | | | | Merge pull request #1747 from DarkLordZach/exefs-lfsbunnei2018-11-242-2/+48
|\ \ \ \ \ \ \ | |_|_|_|_|/ / |/| | | | | | patch_manager: Add support for applying LayeredFS patches to ExeFS
| * | | | | | patch_manager: Show LayeredExeFS patch in add-ons columnZach Hilman2018-11-211-3/+14
| | | | | | | | | | | | | | | | | | | | | The decision was made to name them LayeredExeFS instead of just LayeredFS to differentiate from normal RomFS-based mods. The name may be long/unweildy, but conveys the meaning well.
| * | | | | | patch_manager: Apply LayeredExeFS patchesZach Hilman2018-11-201-0/+25
| | | | | | | | | | | | | | | | | | | | | | | | | | | | This will scan the <mod>/exefs dir for all files and then layer those on top of the game's exefs and use this as the new exefs. This allows for overriding of the compressed NSOs or adding new files. This does use the same dir as IPS/IPSwitch patch, but since the loader will not look for those they are ignored.
| * | | | | | settings: Add option to dump ExeFS of games upon launchZach Hilman2018-11-202-0/+10
| | | | | | | | | | | | | | | | | | | | | | | | | | | | When enabled, all exefs(es) will be copied to yuzu/dump/<title_id>/exefs.
* | | | | | | Merge pull request #1770 from DarkLordZach/applet-stubbunnei2018-11-234-4/+102
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | applets: Add StubApplet and use it as fallback when AppletId is not implemented
| * | | | | | | am: Return StubApplet instead of nullptr when AppletId not foundZach Hilman2018-11-223-11/+11
| | | | | | | |
| * | | | | | | applets: Add StubAppletZach Hilman2018-11-223-0/+98
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This will log all data it receives, log all calls to its methods and push dummy data into both channels on execution.
* | | | | | | | Merge pull request #1777 from lioncash/core-mgrbunnei2018-11-234-97/+225
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | core: Relocate CPU core management to its own class
| * | | | | | | | core: Relocate CPU core management to its own classLioncash2018-11-224-97/+225
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Keeps the CPU-specific behavior from being spread throughout the main System class. This will also act as the home to contain member functions that perform operations on all cores. The reason for this being that the following pattern is sort of prevalent throughout sections of the codebase: If clearing the instruction cache for all 4 cores is necessary: Core::System::GetInstance().ArmInterface(0).ClearInstructionCache(); Core::System::GetInstance().ArmInterface(1).ClearInstructionCache(); Core::System::GetInstance().ArmInterface(2).ClearInstructionCache(); Core::System::GetInstance().ArmInterface(3).ClearInstructionCache(); This is kind of... well, silly to copy around whenever it's needed. especially when it can be reduced down to a single line. This change also puts the basics in place to begin "ungrafting" all of the forwarding member functions from the System class that are used to access CPU state or invoke CPU-specific behavior. As such, this change itself makes no changes to the direct external interface of System. This will be covered by another changeset.
* | | | | | | | | Merge pull request #1762 from bunnei/getgputimebunnei2018-11-232-0/+19
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | nvhost_ctrl_gpu: Implement IoctlGetGpuTime.
| * | | | | | | | | nvhost_ctrl_gpu: Implement IoctlGetGpuTime.bunnei2018-11-212-0/+19
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | - Used by Undertale.
* | | | | | | | | | debug_pad: Avoid loading input for nonexistent buttons (Home and Screenshot)Zach Hilman2018-11-221-2/+3
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Prevents memory exceptions when the debug pad is enabled.
* | | | | | | | | | Merge pull request #1765 from bunnei/multi-audoutbunnei2018-11-222-9/+22
|\ \ \ \ \ \ \ \ \ \ | |_|/ / / / / / / / |/| | | | | | | | | audout_u: Add support for multiple IAudioOut streams.
| * | | | | | | | | audout_u: Add support for multiple IAudioOut streams.bunnei2018-11-222-9/+22
| |/ / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | - Used by Undertale.
* | | | | | | | | Merge pull request #1767 from lioncash/handlebunnei2018-11-222-12/+14
|\ \ \ \ \ \ \ \ \ | |_|/ / / / / / / |/| | | | | | | | kernel/handle_table: Minor changes
| * | | | | | | | kernel/handle_table: Move private static functions into the cpp fileLioncash2018-11-222-7/+9
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | These don't depend on class state, and are effectively implementation details, so they can go into the cpp file .
| * | | | | | | | kernel/handle_table: Restrict handle table size to 1024 entriesLioncash2018-11-221-5/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The previous handle table size is a holdover from Citra. The actual handle table construct on Horizon only allows for a maximum of 1024 entries.
| * | | | | | | | kernel/handle_table: Default destructor in the cpp fileLioncash2018-11-222-0/+3
| |/ / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | We don't need to potentially inline the teardown logic of all of the handle instances.
* | | | | | | | Merge pull request #1742 from lioncash/hle-swkbdbunnei2018-11-215-44/+63
|\ \ \ \ \ \ \ \ | |/ / / / / / / |/| | | | | | | am/applets: Minor cleanup
| * | | | | | | am/applets: Make the applet data broker part of the applet itself.Lioncash2018-11-205-31/+36
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The accessor should be doing just that, accessing, rather than retaining the lifetime of the data broker as well.
| * | | | | | | am/applets: Replace includes with forward declarations where applicableLioncash2018-11-202-2/+9
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Also resolve places where includes should have been provided, but weren't.
| * | | | | | | am/applets: Relocate comments above the relevant data member in AppletDataBrokerLioncash2018-11-201-11/+18
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Avoids wonky wrapping and makes it nicer to read.
* | | | | | | | am: Correct build failureLioncash2018-11-211-2/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The interface for shared memory was changed, but another commit was merged that relied on the (previously public) internals of SharedMemory. This amends that discrepancy.
* | | | | | | | Merge pull request #1734 from lioncash/sharedbunnei2018-11-213-29/+45
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | kernel/shared_memory: Make data members private, plus minor interface changes
| * | | | | | | | kernel/shared_memory: Make Map() and Unmap() take the target process by reference rather than as a pointerLioncash2018-11-193-12/+12
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Both member functions assume the passed in target process will not be null. Instead of making this assumption implicit, we can change the functions to be references and enforce this at the type-system level.
| * | | | | | | | kernel/shared_memory: Add a const qualified member function overload for GetPointer()Lioncash2018-11-192-1/+12
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Given this doesn't mutate instance state, we can provide a const-qualified variant as well.
| * | | | | | | | kernel/shared_memory: Use 64-bit types for offset and size in CreateForAppletLioncash2018-11-192-2/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Keeps the interface consistent with the regular Create() function.
| * | | | | | | | kernel/shared_memory: Make GetPointer() take a std::size_t instead of a u32Lioncash2018-11-192-2/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Makes the interface nicer to use in terms of 64-bit code, as it makes it less likely for one to get truncation warnings (and also makes sense in the context of the rest of the interface where 64-bit types are used for sizes and offsets
| * | | | | | | | kernel/shared_memory: Make data members privateLioncash2018-11-191-12/+17
| | |_|_|_|/ / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Rather than allow unfettered access to the class internals, we hide all members by default and create and API that other code can operate against.
* | | | | | | | Merge pull request #1733 from lioncash/ldrbunnei2018-11-211-29/+12
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | ldr: Clean up error codes
| * | | | | | | | ldr: Clean up error codesLioncash2018-11-191-29/+12
| |/ / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The separate enum isn't particularly necessary here, and the values can just be directly put into the ResultCode instances, given the names are also self-documenting here.
* | | | | | | | Merge pull request #1746 from lioncash/randombunnei2018-11-212-1/+1
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | kernel/process: Move <random> include to the cpp file
| * | | | | | | | kernel/process: Move <random> include to the cpp fileLioncash2018-11-202-1/+1
| | |/ / / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | <random> isn't necesary directly within the header and can be placed in the cpp file where its needed. Avoids propagating random generation utilities via a header file.
* / | | | | | | file_sys/card_image: Provide named members for the GamecardInfo structLioncash2018-11-211-1/+12
|/ / / / / / / | | | | | | | | | | | | | | | | | | | | | Fills out the struct according to information provided by SwitchBrew
* | | | | | | Merge pull request #1667 from DarkLordZach/swkbdbunnei2018-11-2012-106/+840
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | am: Implement HLE software keyboard applet
| * | | | | | | software_keyboard: Fix erroneous extra PushNormalDataZach Hilman2018-11-191-3/+2
| | | | | | | |
| * | | | | | | software_keyboard: Return correct result code on user cancel operationZach Hilman2018-11-193-5/+1
| | | | | | | |
| * | | | | | | applet: Add AppletDataBroker to manage HLE to AM service interactionZach Hilman2018-11-195-104/+194
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This cleans up most of the callbacks and such in the Applets::Applet interface, while also properly implementing all four data channels.
| * | | | | | | software_keyboard: Use correct offset for inital text stringZach Hilman2018-11-191-1/+2
| | | | | | | |
| * | | | | | | software_keyboard: Check for UTF-8 config flagZach Hilman2018-11-192-9/+23
| | | | | | | |
| * | | | | | | software_keyboard: Push all data over all channels on dialog completionZach Hilman2018-11-181-18/+26
| | | | | | | |
| * | | | | | | applet: Use std::queue instead of std::vector for storage stackZach Hilman2018-11-185-18/+44
| | | | | | | |
| * | | | | | | applet: Add operation completed callbackZach Hilman2018-11-184-6/+12
| | | | | | | |
| * | | | | | | software_keyboard: Push buffer size to offset 0x4 in output dataZach Hilman2018-11-184-18/+39
| | | | | | | |
| * | | | | | | software_keyboard: Make GetText asynchronousZach Hilman2018-11-185-11/+29
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | a
| * | | | | | | am: Allow applets to push multiple and different channels of dataZach Hilman2018-11-186-44/+41
| | | | | | | |
| * | | | | | | am: Implement ILibraryAppletAccessor IsCompleted and GetResultZach Hilman2018-11-182-4/+9
| | | | | | | |
| * | | | | | | am: Implement text check software keyboard modeZach Hilman2018-11-185-14/+103
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Allows the game to verify and send a message to the frontend.
| * | | | | | | am: Deglobalize software keyboard appletZach Hilman2018-11-1811-62/+106
| | | | | | | |
| * | | | | | | qt/main: Register Qt Software Keyboard frontend with AMZach Hilman2018-11-181-0/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Allows using Qt provider over default.
| * | | | | | | am: Construct and use proper applets with ILibraryAppletAccessorZach Hilman2018-11-181-1/+26
| | | | | | | | | | | | | | | | | | | | | | | | Allows use of software keyboard applet and future applets to be easily added by adding enum ID and a switch case.
| * | | | | | | am/applets: Add connector between frontend and AM applet classesZach Hilman2018-11-183-0/+130
| | | | | | | | | | | | | | | | | | | | | | | | Provides a middleman between the Frontend provider class and the expected AM::Applets::Applet class needed by ILibraryAppletAccessor
| * | | | | | | frontend/applets: Add frontend software keyboard provider and defaultZach Hilman2018-11-183-0/+63
| | | | | | | | | | | | | | | | | | | | | | | | Default implementation will return "yuzu" for any string. GUI clients (or CLI) can implement the Frontend::SoftwareKeyboardApplet class and register an instance to provide functionality.
| * | | | | | | am/applets: Add Applet superclass to describe a generic appletZach Hilman2018-11-183-0/+77
| | | | | | | | | | | | | | | | | | | | | | | | Adds an Initialize and Execute methods which are used by the ILibraryAppletAccessor to start and control the applet.
| * | | | | | | am: Unstub ILibraryAppletAccessor::StartZach Hilman2018-11-181-5/+17
| | | | | | | | | | | | | | | | | | | | | | | | Now starts the applet provided in constructor.
| * | | | | | | am: Implement PopInteractiveOutData and PushInteractiveInDataZach Hilman2018-11-181-14/+24
| | | | | | | | | | | | | | | | | | | | | | | | Used by software keyboard applet for data transfer.
| * | | | | | | am: Convert storage stack to vectorZach Hilman2018-11-181-27/+59
| | | | | | | | | | | | | | | | | | | | | | | | std::stack was no longer suitable for non-trivial operations
| * | | | | | | am: Move AM::IStorage to headerZach Hilman2018-11-181-0/+16
| | | | | | | | | | | | | | | | | | | | | | | | Needs to be accessible by applet files.
| * | | | | | | am: Move IStorageAccessor to header and update backing bufferZach Hilman2018-11-182-64/+62
| | | | | | | | | | | | | | | | | | | | | | | | Writes to an AM::IStorage object through an IStorageAccessor will now be preserved once the accessor is destroyed.
| * | | | | | | am: Implement CreateTransferMemoryStorageZach Hilman2018-11-182-0/+26
| | | | | | | | | | | | | | | | | | | | | | | | Creates an AM::IStorage object with the contents of the transfer memory located at the handle provided.
| * | | | | | | svc: Implement svcCreateTransferMemoryZach Hilman2018-11-181-3/+33
| | |/ / / / / | |/| | | | | | | | | | | | Seems to be used and created identically to SharedMemory, so just reuse that.
* | | | | | | Merge pull request #1739 from lioncash/lmbunnei2018-11-201-1/+12
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | lm: Implement SetDestination by doing nothing
| * | | | | | | lm: Implement SetDestination by doing nothingLioncash2018-11-201-1/+12
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This service function was likely intended to be a way to redirect where the output of a log went. e.g. Firing a log over a network, dumping over a tunneling session, etc. Given we always want to see the log and not change its output. It's one of the lucky service functions where the easiest implementation is to just do nothing at all and return success.
* | | | | | | | kernel/resource_limit: Clean up interfaceLioncash2018-11-206-190/+81
|/ / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Cleans out the citra/3DS-specific implementation details that don't apply to the Switch. Sets the stage for implementing ResourceLimit instances properly. While we're at it, remove the erroneous checks within CreateThread() and SetThreadPriority(). While these are indeed checked in some capacity, they are not checked via a ResourceLimit instance. In the process of moving out Citra-specifics, this also replaces the system ResourceLimit instance's values with ones from the Switch.
* | | | | | | hid: Use player-defined controller type as PREFERRED_CONTROLLERZach Hilman2018-11-196-215/+114
| | | | | | |
* | | | | | | hid/npad: Update NPad to use player controller bindings and typeZach Hilman2018-11-192-55/+108
| | | | | | |
* | | | | | | hid/touchscreen: Update Touchscreen to use advanced parametersZach Hilman2018-11-191-6/+6
| | | | | | | | | | | | | | | | | | | | | | | | | | | | Including finger ID, diamater x/y, and angle. Additionally, checks if the touchscreen is enabled.
* | | | | | | hid: Add controller bindings for Mouse controllerZach Hilman2018-11-192-4/+30
| | | | | | |
* | | | | | | hid: Add keyboard bindings for Keyboard controllerZach Hilman2018-11-192-2/+24
| | | | | | |
* | | | | | | hid: Add controller bindings for DebugPad controllerZach Hilman2018-11-192-21/+43
| | | | | | | | | | | | | | | | | | | | | | | | | | | | Used by developers to test games, not present on retail systems. Some games are known to respond to DebugPad input though, for example Kirby Star Allies.
* | | | | | | settings: Add settings for multiple players and controllersZach Hilman2018-11-191-3/+48
| | | | | | | | | | | | | | | | | | | | | | | | | | | | Uses the PlayerInput struct to represent all of the data that constitutes a player.
* | | | | | | settings: Add Native type for keyboardZach Hilman2018-11-191-0/+210
| | | | | | |
* | | | | | | settings: Add Native type for mouse buttonsZach Hilman2018-11-192-0/+34
| | | | | | |
* | | | | | | Added missing start/end touch attributes to touchscreenDavid Marcec2018-11-192-1/+18
| | | | | | |
* | | | | | | Added debugpad skeletonDavid Marcec2018-11-192-2/+55
| | | | | | |
* | | | | | | Added controller helper funcsDavid Marcec2018-11-192-0/+35
| | | | | | |
* | | | | | | Changed polling rate of hid and Right joycon rotationDavid Marcec2018-11-191-2/+2
| | | | | | |
* | | | | | | Left joycon rotation button remappingDavid Marcec2018-11-192-7/+21
| | | | | | |
* | | | | | | Added automatic npad switch based on supported stylesetsDavid Marcec2018-11-192-4/+124
| | | | | | |
* | | | | | | Added multi-input support and controller assignment at any portDavid Marcec2018-11-192-122/+181
| |/ / / / / |/| | | | |
* | | | | | Merge pull request #1620 from DarkLordZach/ldr-robunnei2018-11-197-23/+405
|\ \ \ \ \ \ | | | | | | | | | | | | | | ldr_ro: Complete LDR:RO implementation
| * | | | | | ldr_ro: Add error check for memory allocation failureZach Hilman2018-11-184-13/+27
| | | | | | |
| * | | | | | ldr_ro: Implement UnloadNro (command 1)Zach Hilman2018-11-151-22/+85
| | | | | | | | | | | | | | | | | | | | | | | | | | | | Includes actual unmapping and address error checking.
| * | | | | | ldr_ro: Fully Implement LoadNro (command 0)Zach Hilman2018-11-151-11/+110
| | | | | | | | | | | | | | | | | | | | | | | | | | | | Includes NRO and BSS error checking, maximum loaded NRO check, NRR hash check, and proper remapping of BSS data.
| * | | | | | ldr_ro: Implement UnloadNrr (command 3)Zach Hilman2018-11-151-2/+84
| | | | | | | | | | | | | | | | | | | | | | | | | | | | Includes initialization check, proper address check, alignment check, and actual unloading of a loaded NRR.
| * | | | | | ldr_ro: Fully implement LoadNrr (command 2)Zach Hilman2018-11-151-0/+112
| | | | | | | | | | | | | | | | | | | | | | | | | | | | Includes parameter error checking, hash enforcement, initialization check, and max NRR load check.
| * | | | | | process: Make MirrorMemory take state to map new memory asZach Hilman2018-11-152-3/+7
| | | | | | | | | | | | | | | | | | | | | | | | | | | | Credits to Subv
| * | | | | | pl_u: Resize buffers in shared font data getter to what game requestsZach Hilman2018-11-151-0/+8
| | | | | | | | | | | | | | | | | | | | | | | | | | | | Fixes unmapped spam in SMP and buffer size errors in some other games
* | | | | | | Merge pull request #1718 from ogniK5377/lets-go-softlockbunnei2018-11-193-1/+18
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | Implemented CalculateStandardUserSystemClockDifferenceByUser
| * | | | | | | Implemented CalculateStandardUserSystemClockDifferenceByUserDavid Marcec2018-11-173-1/+18
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Seems pokemon calls this sometimes and it caused "random crashes"
* | | | | | | | Merge pull request #1671 from DarkLordZach/vi-disconnectbunnei2018-11-191-0/+22
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | vi: Implement TransactParcel for Disconnect and DetachBuffer
| * | | | | | | | vi: Implement TransactParcel for Disconnect and DetachBufferZach Hilman2018-11-171-0/+22
| | |_|_|_|_|/ / | |/| | | | | | | | | | | | | | | | | | | | | | Used by homebrew on exit. According to switchbrew, returns an empty response parcel with one zero in it.
* | | | | | | | Merge pull request #1728 from FearlessTobi/reset-signalMat M2018-11-181-1/+1
|\ \ \ \ \ \ \ \ | |_|_|_|/ / / / |/| | | | | | | svc: ResetSignal is not stubbed
| * | | | | | | svc: ResetSignal is not stubbedTobias2018-11-181-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | https://user-images.githubusercontent.com/20753089/48677874-b8e01c80-eb7b-11e8-8043-b99faa29022c.PNG
* | | | | | | | Stubbed am:EnableApplicationCrashReportMysticExile2018-11-172-10/+18
| | | | | | | |
* | | | | | | | Merge pull request #1711 from ogniK5377/bluetooth-lets-gobunnei2018-11-172-1/+145
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | Added various bluetooth based cmds for palma
| * | | | | | | | Added various bluetooth based cmds for palmaDavid Marcec2018-11-162-1/+145
| | |_|_|_|/ / / | |/| | | | | | | | | | | | | | | | | | | | | | It seems palma is done through bluetooth, we need this for pokemon go however more research needs to be done when we actually get palma working. This is presumably used for transfering data between the controller and the console, it does not seem for actual input as far as I know.
* | | | | | | | Merge pull request #1719 from bunnei/hwopus-fixbunnei2018-11-171-1/+1
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | hwopus: DecodeInterleavedWithPerformance: Fix ordering of output parameters.
| * | | | | | | | hwopus: DecodeInterleavedWithPerformance: Fix ordering of output parameters.bunnei2018-11-171-1/+1
| | |_|_|/ / / / | |/| | | | | | | | | | | | | | | | | | | | | | - Fixes audio issues with Pokemon: Let's Go Pikachu & Eevee.
* / | | | | | | kernel/errors: Clean up error codesLioncash2018-11-162-62/+32
|/ / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Similar to PR 1706, which cleans up the error codes for the filesystem code, but done for the kernel error codes. This removes the ErrCodes namespace and specifies the errors directly. This also fixes up any straggling lines of code that weren't using the named error codes where applicable.
* | | | | | | Merge pull request #1638 from FreddyFunk/SetMemoryPermission-StubbedMat M2018-11-162-1/+48
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | Implement SetMemoryPermission
| * | | | | | | Implement SetMemoryPermissionFrederic Laing2018-11-061-3/+39
| | | | | | | |
| * | | | | | | Stubbed SetMemoryPermissionFrederic Laing2018-11-032-1/+12
| | |_|/ / / / | |/| | | | |
* | | | | | | Merge pull request #1632 from DarkLordZach/keys-manager-optimizationsbunnei2018-11-1610-14/+34
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | game_list: Optimize game list refresh
| * | | | | | | filesystem: Cache RegisteredCacheUnion instead of constructing on demandZach Hilman2018-11-022-4/+11
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Prevents unnecessary re-reads of the metadata and unnecessary temporary objects.
| * | | | | | | file_sys: Use common KeyManager in NCA container typesZach Hilman2018-11-026-7/+18
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Creates a single KeyManager for the entire container and then passes it into the NCA constructor, eliminating several unnecessary KeyManager reads.
| * | | | | | | content_archive: Add optional KeyManager parameter to constructorZach Hilman2018-11-022-3/+5
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Allows resuing a common KeyManager when a large amount of NCAs are handled by the same class. Should the parameter not be provided, a new KeyManager will be constructed, as was the default behavior prior to this.
* | | | | | | | Merge pull request #1706 from lioncash/file-errbunnei2018-11-164-33/+16
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | file_sys/errors: Clean up error code values
| * | | | | | | | file_sys/errors: Remove currently unused filesystem error codesLioncash2018-11-161-10/+0
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Rather than keeping around unused values, we can just introduce them as needed.
| * | | | | | | | file_sys/errors: Get rid of the ErrCodes namespaceLioncash2018-11-161-17/+5
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | There's no real point to keeping the separate enum around, especially given the name of the error code itself is supposed to document what the value actually represents.
| * | | | | | | | file_sys/errors: Extract FS-related error codes to file_sys/errors.hLioncash2018-11-164-14/+19
| | |_|/ / / / / | |/| | | | | | | | | | | | | | | | | | | | | | Keeps filesystem-related error codes in one spot.
* / | | | | | | Added SetIsPalmaAllConnectable, SetPalmaBoostModeDavid Marcec2018-11-161-2/+14
|/ / / / / / / | | | | | | | | | | | | | | | | | | | | | Currently unclear what these do yet, will be researched at a later time when we want to implement palma.
* | | | | | | Fixed priority switching edge case for handheld (#1675)David2018-11-161-12/+46
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * Fixed priority switching edge case for handheld We accidently used controller index instead of npad id * Moved NPadIdToIndex
* | | | | | | Merge pull request #1699 from DarkLordZach/deterministic-rng-3bunnei2018-11-161-1/+2
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | csrng: Use random integer distribution instead of raw engine
| * | | | | | | csrng: Use random integer distribution instead of raw engineZach Hilman2018-11-161-1/+2
| | |_|_|/ / / | |/| | | | | | | | | | | | | | | | | | | Prevents returning the same value every single call.
* | | | | | | Merge pull request #1687 from lioncash/deduplicationbunnei2018-11-152-37/+13
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | kernel/thread: Deduplicate scheduler switching code
| * | | | | | | kernel/thread: Deduplicate scheduler switching codeLioncash2018-11-142-37/+13
| | |_|_|_|/ / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | The code in both places was the same verbatim, so we can extract it to a function to deduplicate the logic.
* | | | | | | Merge pull request #1618 from DarkLordZach/dump-nsobunnei2018-11-157-7/+48
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | patch_manager: Add support for dumping uncompressed NSOs
| * | | | | | | patch_manager: Add support for dumping decompressed NSOsZach Hilman2018-10-292-1/+14
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | When enabled in settings, PatchNSO will dump the unmodified NSO that it was passed to a file named <build id>.nso in the dump root for the current title ID.
| * | | | | | | settings: Add setting to control NSO dumpingZach Hilman2018-10-291-0/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Also adds UI option in Debug > Dump section, with the idea later things to be dumped (i.e. other game data or textures, etc) will use the same group box.
| * | | | | | | bis_factory: Add getter for mod dump root for a title IDZach Hilman2018-10-294-6/+33
| | |_|_|_|/ / | |/| | | | | | | | | | | | | | | | | | | Equates to yuzu_dir/dump/<title id>/
* | | | | | | Merge pull request #1691 from lioncash/audrenbunnei2018-11-151-3/+3
|\ \ \ \ \ \ \ | |_|_|/ / / / |/| | | | | | service/audren_u: Forward RequestUpdateAuto through the same function as RequestUpdate
| * | | | | | service/audren_u: Forward RequestUpdateAuto through the same function as RequestUpdateLioncash2018-11-141-3/+3
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Based off RE, they both currently go through the same codepath with no difference in behavior.
* | | | | | | Merge pull request #1697 from lioncash/accbunnei2018-11-152-15/+23
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | acc/profile_manager: Minor cleanup-related changes
| * | | | | | | profile_manager: Replace iterative loop with a ranged-for loop in ParseUserSaveFile()Lioncash2018-11-141-4/+5
| | | | | | | |
| * | | | | | | profile_manager: Move UUID Format function definitions into the cpp fileLioncash2018-11-142-11/+18
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Avoids relying on fmt always being indirectly included.
* | | | | | | | Merge pull request #1696 from lioncash/acc-condbunnei2018-11-151-2/+4
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | service/acc: Correct error case within TrySelectUserWithoutInteraction()
| * | | | | | | | service/acc: Correct error case within TrySelectUserWithoutInteraction()Lioncash2018-11-141-2/+4
| |/ / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | empty() in this case will always return false, since the returned container is a std::array. Instead, check if all given users are invalid before returning the error code.
* | | | | | | | Merge pull request #1690 from lioncash/nfpbunnei2018-11-141-1/+1
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | nfp: Correct erroneous sizeof expression within GetTagInfo()
| * | | | | | | | nfp: Correct erroneous sizeof expression within GetTagInfo()Lioncash2018-11-141-1/+1
| | |_|_|/ / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The previous expression would copy sizeof(size_t) amount of bytes (8 on a 64-bit platform) rather than the full 10 bytes comprising the uuid member. Given the source and destination types are the same, we can just use an assignment here instead.
* | | | | | | | Merge pull request #1689 from lioncash/breakbunnei2018-11-141-0/+1
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | hid/npad: Add missing break in switch statement within Controller_NPad::OnUpdate
| * | | | | | | | hid/npad: Add missing break in switch statement within Controller_NPad::OnUpdate()Lioncash2018-11-141-0/+1
| |/ / / / / / /
* | | | | | | | Merge pull request #1688 from lioncash/unusedbunnei2018-11-141-2/+2
|\ \ \ \ \ \ \ \ | |_|/ / / / / / |/| | | | | | | service: Mark MakeFunctionString with the [[maybe_unused]] attribute.
| * | | | | | | service: Mark MakeFunctionString with the [[maybe_unused]] attribute.Lioncash2018-11-141-2/+2
| |/ / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | When yuzu is compiled in release mode this function is unused, however, when compiled in debug mode, it's used within a LOG_TRACE statement. This prevents erroneous compilation warnings about an unused function (that isn't actually totally unused).
* | | | | | | Merge pull request #1679 from DarkLordZach/deterministic-rng-2bunnei2018-11-144-2/+28
|\ \ \ \ \ \ \ | |_|/ / / / / |/| | | | | | svc: Use proper random entropy generation algorithm
| * | | | | | svc: Use proper random entropy generation algorithmZach Hilman2018-11-134-2/+28
| |/ / / / /
* | | | | | Merge pull request #1680 from lioncash/membunnei2018-11-144-86/+98
|\ \ \ \ \ \ | | | | | | | | | | | | | | kernel/process: Migrate heap-related memory management out of the process class and into the vm manager
| * | | | | | vm_manager: Unstub GetTotalHeapUsage()Lioncash2018-11-131-2/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Now that we've moved all of the heap-related stuff to the VMManager class, we can unstub this function, as the necessary members are visible now.
| * | | | | | kernel/process: Migrate heap-related memory management out of the process class and into the vm managerLioncash2018-11-134-84/+97
| |/ / / / / | | | | | | | | | | | | | | | | | | | | | | | | Avoids a breach of responsibilities in the interface and keeps the direct code for memory management within the VMManager class.
* | | | | | Merge pull request #1682 from lioncash/audiobunnei2018-11-141-2/+23
|\ \ \ \ \ \ | | | | | | | | | | | | | | hle/audren_u: Implement Get/SetRenderingTimeLimit
| * | | | | | hle/audren_u: Implement Get/SetRenderingTimeLimitLioncash2018-11-131-2/+23
| |/ / / / / | | | | | | | | | | | | | | | | | | | | | | | | These appear to be a basic getter and setter pair, so these are fairly trivial to implement and get out of the way.
* | | | | | Merge pull request #1608 from DarkLordZach/save-data-readerbunnei2018-11-1410-16/+260
|\ \ \ \ \ \ | |/ / / / / |/| | | | | [ns|fsp_srv]: Implement various functions to boot Checkpoint
| * | | | | ns: Implement command 400: GetApplicationControlDataZach Hilman2018-10-294-17/+75
| | | | | | | | | | | | | | | | | | Returns the raw NACP bytes and the raw icon bytes into a title-provided buffer. Pulls from Registration Cache for control data, returning all zeros should it not exist.
| * | | | | fsp_srv: Implement ISaveDataInfoReaderZach Hilman2018-10-291-0/+144
| | | | | | | | | | | | | | | | | | | | | | | | An object to read SaveDataInfo objects, which describe a unique save on the system. This implementation iterates through all the directories in the save data space and uses the paths to reconstruct the metadata.
| * | | | | fsp_srv: Implement command 61: OpenSaveDataInfoReaderBySaveDataSpaceIdZach Hilman2018-10-292-1/+13
| | | | | | | | | | | | | | | | | | | | | | | | Needed by Checkpoint. Returns an object that can iterate through all savedata on the system.
| * | | | | savedata_factory: Expose accessors for SaveDataSpaceZach Hilman2018-10-294-14/+32
| | | | | |
| * | | | | loader/nro: Call RegisterRomFS from LoadZach Hilman2018-10-291-0/+5
| | | | | | | | | | | | | | | | | | | | | | | | Allows NRO homebrew to use the RomFS in the ASET section.
| * | | | | control_metadata: Add GetRawBytes function to NACPZach Hilman2018-10-292-0/+7
| |/ / / / | | | | | | | | | | | | | | | Returns the raw bytes of the NACP file. Needed for GetApplicationControlData which returns the raw, unprocessed NACP to the game.
* | | | | Merge pull request #1670 from DarkLordZach/deterministic-rngbunnei2018-11-134-3/+15
|\ \ \ \ \ | | | | | | | | | | | | csrng: Add config option to set RNG seed
| * | | | | svc: Return random seed for svcGetInfo RandomEntropyZach Hilman2018-11-131-1/+2
| | | | | |
| * | | | | settings: Add config option to set RNG seedZach Hilman2018-11-121-0/+2
| | | | | |
| * | | | | csrng: Use std::mt19937 engine for random number generationZach Hilman2018-11-122-2/+11
| | |_|_|/ | |/| | |
* | | | | Merge pull request #1665 from ogniK5377/GetClockSnapshotbunnei2018-11-133-21/+132
|\ \ \ \ \ | |/ / / / |/| | | | Implement GetClockSnapshot, ToPosixTime & ToPosixTimeWithMyRule
| * | | | Added maybe_unusedDavid Marcec2018-11-102-2/+7
| | | | |
| * | | | Added ToPosixTime & ToPosixTimeWithMyRuleDavid Marcec2018-11-101-2/+41
| | | | | | | | | | | | | | | | | | | | Added instead of using a seperate PR to prevent conflicts
| * | | | Added consts and staticDavid Marcec2018-11-101-6/+6
| | | | |
| * | | | Implement GetClockSnapshotDavid Marcec2018-11-093-21/+88
| | | | | | | | | | | | | | | | | | | | Needed by megaman 11
* | | | | Merge pull request #1652 from FreddyFunk/static-castbunnei2018-11-111-2/+2
|\ \ \ \ \ | | | | | | | | | | | | configure_system: Fix compiler warning
| * | | | | configure_system: Fix compiler warningFrederic Laing2018-11-061-2/+2
| | | | | |
* | | | | | Merge pull request #1656 from ogniK5377/message-queueJames Rowe2018-11-106-35/+138
|\ \ \ \ \ \ | |_|/ / / / |/| | | | | Ability to switch between docked and undocked mode in-game
| * | | | | FixupsDavid Marcec2018-11-071-1/+1
| | | | | |
| * | | | | Ability to switch between docked and undocked mode in-gameDavid Marcec2018-11-076-35/+138
| |/ / / / | | | | | | | | | | | | | | | Started implementation of the AM message queue mainly used in state getters. Added the ability to switch docked mode whilst in game without stopping emulation. Also removed some things which shouldn't be labelled as stubs as they're implemented correctly
* | | | | Merge pull request #1658 from ogniK5377/holdtype-stylebunnei2018-11-081-0/+2
|\ \ \ \ \ | | | | | | | | | | | | Updated npad styles on holdtype switches
| * | | | | Updated npad styles on holdtype switchesDavid Marcec2018-11-071-0/+2
| |/ / / / | | | | | | | | | | | | | | | Fixes input for megaman
* | | | | svcBreak now dumps information from the debug buffer passed (#1646)David2018-11-081-0/+28
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * svcBreak now dumps information from the debug buffer passed info1 and info2 seem to somtimes hold an address to a buffer, this is usually 4 bytes or the size of the int and contains an error code. There's other circumstances where it can be something different so we hexdump these to examine them at a later date. * Addressed comments
* | | | | fixed spelling errorDavid Marcec2018-11-071-1/+1
| | | | |
* | | | | Added missing logDavid Marcec2018-11-071-0/+1
| | | | |
* | | | | Implement acc:TrySelectUserWithoutInteractionDavid Marcec2018-11-075-3/+25
|/ / / / | | | | | | | | | | | | Needed for Shantae - Half-Genie Hero - Ultimate Edition!
* | | | Merge pull request #1633 from ogniK5377/reload-inputbunnei2018-11-052-0/+5
|\ \ \ \ | | | | | | | | | | Fixed HID crash when launching more than 1 game & signaled styleset change event
| * | | | Fixed HID crash when launching more than 1 game & signaled syleset change eventDavid Marcec2018-11-022-0/+5
| | | | | | | | | | | | | | | | | | | | This should fix crashes when launching multiple games in yuzu
* | | | | Fix typo in BufferTransformFlagsFrederic Laing2018-11-041-2/+2
| |_|_|/ |/| | |
* | | | Fixed incorrect hwopus assertDavid Marcec2018-11-021-1/+1
|/ / /
* | | Merge pull request #1615 from lioncash/inputbunnei2018-11-021-1/+2
|\ \ \ | | | | | | | | configure_system: Contrain profile usernames to 32 characters
| * | | configure_system: Contrain profile usernames to 32 charactersLioncash2018-10-311-1/+2
| |/ / | | | | | | | | | | | | | | | | | | | | | | | | | | | Previously, we would let a user enter an unbounded name and then silently truncate away characters that went over the 32-character limit. This is kind of bad from the UX point of view, because we're essentially not doing what the user intended in certain scenarios. Instead, we clamp it to 32 characters and make that visually apparent in the dialog box to provide a name for a user.
* | | Merge pull request #1604 from FearlessTobi/port-4369bunnei2018-11-012-0/+15
|\ \ \ | | | | | | | | Port citra-emu/citra#4369: "compatdb: Use a seperate endpoint for testcase submission"
| * | | compatdb: Use a seperate endpoint for testcase submissionfearlessTobi2018-10-282-0/+15
| | | |
* | | | service/usb: Update IPdSession's function tableLioncash2018-10-301-3/+3
| |_|/ |/| | | | | | | | Updated based off information on SwitchBrew.
* | | general: Remove unused boost inclusions where applicableLioncash2018-10-302-3/+0
| | | | | | | | | | | | Cleans up unused includes and trims off some dependencies on externals.
* | | global: Use std::optional instead of boost::optional (#1578)Frederic L2018-10-3024-144/+141
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * get rid of boost::optional * Remove optional references * Use std::reference_wrapper for optional references * Fix clang format * Fix clang format part 2 * Adressed feedback * Fix clang format and MacOS build
* | | Merge pull request #1621 from lioncash/ipcbunnei2018-10-303-6/+9
|\ \ \ | | | | | | | | hle_ipc: Make GetDomainMessageHeader return a regular pointer
| * | | hle_ipc: Add member function for querying the existence of a domain headerLioncash2018-10-303-3/+6
| | | | | | | | | | | | | | | | Gets rid of the need to call the getter and then check for null.
| * | | hle_ipc: Make GetDomainMessageHeader return a regular pointerLioncash2018-10-302-3/+3
| | |/ | |/| | | | | | | | | | Nothing requires the shared owner ship here, so we can just return a plain pointer.
* | | core: Make System references const where applicableLioncash2018-10-282-3/+3
| | |
* | | core: Add missing const variants of getters for the System classLioncash2018-10-282-10/+49
|/ / | | | | | | | | | | Many of the Current<Thing> getters (as well as a few others) were missing const qualified variants, which makes it a pain to retrieve certain things from const qualified references to System.
* | Merge pull request #1593 from lioncash/svcbunnei2018-10-286-35/+128
|\ \ | | | | | | svc: Implement svcGetInfo command 0xF0000002
| * | svc: Localize the GetInfo enum class to the function itselfLioncash2018-10-262-32/+31
| | | | | | | | | | | | Nothing from this enum is intended to be used outside of this function.
| * | svc: Implement svcGetInfo command 0xF0000002Lioncash2018-10-266-4/+98
| |/ | | | | | | | | | | | | | | | | | | This retrieves: if (curr_thread == handle_thread) { result = total_thread_ticks + (hardware_tick_count - last_context_switch_ticks); } else if (curr_thread == handle_thread && sub_id == current_core_index) { result = hardware_tick_count - last_context_switch_ticks; }
* | file_sys/patch_manager: Remove unnecessary if-statements (#1586)Frederic L2018-10-281-7/+6
| | | | | | | | | | | | * remove unnecessary if-statements * Addressed feedback
* | Merge pull request #1598 from DeeJayBro/delete-directorybunnei2018-10-281-2/+26
|\ \ | | | | | | service/filesystem: Implemented DeleteDirectory & DeleteDirectoryRecursive
| * | service/filesystem: Add DirectoryDelete & DirectoryDeleteRecursivelyDeeJayBro2018-10-271-2/+26
| |/
* | Merge pull request #1600 from DarkLordZach/nsp-secondary-loader-fixbunnei2018-10-281-17/+20
|\ \ | | | | | | loader/nsp: Move secondary loader initialization to constructor
| * | loader/nsp: Move secondary loader initialization to constructorZach Hilman2018-10-271-17/+20
| |/ | | | | | | Prevents nullptr bug when trying to dump the RomFS of an NSP resulting from secondary_loader not being initialized.
* / key_manager: Use isxdigit instead of isdigit when reading key fileZach Hilman2018-10-281-1/+1
|/ | | | Crypto revisions are hex numbers and this function only checks if the string is valid for stoul in base 16, so it should be isxdigit.
* Merge pull request #1430 from DarkLordZach/remove-promote-dirbunnei2018-10-2617-95/+1
|\ | | | | vfs: Remove InterpretAsDirectory and related functions
| * vfs: Remove InterpretAsDirectory and related functionsZach Hilman2018-10-1917-95/+1
| | | | | | | | When writing VFS, it initally seemed useful to include a function to in-place convert container files into directories in one homogenous directory structure, but re-evaluating it now there have been plenty of chances to use it and there has always been a better way. Removing as it is unused and likely will not be used.
* | Merge pull request #1569 from lioncash/amiibobunnei2018-10-262-3/+5
|\ \ | | | | | | yuzu/main: Notify user of loading errors with Amiibo data
| * | yuzu/main: Notify user of loading errors with Amiibo dataLioncash2018-10-242-3/+5
| | | | | | | | | | | | | | | We shouldn't silently continue if loading failed, since the general assumption is that no messages showing up implicitly indicates success.
* | | ldr: Partially implement LoadNro.bunnei2018-10-261-3/+49
| | | | | | | | | | | | - This is an incomplete implementation. It was tested with Super Mario Party.
* | | process: LoadModule should clear JIT instruction cache.bunnei2018-10-261-0/+6
| | |
* | | Kernel/Memory: Added a function to first a suitable guest address at which to allocate a region of a given size.bunnei2018-10-262-0/+28
| | |
* | | nro: Make LoadNro method accessible outside of apploader code.bunnei2018-10-262-6/+18
| | |
* | | ips_layer: Use rle_size instead of data_size in RLE patch applicationZach Hilman2018-10-251-1/+1
| | | | | | | | | | | | Prevents a potential bug when using RLE records in an IPS patch.
* | | Merge pull request #1579 from lioncash/usbbunnei2018-10-251-21/+22
|\ \ \ | | | | | | | | service/usb: Update service function tables
| * | | service/usb: Update service function tablesLioncash2018-10-251-21/+22
| | | | | | | | | | | | | | | | Updated based off the information provided by Hexkyz on Switchbrew.
* | | | Merge pull request #1576 from lioncash/acc-warnbunnei2018-10-251-25/+27
|\ \ \ \ | | | | | | | | | | service/acc: Silence compiler truncation warnings
| * | | | service/acc: Move fallback image to file scopeLioncash2018-10-251-14/+13
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This is just flat data, so it doesn't really need to be in the function itself. This also allows deduplicating the constant for the backup size in GetImageSize().
| * | | | service/acc: Silence compiler warningsLioncash2018-10-251-5/+8
| | | | | | | | | | | | | | | | | | | | | | | | | Silences compiler warnings related to truncation. This also introduces a small helper function to perform the clamping of the image size.
| * | | | service/acc: Early return in failure case in LoadImage()Lioncash2018-10-251-8/+8
| |/ / / | | | | | | | | | | | | Allows unindenting the other branch's code.
* | | | Merge pull request #1577 from lioncash/errbunnei2018-10-255-34/+16
|\ \ \ \ | | | | | | | | | | kernel/error: Amend error return code values
| * | | | kernel/errors: Remove now-unused, unnecessary, error codesLioncash2018-10-242-13/+0
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Now that we've gotten the innaccurate error codes out of the way, we can finally toss away a bunch of these, trimming down the error codes to ones that are actually used and knocking out two TODO comments.
| * | | | kernel/shared_memory: Return ERR_INVALID_MEMORY_PERMISSIONS instead of ERR_INVALID_COMBINATIONLioncash2018-10-241-4/+3
| | | | | | | | | | | | | | | | | | | | This is more consistent with what the kernel does.
| * | | | kernel/server_port: Simplify emptiness check within ShouldWait()Lioncash2018-10-241-1/+1
| | | | |
| * | | | kernel/server_port: Change error case return value in Accept() to ERR_NOT_FOUNDLioncash2018-10-242-3/+1
| | | | | | | | | | | | | | | | | | | | This is what the kernel does in this instance.
| * | | | kernel/error: Remove leftover 3DS error codesLioncash2018-10-241-5/+0
| | | | | | | | | | | | | | | | | | | | These are now entirely unused and can be removed.
| * | | | kernel/svc: Amend returned error code for invalid priorities in CreateThreadLioncash2018-10-241-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | Like with the previous change, the kernel doesn't return NOT_AUTHORIZED here. It returns INVALID_THREAD_PRIORITY.
| * | | | kernel/svc: Move and correct returned error code for invalid thread priorities in SetThreadPriority()Lioncash2018-10-241-5/+6
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | All priority checks are supposed to occur before checking the validity of the thread handle, we're also not supposed to return ERR_NOT_AUTHORIZED here.
| * | | | kernel/error: Add error code for invalid pointersLioncash2018-10-241-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | The kernel appears to return 0xE601 for this situation. Particularly in svcWaitSynchronization, svcReplyAndReceive, and svcGetThreadContext
| * | | | kernel/error: Add error code for closed sessionsLioncash2018-10-241-1/+3
| |/ / / | | | | | | | | | | | | The kernel appears to return 0xF601 for this case.
* | | | Merge pull request #1570 from lioncash/optionalbunnei2018-10-253-43/+48
|\ \ \ \ | | | | | | | | | | profile_manager: Use std::optional instead of boost::optional
| * | | | profile_manager: Use std::optional instead of boost::optionalLioncash2018-10-243-43/+48
| |/ / / | | | | | | | | | | | | | | | | Now that we can actually use std::optional on macOS, we don't need to continue using boost::optional here.
* | | | Merge pull request #1564 from lioncash/npadbunnei2018-10-241-2/+3
|\ \ \ \ | | | | | | | | | | npad: Remove unused controller variable from OnInit()
| * | | | npad: Remove unused controller variable from OnInit()Lioncash2018-10-241-2/+3
| | |/ / | |/| | | | | | | | | | | | | | This also gets rid of variable shadowing related to the lambda parameter a little bit below this code as well.
* | | | Merge pull request #1563 from lioncash/framebunnei2018-10-241-4/+0
|\ \ \ \ | | | | | | | | | | perf_stats: Remove unused variable within DoFrameLimiting()
| * | | | perf_stats: Remove unused variable within DoFrameLimiting()Lioncash2018-10-241-4/+0
| |/ / / | | | | | | | | | | | | This hasn't been used since ba8ff096fdc9f7ab101851c4cd06c3244a7d84c3
* | | | Merge pull request #1562 from lioncash/aocbunnei2018-10-241-3/+3
|\ \ \ \ | | | | | | | | | | aoc_u: Make use of previously-unused CheckAOCTitleIDMatchesBase() function
| * | | | aoc_u: Make use of previously-unused CheckAOCTitleIDMatchesBase() functionLioncash2018-10-241-3/+3
| |/ / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | We can just call the function instead of duplicating the code here. This also prevents an unused function warning. We also don't need to take the lambda capture by reference. It's just a u64 value, so by value is fine here.
* | | | Merge pull request #1561 from lioncash/fsbunnei2018-10-242-3/+6
|\ \ \ \ | |_|/ / |/| | | file_sys: Remove unused variables
| * | | vfs: Handle failure of file reading within VfsRawCopy()Lioncash2018-10-241-2/+6
| | | | | | | | | | | | | | | | Also gets rid of an unused variable.
| * | | key_manager: Remove unused variable in DeriveBase()Lioncash2018-10-241-1/+0
| |/ /
* | | Merge pull request #1468 from DarkLordZach/profile-manager-uiMat M2018-10-245-30/+227
|\ \ \ | |/ / |/| | qt: Add UI to manage emulated user profiles
| * | profile_manager: Create save data if it doesn't exist on useZach Hilman2018-10-242-13/+37
| | |
| * | acc: Fix account UUID duplication errorZach Hilman2018-10-244-17/+47
| | |
| * | configure_system: Clear selection after user deleteZach Hilman2018-10-241-1/+1
| | |
| * | profile_manager: Load user icons, names, and UUIDs from system saveZach Hilman2018-10-245-28/+129
| | |
| * | acc: Load user images from config dirZach Hilman2018-10-241-9/+45
| | |
| * | am: Pass current user UUID to launch parametersZach Hilman2018-10-241-7/+9
| | |
| * | profile_manager: Load users from emulator settingsZach Hilman2018-10-242-5/+7
| | |
| * | settings: Add users and current_user settings and remove usernameZach Hilman2018-10-241-1/+3
| | |
* | | Merge pull request #1551 from ogniK5377/improved-svcbreakbunnei2018-10-241-5/+51
|\ \ \ | |/ / |/| | Added break types to svcBreak
| * | Added assertion failed, reworked logging levelsDavid Marcec2018-10-231-16/+24
| | |
| * | Added break types to svcBreakDavid Marcec2018-10-231-4/+42
| | | | | | | | | | | | There seems to be more such as type 1, and 2. Unsure what these currently are but when a game hits them we can investigate and add the rest
* | | Added Amiibo support (#1390)David2018-10-244-50/+295
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * Fixed conflict with nfp * Few fixups for nfc * Conflict 2 * Fixed AttachAvailabilityChangeEvent * Conflict 3 * Fixed byte padding * Refactored amiibo to not reside in "System" * Removed remaining references of nfc from system * used enum for Nfc GetStateOld * Added missing newline * Moved file operations to front end * Conflict 4 * Amiibos now use structs and added mutexes * Removed amiibo_path
* | | Merge pull request #1515 from DarkLordZach/dlc-lfsbunnei2018-10-244-5/+29
|\ \ \ | | | | | | | | patch_manager: Add support for LayeredFS on DLC RomFS
| * | | qt: Add support for dumping a DLC Data RomFSZach Hilman2018-10-182-0/+5
| | | |
| * | | registered_cache: Deduplicate results of ListEntry and ListEntryFilterZach Hilman2018-10-172-2/+16
| | | | | | | | | | | | | | | | Prevents a Entry from appearing in the list twice if the user has it installed in two places (e.g. User NAND and SDMC)
| * | | fsp_srv: Apply patches to Data storage in OpenDataStorageByDataIdZach Hilman2018-10-171-1/+5
| | | |
| * | | patch_manager: Add support for using LayeredFS with DataZach Hilman2018-10-171-2/+3
| | | |
* | | | Merge pull request #1540 from lioncash/handlebunnei2018-10-248-98/+95
|\ \ \ \ | |_|/ / |/| | | kernel/process: Make the handle table per-process
| * | | kernel/process: Make the handle table per-processLioncash2018-10-208-98/+95
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | In the kernel, there isn't a singular handle table that everything gets tossed into or used, rather, each process gets its own handle table that it uses. This currently isn't an issue for us, since we only execute one process at the moment, but we may as well get this out of the way so it's not a headache later on.
* | | | Merge pull request #1545 from DarkLordZach/psmbunnei2018-10-224-0/+90
|\ \ \ \ | | | | | | | | | | psm: Add psm service and stub commands 0 and 1
| * | | | psm: Stub GetChargerTypeZach Hilman2018-10-222-24/+27
| | | | | | | | | | | | | | | Used by LovePotion Lua Homebrew. Stubbed as connected to official Nintendo Switch dock.
| * | | | psm: Stub GetBatteryChargePercentageZach Hilman2018-10-212-1/+14
| | | | | | | | | | | | | | | | | | | | Used by LovePotion Lua Homebrew. Stubbed to return 100% charge.
| * | | | service: Add skeleton for psm serviceZach Hilman2018-10-214-0/+74
| |/ / / | | | | | | | | | | | | Seems to be the power controller. Listed in switchbrew under the category PTM services.
* | | | Merge pull request #1538 from lioncash/querybunnei2018-10-221-1/+1
|\ \ \ \ | | | | | | | | | | svc: Fix vma boundary check in svcQueryMemory
| * | | | svc: Fix vma boundary check in svcQueryMemoryLioncash2018-10-201-1/+1
| |/ / / | | | | | | | | | | | | | | | | | | | | This should be comparing against the queried process' vma_map, not the current process'. The only reason this hasn't become an issue yet is we currently only handle one process being active at any time.
* | | | service: Add the basic skeleton for the NPNS servicesLioncash2018-10-214-2/+109
| | | |
* | | | hid: Update service function table for hidbusLioncash2018-10-211-0/+1
| | | | | | | | | | | | | | | | Updated based off information provided by Switchbrew.
* | | | am: Add the basic skeleton for the tcap serviceLioncash2018-10-214-0/+44
| | | | | | | | | | | | | | | | Added based off information provided by Switchbrew.
* | | | am: Update service function tablesLioncash2018-10-214-15/+60
| | | | | | | | | | | | | | | | Updated based off information from Switchbrew
* | | | prepo: Update service function table.Lioncash2018-10-211-8/+13
| | | | | | | | | | | | | | | | | | | | | | | | Also introduces the new prepo:a2 service. Updated based off information provided by Switchbrew.
* | | | lbl: Update service function table namesLioncash2018-10-211-28/+28
| | | | | | | | | | | | | | | | Updated based off information provided by Switchbrew.
* | | | Added auto controller switching to supported controllers and single joycon button rotationDavid Marcec2018-10-202-4/+189
|/ / / | | | | | | | | | This is a subset of the better-hid-2 changes, this fixes input in various games which don't support dual joycons. This pr will search for the next best controller which is supported by the current game
* | | Merge pull request #1520 from lioncash/sanbunnei2018-10-203-3/+50
|\ \ \ | | | | | | | | svc: Add missing sanitizing checks for MapSharedMemory/UnmapSharedMemory
| * | | svc: Add missing sanitizing checks for MapSharedMemory/UnmapSharedMemoryLioncash2018-10-183-3/+50
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Now that the changes clarifying the address spaces has been merged, we can wrap the checks that the kernel performs when mapping shared memory (and other forms of memory) into its own helper function and then use those within MapSharedMemory and UnmapSharedMemory to complete the sanitizing checks that are supposed to be done.
* | | | Merge pull request #1526 from lioncash/svc-idbunnei2018-10-208-53/+163
|\ \ \ \ | | | | | | | | | | service: Update function tables
| * | | | es: Update service function tablesLioncash2018-10-191-7/+11
| | | | | | | | | | | | | | | | | | | | Updated based off information provided by Switchbrew.
| * | | | audio: Update service function tablesLioncash2018-10-191-17/+20
| | | | | | | | | | | | | | | | | | | | Updated based off information provided by Switchbrew.
| * | | | omm: Update service function tablesLioncash2018-10-191-16/+18
| | | | | | | | | | | | | | | | | | | | Updated based off information provided by Switchbrew.
| * | | | nifm: Update service function tablesLioncash2018-10-191-0/+1
| | | | | | | | | | | | | | | | | | | | Updated based off information provided by switchbrew.
| * | | | hid: Update service function tablesLioncash2018-10-191-6/+45
| | | | | | | | | | | | | | | | | | | | Updated based off information provided by Switchbrew.
| * | | | nim: Add the basic skeleton of the nim:eca serviceLioncash2018-10-191-0/+17
| | | | | | | | | | | | | | | | | | | | Added based off information provided by Switchbrew
| * | | | ns: Update service function tableLioncash2018-10-191-6/+49
| | | | | | | | | | | | | | | | | | | | Updated based off information provided by Switchbrew.
| * | | | set_cal: Update service function tableLioncash2018-10-191-1/+2
| | | | | | | | | | | | | | | | | | | | Updated based on information from Switchbrew.
* | | | | Merge pull request #1530 from DarkLordZach/aoc-8bunnei2018-10-202-1/+16
|\ \ \ \ \ | | | | | | | | | | | | aoc_u: Stub GetAddOnContentListChangedEvent
| * | | | | aoc_u: Stub GetAddOnContentListChangedEventZach Hilman2018-10-202-1/+16
| | |_|_|/ | |/| | | | | | | | | | | | | This event signals the game when new DLC is purchased from the eShop while the game is running. Since, for the forseeable future, yuzu will not have this ability, it seems safe to stub with a dummy event that will never fire. This is needed to boot Sonic Mania Plus (update v1.04).
* | | | | Merge pull request #1516 from lioncash/hidbunnei2018-10-2018-19/+33
|\ \ \ \ \ | | | | | | | | | | | | hid: Minor cleanup-related changes
| * | | | | hid/controller: Remove unused header inclusionsLioncash2018-10-189-9/+0
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | swap.h only needs to be present in the header for the type aliases and definitions, it's not actually needed in the cpp files though. input.h is just unused entirely in xpad.h
| * | | | | hid/controller/npad: Remove unused dump_idx member variableLioncash2018-10-181-1/+0
| | | | | | | | | | | | | | | | | | | | | | | | Given it's unused, we may as well toss it.
| * | | | | hid/controller/npad: Remove unnecessary semicolon from the closing brace of LedPattern's constructorLioncash2018-10-181-1/+1
| | | | | |
| * | | | | hid/controller/npad: Remove #pragma once from the cpp fileLioncash2018-10-181-2/+0
| | | | | | | | | | | | | | | | | | | | | | | | This is only useful in headers.
| * | | | | hid/controller/npad: Move npad_id_list into the cpp fileLioncash2018-10-182-2/+10
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This is just a lookup table, and since it's private, there's nothing really stateful about it, so we can just move it into the cpp file.
| * | | | | hid/controller/npad: Remove unnecessary const from void return typeLioncash2018-10-182-2/+2
| | | | | | | | | | | | | | | | | | | | | | | | This literally does nothing.
| * | | | | hid/controller: Default the destructors of all controller types in the cpp fileLioncash2018-10-1816-0/+16
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | These classes are non-trivial and are definitely going to be changed in the future, so we default these to prevent issues with forward declarations, and to keep the compiler from inlining tear-down code.
| * | | | | controller_base: Default the base class constructor and destructor in the cpp fileLioncash2018-10-182-2/+4
| | |_|/ / | |/| | | | | | | | | | | | | The destructor doesn't need to be a pure-virtual function.
* | | | | crypto: Use compressed sizes in offset calculation for KIP decompressionZach Hilman2018-10-201-1/+2
| |/ / / |/| | | | | | | | | | | Fixes a fatal crash on start when deriving keys.
* | | | Stubbed home blockingDavid Marcec2018-10-192-4/+36
| |/ / |/| | | | | | | | Needed by arms due to new hid rework
* | | Merge pull request #1523 from lioncash/lockbunnei2018-10-191-9/+15
|\ \ \ | | | | | | | | svc: Add missing error checks in svcArbitrateLock/svcArbitrateUnlock
| * | | svc: Check for word alignment of addresses within svcArbitrateLock/svcArbitrateUnlockLioncash2018-10-181-0/+8
| | | | | | | | | | | | | | | | | | | | The kernel itself checks whether or not the provided addresses are word aligned before continuing, so we should be doing the same.
| * | | common: Move Is4KBAligned() to alignment.hLioncash2018-10-181-9/+7
| | | | | | | | | | | | | | | | | | | | Aligning on 4KB pages isn't a Switch-specific thing, so this can be moved to common so it can be used with other things as well.
* | | | Merge pull request #1511 from lioncash/contentbunnei2018-10-192-258/+292
|\ \ \ \ | | | | | | | | | | content_archive: Minor reorganization changes
| * | | | content_archive: Simpify assignment of bktr_base_romfs in the constructorLioncash2018-10-161-2/+1
| | | | | | | | | | | | | | | | | | | | | | | | | std::move doesn't actually dereference the data, so it doesn't matter whether or not the type is null.
| * | | | content_archive: Make IsValidNCA() an internally linked functionLioncash2018-10-162-3/+1
| | | | | | | | | | | | | | | | | | | | | | | | | This is only ever used within the cpp file, so it can just be an internal function.
| * | | | content_archive: Simplify rights ID checkLioncash2018-10-161-2/+2
| | | | | | | | | | | | | | | | | | | | This is the same as using std::any_of with an inverted predicate.
| * | | | content_archive: Split loading into separate functionsLioncash2018-10-162-253/+290
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The constructor alone is pretty large, the reading code should be split into its consistuent parts to make it easier to understand it without having to build a mental model of a 300+ line function.
| * | | | content_archive: Pass and take NCASectionHeader instance by referenceLioncash2018-10-162-3/+3
| | |_|/ | |/| | | | | | | | | | | | | | Each header is 512 bytes in size, which is kind of an excessive amount to copy all the time when it's possible to avoid doing so.
* | | | Merge pull request #1521 from ogniK5377/imp-mmubunnei2018-10-191-8/+42
|\ \ \ \ | | | | | | | | | | Used better names for mm:u and fixed a bad stub
| * | | | Used better names for mm:u and fixed bad stubDavid Marcec2018-10-181-8/+42
| | |_|/ | |/| | | | | | | | | | InitializeWithId needs to return an id which is a u32 which should be a non zero value
* | | | core: Remove unnecessary assert in ArmInterface()Lioncash2018-10-181-2/+1
| |_|/ |/| | | | | | | | | | | CpuCore already does this sort of checking, so we can just call that instead of duplicating the assertions.
* | | Merge pull request #1510 from lioncash/xcibunnei2018-10-183-7/+8
|\ \ \ | |/ / |/| | XCI: Add function for checking the existence of the program NCA
| * | XCI: Add function for checking the existence of the program NCALioncash2018-10-163-7/+8
| |/ | | | | | | | | | | The only reason the getter existed was to check whether or not the program NCA was null. Instead, we can just provide a function to query for the existence of it, instead of exposing it entirely.
* | Merge pull request #1444 from ogniK5377/better-hidbunnei2018-10-1822-648/+1720
|\ \ | | | | | | "Better Hid" Rework Part 1
| * | Using dual joycons as the default controllerDavid Marcec2018-10-173-77/+59
| | | | | | | | | | | | Reason for the change is to allow both docked and undocked mode to work
| * | WipDavid Marcec2018-10-122-3/+23
| | |
| * | Dynamically decide handheld variant based on supported npad id priorityDavid Marcec2018-10-113-19/+62
| | | | | | | | | | | | Kirby input still doesn't work, should fix a lot of other games
| * | Added BeginPermitVibrationSession and EndPermitVibrationSessionDavid Marcec2018-10-103-2/+26
| | | | | | | | | | | | Used by Mario Party
| * | Added GetLedPattern and HandheldVariantDavid Marcec2018-10-103-6/+63
| | | | | | | | | | | | HandheldVariant is for specific games which expect handheld controllers to be at position 8(kirby), however this doesn't fix all games as some games require handhelds to be at position 0(snipperclips)
| * | Kirby expects handheld controllers to be at position 8David Marcec2018-10-101-2/+8
| | |
| * | Added the ability to "disconnect" individual npadsDavid Marcec2018-10-103-16/+40
| | | | | | | | | | | | Fixes arms
| * | Removed unneeded forward declarationsDavid Marcec2018-10-102-13/+2
| | |
| * | Addressed changes for better hidDavid Marcec2018-10-1019-167/+238
| | |
| * | "Better Hid" rework part 1David Marcec2018-10-1022-644/+1500
| | |
* | | Merge pull request #1497 from bunnei/flush-framebuffersbunnei2018-10-182-3/+3
|\ \ \ | | | | | | | | Implement flushing in the rasterizer cache
| * | | config: Rename use_accurate_framebuffers -> use_accurate_gpu_emulation.bunnei2018-10-162-3/+3
| | |/ | |/| | | | | | | - This will be used as a catch-all for slow-but-accurate GPU emulation paths.
* | | Merge pull request #1498 from lioncash/aslrbunnei2018-10-184-28/+44
|\ \ \ | | | | | | | | svc: Clarify enum values for AddressSpaceBaseAddr and AddressSpaceSize in svcGetInfo()
| * | | svc: Clarify enum values for AddressSpaceBaseAddr and AddressSpaceSize in svcGetInfo()Lioncash2018-10-154-28/+44
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | So, one thing that's puzzled me is why the kernel seemed to *not* use the direct code address ranges in some cases for some service functions. For example, in svcMapMemory, the full address space width is compared against for validity, but for svcMapSharedMemory, it compares against 0xFFE00000, 0xFF8000000, and 0x7FF8000000 as upper bounds, and uses either 0x200000 or 0x8000000 as the lower-bounds as the beginning of the compared range. Coincidentally, these exact same values are also used in svcGetInfo, and also when initializing the user address space, so this is actually retrieving the ASLR extents, not the extents of the address space in general.
* | | | Merge pull request #1509 from DarkLordZach/device-save-databunnei2018-10-181-1/+12
|\ \ \ \ | |_|/ / |/| | | savedata_factory: Add DeviceSaveData and fix TemporaryStorage
| * | | savedata_factory: Add TemporaryStorage SaveDataSpaceIdZach Hilman2018-10-161-1/+4
| | | | | | | | | | | | | | | | Required for TemporaryStorage saves (in addition to SaveDataType)
| * | | savedata_factory: Add support for DeviceSaveDataZach Hilman2018-10-161-0/+8
| | | | | | | | | | | | | | | | Uses the same path as SaveData except with UID 0. Adds a warning if UID is not 0.
* | | | Merge pull request #1443 from DarkLordZach/lower-loader-logs-1bunnei2018-10-162-3/+9
|\ \ \ \ | | | | | | | | | | content_archive/patch_manager: Lower log levels to eliminate some unnecessary logs
| * | | | patch_manager: Move non-Program RomFS patch log to DebugZach Hilman2018-10-131-2/+8
| | | | | | | | | | | | | | | | | | | | Normal Program-type patches will still be logged to aid in debugging, but for others (mainly Control), it was moved to Debug.
| * | | | content_archive: Move get key log to Trace levelZach Hilman2018-10-131-1/+1
| | | | | | | | | | | | | | | | | | | | Avoids printing live keys in the general log.
* | | | | Implement VI ConvertScalingMode (#1475)David2018-10-161-1/+49
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * Implement VI ConvertScalingMode * Fixed push enum * Scale mode now uses Nintendo scale mode as an enum as well
* | | | | Merge pull request #1502 from lioncash/uniquebunnei2018-10-1611-56/+71
|\ \ \ \ \ | | | | | | | | | | | | core: Convert shared_ptr instances into unique_ptr instances where applicable for System and Cpu
| * | | | | core_cpu: Make Cpu scheduler instances unique_ptrs instead of shared_ptrsLioncash2018-10-159-27/+45
| | | | | |
| * | | | | core: Make the live Cpu instances unique_ptrs instead of shared_ptrsLioncash2018-10-151-9/+9
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | There's no need for shared ownership here, as the only owning class instance of those Cpu instances is the System class itself. We can also make the thread_to_cpu map use regular pointers instead of shared_ptrs, given that the Cpu instances will always outlive the cases where they're used with that map.
| * | | | | core: Make the exclusive monitor a unique_ptr instead of a shared_ptrLioncash2018-10-155-15/+13
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Like the barrier, this is owned entirely by the System and will always outlive the encompassing state, so shared ownership semantics aren't necessary here.
| * | | | | core: Make CPUBarrier a unique_ptr instead of a shared_ptrLioncash2018-10-153-11/+10
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This will always outlive the Cpu instances, since it's destroyed after we destroy the Cpu instances on shutdown, so there's no need for shared ownership semantics here.
* | | | | | file_sys/registered_cache: Use unique_ptr and regular pointers instead of shared_ptrs where applicableLioncash2018-10-1610-42/+41
| |_|/ / / |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The data retrieved in these cases are ultimately chiefly owned by either the RegisteredCache instance itself, or the filesystem factories. Both these should live throughout the use of their contained data. If they don't, it should be considered an interface/design issue, and using shared_ptr instances here would mask that, as the data would always be prolonged after the main owner's lifetime ended. This makes the lifetime of the data explicit and makes it harder to accidentally create cyclic references. It also makes the interface slightly more flexible than the previous API, as a shared_ptr can be created from a unique_ptr, but not the other way around, so this allows for that use-case if it ever becomes necessary in some form.
* | | | | Merge pull request #1473 from lioncash/cmakebunnei2018-10-161-2/+2
|\ \ \ \ \ | | | | | | | | | | | | web_service: Make linkage of web_service-related externals and the library private
| * | | | | core/CMakeLists: Make all web_service-related libraries privateLioncash2018-10-111-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Now that all external dependencies are hidden, we can remove json-headers from the publically linked libraries, as the use of this library is now completely hidden from external users of the web_service library. We can also make the web_services library private as well, considering it's not a requirement. If a library needs to link in web_service, it should be done explicitly -- not via indirect linking.
| * | | | | core/CMakeLists: Use target_compile_definitions instead of add_definitions for specifying ENABLE_WEB_SERVICELioncash2018-10-111-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Avoids introducing the definition to the whole directory space and localizes it to being added to the library that needs it.
* | | | | | file_sys/control_metadata: Get rid of magic constantsLioncash2018-10-161-3/+6
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | These are just the size of the data being passed in, so we can specify that via the size() member function.
* | | | | | Merge pull request #1494 from DarkLordZach/aoc-signature-fixesbunnei2018-10-163-3/+20
|\ \ \ \ \ \ | | | | | | | | | | | | | | aoc: Fix various bugs in current AOC implementation
| * | | | | | aoc: Read DLC base title ID from RegisteredCacheZach Hilman2018-10-153-2/+18
| | | | | | | | | | | | | | | | | | | | | Falls back to title ID + 0x1000, which is what HOS does.
| * | | | | | aoc: Return size in ListAddOnContentZach Hilman2018-10-141-1/+2
| | | | | | |
* | | | | | | Merge pull request #1499 from lioncash/nrobunnei2018-10-157-28/+39
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | nro/nso: Minor error handling changes
| * | | | | | | nso: Return an optional address from LoadModuleLioncash2018-10-155-16/+29
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | If a malformed NSO is attempted to be loaded, we shouldn't continue onwards. We should be reporting an error and bailing out.
| * | | | | | | nso: Make LoadModule take a VfsFile by const referenceLioncash2018-10-153-11/+9
| | | | | | | |
| * | | | | | | nro: Make LoadNro take a VfsFile by const referenceLioncash2018-10-152-6/+6
| | |_|_|_|/ / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This function doesn't need to care about ownership semantics, so we can just pass it a reference to the file itself, rather than a std::shared_ptr alias.
* | | | | | | crypto: Various crypto fixes for quickstart guideZach Hilman2018-10-151-2/+2
| |_|_|/ / / |/| | | | |
* | | | | | Merge pull request #1486 from lioncash/filebunnei2018-10-144-63/+72
|\ \ \ \ \ \ | | | | | | | | | | | | | | key_manager/partition_data_manager: Minor changes
| * | | | | | partition_data_manager: Reserve and insert data within output vector in DecryptPackage2()Lioncash2018-10-131-20/+16
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | We can just reserve the memory then perform successive insertions instead of needing to use memcpy. This also avoids the need to zero out the output vector's memory before performing the insertions. We can also std::move the output std::vector into the destination so that we don't need to make a completely new copy of the vector, getting rid of an unnecessary allocation. Additionally, we can use iterators to determine the beginning and end ranges of the std::vector instances that comprise the output vector, as the end of one range just becomes the beginning for the next successive range, and since std::vector's iterator constructor copies data within the range [begin, end), this is more straightforward and gets rid of the need to have an offset variable that keeps getting incremented to determine where to do the next std::memcpy.
| * | | | | | partition_data_manager: Remove unused std::map instance within DecryptPackage2()Lioncash2018-10-131-2/+0
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Aside from emplacing elements into the map, the map itself is never actually queried for contained data.
| * | | | | | partition_data_manager: Take package2_keys by const referenceLioncash2018-10-132-2/+3
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | These are only ever read from, so we don't need to make a copy of all the keys here.
| * | | | | | partition_data_manager: Move IV data to where it's needed in DecryptPackage2()Lioncash2018-10-131-3/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Given it's only used in one spot and has a fairly generic name, we can just specify it directly in the function call. This also the benefit of automatically moving it.
| * | | | | | partition_data_manager: Remove commented out codeLioncash2018-10-131-2/+0
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Commented out code shouldn't be left in without a reason indicating why in a comment.
| * | | | | | key_manager/partition_data_manager: Silence truncation compiler warningsLioncash2018-10-134-10/+15
| | | | | | |
| * | | | | | partition_data_manager: Dehardcode array boundsLioncash2018-10-132-7/+12
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Instead, we can make it part of the type and make named variables for them, so they only require one definition (and if they ever change for whatever reason, they only need to be changed in one spot).
| * | | | | | partition_data_manager: Take VirtualFile by const reference in constructorLioncash2018-10-132-2/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Given the VirtualFile instance isn't stored into the class as a data member, or written to, this can just be turned into a const reference, as the constructor doesn't need to make a copy of it.
| * | | | | | partition_data_manager: Amend constructor initializer list orderLioncash2018-10-131-2/+3
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Orders the members in the exact order they would be initialized. This also prevents compiler warnings about this sort of thing.
| * | | | | | partition_data_manager: Remove unused includesLioncash2018-10-132-4/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Gets unused includes out of the headers and moves them into the cpp file if they're used there instead.
| * | | | | | key_manager: Use std::vector's insert() instead of std::copy with a back_inserterLioncash2018-10-131-2/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | If the data is unconditionally being appended to the back of a std::vector, we can just directly insert it there without the need to insert all of the elements one-by-one with a std::back_inserter.
| * | | | | | key_manager: Brace long conditional bodyLioncash2018-10-131-1/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | If a conditional (or it's body) travels more than one line, it should be braced.
| * | | | | | key_manager: Don't assume file seeks and reads will always succeedLioncash2018-10-131-7/+17
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Given the filesystem should always be assumed to be volatile, we should check and bail out if a seek operation isn't successful. This'll prevent potentially writing/returning garbage data from the function in rare cases. This also allows removing a check to see if an offset is within the bounds of a file before perfoming a seek operation. If a seek is attempted beyond the end of a file, it will fail, so this essentially combines two checks into one in one place.
| * | | | | | key_manager: Remove unnecessary seek in DeriveSDSeed()Lioncash2018-10-131-1/+0
| | |/ / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | Given the file is opened a few lines above and no operations are done, other than check if the file is in a valid state, the read/write pointer will always be at the beginning of the file.
* | | | | | Merge pull request #1491 from lioncash/referencebunnei2018-10-145-15/+14
|\ \ \ \ \ \ | |_|/ / / / |/| | | | | filesystem: Make CreateFactories() and InstallInterface() take a VfsFilesystem by reference
| * | | | | filesystem: Make CreateFactories() and InstallInterface() take a VfsFilesystem instance by referenceLioncash2018-10-135-15/+14
| |/ / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Neither of these functions alter the ownership of the provided pointer, so we can simply make the parameters a reference rather than a direct shared pointer alias. This way we also disallow passing incorrect memory values like nullptr.
* | | | | Merge pull request #1492 from lioncash/procbunnei2018-10-143-4/+50
|\ \ \ \ \ | | | | | | | | | | | | svc: Implement svcGetProcessInfo
| * | | | | svc: Implement svcGetProcessInfoLioncash2018-10-133-4/+50
| |/ / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | A fairly basic service function, which only appears to currently support retrieving the process state. This also alters the ProcessStatus enum to contain all of the values that a kernel process seems to be able of reporting with regards to state.
* / / / / Stop all threads on svcBreakDavid Marcec2018-10-141-0/+6
|/ / / / | | | | | | | | | | | | This should help diagnose crashes easier and prevent many users thinking that a game is still running when in fact it's just an audio thread still running(this is typically not killed when svcBreak is hit since the game expects us to do this)
* | | | Merge pull request #1409 from DarkLordZach/key-derivationbunnei2018-10-137-74/+1569
|\ \ \ \ | | | | | | | | | | crypto: Add support for full key derivation
| * | | | partition_data_manager: Rename system files for hekateZach Hilman2018-10-074-178/+228
| | | | | | | | | | | | | | | | | | | | x
| * | | | crypto: Add PartitionDataManagerZach Hilman2018-10-073-0/+692
| | | | | | | | | | | | | | | | | | | | Keeps track of system files for key derivation
| * | | | key_manager: Add support for loading keys from partition dataZach Hilman2018-10-072-0/+88
| | | | |
| * | | | key_manager: Add ETicket key derivationZach Hilman2018-10-073-2/+277
| | | | | | | | | | | | | | | | | | | | Derives titlekeys
| * | | | key_manager: Add base key derivationZach Hilman2018-10-072-4/+220
| | | | | | | | | | | | | | | | | | | | Derives master keys, game encryption keys, and package1/2 keys
| * | | | key_manager: Add BIS key getterZach Hilman2018-10-072-2/+19
| | | | |
| * | | | key_manager: Add support for more keysZach Hilman2018-10-072-3/+99
| | | | | | | | | | | | | | | | | | | | TSEC, SBK, BIS, and other Sources for proper derivation
| * | | | key_manager: Add keyblob supportZach Hilman2018-10-072-0/+14
| | | | |
| * | | | key_manager: Add support for crypto revisions past 04Zach Hilman2018-10-071-43/+63
| | | | |
| * | | | key_manager: Add support for comments in keyfilesZach Hilman2018-10-071-0/+3
| | | | |
| * | | | vfs: Move forward declarations to separate fileZach Hilman2018-10-072-9/+22
| | | | |
| * | | | key_manager: Add support for console-specific keyfileZach Hilman2018-10-072-3/+13
| | | | |
| * | | | key_manager: Rename KEK to KekZach Hilman2018-10-072-8/+9
| | | | |
* | | | | Merge pull request #1483 from lioncash/codesetbunnei2018-10-137-83/+45
|\ \ \ \ \ | | | | | | | | | | | | kernel/process: Make CodeSet a regular non-inherited object
| * | | | | kernel/process: Make CodeSet a regular non-inherited objectLioncash2018-10-127-83/+45
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | These only exist to ferry data into a Process instance and end up going out of scope quite early. Because of this, we can just make it a plain struct for holding things and just std::move it into the relevant function. There's no need to make this inherit from the kernel's Object type.
* | | | | | Merge pull request #1481 from lioncash/typobunnei2018-10-131-3/+3
|\ \ \ \ \ \ | |_|_|_|/ / |/| | | | | svc: Fix typos in sanitizing checks for MapMemory/UnmapMemory
| * | | | | svc: Fix typos in sanitizing checks for MapMemory/UnmapMemoryLioncash2018-10-121-3/+3
| |/ / / /
* | | | | Merge pull request #1467 from ogniK5377/svcbreak-type-fixbunnei2018-10-122-28/+36
|\ \ \ \ \ | | | | | | | | | | | | Fixed incorrect types for svcBreak
| * | | | | Changed all casts in svc_wrap.h to be static_cast insteadDavid Marcec2018-10-101-25/+28
| | | | | |
| * | | | | Use a better name than "dont_kill_application"David Marcec2018-10-101-2/+2
| | | | | | | | | | | | | | | | | | | | | | | | signal_debugger seems like a more fitting name
| * | | | | Fixed incorrect types for svcBreakDavid Marcec2018-10-102-3/+8
| | |_|_|/ | |/| | | | | | | | | | | | | svcBreak reason should be a u32, not a u64.
* | | | | Merge pull request #1478 from ogniK5377/remap-invalidhandle-remapbunnei2018-10-121-3/+10
|\ \ \ \ \ | | | | | | | | | | | | Passing an invalid nmap handle to Remap should throw an error
| * | | | | Returned an error before processing other remapsDavid Marcec2018-10-121-6/+2
| | | | | |
| * | | | | Passing an invalid nmap handle to Remap should throw an errorDavid Marcec2018-10-111-3/+14
| | |_|_|/ | |/| | | | | | | | | | | | | Added error for invalid nmap handles
* | | | | Merge pull request #1482 from lioncash/initbunnei2018-10-121-4/+1
|\ \ \ \ \ | | | | | | | | | | | | thread: Remove unnecessary memset from ResetThreadContext()
| * | | | | thread: Remove unnecessary memset from ResetThreadContext()Lioncash2018-10-121-4/+1
| | |_|/ / | |/| | | | | | | | | | | | | | | | | | | | | | | Regular value initialization is adequate here for zeroing out data. It also has the benefit of not invoking undefined behavior if a non-trivial type is ever added to the struct for whatever reason.
* | | | | Merge pull request #1479 from ogniK5377/nmap-revampedbunnei2018-10-121-12/+60
|\ \ \ \ \ | |/ / / / |/| | | | Added error codes for nvmap
| * | | | Made the minimum alignment more clearDavid Marcec2018-10-121-2/+3
| | | | |
| * | | | Added error codes for nvmapDavid Marcec2018-10-111-12/+59
| |/ / /
* | | | Merge pull request #1474 from ogniK5377/hwopus-decodeinterleavedwithperformancebunnei2018-10-111-3/+34
|\ \ \ \ | | | | | | | | | | HwOpus, Implemented DecodeInterleavedWithPerformance
| * | | | HwOpus, Implemented DecodeInterleavedWithPerformanceDavid Marcec2018-10-111-3/+34
| |/ / / | | | | | | | | | | | | Used by sonic ages
* | | | Merge pull request #1472 from lioncash/sanbunnei2018-10-112-12/+81
|\ \ \ \ | | | | | | | | | | svc: Add missing address range sanitizing checks to MapMemory/UnmapMemory
| * | | | svc: Add missing address range sanitizing checks to MapMemory/UnmapMemoryLioncash2018-10-112-12/+81
| |/ / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | This adds the missing address range checking that the service functions do before attempting to map or unmap memory. Given that both service functions perform the same set of checks in the same order, we can wrap these into a function and just call it from both functions, which deduplicates a little bit of code.
* / / / nvhost_as_gpu: Flush CPU VAddr on UnmapBuffer.bunnei2018-10-111-3/+4
|/ / /
* | | kernel/thread: Use a regular pointer for the owner/current processLioncash2018-10-109-38/+39
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | There's no real need to use a shared pointer in these cases, and only makes object management more fragile in terms of how easy it would be to introduce cycles. Instead, just do the simple thing of using a regular pointer. Much of this is just a hold-over from citra anyways. It also doesn't make sense from a behavioral point of view for a process' thread to prolong the lifetime of the process itself (the process is supposed to own the thread, not the other way around).
* | | Merge pull request #1461 from lioncash/warnbunnei2018-10-101-3/+3
|\ \ \ | | | | | | | | ips_layer: Silence truncation and conversion warnings
| * | | ips_layer: Silence truncation and conversion warningsLioncash2018-10-091-3/+3
| | | | | | | | | | | | | | | | Makes type conversions explicit to avoid compiler warnings.
* | | | Merge pull request #1464 from lioncash/uniquebunnei2018-10-106-15/+13
|\ \ \ \ | |_|/ / |/| | | patch_manager: Return a std::unique_ptr from ParseControlNCA() and GetControlMetadata() instead of a std::shared_ptr
| * | | patch_manager: Return a std::unique_ptr from ParseControlNCA() and GetControlMetadata() instead of a std::shared_ptrLioncash2018-10-096-15/+13
| |/ / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Neither of these functions require the use of shared ownership of the returned pointer. This makes it more difficult to create reference cycles with, and makes the interface more generic, as std::shared_ptr instances can be created from a std::unique_ptr, but the vice-versa isn't possible. This also alters relevant functions to take NCA arguments by const reference rather than a const reference to a std::shared_ptr. These functions don't alter the ownership of the memory used by the NCA instance, so we can make the interface more generic by not assuming anything about the type of smart pointer the NCA is contained within and make it the caller's responsibility to ensure the supplied NCA is valid.
* | | Merge pull request #1459 from ogniK5377/breakbunnei2018-10-091-5/+20
|\ \ \ | | | | | | | | svcBreak, Signalling to the debugger should not kill execution
| * | | Added bitfield instead of manually checking if the bit is setDavid Marcec2018-10-091-4/+12
| | | |
| * | | Actual kill execution when the bit isn't set, not the other way aroundDavid Marcec2018-10-091-1/+1
| | | |
| * | | svcBreak, Signalling to the debugger should not kill executionDavid Marcec2018-10-091-5/+12
| | | | | | | | | | | | | | | | When loading NROs, svcBreak is called to signal to the debugger that a new "module" is loaded. As no debugger is technically attached we shouldn't be killing the programs execution.
* | | | Merge pull request #1465 from lioncash/telemetrybunnei2018-10-092-7/+9
|\ \ \ \ | | | | | | | | | | telemetry_session: Minor miscellaneous changes
| * | | | telemetry_session: Remove doxygen comment for a non-existent parameterLioncash2018-10-091-1/+0
| | | | | | | | | | | | | | | | | | | | There's no "func" parameter, so this can just be removed.
| * | | | telemetry_session: Add missing includesLioncash2018-10-092-2/+5
| | | | | | | | | | | | | | | | | | | | | | | | | Prevents potential compilation issues in the future by including missing headers for certain functions and types.
| * | | | telemetry_session: Remove unimplemented FinalizeAsyncJob prototypeLioncash2018-10-091-2/+0
| | | | | | | | | | | | | | | | | | | | This isn't implemented anywhere, so it can just be removed.
| * | | | telemetry_session: Use a std::array in GenerateTelemetryId()Lioncash2018-10-091-2/+4
| | |/ / | |/| | | | | | | | | | | | | | | | | | We don't need to potentially heap-allocate a std::string instance here, given the data is known ahead of time. We can just place it within an array and pass this to the mbedtls functions.
* | | | ips_layer: Avoid constructing std::vector instances where not necessaryLioncash2018-10-091-6/+25
| | | | | | | | | | | | | | | | | | | | | | | | We can just compare the existing std::vector instance with a constexpr std::array containing the desired match. This is lighter resource-wise, as we don't need to allocate on the heap.
* | | | ips_layer: Remove unnecessary explicit std::pair constructor in std::arrayLioncash2018-10-091-5/+13
| | | | | | | | | | | | | | | | | | | | Makes the layout of the array consistent, by making all elements match, instead of special-casing the first one.
* | | | ips_layer: Add missing includesLioncash2018-10-092-7/+17
| | | | | | | | | | | | | | | | | | | | | | | | Adds missing includes to prevent potential compilation issues in the future. Also moves the definition of a struct into the cpp file, so that some includes don't need to be introduced within the header.
* | | | ips_layer: std::move data within PatchIPS() and Apply()Lioncash2018-10-091-2/+5
|/ / / | | | | | | | | | | | | We don't need to make a copy of the read data, so we can std::move it into the make_shared call here.
* | | Merge pull request #1423 from DarkLordZach/romfs-file-extsbunnei2018-10-085-10/+38
|\ \ \ | | | | | | | | fsmitm_romfsbuild: Add support for stubbing and IPS patches in LFS
| * | | patch_manager: Avoid romfs_ext requirement for patchingZach Hilman2018-10-041-4/+1
| | | |
| * | | fsmitm_romfsbuild: Extract stubs and IPS to romfs_ext dirZach Hilman2018-10-045-21/+38
| | | |
| * | | fsmitm_romfsbuild: Add support for stubbing and IPS patches in LFSZach Hilman2018-10-041-0/+14
| | | |
* | | | Merge pull request #1424 from DarkLordZach/ips-witchbunnei2018-10-084-23/+299
|\ \ \ \ | |_|/ / |/| | | ips_layer: Add support for IPSwitch executable patches
| * | | ips_layer: Fix inaccuracies with comments and flagsZach Hilman2018-10-043-16/+51
| | | | | | | | | | | | Specifically bugs/crashes that arise when putting them in positions that are legal but not typical, such as midline, between patch data, or between patch records.
| * | | ips_layer: Deduplicate resource usageZach Hilman2018-10-043-31/+37
| | | |
| * | | ips_layer: Add support for escape sequences and midline commentsZach Hilman2018-10-043-8/+41
| | | | | | | | | | | | | | | | More accurately follows IPSwitch specification.
| * | | patch_manager: Add support for IPSwitch format patchesZach Hilman2018-10-041-22/+56
| | | |
| * | | ips_layer: Add IPSwitchCompiler to process IPSwitch formatZach Hilman2018-10-042-0/+168
| |/ /
* | | Merge pull request #1456 from ogniK5377/aoc-u-fixupsbunnei2018-10-081-5/+5
|\ \ \ | | | | | | | | Fixed assertion due to CountAddOnContent & Casting warnings
| * | | Fixed assertion due to CountAddOnContentDavid Marcec2018-10-071-5/+5
| | |/ | |/| | | | | | | | | | | | | Word count should be 3 since we're pushing a result code and a u32. Also fixed up compiler warnings due to casting
* | | Merge pull request #1457 from ogniK5377/unmap-bufferbunnei2018-10-081-1/+6
|\ \ \ | | | | | | | | Unmapping an unmapped buffer should succeed
| * | | Unmapping an unmapped buffer should succeedDavid Marcec2018-10-081-1/+6
| |/ / | | | | | | | | | Hardware tests show that trying to unmap an unmapped buffer already should always succeed. Hardware test was tested up to 32 iterations of attempting to unmap
* | | nso/nro: Use default allocation size for arg_dataZach Hilman2018-10-074-14/+20
| | |
* | | cmd: Support passing game arguments from command lineZach Hilman2018-10-072-2/+2
| | | | | | | | | | | | Uses -p (--program) and following string as args.
* | | settings: Add program_args string settingZach Hilman2018-10-071-0/+1
| | |
* | | nso/nro: Add NSO arguments structure to data sectionZach Hilman2018-10-074-3/+38
|/ / | | | | | | Only added if arguments string is non-empty and a pass is requested by loader.
* | Merge pull request #1396 from DarkLordZach/packed-updatesbunnei2018-10-0715-16/+128
|\ \ | | | | | | loader: Add support for packed updates
| * | romfs_factory: Extract packed update setter to new functionZach Hilman2018-10-059-6/+36
| | |
| * | patch_manager: Add support for NSP packed updatesZach Hilman2018-10-051-2/+2
| | | | | | | | | | | | Reads as Update (NSP) in add-ons
| * | patch_manager: Add support for packed updatesZach Hilman2018-10-054-5/+18
| | | | | | | | | | | | Will prefer any installed update over the packed version.
| * | loader: Add getter for packed updateZach Hilman2018-10-056-3/+58
| | | | | | | | | | | | Reads the update included with the game if it has one and adds the new ErrorNoPackedUpdate status.
| * | loader: Add ReadRomFSIVFCOffset to NSP, XCI, and NAX loadersZach Hilman2018-10-056-6/+20
| |/ | | | | | | Fixes errors with certain updates
* | Merge pull request #1448 from ogniK5377/frontend-accessbunnei2018-10-074-0/+26
|\ \ | | | | | | Ported #4296 from citra
| * | Added forward define for ServerPortDavid Marcec2018-10-062-4/+6
| | |
| * | Ported #4296 from citraDavid Marcec2018-10-063-1/+25
| | | | | | | | | | | | This will allow us to easily remove the use of "NFC" in "System"
* | | Merge pull request #1332 from FearlessTobi/port-web-backendbunnei2018-10-064-14/+53
|\ \ \ | |/ / |/| | Port web_service from Citra
| * | Review comments -part 4fearlessTobi2018-10-021-0/+1
| | |
| * | Address more review commentsfearlessTobi2018-10-021-1/+1
| | |
| * | Address a bunch of review commentsfearlessTobi2018-10-022-6/+7
| | |
| * | Port web_service from CitrafearlessTobi2018-10-024-14/+51
| | |
* | | kernel/mutex: Amend behavior of TransferMutexOwnership()Lioncash2018-10-061-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | This was the result of a typo accidentally introduced in e51d715700a35a8f14e5b804b6f7553c9a40888b. This restores the previous correct behavior. The behavior with the reference was incorrect and would cause some games to fail to boot.
* | | thread: Make the scheduler pointer a regular pointerbalika0112018-10-052-4/+4
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Conceptually, it doesn't make sense for a thread to be able to persist the lifetime of a scheduler. A scheduler should be taking care of the threads; the threads should not be taking care of the scheduler. If the threads outlive the scheduler (or we simply don't actually terminate/shutdown the threads), then it should be considered a bug that we need to fix. Attributing this to balika011, as they opened #1317 to attempt to fix this in a similar way, but my refactoring of the kernel code caused quite a few conflicts.
* | | Merge pull request #1439 from lioncash/threadbunnei2018-10-0514-206/+392
|\ \ \ | |_|/ |/| | kernel/thread: Make all instance variables private
| * | kernel/thread: Make all instance variables privateLioncash2018-10-0414-206/+392
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Many of the member variables of the thread class aren't even used outside of the class itself, so there's no need to make those variables public. This change follows in the steps of the previous changes that made other kernel types' members private. The main motivation behind this is that the Thread class will likely change in the future as emulation becomes more accurate, and letting random bits of the emulator access data members of the Thread class directly makes it a pain to shuffle around and/or modify internals. Having all data members public like this also makes it difficult to reason about certain bits of behavior without first verifying what parts of the core actually use them. Everything being public also generally follows the tendency for changes to be introduced in completely different translation units that would otherwise be better introduced as an addition to the Thread class' public interface.
* | | Merge pull request #1415 from DarkLordZach/ipsbunnei2018-10-048-36/+255
|\ \ \ | | | | | | | | file_sys: Add support for loading IPS patches
| * | | nso: Optimize loading of IPS patchesZach Hilman2018-10-025-51/+43
| | | | | | | | | | | | | | | | Avoid resource-heavy classes and remove quasi-duplicated code.
| * | | deconstructed_rom_directory: Force NSO loader to patch NSOsZach Hilman2018-10-011-1/+3
| | | |
| * | | nso: Add framework to support patching of uncompressed NSOsZach Hilman2018-10-012-2/+17
| | | |
| * | | patch_manager: Add PatchNSO functionZach Hilman2018-10-013-0/+104
| | | | | | | | | | | | | | | | While PatchExeFS operated on the entire directory, this function operates on the uncompressed NSO. Avoids copying decompression code to PatchManager.
| * | | patch_manager: Use strings for patch type instead of enumZach Hilman2018-10-012-29/+33
| | | |
| * | | file_sys: Implement function to apply IPS patchesZach Hilman2018-10-012-0/+103
| | | |
| * | | nso: Replace NSOHeader padding bytes with build IDZach Hilman2018-10-011-2/+1
| | |/ | |/|
* | | Merge pull request #1434 from DarkLordZach/dlc-edge-casebunnei2018-10-041-1/+1
|\ \ \ | | | | | | | | aoc_u: Fix edge case with DLC that causes breaks
| * | | aoc_u: Fix edge case with DLC that causes breaksZach Hilman2018-10-031-1/+1
| |/ / | | | | | | | | | In some games (Splatoon 2 and Splatoon 2 Splatfest World Premiere, notably), pass offset=0 and count=2047 into the ListAddOnContent method which should return all DLCs for the current title. The (presumably) intended behavior is to successfully return a empty array but because of a < v. <= in an if statement, a failure error code was returned causing these games to svcBreak. This fixes that if statement.
* | | Merge pull request #1433 from lioncash/fsbunnei2018-10-041-0/+2
|\ \ \ | | | | | | | | services/fsp_srv: Amend service function table
| * | | services/fsp_srv: Amend service function tableLioncash2018-10-031-0/+2
| | |/ | |/| | | | | | | | | | Adds new functions that have been given names to the table. Information is based off what is provided on Switchbrew.
* | | Merge pull request #1436 from lioncash/viewbunnei2018-10-042-73/+101
|\ \ \ | | | | | | | | submission_package: Cleanup and bug fixes
| * | | submission_package: Avoid dangling std::string_view within SetTicketKeys()Lioncash2018-10-031-2/+5
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | GetName() returns a std::string by value, not by reference, so after the std::string_view is constructed, it's not well defined to actually execute any member functions of std::string_view that attempt to access the data, as the std::string has already been destroyed. Instead, we can just use a std::string and erase the last four characters.
| * | | submission_package: Correct location of null check within SetTicketKeys()Lioncash2018-10-031-3/+6
| | | | | | | | | | | | | | | | | | | | If a ticket file was ever a null pointer, we'd cause a null pointer dereference, as we were calling GetExtension() on the pointer instance.
| * | | submission_package: Use std::string's rfind() when looking for the extension in InitializeExeFSAndRomFS()Lioncash2018-10-031-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | When searching for a file extension, it's generally preferable to begin the search at the end of the string rather than the beginning, as the whole string isn't going to be walked just to check for something at the end of it.
| * | | submission_package: Ensure the 'extracted' member variable is always initializedLioncash2018-10-032-3/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | If an error occurs when constructing the PartitionFilesystem instance, the constructor would be exited early, which wouldn't initialize the extracted data member, making it possible for other code to perform an uninitialized read by calling the public IsExtractedType() member function. This prevents that.
| * | | submission_package: Move ExeFS and RomFS initialization to its own functionLioncash2018-10-032-10/+18
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Like the other two bits of factored out code, this can also be put within its own function. We can also modify the code so that it accepts a const reference to a std::vector of files, this way, we can deduplicate the file retrieval. Now the constructor for NSP isn't a combination of multiple behaviors in one spot. It's nice and separate.
| * | | submission_package: Move NCA reading code to its own functionLioncash2018-10-032-43/+48
| | | | | | | | | | | | | | | | | | | | | | | | This too, is completely separate behavior from what is in the constructor, so we can move this to its own isolated function to keep everything self-contained.
| * | | submission_package: Move ticket key setting to its own functionLioncash2018-10-031-21/+28
| | | | | | | | | | | | | | | | | | | | This behavior is entirely independent of the surrounding code, so it can be put in its own function to keep the behavior separate.
| * | | submission_package: Invert conditionals within NSP's constructor to reduce nestingLioncash2018-10-031-45/+49
| |/ / | | | | | | | | | We can use early continues here to reduce the amount of nesting.
* | | Merge pull request #1432 from lioncash/lblbunnei2018-10-041-19/+19
|\ \ \ | | | | | | | | service/lbl: Update service function table
| * | | service/lbl: Update service function tableLioncash2018-10-031-19/+19
| | |/ | |/| | | | | | | | | | Amends the lbl service table to include new names of functions that were added to Switchbrew.
* | | Merge pull request #1435 from lioncash/xcibunnei2018-10-041-1/+3
|\ \ \ | |/ / |/| | card_image: Ensure program_nca_status is always initialized
| * | card_image: Ensure program_nca_status is always initializedLioncash2018-10-031-1/+3
| |/ | | | | | | | | | | If any of the error paths before the NCA retrieval are taken, it'll result in program_nca_status being left in an inconsistent state. So we initialize it by default with a value indicating an error.
* | aoc_u: Extract AccumulateAOCTitleIDs to separate functionZach Hilman2018-10-012-21/+28
| |
* | aoc_u: Implement GetAddOnContentBaseIdZach Hilman2018-10-013-5/+8
| | | | | | Command #5
* | aoc_u: Implement Count, List and Prepare AddOnContentZach Hilman2018-10-012-3/+78
| | | | | | | | Commands #2, #3, and #7
* | romfs_factory: Read from all locations with StorageId NoneZach Hilman2018-10-011-26/+25
| | | | | | | | Previous behavior was to assert. Seems to mirror expected game behavior.
* | patch_manager: Add DLC recognition to PatchManagerZach Hilman2018-10-012-0/+27
|/
* Merge pull request #1338 from raven02/service_vibunnei2018-09-301-1/+19
|\ | | | | Implement ISystemDisplayService::GetDisplayMode
| * Implement ISystemDisplayService::GetDisplayModeraven022018-09-301-1/+19
| |
* | kernel/svc: Implement svcGetThreadContext()Lioncash2018-09-303-2/+37
| | | | | | | | | | | | | | | | | | Now that we have all of the rearranging and proper structure sizes in place, it's fairly trivial to implement svcGetThreadContext(). In the 64-bit case we can more or less just write out the context as is, minus some minor value sanitizing. In the 32-bit case we'll need to clear out the registers that wouldn't normally be accessible from a 32-bit AArch32 exectuable (or process).
* | kernel/process: Add a data member to determine if a process is 64-bit or not.Lioncash2018-09-302-0/+11
| | | | | | | | | | | | | | | | | | | | | | This will be necessary for the implementation of svcGetThreadContext(), as the kernel checks whether or not the process that owns the thread that has it context being retrieved is a 64-bit or 32-bit process. If the process is 32-bit, then the upper 15 general-purpose registers and upper 16 vector registers are cleared to zero (as AArch32 only has 15 GPRs and 16 128-bit vector registers. not 31 general-purpose registers and 32 128-bit vector registers like AArch64).
* | kernel/process: Make data member variables privateLioncash2018-09-3016-72/+117
| | | | | | | | | | | | | | Makes the public interface consistent in terms of how accesses are done on a process object. It also makes it slightly nicer to reason about the logic of the process class, as we don't want to expose everything to external code.
* | arm_interface: Add missing fpsr/tpidr members to the ThreadContext structLioncash2018-09-303-5/+15
| | | | | | | | | | | | | | | | | | Internally within the kernel, it also includes a member variable for the floating-point status register, and TPIDR, so we should do the same here to match it. While we're at it, also fix up the size of the struct and add a static assertion to ensure it always stays the correct size.
* | loader: Make the Load() function take a process as a regular reference, not a SharedPtrLioncash2018-09-2918-42/+28
| | | | | | | | | | | | | | | | A process should never require being reference counted in this situation. If the handle to a process is freed before this function is called, it's definitely a bug with our lifetime management, so we can put the requirement in place for the API that the process must be a valid instance.
* | Merge pull request #1412 from lioncash/movebunnei2018-09-292-3/+2
|\ \ | | | | | | kernel/object: Remove unnecessary std::move from DynamicObjectCast()
| * | kernel/object: Remove unnecessary std::move from DynamicObjectCast()Lioncash2018-09-282-3/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | boost::static_pointer_cast for boost::intrusive_ptr (what SharedPtr is), takes its parameter by const reference. Given that, it means that this std::move doesn't actually do anything other than obscure what the function's actual behavior is, so we can remove this. To clarify, this would only do something if the parameter was either taking its argument by value, by non-const ref, or by rvalue-reference.
* | | Merge pull request #1395 from lioncash/vmbunnei2018-09-2917-158/+413
|\ \ \ | | | | | | | | process/vm_manager: Initial modifications to load NPDM metadata
| * | | memory: Dehardcode the use of fixed memory range constantsLioncash2018-09-2511-75/+60
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The locations of these can actually vary depending on the address space layout, so we shouldn't be using these when determining where to map memory or be using them as offsets for calculations. This keeps all the memory ranges flexible and malleable based off of the virtual memory manager instance state.
| * | | svc: Report correct memory-related values within some of the cases in svcGetInfo()Lioncash2018-09-253-28/+41
| | | | | | | | | | | | | | | | | | | | | | | | Previously, these were reporting hardcoded values, but given the regions can change depending on the requested address spaces, these need to report the values that the memory manager contains.
| * | | memory: Dehardcode the use of a 36-bit address spaceLioncash2018-09-255-20/+56
| | | | | | | | | | | | | | | | | | | | Given games can also request a 32-bit or 39-bit address space, we shouldn't be hardcoding the address space range as 36-bit.
| * | | process/vm_manager: Amend API to allow reading parameters from NPDM metadataLioncash2018-09-2410-38/+259
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Rather than hard-code the address range to be 36-bit, we can derive the parameters from supplied NPDM metadata if the supplied exectuable supports it. This is the bare minimum necessary for this to be possible. The following commits will rework the memory code further to adjust to this.
* | | | Merge pull request #1394 from lioncash/streambunnei2018-09-271-1/+1
|\ \ \ \ | |_|/ / |/| | | stream: Preserve enum class type in GetState()
| * | | stream: Preserve enum class type in GetState()Lioncash2018-09-241-1/+1
| |/ / | | | | | | | | | | | | | | | Preserves the meaning/type-safetiness of the stream state instead of making it an opaque u32. This makes it usable for other things outside of the service HLE context.
* | | Merge pull request #1389 from PhiBabin/valgrindMat M2018-09-271-1/+1
|\ \ \ | | | | | | | | FPCR register was uninitialized at start up
| * | | FPCR register was uninitialized at start upPhilippe Babin2018-09-231-1/+1
| | | |
* | | | fsmitm_romfsbuild: std::move std::vector instances in Build()Lioncash2018-09-261-2/+2
| | | | | | | | | | | | | | | | | | | | Avoids making copies of large std::vector instances where it's trivially avoidable to do so.
* | | | fsmitm_romfsbuild: Replace manual value aligning with Common::AlignUp()Lioncash2018-09-261-12/+11
| | | | | | | | | | | | | | | | | | | | Theres no need to do explicit bitwise arithmetic here, when we have a function that does this with a more descriptive name.
* | | | Merge pull request #1399 from lioncash/schedbunnei2018-09-264-14/+14
|\ \ \ \ | | | | | | | | | | kernel/scheduler: Take ARM_Interface instances by reference
| * | | | core_cpu: Make arm_interface instances a std::unique_ptrLioncash2018-09-252-4/+4
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This is only exposed by reference, so we can just make it a unique pointer to get rid of the need to also use reference counting for the pointer.
| * | | | kernel/scheduler: Take ARM_Interface instance by reference in the constructorLioncash2018-09-253-10/+10
| |/ / / | | | | | | | | | | | | | | | | It doesn't make sense to allow a scheduler to be constructed around a null pointer.
* | | | Merge pull request #1400 from lioncash/headerbunnei2018-09-265-1/+7
|\ \ \ \ | | | | | | | | | | service: Add missing headers inclusions where applicable
| * | | | service: Add missing headers inclusions where applicableLioncash2018-09-255-1/+7
| | | | | | | | | | | | | | | | | | | | Gets rid of a few indirect inclusions.
* | | | | patch_manager: Invert conditionals within ApplyLayeredFS()Lioncash2018-09-261-27/+30
| | | | | | | | | | | | | | | | | | | | | | | | | Avoids the need to nest code quite a bit by early-exiting in error cases.
* | | | | vfs_vector: Amend initializer list order in VectorVfsFile's constructor initializer listLioncash2018-09-261-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | Orders the initializer list members to be in the same order that they would be initialized in. Avoids compiler warnings.
* | | | | fsmitm_romfsbuild: Avoid type truncation warningsLioncash2018-09-261-7/+10
| | | | | | | | | | | | | | | | | | | | | | | | | Cast where explicitly necessary and in other cases we can simply modify the algorithm to accomodate larger data.
* | | | | fsmitm_romfsbuild: Remove unnecessary constructors and initializers for RomFSBuildFileContext and RomFSBuildDirectoryContextLioncash2018-09-261-5/+3
| | | | | | | | | | | | | | | | | | | | | | | | | There's no need to duplicate in-class initializers with a constructor initializer list. std::strings also initialize to empty by default.
* | | | | fsmitm_romfsbuild: Remove unnecessary loops in Build()Lioncash2018-09-261-6/+0
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The std::vector instances are already initially allocated with all entries having these values, there's no need to loop through and fill them with it again when they aren't modified.
* | | | | fsmitm_romfsbuild: Make auto variable into a std::size_t variable within Build()Lioncash2018-09-261-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | auto x = 0; auto-deduces x to be an int. This is undesirable when working with unsigned values. It also causes sign conversion warnings. Instead, we can make it a proper unsigned value with the correct width that the following expressions operate on.
* | | | | vfs/etc: Append std:: to size_t usagesLioncash2018-09-266-22/+23
| | | | | | | | | | | | | | | | | | | | | | | | | Given we just recently had a patch backport this from citra, let's try and keep the convention uniform.
* | | | | vfs_concat/vfs_layered: Remove friend declarations from ConcatenatedVfsFileLioncash2018-09-268-61/+59
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Given these are only added to the class to allow those functions to access the private constructor, it's a better approach to just make them static functions in the interface, to make the dependency explicit.
* | | | | vfs_static: Remove template byte parameter from StaticVfsFileLioncash2018-09-254-42/+42
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This converts it into a regular constructor parameter. There's no need to make this a template parameter on the class when it functions perfectly well as a constructor argument. This also reduces the amount of code bloat produced by the compiler, as it doesn't need to generate the same code for multiple different instantiations of the same class type, but with a different fill value.
* | | | | Merge pull request #1365 from DarkLordZach/lfsbunnei2018-09-2524-33/+1037
|\ \ \ \ \ | |/ / / / |/| | | | file_sys: Add support for LayeredFS mods
| * | | | fsmitm: Cleanup and modernize fsmitm portZach Hilman2018-09-2421-377/+377
| | | | |
| * | | | qt: Add UI elements for LayeredFS and related toolsZach Hilman2018-09-222-2/+2
| | | | |
| * | | | romfs: Implement CreateRomFSZach Hilman2018-09-222-4/+25
| | | | |
| * | | | file_sys: Port Atmosphere-NX fs_mitm implementationZach Hilman2018-09-222-0/+474
| | | | |
| * | | | filesystem: Add LayeredFS VFS directory getterZach Hilman2018-09-222-1/+14
| | | | |
| * | | | bis_factory: Add mod directory VFS getterZach Hilman2018-09-223-3/+18
| | | | |
| * | | | patch_manager: Add LayeredFS mods supportZach Hilman2018-09-222-1/+44
| | | | |
| * | | | vfs_concat: Rewrite and fix ConcatenatedVfsFileZach Hilman2018-09-222-14/+59
| | | | |
| * | | | vfs_layered: Add LayeredVfsDirectoryZach Hilman2018-09-222-0/+178
| | | | | | | | | | | | | | | | | | | | Reads multiple dirs through as if a waterfall.
| * | | | vfs_vector: Add VectorVfsFileZach Hilman2018-09-222-0/+75
| | | | | | | | | | | | | | | | | | | | Maps a vector into the VFS interface.
| * | | | vfs_static: Add StaticVfsFileZach Hilman2018-09-222-0/+78
| | | | | | | | | | | | | | | | | | | | Always returns the template argument byte for all reads. Doesn't support writes.
| * | | | vfs: Add and rewite VfsRawCopy functionsZach Hilman2018-09-222-6/+36
| | | | |
| * | | | vfs: Add GetEntries methodZach Hilman2018-09-224-0/+32
| | | | | | | | | | | | | | | | | | | | Maps name string to directory or file.
* | | | | Merge pull request #1393 from tech4me/svcbunnei2018-09-251-7/+7
|\ \ \ \ \ | | | | | | | | | | | | svc: Updated svc names
| * | | | | svc: Updated svc namestech4me2018-09-241-7/+7
| | | | | |
* | | | | | Implemented fatal:u properly (#1347)David2018-09-243-4/+140
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * Implemented fatal:u properly fatal:u now is properly implemented with all the ipc cmds. Error reports/Crash reports are also now implemented for fatal:u. Crash reports save to yuzu/logs/crash_reports/ The register dump is currently known as sysmodules send all zeros. If there are any non zero values for the "registers" or the unknown values, let me know! * Fatal:U fixups * Made fatal:u execution break more clear * Fatal fixups
* | | | | | Stubbed IRS (#1349)David2018-09-242-18/+167
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * Stubbed IRS Currently we have no ideal way of implementing IRS. For the time being we should have the functions stubbed until we come up with a way to emulate IRS properly. * Added IRS to logging backend * Forward declared shared memory for irs
* | | | | | Merge pull request #1354 from ogniK5377/ssl-versionbunnei2018-09-241-3/+3
|\ \ \ \ \ \ | |_|_|_|/ / |/| | | | | Corrected SSL::SetInterfaceVersion
| * | | | | Corrected SSL::SetInterfaceVersionDavid Marcec2018-09-191-3/+3
| | | | | | | | | | | | | | | | | | | | | | | | Should be a single u32
* | | | | | Added audren:u#GetAudioRendererStateDavid Marcec2018-09-231-1/+8
| |_|_|/ / |/| | | |
* | | | | svc: Move most process termination code to its own function within ProcessLioncash2018-09-213-32/+56
| | | | | | | | | | | | | | | | | | | | | | | | | Reduces the use of Process class members externally and keeps most code related to tearing down a process with the rest of the process code.
* | | | | thread/process: Move TLS slot marking/freeing to the process classLioncash2018-09-214-68/+89
| |_|/ / |/| | | | | | | | | | | | | | | | | | | Allows making several members of the process class private, it also avoids going through Core::CurrentProcess() just to retrieve the owning process.
* | | | Added support for uncompressed NSOs (#1374)David2018-09-211-3/+12
| | | | | | | | | | | | | | | | | | | | | | | | * Added support for uncompressed NSOs * Moved compressed section check to NsoHeader
* | | | Merge pull request #1372 from lioncash/threadbunnei2018-09-213-5/+5
|\ \ \ \ | | | | | | | | | | kernel/thread: Use owner_process when setting the page table in SetupMainThread()
| * | | | kernel/thread: Use owner_process when setting the page table in SetupMainThread()Lioncash2018-09-213-5/+5
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The owning process of a thread is required to exist before the thread, so we can enforce this API-wise by using a reference. We can also avoid the reliance on the system instance by using that parameter to access the page table that needs to be set.
* | | | | Merge pull request #1371 from lioncash/fwd-armbunnei2018-09-214-1/+10
|\ \ \ \ \ | | | | | | | | | | | | arm_interface: Replace kernel vm_manager include with a forward declaration
| * | | | | arm_interface: Replace kernel vm_manager include with a forward declarationLioncash2018-09-214-1/+10
| |/ / / / | | | | | | | | | | | | | | | | | | | | | | | | | Avoids an unnecessary inclusion and also uncovers three places where indirect inclusions were relied upon, which allows us to also resolve those.
* | | | | Merge pull request #1364 from lioncash/contentbunnei2018-09-2125-1/+45
|\ \ \ \ \ | | | | | | | | | | | | file-sys: Default heavy-weight class destructors in the cpp file
| * | | | | file-sys: Default heavy-weight class destructors in the cpp fileLioncash2018-09-2025-1/+45
| | |_|/ / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Several classes have a lot of non-trivial members within them, or don't but likely should have the destructor defaulted in the cpp file for future-proofing/being more friendly to forward declarations. Leaving the destructor unspecified allows the compiler to inline the destruction code all over the place, which is generally undesirable from a code bloat perspective.
* | | | | Merge pull request #1368 from ogniK5377/nifm-fixbunnei2018-09-211-1/+7
|\ \ \ \ \ | | | | | | | | | | | | Added IRequest::Submit
| * | | | | Fixed submitDavid Marcec2018-09-201-2/+1
| | | | | |
| * | | | | Added IRequest::SubmitDavid Marcec2018-09-201-1/+8
| | | | | | | | | | | | | | | | | | | | | | | | This fixes updated versions of SMO. Currently unable to test as I don't have an updated version
* | | | | | Revert GetRequestStateDavid Marcec2018-09-211-1/+1
| |_|/ / / |/| | | | | | | | | | | | | | Even though setting this value to 3 is more correct. We break more games than we fix due to missing implementations. We should keep this as 0 for the time being
* | | | | Merge pull request #1370 from Hedges/GDBCleanMat M2018-09-201-1/+1
|\ \ \ \ \ | | | | | | | | | | | | Correct endianness of BRK
| * | | | | Correct endianness of BKPTJarek Syrylak2018-09-201-1/+1
| |/ / / /
* | | | | Merge pull request #1362 from MerryMage/dynarmicMat M2018-09-201-0/+12
|\ \ \ \ \ | |/ / / / |/| | | | externals: Update dynarmic to 171d116
| * | | | arm_dynarmic: Halt when BRK encounteredMerryMage2018-09-201-0/+1
| | | | |
| * | | | arm_dynarmic: Support BKPT instructionMerryMage2018-09-191-0/+11
| |/ / /
* | | | Merge pull request #1358 from DarkLordZach/temp-storagebunnei2018-09-201-4/+7
|\ \ \ \ | | | | | | | | | | savedata_factory: Add TemporaryStorage SaveDataType
| * | | | savedata_factory: Add TemporaryStorage SaveDataTypeZach Hilman2018-09-191-4/+7
| | |_|/ | |/| | | | | | Seems to be used by NSO NES Emulator
* | | | Merge pull request #1363 from lioncash/controlbunnei2018-09-202-14/+17
|\ \ \ \ | | | | | | | | | | control_metadata: Move language name array definition to the cpp file
| * | | | control_metadata: Remove unnecessary else within GetLanguageEntry()Lioncash2018-09-201-8/+8
| | | | | | | | | | | | | | | | | | | | | | | | | There's no need to indent the code here, given the if case contains a return statement at the end of it.
| * | | | control_metadata: Move language name array definition to the cpp fileLioncash2018-09-202-6/+9
| | |/ / | |/| | | | | | | | | | | | | | | | | | | | | | This was used in two different translation units (deconstructed_rom_directory and patch_manager). This means we'd be pointlessly duplicating the whole array twice due to it being defined within the header.
* | | | Merge pull request #1361 from lioncash/naxbunnei2018-09-204-19/+26
|\ \ \ \ | | | | | | | | | | xts_archive/nax: Minor interface changes
| * | | | xts_archive: Remove unused variables from CalculateHMAC256()Lioncash2018-09-191-3/+0
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | These variables aren't used, which still has an impact, as std::vector cannot be optimized away by the compiler (it's constructor and destructor are both non-trivial), so this was just wasting memory.
| * | | | xts_archive: Make AsNCA() return a std::unique_ptr instead of a std::shared_ptrLioncash2018-09-192-3/+3
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | std::shared_ptr isn't strictly necessary here and is only ever used in contexts where the object doesn't depend on being shared. This also makes the interface more flexible, as it's possible to create a std::shared_ptr from a std::unique_ptr (std::shared_ptr has a constructor that accepts a std::unique_ptr), but not the other way around.
| * | | | nax: Avoid re-parsing NAX data with GetFileType()Lioncash2018-09-192-13/+19
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | An instance of the NAX apploader already has an existing NAX instance in memory. Calling directly into IdentifyType() directly would re-parse the whole file again into yet another NAX instance, only to toss it away again. This gets rid of unnecessary/redundant file parsing and allocations.
| * | | | nax: Avoid unnecessary calls to AsNCA() in IdentifyType()Lioncash2018-09-191-4/+8
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | AsNCA() allocates an NCA instance every time it's called. In the current manner it's used, it's quite inefficient as it's making a redundant allocation. We can just amend the order of the conditionals to make it easier to just call it once.
| * | | | xts_archive: Ensure NAX's type member is always initializedLioncash2018-09-191-1/+1
| | | | | | | | | | | | | | | | | | | | Ensures that the member always has a deterministic value.
| * | | | xts_archive: Amend initializer order of NAX's constructorLioncash2018-09-191-2/+2
| |/ / / | | | | | | | | | | | | | | | | Orders the initializer list in the same order the members would be initialized. Avoids compiler warnings.
* | | | Removed unneeded event clearDavid Marcec2018-09-201-1/+0
| | | |
* | | | Implemented NTC & IEnsureNetworkClockAvailabilityServiceDavid Marcec2018-09-201-3/+100
|/ / / | | | | | | | | | Needed because of the recent nim fixes
* | | Reworked incorrect nifm stubs (#1355)David2018-09-191-3/+10
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * Reworked incorrect nifm stubs Need confirmation on `CreateTemporaryNetworkProfile`, unsure which game uses it but according to reversing. It should return a uuid which we currently don't do. Any 0 client id is considered an invalid client id. GetRequestState 0 is considered invalid. * Fixups for nifm
* | | Merge pull request #1359 from ogniK5377/nesbunnei2018-09-193-7/+12
|\ \ \ | | | | | | | | Fixed GetAccountId stub, Added error code for OpenDirectory and added ActivateNpadWithRevision
| * | | Fixed GetAccountId stub, Added error code for OpenDirectory and added ActivateNpadWithRevisionDavid Marcec2018-09-193-7/+12
| | |/ | |/| | | | | | | With these, `Nintendo Entertainment System - Nintendo Switch Online` loads
* | | Removed MakeBuilder as it's not needed anymoreDavid Marcec2018-09-191-7/+0
| | |
* | | Removed the use of rp.MakeBuilderDavid Marcec2018-09-196-27/+26
|/ / | | | | | | Due to keeping the code style consistent in the yuzu codebase. `rb = rp.MakeBuilder(...)` was replaced with `rb{ctx, ...}`
* | Merge pull request #1348 from ogniK5377/GetImageSizebunnei2018-09-191-1/+9
|\ \ | | | | | | Implemented IProfile::GetImageSize
| * | Implemented GetImageSizeDavid Marcec2018-09-181-1/+9
| | |
* | | Merge pull request #1351 from ogniK5377/GetDefaultDisplayResolutionbunnei2018-09-192-1/+18
|\ \ \ | | | | | | | | Implemented GetDefaultDisplayResolution
| * | | Implemented GetDefaultDisplayResolutionDavid Marcec2018-09-182-1/+18
| |/ /
* | | Merge pull request #1341 from lioncash/dependencybunnei2018-09-192-2/+6
|\ \ \ | | | | | | | | core/core_cpu: Replace exclusive monitor include with forward declaration
| * | | core/core_cpu: Replace exclusive monitor include with forward declarationLioncash2018-09-182-2/+6
| |/ / | | | | | | | | | | | | We don't need to include this as a dependency within the header. A regular forward declaration will suffice here.
* | | Merge pull request #1346 from lioncash/svcbunnei2018-09-191-37/+36
|\ \ \ | | | | | | | | svc_wrap: Convert the PARAM macro into a function
| * | | svc_wrap: Convert the PARAM macro into a functionLioncash2018-09-181-37/+36
| |/ / | | | | | | | | | | | | | | | This can just be a regular function, getting rid of the need to also explicitly undef the define at the end of the file. Given FuncReturn() was already converted into a function, it's #undef can also be removed.
* | | Merge pull request #1350 from ogniK5377/Six-Axis-Stubbunnei2018-09-191-4/+28
|\ \ \ | | | | | | | | Stubbed ActivateConsoleSixAxisSensor & StartConsoleSixAxisSensor
| * | | Added ActivateGestureDavid Marcec2018-09-181-1/+7
| | | |
| * | | Added StopSixAxisSensorDavid Marcec2018-09-181-1/+7
| | | |
| * | | Stubbed ActivateConsoleSixAxisSensor & StartConsoleSixAxisSensorDavid Marcec2018-09-181-2/+14
| |/ /
* | | Invalid default value of username in yuzu_cmd (#1334)Philippe Babin2018-09-191-2/+3
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * Fix bug where default username value for yuzu_cmd create an userprofile with uninitialize data as username * Fix format * Apply code review changes * Remove nullptr check
* | | Merge pull request #1343 from lioncash/mutexbunnei2018-09-182-2/+10
|\ \ \ | | | | | | | | kernel/svc: Handle invalid address cases within svcArbitrateLock() and svcArbitrateUnlock()
| * | | kernel/mutex: Replace ResultCode construction for invalid addresses with the named variantLioncash2018-09-181-2/+2
| | | | | | | | | | | | | | | | | | | | | | | | We already have a ResultCode constant for the case of an invalid address, so we can just use it instead of re-rolling that ResultCode type.
| * | | kernel/svc: Handle error cases for svcArbitrateLock() and svcArbitrateUnlock()Lioncash2018-09-181-0/+8
| |/ / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The kernel does the equivalent of the following check before proceeding: if (address + 0x8000000000 < 0x7FFFE00000) { return ERR_INVALID_MEMORY_STATE; } which is essentially what our IsKernelVirtualAddress() function does. So we should also be checking for this. The kernel also checks if the given input addresses are 4-byte aligned, however our Mutex::TryAcquire() and Mutex::Release() functions already handle this, so we don't need to add code for this case.
* | | Merge pull request #1344 from lioncash/armbunnei2018-09-187-99/+86
|\ \ \ | | | | | | | | arm_interface: Remove ARM11-isms from the CPU interface
| * | | arm_interface: Remove ARM11-isms from the CPU interfaceLioncash2018-09-187-99/+86
| |/ / | | | | | | | | | | | | | | | | | | | | | | | | This modifies the CPU interface to more accurately match an AArch64-supporting CPU as opposed to an ARM11 one. Two of the methods don't even make sense to keep around for this interface, as Adv Simd is used, rather than the VFP in the primary execution state. This is essentially a modernization change that should have occurred from the get-go.
* / / arm_dynarmic: Correct ExclusiveWrite128()'s operationLioncash2018-09-181-2/+2
|/ / | | | | | | | | | | Previously the second half of the value being written would overwrite the first half. Thankfully this wasn't a bug that was being encountered, as the function is currently unused.
* | Merge pull request #1312 from lioncash/fwdbunnei2018-09-173-7/+9
|\ \ | | | | | | service/vi: Replace includes with forward declarations where applicable
| * | service/vi: Replace includes with forward declarations where applicableLioncash2018-09-133-7/+9
| | |
* | | Merge pull request #1313 from lioncash/errorbunnei2018-09-171-1/+2
|\ \ \ | | | | | | | | kernel/errors: Amend error code for ERR_NOT_FOUND
| * | | kernel/errors: Amend error code for ERR_NOT_FOUNDLioncash2018-09-131-1/+2
| |/ / | | | | | | | | | | | | This is the value returned by the kernel for svcConnectToNamedPort() if the named port cannot be found.
* | | Merge pull request #1318 from lioncash/errors-smbunnei2018-09-172-8/+6
|\ \ \ | | | | | | | | services/sm: Amend error code constants
| * | | services/sm: Amend error code constantsLioncash2018-09-142-8/+6
| |/ / | | | | | | | | | | | | | | | | | | | | | Courtesy of @ogniK5377. This also moves them into the cpp file and limits the visibility to where they're directly used. It also gets rid of unused or duplicate error codes.
* | | Merge pull request #1315 from lioncash/sizebunnei2018-09-172-19/+74
|\ \ \ | | | | | | | | kernel/svc: Handle a few error cases within memory-related functions
| * | | kernel/svc: Sanitize creation of shared memory via svcCreateSharedMemory()Lioncash2018-09-141-2/+18
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The kernel caps the size limit of shared memory to 8589930496 bytes (or (1GB - 512 bytes) * 8), so approximately 8GB, where every GB has a 512 byte sector taken off of it. It also ensures the shared memory is created with either read or read/write permissions for both permission types passed in, allowing the remote permissions to also be set as "don't care".
| * | | kernel/svc: Sanitize addresses, permissions, and sizes within svcMapSharedMemory() and svcUnmapSharedMemory()Lioncash2018-09-141-17/+25
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Part of the checking done by the kernel is to check if the given address and size are 4KB aligned, as well as checking if the size isn't zero. It also only allows mapping shared memory as readable or read/write, but nothing else, and so we shouldn't allow mapping as anything else either.
| * | | kernel/svc: Sanitize addresses and sizes within svcMapMemory() and svcUnmapMemory()Lioncash2018-09-141-0/+23
| | | | | | | | | | | | | | | | | | | | The kernel checks if the addresses and given size is 4KB aligned before continuing onwards to map the memory.
| * | | kernel/svc: Sanitize heap sizes within svcSetHeapSize()Lioncash2018-09-142-0/+8
| |/ / | | | | | | | | | | | | The kernel checks if the given size is a multiple of 2MB and <= to 4GB before going ahead and attempting to allocate that much memory.
* | | Merge pull request #1328 from FearlessTobi/port-4192bunnei2018-09-171-1/+1
|\ \ \ | | | | | | | | Port #4192 from Citra: "svc: change unknown to thread in CreateThread"
| * | | Port # #4192 from Citra: "svc: change unknown to thread in CreateThread"Valentin Vanelslande2018-09-151-1/+1
| | |/ | |/|
* / | Port #4182 from Citra: "Prefix all size_t with std::"fearlessTobi2018-09-1579-395/+409
|/ /
* | Merge pull request #1310 from lioncash/kernel-nsbunnei2018-09-144-9/+10
|\ \ | | | | | | kernel/thread: Include thread-related enums within the kernel namespace
| * | kernel/thread: Include thread-related enums within the kernel namespaceLioncash2018-09-134-9/+10
| |/ | | | | | | | | | | Previously, these were sitting outside of the Kernel namespace, which doesn't really make sense, given they're related to the Thread class which is within the Kernel namespace.
* | Merge pull request #1309 from lioncash/nestedbunnei2018-09-143-12/+6
|\ \ | | | | | | service: Use nested namespace specifiers where applicable
| * | service: Use nested namespace specifiers where applicableLioncash2018-09-133-12/+6
| |/ | | | | | | | | | | There were a few places where nested namespace specifiers weren't being used where they could be within the service code. This amends that to make the namespacing a tiny bit more compact.
* | Merge pull request #1307 from lioncash/plbunnei2018-09-141-2/+4
|\ \ | |/ |/| services/pl_u: Add missing Korean font to the fallback case for shared fonts
| * services/pl_u: Add missing Korean font to the fallback case for shared fontsLioncash2018-09-131-2/+4
| | | | | | | | Previously this wasn't using the Korean font at all.
* | ipc: minor fixValentin Vanelslande2018-09-131-1/+1
|/
* Merge pull request #1163 from FearlessTobi/add-audio-stretchingbunnei2018-09-132-0/+4
|\ | | | | audio_core: Add audio stretching support
| * Add audio stretching supportfearlessTobi2018-09-082-0/+4
| |
* | Merge pull request #1297 from lioncash/plbunnei2018-09-122-66/+88
|\ \ | | | | | | pl_u: Eliminate mutable file-scope state
| * | pl_u: Eliminate mutable file-scope stateLioncash2018-09-122-66/+88
| | | | | | | | | | | | | | | Converts the PL_U internals to use the PImpl idiom and makes the state part of the Impl struct, eliminating mutable global/file state.
* | | Merge pull request #1303 from lioncash/errorbunnei2018-09-123-9/+11
|\ \ \ | | | | | | | | kernel/errors: Amend invalid thread priority and invalid processor ID error codes
| * | | svc: Return ERR_INVALID_PROCESSOR_ID in CreateThread() if an invalid processor ID is givenLioncash2018-09-121-2/+2
| | | | | | | | | | | | | | | | This is what the kernel does for an out-of-range processor ID.
| * | | kernel/errors: Correct error codes for invalid thread priority and invalid processor IDLioncash2018-09-123-7/+9
| | | |
* | | | svc: Do nothing if svcOutputDebugString() is given a length of zeroLioncash2018-09-121-0/+4
| | | | | | | | | | | | | | | | | | | | | | | | While unlikely, it does avoid constructing a std::string and unnecessarily calling into the memory code if a game or executable decides to be really silly about their logging.
* | | | svc: Correct parameter type for OutputDebugString()Lioncash2018-09-122-3/+3
|/ / / | | | | | | | | | This should be a u64 to represent size.
* | | Merge pull request #1296 from lioncash/prepobunnei2018-09-122-39/+40
|\ \ \ | | | | | | | | service/prepo: Move class into the cpp file
| * | | service/prepo: Move class into the cpp fileLioncash2018-09-122-39/+40
| |/ / | | | | | | | | | | | | | | | This doesn't need to be exposed within the header and be kept in the translation unit, eliminating the need to include anything within the header.
* / / service/audio: Replace includes with forward declarations where applicableLioncash2018-09-127-17/+34
|/ / | | | | | | | | A few headers were including other headers when a forward declaration can be used instead, allowing the include to be moved to the cpp file.
* | Merge pull request #1291 from lioncash/defaultbunnei2018-09-11148-45/+291
|\ \ | | | | | | hle/service: Default constructors and destructors in the cpp file where applicable
| * | hle/service: Default constructors and destructors in the cpp file where applicableLioncash2018-09-11148-45/+291
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | When a destructor isn't defaulted into a cpp file, it can cause the use of forward declarations to seemingly fail to compile for non-obvious reasons. It also allows inlining of the construction/destruction logic all over the place where a constructor or destructor is invoked, which can lead to code bloat. This isn't so much a worry here, given the services won't be created and destroyed frequently. The cause of the above mentioned non-obvious errors can be demonstrated as follows: ------- Demonstrative example, if you know how the described error happens, skip forwards ------- Assume we have the following in the header, which we'll call "thing.h": \#include <memory> // Forward declaration. For example purposes, assume the definition // of Object is in some header named "object.h" class Object; class Thing { public: // assume no constructors or destructors are specified here, // or the constructors/destructors are defined as: // // Thing() = default; // ~Thing() = default; // // ... Some interface member functions would be defined here private: std::shared_ptr<Object> obj; }; If this header is included in a cpp file, (which we'll call "main.cpp"), this will result in a compilation error, because even though no destructor is specified, the destructor will still need to be generated by the compiler because std::shared_ptr's destructor is *not* trivial (in other words, it does something other than nothing), as std::shared_ptr's destructor needs to do two things: 1. Decrement the shared reference count of the object being pointed to, and if the reference count decrements to zero, 2. Free the Object instance's memory (aka deallocate the memory it's pointing to). And so the compiler generates the code for the destructor doing this inside main.cpp. Now, keep in mind, the Object forward declaration is not a complete type. All it does is tell the compiler "a type named Object exists" and allows us to use the name in certain situations to avoid a header dependency. So the compiler needs to generate destruction code for Object, but the compiler doesn't know *how* to destruct it. A forward declaration doesn't tell the compiler anything about Object's constructor or destructor. So, the compiler will issue an error in this case because it's undefined behavior to try and deallocate (or construct) an incomplete type and std::shared_ptr and std::unique_ptr make sure this isn't the case internally. Now, if we had defaulted the destructor in "thing.cpp", where we also include "object.h", this would never be an issue, as the destructor would only have its code generated in one place, and it would be in a place where the full class definition of Object would be visible to the compiler. ---------------------- End example ---------------------------- Given these service classes are more than certainly going to change in the future, this defaults the constructors and destructors into the relevant cpp files to make the construction and destruction of all of the services consistent and unlikely to run into cases where forward declarations are indirectly causing compilation errors. It also has the plus of avoiding the need to rebuild several services if destruction logic changes, since it would only be necessary to recompile the single cpp file.
* | | externals: Place font data within cpp filesLioncash2018-09-111-6/+6
|/ / | | | | | | | | | | | | | | | | | | | | | | | | | | | | This places the font data within cpp files, which mitigates the possibility of the font data being duplicated within the binary if it's referred to in more than one translation unit in the future. It also stores the data within a std::array, which is more flexible when it comes to operating with the standard library. Furthermore, it makes the data arrays const. This is what we want, as it allows the compiler to store the data within the read-only segment. As it is, having several large sections of mutable data like this just leaves spots in memory that we can accidentally write to (via accidental overruns, what have you) and actually have it work. This ensures the font data remains the same no matter what.
* | Use open-source shared fonts if no dumped file is available (#1269)Tobias2018-09-112-2/+26
| | | | | | | | | | | | * Add open-source shared fonts * Address review comments
* | video_core: Move command buffer loop.Markus Wick2018-09-102-31/+12
| | | | | | | | This moves the hot loop into video_core. This refactoring shall reduce the CPU overhead of calling ProcessCommandList.
* | Merge pull request #1276 from FearlessTobi/fix-stupid-stubbunnei2018-09-102-4/+6
|\ \ | | | | | | hid: Implement ReloadInputDevices
generated by cgit v1.2.3 (git 2.25.1) at 2024-10-30 23:16:41 +0100