summaryrefslogtreecommitdiffstats
path: root/src/core (follow)
Commit message (Collapse)AuthorAgeFilesLines
* Merge pull request #1742 from lioncash/hle-swkbdbunnei2018-11-215-44/+63
|\ | | | | am/applets: Minor cleanup
| * am/applets: Make the applet data broker part of the applet itself.Lioncash2018-11-205-31/+36
| | | | | | | | | | The accessor should be doing just that, accessing, rather than retaining the lifetime of the data broker as well.
| * am/applets: Replace includes with forward declarations where applicableLioncash2018-11-202-2/+9
| | | | | | | | | | Also resolve places where includes should have been provided, but weren't.
| * am/applets: Relocate comments above the relevant data member in AppletDataBrokerLioncash2018-11-201-11/+18
| | | | | | | | Avoids wonky wrapping and makes it nicer to read.
* | am: Correct build failureLioncash2018-11-211-2/+2
| | | | | | | | | | | | | | The interface for shared memory was changed, but another commit was merged that relied on the (previously public) internals of SharedMemory. This amends that discrepancy.
* | Merge pull request #1734 from lioncash/sharedbunnei2018-11-213-29/+45
|\ \ | | | | | | kernel/shared_memory: Make data members private, plus minor interface changes
| * | kernel/shared_memory: Make Map() and Unmap() take the target process by reference rather than as a pointerLioncash2018-11-193-12/+12
| | | | | | | | | | | | | | | | | | Both member functions assume the passed in target process will not be null. Instead of making this assumption implicit, we can change the functions to be references and enforce this at the type-system level.
| * | kernel/shared_memory: Add a const qualified member function overload for GetPointer()Lioncash2018-11-192-1/+12
| | | | | | | | | | | | | | | Given this doesn't mutate instance state, we can provide a const-qualified variant as well.
| * | kernel/shared_memory: Use 64-bit types for offset and size in CreateForAppletLioncash2018-11-192-2/+2
| | | | | | | | | | | | Keeps the interface consistent with the regular Create() function.
| * | kernel/shared_memory: Make GetPointer() take a std::size_t instead of a u32Lioncash2018-11-192-2/+2
| | | | | | | | | | | | | | | | | | | | | Makes the interface nicer to use in terms of 64-bit code, as it makes it less likely for one to get truncation warnings (and also makes sense in the context of the rest of the interface where 64-bit types are used for sizes and offsets
| * | kernel/shared_memory: Make data members privateLioncash2018-11-191-12/+17
| | | | | | | | | | | | | | | | | | Rather than allow unfettered access to the class internals, we hide all members by default and create and API that other code can operate against.
* | | Merge pull request #1733 from lioncash/ldrbunnei2018-11-211-29/+12
|\ \ \ | | | | | | | | ldr: Clean up error codes
| * | | ldr: Clean up error codesLioncash2018-11-191-29/+12
| |/ / | | | | | | | | | | | | | | | The separate enum isn't particularly necessary here, and the values can just be directly put into the ResultCode instances, given the names are also self-documenting here.
* | | Merge pull request #1746 from lioncash/randombunnei2018-11-212-1/+1
|\ \ \ | | | | | | | | kernel/process: Move <random> include to the cpp file
| * | | kernel/process: Move <random> include to the cpp fileLioncash2018-11-202-1/+1
| | |/ | |/| | | | | | | | | | | | | <random> isn't necesary directly within the header and can be placed in the cpp file where its needed. Avoids propagating random generation utilities via a header file.
* / | file_sys/card_image: Provide named members for the GamecardInfo structLioncash2018-11-211-1/+12
|/ / | | | | | | Fills out the struct according to information provided by SwitchBrew
* | Merge pull request #1667 from DarkLordZach/swkbdbunnei2018-11-2012-106/+840
|\ \ | | | | | | am: Implement HLE software keyboard applet
| * | software_keyboard: Fix erroneous extra PushNormalDataZach Hilman2018-11-191-3/+2
| | |
| * | software_keyboard: Return correct result code on user cancel operationZach Hilman2018-11-193-5/+1
| | |
| * | applet: Add AppletDataBroker to manage HLE to AM service interactionZach Hilman2018-11-195-104/+194
| | | | | | | | | | | | This cleans up most of the callbacks and such in the Applets::Applet interface, while also properly implementing all four data channels.
| * | software_keyboard: Use correct offset for inital text stringZach Hilman2018-11-191-1/+2
| | |
| * | software_keyboard: Check for UTF-8 config flagZach Hilman2018-11-192-9/+23
| | |
| * | software_keyboard: Push all data over all channels on dialog completionZach Hilman2018-11-181-18/+26
| | |
| * | applet: Use std::queue instead of std::vector for storage stackZach Hilman2018-11-185-18/+44
| | |
| * | applet: Add operation completed callbackZach Hilman2018-11-184-6/+12
| | |
| * | software_keyboard: Push buffer size to offset 0x4 in output dataZach Hilman2018-11-184-18/+39
| | |
| * | software_keyboard: Make GetText asynchronousZach Hilman2018-11-185-11/+29
| | | | | | | | | | | | a
| * | am: Allow applets to push multiple and different channels of dataZach Hilman2018-11-186-44/+41
| | |
| * | am: Implement ILibraryAppletAccessor IsCompleted and GetResultZach Hilman2018-11-182-4/+9
| | |
| * | am: Implement text check software keyboard modeZach Hilman2018-11-185-14/+103
| | | | | | | | | | | | Allows the game to verify and send a message to the frontend.
| * | am: Deglobalize software keyboard appletZach Hilman2018-11-1811-62/+106
| | |
| * | qt/main: Register Qt Software Keyboard frontend with AMZach Hilman2018-11-181-0/+1
| | | | | | | | | | | | Allows using Qt provider over default.
| * | am: Construct and use proper applets with ILibraryAppletAccessorZach Hilman2018-11-181-1/+26
| | | | | | | | | Allows use of software keyboard applet and future applets to be easily added by adding enum ID and a switch case.
| * | am/applets: Add connector between frontend and AM applet classesZach Hilman2018-11-183-0/+130
| | | | | | | | | Provides a middleman between the Frontend provider class and the expected AM::Applets::Applet class needed by ILibraryAppletAccessor
| * | frontend/applets: Add frontend software keyboard provider and defaultZach Hilman2018-11-183-0/+63
| | | | | | | | | Default implementation will return "yuzu" for any string. GUI clients (or CLI) can implement the Frontend::SoftwareKeyboardApplet class and register an instance to provide functionality.
| * | am/applets: Add Applet superclass to describe a generic appletZach Hilman2018-11-183-0/+77
| | | | | | | | | Adds an Initialize and Execute methods which are used by the ILibraryAppletAccessor to start and control the applet.
| * | am: Unstub ILibraryAppletAccessor::StartZach Hilman2018-11-181-5/+17
| | | | | | | | | Now starts the applet provided in constructor.
| * | am: Implement PopInteractiveOutData and PushInteractiveInDataZach Hilman2018-11-181-14/+24
| | | | | | | | | Used by software keyboard applet for data transfer.
| * | am: Convert storage stack to vectorZach Hilman2018-11-181-27/+59
| | | | | | | | | std::stack was no longer suitable for non-trivial operations
| * | am: Move AM::IStorage to headerZach Hilman2018-11-181-0/+16
| | | | | | | | | Needs to be accessible by applet files.
| * | am: Move IStorageAccessor to header and update backing bufferZach Hilman2018-11-182-64/+62
| | | | | | | | | Writes to an AM::IStorage object through an IStorageAccessor will now be preserved once the accessor is destroyed.
| * | am: Implement CreateTransferMemoryStorageZach Hilman2018-11-182-0/+26
| | | | | | | | | Creates an AM::IStorage object with the contents of the transfer memory located at the handle provided.
| * | svc: Implement svcCreateTransferMemoryZach Hilman2018-11-181-3/+33
| | | | | | | | | Seems to be used and created identically to SharedMemory, so just reuse that.
* | | Merge pull request #1739 from lioncash/lmbunnei2018-11-201-1/+12
|\ \ \ | | | | | | | | lm: Implement SetDestination by doing nothing
| * | | lm: Implement SetDestination by doing nothingLioncash2018-11-201-1/+12
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This service function was likely intended to be a way to redirect where the output of a log went. e.g. Firing a log over a network, dumping over a tunneling session, etc. Given we always want to see the log and not change its output. It's one of the lucky service functions where the easiest implementation is to just do nothing at all and return success.
* | | | kernel/resource_limit: Clean up interfaceLioncash2018-11-206-190/+81
|/ / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Cleans out the citra/3DS-specific implementation details that don't apply to the Switch. Sets the stage for implementing ResourceLimit instances properly. While we're at it, remove the erroneous checks within CreateThread() and SetThreadPriority(). While these are indeed checked in some capacity, they are not checked via a ResourceLimit instance. In the process of moving out Citra-specifics, this also replaces the system ResourceLimit instance's values with ones from the Switch.
* | | hid: Use player-defined controller type as PREFERRED_CONTROLLERZach Hilman2018-11-196-215/+114
| | |
* | | hid/npad: Update NPad to use player controller bindings and typeZach Hilman2018-11-192-55/+108
| | |
* | | hid/touchscreen: Update Touchscreen to use advanced parametersZach Hilman2018-11-191-6/+6
| | | | | | | | | | | | Including finger ID, diamater x/y, and angle. Additionally, checks if the touchscreen is enabled.
* | | hid: Add controller bindings for Mouse controllerZach Hilman2018-11-192-4/+30
| | |
* | | hid: Add keyboard bindings for Keyboard controllerZach Hilman2018-11-192-2/+24
| | |
* | | hid: Add controller bindings for DebugPad controllerZach Hilman2018-11-192-21/+43
| | | | | | | | | | | | Used by developers to test games, not present on retail systems. Some games are known to respond to DebugPad input though, for example Kirby Star Allies.
* | | settings: Add settings for multiple players and controllersZach Hilman2018-11-191-3/+48
| | | | | | | | | | | | Uses the PlayerInput struct to represent all of the data that constitutes a player.
* | | settings: Add Native type for keyboardZach Hilman2018-11-191-0/+210
| | |
* | | settings: Add Native type for mouse buttonsZach Hilman2018-11-192-0/+34
| | |
* | | Added missing start/end touch attributes to touchscreenDavid Marcec2018-11-192-1/+18
| | |
* | | Added debugpad skeletonDavid Marcec2018-11-192-2/+55
| | |
* | | Added controller helper funcsDavid Marcec2018-11-192-0/+35
| | |
* | | Changed polling rate of hid and Right joycon rotationDavid Marcec2018-11-191-2/+2
| | |
* | | Left joycon rotation button remappingDavid Marcec2018-11-192-7/+21
| | |
* | | Added automatic npad switch based on supported stylesetsDavid Marcec2018-11-192-4/+124
| | |
* | | Added multi-input support and controller assignment at any portDavid Marcec2018-11-192-122/+181
| |/ |/|
* | Merge pull request #1620 from DarkLordZach/ldr-robunnei2018-11-197-23/+405
|\ \ | | | | | | ldr_ro: Complete LDR:RO implementation
| * | ldr_ro: Add error check for memory allocation failureZach Hilman2018-11-184-13/+27
| | |
| * | ldr_ro: Implement UnloadNro (command 1)Zach Hilman2018-11-151-22/+85
| | | | | | | | | | | | Includes actual unmapping and address error checking.
| * | ldr_ro: Fully Implement LoadNro (command 0)Zach Hilman2018-11-151-11/+110
| | | | | | | | | | | | Includes NRO and BSS error checking, maximum loaded NRO check, NRR hash check, and proper remapping of BSS data.
| * | ldr_ro: Implement UnloadNrr (command 3)Zach Hilman2018-11-151-2/+84
| | | | | | | | | | | | Includes initialization check, proper address check, alignment check, and actual unloading of a loaded NRR.
| * | ldr_ro: Fully implement LoadNrr (command 2)Zach Hilman2018-11-151-0/+112
| | | | | | | | | | | | Includes parameter error checking, hash enforcement, initialization check, and max NRR load check.
| * | process: Make MirrorMemory take state to map new memory asZach Hilman2018-11-152-3/+7
| | | | | | | | | | | | Credits to Subv
| * | pl_u: Resize buffers in shared font data getter to what game requestsZach Hilman2018-11-151-0/+8
| | | | | | | | | | | | Fixes unmapped spam in SMP and buffer size errors in some other games
* | | Merge pull request #1718 from ogniK5377/lets-go-softlockbunnei2018-11-193-1/+18
|\ \ \ | | | | | | | | Implemented CalculateStandardUserSystemClockDifferenceByUser
| * | | Implemented CalculateStandardUserSystemClockDifferenceByUserDavid Marcec2018-11-173-1/+18
| | | | | | | | | | | | | | | | Seems pokemon calls this sometimes and it caused "random crashes"
* | | | Merge pull request #1671 from DarkLordZach/vi-disconnectbunnei2018-11-191-0/+22
|\ \ \ \ | | | | | | | | | | vi: Implement TransactParcel for Disconnect and DetachBuffer
| * | | | vi: Implement TransactParcel for Disconnect and DetachBufferZach Hilman2018-11-171-0/+22
| | | | | | | | | | | | | | | | | | | | Used by homebrew on exit. According to switchbrew, returns an empty response parcel with one zero in it.
* | | | | Merge pull request #1728 from FearlessTobi/reset-signalMat M2018-11-181-1/+1
|\ \ \ \ \ | |_|_|_|/ |/| | | | svc: ResetSignal is not stubbed
| * | | | svc: ResetSignal is not stubbedTobias2018-11-181-1/+1
| | | | | | | | | | | | | | | https://user-images.githubusercontent.com/20753089/48677874-b8e01c80-eb7b-11e8-8043-b99faa29022c.PNG
* | | | | Stubbed am:EnableApplicationCrashReportMysticExile2018-11-172-10/+18
| | | | |
* | | | | Merge pull request #1711 from ogniK5377/bluetooth-lets-gobunnei2018-11-172-1/+145
|\ \ \ \ \ | | | | | | | | | | | | Added various bluetooth based cmds for palma
| * | | | | Added various bluetooth based cmds for palmaDavid Marcec2018-11-162-1/+145
| | | | | | | | | | | | | | | | | | | | | | | | It seems palma is done through bluetooth, we need this for pokemon go however more research needs to be done when we actually get palma working. This is presumably used for transfering data between the controller and the console, it does not seem for actual input as far as I know.
* | | | | | Merge pull request #1719 from bunnei/hwopus-fixbunnei2018-11-171-1/+1
|\ \ \ \ \ \ | | | | | | | | | | | | | | hwopus: DecodeInterleavedWithPerformance: Fix ordering of output parameters.
| * | | | | | hwopus: DecodeInterleavedWithPerformance: Fix ordering of output parameters.bunnei2018-11-171-1/+1
| | |_|_|/ / | |/| | | | | | | | | | | | | | | | - Fixes audio issues with Pokemon: Let's Go Pikachu & Eevee.
* / | | | | kernel/errors: Clean up error codesLioncash2018-11-162-62/+32
|/ / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Similar to PR 1706, which cleans up the error codes for the filesystem code, but done for the kernel error codes. This removes the ErrCodes namespace and specifies the errors directly. This also fixes up any straggling lines of code that weren't using the named error codes where applicable.
* | | | | Merge pull request #1638 from FreddyFunk/SetMemoryPermission-StubbedMat M2018-11-162-1/+48
|\ \ \ \ \ | | | | | | | | | | | | Implement SetMemoryPermission
| * | | | | Implement SetMemoryPermissionFrederic Laing2018-11-061-3/+39
| | | | | |
| * | | | | Stubbed SetMemoryPermissionFrederic Laing2018-11-032-1/+12
| | |_|/ / | |/| | |
* | | | | Merge pull request #1632 from DarkLordZach/keys-manager-optimizationsbunnei2018-11-1610-14/+34
|\ \ \ \ \ | | | | | | | | | | | | game_list: Optimize game list refresh
| * | | | | filesystem: Cache RegisteredCacheUnion instead of constructing on demandZach Hilman2018-11-022-4/+11
| | | | | | | | | | | | | | | | | | | | | | | | Prevents unnecessary re-reads of the metadata and unnecessary temporary objects.
| * | | | | file_sys: Use common KeyManager in NCA container typesZach Hilman2018-11-026-7/+18
| | | | | | | | | | | | | | | | | | | | | | | | Creates a single KeyManager for the entire container and then passes it into the NCA constructor, eliminating several unnecessary KeyManager reads.
| * | | | | content_archive: Add optional KeyManager parameter to constructorZach Hilman2018-11-022-3/+5
| | | | | | | | | | | | | | | | | | | | | | | | Allows resuing a common KeyManager when a large amount of NCAs are handled by the same class. Should the parameter not be provided, a new KeyManager will be constructed, as was the default behavior prior to this.
* | | | | | Merge pull request #1706 from lioncash/file-errbunnei2018-11-164-33/+16
|\ \ \ \ \ \ | | | | | | | | | | | | | | file_sys/errors: Clean up error code values
| * | | | | | file_sys/errors: Remove currently unused filesystem error codesLioncash2018-11-161-10/+0
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Rather than keeping around unused values, we can just introduce them as needed.
| * | | | | | file_sys/errors: Get rid of the ErrCodes namespaceLioncash2018-11-161-17/+5
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | There's no real point to keeping the separate enum around, especially given the name of the error code itself is supposed to document what the value actually represents.
| * | | | | | file_sys/errors: Extract FS-related error codes to file_sys/errors.hLioncash2018-11-164-14/+19
| | |_|/ / / | |/| | | | | | | | | | | | | | | | Keeps filesystem-related error codes in one spot.
* / | | | | Added SetIsPalmaAllConnectable, SetPalmaBoostModeDavid Marcec2018-11-161-2/+14
|/ / / / / | | | | | | | | | | | | | | | Currently unclear what these do yet, will be researched at a later time when we want to implement palma.
* | | | | Fixed priority switching edge case for handheld (#1675)David2018-11-161-12/+46
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * Fixed priority switching edge case for handheld We accidently used controller index instead of npad id * Moved NPadIdToIndex
* | | | | Merge pull request #1699 from DarkLordZach/deterministic-rng-3bunnei2018-11-161-1/+2
|\ \ \ \ \ | | | | | | | | | | | | csrng: Use random integer distribution instead of raw engine
| * | | | | csrng: Use random integer distribution instead of raw engineZach Hilman2018-11-161-1/+2
| | |_|_|/ | |/| | | | | | | | | | | | | Prevents returning the same value every single call.
* | | | | Merge pull request #1687 from lioncash/deduplicationbunnei2018-11-152-37/+13
|\ \ \ \ \ | | | | | | | | | | | | kernel/thread: Deduplicate scheduler switching code
| * | | | | kernel/thread: Deduplicate scheduler switching codeLioncash2018-11-142-37/+13
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The code in both places was the same verbatim, so we can extract it to a function to deduplicate the logic.
* | | | | | Merge pull request #1618 from DarkLordZach/dump-nsobunnei2018-11-157-7/+48
|\ \ \ \ \ \ | | | | | | | | | | | | | | patch_manager: Add support for dumping uncompressed NSOs
| * | | | | | patch_manager: Add support for dumping decompressed NSOsZach Hilman2018-10-292-1/+14
| | | | | | | | | | | | | | | | | | | | | | | | | | | | When enabled in settings, PatchNSO will dump the unmodified NSO that it was passed to a file named <build id>.nso in the dump root for the current title ID.
| * | | | | | settings: Add setting to control NSO dumpingZach Hilman2018-10-291-0/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | Also adds UI option in Debug > Dump section, with the idea later things to be dumped (i.e. other game data or textures, etc) will use the same group box.
| * | | | | | bis_factory: Add getter for mod dump root for a title IDZach Hilman2018-10-294-6/+33
| | |_|_|_|/ | |/| | | | | | | | | | | | | | | | Equates to yuzu_dir/dump/<title id>/
* | | | | | Merge pull request #1691 from lioncash/audrenbunnei2018-11-151-3/+3
|\ \ \ \ \ \ | |_|_|/ / / |/| | | | | service/audren_u: Forward RequestUpdateAuto through the same function as RequestUpdate
| * | | | | service/audren_u: Forward RequestUpdateAuto through the same function as RequestUpdateLioncash2018-11-141-3/+3
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Based off RE, they both currently go through the same codepath with no difference in behavior.
* | | | | | Merge pull request #1697 from lioncash/accbunnei2018-11-152-15/+23
|\ \ \ \ \ \ | | | | | | | | | | | | | | acc/profile_manager: Minor cleanup-related changes
| * | | | | | profile_manager: Replace iterative loop with a ranged-for loop in ParseUserSaveFile()Lioncash2018-11-141-4/+5
| | | | | | |
| * | | | | | profile_manager: Move UUID Format function definitions into the cpp fileLioncash2018-11-142-11/+18
| | | | | | | | | | | | | | | | | | | | | | | | | | | | Avoids relying on fmt always being indirectly included.
* | | | | | | Merge pull request #1696 from lioncash/acc-condbunnei2018-11-151-2/+4
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | service/acc: Correct error case within TrySelectUserWithoutInteraction()
| * | | | | | | service/acc: Correct error case within TrySelectUserWithoutInteraction()Lioncash2018-11-141-2/+4
| |/ / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | empty() in this case will always return false, since the returned container is a std::array. Instead, check if all given users are invalid before returning the error code.
* | | | | | | Merge pull request #1690 from lioncash/nfpbunnei2018-11-141-1/+1
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | nfp: Correct erroneous sizeof expression within GetTagInfo()
| * | | | | | | nfp: Correct erroneous sizeof expression within GetTagInfo()Lioncash2018-11-141-1/+1
| | |_|_|/ / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The previous expression would copy sizeof(size_t) amount of bytes (8 on a 64-bit platform) rather than the full 10 bytes comprising the uuid member. Given the source and destination types are the same, we can just use an assignment here instead.
* | | | | | | Merge pull request #1689 from lioncash/breakbunnei2018-11-141-0/+1
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | hid/npad: Add missing break in switch statement within Controller_NPad::OnUpdate
| * | | | | | | hid/npad: Add missing break in switch statement within Controller_NPad::OnUpdate()Lioncash2018-11-141-0/+1
| |/ / / / / /
* | | | | | | Merge pull request #1688 from lioncash/unusedbunnei2018-11-141-2/+2
|\ \ \ \ \ \ \ | |_|/ / / / / |/| | | | | | service: Mark MakeFunctionString with the [[maybe_unused]] attribute.
| * | | | | | service: Mark MakeFunctionString with the [[maybe_unused]] attribute.Lioncash2018-11-141-2/+2
| |/ / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | When yuzu is compiled in release mode this function is unused, however, when compiled in debug mode, it's used within a LOG_TRACE statement. This prevents erroneous compilation warnings about an unused function (that isn't actually totally unused).
* | | | | | Merge pull request #1679 from DarkLordZach/deterministic-rng-2bunnei2018-11-144-2/+28
|\ \ \ \ \ \ | |_|/ / / / |/| | | | | svc: Use proper random entropy generation algorithm
| * | | | | svc: Use proper random entropy generation algorithmZach Hilman2018-11-134-2/+28
| |/ / / /
* | | | | Merge pull request #1680 from lioncash/membunnei2018-11-144-86/+98
|\ \ \ \ \ | | | | | | | | | | | | kernel/process: Migrate heap-related memory management out of the process class and into the vm manager
| * | | | | vm_manager: Unstub GetTotalHeapUsage()Lioncash2018-11-131-2/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Now that we've moved all of the heap-related stuff to the VMManager class, we can unstub this function, as the necessary members are visible now.
| * | | | | kernel/process: Migrate heap-related memory management out of the process class and into the vm managerLioncash2018-11-134-84/+97
| |/ / / / | | | | | | | | | | | | | | | | | | | | Avoids a breach of responsibilities in the interface and keeps the direct code for memory management within the VMManager class.
* | | | | Merge pull request #1682 from lioncash/audiobunnei2018-11-141-2/+23
|\ \ \ \ \ | | | | | | | | | | | | hle/audren_u: Implement Get/SetRenderingTimeLimit
| * | | | | hle/audren_u: Implement Get/SetRenderingTimeLimitLioncash2018-11-131-2/+23
| |/ / / / | | | | | | | | | | | | | | | | | | | | These appear to be a basic getter and setter pair, so these are fairly trivial to implement and get out of the way.
* | | | | Merge pull request #1608 from DarkLordZach/save-data-readerbunnei2018-11-1410-16/+260
|\ \ \ \ \ | |/ / / / |/| | | | [ns|fsp_srv]: Implement various functions to boot Checkpoint
| * | | | ns: Implement command 400: GetApplicationControlDataZach Hilman2018-10-294-17/+75
| | | | | | | | | | | | | | | Returns the raw NACP bytes and the raw icon bytes into a title-provided buffer. Pulls from Registration Cache for control data, returning all zeros should it not exist.
| * | | | fsp_srv: Implement ISaveDataInfoReaderZach Hilman2018-10-291-0/+144
| | | | | | | | | | | | | | | | | | | | An object to read SaveDataInfo objects, which describe a unique save on the system. This implementation iterates through all the directories in the save data space and uses the paths to reconstruct the metadata.
| * | | | fsp_srv: Implement command 61: OpenSaveDataInfoReaderBySaveDataSpaceIdZach Hilman2018-10-292-1/+13
| | | | | | | | | | | | | | | | | | | | Needed by Checkpoint. Returns an object that can iterate through all savedata on the system.
| * | | | savedata_factory: Expose accessors for SaveDataSpaceZach Hilman2018-10-294-14/+32
| | | | |
| * | | | loader/nro: Call RegisterRomFS from LoadZach Hilman2018-10-291-0/+5
| | | | | | | | | | | | | | | | | | | | Allows NRO homebrew to use the RomFS in the ASET section.
| * | | | control_metadata: Add GetRawBytes function to NACPZach Hilman2018-10-292-0/+7
| |/ / / | | | | | | | | | | | | Returns the raw bytes of the NACP file. Needed for GetApplicationControlData which returns the raw, unprocessed NACP to the game.
* | | | Merge pull request #1670 from DarkLordZach/deterministic-rngbunnei2018-11-134-3/+15
|\ \ \ \ | | | | | | | | | | csrng: Add config option to set RNG seed
| * | | | svc: Return random seed for svcGetInfo RandomEntropyZach Hilman2018-11-131-1/+2
| | | | |
| * | | | settings: Add config option to set RNG seedZach Hilman2018-11-121-0/+2
| | | | |
| * | | | csrng: Use std::mt19937 engine for random number generationZach Hilman2018-11-122-2/+11
| | | | |
* | | | | Merge pull request #1665 from ogniK5377/GetClockSnapshotbunnei2018-11-133-21/+132
|\ \ \ \ \ | |/ / / / |/| | | | Implement GetClockSnapshot, ToPosixTime & ToPosixTimeWithMyRule
| * | | | Added maybe_unusedDavid Marcec2018-11-102-2/+7
| | | | |
| * | | | Added ToPosixTime & ToPosixTimeWithMyRuleDavid Marcec2018-11-101-2/+41
| | | | | | | | | | | | | | | | | | | | Added instead of using a seperate PR to prevent conflicts
| * | | | Added consts and staticDavid Marcec2018-11-101-6/+6
| | | | |
| * | | | Implement GetClockSnapshotDavid Marcec2018-11-093-21/+88
| | | | | | | | | | | | | | | | | | | | Needed by megaman 11
* | | | | Merge pull request #1652 from FreddyFunk/static-castbunnei2018-11-111-2/+2
|\ \ \ \ \ | | | | | | | | | | | | configure_system: Fix compiler warning
| * | | | | configure_system: Fix compiler warningFrederic Laing2018-11-061-2/+2
| | | | | |
* | | | | | Merge pull request #1656 from ogniK5377/message-queueJames Rowe2018-11-106-35/+138
|\ \ \ \ \ \ | |_|/ / / / |/| | | | | Ability to switch between docked and undocked mode in-game
| * | | | | FixupsDavid Marcec2018-11-071-1/+1
| | | | | |
| * | | | | Ability to switch between docked and undocked mode in-gameDavid Marcec2018-11-076-35/+138
| |/ / / / | | | | | | | | | | | | | | | Started implementation of the AM message queue mainly used in state getters. Added the ability to switch docked mode whilst in game without stopping emulation. Also removed some things which shouldn't be labelled as stubs as they're implemented correctly
* | | | | Merge pull request #1658 from ogniK5377/holdtype-stylebunnei2018-11-081-0/+2
|\ \ \ \ \ | | | | | | | | | | | | Updated npad styles on holdtype switches
| * | | | | Updated npad styles on holdtype switchesDavid Marcec2018-11-071-0/+2
| |/ / / / | | | | | | | | | | | | | | | Fixes input for megaman
* | | | | svcBreak now dumps information from the debug buffer passed (#1646)David2018-11-081-0/+28
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * svcBreak now dumps information from the debug buffer passed info1 and info2 seem to somtimes hold an address to a buffer, this is usually 4 bytes or the size of the int and contains an error code. There's other circumstances where it can be something different so we hexdump these to examine them at a later date. * Addressed comments
* | | | | fixed spelling errorDavid Marcec2018-11-071-1/+1
| | | | |
* | | | | Added missing logDavid Marcec2018-11-071-0/+1
| | | | |
* | | | | Implement acc:TrySelectUserWithoutInteractionDavid Marcec2018-11-075-3/+25
|/ / / / | | | | | | | | | | | | Needed for Shantae - Half-Genie Hero - Ultimate Edition!
* | | | Merge pull request #1633 from ogniK5377/reload-inputbunnei2018-11-052-0/+5
|\ \ \ \ | | | | | | | | | | Fixed HID crash when launching more than 1 game & signaled styleset change event
| * | | | Fixed HID crash when launching more than 1 game & signaled syleset change eventDavid Marcec2018-11-022-0/+5
| | | | | | | | | | | | | | | | | | | | This should fix crashes when launching multiple games in yuzu
* | | | | Fix typo in BufferTransformFlagsFrederic Laing2018-11-041-2/+2
| |_|_|/ |/| | |
* | | | Fixed incorrect hwopus assertDavid Marcec2018-11-021-1/+1
|/ / /
* | | Merge pull request #1615 from lioncash/inputbunnei2018-11-021-1/+2
|\ \ \ | | | | | | | | configure_system: Contrain profile usernames to 32 characters
| * | | configure_system: Contrain profile usernames to 32 charactersLioncash2018-10-311-1/+2
| |/ / | | | | | | | | | | | | | | | | | | | | | | | | | | | Previously, we would let a user enter an unbounded name and then silently truncate away characters that went over the 32-character limit. This is kind of bad from the UX point of view, because we're essentially not doing what the user intended in certain scenarios. Instead, we clamp it to 32 characters and make that visually apparent in the dialog box to provide a name for a user.
* | | Merge pull request #1604 from FearlessTobi/port-4369bunnei2018-11-012-0/+15
|\ \ \ | | | | | | | | Port citra-emu/citra#4369: "compatdb: Use a seperate endpoint for testcase submission"
| * | | compatdb: Use a seperate endpoint for testcase submissionfearlessTobi2018-10-282-0/+15
| | | |
* | | | service/usb: Update IPdSession's function tableLioncash2018-10-301-3/+3
| |_|/ |/| | | | | | | | Updated based off information on SwitchBrew.
* | | general: Remove unused boost inclusions where applicableLioncash2018-10-302-3/+0
| | | | | | | | | | | | Cleans up unused includes and trims off some dependencies on externals.
* | | global: Use std::optional instead of boost::optional (#1578)Frederic L2018-10-3024-144/+141
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * get rid of boost::optional * Remove optional references * Use std::reference_wrapper for optional references * Fix clang format * Fix clang format part 2 * Adressed feedback * Fix clang format and MacOS build
* | | Merge pull request #1621 from lioncash/ipcbunnei2018-10-303-6/+9
|\ \ \ | | | | | | | | hle_ipc: Make GetDomainMessageHeader return a regular pointer
| * | | hle_ipc: Add member function for querying the existence of a domain headerLioncash2018-10-303-3/+6
| | | | | | | | | | | | | | | | Gets rid of the need to call the getter and then check for null.
| * | | hle_ipc: Make GetDomainMessageHeader return a regular pointerLioncash2018-10-302-3/+3
| | |/ | |/| | | | | | | | | | Nothing requires the shared owner ship here, so we can just return a plain pointer.
* | | core: Make System references const where applicableLioncash2018-10-282-3/+3
| | |
* | | core: Add missing const variants of getters for the System classLioncash2018-10-282-10/+49
|/ / | | | | | | | | | | Many of the Current<Thing> getters (as well as a few others) were missing const qualified variants, which makes it a pain to retrieve certain things from const qualified references to System.
* | Merge pull request #1593 from lioncash/svcbunnei2018-10-286-35/+128
|\ \ | | | | | | svc: Implement svcGetInfo command 0xF0000002
| * | svc: Localize the GetInfo enum class to the function itselfLioncash2018-10-262-32/+31
| | | | | | | | | | | | Nothing from this enum is intended to be used outside of this function.
| * | svc: Implement svcGetInfo command 0xF0000002Lioncash2018-10-266-4/+98
| |/ | | | | | | | | | | | | | | | | | | This retrieves: if (curr_thread == handle_thread) { result = total_thread_ticks + (hardware_tick_count - last_context_switch_ticks); } else if (curr_thread == handle_thread && sub_id == current_core_index) { result = hardware_tick_count - last_context_switch_ticks; }
* | file_sys/patch_manager: Remove unnecessary if-statements (#1586)Frederic L2018-10-281-7/+6
| | | | | | | | | | | | * remove unnecessary if-statements * Addressed feedback
* | Merge pull request #1598 from DeeJayBro/delete-directorybunnei2018-10-281-2/+26
|\ \ | | | | | | service/filesystem: Implemented DeleteDirectory & DeleteDirectoryRecursive
| * | service/filesystem: Add DirectoryDelete & DirectoryDeleteRecursivelyDeeJayBro2018-10-271-2/+26
| |/
* | Merge pull request #1600 from DarkLordZach/nsp-secondary-loader-fixbunnei2018-10-281-17/+20
|\ \ | | | | | | loader/nsp: Move secondary loader initialization to constructor
| * | loader/nsp: Move secondary loader initialization to constructorZach Hilman2018-10-271-17/+20
| |/ | | | | | | Prevents nullptr bug when trying to dump the RomFS of an NSP resulting from secondary_loader not being initialized.
* / key_manager: Use isxdigit instead of isdigit when reading key fileZach Hilman2018-10-281-1/+1
|/ | | | Crypto revisions are hex numbers and this function only checks if the string is valid for stoul in base 16, so it should be isxdigit.
* Merge pull request #1430 from DarkLordZach/remove-promote-dirbunnei2018-10-2617-95/+1
|\ | | | | vfs: Remove InterpretAsDirectory and related functions
| * vfs: Remove InterpretAsDirectory and related functionsZach Hilman2018-10-1917-95/+1
| | | | | | | | When writing VFS, it initally seemed useful to include a function to in-place convert container files into directories in one homogenous directory structure, but re-evaluating it now there have been plenty of chances to use it and there has always been a better way. Removing as it is unused and likely will not be used.
* | Merge pull request #1569 from lioncash/amiibobunnei2018-10-262-3/+5
|\ \ | | | | | | yuzu/main: Notify user of loading errors with Amiibo data
| * | yuzu/main: Notify user of loading errors with Amiibo dataLioncash2018-10-242-3/+5
| | | | | | | | | | | | | | | We shouldn't silently continue if loading failed, since the general assumption is that no messages showing up implicitly indicates success.
* | | ldr: Partially implement LoadNro.bunnei2018-10-261-3/+49
| | | | | | | | | | | | - This is an incomplete implementation. It was tested with Super Mario Party.
* | | process: LoadModule should clear JIT instruction cache.bunnei2018-10-261-0/+6
| | |
* | | Kernel/Memory: Added a function to first a suitable guest address at which to allocate a region of a given size.bunnei2018-10-262-0/+28
| | |
* | | nro: Make LoadNro method accessible outside of apploader code.bunnei2018-10-262-6/+18
| | |
* | | ips_layer: Use rle_size instead of data_size in RLE patch applicationZach Hilman2018-10-251-1/+1
| | | | | | | | | | | | Prevents a potential bug when using RLE records in an IPS patch.
* | | Merge pull request #1579 from lioncash/usbbunnei2018-10-251-21/+22
|\ \ \ | | | | | | | | service/usb: Update service function tables
| * | | service/usb: Update service function tablesLioncash2018-10-251-21/+22
| | | | | | | | | | | | | | | | Updated based off the information provided by Hexkyz on Switchbrew.
* | | | Merge pull request #1576 from lioncash/acc-warnbunnei2018-10-251-25/+27
|\ \ \ \ | | | | | | | | | | service/acc: Silence compiler truncation warnings
| * | | | service/acc: Move fallback image to file scopeLioncash2018-10-251-14/+13
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This is just flat data, so it doesn't really need to be in the function itself. This also allows deduplicating the constant for the backup size in GetImageSize().
| * | | | service/acc: Silence compiler warningsLioncash2018-10-251-5/+8
| | | | | | | | | | | | | | | | | | | | | | | | | Silences compiler warnings related to truncation. This also introduces a small helper function to perform the clamping of the image size.
| * | | | service/acc: Early return in failure case in LoadImage()Lioncash2018-10-251-8/+8
| |/ / / | | | | | | | | | | | | Allows unindenting the other branch's code.
* | | | Merge pull request #1577 from lioncash/errbunnei2018-10-255-34/+16
|\ \ \ \ | | | | | | | | | | kernel/error: Amend error return code values
| * | | | kernel/errors: Remove now-unused, unnecessary, error codesLioncash2018-10-242-13/+0
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Now that we've gotten the innaccurate error codes out of the way, we can finally toss away a bunch of these, trimming down the error codes to ones that are actually used and knocking out two TODO comments.
| * | | | kernel/shared_memory: Return ERR_INVALID_MEMORY_PERMISSIONS instead of ERR_INVALID_COMBINATIONLioncash2018-10-241-4/+3
| | | | | | | | | | | | | | | | | | | | This is more consistent with what the kernel does.
| * | | | kernel/server_port: Simplify emptiness check within ShouldWait()Lioncash2018-10-241-1/+1
| | | | |
| * | | | kernel/server_port: Change error case return value in Accept() to ERR_NOT_FOUNDLioncash2018-10-242-3/+1
| | | | | | | | | | | | | | | | | | | | This is what the kernel does in this instance.
| * | | | kernel/error: Remove leftover 3DS error codesLioncash2018-10-241-5/+0
| | | | | | | | | | | | | | | | | | | | These are now entirely unused and can be removed.
| * | | | kernel/svc: Amend returned error code for invalid priorities in CreateThreadLioncash2018-10-241-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | Like with the previous change, the kernel doesn't return NOT_AUTHORIZED here. It returns INVALID_THREAD_PRIORITY.
| * | | | kernel/svc: Move and correct returned error code for invalid thread priorities in SetThreadPriority()Lioncash2018-10-241-5/+6
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | All priority checks are supposed to occur before checking the validity of the thread handle, we're also not supposed to return ERR_NOT_AUTHORIZED here.
| * | | | kernel/error: Add error code for invalid pointersLioncash2018-10-241-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | The kernel appears to return 0xE601 for this situation. Particularly in svcWaitSynchronization, svcReplyAndReceive, and svcGetThreadContext
| * | | | kernel/error: Add error code for closed sessionsLioncash2018-10-241-1/+3
| |/ / / | | | | | | | | | | | | The kernel appears to return 0xF601 for this case.
* | | | Merge pull request #1570 from lioncash/optionalbunnei2018-10-253-43/+48
|\ \ \ \ | | | | | | | | | | profile_manager: Use std::optional instead of boost::optional
| * | | | profile_manager: Use std::optional instead of boost::optionalLioncash2018-10-243-43/+48
| |/ / / | | | | | | | | | | | | | | | | Now that we can actually use std::optional on macOS, we don't need to continue using boost::optional here.
* | | | Merge pull request #1564 from lioncash/npadbunnei2018-10-241-2/+3
|\ \ \ \ | | | | | | | | | | npad: Remove unused controller variable from OnInit()
| * | | | npad: Remove unused controller variable from OnInit()Lioncash2018-10-241-2/+3
| | |/ / | |/| | | | | | | | | | | | | | This also gets rid of variable shadowing related to the lambda parameter a little bit below this code as well.
* | | | Merge pull request #1563 from lioncash/framebunnei2018-10-241-4/+0
|\ \ \ \ | | | | | | | | | | perf_stats: Remove unused variable within DoFrameLimiting()
| * | | | perf_stats: Remove unused variable within DoFrameLimiting()Lioncash2018-10-241-4/+0
| |/ / / | | | | | | | | | | | | This hasn't been used since ba8ff096fdc9f7ab101851c4cd06c3244a7d84c3
* | | | Merge pull request #1562 from lioncash/aocbunnei2018-10-241-3/+3
|\ \ \ \ | | | | | | | | | | aoc_u: Make use of previously-unused CheckAOCTitleIDMatchesBase() function
| * | | | aoc_u: Make use of previously-unused CheckAOCTitleIDMatchesBase() functionLioncash2018-10-241-3/+3
| |/ / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | We can just call the function instead of duplicating the code here. This also prevents an unused function warning. We also don't need to take the lambda capture by reference. It's just a u64 value, so by value is fine here.
* | | | Merge pull request #1561 from lioncash/fsbunnei2018-10-242-3/+6
|\ \ \ \ | |_|/ / |/| | | file_sys: Remove unused variables
| * | | vfs: Handle failure of file reading within VfsRawCopy()Lioncash2018-10-241-2/+6
| | | | | | | | | | | | | | | | Also gets rid of an unused variable.
| * | | key_manager: Remove unused variable in DeriveBase()Lioncash2018-10-241-1/+0
| |/ /
* | | Merge pull request #1468 from DarkLordZach/profile-manager-uiMat M2018-10-245-30/+227
|\ \ \ | |/ / |/| | qt: Add UI to manage emulated user profiles
| * | profile_manager: Create save data if it doesn't exist on useZach Hilman2018-10-242-13/+37
| | |
| * | acc: Fix account UUID duplication errorZach Hilman2018-10-244-17/+47
| | |
| * | configure_system: Clear selection after user deleteZach Hilman2018-10-241-1/+1
| | |
| * | profile_manager: Load user icons, names, and UUIDs from system saveZach Hilman2018-10-245-28/+129
| | |
| * | acc: Load user images from config dirZach Hilman2018-10-241-9/+45
| | |
| * | am: Pass current user UUID to launch parametersZach Hilman2018-10-241-7/+9
| | |
| * | profile_manager: Load users from emulator settingsZach Hilman2018-10-242-5/+7
| | |
| * | settings: Add users and current_user settings and remove usernameZach Hilman2018-10-241-1/+3
| | |
* | | Merge pull request #1551 from ogniK5377/improved-svcbreakbunnei2018-10-241-5/+51
|\ \ \ | |/ / |/| | Added break types to svcBreak
| * | Added assertion failed, reworked logging levelsDavid Marcec2018-10-231-16/+24
| | |
| * | Added break types to svcBreakDavid Marcec2018-10-231-4/+42
| | | | | | | | | | | | There seems to be more such as type 1, and 2. Unsure what these currently are but when a game hits them we can investigate and add the rest
* | | Added Amiibo support (#1390)David2018-10-244-50/+295
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * Fixed conflict with nfp * Few fixups for nfc * Conflict 2 * Fixed AttachAvailabilityChangeEvent * Conflict 3 * Fixed byte padding * Refactored amiibo to not reside in "System" * Removed remaining references of nfc from system * used enum for Nfc GetStateOld * Added missing newline * Moved file operations to front end * Conflict 4 * Amiibos now use structs and added mutexes * Removed amiibo_path
* | | Merge pull request #1515 from DarkLordZach/dlc-lfsbunnei2018-10-244-5/+29
|\ \ \ | | | | | | | | patch_manager: Add support for LayeredFS on DLC RomFS
| * | | qt: Add support for dumping a DLC Data RomFSZach Hilman2018-10-182-0/+5
| | | |
| * | | registered_cache: Deduplicate results of ListEntry and ListEntryFilterZach Hilman2018-10-172-2/+16
| | | | | | | | | | | | | | | | Prevents a Entry from appearing in the list twice if the user has it installed in two places (e.g. User NAND and SDMC)
| * | | fsp_srv: Apply patches to Data storage in OpenDataStorageByDataIdZach Hilman2018-10-171-1/+5
| | | |
| * | | patch_manager: Add support for using LayeredFS with DataZach Hilman2018-10-171-2/+3
| | | |
* | | | Merge pull request #1540 from lioncash/handlebunnei2018-10-248-98/+95
|\ \ \ \ | |_|/ / |/| | | kernel/process: Make the handle table per-process
| * | | kernel/process: Make the handle table per-processLioncash2018-10-208-98/+95
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | In the kernel, there isn't a singular handle table that everything gets tossed into or used, rather, each process gets its own handle table that it uses. This currently isn't an issue for us, since we only execute one process at the moment, but we may as well get this out of the way so it's not a headache later on.
* | | | Merge pull request #1545 from DarkLordZach/psmbunnei2018-10-224-0/+90
|\ \ \ \ | | | | | | | | | | psm: Add psm service and stub commands 0 and 1
| * | | | psm: Stub GetChargerTypeZach Hilman2018-10-222-24/+27
| | | | | | | | | | | | | | | Used by LovePotion Lua Homebrew. Stubbed as connected to official Nintendo Switch dock.
| * | | | psm: Stub GetBatteryChargePercentageZach Hilman2018-10-212-1/+14
| | | | | | | | | | | | | | | | | | | | Used by LovePotion Lua Homebrew. Stubbed to return 100% charge.
| * | | | service: Add skeleton for psm serviceZach Hilman2018-10-214-0/+74
| |/ / / | | | | | | | | | | | | Seems to be the power controller. Listed in switchbrew under the category PTM services.
* | | | Merge pull request #1538 from lioncash/querybunnei2018-10-221-1/+1
|\ \ \ \ | | | | | | | | | | svc: Fix vma boundary check in svcQueryMemory
| * | | | svc: Fix vma boundary check in svcQueryMemoryLioncash2018-10-201-1/+1
| |/ / / | | | | | | | | | | | | | | | | | | | | This should be comparing against the queried process' vma_map, not the current process'. The only reason this hasn't become an issue yet is we currently only handle one process being active at any time.
* | | | service: Add the basic skeleton for the NPNS servicesLioncash2018-10-214-2/+109
| | | |
* | | | hid: Update service function table for hidbusLioncash2018-10-211-0/+1
| | | | | | | | | | | | | | | | Updated based off information provided by Switchbrew.
* | | | am: Add the basic skeleton for the tcap serviceLioncash2018-10-214-0/+44
| | | | | | | | | | | | | | | | Added based off information provided by Switchbrew.
* | | | am: Update service function tablesLioncash2018-10-214-15/+60
| | | | | | | | | | | | | | | | Updated based off information from Switchbrew
* | | | prepo: Update service function table.Lioncash2018-10-211-8/+13
| | | | | | | | | | | | | | | | | | | | | | | | Also introduces the new prepo:a2 service. Updated based off information provided by Switchbrew.
* | | | lbl: Update service function table namesLioncash2018-10-211-28/+28
| | | | | | | | | | | | | | | | Updated based off information provided by Switchbrew.
* | | | Added auto controller switching to supported controllers and single joycon button rotationDavid Marcec2018-10-202-4/+189
|/ / / | | | | | | | | | This is a subset of the better-hid-2 changes, this fixes input in various games which don't support dual joycons. This pr will search for the next best controller which is supported by the current game
* | | Merge pull request #1520 from lioncash/sanbunnei2018-10-203-3/+50
|\ \ \ | | | | | | | | svc: Add missing sanitizing checks for MapSharedMemory/UnmapSharedMemory
| * | | svc: Add missing sanitizing checks for MapSharedMemory/UnmapSharedMemoryLioncash2018-10-183-3/+50
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Now that the changes clarifying the address spaces has been merged, we can wrap the checks that the kernel performs when mapping shared memory (and other forms of memory) into its own helper function and then use those within MapSharedMemory and UnmapSharedMemory to complete the sanitizing checks that are supposed to be done.
* | | | Merge pull request #1526 from lioncash/svc-idbunnei2018-10-208-53/+163
|\ \ \ \ | | | | | | | | | | service: Update function tables
| * | | | es: Update service function tablesLioncash2018-10-191-7/+11
| | | | | | | | | | | | | | | | | | | | Updated based off information provided by Switchbrew.
| * | | | audio: Update service function tablesLioncash2018-10-191-17/+20
| | | | | | | | | | | | | | | | | | | | Updated based off information provided by Switchbrew.
| * | | | omm: Update service function tablesLioncash2018-10-191-16/+18
| | | | | | | | | | | | | | | | | | | | Updated based off information provided by Switchbrew.
| * | | | nifm: Update service function tablesLioncash2018-10-191-0/+1
| | | | | | | | | | | | | | | | | | | | Updated based off information provided by switchbrew.
| * | | | hid: Update service function tablesLioncash2018-10-191-6/+45
| | | | | | | | | | | | | | | | | | | | Updated based off information provided by Switchbrew.
| * | | | nim: Add the basic skeleton of the nim:eca serviceLioncash2018-10-191-0/+17
| | | | | | | | | | | | | | | | | | | | Added based off information provided by Switchbrew
| * | | | ns: Update service function tableLioncash2018-10-191-6/+49
| | | | | | | | | | | | | | | | | | | | Updated based off information provided by Switchbrew.
| * | | | set_cal: Update service function tableLioncash2018-10-191-1/+2
| | | | | | | | | | | | | | | | | | | | Updated based on information from Switchbrew.
* | | | | Merge pull request #1530 from DarkLordZach/aoc-8bunnei2018-10-202-1/+16
|\ \ \ \ \ | | | | | | | | | | | | aoc_u: Stub GetAddOnContentListChangedEvent
| * | | | | aoc_u: Stub GetAddOnContentListChangedEventZach Hilman2018-10-202-1/+16
| | |_|_|/ | |/| | | | | | | | | | | | | This event signals the game when new DLC is purchased from the eShop while the game is running. Since, for the forseeable future, yuzu will not have this ability, it seems safe to stub with a dummy event that will never fire. This is needed to boot Sonic Mania Plus (update v1.04).
* | | | | Merge pull request #1516 from lioncash/hidbunnei2018-10-2018-19/+33
|\ \ \ \ \ | | | | | | | | | | | | hid: Minor cleanup-related changes
| * | | | | hid/controller: Remove unused header inclusionsLioncash2018-10-189-9/+0
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | swap.h only needs to be present in the header for the type aliases and definitions, it's not actually needed in the cpp files though. input.h is just unused entirely in xpad.h
| * | | | | hid/controller/npad: Remove unused dump_idx member variableLioncash2018-10-181-1/+0
| | | | | | | | | | | | | | | | | | | | | | | | Given it's unused, we may as well toss it.
| * | | | | hid/controller/npad: Remove unnecessary semicolon from the closing brace of LedPattern's constructorLioncash2018-10-181-1/+1
| | | | | |
| * | | | | hid/controller/npad: Remove #pragma once from the cpp fileLioncash2018-10-181-2/+0
| | | | | | | | | | | | | | | | | | | | | | | | This is only useful in headers.
| * | | | | hid/controller/npad: Move npad_id_list into the cpp fileLioncash2018-10-182-2/+10
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This is just a lookup table, and since it's private, there's nothing really stateful about it, so we can just move it into the cpp file.
| * | | | | hid/controller/npad: Remove unnecessary const from void return typeLioncash2018-10-182-2/+2
| | | | | | | | | | | | | | | | | | | | | | | | This literally does nothing.
| * | | | | hid/controller: Default the destructors of all controller types in the cpp fileLioncash2018-10-1816-0/+16
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | These classes are non-trivial and are definitely going to be changed in the future, so we default these to prevent issues with forward declarations, and to keep the compiler from inlining tear-down code.
| * | | | | controller_base: Default the base class constructor and destructor in the cpp fileLioncash2018-10-182-2/+4
| | |_|/ / | |/| | | | | | | | | | | | | The destructor doesn't need to be a pure-virtual function.
* | | | | crypto: Use compressed sizes in offset calculation for KIP decompressionZach Hilman2018-10-201-1/+2
| |/ / / |/| | | | | | | | | | | Fixes a fatal crash on start when deriving keys.
* | | | Stubbed home blockingDavid Marcec2018-10-192-4/+36
| |/ / |/| | | | | | | | Needed by arms due to new hid rework
* | | Merge pull request #1523 from lioncash/lockbunnei2018-10-191-9/+15
|\ \ \ | | | | | | | | svc: Add missing error checks in svcArbitrateLock/svcArbitrateUnlock
| * | | svc: Check for word alignment of addresses within svcArbitrateLock/svcArbitrateUnlockLioncash2018-10-181-0/+8
| | | | | | | | | | | | | | | | | | | | The kernel itself checks whether or not the provided addresses are word aligned before continuing, so we should be doing the same.
| * | | common: Move Is4KBAligned() to alignment.hLioncash2018-10-181-9/+7
| | | | | | | | | | | | | | | | | | | | Aligning on 4KB pages isn't a Switch-specific thing, so this can be moved to common so it can be used with other things as well.
* | | | Merge pull request #1511 from lioncash/contentbunnei2018-10-192-258/+292
|\ \ \ \ | | | | | | | | | | content_archive: Minor reorganization changes
| * | | | content_archive: Simpify assignment of bktr_base_romfs in the constructorLioncash2018-10-161-2/+1
| | | | | | | | | | | | | | | | | | | | | | | | | std::move doesn't actually dereference the data, so it doesn't matter whether or not the type is null.
| * | | | content_archive: Make IsValidNCA() an internally linked functionLioncash2018-10-162-3/+1
| | | | | | | | | | | | | | | | | | | | | | | | | This is only ever used within the cpp file, so it can just be an internal function.
| * | | | content_archive: Simplify rights ID checkLioncash2018-10-161-2/+2
| | | | | | | | | | | | | | | | | | | | This is the same as using std::any_of with an inverted predicate.
| * | | | content_archive: Split loading into separate functionsLioncash2018-10-162-253/+290
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The constructor alone is pretty large, the reading code should be split into its consistuent parts to make it easier to understand it without having to build a mental model of a 300+ line function.
| * | | | content_archive: Pass and take NCASectionHeader instance by referenceLioncash2018-10-162-3/+3
| | |_|/ | |/| | | | | | | | | | | | | | Each header is 512 bytes in size, which is kind of an excessive amount to copy all the time when it's possible to avoid doing so.
* | | | Merge pull request #1521 from ogniK5377/imp-mmubunnei2018-10-191-8/+42
|\ \ \ \ | | | | | | | | | | Used better names for mm:u and fixed a bad stub
| * | | | Used better names for mm:u and fixed bad stubDavid Marcec2018-10-181-8/+42
| | |_|/ | |/| | | | | | | | | | InitializeWithId needs to return an id which is a u32 which should be a non zero value
* | | | core: Remove unnecessary assert in ArmInterface()Lioncash2018-10-181-2/+1
| |_|/ |/| | | | | | | | | | | CpuCore already does this sort of checking, so we can just call that instead of duplicating the assertions.
* | | Merge pull request #1510 from lioncash/xcibunnei2018-10-183-7/+8
|\ \ \ | |/ / |/| | XCI: Add function for checking the existence of the program NCA
| * | XCI: Add function for checking the existence of the program NCALioncash2018-10-163-7/+8
| |/ | | | | | | | | | | The only reason the getter existed was to check whether or not the program NCA was null. Instead, we can just provide a function to query for the existence of it, instead of exposing it entirely.
* | Merge pull request #1444 from ogniK5377/better-hidbunnei2018-10-1822-648/+1720
|\ \ | | | | | | "Better Hid" Rework Part 1
| * | Using dual joycons as the default controllerDavid Marcec2018-10-173-77/+59
| | | | | | | | | | | | Reason for the change is to allow both docked and undocked mode to work
| * | WipDavid Marcec2018-10-122-3/+23
| | |
| * | Dynamically decide handheld variant based on supported npad id priorityDavid Marcec2018-10-113-19/+62
| | | | | | | | | | | | Kirby input still doesn't work, should fix a lot of other games
| * | Added BeginPermitVibrationSession and EndPermitVibrationSessionDavid Marcec2018-10-103-2/+26
| | | | | | | | | | | | Used by Mario Party
| * | Added GetLedPattern and HandheldVariantDavid Marcec2018-10-103-6/+63
| | | | | | | | | | | | HandheldVariant is for specific games which expect handheld controllers to be at position 8(kirby), however this doesn't fix all games as some games require handhelds to be at position 0(snipperclips)
| * | Kirby expects handheld controllers to be at position 8David Marcec2018-10-101-2/+8
| | |
| * | Added the ability to "disconnect" individual npadsDavid Marcec2018-10-103-16/+40
| | | | | | | | | | | | Fixes arms
| * | Removed unneeded forward declarationsDavid Marcec2018-10-102-13/+2
| | |
| * | Addressed changes for better hidDavid Marcec2018-10-1019-167/+238
| | |
| * | "Better Hid" rework part 1David Marcec2018-10-1022-644/+1500
| | |
* | | Merge pull request #1497 from bunnei/flush-framebuffersbunnei2018-10-182-3/+3
|\ \ \ | | | | | | | | Implement flushing in the rasterizer cache
| * | | config: Rename use_accurate_framebuffers -> use_accurate_gpu_emulation.bunnei2018-10-162-3/+3
| | |/ | |/| | | | | | | - This will be used as a catch-all for slow-but-accurate GPU emulation paths.
* | | Merge pull request #1498 from lioncash/aslrbunnei2018-10-184-28/+44
|\ \ \ | | | | | | | | svc: Clarify enum values for AddressSpaceBaseAddr and AddressSpaceSize in svcGetInfo()
| * | | svc: Clarify enum values for AddressSpaceBaseAddr and AddressSpaceSize in svcGetInfo()Lioncash2018-10-154-28/+44
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | So, one thing that's puzzled me is why the kernel seemed to *not* use the direct code address ranges in some cases for some service functions. For example, in svcMapMemory, the full address space width is compared against for validity, but for svcMapSharedMemory, it compares against 0xFFE00000, 0xFF8000000, and 0x7FF8000000 as upper bounds, and uses either 0x200000 or 0x8000000 as the lower-bounds as the beginning of the compared range. Coincidentally, these exact same values are also used in svcGetInfo, and also when initializing the user address space, so this is actually retrieving the ASLR extents, not the extents of the address space in general.
* | | | Merge pull request #1509 from DarkLordZach/device-save-databunnei2018-10-181-1/+12
|\ \ \ \ | |_|/ / |/| | | savedata_factory: Add DeviceSaveData and fix TemporaryStorage
| * | | savedata_factory: Add TemporaryStorage SaveDataSpaceIdZach Hilman2018-10-161-1/+4
| | | | | | | | | | | | | | | | Required for TemporaryStorage saves (in addition to SaveDataType)
| * | | savedata_factory: Add support for DeviceSaveDataZach Hilman2018-10-161-0/+8
| | | | | | | | | | | | | | | | Uses the same path as SaveData except with UID 0. Adds a warning if UID is not 0.
* | | | Merge pull request #1443 from DarkLordZach/lower-loader-logs-1bunnei2018-10-162-3/+9
|\ \ \ \ | | | | | | | | | | content_archive/patch_manager: Lower log levels to eliminate some unnecessary logs
| * | | | patch_manager: Move non-Program RomFS patch log to DebugZach Hilman2018-10-131-2/+8
| | | | | | | | | | | | | | | | | | | | Normal Program-type patches will still be logged to aid in debugging, but for others (mainly Control), it was moved to Debug.
| * | | | content_archive: Move get key log to Trace levelZach Hilman2018-10-131-1/+1
| | | | | | | | | | | | | | | | | | | | Avoids printing live keys in the general log.
* | | | | Implement VI ConvertScalingMode (#1475)David2018-10-161-1/+49
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * Implement VI ConvertScalingMode * Fixed push enum * Scale mode now uses Nintendo scale mode as an enum as well
* | | | | Merge pull request #1502 from lioncash/uniquebunnei2018-10-1611-56/+71
|\ \ \ \ \ | | | | | | | | | | | | core: Convert shared_ptr instances into unique_ptr instances where applicable for System and Cpu
| * | | | | core_cpu: Make Cpu scheduler instances unique_ptrs instead of shared_ptrsLioncash2018-10-159-27/+45
| | | | | |
| * | | | | core: Make the live Cpu instances unique_ptrs instead of shared_ptrsLioncash2018-10-151-9/+9
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | There's no need for shared ownership here, as the only owning class instance of those Cpu instances is the System class itself. We can also make the thread_to_cpu map use regular pointers instead of shared_ptrs, given that the Cpu instances will always outlive the cases where they're used with that map.
| * | | | | core: Make the exclusive monitor a unique_ptr instead of a shared_ptrLioncash2018-10-155-15/+13
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Like the barrier, this is owned entirely by the System and will always outlive the encompassing state, so shared ownership semantics aren't necessary here.
| * | | | | core: Make CPUBarrier a unique_ptr instead of a shared_ptrLioncash2018-10-153-11/+10
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This will always outlive the Cpu instances, since it's destroyed after we destroy the Cpu instances on shutdown, so there's no need for shared ownership semantics here.
* | | | | | file_sys/registered_cache: Use unique_ptr and regular pointers instead of shared_ptrs where applicableLioncash2018-10-1610-42/+41
| |_|/ / / |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The data retrieved in these cases are ultimately chiefly owned by either the RegisteredCache instance itself, or the filesystem factories. Both these should live throughout the use of their contained data. If they don't, it should be considered an interface/design issue, and using shared_ptr instances here would mask that, as the data would always be prolonged after the main owner's lifetime ended. This makes the lifetime of the data explicit and makes it harder to accidentally create cyclic references. It also makes the interface slightly more flexible than the previous API, as a shared_ptr can be created from a unique_ptr, but not the other way around, so this allows for that use-case if it ever becomes necessary in some form.
* | | | | Merge pull request #1473 from lioncash/cmakebunnei2018-10-161-2/+2
|\ \ \ \ \ | | | | | | | | | | | | web_service: Make linkage of web_service-related externals and the library private
| * | | | | core/CMakeLists: Make all web_service-related libraries privateLioncash2018-10-111-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Now that all external dependencies are hidden, we can remove json-headers from the publically linked libraries, as the use of this library is now completely hidden from external users of the web_service library. We can also make the web_services library private as well, considering it's not a requirement. If a library needs to link in web_service, it should be done explicitly -- not via indirect linking.
| * | | | | core/CMakeLists: Use target_compile_definitions instead of add_definitions for specifying ENABLE_WEB_SERVICELioncash2018-10-111-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Avoids introducing the definition to the whole directory space and localizes it to being added to the library that needs it.
* | | | | | file_sys/control_metadata: Get rid of magic constantsLioncash2018-10-161-3/+6
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | These are just the size of the data being passed in, so we can specify that via the size() member function.
* | | | | | Merge pull request #1494 from DarkLordZach/aoc-signature-fixesbunnei2018-10-163-3/+20
|\ \ \ \ \ \ | | | | | | | | | | | | | | aoc: Fix various bugs in current AOC implementation
| * | | | | | aoc: Read DLC base title ID from RegisteredCacheZach Hilman2018-10-153-2/+18
| | | | | | | | | | | | | | | | | | | | | Falls back to title ID + 0x1000, which is what HOS does.
| * | | | | | aoc: Return size in ListAddOnContentZach Hilman2018-10-141-1/+2
| | | | | | |
* | | | | | | Merge pull request #1499 from lioncash/nrobunnei2018-10-157-28/+39
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | nro/nso: Minor error handling changes
| * | | | | | | nso: Return an optional address from LoadModuleLioncash2018-10-155-16/+29
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | If a malformed NSO is attempted to be loaded, we shouldn't continue onwards. We should be reporting an error and bailing out.
| * | | | | | | nso: Make LoadModule take a VfsFile by const referenceLioncash2018-10-153-11/+9
| | | | | | | |
| * | | | | | | nro: Make LoadNro take a VfsFile by const referenceLioncash2018-10-152-6/+6
| | |_|_|_|/ / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This function doesn't need to care about ownership semantics, so we can just pass it a reference to the file itself, rather than a std::shared_ptr alias.
* | | | | | | crypto: Various crypto fixes for quickstart guideZach Hilman2018-10-151-2/+2
| |_|_|/ / / |/| | | | |
* | | | | | Merge pull request #1486 from lioncash/filebunnei2018-10-144-63/+72
|\ \ \ \ \ \ | | | | | | | | | | | | | | key_manager/partition_data_manager: Minor changes
| * | | | | | partition_data_manager: Reserve and insert data within output vector in DecryptPackage2()Lioncash2018-10-131-20/+16
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | We can just reserve the memory then perform successive insertions instead of needing to use memcpy. This also avoids the need to zero out the output vector's memory before performing the insertions. We can also std::move the output std::vector into the destination so that we don't need to make a completely new copy of the vector, getting rid of an unnecessary allocation. Additionally, we can use iterators to determine the beginning and end ranges of the std::vector instances that comprise the output vector, as the end of one range just becomes the beginning for the next successive range, and since std::vector's iterator constructor copies data within the range [begin, end), this is more straightforward and gets rid of the need to have an offset variable that keeps getting incremented to determine where to do the next std::memcpy.
| * | | | | | partition_data_manager: Remove unused std::map instance within DecryptPackage2()Lioncash2018-10-131-2/+0
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Aside from emplacing elements into the map, the map itself is never actually queried for contained data.
| * | | | | | partition_data_manager: Take package2_keys by const referenceLioncash2018-10-132-2/+3
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | These are only ever read from, so we don't need to make a copy of all the keys here.
| * | | | | | partition_data_manager: Move IV data to where it's needed in DecryptPackage2()Lioncash2018-10-131-3/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Given it's only used in one spot and has a fairly generic name, we can just specify it directly in the function call. This also the benefit of automatically moving it.
| * | | | | | partition_data_manager: Remove commented out codeLioncash2018-10-131-2/+0
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Commented out code shouldn't be left in without a reason indicating why in a comment.
| * | | | | | key_manager/partition_data_manager: Silence truncation compiler warningsLioncash2018-10-134-10/+15
| | | | | | |
| * | | | | | partition_data_manager: Dehardcode array boundsLioncash2018-10-132-7/+12
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Instead, we can make it part of the type and make named variables for them, so they only require one definition (and if they ever change for whatever reason, they only need to be changed in one spot).
| * | | | | | partition_data_manager: Take VirtualFile by const reference in constructorLioncash2018-10-132-2/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Given the VirtualFile instance isn't stored into the class as a data member, or written to, this can just be turned into a const reference, as the constructor doesn't need to make a copy of it.
| * | | | | | partition_data_manager: Amend constructor initializer list orderLioncash2018-10-131-2/+3
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Orders the members in the exact order they would be initialized. This also prevents compiler warnings about this sort of thing.
| * | | | | | partition_data_manager: Remove unused includesLioncash2018-10-132-4/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Gets unused includes out of the headers and moves them into the cpp file if they're used there instead.
| * | | | | | key_manager: Use std::vector's insert() instead of std::copy with a back_inserterLioncash2018-10-131-2/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | If the data is unconditionally being appended to the back of a std::vector, we can just directly insert it there without the need to insert all of the elements one-by-one with a std::back_inserter.
| * | | | | | key_manager: Brace long conditional bodyLioncash2018-10-131-1/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | If a conditional (or it's body) travels more than one line, it should be braced.
| * | | | | | key_manager: Don't assume file seeks and reads will always succeedLioncash2018-10-131-7/+17
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Given the filesystem should always be assumed to be volatile, we should check and bail out if a seek operation isn't successful. This'll prevent potentially writing/returning garbage data from the function in rare cases. This also allows removing a check to see if an offset is within the bounds of a file before perfoming a seek operation. If a seek is attempted beyond the end of a file, it will fail, so this essentially combines two checks into one in one place.
| * | | | | | key_manager: Remove unnecessary seek in DeriveSDSeed()Lioncash2018-10-131-1/+0
| | |/ / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | Given the file is opened a few lines above and no operations are done, other than check if the file is in a valid state, the read/write pointer will always be at the beginning of the file.
* | | | | | Merge pull request #1491 from lioncash/referencebunnei2018-10-145-15/+14
|\ \ \ \ \ \ | |_|/ / / / |/| | | | | filesystem: Make CreateFactories() and InstallInterface() take a VfsFilesystem by reference
| * | | | | filesystem: Make CreateFactories() and InstallInterface() take a VfsFilesystem instance by referenceLioncash2018-10-135-15/+14
| |/ / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Neither of these functions alter the ownership of the provided pointer, so we can simply make the parameters a reference rather than a direct shared pointer alias. This way we also disallow passing incorrect memory values like nullptr.
* | | | | Merge pull request #1492 from lioncash/procbunnei2018-10-143-4/+50
|\ \ \ \ \ | | | | | | | | | | | | svc: Implement svcGetProcessInfo
| * | | | | svc: Implement svcGetProcessInfoLioncash2018-10-133-4/+50
| |/ / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | A fairly basic service function, which only appears to currently support retrieving the process state. This also alters the ProcessStatus enum to contain all of the values that a kernel process seems to be able of reporting with regards to state.
* / / / / Stop all threads on svcBreakDavid Marcec2018-10-141-0/+6
|/ / / / | | | | | | | | | | | | This should help diagnose crashes easier and prevent many users thinking that a game is still running when in fact it's just an audio thread still running(this is typically not killed when svcBreak is hit since the game expects us to do this)
* | | | Merge pull request #1409 from DarkLordZach/key-derivationbunnei2018-10-137-74/+1569
|\ \ \ \ | | | | | | | | | | crypto: Add support for full key derivation
| * | | | partition_data_manager: Rename system files for hekateZach Hilman2018-10-074-178/+228
| | | | | | | | | | | | | | | | | | | | x
| * | | | crypto: Add PartitionDataManagerZach Hilman2018-10-073-0/+692
| | | | | | | | | | | | | | | | | | | | Keeps track of system files for key derivation
| * | | | key_manager: Add support for loading keys from partition dataZach Hilman2018-10-072-0/+88
| | | | |
| * | | | key_manager: Add ETicket key derivationZach Hilman2018-10-073-2/+277
| | | | | | | | | | | | | | | | | | | | Derives titlekeys
| * | | | key_manager: Add base key derivationZach Hilman2018-10-072-4/+220
| | | | | | | | | | | | | | | | | | | | Derives master keys, game encryption keys, and package1/2 keys
| * | | | key_manager: Add BIS key getterZach Hilman2018-10-072-2/+19
| | | | |
| * | | | key_manager: Add support for more keysZach Hilman2018-10-072-3/+99
| | | | | | | | | | | | | | | | | | | | TSEC, SBK, BIS, and other Sources for proper derivation
| * | | | key_manager: Add keyblob supportZach Hilman2018-10-072-0/+14
| | | | |
| * | | | key_manager: Add support for crypto revisions past 04Zach Hilman2018-10-071-43/+63
| | | | |
| * | | | key_manager: Add support for comments in keyfilesZach Hilman2018-10-071-0/+3
| | | | |
| * | | | vfs: Move forward declarations to separate fileZach Hilman2018-10-072-9/+22
| | | | |
| * | | | key_manager: Add support for console-specific keyfileZach Hilman2018-10-072-3/+13
| | | | |
| * | | | key_manager: Rename KEK to KekZach Hilman2018-10-072-8/+9
| | | | |
* | | | | Merge pull request #1483 from lioncash/codesetbunnei2018-10-137-83/+45
|\ \ \ \ \ | | | | | | | | | | | | kernel/process: Make CodeSet a regular non-inherited object
| * | | | | kernel/process: Make CodeSet a regular non-inherited objectLioncash2018-10-127-83/+45
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | These only exist to ferry data into a Process instance and end up going out of scope quite early. Because of this, we can just make it a plain struct for holding things and just std::move it into the relevant function. There's no need to make this inherit from the kernel's Object type.
* | | | | | Merge pull request #1481 from lioncash/typobunnei2018-10-131-3/+3
|\ \ \ \ \ \ | |_|_|_|/ / |/| | | | | svc: Fix typos in sanitizing checks for MapMemory/UnmapMemory
| * | | | | svc: Fix typos in sanitizing checks for MapMemory/UnmapMemoryLioncash2018-10-121-3/+3
| |/ / / /
* | | | | Merge pull request #1467 from ogniK5377/svcbreak-type-fixbunnei2018-10-122-28/+36
|\ \ \ \ \ | | | | | | | | | | | | Fixed incorrect types for svcBreak
| * | | | | Changed all casts in svc_wrap.h to be static_cast insteadDavid Marcec2018-10-101-25/+28
| | | | | |
| * | | | | Use a better name than "dont_kill_application"David Marcec2018-10-101-2/+2
| | | | | | | | | | | | | | | | | | | | | | | | signal_debugger seems like a more fitting name
| * | | | | Fixed incorrect types for svcBreakDavid Marcec2018-10-102-3/+8
| | |_|_|/ | |/| | | | | | | | | | | | | svcBreak reason should be a u32, not a u64.
* | | | | Merge pull request #1478 from ogniK5377/remap-invalidhandle-remapbunnei2018-10-121-3/+10
|\ \ \ \ \ | | | | | | | | | | | | Passing an invalid nmap handle to Remap should throw an error
| * | | | | Returned an error before processing other remapsDavid Marcec2018-10-121-6/+2
| | | | | |
| * | | | | Passing an invalid nmap handle to Remap should throw an errorDavid Marcec2018-10-111-3/+14
| | |_|_|/ | |/| | | | | | | | | | | | | Added error for invalid nmap handles
* | | | | Merge pull request #1482 from lioncash/initbunnei2018-10-121-4/+1
|\ \ \ \ \ | | | | | | | | | | | | thread: Remove unnecessary memset from ResetThreadContext()
| * | | | | thread: Remove unnecessary memset from ResetThreadContext()Lioncash2018-10-121-4/+1
| | |_|/ / | |/| | | | | | | | | | | | | | | | | | | | | | | Regular value initialization is adequate here for zeroing out data. It also has the benefit of not invoking undefined behavior if a non-trivial type is ever added to the struct for whatever reason.
* | | | | Merge pull request #1479 from ogniK5377/nmap-revampedbunnei2018-10-121-12/+60
|\ \ \ \ \ | |/ / / / |/| | | | Added error codes for nvmap
| * | | | Made the minimum alignment more clearDavid Marcec2018-10-121-2/+3
| | | | |
| * | | | Added error codes for nvmapDavid Marcec2018-10-111-12/+59
| |/ / /
* | | | Merge pull request #1474 from ogniK5377/hwopus-decodeinterleavedwithperformancebunnei2018-10-111-3/+34
|\ \ \ \ | | | | | | | | | | HwOpus, Implemented DecodeInterleavedWithPerformance
| * | | | HwOpus, Implemented DecodeInterleavedWithPerformanceDavid Marcec2018-10-111-3/+34
| |/ / / | | | | | | | | | | | | Used by sonic ages
* | | | Merge pull request #1472 from lioncash/sanbunnei2018-10-112-12/+81
|\ \ \ \ | | | | | | | | | | svc: Add missing address range sanitizing checks to MapMemory/UnmapMemory
| * | | | svc: Add missing address range sanitizing checks to MapMemory/UnmapMemoryLioncash2018-10-112-12/+81
| |/ / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | This adds the missing address range checking that the service functions do before attempting to map or unmap memory. Given that both service functions perform the same set of checks in the same order, we can wrap these into a function and just call it from both functions, which deduplicates a little bit of code.
* / / / nvhost_as_gpu: Flush CPU VAddr on UnmapBuffer.bunnei2018-10-111-3/+4
|/ / /
* | | kernel/thread: Use a regular pointer for the owner/current processLioncash2018-10-109-38/+39
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | There's no real need to use a shared pointer in these cases, and only makes object management more fragile in terms of how easy it would be to introduce cycles. Instead, just do the simple thing of using a regular pointer. Much of this is just a hold-over from citra anyways. It also doesn't make sense from a behavioral point of view for a process' thread to prolong the lifetime of the process itself (the process is supposed to own the thread, not the other way around).
* | | Merge pull request #1461 from lioncash/warnbunnei2018-10-101-3/+3
|\ \ \ | | | | | | | | ips_layer: Silence truncation and conversion warnings
| * | | ips_layer: Silence truncation and conversion warningsLioncash2018-10-091-3/+3
| | | | | | | | | | | | | | | | Makes type conversions explicit to avoid compiler warnings.
* | | | Merge pull request #1464 from lioncash/uniquebunnei2018-10-106-15/+13
|\ \ \ \ | |_|/ / |/| | | patch_manager: Return a std::unique_ptr from ParseControlNCA() and GetControlMetadata() instead of a std::shared_ptr
| * | | patch_manager: Return a std::unique_ptr from ParseControlNCA() and GetControlMetadata() instead of a std::shared_ptrLioncash2018-10-096-15/+13
| |/ / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Neither of these functions require the use of shared ownership of the returned pointer. This makes it more difficult to create reference cycles with, and makes the interface more generic, as std::shared_ptr instances can be created from a std::unique_ptr, but the vice-versa isn't possible. This also alters relevant functions to take NCA arguments by const reference rather than a const reference to a std::shared_ptr. These functions don't alter the ownership of the memory used by the NCA instance, so we can make the interface more generic by not assuming anything about the type of smart pointer the NCA is contained within and make it the caller's responsibility to ensure the supplied NCA is valid.
* | | Merge pull request #1459 from ogniK5377/breakbunnei2018-10-091-5/+20
|\ \ \ | | | | | | | | svcBreak, Signalling to the debugger should not kill execution
| * | | Added bitfield instead of manually checking if the bit is setDavid Marcec2018-10-091-4/+12
| | | |
| * | | Actual kill execution when the bit isn't set, not the other way aroundDavid Marcec2018-10-091-1/+1
| | | |
| * | | svcBreak, Signalling to the debugger should not kill executionDavid Marcec2018-10-091-5/+12
| | | | | | | | | | | | | | | | When loading NROs, svcBreak is called to signal to the debugger that a new "module" is loaded. As no debugger is technically attached we shouldn't be killing the programs execution.
* | | | Merge pull request #1465 from lioncash/telemetrybunnei2018-10-092-7/+9
|\ \ \ \ | | | | | | | | | | telemetry_session: Minor miscellaneous changes
| * | | | telemetry_session: Remove doxygen comment for a non-existent parameterLioncash2018-10-091-1/+0
| | | | | | | | | | | | | | | | | | | | There's no "func" parameter, so this can just be removed.
| * | | | telemetry_session: Add missing includesLioncash2018-10-092-2/+5
| | | | | | | | | | | | | | | | | | | | | | | | | Prevents potential compilation issues in the future by including missing headers for certain functions and types.
| * | | | telemetry_session: Remove unimplemented FinalizeAsyncJob prototypeLioncash2018-10-091-2/+0
| | | | | | | | | | | | | | | | | | | | This isn't implemented anywhere, so it can just be removed.
| * | | | telemetry_session: Use a std::array in GenerateTelemetryId()Lioncash2018-10-091-2/+4
| | |/ / | |/| | | | | | | | | | | | | | | | | | We don't need to potentially heap-allocate a std::string instance here, given the data is known ahead of time. We can just place it within an array and pass this to the mbedtls functions.
* | | | ips_layer: Avoid constructing std::vector instances where not necessaryLioncash2018-10-091-6/+25
| | | | | | | | | | | | | | | | | | | | | | | | We can just compare the existing std::vector instance with a constexpr std::array containing the desired match. This is lighter resource-wise, as we don't need to allocate on the heap.
* | | | ips_layer: Remove unnecessary explicit std::pair constructor in std::arrayLioncash2018-10-091-5/+13
| | | | | | | | | | | | | | | | | | | | Makes the layout of the array consistent, by making all elements match, instead of special-casing the first one.
* | | | ips_layer: Add missing includesLioncash2018-10-092-7/+17
| | | | | | | | | | | | | | | | | | | | | | | | Adds missing includes to prevent potential compilation issues in the future. Also moves the definition of a struct into the cpp file, so that some includes don't need to be introduced within the header.
* | | | ips_layer: std::move data within PatchIPS() and Apply()Lioncash2018-10-091-2/+5
|/ / / | | | | | | | | | | | | We don't need to make a copy of the read data, so we can std::move it into the make_shared call here.
* | | Merge pull request #1423 from DarkLordZach/romfs-file-extsbunnei2018-10-085-10/+38
|\ \ \ | | | | | | | | fsmitm_romfsbuild: Add support for stubbing and IPS patches in LFS
| * | | patch_manager: Avoid romfs_ext requirement for patchingZach Hilman2018-10-041-4/+1
| | | |
| * | | fsmitm_romfsbuild: Extract stubs and IPS to romfs_ext dirZach Hilman2018-10-045-21/+38
| | | |
| * | | fsmitm_romfsbuild: Add support for stubbing and IPS patches in LFSZach Hilman2018-10-041-0/+14
| | | |
* | | | Merge pull request #1424 from DarkLordZach/ips-witchbunnei2018-10-084-23/+299
|\ \ \ \ | |_|/ / |/| | | ips_layer: Add support for IPSwitch executable patches
| * | | ips_layer: Fix inaccuracies with comments and flagsZach Hilman2018-10-043-16/+51
| | | | | | | | | | | | Specifically bugs/crashes that arise when putting them in positions that are legal but not typical, such as midline, between patch data, or between patch records.
| * | | ips_layer: Deduplicate resource usageZach Hilman2018-10-043-31/+37
| | | |
| * | | ips_layer: Add support for escape sequences and midline commentsZach Hilman2018-10-043-8/+41
| | | | | | | | | | | | | | | | More accurately follows IPSwitch specification.
| * | | patch_manager: Add support for IPSwitch format patchesZach Hilman2018-10-041-22/+56
| | | |
| * | | ips_layer: Add IPSwitchCompiler to process IPSwitch formatZach Hilman2018-10-042-0/+168
| |/ /
* | | Merge pull request #1456 from ogniK5377/aoc-u-fixupsbunnei2018-10-081-5/+5
|\ \ \ | | | | | | | | Fixed assertion due to CountAddOnContent & Casting warnings
| * | | Fixed assertion due to CountAddOnContentDavid Marcec2018-10-071-5/+5
| | |/ | |/| | | | | | | | | | | | | Word count should be 3 since we're pushing a result code and a u32. Also fixed up compiler warnings due to casting
* | | Merge pull request #1457 from ogniK5377/unmap-bufferbunnei2018-10-081-1/+6
|\ \ \ | | | | | | | | Unmapping an unmapped buffer should succeed
| * | | Unmapping an unmapped buffer should succeedDavid Marcec2018-10-081-1/+6
| |/ / | | | | | | | | | Hardware tests show that trying to unmap an unmapped buffer already should always succeed. Hardware test was tested up to 32 iterations of attempting to unmap
* | | nso/nro: Use default allocation size for arg_dataZach Hilman2018-10-074-14/+20
| | |
* | | cmd: Support passing game arguments from command lineZach Hilman2018-10-072-2/+2
| | | | | | | | | | | | Uses -p (--program) and following string as args.
* | | settings: Add program_args string settingZach Hilman2018-10-071-0/+1
| | |
* | | nso/nro: Add NSO arguments structure to data sectionZach Hilman2018-10-074-3/+38
|/ / | | | | | | Only added if arguments string is non-empty and a pass is requested by loader.
* | Merge pull request #1396 from DarkLordZach/packed-updatesbunnei2018-10-0715-16/+128
|\ \ | | | | | | loader: Add support for packed updates
| * | romfs_factory: Extract packed update setter to new functionZach Hilman2018-10-059-6/+36
| | |
| * | patch_manager: Add support for NSP packed updatesZach Hilman2018-10-051-2/+2
| | | | | | | | | | | | Reads as Update (NSP) in add-ons
| * | patch_manager: Add support for packed updatesZach Hilman2018-10-054-5/+18
| | | | | | | | | | | | Will prefer any installed update over the packed version.
| * | loader: Add getter for packed updateZach Hilman2018-10-056-3/+58
| | | | | | | | | | | | Reads the update included with the game if it has one and adds the new ErrorNoPackedUpdate status.
| * | loader: Add ReadRomFSIVFCOffset to NSP, XCI, and NAX loadersZach Hilman2018-10-056-6/+20
| |/ | | | | | | Fixes errors with certain updates
* | Merge pull request #1448 from ogniK5377/frontend-accessbunnei2018-10-074-0/+26
|\ \ | | | | | | Ported #4296 from citra
| * | Added forward define for ServerPortDavid Marcec2018-10-062-4/+6
| | |
| * | Ported #4296 from citraDavid Marcec2018-10-063-1/+25
| | | | | | | | | | | | This will allow us to easily remove the use of "NFC" in "System"
* | | Merge pull request #1332 from FearlessTobi/port-web-backendbunnei2018-10-064-14/+53
|\ \ \ | |/ / |/| | Port web_service from Citra
| * | Review comments -part 4fearlessTobi2018-10-021-0/+1
| | |
| * | Address more review commentsfearlessTobi2018-10-021-1/+1
| | |
| * | Address a bunch of review commentsfearlessTobi2018-10-022-6/+7
| | |
| * | Port web_service from CitrafearlessTobi2018-10-024-14/+51
| | |
* | | kernel/mutex: Amend behavior of TransferMutexOwnership()Lioncash2018-10-061-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | This was the result of a typo accidentally introduced in e51d715700a35a8f14e5b804b6f7553c9a40888b. This restores the previous correct behavior. The behavior with the reference was incorrect and would cause some games to fail to boot.
* | | thread: Make the scheduler pointer a regular pointerbalika0112018-10-052-4/+4
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Conceptually, it doesn't make sense for a thread to be able to persist the lifetime of a scheduler. A scheduler should be taking care of the threads; the threads should not be taking care of the scheduler. If the threads outlive the scheduler (or we simply don't actually terminate/shutdown the threads), then it should be considered a bug that we need to fix. Attributing this to balika011, as they opened #1317 to attempt to fix this in a similar way, but my refactoring of the kernel code caused quite a few conflicts.
* | | Merge pull request #1439 from lioncash/threadbunnei2018-10-0514-206/+392
|\ \ \ | |_|/ |/| | kernel/thread: Make all instance variables private
| * | kernel/thread: Make all instance variables privateLioncash2018-10-0414-206/+392
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Many of the member variables of the thread class aren't even used outside of the class itself, so there's no need to make those variables public. This change follows in the steps of the previous changes that made other kernel types' members private. The main motivation behind this is that the Thread class will likely change in the future as emulation becomes more accurate, and letting random bits of the emulator access data members of the Thread class directly makes it a pain to shuffle around and/or modify internals. Having all data members public like this also makes it difficult to reason about certain bits of behavior without first verifying what parts of the core actually use them. Everything being public also generally follows the tendency for changes to be introduced in completely different translation units that would otherwise be better introduced as an addition to the Thread class' public interface.
* | | Merge pull request #1415 from DarkLordZach/ipsbunnei2018-10-048-36/+255
|\ \ \ | | | | | | | | file_sys: Add support for loading IPS patches
| * | | nso: Optimize loading of IPS patchesZach Hilman2018-10-025-51/+43
| | | | | | | | | | | | | | | | Avoid resource-heavy classes and remove quasi-duplicated code.
| * | | deconstructed_rom_directory: Force NSO loader to patch NSOsZach Hilman2018-10-011-1/+3
| | | |
| * | | nso: Add framework to support patching of uncompressed NSOsZach Hilman2018-10-012-2/+17
| | | |
| * | | patch_manager: Add PatchNSO functionZach Hilman2018-10-013-0/+104
| | | | | | | | | | | | | | | | While PatchExeFS operated on the entire directory, this function operates on the uncompressed NSO. Avoids copying decompression code to PatchManager.
| * | | patch_manager: Use strings for patch type instead of enumZach Hilman2018-10-012-29/+33
| | | |
| * | | file_sys: Implement function to apply IPS patchesZach Hilman2018-10-012-0/+103
| | | |
| * | | nso: Replace NSOHeader padding bytes with build IDZach Hilman2018-10-011-2/+1
| | |/ | |/|
* | | Merge pull request #1434 from DarkLordZach/dlc-edge-casebunnei2018-10-041-1/+1
|\ \ \ | | | | | | | | aoc_u: Fix edge case with DLC that causes breaks
| * | | aoc_u: Fix edge case with DLC that causes breaksZach Hilman2018-10-031-1/+1
| |/ / | | | | | | | | | In some games (Splatoon 2 and Splatoon 2 Splatfest World Premiere, notably), pass offset=0 and count=2047 into the ListAddOnContent method which should return all DLCs for the current title. The (presumably) intended behavior is to successfully return a empty array but because of a < v. <= in an if statement, a failure error code was returned causing these games to svcBreak. This fixes that if statement.
* | | Merge pull request #1433 from lioncash/fsbunnei2018-10-041-0/+2
|\ \ \ | | | | | | | | services/fsp_srv: Amend service function table
| * | | services/fsp_srv: Amend service function tableLioncash2018-10-031-0/+2
| | |/ | |/| | | | | | | | | | Adds new functions that have been given names to the table. Information is based off what is provided on Switchbrew.
* | | Merge pull request #1436 from lioncash/viewbunnei2018-10-042-73/+101
|\ \ \ | | | | | | | | submission_package: Cleanup and bug fixes
| * | | submission_package: Avoid dangling std::string_view within SetTicketKeys()Lioncash2018-10-031-2/+5
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | GetName() returns a std::string by value, not by reference, so after the std::string_view is constructed, it's not well defined to actually execute any member functions of std::string_view that attempt to access the data, as the std::string has already been destroyed. Instead, we can just use a std::string and erase the last four characters.
| * | | submission_package: Correct location of null check within SetTicketKeys()Lioncash2018-10-031-3/+6
| | | | | | | | | | | | | | | | | | | | If a ticket file was ever a null pointer, we'd cause a null pointer dereference, as we were calling GetExtension() on the pointer instance.
| * | | submission_package: Use std::string's rfind() when looking for the extension in InitializeExeFSAndRomFS()Lioncash2018-10-031-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | When searching for a file extension, it's generally preferable to begin the search at the end of the string rather than the beginning, as the whole string isn't going to be walked just to check for something at the end of it.
| * | | submission_package: Ensure the 'extracted' member variable is always initializedLioncash2018-10-032-3/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | If an error occurs when constructing the PartitionFilesystem instance, the constructor would be exited early, which wouldn't initialize the extracted data member, making it possible for other code to perform an uninitialized read by calling the public IsExtractedType() member function. This prevents that.
| * | | submission_package: Move ExeFS and RomFS initialization to its own functionLioncash2018-10-032-10/+18
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Like the other two bits of factored out code, this can also be put within its own function. We can also modify the code so that it accepts a const reference to a std::vector of files, this way, we can deduplicate the file retrieval. Now the constructor for NSP isn't a combination of multiple behaviors in one spot. It's nice and separate.
| * | | submission_package: Move NCA reading code to its own functionLioncash2018-10-032-43/+48
| | | | | | | | | | | | | | | | | | | | | | | | This too, is completely separate behavior from what is in the constructor, so we can move this to its own isolated function to keep everything self-contained.
| * | | submission_package: Move ticket key setting to its own functionLioncash2018-10-031-21/+28
| | | | | | | | | | | | | | | | | | | | This behavior is entirely independent of the surrounding code, so it can be put in its own function to keep the behavior separate.
| * | | submission_package: Invert conditionals within NSP's constructor to reduce nestingLioncash2018-10-031-45/+49
| |/ / | | | | | | | | | We can use early continues here to reduce the amount of nesting.
* | | Merge pull request #1432 from lioncash/lblbunnei2018-10-041-19/+19
|\ \ \ | | | | | | | | service/lbl: Update service function table
| * | | service/lbl: Update service function tableLioncash2018-10-031-19/+19
| | |/ | |/| | | | | | | | | | Amends the lbl service table to include new names of functions that were added to Switchbrew.
* | | Merge pull request #1435 from lioncash/xcibunnei2018-10-041-1/+3
|\ \ \ | |/ / |/| | card_image: Ensure program_nca_status is always initialized
| * | card_image: Ensure program_nca_status is always initializedLioncash2018-10-031-1/+3
| |/ | | | | | | | | | | If any of the error paths before the NCA retrieval are taken, it'll result in program_nca_status being left in an inconsistent state. So we initialize it by default with a value indicating an error.
* | aoc_u: Extract AccumulateAOCTitleIDs to separate functionZach Hilman2018-10-012-21/+28
| |
* | aoc_u: Implement GetAddOnContentBaseIdZach Hilman2018-10-013-5/+8
| | | | | | Command #5
* | aoc_u: Implement Count, List and Prepare AddOnContentZach Hilman2018-10-012-3/+78
| | | | | | | | Commands #2, #3, and #7
* | romfs_factory: Read from all locations with StorageId NoneZach Hilman2018-10-011-26/+25
| | | | | | | | Previous behavior was to assert. Seems to mirror expected game behavior.
* | patch_manager: Add DLC recognition to PatchManagerZach Hilman2018-10-012-0/+27
|/
* Merge pull request #1338 from raven02/service_vibunnei2018-09-301-1/+19
|\ | | | | Implement ISystemDisplayService::GetDisplayMode
| * Implement ISystemDisplayService::GetDisplayModeraven022018-09-301-1/+19
| |
* | kernel/svc: Implement svcGetThreadContext()Lioncash2018-09-303-2/+37
| | | | | | | | | | | | | | | | | | Now that we have all of the rearranging and proper structure sizes in place, it's fairly trivial to implement svcGetThreadContext(). In the 64-bit case we can more or less just write out the context as is, minus some minor value sanitizing. In the 32-bit case we'll need to clear out the registers that wouldn't normally be accessible from a 32-bit AArch32 exectuable (or process).
* | kernel/process: Add a data member to determine if a process is 64-bit or not.Lioncash2018-09-302-0/+11
| | | | | | | | | | | | | | | | | | | | | | This will be necessary for the implementation of svcGetThreadContext(), as the kernel checks whether or not the process that owns the thread that has it context being retrieved is a 64-bit or 32-bit process. If the process is 32-bit, then the upper 15 general-purpose registers and upper 16 vector registers are cleared to zero (as AArch32 only has 15 GPRs and 16 128-bit vector registers. not 31 general-purpose registers and 32 128-bit vector registers like AArch64).
* | kernel/process: Make data member variables privateLioncash2018-09-3016-72/+117
| | | | | | | | | | | | | | Makes the public interface consistent in terms of how accesses are done on a process object. It also makes it slightly nicer to reason about the logic of the process class, as we don't want to expose everything to external code.
* | arm_interface: Add missing fpsr/tpidr members to the ThreadContext structLioncash2018-09-303-5/+15
| | | | | | | | | | | | | | | | | | Internally within the kernel, it also includes a member variable for the floating-point status register, and TPIDR, so we should do the same here to match it. While we're at it, also fix up the size of the struct and add a static assertion to ensure it always stays the correct size.
* | loader: Make the Load() function take a process as a regular reference, not a SharedPtrLioncash2018-09-2918-42/+28
| | | | | | | | | | | | | | | | A process should never require being reference counted in this situation. If the handle to a process is freed before this function is called, it's definitely a bug with our lifetime management, so we can put the requirement in place for the API that the process must be a valid instance.
* | Merge pull request #1412 from lioncash/movebunnei2018-09-292-3/+2
|\ \ | | | | | | kernel/object: Remove unnecessary std::move from DynamicObjectCast()
| * | kernel/object: Remove unnecessary std::move from DynamicObjectCast()Lioncash2018-09-282-3/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | boost::static_pointer_cast for boost::intrusive_ptr (what SharedPtr is), takes its parameter by const reference. Given that, it means that this std::move doesn't actually do anything other than obscure what the function's actual behavior is, so we can remove this. To clarify, this would only do something if the parameter was either taking its argument by value, by non-const ref, or by rvalue-reference.
* | | Merge pull request #1395 from lioncash/vmbunnei2018-09-2917-158/+413
|\ \ \ | | | | | | | | process/vm_manager: Initial modifications to load NPDM metadata
| * | | memory: Dehardcode the use of fixed memory range constantsLioncash2018-09-2511-75/+60
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The locations of these can actually vary depending on the address space layout, so we shouldn't be using these when determining where to map memory or be using them as offsets for calculations. This keeps all the memory ranges flexible and malleable based off of the virtual memory manager instance state.
| * | | svc: Report correct memory-related values within some of the cases in svcGetInfo()Lioncash2018-09-253-28/+41
| | | | | | | | | | | | | | | | | | | | | | | | Previously, these were reporting hardcoded values, but given the regions can change depending on the requested address spaces, these need to report the values that the memory manager contains.
| * | | memory: Dehardcode the use of a 36-bit address spaceLioncash2018-09-255-20/+56
| | | | | | | | | | | | | | | | | | | | Given games can also request a 32-bit or 39-bit address space, we shouldn't be hardcoding the address space range as 36-bit.
| * | | process/vm_manager: Amend API to allow reading parameters from NPDM metadataLioncash2018-09-2410-38/+259
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Rather than hard-code the address range to be 36-bit, we can derive the parameters from supplied NPDM metadata if the supplied exectuable supports it. This is the bare minimum necessary for this to be possible. The following commits will rework the memory code further to adjust to this.
* | | | Merge pull request #1394 from lioncash/streambunnei2018-09-271-1/+1
|\ \ \ \ | |_|/ / |/| | | stream: Preserve enum class type in GetState()
| * | | stream: Preserve enum class type in GetState()Lioncash2018-09-241-1/+1
| |/ / | | | | | | | | | | | | | | | Preserves the meaning/type-safetiness of the stream state instead of making it an opaque u32. This makes it usable for other things outside of the service HLE context.
* | | Merge pull request #1389 from PhiBabin/valgrindMat M2018-09-271-1/+1
|\ \ \ | | | | | | | | FPCR register was uninitialized at start up
| * | | FPCR register was uninitialized at start upPhilippe Babin2018-09-231-1/+1
| | | |
* | | | fsmitm_romfsbuild: std::move std::vector instances in Build()Lioncash2018-09-261-2/+2
| | | | | | | | | | | | | | | | | | | | Avoids making copies of large std::vector instances where it's trivially avoidable to do so.
* | | | fsmitm_romfsbuild: Replace manual value aligning with Common::AlignUp()Lioncash2018-09-261-12/+11
| | | | | | | | | | | | | | | | | | | | Theres no need to do explicit bitwise arithmetic here, when we have a function that does this with a more descriptive name.
* | | | Merge pull request #1399 from lioncash/schedbunnei2018-09-264-14/+14
|\ \ \ \ | | | | | | | | | | kernel/scheduler: Take ARM_Interface instances by reference
| * | | | core_cpu: Make arm_interface instances a std::unique_ptrLioncash2018-09-252-4/+4
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This is only exposed by reference, so we can just make it a unique pointer to get rid of the need to also use reference counting for the pointer.
| * | | | kernel/scheduler: Take ARM_Interface instance by reference in the constructorLioncash2018-09-253-10/+10
| |/ / / | | | | | | | | | | | | | | | | It doesn't make sense to allow a scheduler to be constructed around a null pointer.
* | | | Merge pull request #1400 from lioncash/headerbunnei2018-09-265-1/+7
|\ \ \ \ | | | | | | | | | | service: Add missing headers inclusions where applicable
| * | | | service: Add missing headers inclusions where applicableLioncash2018-09-255-1/+7
| | | | | | | | | | | | | | | | | | | | Gets rid of a few indirect inclusions.
* | | | | patch_manager: Invert conditionals within ApplyLayeredFS()Lioncash2018-09-261-27/+30
| | | | | | | | | | | | | | | | | | | | | | | | | Avoids the need to nest code quite a bit by early-exiting in error cases.
* | | | | vfs_vector: Amend initializer list order in VectorVfsFile's constructor initializer listLioncash2018-09-261-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | Orders the initializer list members to be in the same order that they would be initialized in. Avoids compiler warnings.
* | | | | fsmitm_romfsbuild: Avoid type truncation warningsLioncash2018-09-261-7/+10
| | | | | | | | | | | | | | | | | | | | | | | | | Cast where explicitly necessary and in other cases we can simply modify the algorithm to accomodate larger data.
* | | | | fsmitm_romfsbuild: Remove unnecessary constructors and initializers for RomFSBuildFileContext and RomFSBuildDirectoryContextLioncash2018-09-261-5/+3
| | | | | | | | | | | | | | | | | | | | | | | | | There's no need to duplicate in-class initializers with a constructor initializer list. std::strings also initialize to empty by default.
* | | | | fsmitm_romfsbuild: Remove unnecessary loops in Build()Lioncash2018-09-261-6/+0
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The std::vector instances are already initially allocated with all entries having these values, there's no need to loop through and fill them with it again when they aren't modified.
* | | | | fsmitm_romfsbuild: Make auto variable into a std::size_t variable within Build()Lioncash2018-09-261-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | auto x = 0; auto-deduces x to be an int. This is undesirable when working with unsigned values. It also causes sign conversion warnings. Instead, we can make it a proper unsigned value with the correct width that the following expressions operate on.
* | | | | vfs/etc: Append std:: to size_t usagesLioncash2018-09-266-22/+23
| | | | | | | | | | | | | | | | | | | | | | | | | Given we just recently had a patch backport this from citra, let's try and keep the convention uniform.
* | | | | vfs_concat/vfs_layered: Remove friend declarations from ConcatenatedVfsFileLioncash2018-09-268-61/+59
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Given these are only added to the class to allow those functions to access the private constructor, it's a better approach to just make them static functions in the interface, to make the dependency explicit.
* | | | | vfs_static: Remove template byte parameter from StaticVfsFileLioncash2018-09-254-42/+42
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This converts it into a regular constructor parameter. There's no need to make this a template parameter on the class when it functions perfectly well as a constructor argument. This also reduces the amount of code bloat produced by the compiler, as it doesn't need to generate the same code for multiple different instantiations of the same class type, but with a different fill value.
* | | | | Merge pull request #1365 from DarkLordZach/lfsbunnei2018-09-2524-33/+1037
|\ \ \ \ \ | |/ / / / |/| | | | file_sys: Add support for LayeredFS mods
| * | | | fsmitm: Cleanup and modernize fsmitm portZach Hilman2018-09-2421-377/+377
| | | | |
| * | | | qt: Add UI elements for LayeredFS and related toolsZach Hilman2018-09-222-2/+2
| | | | |
| * | | | romfs: Implement CreateRomFSZach Hilman2018-09-222-4/+25
| | | | |
| * | | | file_sys: Port Atmosphere-NX fs_mitm implementationZach Hilman2018-09-222-0/+474
| | | | |
| * | | | filesystem: Add LayeredFS VFS directory getterZach Hilman2018-09-222-1/+14
| | | | |
| * | | | bis_factory: Add mod directory VFS getterZach Hilman2018-09-223-3/+18
| | | | |
| * | | | patch_manager: Add LayeredFS mods supportZach Hilman2018-09-222-1/+44
| | | | |
| * | | | vfs_concat: Rewrite and fix ConcatenatedVfsFileZach Hilman2018-09-222-14/+59
| | | | |
| * | | | vfs_layered: Add LayeredVfsDirectoryZach Hilman2018-09-222-0/+178
| | | | | | | | | | | | | | | | | | | | Reads multiple dirs through as if a waterfall.
| * | | | vfs_vector: Add VectorVfsFileZach Hilman2018-09-222-0/+75
| | | | | | | | | | | | | | | | | | | | Maps a vector into the VFS interface.
| * | | | vfs_static: Add StaticVfsFileZach Hilman2018-09-222-0/+78
| | | | | | | | | | | | | | | | | | | | Always returns the template argument byte for all reads. Doesn't support writes.
| * | | | vfs: Add and rewite VfsRawCopy functionsZach Hilman2018-09-222-6/+36
| | | | |
| * | | | vfs: Add GetEntries methodZach Hilman2018-09-224-0/+32
| | | | | | | | | | | | | | | | | | | | Maps name string to directory or file.
* | | | | Merge pull request #1393 from tech4me/svcbunnei2018-09-251-7/+7
|\ \ \ \ \ | | | | | | | | | | | | svc: Updated svc names
| * | | | | svc: Updated svc namestech4me2018-09-241-7/+7
| | | | | |
* | | | | | Implemented fatal:u properly (#1347)David2018-09-243-4/+140
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * Implemented fatal:u properly fatal:u now is properly implemented with all the ipc cmds. Error reports/Crash reports are also now implemented for fatal:u. Crash reports save to yuzu/logs/crash_reports/ The register dump is currently known as sysmodules send all zeros. If there are any non zero values for the "registers" or the unknown values, let me know! * Fatal:U fixups * Made fatal:u execution break more clear * Fatal fixups
* | | | | | Stubbed IRS (#1349)David2018-09-242-18/+167
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * Stubbed IRS Currently we have no ideal way of implementing IRS. For the time being we should have the functions stubbed until we come up with a way to emulate IRS properly. * Added IRS to logging backend * Forward declared shared memory for irs
* | | | | | Merge pull request #1354 from ogniK5377/ssl-versionbunnei2018-09-241-3/+3
|\ \ \ \ \ \ | |_|_|_|/ / |/| | | | | Corrected SSL::SetInterfaceVersion
| * | | | | Corrected SSL::SetInterfaceVersionDavid Marcec2018-09-191-3/+3
| | | | | | | | | | | | | | | | | | | | | | | | Should be a single u32
* | | | | | Added audren:u#GetAudioRendererStateDavid Marcec2018-09-231-1/+8
| |_|_|/ / |/| | | |
* | | | | svc: Move most process termination code to its own function within ProcessLioncash2018-09-213-32/+56
| | | | | | | | | | | | | | | | | | | | | | | | | Reduces the use of Process class members externally and keeps most code related to tearing down a process with the rest of the process code.
* | | | | thread/process: Move TLS slot marking/freeing to the process classLioncash2018-09-214-68/+89
| |_|/ / |/| | | | | | | | | | | | | | | | | | | Allows making several members of the process class private, it also avoids going through Core::CurrentProcess() just to retrieve the owning process.
* | | | Added support for uncompressed NSOs (#1374)David2018-09-211-3/+12
| | | | | | | | | | | | | | | | | | | | | | | | * Added support for uncompressed NSOs * Moved compressed section check to NsoHeader
* | | | Merge pull request #1372 from lioncash/threadbunnei2018-09-213-5/+5
|\ \ \ \ | | | | | | | | | | kernel/thread: Use owner_process when setting the page table in SetupMainThread()
| * | | | kernel/thread: Use owner_process when setting the page table in SetupMainThread()Lioncash2018-09-213-5/+5
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The owning process of a thread is required to exist before the thread, so we can enforce this API-wise by using a reference. We can also avoid the reliance on the system instance by using that parameter to access the page table that needs to be set.
* | | | | Merge pull request #1371 from lioncash/fwd-armbunnei2018-09-214-1/+10
|\ \ \ \ \ | | | | | | | | | | | | arm_interface: Replace kernel vm_manager include with a forward declaration
| * | | | | arm_interface: Replace kernel vm_manager include with a forward declarationLioncash2018-09-214-1/+10
| |/ / / / | | | | | | | | | | | | | | | | | | | | | | | | | Avoids an unnecessary inclusion and also uncovers three places where indirect inclusions were relied upon, which allows us to also resolve those.
* | | | | Merge pull request #1364 from lioncash/contentbunnei2018-09-2125-1/+45
|\ \ \ \ \ | | | | | | | | | | | | file-sys: Default heavy-weight class destructors in the cpp file
| * | | | | file-sys: Default heavy-weight class destructors in the cpp fileLioncash2018-09-2025-1/+45
| | |_|/ / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Several classes have a lot of non-trivial members within them, or don't but likely should have the destructor defaulted in the cpp file for future-proofing/being more friendly to forward declarations. Leaving the destructor unspecified allows the compiler to inline the destruction code all over the place, which is generally undesirable from a code bloat perspective.
* | | | | Merge pull request #1368 from ogniK5377/nifm-fixbunnei2018-09-211-1/+7
|\ \ \ \ \ | | | | | | | | | | | | Added IRequest::Submit
| * | | | | Fixed submitDavid Marcec2018-09-201-2/+1
| | | | | |
| * | | | | Added IRequest::SubmitDavid Marcec2018-09-201-1/+8
| | | | | | | | | | | | | | | | | | | | | | | | This fixes updated versions of SMO. Currently unable to test as I don't have an updated version
* | | | | | Revert GetRequestStateDavid Marcec2018-09-211-1/+1
| |_|/ / / |/| | | | | | | | | | | | | | Even though setting this value to 3 is more correct. We break more games than we fix due to missing implementations. We should keep this as 0 for the time being
* | | | | Merge pull request #1370 from Hedges/GDBCleanMat M2018-09-201-1/+1
|\ \ \ \ \ | | | | | | | | | | | | Correct endianness of BRK
| * | | | | Correct endianness of BKPTJarek Syrylak2018-09-201-1/+1
| |/ / / /
* | | | | Merge pull request #1362 from MerryMage/dynarmicMat M2018-09-201-0/+12
|\ \ \ \ \ | |/ / / / |/| | | | externals: Update dynarmic to 171d116
| * | | | arm_dynarmic: Halt when BRK encounteredMerryMage2018-09-201-0/+1
| | | | |
| * | | | arm_dynarmic: Support BKPT instructionMerryMage2018-09-191-0/+11
| |/ / /
* | | | Merge pull request #1358 from DarkLordZach/temp-storagebunnei2018-09-201-4/+7
|\ \ \ \ | | | | | | | | | | savedata_factory: Add TemporaryStorage SaveDataType
| * | | | savedata_factory: Add TemporaryStorage SaveDataTypeZach Hilman2018-09-191-4/+7
| | |_|/ | |/| | | | | | Seems to be used by NSO NES Emulator
* | | | Merge pull request #1363 from lioncash/controlbunnei2018-09-202-14/+17
|\ \ \ \ | | | | | | | | | | control_metadata: Move language name array definition to the cpp file
| * | | | control_metadata: Remove unnecessary else within GetLanguageEntry()Lioncash2018-09-201-8/+8
| | | | | | | | | | | | | | | | | | | | | | | | | There's no need to indent the code here, given the if case contains a return statement at the end of it.
| * | | | control_metadata: Move language name array definition to the cpp fileLioncash2018-09-202-6/+9
| | |/ / | |/| | | | | | | | | | | | | | | | | | | | | | This was used in two different translation units (deconstructed_rom_directory and patch_manager). This means we'd be pointlessly duplicating the whole array twice due to it being defined within the header.
* | | | Merge pull request #1361 from lioncash/naxbunnei2018-09-204-19/+26
|\ \ \ \ | | | | | | | | | | xts_archive/nax: Minor interface changes
| * | | | xts_archive: Remove unused variables from CalculateHMAC256()Lioncash2018-09-191-3/+0
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | These variables aren't used, which still has an impact, as std::vector cannot be optimized away by the compiler (it's constructor and destructor are both non-trivial), so this was just wasting memory.
| * | | | xts_archive: Make AsNCA() return a std::unique_ptr instead of a std::shared_ptrLioncash2018-09-192-3/+3
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | std::shared_ptr isn't strictly necessary here and is only ever used in contexts where the object doesn't depend on being shared. This also makes the interface more flexible, as it's possible to create a std::shared_ptr from a std::unique_ptr (std::shared_ptr has a constructor that accepts a std::unique_ptr), but not the other way around.
| * | | | nax: Avoid re-parsing NAX data with GetFileType()Lioncash2018-09-192-13/+19
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | An instance of the NAX apploader already has an existing NAX instance in memory. Calling directly into IdentifyType() directly would re-parse the whole file again into yet another NAX instance, only to toss it away again. This gets rid of unnecessary/redundant file parsing and allocations.
| * | | | nax: Avoid unnecessary calls to AsNCA() in IdentifyType()Lioncash2018-09-191-4/+8
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | AsNCA() allocates an NCA instance every time it's called. In the current manner it's used, it's quite inefficient as it's making a redundant allocation. We can just amend the order of the conditionals to make it easier to just call it once.
| * | | | xts_archive: Ensure NAX's type member is always initializedLioncash2018-09-191-1/+1
| | | | | | | | | | | | | | | | | | | | Ensures that the member always has a deterministic value.
| * | | | xts_archive: Amend initializer order of NAX's constructorLioncash2018-09-191-2/+2
| |/ / / | | | | | | | | | | | | | | | | Orders the initializer list in the same order the members would be initialized. Avoids compiler warnings.
* | | | Removed unneeded event clearDavid Marcec2018-09-201-1/+0
| | | |
* | | | Implemented NTC & IEnsureNetworkClockAvailabilityServiceDavid Marcec2018-09-201-3/+100
|/ / / | | | | | | | | | Needed because of the recent nim fixes
* | | Reworked incorrect nifm stubs (#1355)David2018-09-191-3/+10
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * Reworked incorrect nifm stubs Need confirmation on `CreateTemporaryNetworkProfile`, unsure which game uses it but according to reversing. It should return a uuid which we currently don't do. Any 0 client id is considered an invalid client id. GetRequestState 0 is considered invalid. * Fixups for nifm
* | | Merge pull request #1359 from ogniK5377/nesbunnei2018-09-193-7/+12
|\ \ \ | | | | | | | | Fixed GetAccountId stub, Added error code for OpenDirectory and added ActivateNpadWithRevision
| * | | Fixed GetAccountId stub, Added error code for OpenDirectory and added ActivateNpadWithRevisionDavid Marcec2018-09-193-7/+12
| | |/ | |/| | | | | | | With these, `Nintendo Entertainment System - Nintendo Switch Online` loads
* | | Removed MakeBuilder as it's not needed anymoreDavid Marcec2018-09-191-7/+0
| | |
* | | Removed the use of rp.MakeBuilderDavid Marcec2018-09-196-27/+26
|/ / | | | | | | Due to keeping the code style consistent in the yuzu codebase. `rb = rp.MakeBuilder(...)` was replaced with `rb{ctx, ...}`
* | Merge pull request #1348 from ogniK5377/GetImageSizebunnei2018-09-191-1/+9
|\ \ | | | | | | Implemented IProfile::GetImageSize
| * | Implemented GetImageSizeDavid Marcec2018-09-181-1/+9
| | |
* | | Merge pull request #1351 from ogniK5377/GetDefaultDisplayResolutionbunnei2018-09-192-1/+18
|\ \ \ | | | | | | | | Implemented GetDefaultDisplayResolution
| * | | Implemented GetDefaultDisplayResolutionDavid Marcec2018-09-182-1/+18
| |/ /
* | | Merge pull request #1341 from lioncash/dependencybunnei2018-09-192-2/+6
|\ \ \ | | | | | | | | core/core_cpu: Replace exclusive monitor include with forward declaration
| * | | core/core_cpu: Replace exclusive monitor include with forward declarationLioncash2018-09-182-2/+6
| |/ / | | | | | | | | | | | | We don't need to include this as a dependency within the header. A regular forward declaration will suffice here.
* | | Merge pull request #1346 from lioncash/svcbunnei2018-09-191-37/+36
|\ \ \ | | | | | | | | svc_wrap: Convert the PARAM macro into a function
| * | | svc_wrap: Convert the PARAM macro into a functionLioncash2018-09-181-37/+36
| |/ / | | | | | | | | | | | | | | | This can just be a regular function, getting rid of the need to also explicitly undef the define at the end of the file. Given FuncReturn() was already converted into a function, it's #undef can also be removed.
* | | Merge pull request #1350 from ogniK5377/Six-Axis-Stubbunnei2018-09-191-4/+28
|\ \ \ | | | | | | | | Stubbed ActivateConsoleSixAxisSensor & StartConsoleSixAxisSensor
| * | | Added ActivateGestureDavid Marcec2018-09-181-1/+7
| | | |
| * | | Added StopSixAxisSensorDavid Marcec2018-09-181-1/+7
| | | |
| * | | Stubbed ActivateConsoleSixAxisSensor & StartConsoleSixAxisSensorDavid Marcec2018-09-181-2/+14
| |/ /
* | | Invalid default value of username in yuzu_cmd (#1334)Philippe Babin2018-09-191-2/+3
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * Fix bug where default username value for yuzu_cmd create an userprofile with uninitialize data as username * Fix format * Apply code review changes * Remove nullptr check
* | | Merge pull request #1343 from lioncash/mutexbunnei2018-09-182-2/+10
|\ \ \ | | | | | | | | kernel/svc: Handle invalid address cases within svcArbitrateLock() and svcArbitrateUnlock()
| * | | kernel/mutex: Replace ResultCode construction for invalid addresses with the named variantLioncash2018-09-181-2/+2
| | | | | | | | | | | | | | | | | | | | | | | | We already have a ResultCode constant for the case of an invalid address, so we can just use it instead of re-rolling that ResultCode type.
| * | | kernel/svc: Handle error cases for svcArbitrateLock() and svcArbitrateUnlock()Lioncash2018-09-181-0/+8
| |/ / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The kernel does the equivalent of the following check before proceeding: if (address + 0x8000000000 < 0x7FFFE00000) { return ERR_INVALID_MEMORY_STATE; } which is essentially what our IsKernelVirtualAddress() function does. So we should also be checking for this. The kernel also checks if the given input addresses are 4-byte aligned, however our Mutex::TryAcquire() and Mutex::Release() functions already handle this, so we don't need to add code for this case.
* | | Merge pull request #1344 from lioncash/armbunnei2018-09-187-99/+86
|\ \ \ | | | | | | | | arm_interface: Remove ARM11-isms from the CPU interface
| * | | arm_interface: Remove ARM11-isms from the CPU interfaceLioncash2018-09-187-99/+86
| |/ / | | | | | | | | | | | | | | | | | | | | | | | | This modifies the CPU interface to more accurately match an AArch64-supporting CPU as opposed to an ARM11 one. Two of the methods don't even make sense to keep around for this interface, as Adv Simd is used, rather than the VFP in the primary execution state. This is essentially a modernization change that should have occurred from the get-go.
* / / arm_dynarmic: Correct ExclusiveWrite128()'s operationLioncash2018-09-181-2/+2
|/ / | | | | | | | | | | Previously the second half of the value being written would overwrite the first half. Thankfully this wasn't a bug that was being encountered, as the function is currently unused.
* | Merge pull request #1312 from lioncash/fwdbunnei2018-09-173-7/+9
|\ \ | | | | | | service/vi: Replace includes with forward declarations where applicable
| * | service/vi: Replace includes with forward declarations where applicableLioncash2018-09-133-7/+9
| | |
* | | Merge pull request #1313 from lioncash/errorbunnei2018-09-171-1/+2
|\ \ \ | | | | | | | | kernel/errors: Amend error code for ERR_NOT_FOUND
| * | | kernel/errors: Amend error code for ERR_NOT_FOUNDLioncash2018-09-131-1/+2
| |/ / | | | | | | | | | | | | This is the value returned by the kernel for svcConnectToNamedPort() if the named port cannot be found.
* | | Merge pull request #1318 from lioncash/errors-smbunnei2018-09-172-8/+6
|\ \ \ | | | | | | | | services/sm: Amend error code constants
| * | | services/sm: Amend error code constantsLioncash2018-09-142-8/+6
| |/ / | | | | | | | | | | | | | | | | | | | | | Courtesy of @ogniK5377. This also moves them into the cpp file and limits the visibility to where they're directly used. It also gets rid of unused or duplicate error codes.
* | | Merge pull request #1315 from lioncash/sizebunnei2018-09-172-19/+74
|\ \ \ | | | | | | | | kernel/svc: Handle a few error cases within memory-related functions
| * | | kernel/svc: Sanitize creation of shared memory via svcCreateSharedMemory()Lioncash2018-09-141-2/+18
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The kernel caps the size limit of shared memory to 8589930496 bytes (or (1GB - 512 bytes) * 8), so approximately 8GB, where every GB has a 512 byte sector taken off of it. It also ensures the shared memory is created with either read or read/write permissions for both permission types passed in, allowing the remote permissions to also be set as "don't care".
| * | | kernel/svc: Sanitize addresses, permissions, and sizes within svcMapSharedMemory() and svcUnmapSharedMemory()Lioncash2018-09-141-17/+25
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Part of the checking done by the kernel is to check if the given address and size are 4KB aligned, as well as checking if the size isn't zero. It also only allows mapping shared memory as readable or read/write, but nothing else, and so we shouldn't allow mapping as anything else either.
| * | | kernel/svc: Sanitize addresses and sizes within svcMapMemory() and svcUnmapMemory()Lioncash2018-09-141-0/+23
| | | | | | | | | | | | | | | | | | | | The kernel checks if the addresses and given size is 4KB aligned before continuing onwards to map the memory.
| * | | kernel/svc: Sanitize heap sizes within svcSetHeapSize()Lioncash2018-09-142-0/+8
| |/ / | | | | | | | | | | | | The kernel checks if the given size is a multiple of 2MB and <= to 4GB before going ahead and attempting to allocate that much memory.
* | | Merge pull request #1328 from FearlessTobi/port-4192bunnei2018-09-171-1/+1
|\ \ \ | | | | | | | | Port #4192 from Citra: "svc: change unknown to thread in CreateThread"
| * | | Port # #4192 from Citra: "svc: change unknown to thread in CreateThread"Valentin Vanelslande2018-09-151-1/+1
| | |/ | |/|
* / | Port #4182 from Citra: "Prefix all size_t with std::"fearlessTobi2018-09-1579-395/+409
|/ /
* | Merge pull request #1310 from lioncash/kernel-nsbunnei2018-09-144-9/+10
|\ \ | | | | | | kernel/thread: Include thread-related enums within the kernel namespace
| * | kernel/thread: Include thread-related enums within the kernel namespaceLioncash2018-09-134-9/+10
| |/ | | | | | | | | | | Previously, these were sitting outside of the Kernel namespace, which doesn't really make sense, given they're related to the Thread class which is within the Kernel namespace.
* | Merge pull request #1309 from lioncash/nestedbunnei2018-09-143-12/+6
|\ \ | | | | | | service: Use nested namespace specifiers where applicable
| * | service: Use nested namespace specifiers where applicableLioncash2018-09-133-12/+6
| |/ | | | | | | | | | | There were a few places where nested namespace specifiers weren't being used where they could be within the service code. This amends that to make the namespacing a tiny bit more compact.
* | Merge pull request #1307 from lioncash/plbunnei2018-09-141-2/+4
|\ \ | |/ |/| services/pl_u: Add missing Korean font to the fallback case for shared fonts
| * services/pl_u: Add missing Korean font to the fallback case for shared fontsLioncash2018-09-131-2/+4
| | | | | | | | Previously this wasn't using the Korean font at all.
* | ipc: minor fixValentin Vanelslande2018-09-131-1/+1
|/
* Merge pull request #1163 from FearlessTobi/add-audio-stretchingbunnei2018-09-132-0/+4
|\ | | | | audio_core: Add audio stretching support
| * Add audio stretching supportfearlessTobi2018-09-082-0/+4
| |
* | Merge pull request #1297 from lioncash/plbunnei2018-09-122-66/+88
|\ \ | | | | | | pl_u: Eliminate mutable file-scope state
| * | pl_u: Eliminate mutable file-scope stateLioncash2018-09-122-66/+88
| | | | | | | | | | | | | | | Converts the PL_U internals to use the PImpl idiom and makes the state part of the Impl struct, eliminating mutable global/file state.
* | | Merge pull request #1303 from lioncash/errorbunnei2018-09-123-9/+11
|\ \ \ | | | | | | | | kernel/errors: Amend invalid thread priority and invalid processor ID error codes
| * | | svc: Return ERR_INVALID_PROCESSOR_ID in CreateThread() if an invalid processor ID is givenLioncash2018-09-121-2/+2
| | | | | | | | | | | | | | | | This is what the kernel does for an out-of-range processor ID.
| * | | kernel/errors: Correct error codes for invalid thread priority and invalid processor IDLioncash2018-09-123-7/+9
| | | |
* | | | svc: Do nothing if svcOutputDebugString() is given a length of zeroLioncash2018-09-121-0/+4
| | | | | | | | | | | | | | | | | | | | | | | | While unlikely, it does avoid constructing a std::string and unnecessarily calling into the memory code if a game or executable decides to be really silly about their logging.
* | | | svc: Correct parameter type for OutputDebugString()Lioncash2018-09-122-3/+3
|/ / / | | | | | | | | | This should be a u64 to represent size.
* | | Merge pull request #1296 from lioncash/prepobunnei2018-09-122-39/+40
|\ \ \ | | | | | | | | service/prepo: Move class into the cpp file
| * | | service/prepo: Move class into the cpp fileLioncash2018-09-122-39/+40
| |/ / | | | | | | | | | | | | | | | This doesn't need to be exposed within the header and be kept in the translation unit, eliminating the need to include anything within the header.
* / / service/audio: Replace includes with forward declarations where applicableLioncash2018-09-127-17/+34
|/ / | | | | | | | | A few headers were including other headers when a forward declaration can be used instead, allowing the include to be moved to the cpp file.
* | Merge pull request #1291 from lioncash/defaultbunnei2018-09-11148-45/+291
|\ \ | | | | | | hle/service: Default constructors and destructors in the cpp file where applicable
| * | hle/service: Default constructors and destructors in the cpp file where applicableLioncash2018-09-11148-45/+291
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | When a destructor isn't defaulted into a cpp file, it can cause the use of forward declarations to seemingly fail to compile for non-obvious reasons. It also allows inlining of the construction/destruction logic all over the place where a constructor or destructor is invoked, which can lead to code bloat. This isn't so much a worry here, given the services won't be created and destroyed frequently. The cause of the above mentioned non-obvious errors can be demonstrated as follows: ------- Demonstrative example, if you know how the described error happens, skip forwards ------- Assume we have the following in the header, which we'll call "thing.h": \#include <memory> // Forward declaration. For example purposes, assume the definition // of Object is in some header named "object.h" class Object; class Thing { public: // assume no constructors or destructors are specified here, // or the constructors/destructors are defined as: // // Thing() = default; // ~Thing() = default; // // ... Some interface member functions would be defined here private: std::shared_ptr<Object> obj; }; If this header is included in a cpp file, (which we'll call "main.cpp"), this will result in a compilation error, because even though no destructor is specified, the destructor will still need to be generated by the compiler because std::shared_ptr's destructor is *not* trivial (in other words, it does something other than nothing), as std::shared_ptr's destructor needs to do two things: 1. Decrement the shared reference count of the object being pointed to, and if the reference count decrements to zero, 2. Free the Object instance's memory (aka deallocate the memory it's pointing to). And so the compiler generates the code for the destructor doing this inside main.cpp. Now, keep in mind, the Object forward declaration is not a complete type. All it does is tell the compiler "a type named Object exists" and allows us to use the name in certain situations to avoid a header dependency. So the compiler needs to generate destruction code for Object, but the compiler doesn't know *how* to destruct it. A forward declaration doesn't tell the compiler anything about Object's constructor or destructor. So, the compiler will issue an error in this case because it's undefined behavior to try and deallocate (or construct) an incomplete type and std::shared_ptr and std::unique_ptr make sure this isn't the case internally. Now, if we had defaulted the destructor in "thing.cpp", where we also include "object.h", this would never be an issue, as the destructor would only have its code generated in one place, and it would be in a place where the full class definition of Object would be visible to the compiler. ---------------------- End example ---------------------------- Given these service classes are more than certainly going to change in the future, this defaults the constructors and destructors into the relevant cpp files to make the construction and destruction of all of the services consistent and unlikely to run into cases where forward declarations are indirectly causing compilation errors. It also has the plus of avoiding the need to rebuild several services if destruction logic changes, since it would only be necessary to recompile the single cpp file.
* | | externals: Place font data within cpp filesLioncash2018-09-111-6/+6
|/ / | | | | | | | | | | | | | | | | | | | | | | | | | | | | This places the font data within cpp files, which mitigates the possibility of the font data being duplicated within the binary if it's referred to in more than one translation unit in the future. It also stores the data within a std::array, which is more flexible when it comes to operating with the standard library. Furthermore, it makes the data arrays const. This is what we want, as it allows the compiler to store the data within the read-only segment. As it is, having several large sections of mutable data like this just leaves spots in memory that we can accidentally write to (via accidental overruns, what have you) and actually have it work. This ensures the font data remains the same no matter what.
* | Use open-source shared fonts if no dumped file is available (#1269)Tobias2018-09-112-2/+26
| | | | | | | | | | | | * Add open-source shared fonts * Address review comments
* | video_core: Move command buffer loop.Markus Wick2018-09-102-31/+12
| | | | | | | | This moves the hot loop into video_core. This refactoring shall reduce the CPU overhead of calling ProcessCommandList.
* | Merge pull request #1276 from FearlessTobi/fix-stupid-stubbunnei2018-09-102-4/+6
|\ \ | | | | | | hid: Implement ReloadInputDevices
| * | hid: Implement ReloadInputDevicesfearlessTobi2018-09-092-4/+6
| |/
* / service: Remove unused g_kernel_named_ports variableLioncash2018-09-101-2/+0
|/ | | | | With the named port functionality all migrated over to the kernel, there's no need to keep this around anymore.
* core: Migrate current_process pointer to the kernelLioncash2018-09-074-5/+34
| | | | | | | | | | Given we now have the kernel as a class, it doesn't make sense to keep the current process pointer within the System class, as processes are related to the kernel. This also gets rid of a subtle case where memory wouldn't be freed on core shutdown, as the current_process pointer would never be reset, causing the pointed to contents to continue to live.
* Merge pull request #1250 from lioncash/file-sysbunnei2018-09-074-4/+16
|\ | | | | file_sys/{nca_patch, patch_manager}: Amend unnecessary/missing includes.
| * file_sys/nca_patch: Amend constructor initializer list orderLioncash2018-09-061-2/+2
| | | | | | | | | | | | Orders the elements in the initializer list in the order they're specified in the class. This prevents compiler warnings about initialization order.
| * file_sys/nca_patch: Remove unnecessary includesLioncash2018-09-062-2/+9
| | | | | | | | | | romfs.h doesn't need to be included in the header, the only real dependency here is common's swap.h that needs to be included.
| * file_sys/patch_manager: Add missing includesLioncash2018-09-062-0/+5
| | | | | | | | These includes were previously being satisfied indirectly.
* | core/core: Remove unnecessary sm/controller includeLioncash2018-09-065-2/+5
|/ | | | | | | | | | The only reason this include was necessary, was because the constructor wasn't defaulted in the cpp file and the compiler would inline it wherever it was used. However, given Controller is forward declared, all those inlined constructors would see an incomplete type, causing a compilation failure. So, we just place the constructor in the cpp file, where it can see the complete type definition, allowing us to remove this include.
* Merge pull request #1242 from lioncash/file-sysbunnei2018-09-062-8/+17
|\ | | | | file_sys/submission_package: Replace includes with forward declarations where applicable
| * file_sys/submission_package: Correct constructor initialization list orderLioncash2018-09-051-2/+2
| | | | | | | | | | Orders the elements in the sequence to match the order in which they'll actually be initialized in.
| * file_sys/submission_package: Replace includes with forward declarations where applicableLioncash2018-09-052-6/+15
| |
* | bktr: Fix bucket overlap errorZach Hilman2018-09-047-9/+9
| |
* | drd: Parse title ID from program metadataZach Hilman2018-09-042-4/+29
| |
* | patch_manager: Centralize Control-type NCA parsingZach Hilman2018-09-044-55/+74
| |
* | nsp: Fix error masking issue with XCI filesZach Hilman2018-09-043-6/+13
| | | | | | | | Now display correct error instead of catch-all MissingProgramNCA
* | game_list: Fix version display on non-NAND titlesZach Hilman2018-09-043-8/+33
| |
* | bktr: Add logging on successful patchZach Hilman2018-09-043-7/+24
| |
* | bktr: Implement IVFC offset shiftingZach Hilman2018-09-048-8/+36
| | | | | | | | Fixes base game read errors
* | bktr: Fix missing includes and optimize styleZach Hilman2018-09-0411-101/+107
| |
* | loader: Add BKTR-specific error messages and codesZach Hilman2018-09-043-7/+28
| |
* | loader: Ignore patches on NRO and DRDZach Hilman2018-09-044-0/+11
| |
* | patch_manager: Add usages of patches to ExeFSZach Hilman2018-09-045-9/+41
| |
* | file_sys: Add class to manage game patchesZach Hilman2018-09-042-0/+132
| | | | | | | | Right now only includes Updates, but should eventually contain all of the other patches we need.
* | file_sys: Add BKTR patching mechanismZach Hilman2018-09-042-0/+352
| |
* | content_archive: Add BKTR header parsing to NCAZach Hilman2018-09-042-19/+160
| |
* | registration: Add RegisteredCacheUnionZach Hilman2018-09-044-0/+164
| | | | | | | | Aggregates multiple caches into one interface
* | game_list: Use RegisteredCacheUnion for installedZach Hilman2018-09-041-1/+1
| | | | | | | | Reduces code
* | aes_util: Fix error involving reads of less than 0x10Zach Hilman2018-09-041-0/+14
|/ | | | Issues with block size are fixed by making all reads minimum length of 0x10
* main: Only show DRD deprecation warning onceZach Hilman2018-09-046-3/+6
|
* control_metadata: Use alternate language names if AmericanEnglish isn't availableZach Hilman2018-09-042-4/+17
|
* card_image: Add program title ID getterZach Hilman2018-09-042-0/+6
|
* nsp: Comply with style and performance guidelinesZach Hilman2018-09-047-29/+48
|
* qt: Add UI support for NSP filesZach Hilman2018-09-041-0/+4
|
* registration: Add support for installing NSP filesZach Hilman2018-09-042-10/+16
|
* loader: Add AppLoader for NSP filesZach Hilman2018-09-042-0/+182
|
* card_image: Parse XCI secure partition with NSPZach Hilman2018-09-044-11/+38
| | | | Eliminated duplicate code and adds support for Rev1+ carts
* file_sys: Add Nintendo Submission Package (NSP)Zach Hilman2018-09-042-0/+296
|
* drd: Load title ID from program metadataZach Hilman2018-09-041-3/+1
| | | | Previously only loaded from control metadata
* loader: Add NSP file type and NSP-specific errorsZach Hilman2018-09-042-2/+14
|
* key_manager: Avoid autogeneration if key existsZach Hilman2018-09-041-3/+13
|
* Merge pull request #1237 from degasus/optimizationsbunnei2018-09-042-3/+3
|\ | | | | Optimizations
| * core: Use a raw pointer in GetGPUDebugContext.Markus Wick2018-09-042-3/+3
| | | | | | | | This helper is called very often. The memory ownership shall not be transfered, so just return the raw pointer.
* | Merge pull request #1223 from DarkLordZach/custom-nand-sd-dirsbunnei2018-09-041-0/+2
|\ \ | | | | | | file_sys: Allow for custom NAND/SD directories
| * | settings: Save and load NAND/SD dirs from configZach Hilman2018-09-041-0/+2
| | |
* | | Merge pull request #1235 from lioncash/forward-declbunnei2018-09-0420-26/+62
|\ \ \ | | | | | | | | file_sys: Replace includes with forward declarations where applicable
| * | | file_sys: Replace includes with forward declarations where applicableLioncash2018-09-0420-26/+62
| | |/ | |/| | | | | | | | | | Cuts down on include dependencies, resulting in less files that need to be rebuilt when certain things are changed.
* | | Merge pull request #1236 from degasus/microprofilebunnei2018-09-042-2/+6
|\ \ \ | | | | | | | | Update microprofile scopes.
| * | | Update microprofile scopes.Markus Wick2018-09-042-2/+6
| |/ / | | | | | | | | | | | | | | | Blame the subsystems which deserve the blame :) The updated list is not complete, just the ones I've spotted on random sampling the stack trace.
* | | Merge pull request #1230 from lioncash/sslbunnei2018-09-042-37/+39
|\ \ \ | |/ / |/| | ssl: Move SSL class to cpp file
| * | ssl: Move SSL class to cpp fileLioncash2018-09-022-37/+39
| | | | | | | | | | | | | | | | | | This isn't required to be visible to anything outside of the main source file, and will eliminate needing to rebuild anything else including the header if the SSL class needs to be changed in the future.
* | | Merge pull request #1231 from lioncash/globalbunnei2018-09-045-19/+51
|\ \ \ | | | | | | | | service: Migrate global named port map to the KernelCore class
| * | | service: Migrate global named port map to the KernelCore classLioncash2018-09-025-19/+51
| | |/ | |/| | | | | | | | | | | | | Now that we have a class representing the kernel in some capacity, we now have a place to put the named port map, so we move it over and get rid of another piece of global state within the core.
* / | vfs_real: Forward declare IOFileLioncash2018-09-027-14/+31
|/ / | | | | | | | | | | Eliminates the need to rebuild some source files if the file_util header ever changes. This also uncovered some indirect inclusions, which have also been fixed.
* | Merge pull request #1213 from DarkLordZach/octopath-fsbunnei2018-09-022-2/+30
|\ \ | | | | | | filesystem/maxwell_3d: Various changes to boot Project Octopath Traveller
| * | filesystem: Implement OpenReadOnlySaveDataFilesystemZach Hilman2018-09-012-1/+7
| | |
| * | filesystem: Add OpenFileSystemWithPatchZach Hilman2018-09-012-1/+23
| |/
* / filesystem: Move dir retrieval after path checking in DeleteFile()Lioncash2018-09-021-2/+5
|/ | | | | We don't need to do the lookup if the path is considered empty currently.
* core/core: Replace includes with forward declarations where applicableLioncash2018-08-3118-43/+85
| | | | | | | | | | | The follow-up to e2457418dae19b889b2ad85255bb95d4cd0e4bff, which replaces most of the includes in the core header with forward declarations. This makes it so that if any of the headers the core header was previously including change, then no one will need to rebuild the bulk of the core, due to core.h being quite a prevalent inclusion. This should make turnaround for changes much faster for developers.
* gl_renderer: Cache textures, framebuffers, and shaders based on CPU address.bunnei2018-08-313-38/+17
|
* core: Make the main System class use the PImpl idiomLioncash2018-08-314-276/+383
| | | | | | | | | | | | | core.h is kind of a massive header in terms what it includes within itself. It includes VFS utilities, kernel headers, file_sys header, ARM-related headers, etc. This means that changing anything in the headers included by core.h essentially requires you to rebuild almost all of core. Instead, we can modify the System class to use the PImpl idiom, which allows us to move all of those headers to the cpp file and forward declare the bulk of the types that would otherwise be included, reducing compile times. This change specifically only performs the PImpl portion.
* kernel: Eliminate kernel global stateLioncash2018-08-2951-440/+665
| | | | | | | | | | | | | | | | | | | | | | As means to pave the way for getting rid of global state within core, This eliminates kernel global state by removing all globals. Instead this introduces a KernelCore class which acts as a kernel instance. This instance lives in the System class, which keeps its lifetime contained to the lifetime of the System class. This also forces the kernel types to actually interact with the main kernel instance itself instead of having transient kernel state placed all over several translation units, keeping everything together. It also has a nice consequence of making dependencies much more explicit. This also makes our initialization a tad bit more correct. Previously we were creating a kernel process before the actual kernel was initialized, which doesn't really make much sense. The KernelCore class itself follows the PImpl idiom, which allows keeping all the implementation details sealed away from everything else, which forces the use of the exposed API and allows us to avoid any unnecessary inclusions within the main kernel header.
* Merge pull request #1193 from lioncash/privbunnei2018-08-282-8/+8
|\ | | | | gpu: Make memory_manager private
| * gpu: Make memory_manager privateLioncash2018-08-282-8/+8
| | | | | | | | | | | | | | | | | | | | Makes the class interface consistent and provides accessors for obtaining a reference to the memory manager instance. Given we also return references, this makes our more flimsy uses of const apparent, given const doesn't propagate through pointers in the way one would typically expect. This makes our mutable state more apparent in some places.
* | hle/result: Make ResultVal's move constructor as noexceptLioncash2018-08-281-1/+1
|/ | | | | | | | | | | | | | | | | | | | | | | Many containers within the standard library provide different behaviors based on whether or not a move constructor/assignment operator can be guaranteed not to throw or not. Notably, implementations will generally use std::move_if_noexcept (or an internal implementation of it) to provide strong exception guarantees. If a move constructor potentially throws (in other words, is not noexcept), then certain behaviors will create copies, rather than moving the values. For example, consider std::vector. When a std::vector calls resize(), there are two ways the elements can be relocated to the new block of memory (if a reallocation happens), by copy, or by moving the existing elements into the new block of memory. If a type does not have a guarantee that it will not throw in the move constructor, a copy will happen. However, if it can be guaranteed that the move constructor won't throw, then the elements will be moved. This just allows ResultVal to be moved instead of copied all the time if ever used in conjunction with containers for whatever reason.
* Merge pull request #1177 from lioncash/errbunnei2018-08-284-12/+15
|\ | | | | kernel/error: Amend several error codes
| * kernel/error: Amend error code for ERR_MAX_CONNECTIONS_REACHEDLioncash2018-08-251-2/+4
| | | | | | | | | | | | We can make this error code an alias of the resource limit exceeded error code, allowing us to get rid of the lingering 3DS error code of the same type.
| * kernel/error: Amend error code for ERR_PORT_NAME_TOO_LONGLioncash2018-08-251-2/+1
| | | | | | | | | | We can treat this as an alias of TooLarge for documentation purposes. This also lets us get rid of another lingering 3DS-related error code.
| * kernel/error: Add error code for the handle table being fullLioncash2018-08-253-4/+4
| | | | | | | | | | This replaces the lingering 3DS constant with the proper one, and utilizes it within HandleTable's Create() member function.
| * kernel/error: Add error code for invalid memory permissionsLioncash2018-08-252-3/+4
| |
| * kernel/error: Correct kernel error code for invalid combinationLioncash2018-08-251-1/+2
| |
* | Merge pull request #1188 from lioncash/unusedbunnei2018-08-281-1/+0
|\ \ | | | | | | vfs_real: Remove unused variable in CreateDirectoryRelative()
| * | vfs_real: Remove unused variable in CreateDirectoryRelative()Lioncash2018-08-271-1/+0
| |/
* | Merge pull request #1175 from lioncash/nsbunnei2018-08-2813-12/+42
|\ \ | | | | | | core: Namespace all code in the arm subdirectory under the Core namespace
| * | core: Namespace all code in the arm subdirectory under the Core namespaceLioncash2018-08-2513-12/+42
| | | | | | | | | | | | Gets all of these types and interfaces out of the global namespace.
* | | Merge pull request #1187 from lioncash/shadowbunnei2018-08-281-3/+3
|\ \ \ | | | | | | | | registered_cache: Get rid of variable shadowing in ProcessFiles()
| * | | registered_cache: Get rid of variable shadowing in ProcessFiles()Lioncash2018-08-271-3/+3
| | |/ | |/| | | | | | | Prevents compiler warnings.
* | | Merge pull request #1176 from lioncash/infobunnei2018-08-271-2/+1
|\ \ \ | | | | | | | | svc: Return process title ID if queried in GetInfo()
| * | | svc: Return process title ID if queried in GetInfo()Lioncash2018-08-251-2/+1
| | | | | | | | | | | | | | | | | | | | | | | | We already have the variable itself set up to perform this task, so we can just return its value from the currently executing process instead of always stubbing it to zero.
* | | | Merge pull request #1174 from lioncash/debugbunnei2018-08-271-0/+1
|\ \ \ \ | | | | | | | | | | debug_utils: Minor individual interface changes
| * | | | debug_utils: Remove unused includesLioncash2018-08-251-0/+1
| | |_|/ | |/| | | | | | | | | | | | | | Quite a bit of these aren't necessary directly within the debug_utils header and can be removed or included where actually necessary.
* | | | Merge pull request #1162 from ogniK5377/ttf-plubunnei2018-08-271-5/+51
|\ \ \ \ | | | | | | | | | | PL:U Added SharedFonts loading via TTF
| * | | | Addressed plu TTF changesDavid Marcec2018-08-231-6/+7
| | | | |
| * | | | Added SharedFonts loading via TTFDavid Marcec2018-08-231-5/+50
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | By having the following TTF files in your yuzu sysdata directory. You can load sharedfonts via TTF files. FontStandard.ttf FontChineseSimplified.ttf FontExtendedChineseSimplified.ttf FontChineseTraditional.ttf FontKorean.ttf FontNintendoExtended.ttf FontNintendoExtended2.ttf
* | | | | Merge pull request #1168 from lioncash/headerbunnei2018-08-272-1/+4
|\ \ \ \ \ | | | | | | | | | | | | hid: Move core include to cpp file
| * | | | | hid: Move core include to cpp fileLioncash2018-08-242-1/+4
| | |/ / / | |/| | | | | | | | | | | | | | | | | | This isn't required to be in the header. Instead, directly include what this header needs and move it to the cpp file where it belongs.
* | | | | Merge pull request #1171 from lioncash/truebunnei2018-08-271-7/+4
|\ \ \ \ \ | | | | | | | | | | | | core: Remove always true conditionals in Load()
| * | | | | core: Remove always true conditionals in Load()Lioncash2018-08-241-7/+4
| |/ / / / | | | | | | | | | | | | | | | | | | | | These conditions are always true, since the outer conditional already checks for these conditions.
* | | | / set: Fixed GetAvailableLanguageCodes() to follow the max_entriestech4me2018-08-262-8/+45
| |_|_|/ |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Rightnow, in games use GetAvailableLanguageCodes(), there is a WriteBuffer() with size larger than the buffer_size. (Core Critical core\hle\kernel\hle_ipc.cpp:WriteBuffer:296: size (0000000000000088) is greater than buffer_size (0000000000000078)) 0x88 = 17(languages) * 8 0x78 = 15(languages) * 8 GetAvailableLanguageCodes() can only support 15 languages. After firmware 4.0.0 there are 17 supported language instead of 15, to enable this GetAvailableLanguageCodes2() need to be used. So GetAvailableLanguageCodes() will be caped at 15 languages. Reference: http://switchbrew.org/index.php/Settings_services
* | | | Merge pull request #1166 from lioncash/typoSebastian Valle2018-08-251-1/+1
|\ \ \ \ | |_|_|/ |/| | | filesystem: Fix typo in log message
| * | | filesystem: Fix typo in log messageLioncash2018-08-241-1/+1
| |/ /
* | | Merge pull request #1094 from DarkLordZach/nax0Mat M2018-08-2527-81/+806
|\ \ \ | | | | | | | | file_sys: Add support for NAX archives
| * | | file_sys/crypto: Fix missing/unnecessary includesZach Hilman2018-08-259-5/+10
| | | |
| * | | xci: Ignore NCA files with updates in secureZach Hilman2018-08-241-0/+3
| | | |
| * | | content_archive: Add update title detectionZach Hilman2018-08-242-0/+11
| | | | | | | | | | | | | | | | This is needed because the title IDs of update NCAs will not use the update title ID. The only sure way to tell is to look for a partition with BKTR crypto.
| * | | key_manager: Eliminate indexed for loopZach Hilman2018-08-231-6/+13
| | | |
| * | | key_manager: Create keys dir if it dosen't existZach Hilman2018-08-232-0/+2
| | | | | | | | | | | | | | | | On call to WriteKeyToFile, so that the autogenerated file can be written.
| * | | file_sys: Cut down on includes and copiesZach Hilman2018-08-237-19/+30
| | | |
| * | | crypto: Eliminate magic constantsZach Hilman2018-08-234-32/+38
| | | |
| * | | key_manager: Add support for autogenerated keysZach Hilman2018-08-232-3/+45
| | | | | | | | | | | | | | | | Stored in a separate file than manual keys.
| * | | key_manager: Add support for KEK and SD seed derivationZach Hilman2018-08-232-5/+135
| | | |
| * | | key_manager: Switch to boost flat_map for keysZach Hilman2018-08-232-32/+14
| | | | | | | | | | | | | | | | Should make key gets marginally faster.
| * | | file_sys: Implement NAX containersZach Hilman2018-08-233-0/+238
| | | |
| * | | registration: Add GetEntryUnparsed methodsZach Hilman2018-08-232-0/+15
| | | | | | | | | | | | | | | | Returns the file before calling parser on it.
| * | | sdmc_factory: Add SDMC RegisteredCache getterZach Hilman2018-08-232-1/+14
| | | |
| * | | vfs: Add GetOrCreateDirectoryRelative methodZach Hilman2018-08-233-9/+13
| | | |
| * | | filesystem: Add CreateFactories methods to fsZach Hilman2018-08-232-8/+11
| | | | | | | | | | | | | | | | Allows frontend to create registration caches for use before a game has booted.
| * | | filesystem: Add logging to registration gettersZach Hilman2018-08-231-4/+25
| | | |
| * | | loader: Add new NAX-specific errors and messagesZach Hilman2018-08-232-1/+27
| | | |
| * | | nax: Add AppLoader_NAX and update loader to support itZach Hilman2018-08-234-2/+121
| | | |
| * | | xts_encryption_layer: Implement XTSEncryptionLayerZach Hilman2018-08-233-1/+81
| | | |
| * | | aes_util: Make XTSTranscode stricter about sizesZach Hilman2018-08-231-5/+2
| | | | | | | | | | | | | | | | XTS with Nintendo Tweak will fail mysteriously if the sector size is not 0x4000. Upgrade the critical log to an assert to prevent undefined behavior.
| * | | ctr_encryption_layer: Fix bug when transcoding small dataZach Hilman2018-08-231-5/+3
| | | | | | | | | | | | | | | | Fixes a bug where data lengths of less than size 0x10 will fail or have misleading return values.
| * | | xci: Fix error masking issueZach Hilman2018-08-233-5/+17
| | |/ | |/| | | | | | | Prevents NCA-related errors from being masked into MissingProgramNCA or MissingKeyFile
* | | Merge pull request #1065 from DarkLordZach/window-titleZach Hilman2018-08-241-0/+7
|\ \ \ | |_|/ |/| | qt: Add filename and title id to window title while running
| * | qt: Add filename and title id to window title while runningZach Hilman2018-08-231-0/+7
| |/
* / Added GetBootMode (#1107)David2018-08-244-3/+25
|/ | | | | | | | * Added GetBootMode Used by homebrew * Added enum for GetBootMode
* Merge pull request #1136 from tech4me/masterbunnei2018-08-222-4/+4
|\ | | | | qt/main: Port part of citra(#3411), open savedata works
| * qt/main: Port part of citra(#3411), open savedata workstech4me2018-08-212-4/+4
| |
* | Merge pull request #840 from FearlessTobi/port-3353bunnei2018-08-223-7/+18
|\ \ | | | | | | Port #3353 from Citra: "citra-qt: Add customizable speed limit target "
| * | Port #3353 from CitrafearlessTobi2018-08-213-7/+18
| | |
* | | Added missing include for pl:uDavid Marcec2018-08-221-0/+1
| | | | | | | | | | | | Should fix any compile errors
* | | PL:U Added BFTTF loading(Loading from System NAND dumps) (#1088)David2018-08-221-25/+140
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * Added bfttf loading We can now load system bfttf fonts from system archives AND shared memory dumps. This allows people who have installed their system nand dumps to yuzu to automatically get shared font support. We also now don't hard code the offsets or the sizes of the shared fonts and it's all calculated for us now. * Addressed plu fixups * Style changes for plu * Fixed logic error for plu and added more error checks.
* | | Merge pull request #1145 from lioncash/fwd-declbunnei2018-08-225-4/+7
|\ \ \ | | | | | | | | vfs: Replace mode.h include with forward declarations where applicable
| * | | vfs: Replace mode.h include with forward declarations where applicableLioncash2018-08-215-4/+7
| | | | | | | | | | | | | | | | | | | | Avoids the need to rebuild these source files if the mode header changes.
* | | | am: Utilize std::array within PopLaunchParameter()Lioncash2018-08-211-3/+4
|/ / / | | | | | | | | | | | | | | | Gets rid of the potential for C array-to-pointer decay, and also makes pointer arithmetic to get the end of the copy range unnecessary. We can just use std::array's begin() and end() member functions.
* | | Merge pull request #1143 from lioncash/incbunnei2018-08-212-1/+1
|\ \ \ | | | | | | | | sdmc_factory: Remove unnecessary core include
| * | | sdmc_factory: Remove unnecessary core includeLioncash2018-08-212-1/+1
| | |/ | |/| | | | | | | | | | This doesn't require the central core header to be included, it just needs the vfs headers.
* / | perf_stats: Change MAX_LAG_TIME_US to an appropriate valueMerryMage2018-08-211-1/+1
|/ / | | | | | | | | | | | | | | | | | | 25us is far too small, and would result in std::this_thread::sleep_for being called with this as a maximum value. This means that a guest application that produces frames instantly would only be limited to 40 kHz. 25ms is a more appropriate value, as it allows for a 60 Hz refresh rate while providing enough slack in the negative region.
* | Merge pull request #1129 from lioncash/headerbunnei2018-08-218-8/+34
|\ \ | | | | | | romfs_factory, service/filesystem: Use forward declarations where applicable
| * | service/filesystem: Use forward declarations where applicableLioncash2018-08-216-5/+22
| | | | | | | | | | | | | | | | | | | | | | | | Avoids the need to rebuild multiple source files if the filesystem code headers change. This also gets rid of a few instances of indirect inclusions being relied upon
| * | romfs_factory: Remove unnecessary includes and use forward declarations where applicableLioncash2018-08-213-3/+12
| | | | | | | | | | | | | | | | | | Avoids the need to rebuild whatever includes the romfs factory header if the loader header ever changes. We also don't need to include the main core header. We can instead include the headers we specifically need.
* | | Merge pull request #1126 from lioncash/telembunnei2018-08-211-4/+4
|\ \ \ | | | | | | | | telemetry_session: Don't allocate std::string instances for program lifetime in GetTelemetryId() and RegenerateTelemetryId()
| * | | telemetry_session: Don't allocate std::string instances for program lifetime in GetTelemetryId() and RegenerateTelemetryId()Lioncash2018-08-211-4/+4
| | | | | | | | | | | | | | | | | | | | | | | | Given these functions aren't intended to be used frequently, there's no need to keep the std::string instances allocated for the whole lifetime of the program. It's just a waste of memory.
* | | | Merge pull request #1122 from lioncash/accbunnei2018-08-214-57/+61
|\ \ \ \ | |_|/ / |/| | | acc/profile_manager: General cleanup
| * | | acc: Replace profile_manager include with a forward declarationLioncash2018-08-212-2/+6
| | | | | | | | | | | | | | | | This is only used in a shared_ptr, so we can forward declare it.
| * | | acc: Simplify WriteBuffer call within LoadImage()Lioncash2018-08-211-3/+3
| | | | | | | | | | | | | | | | | | | | | | | | We have an overload of WriteBuffer that accepts containers that satisfy the ContiguousContainer concept, which std::array does, so we only need to pass in the array itself.
| * | | acc: Correct IProfile's constructor initializer list orderLioncash2018-08-211-1/+1
| | | | | | | | | | | | | | | | Arranges them in the order the members would be initialized
| * | | acc: Remove unused DEFAULT_USER_IDLioncash2018-08-211-3/+0
| | | | | | | | | | | | | | | | This is no longer used, so it can be removed.
| * | | profile_manager: Use INVALID_UUID in the initializer of last_opened_userLioncash2018-08-211-1/+1
| | | | | | | | | | | | | | | | Makes it a little bit more self-documenting.
| * | | profile_manager: Remove unnecessary memcpy in GetProfileBaseAndData()Lioncash2018-08-211-1/+1
| | | | | | | | | | | | | | | | | | | | Given the source and destination types are the same std::array type, we can simply use regular assignment to perform the same behavior.
| * | | profile_manager: Use type aliases for username data, profile data, and user arraysLioncash2018-08-212-19/+22
| | | | | | | | | | | | | | | | | | | | Avoids the need to repeatedly specify the whole array type in multiple places.
| * | | profile_manager: Take ProfileInfo by const reference where applicableLioncash2018-08-212-8/+8
| | | | | | | | | | | | | | | | | | | | | | | | ProfileInfo is quite a large struct in terms of data, and we don't need to perform a copy in these instances, so we can just pass constant references instead.
| * | | profile_manager: Make array parameter to CreateNewUser a const referenceLioncash2018-08-212-2/+2
| | | | | | | | | | | | | | | | | | | | This doesn't modify the passed in array, so this can be a const reference.
| * | | profile_manager: Remove unnecessary staticLioncash2018-08-211-1/+1
| | | | | | | | | | | | | | | | This can just be constexpr like the others
| * | | profile_manager: Simplify UUID's two param constructor, operator==, and operator boolLioncash2018-08-211-6/+4
| | | | | | | | | | | | | | | | | | | | | | | | We can use the constructor initializer list and just compare the contained u128's together instead of comparing each element individually. Ditto for comparing against an invalid UUID.
| * | | profile_manager: Move UUID generation function to the cpp fileLioncash2018-08-212-10/+12
| | | | | | | | | | | | | | | | | | | | This avoids needing to dump the contents of <random> into other files that include the profile manager header.
| * | | profile_manager: Remove unnecessary std::move in AddToProfiles() and CreateNewUser()Lioncash2018-08-201-2/+2
| | |/ | |/| | | | | | | | | | | | | Moving a const reference isn't possible, so this just results in a copy (and given ProfileInfo is composed of trivial types and aggregates, a move wouldn't really do anything).
* | | Merge pull request #1095 from DarkLordZach/sysarchivesbunnei2018-08-218-20/+100
|\ \ \ | |_|/ |/| | filesystem: Add support for loading of system archives
| * | registration: Add Data_Unknown5 NCAContentTypeZach Hilman2018-08-203-2/+3
| | |
| * | filesystem: Add support for loading of system archivesZach Hilman2018-08-197-20/+99
| | |
* | | Merge pull request #1064 from lioncash/telemetrybunnei2018-08-211-62/+7
|\ \ \ | |_|/ |/| | common/telemetry: Migrate core-independent info gathering to common
| * | common/telemetry: Migrate core-independent info gathering to commonLioncash2018-08-151-62/+7
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Previously core itself was the library containing the code to gather common information (build info, CPU info, and OS info), however all of this isn't core-dependent and can be moved to the common code and use the common interfaces. We can then just call those functions from the core instead. This will allow replacing our CPU detection with Xbyak's which has better detection facilities than ours. It also keeps more architecture-dependent code in common instead of core.
* | | Merge pull request #1117 from ogniK5377/CheckFreeCommunicationPermissionbunnei2018-08-201-1/+8
|\ \ \ | | | | | | | | Added CheckFreeCommunicationPermission
| * | | Added CheckFreeCommunicationPermissionDavid Marcec2018-08-201-1/+8
| | |/ | |/| | | | | | | This fixes save files not loading in splatoon 2
* | | Merge pull request #1017 from ogniK5377/better-accountbunnei2018-08-2013-74/+440
|\ \ \ | |/ / |/| | New account backend to allow for future extended support
| * | Better UUID randomnessDavid Marcec2018-08-111-2/+7
| | |
| * | Removed un-needed count from ListOpenUsers and ListAllUsersDavid Marcec2018-08-111-4/+2
| | |
| * | Added better explanations in the profile managerDavid Marcec2018-08-112-1/+34
| | |
| * | Code cleanup for profile managerDavid Marcec2018-08-113-40/+47
| | |
| * | Removed const from ProfileBase InvalidateDavid Marcec2018-08-111-1/+1
| | |
| * | fixed invalid uuid bool operatorDavid Marcec2018-08-111-1/+1
| | |
| * | Added GetOpenUserCountDavid Marcec2018-08-113-3/+14
| | |
| * | Removed all for loops from the profile managerDavid Marcec2018-08-111-9/+4
| | |
| * | Added missing ListAllUsers countDavid Marcec2018-08-111-1/+2
| | |
| * | If statement style changeDavid Marcec2018-08-111-11/+19
| | |
| * | Second round of account changesDavid Marcec2018-08-113-18/+21
| | |
| * | First round of account changesDavid Marcec2018-08-113-49/+55
| | |
| * | Refactored profile manager sharingDavid Marcec2018-08-1110-20/+28
| | |
| * | Merge remote-tracking branch 'origin/master' into better-accountDavid Marcec2018-08-1137-148/+758
| |\ \
| * | | Added IsUserRegistrationRequestPermittedDavid Marcec2018-08-117-3/+19
| | | |
| * | | Don't add user if the uuid already existsDavid Marcec2018-08-091-0/+4
| | | |
| * | | Open first user addedDavid Marcec2018-08-081-1/+3
| | | |
| * | | Inital pass of account backend implementationDavid Marcec2018-08-083-12/+22
| | | | | | | | | | | | | | | | This commit verified working on puyo
| * | | GetProfileBase and GetProfileBaseAndData addedDavid Marcec2018-08-083-44/+106
| | | |
| * | | began initial implementation of "ProfileManager"David Marcec2018-08-085-44/+202
| | | |
| * | | Switched uuids from u128 to new UUID structDavid Marcec2018-08-082-10/+49
| | | |
* | | | Implement SetIdleTimeDetectionExtension & GetIdleTimeDetectionExtension (#1059)greggameplayer2018-08-172-2/+22
| | | | | | | | | | | | * Used by Mario Tennis Aces
* | | | Merge pull request #1090 from lioncash/ctor-assignbunnei2018-08-171-0/+6
|\ \ \ \ | | | | | | | | | | core: Delete System copy/move constructors and assignment operators
| * | | | core: Delete System copy/move constructors and assignment operatorsLioncash2018-08-161-0/+6
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Prevents potentially making copies or doing silly things by accident with the System instance, particularly given our current core is designed (unfortunately) around one instantiable instance. This will prevent the accidental case of: auto instance = System::Instance(); being compiled without warning when it's supposed to be: auto& instance = System::Instance();
* | | | | Merge pull request #1093 from greggameplayer/GetDefaultDisplayResolutionChangeEventbunnei2018-08-172-1/+13
|\ \ \ \ \ | | | | | | | | | | | | Implement GetDefaultDisplayResolutionChangeEvent
| * | | | | correct coding stylegreggameplayer2018-08-161-1/+1
| | | | | |
| * | | | | Implement GetDefaultDisplayResolutionChangeEventgreggameplayer2018-08-162-1/+13
| | | | | | | | | | | | | | | | | | | | | | | | Require by Toki Tori and Toki Tori 2+
* | | | | | Merge pull request #1087 from MerryMage/dynarmicbunnei2018-08-171-0/+3
|\ \ \ \ \ \ | |/ / / / / |/| | | | | dynarmic: Update to 550d662
| * | | | | dynarmic: Update to 550d662MerryMage2018-08-161-0/+3
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | 550d662 load_store_exclusive: Define s == t state to be Constraint_NONE 0b69381 A64/translate: Allow for unpredictable behaviour to be defined 6d236d4 system: Implement MRS CNTFRQ_EL0 6cbb6fb A32/testenv: Add missing headers 6729328 externals: Update xbyak to v5.67 1812bd2 Squashed 'externals/xbyak/' changes from 2794cde7..671fc805 9a95802 externals: Document subtrees 714a840 A64: Implement SQ{ADD, SUB}, and UQ{ADD, SUB}'s vector variants 8cab459 A64: Implement UQADD/UQSUB's scalar variants 18a8151 ir: Add opcodes for unsigned saturating add and subtract a5660ee x64/reg_alloc: Use type alias for array returned by GetArgumentInfo() 29489b5 ir/value: Use type alias CoprocessorInfo for std::array<u8, 8> e23ba26 status_register_access: Add support for bits 0 and 1 of mask to MSR 55190bd fuzz_with_unicorn: Split utility functions into fuzz_util 23b049d A32/translate/load_store: Correct detection of writeback 7ec9f15 A32/translate: Add TranslateSingleInstruction efeecb4 A32/ir_emitter: Bug fix: IREmitter::ExceptionRaised using incorrect opcode 08d1d19 A32/decoders: Split instruction list into include file 2d929cc tests: Refactor unicorn_emu to allow for A32 unicorn f672368 microinstruction: Improve assert messages 7ebff50 emit_x64_vector: EmitVectorNarrow16: AVX512 implementation edce230 emit_x64_vector: EmitVectorNarrow32: prefer pblendw to loading constant
* | | | | | Merge pull request #1085 from lioncash/namespacebunnei2018-08-162-12/+14
|\ \ \ \ \ \ | |/ / / / / |/| | | | | common: Namespace hex_util.h/.cpp
| * | | | | common: Namespace hex_util.h/.cppLioncash2018-08-162-12/+14
| |/ / / / | | | | | | | | | | | | | | | | | | | | It's in the common code, so it should be under the Common namespace like everything else.
* | | | | Merge pull request #1075 from lioncash/includebunnei2018-08-164-35/+22
|\ \ \ \ \ | |/ / / / |/| | | | loader/{nca, xci}: Remove unnecessary includes and unused member variables
| * | | | loader/nca: Remove unnecessary includes and member variablesLioncash2018-08-152-20/+11
| | | | |
| * | | | loader/xci: Remove unnecessary includes and member variablesLioncash2018-08-152-15/+11
| | |_|/ | |/| | | | | | | | | | | | | | | | | | | | | | | | | | Many of these aren't necessary and will cause this file to be required to be recompiled whenever any changes to those files are made, which lengthens compile times for no reason. This also removes an unused metadata variable from AppLoader_XCI
* | | | Merge pull request #1005 from DarkLordZach/registered-fmtbunnei2018-08-1624-58/+1135
|\ \ \ \ | | | | | | | | | | file_sys: Add support for registration format
| * | | | registration: Various style and documentation improvementsZach Hilman2018-08-123-18/+22
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Fix logic in RealVfsFilesystem Create methods Remove magic numbers Fix regex errors
| * | | | registration: Add support for force overwrite of installedZach Hilman2018-08-122-22/+48
| | | | |
| * | | | vfs_real: Add CreateFullPath to Create* operationsZach Hilman2018-08-122-13/+6
| | | | |
| * | | | control_metadata: Remove unnecessary reference to base fileZach Hilman2018-08-122-2/+1
| | | | |
| * | | | romfs: Remove cyclic shared_ptr leak in romfs codeZach Hilman2018-08-123-8/+8
| | | | |
| * | | | registration: Update documentation and styleZach Hilman2018-08-125-42/+69
| | | | |
| * | | | nca_metadata: Remove unnecessary reference to base fileZach Hilman2018-08-122-3/+2
| | | | |
| * | | | bis_factory: Create NAND dirs if they don't existZach Hilman2018-08-121-2/+9
| | | | |
| * | | | registration: Take RawCopy function as parameterZach Hilman2018-08-122-10/+15
| | | | | | | | | | | | | | | | | | | | Instead of defaulting to VfsRawCopy
| * | | | registered_cache: Fix missing reading from yuzu_metaZach Hilman2018-08-121-7/+16
| | | | |
| * | | | file_sys: Comply to style guidelinesZach Hilman2018-08-126-27/+38
| | | | |
| * | | | qt: Add 'Install to NAND' option to menuZach Hilman2018-08-122-1/+2
| | | | | | | | | | | | | | | | | | | | Prompts for title type on NCA files.
| * | | | file_sys: Add RegisteredCacheZach Hilman2018-08-122-0/+543
| | | | | | | | | | | | | | | | | | | | Manages NAND NCA get and install.
| * | | | file_sys: Add support for parsing NCA metadata (CNMT)Zach Hilman2018-08-123-0/+238
| | | | |
| * | | | card_image: Add accessor for all NCAs in XCIZach Hilman2018-08-122-0/+5
| | | | |
| * | | | vfs_real: Add CreateFullPath to CreateFileZach Hilman2018-08-121-3/+6
| | | | | | | | | | | | | | | | | | | | Fixes bugs with calling CreateFile when the immediate directory does not exist.
| * | | | filesystem: Add Open and Register functions for BISFactoryZach Hilman2018-08-122-4/+23
| | | | |
| * | | | bis_factory: Add partial implementation of BISFactoryZach Hilman2018-08-122-0/+54
| | | | | | | | | | | | | | | | | | | | Creates and stores RegisteredCaches for user and system NAND, as creation of a RegisteredCache is expensive.
| * | | | loader: Join 0* files in directory if filename is 00Zach Hilman2018-08-121-1/+33
| | | | | | | | | | | | | | | | | | | | i.e. Load the concatenated 00+01 if 01 exists as well. Needed for split NAND NCAs.
| * | | | loader: Recognize filename '00' as NCAZach Hilman2018-08-121-0/+2
| | | | | | | | | | | | | | | | | | | | Needed to avoid mismatch filetype warnings on split NAND NCAs
| * | | | vfs: Add ConcatenatedVfsFileZach Hilman2018-08-122-0/+134
| | | | |
| * | | | crypto: Remove hex utilities from key_managerZach Hilman2018-08-122-36/+2
| | | | | | | | | | | | | | | | | | | | Move to hex_util.h in common
* | | | | Merge pull request #1078 from lioncash/messagebunnei2018-08-161-2/+20
|\ \ \ \ \ | | | | | | | | | | | | lm: Handle threads and modules within the logger
| * | | | | lm: Use LOG_DEBUG for printing out trace logsLioncash2018-08-151-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Using LOG_TRACE here isn't a good idea because LOG_TRACE is only enabled when yuzu is compiled in debug mode. Debug mode is also quite slow, and so we're potentially throwing away logging messages that can provide value when trying to boot games.
| * | | | | lm: Handle threads and modules within the loggerLioncash2018-08-151-1/+19
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The thread field serves to indicate which thread a log is related to and provides the length of the thread's name, so we can print that out, ditto for modules. Now we can know what threads are potentially spawning off logging messages (for example Lydie & Suelle bounces between MainThread and LoadingThread when initializing the game).
* | | | | | Merge pull request #1079 from lioncash/fmtbunnei2018-08-163-12/+11
|\ \ \ \ \ \ | | | | | | | | | | | | | | loader: Make ResultStatus directly compatible with fmt
| * | | | | | loader: Make ResultStatus directly compatible with fmtLioncash2018-08-153-12/+11
| |/ / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | We can make the enum class type compatible with fmt by providing an overload of operator<<. While we're at it, perform proper bounds checking. If something exceeds the array, it should be a hard fail, because it's, without a doubt, a programmer error in this case.
* | | | | | Merge pull request #1051 from B3n30/UnscheduleEventThreadsafebunnei2018-08-163-1/+12
|\ \ \ \ \ \ | | | | | | | | | | | | | | Core::CoreTiming: add UnscheduleEventThreadsafe
| * | | | | | Core::CoreTiming: add UnscheduleEventThreadsafeB3n302018-08-133-1/+12
| | | | | | |
* | | | | | | Merge pull request #1080 from lioncash/retbunnei2018-08-161-1/+1
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | sm/controller: Correct return value of QueryPointerBufferSize
| * | | | | | | sm/controller: Correct return value of QueryPointerBufferSizeLioncash2018-08-151-1/+1
| | |/ / / / / | |/| | | | | | | | | | | | | | | | | | | This should be returning a u16 according to Switch Brew.
* / | | | | | kernel/server_session: Add IsSession() member functionLioncash2018-08-153-3/+8
|/ / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Allows querying the inverse of IsDomain() to make things more readable. This will likely also be usable in the event of implementing ConvertDomainToSession().
* | | | | | Merge pull request #1067 from lioncash/initbunnei2018-08-151-3/+3
|\ \ \ \ \ \ | | | | | | | | | | | | | | emu_window: Ensure WindowConfig members are always initialized
| * | | | | | emu_window: Ensure WindowConfig members are always initializedLioncash2018-08-151-3/+3
| | |_|/ / / | |/| | | | | | | | | | | | | | | | | | | | | | Previously we weren't always initializing all members of the struct. Prevents potentially wonky behavior from occurring.
* | | | | | Merge pull request #1073 from lioncash/3dsbunnei2018-08-156-17/+0
|\ \ \ \ \ \ | | | | | | | | | | | | | | loader: Remove address mapping remnants from citra
| * | | | | | loader: Remove address mapping remnants from citraLioncash2018-08-156-17/+0
| |/ / / / / | | | | | | | | | | | | | | | | | | These mappings are leftovers from citra and don't apply to the Switch.
* | | | | | Merge pull request #1072 from lioncash/svcbunnei2018-08-151-2/+5
|\ \ \ \ \ \ | | | | | | | | | | | | | | kernel/svc: Log svcBreak parameters
| * | | | | | kernel/svc: Log svcBreak parametersLioncash2018-08-151-2/+5
| |/ / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Given if we hit here all is lost, we should probably be logging the break reason code and associated information to distinguish between the causes.
* | | | | | Merge pull request #1056 from lioncash/mmbunnei2018-08-152-46/+52
|\ \ \ \ \ \ | |/ / / / / |/| | | | | mm_u: Move interface class into the cpp file
| * | | | | mm_u: Forward all old variants of functions to the new onesLioncash2018-08-141-5/+11
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Ensures both variants go through the same interface, and while we're at it, add Finalize to provide the inverse of Initialize for consistency.
| * | | | | mm_u: Move implementation class into the cpp fileLioncash2018-08-142-46/+46
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Now if changes are ever made to the behavior of the class, it doesn't involve rebuilding everything that includes the mm_u header.
* | | | | | Merge pull request #1055 from lioncash/initbunnei2018-08-141-1/+1
|\ \ \ \ \ \ | | | | | | | | | | | | | | audout_u: Correct IAudioOut initializer list order
| * | | | | | audout_u: Correct IAudioOut initializer list orderLioncash2018-08-141-1/+1
| |/ / / / / | | | | | | | | | | | | | | | | | | Orders elements in the precise order they'll be initialized.
* | | | | | Merge pull request #1046 from ogniK5377/missing-channelsMat M2018-08-146-0/+148
|\ \ \ \ \ \ | |/ / / / / |/| | | | | Added missing channel devices
| * | | | | Registered missing channel devicesDavid Marcec2018-08-131-0/+4
| | | | | |
| * | | | | Added missing channel devicesDavid Marcec2018-08-135-0/+144
| | | | | |
* | | | | | arm_dynarmic: Remove IsExecuting check from PrepareRescheduleMerryMage2018-08-131-3/+1
| |/ / / / |/| | | | | | | | | | | | | | No longer required. HaltExecution is a no-op if it is not currently executing.
* | | | | Merge pull request #1032 from lioncash/sanitizebunnei2018-08-131-10/+10
|\ \ \ \ \ | | | | | | | | | | | | vfs: Use sanitized paths within MoveFile() and MoveDirectory()
| * | | | | vfs: Use sanitized paths within MoveFile() and MoveDirectory()Lioncash2018-08-121-10/+10
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Previously these were being unused (or partially unused). While we're at it, use better naming to make it visibly obvious which variant of the path is being used.
* | | | | | Merge pull request #1031 from lioncash/verbositybunnei2018-08-132-7/+7
|\ \ \ \ \ \ | | | | | | | | | | | | | | card_image: Simplify return statement of GetSubdirectories()
| * | | | | | card_image: Use type aliases to shorten definitionsLioncash2018-08-122-6/+6
| | | | | | | | | | | | | | | | | | | | | | | | | | | | We have the aliases, so we may as well use 'em.
| * | | | | | card_image: Simplify return statement of GetSubdirectories()Lioncash2018-08-121-1/+1
| |/ / / / / | | | | | | | | | | | | | | | | | | | | | | | | We don't need to write out the construction long-form, we can just let the language itself work it out off the return type.
* | / / / / kernel/object: Tighten object against data racesLioncash2018-08-132-8/+9
| |/ / / / |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Despite being covered by a global mutex, we should still ensure that the class handles its reference counts properly. This avoids potential shenanigans when it comes to data races. Given this is the root object that drives quite a bit of the kernel object hierarchy, ensuring we always have the correct behavior (and no races) is a good thing.
* | | | | Merge pull request #1043 from Subv/timingbunnei2018-08-133-2/+11
|\ \ \ \ \ | | | | | | | | | | | | Use an approximated amortized amount of ticks when advancing timing.
| * | | | | CPU/Timing: Use an approximated amortized amount of ticks when advancing timing.Subv2018-08-132-1/+11
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | We divide the number of ticks to add by the number of cores (4) to obtain a more or less rough estimate of the actual number of ticks added. This assumes that all 4 cores are doing similar work. Previously we were adding ~4 times the number of ticks, thus making the games think that time was going way too fast. This lets us bypass certain hangs in some games like Breath of the Wild. We should modify our CoreTiming to support multiple cores (both running in a single thread, and in multiple host threads).
| * | | | | Kernel/SVC: Don't reschedule the current core when creating a new thread.Subv2018-08-131-1/+0
| |/ / / / | | | | | | | | | | | | | | | The current core may have nothing to do with the core where the new thread was scheduled to run. In case it's the same core, then the following PrepareReshedule call will take care of that.
* | | | | Merge pull request #1036 from lioncash/threadbunnei2018-08-132-2/+2
|\ \ \ \ \ | | | | | | | | | | | | scheduler: Make HaveReadyThreads() a const member function
| * | | | | scheduler: Make HaveReadyThreads() a const member functionLioncash2018-08-122-2/+2
| |/ / / / | | | | | | | | | | | | | | | | | | | | This function doesn't modify instance state, so the const qualifier can be added to it.
* | | | | Merge pull request #1042 from Subv/racesbunnei2018-08-134-5/+13
|\ \ \ \ \ | | | | | | | | | | | | Fixed a bunch of race conditions when running in multicore mode.
| * | | | | Core/HLE: Make the 'reschedule_pending' flag atomic.Subv2018-08-131-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | Another thread may write to this variable while the core in question is in the middle of checking for a reschedule request.
| * | | | | CPU/HLE: Lock the HLE mutex before performing a reschedule.Subv2018-08-131-0/+3
| | | | | | | | | | | | | | | | | | | | | | | | Another thread might be in the middle of an SVC, thus altering the state of the schedulers.
| * | | | | Kernel/Threads: Lock the HLE mutex when executing the wakeup callback.Subv2018-08-131-0/+5
| | | | | | | | | | | | | | | | | | | | | | | | Another thread might be in the middle of a reschedule, thus altering the state of the schedulers.
| * | | | | Kernel/Thread: Always use the threadsafe option when scheduling wakeups.Subv2018-08-132-4/+4
| |/ / / / | | | | | | | | | | | | | | | | | | | | | | | | | WakeAfterDelay might be called from any host thread, so err on the side of caution and use the thread-safe CoreTiming::ScheduleEventThreadsafe. Note that CoreTiming is still far from thread-safe, there may be more things we have to work on for it to be up to par with what we want.
* | | | | Merge pull request #1041 from Subv/duplicated_mutexbunnei2018-08-132-2/+22
|\ \ \ \ \ | | | | | | | | | | | | Kernel/Mutex: Don't duplicate threads in the mutex waiter list.
| * | | | | Kernel/Mutex: Don't duplicate threads in the mutex waiter list.Subv2018-08-122-2/+22
| |/ / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Exit from AddMutexWaiter early if the thread is already waiting for a mutex owned by the owner thread. This accounts for the possibility of a thread that is waiting on a condition variable being awakened twice in a row. Also added more validation asserts. This should fix one of the random crashes in Breath Of The Wild.
* | | | | vfs: Make VfsFilesystem constructor explicitLioncash2018-08-121-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | Makes it consistent with the other VFS interfaces and prevents implicit construction.
* | | | | vfs: Make type hierarchy objects classes instead of structsLioncash2018-08-124-10/+16
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | struct should be used when the data type is very simple or otherwise has no invariants associated with it. Given these are used to form a hierarchy, class should be used instead.
* | | | | Merge pull request #1025 from ogniK5377/bad-castbunnei2018-08-124-4/+4
|\ \ \ \ \ | | | | | | | | | | | | Fixed invalid cast in loader
| * | | | | made ResultStatus a u16David Marcec2018-08-123-3/+3
| | | | | |
| * | | | | Fixed invalid cast in loaderDavid Marcec2018-08-121-1/+1
| | |/ / / | |/| | | | | | | | | | | | | GetMessageForResultStatus takes a u16, not a size_t.
* | | | | Merge pull request #1035 from ogniK5377/audio-dev-revision-infobunnei2018-08-122-1/+13
|\ \ \ \ \ | | | | | | | | | | | | GetAudioDeviceServiceWithRevisionInfo (Used by Bloodstained: Curse of the Moon)
| * | | | | GetAudioDeviceServiceWithRevisionInfoDavid Marcec2018-08-122-1/+13
| | |/ / / | |/| | | | | | | | | | | | | As we're not handling any anything about the revision data for GetAudioDeviceServiceWithRevisionInfo, it's currently marked as stubbed. However for games this shouldn't affect the result. Proper revision info would be more for homebrew.
* | | | | Merge pull request #1028 from ogniK5377/aoabunnei2018-08-121-5/+26
|\ \ \ \ \ | | | | | | | | | | | | Added GetAudioRendererSampleRate, GetAudioRendererSampleCount & GetAudioRendererMixBufferCount
| * | | | | Pushed the requested sample rate instead of our fixed sample rateDavid Marcec2018-08-121-4/+2
| | | | | |
| * | | | | Added GetAudioRendererSampleRate, GetAudioRendererSampleCount & GetAudioRendererMixBufferCountDavid Marcec2018-08-121-5/+28
| | |/ / / | |/| | | | | | | | | | | | | GetAudioRendererSampleRate is set as a "STUB" as a game could check if the sample rate it sent and the sample rate it wants don't match. Just a thought of something which could happen so keeping it as stub for the mean time
* | | | | hid: disable clang-format around tablesLioncash2018-08-121-4/+5
| | | | | | | | | | | | | | | | | | | | Prevents clang-format from butchering them.
* | | | | hid: Stub DisconnectNpad()Lioncash2018-08-121-1/+7
| |/ / / |/| | | | | | | | | | | This is required by ARMS.
* | | | Stub UpdateUserPresenceDavid Marcec2018-08-121-1/+8
|/ / / | | | | | | | | | Needed for Retro City Rampage to go in game
* | | Merge pull request #1022 from bunnei/fix-splatbunnei2018-08-122-2/+103
|\ \ \ | | | | | | | | Several Friend service fixes
| * | | friend: Stub DeclareCloseOnlinePlaySession.bunnei2018-08-121-1/+10
| | | | | | | | | | | | | | | | - Used by Splatoon 2.
| * | | friend: Fix CreateFriendService to return an IFriendService interface.bunnei2018-08-121-2/+86
| | | |
| * | | server_session: Provide more useful information and don't crash on bad IPC request.bunnei2018-08-121-0/+8
| | | |
* | | | core: Namespace EmuWindowLioncash2018-08-124-5/+16
|/ / / | | | | | | | | | Gets the class out of the global namespace.
* | | Merge pull request #970 from DarkLordZach/loader-errorsbunnei2018-08-1214-103/+219
|\ \ \ | | | | | | | | loader: Add more descriptive errors
| * | | loader: Add more descriptive errorsZach Hilman2018-08-1014-103/+219
| | |/ | |/| | | | Full list of new errors and descriptions in core/loader/loader.h
* / | video_core; Get rid of global g_toggle_framelimit_enabled variableLioncash2018-08-112-5/+2
|/ / | | | | | | | | | | | | | | | | Instead, we make a struct for renderer settings and allow the renderer to update all of these settings, getting rid of the need for global-scoped variables. This also uncovered a few indirect inclusions for certain headers, which this commit also fixes.
* | Merge pull request #997 from lioncash/const-funcbunnei2018-08-104-4/+4
|\ \ | | | | | | core: Make function reference parameters const where applicable
| * | buffer_queue: Make reference parameter of SetPreallocatedBuffer constLioncash2018-08-092-2/+2
| | | | | | | | | | | | | | | | | | | | | | | | This is simply copied by value, so there's no need to make it a modifiable reference. While we're at it, make the names of the parameters match its definition.
| * | hle_ipc: Make WriteToOutgoingCommandBuffer()'s reference parameter constLioncash2018-08-092-2/+2
| | | | | | | | | | | | | | | This function doesn't modify anything within the reference Thread instance.
* | | Merge pull request #990 from lioncash/entrybunnei2018-08-102-9/+12
|\ \ \ | | | | | | | | fsp_srv: Emplace entries first when building index instead of emplacing last
| * | | fsp_srv: Use std::string_view's copy() function instead of strncpy()Lioncash2018-08-092-8/+10
| | | | | | | | | | | | | | | | | | | | | | | | Given elements inserted into a vector are zeroed out, we can just copy MAX_LEN - 1 elements and the data will already be properly null terminated.
| * | | fsp_srv: Emplace entries first when building index instead of emplacing lastLioncash2018-08-091-2/+3
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The current way were doing it would require copying a 768 character buffer (part of the Entry struct) to the new element in the vector. Given it's a plain array, std::move won't eliminate that. Instead, we can emplace an instance directly into the destination buffer and then fill it out, avoiding the need to perform any unnecessary copies. Given this is done in a loop, we can request the destination to allocate all of the necessary memory ahead of time, avoiding the need to potentially keep reallocating over and over on every few insertions into the vector.
* | | | Merge pull request #897 from DarkLordZach/vfs-accuracy-2bunnei2018-08-1013-113/+560
|\ \ \ \ | |_|/ / |/| | | vfs: Add VfsFilesystem and fix RealVfs* implementations
| * | | vfs: Fix documentationZach Hilman2018-08-091-2/+2
| | | |
| * | | vfs: Fix typo in VfsFilesystem docsZach Hilman2018-08-091-1/+1
| | | |
| * | | file_util: Use enum instead of bool for specifing path behaviorZach Hilman2018-08-091-17/+27
| | | |
| * | | loader: Remove unused IdentifyFile overloadZach Hilman2018-08-092-12/+0
| | | |
| * | | vfs: Use RealVfsFilesystem for fs-operations in RealVfsDirectoryZach Hilman2018-08-091-2/+10
| | | |
| * | | file_sys: Add missing include in savedata_factoryZach Hilman2018-08-091-0/+1
| | | |
| * | | core: Port core to VfsFilesystem for file accessZach Hilman2018-08-096-13/+34
| | | |
| * | | vfs: Add unreachable assert to file permissions converterZach Hilman2018-08-091-1/+3
| | | |
| * | | vfs: Add RealVfsFilesystem implementationZach Hilman2018-08-092-81/+290
| | | |
| * | | vfs: Add VfsFilesystem interface and default implementationZach Hilman2018-08-092-3/+211
| | | |
| * | | filesystem: Remove unnecessary if conditionsZach Hilman2018-08-091-1/+1
| | | |
* | | | Merge pull request #986 from mailwl/acc-loadimagebunnei2018-08-091-1/+22
|\ \ \ \ | |/ / / |/| | | Service/Account: stub LoadImage function
| * | | Service/Account: stub LoadImage functionmailwl2018-08-081-1/+22
| | |/ | |/|
* | | Merge pull request #978 from bunnei/fixioctlbunnei2018-08-091-1/+1
|\ \ \ | | | | | | | | nvhost_gpu: Don't over copy IoctlSubmitGpfifo.
| * | | nvhost_gpu: Don't over copy IoctlSubmitGpfifo.bunnei2018-08-081-1/+1
| | | |
* | | | Merge pull request #975 from bunnei/am-stubbunnei2018-08-082-1/+9
|\ \ \ \ | |_|_|/ |/| | | am: Stub SetScreenShotImageOrientation.
| * | | am: Stub SetScreenShotImageOrientation.bunnei2018-08-082-1/+9
| |/ / | | | | | | | | | - Used by Super Mario Odyssey.
* | | Merge pull request #850 from DarkLordZach/icon-metabunnei2018-08-0812-8/+128
|\ \ \ | | | | | | | | Add Icons and Metadata Support
| * | | loader: Add icon and title support to XCIZach Hilman2018-08-076-3/+43
| | | |
| * | | Use const where applicableZach Hilman2018-08-072-2/+2
| | | |
| * | | Avoid parsing RomFS to directory in NCAZach Hilman2018-08-077-6/+86
| | | |
* | | | Merge pull request #958 from lioncash/nv-globalbunnei2018-08-085-11/+22
|\ \ \ \ | |_|_|/ |/| | | nvdrv: Get rid of global std::weak_ptr
| * | | nvdrv: Get rid of global std::weak_ptrLioncash2018-08-085-11/+22
| | |/ | |/| | | | | | | | | | Rather than use global state, we can simply pass the instance into the NVFlinger instance directly.
* | | Merge pull request #965 from lioncash/unused-filesbunnei2018-08-083-126/+0
|\ \ \ | | | | | | | | hle: Remove unused romfs.cpp/.h
| * | | hle: Remove unused romfs.cpp/.hLioncash2018-08-083-126/+0
| |/ / | | | | | | | | | These files are no longer used, so we can get rid of them.
* | | Merge pull request #974 from lioncash/accbunnei2018-08-082-2/+2
|\ \ \ | | | | | | | | acc: Add missing function table entries for GetUserCount
| * | | acc: Add missing function table entries for GetUserCountLioncash2018-08-082-2/+2
| | | | | | | | | | | | | | | | | | | | Given this is stubbed within the common module in 5ac7b84, it should be added to the other relevant tables as well.
* | | | hid: fix IsSixAxisSensorAtRest() responsemailwl2018-08-081-1/+1
|/ / /
* / / acc: Stub GetUserCount. (#973)bunnei2018-08-083-1/+9
|/ / | | | | - Used by Pokken Tournament DX.
* | Merge pull request #920 from DarkLordZach/titlekeybunnei2018-08-072-7/+39
|\ \ | | | | | | content_archive: Add support for titlekey cryptography
| * | content_archive: Add support for titlekey cryptographyZach Hilman2018-08-042-7/+39
| | |
* | | Merge pull request #957 from lioncash/eventbunnei2018-08-071-1/+1
|\ \ \ | | | | | | | | nvflinger: Correct typo in name of composition event
| * | | nvflinger: Correct typo in name of composition eventLioncash2018-08-071-1/+1
| | |/ | |/|
* | | Merge pull request #954 from lioncash/hidbunnei2018-08-071-0/+1
|\ \ \ | | | | | | | | services/hid: Add ActivateNpadWithRevision() to the hid function info array
| * | | services/hid: Add ActivateNpadWithRevision() to the hid function info arrayLioncash2018-08-071-0/+1
| |/ / | | | | | | | | | Updated based off the information on Switch Brew.
* | | Merge pull request #960 from lioncash/apmbunnei2018-08-073-0/+34
|\ \ \ | | | | | | | | service/apm: Add the apm:sys service
| * | | service/apm: Add the apm:sys serviceLioncash2018-08-073-0/+34
| |/ / | | | | | | | | | | | | Adds the basic skeleton of the apm:sys service based off the information on Switch Brew.
* | | Merge pull request #955 from lioncash/viewbunnei2018-08-072-3/+10
|\ \ \ | | | | | | | | nvflinger: Use std::string_view in OpenDisplay()
| * | | nvflinger: Get rid of indirect inclusionsLioncash2018-08-072-1/+7
| | | |
| * | | nvflinger: Use std::string_view in OpenDisplay()Lioncash2018-08-072-2/+3
| |/ / | | | | | | | | | | | | | | | We don't need to use a std::string here, given all that's done is comparing the character sequence against another. This allows passing regular const char* without needing to heap allocate.
* | | Merge pull request #953 from lioncash/timebunnei2018-08-071-2/+2
|\ \ \ | | | | | | | | service/time: Amend command IDs of ToPosixTime() and ToPosixTimeWithMyRule()
| * | | service/time: Amend command IDs of ToPosixTime() and ToPosixTimeWithMyRule()Lioncash2018-08-071-2/+2
| |/ / | | | | | | | | | Updates the ID of these based off the information on Switch Brew.
* | | Merge pull request #956 from lioncash/nvbunnei2018-08-0713-16/+18
|\ \ \ | | | | | | | | nvdrv: Get rid of indirect inclusions
| * | | nvdrv: Make Ioctl()'s definition match its prototypeLioncash2018-08-071-1/+1
| | | | | | | | | | | | | | | | | | | | The only reason this wasn't a compilation error is because we use little-endian systems.
| * | | nvdrv: Get rid of indirect inclusionsLioncash2018-08-0712-15/+17
| |/ /
* | | Merge pull request #952 from lioncash/usbbunnei2018-08-074-0/+257
|\ \ \ | | | | | | | | service: Add usb services
| * | | service: Add usb servicesLioncash2018-08-074-0/+257
| |/ / | | | | | | | | | Adds basic skeleton for the usb services based off the information provided by Switch Brew.
* | | Merge pull request #949 from lioncash/privbunnei2018-08-073-7/+21
|\ \ \ | | | | | | | | client_port: Make all data members private
| * | | client_port: Make all data members privateLioncash2018-08-073-7/+21
| |/ / | | | | | | | | | | | | | | | | | | | | | These members don't need to be entirely exposed, we can instead expose an API to operate on them without directly needing to mutate them We can also guard against overflow/API misuse this way as well, given active_sessions is an unsigned value.
* / / loader: Fix scope error in DeconstructedRomDirectoryZach Hilman2018-08-071-1/+1
|/ /
* | Merge pull request #931 from DarkLordZach/nca-as-drdbunnei2018-08-074-37/+24
|\ \ | | | | | | loader: Make AppLoader_NCA rely on directory loading code
| * | loader: Make AppLoader_NCA rely on directory loading codeZach Hilman2018-08-064-37/+24
| | | | | | | | | Eliminates duplicate code shared between their Load methods, after all the only difference is how the romfs is handled.
* | | GDBStub works with both Unicorn and Dynarmic now (#941)Hedges2018-08-074-2/+26
| | | | | | | | | | | | | | | | | | * GDBStub works with both Unicorn and Dynarmic now * Tidy up
* | | Merge pull request #940 from lioncash/privatebunnei2018-08-071-4/+8
|\ \ \ | | | | | | | | kernel/event: Make data members private
| * | | kernel/event: Make data members privateLioncash2018-08-061-4/+8
| | | | | | | | | | | | | | | | | | | | Instead we can simply provide accessors to the required data instead of giving external read/write access to the variables directly.
* | | | Merge pull request #934 from lioncash/chronobunnei2018-08-074-16/+16
|\ \ \ \ | |/ / / |/| | | core_timing: Make GetGlobalTimeUs() return std::chrono::microseconds
| * | | perf_stats: Correct literal used for MAX_LAG_TIME_USLioncash2018-08-061-2/+2
| | | | | | | | | | | | | | | | | | | | ms is shorthand for milliseconds, not microseconds, and given there's no comment indicating that this was intentional, it probably wasn't.
| * | | core_timing: Make GetGlobalTimeUs() return std::chrono::microsecondsLioncash2018-08-064-14/+14
| |/ / | | | | | | | | | | | | Enforces the time unit being returned and also allows using the standard time utilities to manipulate it.
* | | Merge pull request #933 from lioncash/memorybunnei2018-08-061-12/+11
|\ \ \ | | | | | | | | memory: Correct prototype of ZeroBlock
| * | | memory: Make prototype parameter names match their definitionsLioncash2018-08-061-5/+5
| | | | | | | | | | | | | | | | Keeps the code consistent.
| * | | memory: Correct prototype of ZeroBlockLioncash2018-08-061-1/+1
| | | | | | | | | | | | | | | | | | | | Previously, the prototype wasn't matching the definition, which has a Processor parameter before the destination address.
| * | | memory: Remove unnecessary const qualifiers in prototypesLioncash2018-08-061-9/+8
| |/ / | | | | | | | | | | | | These aren't necessary, as value-wise const only matters in the definition.
* | | Service/Audio: audout_a.cpp: remove pragma oncemailwl2018-08-061-2/+0
| | |
* | | Merge pull request #932 from lioncash/funcbunnei2018-08-062-9/+9
|\ \ \ | | | | | | | | core_timing: Use transparent functors where applicable
| * | | core_timing: Convert typedef into a type aliasLioncash2018-08-061-4/+4
| | | | | | | | | | | | | | | | Makes the alias a little more readable from left-to-right.
| * | | core_timing: Use transparent functors where applicableLioncash2018-08-061-5/+5
| |/ / | | | | | | | | | | | | | | | Gets rid of the need to hardcode the type in multiple places. This will now be deduced automatically, based off the elements in the container being provided to the algorithm.
* | | Merge pull request #929 from lioncash/addrbunnei2018-08-062-83/+89
|\ \ \ | | | | | | | | gdbstub: Minor changes
| * | | gdbstub: Use type alias for breakpoint mapsLioncash2018-08-051-37/+42
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Rather than having to type out the full std::map type signature, we can just use a straightforward alias. While we're at it, rename GetBreakpointList to GetBreakpointMap, which makes the name more accurate. We can also get rid of unnecessary u64 static_casts, since VAddr is an alias for a u64.
| * | | gdbstub: Move all file-static variables into the GDBStub namespaceLioncash2018-08-051-35/+36
| | | | | | | | | | | | | | | | | | | | Keeps everything under the same namespace. While we're at it, enclose them all within an inner anonymous namespace.
| * | | gdbstub: Replace PAddr alias with VAddrLioncash2018-08-052-14/+14
| | | | | | | | | | | | | | | | In all cases, a virtual address is being passed in, not a physical one.
* | | | Merge pull request #930 from lioncash/threadbunnei2018-08-061-15/+15
|\ \ \ \ | | | | | | | | | | address_arbiter: Return by value from GetThreadsWaitingOnAddress()
| * | | | address_arbiter: Return by value from GetThreadsWaitingOnAddress()Lioncash2018-08-051-15/+15
| |/ / / | | | | | | | | | | | | | | | | In all cases the vector being supplied is empty, so we can just return by value in these instances.
* | | | Merge pull request #925 from bunnei/audrenbunnei2018-08-064-233/+16
|\ \ \ \ | |_|/ / |/| | | Implement audren audio output
| * | | audio_core: Implement audren_u audio playback.bunnei2018-08-052-218/+9
| | | |
| * | | audio_core: Use s16 where possible for audio samples.bunnei2018-08-051-3/+3
| | | |
| * | | audio_core: Port codec code from Citra for ADPCM decoding.bunnei2018-08-052-11/+3
| | | |
| * | | audio_core: Streams need unique names for CoreTiming.bunnei2018-08-041-1/+1
| | |/ | |/|
* | | Merge pull request #912 from lioncash/global-varbunnei2018-08-057-27/+57
|\ \ \ | |_|/ |/| | video_core: Eliminate the g_renderer global variable
| * | renderer_base: Make Rasterizer() return the rasterizer by referenceLioncash2018-08-043-7/+7
| | | | | | | | | | | | | | | | | | | | | All calling code assumes that the rasterizer will be in a valid state, which is a totally fine assumption. The only way the rasterizer wouldn't be is if initialization is done incorrectly or fails, which is checked against in System::Init().
| * | video_core: Eliminate the g_renderer global variableLioncash2018-08-047-24/+54
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | We move the initialization of the renderer to the core class, while keeping the creation of it and any other specifics in video_core. This way we can ensure that the renderer is initialized and doesn't give unfettered access to the renderer. This also makes dependencies on types more explicit. For example, the GPU class doesn't need to depend on the existence of a renderer, it only needs to care about whether or not it has a rasterizer, but since it was accessing the global variable, it was also making the renderer a part of its dependency chain. By adjusting the interface, we can get rid of this dependency.
* | | Merge pull request #924 from lioncash/arpbunnei2018-08-054-0/+95
|\ \ \ | | | | | | | | service: Add arp services
| * | | service: Add arp servicesLioncash2018-08-054-0/+95
| | |/ | |/| | | | | | | | | | Adds the basic skeleton of the arp services based off the information provided by Switch Brew.
* | | Merge pull request #921 from lioncash/viewbunnei2018-08-055-35/+35
|\ \ \ | | | | | | | | core/crypto: Minor changes
| * | | aes_util: Add static assertion to Transcode() and XTSTranscode() to ensure well-defined behaviorLioncash2018-08-041-0/+4
| | | | | | | | | | | | | | | | These functions should only be given trivially-copyable types.
| * | | aes_util: Make CalculateNintendoTweak() an internally linked functionLioncash2018-08-042-12/+10
| | | | | | | | | | | | | | | | | | | | This function doesn't directly depend on class state, so it can be hidden entirely from the interface in the cpp file.
| * | | aes_util: Make Transcode() a const member functionLioncash2018-08-042-8/+9
| | | | | | | | | | | | | | | | This doesn't modify member state, so it can be made const.
| * | | core/crypto: Remove unnecessary includesLioncash2018-08-044-5/+5
| | | |
| * | | key_manager: Use regular std::string instead of std::string_viewLioncash2018-08-042-10/+7
| |/ / | | | | | | | | | | | | | | | | | | The benefit of std::string_view comes from the idea of avoiding copies (essentially acting as a non-owning view), however if we're just going to copy into a local variable immediately, there's not much benefit gained here.
* / / service: Remove redundant #pragma once directivesLioncash2018-08-045-10/+0
|/ / | | | | | | | | These don't do anything within .cpp files (we don't include cpp files, so...)
* | Merge pull request #849 from DarkLordZach/xcibunnei2018-08-0426-62/+1318
|\ \ | |/ |/| XCI and Encrypted NCA Support
| * Add missing parameter to files.push_back()Zach Hilman2018-08-011-5/+5
| |
| * Fix merge conflicts with opus and update docsZach Hilman2018-08-012-1/+3
| |
| * Use more descriptive error codes and messagesZach Hilman2018-08-017-19/+51
| |
| * Use static const instead of const staticZach Hilman2018-08-011-2/+2
| |
| * Use ErrorEncrypted where applicable and fix no keys crashZach Hilman2018-08-014-17/+37
| |
| * Add missing includes and use const where applicableZach Hilman2018-08-0111-24/+40
| |
| * Allow key loading from %YUZU_DIR%/keys in addition to ~/.switchZach Hilman2018-08-012-7/+20
| |
| * Make XCI comply to review and style guidelinesZach Hilman2018-08-0114-455/+222
| |
| * Extract mbedtls to cpp fileZach Hilman2018-08-014-86/+126
| |
| * Add missing string.h includeZach Hilman2018-08-011-0/+1
| |
| * Update mbedtls and fix compile errorZach Hilman2018-08-011-0/+1
| |
| * Remove files that are not usedZach Hilman2018-08-0124-42/+1406
| |
* | Merge pull request #913 from lioncash/unused-funcbunnei2018-08-041-16/+0
|\ \ | | | | | | memory: Remove unused GetSpecialHandlers() function
| * | memory: Remove unused GetSpecialHandlers() functionLioncash2018-08-031-16/+0
| | | | | | | | | | | | This is just unused code, so we may as well get rid of it.
* | | Merge pull request #914 from lioncash/codesetbunnei2018-08-045-20/+41
|\ \ \ | | | | | | | | kernel/process: Use accessors instead of class members for referencing segment array
| * | | kernel/process: Use std::array where applicableLioncash2018-08-031-1/+2
| | | |
| * | | kernel/process: Use accessors instead of class members for referencing segment arrayLioncash2018-08-035-20/+40
| |/ / | | | | | | | | | | | | | | | | | | Using member variables for referencing the segments array increases the size of the class in memory for little benefit. The same behavior can be achieved through the use of accessors that just return the relevant segment.
* / / kernel/thread: Fix potential crashes introduced in 26de4bb521b1ace7af76eff4f6956cb23ac0d58cLioncash2018-08-043-13/+38
|/ / | | | | | | | | | | This amends cases where crashes can occur that were missed due to the odd way the previous code was set up (using 3DS memory regions that don't exist).
* | Merge pull request #908 from lioncash/memorybunnei2018-08-0314-502/+29
|\ \ | | | | | | core/memory: Get rid of 3DS leftovers
| * | core/memory: Get rid of 3DS leftoversLioncash2018-08-0314-502/+29
| | | | | | | | | | | | Removes leftover code from citra that isn't needed.
* | | Added ability to change username & language code in the settings ui. Added IProfile::Get and SET::GetLanguageCode for libnx tests (#851)David2018-08-035-5/+47
| | |
* | | Merge pull request #898 from lioncash/migbunnei2018-08-034-0/+53
|\ \ \ | |/ / |/| | service: Add migration services
| * | service: Add migration servicesLioncash2018-08-024-0/+53
| | | | | | | | | | | | | | | Adds the basic skeleton for the mig:usr service based off information provided by Switch Brew.
* | | Merge pull request #892 from lioncash/globalbunnei2018-08-033-11/+11
|\ \ \ | | | | | | | | video_core: Make global EmuWindow instance part of the base renderer …
| * | | video_core: Make global EmuWindow instance part of the base renderer classLioncash2018-08-023-11/+11
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Makes the global a member of the RendererBase class. We also change this to be a reference. Passing any form of null pointer to these functions is incorrect entirely, especially given the code itself assumes that the pointer would always be in a valid state. This also makes it easier to follow the lifecycle of instances being used, as we explicitly interact the renderer with the rasterizer, rather than it just operating on a global pointer.
* | | | Merge pull request #894 from lioncash/objectbunnei2018-08-0343-155/+185
|\ \ \ \ | | | | | | | | | | kernel: Move object class to its own source files
| * | | | kernel: Move object class to its own source filesLioncash2018-08-0243-155/+185
| | |/ / | |/| | | | | | | | | | | | | | | | | | General moving to keep kernel object types separate from the direct kernel code. Also essentially a preliminary cleanup before eliminating global kernel state in the kernel code.
* | | | Merge pull request #904 from lioncash/staticbunnei2018-08-031-8/+6
|\ \ \ \ | | | | | | | | | | kernel/thread: Minor changes
| * | | | kernel/thread: Make GetFreeThreadLocalSlot()'s loop indices size_tLioncash2018-08-021-8/+5
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Avoids using a u32 to compare against a range of size_t, which can be a source of warnings. While we're at it, compress a std::tie into a structured binding.
| * | | | kernel/thread: Make GetFreeThreadLocalSlot() reference parameter a const referenceLioncash2018-08-021-1/+2
| | | | | | | | | | | | | | | | | | | | | | | | | This function only reads the data being referenced, it doesn't modify it, so we can turn the reference into a const reference.
| * | | | kernel/thread: Make GetFreeThreadLocalSlot() internally linkedLioncash2018-08-021-1/+1
| |/ / / | | | | | | | | | | | | | | | | This function isn't used outside of this translation unit, so we can make it internally linked.
* | | | Merge pull request #905 from lioncash/vmabunnei2018-08-033-23/+23
|\ \ \ \ | | | | | | | | | | kernel/vm_manager: Minor changes
| * | | | kernel/vm_manager: Convert loop into std::any_of()Lioncash2018-08-021-4/+4
| | | | |
| * | | | kernel/vm_manager: Use const where applicableLioncash2018-08-023-19/+19
| | | | | | | | | | | | | | | | | | | | Makes our immutable state explicit.
| * | | | kernel/vm_manager: Use the VAddr type alias in CarveVMA()Lioncash2018-08-021-2/+2
| |/ / / | | | | | | | | | | | | These two variables correspond to address ranges.
* | | | Merge pull request #903 from lioncash/copybunnei2018-08-031-3/+6
|\ \ \ \ | | | | | | | | | | vfs_vector: Minor changes
| * | | | vfs_vector: Remove unused variable in FindAndRemoveVectorElement()Lioncash2018-08-021-2/+2
| | | | | | | | | | | | | | | | | | | | This wasn't being used for anything, so it can be removed.
| * | | | vfs_vector: Avoid unnecessary copies where applicableLioncash2018-08-021-2/+5
| |/ / / | | | | | | | | | | | | | | | | The lambda elements should be taken by const reference here, and we can move the virtual directory passed to ReplaceFileWithSubdirectory()
* | | | Merge pull request #899 from lioncash/unusedbunnei2018-08-027-334/+0
|\ \ \ \ | | | | | | | | | | hw: Remove unused files
| * | | | hw: Remove unused filesLioncash2018-08-027-334/+0
| |/ / / | | | | | | | | | | | | | | | | | | | | None of these files are used in any meaningful way. They're just leftovers from citra. Also has the benefit of getting rid of an unused global variable.
* | | | Merge pull request #891 from lioncash/nsbunnei2018-08-021-0/+447
|\ \ \ \ | | | | | | | | | | service/ns: Add missing ns services
| * | | | service/ns: Add missing ns servicesLioncash2018-08-021-0/+447
| | |/ / | |/| | | | | | | | | | | | | | | | | | Implements the basic skeleton of ns:am2, ns:ec, ns:rid, ns:rt, ns:su, ns:vm, and ns:web based off the information provided by Switch Brew and SwIPC.
* | | | service: Add psc servicesLioncash2018-08-024-0/+96
| |/ / |/| | | | | | | | | | | Adds the basic skeleton for the psc services based off the information provided by Switch Brew.
* | | Merge pull request #888 from lioncash/capsbunnei2018-08-024-0/+171
|\ \ \ | | | | | | | | service: Add capture services
| * | | service: Add capture servicesLioncash2018-08-014-0/+171
| |/ / | | | | | | | | | | | | Adds the basic skeleton for the capture services based off information provided by Switch Brew.
* | | Merge pull request #890 from lioncash/loggerbunnei2018-08-021-4/+4
|\ \ \ | | | | | | | | lm: Amend name of ILogger
| * | | lm: Amend name of ILoggerLioncash2018-08-011-4/+4
| |/ / | | | | | | | | | | | | Previously this was being registered with the name "Logger". While we're at it, also change the name of the class to match it.
* | | Merge pull request #889 from lioncash/fspbunnei2018-08-026-0/+89
|\ \ \ | | | | | | | | service/filesystem: Add fsp:ldr and fsp:pr services
| * | | service/filesystem: Add fsp:ldr and fsp:pr servicesLioncash2018-08-016-0/+89
| |/ / | | | | | | | | | | | | Adds the basic skeleton for the remaining fsp services based off information provided by Switch Brew.
* / / service: Add bpc and pcv servicesLioncash2018-08-016-0/+179
|/ / | | | | | | | | Adds the basic skeleton for the remaining pcv-related services based off information on Switch Brew.
* | Merge pull request #882 from lioncash/unusedbunnei2018-08-011-6/+0
|\ \ | |/ |/| kernel/thread: Remove unimplemented function prototype
| * kernel/thread: Remove unimplemented function prototypeLioncash2018-08-011-6/+0
| | | | | | | | | | Given there's no implementation, we may as well remove the code entirely.
* | Merge pull request #871 from bunnei/audio-configbunnei2018-08-011-0/+5
|\ \ | |/ |/| audio_core: Add configuration settings.
| * audio_core: Add configuration settings.bunnei2018-08-011-0/+5
| |
* | Merge pull request #877 from lioncash/removebunnei2018-08-016-104/+0
|\ \ | | | | | | kernel: Remove unused object_address_table.cpp/.h
| * | kernel: Remove unused object_address_table.cpp/.hLioncash2018-07-316-104/+0
| | | | | | | | | | | | | | | | | | These source files were entirely unused throughout the rest of the codebase. This also has the benefit of getting rid of a global variable as well.
* | | Merge pull request #880 from lioncash/audiobunnei2018-08-0114-2/+289
|\ \ \ | |_|/ |/| | service/audio: Add missing services
| * | service/audio: Add missing servicesLioncash2018-08-0114-2/+289
| | | | | | | | | | | | | | | Adds the missing audctl service, as well as the :a and :d services for audin, audout, audrec, and audren.
* | | Merge pull request #876 from lioncash/includebunnei2018-08-0123-28/+47
|\ \ \ | | | | | | | | kernel: Remove unnecessary includes
| * | | kernel: Remove unnecessary includesLioncash2018-07-3123-28/+47
| | |/ | |/| | | | | | | | | | Removes unnecessary direct dependencies in some headers and also gets rid of indirect dependencies that were being relied on to be included.
* | | Merge pull request #879 from lioncash/audiobunnei2018-08-011-1/+1
|\ \ \ | |_|/ |/| | audout_u: Remove std::move in OpenAudioOutImpl()
| * | audout_u: Remove std::move in OpenAudioOutImpl()Lioncash2018-07-311-1/+1
| | | | | | | | | | | | | | | | | | | | | Previously the code was using the values from params further below after it was std::moved. Thankfully, given AudoutParams is a trivially copyable struct, the values would have simply been copied in this instance and not invalidated to garbage values.
* | | Merge pull request #869 from Subv/ubsanbunnei2018-07-312-6/+17
|\ \ \ | | | | | | | | Corrected a few error cases detected by asan/ubsan
| * | | nvhost_gpu: Added checks to ensure we don't read past the end of the entries when handling a GPU command list.Subv2018-07-311-3/+6
| | | |
| * | | nvhost_ctrl_gpu: Only read the input parameters if they are actually there.Subv2018-07-311-3/+11
| | | | | | | | | | | | | | | | Passing nullptr to memcpy is undefined behavior.
* | | | Merge pull request #875 from lioncash/fgmbunnei2018-07-314-0/+94
|\ \ \ \ | | | | | | | | | | service: Add fgm services
| * | | | service: Add fgm servicesLioncash2018-07-314-0/+94
| | |_|/ | |/| | | | | | | | | | | | | | Adds the basic skeleton for the fgm services based off the information provided by Switch Brew.
* | | | Merge pull request #874 from lioncash/ambunnei2018-07-318-0/+156
|\ \ \ \ | |_|_|/ |/| | | service/am: Add missing am services
| * | | service/am: Add missing am servicesLioncash2018-07-318-0/+156
| |/ / | | | | | | | | | | | | Adds the basic skeleton for missing am services idle:sys, omm, and spsm based off the information provided by Switch Brew.
* | | Merge pull request #870 from lioncash/initbunnei2018-07-311-9/+7
|\ \ \ | | | | | | | | arm_dynarmic: Correct initializer list order
| * | | arm_dynarmic: Make SetTlsAddress() prototype and definition consistentLioncash2018-07-311-1/+1
| | | | | | | | | | | | | | | | Makes the definition use the same type aliases as in its prototype.
| * | | arm_dynarmic: Remove unnecessary qualifying of ThreadContextLioncash2018-07-311-3/+3
| | | | | | | | | | | | | | | | | | | | Given the ARM_Dynarmic class inherits from ARM_Interface, we don't need to qualify here.
| * | | arm_dynarmic: Correct initializer list orderLioncash2018-07-311-5/+3
| |/ / | | | | | | | | | | | | | | | | | | | | | | | | Amends the initializer list to be in the same order that each variable would be initialized in. We also do this to ensure we don't use a bogus uninitialized instance of the exclusive monitor within MakeJit() We can also remove the jit member from the initializer list as this is initialized by PageTableChanged()
* / / service: Add the pcie serviceLioncash2018-07-314-0/+83
|/ / | | | | | | | | Adds the basic skeleton of the pcie service based off information on Switch Brew.
* | audio_core: Move to audout_u impl.bunnei2018-07-314-13/+6
| | | | | | | | - This is necessary so streams are created on the same thread.
* | Implemented various hwopus functions (#853)David2018-07-313-6/+132
| |
* | Merge pull request #858 from lioncash/castbunnei2018-07-301-3/+2
|\ \ | | | | | | partition_filesystem: Remove dynamic_cast in PrintDebugInfo()
| * | partition_filesystem: Remove dynamic_cast in PrintDebugInfo()Lioncash2018-07-291-3/+2
| | | | | | | | | | | | | | | | | | | | | We shouldn't be upcasting our file instances. Given a PartitionFilesystem is currently designed to accept any arbitrary VfsFile instances, casting to a more specific type than that is just bad design, and shows an interface design issue.
* | | Merge pull request #857 from lioncash/wlanbunnei2018-07-304-1/+192
|\ \ \ | | | | | | | | service: Add wlan services
| * | | service: Add wlan servicesLioncash2018-07-294-1/+192
| |/ / | | | | | | | | | | | | Adds the basic skeleton for the wlan services based off the information on Switch Brew.
* | | Merge pull request #856 from lioncash/btmbunnei2018-07-304-0/+140
|\ \ \ | | | | | | | | service: Add btm services
| * | | service/btm: Add basic implementation of GetCoreImpl()Lioncash2018-07-291-1/+35
| | | | | | | | | | | | | | | | Based off information on SwIPC and Switch Brew.
| * | | service: Add btm servicesLioncash2018-07-294-0/+106
| |/ / | | | | | | | | | | | | Adds the skeleton for the btm services based off the information on Switch Brew.
* / / Add some HID commands (#843)Hexagon122018-07-301-2/+16
|/ / | | | | | | | | | | * Added some HID commands * Addressed comments
* | Merge pull request #847 from lioncash/ncmbunnei2018-07-284-0/+78
|\ \ | | | | | | service: Add ncm services
| * | service: Add ncm servicesLioncash2018-07-274-0/+78
| | | | | | | | | | | | | | | Adds the basic skeleton for the ncm services based off information on Switch Brew.
* | | Merge pull request #846 from lioncash/miibunnei2018-07-284-0/+126
|\ \ \ | | | | | | | | service: Add mii services
| * | | service: Add mii servicesLioncash2018-07-274-0/+126
| | | | | | | | | | | | | | | | | | | | Adds the skeleton for the mii services based off information provided by Switch Brew
* | | | Merge pull request #842 from bunnei/audio-corebunnei2018-07-285-94/+124
|\ \ \ \ | | | | | | | | | | Initial implementation of Audio Core
| * | | | audout: Implement IAudioOut interface with AudioCore.bunnei2018-07-282-93/+114
| | | | |
| * | | | core: Add AudioCore to global state.bunnei2018-07-282-0/+9
| | | | |
| * | | | audio_core: Add initial code for keeping track of audout state.bunnei2018-07-281-1/+1
| | |/ / | |/| |
* / | | RomFS ExtractionZach Hilman2018-07-2812-20/+351
|/ / /
* | | Merge pull request #845 from lioncash/nfcbunnei2018-07-274-0/+241
|\ \ \ | | | | | | | | service: Add nfc services
| * | | service/nfc: Implement Create[x]Interface functionsLioncash2018-07-271-4/+43
| | | | | | | | | | | | | | | | These simply return the respective interface.
| * | | service: Add nfc servicesLioncash2018-07-274-0/+202
| |/ / | | | | | | | | | | | | Adds the skeleton of the nfc service based off the information provided on Switch Brew.
* | | Merge pull request #844 from lioncash/lblbunnei2018-07-274-0/+109
|\ \ \ | | | | | | | | service: Add the lbl service
| * | | service/lbl: Implement EnableVrMode, DisableVrMode and GetVrModeLioncash2018-07-271-3/+35
| | | | | | | | | | | | | | | | | | | | Implements these functions according to the information available on Switch Brew.
| * | | service: Add the lbl serviceLioncash2018-07-274-0/+77
| |/ / | | | | | | | | | | | | Adds the skeleton of the lbl service based off the information provided by Switch Brew.
* | | Merge pull request #841 from lioncash/btdrvbunnei2018-07-274-1/+93
|\ \ \ | |/ / |/| | service: Add the btdrv service
| * | service: Add the btdrv serviceLioncash2018-07-274-1/+93
| | | | | | | | | | | | Adds the skeleton for the btdrv service based off the information provided by Switch Brew
* | | Merge pull request #837 from lioncash/privbunnei2018-07-271-5/+17
|\ \ \ | | | | | | | | kernel/timer: Make data members private where applicable
| * | | kernel/timer: Make data members private where applicableLioncash2018-07-261-5/+17
| | | | | | | | | | | | | | | | | | | | Instead, we can just expose functions that return the queryable state instead of letting anything modify it.
* | | | service/hid: Add the hidbus, hid:dbg, hid:sys, and hid:tmp servicesLioncash2018-07-261-0/+220
| | | |
* | | | service/hid: Add the xcd:sys serviceLioncash2018-07-264-0/+57
| | | |
* | | | service/hid: Add irs servicesLioncash2018-07-264-0/+75
| |/ / |/| |
* | | Merge pull request #834 from lioncash/grcbunnei2018-07-264-0/+50
|\ \ \ | | | | | | | | service: Add the grc:c service
| * | | service: Add the grc:c serviceLioncash2018-07-264-0/+50
| |/ / | | | | | | | | | | | | Adds the basic skeleton for the grc:c service based off the information provided by Switch Brew.
* | | Merge pull request #832 from lioncash/nimbunnei2018-07-264-0/+143
|\ \ \ | | | | | | | | service: Add the nim services
| * | | service: Add the nim servicesLioncash2018-07-264-0/+143
| |/ / | | | | | | | | | | | | Adds the skeleton for the nim services based off information from Switch Brew.
* | | Merge pull request #831 from lioncash/ldnbunnei2018-07-264-0/+162
|\ \ \ | | | | | | | | service: Add ldn services
| * | | service: Add ldn servicesLioncash2018-07-264-0/+162
| |/ / | | | | | | | | | Adds ldn services based off information provided by Switch Brew.
* | | Merge pull request #830 from lioncash/socketbunnei2018-07-266-0/+95
|\ \ \ | |_|/ |/| | service/sockets: Add missing socket services
| * | service/sockets: Add ethc:c and ethc:i servicesLioncash2018-07-264-0/+66
| | |
| * | service/sockets: Add missing bsdcfg socket serviceLioncash2018-07-263-0/+29
| |/
* | Merge pull request #827 from lioncash/logbunnei2018-07-262-40/+35
|\ \ | |/ |/| service/lm: Minor changes
| * lm: Move LM's class declaration into the cpp fileLioncash2018-07-262-37/+31
| | | | | | | | | | This isn't used directly outside of this translation unit, so we can hide it from external use.
| * lm: Amend names of Initialize() in Logger and Initialize() in LMLioncash2018-07-262-7/+7
| | | | | | | | Amends these to match the information on Switch Brew.
| * lm: Add missing function entry to Logger's function tableLioncash2018-07-261-0/+1
| |
* | Merge pull request #828 from lioncash/ldrSebastian Valle2018-07-264-0/+101
|\ \ | | | | | | service: Add ldr services
| * | service: Add ldr servicesLioncash2018-07-264-0/+101
| | | | | | | | | | | | | | | Adds the skeleton for the ldr-related services based off the information provided on Switch Brew.
* | | Merge pull request #826 from lioncash/erptSebastian Valle2018-07-266-0/+143
|\ \ \ | | | | | | | | service: Add erpt and eupld services
| * | | service: Add eupld servicesLioncash2018-07-264-0/+72
| | | | | | | | | | | | | | | | | | | | Adds the skeleton for the eupld services based off information on Switch Brew.
| * | | service: Add the erpt servicesLioncash2018-07-264-0/+71
| | |/ | |/| | | | | | | | | | Adds the basic skeleton of the erpt service based off information on Switch Brew.
* | | Merge pull request #823 from lioncash/nifmSebastian Valle2018-07-269-141/+30
|\ \ \ | |_|/ |/| | service/nifm: Deduplicate interface code
| * | service/nifm: Deduplicate interface codeLioncash2018-07-259-141/+30
| | | | | | | | | | | | | | | Rather than having the same code for each nifm service variant, we can centralize it on one class and get rid of a bit of extra code.
* | | Merge pull request #824 from lioncash/nvdrvbunnei2018-07-262-5/+7
|\ \ \ | | | | | | | | service/nvdrv: Minor changes
| * | | service/nvdrv: Take std::string in Open() by const referenceLioncash2018-07-252-2/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Avoids copies from being made, since the string is only ever used for lookup, the data is never transfered anywhere. Ideally, we'd use a std::string_view here, but devices is a std::unordered_map, not a std::map, so we can't use heterogenous lookup here.
| * | | service/nvdrv: Use std::move where applicableLioncash2018-07-251-3/+5
| |/ / | | | | | | | | | | | | | | | | | | Avoids unnecessary reference count increments and decrements. In one case, we don't need to make a shared_ptr copy at all, just to call a member function.
* | | Merge pull request #822 from lioncash/pmbunnei2018-07-264-0/+90
|\ \ \ | |_|/ |/| | service: Add pm services
| * | service: Add pm servicesLioncash2018-07-254-0/+90
| |/ | | | | | | | | Adds the skeleton for the process management services based off information on Switch Brew.
* / service: Add the es serviceLioncash2018-07-254-0/+77
|/ | | | | Adds the skeleton for the ETicket service based off the information on Switch Brew
* Merge pull request #801 from lioncash/timeMat M2018-07-256-64/+16
|\ | | | | time: Add the time:a service
| * time: Add the time:a serviceLioncash2018-07-253-10/+11
| | | | | | | | Given we already have time:s and time:u, we should also have time:a
| * time: Simplify interface creationLioncash2018-07-246-64/+15
| | | | | | | | We can use one instance of the interface instead of duplicating code.
* | Merge pull request #804 from lioncash/logMat M2018-07-251-1/+3
|\ \ | | | | | | svc: Log parameters in SetMemoryAttribute()
| * | svc: Log parameters in SetMemoryAttribute()Lioncash2018-07-241-1/+3
| | | | | | | | | | | | Provides slightly more context than only logging out the address value.
* | | Merge pull request #803 from MerryMage/core_timing_utilbunnei2018-07-2512-114/+146
|\ \ \ | | | | | | | | core_timing: Split off utility functions into core_timing_util
| * | | core_timing: Split off utility functions into core_timing_utilMerryMage2018-07-2412-105/+137
| | | |
| * | | CMakeLists: Sort filenamesMerryMage2018-07-241-9/+9
| | | |
* | | | Merge pull request #800 from lioncash/setbunnei2018-07-253-5/+33
|\ \ \ \ | | | | | | | | | | set_sys: Implement SetColorSetId()
| * | | | set_sys: Implement SetColorSetId()Lioncash2018-07-242-5/+25
| | | | |
| * | | | ipc_helper: Add helper member function for popping enum values to RequestParserLioncash2018-07-241-0/+8
| | |_|/ | |/| |
* | | | Merge pull request #806 from lioncash/friendbunnei2018-07-256-48/+15
|\ \ \ \ | | | | | | | | | | friend: Deduplicate interfaces
| * | | | friend: Add friend:m, friend:s, and friend:v servicesLioncash2018-07-241-0/+3
| | | | | | | | | | | | | | | | | | | | | | | | | Given we already have friend:a and friend:u, we should add the remaining services as well.
| * | | | friend/interface: Add missing CreateDaemonSuspendSessionService() to the function handler tableLioncash2018-07-241-0/+1
| | | | |
| * | | | friend: Deduplicate interfacesLioncash2018-07-246-48/+11
| | |_|/ | |/| |
* | | | Merge pull request #805 from lioncash/signbunnei2018-07-241-4/+7
|\ \ \ \ | | | | | | | | | | svc: Resolve sign comparison warnings in WaitSynchronization()
| * | | | svc: Resolve sign comparison warnings in WaitSynchronization()Lioncash2018-07-241-4/+7
| |/ / / | | | | | | | | | | | | | | | | The loop's induction variable was signed, but we were comparing against an unsigned variable.
* / / / deconstructed_rom_directory: Remove unused FindRomFS() functionLioncash2018-07-241-29/+0
|/ / /
* | | Merge pull request #798 from lioncash/constbunnei2018-07-242-3/+3
|\ \ \ | | | | | | | | arm_dynarmic: Make MakeJit() a const member function
| * | | arm_dynarmic: Make MakeJit() a const member functionLioncash2018-07-242-3/+3
| |/ / | | | | | | | | | | | | This functions doesn't modify instance state, so it can be a made a const member function.
* | | Merge pull request #797 from lioncash/explicitbunnei2018-07-245-5/+5
|\ \ \ | | | | | | | | core: Make converting constructors explicit where applicable
| * | | core: Make converting constructors explicit where applicableLioncash2018-07-245-5/+5
| |/ / | | | | | | | | | | | | Avoids unwanted implicit conversions. Thankfully, given the large amount of cleanup in past PRs, only this tiny amount is left over to cover.
* | | Merge pull request #795 from lioncash/declbunnei2018-07-241-3/+0
|\ \ \ | | | | | | | | apm/interface: Remove redundant declaration of InstallInterfaces()
| * | | apm/interface: Remove redundant declaration of InstallInterfaces()Lioncash2018-07-241-3/+0
| |/ / | | | | | | | | | This is already declared in apm/apm.h
* | | Merge pull request #794 from lioncash/refbunnei2018-07-241-1/+1
|\ \ \ | |_|/ |/| | mutex: Pass SharedPtr to GetHighestPriorityMutexWaitingThread() by reference
| * | mutex: Pass SharedPtr to GetHighestPriorityMutexWaitingThread() by referenceLioncash2018-07-241-1/+1
| | | | | | | | | | | | | | | The pointed to thread's members are simply observed in this case, so we don't need to copy it here.
* | | Merge pull request #793 from lioncash/privbunnei2018-07-242-17/+19
|\ \ \ | | | | | | | | ipc_helpers: Make member variables of ResponseBuilder private
| * | | hle_ipc: Make constructors explicit where applicableLioncash2018-07-242-12/+13
| | | |
| * | | ipc_helpers: Make member variables of ResponseBuilder privateLioncash2018-07-241-5/+6
| |/ / | | | | | | | | | These aren't used externally at all, so they can be made private.
* | | Merge pull request #785 from lioncash/fsbunnei2018-07-241-3/+3
|\ \ \ | |_|/ |/| | partition_filesystem: Use std::move where applicable
| * | partition_filesystem: Use std::move where applicableLioncash2018-07-241-3/+3
| | | | | | | | | | | | | | | Avoids copying a std::string instance and avoids unnecessary atomic reference count incrementing and decrementing.
* | | VFS Regression and Accuracy Fixes (#776)Zach Hilman2018-07-243-36/+62
| |/ |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | * Regression and Mode Fixes * Review Fixes * string_view correction * Add operator& for FileSys::Mode * Return std::string from SanitizePath * Farming Simulator Fix * Use != With mode operator&
* | Merge pull request #786 from lioncash/exclusivebunnei2018-07-243-22/+18
|\ \ | | | | | | exclusive_monitor: Use consistent type alias for u64
| * | exclusive_monitor: Use consistent type alias for u64Lioncash2018-07-243-22/+18
| |/ | | | | | | | | Uses the same type aliases we use for virtual addresses, and converts one lingering usage of std::array<uint64_t, 2> to u128 for consistency.
* | Merge pull request #784 from lioncash/loaderbunnei2018-07-241-1/+1
|\ \ | | | | | | loader: Minor cleanup
| * | loader: Remove unnecessary constructor call in IdentifyFile()Lioncash2018-07-231-1/+1
| |/ | | | | | | | | | | RealVfsFile inherits from VfsFile, the instance from std::make_shared is already compatible with the function argument type, making the copy constructor call unnecessary.
* | Merge pull request #783 from lioncash/linkerbunnei2018-07-242-7/+4
|\ \ | | | | | | linker: Remove unused parameter from WriteRelocations()
| * | linker: Remove unused parameter from WriteRelocations()Lioncash2018-07-232-7/+4
| |/ | | | | | | | | is_jump_relocation is never used within the function, so we can just remove it.
* | Merge pull request #782 from lioncash/filebunnei2018-07-242-14/+33
|\ \ | | | | | | loader/nro: Minor changes
| * | nro: Replace inclusion with a forward declarationLioncash2018-07-232-1/+8
| | | | | | | | | | | | | | | It's sufficient to use a forward declaration instead of a direct inclusion here.
| * | nro: Make bracing consistentLioncash2018-07-231-10/+24
| | | | | | | | | | | | | | | Makes the code more uniform, and also braces cases where the body of an unbraced conditional travels more than one line.
| * | nro: Make constructor explicitLioncash2018-07-231-1/+1
| | | | | | | | | | | | | | | Makes it consistent with the other Apploader constructors, and prevents implicit conversions.
| * | nro: Remove unused forward declarationLioncash2018-07-231-2/+0
| |/ | | | | | | This isn't used anywhere in the header.
* | Merge pull request #780 from lioncash/movebunnei2018-07-241-11/+22
|\ \ | | | | | | vi: Minor changes
| * | vi: Add std::is_trivially_copyable checks to Read and Write functionsLioncash2018-07-231-2/+13
| | | | | | | | | | | | | | | | | | It's undefined behavior to memcpy an object that isn't considered trivially copyable, so put a compile-time check in to make sure this doesn't occur.
| * | vi: std::move std::vector in constructors where applicableLioncash2018-07-231-9/+9
| | | | | | | | | | | | | | | | | | | | | Allows avoiding unnecessary copies of the vector depending on the calling code. While we're at it, remove a redundant no-parameter base constructor call
* | | Merge pull request #779 from lioncash/sharedbunnei2018-07-248-263/+0
|\ \ \ | |_|/ |/| | hle: Remove unused config_mem and shared_page source files
| * | hle: Remove config_mem.h/.cppLioncash2018-07-236-102/+0
| | | | | | | | | | | | | | | This is just an unused hold-over from citra, so we can get rid of this to trim off an exposed global, among other things.
| * | hle: Remove shared_page.h/.cppLioncash2018-07-236-161/+0
| |/ | | | | | | This is a holdover from citra that's essentially unused.
* | Merge pull request #695 from DarkLordZach/nro-assetbunnei2018-07-235-1/+215
|\ \ | | | | | | NRO Assets and NACP File Format
| * | NRO Assets and NACP file formatZach Hilman2018-07-235-1/+215
| | | | | | | | | | | | | | | | | | Cleanup Review fixes
* | | set: Add missing log call in GetAvailableLanguageCodeCount()Lioncash2018-07-231-0/+2
| |/ |/| | | | | Forgot to include this in 22f448b6327044076959e338811ee576f3dcf093
* | Merge pull request #777 from lioncash/langbunnei2018-07-232-23/+31
|\ \ | |/ |/| set: Amend return value of GetAvailableLanguageCodes()
| * set: Implement GetAvailableLanguageCodeCount()Lioncash2018-07-232-21/+29
| | | | | | | | This just returns the size of the language code buffer.
| * set: Correct return code size of value in GetAvailableLanguageCodes()Lioncash2018-07-231-2/+2
| | | | | | | | The return code should be 32-bit in size.
* | Merge pull request #774 from Subv/atomic_signalbunnei2018-07-221-7/+31
|\ \ | |/ |/| Kernel/SVC: Perform atomic accesses in SignalProcessWideKey as per the real kernel.
| * Kernel/SVC: Perform atomic accesses in SignalProcessWideKey as per the real kernel.Subv2018-07-221-7/+31
| |
* | Merge pull request #768 from lioncash/string-viewbunnei2018-07-228-93/+158
|\ \ | |/ |/| file_util, vfs: Use std::string_view where applicable
| * vfs: Correct file_p variable usage within InterpretAsDirectory()Lioncash2018-07-221-2/+5
| | | | | | | | | | | | | | | | | | ReplaceFileWithSubdirectory() takes a VirtualFile and a VirtualDir, but it was being passed a string as one of its arguments. The only reason this never caused issues is because this template isn't instantiated anywhere yet. This corrects an issue before it occurs.
| * file_util, vfs: Use std::string_view where applicableLioncash2018-07-228-91/+153
| | | | | | | | | | Avoids unnecessary construction of std::string instances where applicable.
* | Implement exclusive monitorMerryMage2018-07-229-13/+160
|/
* file_util: Use a u64 to represent number of entriesLioncash2018-07-222-4/+4
| | | | | This avoids a truncating cast on size. I doubt we'd ever traverse a directory this large, however we also shouldn't truncate sizes away.
* Merge pull request #760 from lioncash/pathbunnei2018-07-223-5/+7
|\ | | | | file_util: Use an enum class for GetUserPath()
| * file_util: Use an enum class for GetUserPath()Lioncash2018-07-213-5/+7
| | | | | | | | | | | | | | | | | | | | | | | | | | Instead of using an unsigned int as a parameter and expecting a user to always pass in the correct values, we can just convert the enum into an enum class and use that type as the parameter type instead, which makes the interface more type safe. We also get rid of the bookkeeping "NUM_" element in the enum by just using an unordered map. This function is generally low-frequency in terms of calls (and I'd hope so, considering otherwise would mean we're slamming the disk with IO all the time) so I'd consider this acceptable in this case.
* | GPU: Implement the NVGPU_IOCTL_CHANNEL_KICKOFF_PB ioctl2 command.Subv2018-07-213-6/+34
|/ | | | | This behaves quite similarly to the SubmitGPFIFO command. Referenced from Ryujinx. Many thanks to @gdkchan for investigating this!
* Merge pull request #754 from lioncash/partbunnei2018-07-212-8/+20
|\ | | | | partition_filesystem, vfs_real: Minor changes
| * vfs_real: Remove redundant copying of std::vector instances in GetFiles() and GetSubdirectories()Lioncash2018-07-211-2/+3
| | | | | | | | | | We already return by value, so we don't explicitly need to make the copy.
| * partition_filesystem, vfs_real: Add missing standard includesLioncash2018-07-212-0/+4
| |
| * partition_filesystem, vfs_real: Use std::move in ReplaceFileWithSubdirectory() where applicableLioncash2018-07-212-2/+3
| | | | | | | | Avoids unnecessary atomic increment and decrement operations.
| * partition_filesystem, vfs_real: Use std::distance() instead of subtractionLioncash2018-07-212-4/+10
| | | | | | | | This is a little bit more self-documenting on what is being done here.
* | Merge pull request #750 from lioncash/ctxbunnei2018-07-213-9/+0
|\ \ | | | | | | arm_interface: Remove unused tls_address member of ThreadContext
| * | arm_interface: Remove unused tls_address member of ThreadContextLioncash2018-07-213-9/+0
| |/ | | | | | | | | Currently, the TLS address is set within the scheduler, making this member unused.
* | Merge pull request #755 from lioncash/ctorbunnei2018-07-211-8/+8
|\ \ | | | | | | file_sys/errors: Remove redundant object constructor calls
| * | file_sys/errors: Remove redundant object constructor callsLioncash2018-07-211-8/+8
| |/ | | | | | | | | Given we're already constructing the error code, we don't need to call the constructor inside of it.
* | Merge pull request #751 from Subv/tpidr_el0bunnei2018-07-218-0/+39
|\ \ | | | | | | CPU: Save and restore the TPIDR_EL0 system register on every context switch
| * | CPU: Save and restore the TPIDR_EL0 system register on every context switch.Subv2018-07-218-0/+39
| | | | | | | | | | | | Note that there's currently a dynarmic bug preventing this register from being written.
* | | Merge pull request #753 from lioncash/constbunnei2018-07-214-21/+15
|\ \ \ | | | | | | | | vfs: Minor changes
| * | | vfs_offset: Simplify TrimToFit()Lioncash2018-07-211-1/+2
| | | | | | | | | | | | | | | | | | | | We can simply use std::clamp() here, instead of using an equivalent with std::max() and std::min().
| * | | vfs: Make WriteBytes() overload taking a std::vector pass the std::vector by const referenceLioncash2018-07-214-4/+4
| | | | | | | | | | | | | | | | | | | | Given the data is intended to be directly written, there's no need to take the std::vector by value and copy the data.
| * | | vfs: Use variable template variants of std::is_trivially_copyableLioncash2018-07-211-13/+6
| | | | | | | | | | | | | | | | Provides the same behavior, but with less writing
| * | | vfs: Amend constness on pointers in WriteBytes() and WriteArrays() member functions to be const qualifiedLioncash2018-07-211-3/+3
| | |/ | |/| | | | | | | | | | These functions don't modify the data being pointed to, so these can be pointers to const data
* | | Merge pull request #752 from Subv/vfs_loadbunnei2018-07-211-5/+2
|\ \ \ | |/ / |/| | Loader: Only print the module names and addresses if they actually exist.
| * | Loader: Only print the module names and addresses if they actually exist.Subv2018-07-211-5/+2
| |/
* | Merge pull request #742 from bunnei/misc-apmbunnei2018-07-211-1/+16
|\ \ | | | | | | apm: Improve stub for GetPerformanceConfiguration.
| * | apm: Improve stub for GetPerformanceConfiguration.bunnei2018-07-201-1/+16
| | |
* | | ipc_helpers: Add PushEnum() member function to ResponseBuilderLioncash2018-07-201-0/+19
|/ / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Allows pushing strongly-typed enum members without the need to always cast them at the call sites. Note that we *only* allow strongly-typed enums in this case. The reason for this is that strongly typed enums have a guaranteed defined size, so the size of the data being pushed is always deterministic. With regular enums this can be a little more error-prone, so we disallow them. This function simply uses the underlying type of the enum to determine the size of the data. For example, if an enum is defined as: enum class SomeEnum : u16 { SomeEntry }; if PushEnum(SomeEnum::SomeEntry); is called, then it will push a u16-size amount of data.
* | Merge pull request #740 from Subv/acc_crashbunnei2018-07-201-6/+8
|\ \ | | | | | | HLE/ACC: Stub IManagerForApplication::GetAccountId to return an error.
| * | HLE/ACC: Stub IManagerForApplication::GetAccountId to return an error.Subv2018-07-201-6/+8
| |/ | | | | | | | | | | And make IManagerForApplication::CheckAvailability always return false. Returning a bogus id from GetAccountId causes games to crash on boot. We should investigate this with a hwtest and either stub it properly or implement it.
* | Merge pull request #737 from lioncash/movebunnei2018-07-204-5/+9
|\ \ | | | | | | filesys/loader: std::move VirtualFile instances in constructors where applicable
| * | loader/{nca, nro}: std::move VirtualFile in the constructors where applicableLioncash2018-07-202-2/+4
| | | | | | | | | | | | This avoids unnecessary atomic reference count increments and decrements
| * | vfs_offset: std::move file and name parameters of OffsetVfsFileLioncash2018-07-202-3/+5
| | | | | | | | | | | | | | | Avoids potentially unnecessary atomic reference count incrementing and decrementing, as well as string copying.
* | | Merge pull request #736 from lioncash/nullbunnei2018-07-202-3/+6
|\ \ \ | | | | | | | | audout_u/audren_u: Ensure null terminators are written out in ListAudioOutsImpl(), ListAudioDeviceName(), and GetActiveAudioDeviceName()
| * | | audren_u: Use a std::array instead of std::string for holding the audio interface/device nameLioncash2018-07-201-2/+4
| | | | | | | | | | | | | | | | | | | | std::string doesn't include the null-terminator in its data() + size() range. This ensures that the null-terminator will also be written to the buffer
| * | | audout_u: Use a std::array instead of std::string for holding the audio interface nameLioncash2018-07-201-1/+2
| |/ / | | | | | | | | | | | | | | | Uses a type that doesn't potentially dynamically allocate, and ensures that the name of the interface is properly null-terminated when writing it to the buffer.
* | | Merge pull request #734 from lioncash/threadbunnei2018-07-209-71/+70
|\ \ \ | | | | | | | | thread: Convert ThreadStatus into an enum class
| * | | thread: Convert ThreadStatus into an enum classLioncash2018-07-209-71/+70
| |/ / | | | | | | | | | | | | Makes the thread status strongly typed, so implicit conversions can't happen. It also makes it easier to catch mistakes at compile time.
* | | Merge pull request #733 from lioncash/dirsbunnei2018-07-201-1/+1
|\ \ \ | | | | | | | | partition_filesystem: Return pfs_dirs member variable within GetSubdirectories()
| * | | partition_filesystem: Return pfs_dirs member variable within GetSubdirectories()Lioncash2018-07-201-1/+1
| |/ / | | | | | | | | | | | | This should be returned here, otherwise pfs_dirs is effectively only ever added to, but never read.
* | | Merge pull request #732 from lioncash/unusedbunnei2018-07-201-17/+6
|\ \ \ | |_|/ |/| | nso: Minor changes
| * | nso: Silence implicit sign conversion warningsLioncash2018-07-201-4/+6
| | |
| * | nso: Remove unused function ReadSegment()Lioncash2018-07-201-13/+0
| |/
* / pl_u: Simplify WriteBuffer() calls in GetSharedFontInOrderOfPriority()Lioncash2018-07-201-3/+3
|/ | | | With the new overload, we can simply pass the container directly.
* Merge pull request #726 from lioncash/overloadbunnei2018-07-205-10/+25
|\ | | | | hle_ipc: Introduce generic WriteBuffer overload for multiple container types
| * hle_ipc: Introduce generic WriteBuffer overload for multiple container typesLioncash2018-07-195-10/+25
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This introduces a slightly more generic variant of WriteBuffer(). Notably, this variant doesn't constrain the arguments to only accepting std::vector instances. It accepts whatever adheres to the ContiguousContainer concept in the C++ standard library. This essentially means, std::array, std::string, and std::vector can be used directly with this interface. The interface no longer forces you to solely use containers that dynamically allocate. To ensure our overloads play nice with one another, we only enable the container-based WriteBuffer if the argument is not a pointer, otherwise we fall back to the pointer-based one.
* | Merge pull request #725 from lioncash/bytesbunnei2018-07-201-3/+3
|\ \ | | | | | | pl_u: Specify correct size for buffers in GetSharedFontInOrderOfPriority()
| * | pl_u: Specify correct size for buffers in GetSharedFontInOrderOfPriority()Lioncash2018-07-191-3/+3
| |/ | | | | | | | | This WriteBuffer overload expects its size argument to be in bytes, not elements.
* | Merge pull request #728 from Subv/acc_profilebunnei2018-07-201-7/+16
|\ \ | | | | | | HLE/ACC: Change the default user id and small improvements to the way we handle profiles
| * | HLE/ACC: Return an IProfile that is consistent with what was requested.Subv2018-07-191-5/+15
| | | | | | | | | | | | | | | The default username for now is "yuzu". We should eventually allow the creation of users in the emulator and have the ability to modify their parameters.
| * | HLE/ACC: Change the default user id to be consistent with what we tell games on startup.Subv2018-07-191-2/+1
| | | | | | | | | | | | In IApplicationFunctions::PopLaunchParameter we tell the games that they were launched as user id 1.
* | | Merge pull request #727 from Subv/acc_usersbunnei2018-07-201-4/+6
|\ \ \ | | | | | | | | HLE/ACC: Write a single whole user id in ListAllUsers and ListOpenUsers.
| * | | HLE/ACC: Write a single whole user id in ListAllUsers and ListOpenUsers.Subv2018-07-191-4/+6
| |/ / | | | | | | | | | We only emulate a single user id for now.
* | | Merge pull request #724 from lioncash/printfbunnei2018-07-201-1/+1
|\ \ \ | | | | | | | | pl_u: Remove printf specifier in log call in a log call in GetSharedFontInOrderOfPriority()
| * | | pl_u: Remove printf specifier in log call in a log call in GetSharedFontInOrderOfPriority()Lioncash2018-07-191-1/+1
| | |/ | |/| | | | | | | This can just use the fmt specifiers and be type-agnostic.
* | | Merge pull request #723 from lioncash/gdbbunnei2018-07-201-7/+7
|\ \ \ | | | | | | | | gdbstub: Get rid of a few signed/unsigned comparisons
| * | | gdbstub: Get rid of a few signed/unsigned comparisonsLioncash2018-07-191-7/+7
| | | | | | | | | | | | | | | | Ensures both operands in comparisons are the same signedness.
* | | | Merge pull request #722 from lioncash/signedbunnei2018-07-202-8/+4
|\ \ \ \ | | | | | | | | | | hid: Resolve a signed/unsigned comparison warning
| * | | | hid: Use a ranged-for loops in UpdatePadCallbackLioncash2018-07-191-7/+3
| | | | | | | | | | | | | | | | | | | | | | | | | Modernizes the loops themselves while also getting rid of a signed/unsigned comparison in a loop condition.
| * | | | hid: Use HID_NUM_LAYOUTS constant for indicating size of the layouts arrayLioncash2018-07-191-1/+1
| |/ / / | | | | | | | | | | | | Gets rid of the use of a magic constant
* | | | Merge pull request #721 from lioncash/svcbunnei2018-07-201-3/+4
|\ \ \ \ | | | | | | | | | | svc: Correct always true assertion case in SetThreadCoreMask
| * | | | svc: Correct always true assertion case in SetThreadCoreMaskLioncash2018-07-191-3/+4
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The reason this would never be true is that ideal_processor is a u8 and THREADPROCESSORID_DEFAULT is an s32. In this case, it boils down to how arithmetic conversions are performed before performing the comparison. If an unsigned value has a lesser conversion rank (aka smaller size) than the signed type being compared, then the unsigned value is promoted to the signed value (i.e. u8 -> s32 happens before the comparison). No sign-extension occurs here either. An alternative phrasing: Say we have a variable named core and it's given a value of -2. u8 core = -2; This becomes 254 due to the lack of sign. During integral promotion to the signed type, this still remains as 254, and therefore the condition will always be true, because no matter what value the u8 is given it will never be -2 in terms of 32 bits. Now, if one type was a s32 and one was a u32, this would be entirely different, since they have the same bit width (and the signed type would be converted to unsigned instead of the other way around) but would still have its representation preserved in terms of bits, allowing the comparison to be false in some cases, as opposed to being true all the time. --- We also get rid of two signed/unsigned comparison warnings while we're at it.
* | | | | Merge pull request #719 from lioncash/docsbunnei2018-07-202-5/+5
|\ \ \ \ \ | | | | | | | | | | | | loader: Amend Doxygen comments
| * | | | | loader: Amend Doxygen commentsLioncash2018-07-192-5/+5
| |/ / / / | | | | | | | | | | | | | | | These weren't adjusted when VFS was introduced
* | | | | Merge pull request #718 from lioncash/readbunnei2018-07-201-4/+6
|\ \ \ \ \ | | | | | | | | | | | | loader/nso: Check if read succeeded in IdentifyFile() before checking magic value
| * | | | | loader/nso: Check if read succeeded in IdentifyFile() before checking magic valueLioncash2018-07-191-4/+6
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | We should always assume the filesystem is volatile and check each IO operation. While we're at it reorganize checks so that early-out errors are near one another.
* | | | | | Merge pull request #717 from lioncash/explicitbunnei2018-07-2022-25/+25
|\ \ \ \ \ \ | | | | | | | | | | | | | | hle/service: Make constructors explicit where applicable
| * | | | | | hle/service: Make constructors explicit where applicableLioncash2018-07-1922-25/+25
| |/ / / / / | | | | | | | | | | | | | | | | | | | | | | | | Prevents implicit construction and makes these lingering non-explicit constructors consistent with the rest of the other classes in services.
* | | | | | Merge pull request #716 from lioncash/constructbunnei2018-07-191-9/+4
|\ \ \ \ \ \ | | | | | | | | | | | | | | nvflinger: Emplace Display instances directly
| * | | | | | nvflinger: Emplace Display instances directlyLioncash2018-07-191-9/+4
| |/ / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | We can use emplace_back to construct the Display instances directly, instead of constructing them separately and copying them, avoiding the need to copy std::string and std::vector instances that are part of the Display struct.
* | | | | | Merge pull request #715 from lioncash/const-refbunnei2018-07-191-1/+1
|\ \ \ \ \ \ | |_|_|_|_|/ |/| | | | | nvdrv: Take std::string by const reference in GetDevice()
| * | | | | nvdrv: Take std::string by const reference in GetDevice()Lioncash2018-07-191-1/+1
| |/ / / / | | | | | | | | | | | | | | | | | | | | This is only ever used as a lookup into the device map, so we don't need to take the std::string instance by value here.
* | | | | Merge pull request #720 from Subv/getentrytype_rootSebastian Valle2018-07-191-0/+4
|\ \ \ \ \ | |_|_|_|/ |/| | | | Filesystem: Return EntryType::Directory for the root directory.
| * | | | Filesystem: Return EntryType::Directory for the root directory.Subv2018-07-191-0/+4
| | | | | | | | | | | | | | | | | | | | It is unknown if this is correct behavior, but it makes sense and fixes a regression with Stardew Valley.
* | | | | Merge pull request #714 from lioncash/indexSebastian Valle2018-07-191-1/+1
|\ \ \ \ \ | | | | | | | | | | | | hle_ipc: Amend usage of buffer_index within one of HLERequestContext's WriteBuffer() overloads
| * | | | | hle_ipc: Amend usage of buffer_index within one of HLERequestContext's WriteBuffer() overloadsLioncash2018-07-191-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Previously, the buffer_index parameter was unused, causing all writes to use the buffer index of zero, which is not necessarily what is wanted all the time. Thankfully, all current usages don't use a buffer index other than zero, so this just prevents a bug before it has a chance to spring.
* | | | | | Merge pull request #712 from lioncash/fspbunnei2018-07-191-17/+22
|\ \ \ \ \ \ | |_|_|_|_|/ |/| | | | | fsp_srv: Misc individual changes
| * | | | | fsp_srv: Remove unnecessary vector construction in IFile's Write() functionLioncash2018-07-191-2/+3
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | We can avoid constructing a std::vector here by simply passing a pointer to the original data and the size of the copy we wish to perform to the backend's Write() function instead, avoiding copying the data where it's otherwise not needed.
| * | | | | fsp_srv: Remove unnecessary std::vector construction in IDirectory's Read() functionLioncash2018-07-191-10/+8
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | We were using a second std::vector as a buffer to convert another std::vector's data into a byte sequence, however we can just use pointers to the original data and use them directly with WriteBuffer, which avoids copying the data at all into a separate std::vector. We simply cast the pointers to u8* (which is allowed by the standard, given std::uint8_t is an alias for unsigned char on platforms that we support).
| * | | | | fsp_srv: Make IStorage constructor explicitLioncash2018-07-191-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | Prevents implicit conversions.
| * | | | | fsp_srv: Add missing includesLioncash2018-07-191-0/+5
| | | | | | | | | | | | | | | | | | | | | | | | Gets rid of relying on indirect inclusions.
| * | | | | fsp_srv: Resolve sign-mismatch warnings in assertion comparisonsLioncash2018-07-191-3/+3
| | | | | |
| * | | | | fsp_srv: Respect write length in Write()Lioncash2018-07-191-4/+5
| |/ / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Previously we were just copying the data whole-sale, even if the length was less than the total data size. This effectively makes the actual_data vector useless, which is likely not intended. Instead, amend this to only copy the given length amount of data. At the same time, we can avoid zeroing out the data before using it by passing iterators to the constructor instead of a size.
* | | | | Merge pull request #713 from lioncash/filesysbunnei2018-07-191-3/+3
|\ \ \ \ \ | | | | | | | | | | | | filesystem: Minor changes
| * | | | | filesystem: std::move VirtualDir instance in VfsDirectoryServiceWrapper's constructorLioncash2018-07-191-1/+3
| | | | | | | | | | | | | | | | | | | | | | | | Avoids unnecessary atomic reference count incrementing and decrementing
| * | | | | filesystem: Use std::string's empty() function instead of comparing against a literalLioncash2018-07-191-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This is simply a basic value check as opposed to potentially doing string based operations (unlikely, but still, avoiding it is free).
| * | | | | filesystem: Remove pragma disabling global optimizationsLioncash2018-07-191-2/+0
| |/ / / / | | | | | | | | | | | | | | | This was just an artifact missed during PR review.
* | | | | Merge pull request #694 from lioncash/warnbunnei2018-07-192-6/+4
|\ \ \ \ \ | |_|_|_|/ |/| | | | loader/{nro, nso}: Resolve compilation warnings
| * | | | loader/nro: Resolve sign mismatch warningsLioncash2018-07-191-1/+1
| | | | |
| * | | | loader/nso: Remove unnecessary vector resizesLioncash2018-07-191-4/+2
| | | | | | | | | | | | | | | | | | | | We can just initialize these vectors directly via their constructor.
| * | | | loader/nso: Resolve sign mismatch warningsLioncash2018-07-191-1/+1
| | | | |
* | | | | Merge pull request #703 from lioncash/constbunnei2018-07-192-2/+2
|\ \ \ \ \ | | | | | | | | | | | | savedata_factory: Make SaveDataDescriptor's DebugInfo() function a const member function
| * | | | | savedata_factory: Make SaveDataDescriptor's DebugInfo() function a const member functionLioncash2018-07-192-2/+2
| | | | | | | | | | | | | | | | | | | | | | | | This function doesn't alter class state.
* | | | | | Merge pull request #702 from lioncash/initializebunnei2018-07-192-24/+15
|\ \ \ \ \ \ | |_|_|_|/ / |/| | | | | partition_filesystem: Ensure all class members of PartitionFilesystem are initialized
| * | | | | partition_filesystem: Ensure all class members of PartitionFilesystem are initializedLioncash2018-07-192-24/+15
| |/ / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Previously is_hfs and pfs_header members wouldn't be initialized in the constructor, as they were stored in locals instead. This would result in things like GetName() and PrintDebugInfo() behaving incorrectly. While we're at it, initialize the members to deterministic values as well, in case loading ever fails.
* | | | | Merge pull request #701 from lioncash/movingbunnei2018-07-192-2/+10
|\ \ \ \ \ | |_|_|_|/ |/| | | | content_archive: Minor changes
| * | | | content_archive: Make IsDirectoryExeFS() take a shared_ptr as a const referenceLioncash2018-07-191-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | There's no need to take this by value when it's possible to avoid unnecessary copies entirely like this.
| * | | | content_archive: Add missing standard includesLioncash2018-07-191-0/+5
| | | | |
| * | | | content_archive: std::move VirtualFile in NCA's constructorLioncash2018-07-191-1/+4
| |/ / / | | | | | | | | | | | | | | | | Gets rid of unnecessary atomic reference count incrementing and decrementing.
* | | | Merge pull request #699 from lioncash/vfsbunnei2018-07-191-6/+6
|\ \ \ \ | |_|_|/ |/| | | vfs: Deduplicate accumulation code in VfsDirectory's GetSize()
| * | | vfs: Deduplicate accumulation code in VfsDirectory's GetSize()Lioncash2018-07-191-6/+6
| |/ / | | | | | | | | | We can just use a generic lambda to avoid writing the same thing twice.
* | | Merge pull request #692 from lioncash/assignbunnei2018-07-191-1/+1
|\ \ \ | | | | | | | | address_arbiter: Correct assignment within an assertion statement in WakeThreads()
| * | | address_arbiter: Correct assignment within an assertion statement in WakeThreads()Lioncash2018-07-191-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | This was introduced within 4f81bc4e1bd12e4df7410c6790ba818d8dbba9c0, and considering there's no comment indicating that this is intentional, this is very likely a bug.
* | | | Merge pull request #690 from lioncash/movebunnei2018-07-199-16/+26
|\ \ \ \ | |_|/ / |/| | | core/memory, core/hle/kernel: Use std::move where applicable
| * | | core/memory, core/hle/kernel: Use std::move where applicableLioncash2018-07-199-16/+26
| | | | | | | | | | | | | | | | Avoids pointless copies
* | | | Merge pull request #691 from lioncash/guardbunnei2018-07-191-0/+2
|\ \ \ \ | |_|_|/ |/| | | service/prepo: Add missing header guard
| * | | service/prepo: Add missing header guardLioncash2018-07-191-0/+2
| | |/ | |/|
* | | Merge pull request #688 from lioncash/commabunnei2018-07-191-22/+12
|\ \ \ | | | | | | | | vm_manager: Add missing commas to string literal array elements in GetMemoryStateName()
| * | | vm_manager: Add missing commas to string literal array elements in GetMemoryStateName()Lioncash2018-07-191-22/+12
| | |/ | |/| | | | | | | | | | Without these, this would perform concatenation, which is definitely not what we want here.
* | | Merge pull request #693 from lioncash/unusedbunnei2018-07-191-7/+0
|\ \ \ | | | | | | | | core/memory: Remove unused function GetSpecialHandlers() and an unused variable in ZeroBlock()
| * | | core/memory: Remove unused function GetSpecialHandlers() and an unused variable in ZeroBlock()Lioncash2018-07-191-7/+0
| | |/ | |/|
* | | Merge pull request #687 from lioncash/instancebunnei2018-07-193-7/+11
|\ \ \ | | | | | | | | core: Don't construct instance of Core::System, just to access its live instance
| * | | core: Make System's default constructor privateLioncash2018-07-192-0/+4
| | | | | | | | | | | | | | | | | | | | | | | | This makes it a compilation error to construct additional instances of the System class directly, preventing accidental wasteful constructions over and over.
| * | | core: Don't construct instance of Core::System, just to access its live instanceLioncash2018-07-192-7/+7
| | |/ | |/| | | | | | | | | | | | | | | | | | | | | | This would result in a lot of allocations and related object construction, just to toss it all away immediately after the call. These are definitely not intentional, and it was intended that all of these should have been accessing the static function GetInstance() through the name itself, not constructed instances.
* | | Virtual Filesystem 2: Electric Boogaloo (#676)Zach Hilman2018-07-1949-1862/+1807
| |/ |/| | | | | | | | | | | | | | | | | * Virtual Filesystem * Fix delete bug and documentate * Review fixes + other stuff * Fix puyo regression
* | Fill in more fields in TouchScreenEntryTouchZach Hilman2018-07-181-4/+9
| |
* | Single touch supportZach Hilman2018-07-181-4/+19
|/
* vi: Change TransactionId::CancelBuffer to LOG_CRITICAL.bunnei2018-07-181-1/+1
|
* vi: Fix size for ListDisplays default display.bunnei2018-07-181-2/+2
|
* vi: Partially implement buffer crop parameters.bunnei2018-07-186-10/+26
|
* General Filesystem and Save Data Fixes (#670)Zach Hilman2018-07-1716-212/+256
|
* Merge pull request #671 from MerryMage/clear-exclusive-statebunnei2018-07-176-0/+11
|\ | | | | scheduler: Clear exclusive state when switching contexts
| * scheduler: Clear exclusive state when switching contextsMerryMage2018-07-166-0/+11
| |
* | Merge pull request #672 from SciresM/to_address_fixbunnei2018-07-171-2/+4
|\ \ | | | | | | svc:: Fix bug in svcWaitForAddress
| * | Kernel/Arbiter: Fix bug in WaitIfLessThanMichael Scire2018-07-171-2/+4
| |/
* / nvflinger: Fix for BufferQueue event handling.bunnei2018-07-176-32/+21
|/
* HID: Update controllers less oftenJames Rowe2018-07-151-3/+3
|
* Merge pull request #663 from Subv/bsdbunnei2018-07-151-2/+1
|\ | | | | Services/BSD: Corrected the return for StartMonitoring according to SwIPC
| * Services/BSD: Corrected the return for StartMonitoring according to SwIPC.Subv2018-07-141-2/+1
| |
* | Merge pull request #662 from Subv/delete_filebunnei2018-07-141-2/+4
|\ \ | | | | | | FileSys: Append the requested path to the filesystem base path in DeleteFile
| * | FileSys: Append the requested path to the filesystem base path in DeleteFile.Subv2018-07-141-2/+4
| |/ | | | | | | We were trying to delete things in the current directory instead of the actual filesystem directory. This may fix some savedata issues in some games.
* / No need to use ASSERT_MSG with an empty messageDavid Marcec2018-07-141-2/+2
|/
* More improvements to GDBStub (#653)Hedges2018-07-137-49/+172
| | | | | | | | | | | * More improvements to GDBStub - Debugging of threads should work correctly with source and assembly level stepping and modifying registers and memory, meaning threads and callstacks are fully clickable in VS. - List of modules is available to the client, with assumption that .nro and .nso are backed up by an .elf with symbols, while deconstructed ROMs keep N names. - Initial support for floating point registers. * Tidy up as requested in PR feedback * Tidy up as requested in PR feedback
* We only need to alert for memory pool changesDavid Marcec2018-07-131-2/+0
|
* initialized voice status and unused sizes in the update data headerDavid Marcec2018-07-131-1/+3
|
* Merge pull request #648 from ogniK5377/no-netbunnei2018-07-121-3/+21
|\ | | | | Let games/application know that we're offline
| * Added IsWirelessCommunicationEnabled, IsEthernetCommunicationEnabled, IsAnyInternetRequestAcceptedDavid Marcec2018-07-121-3/+21
| | | | | | | | Since we have no socket implementation we should be returning 0 to indicate we're currently offline.
* | Audout "Auto" functionsDavid Marcec2018-07-122-14/+14
|/ | | | Audout autos are identical to their counterpart except for the buffer type which yuzu already handles for us.
* Merge pull request #559 from Subv/mount_savedatabunnei2018-07-122-2/+12
|\ | | | | Services/FS: Return the correct error code when trying to mount a nonexistent savedata.
| * Services/FS: Return the correct error code when trying to mount a nonexistent savedata.Subv2018-06-192-2/+12
| |
* | hid: Fix timestamps and controller type.bunnei2018-07-111-7/+5
| | | | | | | | - This fixes user input in SMO.
* | Merge pull request #644 from ogniK5377/getconfig-errbunnei2018-07-111-17/+2
|\ \ | | | | | | NvOsGetConfigU32 production impl
| * | NvOsGetConfigU32 production implDavid Marcec2018-07-101-17/+2
| | | | | | | | | | | | | | | Settings are only used when RMOS_SET_PRODUCTION_MODE is set to 0. If production mode is set, the error code 0x30006 is returned instead
* | | Merge pull request #642 from bunnei/create-save-dirbunnei2018-07-101-0/+9
|\ \ \ | |/ / |/| | savedata_factory: Always create a save directory for games.
| * | savedata_factory: Always create a save directory for games.bunnei2018-07-081-0/+9
| | |
* | | nvhost_ctrl: Fix NvOsGetConfigU32 for Snipper Clips.bunnei2018-07-081-1/+1
|/ /
* | Revert "Virtual Filesystem (#597)"bunnei2018-07-0842-1682/+1618
| | | | | | | | This reverts commit 77c684c1140f6bf3fb7d4560d06d2efb1a2ee5e2.
* | Virtual Filesystem (#597)Zach Hilman2018-07-0642-1618/+1682
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * Add VfsFile and VfsDirectory classes * Finish abstract Vfs classes * Implement RealVfsFile (computer fs backend) * Finish RealVfsFile and RealVfsDirectory * Finished OffsetVfsFile * More changes * Fix import paths * Major refactor * Remove double const * Use experimental/filesystem or filesystem depending on compiler * Port partition_filesystem * More changes * More Overhaul * FSP_SRV fixes * Fixes and testing * Try to get filesystem to compile * Filesystem on linux * Remove std::filesystem and document/test * Compile fixes * Missing include * Bug fixes * Fixes * Rename v_file and v_dir * clang-format fix * Rename NGLOG_* to LOG_* * Most review changes * Fix TODO * Guess 'main' to be Directory by filename
* | Update AudioRenderer Voice Sections (#614)David2018-07-031-0/+87
| | | | | | | | | | | | | | | | * voice section updating * fixed slight offset miscalculation * fixed overflow
* | Update clang formatJames Rowe2018-07-0325-114/+106
| |
* | Rename logging macro back to LOG_*James Rowe2018-07-0379-556/+556
| |
* | GPU: Remove a surface from the cache when its backing memory is being unmapped from the GPU's MMU.Subv2018-07-011-0/+5
| |
* | nvmap: Return the address of the nvmap object when Freeing it for the last time.Subv2018-07-012-4/+11
| | | | | | | | This behavior is confirmed by reverse engineering.
* | Merge pull request #595 from bunnei/raster-cachebunnei2018-06-292-0/+3
|\ \ | | | | | | Rewrite the OpenGL rasterizer cache
| * | settings: Add a configuration for use_accurate_framebuffers.bunnei2018-06-272-0/+3
| | |
* | | Merge pull request #588 from mailwl/hwopusbunnei2018-06-284-0/+53
|\ \ \ | |/ / |/| | Service/Audio: add hwopus service, stub GetWorkBufferSize function
| * | Service/Audio: add hwopus service, stub GetWorkBufferSize functionmailwl2018-06-254-0/+53
| | |
* | | Send the correct RequestUpdateAudioRenderer revision in the output header (#587)David2018-06-251-1/+1
|/ / | | | | | | | | | | | | | | * We should be returning our revision instead of what is requested. Hardware test on a 5.1.0 console * Added sysversion comment
* | Removed duplicate structs, changed AudioRendererResponse -> UpdateDataHeader (#583)David2018-06-242-34/+21
| | | | | | | | | | | | | | | | | | | | * Removed duplicate structs, changed AudioRendererResponse -> UpdateDataHeader According to game symbols(SMO), there's references to UpdateDataHeader which seems to be what AudioRendererResponse actually is * oops * AudioRendererParameters should be AudioRendererParameter according to SMO
* | Fixed RequestUpdateAudioRenderer deadlocks and calculated section sizes properly (#580)David2018-06-232-44/+76
| | | | | | | | | | * Fixed RequestUpdateAudioRenderer deadlocks and calculated section sizes properly This fixes RequestUpdateAudioRenderer deadlocks in games like Puyo Puyo Tetris and games which require a proper section size in games such as Retro City Rampage. This fixes causes various games to start rendering or trying to render
* | Merge pull request #579 from SciresM/masterbunnei2018-06-2211-9/+308
|\ \ | | | | | | svc: Fully implement svcSignalToAddress and svcWaitForAddress
| * | Kernel/Arbiters: Fix casts, cleanup comments/magic numbersMichael Scire2018-06-224-17/+27
| | |
| * | Add additional missing format.Michael Scire2018-06-222-21/+27
| | |
| * | Run clang-format on PR.Michael Scire2018-06-223-180/+181
| | |
| * | Kernel/Arbiters: HLE is atomic, adjust code to reflect that.Michael Scire2018-06-222-37/+13
| | |
| * | Kernel/Arbiters: Initialize arb_wait_address in thread struct.Michael Scire2018-06-213-1/+7
| | |
| * | Kernel/Arbiters: Clear WaitAddress in SignalToAddressMichael Scire2018-06-211-0/+1
| | |
| * | Kernel/Arbiters: Mostly implement SignalToAddressMichael Scire2018-06-214-10/+110
| | |
| * | Kernel/Arbiters: Implement WaitForAddressMichael Scire2018-06-214-6/+67
| | |
| * | Kernel/Arbiters: Add stubs for 4.x SignalToAddress/WaitForAddres SVCs.Michael Scire2018-06-217-9/+147
| | |
* | | IPC: skip empty buffer writemailwl2018-06-221-0/+5
| | | | | | | | | | | | prevent yuzu crash, if games, like Axiom Verge, trying to read 0 bytes from file
* | | Merge pull request #577 from mailwl/audren-updatebunnei2018-06-222-49/+60
|\ \ \ | | | | | | | | Service/Audio: update audren:u service
| * | | Service/Audio: update audren:u servicemailwl2018-06-212-49/+60
| |/ /
* / / Add support for decrypted NCA files (#567)Zach Hilman2018-06-219-15/+452
|/ / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * Start to add NCA support in loader * More nca stuff * More changes to nca.cpp * Now identifies decrypted NCA cont. * Game list fixes and more structs and stuff * More updates to Nca class * Now reads ExeFs (i think) * ACTUALLY LOADS EXEFS! * RomFS loads and games execute * Cleanup and Finalize * plumbing, cleanup and testing * fix some things that i didnt think of before * Preliminary Review Changes * Review changes for bunnei and subv
* | Build: Fixed some MSVC warnings in various parts of the code.Subv2018-06-205-10/+11
| |
* | Implement GetAvailableLanguageCodes2 (#575)greggameplayer2018-06-191-4/+1
| | | | | | | | | | | | | | | | | | | | | | | | * Implement GetAvailableLanguageCodes2 * Revert "Implement GetAvailableLanguageCodes2" This reverts commit caadd9eea3497ae2a13382aecb8ca29e1c02c5af. * Implement GetAvailableLanguageCodes2 * Implement GetAvailableLanguageCodes2
* | Merge pull request #561 from DarkLordZach/fix-odyssey-input-crashbunnei2018-06-191-0/+4
|\ \ | | | | | | Avoid initializing single-joycon layouts with handheld controller
| * | Narrow down filter of layout configsZach Hilman2018-06-142-10/+5
| | |
| * | Move loop condition to free functionZach Hilman2018-06-131-4/+9
| | |
| * | Avoid initializing single-joycon layouts with handheld controllerZach Hilman2018-06-132-1/+5
| | |
* | | Merge pull request #572 from Armada651/user-except-stubbunnei2018-06-181-0/+5
|\ \ \ | |/ / |/| | svc: Add a stub for UserExceptionContextAddr.
| * | svc: Add a stub for UserExceptionContextAddr.Jules Blok2018-06-181-0/+5
| | |
* | | hid: Update all layouts and only show handheld as connected, fixes libnx input for P1_AUTOshinyquagsire232018-06-122-2/+3
| |/ |/|
* | Common/string_util: add StringFromBuffer functionmailwl2018-06-071-22/+9
| | | | | | | | convert input buffer (std::vector<u8>) to string, stripping zero chars
* | Merge pull request #522 from mailwl/mm-ubunnei2018-06-074-0/+83
|\ \ | | | | | | Service/MM: add service and stub some functions
| * | Remove unused header filesmailwl2018-06-061-2/+0
| | |
| * | Small fixesmailwl2018-06-052-6/+8
| | |
| * | Service/MM: add service and stub some functionsmailwl2018-06-054-0/+83
| | |
* | | Merge pull request #503 from mailwl/nfp-stubsbunnei2018-06-071-7/+101
|\ \ \ | | | | | | | | Service/nfp:user : stub some functions.
| * | | Stub IUser::AttachAvailabilityChangeEventmailwl2018-06-061-5/+23
| | | |
| * | | Correct function resultsmailwl2018-06-041-4/+16
| | | |
| * | | Service/nfp:user : stub some functions.mailwl2018-06-041-6/+70
| | | | | | | | | | | | | | | | Used by Zelda: BoTW
* | | | nvdrv/devices/nvidia_ctrl_gpu : add IoctlCommands with their params (#524)greggameplayer2018-06-062-0/+53
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * add IoctlCommands with their params in nvidia_ctrl_gpu.h * add function related to the changes done previously * fix clang-format * delete trailing whitespace * correct mistake
* | | | Merge pull request #529 from bunnei/am-nifm-stubsSebastian Valle2018-06-063-2/+23
|\ \ \ \ | | | | | | | | | | Stub SetConnectionConfirmationOption, GetPseudoDeviceId
| * | | | nifm: Stub out IRequest::SetConnectionConfirmationOption.bunnei2018-06-061-1/+10
| | | | |
| * | | | am: Stub out IApplicationFunctions::GetPseudoDeviceId.bunnei2018-06-062-1/+13
| | |/ / | |/| |
* / | | GDB Stub Improvements (#508)Hedges2018-06-064-27/+194
|/ / / | | | | | | | | | | | | | | | | | | | | | | | | | | | * GDB Stub should work now. * Applied clang-format. * Replaced htonll with swap64. * Tidy up.
* | | Nvdrv/devices/nvhost_gpu : Add some IoctlCommands with their params (#511)greggameplayer2018-06-041-0/+47
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * Add some IoctlCommand with their params to nvhost_gpu * fix clang-format * delete trailing whitespace * fix some clang-format * delete one other trailing whitespace * last clang-format fix
* | | am: Implement ILibraryAppletAccessor::PopOutData.bunnei2018-06-041-1/+11
| | |
* | | am: ISelfController:LaunchableEvent should be sticky.bunnei2018-06-041-1/+1
| | |
* | | am: Stub out ILibraryAppletAccessor Start and GetResult methods.bunnei2018-06-041-2/+16
|/ /
* | am: Implement ILibraryAppletAccessor::PushInData.bunnei2018-06-041-43/+55
| |
* | am: Implement IStorageAccessor::Write.bunnei2018-06-041-1/+17
| |
* | am: Cleanup IStorageAccessor::Read.bunnei2018-06-041-5/+3
| |
* | am: Implement ILibraryAppletCreator::CreateStorage.bunnei2018-06-042-21/+34
| |
* | Merge pull request #484 from mailwl/nvhost-nvdecbunnei2018-06-034-0/+74
|\ \ | | | | | | Services/nvdrv: add '/dev/nvhost-nvdec' device
| * | Services/nvdrv: add '/dev/nvhost-nvdec' devicemailwl2018-05-304-0/+74
| | |
* | | Kernel/Threads: A thread waking up by timeout from a WaitProcessWideKey may already have an assigned lock owner.Subv2018-06-021-2/+5
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This situation may happen like so: Thread 1 with low priority calls WaitProcessWideKey with timeout. Thread 2 with high priority calls WaitProcessWideKey without timeout. Thread 3 calls SignalProcessWideKey - Thread 2 acquires the lock and awakens. - Thread 1 can't acquire the lock and is put to sleep with the lock owner being Thread 2. Thread 1's timeout expires, with the lock owner still being set to Thread 2.
* | | Service/time: implement posix time to calendar conversionmailwl2018-06-012-14/+72
| | |
* | | Merge pull request #488 from Subv/thread_masksbunnei2018-06-013-4/+31
|\ \ \ | | | | | | | | Kernel/SVC: Corrected the behavior of svcSetThreadCoreMask for core values -2 and -3.
| * | | Kernel/Thread: Corrected a typo that caused the affinity mask to never be changed.Subv2018-05-311-2/+2
| | | |
| * | | Kernel/SVC: Support special core values -2 and -3 in svcSetThreadCoreMask.Subv2018-05-312-1/+28
| | | | | | | | | | | | | | | | Also added some proper error handling.
| * | | Kernel/Thread: Corrected a typo in an assert about the processor id.Subv2018-05-301-1/+1
| |/ /
* | | add IPC CommandType & Some HID FunctionInfo (#487)greggameplayer2018-05-302-0/+33
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * add some CommandType * add some hid FunctionInfo * add some other HID FunctionInfo * delete non useful comments
* | | nvhost_ctrl: Stub out IocCtrlEventRegister.bunnei2018-05-302-0/+10
| | |
* | | nvhost_ctrl: Stub out IocCtrlEventWaitAsyncCommand.bunnei2018-05-302-5/+9
|/ /
* | Service/BCAT: add module and servicesmailwl2018-05-286-0/+118
| |
* | Merge pull request #475 from ogniK5377/nvos-getconfigbunnei2018-05-271-1/+1
|\ \ | | | | | | NvOsGetConfigU32 should return null instead of 0 for default output value
| * | NvOsGetConfigU32 should return null instead of 0 for default outputDavid Marcec2018-05-271-1/+1
| | |
* | | am: Stub IApplicationFunctions GetDisplayVersion.bunnei2018-05-262-1/+10
|/ /
* | Add & correct miscellaneous things (#470)greggameplayer2018-05-264-4/+55
| | | | | | | | | | | | | | | | | | | | | | | | * add some InfoType * correct OpenApplicationProxy cmd number * add IDisplayController functions * fix clang-format * add more system languages
* | Merge pull request #466 from mailwl/nv-timeoutbunnei2018-05-262-0/+16
|\ \ | | | | | | Stub NVGPU_IOCTL_CHANNEL_SET_TIMEOUT
| * | Stub NVGPU_IOCTL_CHANNEL_SET_TIMEOUTmailwl2018-05-242-0/+16
| | | | | | | | | | | | Used in Nintendo Labo ToyCon 1&2
* | | GetAudioRendererWorkBufferSize impl (#465)David2018-05-262-2/+88
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * GetAudioRendererWorkBufferSize impl Impl of GetAudioRendererWorkBufferSize based on RE, if this can be cleaned up, please contribute! * Naming conventions * Removed unneeded placeholder * lioncache changes * fixed const * switched to Common::AlignUp
* | | Stubbed NVGPU_GPU_IOCTL_ZBC_SET_TABLE (#463)David2018-05-252-0/+22
|/ / | | | | We have no clue on what this actually does yet so stubbing it since it's just input only should be fine for now
* | Fix deadlocks caused from HID having too many layoutsDavid Marcec2018-05-241-1/+1
| | | | | | | | Games such as SMO deadlock if we have more than 2 layouts
* | Merge pull request #460 from greggameplayer/patch-6bunnei2018-05-231-2/+8
|\ \ | | | | | | Add & correct some error modules
| * | Add & correct some error modulesgreggameplayer2018-05-231-2/+8
| | |
* | | Merge pull request #459 from greggameplayer/patch-5bunnei2018-05-233-29/+117
|\ \ \ | | | | | | | | Add ioctl commands with their params and size check
| * | | change some functionsgreggameplayer2018-05-231-6/+6
| | | | | | | | | | | | according to the changes made previously
| * | | correct placement and add size checkgreggameplayer2018-05-231-21/+25
| | | |
| * | | Add ioctl commands with their params and size checkgreggameplayer2018-05-231-2/+86
| |/ /
* | | Merge pull request #454 from Subv/signal_processwidebunnei2018-05-231-83/+74
|\ \ \ | |/ / |/| | Kernel/SVC: Signal the highest priority threads first in svcSignalProcessWideKey
| * | Kernel/SVC: Signal the highest priority threads first in svcSignalProcessWideKey.Subv2018-05-191-51/+68
| | |
| * | Kernel/Threads: Reschedule the proper core when operating on that core's threads.Subv2018-05-191-2/+6
| | |
| * | SVC: Removed unused WaitSynchronization1 functionSubv2018-05-191-30/+0
| | |
* | | Implemented NVHOST_IOCTL_CHANNEL_GET_WAITBASE (#440)David2018-05-222-1/+20
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * Implemented NVHOST_IOCTL_CHANNEL_GET_WAITBASE struct + 4 seems to be hard coded at 0 and struct + 0 seems to be ignored? * IocGetWaitbase -> IocChannelGetWaitbaseCommand * Added super late fixes
* | | Merge pull request #456 from Subv/unmap_bufferbunnei2018-05-214-1/+98
|\ \ \ | | | | | | | | Implemented nvhost-as-gpu's UnmapBuffer and nvmap's Free ioctls.
| * | | GPU: Implemented the nvmap Free ioctl.Subv2018-05-202-1/+48
| | | | | | | | | | | | | | | | It releases a reference to an nvmap object
| * | | GPU: Implemented nvhost-as-gpu's UnmapBuffer ioctl.Subv2018-05-202-0/+50
| |/ / | | | | | | | | | It removes a mapping previously created with the MapBufferEx ioctl.
* | | Correct audio command numbers & add or rename some functions (#455)greggameplayer2018-05-215-34/+34
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * Add unknown function at the number command 2 * correct audout:u commands numbers * correct audrec:u cmd number & add Unknown function * correct IAudioDevice command numbers * correct codecctl cmd numbers & rename the 8 function * correct place of unknown function & fix clang-format
* | | Merge pull request #457 from Subv/mutex_waitersbunnei2018-05-211-1/+0
|\ \ \ | | | | | | | | Mutex: Do not assert when the mutex waiting threads list isn't empty on mutex release.
| * | | Mutex: Do not assert when the mutex waiting threads list isn't empty on mutex release.Subv2018-05-201-1/+0
| |/ / | | | | | | | | | A thread may own multiple mutexes at the same time, and only release one of them while other threads are waiting for the other mutexes.
* | | Merge pull request #445 from greggameplayer/patch-2bunnei2018-05-213-6/+7
|\ \ \ | | | | | | | | Properly rename functions of Fatal Module & add ThrowFatal to this module
| * | | rename fatal:u functions & add ThrowFatalgreggameplayer2018-05-181-2/+3
| | | |
| * | | Properly update fatal.h void namegreggameplayer2018-05-181-2/+2
| | | |
| * | | Properly rename fatal module functionsgreggameplayer2018-05-181-2/+2
| |/ /
* | | Merge pull request #443 from ogniK5377/ipc-500Sebastian Valle2018-05-203-1/+7
|\ \ \ | | | | | | | | Added IPC RequestWithContext & ControlWithContext
| * | | Added RequestWithContext & ControlWithContextDavid Marcec2018-05-173-1/+7
| |/ /
* | | Add and correct some Error Modules (#444)greggameplayer2018-05-201-6/+40
| | | | | | | | | | | | * Add and correct some Error Modules
* | | Updated nfp with more service namesHexagon122018-05-131-24/+24
|/ /
* | Merge pull request #436 from bunnei/multi-corebunnei2018-05-1117-181/+577
|\ \ | | | | | | Initial support for multi-core
| * | core: Add several missing docstrings.bunnei2018-05-111-0/+8
| | |
| * | thread: Rename mask to affinity_masks.bunnei2018-05-113-4/+4
| | |
| * | core: Run all CPU cores separately, even in single-thread mode.bunnei2018-05-112-13/+23
| | |
| * | thread: Support core change on ResumeFromWait and improve ChangeCore.bunnei2018-05-111-37/+68
| | |
| * | scheduler: Protect scheduling functions with a global mutex.bunnei2018-05-112-0/+18
| | |
| * | thread: Initialize ideal_core and mask members.bunnei2018-05-111-0/+2
| | |
| * | threading: Reschedule only on cores that are necessary.bunnei2018-05-114-3/+10
| | |
| * | svc: Implement GetThreadCoreMask and SetThreadCoreMask.bunnei2018-05-111-7/+22
| | |
| * | thread: Implement ChangeCore function.bunnei2018-05-112-1/+58
| | |
| * | svc: SignalProcessWideKey should apply to all cores.bunnei2018-05-111-43/+50
| | |
| * | svc: Implement GetCurrentProcessorNumber.bunnei2018-05-111-2/+2
| | |
| * | core: Add a configuration setting for use_multi_core.bunnei2018-05-115-17/+39
| | |
| * | core: Support session close with multicore.bunnei2018-05-114-16/+47
| | |
| * | core: Implement multicore support.bunnei2018-05-1111-75/+110
| | |
| * | core: Create a thread for each CPU core, keep in lock-step with a barrier.bunnei2018-05-114-18/+94
| | |
| * | core: Move common CPU core things to its own class.bunnei2018-05-115-58/+135
| | |
* | | More accurate GetTPCMasks implDavid Marcec2018-05-112-4/+8
|/ /
* | Stubs for QLaunch (#428)Hexagon122018-05-074-5/+221
| | | | | | | | | | | | | | | | | | | | * Stubs for QLaunch * Wiped unrelated stuff * Addressed comment * Dropped GetPopFromGeneralChannelEvent
* | hid: Tweaks, Analog Sticks (#435)Max Thomas2018-05-073-68/+224
| | | | | | | | | | | | | | | | | | | | | | | | | | | | * hid: Update mouse/keyboard state * hid: Working analog sticks * hid: Nits * hid: Nits * hid: Update mystery sections * hid: Tweaks
* | Merge pull request #434 from lioncash/vdtorbunnei2018-05-033-1/+13
|\ \ | | | | | | memory_hook: Default virtual destructor in the cpp file
| * | memory_hook: Default virtual destructor in the cpp fileLioncash2018-05-033-1/+13
| | | | | | | | | | | | | | | Prevents creating multiple copies of the vtable in every translation unit that uses the class. Also silences a -Wweak-vtables warning
* | | core_timing: Don't include the log header in core timing's headerLioncash2018-05-032-48/+55
|/ / | | | | | | | | Avoids propagating logging macros and facilities to files that may not need them. This also allows hiding an internal constant.
* | Merge pull request #431 from lioncash/fmtbunnei2018-05-0228-103/+104
|\ \ | | | | | | general: Make formatting of logged hex values more straightforward
| * | general: Make formatting of logged hex values more straightforwardLioncash2018-05-0228-103/+104
| | | | | | | | | | | | | | | | | | This makes the formatting expectations more obvious (e.g. any zero padding specified is padding that's entirely dedicated to the value being printed, not any pretty-printing that also gets tacked on).
* | | ipc: Add support for PopIpcInterface() method.bunnei2018-05-024-0/+23
|/ / | | | | | | - This can be used for domain objects as inputs to service functions.
* | Merge pull request #429 from Subv/ioctl_corruptionbunnei2018-05-012-5/+0
|\ \ | | | | | | GPU: Don't write to invalid memory locations when handling ioctls that don't have an output.
| * | GPU: Don't write to invalid memory locations when handling ioctls that don't have an output.Subv2018-05-012-5/+0
| | |
* | | GetSharedFontInOrderOfPriority (#381)David2018-05-014-24/+54
|/ / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * GetSharedFontInOrderOfPriority * Update pl_u.cpp * Ability to use ReadBuffer and WriteBuffer with different buffer indexes, fixed up GetSharedFontInOrderOfPriority * switched to NGLOG * Update pl_u.cpp * Update pl_u.cpp * language_code is actually language code and not index * u32->u64 * final cleanups
* | core_timing: Namespace all functions and constants in core_timing's headerLioncash2018-04-309-14/+18
| | | | | | | | All of these variables and functions are related to timings and should be within the namespace.
* | string_util: Remove StringFromFormat() and related functionsLioncash2018-04-302-4/+3
| | | | | | | | Given we utilize fmt, we don't need to provide our own functions for formatting anymore
* | am: Fix GetDesiredLanguage implementation.bunnei2018-04-291-2/+4
| |
* | set: Fix GetAvailableLanguageCodes implementation.bunnei2018-04-292-6/+45
| |
* | core: Replace usages of LOG_GENERIC with new fmt-capable equivalentsLioncash2018-04-273-6/+4
| |
* | general: Convert assertion macros over to be fmt-compatibleLioncash2018-04-2711-27/+26
| |
* | Merge pull request #380 from ogniK5377/service-implbunnei2018-04-2711-13/+138
|\ \ | | | | | | Implemented some useful interfaces needed for games.
| * | Switched to NGLOG_WARNINGDavid Marcec2018-04-273-4/+4
| | |
| * | Merge branch 'master' of https://github.com/yuzu-emu/yuzu into service-implDavid Marcec2018-04-2684-1072/+1018
| |\ \
| * | | Added PREPO to logging backend, Removed comments from SaveReportWithUserDavid Marcec2018-04-262-13/+2
| | | |
| * | | GetIUserInterface->CreateUserInterface, Added todos and stub logs. Playreport->PlayReport.David Marcec2018-04-239-25/+63
| | | |
| * | | lioncash proposed changesDavid2018-04-221-2/+2
| | | |
| * | | Implemented GetIUserInterface properly, Playreport and SSL::SetInterfaceVersion. Fixed ipc issues with IAudioDevice(wrong ids)David Marcec2018-04-2211-11/+109
| | | |
* | | | core: Replace remaining old non-generic logger usages with fmt-capable equivalentsLioncash2018-04-266-28/+28
| |/ / |/| | | | | | | | | | | | | | LOG_GENERIC usages will be amended in a follow-up to keep API changes separate from interface changes, as it will require removing a parameter from the relevant function in the VMManager class.
* | | core/gdbstub: Move logging macros to new fmt-compatible onesLioncash2018-04-261-38/+37
| | |
* | | core/hw: Move logging macros over to fmt-capable onesLioncash2018-04-262-8/+10
| | |
* | | Merge pull request #398 from lioncash/kernelbunnei2018-04-2611-107/+110
|\ \ \ | | | | | | | | kernel: Migrate logging macros to fmt-compatible ones
| * | | kernel/shared_memory: Remove unnecessary semicolon at end of ConvertPermissions()Lioncash2018-04-261-1/+1
| | | | | | | | | | | | | | | | Functions don't need to be terminated by semicolons.
| * | | kernel: Migrate logging macros to fmt-compatible onesLioncash2018-04-2611-106/+109
| | | |
* | | | Merge pull request #387 from Subv/maxwell_2dbunnei2018-04-261-0/+4
|\ \ \ \ | | | | | | | | | | GPU: Partially implemented the 2D surface copy engine
| * | | | Memory: Added a missing shortcut for Memory::CopyBlock for the current process.Subv2018-04-251-0/+4
| | | | |
* | | | | Merge pull request #395 from lioncash/file-sysbunnei2018-04-268-68/+59
|\ \ \ \ \ | |_|/ / / |/| | | | file-sys: Move logging macros over to the new fmt-capable ones
| * | | | file-sys: convert a StringFromFormat call into fmt::format in GetFullPath()Lioncash2018-04-251-4/+1
| | | | | | | | | | | | | | | | | | | | | | | | | Lessens the amount to read and gets rid of the PRIX64 macro, allowing us to use a single string for the whole path, making it easier to read.
| * | | | file-sys: Move logging macros over to the new fmt-capable onesLioncash2018-04-258-64/+58
| |/ / /
* | | | Merge pull request #390 from mailwl/pctl-modulebunnei2018-04-257-39/+71
|\ \ \ \ | | | | | | | | | | Service/PCTL: convert to module, add services, stub
| * | | | Service/PCTL: convert to module, add services, stubmailwl2018-04-257-39/+71
| |/ / / | | | | | | | | | | | | PCTL::CreateServiceWithoutInitialize and IParentalControlService::Initialize, required by Kirby Star Allies
* | | | core/memory: Amend address widths in assertsLioncash2018-04-251-2/+2
| | | | | | | | | | | | | | | | Addresses are 64-bit, these formatting specifiers are simply holdovers from citra. Adjust them to be the correct width.
* | | | core/memory: Move logging macros over to new fmt-capable onesLioncash2018-04-251-22/+24
|/ / / | | | | | | | | | While we're at it, correct addresses to print all 64 bits where applicable, which were holdovers from citra.
* | | Merge pull request #388 from bunnei/refactor-rasterizer-cachebunnei2018-04-252-17/+50
|\ \ \ | | | | | | | | Refactor rasterizer cache
| * | | gl_rasterizer_cache: Update to be based on GPU addresses, not CPU addresses.bunnei2018-04-252-17/+50
| | | |
* | | | loader: Move old logging macros over to new fmt-capable onesLioncash2018-04-255-26/+25
|/ / /
* | | service: Move logging macros over to new fmt-compatible onesLioncash2018-04-241-5/+5
| | |
* | | vi: Move logging macros over to new fmt-compatible onesLioncash2018-04-241-26/+27
| | |
* | | time: Move logging macros over to new fmt-compatible onesLioncash2018-04-241-12/+12
| | |
* | | ssl: Move logging macros over to new fmt-compatible onesLioncash2018-04-241-3/+3
| | |
* | | spl: Move logging macros over to new fmt-compatible onesLioncash2018-04-241-1/+1
| | |
* | | sockets: Move logging macros over to new fmt-compatible onesLioncash2018-04-242-7/+8
| | |
* | | sm: Move logging macros over to new fmt-compatible onesLioncash2018-04-242-9/+8
| | |
* | | set: Move logging macros over to new fmt-compatible onesLioncash2018-04-242-2/+2
| | |
* | | pctl: Move logging macros over to new fmt-compatible onesLioncash2018-04-241-1/+1
| | |
* | | nvflinger: Move logging macros over to new fmt-compatible onesLioncash2018-04-242-3/+3
| | |
* | | nvdrv: Move logging macros over to new fmt-compatible onesLioncash2018-04-247-60/+61
| | |
* | | ns: Move logging macros over to new fmt-compatible onesLioncash2018-04-241-6/+6
| | |
* | | nifm: Move logging macros over to new fmt-compatible onesLioncash2018-04-241-11/+11
| | |
* | | nfp: Move logging macros over to new fmt-compatible onesLioncash2018-04-241-1/+1
| | |
* | | lm: Move logging macros over to new fmt-compatible onesLioncash2018-04-241-6/+6
| | |
* | | hid: Move logging macros over to new fmt-compatible onesLioncash2018-04-241-25/+25
| | |
* | | friend: Move logging macros over to new fmt-compatible onesLioncash2018-04-241-1/+1
| | |
* | | filesystem: Move logging macros over to new fmt-compatible onesLioncash2018-04-242-30/+29
| | |
* | | fatal: Move logging macros over to new fmt-compatible onesLioncash2018-04-241-2/+2
| | |
* | | audio: Move logging macros over to new fmt-compatible onesLioncash2018-04-242-21/+21
| | |
* | | apm: Move logging macros over to new fmt-compatible onesLioncash2018-04-241-3/+3
| | |
* | | aoc: Move logging macros over to new fmt-compatible onesLioncash2018-04-241-2/+2
| | |
* | | am: Move logging macros over to new fmt-compatible onesLioncash2018-04-243-50/+50
| | |
* | | acc: Move logging macros over to new fmt-compatible onesLioncash2018-04-241-10/+10
| | |
* | | Service/FS: implement IFileSystem::RenameFilemailwl2018-04-246-8/+36
| | |
* | | Merge pull request #370 from Subv/sync_primitivesbunnei2018-04-2314-443/+238
|\ \ \ | | | | | | | | Kernel: Reworked the new kernel synchronization primitives.
| * | | Kernel: Implemented mutex priority inheritance.Subv2018-04-234-10/+94
| | | | | | | | | | | | | | | | | | | | | | | | | | | | Verified with a hwtest and implemented based on reverse engineering. Thread A's priority will get bumped to the highest priority among all the threads that are waiting for a mutex that A holds. Once A releases the mutex and ownership is transferred to B, A's priority will return to normal and B's priority will be bumped.
| * | | Kernel: Use 0x2C as default main thread priority for homebrew and lone NRO/NSOsSubv2018-04-213-3/+3
| | | |
| * | | Qt: Update the WaitTree widget to show info about the current mutex of each thread.Subv2018-04-213-8/+8
| | | |
| * | | Kernel: Remove unused ConditionVariable class.Subv2018-04-216-150/+0
| | | |
| * | | Kernel: Remove old and unused Mutex code.Subv2018-04-214-209/+3
| | | |
| * | | Kernel: Properly implemented svcWaitProcessWideKey and svcSignalProcessWideKeySubv2018-04-211-83/+46
| | | | | | | | | | | | | | | | They work in tandem with guest code to provide synchronization primitives along with svcArbitrateLock/Unlock
| * | | Kernel: Corrected the implementation of svcArbitrateLock and svcArbitrateUnlock.Subv2018-04-216-22/+126
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Switch mutexes are no longer kernel objects, they are managed in userland and only use the kernel to handle the contention case. Mutex addresses store a special flag value (0x40000000) to notify the guest code that there are still some threads waiting for the mutex to be released. This flag is updated when a thread calls ArbitrateUnlock. TODO: * Fix svcWaitProcessWideKey * Fix svcSignalProcessWideKey * Remove the Mutex class.
* | | | Merge pull request #384 from Subv/nvhost-remapbunnei2018-04-232-0/+57
|\ \ \ \ | | | | | | | | | | Nvdrv/nvhost-as-gpu: Implemented the ioctl REMAP command.
| * | | | NvDrv/nvhost-as-gpu: Ensure that the object passed to MapBufferEx has already been allocated.Subv2018-04-231-0/+10
| | | | | | | | | | | | | | | | | | | | Also added a consistency check and a comment for the case when the object id is different than its handle. The real nvservices doesn't make a distinction between ids and handles, each object gets an unique handle which doubles as its id.
| * | | | Nvdrv/nvhost-as-gpu: Implemented the ioctl REMAP command.Subv2018-04-232-0/+47
| | |/ / | |/| | | | | | | | | | It takes a previously-reserved (AllocateSpace) GPU memory address and maps it to the address of the nvmap object passed to Remap.
* / | | Nvdrv: Assert when receiving an unimplemented ioctl in the nv* handlers.Subv2018-04-235-5/+5
|/ / /
* | | Merge pull request #372 from lioncash/enumbunnei2018-04-213-38/+38
|\ \ \ | | | | | | | | resource_limit: Make ResourceTypes an enum class
| * | | resource_limit: Make ResourceTypes an enum classLioncash2018-04-213-38/+38
| | | | | | | | | | | | | | | | Prevents enum identifiers from leaking into the surrounding scope.
* | | | core: Relocate g_service_manager to the System classLioncash2018-04-216-38/+66
|/ / / | | | | | | | | | | | | Converts the service manager from a global into an instance-based variable.
* | | Merge pull request #340 from mailwl/vi-updatebunnei2018-04-201-7/+27
|\ \ \ | |/ / |/| | Service/VI: stub SetLayerVisibility, fix GetDisplayResolution output
| * | Service/VI: stub SetLayerVisibility, fix GetDisplayResolution outputmailwl2018-04-171-7/+27
| | | | | | | | | | | | | | | both SetLayerVisibility() functions used in Lego games, GetDisplayResolution() fixed according switchbrew.org
* | | Merge pull request #367 from lioncash/clampbunnei2018-04-201-1/+2
|\ \ \ | | | | | | | | math_util: Remove the Clamp() function
| * | | math_util: Remove the Clamp() functionLioncash2018-04-201-1/+2
| | | | | | | | | | | | | | | | | | | | C++17 adds clamp() to the standard library, so we can remove ours in favor of it.
* | | | Merge pull request #360 from lioncash/namespacesbunnei2018-04-20136-570/+273
|\ \ \ \ | | | | | | | | | | service: Use nested namespace specifiers where applicable
| * | | | service: Use nested namespace specifiers where applicableLioncash2018-04-20136-570/+273
| |/ / / | | | | | | | | | | | | Tidies up namespace declarations
* | | | Merge pull request #363 from lioncash/array-sizebunnei2018-04-201-1/+2
|\ \ \ \ | | | | | | | | | | common_funcs: Remove ARRAY_SIZE macro
| * | | | common_funcs: Remove ARRAY_SIZE macroLioncash2018-04-201-1/+2
| |/ / / | | | | | | | | | | | | C++17 has non-member size() which we can just call where necessary.
* | | | Merge pull request #358 from lioncash/explicitbunnei2018-04-202-4/+3
|\ \ \ \ | | | | | | | | | | disk_filesystem: Minor changes
| * | | | disk_filesystem: Remove unused total_entries_in_directory member from Disk_DirectoryLioncash2018-04-201-1/+0
| | | | |
| * | | | disk_filesystem: Remove redundant initializer in Disk_Directory's constructorLioncash2018-04-201-1/+1
| | | | |
| * | | | disk_filesystem: Make constructors explicit where applicableLioncash2018-04-201-2/+2
| |/ / /
* / / / vi: Remove redundant initializers in the constructorsLioncash2018-04-201-9/+5
|/ / /
* | | nvflinger: Call MicroProfileFlip on NVFlinger::Compose.bunnei2018-04-191-0/+3
| | |
* | | Merge pull request #341 from shinyquagsire23/pfs-hfs-implbunnei2018-04-173-0/+214
|\ \ \ | |/ / |/| | file_sys: Add HFS/PFS helper component
| * | file_sys: Use NGLOGshinyquagsire232018-04-171-5/+5
| | |
| * | file_sys: tweaksshinyquagsire232018-04-162-6/+7
| | |
| * | file_sys: Add HFS/PFS helper componentshinyquagsire232018-04-163-0/+213
| | |
* | | Various service name fixes - part 2 (rebased) (#322)Hexagon122018-04-1713-11/+207
|/ / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * Updated ACC with more service names * Updated SVC with more service names * Updated set with more service names * Updated sockets with more service names * Updated SPL with more service names * Updated time with more service names * Updated vi with more service names
* | Merge pull request #338 from bunnei/unrequire-shared-fontbunnei2018-04-151-17/+14
|\ \ | | | | | | pl_u: Use empty shared font if none is available.
| * | pl_u: Use empty shared font if none is available.bunnei2018-04-151-17/+14
| | | | | | | | | | | | - Makes games work in lieu of shared_font.bin.
* | | fsp_srv: Implement DeleteFile.bunnei2018-04-156-9/+27
|/ / | | | | | | - Used by Binding of Isaac.
* | Merge pull request #332 from bunnei/fix-total-mem-usagebunnei2018-04-151-1/+1
|\ \ | | | | | | vm_manager: Increase GetTotalMemoryUsage value.
| * | vm_manager: Increase GetTotalMemoryUsage value.bunnei2018-04-151-1/+1
| | | | | | | | | | | | - Gets Binding of Isaac running.
* | | fsp_srv: Implement IFile::Flush.bunnei2018-04-151-1/+9
|/ /
* | Merge pull request #323 from Hexagon12/stub-hidbunnei2018-04-131-1/+7
|\ \ | | | | | | Service/HID: Stubbed out GetPlayerLedPattern
| * | Stubbed out GetPlayerLedPatternHexagon122018-04-131-1/+7
| | |
* | | Fixed normal params in GetDisplayResolutionHexagon122018-04-131-1/+1
|/ /
* | Merge pull request #319 from Hexagon12/service-name-fixbunnei2018-04-1321-65/+413
|\ \ | | | | | | Various service name fixes - part 1
| * | Various fixes and clangHexagon122018-04-116-115/+108
| | |
| * | Decimal changeHexagon122018-04-101-4/+4
| | |
| * | Updated pctl:a with new service names.Hexagon122018-04-101-4/+101
| | |
| * | Updated nvmemp with new service names.Hexagon122018-04-101-4/+4
| | |
| * | Updated nvdrv with more service names.Hexagon122018-04-101-0/+7
| | |
| * | Updated pl:u with more service names.Hexagon122018-04-101-1/+3
| | |
| * | Updated hid with more service names.Hexagon122018-04-101-0/+50
| | |
| * | Updated friend:u with more service names.Hexagon122018-04-101-1/+2
| | |
| * | Updated the unknown nameHexagon122018-04-101-1/+1
| | |
| * | Updated friend:a with more service names.Hexagon122018-04-101-1/+2
| | |
| * | Updated fsp-srv with more service names.Hexagon122018-04-101-4/+102
| | |
| * | Updated CodecCtl with more service names.Hexagon122018-04-101-3/+3
| | |
| * | Updated audren with more service names.Hexagon122018-04-101-10/+14
| | |
| * | Updated audrec with more service names.Hexagon122018-04-101-7/+9
| | |
| * | Updated audout with more service names.Hexagon122018-04-101-13/+16
| | |
| * | Updated audin with more service names.Hexagon122018-04-101-9/+16
| | |
| * | Updated AOC with more service names.Hexagon122018-04-101-0/+1
| | |
| * | Updated AppletOE with more service names.Hexagon122018-04-101-0/+1
| | |
| * | Updated AppletAE with more service names.Hexagon122018-04-101-0/+1
| | |
| * | Updated AM with more service names.Hexagon122018-04-101-2/+82
| | |
* | | Service/SSL: update service according switchbrewmailwl2018-04-112-1/+98
| | |
* | | Service/ACC: convert to module, add acc:aa, acc:su, acc:u1 servicesmailwl2018-04-1011-127/+342
|/ /
* | Fix spelling of InitializeJames Rowe2018-04-072-3/+3
| |
* | core, main.h: Abort on 32Bit ROMs (#309)N00byKing2018-04-064-0/+11
| | | | | | | | | | | | * core, main.h: Abort on 32Bit ROMs * main.cpp: Fix Grammar
* | svc: Stub out SetThreadActivity, GetThreadContext.bunnei2018-04-032-2/+19
| |
* | audren_u: Stub out GetActiveAudioDeviceName.bunnei2018-04-031-1/+13
| |
* | audout_u: Implement GetAudioOutState.bunnei2018-04-031-1/+8
| |
* | nifm: GetResult does not return a data field.bunnei2018-04-031-2/+1
| |
* | vi: Implement GetDisplayResolution.bunnei2018-04-032-0/+26
| |
* | shared_memory: Remove incorrect 3ds-specific check.bunnei2018-04-031-12/+0
| |
* | service: Add friend:u interface.bunnei2018-04-034-0/+41
| |
* | Merge pull request #276 from N00byKing/acctoyuzubunnei2018-04-032-4/+4
|\ \ | | | | | | Change Telemetry Names to yuzu and remove links to citra
| * | telemetry_session.h: Reword Documentation Comment from citra to yuzuN00byKing2018-03-271-2/+2
| | |
| * | Change Telemetry Names to yuzuN00byKing2018-03-271-2/+2
| | |
* | | Merge pull request #304 from daniellimws/fix-openbsdbunnei2018-04-031-6/+6
|\ \ \ | | | | | | | | Fix build on OpenBSD
| * | | externals: Update fmt to 4d35f94Daniel Lim Wee Soong2018-04-021-6/+6
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Versions prior to this didn't compile on OpenBSD due to unconditional use of the non-standard strtod_l() function. The fmt::MemoryWriter API has been removed in the intervening versions, so replace its use with fmt::memory_buffer and fmt::format_to. The library also no longer provides the fmt::fmt ALIAS, so define it in externals/CMakeLists.txt.
* | | | deconstructed_rom_directory.cpp: Fix TypoN00byKing2018-04-031-1/+1
|/ / /
* | | Merge pull request #297 from bunnei/hid-touch-statebunnei2018-04-021-5/+21
|\ \ \ | | | | | | | | hid: Write empty touch screen state.
| * | | hid: Write empty touch screen state.bunnei2018-04-011-5/+21
| | | |
* | | | hle_ipc, fsp_srv: Cleanup logging.bunnei2018-04-012-3/+3
| | | |
* | | | hid: Stub out GetSupportedNpadStyleSet.bunnei2018-03-311-0/+8
| | | |
* | | | hle_ipc: Do not ensure write buffer size.bunnei2018-03-311-2/+5
| | | |
* | | | fsp_srv: Implement GetSize and SetSize.bunnei2018-03-312-4/+24
| | | |
* | | | memory: Fix stack region.bunnei2018-03-316-10/+12
|/ / /
* | | audren_u: Stub QueryAudioDeviceSystemEvent and GetActiveChannelCount.bunnei2018-03-301-8/+36
| | |
* | | svc: Stub GetThreadCoreMask.bunnei2018-03-302-3/+26
| | |
* | | service: Add NFP module interface.bunnei2018-03-306-0/+99
| | | | | | | | | | | | | | | | | | service: Initialize NFP service. Log: Add NFP service as a log subtype.
* | | result: Check against self-assignment in ResultVal's copy assignment operatorLioncash2018-03-291-0/+3
| | | | | | | | | | | | Avoids doing work that doesn't need to be done.
* | | settings: Remove unused CpuCore class.bunnei2018-03-271-5/+0
| | |
* | | config: Use simplified checkbox (from Citra) for CPU JIT.bunnei2018-03-273-10/+7
| | |
* | | config: Rename is_docked to use_docked_mode to be consistent with other config bools.bunnei2018-03-272-6/+6
| | |
* | | config: Add setting for whether the system is docked or not.bunnei2018-03-272-2/+9
|/ /
* | memory: Fix cast for ReadBlock/WriteBlock/ZeroBlock/CopyBlock.bunnei2018-03-271-4/+8
| |
* | memory: Add RasterizerMarkRegionCached code and cleanup.bunnei2018-03-272-200/+195
| |
* | Merge pull request #280 from bunnei/misc-service-fixesbunnei2018-03-255-8/+66
|\ \ | | | | | | Minor changes to VI, PL, HID, and AUDREN
| * | audren_u: Fix GetAudioDevice.bunnei2018-03-252-7/+48
| | |
| * | hid: Stub out SetNpadJoyAssignmentModeDual.bunnei2018-03-251-1/+7
| | |
| * | pl_u: Add RequestLoad.bunnei2018-03-252-0/+11
| | |
* | | Merge pull request #273 from Subv/texturesbunnei2018-03-251-0/+11
|\ \ \ | | | | | | | | GPU: Added code to unswizzle textures and ported the surface viewer from citra
| * | | GPU: Make the debug_context variable a member of the frontend instead of a global.Subv2018-03-251-0/+11
| |/ /
* / / Service/sockets: add bsd:s, nsd:a, nsd:u servicesmailwl2018-03-258-32/+96
|/ /
* | arm_dynarmic: Fix timingMerryMage2018-03-241-7/+3
| |
* | Merge pull request #265 from bunnei/tegra-progress-2bunnei2018-03-244-7/+66
|\ \ | | | | | | Tegra progress 2
| * | renderer_opengl: Fixes for properly flushing & rendering the framebuffer.bunnei2018-03-231-6/+0
| | |
| * | memory: Fix typo in RasterizerFlushVirtualRegion.bunnei2018-03-231-3/+3
| | |
| * | memory: RasterizerFlushVirtualRegion should also check process image region.bunnei2018-03-231-0/+1
| | |
| * | rasterizer: Flush and invalidate regions should be 64-bit.bunnei2018-03-232-3/+3
| | |
| * | renderer_opengl: Better handling of framebuffer transform flags.bunnei2018-03-232-3/+3
| | |
| * | nvdisp_disp0: Always flush and invalidate framebuffer region.bunnei2018-03-231-0/+7
| | | | | | | | | | | | - Workaround for texture forwarding until we have a better place.
| * | memory: Port RasterizerFlushVirtualRegion from Citra.bunnei2018-03-232-1/+58
| | |
| * | video_core: Move FramebufferInfo to FramebufferConfig in GPU.bunnei2018-03-231-3/+3
| | |
* | | Merge pull request #255 from Subv/sd_cardbunnei2018-03-2412-48/+329
|\ \ \ | | | | | | | | FS: Implemented access to the SD card
| * | | FS: Move the file open mode calculation to a separate function.Subv2018-03-231-7/+14
| | | |
| * | | FS: Implemented IFileSystem::CreateDirectory.Subv2018-03-216-7/+29
| | | |
| * | | FS: Implemented IFileSystem's OpenDirectory function.Subv2018-03-201-0/+28
| | | | | | | | | | | | | | | | Note that the filter parameter is not yet implemented.
| * | | FS: Added the IDirectory IPC interface and implemented its two functions.Subv2018-03-201-0/+51
| | | |
| * | | FS: Implement DiskFileSystem's OpenDirectory interface.Subv2018-03-205-6/+19
| | | |
| * | | FS: Implement DiskFileSystem::GetEntryType for existing files/directories.Subv2018-03-201-2/+4
| | | |
| * | | FS: Updated the Directory Entry structure to match the Switch.Subv2018-03-205-30/+84
| | | |
| * | | FS: Support the file Append open mode.Subv2018-03-202-2/+23
| | | |
| * | | FS: Implement MountSdCard.Subv2018-03-201-2/+6
| | | |
| * | | FS: Added an SDMC archive factory and registered it to the SDMC archive on startup.Subv2018-03-205-0/+79
| | | |
* | | | Service/SSL: add ssl servicemailwl2018-03-234-0/+43
| | | |
* | | | Remove more N3DS ReferencesN00byKing2018-03-222-20/+0
| | | |
* | | | Service/spl: add module and servicesmailwl2018-03-228-0/+174
| |/ / |/| |
* | | Service/vi: convert services to modulemailwl2018-03-218-212/+160
| | |
* | | Service: add fatal:u, fatal:p servicesmailwl2018-03-208-0/+144
| | |
* | | Clang FixesN00byKing2018-03-194-8/+9
| | |
* | | oopsN00byKing2018-03-191-3/+3
| | |
* | | More Warning cleanupsN00byKing2018-03-193-3/+3
| | |
* | | Clean Warnings (?)N00byKing2018-03-1914-19/+19
|/ /
* | Merge pull request #193 from N00byKing/3184_2_robotic_boogaloobunnei2018-03-197-41/+41
|\ \ | | | | | | Implement Pull #3184 from citra: core/arm: Improve timing accuracy before service calls in JIT (Rebased)
| * | Implements citra-emu/citra#3184N00byKing2018-02-257-41/+41
| | |
* | | vi: Remove DequeueBuffer and wait until next available buffer.bunnei2018-03-193-12/+49
| | |
* | | hle_ipc: Add SleepClientThread to block current thread within HLE routines.bunnei2018-03-192-0/+47
| | |
* | | hle_ipc: Use shared_ptr instead of unique_ptr to allow copies.bunnei2018-03-192-9/+9
| | |
* | | hle_ipc: Remove GetPointer(..) usage with WriteToOutgoingCommandBuffer.bunnei2018-03-193-7/+14
| | |
* | | thread: Add THREADSTATUS_WAIT_HLE_EVENT, remove THREADSTATUS_WAIT_ARB.bunnei2018-03-193-20/+6
| | |
* | | nvflinger: Remove superfluous buffer format check.bunnei2018-03-171-3/+1
| | |
* | | process: MirrorMemory should use MemoryState::Mapped.bunnei2018-03-171-1/+1
| | |
* | | process: Unmap previously allocated heap.bunnei2018-03-161-1/+3
| | |
* | | arm_interface: Support unmapping previously mapped memory.bunnei2018-03-166-2/+18
| | |
* | | svc: Use more correct values for GetInfo MapRegion and NewMapRegion.bunnei2018-03-163-29/+5
| | |
* | | kernel: Move stack region outside of application heap.bunnei2018-03-166-11/+6
| | |
* | | memory: Add regions for map region, "new" map region, etc.bunnei2018-03-161-19/+29
| | |
* | | process: Fix stack memory state.bunnei2018-03-161-2/+4
| | |
* | | MemoryState: Add additional memory states and improve naming.bunnei2018-03-165-18/+45
| | |
* | | IGeneralService: fix function listmailwl2018-03-161-2/+3
| | |
* | | Service/NIFM: stub cancel functionmailwl2018-03-161-1/+6
| | |
* | | Service/NIFM: convert to modulemailwl2018-03-168-122/+75
| | |
* | | core: Move process creation out of global state.bunnei2018-03-1420-66/+81
| | |
* | | Merge pull request #229 from Subv/ensuresavedata_implbunnei2018-03-0412-43/+91
|\ \ \ | | | | | | | | FS: Make EnsureSaveData create the save data if it doesn't already exist.
| * | | FS: Use the correct error code when trying to open files that don't exist.Subv2018-03-042-26/+6
| | | |
| * | | FS: Stubbed CreateSaveData. It currently does nothing.Subv2018-03-042-0/+15
| | | |
| * | | FS: Make EnsureSaveData create the savedata folder when called for the first time.Subv2018-03-048-17/+70
| | | |
* | | | CoreTiming: Unschedule the pending events when an Interface is destroyed.Subv2018-03-043-2/+10
|/ / /
* | | Merge pull request #226 from Subv/buffer_queue_eventbunnei2018-03-031-0/+3
|\ \ \ | | | | | | | | Vi: Signal the BufferQueue's Native Handle right after ReleaseBuffer is called
| * | | Vi: Signal the BufferQueue's Native Handle right after ReleaseBuffer is called.Subv2018-03-031-0/+3
| | | | | | | | | | | | | | | | | | | | This prevents a thread starvation issue in Puyo Puyo Tetris. We should hwtest this behavior and figure out where exactly this event is signaled.
* | | | Service/Set: add more servicesmailwl2018-03-0312-10/+348
|/ / /
* | | Merge pull request #216 from Subv/savedatabunnei2018-03-0220-39/+541
|\ \ \ | | | | | | | | Implemented the SaveData archive and MountSaveData.
| * | | SaveData: Use the current titleid when opening the savedata archive.Subv2018-03-021-2/+3
| | | |
| * | | Kernel: Store the program id in the Process class instead of the CodeSet class.Subv2018-03-027-21/+20
| | | | | | | | | | | | | | | | There may be many CodeSets per Process, so it's wasteful and overcomplicated to store the program id in each of them.
| * | | FS: Implement MountSaveData and some of the IFile interface.Subv2018-03-022-0/+189
| | | |
| * | | Filesystem: Added a SaveData Factory and associated Disk_FileSystem.Subv2018-03-0210-16/+329
| | | |
| * | | ResultCode: Mark any error code that isn't 0 as an error.Subv2018-02-271-2/+2
| | |/ | |/|
* / | thread: Clear the process list on shutdown.Jules Blok2018-02-271-1/+3
|/ /
* | Merge pull request #207 from mailwl/duplicatesessionbunnei2018-02-273-6/+12
|\ \ | | | | | | IPC: add domain header to response if only it exists in request
| * | Add warning if Domain request has no domain message headermailwl2018-02-201-0/+3
| | |
| * | Fix: change check for domain order and existance of domain message headermailwl2018-02-203-3/+4
| | |
| * | IPC: add domain header to response if only it exists in requestmailwl2018-02-203-6/+8
| | |
* | | Merge pull request #215 from N00byKing/umapsharedmmrybunnei2018-02-262-1/+17
|\ \ \ | | | | | | | | UnmapSharedMemory
| * | | (Hopefully) Fix MinGW BuildN00byKing2018-02-251-1/+1
| | | |
| * | | Add UnmapSharedMemoryN00byKing2018-02-252-1/+17
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | C++11 requires spaces on the Identifier Add inttypes include clang
* | | | file_sys: Style tweaksshinyquagsire232018-02-262-11/+5
| | | | | | | | | | | | | | | | Asdf
* | | | loader: Check error on NPDM load, use TID for CodeSetshinyquagsire232018-02-253-6/+10
| | | |
* | | | loader: Use NPDM information when loading NSOsshinyquagsire232018-02-252-4/+15
| | | |
* | | | file_sys: Add support for parsing NPDM filesshinyquagsire232018-02-253-0/+276
| | | |
* | | | Merge pull request #212 from mailwl/stubsbunnei2018-02-2410-9/+112
|\ \ \ \ | | | | | | | | | | Stub some functions
| * | | | Stub more functionsmailwl2018-02-227-8/+90
| | | | |
| * | | | Stub am::SetScreenShotPermission, and bsd::StartMonitoring functionsmailwl2018-02-225-1/+22
| |/ / /
* | | | Merge pull request #217 from shinyquagsire23/time-s-missingbunnei2018-02-231-0/+4
|\ \ \ \ | | | | | | | | | | time: Add missing time:s functions, used for libnx
| * | | | time: Add missing time:s functions, used for libnxshinyquagsire232018-02-231-0/+4
| |/ / /
* | | | Merge pull request #210 from MerryMage/f/dynarmic/sysregbunnei2018-02-232-2/+33
|\ \ \ \ | |/ / / |/| | | arm_dynarmic: Implement system registers and provide more hooks
| * | | dynarmic: Update to 6b4c6b0MerryMage2018-02-211-2/+18
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | 6b4c6b0 impl: Update PC when raising exception 7a1313a A64: Implement FDIV (vector) b2d781d system: Raise exception for YIELD, WFE, WFI, SEV, SEVL b277bf5 Correct FPSR and FPCR 7673933 A64: Implement USHL 8d0e558 A64: Implement UCVTF (vector, integer), scalar variant da9a4f8 A64: Partially implement FCVTZU (scalar, fixed-point) and FCVTZS (scalar, fixed-point) 7479684 A64: Implement system register TPIDR_EL0 0fd75fd A64: Implement system registers FPCR and FPSR 31e370c A64: Implement system register CNTPCT_EL0 9a88fd3 A64: Implement system register CTR_EL0 1d16896 A64: Implement NEG (vector) 3184edf IR: Add IR instruction ZeroVector 31f8fbc emit_x64_floating_point: Add maybe_unused to preprocess parameter 567eb1a A64: Implement FMINNM (scalar) c6d8fa1 A64: Implement FMAXNM (scalar) 616056d constant_pool: Add frame parameter a3747cb A64: Implement ADDP (scalar) 5cd5d9f reg_alloc: Only exchange GPRs dd0452a A64: Implement DUP (element), scalar variant e5732ea emit_x64_floating_point: Correct FP{Max,Min}{32,64} implementations for -0/+0 40eb9c3 A64: Implement FMAX (scalar), FMIN (scalar) 7cef39b fuzz_with_unicorn: QEMU's implementation of FCVT is incorrect 826dce2 travis: Switch unicorn repository 9605f28 a64/config: Allow NaN emulation accuracy to be set e9435bc a64_emit_x64: Add conf to A64EmitContext 30b596d fuzz_with_unicorn: Explicitly test floating point instructions be292a8 A64: Implement FSQRT (scalar) 3c42d48 backend_x64: Accurately handle NaNs 4aefed0 fuzz_with_unicorn: Print AArch64 disassembly
| * | | arm_dynarmic: LOG_INFO on unicorn fallbackMerryMage2018-02-211-0/+4
| | | |
| * | | memory: LOG_ERROR when falling off end of page tableMerryMage2018-02-211-0/+11
| |/ /
* | | Merge pull request #211 from shinyquagsire23/time_localbunnei2018-02-223-0/+9
|\ \ \ | | | | | | | | time: Add GetStandardLocalSystemClock, used by libnx
| * | | time: Add GetStandardLocalSystemClock, used by libnxshinyquagsire232018-02-223-0/+9
| |/ /
* / / core: Fix scheduler-shutdown related crashMerryMage2018-02-211-5/+9
|/ /
* | Merge pull request #206 from mailwl/aoc-listaddoncontentbunnei2018-02-202-2/+26
|\ \ | | | | | | Service/AOC: stub ListAddOnContent function
| * | Service/AOC: stub ListAddOnContent functionmailwl2018-02-202-2/+26
| | |
* | | acc_u0: Stub ListOpenUsers service function.bunnei2018-02-192-1/+11
| | |
* | | service: Add Friend service interface.bunnei2018-02-196-0/+100
|/ /
* | Merge pull request #202 from bunnei/scheduler-cleanupbunnei2018-02-1910-378/+237
|\ \ | | | | | | Scheduler cleanup
| * | scheduler: Cleanup based on PR feedback.bunnei2018-02-193-5/+4
| | |
| * | kernel: Use Scheduler class for threading.bunnei2018-02-185-173/+24
| | |
| * | kernel: Add Scheduler, which encapsulates the scheduling loading from Thread module.bunnei2018-02-183-0/+210
| | |
| * | core: Use shared_ptr for cpu_core.bunnei2018-02-182-6/+4
| | |
| * | kernel: Remove unused address_arbiter code.bunnei2018-02-185-199/+0
| | |
* | | AM: Corrected the response in EnsureSaveData.Subv2018-02-191-1/+2
|/ / | | | | | | | | The values are still unknown and the function is still considered a stub. Puyo Puyo Tetris now tries to call fsp-srv:MountSaveData.
* | Merge pull request #201 from Subv/ipc_delay_bunnei2018-02-184-50/+63
|\ \ | | | | | | Kernel/IPC: Add a small delay after each SyncRequest to prevent thread starvation.
| * | Kernel/IPC: Add a small delay after each SyncRequest to prevent thread starvation.Subv2018-02-184-50/+63
| | | | | | | | | | | | | | | | | | | | | | | | Ported from citra PR #3091 The delay specified here is from a Nintendo 3DS, and should be measured in a Nintendo Switch. This change is enough to prevent Puyo Puyo Tetris's main thread starvation.
* | | Merge pull request #200 from Subv/bufferproducerfencebunnei2018-02-185-28/+68
|\ \ \ | |/ / |/| | Make the fence handling in Vi a little less of a hack.
| * | nvmap: Make IocFromId return the same existing handle instead of creating a new one.Subv2018-02-171-5/+2
| | | | | | | | | | | | Games like Puyo Puyo Tetris and BOTW seem to depend on the buffer always having the same handle
| * | Parcel: Ensure we don't read past the end of the parcels in Vi.Subv2018-02-171-0/+5
| | |
| * | Vi: Mark all fences as NO_FENCE in the DequeueBuffer response parcel.Subv2018-02-171-2/+2
| | |
| * | Vi: Always write the IGBPBuffer in the RequestBuffer response parcel.Subv2018-02-171-1/+2
| | | | | | | | | | | | This may break libnx homebrew due to a bug in libnx but is required by official games since they always assume that the buffer will be there.
| * | nvhost-ctrl: Stub NVHOST_IOCTL_CTRL_EVENT_WAIT.Subv2018-02-152-0/+25
| | |
| * | Vi: Mark the fences as valid in the DequeueBuffer response parcel.Subv2018-02-151-0/+3
| | |
| * | Vi: Added a missing u32 in the DequeueBuffer response parcel.Subv2018-02-151-0/+1
| | |
| * | Vi: Don't write the IGBPBuffer in the IGBPRequestBufferResponseParcel.Subv2018-02-151-4/+2
| | |
| * | Vi: Properly write the BufferProducerFence object in the DequeueBuffer response parcel.Subv2018-02-152-18/+28
| | |
* | | Service/hid: stub some functionsmailwl2018-02-164-1/+98
| | |
* | | shared_memory: Remove some checks.bunnei2018-02-151-13/+0
| | |
* | | pl_u: Implement basic shared font loading from RAM dump.bunnei2018-02-156-0/+182
| | |
* | | hid: Stub GetVibrationDeviceInfo and SendVibrationValues.bunnei2018-02-151-0/+15
|/ /
* | Merge pull request #188 from bunnei/refactor-buffer-descriptorbunnei2018-02-1511-108/+102
|\ \ | | | | | | Refactor IPC buffer descriptor interface
| * | hle_ipc: Remove const from WriteBuffer size.bunnei2018-02-142-2/+2
| | |
| * | hle_ipc: Add GetReadBufferSize and check write buffer size.bunnei2018-02-142-0/+10
| | |
| * | service: Remove remaining uses of BufferDescriptor*.bunnei2018-02-145-14/+8
| | |
| * | audio: Use WriteBuffer instead of BufferDescriptorB.bunnei2018-02-142-9/+3
| | |
| * | vi: Eliminate direct usage of BufferDescriptorB.bunnei2018-02-141-14/+3
| | |
| * | nvdrv: Use ReadBuffer/WriteBuffer functions for Ioctl.bunnei2018-02-141-17/+5
| | |
| * | vi: Use ReadBuffer/WriteBuffer functions for TransactParcel.bunnei2018-02-141-44/+19
| | |
| * | hle_ipc: Add helper functions for reading and writing buffers.bunnei2018-02-141-4/+2
| | |
| * | hle_ipc: Add helper functions for reading and writing buffers.bunnei2018-02-143-0/+55
| | |
| * | vi: Fix TransactParcelAuto to support both buffer formats.bunnei2018-02-141-25/+16
| | |
* | | Fix fps counter to correctly measure frame end when there was no frame to drawJames Rowe2018-02-141-0/+2
| |/ |/|
* | memory: Silence formatting sepecifier warningsLioncash2018-02-141-21/+30
| |
* | nso: Silence formatting specifier warningsLioncash2018-02-141-2/+4
| |
* | deconstructed_rom_directory: Silence formatting specifier warningsLioncash2018-02-141-3/+4
| |
* | nvdrv/interface: Silence formatting specifier warningsLioncash2018-02-141-1/+2
| |
* | nvmap: Silence formatting specifier warningsLioncash2018-02-141-1/+2
| |
* | nvhost_gpu: Silence formatting specifier warningsLioncash2018-02-141-6/+8
| |
* | nvhost_ctrl: Silence formatting specifier warningsLioncash2018-02-141-2/+2
| |
* | nvhost_ctrl_gpu: Silence formatting specifier warningsLioncash2018-02-141-3/+4
| |
* | nvhost_as_gpu: Silence formatting specifier warningsLioncash2018-02-141-5/+7
| |
* | thread: Silence formatting specifier warningsLioncash2018-02-141-2/+3
| |
* | vm_manager: Silence formatting specifier warningsLioncash2018-02-141-5/+7
| |
* | gdbstub: Silence formatting specifier warningsLioncash2018-02-141-6/+9
|/
* audren_u: Schedule reoccuring event. (#183)bunnei2018-02-142-6/+36
| | | | | | * audren_u: Schedule reoccuring event. * audren_u: Stub GetAudioRenderersProcessMasterVolume, and misc. changes.
* Merge pull request #181 from bunnei/vi-fixes-2bunnei2018-02-141-17/+36
|\ | | | | VI cleanup and add a hack for booting games
| * vi: Add FENCE_HACK, which is useful for booting BOTW.bunnei2018-02-131-7/+21
| |
| * vi: Stub TransactParcel CancelBuffer.bunnei2018-02-131-0/+2
| |
| * TransactParcel: Move WriteBlock to narrowest scope.bunnei2018-02-131-10/+13
| |
* | Merge pull request #184 from mailwl/lmbunnei2018-02-131-20/+49
|\ \ | |/ |/| Service/lm: add support to multiline logs
| * Service/lm: add support to multiline logsmailwl2018-02-131-20/+49
| |
* | arm_dynarmic: Support direct page table accessMerryMage2018-02-122-10/+19
|/
* Merge pull request #179 from gdkchan/audren_stubsbunnei2018-02-121-2/+76
|\ | | | | Stub RequestUpdateAudioRenderer, StartAudioRenderer and StopAudioRenderer
| * Add RequestUpdateAudioRenderer, StartAudioRenderer and StopAudioRenderer stubs to audren:ugdkchan2018-02-121-2/+76
| |
* | Merge pull request #178 from Subv/command_buffersbunnei2018-02-1210-174/+27
|\ \ | |/ |/| GPU: Added a command processor to decode the GPU pushbuffers and forward the commands to their respective engines
| * Make a GPU class in VideoCore to contain the GPU state.Subv2018-02-1210-183/+24
| | | | | | | | Also moved the GPU MemoryManager class to video_core since it makes more sense for it to be there.
| * GPU: Added a command processor to decode the GPU pushbuffers and forward the commands to their respective engines.Subv2018-02-123-3/+5
| |
| * nvdrv: Make the GPU memory manager available to nvhost-gpu.Subv2018-02-123-6/+16
| |
* | vi: Parse IGBPQueueBufferRequestParcel params and expose buffer flip vertical.bunnei2018-02-126-11/+46
| |
* | vi: Fix OpenLayer and CreateStrayLayer.bunnei2018-02-111-6/+8
|/
* fsp_srv: Stub MountSdCard.bunnei2018-02-102-0/+9
|
* apm: Refactor service impl. to support multiple ports.bunnei2018-02-105-58/+102
|
* vi: Implement TransactParcelAuto.bunnei2018-02-101-32/+46
|
* nvflinger: (Hack) Use first available buffer if none are found.bunnei2018-02-101-1/+5
|
* IGBPQueueBufferRequestParcel: Don't enforce buffer length.bunnei2018-02-101-1/+0
| | | | - Another fix for libnx.
* IGBPRequestBufferResponseParcel: Fix response for libnx.bunnei2018-02-101-7/+4
|
* Merge pull request #171 from bunnei/libnx-fixesbunnei2018-02-096-9/+38
|\ | | | | Various fixes for libnx, etc.
| * nvdrv: Fix QueryEvent for libnx.bunnei2018-02-092-4/+8
| |
| * IApplicationDisplayService::CloseDisplay: Fix response params size.bunnei2018-02-091-1/+1
| |
| * nvhost_ctrl_gpu: Implement ZCullGetInfo.bunnei2018-02-091-2/+14
| |
| * acc_u0: Implement ListAllUsers.bunnei2018-02-092-2/+15
| |
* | dynarmic: Update to 41ae12263MerryMage2018-02-092-31/+45
|/ | | | Changes: Primarily implementing more A64 instructions
* nvhost_as_gpu: Implement AllocateSpace and MapBufferEx.bunnei2018-02-082-10/+33
|
* nvdrv: Add MemoryManager class to track GPU memory.bunnei2018-02-083-0/+162
|
* nvmap: Refactor to expose nvmap objects.bunnei2018-02-082-19/+22
|
* nvhost_as_gpu: Add nvmap as a class member.bunnei2018-02-083-2/+9
|
* Service: stub some functions in am, audio, time, vi servicesmailwl2018-02-079-6/+191
|
* Service/hid: stub SetNpadHandheldActivationModemailwl2018-02-061-0/+7
|
* Merge pull request #165 from bunnei/puyo-fixesbunnei2018-02-064-2/+23
|\ | | | | Stubs for HID, AM, and a mutex fix
| * mutex: Update hasWaiters on release.bunnei2018-02-061-0/+1
| |
| * hid: Stub ActivateTouchScreen and SetNpadJoyHoldType.bunnei2018-02-061-2/+14
| |
| * IApplicationFunctions: Stub out EnsureSaveData.bunnei2018-02-062-0/+8
| |
* | Extra nvdrv support (#162)David2018-02-0617-37/+765
|/ | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * FinishInitalize needed for 3.0.1+ games * nvdrv:s and nvdrv:t both use NVDRV * Most settings return 0 on hardware, disabled NV_MEMORY_PROFILER for now. NVN_THROUGH_OPENGL & NVRM_GPU_PREVENT_USE are a few interesting settings to look at. Carefully choosing settings can help with drawing graphics later on * Initial /dev/nvhost-gpu support * ZCullBind * Stubbed SetErrorNotifier * Fixed SetErrorNotifier log, Added SetChannelPriority * Allocate GPFIFO Ex2, Allocate Obj Ctx, Submit GPFIFO * oops * Fixed up naming/structs/enums. Used vector instead of array for "gpfifo_entry" * Added missing fixes * /dev/nvhost-ctrl-gpu * unneeded struct * Forgot u32 in enum class * Automatic descriptor swapping for ioctls, fixed nvgpu_gpu_get_tpc_masks_args being incorrect size * nvdrv#QueryEvent * Renamed logs for nvdrv * Refactor ioctl so nv_result isn't needed * /dev/nvhost-as-gpu * Fixed Log service naming, CtxObjects now u32, renamed all structs, added static_asserts to structs, used INSERT_PADDING_WORDS instead of u32s * nvdevices now uses "Ioctl" union, * IoctlGpfifoEntry now uses bit field * final changes
* Merge pull request #164 from ogniK5377/libnx_sm_fixbunnei2018-02-051-0/+2
|\ | | | | Don't call UNIMPLEMENTED for 'empty services', just return error code
| * Dont call UNIMPLEMENTED for 'empty services', just return error codeDavid Marcec2018-02-051-0/+2
| |
* | Changed .istorage to .romfsDavid Marcec2018-02-052-5/+5
|/
* set: GetAvailableLanguageCodes should not return lang_codes size.bunnei2018-02-051-2/+3
|
* nvflinger: Signal BufferQueue native handle event.bunnei2018-02-051-0/+1
| | | | - This gets BOTW booting.
* logger: Add Time service logging category.bunnei2018-02-051-10/+10
|
* logger: Add SET service logging category.bunnei2018-02-051-1/+1
|
* logger: Add PCTL service logging category.bunnei2018-02-051-1/+1
|
* logger: Add LM service logging category.bunnei2018-02-051-2/+2
|
* logger: Add APM service logging category.bunnei2018-02-051-2/+3
|
* lm: Ensure log string is non-empty before checking back().bunnei2018-02-051-1/+1
|
* logger: Add NIFM service logging category.bunnei2018-02-054-11/+11
|
* logger: Add VI service logging category.bunnei2018-02-054-21/+20
|
* hid: Stub out several functions.bunnei2018-02-051-1/+39
|
* hid: Implement CreateActiveVibrationDeviceList.bunnei2018-02-041-0/+25
|
* logger: Use Service_HID category where applicable.bunnei2018-02-041-2/+2
|
* logger: Use Service_NVDRV category where applicable.bunnei2018-02-042-10/+10
|
* logger: Add AM service logging category.bunnei2018-02-043-42/+42
|
* logger: Add "account" service logging category.bunnei2018-02-041-8/+8
|
* acc_u0: Stub out GetLastOpenedUser.bunnei2018-02-042-0/+10
|
* Merge pull request #160 from bunnei/svc-improvementsbunnei2018-02-045-24/+32
|\ | | | | Several SVC fixes and improvements
| * GetInfo: Implement IsCurrentProcessBeingDebugged.bunnei2018-02-041-0/+3
| |
| * WaitProcessWideKeyAtomic: Handle case where condition variable was already created.bunnei2018-02-043-13/+17
| |
| * svc: SharedMemory size should be 64-bits and cleanup.bunnei2018-02-033-11/+11
| |
| * ArbitrateLock: Assert that requesting_thread is current_thread.bunnei2018-02-031-0/+1
| |
* | acc:u0 : stub GetAccountIdmailwl2018-02-041-1/+9
|/
* Merge pull request #157 from bunnei/fix-duplicate-sessionbunnei2018-02-031-4/+9
|\ | | | | controller: DuplicateSession should return a ClientSession.
| * controller: DuplicateSession should return a ClientSession.bunnei2018-02-031-4/+9
| |
* | Service:nifm: add nifm:a, nifm:s and nifm:u servicesmailwl2018-02-0310-0/+378
|/
* Service/am: Add AppletAE service (#153)mailwl2018-02-027-379/+571
| | | | | | * Add AppletAE, step 1: move common interfaces to am.h * Add AppletAE, step 2
* Merge pull request #154 from mailwl/vi_create_stray_arraybunnei2018-02-021-0/+1
|\ | | | | vi::CreateStrayLayer : add padding to request
| * vi::CreateStrayLayer : add padding to requestmailwl2018-02-021-0/+1
| |
* | Merge pull request #155 from mailwl/vi-servicesbunnei2018-02-026-0/+128
|\ \ | | | | | | Services/vi: add vi:s and vi:u services
| * | Services/vi: add vi:s and vi:u servicesmailwl2018-02-026-0/+128
| |/
* | Merge pull request #152 from shinyquagsire23/sharedmem-valid-boundsbunnei2018-02-021-1/+2
|\ \ | |/ |/| shared_memory: Only mark addresses as invalid if they are within the heap
| * shared_memory: Only mark addresses as invalid if they are within the heapshinyquagsire232018-01-301-1/+2
| |
* | [WIP] sfdnsres: stub (#146)mailwl2018-01-305-2/+52
|/ | | sfdnsres: Add several stubs
* Merge pull request #148 from MerryMage/feature/special-memorybunnei2018-01-278-415/+243
|\ | | | | memory: Replace all memory hooking with Special regions
| * memory: Replace all memory hooking with Special regionsMerryMage2018-01-278-415/+243
| |
* | time: Implement ISteadyClock::GetCurrentTimePoint.bunnei2018-01-262-1/+22
| |
* | audout_u: Various cleanups.bunnei2018-01-251-29/+17
| |
* | ResponseBuilder: Use a bit field for customizing instead of always_move_handles.bunnei2018-01-253-11/+21
| |
* | time: Stub GetSystemClockContext function.bunnei2018-01-252-2/+17
| |
* | server_session: Fix scenario where all domain handlers are closed.bunnei2018-01-251-3/+3
| |
* | hle: Rename RequestBuilder to ResponseBuilder.bunnei2018-01-2519-128/+129
| |
* | service: Fix all incorrect IPC response headers.bunnei2018-01-2514-82/+42
| |
* | ipc_helpers: Make interface domain agnostic and add header validation.bunnei2018-01-252-25/+58
| |
* | hle: Integrate Domain handling into ServerSession.bunnei2018-01-257-38/+74
| |
* | hle: Remove Domain and SyncObject kernel objects.bunnei2018-01-2510-169/+2
| |
* | handle_table: Remove ConvertSessionToDomain.bunnei2018-01-252-17/+0
| |
* | audout:u OpenAudioOut and IAudioOut (#138)st4rk2018-01-252-14/+166
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * Updated the audout:u and IAudioOut, now it might work with RetroArch without trigger an assert, however it's not the ideal implementation * Updated the audout:u and IAudioOut, now it might work with RetroArch without trigger an assert, however it's not the ideal implementation * audout:u OpenAudioOut implementation and IAudioOut cmd 1,2,3,4,5 implementation * using an enum for audio_out_state as well as changing its initialize to member initializer list * Minor fixes, added Service_Audio for LOG_*, changed PcmFormat enum to EnumClass * Minor fixes, added Service_Audio for LOG_*, changed PcmFormat enum to EnumClass * added missing Audio loggin subclass, minor fixes, clang comment breakline * Solving backend logging conflict * minor fix * Fixed duplicated Service NVDRV in backend.cpp, my bad
* | Fix time returning epoch time in milliseconds rather than in secondsgdkchan2018-01-241-1/+1
| |
* | Correct SpellingN00byKing2018-01-231-2/+2
| |
* | Merge pull request #135 from Subv/no_portsbunnei2018-01-235-65/+67
|\ \ | | | | | | IPC: Don't create unnecessary ports when returning sub interfaces.
| * | Services: Added a todo about returning interfaces as domain objects in lm, hid and time.Subv2018-01-233-0/+12
| | |
| * | Time: Don't create unnecessary ports when retrieving the clock service sessions.Subv2018-01-221-33/+27
| | |
| * | HID: Don't create an unnecessary port in CreateAppletResource.Subv2018-01-221-13/+13
| | |
| * | LM: Don't create an unnecessary port in Initialize.Subv2018-01-222-15/+10
| | |
| * | IPC: Don't create an unnecessary port when using PushIpcInterface outside of a domain.Subv2018-01-221-4/+5
| | |
* | | Merge pull request #133 from Subv/nvflinger2bunnei2018-01-229-17/+59
|\ \ \ | |/ / |/| | AppletOE: Stubbed CreateManagedDisplayLayer to create a new layer in the default display.
| * | AppletOE: Stubbed CreateManagedDisplayLayer to create a new layer in the Default display.Subv2018-01-221-0/+14
| | | | | | | | | | | | This function is used by libnx to obtain a new layer.
| * | AppletOE: Make ISelfController keep a reference to nvflinger.Subv2018-01-225-10/+32
| | | | | | | | | | | | It'll be needed when we implement CreateManagedDisplayLayer.
| * | Services: Vi shouldn't be responsible for creating nvflinger.Subv2018-01-225-7/+13
| | | | | | | | | | | | It is now created during Service initialization and passed to all the services that need it.
* | | Merge pull request #134 from gdkchan/audout_hid_fixbunnei2018-01-223-2/+21
|\ \ \ | |/ / |/| | Stub OpenAudioOut and fix a issue with HID IAppletResource
| * | Stub OpenAudioOut and fix a issue with HID IAppletResource being created more than oncegdkchan2018-01-223-2/+21
| | |
* | | VI: Move BufferQueue and NVFlinger to their own folder/namespace.Subv2018-01-229-363/+452
|/ /
* | Added stubs for audio services. (#116)st4rk2018-01-2212-5/+309
| | | | | | | | | | | | * stubs for audout:u, audin:u, audrec:u, audren:u, codecctl and decoding tables with nullptr for future implementations * fixing the changes requested (remove private, explicit)
* | Merge pull request #131 from lioncash/enumbunnei2018-01-222-12/+13
|\ \ | | | | | | nvmap: Make IoctlCommands an enum class
| * | nvmap: Add a return 0 underneath the UNIMPLEMENTED macroLioncash2018-01-211-0/+1
| | | | | | | | | | | | This macro resolves to an empty macro in release builds.
| * | nvmap: Make IoctlCommands an enum classLioncash2018-01-212-12/+12
| | | | | | | | | | | | Prevents the enum values from polluting the surrounding scope
* | | Added nvmemp, Added /dev/nvhost-ctrl, SetClientPID now stores pid (#114)David2018-01-218-5/+162
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * Added nvmemp, Added /dev/nvhost-ctrl, SetClientPID now stores pid * used clang-format-3.9 instead * lowercase pid * Moved nvmemp handlers to cpp * Removed unnecessary logging for NvOsGetConfigU32. Cleaned up log and changed to LOG_DEBUG * using std::arrays instead of c arrays * nvhost get config now uses std::array completely * added pid logging back * updated cmakelist * missing includes * added array, removed memcpy * clang-format6.0
* | | Merge pull request #128 from Subv/parcel_querybunnei2018-01-212-0/+58
|\ \ \ | | | | | | | | VI: Implement the Query transaction of IHOSBinderDriver, and stubbed some results.
| * | | VI: Implement the Query transaction of IHOSBinderDriver, and stubbed some results.Subv2018-01-212-0/+58
| | |/ | |/|
* | | file_sys: Clang format fixes.bunnei2018-01-213-4/+4
| | |
* | | fsp_srv: Various improvements to IStorage:Read implementation.bunnei2018-01-215-48/+79
| | |
* | | deconstructed_rom_directory: Implement istorage loading for RomFS.bunnei2018-01-212-2/+71
| | |
* | | filesystem: Implement basic IStorage functionality.David Marcec2018-01-216-0/+258
| | |
* | | file_sys: Cleanup to better match Switch file system constructs.bunnei2018-01-2110-63/+136
| | | | | | | | | | | | file_sys: Add factory class for RomFS file system.
* | | file_sys: Remove disk_archive, savedata_archive, and title_metadata.bunnei2018-01-217-835/+0
| | |
* | | archive_backend: Minor changes to match Switch IFileSystem.bunnei2018-01-215-26/+26
| | |
* | | file_sys: Repurpose 3DS IVFC code for Switch ROMFS.bunnei2018-01-213-51/+43
| |/ |/|
* | gdbstub: Update registers and sizes for aarch64Rozlette2018-01-211-113/+155
|/ | | | | | | | | | | | | | | | | This gets gdbstub working at least to the point where clients can communicate with it. What works: - Reading/writing GPRegs - Reading/writing memory - Interrupting the emulated program and continuing What does NOT work: - Breakpoints. Sizes have been updated to u64, but support will need to be added in the interpreter for them to work. - VRegs. Mostly because my gdb was having issues with 128-bit regs for some reason. However, the current u128 representation is a bit awkward to use and should probably be updated first.
* Merge pull request #72 from N00byKing/patch-2bunnei2018-01-211-1/+0
|\ | | | | Implement Pull #3275 from citra: core: Don't Shutdown before we've even Init-ed
| * Update core.cppN00byKing2018-01-171-1/+0
| |
* | Merge pull request #92 from gdkchan/nro_refactorbunnei2018-01-211-2/+2
|\ \ | | | | | | Fix NRO entry point
| * | Fix NRO Entry Pointgdkchan2018-01-181-2/+2
| | |
* | | Merge pull request #122 from tgsm/time-remove-pragmabunnei2018-01-212-4/+0
|\ \ \ | | | | | | | | service/time: remove accidental #pragmas
| * | | service/time: remove accidental #pragmastgsm2018-01-212-4/+0
| | | |
* | | | loader: Minor style fix in deconstructed_rom_directoryRozlette2018-01-211-1/+0
|/ / /
* | | Merge pull request #117 from jroweboy/clang-formatbunnei2018-01-2143-57/+62
|\ \ \ | | | | | | | | Clang format as a build target
| * | | Format: Run the new clang format on everythingJames Rowe2018-01-2143-57/+62
| | | |
* | | | Merge pull request #120 from Rozelette/masterbunnei2018-01-201-0/+3
|\ \ \ \ | | | | | | | | | | memory: Return false for large VAddr in IsValidVirtualAddress
| * | | | memory: Return false for large VAddr in IsValidVirtualAddressRozlette2018-01-201-0/+3
| |/ / /
* | | | loader: Clean up ctors and includes.bunnei2018-01-2010-18/+22
| | | |
* | | | loader: Add DeconstructedRomDirectory for game dumps.bunnei2018-01-205-0/+156
| | | |
* | | | loader: Refactor to also pass filepath into IdentifyType.bunnei2018-01-208-19/+19
| | | |
* | | | nso: Remove code specific to directory loading.bunnei2018-01-202-17/+6
|/ / /
* | | Port citra #3352 to yuzu (#103)River City Ransomware2018-01-203-4/+25
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * Port citra #3352 to yuzu This change allows non x86_64 architectures to compile yuzu by skipping the building of dynarmic * Fixed clang-format errors * fixes more clang-format errors
* | | Added CreateSharedMemory & UNIMPLEMENTED() for non existent services. (#113)David2018-01-203-1/+23
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * Added svcCreateSharedMemory * Services which are not implemented now throw UNIMPLEMENTED() * clang-format * changed perms to u32 * removed camelcase
* | | Fixes some cast warnings, partial port of citra #3064 (#106)River City Ransomware2018-01-206-21/+22
| | | | | | | | | | | | | | | | | | | | | | | | * Fixes some cast warnings, partially fixes citra #3064 * Converted casts to uint32_t to u32 * Ran clang-format
* | | Merge pull request #112 from Rozelette/masterbunnei2018-01-191-0/+16
|\ \ \ | | | | | | | | ISelfController: Stub LockExit and UnlockExit
| * | | ISelfController: Stub LockExit and UnlockExitRozlette2018-01-191-0/+16
| | | |
* | | | acc, set, applet_oe: stub various functions, add set service (#105)goaaats2018-01-198-0/+161
|/ / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * Stubs for various acc:u0 funcs needed * Stub for GetDesiredLanguage in IApplicationFunctions * Add set service + stubs needed for games * Fix formatting * Implement IProfile, IManagerForApplication, return bool in CheckAvailability, style fixes * Remove IProfile::Get(needs more research), fix IPC response sizes
* | | Merge pull request #109 from bunnei/libnx-fixesbunnei2018-01-196-1/+26
|\ \ \ | | | | | | | | Fix svcGetInfo for libnx
| * | | nvdrv: Stub SetClientPID.bunnei2018-01-192-0/+13
| | | |
| * | | svc: Fix svcGetInfo MapRegionBaseAddr.bunnei2018-01-193-1/+9
| | | |
| * | | svc: Add additional fields to MemoryInfo struct.bunnei2018-01-191-0/+4
| | | |
* | | | Merge pull request #97 from bunnei/time-stubbunnei2018-01-192-4/+12
|\ \ \ \ | | | | | | | | | | time: Stub out GetTotalLocationNameCount and some cleanup.
| * | | | time: Stub out GetTotalLocationNameCount and some cleanup.bunnei2018-01-192-4/+12
| | | | |
* | | | | time: Add new line to ends of files.bunnei2018-01-194-4/+4
| | | | |
* | | | | applet_oe: Clang-format.bunnei2018-01-191-2/+1
|/ / / /
* / / / Fix dispdrv typogdkchan2018-01-191-1/+1
|/ / /
* | | Merge pull request #100 from Rozelette/masterbunnei2018-01-197-32/+113
|\ \ \ | |/ / |/| | time: Refactor time:* to use a single shared module
| * | time: Fix use of CamelCase in ToCalendarTimeWithMyRuleRozlette2018-01-181-6/+6
| | |
| * | time: Refactor time:* to use a single shared moduleRozlette2018-01-187-26/+107
| | |
* | | Stub PopLaunchParameter and implement Buffer C Descriptors reading on hle_ipc (#96)gdkchan2018-01-185-7/+127
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * Stub PopLaunchParameter and implement Buffer C Descriptors reading * Address PR feedback * Ensure we push a u64 not a size_t * Fix formatting
* | | Start to implement/stub BSD:U and SFDNSRES services (#78)flerovium^-^2018-01-187-0/+159
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * bsd: start stubbing bsd:u and sfdnsres * bsd: stubbed RegisterClient * bsd: attempt to get past socket() * bsd: fix some wrong assumptions about IPC * bsd: fix format specifiers * bsd: stubbed Connect() * bsd: stubbed SendTo() * made requested changes * sockets: respect alphabetical order at service installation * run clang-format * bsd: start stubbing bsd:u and sfdnsres * bsd: stubbed RegisterClient * bsd: attempt to get past socket() * bsd: fix some wrong assumptions about IPC * bsd: fix format specifiers * bsd: stubbed Connect() * bsd: stubbed SendTo() * made requested changes * sockets: respect alphabetical order at service installation * run clang-format * run clang-format (2)
* | | Merge pull request #95 from bunnei/lm-skip-bytebunnei2018-01-181-0/+7
|\ \ \ | |/ / |/| | lm: Minor logging fix to skip a byte.
| * | lm: Minor logging fix to skip a byte.bunnei2018-01-181-0/+7
| | |
* | | Merge pull request #84 from lioncash/cmakebunnei2018-01-181-170/+167
|\ \ \ | | | | | | | | CMakeLists: Derive the source directory grouping from targets themselves
| * | | CMakeLists: Derive the source directory grouping from targets themselvesLioncash2018-01-181-170/+167
| | | | | | | | | | | | | | | | | | | | Removes the need to store to separate SRC and HEADER variables, and then construct the target in most cases.
* | | | Merge pull request #91 from lioncash/svcbunnei2018-01-181-9/+9
|\ \ \ \ | | | | | | | | | | svc: Minor clarity changes
| * | | | svc: Rename some entries to match their analogue on SwitchBrewLioncash2018-01-181-7/+7
| | | | | | | | | | | | | | | | | | | | Makes the codebase a little more consistent with regards to available documentation. Also amends the duplicate case where there was a similar entry at 0x72 named ConnectToPort.
| * | | | svc: Add CreateJitMemory and MapJitMemory svc stringsLioncash2018-01-181-2/+2
| |/ / / | | | | | | | | | | | | Makes the table match SwitchBrew for these entries
* | | | Merge pull request #90 from lioncash/vi-overridebunnei2018-01-181-20/+21
|\ \ \ \ | | | | | | | | | | vi: Minor clean up/correctness changes
| * | | | vi: Make constructors explicit where applicableLioncash2018-01-181-13/+14
| | | | | | | | | | | | | | | | | | | | Prevents implicit conversions.
| * | | | vi: Add missing override specifiersLioncash2018-01-181-7/+7
| |/ / /
* | | | Merge pull request #89 from lioncash/vi-vectorbunnei2018-01-181-2/+3
|\ \ \ \ | |_|/ / |/| | | vi: Copy data directly into the std::vector within Parcel's ReadBlock function
| * | | vi: Copy data directly into the std::vector within Parcel's ReadBlock functionLioncash2018-01-181-2/+3
| |/ / | | | | | | | | | | | | Previously this would unnecessarily zero-initialize the vector before copying the actual data into the vector instance.
* | | controller: Use DuplicateSession for DuplicateSessionEx.bunnei2018-01-182-1/+8
| | |
* | | Merge pull request #80 from gdkchan/nro_fixbunnei2018-01-181-20/+9
|\ \ \ | |/ / |/| | Fix NRO loading
| * | Fix NRO loadinggdkchan2018-01-181-20/+9
| | |
* | | Merge pull request #73 from N00byKing/3093bunnei2018-01-182-0/+2
|\ \ \ | |/ / |/| | Implement Pull #3093 from citra: Added missing headers to CMakeLists.txt and fixed includes.
| * | Update CMakeLists.txtN00byKing2018-01-171-0/+1
| | |
| * | Update title_metadata.hN00byKing2018-01-171-0/+1
| | |
* | | Merge pull request #76 from Rozelette/masterbunnei2018-01-175-85/+164
|\ \ \ | | | | | | | | TIME: consolidate time:* interfaces, stub functions and structs
| * | | TIME: consolidate time:* interfaces, stub functions and structsRozlette2018-01-175-85/+164
| | | |
* | | | Remove relocation on NSO/NROgdkchan2018-01-173-19/+2
|/ / /
* | | Merge pull request #64 from shinyquagsire23/hid-timingbunnei2018-01-171-3/+3
|\ \ \ | | | | | | | | hid: Adjust timing based on actual hardware
| * | | hid: Adjust timing based on actual hardwareshinyquagsire232018-01-171-3/+3
| | | |
* | | | Merge pull request #70 from flerovii/nvdrv-closebunnei2018-01-174-0/+26
|\ \ \ \ | | | | | | | | | | nvdrv: stubbed Close(cmd 2)
| * | | | nvdrv: stubbed Close(cmd 2)Frederic Meyer2018-01-174-0/+26
| | | | |
* | | | | svc: Clang-format fix.bunnei2018-01-171-6/+4
| |_|_|/ |/| | |
* | | | Merge pull request #62 from bunnei/domain-close-handlebunnei2018-01-173-3/+35
|\ \ \ \ | |/ / / |/| | | Implement IPC domain command CloseVirtualHandle
| * | | hle_ipc: Clang format.bunnei2018-01-171-2/+3
| | | |
| * | | ipc: Implement domain command CloseVirtualHandle.bunnei2018-01-173-3/+34
| | | |
* | | | Fix gdbstub typo, fixes Citra #3318River City Ransomware2018-01-171-1/+1
| |/ / |/| | | | | Core::System().GetInstance().IsPoweredOn() -> Core::System::GetInstance().IsPoweredOn()
* | | Merge pull request #60 from jroweboy/game-framebunnei2018-01-172-1/+4
|\ \ \ | |/ / |/| | UI: Fix frame rate perf stats
| * | UI: Fix frame rate perf statsJames Rowe2018-01-172-1/+4
| | | | | | | | | | | | Adds in a missing EndGameFrame when nvdrv swaps buffers
* | | Merge pull request #34 from shinyquagsire23/hid-sharedmem-layouts-circbufs-metabunnei2018-01-172-88/+125
|\ \ \ | |/ / |/| | hid: Write to all layouts, implement circular buffers, set up controller metadata.
| * | hid: clang-formatshinyquagsire232018-01-171-3/+3
| | |
| * | hid: Adjust for style guideshinyquagsire232018-01-172-63/+68
| | |
| * | hid: Write to all layouts, implement circular buffers, set up controller metadata.shinyquagsire232018-01-162-39/+71
| |/
* | acc_u0: Add IPC interface and stub InitializeApplicationInfo.bunnei2018-01-176-0/+86
| |
* | applet_oe: Fix GetOperationMode and GetPerformanceMode.bunnei2018-01-171-2/+2
| |
* | NV: Implemented the nvdrv service, which uses the same interface as nvdrv:aSubv2018-01-174-16/+18
| |
* | NV: Move the nvdrv classes into the Nvidia namespace, and move the functionality to a s single module that services call.Subv2018-01-1713-165/+95
| |
* | VI: Stubbed GetNativeHandle, Create/DestroyStrayLayer and CloseDisplaySubv2018-01-172-3/+85
| |
* | Services: Stubbed APM::OpenSession and the ISession interface.Subv2018-01-173-2/+53
| | | | | | | | | | | | # Conflicts: # src/core/hle/service/am/applet_oe.cpp # src/core/hle/service/apm/apm.cpp
* | AppletOE: Stub a bunch of functions required by libnx homebrew.Subv2018-01-171-4/+62
| |
* | SVC: Correct some return values in svcGetInfo and added TitleId and PrivilegedProcessId stubs.Subv2018-01-171-6/+21
| | | | | | | | | | # Conflicts: # src/core/hle/kernel/svc.cpp
* | SVC: Add 4.0.0+ comment to GetInfoType enum values.Subv2018-01-171-0/+1
| |
* | IPC: Push domain objects as move handles when not in a domain.Subv2018-01-172-2/+28
| |
* | Merge pull request #52 from ogniK5377/fspbunnei2018-01-176-5/+90
|\ \ | | | | | | added more svcGetInfo pairs for 3.0.0+ support, Changed HEAP_SIZE and TLS_AREA_VADDR. changed mem usage & heap usage stub added, ISelfController, IApplication function stubs. Added SetThreadCoreMask
| * | Update memory.hDavid2018-01-171-2/+2
| | |
| * | SetThreadCoreMask stub, time to implement fspDavid Marcec2018-01-161-1/+6
| | |
| * | implemented more of ISelfController and IApplicationFunctionsDavid Marcec2018-01-161-0/+53
| | |
| * | Added more svcGetInfo pairsDavid Marcec2018-01-164-2/+29
| | |
| * | Increased heap size and changed tls area vaddrDavid Marcec2018-01-161-2/+2
| | |
* | | Merge pull request #44 from Rozelette/masterbunnei2018-01-161-3/+7
|\ \ \ | | | | | | | | nso: Modify .bss size calculation logic
| * | | nso: Modify .bss size calculation logicRozlette2018-01-161-3/+7
| | |/ | |/|
* | | clang-formatMerryMage2018-01-1613-37/+31
| |/ |/|
* | Build: Automagically handle unicornJames Rowe2018-01-161-1/+1
| | | | | | | | | | | | | | On MSVC if unicorn isn't found, fallback to bundled unicorn On everything else, fallback to building unicorn in externals Also fixes loading unicorn in msvc
* | Build: Add unicorn as a submodule and build it if neededJames Rowe2018-01-161-1/+1
|/ | | | | | | Adds a cmake custom target that will build unicorn on first compile and uses this in the build scripts as well. Updates Appveyor and Travis build scripts to work with the new unicorn build, and updates the paths to all of the different artifacts.
* nso: Load subsdk4 if available.bunnei2018-01-151-1/+1
|
* pctl: Clang format.bunnei2018-01-151-1/+1
|
* pctl: GetService should return an IParentalControlService interface.bunnei2018-01-151-3/+8
|
* applet_oe: Stub SetFocusHandlingMode, GetCurrentFocusState, SetTerminateResult.bunnei2018-01-151-2/+55
|
* settings: Fix button mappings array to have correct entries.bunnei2018-01-151-2/+6
|
* Merge pull request #16 from shinyquagsire23/hid-sharedmem-impl-startbunnei2018-01-153-17/+450
|\ | | | | HID Sharedmem Impl Start
| * hid: Bare-minimum sharedmem inputshinyquagsire232018-01-152-2/+88
| |
| * hid: Remove redundant HID prefix on structs/enumsshinyquagsire232018-01-151-73/+73
| |
| * settings: Screenshot buttonshinyquagsire232018-01-151-0/+2
| |
| * settings: adjust button configs for Switch controllersshinyquagsire232018-01-151-17/+50
| |
| * hid: Add sharedmem structsshinyquagsire232018-01-151-0/+312
| |
* | vi: Add IManagerDisplayService::CloseDisplay functionbsaleil2018-01-151-0/+10
|/
* Games expect 15 for ICommonStateGetter::ReceiveMessage in order to continue executionDavid Marcec2018-01-151-1/+1
|
* renderer: Render previous frame when no new one is available.bunnei2018-01-151-1/+4
|
* lm: Fix IPC header for Initialize.bunnei2018-01-151-1/+1
|
* time: Implement GetStandardUserSystemClock, GetCurrentTime.bunnei2018-01-156-1/+121
|
* audio: Add files to CMake.bunnei2018-01-152-1/+4
|
* hid: Remove unused registered_loggers.bunnei2018-01-151-3/+0
|
* audio: Stub out AudOutU::ListAudioOuts.bunnei2018-01-155-0/+84
|
* hid: Implement IAppletResource::GetSharedMemoryHandle.bunnei2018-01-153-14/+68
|
* shared_memory: Minor fixes and cleanup.bunnei2018-01-141-6/+6
|
* svc: Implement svcMapSharedMemory.bunnei2018-01-142-1/+38
|
* kernel: Increase default stack size to 64K.bunnei2018-01-141-1/+1
|
* Add missing FileType declarations in GuessFromExtension and GetFileTypeStringThog2018-01-141-0/+8
|
* Update dynarmic to bc73004MerryMage2018-01-131-12/+17
| | | | | | | | | | | | | | | | | | bc73004 a64_merge_interpret_blocks: Remove debug output 4e656ed tests/A64: Randomize PSTATE.<NZCV> fd9530b A64: Optimization: Merge interpret blocks 3c9eb04 testenv: Use format constants 324f3fc tests/A64: Unicorn interface fixes 98ecbe7 tests/A64: Fuzz against unicorn b1d38e7 tests/A64: Move TestEnvironment to own header 5218ad9 A64/data_processing_pcrel: bug: ADR{,P} instructions sign extend their immediate b1a8c39 A64/data_processing_addsub: bug: {ADD,SUB}S (extended register) instructions write to ZR when d = 31 64827fb a64_emit_x64: bug: A64CallSupervisor trampled callee-save registers 1bfa04d emit_x64: bug: OP m/r64, imm32 form instructions sign-extend their immediate on x64 edadeea A64 inferface: Use two argument static_assert 9ab1304 A64: Add ExceptionRaised IR instruction 6843eed Update readme 7438d07 A64/translate: Add TranslateSingleInstruction function
* Fix build on macOS and linuxMerryMage2018-01-131-2/+0
|
* arm_unicorn: Log unmapped memory access address.bunnei2018-01-131-1/+1
|
* yuzu: Update license text to be consistent across project.bunnei2018-01-1361-61/+61
|
* Remove settings issues in sdl and fix a few files that broke in mingwJames Rowe2018-01-132-4/+1
|
* Removing unused settings and yuzu rebrandingJames Rowe2018-01-132-53/+0
|
* Remove gpu debugger and get yuzu qt to compileJames Rowe2018-01-135-69/+1
|
* Remove references to PICA and rasterizers in video_coreJames Rowe2018-01-1313-1492/+1
|
* core: Gut out cryptop, since it doesn't compile with C++17.bunnei2018-01-134-126/+7
|
* configuration: Add cpu_core configuration optionMerryMage2018-01-123-4/+18
|
* arm_dynarmic: Implement coreMerryMage2018-01-127-64/+165
|
* core: Include <algorithm> where used.bunnei2018-01-123-0/+6
|
* nv: Fix more broken asserts.bunnei2018-01-122-3/+3
|
* nvdisp_disp0: Fix broken assert.bunnei2018-01-121-1/+1
|
* core: Fix recent GCC build breaks.bunnei2018-01-122-2/+4
|
* svc: Implement GetSystemTick.bunnei2018-01-122-2/+21
|
* nvdisp_disp0: Call SwapBuffers to render framebuffer.bunnei2018-01-111-0/+7
|
* CMakeLists: Add framebuffer_layout.cpp.bunnei2018-01-111-0/+1
|
* frontend: Update for undocked Switch screen layout.bunnei2018-01-116-274/+39
|
* NV: Move the nv device nodes to their own directory and namespace.Subv2018-01-1111-166/+430
|
* VI: Use a Pulse event instead of OneShot for the vblank events.Subv2018-01-111-1/+1
| | | | This prevents missing frames if the vblank fires between the DequeueBuffer and Wait(vsync) calls
* vi: Use new CoreTiming::EventTypebunnei2018-01-111-1/+5
|
* NV: Expose the nvdisp_disp0 device and a weak reference to the nvdrv:a service.Subv2018-01-116-172/+252
| | | | | | NVFlinger will call into the nvdisp_disp0 device to perform screen flips, bypassing the ioctl interface. We now have the address of the framebuffer to draw, we just need to actually put it on the screen.
* NV: Determine what buffer to draw for each layer of each display.Subv2018-01-112-13/+58
| | | | | | Don't try to draw buffers that the guest application is using, only queued buffers are eligible for drawing. Drawing actual pixels is still not implemented.
* NV: Signal all display's vsync event 60 times per second.Subv2018-01-112-1/+32
|
* NV: Give each display its own vsync event.Subv2018-01-112-12/+29
|
* NV: Keep track of Displays, Layers and BufferQueues in nvflinger.Subv2018-01-114-41/+261
|
* IPC: Allow passing arguments to the Interfaces when using PushIpcInterfaceSubv2018-01-111-3/+3
|
* NV: Implemented (with stubs) the vi:m service and some of its subservices.Subv2018-01-116-0/+726
| | | | The homebrew display test application now properly writes graphics data to the graphics buffer but we still don't have a way to compose the display layers.
* NV: Implemented the nvdrv:a service and the /dev/nvmap device.Subv2018-01-114-0/+354
|
* IPC: Corrected some definitions for the buffer C descriptor flags.Subv2018-01-113-3/+10
|
* svc: Stub ResetSignal and CreateTransferMemorySubv2018-01-112-3/+28
|
* svc: Stub SetMemoryAttributeSubv2018-01-112-0/+11
|
* Threads: Added enum values for the Switch's 4 cpu cores and implemented svcGetInfo(AllowedCpuIdBitmask)Subv2018-01-104-10/+25
|
* Services: Allow lm to log single-character messages.Subv2018-01-101-7/+3
|
* SVC: Fixed WaitSynchronization with multiple handles when none is immediately ready.Subv2018-01-091-7/+18
|
* SVC: Implemented CancelSynchronization.Subv2018-01-092-1/+19
|
* ErrorCodes: Updated the InvalidHandle and Timeout kernel error codes.Subv2018-01-091-2/+7
|
* SVC: Fixed WaitSynchronization with multiple handles when at least one of them is ready.Subv2018-01-092-3/+29
|
* kernel: Rename Semaphore to ConditionVariable.bunnei2018-01-099-161/+169
|
* mutex: Remove unused call to VerifyGuestState.bunnei2018-01-091-3/+0
|
* Kernel: Actually wake up the requested number of threads in Semaphore::Release.Subv2018-01-093-18/+16
| | | | | | Also properly keep track of data in guest memory, this fixes managing the semaphore from userland. It was found that Semaphores are actually Condition Variables, with Release(1) and Release(-1) being equivalent to notify_one and notify_all. We should change the name of the class to reflect this.
* Kernel: Properly keep track of mutex lock data in the guest memory. This fixes userland locking/unlocking.Subv2018-01-093-63/+60
|
* Kernel: Allow chaining WaitSynchronization calls inside a wakeup callback.Subv2018-01-094-30/+78
|
* fix macos buildMerryMage2018-01-091-4/+4
|
* core_timing: Use 1.020GHz for core clock rate.bunnei2018-01-091-5/+3
|
* CoreTiming: Reworked CoreTiming (cherry-picked from Citra #3119)B3n302018-01-097-556/+276
| | | | * CoreTiming: New CoreTiming; Add Test for CoreTiming
* IPC: Make DuplicateSession return the Domain instead of the Session if the request was made on a Domain interface.Subv2018-01-072-2/+7
|
* AppletOE: Fixed command buffer structure for ReceiveMessage.Subv2018-01-071-2/+1
|
* IPC: Corrected some command headers in the IPC Controller interface.Subv2018-01-071-4/+2
|
* IPC: Corrected some command header sizes in appletOE.Subv2018-01-071-12/+21
|
* IPC: Take the number of domain objects as a parameter in MakeBuilder.Subv2018-01-072-4/+6
|
* SM: Fixed connecting to services with an 8-byte name, like appletOE.Subv2018-01-071-12/+4
|
* IPC: Fixed pushing ResultCodes into the command buffer.Subv2018-01-072-7/+9
| | | | They should have 32 bits of padding after the error code now.
* IPC: Add functions to read the input move/copy objects from an IPC request.Subv2018-01-073-2/+42
|
* IPC: Don't attempt to read the command buffer if it holds a Close request.Subv2018-01-071-0/+5
|
* IPC Cleanup: Remove 3DS-specific code and translate copy, move and domain objects in IPC requests.Subv2018-01-078-405/+118
| | | | Popping objects from the buffer is still not implemented.
* IPC: Skip the entire u64 of the command id when receiving an IPC request.Subv2018-01-072-15/+5
| | | | Service code now doesn't have to deal with this.
* IPC: Use the correct size when pushing raw data to the command buffer and fixed pushing domain objects.Subv2018-01-074-10/+29
| | | | Domain object ids are always stored immediately after the raw data.
* svc: Implement svcSignalProcessWideKey.bunnei2018-01-072-4/+23
|
* semaphore: More changes for Switch.bunnei2018-01-072-11/+17
|
* wait_object: Refactor to allow waking up a single thread.bunnei2018-01-072-15/+28
|
* nso: Always load the filepath specified by the user.bunnei2018-01-071-1/+3
|
* core_timing: Increase clock speed for Switch docked.bunnei2018-01-073-3/+3
|
* svc: Implement svcWaitProcessWideKeyAtomic.bunnei2018-01-062-1/+54
|
* semaphore: Updates for Switch.bunnei2018-01-062-21/+31
|
* lm: Assert on unsupported multi-message.bunnei2018-01-061-0/+9
|
* svc: Implement WaitSynchronization for a single handle.bunnei2018-01-061-4/+24
|
* svc: Refactor LockMutex code to use WaitSynchronization1.bunnei2018-01-061-13/+45
|
* lm: Improve Log() to format a useful string.bunnei2018-01-051-10/+75
|
* svc: Add missing string_util include.bunnei2018-01-051-0/+1
|
* cmake: Don't compile Dynarmic as it's unused.bunnei2018-01-041-1/+1
|
* core: Increase tight_loop 100x for speed.bunnei2018-01-041-1/+1
|
* arm_unicorn: Load/release unicorn DLL.bunnei2018-01-041-0/+16
|
* unicorn: Use for arm interface on Windows.bunnei2018-01-044-9/+242
|
* arm_dynarmic: More cleanup.bunnei2018-01-041-6/+0
|
* core: Remove unicorn_dynload.bunnei2018-01-041-2/+0
|
* arm_dynarmic: Gut interface until dynarmic is ready for general use.bunnei2018-01-042-142/+44
|
* arm: Remove SkyEye/Dyncom code that is ARMv6-only.bunnei2018-01-0333-14549/+22
|
* vm_manager: Use a more reasonable MAX_ADDRESS size.bunnei2018-01-031-5/+4
|
* svc: Remove unnecessary "svc" prefix to naming scheme.bunnei2018-01-031-106/+106
|
* pctl: Remove duplicate InstallInterfaces function.bunnei2018-01-031-4/+0
|
* hle: Move SVC code to kernel namespace.bunnei2018-01-034-134/+121
|
* svc: Improve svcGetInfo.bunnei2018-01-012-35/+41
|
* vm_manager: Stub out a bunch of interfaces used by svcGetInfo.bunnei2018-01-012-1/+51
|
* svc: Fix string formatting for CreateThread.bunnei2018-01-011-1/+1
|
* cmake: Add missing object_address_table.bunnei2018-01-011-0/+2
|
* core/video_core: Fix a bunch of u64 -> u32 warnings.bunnei2018-01-014-18/+18
|
* svc: Stub out svcWaitSynchronization.bunnei2018-01-011-1/+9
| | | | - This does not matter until we implement other kernel objects, mutexes use svcLockMutex for waiting.
* svc: Implement svcExitProcess.bunnei2018-01-013-11/+77
|
* svc: Implement svcUnlockMutex.bunnei2018-01-011-1/+11
|
* svc: Implement svcLockMutex.bunnei2018-01-013-24/+134
|
* kernel: Add ObjectAddressTable class.bunnei2018-01-013-2/+101
|
* thread: Keep track of the initially created handle.bunnei2017-12-313-2/+7
| | | | This is kinda crufty, but we need it for now to update guest state variables.
* svc: Implement svcExitThread.bunnei2017-12-311-1/+9
|
* svc: Implement svcCreateThread.bunnei2017-12-311-2/+57
|
* svc: Cleanup svcGetThreadPriority.bunnei2017-12-311-3/+5
|
* svc: Stub out svcGetCurrentProcessorNumber.bunnei2017-12-311-1/+7
|
* errors: Define missing kernel error codes.bunnei2017-12-311-0/+3
|
* svc: Implement svcSetThreadPriority.bunnei2017-12-311-1/+30
|
* svc: Change SignalProcessWideKey to a stub.bunnei2017-12-311-2/+2
|
* function_wrappers: Cleanup, fix warnings, remove unused code.bunnei2017-12-311-187/+35
|
* svc: Implement svcUnmapMemory.bunnei2017-12-313-1/+15
|
* svc: Minor cleanups.bunnei2017-12-301-8/+9
|
* svc: Implement svcStartThread.bunnei2017-12-301-0/+16
|
* thread: Main thread should set thread handle to reg 1.bunnei2017-12-301-1/+4
|
* thread: Remove THUMB mode flag.bunnei2017-12-301-1/+1
|
* thread: Main thread should be ready by default, all others dormant.bunnei2017-12-301-4/+3
|
* kernel: Various 64-bit fixes in memory/process/threadbunnei2017-12-295-14/+14
|
* applet_oe: Stub out a bunch of interfaces necessary for boot.bunnei2017-12-292-1/+159
|
* controller: Implement DuplicateSession.bunnei2017-12-292-9/+11
|
* kernel: Fix implementation of ConvertSessionToDomain.bunnei2017-12-2910-54/+90
|
* ap, aoc_u: Minor cleanup.bunnei2017-12-293-4/+1
|
* service: Add empty interface for pctl:a.bunnei2017-12-296-0/+90
|
* kernel: Add basic support for Domain object.bunnei2017-12-295-4/+112
|
* kernel: Add SyncObject primitive, use it for ClientSession.bunnei2017-12-294-10/+41
|
* svc: Implement MapMemory.bunnei2017-12-293-4/+17
|
* process: Add method to mirror a memory region.bunnei2017-12-292-0/+27
|
* svc: Implement SetHeapSize.bunnei2017-12-282-3/+19
|
* service: Clean up apm/lm/applet_oe/controller/sm ctor/dtor.bunnei2017-12-2810-20/+10
|
* service: Halt on ReportUnimplementedFunction and improve output log.bunnei2017-12-281-4/+2
|
* service: Add empty interface for aoc:u.bunnei2017-12-284-0/+44
|
* service: Return proper result code for IPC::CommandType::Close.bunnei2017-11-014-9/+12
|
* hle: Use Switch formatted result codes.bunnei2017-11-018-346/+110
|
* svc: Implement GetThreadId and GetProcessId.bunnei2017-10-232-2/+37
|
* logging: Rename category "Core_ARM11" to "Core_ARM".bunnei2017-10-238-87/+87
|
* nso: Load more common submodules.bunnei2017-10-231-15/+11
|
* memory: Support 32-bit paging, move heap address space up.bunnei2017-10-232-3/+3
|
* hle: Fix QueryMemory response for MemoryInfo.bunnei2017-10-207-149/+31
|
* lm: Implement lm::Initialize and Logger::log.bunnei2017-10-192-3/+67
|
* hle_ipc: Only copy necessary fields for outgoing command buffer.bunnei2017-10-191-1/+1
|
* hle_ipc: Parse out buffer X/A/B/B descriptors from incoming command buffer.bunnei2017-10-192-14/+19
|
* service: Add CreatePort function (that does not register/install).bunnei2017-10-192-0/+12
|
* memory: Print addresses as 64-bit.bunnei2017-10-191-2/+2
|
* ipc_helpers: Fix alignment (was wrong as a result of a dynarmic bug).bunnei2017-10-181-3/+4
|
* service: Print correct command ID on unimplemented function.bunnei2017-10-181-1/+1
|
* hle: Implement ConvertSessionToDomain, various cleanups.bunnei2017-10-1510-33/+82
|
* core: Refactor MakeMagic usage and remove dead code.bunnei2017-10-159-843/+10
|
* hle: Add service stubs for apm and appletOE.bunnei2017-10-1510-2/+136
|
* hle: Initial implementation of NX service framework and IPC.bunnei2017-10-1516-639/+571
|
* nso: Add a log for loading submodules.bunnei2017-10-141-0/+1
|
* svc: Some logging cleanup.bunnei2017-10-141-7/+5
|
* svc: Update MemoryInfo flags for 64-bit.bunnei2017-10-141-5/+5
|
* svc: Initial nx impl. for QueryMemory, ConnectToPort, SendSyncRequest, etc.bunnei2017-10-141-1185/+185
|
* Remove more 3DS-specific code.bunnei2017-10-135-48/+3
|
* Remove more 3DS-specific code.bunnei2017-10-136-1413/+1
|
* Remove more 3DS-specific code.bunnei2017-10-133-55/+0
|
* Remove lots more 3DS-specific code.bunnei2017-10-1348-6870/+6
|
* hle: Remove a large amount of 3ds-specific service code.bunnei2017-10-10195-22288/+2
|
* Merge remote-tracking branch 'upstream/master' into nxbunnei2017-10-10116-1713/+3915
|\ | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | # Conflicts: # src/core/CMakeLists.txt # src/core/arm/dynarmic/arm_dynarmic.cpp # src/core/arm/dyncom/arm_dyncom.cpp # src/core/hle/kernel/process.cpp # src/core/hle/kernel/thread.cpp # src/core/hle/kernel/thread.h # src/core/hle/kernel/vm_manager.cpp # src/core/loader/3dsx.cpp # src/core/loader/elf.cpp # src/core/loader/ncch.cpp # src/core/memory.cpp # src/core/memory.h # src/core/memory_setup.h
| * Change command header in nwm::UDS Initialize functionDragios2017-10-091-1/+1
| |
| * Merge pull request #2991 from Subv/getpointerSebastian Valle2017-10-083-63/+61
| |\ | | | | | | Remove more usages of GetPointer.
| | * SVC: Removed GetPointer usage in the GetResourceLimit functions.Subv2017-10-041-10/+16
| | |
| | * SVC: Remove GetPointer usage in CreatePort.Subv2017-10-042-6/+4
| | |
| | * SVC: Replace GetPointer usage with ReadCString in ConnectToPort.Subv2017-10-042-20/+9
| | |
| | * SVC: Replace GetPointer usage with ReadBlock in OutputDebugString.Subv2017-10-042-4/+6
| | |
| | * SVC: Replace GetPointer usage with Read32 in ReplyAndReceive.Subv2017-10-042-7/+6
| | |
| | * SVC: Replace GetPointer usage with Read32 in WaitSynchronizationN.Subv2017-10-042-8/+8
| | |
| | * Memory: Remove all GetPointer usages from the GDB stub.Subv2017-10-041-8/+12
| | |
| * | Merge pull request #2975 from shinyquagsire23/archive-ncch-container-and-overrideSebastian Valle2017-10-067-78/+581
| |\ \ | | | | | | | | file_sys/archive_ncch: use NCCHs/.apps instead of .romfs files, NCCH section override
| | * | file_sys, loader: add support for reading TMDs to determine app pathsshinyquagsire232017-10-012-5/+27
| | | |
| | * | file_sys: add class for Title Metadata (TMD)shinyquagsire232017-10-013-0/+338
| | | |
| | * | file_sys/ncch_container: add RomFS, ExeFS override to allow for backward compatibility with existing .romfs system archive dumpsshinyquagsire232017-10-012-69/+206
| | | |
| | * | file_sys/archive_ncch: use NCCHContainer instead of loading .romfs filesshinyquagsire232017-10-011-6/+12
| | | |
| * | | Merge pull request #2953 from Subv/applet_launchSebastian Valle2017-10-042-30/+47
| |\ \ \ | | | | | | | | | | HLE/APT: Always set up the APT parameter when starting a library applet.
| | * | | HLE/APT: Always set up the APT parameter when starting a library applet.Subv2017-09-262-30/+47
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Only use the HLE interface if an HLE applet with the desired id was started. This commit reorganizes the APT code surrounding parameter creation and delivery to make it easier to support LLE applets in the future. As future work, the HLE applet interface can be reworked to utilize the same facilities as the LLE interface.
| * | | | Merge pull request #2977 from Subv/shmem_createbunnei2017-10-031-15/+12
| |\ \ \ \ | | |_|_|/ | |/| | | SharedMemory: Don't take over and unmap the source memory block when creating a shared memory, just reference it
| | * | | Kernel/SharedMemory: Don't take over and unmap the source memory block when creating a shared memory, just reference it.Subv2017-10-021-15/+12
| | | |/ | | |/| | | | | | | | | Also reference the right offset into the backing block for the requested address.
| * | | Merge pull request #2971 from Subv/per_process_memopsSebastian Valle2017-10-014-22/+61
| |\ \ \ | | | | | | | | | | Memory: Add overloads for ReadBlock and WriteBlock that operate on a specific process.
| | * | | Memory: Make WriteBlock take a Process parameter on which to operateSubv2017-10-012-10/+19
| | | | |
| | * | | Memory: Make ReadBlock take a Process parameter on which to operateSubv2017-10-012-12/+30
| | | | |
| | * | | Kernel/Thread: Added a helper function to get a thread's command buffer VAddr.Subv2017-10-012-0/+12
| | | | |
| * | | | Merge pull request #2974 from Subv/nim_eventSebastian Valle2017-10-013-2/+29
| |\ \ \ \ | | |_|/ / | |/| | | Services/NIM: Implement CheckForSysUpdateEvent.
| | * | | Services/NIM: Implement CheckForSysUpdateEvent.Subv2017-09-303-2/+29
| | | | | | | | | | | | | | | | | | | | | | | | | Implementation verified by reverse engineering. This lets the Home Menu boot without crashing on startup.
| * | | | Moved down_count to CoreTimingHuw Pascoe2017-09-308-42/+32
| |/ / /
| * | | Services/UDS: Handle the rest of the connection sequence. (#2963)B3n302017-09-303-19/+250
| | | | | | | | | | | | Services/UDS: Handle the rest of the connection sequence.
| * | | Merge pull request #2946 from Subv/home_menu_aptSebastian Valle2017-09-303-8/+45
| |\ \ \ | | | | | | | | | | Implement PrepareToStartNewestHomeMenu and fixed an APT regression.
| | * | | HLE/APT: Always return an error from PrepareToStartNewestHomeMenu so that the Home Menu doesn't try to reboot the system.Subv2017-09-243-2/+26
| | | | | | | | | | | | | | | | | | | | | | | | | As per 3dbrew: "During Home Menu start-up it uses APT:PrepareToStartNewestHomeMenu. If that doesn't return an error(normally NS returns 0xC8A0CFFC for that), Home Menu starts a hardware reboot with APT:StartNewestHomeMenu etc. "
| | * | | HLE/APT: Prepare the APT Wakeup parameter when the game calls InitializeSubv2017-09-241-6/+19
| | | |/ | | |/| | | | | | | | | | | | | We need to know what is being run so we can set the APT parameter destination AppId correctly. Delaying the preparation of the parameter until we know which AppId is running lets us support booting both the Home Menu and normal game Applications.
| * | | Merge pull request #2967 from Subv/thread_wakeup_callbacksSebastian Valle2017-09-304-17/+91
| |\ \ \ | | |_|/ | |/| | Kernel/Threads: When putting a thread to wait, specify a function to execute when it is awoken
| | * | Kernel/Threads: When putting a thread to wait, specify a function to execute when it is awoken.Subv2017-09-284-17/+91
| | | | | | | | | | | | | | | | | | | | | | | | This change makes for a clearer (less confusing) path of execution in the scheduler, now the code to execute when a thread awakes is closer to the code that puts the thread to sleep (WaitSynch1, WaitSynchN). It also allows us to implement the special wake up behavior of ReplyAndReceive without hacking up WaitObject::WakeupAllWaitingThreads. If savestates are desired in the future, we can change this implementation to one similar to the CoreTiming event system, where we first register the callback functions at startup and assign their identifiers to the Thread callback variable instead of directly assigning a lambda to the wake up callback variable.
| * | | Fixed type conversion ambiguityHuw Pascoe2017-09-3023-72/+83
| | | |
| * | | Merge pull request #2961 from Subv/load_titlesbunnei2017-09-2914-61/+87
| |\ \ \ | | |/ / | |/| | Loaders: Don't automatically set the current process every time we load an application.
| | * | Loaders: Don't automatically set the current process every time we load an application.Subv2017-09-278-37/+40
| | | | | | | | | | | | | | | | The loaders will now just create a Kernel::Process, construct it and return it to the caller, which is responsible for setting it as the current process and configuring the global page table.
| | * | Kernel/Thread: Allow specifying which process a thread belongs to when creating it.Subv2017-09-274-17/+22
| | | | | | | | | | | | | | | | Don't automatically assume that Thread::Create will only be called when the parent process is currently scheduled. This assumption will be broken when applets or system modules are loaded.
| | * | Memory: Allow IsValidVirtualAddress to be called with a specific process parameter.Subv2017-09-272-7/+25
| | | | | | | | | | | | | | | | There is still an overload of IsValidVirtualAddress that only takes the VAddr and will default to the current process.
| * | | Merge pull request #2954 from Subv/cache_unmapped_memJames Rowe2017-09-271-1/+16
| |\ \ \ | | |/ / | |/| | Memory/RasterizerCache: Ignore unmapped memory regions when caching physical regions
| | * | Memory/RasterizerCache: Ignore unmapped memory regions when caching physical regions.Subv2017-09-261-1/+16
| | |/ | | | | | | | | | | | | | | | Not all physical regions need to be mapped into the address space of every process, for example, system modules do not have a VRAM mapping. This fixes a crash when loading applets and system modules.
| * | HLE/Archives: Allow multiple loaded applications to access their SelfNCCH archive independently.Subv2017-09-256-18/+65
| | | | | | | | | | | | | | | | | | | | | | | | The loaders now register each loaded ROM with the SelfNCCH factory, which keeps the data around for the duration of the emulation session. When opening the SelfNCCH archive, the factory queries the current program's programid and uses that as a key to the map that contains the NCCHData structure (RomFS, Icon, Banner, etc). 3dsx files do not have a programid and will use a default of 0 for this value, thus, only 1 3dsx file with RomFS is loadable at the same time.
| * | Merge pull request #2952 from MerryMage/page-tablesB3n302017-09-2511-26/+55
| |\ \ | | | | | | | | Switchable Page Tables
| | * | ARM_Interface: Implement PageTableChangedMerryMage2017-09-256-6/+39
| | | |
| | * | memory: Remove GetCurrentPageTablePointersMerryMage2017-09-242-10/+0
| | | |
| | * | memory: Add GetCurrentPageTable/SetCurrentPageTableMerryMage2017-09-246-12/+18
| | |/ | | | | | | | | | Don't expose Memory::current_page_table as a global.
| * | Merge pull request #2948 from Subv/register_serviceB3n302017-09-254-1/+33
| |\ \ | | | | | | | | HLE/SRV: Implemented RegisterService.
| | * | HLE/SRV: Implemented RegisterService.Subv2017-09-244-1/+33
| | |/ | | | | | | | | | Now system modules can do more than just crash immediately on startup.
| * | Loader/NCCH: Add support for loading application updates (#2927)Max Thomas2017-09-258-439/+670
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * loader/ncch: split NCCH parsing into its own file * loader/ncch: add support for loading update NCCHs from the SD card * loader/ncch: fix formatting * file_sys/ncch_container: Return a value for OpenFile * loader/ncch: cleanup, always instantiate overlay_ncch to base_ncch * file_sys/ncch_container: better encryption checks, allow non-app NCCHs to load properly and for the existence of NCCH structures to be checked * file_sys/ncch_container: pass filepath as a const reference
| * | Services/UDS: Added a function to send EAPoL-Start packets (#2920)B3n302017-09-255-88/+250
| |/ | | | | | | | | | | | | | | | | | | | | | | | | | | * Services/UDS: Added a function to generate the EAPoL-Start packet body. * Services/UDS: Added filter for beacons. * Services/UDS: Lock a mutex when accessing connection_status from both the emulation and network thread. * Services/UDS: Handle the Association Response frame and respond with the EAPoL-Start frame. * fixup: make use of current_node, changed received_beacons into a list, mutex and assert corrections * fixup: fix damn clang-format
| * WebService: Verify username and token (#2930)B3n302017-09-193-0/+23
| | | | | | | | | | | | | | | | | | | | * WebService: Verify username and token; Log errors in PostJson * Fixup: added docstrings to the functions * Webservice: Added Icons to the verification, imrpved error detection in cpr, fixup nits * fixup: fmt warning
| * Merge pull request #2906 from Subv/ns_new_frameworkYuri Kunde Schlesner2017-09-167-42/+77
| |\ | | | | | | Services/NS: Port ns:s to the new service framework.
| | * Services/NS: Port ns:s to the new service framework.Subv2017-09-167-42/+77
| | |
| * | Merge pull request #2842 from Subv/switchable_page_tableB3n302017-09-1513-119/+177
| |\ \ | | | | | | | | Kernel/Memory: Give each process its own page table and allow switching the current page table upon reschedule
| | * | CPU/Dynarmic: Disable the fast page-table access in dynarmic until it supports switching page tables at runtime.Subv2017-09-151-1/+3
| | | |
| | * | Kernel/Memory: Make IsValidPhysicalAddress not go through the current process' virtual memory mapping.Subv2017-09-151-2/+1
| | | |
| | * | Kernel/Threads: Don't clear the CPU instruction cache when performing a context switch from an idle thread into a thread in the same process.Subv2017-09-151-1/+3
| | | | | | | | | | | | | | | | We were unnecessarily clearing the cache when going from Process A -> Idle -> Process A, this caused extreme performance regressions.
| | * | Kernel/Memory: Changed GetPhysicalPointer so that it doesn't go through the current process' page table to obtain a pointer.Subv2017-09-154-30/+69
| | | |
| | * | Kernel/Memory: Switch the current page table when a new process is scheduled.Subv2017-09-101-0/+10
| | | |
| | * | Kernel/Memory: Give each Process its own page table.Subv2017-09-109-87/+93
| | | | | | | | | | | | | | | | The loader is in charge of setting the newly created process's page table as the main one during the loading process.
| * | | Merge pull request #2915 from wwylele/font-archive-2bunnei2017-09-123-135/+155
| |\ \ \ | | | | | | | | | | APT: load different shared font depending on the region
| | * | | APT: load different shared font depending on the regionwwylele2017-09-033-135/+155
| | | | |
| * | | | Merge pull request #2831 from Subv/uds_authWeiyi Wang2017-09-057-53/+289
| |\ \ \ \ | | | | | | | | | | | | Services/UDS: Handle beacon frames and the basic AP connection sequence frames.
| | * | | | Services/UDS: Remove an old duplicated declaration of WifiPacket.Subv2017-08-272-22/+0
| | | | | |
| | * | | | Services/UDS: Handle the connection sequence packets.Subv2017-08-271-17/+83
| | | | | | | | | | | | | | | | | | | | | | | | There is currently no stage tracking, a client is considered "Connected" when it receives the EAPoL Logoff packet from the server, this is not yet implemented.
| | * | | | Services/UDS: Store the received beacon frames until RecvBeaconBroadcastData is called, up to 15 beacons at the same time, removing any older beacon frames when the limit is exceeded.Subv2017-08-271-3/+62
| | | | | |
| | * | | | Services/UDS: Add functions to generate 802.11 auth and assoc response frames.Subv2017-08-275-11/+144
| | | | | |
| * | | | | Remove _flag in var namesmailwl2017-09-041-6/+6
| | | | | |
| * | | | | Mii Selector Applet: update Mii structuresmailwl2017-09-042-34/+29
| | |/ / / | |/| | |
| * | | | Merge pull request #2899 from wwylele/touch-refactorbunnei2017-08-295-43/+78
| |\ \ \ \ | | | | | | | | | | | | Refactor touch input into a TouchDevice
| | * | | | EmuWindow: refactor touch input into a TouchDevicewwylele2017-08-242-39/+63
| | | | | |
| | * | | | HID: use TouchDevice for touch padwwylele2017-08-243-4/+15
| | | | | |
| * | | | | Merge pull request #2905 from danzel/fix-2902Sebastian Valle2017-08-294-5/+5
| |\ \ \ \ \ | | |_|_|_|/ | |/| | | | Use recursive_mutex instead of mutex to fix #2902
| | * | | | Use recursive_mutex instead of mutex to fix #2902danzel2017-08-294-5/+5
| | |/ / /
| * | | | web_services: Refactor to remove dependency on Core.bunnei2017-08-261-1/+7
| | | | |
| * | | | qt: Add an option to view/regenerate telemetry ID.bunnei2017-08-262-3/+28
| | | | |
| * | | | settings: Add enable_telemetry, citra_username, and citra_token.bunnei2017-08-261-0/+3
| | | | |
| * | | | telemetry_session: Log telemetry ID.bunnei2017-08-261-0/+36
| | | | |
| * | | | SidebySide Layout (#2859)ThaMighty902017-08-255-4/+53
| |/ / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * added a SidebySide Layout * Reworked, so both screen have the same height and cleaned up screen translates. * added the option in the UI, hope this is the right way to do it. formated framebuffer_layout.cpp * delete the x64 files * deleted ui_configure_graphics.h * added Option for the Layout in the xml * got rid of SIDE_BY_SIDE_ASPECT_RATIO because it was useless. pulled translate into variables * changed shift variables to u32 and moved them in their respective branch. remove notr="true" for the Screen layout drop down * reworked intends :). changed function description for SideFrameLayout * some description reworking
| * | | Merge pull request #2839 from Subv/global_kernel_lockJames Rowe2017-08-246-4/+46
| |\ \ \ | | | | | | | | | | Kernel/HLE: Use a mutex to synchronize access to the HLE kernel state between the cpu thread and any other possible threads that might touch the kernel (network thread, etc).
| | * | | Kernel/Memory: Acquire the global HLE lock when a memory read/write operation falls outside of the fast path, for it might perform an MMIO operation.Subv2017-08-221-1/+8
| | | | |
| | * | | Kernel/HLE: Use a mutex to synchronize access to the HLE kernel state between the cpu thread and any other possible threads that might touch the kernel (network thread, etc).Subv2017-08-225-3/+38
| | | | | | | | | | | | | | | | | | | | This mutex is acquired in SVC::CallSVC, ie, as soon as the guest application enters the HLE kernel, and should be acquired by the aforementioned threads before modifying kernel structures.
| * | | | Merge pull request #2893 from Subv/not_schedule_main_threadbunnei2017-08-221-5/+1
| |\ \ \ \ | | | | | | | | | | | | Kernel/Threads: Don't immediately switch to the new main thread when loading a new process.
| | * | | | Kernel/Threads: Don't immediately switch to the new main thread when loading a new process.Subv2017-08-221-5/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This is necessary for loading multiple processes at the same time. The main thread will be automatically scheduled when necessary once the scheduler runs.
| * | | | | GPU/Warnings: Explicitly cast the screen refresh ticks to u64.Subv2017-08-211-1/+1
| | | | | |
| * | | | | Warnings: Add UNREACHABLE macros to switches that contemplate all possible values.Subv2017-08-213-2/+7
| | | | | |
| * | | | | HLE/Applets: Fixed some conversion warnings when creating the framebuffer shared memory objects.Subv2017-08-214-8/+8
| | | | | |
| * | | | | CPU/Dynarmic: Fixed a warning when incrementing the number of ticks in ExecuteInstructions.Subv2017-08-211-1/+1
| | | | | |
| * | | | | Dyncom: Use size_t instead of int to store the instruction offsets in the instruction cache.Subv2017-08-212-4/+4
| | | | | | | | | | | | | | | | | | | | | | | | Fixes a few warnings.
| * | | | | Dyncom: Fixed a conversion warning when decoding thumb instructions.Subv2017-08-211-1/+1
| |/ / / /
| * | | | Merge pull request #2861 from wwylele/motion-refactorJames Rowe2017-08-208-254/+47
| |\ \ \ \ | | |_|_|/ | |/| | | Refactor MotionEmu into a InputDevice
| | * | | HID: fix a comment and a warningwwylele2017-08-201-2/+2
| | | | |
| | * | | move MotionEmu from core/frontend to input_common as a InputDevicewwylele2017-08-116-254/+4
| | | | |
| | * | | HID: use MotionDevice for Accelerometer and Gyroscopewwylele2017-08-113-5/+48
| | | | |
| * | | | Added missing parts in libnetwork (#2838)B3n302017-08-193-1/+14
| | | | | | | | | | | | | | | | | | | | | | | | | * Network: Set and send the game information over enet Added Callbacks for RoomMember and GetMemberList to Room in preparation for web_services.
| * | | | Merge pull request #2881 from MerryMage/dsp-firm-checkYuri Kunde Schlesner2017-08-161-3/+4
| |\ \ \ \ | | | | | | | | | | | | dsp_dsp: Remove size assertion in LoadComponent
| | * | | | dsp_dsp: Remove size assertion in LoadComponentMerryMage2017-08-151-3/+4
| | | | | |
| * | | | | Merge pull request #2843 from Subv/applet_slotsSebastian Valle2017-08-122-35/+200
| |\ \ \ \ \ | | |_|/ / / | |/| | | | Services/APT: Use an array to hold data about the 4 possible concurrent applet types (Application, Library, HomeMenu, System)
| | * | | | Services/APT: Use the AppletAttributes union directly when dealing with applet attrs.Subv2017-08-071-19/+15
| | | | | |
| | * | | | Services/APT: Use an array to hold data about the 4 possible concurrent applet types (Application, Library, HomeMenu, System).Subv2017-08-072-35/+204
| | |/ / / | | | | | | | | | | | | | | | This gives each applet type its own set of events as per the real NS module.
| * | | | Merge pull request #2863 from wwylele/pad-state-zeroWeiyi Wang2017-08-102-2/+2
| |\ \ \ \ | | | | | | | | | | | | HID: zero unused PadState bits
| | * | | | HID: zero unused PadState bitswwylele2017-08-102-2/+2
| | |/ / /
| * | | | Merge pull request #2862 from j-selby/update-cryptoppbunnei2017-08-091-1/+1
| |\ \ \ \ | | | | | | | | | | | | Update CryptoPP (byte ambiguity)
| | * | | | Update cryptoppJames2017-08-081-1/+1
| | |/ / /
| * / / / Service/dlp: Update function tables according 3dbrewmailwl2017-08-093-4/+44
| |/ / /
| * | | telemetry: Add field for OsPlatform.bunnei2017-08-041-0/+9
| | | |
| * | | telemetry: Add field for BuildName.bunnei2017-08-041-0/+1
| | | |
| * | | telemetry: Add field for RequiresSharedFont.bunnei2017-08-041-0/+4
| | | |
| * | | telemetry_session: Log BuildDate and ProgramName fields.bunnei2017-08-041-0/+7
| | | |
| * | | core: Expose AppLoader as a public interface.bunnei2017-08-041-4/+5
| | | |
| * | | loader: Expose program title.bunnei2017-08-043-12/+31
| | | |
| * | | Handle invalid filenames when renaming files/directoriesJames2017-07-312-4/+78
| | | |
| * | | Merge pull request #2840 from Subv/apt_parameterbunnei2017-07-272-33/+105
| |\ \ \ | | | | | | | | | | Services/APT: Corrected the behavior of the Receive/Send/Glance/CancelParameter functions
| | * | | Service/APT: Log Send/Cancel/Receive/GlanceParameter calls even if they return an error.Subv2017-07-211-7/+9
| | | | |
| | * | | Services/APT: Return the proper error code when calling SendParameter with an outstanding parameter already in memory.Subv2017-07-212-4/+17
| | | | |
| | * | | Services/APT: Reset the APT parameter inside CancelParameter if the conditions are met.Subv2017-07-211-6/+23
| | | | |
| | * | | Services/APT: Properly clear the apt parameter after a successful ReceiveParameter call.Subv2017-07-211-2/+8
| | | | |
| | * | | Services/APT: Use the right error codes in ReceiveParameter and GlanceParameter when the parameter doesn't exist.Subv2017-07-211-0/+28
| | | | |
| | * | | Services/APT: Use boost::optional for the APT parameter structure.Subv2017-07-211-20/+26
| | |/ /
* | | | loader: Various improvements for NSO/NRO loaders.bunnei2017-10-108-58/+40
| | | |
* | | | loader: Add support for NRO, as well as various fixes and shared linker.bunnei2017-10-069-146/+434
| | | |
* | | | nso: Fixes to support homebrew NSOs without a MOD header.bunnei2017-10-042-17/+23
| | | |
* | | | arm_interface: Set TLS address for dynarmic core.bunnei2017-09-305-0/+32
| | | |
* | | | nso: Refactor and allocate .bss section.bunnei2017-09-308-130/+160
| | | |
* | | | process: Support loading multiple codesets.bunnei2017-09-302-20/+27
| | | |
* | | | loader: Add support for loading an NSO.bunnei2017-09-305-0/+342
| | | |
* | | | externals: Add lz4.bunnei2017-09-301-1/+1
| | | |
* | | | memory: Log with 64-bit values.bunnei2017-09-301-8/+8
| | | |
* | | | kernel: Various threading fixes to support 64-bit addressing.bunnei2017-09-302-8/+8
| | | |
* | | | core: Various changes to support 64-bit addressing.bunnei2017-09-305-54/+54
| | | |
* | | | arm: Use 64-bit addressing in a bunch of places.bunnei2017-09-308-78/+111
| | | |
* | | | elf: Check if machine is ARM.bunnei2017-09-301-2/+9
|/ / /
* | | Merge pull request #2799 from yuriks/virtual-cached-range-flushWeiyi Wang2017-07-226-68/+113
|\ \ \ | |/ / |/| | Add address conversion functions returning optional, Add function to flush virtual region from rasterizer cache
| * | Memory: Add function to flush a virtual range from the rasterizer cacheYuri Kunde Schlesner2017-06-224-47/+72
| | | | | | | | | | | | | | | | | | This is slightly more ergonomic to use, correctly handles virtual regions which are disjoint in physical addressing space, and checks only regions which can be cached by the rasterizer.
| * | Memory: Add TryVirtualToPhysicalAddress, returning a boost::optionalYuri Kunde Schlesner2017-06-222-7/+23
| | |
| * | Memory: Make PhysicalToVirtualAddress return a boost::optionalYuri Kunde Schlesner2017-06-224-14/+18
| | | | | | | | | | | | And fix a few places in the code to take advantage of that.
* | | telemetry: Log performance, configuration, and system data.bunnei2017-07-183-12/+80
| | |
* | | stubbed frd::UnscrambleLocalFriendCode (#2827)B3n302017-07-173-1/+57
| | |
* | | Merge pull request #2784 from wwylele/font-archiveWeiyi Wang2017-07-165-22/+264
|\ \ \ | | | | | | | | load shared font from system archive
| * | | apt: load shared font from system archivewwylele2017-06-264-20/+260
| | | |
| * | | apt/shared_font: don't relocate zero offsetwwylele2017-06-251-2/+4
| |/ /
* | | web_service: Add CMake flag to enable.bunnei2017-07-122-3/+12
| | |
* | | telemetry_session: Use TelemetryJson to submit real telemetry.bunnei2017-07-121-2/+2
| | |
* | | web_service: Add skeleton project.bunnei2017-07-101-1/+1
| | |
* | | settings: Add telemetry endpoint URL.bunnei2017-07-101-0/+3
| | |
* | | Merge pull request #2815 from mailwl/bosspSebastian Valle2017-07-081-0/+3
|\ \ \ | | | | | | | | Service/boss:P: Add some functions to FunctionTable
| * | | Service/boss:P: Add some functions to FunctionTablemailwl2017-07-011-0/+3
| | |/ | |/|
* | | Merge pull request #2797 from yuriks/cached-vma-free-crashbunnei2017-07-081-5/+20
|\ \ \ | |/ / |/| | Memory: Fix crash when unmapping a VMA covering cached surfaces
| * | Memory: Fix crash when unmapping a VMA covering cached surfacesYuri Kunde Schlesner2017-06-221-5/+20
| |/ | | | | | | | | | | | | | | | | | | Unmapping pages tries to flush any cached GPU surfaces touching that region. When a cached page is invalidated, GetPointerFromVMA() is used to restore the original pagetable pointer. However, since that VMA has already been deleted, this hits an UNREACHABLE case in that function. Now when this happens, just set the page type to Unmapped and continue, which arrives at the correct end result.
* | Merge pull request #2793 from Subv/replyandreceiveSebastian Valle2017-06-306-23/+161
|\ \ | | | | | | Kernel/SVC: Partially implemented svcReplyAndReceive
| * | Kernel/SVC: Pass the current thread as a parameter to ClientSession::SendSyncRequest.Subv2017-06-293-4/+7
| | |
| * | Kernel/Sessions: Clean up the list of pending request threads of a session when the client endpoint is closed.Subv2017-06-261-0/+5
| | |
| * | Kernel/SVC: Partially implemented svcReplyAndReceive.Subv2017-06-262-11/+121
| | | | | | | | | | | | | | | | | | | | | | | | It behaves mostly as WaitSynchronizationN with wait_all = false, except for IPC buffer translation. The target thread of an IPC response will now wake up when responding. IPC buffer translation is currently not implemented. Error passing back to svcSendSyncRequest is currently not implemented.
| * | Kernel/ServerSession: Keep track of which threads have issued sync requests.Subv2017-06-253-9/+29
| | |
* | | gpu: add comments for TextureCopywwylele2017-06-292-8/+8
| | |
* | | gpu: fix edge cases for TextureCopywwylele2017-06-271-18/+23
| | |
* | | Merge pull request #2778 from Subv/uds_moreSebastian Valle2017-06-275-1/+436
|\ \ \ | | | | | | | | Services/UDS: Stub SendTo to generate the unencrypted data frames with the right headers
| * | | UDS: Use the ToDS and FromDS fields to properly calculate the AAD used during encryption.Subv2017-06-261-15/+32
| | | |
| * | | UDS: Move the UDS keyslot used to generate the CCMP key to the AES::KeySlotID enum.Subv2017-06-262-4/+3
| | | |
| * | | UDS: Run clang-format.Subv2017-06-263-51/+55
| | | |
| * | | UDS: Added functions to encrypt and decrypt the data frames.Subv2017-06-263-12/+156
| | | | | | | | | | | | | | | | The responsibility of encryption and encapsulation into an 802.11 MAC frame will fall into the callers of GenerateDataPayload.
| * | | UDS: Clarify comment about the first 4 bytes of the SecureData header.Subv2017-06-152-1/+5
| | | | | | | | | | | | | | | | It is likely that these 4 bytes are actually a different header, part of some protocol that encapsulates the SecureData protocol.
| * | | UDS: Return the correct error messages in SendTo when not connected to a network or trying to send to itself.Subv2017-06-151-6/+13
| | | |
| * | | UDS: Stub SendTo to generate the unencrypted data frame with the right headers.Subv2017-06-154-1/+261
| |/ /
* | | Kernel: Implement AcceptSession SVCYuri Kunde Schlesner2017-06-234-3/+38
| | |
* | | Kernel: Fix SVC wrapper for CreatePortYuri Kunde Schlesner2017-06-231-3/+2
| | | | | | | | | | | | The return parameters were flipped.
* | | Kernel: Implement CreateSessionToPort SVCYuri Kunde Schlesner2017-06-231-1/+12
| | |
* | | Merge pull request #2798 from yuriks/svc-create-sessionYuri Kunde Schlesner2017-06-232-3/+26
|\ \ \ | | | | | | | | Kernel: Implement CreateSession SVC
| * | | Kernel: Implement CreateSession SVCYuri Kunde Schlesner2017-06-222-3/+26
| | |/ | |/|
* / | Kernel/IPC: Support translation of null handlesYuri Kunde Schlesner2017-06-211-7/+12
|/ / | | | | | | | | Missed this in my first implementation. Thanks to @wwylele for pointing out that this was missing.
* | Merge pull request #2789 from yuriks/misc-kernelWeiyi Wang2017-06-212-1/+5
|\ \ | | | | | | Trivial no-op additions
| * | Memory: Add enum definitions for the n3DS FCRAM sizeYuri Kunde Schlesner2017-06-211-1/+3
| | |
| * | Kernel: Add comment about the extended linear heap areaYuri Kunde Schlesner2017-06-191-0/+2
| |/
* | Merge pull request #2790 from yuriks/remove-movefromYuri Kunde Schlesner2017-06-2124-56/+57
|\ \ | | | | | | Remove ResultVal::MoveFrom
| * | ResultVal: Remove MoveFrom()Yuri Kunde Schlesner2017-06-1924-57/+53
| | | | | | | | | | | | | | | Replace it with std::move(result_val).Unwrap(), or Foo().Unwrap() in case you already have an rvalue.
| * | ResultVal: Add an rvalue overload of Unwrap()Yuri Kunde Schlesner2017-06-191-1/+6
| |/
* | Merge pull request #2779 from Subv/uds_more2Sebastian Valle2017-06-211-0/+36
|\ \ | | | | | | UDS: Added a hook for updating the connection status when a client connects to the network.
| * | UDS: Added a hook for updating the connection status when a client connects to the network.Subv2017-06-151-0/+36
| |/
* / Kernel/IPC: Make HLERequestContext usable from outside kernelYuri Kunde Schlesner2017-06-193-5/+10
|/
* Services/UDS: Set the proper bit in the ConnectionStatus structure when creating a network. (#2738)Sebastian Valle2017-06-133-5/+15
| | | | | | | | | | * Services/UDS: Set the proper bit in the ConnectionStatus structure when creating a network. This lets the application know that the host was successfully added to the session. * Services/UDS: Reset the connection status when destroying the network * Services/UDS: Reset the connection status's bitmask of changed nodes after reporting it to the game.
* Kernel/IPC: Use boost::small_vector for HLE context objectsYuri Kunde Schlesner2017-06-121-1/+3
|
* Kernel: Allow clearing request_objects to re-use buffer spaceYuri Kunde Schlesner2017-06-113-0/+14
| | | | | Reduces the necessary allocation to max(in_handles, out_handles) rather than (in_handles + out_handles).
* Kernel: Basic support for IPC translation for HLE servicesYuri Kunde Schlesner2017-06-113-18/+130
|
* Service/sm: Convert srv: to use IPC helpersYuri Kunde Schlesner2017-06-111-49/+56
|
* IPC: Add Pop/PushObjects methods to RequestParser/BuilderYuri Kunde Schlesner2017-06-111-10/+103
| | | | | These use the context functions to create and look-up handles for the user.
* IPC: Add basic HLERequestContext support to RequestParser/BuilderYuri Kunde Schlesner2017-06-111-1/+32
|
* Kernel: Add methods in HLERequestContext abstracting handle creationYuri Kunde Schlesner2017-06-112-0/+12
|
* ServiceFramework: Use separate copy of command bufferYuri Kunde Schlesner2017-06-113-9/+29
| | | | | | Copy the IPC command buffer to/from the request context before/after the handler is invoked. This is part of a move away from using global data for handling IPC requests.
* Merge pull request #2756 from yuriks/service-frameworkYuri Kunde Schlesner2017-06-099-64/+355
|\ | | | | New service framework
| * Service/sm: Convert 'srv:' to ServiceFrameworkYuri Kunde Schlesner2017-06-095-51/+75
| |
| * Service: Remove a few redundant namespace qualifiersYuri Kunde Schlesner2017-06-081-5/+5
| |
| * Service: Add new ServiceFramework framework for writing HLE servicesYuri Kunde Schlesner2017-06-085-4/+269
| | | | | | | | | | | | | | | | | | | | | | | | The old "Interface" class had a few problems such as using free functions (Which didn't allow you to write the service handler as if it were a regular class.) which weren't very extensible. (Only received one parameter with a pointer to the Interface object.) The new ServiceFramework aims to solve these problems by working with member functions and passing a generic context struct as parameter. This struct can be extended in the future without having to update all existing service implementations.
| * Kernel: Remove some unnecessary namespace qualificationsYuri Kunde Schlesner2017-06-061-4/+6
| |
* | Session: Remove/add some forward declarationsYuri Kunde Schlesner2017-06-082-1/+2
| |
* | Kernel: Ensure objects are kept alive during ClientSession disconnectionYuri Kunde Schlesner2017-06-081-7/+13
| | | | | | | | Fixes #2760
* | Merge pull request #2737 from Subv/decryptbeacondataJames Rowe2017-06-071-1/+97
|\ \ | |/ |/| Services/UDS: Implement DecryptBeaconData.
| * Services/UDS: Implement DecryptBeaconData.Subv2017-06-061-1/+97
| | | | | | | | This function decrypts the encrypted data tags contained in the 802.11 beacon frames.
* | Service: Remove unnecessary includes from service.hYuri Kunde Schlesner2017-06-0631-12/+79
| | | | | | | | | | This has a huge fallout in terms of needing to fix other files because all service implementations included that file.
* | Service: Make service registration part of the sm implementationYuri Kunde Schlesner2017-06-066-24/+147
| | | | | | | | Also enhances the GetServiceHandle implementation to be more accurate.
* | Service/sm: Use an actual semaphore for the notification semaphoreYuri Kunde Schlesner2017-06-061-8/+9
| | | | | | | | | | An Event was used way back then when we didn't have proper working semaphores. Our Semaphore implementation is good enough now.
* | Service: Move SRV interface to a new sm/ subdirectoryYuri Kunde Schlesner2017-06-064-9/+10
| | | | | | | | | | This will contain the implementation of the sm (Service Manager) system module.
* | Kernel: Add a dedicated SetHleHandler method to ServerPort/ServerSessionYuri Kunde Schlesner2017-06-0611-62/+73
| | | | | | | | | | | | This allows attaching a HLE handle to a ServerPort at any point after it is created, allowing port/session creation to be generic between HLE and regular services.
* | ResultVal: Add more convenience utils for creating and cascading resultsYuri Kunde Schlesner2017-06-061-0/+19
| |
* | HLE: Move SessionRequestHandler from Service:: to Kernel::Yuri Kunde Schlesner2017-06-0614-73/+100
| | | | | | | | | | Most of the code that works with this is or will be in the kernel, so it's a more appropriate place for it to be.
* | Addressed Bunnei's review comments, and made some other tweaks:TheKoopaKingdom2017-06-036-24/+22
| | | | | | | | | | - Deleted GetStatus() because it wasn't used anywhere outside of Core::System. - Fixed design flaw where the message bar status could be set despite the game being stopped.
* | Switched to the ERROR_NOT_FOUND constant from errors.h.TheKoopaKingdom2017-06-032-4/+3
| |
* | Moved whitelist checks from FS_User to the Archive_NCCH handler.TheKoopaKingdom2017-06-032-53/+37
| |
* | Created a whitelist of system archives to prevent false positives creating dialogs.TheKoopaKingdom2017-06-036-24/+60
| |
* | Optimized messages that were repetitive and added ability for core errors to specify more details optionally.TheKoopaKingdom2017-06-031-2/+15
| |
* | Made some changes from review comments:TheKoopaKingdom2017-06-038-35/+33
| | | | | | | | | | | | | | | | - Made LoadKernelSystemMode return a pair consisting of a system mode and a result code (Could use review). - Deleted ErrorOpenGL error code in favor of just having ErrorVideoCore. - Made dialog messages more clear. - Compared archive ID in fs_user.cpp to ArchiveIdCode::NCCH as opposed to hex magic. - Cleaned up some other stuff.
* | Added system for handling core errors in citra-qt.TheKoopaKingdom2017-06-035-8/+43
| |
* | Fixed encrypted ROM error messages.TheKoopaKingdom2017-06-033-9/+19
| |
* | Merge pull request #2722 from wwylele/cam-ipc-helperbunnei2017-06-012-293/+265
|\ \ | | | | | | CAM: use IPCHelper
| * | fixup!cam: use IPCHelperwwylele2017-05-272-30/+43
| | |
| * | cam: move u32->u8 trancation to IPCHelperwwylele2017-05-241-34/+33
| | |
| * | cam: use IPCHelperwwylele2017-05-241-278/+238
| | |
* | | Merge pull request #2739 from yuriks/kernel-reorgbunnei2017-06-0125-341/+428
|\ \ \ | | | | | | | | Split-up kernel.h
| * | | Kernel: Move HandleTable to a separate fileYuri Kunde Schlesner2017-05-3018-203/+242
| | | |
| * | | Kernel: Move WaitObject to a separate fileYuri Kunde Schlesner2017-05-3013-132/+176
| | | | | | | | | | | | | | | | | | | | Now that HandleTable doesn't directly depend on WaitObject anymore, this can be separated from the main kernel.h header.
| * | | Kernel: Removed HandleTable::GetWaitObjectYuri Kunde Schlesner2017-05-302-11/+2
| | | | | | | | | | | | | | | | | | | | This isn't necessary anymore since plain Get works correctly for WaitObjects.
| * | | Kernel: Extract dynamic Object pointer cast into its own functionYuri Kunde Schlesner2017-05-291-11/+24
| | |/ | |/|
* | | CMake: Remove unnecessary include_directories for dynarmicYuri Kunde Schlesner2017-05-281-3/+0
| | | | | | | | | | | | Dynarmic already adds the correct include paths to the library target.
* | | CMake: Add cryptopp include path to target propertyYuri Kunde Schlesner2017-05-281-1/+0
| | |
* | | CMake: Use IMPORTED target for BoostYuri Kunde Schlesner2017-05-281-1/+1
|/ /
* | CMake: Correct inter-module dependencies and library visibilityYuri Kunde Schlesner2017-05-281-2/+2
| | | | | | | | | | | | | | | | | | | | Modules didn't correctly define their dependencies before, which relied on the frontends implicitly including every module for linking to succeed. Also changed every target_link_libraries call to specify visibility of dependencies to avoid leaking definitions to dependents when not necessary.
* | Remove some unnecessary inclusions of video_core.hYuri Kunde Schlesner2017-05-282-2/+0
| |
* | Move screen size constants from video_core to coreYuri Kunde Schlesner2017-05-285-13/+46
| | | | | | | | | | video_core didn't even properly use them, and they were the source of many otherwise-unnecessary dependencies from core to video_core.
* | Core: Fix some out-of-style includesYuri Kunde Schlesner2017-05-284-4/+4
| |
* | Move framebuffer_layout from Common to CoreYuri Kunde Schlesner2017-05-284-1/+215
| | | | | | | | | | | | This removes a dependency inversion between core and common. It's also the proper place for the file since it makes screen layout decisions specific to the 3DS.
* | Merge pull request #2716 from yuriks/decentralized-resultbunnei2017-05-2632-277/+343
|\ \ | | | | | | Decentralize ResultCode
| * | FS: Remove unused result definitionYuri Kunde Schlesner2017-05-251-5/+0
| | |
| * | Kernel: Centralize error definitions in errors.hYuri Kunde Schlesner2017-05-2523-132/+178
| | |
| * | GSP_GPU: Move error codes from result.h to local fileYuri Kunde Schlesner2017-05-252-17/+23
| | |
| * | FileSys: Move all result description to errors.hYuri Kunde Schlesner2017-05-2510-105/+115
| | |
| * | result: Make error description a generic integerYuri Kunde Schlesner2017-05-253-6/+18
| | | | | | | | | | | | | | | | | | | | | | | | | | | It is now known that result code description vary depending on the module, and so they're best defined on a per-module basis. To support this, allow passing in an arbitrary integer instead of limiting to the ones in the ErrorDescription enum. These will be gradually migrated to their individual users, but a few will be kept as "common" codes shared by all modules.
| * | Make BitField and ResultCode constexpr-initializableYuri Kunde Schlesner2017-05-251-18/+15
| | |
* | | telemetry: Log a few simple data fields throughout core.bunnei2017-05-253-1/+22
| | |
* | | core: Keep track of telemetry for the current emulation session.bunnei2017-05-255-0/+83
| |/ |/|
* | Merge pull request #2692 from Subv/vfp_ftzSebastian Valle2017-05-222-0/+26
|\ \ | |/ |/| Dyncom/VFP: Convert denormal outputs into 0 when the FTZ flag is enabled.
| * fixup! Dyncom/VFP: Convert denormal outputs into 0 when the FTZ flag is enabled.Subv2017-05-222-4/+0
| |
| * Dyncom/VFP: Convert denormal outputs into 0 when the FTZ flag is enabled.Subv2017-05-082-0/+30
| | | | | | | | Inputs are still not flushed to 0 if they are denormals.
* | Merge pull request #2406 from Subv/session_disconnectYuri Kunde Schlesner2017-05-228-51/+84
|\ \ | | | | | | Kernel: Properly update port counters on session disconnection.
| * | Kernel/Sessions: Remove the ClientSession::Create function.Subv2017-05-223-16/+3
| | | | | | | | | | | | It is not meant to be used by anything other than CreateSessionPair.
| * | Kernel: Remove a now unused enum and variable regarding a session's status.Subv2017-05-152-8/+0
| | |
| * | Kernel: Use a Session object to keep track of the status of a Client/Server session pair.Subv2017-05-158-32/+86
| | | | | | | | | | | | Reduce the associated port's connection count when a ServerSession is destroyed.
* | | Merge pull request #2694 from Subv/vfp_vsub_ftzMerry2017-05-221-2/+12
|\ \ \ | | | | | | | | Dyncom/VFP: Perform flush-to-zero on the second operand of vsub before sending it to vadd.
| * | | Dyncom/VFP: Perform flush-to-zero on the second operand of vsub before sending it to vadd.Subv2017-05-141-2/+12
| | |/ | |/| | | | | | | | | | | | | | | | | | | | | | Previously we were letting vadd flush the value to positive 0, but there are cases where this behavior is wrong, for example, vsub: -0 - +0 = -0 vadd: -0 + +0 = +0 Now we'll flush the value to +0 inside vsub, and then negate it.
* | | Merge pull request #2661 from Subv/uds5bunnei2017-05-195-33/+602
|\ \ \ | | | | | | | | Services/UDS: Generate 802.11 beacon frames when a network is open.
| * | | Services/UDS: Use the new IPC helper functions.Subv2017-05-151-21/+10
| | | |
| * | | Services/UDS: Implement RecvBeaconBroadcastData.Subv2017-05-151-19/+69
| | | | | | | | | | | | | | | | | | | | This allows the applications to retrieve 802.11 beacon frames from nearby UDS networks. Note that the networks are still not announced anywhere.
| * | | Services/UDS: Generate the UDS beacons when the beacon callback fires.Subv2017-05-155-7/+537
| | | |
* | | | use IPCHelper for PTM servicesemmaus2017-05-193-31/+45
| | | |
* | | | Merge pull request #2687 from yuriks/address-mappingsYuri Kunde Schlesner2017-05-147-49/+121
|\ \ \ \ | | | | | | | | | | Kernel: Map special regions according to ExHeader
| * | | | Kernel: Map special regions according to ExHeaderYuri Kunde Schlesner2017-05-105-52/+105
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This replaces the hardcoded VRAM/DSP mappings with ones made based on the ExHeader ARM11 Kernel caps list. While this has no visible effect for most applications (since they use a standard set of mappings) it does improve support for system modules and n3DS exclusives.
| * | | | DSP: Create backing memory for entire DSP RAMYuri Kunde Schlesner2017-05-101-1/+6
| | | | | | | | | | | | | | | | | | | | Also move address space mapping out of video_core.
| * | | | Memory: Add constants for the n3DS additional RAMYuri Kunde Schlesner2017-05-102-2/+16
| | | | | | | | | | | | | | | | | | | | This is 4MB of extra, separate memory that was added on the New 3DS.
* | | | | Merge pull request #2676 from wwylele/irrstbunnei2017-05-109-24/+208
|\ \ \ \ \ | |/ / / / |/| | | | ir: implement new 3ds HID via ir:rst
| * | | | fixup!ir: implement new 3ds HID via ir:rstwwylele2017-05-071-31/+32
| | | | |
| * | | | ir: implement new 3ds HID via ir:rstwwylele2017-05-049-24/+207
| | | | |
* | | | | Merge pull request #2696 from Subv/vfp_revertYuri Kunde Schlesner2017-05-093-59/+30
|\ \ \ \ \ | | | | | | | | | | | | Dyncom/VFP: Revert edf30d8 and fix the FPSCR getting invalid values.
| * | | | | Dyncom/VFP: Strip the VFP_NAN_FLAG sentinel value when setting vfp exceptions.Subv2017-05-092-2/+2
| | | | | |
| * | | | | Revert "Remove `exceptions` parameter from `normaliseround` VFP functions"Subv2017-05-093-57/+28
| | |_|/ / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This reverts commit edf30d84cc0e8299d61c98f5bb40a6428d1576bc. Conflicts: src/core/arm/skyeye_common/vfp/vfp_helper.h src/core/arm/skyeye_common/vfp/vfpdouble.cpp src/core/arm/skyeye_common/vfp/vfpsingle.cpp
* | | | | Dyncom: Remove disassembler codeYuri Kunde Schlesner2017-05-084-1589/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Had licensing issue around it, in addition to several bugs. Closes #1632, #1280
* | | | | Dyncom: Tweak types and log formattingYuri Kunde Schlesner2017-05-083-8/+10
| | | | |
* | | | | Remove unused symbols codeYuri Kunde Schlesner2017-05-083-46/+0
| | | | |
* | | | | Remove ability to load symbol mapsYuri Kunde Schlesner2017-05-082-40/+2
|/ / / / | | | | | | | | | | | | | | | | This was now mostly unused except by thread creation, which used a symbol of the entrypoint, if available, to name the thread.
* / / / Create a random console_unique_id (#2668)B3n302017-05-062-5/+71
|/ / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * Create a random console_id when config save_file is created Added button in system config to refresh the console unique id * Moved the connect for the button from .ui file to constructor of ConfigureSystem * Added warning and info dialog Fixup: Make use of qt5 style connects, renamed the refresh button, removed some duplicate code, changed random device and moved all to the generate function * Changed the random generator to reflect what a real 3DS stores as console unique id Fixup: Changed the warning message * Fixup: Set and Create * Fixup: Added console id label, therfore removed second message box * Fixup: fixed the endianess * Fixup: more endianness fixes * Fixup: Endianness the 3rd
* | | Merge pull request #2606 from wwylele/irbunnei2017-05-046-44/+761
|\ \ \ | | | | | | | | ir: implement circle pad pro
| * | | ir: implement circle pad prowwylele2017-05-036-44/+761
| | | |
* | | | Merge pull request #2532 from wwylele/ldrro-ipcYuri Kunde Schlesner2017-04-181-193/+138
|\ \ \ \ | |_|_|/ |/| | | ldr_ro: use IPC helper
| * | | ldr_ro: use IPC helperwwylele2017-04-171-193/+138
| |/ /
* | | Merge pull request #2659 from MerryMage/dsp_dsp-correctionbunnei2017-04-131-0/+18
|\ \ \ | |_|/ |/| | dsp_dsp: Messages are modified by service before being sent to DSP
| * | dsp_dsp: Messages are modified by service before being sent to DSPMerryMage2017-04-121-0/+18
| | |
* | | Merge pull request #2628 from Subv/udsSebastian Valle2017-04-122-45/+388
|\ \ \ | |_|/ |/| | Services/UDS: Initial support for hosting local-wlan networks.
| * | Services/UDS: Fixed a style mistake in GetChannel.Sebastian Valle2017-03-271-2/+1
| | |
| * | Services/UDS: Use consistent spelling for WiFi and simplify the GetChannel function.Subv2017-03-261-4/+4
| | |
| * | Services/UDS: Signal the connection event when closing down the network.Subv2017-03-261-0/+1
| | |
| * | Services/UDS: Do not allow trying to start up a network that only the host can connect to.Subv2017-03-261-0/+3
| | |
| * | Service/UDS: Schedule an event to broadcast the beacon frames every 102.4ms.Subv2017-03-262-2/+58
| | |
| * | Services/UDS: Store the entire NetworkInfo structure that was used to create the network.Subv2017-03-261-13/+5
| | | | | | | | | | | | It will be needed when generating the beacon frames.
| * | Services/UDS: Initial support for hosting local-wlan networks.Subv2017-03-262-44/+336
| | | | | | | | | | | | Currently it will let games create a network as hosts, but will not broadcast it anywhere and will not allow clients to connect.
* | | Merge pull request #2533 from Lectem/apt_ipchelperbunnei2017-04-066-257/+386
|\ \ \ | | | | | | | | IpcHelper enhancement and APT refactor
| * | | hopefully fix clang-format issues with old versionLectem2017-03-201-3/+2
| | | |
| * | | address more commentsLectem2017-03-191-20/+20
| | | |
| * | | Cast size_t to u32 for PushStaticBuffer usagesLectem2017-03-181-2/+2
| | | |
| * | | IPCHelper Skip method + address comments for aptLectem2017-03-183-38/+46
| | | |
| * | | fix #2560 and other commentsLectem2017-03-183-22/+22
| | | |
| * | | move push out of class body and add u8 u16 bool specializationsLectem2017-03-184-55/+114
| | | |
| * | | refactor APT service to use the new IPC helpersLectem2017-03-184-195/+258
| | | |
* | | | Merge pull request #2634 from wwylele/batterybunnei2017-04-062-1/+16
|\ \ \ \ | | | | | | | | | | shared_page: stub battery state
| * | | | shared_page: stub battery statewwylele2017-03-212-1/+16
| | | | |
* | | | | error conversion fixes for soc_unoah the goodra2017-04-031-39/+32
| | | | |
* | | | | Fix OutputDebugString syscallMichael Theall2017-04-012-4/+4
| | | | |
* | | | | ptm: create SharedExtSave file before openning itwwylele2017-03-251-1/+1
| | | | |
* | | | | Merge pull request #2512 from SonofUgly/custom-layoutbunnei2017-03-222-12/+24
|\ \ \ \ \ | |/ / / / |/| | | | Add custom layout settings.
| * | | | Add custom layout settings.SonofUgly2017-02-232-12/+24
| | | | |
* | | | | apt: fix RequestBuilder parameters for Unwrapwwylele2017-03-181-1/+1
| |/ / / |/| | |
* | | | Merge pull request #2497 from wwylele/input-2bunnei2017-03-1710-401/+213
|\ \ \ \ | | | | | | | | | | Refactor input emulation & add SDL gamepad support
| * | | | Input: remove unused stuff & clean upwwylele2017-03-017-412/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | 1. removed zl, zr and c-stick from HID::PadState. They are handled by IR, not HID 2. removed button handling in EmuWindow 3. removed key_map 4. cleanup #include
| * | | | InputCommon: add Keyboardwwylele2017-03-011-2/+0
| | | | |
| * | | | HID: use AnalogDevicewwylele2017-03-013-2/+30
| | | | |
| * | | | HID: use ButtonDevicewwylele2017-03-015-1/+100
| | | | |
| * | | | Input: add device and factory templatewwylele2017-03-012-0/+98
| | |/ / | |/| |
* | | | Merge pull request #2618 from wwylele/log-less-filenamebunnei2017-03-176-8/+11
|\ \ \ \ | | | | | | | | | | Reduce host file name and path logging
| * | | | file_sys: lower log level for setting host pathwwylele2017-03-084-4/+4
| | | | |
| * | | | loader/ncch: less verbose log for loading game list. only log program ID when bootingwwylele2017-03-081-3/+6
| | | | |
| * | | | loader: lower file name logging levelwwylele2017-03-081-1/+1
| |/ / /
* | | | Merge pull request #2620 from FernandoS27/syscore_errorbunnei2017-03-161-5/+15
|\ \ \ \ | | | | | | | | | | Refined thread launch on syscore error messages
| * | | | Refined thread launch on syscore error messagesFernando Sahmkow2017-03-091-5/+15
| |/ / /
* / / / cfg: implement GenHashConsoleUniquewwylele2017-03-121-7/+24
|/ / /
* | | Timer: restore missing signaled=true from #2421wwylele2017-02-271-0/+2
| | |
* | | Merge pull request #2594 from wwylele/ir-separatebunnei2017-02-276-147/+159
|\ \ \ | | | | | | | | IR: separate functions of each port to their own files
| * | | IR: separate functions of each port to their own fileswwylele2017-02-266-147/+159
| | | |
* | | | Fix log entry in timer::signal (#2600)B3n302017-02-271-1/+1
| | | |
* | | | Doxygen: Amend minor issues (#2593)Mat M2017-02-279-13/+15
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Corrects a few issues with regards to Doxygen documentation, for example: - Incorrect parameter referencing. - Missing @param tags. - Typos in @param tags. and a few minor other issues.
* | | | Merge pull request #2587 from yuriks/status-barYuri Kunde Schlesner2017-02-2712-45/+213
|\ \ \ \ | |/ / / |/| | | Replace built-in Profiler with indicators in status bar
| * | | PerfStats: Re-order and document members betterYuri Kunde Schlesner2017-02-272-5/+14
| | | |
| * | | Core: Re-write frame limiterYuri Kunde Schlesner2017-02-274-39/+50
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Now based on std::chrono, and also works in terms of emulated time instead of frames, so we can in the future frame-limit even when the display is disabled, etc. The frame limiter can also be enabled along with v-sync now, which should be useful for those with displays running at more than 60 Hz.
| * | | Core: Make PerfStats internally lockedYuri Kunde Schlesner2017-02-276-8/+23
| | | | | | | | | | | | | | | | More ergonomic to use and will be required for upcoming changes.
| * | | PerfStats: Add method to get the instantaneous time ratioYuri Kunde Schlesner2017-02-273-7/+22
| | | |
| * | | Add performance statistics to status barYuri Kunde Schlesner2017-02-278-3/+120
| | | |
| * | | Core: Remove unnecessary include in thread.hYuri Kunde Schlesner2017-02-273-1/+2
| | | |
* | | | Merge pull request #2569 from wwylele/wrap-unwrapbunnei2017-02-2513-6/+564
|\ \ \ \ | | | | | | | | | | APT: implemented Wrap and Unwrap
| * | | | APT: implement Wrap and Unwrapwwylele2017-02-215-6/+149
| | | | |
| * | | | HW: add AES engine & implement AES-CCMwwylele2017-02-218-0/+415
| | | | |
* | | | | Merge pull request #2421 from Subv/timersYuri Kunde Schlesner2017-02-253-16/+36
|\ \ \ \ \ | | | | | | | | | | | | Timers: Immediately signal the timer if it was started with an initial value of 0
| * | | | | Timers: Return an error when calling SetTimer with negative timeouts.Subv2017-02-221-0/+5
| | | | | |
| * | | | | Timers: Immediately signal the timer if it was started with an initial value of 0.Subv2017-02-222-16/+31
| | |/ / / | |/| | |
* | | | | Merge pull request #2585 from MerryMage/sxtb16-sxtab16bunnei2017-02-201-4/+4
|\ \ \ \ \ | |/ / / / |/| | | | dyncom: Correct SXTAB16 and SXTB16
| * | | | dyncom: Correct SXTAB16 and SXTB16MerryMage2017-02-181-4/+4
| | | | |
* | | | | HID: move enable_accelerometer/gyroscope_count initialization into Init() (#2574)Weiyi Wang2017-02-171-2/+5
| | | | | | | | | | | | | | | Fixes #2556
* | | | | core: add missing errors.h in CMakeLists.txtwwylele2017-02-151-0/+1
| | | | |
* | | | | HLE/IPC: Fix uninitialized variables in helpers (#2568)Yuri Kunde Schlesner2017-02-141-3/+3
| | | | | | | | | | | | | | | Fixes #2567
* | | | | NWM changed to NIMnoah the goodra2017-02-141-1/+1
| | | | |
* | | | | turned clang format back onnoah the goodra2017-02-141-1/+1
| |/ / / |/| | |
* | | | Core: add cryptopp library (#2412)Weiyi Wang2017-02-131-1/+2
| | | |
* | | | Merge pull request #2561 from wwylele/fs-romYuri Kunde Schlesner2017-02-139-60/+295
|\ \ \ \ | | | | | | | | | | file_sys: change RomFS archive to Self NCCH archive
| * | | | loader: use self NCCH archivewwylele2017-02-136-90/+7
| | | | |
| * | | | file_sys: add Self NCCH archivewwylele2017-02-135-0/+318
| |/ / /
* | | | core: Free AppLoader on shutdown to release file (#2558)Yuri Kunde Schlesner2017-02-111-9/+2
| | | | | | | | | | | | Fixes #2455
* | | | hid: remove the touch field from PadState (#2557)Weiyi Wang2017-02-112-6/+0
|/ / /
* | | Merge pull request #2027 from Lectem/ipcrefactorWeiyi Wang2017-02-056-68/+364
|\ \ \ | | | | | | | | IPC helper
| * | | fix wwylele's comment and use typename in templatesLectem2017-02-051-4/+4
| | | |
| * | | fix comments alignmentLectem2016-12-301-22/+22
| | | |
| * | | move Pop methods out of class bodyLectem2016-12-261-72/+88
| | | |
| * | | IPC helpers exampleLectem2016-12-263-35/+40
| | | |
| * | | IPC helpersLectem2016-12-263-48/+323
| | | |
* | | | Merge pull request #2496 from mailwl/cfg-memYuri Kunde Schlesner2017-02-041-5/+8
|\ \ \ \ | | | | | | | | | | Core: update Kernel Config Memory to latest version (11.2)
| * | | | Core: update Kernel Config Memory to latest version (11.2)mailwl2017-01-301-5/+8
| | |_|/ | |/| |
* | | | Merge pull request #2518 from MerryMage/coprocYuri Kunde Schlesner2017-02-045-15/+140
|\ \ \ \ | | | | | | | | | | arm_dynarmic: Coprocessor support
| * | | | arm_dynarmic: Update memory interfaceMerryMage2017-02-031-10/+10
| | | | |
| * | | | arm_dynarmic: CP15 supportMerryMage2017-02-035-5/+130
| |/ / /
* | | | Merge pull request #2509 from jfmherokiller/settingscastpatchbunnei2017-02-031-1/+1
|\ \ \ \ | | | | | | | | | | removed the possibly uneeded cast on values.gdbstub_port
| * | | | removed the possibly uneeded cast on values.gdbstub_portnoah the goodra2017-01-311-1/+1
| | | | | | | | | | | | | | | | | | | | as far as i could tell this cast is unneeded because [GDBStub::SetServerPort](https://github.com/citra-emu/citra/blob/master/src/core/gdbstub/gdbstub.cpp#L897) takes a u16 and [values.gdbstub_port](https://github.com/citra-emu/citra/blob/master/src/core/settings.h#L116) is already a u16
* | | | | GSP_GPU::StoreDataCache stubbed (#2428)mailwl2017-02-031-1/+28
|/ / / /
* / / / HLE/Applets: Stub Mint (eShop) Applet (#2463)mailwl2017-01-314-0/+108
|/ / / | | | | | | | | | This allows Phoenix Wright - Dual Destinies to boot.
* | | Merge pull request #2368 from wwylele/camera-2Yuri Kunde Schlesner2017-01-3011-172/+1457
|\ \ \ | | | | | | | | CAM: build the service framework with a dummy implementation
| * | | CAM: implement basic camera functions with a blank camerawwylele2017-01-1111-172/+1457
| |/ /
* | | Merge pull request #2429 from wwylele/auto-language-fixYuri Kunde Schlesner2017-01-301-36/+38
|\ \ \ | | | | | | | | CFG: move language override to the boot process
| * | | CFG: override language setting on bootwwylele2017-01-191-36/+38
| | | |
* | | | Merge pull request #2494 from Kloen/killing-warnings-2-final-mixYuri Kunde Schlesner2017-01-301-1/+1
|\ \ \ \ | | | | | | | | | | core: inline CPU, 132 warnings fixed on GCC
| * | | | core: inline CPU, 132 warnings fixed on GCCKloen2017-01-301-1/+1
| | | | |
* | | | | Merge pull request #2492 from Kloen/killing-warnings-HD1.5ReMIXYuri Kunde Schlesner2017-01-304-0/+28
|\ \ \ \ \ | |/ / / / |/| | | | Fix OSX build warnings about unhandled enumeration values.
| * | | | core: fix err_f.cpp warning about unhandled enumeration value on OSXKloen2017-01-291-0/+2
| | | | |
| * | | | core: fix savedata_archive.cpp warnings about unhandled enumeration values on OSXKloen2017-01-291-0/+12
| | | | |
| * | | | core: fix archive_sdmc.cpp warnings about unhandled enumeration value on OSXKloen2017-01-291-0/+12
| | | | |
| * | | | core: fix archive_extsavedata.cpp warning on OSXKloen2017-01-291-0/+2
| | |_|/ | |/| |
* / | | core: emu_window.cpp, fix conversion warnings from float to s16 on MSVCKloen2017-01-291-6/+6
|/ / /
* | | SDL: Select audio device (#2403)Kloen Lansfiel2017-01-261-0/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * Initial Commit Added Device logic to Sinks Started on UI for selecting devices Removed redundant import * Audio Core: Complete Device Switching Complete the device switching implementation by allowing the output device to be loaded, changed and saved through the configurations menu. Worked with the Sink abstraction and tuned the "Device Selection" configuration so that the Device List is automatically populated when the Sink is changed. This hopefully addresses the concerns and recommendations mentioned in the comments of the PR. * Clean original implementation. * Refactor GetSinkDetails
* | | Merge pull request #2434 from mailwl/nfc-amiiboYuri Kunde Schlesner2017-01-264-20/+249
|\ \ \ | | | | | | | | Service/NFC: stub some functions
| * | | Service/NFC: stub some functionsmailwl2017-01-144-20/+249
| | | | | | | | | | | | | | | | Tested on: Mini-Mario & Friends - amiibo Challenge
* | | | core: fix mic_u warnings on MSVCKloen2017-01-231-4/+4
| | | |
* | | | HID: reset acceleroeter and gyroscope index in Initwwylele2017-01-201-0/+2
| | | |
* | | | loader: Add support for 3DSX special relocation types, fixes citra-emu/citra#2449Thomas Farr2017-01-181-9/+25
| | | | | | | | | | | | | | | | As per devkitPro/3dstools@47bea18
* | | | CoreTiming: use named constant for ARM11 clock ratewwylele2017-01-164-5/+6
| | | |
* | | | HID: manages updating itself using correct tickswwylele2017-01-163-62/+93
|/ / /
* / / GSP::WriteHWRegsWithMask: fix register maskmailwl2017-01-141-1/+1
|/ /
* | Merge pull request #2425 from Subv/cleanup_todosbunnei2017-01-124-32/+30
|\ \ | | | | | | Implement some TODOs in the code.
| * | Threads: Check the process' resource limit for the max allowed priority when creating a thread and remove the priority clamping code.Subv2017-01-112-13/+9
| | |
| * | Thread: Added priority range checking to svcSetThreadPriority and removed priority clamping code from Thread::SetPriority.Subv2017-01-113-18/+18
| | |
| * | Y2R: Use the proper error code when GetStandardCoefficient receives an invalid value.Subv2017-01-111-1/+3
| | |
* | | Merge pull request #2308 from mailwl/ac-ibunnei2017-01-129-297/+424
|\ \ \ | |/ / |/| | Service/AC: add ac:i service
| * | Service/AC: add ac:i servicemailwl2016-12-309-297/+424
| | |
* | | Merge pull request #2397 from Subv/pulsebunnei2017-01-105-13/+20
|\ \ \ | | | | | | | | Kernel: Implemented Pulse event and timers.
| * | | Kernel: Implemented Pulse event and timers.Subv2017-01-055-13/+20
| |/ / | | | | | | | | | Closes #1904
* | | Merge pull request #2384 from bunnei/internal-res-optionbunnei2017-01-082-2/+1
|\ \ \ | | | | | | | | config: Add option for specifying screen resolution scale factor.
| * | | config: Add option for specifying screen resolution scale factor.bunnei2017-01-072-2/+1
| | | |
* | | | Merge pull request #1951 from wwylele/motion-sensorbunnei2017-01-075-8/+212
|\ \ \ \ | |/ / / |/| | | Emulate motion sensor in frontend
| * | | Frontend: make motion sensor interfaced thread-safewwylele2016-12-292-2/+8
| | | |
| * | | Frontend: emulate motion sensorwwylele2016-12-265-8/+206
| | |/ | |/|
* | | Merge pull request #2410 from Subv/sleepthreadbunnei2017-01-073-0/+14
|\ \ \ | | | | | | | | Don't yield execution in SleepThread(0) if there are no available threads to run
| * | | Kernel: Don't attempt to yield execution in SleepThread(0) if there are no available threads to run.Subv2017-01-063-0/+14
| | | | | | | | | | | | | | | | With this we avoid an useless temporary deschedule of the current thread.
* | | | Merge pull request #2396 from Subv/sema_acquirebunnei2017-01-071-1/+2
|\ \ \ \ | | | | | | | | | | Kernel/Semaphore: Fixed a regression in semaphore waits.
| * | | | Kernel/Semaphore: Fixed a regression in semaphore waits.Subv2017-01-051-1/+2
| |/ / / | | | | | | | | | | | | | | | | | | | | The regression was caused by a missing check in #2260. The new behavior is consistent with the real kernel.
* | | | Kernel: Fix SharedMemory objects always returning error when addr = 0 (#2404)Hyper2017-01-061-1/+5
| | | | | | | | | | | | Closes #2400
* | | | Merge pull request #2408 from Subv/priority_boostingbunnei2017-01-061-27/+0
|\ \ \ \ | | | | | | | | | | Kernel: Removed the priority boost code for starved threads.
| * | | | Kernel: Removed the priority boost code for starved threads.Subv2017-01-051-27/+0
| |/ / / | | | | | | | | | | | | | | | | | | | | After hwtesting and reverse engineering the kernel, it was found that the CTROS scheduler performs no priority boosting for threads like this, although some other forms of scheduling priority-starved threads might take place. For example, it was found that hardware interrupts might cause low-priority threads to run if the CPU is preempted in the middle of an SVC handler that deschedules the current (high priority) thread before scheduling it again.
* / / / Kernel: Remove some unused functions.Subv2017-01-052-32/+0
|/ / /
* | | Merge pull request #2393 from Subv/synchSebastian Valle2017-01-0517-159/+221
|\ \ \ | | | | | | | | Kernel: Mutex priority inheritance and synchronization improvements.
| * | | Kernel: Add some asserts to enforce the invariants in the scheduler.Subv2017-01-052-2/+13
| | | |
| * | | Kernel: Remove a thread from all of its waiting objects' waiting_threads list when it is awoken.Subv2017-01-051-18/+4
| | | | | | | | | | | | | | | | This fixes a potential bug where threads would not get removed from said list if they awoke after waiting with WaitSynchronizationN with wait_all = false
| * | | Kernel: Remove Thread::wait_objects_index and use wait_objects to hold all the objects that a thread is waiting on.Subv2017-01-054-21/+22
| | | |
| * | | Kernel: Use different thread statuses when a thread calls WaitSynchronization1 and WaitSynchronizationN with wait_all = true.Subv2017-01-043-16/+20
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This commit removes the overly general THREADSTATUS_WAIT_SYNCH and replaces it with two more granular statuses: THREADSTATUS_WAIT_SYNCH_ANY when a thread waits on objects via WaitSynchronization1 or WaitSynchronizationN with wait_all = false. THREADSTATUS_WAIT_SYNCH_ALL when a thread waits on objects via WaitSynchronizationN with wait_all = true.
| * | | Kernel/Mutex: Propagate thread priority changes to other threads inheriting the priority via mutexesSubv2017-01-045-42/+60
| | | |
| * | | Kernel/Mutex: Update a mutex priority when a thread stops waiting on it.Subv2017-01-045-24/+42
| | | |
| * | | Kernel/Mutex: Implemented priority inheritance.Subv2017-01-045-31/+51
| | | | | | | | | | | | | | | | | | | | | | | | | | | | The implementation is based on reverse engineering of the 3DS's kernel. A mutex holder's priority will be temporarily boosted to the best priority among any threads that want to acquire any of its held mutexes. When the holder releases the mutex, it's priority will be boosted to the best priority among the threads that want to acquire any of its remaining held mutexes.
| * | | Kernel: Object ShouldWait and Acquire calls now take a thread as a parameter.Subv2017-01-0417-68/+56
| | | | | | | | | | | | | | | | This will be useful when implementing mutex priority inheritance.
| * | | Kernel/Synch: Do not attempt a reschedule on every syscall.Subv2017-01-042-2/+18
| | |/ | |/| | | | | | | Not all syscalls should cause reschedules, this commit attempts to remedy that, however, it still does not cover all cases.
* | | Fix some warnings (#2399)Jonathan Hao2017-01-047-15/+8
| | |
* | | Service/NFC: stub GetTagInRangeEventmailwl2016-12-305-0/+42
|/ / | | | | | | Fix Fatal Error in Mini-Mario & Friends - amiibo Challenge
* | Merge pull request #2240 from wwylele/auto-regionbunnei2016-12-305-2/+91
|\ \ | | | | | | Config: auto-select region and language
| * | Config: auto-select region and languagewwylele2016-12-075-2/+91
| | |
* | | Core: remove unused hle.cppwwylele2016-12-271-58/+0
| | |
* | | Core: reset cpu_core in Shutdown to make IsPoweredOn work properlywwylele2016-12-241-0/+1
| |/ |/|
* | core: Move emu_window and key_map into coreMerryMage2016-12-237-2/+648
| | | | | | | | * Removes circular dependences (common should not depend on core)
* | Service/NWM: add nwm servicesmailwl2016-12-2218-10/+317
| |
* | Merge pull request #2366 from MerryMage/MemoryReadCodebunnei2016-12-221-0/+1
|\ \ | | | | | | arm_dynarmic: Provide MemoryReadCode callback
| * | arm_dynarmic: Provide MemoryReadCode callbackMerryMage2016-12-221-0/+1
| | | | | | | | | | | | Change of interface in dynarmic 36082087ded632079b16d24137fdd0c450ce82ea
* | | Merge pull request #2343 from bunnei/core-cleanupbunnei2016-12-2232-407/+377
|\ \ \ | |/ / |/| | Core: Top-level consolidate & misc cleanup
| * | ThreadContext: Move from "core" to "arm_interface".bunnei2016-12-228-37/+26
| | |
| * | core: Replace "AppCore" nomenclature with just "CPU".bunnei2016-12-228-93/+91
| | |
| * | Address clang-format issues.bunnei2016-12-226-32/+33
| | |
| * | core: Remove HLE module, consolidate code & various cleanups.bunnei2016-12-2219-107/+94
| | |
| * | core: Consolidate core and system state, remove system module & cleanups.bunnei2016-12-2212-311/+264
| | |
| * | core: Consolidate top-level system state into a singleton.bunnei2016-12-222-23/+120
| | |
| * | loader: Remove duplicate docstrings.bunnei2016-12-223-56/+0
| | |
* | | Merge pull request #2285 from mailwl/csnd-formatbunnei2016-12-222-49/+92
|\ \ \ | |/ / |/| | csnd:SND: Reformat source code
| * | csnd:SND reformat source codemailwl2016-12-122-49/+92
| | |
* | | Revert "Memory: Always flush whole pages from surface cache"bunnei2016-12-181-10/+0
| | |
* | | Thread: remove the thread from the thread list when exitingwwylele2016-12-173-3/+15
| | |
* | | Merge pull request #2337 from lioncash/gdbbunnei2016-12-161-9/+8
|\ \ \ | | | | | | | | gdbstub: const correctness changes
| * | | gdbstub: const correctness changesLioncash2016-12-161-9/+8
| | | | | | | | | | | | | | | | Also uses size_t as the length indicator type, as is common with buffers.
* | | | Merge pull request #2322 from MerryMage/ctx-mnuMerry2016-12-165-0/+35
|\ \ \ \ | | | | | | | | | | game_list: Add a context menu with "Open Save Location" option
| * | | | loader: Implement ReadProgramIdMerryMage2016-12-153-0/+28
| | | | |
| * | | | archive_source_sd_savedata: Add static method to get a specific save data pathMerryMage2016-12-152-0/+7
| | | | |
* | | | | Kernel: remove object's waiting thread if it is deadwwylele2016-12-161-1/+2
| |/ / / |/| | |
* | | | Merge pull request #2260 from Subv/schedulingbunnei2016-12-167-195/+209
|\ \ \ \ | | | | | | | | | | Threading: Reworked the way our scheduler works.
| * | | | Fixed the codestyle to match our clang-format rules.Subv2016-12-143-27/+39
| | | | |
| * | | | Properly remove a thread from its wait_objects' waitlist when it is awoken by a timeout.Subv2016-12-103-2/+11
| | | | |
| * | | | WaitSynch: Removed unused variables and reduced SharedPtr copies.Subv2016-12-094-73/+56
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Define a variable with the value of the sync timeout error code. Use a boost::flat_map instead of an unordered_map to hold the equivalence of objects and wait indices in a WaitSynchN call.
| * | | | Use boost remove_erase_if instead of the erase-remove idiomSubv2016-12-071-2/+3
| | | | |
| * | | | Improved the algorithm for GetHighestPriorityReadyThread.Subv2016-12-071-14/+13
| | | | |
| * | | | Threading: Added some utility functions and const correctness.Subv2016-12-043-15/+35
| | | | |
| * | | | Threading: Reworked the way our scheduler works.Subv2016-12-047-189/+179
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Threads will now be awakened when the objects they're waiting on are signaled, instead of repeating the WaitSynchronization call every now and then. The scheduler is now called once after every SVC call, and once after a thread is awakened from sleep by its timeout callback. This new implementation is based off reverse-engineering of the real kernel. See https://gist.github.com/Subv/02f29bd9f1e5deb7aceea1e8f019c8f4 for a more detailed description of how the real kernel handles rescheduling.
* | | | | Merge pull request #2328 from wwylele/fix-traceYuri Kunde Schlesner2016-12-161-11/+9
|\ \ \ \ \ | | | | | | | | | | | | Fix debug build from #2249
| * | | | | FS: fix debug build from #2249wwylele2016-12-151-11/+9
| | | | | |
* | | | | | Merge pull request #2332 from lioncash/gdbYuri Kunde Schlesner2016-12-165-16/+23
|\ \ \ \ \ \ | | | | | | | | | | | | | | gdbstub: Remove global variable from public interface
| * | | | | | gdbstub: Remove global variable from public interfaceLioncash2016-12-155-16/+23
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Currently, this is only ever queried, so adding a function to check if the server is enabled is more sensible. If directly modifying this externally is ever desirable, it should be done by adding a function to the interface, rather than exposing implementation details directly.
* | | | | | | Merge pull request #2320 from mailwl/cecd-updateYuri Kunde Schlesner2016-12-168-13/+81
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | Service/CECD: Add cecd:ndm service
| * | | | | | | Service/CECD: Add cecd:ndm servicemailwl2016-12-158-13/+81
| | | | | | | |
* | | | | | | | Merge pull request #2331 from lioncash/truncbunnei2016-12-151-1/+2
|\ \ \ \ \ \ \ \ | |_|/ / / / / / |/| | | | | | | hid: Get rid of a double -> float truncation warning
| * | | | | | | hid: Get rid of a double -> float truncation warningLioncash2016-12-151-1/+2
| | |/ / / / / | |/| | | | | | | | | | | | | | | | | | | float literals need to have the 'f' prefix.
* | | | | | | Merge pull request #2330 from lioncash/pragmaSebastian Valle2016-12-153-0/+6
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | core: Add missing #pragma once directives where applicable
| * | | | | | | core: Add missing #pragma once directives where applicableLioncash2016-12-153-0/+6
| |/ / / / / /
* / / / / / / act: Fix docstring typoLioncash2016-12-151-1/+1
|/ / / / / / | | | | | | | | | | | | | | | | | | These aren't the AM services.
* | | | | | Merge pull request #2314 from mailwl/accountbunnei2016-12-158-10/+44
|\ \ \ \ \ \ | | | | | | | | | | | | | | Service/ACT: move ACT services to folder
| * | | | | | Service/ACT: move ACT services to foldermailwl2016-12-148-10/+44
| | |_|/ / / | |/| | | |
* | | | | | Memory: Always flush whole pages from surface cacheYuri Kunde Schlesner2016-12-151-0/+10
| |/ / / / |/| | | | | | | | | | | | | | | | | | | This prevents individual writes touching a cached page, but which don't overlap the surface, from constantly hitting the surface cache lookup.
* | | | | Merge pull request #2249 from Subv/sessions_v3Yuri Kunde Schlesner2016-12-1524-170/+591
|\ \ \ \ \ | |/ / / / |/| | | | Kernel/IPC: Use Ports and Sessions as the fundamental building block of Inter Process Communication.
| * | | | Fixed the codestyle to match our clang-format rules.Subv2016-12-1416-68/+108
| | | | |
| * | | | Moved the HLE command buffer translation task to ServerSession instead of the HLE handler superclass.Subv2016-12-096-47/+38
| | | | |
| * | | | Kernel/IPC: Small codestyle cleanupSubv2016-12-092-3/+1
| | | | |
| * | | | Added a framework for partially handling Session disconnections.Subv2016-12-088-9/+67
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Further implementation will happen in a future commit. Fixes a regression.
| * | | | Use std::move where appropriate.Subv2016-12-0812-177/+187
| | | | |
| * | | | Return an error code when connecting to a saturated port.Subv2016-12-055-7/+20
| | | | | | | | | | | | | | | | | | | | The error code was taken from the 3DS kernel.
| * | | | HLE: Use a member variable instead of a virtual function to retrieve the max number of sessions that can be connected to an HLE service at the same time.Subv2016-12-055-8/+18
| | | | |
| * | | | Split SessionRequestHandler::HandleSyncRequest into HandleSyncRequest, TranslateRequest and HandleSyncRequestImpl.Subv2016-12-056-22/+59
| | | | | | | | | | | | | | | | | | | | HandleSyncRequest now takes care of calling the command buffer translate function before actually invoking the command handler for HLE services.
| * | | | Kernel: Remove the Redirection handle type.Subv2016-12-051-2/+0
| | | | |
| * | | | KServerPorts now have an HLE handler "template", which is inherited by all ServerSessions created from it.Subv2016-12-0512-69/+86
| | | | |
| * | | | Declare empty ServerSession and ClientSession constructors as default.Subv2016-12-032-4/+4
| | | | |
| * | | | Threads do not wait for the server endpoint to call AcceptSession before returning from a ConnectToPort or GetServiceHandle call.Subv2016-12-012-3/+5
| | | | |
| * | | | Fixed the rebase mistakes.Subv2016-12-0110-82/+76
| | | | |
| * | | | A bit of a redesign.Subv2016-12-0113-263/+266
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Sessions and Ports are now detached from each other. HLE services are handled by means of a SessionRequestHandler class, Interface now inherits from this class. The File and Directory classes are no longer kernel objects, but SessionRequestHandlers instead, bound to a ServerSession when requested. File::OpenLinkFile now creates a new session pair and binds the File instance to it.
| * | | | IPC/HLE: Associate the ClientSessions with their parent port's HLE interface if it exists.Subv2016-12-016-26/+21
| | | | | | | | | | | | | | | | | | | | Pass the triggering ServerSession to the HLE command handler to differentiate which session caused the request.
| * | | | Kernel/HLE: Service::Interface no longer inherits from any Kernel object, and is now its own standalone class.Subv2016-12-014-24/+52
| | | | | | | | | | | | | | | | | | | | Interface is now used by aggregation in ClientPort, to forward service commands to their HLE implementation if needed.
| * | | | fixup! Kernel/IPC: Use Ports and Sessions as the fundamental building block of Inter Process Communication.Subv2016-12-014-5/+6
| | | | |
| * | | | Kernel/IPC: Use Ports and Sessions as the fundamental building block of Inter Process Communication.Subv2016-12-0116-88/+314
| |/ / / | | | | | | | | | | | | | | | | | | | | | | | | All handles obtained via srv::GetServiceHandle or svcConnectToPort are references to ClientSessions. Service modules will wait on the counterpart of those ClientSessions (Called ServerSessions) using svcReplyAndReceive or svcWaitSynchronization[1|N], and will be awoken when a SyncRequest is performed. HLE Interfaces are now ClientPorts which override the HandleSyncRequest virtual member function to perform command handling immediately.
* | / / Minor amendment of GSP_GPU::ImportDisplayCaptureInfo codeJamePeng2016-12-131-3/+5
| |/ / |/| |
* | | Merge pull request #2267 from JayFoxRox/fix-mingw-ccSebastian Valle2016-12-111-2/+2
|\ \ \ | | | | | | | | Support mingw cross-compilation
| * | | gdbstub: Remove unused includeJannik Vogel2016-12-051-1/+0
| | | |
| * | | Support mingw cross-compileJannik Vogel2016-12-051-1/+2
| | | |
* | | | APT::GetStartupArgument: force clear startup argumentmailwl2016-12-112-5/+11
| | | |
* | | | Core: Add a forgotten #include <cstring> for memcpy.Emmanuel Gil Peyrot2016-12-111-0/+1
| | | |
* | | | Add all services to the Service namespaceLioncash2016-12-1145-482/+390
| | | | | | | | | | | | | | | | | | | | Previously there was a split where some of the services were in the Service namespace and others were not.
* | | | Merge pull request #2291 from lioncash/svcbunnei2016-12-0910-12/+61
|\ \ \ \ | | | | | | | | | | service: Add the cfg:nor service
| * | | | service: Add cfg:nor serviceLioncash2016-12-094-0/+49
| | | | |
| * | | | service: Drop '_Interface' from cfg service namesLioncash2016-12-097-12/+12
| | | | |
* | | | | Merge pull request #2292 from lioncash/boolYuri Kunde Schlesner2016-12-091-1/+1
|\ \ \ \ \ | |/ / / / |/| | | | ptm: Use boolean instead of integral value
| * | | | ptm: Use boolean instead of integral valueLioncash2016-12-091-1/+1
| | | | | | | | | | | | | | | | | | | | The third parameter of Write is actually a bool type, not an int.
* | | | | Merge pull request #2287 from lioncash/svcYuri Kunde Schlesner2016-12-0912-12/+170
|\ \ \ \ \ | | | | | | | | | | | | service: Minor PTM changes
| * | | | | service: Add the ptm:s serviceLioncash2016-12-083-0/+14
| | | | | | | | | | | | | | | | | | | | | | | | 3dbrew documents this as being the exact same as ptm:sysm
| * | | | | service: Add common ptm:u commands to other ptm servicesLioncash2016-12-084-0/+54
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | 3dbrew indicates that all services have access to these commands except for ptm:sets.
| * | | | | service: Drop '_Interface' in ptm service class namesLioncash2016-12-087-14/+14
| | | | | | | | | | | | | | | | | | | | | | | | Inheriting from Service::Interface makes this obvious.
| * | | | | service: Add ptm::gets and ptm::sets servicesLioncash2016-12-086-0/+90
| | | | | |
* | | | | | Merge pull request #2280 from Subv/citrace_sizeSebastian Valle2016-12-081-2/+2
|\ \ \ \ \ \ | |/ / / / / |/| | | | | Fixed the gpu command list size when creating CiTraces.
| * | | | | Fixed the gpu command list size when creating CiTraces.Subv2016-12-081-2/+2
| | |/ / / | |/| | |
* | | | | service: Add mvd and qtm servicesLioncash2016-12-0814-0/+271
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Adds the two New3DS-only modules. 3dbrew was used for command information.
* | | | | Merge pull request #2284 from lioncash/svcYuri Kunde Schlesner2016-12-088-30/+199
|\ \ \ \ \ | | | | | | | | | | | | service: Add nfc services
| * | | | | service: Add nfc servicesLioncash2016-12-088-30/+199
| | | | | | | | | | | | | | | | | | | | | | | | 3dbrew was used for the command information.
* | | | | | Merge pull request #2277 from lioncash/explicitYuri Kunde Schlesner2016-12-088-10/+10
|\ \ \ \ \ \ | |/ / / / / |/| | | | | file_sys: Make a few single-argument constructors explicit
| * | | | | file_sys: Make a few single-argument constructors explicitLioncash2016-12-078-10/+10
| | |_|_|/ | |/| | | | | | | | | | | | | Prevents implicit conversions.
* | | | | Merge pull request #2283 from lioncash/svcYuri Kunde Schlesner2016-12-0821-28/+212
|\ \ \ \ \ | | | | | | | | | | | | service: Update function tables
| * | | | | ssl_c: Update function tableLioncash2016-12-081-0/+3
| | | | | | | | | | | | | | | | | | | | | | | | Updated based off information from 3dbrew
| * | | | | ptm: Update ptm_sysm function tableLioncash2016-12-083-6/+7
| | | | | | | | | | | | | | | | | | | | | | | | Updated based off information from 3dbrew.
| * | | | | pm_app: Update function tableLioncash2016-12-081-6/+9
| | | | | | | | | | | | | | | | | | | | | | | | Updated based off information from 3dbrew.
| * | | | | nwm_uds: Update function tableLioncash2016-12-081-5/+7
| | | | | | | | | | | | | | | | | | | | | | | | Updated based off information from 3dbrew.
| * | | | | nim: Update function tablesLioncash2016-12-082-0/+2
| | | | | | | | | | | | | | | | | | | | | | | | Updated based off information from 3dbrew.
| * | | | | http_c: Update function tableLioncash2016-12-081-0/+4
| | | | | | | | | | | | | | | | | | | | | | | | Updated based off information from 3dbrew.
| * | | | | gsp_lcd: Update function tableLioncash2016-12-081-0/+4
| | | | | | | | | | | | | | | | | | | | | | | | Updated based off information from 3dbrew.
| * | | | | fs_user: Update function tableLioncash2016-12-081-0/+2
| | | | | | | | | | | | | | | | | | | | | | | | Updated based off information from 3dbrew.
| * | | | | dlp_srvr: Update function tableLioncash2016-12-081-0/+7
| | | | | |
| * | | | | cfg: Update function tablesLioncash2016-12-083-0/+3
| | | | | | | | | | | | | | | | | | | | | | | | Updated based off information from 3dbrew
| * | | | | cecd_u: Update function tableLioncash2016-12-081-1/+13
| | | | | | | | | | | | | | | | | | | | | | | | Updated based off information from 3dbrew.
| * | | | | boss_p: Update function tableLioncash2016-12-081-3/+68
| | | | | |
| * | | | | act: Update function tablesLioncash2016-12-082-0/+10
| | | | | | | | | | | | | | | | | | | | | | | | Updated based off information from 3dbrew.
| * | | | | apt: Update apt function tablesLioncash2016-12-082-7/+73
| | |_|/ / | |/| | | | | | | | | | | | | Updated based off information from 3dbrew.
* | | | | Merge pull request #2281 from lioncash/appletYuri Kunde Schlesner2016-12-088-30/+22
|\ \ \ \ \ | |/ / / / |/| | | | applet: minor interface changes
| * | | | applet: Move common IsRunning underlying variable to the Applet classLioncash2016-12-078-28/+19
| | | | | | | | | | | | | | | | | | | | Gets rid of basic duplication.
| * | | | applet: Make virtual destructor defaultedLioncash2016-12-071-1/+1
| | | | |
| * | | | applet: Make constructor protectedLioncash2016-12-071-1/+2
| | | | | | | | | | | | | | | | | | | | | | | | | Considering the class is abstract, there's no need to make the constructor public.
* | | | | Update AM service function tablesLioncash2016-12-086-113/+246
| |/ / / |/| | | | | | | | | | | Updated based off information from 3dbrew.
* | | | Merge pull request #2232 from wwylele/other-savebunnei2016-12-0711-80/+351
|\ \ \ \ | |/ / / |/| | | FS: implement archives for other game save data
| * | | FileSys: Implement OtherSaveDatawwylele2016-11-297-0/+214
| | | |
| * | | FS: add missing MediaTypewwylele2016-11-291-1/+1
| | | |
| * | | FileSys: abstract SD save data archive sourcewwylele2016-11-296-79/+136
| | | |
* | | | Implement Frame rate limiter (#2223)emmauss2016-12-063-0/+35
| |/ / |/| | | | | | | | | | | | | | * implement frame limiter * fixes
* | | GSP: Downgrade log severity of SetAxiConfigQoSModeYuri Kunde Schlesner2016-12-041-1/+1
| |/ |/| | | | | | | This function doesn't need to do anything for HLE and some games call it quite often, spamming up the logs.
* | Set client SDK version to Service APIsmailwl2016-11-307-13/+86
|/
* Merge pull request #2196 from Subv/system_modeYuri Kunde Schlesner2016-11-287-9/+35
|\ | | | | Kernel/Loader: Grab the system mode from the NCCH ExHeader.
| * Kernel/Loader: Grab the system mode from the NCCH ExHeader.Subv2016-11-283-16/+17
| | | | | | | | | | | | | | 3dsx and elf files default to system mode 2 (96MB allocated to the application). This allows Home Menu to boot without modifications. Closes #1849
| * Kernel/Loader: Grab the system mode from the NCCH ExHeader.Subv2016-11-207-9/+34
| | | | | | | | | | | | | | 3dsx and elf files default to system mode 2 (96MB allocated to the application). This allows Home Menu to boot without modifications. Closes #1849
* | Merge pull request #2222 from linkmauve/die-frameskip-dieYuri Kunde Schlesner2016-11-283-22/+1
|\ \ | | | | | | Remove the broken frame_skip option
| * | GPU: Remove the broken frame_skip option.Emmanuel Gil Peyrot2016-11-273-22/+1
| | | | | | | | | | | | Fixes #1960.
* | | Merge pull request #2132 from wwylele/fix-fs-errSebastian Valle2016-11-2827-304/+1180
|\ \ \ | |/ / |/| | Correct FS error codes & add path boundary checks
| * | FileSys: rename SaveDataCheck archive to NCCH archivewwylele2016-11-195-23/+22
| | | | | | | | | | | | According to the observation from game and 3dbrew "Used for accessing general NCCH data"
| * | FileSys: remove unused DiskArchivewwylele2016-11-192-179/+0
| | | | | | | | | | | | All "subclasses" of DiskArchive are splitted out. This class is useless
| * | PTM & CFG: use the correct path and error code according to the new FileSys policywwylele2016-11-192-5/+6
| | |
| * | FileSys: w->rw permission lift only happens in SDMC archivewwylele2016-11-194-2/+14
| | |
| * | FileSys: add SDMCWriteOnlyArchivewwylele2016-11-196-0/+140
| | |
| * | FileSys: add SDMCArchivewwylele2016-11-193-1/+301
| | | | | | | | | | | | Now DiskArchive only serves for SDMC, then it should be just a "SDMCArchive"
| * | FileSys: add ExtSaveDataArchivewwylele2016-11-192-1/+115
| | | | | | | | | | | | ExtSaveData is more similar to SaveData, so let it be a subclass of SaveData
| * | FileSys: add SaveDataArchivewwylele2016-11-197-4/+368
| | | | | | | | | | | | The error checking of SaveDataArchive is completely different from DiskArchive, so it has to be a new class instead of a subclass of DiskArchive.
| * | FileSys: remove Open from FileBackendwwylele2016-11-194-64/+44
| | | | | | | | | | | | Same as directory, file shouldn't expose Open either.
| * | FileSys: remove Open from DirectoryBackendwwylele2016-11-194-25/+5
| | | | | | | | | | | | Open should not be an interface exposed by Directory because it is the Archive thats implement the methed to open the directory. The service API of 3DS also implies this - Open is not a function of directory service, but is of FS main service
| * | FileSys: add PathParserwwylele2016-11-193-0/+161
| | |
| * | FileSys: make Archive interfaces return error codewwylele2016-11-016-87/+91
| | | | | | | | | | | | and make the mode parameter a reference since it is a BitField union
* | | Merge pull request #2168 from mailwl/micSebastian Valle2016-11-272-16/+307
|\ \ \ | | | | | | | | MIC_U: Stub service funcions
| * | | Output parameters to logmailwl2016-11-251-4/+6
| | | |
| * | | MIC_U: Stub service funcionsmailwl2016-11-252-16/+305
| | | |
* | | | dynarmic: Add ticks based on ticks executed, not ticks requestedMerryMage2016-11-261-2/+2
|/ / /
* | | Expose page table to dynarmic for optimized reads and writes to the JITJames Rowe2016-11-253-6/+18
| | |
* | | Bravely Default/Second stuck #1822 (#2188)pippo29312016-11-244-2/+22
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * Bravely Default/Second stuck #1822 CancelLibraryApplet stub * Log parameter. * Taking care of comments * Sync with 3DBrew * White space ? * lower case
* | | Merge pull request #2186 from wwylele/config9Yuri Kunde Schlesner2016-11-241-2/+8
|\ \ \ | | | | | | | | cfg: add config block 0x00090000
| * | | cfg: add config block 0x00090000wwylele2016-11-171-2/+8
| | | |
* | | | Merge pull request #1654 from JamePeng/errdispYuri Kunde Schlesner2016-11-241-118/+198
|\ \ \ \ | | | | | | | | | | Rework the code of err:f service!
| * | | | Rework the code of err:f serviceJamePeng2016-10-061-118/+198
| | | | |
* | | | | Merge pull request #2193 from Subv/pulse_eventsbunnei2016-11-202-0/+10
|\ \ \ \ \ | | | | | | | | | | | | Kernel/Events: Log an error when trying to create Pulse events and timers
| * | | | | Kernel/Events: Log an error when trying to create Pulse events and timers.Subv2016-11-192-0/+10
| | |_|_|/ | |/| | | | | | | | | | | | | Related to #1904
* / | | | APT/Applets: Renamed the members of the SignalType enum.Subv2016-11-195-16/+27
|/ / / / | | | | | | | | | | | | Names now make sense and match 3dbrew.
* | | | Merge pull request #2172 from jroweboy/fix-mingwbunnei2016-11-161-1/+1
|\ \ \ \ | | | | | | | | | | Fix mingw compilation support
| * | | | Add mingw compile supportJames Rowe2016-11-141-1/+1
| | |/ / | |/| |
* / | | Support additional screen layouts.James Rowe2016-11-052-0/+18
|/ / / | | | | | | | | | | | | Allows users to choose a single screen layout or a large screen layout. Adds a configuration option to change the prominent screen.
* | | Style fixmailwl2016-11-021-2/+2
| | |
* | | Rename AcConfig, change types u8 to u32mailwl2016-11-021-21/+25
| | |
* | | AC_U: Stub functions, used if EULA agreedmailwl2016-11-022-14/+190
| |/ |/|
* | Merge pull request #2126 from wwylele/stub-nwmbunnei2016-10-311-0/+11
|\ \ | | | | | | NWM: stub Initialize with an error
| * | NWM: stub Initialize with an errorwwylele2016-10-121-0/+11
| |/
* | Merge pull request #2123 from jbeich/freebsdbunnei2016-10-311-0/+8
|\ \ | | | | | | Fix build on DragonFly and FreeBSD
| * | core: some errno values are uncommon on UnixJan Beich2016-10-281-0/+8
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | src/core/hle/service/soc_u.cpp:107:6: error: 'ENODATA' was not declared in this scope {ENODATA, 43}, ^ src/core/hle/service/soc_u.cpp:117:6: error: 'ENOSR' was not declared in this scope {ENOSR, 53}, ^ src/core/hle/service/soc_u.cpp:118:6: error: 'ENOSTR' was not declared in this scope {ENOSTR, 54}, ^ src/core/hle/service/soc_u.cpp:139:6: error: 'ETIME' was not declared in this scope {ETIME, 75}, ^
* | | Small fix to let IDA see target.xmlmailwl2016-10-281-1/+1
|/ /
* | FRD: fix GetMyFriendKeymailwl2016-10-251-1/+1
| |
* | Fix typosRicardo de Almeida Gonzaga2016-10-205-5/+5
| |
* | Merge pull request #2024 from JamePeng/update-boss-codebunnei2016-10-083-4/+1808
|\ \ | |/ |/| Update the stub code of BOSS
| * Update the stub code of BOSSJamePeng2016-10-023-4/+1808
| |
* | Merge pull request #1652 from wwylele/kernal-toolbunnei2016-10-057-7/+26
|\ \ | | | | | | Debugger: implement wait tree widget
| * | move ResetType to kernel.hwwylele2016-09-223-7/+6
| | |
| * | name objectswwylele2016-09-221-0/+4
| | |
| * | implement wait tree widgetwwylele2016-09-224-0/+16
| |/
* | Merge pull request #2106 from wwylele/delete-recursivebunnei2016-10-048-22/+93
|\ \ | | | | | | FS: implement DeleteDirectoryRecursively
| * | fs: clean up log formatwwylele2016-10-021-22/+24
| | |
| * | fs: implement DeleteDirectoryRecursivelywwylele2016-10-028-1/+70
| |/
* | gpu: DisplayTransfer: a less amazing algorithm for flipwwylele2016-09-291-8/+11
| | | | | | | | the old implementation modifies the loop variable in the loop. Though it actually works, it is really confusing. Makes it morereadable now.
* | gpu: keep the old signal strategy for null pointerwwylele2016-09-291-4/+8
| | | | | | | | | | previous commits changes the behaviour of interrupt when meeting invalid params. Regresses to the same behaviour as before needs more hwtest
* | gpu: add validity check for TextureCopy, DisplayTransfer and FillMemorywwylele2016-09-291-6/+88
| | | | | | | | | | prevent further operation with invalid values which may cause assertion failure or divided by zero. needs more hwtest
* | memory: fix IsValidVirtualAddress for RasterizerCachedMemorywwylele2016-09-291-0/+3
| | | | | | | | RasterizerCachedMemory doesn't has pointer but should be considered as valid
* | gpu: move MemoryFill, TextureCopy and DisplayTransfer into functionswwylele2016-09-291-247/+249
|/ | | | The old code indented too much to read. Split into functions and do general cleanup.
* Remove special rules for Windows.h and library includesYuri Kunde Schlesner2016-09-211-1/+1
|
* Use negative priorities to avoid special-casing the self-includeYuri Kunde Schlesner2016-09-21106-106/+106
|
* Remove empty newlines in #include blocks.Emmanuel Gil Peyrot2016-09-21146-369/+117
| | | | | | | This makes clang-format useful on those. Also add a bunch of forgotten transitive includes, which otherwise prevented compilation.
* Manually tweak source formatting and then re-run clang-formatYuri Kunde Schlesner2016-09-1995-451/+467
|
* Sources: Run clang-format on everything.Emmanuel Gil Peyrot2016-09-18208-10514/+10705
|
* Dyncom: Disable clang-format on the decoding table.Emmanuel Gil Peyrot2016-09-181-0/+3
|
* arm_dynarmic: Implement GetVFPSystemReg/SetVFPSystemReg.bunnei2016-09-151-5/+12
|
* arm: ResetContext shouldn't be part of ARM_Interface.bunnei2016-09-156-30/+17
|
* arm_dynarmic/arm_dyncom: Remove unnecessary "virtual" keyword.bunnei2016-09-152-2/+2
|
* dyncom: Use VFP_FPSCR/VFP_FPEXC.bunnei2016-09-151-4/+4
|
* core: Add configuration option for CPU JIT.bunnei2016-09-152-7/+13
|
* dynarmic: Implement ARM CPU interface.bunnei2016-09-153-0/+233
|
* Merge pull request #2032 from bunnei/qt-graphicsbunnei2016-09-013-0/+12
|\ | | | | Qt graphics configure & V-Sync option
| * system: Add a function to see if the emulator is running.bunnei2016-08-302-0/+11
| |
| * config: Add a setting for graphics V-Sync.bunnei2016-08-301-0/+1
| |
* | configure_audio: User-configuratble option to enable/disable audio stretchingMerryMage2016-08-312-0/+2
| |
* | Merge pull request #2023 from yuriks/autobase-bcfntbunnei2016-08-303-30/+68
|\ \ | |/ |/| Auto-detect original shared_font.bin memory base
| * Auto-detect original shared_font.bin memory baseYuri Kunde Schlesner2016-08-273-30/+68
| | | | | | | | | | This allows a file dumped from either an o3DS or a n3DS (and potentially even an original unrebased file) to be used.
* | Merge pull request #1948 from wwylele/cro++Yuri Kunde Schlesner2016-08-2914-99/+3041
|\ \ | | | | | | Implemented CRO
| * | LDR: Implement CROwwylele2016-08-279-99/+3013
| | |
| * | ARM: add ClearInstructionCache functionwwylele2016-08-273-0/+11
| | |
| * | Memory: add ReadCString functionwwylele2016-08-272-0/+17
| |/
* | Merge pull request #1987 from Lectem/ipcdescriptorsYuri Kunde Schlesner2016-08-275-22/+110
|\ \ | |/ |/| fix #1942 and add a few IPC functions for descriptors
| * fix #1942 and adds a few IPC functions for descriptorsLectem2016-08-025-22/+110
| |
* | dyncom: Read-after-write in SMLAMerryMage2016-08-221-2/+4
| | | | | | | | | | In the case when RD === RN, RD was updated before AddOverflow was called to check for an overflow, resulting in an incorrect state of the Q flag.
* | Dyncom: Correct implementation of STM for R15MerryMage2016-08-141-3/+4
|/
* Merge pull request #1950 from JamePeng/fix-apt-0x0055004-and-0x00560000bunnei2016-07-295-22/+31
|\ | | | | Correct APT::0x00550040 and APT::0x00560000 function
| * Correct APT::0x00550040 and APT::0x00560000 functionJamePeng2016-07-155-22/+31
| |
* | Instead of segfaulting, log an error to remind the user to dump the shared font fileHenrik Rydgard2016-07-281-0/+7
| |
* | Merge pull request #1959 from MerryMage/revsh-upstreambunnei2016-07-281-4/+13
|\ \ | | | | | | dyncom: Fix translation of thumb REVSH
| * | dyncom: Fix translation of thumb REVSHMerryMage2016-07-281-4/+13
| | |
* | | CoreTiming: avoid overflowwwylele2016-07-231-1/+1
| | |
* | | HLE: implement system timewwylele2016-07-232-2/+60
| |/ |/|
* | Merge pull request #1894 from wwylele/set-config-blockYuri Kunde Schlesner2016-07-106-37/+253
|\ \ | | | | | | Implement config savegame editing & clean up
| * | Service::CFG/FS: add and refactor out utilities for front-endwwylele2016-07-034-15/+146
| | |
| * | Service::CFG: move known block ID to an enumwwylele2016-07-031-11/+25
| | |
| * | Service::CFG: add SetConfigInfoBlk4wwylele2016-07-034-8/+73
| | |
| * | Service::CFG: add missing languagewwylele2016-07-021-1/+2
| | |
| * | Service::CFG: name sound output modeswwylele2016-07-022-2/+7
| |/
* | Merge pull request #1940 from JamePeng/fix-archive-error-codebunnei2016-07-072-10/+15
|\ \ | | | | | | Fix the errorcode of archive handle
| * | Fix the errorcode of archive handleJamePeng2016-07-042-10/+15
| | |
* | | Merge pull request #1921 from Subv/fs_funcsSebastian Valle2016-07-051-11/+42
|\ \ \ | | | | | | | | HLE/FS: Document some command parameters and implemented command 0x08560240
| * | | HLE/FS: Document some command parameters and implemented command 0x08560240 (CreateLegacySystemSaveData)Subv2016-07-031-11/+42
| | | |
* | | | HLE/Applets: Implement ErrEula appletmailwl2016-07-045-0/+118
| |/ / |/| |
* | | Result: fix and update ErrorModulewwylele2016-06-301-6/+19
| |/ |/|
* | Merge pull request #1869 from wwylele/dont-be-lazyYuri Kunde Schlesner2016-06-291-2/+6
|\ \ | | | | | | Switch context to the same thread if necessary
| * | Switch context on the same thread if necessarywwylele2016-05-301-2/+6
| | |
* | | Merge pull request #1867 from mailwl/srv-updatebunnei2016-06-292-15/+125
|\ \ \ | | | | | | | | srv: Update according 3dbrew
| * | | Fix parameter name in EnableNotificationmailwl2016-05-312-2/+6
| | | |
| * | | Fix mistakes, add output header codesmailwl2016-05-311-8/+24
| | | |
| * | | remove ugly functionmailwl2016-05-311-35/+3
| | | |
| * | | srv: Update according 3dbrewmailwl2016-05-311-15/+137
| |/ /
* | | Merge pull request #1877 from wwylele/wait-fix-timeoutbunnei2016-06-181-0/+49
|\ \ \ | | | | | | | | Thread: update timeout when reruning WaitSynch
| * | | Thread: update timeout when rerunning WaitSynchwwylele2016-06-041-0/+49
| |/ /
* | | Merge pull request #1898 from archshift/interpreter-split-take2bunnei2016-06-165-2727/+2729
|\ \ \ | |_|/ |/| | Refactor arm_dyncom_interpreter into several files (take 2)
| * | Make arm_dyncom_trans* into a fully fledged compilation unitarchshift2016-06-124-53/+73
| | |
| * | arm_dyncom_interpreter: slightly change AllocBuffer to be intuitivearchshift2016-06-121-15/+15
| | |
| * | arm_dyncom_interpreter: Add specialized GetAddressingOpLoadStoreT funcarchshift2016-06-112-39/+19
| | | | | | | | | | | | | | | | | | This allows us to get the addressing operation for STRT, LDRT, STRBT, and LDRBT. We do this so that translation functions don't need to see the addressing ops directly.
| * | arm_dyncom_interpreter: rename operation functions to fit style guidearchshift2016-06-112-34/+34
| | |
| * | arm_dyncom_interpreter: Rename anonymous enum to TransExtDataarchshift2016-06-114-166/+164
| | |
| * | arm_dyncom_interpreter.cpp: #include translation info from inc filesarchshift2016-06-113-2648/+2652
| | |
* | | Merge pull request #1842 from Subv/portsbunnei2016-06-128-3/+178
|\ \ \ | | | | | | | | Kernel: Added ClientPort and ServerPort classes, along with svcCreatePort.
| * | | Kernel/SVC: Implemented svcCreatePort.Subv2016-06-116-3/+41
| | | |
| * | | Kernel: Added ClientPort and ServerPort classes.Subv2016-06-056-2/+139
| | | | | | | | | | | | | | | | This is part of an ongoing effort to implement support for multiple processes.
* | | | hid: add missing headerwwylele2016-06-111-0/+2
| | | |
* | | | Merge pull request #1789 from wwylele/input-refactorbunnei2016-06-113-40/+53
|\ \ \ \ | | | | | | | | | | Refactor input mapping & implement circle pad modifier
| * | | | fixup! fixup! Refactor input systemwwylele2016-05-151-1/+1
| | | | |
| * | | | implement circle pad modifierwwylele2016-05-151-1/+5
| | | | |
| * | | | Refactor input subsystemwwylele2016-05-153-40/+49
| | | | |
* | | | | Revert "Split huge interpreter source file into translation info and interpreter (+ some tiny misc style fixes)"archshift2016-06-115-2731/+2727
| | | | |
* | | | | arm_dyncom_interpreter: rename operation functions to fit style guidearchshift2016-06-092-42/+42
| | | | |
* | | | | arm_dyncom_interpreter.cpp: Split by translation and interpreter logicarchshift2016-06-095-2727/+2731
| |_|/ / |/| | | | | | | | | | | | | | | To facilitate the split, some small changes were made to names of various structures and functions.
* | | | gdbstub: E0 should be E00shinyquagsire232016-06-081-1/+1
| | | |
* | | | service: Add other DLP servicesLioncash2016-06-0510-23/+150
| |/ / |/| | | | | | | | | | | | | | Specifically, dlp::CLNT and dlp::FKCL Moves them to their own folder like with other services.
* | | gsp::gpu: Reset g_thread_id in UnregisterInterruptRelayQueuemailwl2016-06-012-15/+22
| |/ |/|
* | Merge pull request #1692 from Subv/rm_getpointer2bunnei2016-05-3017-138/+454
|\ \ | | | | | | Memory: Remove most usages of GetPointer
| * | Memory: Handle RasterizerCachedMemory and RasterizerCachedSpecial page types in the memory block manipulation functions.Subv2016-05-282-2/+60
| | |
| * | Memory: Make ReadBlock and WriteBlock accept void pointers.Subv2016-05-285-21/+19
| | |
| * | SOC_U: Remove usage of GetPointerSubv2016-05-281-27/+73
| | |
| * | SSL_C: Remove use of Memory::GetPointerMerryMage2016-05-281-4/+3
| | |
| * | GSP_GPU: Remove use of Memory::GetPointerMerryMage2016-05-281-33/+50
| | |
| * | Memory: CopyBlockMerryMage2016-05-282-2/+43
| | |
| * | DSP_DSP: Remove use of Memory::GetPointerMerryMage2016-05-281-7/+10
| | |
| * | FS/Archive: Remove use of Memory::GetPointerMerryMage2016-05-281-7/+14
| | |
| * | CFG: Remove use of Memory::GetPointerMerryMage2016-05-211-6/+10
| | |
| * | APT: Remove use of Memory::GetPointerMerryMage2016-05-215-35/+36
| | |
| * | Kernel/Thread: Remove use of Memory::GetPointerMerryMage2016-05-211-1/+1
| | |
| * | Applets/swkdb: Remove use of Memory::GetPointerMerryMage2016-05-211-1/+1
| | |
| * | Memory: ZeroBlockMerryMage2016-05-212-0/+39
| | |
| * | FileSys/Path: Replace Memory::GetPointer with Memory::ReadBlockMerryMage2016-05-211-6/+6
| | |
| * | Memory: ReadBlock/WriteBlockMerryMage2016-05-213-4/+81
| | |
| * | Memory: IsValidVirtualAddress/IsValidPhysicalAddressMerryMage2016-05-213-0/+26
| | |
* | | Merge pull request #1756 from wwylele/config-cleanupbunnei2016-05-291-29/+13
|\ \ \ | | | | | | | | Config block: clean up
| * | | clean up config blockwwylele2016-05-031-29/+13
| | | |
* | | | Merge pull request #1568 from JayFoxRox/fix-printfMat M2016-05-273-26/+61
|\ \ \ \ | | | | | | | | | | Fix ftoi and disable VFPv3
| * | | | Fix ftoi behaviourJannik Vogel2016-05-162-22/+53
| | | | |
| * | | | Respect fpscr in ftoizJannik Vogel2016-05-162-4/+4
| | | | |
| * | | | Disable VFP3 instructionsJannik Vogel2016-05-161-0/+4
| | | | |
* | | | | Merge pull request #1810 from JayFoxRox/fix-float-exceptionsbunnei2016-05-273-91/+130
|\ \ \ \ \ | | | | | | | | | | | | Fix float exceptions
| * | | | | Remove `exceptions` parameter from `normaliseround` VFP functionsJannik Vogel2016-05-183-28/+57
| | | | | |
| * | | | | Fix exception propagation for VFP single precisionJannik Vogel2016-05-182-33/+38
| | | | | |
| * | | | | Fix exception propagation for VFP double precisionJannik Vogel2016-05-182-34/+39
| | |_|/ / | |/| | |
* | | | | Merge pull request #1855 from MerryMage/memory-headers-20160526Mat M2016-05-262-1/+2
|\ \ \ \ \ | | | | | | | | | | | | Memory: Added necessary headers and removed unnecessary header
| * | | | | Memory: Added necessary headers and removed unnecessary headerMerryMage2016-05-262-1/+2
| |/ / / /
* | | | | Merge pull request #1817 from linkmauve/smdh-stuffbunnei2016-05-2510-105/+198
|\ \ \ \ \ | | | | | | | | | | | | Improve SMDH support in loaders and frontends
| * | | | | Loader: Split SMDH into its own header and import helpers from QGameListEmmanuel Gil Peyrot2016-05-214-47/+138
| | | | | | | | | | | | | | | | | | | | | | | | Also rewrite Qt wrappers to use those.
| * | | | | CitraQt: Simplify the game list loader codeEmmanuel Gil Peyrot2016-05-212-14/+12
| | | | | |
| * | | | | Loader: Add a GetFileType method to get the type of a loaded fileEmmanuel Gil Peyrot2016-05-214-0/+30
| | | | | |
| * | | | | Loader, Frontends: Refactor loader creation and game loadingEmmanuel Gil Peyrot2016-05-214-47/+21
| |/ / / / | | | | | | | | | | | | | | | | | | | | This allows frontends to keep a single loader and use it multiple times e.g. for code loading and SMDH parsing.
* | | | | New3DS: Minor style cleanup to #1520.bunnei2016-05-242-3/+3
| | | | |
* | | | | Merge pull request #1520 from JamePeng/checknew3dsbunnei2016-05-249-10/+138
|\ \ \ \ \ | | | | | | | | | | | | Implement CheckNew3DS and CheckNew3DSApp
| * | | | | Implement CheckNew3DS and CheckNew3DSAppJamePeng2016-04-209-10/+138
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Append an item[is_new3ds] to config file[System] group Implement APT::SetNSStateField,it will update the unknown NS_state_field
* | | | | | SVC::WaitSynchronizationN: Reschedule at the endwwylele2016-05-211-2/+3
| |/ / / / |/| | | |
* | | | | Fix read-after-write in SMUAD, SMLAD, SMUSD, SMLSDJannik Vogel2016-05-181-4/+8
| | | | |
* | | | | Update ACT:U and create ACT:A (#1809)András Domonkos2016-05-185-0/+56
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * Update ACT_U * Create act_a.h * Create act_a.cpp * Add service ACT:A * Add ACT:A source and header * Fix wrong header
* | | | | Merge pull request #1800 from JayFoxRox/set-fpscrbunnei2016-05-183-0/+6
|\ \ \ \ \ | |_|/ / / |/| | | | Set fpscr for new threads
| * | | | Set fpscr for new threadsJannik Vogel2016-05-173-0/+6
| | | | |
* | | | | DSP_DSP: Remove GetHeadphoneStatus logspam (#1799)Maribel2016-05-161-2/+2
| |_|_|/ |/| | |
* | | | Memory: Fixed a regression caused by #1695 and #1689.Subv2016-05-141-0/+3
|/ / / | | | | | | | | | | | | | | | Reserve enough space in the vector that holds the linear heap memory to prevent relocations of the backing memory when growing too much. Closes #1790
* | | Merge pull request #1689 from Subv/shmembunnei2016-05-1318-128/+417
|\ \ \ | | | | | | | | Kernel: Implemented shared memory.
| * | | HLE/Applets: Give each applet its own block of heap memory, and use that when creating the framebuffer shared memory block.Subv2016-05-135-5/+44
| | | |
| * | | Kernel: Account for automatically-allocated shared memories in the amount of used linear heap memory.Subv2016-05-131-0/+5
| | | |
| * | | APT: Move the shared font loading and relocation functions to their own subdirectory services/apt/bcfnt.Subv2016-05-134-66/+167
| | | |
| * | | Kernel/SharedMemory: Log an error when Map fails.Subv2016-05-131-1/+10
| | | |
| * | | Kernel: Implemented shared memory permissions.Subv2016-05-134-9/+50
| | | |
| * | | APT: Implement relocating the shared font to its true address.Subv2016-05-131-9/+74
| | | |
| * | | Kernel/Memory: Remove the Shared Memory region from the legacy memory map.Subv2016-05-131-1/+0
| | | |
| * | | Kernel/SharedMemory: Properly implemented shared memory support.Subv2016-05-1310-118/+147
| | | | | | | | | | | | | | | | | | | | | | | | | | | | Applications can request the kernel to allocate a piece of the linear heap for them when creating a shared memory object. Shared memory areas are now properly mapped into the target processes when calling svcMapMemoryBlock. Removed the APT Shared Font hack as it is no longer needed.
| * | | Kernel/SVC: Fixed the register order for svcCreateMemoryBlock.Subv2016-05-132-2/+3
| | | | | | | | | | | | | | | | R0 is used as the last parameter instead of R4.
* | | | Merge pull request #1695 from Subv/tls_allocbunnei2016-05-135-28/+74
|\ \ \ \ | | | | | | | | | | Kernel/Threads: Dynamically allocate the TLS region for threads.
| * | | | Kernel/Threads: Dynamically allocate the TLS region for threads in the BASE region of the linear heap.Subv2016-05-075-28/+74
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Each thread gets a 0x200-byte area from the 0x1000-sized page, when all 8 thread slots in a single page are used up, the kernel allocates a new page to hold another 8 entries. This is consistent with what the real kernel does.
* | | | | gdbstub: Silence missing prototype warningsLioncash2016-05-101-3/+3
| | | | |
* | | | | dyncom: Reset the context into user mode correctlyLioncash2016-05-091-1/+1
| |/ / / |/| | | | | | | | | | | The other mode was system mode.
* | | | Merge pull request #1766 from Subv/log_cpubunnei2016-05-083-0/+10
|\ \ \ \ | | | | | | | | | | Kernel/Threading: Warn when a thread can be scheduled in the Syscore (Core 1)
| * | | | Kernel/Threading: Warn when a thread can be scheduled in the Syscore (Core 1).Subv2016-05-073-0/+10
| |/ / / | | | | | | | | | | | | We do not currently implement any cores other than the AppCore (Core 0).
* | | | Merge pull request #1718 from alex-laties/fixup-type-conversionsbunnei2016-05-075-29/+29
|\ \ \ \ | | | | | | | | | | fixup simple type conversions where possible
| * | | | fixup simple type conversions where possibleAlexander Laties2016-05-075-29/+29
| | | | |
* | | | | Merge pull request #1761 from Subv/applets_fbbunnei2016-05-075-23/+44
|\ \ \ \ \ | |/ / / / |/| | | | HLE/Applets: Use the correct size for the framebuffer SharedMemory
| * | | | HLE/Applets: Use the correct size for the framebuffer SharedMemory in the swkbd and MiiSelector applets.Subv2016-05-075-23/+44
| | |_|/ | |/| |
* | | | fix:return proper errorwwylele2016-05-061-2/+3
| | | |
* | | | Merge pull request #1762 from bunnei/globalbunnei2016-05-064-8/+21
|\ \ \ \ | | | | | | | | | | hle: Get rid of direct global access to g_reschedule
| * | | | HLE: Rename RescheduleIsPending to IsReschedulePending.bunnei2016-05-063-3/+3
| | | | |
| * | | | hle: Get rid of global access to g_rescheduleLioncash2016-03-214-8/+21
| | | | | | | | | | | | | | | | | | | | | | | | | This shouldn't be directly exposed if there's already a partial API that operates on it. We can just provide the rest of that API.
* | | | | Merge pull request #1700 from wwylele/gamelist-iconbunnei2016-05-066-23/+149
|\ \ \ \ \ | | | | | | | | | | | | Qt: display game icon and title in the game list
| * | | | | add icon & title to game listwwylele2016-05-046-23/+149
| | | | | |
* | | | | | Layout Mii parameters input/output, and return success as result of applet workmailwl2016-05-052-0/+49
| |_|/ / / |/| | | |
* | | | | Merge pull request #1732 from wwylele/config00170000bunnei2016-05-032-13/+4
|\ \ \ \ \ | | | | | | | | | | | | add config block 0x00170000; remove duplicated content
| * | | | | remove duplicated function declarationwwylele2016-05-011-13/+0
| | | | | |
| * | | | | add config block 0x00170000wwylele2016-04-291-0/+4
| |/ / / /
* | | | | VideoCore: Run include-what-you-use and fix most includes.Emmanuel Gil Peyrot2016-04-304-2/+4
| | | | |
* | | | | LCD: Remove unneeded #undef with no matching #define.Emmanuel Gil Peyrot2016-04-301-2/+0
| | | | |
* | | | | Merge pull request #1729 from MerryMage/null-sinkbunnei2016-04-302-0/+8
|\ \ \ \ \ | | | | | | | | | | | | Audio Config: Implement null sink and implement sink configuration
| * | | | | Audio: Add sink selection to configuration filesMerryMage2016-04-302-0/+8
| |/ / / /
* | | | | Merge pull request #1650 from JamePeng/update-the-ndm-codebunnei2016-04-303-27/+420
|\ \ \ \ \ | | | | | | | | | | | | Update the stub code of NDM service!
| * | | | | Update the stub code of NDM service!JamePeng2016-04-203-27/+420
| | | | | |
* | | | | | Merge pull request #1647 from mailwl/acu-closeasyncbunnei2016-04-302-1/+29
|\ \ \ \ \ \ | | | | | | | | | | | | | | ac:u: stub CloseAsync; align memory size in svc:GetProcessInfo(type=2)
| * | | | | | ac:u: stub CloseAsync; check memory size aling in svc:GetProcessInfo(type=2)mailwl2016-04-212-1/+29
| |/ / / / /
* | | | | | Merge pull request #1699 from mailwl/gpu-rightsbunnei2016-04-301-2/+38
|\ \ \ \ \ \ | |_|/ / / / |/| | | | | gsp::Gpu: implement AcquireRight, ReleaseRight functions
| * | | | | return checks if event and memory createdmailwl2016-04-231-1/+8
| | | | | |
| * | | | | gsp::Gpu: implement AcquireRight, ReleaseRight functionsmailwl2016-04-221-8/+37
| | | | | |
* | | | | | Common: Remove section measurement from profiler (#1731)Yuri Kunde Schlesner2016-04-293-12/+0
| | | | | | | | | | | | | | | | | | | | | | | | This has been entirely superseded by MicroProfile. The rest of the code can go when a simpler frametime/FPS meter is added to the GUI.
* | | | | | Merge pull request #1708 from MerryMage/dsp_dspbunnei2016-04-273-59/+152
|\ \ \ \ \ \ | | | | | | | | | | | | | | DSP Service: Cleanup
| * | | | | | DSP_DSP: Fix log format strings and argumentsMerryMage2016-04-271-12/+20
| | | | | | |
| * | | | | | DSP_DSP: Add return IPC headersMerryMage2016-04-272-4/+27
| | | | | | |
| * | | | | | DSP_DSP: Updated interrupt implementationMerryMage2016-04-272-42/+106
| | | | | | |
| * | | | | | DSP_DSP: Remove unused variableMerryMage2016-04-241-2/+0
| | | | | | |
* | | | | | | y2r_u: Cleanup some formatting.bunnei2016-04-271-52/+89
| | | | | | |
* | | | | | | Merge pull request #1447 from JamePeng/update-y2r-servicebunnei2016-04-272-32/+357
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | Update the code of service y2r!
| * | | | | | | Update the code of service y2r!JamePeng2016-04-202-32/+357
| | |_|/ / / / | |/| | | | |
* | | | | | | am: title_id is long long uintSam Spilsbury2016-04-241-1/+1
| |/ / / / / |/| | | | |
* | | | | | ncch: Use correct format specifier (for long long uint)Sam Spilsbury2016-04-231-1/+1
| | | | | |
* | | | | | fs: Fix what appears to be a typo (filename_size / file_size)Sam Spilsbury2016-04-231-1/+1
| | | | | |
* | | | | | gdbstub: Don't check if unsigned int is > 0Sam Spilsbury2016-04-231-2/+2
| |/ / / / |/| | | |
* | | | | HWRasterizer: Texture forwardingtfarley2016-04-217-181/+348
| | | | |
* | | | | Config: Add scaled resolution optiontfarley2016-04-212-1/+2
|/ / / /
* | | | Merge pull request #1612 from ObsidianX/get-set-sockoptbunnei2016-04-191-3/+97
|\ \ \ \ | |_|/ / |/| | | SOC:U GetSockOpt/SetSockOpt
| * | | Rework sockopt translation to match the error translation code already in placeRyan Loebs2016-04-021-22/+30
| | | |
| * | | Code styleRyan Loebs2016-03-301-2/+2
| | | |
| * | | Added GetSockOptNameRyan Loebs2016-03-301-15/+58
| | | | | | | | | | | | | | | | Filter out and translate invalid sockopt names.
| * | | Derp: win32: typedef int socklen_t;Ryan Loebs2016-03-291-4/+0
| | | |
| * | | But of course, Windows uses 'int' while Linux uses 'socklen_t'Ryan Loebs2016-03-291-0/+4
| | | |
| * | | Compiling on Windows nowRyan Loebs2016-03-291-3/+3
| | | |
| * | | Formatting...Ryan Loebs2016-03-291-1/+1
| | | |
| * | | Addressing PR commentsRyan Loebs2016-03-291-4/+4
| | | |
| * | | SOC UpdatesRyan Loebs2016-03-291-3/+46
| | | | | | | | | | | | | | | | | | | | | | | | -Implement GetSockOpt / SetSockOpt -Fix bug in RecvFrom where sending from localhost does not fill in src_addr/src_addr_len on Linux
* | | | core: Clean out some unnecessary header includesLioncash2016-04-163-14/+1
| | | |
* | | | Merge pull request #1667 from wwylele/ncch-loader-fixbunnei2016-04-151-2/+2
|\ \ \ \ | | | | | | | | | | loader: only decompress code section
| * | | | ncch:only decompress .code sectionwwylele2016-04-141-2/+2
| | | | |
* | | | | Y2R: num_tiles should be allowed when its value is 128 (#1669)JamePeng2016-04-151-1/+1
|/ / / /
* | | | Merge pull request #1613 from mailwl/anpbunnei2016-04-112-2/+7
|\ \ \ \ | | | | | | | | | | Set Kernel config "Hardware Inited" to 1 (true)
| * | | | Set Kernel config "Unknown Value" to 0x1mailwl2016-04-112-2/+7
| | | | |
* | | | | CitraQt: Apply config at startupJannik Vogel2016-04-112-0/+16
|/ / / /
* | | / Fix BLX LR opcode interpretationmailwl2016-04-091-2/+3
| |_|/ |/| |
* | | Merge pull request #1644 from polaris-/gdb-fixesbunnei2016-04-081-23/+85
|\ \ \ | | | | | | | | Adopted WinterMute's gdbstub changes
| * | | Adopted WinterMute's gdbstub changespolaris-2016-04-061-23/+85
| | | | | | | | | | | | | | | | | | | | This fixes the comments left on the PR (whitespace, SO_REUSEADDR, comment changes).
* | | | update the code of AM service! (#1623)JamePeng2016-04-086-51/+289
| | | |
* | | | cecd:u: stub GetCecStateAbbreviated (#1648)mailwl2016-04-083-0/+28
| | | |
* | | | Update cpsr (T)humb bit while creating threadmailwl2016-04-081-1/+1
| | | |
* | | | Merge pull request #1577 from JamePeng/update-apta-funcbunnei2016-04-075-8/+47
|\ \ \ \ | | | | | | | | | | Append the missing function name"GetAppletInfo", "SetAppCpuTimeLimit" and "GetAppCpuTimeLimit" to APT:A
| * | | | append SetAppCpuTimeLimit and GetAppCpuTimeLimit to APT:AJamePeng2016-04-063-13/+16
| | | | |
| * | | | implement APT::GetStartupArgumentJamePeng2016-04-045-2/+37
| | | | |
| * | | | Append the missing function name"GetAppletInfo" to APT:AJamePeng2016-04-041-1/+2
| | | | |
* | | | | Fix thumb ADR instruction alignmentmailwl2016-04-061-6/+2
| |/ / / |/| | |
* | | | Merge pull request #1435 from mailwl/frd_ubunnei2016-04-064-55/+234
|\ \ \ \ | | | | | | | | | | frd:u: Initial stub some functions
| * | | | frd:u: Initial stub some functionsmailwl2016-03-274-55/+234
| | |/ / | |/| |
* | | | Merge pull request #1643 from MerryMage/make_uniqueMathew Maidment2016-04-0614-37/+31
|\ \ \ \ | |_|/ / |/| | | Common: Remove Common::make_unique, use std::make_unique
| * | | Common: Remove Common::make_unique, use std::make_uniqueMerryMage2016-04-0514-37/+31
| | |/ | |/|
* | | Merge pull request #1616 from exhalatio/dlp_dummybunnei2016-04-034-0/+63
|\ \ \ | | | | | | | | Dummy implementation dlp:SRVR Service.
| * | | Dummy implementation dlp:SRVR Service.exhalatio2016-04-024-0/+63
| | | |
* | | | Merge pull request #1619 from mailwl/cecdbunnei2016-04-023-3/+54
|\ \ \ \ | | | | | | | | | | cecd:u: stub GetCecInfoEventHandle, GetChangeStateEventHandle
| * | | | cecd:u: stub GetCecInfoEventHandle, GetChangeStateEventHandlemailwl2016-03-313-3/+54
| | | | |
* | | | | Merge pull request #1390 from purpasmart96/citra_gsp_error_codesbunnei2016-04-013-80/+97
|\ \ \ \ \ | | | | | | | | | | | | GSP: Return proper error codes for register writes
| * | | | | GSP: Return proper error codes for register writespurpasmart962016-03-313-80/+97
| |/ / / /
* | | | | Merge pull request #1618 from MerryMage/one-stepMathew Maidment2016-03-311-26/+57
|\ \ \ \ \ | | | | | | | | | | | | Prevent cache overflow when single stepping
| * | | | | DynCom: Optimize single steppingMerryMage2016-03-301-26/+57
| | |_|/ / | |/| | |
* | | | | Merge pull request #1419 from mailwl/branch-gspbunnei2016-03-311-6/+41
|\ \ \ \ \ | |_|/ / / |/| | | | Add gsp functions: SetAxiConfigQoSMode, UnregisterInterruptRelayQueue
| * | | | Add gsp functions: SetAxiConfigQoSMode, UnregisterInterruptRelayQueuemailwl2016-03-311-6/+41
| | |_|/ | |/| |
* / | | Add common methods to all cfg:* portsRyan Loebs2016-03-293-0/+21
|/ / /
* | | use reference instead of pointerwwylele2016-03-261-9/+9
| | |
* | | Merge pull request #1549 from wwylele/acc_gyrobunnei2016-03-264-23/+187
|\ \ \ | |_|/ |/| | hid: implement accelerometer and gyroscope back-end
| * | implement GyroscopeCalibrateParamwwylele2016-03-252-9/+20
| | |
| * | implement accel and gyro backendwwylele2016-03-224-23/+176
| | |
* | | Merge pull request #1560 from lioncash/savedatabunnei2016-03-221-1/+2
|\ \ \ | | | | | | | | archive_extsavedata: Fix member initialization order
| * | | archive_extsavedata: Fix member initialization orderLioncash2016-03-211-1/+2
| | |/ | |/| | | | | | | shared appears in the initializer list before mount_point
* | | Merge pull request #1563 from lioncash/lolfiqbunnei2016-03-221-4/+3
|\ \ \ | | | | | | | | armstate: Correct FIQ register banking
| * | | armstate: Correct FIQ register bankingLioncash2016-03-211-4/+3
| |/ / | | | | | | | | | FIQ has seven banked registers (R8 to R14), not two.
* | | Merge pull request #1559 from lioncash/vecbunnei2016-03-211-8/+5
|\ \ \ | | | | | | | | soc_u: Get rid of explicit delete and new
| * | | soc_u: Get rid of explicit delete and newLioncash2016-03-211-8/+5
| |/ /
* | | session: Make helper functions constexprLioncash2016-03-211-6/+6
| | |
* | | loader: Make MakeMagic constexprLioncash2016-03-211-1/+1
|/ /
* | Merge pull request #1302 from Subv/save_fixbunnei2016-03-2024-143/+400
|\ \ | | | | | | HLE/FS: Fixed many corner cases in our file handling
| * | HLE/FS: Change the error code returned when an ExtSaveData archive is not found.Subv2016-03-205-33/+45
| | | | | | | | | | | | This allows Fire Emblem to boot again.
| * | HLE/FS: Corrected some style concerns.Subv2016-03-208-14/+12
| | |
| * | HLE/FS: Fixed creating the config savefile when it doesn't exist.Subv2016-03-201-1/+1
| | | | | | | | | | | | This fixes a regression.
| * | HLE/FS: Implemented GetFormatInfoSubv2016-03-2019-62/+257
| | | | | | | | | | | | Format information is currently only implemented for the ExtSaveData, SharedExtSaveData and SaveData archives, the information is stored in a file alongside the root folder of the archive.
| * | HLE/FS: Don't return an error when deleting the ExtSaveData if it does not exist.Subv2016-03-201-1/+1
| | |
| * | HLE/FS: Return the proper error codes when opening files.Subv2016-03-207-28/+43
| | |
| * | HLE/FS: Fixed the OpenDirectory error codeSubv2016-03-201-1/+1
| | |
| * | HLE/FS: Return the proper error codes on file Read/Write operations.Subv2016-03-207-18/+40
| | | | | | | | | | | | These operations are limited by the open flags specified while opening the file.
| * | HLE/FS: Corrected the error codes for DeleteFileSubv2016-03-206-12/+22
| | |
| * | HLE/FS: Corrected the error codes for CreateFileSubv2016-03-202-2/+7
| | |
| * | HLE/FS: FS::CreateFile takes an u64 for the file size.Subv2016-03-208-10/+10
| |/
* / Fix missing headerLittleWhite2016-03-201-0/+2
|/
* Merge pull request #1505 from pippo2931/fefbunnei2016-03-181-1/+25
|\ | | | | GetArchiveResource stub
| * Fix headerpippo29312016-03-121-1/+1
| |
| * GetArchiveResource stubpippo29312016-03-121-1/+25
| |
* | core/video_core: Make NumIds functions constexprLioncash2016-03-172-2/+2
| |
* | core/video_core: Don't cast away const in subscript operatorsLioncash2016-03-172-6/+6
| | | | | | | | Not to say these subscript operators aren't totally ugly as is.
* | Reorganize the ndm service path for dummy implement functionJamePeng2016-03-146-26/+122
| | | | | | | | | | | | SuspendDaemons , ResumeDaemons , OverrideDefaultDaemons The NDM file move to /core/hle/service/ndm/ now!
* | hid: fix pad updatewwylele2016-03-131-1/+1
| |
* | svc: Move ResetType enum to the kernel event headerLioncash2016-03-1310-16/+17
| |
* | svc: Remove unused ArbitrationType enumLioncash2016-03-121-9/+0
| | | | | | | | An equivalent enum already exists within address_arbiter.h
* | svc: Make ResetType an enum classLioncash2016-03-1211-24/+23
|/
* Merge pull request #1266 from Subv/miiappletbunnei2016-03-127-2/+156
|\ | | | | HLE/Applets: Implemented a dummy Mii Selector applet.
| * HLE/Applets: Implemented a dummy Mii Selector applet.Subv2016-03-127-2/+156
| | | | | | | | This prevents some games (like Super Mario 3D Land) from freezing when trying to launch it, however, it's not complete and won't let you go past Mii selection as the parameter structure hasn't been reverse engineered yet.
* | Merge pull request #1500 from lioncash/nullptrbunnei2016-03-121-1/+1
|\ \ | | | | | | gsp_gpu: Change 0 literal to nullptr
| * | gsp_gpu: Change 0 literal to nullptrLioncash2016-03-121-1/+1
| | |
* | | hle: Update service function tablesLioncash2016-03-124-1/+16
|/ /
* | Fix missing returnLittleWhite2016-03-091-0/+2
| |
* | Merge pull request #1474 from lioncash/rendererbunnei2016-03-093-10/+10
|\ \ | | | | | | renderer_base: Minor changes
| * | renderer_base: Don't directly expose the rasterizer unique_ptrLioncash2016-03-093-10/+10
| | | | | | | | | | | | | | | There's no reason to allow direct access to the unique_ptr instance. Only its contained pointer.
* | | Merge pull request #1344 from LittleWhite-tb/error-outputbunnei2016-03-095-9/+17
|\ \ \ | |/ / |/| | Output errors in GUI
| * | Improve error report from Init() functionsLittleWhite2016-03-085-7/+14
| | | | | | | | | | | | Add error popup when citra initialization failed
| * | Display errors in GUI when loading ROM failedLittleWhite2016-03-031-2/+3
| | |
* | | DSP: Implement Pipe 2MerryMage2016-03-061-43/+151
| | | | | | | | | | | | | | | | | | Pipe 2 is a DSP pipe that is used to initialize both the DSP hardware (the application signals to the DSP to initialize) and the application (the DSP provides the memory location of structures in the shared memory region).
* | | Memory: Do correct Phys->Virt address translation for non-APP linheapYuri Kunde Schlesner2016-03-063-3/+6
| | |
* | | Merge pull request #1455 from yuriks/ResultVal-unionMathew Maidment2016-03-061-42/+16
|\ \ \ | | | | | | | | core: Use unrestricted union to hold storage of ResultVal value
| * | | core: Use unrestricted union to hold storage of ResultVal valueYuri Kunde Schlesner2016-03-051-42/+16
| | | |
* | | | DSP: Print hash of firmware to consoleMerryMage2016-03-061-8/+21
| | | |
* | | | Loader/NCCH: Log the program ID during loadingYuri Kunde Schlesner2016-03-051-1/+2
|/ / / | | | | | | | | | | | | This is useful for all sorts of things, but mainly to identify save folders more easily.
* | | Merge pull request #1429 from mailwl/branch-acubunnei2016-03-051-2/+17
|\ \ \ | | | | | | | | ac:u IsConnected implemented
| * | | ac:u: Stub IsConnectedmailwl2016-03-041-2/+17
| |/ /
* | | Merge pull request #1389 from yuriks/stub-cambunnei2016-03-043-20/+563
|\ \ \ | |/ / |/| | Stub CAM:U service
| * | Service/CAM: Add doxycomments to all service functionsYuri Kunde Schlesner2016-03-011-0/+217
| | |
| * | Service/CAM: Dummy implementation of some functionsYuri Kunde Schlesner2016-02-133-20/+346
| | | | | | | | | | | | Thanks to @mailwl for the initial version of the stubs.
* | | Merge pull request #1434 from Kloen/legendbunnei2016-03-021-0/+1
|\ \ \ | | | | | | | | Add THREADPROCESSORID_ALL on SVC::CreateThread
| * | | ThreadProcessorId_All on SVC::CreateThreadKloen2016-03-011-0/+1
| | | |
* | | | Merge pull request #1297 from Subv/savesbunnei2016-03-011-2/+4
|\ \ \ \ | | | | | | | | | | DiskDirectory: Initialize the directory member with valid info.
| * | | | DiskDirectory: Initialize the directory member with valid info.Subv2016-01-161-2/+4
| | | | |
* | | | | Service/CFG: Fix potential endianess issueYuri Kunde Schlesner2016-03-011-2/+3
| | | | |
* | | | | Service/CFG: Add block 0x000A0000 (username) to default config fileYuri Kunde Schlesner2016-03-011-1/+14
| |/ / / |/| | |
* | | | Initial implementation ir:usermailwl2016-02-263-18/+142
| | | |
* | | | AudioCore: Skeleton ImplementationMerryMage2016-02-215-66/+99
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This commit: * Adds a new subproject, audio_core. * Defines structures that exist in DSP shared memory. * Hooks up various other parts of the emulator into audio core. This sets the foundation for a later HLE DSP implementation.
* | | | BitField: Make trivially copyable and remove assignment operatorMerryMage2016-02-128-28/+28
| |/ / |/| |
* | | services: Get rid of unnecessary includesLioncash2016-02-0269-132/+32
| | |
* | | services: Update function tablesLioncash2016-02-022-5/+11
| | |
* | | Merge pull request #1377 from MerryMage/mmiobunnei2016-01-316-13/+127
|\ \ \ | | | | | | | | Memory: Implemented MMIO
| * | | Memory: Implement MMIOMerryMage2016-01-306-13/+127
| |/ /
* | | elf: Don't cast away constLioncash2016-01-251-3/+3
| | |
* | | archive_backend: Remove unnecessary const from return typesLioncash2016-01-252-8/+8
| | | | | | | | | | | | This doesn't return by reference so const isn't really necessary
* | | ARM_Disasm::DisassembleMemHalf: actually use width in determining opcode namerob turner2016-01-191-9/+9
|/ /
* | Merge pull request #1327 from Subv/unmap_memblockbunnei2016-01-155-5/+60
|\ \ | | | | | | HLE/SVC: Implement UnmapMemoryBlock.
| * | HLE/SVC: Implement UnmapMemoryBlock.Subv2016-01-145-5/+60
| | | | | | | | | | | | This implementation will need to be (almost completely) changed when we implement multiprocess support.
* | | Merge pull request #1283 from Subv/soc_fixupbunnei2016-01-051-3/+13
|\ \ \ | | | | | | | | HLE/Sockets: Fixed the buffer offset in recvfrom.
| * | | HLE/Sockets: Fixed the buffer offset in recvfrom.Subv2015-12-241-3/+13
| | | | | | | | | | | | | | | | Closes #1277
* | | | Merge pull request #1310 from lioncash/servicesbunnei2015-12-3125-113/+369
|\ \ \ \ | | | | | | | | | | services: Update some function tables
| * | | | services: Update some function tablesLioncash2015-12-3025-113/+369
| | |/ / | |/| |
* / | | arm_dyncom_dec: Fix decoding of VMLSLioncash2015-12-302-206/+202
|/ / / | | | | | | | | | | | | | | | Previously, all VMLS variants would misdecode as CDP (which isn't necessarily wrong in itself, however VMLS has it's own label of execution)
* | | Merge pull request #1306 from Subv/syncbunnei2015-12-301-3/+3
|\ \ \ | | | | | | | | HLE/Timers: Reset OneShot timers when they are acquired instead of when they're triggered
| * | | HLE/Timers: Reset OneShot timers when they are acquired instead of when they're triggered.Subv2015-12-301-3/+3
| | | | | | | | | | | | | | | | Closes #1139
* | | | core: Use unique_ptr for holding the interpreter instancesLioncash2015-12-302-8/+12
|/ / /
* | | Merge pull request #1300 from Subv/arbitrateaddressbunnei2015-12-292-9/+18
|\ \ \ | | | | | | | | SVC: Fixed ArbitrateAddress to behave as it does on hardware.
| * | | SVC: Fixed ArbitrateAddress to behave as it does on hardware.Subv2015-12-282-9/+18
| | | | | | | | | | | | | | | | This was verified with hwtests that i plan to upload later on.
* | | | dyncom: Handle modifying the APSR via an MRC instructionLioncash2015-12-281-12/+9
| | | |
* | | | svc: Remove superfluous printf argumentLioncash2015-12-251-1/+1
|/ / /
* | | dyncom: Remove PC dispatch from several instructionsLioncash2015-12-211-94/+0
| | | | | | | | | | | | These instructions aren't capable of using the PC as a destination
* | | dyncom: Handle unprivileged load/store variants correctlyLioncash2015-12-201-7/+33
| | | | | | | | | | | | | | | | | | | | | LDRT/LDRBT/STRBT/STRT should simulate the load or store as if the host CPU is in user mode. STRT is also allowed to use the PC as an operand
* | | svc: Fix compilation with LOG_TRACE enabledLioncash2015-12-131-1/+1
|/ /
* | Merge pull request #1272 from yuriks/merge-rasterizerYuri Kunde Schlesner2015-12-083-11/+11
|\ \ | | | | | | VideoCore: Unify interface to OpenGL and SW rasterizers
| * | VideoCore: Unify interface to OpenGL and SW rasterizersYuri Kunde Schlesner2015-12-083-11/+11
| | | | | | | | | | | | | | | | | | This removes explicit checks sprinkled all over the codebase to instead just have the SW rasterizer expose an implementation with no-ops for most operations.
| * | VideoCore: Rename HWRasterizer methods to be less confusingYuri Kunde Schlesner2015-12-073-10/+10
| | |
* | | dyncom: Remove static keyword from header functionsLioncash2015-12-063-19/+19
| | |
* | | arm_interface: Make GetNumInstructions constLioncash2015-12-061-1/+1
| | |
* | | arm_interface: directly initialize class membersLioncash2015-12-061-7/+2
| | |
* | | dyncom: const correctness changesLioncash2015-12-063-7/+7
|/ /
* | Merge pull request #1252 from Subv/cambunnei2015-12-041-0/+156
|\ \ | |/ |/| Services/Cam: Added new log type and camera enums from 3dbrew.
| * Services/Cam: Added new log type and camera enums from 3dbrew.Subv2015-11-231-0/+156
| | | | | | | | | | Followup to #1102 Original author @mailwl
* | Kernel: Implement svcGetSystemInfoYuri Kunde Schlesner2015-12-017-1/+95
| | | | | | | | | | This makes smealum/ctrulib@b96dd51d3349961189d4ab1bc2a5c45deff21c09 work with Citra.
* | armstate: Zero out the registers on creationLioncash2015-11-291-11/+11
| | | | | | | | | | std::array isn't always guaranteed to explicitly zero out it's contents without an initializer list.
* | Core/ARM11: Correct the size of the VFP register array in the ThreadContext structure.Subv2015-11-291-1/+1
| | | | | | | | The VFP registers are 64 bits each, and there are 32 of them.
* | Merge pull request #1225 from lioncash/cleanbunnei2015-11-291-12/+13
|\ \ | | | | | | csnd_snd: Get rid of type punning
| * | csnd_snd: Get rid of type punningLioncash2015-10-281-12/+13
| | |
* | | Merge pull request #1248 from polaris-/add-ssl-stubsbunnei2015-11-241-2/+51
|\ \ \ | |_|/ |/| | Add stub functions for Initialize and GenerateRandomData in ssl:C
| * | Add stub functions for Initialize and GenerateRandomData in ssl:Cpolaris-2015-11-221-2/+51
| | |
* | | Merge pull request #1246 from polaris-/patch-1bunnei2015-11-221-26/+31
|\ \ \ | |/ / |/| | Fix read and write register blocks in gdbstub
| * | Fix read and write register blocks in gdbstubpolaris-2015-11-221-26/+31
| | | | | | | | | | | | Previously, the padding wasn't correctly accounted for which caused the gdbstub to read and write everything after R15 (starting with the dummy FPA registers) incorrectly, which caused CPSR to not be handled correctly. Everything appears to be working as expected with this change.
* | | Add Initialize and GenerateRandomData stubspolaris-2015-11-221-0/+2
|/ /
* | Merge pull request #1122 from polaris-/gdbstubbunnei2015-11-129-9/+1145
|\ \ | |/ |/| gdbstub implementation
| * Fix bug with reading addresses and lengthspolaris-2015-11-041-45/+55
| |
| * Change headerspolaris-2015-10-291-2/+2
| |
| * Add some headers so TravisCI will hopefully workpolaris-2015-10-221-0/+2
| |
| * Use CHAR_BIT instead of 8polaris-2015-10-221-11/+11
| |
| * Handle changes pointed out in comments on PRpolaris-2015-10-221-61/+34
| |
| * Add a register variable to loopspolaris-2015-10-211-6/+9
| |
| * Update register read loops to go with last commitpolaris-2015-10-211-6/+7
| |
| * Pad responses to gdb for VFP registerspolaris-2015-10-211-0/+3
| |
| * Try to add support for VFP registerspolaris-2015-10-211-4/+21
| |
| * Fix buffer overflow commentspolaris-2015-10-211-2/+3
| |
| * Remove unnecessary new lines, changed Deinit to Shutdownpolaris-2015-10-124-10/+7
| |
| * Use BreakpointAddress struct instead of passing address directlypolaris-2015-10-043-8/+18
| |
| * Implement gdbstubpolaris-2015-10-049-9/+1128
| |
* | Merge pull request #1165 from esoteric-programmer/masterbunnei2015-10-282-4/+66
|\ \ | | | | | | Added CSND_ExecuteType0Commands stub.
| * | Added CSND stub.Matthias Ernst2015-10-282-4/+66
| | |
* | | Merge pull request #1208 from archshift/free-bytesbunnei2015-10-288-1/+60
|\ \ \ | | | | | | | | Implement FS_User::GetFreeBytes
| * | | Implement FS_User::GetFreeBytesarchshift2015-10-288-1/+60
| | | |
* | | | Fix copy pasteFiliph Sandström2015-10-241-1/+1
| | | |
* | | | Fix wrong branchFiliph Sandström2015-10-231-0/+12
| | | |
* | | | Add GetTotalStepCount StubFiliph Sandström2015-10-231-1/+1
| | | |
* | | | Update ptm.hFiliph Sandström2015-10-231-0/+8
| | | |
* | | | Merge pull request #1199 from Gareth422/encryption-checkbunnei2015-10-203-20/+25
|\ \ \ \ | |/ / / |/| | | Loader: Implement NCCH encryption check
| * | | Loader: Change NCCH header types to be explicitly little-endianGareth Poole2015-10-112-18/+17
| | | |
| * | | Loader: Implement encryption checkGareth Poole2015-10-113-2/+8
| | | |
* | | | Merge pull request #1194 from linkmauve/no-newlinebunnei2015-10-104-47/+47
|\ \ \ \ | |/ / / |/| | | Remove newlines in LOG_* calls
| * | | CitraQt, SkyEye, Loader, VideoCore: Remove newlines in LOG_* calls.Emmanuel Gil Peyrot2015-10-094-47/+47
| | | | | | | | | | | | | | | | The LOG_* function itself already appends one.
* | | | Fixed spelling errorsGareth Poole2015-10-091-2/+2
|/ / /
* | / Silence -Wsign-compare warnings.Rohit Nirmal2015-10-072-2/+2
| |/ |/|
* | Merge pull request #1095 from archshift/game-listbunnei2015-10-022-13/+41
|\ \ | | | | | | Initial implementation of a game list
| * | Expose loader helper functions for identifying files.archshift2015-10-012-13/+41
| | |
* | | Merge pull request #1177 from linkmauve/fix-msvc-todobunnei2015-09-301-4/+3
|\ \ \ | | | | | | | | Use a constexpr function for country initialization in service/cfg
| * | | Service/CFG: Use a constexpr function for country initializationEmmanuel Gil Peyrot2015-09-301-4/+3
| | | | | | | | | | | | | | | | This fixes a TODO left over from when we supported MSVC 2013.
* | | | ivfc_archive: Fix a printf specifierLioncash2015-09-301-1/+1
|/ / /
* | | fix some xcode 7.0 warningsMartin Lindhe2015-09-292-4/+4
| | |
* | | Merge pull request #1160 from lioncash/clangbunnei2015-09-228-16/+18
|\ \ \ | | | | | | | | Silence some clang warnings
| * | | general: Silence some warnings when using clangLioncash2015-09-168-16/+18
| | |/ | |/|
* / | Implement 3dsx RomFSCruel2015-09-213-3/+61
|/ /
* | Service/CFG: Add default entry for block 0x000A0001 (birthday)Yuri Kunde Schlesner2015-09-141-0/+6
| |
* | Service/CFG: Correct flags in 2 default blocksYuri Kunde Schlesner2015-09-141-2/+2
| | | | | | | | Verified against a 9.2.0-20 config save
* | Service/CFG: Add additional blocks to default save dataYuri Kunde Schlesner2015-09-141-0/+34
| | | | | | | | These blocks are required by various games to boot.
* | Fix narrowing conversion warningYuri Kunde Schlesner2015-09-141-1/+1
| |
* | Service/CFG: Move several private types from the header to the cppYuri Kunde Schlesner2015-09-142-63/+49
| |
* | Service/CFG: Clean up default block creationYuri Kunde Schlesner2015-09-142-27/+17
|/
* GSP: Implement command 0x05, used for flushing cachesYuri Kunde Schlesner2015-09-142-13/+34
| | | | | | May fix additional texture caching issues. (Though mostly in homebrew, I haven't seen any commercial software use this to flush anything but command lists.)
* general: Replace 0 literals with nullptr where applicableLioncash2015-09-121-1/+1
|
* General: Replace NULL and '0' usages with nullptr where applicableLioncash2015-09-114-31/+31
|
* Merge pull request #1130 from lioncash/blockYuri Kunde Schlesner2015-09-101-14/+7
|\ | | | | memory: Get rid of pointer casts
| * memory: Get rid of pointer castsLioncash2015-09-101-14/+7
| |
* | General: Fix up doxygen commentsLioncash2015-09-107-11/+9
| |
* | Merge pull request #1131 from lioncash/uninitYuri Kunde Schlesner2015-09-101-3/+6
|\ \ | | | | | | y2r: Give local variables an initial value
| * | y2r: Give local variables an initial valueLioncash2015-09-101-3/+6
| |/ | | | | | | Keeps compilers/static analyzers quiet.
* / disk_archive: Remove unimplemented constructor declarationsLioncash2015-09-101-2/+0
|/
* DynCom: Converted all 0xE condition code checks to ConditionCode::ALarchshift2015-09-062-132/+132
|
* Merge pull request #1101 from archshift/camu-service-namesbunnei2015-09-031-3/+60
|\ | | | | Add cam:u service function names to its function table
| * Add cam:u service function names to its function tablearchshift2015-09-031-3/+60
| |
* | Merge pull request #1072 from yuriks/GetSystemTick-advance-timebunnei2015-09-011-1/+4
|\ \ | |/ |/| SVC: Advance time when calling GetSystemTick to escape busy-wait loops
| * SVC: Advance time when calling GetSystemTick to escape busy-wait loopsYuri Kunde Schlesner2015-08-301-1/+4
| | | | | | | | | | | | | | | | Cubic Ninja waited for the frame to end by spinning on a loop calling GetSystemTick while doing nothing else. Since GetSystemTick doesn't cause a reschedule (which advances time), this meant that very little emulated time would pass inside that loop, causing the game to spend most of the frame burning away CPU.
* | Merge pull request #1085 from Subv/fs_statbunnei2015-08-301-1/+1
|\ \ | | | | | | Services/FS: Correctly tell the guest app whether a file was correctly opened or not
| * | Services/FS: Correctly tell the guest app whether a file was correctly opened or not.Subv2015-08-291-1/+1
| | | | | | | | | | | | Closes #1067
* | | Kernel: Fix wrong linear heap base on titles using newer kernelsYuri Kunde Schlesner2015-08-281-1/+1
| | | | | | | | | | | | Typo which sneaked in through review on #1025
* | | Kernel: Fix assertion failure when ControlMemory is called with size=0Yuri Kunde Schlesner2015-08-271-0/+8
| | |
* | | Core: Improve APT Shared Font hackYuri Kunde Schlesner2015-08-273-4/+29
| | | | | | | | | | | | Should fix invalid read loops in some games
* | | dyncom: Simplify some comparisons in CondPassedLioncash2015-08-261-4/+4
| | |
* | | dyncom: Change return type of CondPassed to boolLioncash2015-08-261-57/+39
| |/ |/|
* | Integrate the MicroProfile profiling libraryYuri Kunde Schlesner2015-08-254-0/+24
| | | | | | | | | | This brings goodies such as a configurable user interface and multi-threaded timeline view.
* | Fix broken boot introduced by last-minute change in #1025Yuri Kunde Schlesner2015-08-221-1/+1
| |
* | Merge pull request #1025 from yuriks/heap-managementYuri Kunde Schlesner2015-08-2228-308/+722
|\ \ | | | | | | Kernel: Correct(er) handling of Heap and Linear Heap allocations
| * | Kernel: Remove unused legacy heap MapBlock_* functionsYuri Kunde Schlesner2015-08-163-78/+0
| | |
| * | APT: Adjust shared font hack so it works with the new linear heap codeYuri Kunde Schlesner2015-08-161-10/+11
| | |
| * | Kernel: Implement svcGetProcessInfo in a basic wayYuri Kunde Schlesner2015-08-166-3/+73
| | | | | | | | | | | | | | | This also adds some basic memory usage accounting. These two types are used by Super Smash Bros. during startup.
| * | Kernel: Add more infrastructure to support different memory layoutsYuri Kunde Schlesner2015-08-1610-28/+148
| | | | | | | | | | | | | | | | | | This adds some structures necessary to support multiple memory regions in the future. It also adds support for different system memory types and the new linear heap mapping at 0x30000000.
| * | HLE: Remove empty ConfigMem and SharedPage Shutdown functionsYuri Kunde Schlesner2015-08-165-10/+0
| | |
| * | Move core/mem_map.{cpp,h} => core/hle/kernel/memory.{cpp,h}Yuri Kunde Schlesner2015-08-166-6/+5
| | |
| * | Memory: Move address type conversion routines to memory.cpp/hYuri Kunde Schlesner2015-08-169-53/+47
| | | | | | | | | | | | | | | These helpers aren't really part of the kernel, and mem_map.cpp/h is going to be moved there next.
| * | Process: Store kernel compatibility version during loadingYuri Kunde Schlesner2015-08-162-3/+7
| | |
| * | Kernel: Properly implement ControlMemory FREE and COMMITYuri Kunde Schlesner2015-08-166-38/+338
| | |
| * | Memory: Move PAGE_MASK and PAGE_BITS to memory.hYuri Kunde Schlesner2015-08-162-3/+2
| | |
| * | VMManager: Introduce names for used ResultCodesYuri Kunde Schlesner2015-08-162-6/+11
| | |
| * | VMManager: Make LogLayout log level configurable as a parameterYuri Kunde Schlesner2015-08-163-5/+15
| | |
| * | VMManager: Change block offsets to size_tYuri Kunde Schlesner2015-08-162-3/+3
| | |
* | | Merge pull request #996 from yuriks/texture-copyYuri Kunde Schlesner2015-08-194-36/+101
|\ \ \ | |_|/ |/| | GPU: Implement TextureCopy-mode display transfers
| * | GPU: Implement TextureCopy-mode display transfersYuri Kunde Schlesner2015-08-164-36/+101
| |/ | | | | | | Fixes glitchy garbage in Fire Emblem 3D scenes.
* | Merge pull request #1033 from bbarenblat/masterYuri Kunde Schlesner2015-08-161-0/+6
|\ \ | | | | | | Handle `FileType::CIA` in `switch` statements
| * | Properly indicate that CIA support is not implemented yetBenjamin Barenblat2015-08-151-0/+4
| | | | | | | | | | | | | | | Make `Loader::LoadFile` return an `ErrorNotImplemented` if you call it on a CIA file.
| * | Give CIA file type a nameBenjamin Barenblat2015-08-151-0/+2
| | | | | | | | | | | | | | | Make `GetFileTypeString` return ‘CIA’ for CIA (CTR Importable Archive) files.
* | | Merge pull request #1032 from lioncash/swapbunnei2015-08-162-12/+6
|\ \ \ | |_|/ |/| | vfp: use std::swap where applicable
| * | vfp: use std::swap where applicableLioncash2015-08-162-12/+6
| |/
* / Shader: Initial implementation of x86_x64 JIT compiler for Pica vertex shaders.bunnei2015-08-161-0/+1
|/ | | | | - Config: Add an option for selecting to use shader JIT or interpreter. - Qt: Add a menu option for enabling/disabling the shader JIT.
* Merge pull request #1027 from lioncash/debuggerbunnei2015-08-144-1/+49
|\ | | | | debugger: Add the ability to view VFP register contents
| * arm_interface: Implement interface for retrieving VFP registersLioncash2015-08-074-1/+49
| |
* | ARM Core, Video Core, CitraQt, Citrace: Use CommonTypes types instead of the standard u?int*_t types.Emmanuel Gil Peyrot2015-08-115-340/+345
| |
* | arm_disasm: ARMv6 mul/div and abs media instructionsaroulin2015-08-112-1/+119
| | | | | | | | | | | | SMLAD, SMUAD, SMLSD, SMUSD, SMLALD, SMLSLD, SMMLA, SMMUL, SMMLS USAD8, USADA8
* | arm_disasm: ARMv6 parallel add/sub media instructionsaroulin2015-08-112-0/+167
| | | | | | | | {S, U, Q, UQ, SH, UH}{ADD16, ASX, SAX, SUB16, ADD8, SUB8}
* | arm_disasm: ARMv6 reversal media instructionsaroulin2015-08-092-0/+26
| | | | | | | | | | REV, REV16, REVSH Only their ARM encoding, Thumb encoding is still missing.
* | arm_disasm: ARMv6 saturation media instructionsaroulin2015-08-092-2/+55
| | | | | | | | SSAT, SSAT16, USAT, USAT16
* | arm_disasm: ARMv6 packing and sign-extend media instructionsaroulin2015-08-092-1/+181
| | | | | | | | | | | | PKH, SEL SXTAB, SXTAB16, SXTB, SXTB16, SXTH, SXTAH UXTAB, UXTAB16, UXTB, UXTB16, UXTH, UXTAH
* | Merge pull request #1026 from lioncash/disasmLioncash2015-08-071-12/+4
|\ \ | |/ |/| arm_disasm: Remove unnecessary code
| * arm_disasm: Remove unnecessary codeLioncash2015-08-071-12/+4
| | | | | | | | This part of disassembly only determines the opcode, there's no need for offset calculation here.
* | Disassembler: ARMv6K REX instructionsaroulin2015-08-062-6/+97
| |
* | Disassembler: ARMv6K hint instructionsaroulin2015-08-062-0/+56
| |
* | Merge pull request #1008 from lioncash/pcbunnei2015-07-302-21/+40
|\ \ | | | | | | dyncom: Handle the case where PC is the source register for STR/VSTM/VLDM
| * | dyncom: Handle the case where PC is the source register for STR/VSTM/VLDMLioncash2015-07-292-21/+40
| |/
* | Merge pull request #1014 from lioncash/unused-warnbunnei2015-07-292-3/+5
|\ \ | | | | | | core: Eliminate some unused variable warnings
| * | core: Eliminate some unused variable warningsLioncash2015-07-292-3/+5
| | |
* | | Merge pull request #1013 from lioncash/unusedYuri Kunde Schlesner2015-07-291-3/+0
|\ \ \ | |/ / |/| | dyncom: Remove an unused variable
| * | dyncom: Remove an unused variableLioncash2015-07-291-3/+0
| | | | | | | | | | | | This was used prior to InterpreterTranslate existing.
* | | core: Fix missing prototype warningsLioncash2015-07-292-0/+2
|/ /
* | Merge pull request #1009 from lioncash/tableYuri Kunde Schlesner2015-07-291-1/+2
|\ \ | | | | | | am_net: Update function table data
| * | am_net: Add missing function to the function tableLioncash2015-07-291-0/+1
| | |
| * | am_net: Add correct function name to the function tableLioncash2015-07-291-1/+1
| |/
* | Merge pull request #982 from Subv/homebunnei2015-07-297-18/+84
|\ \ | |/ |/| Service/APT: Return proper parameters in GetLockHandle.
| * Service/APT: Fixed a regression, PreloadLibraryApplet should also start an applet when called.Subv2015-07-246-5/+36
| |
| * Service/APT: Return proper parameters in GetLockHandle.Subv2015-07-244-14/+49
| | | | | | | | | | Documented some APT functions This allows applets to boot.
* | dyncom: Handle left-operand PC correctly for data-processing opsLioncash2015-07-291-7/+33
| | | | | | | | | | | | This is considered deprecated in the ARM manual (using PC as an operand), however, this is still able to be executed on the MPCore (which I'm quite sure would be rare to begin with).
* | Merge pull request #899 from zawata/Winsock-Deprecationbunnei2015-07-281-2/+8
|\ \ | | | | | | SOC:U : Fix WinSock function deprecation
| * | SOC:U : Update deprecated function gethostbyname() to getaddrinfo()zawata2015-07-201-2/+8
| | |
* | | Merge pull request #1003 from lioncash/armcruftbunnei2015-07-286-124/+91
|\ \ \ | | | | | | | | dyncom: Minor cleanups.
| * | | dyncom: Remove an unnecessary typedefLioncash2015-07-282-7/+5
| | | |
| * | | dyncom: Use enum class for instruction decoding resultsLioncash2015-07-285-41/+40
| | | |
| * | | dyncom: Remove code duplication regarding thumb instructionsLioncash2015-07-283-23/+12
| | | |
| * | | dyncom: Migrate exclusive memory access control into armstateLioncash2015-07-282-50/+35
| | | |
| * | | dyncom: Remove duplicated typedef and externLioncash2015-07-281-4/+0
| | | | | | | | | | | | | | | | These are already present in arm_dyncom_dec.h.
* | | | Merge pull request #873 from jroweboy/input_arrayTony Wasserka2015-07-283-24/+45
|\ \ \ \ | |/ / / |/| | | Move input values into an array.
| * | | Move input values into an arrayJames Rowe2015-07-283-24/+45
| | | |
* | | | dyncom: Use std::array for register arraysLioncash2015-07-262-28/+29
| | | |
* | | | dyncom: Use ARMul_State as an objectLioncash2015-07-2612-1105/+1023
| | | | | | | | | | | | | | | | Gets rid of C-like parameter passing.
* | | | dyncom: Remove unnecessary initialization code.Lioncash2015-07-264-59/+2
| | | | | | | | | | | | | | | | | | | | | | | | Targeting ARM version variants was only a thing on armemu. The reset routine also does basically the same thing as NewState.
* | | | dyncom: Remove unnecessary abort-related cruftLioncash2015-07-262-48/+1
| | | | | | | | | | | | | | | | Both the MPCore and the ARM9 have the same data abort model (base restored), so differentiating isn't necessary.
* | | | dyncom: Rename armdefs.h to armstate.hLioncash2015-07-2615-33/+33
| | | |
* | | | dyncom: Get rid of skyeye typedefsLioncash2015-07-267-61/+55
| | | |
* | | | dyncom: Move helper functions to their own headerLioncash2015-07-2610-41/+57
| | | |
* | | | dyncom: Move arminit.cpp and armsupp.cpp into skyeye_commonLioncash2015-07-263-2/+2
|/ / /
* | | Merge pull request #989 from lioncash/externYuri Kunde Schlesner2015-07-261-25/+25
|\ \ \ | | | | | | | | armdefs: Remove unnecessary extern keywords
| * | | armdefs: Remove unnecessary extern keywordsLioncash2015-07-261-25/+25
| | | |
* | | | loader: Remove unnecessary else usagesLioncash2015-07-261-9/+9
|/ / /
* | | Merge pull request #888 from zawata/Warning-Fixes-2Yuri Kunde Schlesner2015-07-252-3/+3
|\ \ \ | | | | | | | | Core\HLE : Fix Warning
| * | | Core\HLE : Fix Warningzawata2015-07-172-3/+3
| |/ / | | | | | | | | | "signed/unsigned mismatch"
* | | Merge pull request #892 from zawata/another-warning-fixesYuri Kunde Schlesner2015-07-252-2/+2
|\ \ \ | | | | | | | | Yet More Warning Fixes
| * | | Core : Change variable typezawata2015-07-191-1/+1
| | | | | | | | | | | | | | | | and fix various warnings
| * | | Core : Fix Conversion Warningszawata2015-07-191-1/+1
| | | |
* | | | Merge pull request #983 from yuriks/null-memory-fillYuri Kunde Schlesner2015-07-241-13/+18
|\ \ \ \ | | | | | | | | | | GSP: Don't try to write memory fill registers if start address is 0
| * | | | GSP: Don't try to write memory fill registers if start address is 0Yuri Kunde Schlesner2015-07-241-13/+18
| | |_|/ | |/| | | | | | | | | | | | | | Verified to be what GSP does via REing. Fixes invalid virt->phys translation error spam in some games.
* / | | Qt/GPU Breakpoints: Added three more breakpoint types:Subv2015-07-232-0/+11
|/ / / | | | | | | | | | | | | | | | * IncomingDisplayTransfer: Triggered just before a display transfer is performed. * GSPCommandProcessed: Triggered right after a GSP command is processed. * BufferSwapped: Triggered when the frames flip
* | | Merge pull request #962 from Subv/am_appbunnei2015-07-223-3/+33
|\ \ \ | | | | | | | | Services/AM: Stubbed am:app::GetNumContentInfos to return 0 results.
| * | | Services/AM: Stubbed am:app::GetNumContentInfos to return 0 results.Subv2015-07-213-3/+33
| | | | | | | | | | | | | | | | | | | | | | | | Named the service functions in am:app as per 3dbrew. This fixes an illegal read loop in Steel Diver
* | | | Merge pull request #966 from Subv/logbunnei2015-07-211-4/+8
|\ \ \ \ | | | | | | | | | | Services/Logging: Log more useful information when some operations fail.
| * | | | Services/Logging: Log more useful information when some operations fail.Subv2015-07-211-4/+8
| |/ / / | | | | | | | | | | | | Namely OpenFileDirectly, OpenDirectory and OpenArchive
* | | | Merge pull request #957 from Subv/hwtest_crashbunnei2015-07-211-0/+8
|\ \ \ \ | | | | | | | | | | Kernel/Scheduling: Clean up a thread's wait_objects when its scheduled.
| * | | | Kernel/Scheduling: Clean up a thread's wait_objects when its scheduled.Subv2015-07-211-0/+8
| |/ / / | | | | | | | | | | | | They'll be reset if needed during the next svcWaitSynchronization call (if there's any pending)
* | | | dyncom: Pass SVC immediates directly.Lioncash2015-07-213-6/+6
| | | | | | | | | | | | | | | | Previously it would just re-read the already decoded instruction and extract the immediate value.
* | | | Services/CFG: Added some missing functions to cfg:sSubv2015-07-211-1/+3
|/ / /
* | | Merge pull request #939 from Subv/queryprocmembunnei2015-07-202-6/+28
|\ \ \ | | | | | | | | Kernel/SVC: Implemented svcQueryProcessMemory
| * | | Kernel/SVC: Implemented svcQueryProcessMemorySubv2015-07-172-6/+28
| | | |
* | | | Merge pull request #951 from Subv/bit5bunnei2015-07-202-12/+31
|\ \ \ \ | | | | | | | | | | GPU/DisplayTransfer: Implemented bit 5 in the transfer flags.
| * | | | GPU/DisplayTransfer: Implemented bit 5 in the transfer flags.Subv2015-07-202-12/+31
| | | | | | | | | | | | | | | | | | | | It tells the GPU to not swizzle/de-swizzle the input during the transfer.
* | | | | Merge pull request #946 from archshift/update-frdubunnei2015-07-201-1/+12
|\ \ \ \ \ | | | | | | | | | | | | Add more frd:u unknown service commands from 3dbrew
| * | | | | Add more frd:u unknown service commands from 3dbrewarchshift2015-07-191-1/+12
| | |_|/ / | |/| | |
* | | | | dyncom: Properly retrieve the PC value in BX if used.Lioncash2015-07-201-3/+5
| |/ / / |/| | |
* | | | Change trace/unimplemented service call logs to use hexarchshift2015-07-191-1/+1
|/ / / | | | | | | | | | Changes the log to use hex in the parameter list instead of decimal.
* / / Dyncom: Support for a missing ARMv6 Thumb MOV encodingYuri Kunde Schlesner2015-07-181-10/+4
|/ /
* | Merge pull request #938 from Subv/querymemYuri Kunde Schlesner2015-07-172-4/+24
|\ \ | | | | | | Kernel/SVC: Implemented svcQueryMemory.
| * | Kernel/SVC: Implemented svcQueryMemory.Subv2015-07-172-4/+24
| | |
* | | Merge pull request #937 from yuriks/codeset-leakbunnei2015-07-1712-8/+45
|\ \ \ | |/ / |/| | Ensure all kernel objects are released during shutdown
| * | Ensure all kernel objects are released during shutdownYuri Kunde Schlesner2015-07-1712-8/+45
| | | | | | | | | | | | | | | | | | | | | | | | This commit fixes several kernel object leaks. The most severe of them was threads not being removed from the private handle table used for CoreTiming events. This resulted in Threads never being released, which in turn held references to Process, causing CodeSets to never be freed when loading other applications.
* | | arm_dyncom_interpreter: Simplify assignment in SMLAWLioncash2015-07-171-1/+1
|/ / | | | | | | Also a side-benefit of not having implementation-defined behavior.
* | Merge pull request #918 from yuriks/romfsbunnei2015-07-1717-97/+111
|\ \ | | | | | | Do not load entire RomFS to memory, read from the file as needed instead (rebased)
| * | Loader: Fix variable type and remove unused variableYuri Kunde Schlesner2015-07-141-2/+1
| | |
| * | Archive: Correct a few incorrect types in function signaturesYuri Kunde Schlesner2015-07-146-22/+22
| | | | | | | | | | | | Buffer lengths should be size_t, and file offsets should be u64.
| * | Loader: Remove unnecessary pointer indirection to IOFileYuri Kunde Schlesner2015-07-1410-50/+50
| | |
| * | FS: Stream RomFS from file instead of loading all of it to memorycondut2015-07-149-32/+47
| | |
* | | Merge pull request #904 from aroulin/y2r-narrowing-warningarchshift2015-07-141-1/+1
|\ \ \ | |/ / |/| | Y2R: Fix narrowing warning
| * | Y2R: Fix narrowing warningaroulin2015-07-121-1/+1
| | |
* | | CiTrace: Clean up initialization method.Tony Wasserka2015-07-132-70/+46
| | |
* | | CiTrace: Record default vertex attributes.Tony Wasserka2015-07-134-43/+57
| | |
* | | Add CiTrace recording support.Tony Wasserka2015-07-137-1/+419
| | | | | | | | | | | | | | | | | | This is exposed in the GUI as a new "CiTrace Recording" widget. Playback is implemented by a standalone 3DS homebrew application (which only runs reliably within Citra currently; on an actual 3DS it will often crash still).
* | | GPU: Be robust against nullptr addresses; properly reset busy bits in the trigger registers.Tony Wasserka2015-07-131-27/+34
| | |
* | | HW: Fix a stupid issue which led to unknown register reads/writes.Tony Wasserka2015-07-131-0/+30
| | |
* | | Merge pull request #921 from linkmauve/fix-appletbunnei2015-07-127-7/+32
|\ \ \ | | | | | | | | Fix applet includes using iwyu
| * | | Core: Fix applet includes using iwyu.Emmanuel Gil Peyrot2015-07-127-7/+32
| |/ /
* / / Kernel: Add CodeSet case to Object::IsWaitableYuri Kunde Schlesner2015-07-121-0/+1
|/ /
* | Merge pull request #823 from Subv/applets_drawingbunnei2015-07-1211-58/+567
|\ \ | | | | | | Library applet support (swkbd for now)
| * | Applets: Reworked how the Applet update event is handled.Subv2015-07-127-35/+61
| | | | | | | | | | | | Applets are now cleaned up in AppletUpdateEvent after calling their respective Update method.
| * | Applets: Add infrastructure to allow custom drawing and input handling in Applets.Subv2015-07-127-39/+162
| | |
| * | HLE/APT: Initial HLE support for applets.Subv2015-07-129-50/+410
| | | | | | | | | | | | Currently only the SWKBD is emulated, and there's currently no way to ask the user for input, so it always returns "Subv" as the text.
* | | Core: Properly configure address space when loading a binaryYuri Kunde Schlesner2015-07-1211-52/+223
| | | | | | | | | | | | | | | | | | The code now properly configures the process image to match the loaded binary segments (code, rodata, data) instead of just blindly allocating a large chunk of dummy memory.
* | | Memory: Fix unmapping of pagesYuri Kunde Schlesner2015-07-121-4/+2
| | |
* | | Loader: Clean up 3dsx loader a bit, fixing a potential buffer overrunYuri Kunde Schlesner2015-07-121-13/+16
| | |
* | | Loader: Make 3dsx loader logs a bit less confusingYuri Kunde Schlesner2015-07-121-6/+3
| | |
* | | Kernel: Remove unused member from EventYuri Kunde Schlesner2015-07-122-2/+1
|/ /
* | Merge pull request #876 from linkmauve/include-cleanupsYuri Kunde Schlesner2015-07-1159-120/+203
|\ \ | | | | | | Cleanup includes, mostly in common
| * | Core: Cleanup hw includes.Emmanuel Gil Peyrot2015-06-288-7/+18
| | |
| * | Core: Cleanup soc:U includes.Emmanuel Gil Peyrot2015-06-282-26/+36
| | |
| * | Core, VideoCore: Replace or fix exit() calls.Emmanuel Gil Peyrot2015-06-282-4/+6
| | |
| * | Core: Cleanup file_sys includes.Emmanuel Gil Peyrot2015-06-2821-38/+72
| | |
| * | Core: Cleanup core includes.Emmanuel Gil Peyrot2015-06-288-14/+14
| | |
| * | CitraQt: Cleanup includes.Emmanuel Gil Peyrot2015-06-288-4/+17
| | |
| * | Common: Cleanup key_map includes.Emmanuel Gil Peyrot2015-06-2810-16/+22
| | |
| * | Common: Cleanup memory and misc includes.Emmanuel Gil Peyrot2015-06-283-3/+4
| | |
| * | Common: Fix FileUtil includes, and everything relying on those.Emmanuel Gil Peyrot2015-06-287-0/+7
| | |
| * | Services: Use the standard _WIN32 define in soc:U instead of our own EMU_PLATFORM.Emmanuel Gil Peyrot2015-06-271-8/+7
| |/
* | Loader: Remove log line causing warningaroulin2015-07-081-1/+0
| |
* | Merge pull request #797 from linkmauve/blended-downscalingbunnei2015-07-061-33/+46
|\ \ | | | | | | Implement blended downscaling for display transfers
| * | GPU: Implement blended downscaling for display transfers.Emmanuel Gil Peyrot2015-06-281-27/+40
| | |
| * | GPU: Use shifts instead of multiplications to calculate the actual size of the output.Emmanuel Gil Peyrot2015-06-281-6/+6
| |/
* | Merge pull request #885 from Subv/ipc_headersbunnei2015-07-061-5/+13
|\ \ | | | | | | Services/SOC: Added command headers to some of the soc commands.
| * | Services/SOC: Added command headers to some of the soc commands.Subv2015-06-251-5/+13
| |/
* | vfp: Change return type of VFPInit from unsigned int to void.Lioncash2015-06-292-4/+2
| |
* | vfp: Handle accesses to FPINST/FPINST2 system registersLioncash2015-06-294-42/+53
|/ | | | Also has a side-benefit of correcting access to the FPEXC register.
* Add helpers to create IPC command buffer headers and descriptorsYuri Kunde Schlesner2015-06-233-7/+43
|
* Merge pull request #860 from yuriks/y2r-colorYuri Kunde Schlesner2015-06-225-174/+734
|\ | | | | Color support for Y2R
| * Y2R: Rework conversion process, enabling support for all formatsYuri Kunde Schlesner2015-06-225-163/+695
| |
| * Y2R: Re-organize how params are stored. Support SetConversionParamsYuri Kunde Schlesner2015-06-211-72/+100
| |
* | Merge pull request #855 from purpasmart96/service_rearrangmentbunnei2015-06-2173-635/+1186
|\ \ | |/ |/| Services: Continue separation of services into their own folders
| * Services: Continue separation of services into their own folderspurpasmart962015-06-1273-635/+1186
| |
* | kernel: Fix svcWaitSynch to always acquire requested wait objects.bunnei2015-06-179-113/+68
| |
* | Merge pull request #866 from lioncash/typoLioncash2015-06-161-1/+1
|\ \ | | | | | | hw: Fix mismatched Write call
| * | hw: Fix mismatched Write callLioncash2015-06-161-1/+1
| |/
* | vfp: Handle accesses to the VFP media feature registersLioncash2015-06-133-4/+8
| | | | | | | | These are able to be accessed in any privilege mode.
* | vfp: Implement VMOVBCR/VMOVBRCLioncash2015-06-122-5/+8
|/
* arm_dyncom_thumb: Fix handling of writeback for thumb LDMIALioncash2015-06-041-5/+19
|
* ExtSavedata: Save the icon passed to CreateExtSaveData to the correct folder.Subv2015-06-024-14/+38
| | | | Organize the ExtSaveData folders as they are stored in the console.
* Merge pull request #838 from lioncash/thumbLioncash2015-06-011-3/+40
|\ | | | | arm_dyncom_thumb: Implement missing instructions.
| * arm_dyncom_thumb: Fix encoding of BKPT's immediateLioncash2015-06-011-1/+4
| |
| * arm_dyncom_thumb: Implement CPS and SETENDLioncash2015-06-011-0/+13
| |
| * arm_dyncom_thumb: Implement SXTH, SXTB, UXTH, and UXTB.Lioncash2015-06-011-0/+11
| |
| * arm_dyncom_thumb: Implement REV, REV16, and REVSH.Lioncash2015-06-011-2/+12
| |
* | Merge pull request #811 from archshift/commonifyarchshift2015-05-311-1/+1
|\ \ | | | | | | Commonify video_core utility headers
| * | Move video_core/color.h to common/color.harchshift2015-05-301-1/+1
| |/
* | Merge pull request #832 from yuriks/refresh-rate-optionbunnei2015-05-312-4/+2
|\ \ | |/ |/| Remove gpu_refresh_rate configuration option
| * Remove gpu_refresh_rate configuration optionYuri Kunde Schlesner2015-05-302-4/+2
| | | | | | | | | | | | | | Changing it makes emulation inherently inaccurate. It also had a wrong default value (30, whereas the real system has a refresh rate of 60 Hz) which, even if changed, would continue to be used unless people manually removed it from their config files.
* | Merge pull request #810 from yuriks/memmapYuri Kunde Schlesner2015-05-307-38/+491
|\ \ | | | | | | Kernel: Add VMManager to manage process address spaces
| * | Memmap: Remove unused global pointers to memory areasYuri Kunde Schlesner2015-05-272-31/+8
| | |
| * | Kernel: Add VMManager to manage process address spacesYuri Kunde Schlesner2015-05-276-16/+492
| | | | | | | | | | | | | | | | | | | | | | | | This enables more dynamic management of the process address space, compared to just directly configuring the page table for major areas. This will serve as the foundation upon which the rest of the Kernel memory management functions will be built.
* | | Remove every trailing whitespace from the project (but externals).Emmanuel Gil Peyrot2015-05-2938-105/+105
| |/ |/|
* | hid: Get rid of undefined behaviorLioncash2015-05-271-2/+2
|/ | | | Modifying a variable twice across a sequence point.
* Merge pull request #826 from lioncash/tablesYuri Kunde Schlesner2015-05-271-22/+11
|\ | | | | arm_dyncom_thumb: Merge STR/LDR table subsets.
| * arm_dyncom_thumb: Merge STR/LDR table subsets.Lioncash2015-05-271-22/+11
| |
* | Merge pull request #825 from lioncash/dyncLioncash2015-05-271-6/+1
|\ \ | | | | | | dyncom: Minor cleanup.
| * | arm_dyncom_interpreter: Remove unused variableLioncash2015-05-261-5/+1
| | | | | | | | | | | | Thum decoding directly checks if the thumb bit is set instead of using a temporary.
| * | arm_dyncom_interpreter: Remove unused macroLioncash2015-05-251-1/+0
| |/
* | Merge pull request #821 from Subv/ImportDisplayCaptureInfobunnei2015-05-261-1/+47
|\ \ | | | | | | Service/GSP: Implemented ImportDisplayCaptureInfo.
| * | Service/GSP: Implemented ImportDisplayCaptureInfo.Subv2015-05-261-1/+47
| |/
* / Core/SVC: Map the shared memory created in CreateMemoryBlock to the specified address.Subv2015-05-251-0/+2
|/ | | | This SharedMemory can be passed to service functions (Which should map the memory into their own address space).
* dyncom: Get rid of armemu.hLioncash2015-05-245-50/+29
|
* y2r_u: Remove unused variable in StartConversionLioncash2015-05-231-1/+0
|
* dyncom: Remove unused cpu parameter from decode_thumb_instrLioncash2015-05-231-3/+2
|
* dyncom: remove load_r15 from arm_instLioncash2015-05-232-490/+331
| | | | It's entirely unused. Also allows getting rid of more clunky macros.
* dyncom: Remove unnecessary parameter for load/store operationsLioncash2015-05-231-39/+39
|
* Merge pull request #801 from purpasmart96/hid_stubsbunnei2015-05-234-9/+47
|\ | | | | HID: Stub DisableAccelerometer and DisableGyroscopeLow
| * HID: Stub DisableAccelerometer and DisableGyroscopeLowpurpasmart962015-05-234-9/+47
| |
* | Merge pull request #802 from bunnei/vfp-trace-logLioncash2015-05-231-23/+23
|\ \ | | | | | | VFP: Log as trace to get rid of spamming.
| * | VFP: Log as trace to get rid of spamming.bunnei2015-05-231-23/+23
| |/
* | Flush for y2r (moflex)tfarley2015-05-231-0/+11
| |
* | OpenGL renderertfarley2015-05-232-3/+22
| |
* | INI hw/sw renderer toggletfarley2015-05-221-0/+2
|/
* Merge pull request #798 from yuriks/y2r-bwYuri Kunde Schlesner2015-05-221-35/+265
|\ | | | | Service::Y2R: Support for grayscale decoding of specific formats
| * Service::Y2R: Support for grayscale decoding of specific formatsYuri Kunde Schlesner2015-05-221-35/+265
| | | | | | | | | | | | | | | | | | | | | | | | Implements unrotated planar YUV 4:2:0 -> RGB24 conversions in Y2R. Currently only the Y (luma) channel is used, so the results don't contain color. This will be added in a later PR at some point. This is enough to get all currently know Moflex videos to decode. (Some don't display on-screen due to seemingly unrelated reasons.) Thanks to @archshift for doing the initial implementation which I cleaned up and then fixed the 8x8 block mode.
* | dyncom: Eliminate clang warningsLioncash2015-05-214-406/+404
|/ | | | Gets rid of a whole load of missing brace initialization warnings.
* Kernel: Fix a warning introduced with ResourceLimit, and remove the fallback code to prevent it from happening again.Emmanuel Gil Peyrot2015-05-211-2/+1
|
* y2r_u: Stub StartConversion to prevent moflex games from hanging.bunnei2015-05-211-1/+17
|
* Kernel: Move reschedules from SVCs to actual mechanisms that reschedule.bunnei2015-05-217-20/+22
|
* Merge pull request #766 from purpasmart96/cfg_service_updatebunnei2015-05-185-337/+304
|\ | | | | CFG: Update the cfg service to be like other integrated services
| * CFG: Update the cfg service to be like other integrated servicespurpasmart962015-05-165-337/+304
| |
* | Merge pull request #772 from lioncash/warnbunnei2015-05-183-9/+9
|\ \ | | | | | | core/video_core: Fix a few warnings when compiling on MSVC.
| * | vfp: Get rid of warningsLioncash2015-05-142-6/+6
| | | | | | | | | | | | | | | - Unary minus operator applied to unsigned type. - Unsafe use of bool.
| * | process: Get rid of warningsLioncash2015-05-141-3/+3
| | | | | | | | | | | | Sign mismatches and "forcing value to bool" warnings.
* | | Implement svcBreakarchshift2015-05-172-1/+17
| | |
* | | Merge pull request #781 from archshift/deletebunnei2015-05-161-33/+0
|\ \ \ | | | | | | | | Delete unused hle/coprocessor.cpp
| * | | Delete unused hle/coprocessor.cpparchshift2015-05-161-33/+0
| | | |
* | | | APT/FS: Remove asserts that were causing false positivespurpasmart962015-05-162-5/+5
|/ / /
* | | Merge pull request #774 from lioncash/decodingsYuri Kunde Schlesner2015-05-152-33/+191
|\ \ \ | | | | | | | | dyncom: Add ARMv6K NOP and hint instructions to the interpreter.
| * | | dyncom: Add ARMv6K NOP and hint instructions to the decoding tableLioncash2015-05-142-12/+152
| | | |
| * | | dyncom: Handle some MSR variants individuallyLioncash2015-05-142-24/+41
| | | | | | | | | | | | | | | | This is necessary, as hint instructions will be recognized as MSR, which is pretty bad.
| * | | dyncom: Move exclusive load/stores above bbl and swi in the decoding tableLioncash2015-05-142-14/+15
| |/ /
* | | Merge pull request #770 from lioncash/dyncom_cleanbunnei2015-05-152-275/+260
|\ \ \ | | | | | | | | dyncom: Minor cleanup.
| * | | dyncom: Remove duplicate enums/prototypesLioncash2015-05-141-7/+1
| | | | | | | | | | | | | | | | These are already defined in arm_dyncom_interpreter_dec.cpp.
| * | | dyncom: Remove unnecessary definesLioncash2015-05-141-4/+4
| | | | | | | | | | | | | | | | These can simply be const vars.
| * | | dyncom: Make translation-unit functions and variables staticLioncash2015-05-141-66/+64
| | | |
| * | | dyncom: Remove unnecessary typedefsLioncash2015-05-142-196/+197
| | | |
| * | | dyncom: Remove unused structsLioncash2015-05-141-8/+0
| |/ /
* | | Core/ResourceLimits: Implemented the basic structure of ResourceLimits.Subv2015-05-1512-14/+341
| | | | | | | | | | | | | | | | | | Implemented svcs GetResourceLimit, GetResourceLimitCurrentValues and GetResourceLimitLimitValues. Note that the resource limits do not currently keep track of used objects, since we have no way to distinguish between an object created by the application, and an object created by some HLE module once we're inside Kernel::T::Create.
* | | Memory: Use a table based lookup scheme to read from memory regionsYuri Kunde Schlesner2015-05-155-128/+174
| | |
* | | Memory: Read SharedPage directly from Memory::ReadYuri Kunde Schlesner2015-05-153-59/+37
| | |
* | | Memory: Read ConfigMem directly from Memory::ReadYuri Kunde Schlesner2015-05-153-50/+38
| | |
* | | Memmap: Re-organize memory function in two filesYuri Kunde Schlesner2015-05-1526-257/+247
| | | | | | | | | | | | | | | | | | | | | memory.cpp/h contains definitions related to acessing memory and configuring the address space mem_map.cpp/h contains higher-level definitions related to configuring the address space accoording to the kernel and allocating memory.
* | | Memmap: Remove unused declarationsYuri Kunde Schlesner2015-05-152-20/+3
| | |
* | | thread: Fix a conditional check in RescheduleLioncash2015-05-141-1/+1
|/ /
* | dyncom: Removed irrelevant log.bunnei2015-05-141-2/+0
| |
* | dyncom: Fix decoding of BKPT's immediateLioncash2015-05-131-1/+1
|/ | | | A shift here is intended since the representation is imm12:imm4
* Merge pull request #756 from purpasmart96/ptm_service_changesbunnei2015-05-135-125/+112
|\ | | | | PTM: Changed the ptm services to be like the IR, HID, and APT services.
| * PTM: Changed the way the ptm services are handled to be like thepurpasmart962015-05-125-125/+112
| | | | | | | | IR, HID, and APT services.
* | Merge pull request #748 from Subv/tls_maxbunnei2015-05-124-10/+24
|\ \ | | | | | | Core/Memory: Add TLS support for creating up to 300 threads
| * | Core/Memory: Add TLS support for creating up to 300 threadsSubv2015-05-124-10/+24
| | |
* | | Merge pull request #751 from yuriks/idle-threadbunnei2015-05-123-46/+21
|\ \ \ | | | | | | | | Thread: Remove the idle thread
| * | | Thread: Remove the idle threadYuri Kunde Schlesner2015-05-123-46/+21
| | | | | | | | | | | | | | | | Instead just use nullptr to represent no thread is active.
* | | | Merge pull request #757 from Subv/schedulingbunnei2015-05-121-0/+2
|\ \ \ \ | | | | | | | | | | Core/Scheduling: Prepare the new priority in the thread queue when svcSetPriority is called
| * | | | Core/Scheduling: Prepare the new priority in the thread queue when svcSetPriority is calledSubv2015-05-121-0/+2
| |/ / /
* | | | Merge pull request #752 from lioncash/flushbunnei2015-05-123-84/+98
|\ \ \ \ | | | | | | | | | | vfp: Handle flush-to-zero mode.
| * | | | vfp: Handle flush-to-zero mode.Lioncash2015-05-113-84/+98
| |/ / /
* | | | Merge pull request #755 from lioncash/mcrr-mrrcbunnei2015-05-121-7/+68
|\ \ \ \ | |_|/ / |/| | | dyncom: Stub MCRR and MRRC
| * | | dyncom: Stub MCRR and MRRCLioncash2015-05-121-7/+68
| |/ / | | | | | | | | | | | | There's no other coprocessor outside the VFP (which has its own VMOV variants) in which the MPCore can send/retrieve data from. Stubbed so citra won't crash and burn on the odd chance someone actually tries to use these.
* | | Merge pull request #750 from Subv/process_svcYuri Kunde Schlesner2015-05-126-4/+46
|\ \ \ | |_|/ |/| | Core/HLE: Implemented the SVCs GetProcessId and GetProcessIdOfThread
| * | fixup!Subv2015-05-123-16/+12
| | |
| * | Core/HLE: Implemented the SVCs GetProcessId and GetProcessIdOfThreadSubv2015-05-116-4/+50
| | |
* | | NWM_UDS: Fix a typo in the nwm service port namepurpasmart962015-05-121-1/+1
| |/ |/|
* | Thread: Correctly set main thread initial stack positionYuri Kunde Schlesner2015-05-113-5/+4
|/
* Merge pull request #740 from yuriks/gsp-shmemarchshift2015-05-117-34/+67
|\ | | | | Fix crashes due to un-initialized GSP shared memory
| * fixup! GSP: Small tweaks to shared memory initializationYuri Kunde Schlesner2015-05-111-1/+1
| |
| * GSP: Small tweaks to shared memory initializationYuri Kunde Schlesner2015-05-111-9/+11
| |
| * Kernel: Zero-fill shared memory blocks when mappingYuri Kunde Schlesner2015-05-111-0/+8
| | | | | | | | | | | | This works around crashes related to GSP/HID/etc. shared memory blocks having garbage values. The proper fix requires proper management of mapped memory blocks in the process.
| * Kernel: Capture SharedMemory attributes at creation, not when mappingYuri Kunde Schlesner2015-05-117-28/+51
| |
* | fixup! Set the TLS address in the schedulerSubv2015-05-116-11/+10
| |
* | Core/Memory: Give every emulated thread it's own TLS area.Subv2015-05-118-11/+31
|/ | | | | The TLS area for thread T with id Ti is located at TLS_AREA_VADDR + (Ti - 1) * 0x200. This allows some games like Mario Kart 7 to continue further.
* Common: Remove the BIT macroYuri Kunde Schlesner2015-05-091-2/+2
| | | | | | | When the macro was introduced in 326ec51261299e48de97592631c02523da9c8118 it wasn't noticed that it conflicted in name with a heavily used macro inside of dyncom. This causes some compiler warnings. Since it's only lightly used, it was opted to simply remove the new macro.
* Merge pull request #734 from yuriks/memmapTony Wasserka2015-05-0910-167/+181
|\ | | | | Small memory map definitions cleanup
| * Memory: Add GetPhysicalPointer helper functionYuri Kunde Schlesner2015-05-092-5/+14
| |
| * Memory: Support more regions in the VAddr-PAddr translation functionsYuri Kunde Schlesner2015-05-092-28/+33
| | | | | | | | | | Also adds better documentation and removes the one-off reimplementation of the function in pica.h.
| * Memory: Sort memory region variables by VAddrYuri Kunde Schlesner2015-05-092-10/+10
| |
| * Memory: Re-organize and rename memory area address constantsYuri Kunde Schlesner2015-05-099-131/+131
| |
* | Loader: Add missing includeYuri Kunde Schlesner2015-05-091-0/+1
|/
* Loader: Remove .bin file supportYuri Kunde Schlesner2015-05-092-20/+0
| | | | | It is of very limited practical utility currently, and will soon be impossible to support due to more accurate memory map emulation.
* Kernel: Remove unused g_main_thread variableYuri Kunde Schlesner2015-05-093-5/+1
|
* Process: Rename StaticAddressMapping => AddressMappingYuri Kunde Schlesner2015-05-096-10/+10
|
* Process: Add more documentation to the class membersYuri Kunde Schlesner2015-05-091-2/+16
|
* Process: Use BitField to store process flagsYuri Kunde Schlesner2015-05-092-16/+24
|
* Loader/NCCH: Fix formatting of bracesYuri Kunde Schlesner2015-05-091-9/+9
|
* Process: Support parsing of exheader kernel capsYuri Kunde Schlesner2015-05-096-4/+77
|
* Kernel: Remove g_program_idYuri Kunde Schlesner2015-05-096-21/+3
| | | | This has been obsoleted by the field in Process.
* Kernel: Introduce skeleton Process class to hold process dataYuri Kunde Schlesner2015-05-0913-48/+191
|
* Core: Fix sorting in CMakeFiles.txtYuri Kunde Schlesner2015-05-081-21/+21
|
* Merge pull request #728 from lioncash/varsLioncash2015-05-081-19/+17
|\ | | | | dyncom: Remove an unnecessary variable in the interpreter
| * dyncom: Remove an unnecessary variable in the interpreterLioncash2015-05-081-19/+17
| | | | | | | | All this was doing was needlessly aliasing a variable.
* | Remove unnecessary dyncom header filesLioncash2015-05-086-82/+2
|/
* Common: Remove mem_arena.cpp/hYuri Kunde Schlesner2015-05-082-94/+31
| | | | | | It is superfluous for Citra. (It's only really necessary if you're doing JIT. We were using it but not taking any advantage from it.) This should make 32-bit builds work again.
* Fix printf format warningYuri Kunde Schlesner2015-05-071-1/+1
|
* Common: Remove common.hYuri Kunde Schlesner2015-05-0757-29/+85
|
* Clean-up includesYuri Kunde Schlesner2015-05-077-9/+13
|
* FileSys: De-inline Path membersYuri Kunde Schlesner2015-05-074-125/+139
|
* FileSys: Clean-up includes, de-inline destructorsYuri Kunde Schlesner2015-05-077-20/+35
|
* Move typedefs from kernel.h to more appropriate placesYuri Kunde Schlesner2015-05-072-10/+8
|
* HLE: Clean up SVC dispatch mechanismYuri Kunde Schlesner2015-05-065-79/+40
|
* Core: Remove some unused functions and typesYuri Kunde Schlesner2015-05-042-32/+1
|
* CoreTiming: Initialize static variables at bootup.bunnei2015-05-021-0/+10
|
* HLE: Properly initialize and shutdown remaining modules.bunnei2015-05-025-3/+20
|
* Dyncom: Move cream cache to ARMul_State.bunnei2015-05-024-25/+18
|
* Kernel: Properly initialize and shutdown all modules.bunnei2015-05-024-9/+20
|
* HW: Properly initialize and shutdown all modules.bunnei2015-05-023-3/+8
|
* Services: Initialize all state variables at bootup.bunnei2015-05-028-22/+38
|
* Memory: Properly cleanup & shutdown.bunnei2015-05-023-38/+60
|
* ConfigMem: Remove duplicate retail bitpurpasmart962015-04-291-1/+0
|
* Merge pull request #692 from purpasmart96/log_improvementsbunnei2015-04-284-22/+59
|\ | | | | Services/Loader: Use more sensible log formats for certain functions along with more info being logged.
| * Services/Loader: Use more sensible log formats for certain functionspurpasmart962015-04-284-22/+59
| | | | | | | | along with more info being logged.
* | ptm_sysm: Add static specifier to IsLegacyPowerOffLioncash2015-04-251-1/+1
| |
* | dyncom: Remove more unused/unnecessary codeLioncash2015-04-205-95/+1
| | | | | | | | Gets rid of a sizeable amount of stuff in armdefs.
* | dyncom: Remove unused/unnecessary VFP cruftLioncash2015-04-187-823/+15
| |
* | Merge pull request #696 from yuriks/interface-deinlinebunnei2015-04-153-50/+49
|\ \ | | | | | | De-inline functions from Interface, removing them from service.h
| * | De-inline functions from Interface, removing them from service.hYuri Kunde Schlesner2015-04-143-50/+49
| | | | | | | | | | | | This reduces the time for a full recompile from 65.43s to 59.53s (~9%)
* | | Core_ARM11: Replace debug prints with our own logging functions in vfpsingle.Emmanuel Gil Peyrot2015-04-142-39/+36
| | |
* | | Kernel: Use the correct format string for u64 hex.Emmanuel Gil Peyrot2015-04-141-1/+1
| | |
* | | Headers: Add some forgotten overrides, thanks clang!Emmanuel Gil Peyrot2015-04-142-2/+2
|/ /
* | SVC: Assert on unsupported CreateThread processor ID.bunnei2015-04-101-3/+9
| |
* | SVC: Update various SVCs to cause a reschedule.bunnei2015-04-102-6/+22
| | | | | | | | - CreateMutex/ReleaseMutex/ReleaseSemaphore/SetTimer/CancelTimer/ArbitrateAddress
* | Kernel: Implemented priority inheritance for mutexes.bunnei2015-04-103-4/+22
| |
* | Thread: Implement priority boost for starved threads.bunnei2015-04-104-28/+74
| | | | | | | | | | | | SVC: Return correct error code on invalid CreateThread processor ID. SVC: Assert when creating a thread with an invalid userland priority.
* | SVC: Reschedule on svcCreateThread.bunnei2015-04-101-0/+2
| |
* | APT: (Subv) Fix bug where start event was being incorrectly signaled.bunnei2015-04-101-6/+7
| |
* | Kernel: Fixed default thread priority.bunnei2015-04-102-5/+4
| |
* | Initialize base address to 0x0Gareth Higgins2015-04-091-0/+1
|/
* Merge pull request #689 from lioncash/formatTony Wasserka2015-04-081-1/+1
|\ | | | | gpu: Fix a missing format specifier
| * gpu: Fix a missing format specifierLioncash2015-04-071-1/+1
| |
* | Merge pull request #688 from lioncash/unusedbunnei2015-04-085-50/+30
|\ \ | | | | | | dyncom: Remove unnecessary enum and typedef
| * | dyncom: Remove unnecessary enum and typedefLioncash2015-04-075-50/+30
| |/ | | | | | | Also fixes descriptions in the process.
* | Merge pull request #676 from purpasmart96/ir_service_refcbunnei2015-04-0811-59/+188
|\ \ | |/ |/| IR: Move The IR services to their own folder and implement "GetHandles"
| * IR: Move The IR services to their own folder and implement "GetHandles"purpasmart962015-04-0411-59/+188
| |
* | vfp: Make the FPSID values match the MPCoreLioncash2015-04-061-7/+7
| |
* | vfp: Get rid of the VFP_OFFSET macroLioncash2015-04-065-64/+69
| |
* | Merge pull request #685 from lioncash/cpregsbunnei2015-04-069-134/+217
|\ \ | | | | | | dyncom: Set the MPCore CP15 register reset values on initialization.
| * | core: Migrate 3DS-specific CP15 register setting into InitLioncash2015-04-062-8/+5
| | |
| * | arm_interface: Support retrieval/storage to CP15 registersLioncash2015-04-063-0/+25
| | |
| * | Move CP15 enum definitions into their own enum.Lioncash2015-04-065-168/+163
| | | | | | | | | | | | Also gets rid of preprocessor mumbo-jumbo
| * | dyncom: Properly return the value of the user RO thread registerLioncash2015-04-062-4/+10
| | |
| * | dyncom: Set CP15 reset values on initializationLioncash2015-04-061-0/+60
| | |
* | | dyncom: Suppress uninitialized variable warningsLioncash2015-04-061-4/+4
|/ / | | | | | | The switch cases will always be hit, but this makes compilers stop complaining.
* | Clean-up mem_map constants and fix framebuffer translation errorsYuri Kunde Schlesner2015-04-063-27/+27
| |
* | Merge pull request #680 from archshift/bg-colorbunnei2015-04-041-0/+5
|\ \ | |/ |/| Allow the user to set the background clear color during emulation
| * Allow the user to set the background clear color during emulationarchshift2015-04-041-0/+5
| | | | | | | | The background color can be seen at the sides of the bottom screen or when the window is wider than normal.
* | Merge pull request #641 from purpasmart96/service_stubsbunnei2015-04-0418-68/+405
|\ \ | |/ |/| Services: Stubs and minor changes
| * Services: Stubs and minor changespurpasmart962015-04-0318-68/+405
| |
* | dyncom: Move CP15 register writing into its own function.Lioncash2015-04-024-88/+265
| | | | | | | | Also implements writing to the rest of the ARM11 MPCore CP15 register set.
* | dyncom: Move CP15 register reading into its own function.Lioncash2015-04-024-49/+253
| | | | | | | | Keeps everything contained. Added all supported readable registers in an ARM11 MPCore.
* | dyncom: Migrate InAPrivilegedMode to armsuppLioncash2015-03-263-4/+7
| | | | | | | | It's a generic helper function, so it should be here anyway.
* | Merge pull request #672 from purpasmart96/citra_moar_app_membunnei2015-03-251-2/+2
|\ \ | | | | | | ConfigMem: Set the app memory to be 96MB instead of the default 64MB
| * | ConfigMem: Set the app memory to be 96MB instead of the default 64MBpurpasmart962015-03-241-2/+2
| |/
* | Merge pull request #674 from lioncash/sys-instrsbunnei2015-03-251-2/+62
|\ \ | | | | | | dyncom: Implement RFE and SRS.
| * | dyncom: Implement SRSLioncash2015-03-241-1/+32
| | |
| * | dyncom: Implement RFELioncash2015-03-241-1/+30
| |/
* / dyncom: Remove unused/unnecessary macros and macro constantsLioncash2015-03-242-39/+2
|/
* Merge pull request #656 from Subv/nzbunnei2015-03-227-26/+265
|\ | | | | Services/FS: Implemented DeleteExtSaveData, CreateSystemSaveData and Del...
| * Service/FS: Document and log some unknown values.Subv2015-03-191-1/+26
| | | | | | | | In CreateExtSaveData, DeleteExtSaveData and CreateSystemSaveData
| * Services/FS: Implemented DeleteExtSaveData, CreateSystemSaveData and DeleteSystemSaveDataSubv2015-03-147-26/+240
| | | | | | | | Also fixed a bug with CreateExtSaveData that made it unable to create ExtSaveData archives in the SDMC directory.
* | armmmu: Remove unnecessary enum valuesLioncash2015-03-211-30/+20
| | | | | | | | We don't need to care about XScale or Intel specific ARM stuff.
* | Merge pull request #659 from lioncash/setendbunnei2015-03-207-83/+240
|\ \ | | | | | | Implement SETEND.
| * | dyncom: Make Load/Store instructions support big endianLioncash2015-03-177-82/+205
| | |
| * | dyncom: Implement SETENDLioncash2015-03-151-1/+35
| | |
* | | Merge pull request #650 from Subv/scalingbunnei2015-03-182-5/+16
|\ \ \ | | | | | | | | GPU: Fixed the bit 25 in the display transfer flags.
| * | | GPU/DisplayTransfer: Made the scaling bits a single 2bit valueSubv2015-03-162-6/+17
| | | | | | | | | | | | | | | | Rephrased some comments.
| * | | GPU: Fixed the bit 25 in the display transfer flags.Subv2015-03-102-5/+5
| | | | | | | | | | | | | | | | It is used to downscale the input image horizontally and vertically, previously we were only downscaling it vertically so this caused a hard-to-debug memory corruption problem.
* | | | Merge pull request #655 from purpasmart96/hid_fixesbunnei2015-03-174-12/+72
|\ \ \ \ | | | | | | | | | | HID: Proper Signal Interrupts for EnableAccelerometer & EnableGyroscopeLow along with a stub for GetSoundVolume
| * | | | HID: Proper Signal Interrupts for EnableAccelerometer & EnableGyroscopeLow alongpurpasmart962015-03-174-12/+72
| | |_|/ | |/| | | | | | | | | | with a stub for GetSoundVolume
* | | | Merge pull request #660 from purpasmart96/ncch_updatesbunnei2015-03-171-11/+14
|\ \ \ \ | | | | | | | | | | NCCH: Minor updates to the ncch header
| * | | | NCCH: Minor updates to the ncch headerpurpasmart962015-03-151-11/+14
| |/ / /
* | | | arm_interface: Get rid of GetTicks.Lioncash2015-03-165-17/+6
| | | | | | | | | | | | | | | | Removes a TODO.
* | | | GPU: Implemented the flip_data (bit 0) bit in display transfers.Subv2015-03-142-6/+15
|/ / /
* | | Merge pull request #642 from bunnei/touchpadbunnei2015-03-124-130/+140
|\ \ \ | |_|/ |/| | Touchpad support
| * | hid_user: Removed unnecessary includes.bunnei2015-03-111-2/+0
| | |
| * | HID: Removed unnecessary global variables.bunnei2015-03-112-58/+42
| | |
| * | HID: Added additional variable comments and some code cleanups.bunnei2015-03-112-20/+29
| | |
| * | HID: Complete refactor of pad/touch input to fix threading issues.bunnei2015-03-113-111/+32
| | |
| * | HID: Cleanup how `next_touch_index` is calculated for Pad and touch.bunnei2015-03-101-2/+2
| | |
| * | HID: Changed TouchDataEntry `valid` to a BitField and added some doc strings.bunnei2015-03-102-4/+4
| | |
| * | HID: Added static asserts to check register position in shared memory.bunnei2015-03-101-2/+16
| | |
| * | HID: Added functions to emulate the touchpad.bunnei2015-03-102-0/+61
| | |
| * | HID: Moved some docstrings to the header.bunnei2015-03-102-24/+16
| | |
| * | HID: Refactored shared memory decoding for touchpad support.bunnei2015-03-102-33/+64
| | |
* | | Merge pull request #629 from archshift/lcdfbbunnei2015-03-108-41/+232
|\ \ \ | |/ / |/| | Implement SetLcdForceBlack and add implementation for color filling in the GPU code
| * | Added LCD registers, and implementation for color filling in OGL code.archshift2015-03-097-26/+184
| | |
| * | Implement SetLcdForceBlack, move register enum to hw.harchshift2015-03-064-36/+69
| | |
* | | dyncom: Minor cleanupLioncash2015-03-101-26/+7
| |/ |/| | | | | Assemblers will exit with an error when trying to assemble instructions with disallowed registers.
* | Merge pull request #648 from Subv/fill_bitTony Wasserka2015-03-091-1/+1
|\ \ | | | | | | GPU: Use the correct position for the finished bit in memory fills
| * | GPU: Use the correct position for the finished bit in memory fillsSubv2015-03-091-1/+1
| | |
* | | Merge pull request #646 from Subv/24bit_fillsTony Wasserka2015-03-092-5/+5
|\ \ \ | | | | | | | | GPU: Corrected the 24 bit memory fills component order
| * | | GPU: Corrected the 24 bit memory fills component orderSubv2015-03-092-5/+5
| |/ /
* | | Merge pull request #589 from kevinhartman/config-errorsbunnei2015-03-091-5/+10
|\ \ \ | | | | | | | | Fix errorcodes for bad config block request
| * | | Fix error message for bad config block request.Kevin Hartman2015-02-211-5/+10
| | | |
* | | | dyncom: Fix an indexing bug in STMLioncash2015-03-091-5/+4
| | | | | | | | | | | | | | | | Previously it would write the contents of register 13 for the case where the link register (r14) is supposed to be written.
* | | | dyncom: General cleanup of STMLioncash2015-03-091-16/+14
| | | |
* | | | dyncom: Increment addr when accessing LR in LDMLioncash2015-03-091-0/+2
| |/ / |/| |
* | | Merge pull request #538 from yuriks/perf-statTony Wasserka2015-03-072-0/+14
|\ \ \ | |_|/ |/| | Add profiling infrastructure and widget
| * | Add profiling infrastructure and widgetYuri Kunde Schlesner2015-03-022-0/+14
| | |
* | | Merge pull request #615 from Subv/servicesbunnei2015-03-0540-1110/+1202
|\ \ \ | | | | | | | | Services: Moved the PTM and APT services to their own folder
| * | | Services: Moved the PTM and APT services to their own folderSubv2015-03-0440-1110/+1202
| | | | | | | | | | | | | | | | | | | | | | | | This coincidentally fixes an issue about the PTM service failing to create its SharedExtSaveData archive due to the FS service not being initialized by the time the creating code runs. Ideally I'd like to move each process to its own folder, and have a single file per process that registers the service classes, which would be in their own files inside that folder. Then each service class would just call functions from the process to complete the commands.
* | | | Merge pull request #625 from lioncash/warnbunnei2015-03-042-4/+4
|\ \ \ \ | | | | | | | | | | vfp: Get rid of warnings
| * | | | vfp: Get rid of warningsLioncash2015-03-042-4/+4
| | | | |
* | | | | GPU: Added RGB565/RGB8 framebuffer support and various cleanups.bunnei2015-03-041-50/+25
| |/ / / |/| | | | | | | | | | | | | | | | | | | - Centralizes color format encode/decode functions. - Fixes endianness issues. - Implements remaining framebuffer formats in the debugger.
* | | | Merge pull request #622 from Subv/titlesYuri Kunde Schlesner2015-03-021-8/+45
|\ \ \ \ | | | | | | | | | | Services/AM: Stubbed TitleIDListGetTotal and GetTitleIDList.
| * | | | Services/AM: Stubbed TitleIDListGetTotal and GetTitleIDList.Subv2015-03-021-8/+45
| | | | | | | | | | | | | | | | | | | | | | | | | They will always return 0 titles for every media type for now. This is needed to boot Home Menu further
* | | | | Merge pull request #623 from Subv/cardbunnei2015-03-021-1/+25
|\ \ \ \ \ | | | | | | | | | | | | Services/FS: Stubbed CardSlotIsInserted to always return false
| * | | | | Services/FS: Stubbed CardSlotIsInserted to always return falseSubv2015-03-011-1/+25
| |/ / / / | | | | | | | | | | | | | | | We won't be emulating this for the foreseeable future and it is needed for Home Menu to boot further
* | | | | Merge pull request #618 from lioncash/refbunnei2015-03-021-2/+2
|\ \ \ \ \ | |_|/ / / |/| | | | result: Make comparison operators take references
| * | | | result: Make comparison operators take referencesLioncash2015-02-281-2/+2
| |/ / / | | | | | | | | | | | | It's unnecessary to make copies for simple comparisons like this.
* | | | Merge pull request #621 from Subv/powerbunnei2015-03-021-1/+13
|\ \ \ \ | |_|/ / |/| | | Services/PTM: Stubbed PTM_Sysm::IsLegacyPowerOff.
| * | | Services/PTM: Stubbed PTM_Sysm::IsLegacyPowerOff.Subv2015-03-011-1/+13
| |/ / | | | | | | | | | This allows the Home Menu to boot further
* | | Merge pull request #616 from archshift/5551archshift2015-02-281-1/+1
|\ \ \ | | | | | | | | Added RGBA5551 compatibility in the rasterizer
| * | | Added RGBA5551 compatibility in the rasterizerarchshift2015-02-281-1/+1
| |/ / | | | | | | | | | This allows Virtual Console games to display properly.
* | | Merge pull request #620 from lioncash/bkptbunnei2015-02-281-2/+3
|\ \ \ | | | | | | | | arm_disasm: Show conditional code for BKPT instructions.
| * | | arm_disasm: Show conditional code for BKPT instructions.Lioncash2015-02-281-2/+3
| |/ / | | | | | | | | | Changed cond_to_str to take a uint32, since unsigned numbers are only ever passed to it, and this can be a source of warnings for some compilers (also indexing an array without bounds checking a signed number is kind of iffy).
* / / arm_disasm: Remove unused variableLioncash2015-02-281-2/+1
|/ / | | | | | | Also declared an array as static, as it's only used in this translation unit.
* | Merge pull request #599 from Subv/mortonbunnei2015-02-272-23/+64
|\ \ | | | | | | GPU: Implemented bits 3 and 1 from the display transfer flags.
| * | GPU: Implemented bits 3 and 1 from the display transfer flags.Subv2015-02-272-23/+64
| | | | | | | | | | | | | | | Bit 3 is used to specify a raw copy, where no processing is done to the data, seems to behave exactly as a DMA. Bit 1 is used to specify whether to convert from a tiled format to a linear format or viceversa.
* | | arm: The CP15 Main ID register is not writeableLioncash2015-02-261-3/+1
|/ /
* | Merge pull request #604 from Subv/arc_ssdYuri Kunde Schlesner2015-02-264-45/+70
|\ \ | | | | | | Archives: Properly implemented the SystemSaveData archive.
| * | Archives: Properly implemented the SystemSaveData archive.Subv2015-02-264-45/+70
| | | | | | | | | | | | Ported to the new factory pattern we have for archives.
* | | arm: Remove unnecessary booleansLioncash2015-02-252-22/+5
| | | | | | | | | | | | We don't care about any of these.
* | | Services: Implemented Y2R_U::GetTransferEndEventSubv2015-02-241-1/+18
|/ / | | | | | | Aero Porter was throwing an "Invalid Handle" fatal error without this.
* | Merge pull request #595 from linkmauve/new-3ds-inputbunnei2015-02-242-0/+25
|\ \ | | | | | | Frontends, HID: Add New 3DS specific pad buttons, and stub the touch one.
| * | Frontends, HID: Add New 3DS specific pad buttons, and stub the touch one.Emmanuel Gil Peyrot2015-02-222-0/+25
| | |
* | | Merge pull request #581 from archshift/tfebunnei2015-02-231-1/+164
|\ \ \ | | | | | | | | Added information reporting from ThrowFatalError
| * | | Added information reporting from ThrowFatalErrorarchshift2015-02-221-1/+164
| | | | | | | | | | | | | | | | This was RE'd from the errdisp applet.
* | | | GPU: Fixed RGBA8 as output format in a display transfer.Subv2015-02-221-8/+7
| | | | | | | | | | | | | | | | Verified with hwtests
* | | | Merge pull request #471 from archshift/pp3ports3bunnei2015-02-221-0/+37
|\ \ \ \ | | | | | | | | | | GPU: Add support for more framebuffer formats in display transfers.
| * | | | GPU: Add support for more framebuffer formats in display transfers.Tony Wasserka2015-02-221-0/+37
| | | | |
* | | | | Merge pull request #596 from kevinhartman/unaligned-cleanupbunnei2015-02-222-35/+2
|\ \ \ \ \ | | | | | | | | | | | | Clean up unaligned 32-bit memory reads
| * | | | | Cleaned up unaligned access.Kevin Hartman2015-02-222-35/+2
| | |_|_|/ | |/| | |
* | | | | Merge pull request #594 from Subv/display_transferbunnei2015-02-221-8/+6
|\ \ \ \ \ | |_|_|_|/ |/| | | | GPU: Fixed the RGBA8 input format and RGB8 output format
| * | | | GPU: Fixed the RGBA8 input format and RGB8 output formatSubv2015-02-221-8/+6
| |/ / / | | | | | | | | | | | | in Display Transfers, tested with hwtests.
* | | | Merge pull request #588 from archshift/somebranchbunnei2015-02-203-15/+5
|\ \ \ \ | |/ / / |/| | | Sweeping cleanup of Common
| * | | Misc cleanup of common and related functionsarchshift2015-02-201-2/+3
| | | |
| * | | Remove duplication of INSERT_PADDING_WORDS between pica.h and gpu.harchshift2015-02-201-11/+0
| | | |
| * | | Remove the useless msg_handler compilation unit that was left over from Dolphinarchshift2015-02-191-2/+2
| | |/ | |/|
* / | Convert a few C stdlib asserts to Citra's own assertsarchshift2015-02-191-6/+4
|/ /
* | Merge pull request #580 from lioncash/emplacebunnei2015-02-181-1/+1
|\ \ | | | | | | core/video_core: Use in-place construction where possible
| * | core/video_core: Use in-place construction where possibleLioncash2015-02-171-1/+1
| | |
* | | GPU: Properly implement memory fills.Tony Wasserka2015-02-184-33/+78
| | |
* | | Merge pull request #570 from purpasmart96/config_membunnei2015-02-184-50/+58
|\ \ \ | | | | | | | | ConfigMem: Clean up the Config memory to be more like the shared page
| * | | ConfigMem: Clean up the Config memory to be more like the shared page and movedpurpasmart962015-02-174-50/+58
| | | | | | | | | | | | | | | | the helper macro for padding to common_funcs.h
* | | | Merge pull request #582 from lioncash/warningsbunnei2015-02-181-4/+4
|\ \ \ \ | | | | | | | | | | vfpinstr: Fix trivial signed/unsigned mismatch warnings
| * | | | vfpinstr: Fix trivial signed/unsigned mismatch warningsLioncash2015-02-181-4/+4
| | | | |
* | | | | Merge pull request #579 from lioncash/bkptbunnei2015-02-182-2/+28
|\ \ \ \ \ | |/ / / / |/| | | | dyncom: Support conditional BKPT instructions
| * | | | dyncom: Support conditional BKPT instructionsLioncash2015-02-172-2/+28
| | | | |
* | | | | Services: Fixed "Tried to connect to named port err:f".Subv2015-02-161-1/+1
| | | | | | | | | | | | | | | | | | | | err:f is a named port, not a service
* | | | | Merge pull request #574 from lioncash/warnbunnei2015-02-161-2/+2
|\ \ \ \ \ | |/ / / / |/| | | | vfpdouble: Use %p for printing pointer addresses.
| * | | | vfpdouble: Use %p for printing pointer addresses.Lioncash2015-02-151-2/+2
| | | | |
* | | | | dyncom: Actually set the destination register for USAD8/USADA8.Lioncash2015-02-161-0/+1
|/ / / / | | | | | | | | | | | | Idiotville: Population: 1 - Inhabitant name: Lioncash
* | | | Merge pull request #539 from linkmauve/framebuffer-formatsbunnei2015-02-151-0/+19
|\ \ \ \ | | | | | | | | | | Framebuffer formats
| * | | | video_core: Implement the remaining framebuffer formats in the OpenGL renderer.Emmanuel Gil Peyrot2015-02-151-0/+19
| | |/ / | |/| |
* / | | arm: Set the A bit on reset.Lioncash2015-02-151-1/+1
|/ / / | | | | | | | | | This enum value is ORed against in ARMul_Reset (and used to refer to all interrupt bits in the CPSR). So simply updating this is enough.
* | | Merge pull request #529 from Subv/masterbunnei2015-02-148-46/+64
|\ \ \ | | | | | | | | Build: Fixed some warnings
| * | | Build: Fixed some warningsSubv2015-02-128-46/+64
| | | |
* | | | core: Apply static to local functionsLioncash2015-02-1311-245/+252
| | | |
* | | | arm: General cleanupLioncash2015-02-1313-227/+116
| |/ / |/| | | | | | | | | | | | | | | | | - Remove several typedefs for ARMul_State. - Remove unused functions - Remove unused/unnecessary headers - Removed unused enums, etc.
* | | dyncom: Switch the app and system cores into the correct mode at initializationLioncash2015-02-135-17/+21
| | |
* | | dyncom: Clean up the constructorLioncash2015-02-133-16/+7
| | | | | | | | | | | | Some function calls aren't necessary and would be handled by regular initialization routines.
* | | dyncom: Remove warning for SXTAHLioncash2015-02-131-1/+0
| | | | | | | | | | | | This is tested to work correctly.
* | | arm: Remove ARMul_EmulateInitLioncash2015-02-124-55/+1
| | | | | | | | | | | | This was only used for armemu, which has since been removed. Removed components related to this as well.
* | | armdefs: Remove unnecessary extern CLioncash2015-02-121-6/+0
|/ /
* | Implemented WriteHWRegsWithMask for GSP.Kevin Hartman2015-02-111-6/+91
| |
* | arm: Remove ARM26 support.Lioncash2015-02-112-45/+4
| | | | | | | | This will never be used. 32-bit is the norm.
* | Merge pull request #559 from lioncash/cleanbunnei2015-02-114-24/+40
|\ \ | | | | | | arm: Some cleanup. Also fixed the initial ARM mode that is emulated.
| * | arm: Get rid of some magic constants. Specify proper ARM mode.Lioncash2015-02-113-3/+10
| | | | | | | | | | | | Initially, we were starting the emulator in USER26MODE, which is incorrect, this should be USER32MODE.
| * | arm: Change some more constants into enumsLioncash2015-02-112-21/+30
| | |
* | | Asserts: break/crash program, fit to style guide; log.h->assert.harchshift2015-02-1159-77/+33
| | | | | | | | | | | | | | | | | | | | | Involves making asserts use printf instead of the log functions (log functions are asynchronous and, as such, the log won't be printed in time) As such, the log type argument was removed (printf obviously can't use it, and it's made obsolete by the file and line printing) Also removed some GEKKO cruft.
* | | GSP: Fixed typo in SignalInterruptbunnei2015-02-111-1/+1
| | |
* | | Merge pull request #552 from bunnei/setbufferswap-fixbunnei2015-02-111-4/+3
|\ \ \ | | | | | | | | GSP SetBufferSwap fix
| * | | GSP: Call SetBufferSwap for each screen on corresponding signal interrupt.bunnei2015-02-111-4/+3
| | | |
* | | | Merge pull request #526 from purpasmart96/citra_stubsbunnei2015-02-114-8/+191
|\ \ \ \ | | | | | | | | | | Services: Stub some functions
| * | | | Services: Stub some functionspurpasmart962015-02-084-8/+191
| | | | |
* | | | | Merge pull request #556 from lioncash/cleanbunnei2015-02-114-28/+19
|\ \ \ \ \ | | |_|/ / | |/| | | arm: Remove TRUE/FALSE defines
| * | | | arm: Remove TRUE/FALSE definesLioncash2015-02-104-28/+19
| | | | | | | | | | | | | | | | | | | | | | | | | - Removed the Debug parameter from ARMul_State since it isn't used. - Changed ARMul_CoProInit to a void function. It always returned true.
* | | | | Merge pull request #555 from lioncash/lutbunnei2015-02-111-7/+7
|\ \ \ \ \ | | | | | | | | | | | | arm_dyncom_thumb: Make lookup tables static
| * | | | | arm_dyncom_thumb: Make lookup tables staticLioncash2015-02-101-7/+7
| |/ / / / | | | | | | | | | | | | | | | These don't need to be recreated all the time.
* | | | | PTM: Fixed a problem with the gamecoin PTM file.Subv2015-02-101-21/+13
| | | | |
* | | | | Archives: Made the Format function more generic.Subv2015-02-103-9/+10
| | | | |
* | | | | Archives: Expose the File and Directory classes to HLESubv2015-02-103-58/+62
| | | | |
* | | | | ResultVal: Fixed compilation when reassigning a ResultVal.Subv2015-02-101-3/+3
| | | | |
* | | | | FS: Allow multiple instances of the same archive type to be open at onceYuri Kunde Schlesner2015-02-1019-159/+199
| | | | |
* | | | | FS: Get rid of completely useless Archive classYuri Kunde Schlesner2015-02-101-36/+26
|/ / / /
* | | | Merge pull request #553 from lioncash/denormbunnei2015-02-102-0/+6
|\ \ \ \ | | | | | | | | | | vfp: Normalize accumulator for multiply accumulate instructions
| * | | | vfp: Normalize accumulator for multiply accumulate instructionsLioncash2015-02-102-0/+6
| | | | |
* | | | | dyncom: Add more regs to MCR/MRCLioncash2015-02-102-18/+35
|/ / / / | | | | | | | | | | | | Adds the registers that were left out of some coprocessor ranges.
* | / / Scheduler refactor Pt. 1Kevin Hartman2015-02-107-284/+287
| |/ / |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * Simplifies scheduling logic, specifically regarding thread status. It should be much clearer which statuses are valid for a thread at any given point in the system. * Removes dead code from thread.cpp. * Moves the implementation of resetting a ThreadContext to the corresponding core's implementation. Other changes: * Fixed comments in arm interfaces. * Updated comments in thread.cpp * Removed confusing, useless, functions like MakeReady() and ChangeStatus() from thread.cpp. * Removed stack_size from Thread. In the CTR kernel, the thread's stack would be allocated before thread creation.
* | | Merge pull request #551 from bunnei/mutex-fixesbunnei2015-02-103-20/+24
|\ \ \ | | | | | | | | Mutex/synch fixes
| * | | Mutex: Locks should be recursive.bunnei2015-02-102-16/+20
| | | |
| * | | WaitSynch: Always reschedule (verified behavior on hw).bunnei2015-02-101-4/+4
| | | |
* | | | vfpdouble: Fix the FTOUI NaN sign settingLioncash2015-02-091-1/+1
| | | | | | | | | | | | | | | | This was fixed for vfpsingle, but not vfpdouble
* | | | Throw more unused/unnecessary VFP code outLioncash2015-02-093-215/+1
| | | |
* | | | vfp_helper: Convert some flags to enums. Throw out more duplicated FPSCR stuffLioncash2015-02-094-192/+153
| | | |
* | | | vfp_helper: Normalize tabs to spacesLioncash2015-02-091-172/+170
|/ / /
* | | vfp_helper: Remove unnecessary extern C blocksLioncash2015-02-061-17/+1
| | |
* | | vfp: Move FPSID, FPEXC, and FPSCR values over to enums.Lioncash2015-02-063-150/+104
| | | | | | | | | | | | Also got rid of duplicate definitions of some of these values.
* | | Merge pull request #537 from lioncash/vfpbunnei2015-02-041-6/+6
|\ \ \ | | | | | | | | vfp: Fix VCVT
| * | | vfp: Fix VCVTLioncash2015-02-041-6/+6
| | | | | | | | | | | | | | | | | | | | These variants exclusively read from the single precision regs and write to double-precision registers Fixes issues where converted values would be way off from what they should be due to the results being stored in the wrong registers.
* | | | Merge pull request #536 from lioncash/deadbunnei2015-02-042-1765/+0
|\ \ \ \ | |/ / / |/| | | vfp: Throw out unused code
| * | | vfp: Throw out unused codeLioncash2015-02-042-1765/+0
| | | |
* | | | dyncom: Remove more unnecessary codeLioncash2015-02-031-45/+3
|/ / /
* | | core: Fix some warnings on OSXLioncash2015-02-034-6/+5
| | |
* | | Kernel: Stop creating useless Handles during object creationYuri Kunde Schlesner2015-02-0218-57/+41
| | | | | | | | | | | | | | | They're finally unnecessary, and will stop cluttering the application's handle table.
* | | Kernel: Make WaitObjects share ownership of Threads waiting on themYuri Kunde Schlesner2015-02-026-12/+17
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | During normal operation, a thread waiting on an WaitObject and the object hold mutual references to each other for the duration of the wait. If a process is forcefully terminated (The CTR kernel has a SVC to do this, TerminateProcess, though no equivalent exists for threads.) its threads would also be stopped and destroyed, leaving dangling pointers in the WaitObjects. The solution is to simply have the Thread remove itself from WaitObjects when it is stopped. The vector of Threads in WaitObject has also been changed to hold SharedPtrs, just in case. (Better to have a reference cycle than a crash.)
* | | Explicitly instantiate constructors/destructors for Kernel objectsYuri Kunde Schlesner2015-02-0217-8/+51
| | | | | | | | | | | | | | | | | | This should speed up compile times a bit, as well as enable more liberal use of forward declarations. (Due to SharedPtr not trying to emit the destructor anymore.)
* | | Mutex: Replace g_mutex_held_locks with a set inside ThreadYuri Kunde Schlesner2015-02-023-23/+18
| | |
* | | HID: Fix crash when pressing a key when the emulator is stoppedYuri Kunde Schlesner2015-02-021-0/+2
| | |
* | | SVC: Enable CloseHandle, clean up DuplicateHandleYuri Kunde Schlesner2015-02-021-9/+5
| | |
* | | Kernel: Fix bug in HandleTable::CloseYuri Kunde Schlesner2015-02-021-1/+1
| | |
* | | Kernel: Remove Object::GetHandle (it's not used anymore :D)Yuri Kunde Schlesner2015-02-022-9/+1
| | |
* | | Kernel: Introduce unique Object ids for debuggingYuri Kunde Schlesner2015-02-024-8/+16
| | |
* | | Kernel: Use separate Handle tables for CoreTiming userdataYuri Kunde Schlesner2015-02-024-18/+25
| | | | | | | | | | | | This is to support the removal of GetHandle soon
* | | Kernel: Remove previous scheduled event when a Timer is re-SetYuri Kunde Schlesner2015-02-021-0/+3
| | |
* | | FS: Remove use of GetHandleYuri Kunde Schlesner2015-02-021-1/+1
| | |
* | | Thread: Modernize two functions that slipped through previous rebasesYuri Kunde Schlesner2015-02-024-18/+16
| | |
* | | Service: Store function names as const char* instead of std::stringYuri Kunde Schlesner2015-02-021-6/+6
| | | | | | | | | | | | | | | Uses less memory (strings and function table is stored in constant data) and speeds up start up (no need to allocate and copy strings).
* | | Service: Clean-up InterfaceYuri Kunde Schlesner2015-02-0246-67/+54
| | |
* | | Make Port/Service registration and querying more HW-accurateYuri Kunde Schlesner2015-02-024-106/+80
| | |
* | | Filesys: Move creation of Handles for File/Directory to service handlersYuri Kunde Schlesner2015-02-023-32/+33
| | |
* | | Merge pull request #514 from rohit-n/fix-warningsbunnei2015-02-011-2/+2
|\ \ \ | | | | | | | | Silence a few warnings.
| * | | Silence a few warnings.Rohit Nirmal2015-01-301-2/+2
| | | |
* | | | Merge pull request #525 from lioncash/armwarnbunnei2015-02-012-6/+3
|\ \ \ \ | | | | | | | | | | vfp: Get rid of some compile warnings
| * | | | vfp: Get rid of some compile warningsLioncash2015-02-012-6/+3
| | | | |
* | | | | arm: Clean up ARMul_StateLioncash2015-02-015-138/+84
|/ / / / | | | | | | | | | | | | Remove unnecessary/unused struct variables.
* | | | arm: Adios armemuLioncash2015-02-0116-8599/+166
| | | |
* | | | Merge pull request #512 from lioncash/assignmentTony Wasserka2015-01-312-4/+4
|\ \ \ \ | |_|/ / |/| | | shared_memory: Fix assignments in SharedMemory::Map
| * | | shared_memory: Fix assignments in SharedMemory::MapLioncash2015-01-302-4/+4
| |/ /
* | | dyncom: clean up arm_dyncom_dec.hLioncash2015-01-301-43/+2
| | |
* | | arm: Move headers over to pragma onceLioncash2015-01-307-31/+11
| | |
* | | arm: Get rid of armcpu.h and skyeye_types.hLioncash2015-01-306-115/+0
| | |
* | | arm: Clean out armos.h and armmmu.hLioncash2015-01-302-181/+23
| | |
* | | Merge pull request #513 from lioncash/cleanupbunnei2015-01-306-1667/+168
|\ \ \ | | | | | | | | arm: Cleanup.
| * | | arm: Throw out a lot of unnecessary codeLioncash2015-01-306-1536/+56
| | | |
| * | | armdefs: Move some defines over to enumsLioncash2015-01-301-131/+112
| |/ /
* | | loader: Add missing printf argumentLioncash2015-01-301-1/+1
| | |
* | | archive: Fix initializer list order for the File class.Lioncash2015-01-301-1/+1
| | |
* | | apt_u: Fix missing printf specifiersLioncash2015-01-301-2/+2
|/ /
* | Kernel: Mark all appropriate kernel objects as "final"Yuri Kunde Schlesner2015-01-307-8/+7
| |
* | SVC: Use CASCADE_RESULT in SVC handlersYuri Kunde Schlesner2015-01-302-77/+32
| |
* | Remove result.h InvalidHandleYuri Kunde Schlesner2015-01-304-30/+32
| | | | | | | | | | It was only being used in two places, where it was replaced by a local constant.
* | SVC: Change return type of handlers to ResultCodeYuri Kunde Schlesner2015-01-302-132/+127
| |
* | Kernel: Convert Event to not use HandlesYuri Kunde Schlesner2015-01-3010-152/+151
| |
* | Kernel: Convert Timer to (mostly) not use HandlesYuri Kunde Schlesner2015-01-303-111/+112
| |
* | Kernel: Convert Mutex to not use HandlesYuri Kunde Schlesner2015-01-305-114/+110
| |
* | Kernel: Convert AddressArbiter to not use HandlesYuri Kunde Schlesner2015-01-303-38/+55
| |
* | Kernel: Convert Semaphore to not use HandlesYuri Kunde Schlesner2015-01-303-67/+88
| |
* | Kernel: Convert SharedMemory to not use HandlesYuri Kunde Schlesner2015-01-308-102/+107
| |
* | Additions to ResultVal to make it more convenient to use.Yuri Kunde Schlesner2015-01-301-1/+25
| |
* | Move VAddr/PAddr typedefs to kernel.hYuri Kunde Schlesner2015-01-302-9/+7
| |
* | Kernel: Remove useless/duplicated comments; mark functions staticYuri Kunde Schlesner2015-01-306-32/+8
| |
* | Merge pull request #412 from purpasmart96/svc_table_cleanupbunnei2015-01-281-7/+7
|\ \ | | | | | | SVC: Update the SVC function table
| * | SVC: Update the SVC function tablepurpasmart962015-01-271-7/+7
| | |
* | | dyncom: Minor cleanupLioncash2015-01-271-126/+137
| | | | | | | | | | | | Narrow scopes for the instruction variables. Remove unnecessary parentheses.
* | | Merge pull request #345 from purpasmart96/apt_stubsbunnei2015-01-271-91/+276
|\ \ \ | | | | | | | | APT_U: Stub some functions & misc changes
| * | | APT_U: Stub some functions & misc changespurpasmart962015-01-231-91/+276
| | | |
* | | | Update vfp.cppbunnei2015-01-271-1/+1
| | | | | | | | | | | | VFP: Changed a debug log to trace.
* | | | Merge pull request #485 from Subv/more_servsbunnei2015-01-2621-3/+426
|\ \ \ \ | | | | | | | | | | Services: Stubbed more services.
| * | | | Services/HID: Removed some files due to a rebase errorSubv2015-01-243-267/+0
| | | | |
| * | | | Services: Stubbed more services.Subv2015-01-2424-3/+693
| | | | | | | | | | | | | | | | | | | | Implemented FSUser::CreateExtSaveData
* | | | | Merge pull request #410 from chinhodado/cleanupbunnei2015-01-245-483/+157
|\ \ \ \ \ | | | | | | | | | | | | Cleanup: Logging in Core
| * | | | | Cleanup: Logging in CoreChin2015-01-195-483/+157
| | | | | |
* | | | | | vfp: Clean up vertical alignment for instructionsLioncash2015-01-231-131/+125
| | | | | |
* | | | | | cam_u.h: fix indentationarchshift2015-01-221-2/+2
| |/ / / / |/| | | | | | | | | Withholding my profanity towards Xcode.
* | | | | Merge pull request #493 from archshift/ptmplaybunnei2015-01-226-0/+106
|\ \ \ \ \ | | | | | | | | | | | | Stubbed some services
| * | | | | Stubbed cam:u servicearchshift2015-01-214-0/+51
| | | | | |
| * | | | | Stubbed ptm:play servicearchshift2015-01-214-0/+55
| | | | | |
* | | | | | dyncom: Minor cleanupLioncash2015-01-221-282/+270
| | | | | | | | | | | | | | | | | | | | | | | | Removes some unused macros and cleans up indentation inconsistencies
* | | | | | WaitSynchronization: Added a result code for invalid result, fixed bug.bunnei2015-01-221-3/+9
| | | | | |
* | | | | | Thread: Fix WaitSynchronization1 to not set register 1 on thread wakeup.bunnei2015-01-223-25/+45
| | | | | |
* | | | | | Thread: Use std::find in CheckWait_WaitObject.bunnei2015-01-221-4/+5
| | | | | |
* | | | | | Mutex: Cleanup and remove redundant code.bunnei2015-01-223-47/+29
| | | | | |
* | | | | | Kernel: Renamed some functions for clarity.bunnei2015-01-227-10/+10
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | - ReleaseNextThread->WakeupNextThread - ReleaseAllWaitingThreads->WakeupAllWaitingThreads.
* | | | | | Kernel: Changed "ShouldWait" to return bool and "Acquire" to return void.bunnei2015-01-229-71/+42
| | | | | |
* | | | | | WaitObject: Renamed "Wait" to "ShouldWait", made "ShouldWait" and "Acquire" pure virtual.bunnei2015-01-229-23/+22
| | | | | |
* | | | | | Event: Fix implementation of "non-sticky" events.bunnei2015-01-221-0/+4
| | | | | |
* | | | | | Session: Change to a WaitObject.bunnei2015-01-223-2/+9
| | | | | |
* | | | | | Kernel: Reschedule on SignalEvent and SendSyncRequest, fix some bugs.bunnei2015-01-222-1/+2
| | | | | |
* | | | | | Mutex: Fix a bug where the thread should not wait if it already has the mutex.bunnei2015-01-221-1/+4
| | | | | |
* | | | | | Kernel: Moved Wait and Acquire to WaitObject, added way to retrieve a WaitObject safely.bunnei2015-01-224-20/+59
| | | | | |
* | | | | | SVC: Removed a Sleep that made no sensebunnei2015-01-221-6/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | - Would deadlock the calling thread - Code would never get hit anyways
* | | | | | AddressArbiter: Changed to Kernel::Object, big cleanup, removed code that made no sense.bunnei2015-01-225-38/+45
| | | | | |
* | | | | | Kernel: Get rid of WaitTypes and simplify lots of code, removing hacks.bunnei2015-01-229-122/+63
| | | | | |
* | | | | | WaitSynchronizationN: Improved commentsbunnei2015-01-221-7/+12
| | | | | |
* | | | | | WaitSynchronizationN: Refactor to fix several bugsbunnei2015-01-228-79/+76
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | - Separate wait checking from waiting the current thread - Resume thread when wait_all=true only if all objects are available at once - Set output to correct wait object index when there are duplicate handles
* | | | | | Kernel: Separate WaitSynchronization into Wait and Acquire methods.bunnei2015-01-228-18/+59
| | | | | |
* | | | | | WaitSynchronizationN: Handle case where handles=nullptr.bunnei2015-01-221-0/+4
| | | | | |
* | | | | | WaitSynchronizationN: Handle case where handle_count is invalid.bunnei2015-01-221-3/+7
| | | | | |
* | | | | | WaitSynchronizationN: Handle case where handle_count=0.bunnei2015-01-221-19/+29
| | | | | |
* | | | | | WaitSynchronizationN: Implement return valuesbunnei2015-01-2210-83/+189
| | | | | |
* | | | | | Event: Fixed some bugs and cleanup (Subv)bunnei2015-01-224-57/+16
| | | | | |
* | | | | | Thread: Keep track of multiple wait objects.bunnei2015-01-223-16/+30
| | | | | |
* | | | | | Event: Get rid of permanent_lock hack.bunnei2015-01-222-36/+8
| | | | | |
* | | | | | WaitObject: Added RemoveWaitingThread, fixed a bug, and cleanup.bunnei2015-01-222-4/+17
| | | | | |
* | | | | | Kernel: Added WaitObject and changed "waitable" objects inherit from it.bunnei2015-01-228-71/+73
| | | | | |
* | | | | | Added HID_SPVR service and split HID_U implementation into service/hid/hid.xxxarchshift2015-01-2110-219/+333
|/ / / / /
* | | | | Merge pull request #498 from lioncash/staticsbunnei2015-01-201-14/+14
|\ \ \ \ \ | | | | | | | | | | | | core_timing: Mark several variables as static
| * | | | | core_timing: Mark several variables as staticLioncash2015-01-201-14/+14
| | | | | | | | | | | | | | | | | | | | | | | | These are only used in this translation unit.
* | | | | | core: Fix a few docstringsLioncash2015-01-204-4/+4
|/ / / / /
* | | | | Merge pull request #492 from archshift/aptbunnei2015-01-202-1/+4
|\ \ \ \ \ | | | | | | | | | | | | Expose GetSharedFont and NotifyToWait to APT:A and APT:S respectively
| * | | | | Expose GetSharedFont and NotifyToWait to APT:A and APT:S respectivelyarchshift2015-01-192-1/+4
| | | | | |
* | | | | | Merge pull request #241 from linkmauve/better-loaderbunnei2015-01-208-352/+344
|\ \ \ \ \ \ | | | | | | | | | | | | | | Improve the loader a bit
| * | | | | | Loader: Clean up the ELF AppLoader.Emmanuel Gil Peyrot2015-01-152-42/+35
| | | | | | |
| * | | | | | Loader: Clean up the 3DSX AppLoader.Emmanuel Gil Peyrot2015-01-151-17/+24
| | | | | | |
| * | | | | | Loader: Clean up the NCCH AppLoader.Emmanuel Gil Peyrot2015-01-151-51/+48
| | | | | | |
| * | | | | | Loader: Display the type of the file being loaded.Emmanuel Gil Peyrot2015-01-151-3/+23
| | | | | | |
| * | | | | | Loader: Guess filetype from the magic, or fallback to the extension.Emmanuel Gil Peyrot2015-01-158-26/+112
| | | | | | |
| * | | | | | Loader: Don’t assume the file hasn’t been read before.Emmanuel Gil Peyrot2015-01-153-4/+13
| | | | | | |
| * | | | | | Loader: Keep a reference to the file and pass it to the correct AppLoader, instead of loading it multiple times.Emmanuel Gil Peyrot2015-01-158-176/+116
| | | | | | |
| * | | | | | Loader: Initialize the default NCCH values in the class declaration, not in the constructor.Emmanuel Gil Peyrot2015-01-152-8/+4
| | | | | | |
| * | | | | | Loader: Remove the useless THREEDSXReader class.Emmanuel Gil Peyrot2015-01-151-10/+4
| | | | | | |
| * | | | | | Loader: Never forget to change is_loaded.Emmanuel Gil Peyrot2015-01-156-7/+15
| | | | | | |
| * | | | | | Loader: Don’t duplicate the docstring into the cpp file.Emmanuel Gil Peyrot2015-01-154-56/+0
| | | | | | |
| * | | | | | Loader: Fix indentation, whitespace, and a few other such cosmetic stuff.Emmanuel Gil Peyrot2015-01-152-26/+24
| | | | | | |
* | | | | | | dyncom: Clarify precedence for ternary statementsLioncash2015-01-203-3/+3
| | | | | | |
* | | | | | | Merge pull request #494 from lioncash/shiftbunnei2015-01-191-7/+33
|\ \ \ \ \ \ \ | |_|_|/ / / / |/| | | | | | dyncom: Implement missing shifts in ScaledRegisterPostIndexed, etc
| * | | | | | dyncom: Implement missing shifts in ScaledRegisterPostIndexed, etcLioncash2015-01-191-7/+33
| | |/ / / / | |/| | | |
* | | | | | Merge pull request #383 from zhuowei/shared_pagebunnei2015-01-195-0/+116
|\ \ \ \ \ \ | |/ / / / / |/| | | | | Add some support for the shared page
| * | | | | Add some support for the shared page (currently 3d slider is implemented)Zhuowei Zhang2015-01-165-0/+116
| | | | | |
* | | | | | dyncom: Handle the ARM A2 encoding of STRT/LDRTLioncash2015-01-171-10/+24
| | | | | | | | | | | | | | | | | | | | | | | | These were also missing the shifted register case.
* | | | | | dyncom: Handle the ARM A2 encoding of LDRBT/STRBT.Lioncash2015-01-171-17/+15
| |_|/ / / |/| | | |
* | | | | APT: Fix typo in setting return code for NotifyToWaitbunnei2015-01-161-1/+1
| | | | |
* | | | | DSP: Removed useless spam log for SignalInterruptbunnei2015-01-161-5/+2
| | | | |
* | | | | Merge pull request #482 from yuriks/fix-vblankbunnei2015-01-165-102/+91
|\ \ \ \ \ | |_|/ / / |/| | | | Correctness fixes for GPU flipping and interrupts
| * | | | GPU: Fix buffer overrun in Display TransfersYuri Kunde Schlesner2015-01-141-9/+12
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Display transfers with the horizontal downscaling flag were calculating the wrong output size, causing them to write double the amount of data intended. It is likely that this was perceived as correct due to a separate bug in calculating source indices which caused the image to be padded unless the previous bug was present. This fixes both issues, correcting flickering issues in 3dscraft, blargSnes and more (caused by the transfer overwriting the back buffer which followed) as well as potentially fixing other crashes.
| * | | | GSP: Fix appending of interrupts to the shared memory bufferYuri Kunde Schlesner2015-01-142-17/+12
| | | | | | | | | | | | | | | | | | | | | | | | | The code was previously appending the interrupt to after the end of the buffer, instead of at the end.
| * | | | GPU: Do periodic VBlank updates using CoreTimingYuri Kunde Schlesner2015-01-143-51/+44
| | | | |
| * | | | GPU: Correct wrong default framebuffer address for sub-screen.Yuri Kunde Schlesner2015-01-141-2/+2
| | | | | | | | | | | | | | | | | | | | | | | | | It appears this is a mistake, since the sub-screen has no right framebuffer.
| * | | | GSP: Update framebuffer info on all interruptsYuri Kunde Schlesner2015-01-141-12/+13
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Hardware testing determined that the GSP processes shared memory framebuffer update info even when no memory transfer or filling GX commands are used. They are now updated on every interrupt, which isn't confirmed correct but matches hardware behaviour more closely. This also reverts the hack introduced in #404. It made a few games behave better, but I believe it's incorrect and also breaks other games.
| * | | | GPU: Fire GPU interrupts at the correct places.Yuri Kunde Schlesner2015-01-142-21/+18
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | PDC0 and PDC1 are both VBlank interrupts. PDC0 was being treated as a HBlank interrupt and fired many more times than it should. They now both fire together at 60 Hz. This puzzlingly *improves* apparent framerate on many applications. A few other interrupts were being fired inside the GSP command processing instead of on the actual GPU register writes, so they were moved there, which should cover direct writes tho those registers not going through the GX command queue.
* | | | | Merge pull request #481 from Subv/hm_bbunnei2015-01-151-7/+21
|\ \ \ \ \ | | | | | | | | | | | | APTU: Stubbed NotifyToWait, taken from 3dmoo.
| * | | | | APT: Fixed the comment style in some variablesSebastian Valle2015-01-141-2/+2
| | | | | |
| * | | | | APTU: Stubbed NotifyToWait, taken from 3dmoo.Subv2015-01-141-7/+21
| |/ / / / | | | | | | | | | | | | | | | | | | | | Also renamed some handles in the APT:U service to be more descriptive. Fixed a typo in InquireNotification
* | | | | Merge pull request #480 from Subv/arb_2bunnei2015-01-143-4/+21
|\ \ \ \ \ | |/ / / / |/| | | | AddrArbiter: Implement arbitration types 3 and 4.
| * | | | AddrArbiter: Implement arbitration types 3 and 4.Subv2015-01-133-4/+21
| | | | |
* | | | | Services: Added some missing services.Subv2015-01-139-1/+364
|/ / / / | | | | | | | | | | | | | | | | cfg:s, ptm:sysm, apt:s. apt:s is almost exactly the same as apt:u as per 3dbrew
* | / / vfp: Remove dead codeLioncash2015-01-121-50/+14
| |/ / |/| |
* | | dyncom: Fix 32-bit ASR shifts for immediatesLioncash2015-01-121-5/+3
| | |
* | | dyncom: Remove unused flag macrosLioncash2015-01-121-15/+3
| | |
* | | Merge pull request #472 from lioncash/overflowbunnei2015-01-123-147/+175
|\ \ \ | |_|/ |/| | dyncom: Fix some more V-flag setting ops. Plus some cleanup.
| * | dyncom: Get rid of unnecessary outer-scope variables in InterpreterMainLoopLioncash2015-01-121-97/+108
| | |
| * | dyncom: Fix overflow flag setting for ADD/RSB/RSC/SUB/SBCLioncash2015-01-121-38/+41
| | | | | | | | | | | | Also cleans up CMN, and CMP.
| * | dyncom: Add a helper function for addition with a carryLioncash2015-01-123-12/+26
| | |
* | | Fix building on MinGWdarkf2015-01-121-0/+13
|/ /
* | dyncom: Fix ADC overflow flag settingLioncash2015-01-121-8/+12
| |
* | Merge pull request #456 from Subv/waitsync1bunnei2015-01-121-3/+2
|\ \ | | | | | | SVC: Wake up the thread after the delay in WaitSync1
| * | SVC: Wake up the thread after the delay in WaitSync1Subv2015-01-111-3/+2
| | |
* | | dyncom: Fix conditional execution of MSRLioncash2015-01-121-29/+31
| | |
* | | Merge pull request #466 from Subv/wakebunnei2015-01-111-0/+3
|\ \ \ | |/ / |/| | Thread: Prevent waking a thread multiple times.
| * | Thread: Prevent waking a thread multiple times.Subv2015-01-111-0/+3
| | | | | | | | | | | | If a thread was woken up by something, cancel the wakeup timeout.
* | | Stubbed y2r:u IsBusyConversionarchshift2015-01-111-1/+16
| | | | | | | | | | | | | | | There is no documentation available on this function, but we set the result to false as a stub. This allows Super Little Acorns to move all the way in game with pp3c.
* | | Added Archive ID to fs:USER debug logs involving opening the archive.archshift2015-01-101-3/+3
| | |
* | | Logging: Log all called service functions (under trace). Compile out all trace logs under release for performance.archshift2015-01-109-33/+22
| | |
* | | Kernel: Start using boost::intrusive_ptr for lifetime managementYuri Kunde Schlesner2015-01-0912-90/+95
| | |
* | | Kernel: Don't re-assign object's handle when duplicating oneYuri Kunde Schlesner2015-01-092-2/+3
|/ /
* | Merge pull request #444 from yuriks/handle-reform2bunnei2015-01-0924-374/+329
|\ \ | | | | | | Kernel Lifetime Reform Pt. 2
| * | Thread: Fix nullptr access in a logging functionYuri Kunde Schlesner2015-01-091-1/+2
| | |
| * | Thread: Rename thread_queue => thread_listYuri Kunde Schlesner2015-01-091-6/+6
| | |
| * | Thread: Reduce use of Handles and move some funcs to inside the class.Yuri Kunde Schlesner2015-01-0911-302/+222
| | |
| * | Kernel: Move Thread's definition to the header fileYuri Kunde Schlesner2015-01-093-53/+67
| | |
| * | Move ThreadContext to core/core.h and deal with the falloutYuri Kunde Schlesner2015-01-0917-32/+52
| | |
* | | Merge pull request #436 from kevinhartman/system-corebunnei2015-01-091-0/+5
|\ \ \ | |/ / |/| | Warn if a new thread is intended to be run on the system CPU core
| * | Warn if a new thread is intended to be run on the system CPU core until we implement correct scheduling for such a thread.Kevin Hartman2015-01-071-0/+5
| | |
* | | Merge pull request #255 from Subv/cbranch_3bunnei2015-01-098-5/+234
|\ \ \ | | | | | | | | Implemented timers
| * | | SVC: Implemented the Timer service calls.Subv2015-01-098-5/+234
| | | |
* | | | Core: Fixed a crash and removed some unused variables.Subv2015-01-092-8/+2
| | | | | | | | | | | | | | | | ARM_Disasm only has static methods, so there's no need to have an instance of it.
* | | | DynCom: Add a comment to GetTicks.Subv2015-01-091-0/+1
| | | |
* | | | Timing: Use CoreTiming::GetTicks to keep track of ticks.Subv2015-01-092-6/+2
| | | | | | | | | | | | | | | | This will keep track of idle ticks for us, and fixes some tickcount-related issues
* | | | Merge pull request #443 from Subv/sleep_threadbunnei2015-01-093-8/+43
|\ \ \ \ | | | | | | | | | | SVC: Fixed SleepThread
| * | | | SVC: Fixed SleepThread.Subv2015-01-093-8/+43
| | |_|/ | |/| | | | | | | | | | It will now properly wait the specified number of nanoseconds and then wake up the thread.
* | | | Merge pull request #446 from lioncash/umaalbunnei2015-01-081-4/+4
|\ \ \ \ | |/ / / |/| | | dyncom: Fix UMAAL
| * | | dyncom: Fix UMAALLioncash2015-01-081-4/+4
| | | | | | | | | | | | | | | | These need to be done as a 64-bit operation.
* | | | Threads: Use a dummy idle thread when no other are ready.Subv2015-01-084-2/+47
| | | | | | | | | | | | | | | | This thread will not actually execute instructions, it will only advance the timing/events and try to yield immediately to the next ready thread, if there aren't any ready threads then it will be rescheduled and start its job again.
* | | | Merge pull request #404 from bunnei/more-frame-synch-fixesbunnei2015-01-081-1/+4
|\ \ \ \ | | | | | | | | | | GPU: Toggle active framebuffer each frame
| * | | | GSP: Toggle active framebuffer each framebunnei2015-01-081-1/+4
| | | | |
* | | | | Merge pull request #431 from yuriks/thread-queue-cleanupbunnei2015-01-071-1/+1
|\ \ \ \ \ | |_|/ / / |/| | | | Common: Clean up ThreadQueueList
| * | | | Common: Clean up ThreadQueueListYuri Kunde Schlesner2015-01-071-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Replace all the C-style complicated buffer management with a std::deque. In addition to making the code easier to understand it also adds support for non-POD IdTypes. Also clean the rest of the code to follow our code style.
* | | | | Merge pull request #442 from lioncash/smulbunnei2015-01-071-10/+7
|\ \ \ \ \ | |_|_|/ / |/| | | | dyncom: Fix SMULWB/SMULWT
| * | | | dyncom: Fix SMULWB/SMULWTLioncash2015-01-071-10/+7
| |/ / / | | | | | | | | | | | | Wasn't doing proper sign-extension
* | | | Merge pull request #425 from Subv/coretimingbunnei2015-01-074-418/+378
|\ \ \ \ | | | | | | | | | | Ported the CoreTiming namespace from PPSSPP
| * | | | CoreTiming: Ported the CoreTiming namespace from PPSSPPSubv2015-01-074-418/+378
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Implemented the required calls to make it work. CoreTiming: Added a new logging class Core_Timing.
* | | | | Fix double-free in Service manager during shutdownYuri Kunde Schlesner2015-01-072-25/+4
| |/ / / |/| | | | | | | | | | | Fixes #423.
* | | | Merge pull request #438 from lioncash/swpbunnei2015-01-071-0/+1
|\ \ \ \ | | | | | | | | | | dyncom: Fix SWPB
| * | | | dyncom: Fix SWPBLioncash2015-01-071-0/+1
| | |_|/ | |/| |
* | | | Merge pull request #434 from lioncash/smbunnei2015-01-071-1/+56
|\ \ \ \ | |/ / / |/| | | dyncom: Move over SMLALXY
| * | | dyncom: Move over SMLALXYLioncash2015-01-071-1/+56
| | |/ | |/|
* | | Merge pull request #376 from Subv/arc_reorderbunnei2015-01-0711-34/+73
|\ \ \ | |/ / |/| | Archives: Change the folder layout of some archives.
| * | Archives/Exdata: Don't set concrete_mount_point in the ctorSubv2015-01-061-1/+1
| | |
| * | Archives: Changed the unimplemented archives comment.Subv2015-01-061-1/+1
| | | | | | | | | | | | It now refers to me as the PoC
| * | Archives: Addressed some commentsSubv2015-01-065-15/+15
| | |
| * | SaveDataCheck: Fixed a typoSubv2015-01-051-1/+1
| | |
| * | Archives: Make SYSTEM_ID and SDCARD_ID stringsSubv2015-01-046-9/+11
| | |
| * | Archives: Changed the way paths are built for the archives.Subv2015-01-0410-27/+64
| | | | | | | | | | | | Each archive now takes a mount point of either NAND or SDMC, and builds its own directory structure there, trying to simulate an HLE-friendly hardware layout
| * | SaveDataCheck: Move the files to nand/titleSubv2015-01-041-1/+2
| | | | | | | | | | | | under /nand/title/high/low/content/00000000.app.romfs
| * | Archives: Change the folder layout of some archives.Subv2015-01-033-4/+3
| | | | | | | | | | | | This is to better represent the hardware layout, they are still aren't quite accurate, but this better and will help a bit when implementing the other archives like NAND-RO and NAND-RW
* | | Merge pull request #417 from kevinhartman/exclusive-tag-fixbunnei2015-01-062-16/+18
|\ \ \ | | | | | | | | Added exclusive reservation granule from ARMv7 spec to dyncom...
| * | | Added exclusive reservation granule from ARMv7 spec to dyncom to protect LDR/STREX.Kevin Hartman2015-01-062-16/+18
| | | |
* | | | Merge pull request #413 from purpasmart96/serv_cleanbunnei2015-01-067-33/+36
|\ \ \ \ | | | | | | | | | | Services: Clean up a few things and add a few function names
| * | | | Services: Clean up a few things and add a few function namespurpasmart962015-01-067-33/+36
| | | | |
* | | | | Merge pull request #272 from rohit-n/sign-comparebunnei2015-01-061-4/+4
|\ \ \ \ \ | |_|_|_|/ |/| | | | Silence some -Wsign-compare warnings.
| * | | | Silence some -Wsign-compare warnings.Rohit Nirmal2015-01-011-4/+4
| |/ / /
* | | | Merge pull request #422 from lioncash/bxjbunnei2015-01-051-8/+25
|\ \ \ \ | | | | | | | | | | dyncom: Partially emulate BXJ
| * | | | dyncom: Partially emulate BXJLioncash2015-01-051-8/+25
| | | | | | | | | | | | | | | | | | | | Just in case some game studio let the intern write inline assembly or something.
* | | | | Merge pull request #416 from bunnei/fake-dsp-interruptbunnei2015-01-053-5/+28
|\ \ \ \ \ | |/ / / / |/| | | | DSP: Signal (faked) interrupt on every frame.
| * | | | DSP: Signal (faked) interrupt on every frame.bunnei2015-01-053-5/+28
| | | | | | | | | | | | | | | | | | | | - Hack to work around games checking that the DSP event has been signaled by a real DSP interrupt.
* | | | | dyncom: Actually set the Q flag for SMLABB/SMLABT/SMLATB/SMLATTLioncash2015-01-051-1/+2
| | | | | | | | | | | | | | | | | | | | Easy skyeye todo fix.
* | | | | Merge pull request #418 from lioncash/qdbunnei2015-01-054-25/+117
|\ \ \ \ \ | |/ / / / |/| | | | dyncom: Implement QADD/QSUB/QDADD/QDSUB
| * | | | dyncom: Implement QADD/QSUB/QDADD/QDSUBLioncash2015-01-054-25/+117
| | | | |
* | | | | Merge pull request #407 from Subv/arbiterbunnei2015-01-051-0/+11
|\ \ \ \ \ | | | | | | | | | | | | AddressArbiter: Ported arbitration type 2 from 3dmoo.
| * | | | | AddressArbiter: Ported arbitration type 2 from 3dmoo.Subv2015-01-031-0/+11
| | | | | | | | | | | | | | | | | | | | | | | | (Thanks 3dmoo!)
* | | | | | Merge pull request #415 from Dante38490/masterbunnei2015-01-051-0/+2
|\ \ \ \ \ \ | | | | | | | | | | | | | | Loader: Add support for loading NCCH ROMs with the .3DS extension
| * | | | | | Fix correct espaceDante384902015-01-051-2/+2
| | | | | | |
| * | | | | | Add support load 3DS roomDante384902015-01-051-0/+2
| | | | | | |
* | | | | | | Merge pull request #408 from Subv/mutexbunnei2015-01-051-2/+2
|\ \ \ \ \ \ \ | |/ / / / / / |/| | | | | | Mutex: Add the calling thread to the waiting list when needed
| * | | | | | Mutex: Add the calling thread to the waiting list when neededSubv2015-01-041-2/+2
| | |/ / / / | |/| | | | | | | | | | | | | | | | This will happen when the mutex is already owned by another thread. Should fix some issues with games being stuck due to waiting threads not being awoken.
* | | | | | Merge pull request #386 from archshift/y2rubunnei2015-01-054-0/+72
|\ \ \ \ \ \ | | | | | | | | | | | | | | Stub the y2r:u service
| * | | | | | Stub the y2r:u servicearchshift2015-01-034-0/+72
| | | | | | |
* | | | | | | skyeye: Remove duplicate typedefsLioncash2015-01-044-41/+17
| |/ / / / / |/| | | | | | | | | | | | | | | | | citra already has its own typedefs like this.
* | | | | | FileSys: Fix crash bug in DiskFile exposed by #400Yuri Kunde Schlesner2015-01-031-4/+0
| | | | | |
* | | | | | FileSys: Fix a few memory leaksYuri Kunde Schlesner2015-01-032-6/+7
| | | | | |
* | | | | | Merge pull request #396 from bunnei/default-dyncombunnei2015-01-032-3/+3
|\ \ \ \ \ \ | | | | | | | | | | | | | | Core: Change default CPU to dyncom.
| * | | | | | Core: Change default CPU to dyncom.bunnei2015-01-032-3/+3
| | |_|_|_|/ | |/| | | |
* | | | | | Merge pull request #398 from lioncash/smbunnei2015-01-031-1/+43
|\ \ \ \ \ \ | |_|_|_|_|/ |/| | | | | dyncom: Implement SMLAW
| * | | | | dyncom: Implement SMLAWLioncash2015-01-031-1/+43
| | |_|/ / | |/| | |
* / | | | VFP: Minor cleanup, functionally the same.bunnei2015-01-031-2587/+2476
|/ / / /
* | | | Merge pull request #395 from lioncash/revbunnei2015-01-031-45/+45
|\ \ \ \ | | | | | | | | | | dyncom: Implement REVSH
| * | | | dyncom: Implement REVSHLioncash2015-01-031-45/+45
| |/ / / | | | | | | | | | | | | Also joins the REV ops into one common place.
* / / / dyncom: Implement SMLALD/SMLSLDLioncash2015-01-031-3/+72
|/ / /
* | | Merge pull request #381 from Subv/savedatacheckbunnei2015-01-0314-319/+275
|\ \ \ | | | | | | | | Implemented the SaveDataCheck archive
| * | | IVFCArchive: Use a critical log to notify of invalid operations.Subv2015-01-031-9/+9
| | | |
| * | | SaveDataCheck: Remove unneeded constructor from a classSubv2015-01-031-2/+0
| | | |
| * | | Archives: Added some documentation to IVFCArchiveSubv2015-01-031-0/+5
| | | |
| * | | Archives: Reduced duplicate code in RomFS and SaveCheck.Subv2015-01-0314-341/+238
| | | | | | | | | | | | | | | | Fixed a few warnings and cleaned up the code
| * | | SaveDataCheck: Preliminary work in this archive.Subv2015-01-034-7/+63
| | | | | | | | | | | | | | | | | | | | | | | | This allows Steel Diver to boot further, some files are needed. This is still not ready and needs a big cleanup, this will possibly be delayed until the way we handle archives is fixed (with factory classes instead of ahead-of-time creation of archives)
* | | | Merge pull request #392 from lioncash/smbunnei2015-01-031-3/+64
|\ \ \ \ | |/ / / |/| | | dyncom: Implement SMMLA/SMMUL/SMMLS
| * | | dyncom: Implement SMMLA/SMMUL/SMMLSLioncash2015-01-031-3/+64
| | | |
* | | | Merge pull request #391 from lioncash/pedanticbunnei2015-01-032-4/+4
|\ \ \ \ | | | | | | | | | | archive/elf: Minor misc changes.
| * | | | elf: Make DidRelocate constLioncash2015-01-031-1/+1
| | | | |
| * | | | archive: Fix initializer list orderLioncash2015-01-031-3/+3
| | |/ / | |/| |
* | | | dyncom: Implemented LDREXD/STREXD/LDREXH/STREXHbunnei2015-01-033-227/+282
| |/ / |/| |
* | | Merge pull request #390 from lioncash/wutbunnei2015-01-031-27/+0
|\ \ \ | | | | | | | | dyncom: Remove dead function InterpreterInitInstLength
| * | | dyncom: Remove dead function InterpreterInitInstLengthLioncash2015-01-031-27/+0
| |/ / | | | | | | | | | Technically eliminates two memory leaks as well.
* | | Merge pull request #388 from lioncash/smbunnei2015-01-035-52/+90
|\ \ \ | | | | | | | | dyncom: Implement SMLAD/SMUAD/SMLSD/SMUSD
| * | | armemu: Fix missing Q flag check for SMLSD.Lioncash2015-01-031-2/+6
| | | |
| * | | dyncom: Implement SMLAD/SMUAD/SMLSD/SMUSDLioncash2015-01-035-50/+84
| |/ /
* / / soc_u: Fix a missing formatting argumentLioncash2015-01-031-1/+1
|/ /
* | dyncom: Implement SXTAB16 and SXTB16Lioncash2015-01-021-3/+58
| |
* | Merge pull request #358 from neobrain/pica_progress2bunnei2015-01-022-1/+8
|\ \ | | | | | | pica_progress followups
| * | GPU: Pseudo-implement horizontal scaling.Tony Wasserka2014-12-312-1/+8
| | | | | | | | | | | | | | | It's not really known how this actually works. Some testing has shown that this probably performs no filtering, and common usage in games suggests it's not actually resizing the image at all. However, this patch does seem to fix some homebrew showing quasi-duplicated images while still keeping other applications in a working state.
* | | Merge pull request #379 from lioncash/shbunnei2015-01-021-8/+110
|\ \ \ | | | | | | | | dyncom: Implement SHADD8/SHADD16/SHSUB8/SHSUB16/SHASX/SHSAX
| * | | dyncom: Implement SHADD8/SHADD16/SHSUB8/SHSUB16/SHASX/SHSAXLioncash2015-01-011-8/+110
| | |/ | |/|
* | | Fix SADD8/SSUB8 in the armemuLioncash2015-01-011-50/+28
| | |
* | | dyncom: Implement SADD8/SSUB8Lioncash2015-01-011-55/+108
|/ /
* | SOC_U: Preliminary implementation of sockets.Subv2014-12-314-22/+721
| | | | | | | | | | | | | | | | | | | | | | | | | | Stubbed CreateMemoryBlock Using Berkeley sockets, and Winsock2.2 on Windows. So far ftpony creates the socket and accepts incoming connections SOC_U: Renamed functions to maintain consistency Also prevents possible scope errors / conflicts with the actual Berkeley socket functions SOCU: Close all the opened sockets when cleaning up SOCU
* | Merge pull request #375 from lioncash/uopsbunnei2014-12-311-9/+208
|\ \ | |/ |/| dyncom: Implement UADD8/UADD16/USUB8/USUB16/UASX/USAX
| * dyncom: Implement UADD8/UADD16/USUB8/USUB16/UASX/USAXLioncash2014-12-311-9/+208
| |
* | dyncom: Massive refactorbunnei2014-12-312-654/+221
| |
* | Merge pull request #369 from darkf/mingw_bunnei2014-12-311-0/+8
|\ \ | | | | | | Fix MinGW build (2)
| * \ Fix merge conflictsdarkf2014-12-30167-12294/+13495
| |\ \
| * | | Add comment regarding __WIN32__ in SkyEye codedarkf2014-11-291-0/+4
| | | |
| * | | Fix MinGW builddarkf2014-11-291-0/+4
| | | |
* | | | vfp: Get rid of a few warningsLioncash2014-12-302-2/+2
| |_|/ |/| |
* | | vfp: Implement VMOVBRRSSLioncash2014-12-303-12/+44
| | |
* | | dyncom: Implement USAT16/SSAT16Lioncash2014-12-301-2/+61
| | |
* | | Merge pull request #368 from purpasmart96/dsp_membunnei2014-12-303-2/+12
|\ \ \ | | | | | | | | MemMap: Add support for DSP Read & Writes in the memory map
| * | | MemMap: Add support for DSP Read & Writes in the memory mappurpasmart962014-12-303-2/+12
| | | |
* | | | APT:A: Some style changesSubv2014-12-301-12/+12
| | | |
* | | | Archives: Implemented ExtSaveData and SharedExtSaveDataSubv2014-12-3014-60/+264
| |_|/ |/| | | | | | | | | | | | | | | | | | | | They will be stored in /extsavedata/SDMC and /extsavedata/NAND respectively. Also redirect some APT_A functions to their APT_U equivalents. Implemented the gamecoin.dat file in SharedExtSaveData in the PTM module. Implemented formatting the savegame. Retake a previous savegame if it exists instead of reporting them as not formatted every time a game is loaded.
* | | dyncom: Implement USAT/SSATbunnei2014-12-303-2/+131
|/ /
* | Merge pull request #253 from purpasmart96/mem_mapbunnei2014-12-302-69/+76
|\ \ | | | | | | MemMap: Removed I/O address's and added more stuff
| * | MemMap: Added AXI_WRAM & SHARED_PAGE along with other stuffpurpasmart962014-12-142-69/+76
| | | | | | | | | | | | | | | | | | Got rid of I/O address's since the I/O addresses range's overlap with other address's types such as vram, these I/O addresses need to be done in an different way.
* | | dyncom: Various cleanups to match coding style, no functional changes.bunnei2014-12-305-7087/+5962
| | |
* | | Merge pull request #361 from lioncash/moreqopsbunnei2014-12-294-65/+142
|\ \ \ | | | | | | | | dyncom/armemu: Implement QADD8/QSUB8.
| * | | dyncom: Implement QADD8/QSUB8Lioncash2014-12-291-32/+42
| | | |
| * | | armemu: Implement QADD8/QSUB8Lioncash2014-12-293-33/+100
| | | |
* | | | dyncom: Fix SMLALXY's instruction labelsLioncash2014-12-291-2/+2
| | | | | | | | | | | | | | | | They were erroneously labeled as SMLAL.
* | | | Merge pull request #303 from linkmauve/fs-cleanupTony Wasserka2014-12-299-169/+97
|\ \ \ \ | |/ / / |/| | | FileSys cleanup
| * | | FileSys: Clean up according to the coding style, and remove redundant namespaced names.Emmanuel Gil Peyrot2014-12-249-169/+97
| | | |
* | | | Merge pull request #360 from lioncash/dynuxtbunnei2014-12-291-2/+55
|\ \ \ \ | | | | | | | | | | dyncom: Implement UXTB16/UXTAB16
| * | | | dyncom: Implement UXTB16/UXTAB16Lioncash2014-12-291-2/+55
| | | | |
* | | | | Merge pull request #347 from bunnei/frameskipbunnei2014-12-293-27/+38
|\ \ \ \ \ | |/ / / / |/| | | | Frameskip
| * | | | GPU: Implement frameskip and remove forced framebuffer swap hack.bunnei2014-12-293-27/+38
| | | | |
* | | | | Merge pull request #355 from lioncash/simpbunnei2014-12-291-225/+142
|\ \ \ \ \ | | | | | | | | | | | | armemu: Simplify some instructions.
| * | | | | armemu: Simplify SSAT/SSAT16/SXTB/SXTABLioncash2014-12-281-71/+48
| | | | | |
| * | | | | armemu: Simplify REV/REV16/SXTH/SXTAHLioncash2014-12-281-38/+26
| | | | | |
| * | | | | armemu: Simplify USAT16/UXTB/UXTABLioncash2014-12-281-65/+42
| | | | | |
| * | | | | armemu: Simplify REVSH/UXTH/UXTAHLioncash2014-12-281-48/+23
| | | | | |
* | | | | | Merge pull request #359 from lioncash/vfpbunnei2014-12-295-1664/+1053
|\ \ \ \ \ \ | | | | | | | | | | | | | | vfp: Actually make the code somewhat readable
| * | | | | | vfp: Actually make the code somewhat readableLioncash2014-12-295-1664/+1053
| | | | | | |
* | | | | | | Merge pull request #331 from yuriks/handle-reformbunnei2014-12-2914-208/+249
|\ \ \ \ \ \ \ | |/ / / / / / |/| | | | | | New Handle manager
| * | | | | | Kernel: New handle managerYuri Kunde Schlesner2014-12-2813-168/+209
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This handle manager more closely mirrors the behaviour of the CTR-OS one. In addition object ref-counts and support for DuplicateHandle have been added. Note that support for DuplicateHandle is still experimental, since parts of the kernel still use Handles internally, which will likely cause troubles if two different handles to the same object are used to e.g. wait on a synchronization primitive.
| * | | | | | Kernel: Replace GetStaticHandleType by HANDLE_TYPE constantsYuri Kunde Schlesner2014-12-288-15/+15
| | | | | | |
| * | | | | | Rename ObjectPool to HandleTableYuri Kunde Schlesner2014-12-2812-54/+54
| | | | | | |
* | | | | | | dyncom: Implement PKHBT and PKHTB.bunnei2014-12-281-2/+57
| | | | | | |
* | | | | | | armemu: Fix PKHTB to do an arithmetic shift and correctly decode immediate field.bunnei2014-12-281-13/+5
| | | | | | |
* | | | | | | dyncom: Implement USAD8/USADA8Lioncash2014-12-283-3/+53
| | | | | | |
* | | | | | | Merge pull request #354 from lioncash/usaduflowbunnei2014-12-283-4/+14
|\ \ \ \ \ \ \ | |_|/ / / / / |/| | | | | | armemu: Fix underflows in USAD8/USADA8
| * | | | | | armemu: Fix underflows in USAD8/USADA8Lioncash2014-12-283-4/+14
| |/ / / / / | | | | | | | | | | | | | | | | | | Initially reported by xdec.
* | | | | | dyncom: Implement UQADD8, UQADD16, UQSUB8, UQSUB16, UQASX, and UQSAX.Lioncash2014-12-273-12/+102
| | | | | |
* | | | | | armemu: Implement UQADD8, UQADD16, UQSUB16, UQASX, and UQSAXLioncash2014-12-273-19/+93
|/ / / / /
* | | | | dyncom: Implement UHADD8, UHADD16, UHSUB8, UHSUB16, UHASX, and UHSAXLioncash2014-12-271-11/+123
| | | | |
* | | | | armemu: Implement UHADD8, UHADD16, UHSUB8, UHSUB16, UHASX, and UHSAXLioncash2014-12-271-2/+73
|/ / / /
* | | | Merge pull request #339 from bunnei/fixup-gsp-synchbunnei2014-12-267-117/+59
|\ \ \ \ | | | | | | | | | | Fixup gsp synch
| * | | | GPU: Further improve synchronization.bunnei2014-12-261-22/+20
| | | | |
| * | | | ARM: Add a mechanism for faking CPU time elapsed during HLE.bunnei2014-12-266-95/+39
| | | | | | | | | | | | | | | | | | | | - Also a few cleanups.
* | | | | Merge pull request #330 from purpasmart96/new_srvbunnei2014-12-2661-309/+367
|\ \ \ \ \ | | | | | | | | | | | | More services & small clean ups
| * | | | | More services & small clean upspurpasmart962014-12-2661-309/+367
| | | | | |
* | | | | | Merge pull request #343 from lioncash/smmlabunnei2014-12-261-2/+30
|\ \ \ \ \ \ | | | | | | | | | | | | | | armemu: Implement SMMUL, SMMLA, and SMMLS.
| * | | | | | armemu: Implement SMMUL, SMMLA, and SMMLS.Lioncash2014-12-251-2/+30
| | |_|/ / / | |/| | | |
* | | | | | Merge pull request #341 from lioncash/moresmopsbunnei2014-12-261-2/+33
|\ \ \ \ \ \ | | | | | | | | | | | | | | armemu: Implement SMLALD/SMLSLD
| * | | | | | armemu: Implement SMLALD/SMLSLDLioncash2014-12-241-2/+33
| |/ / / / /
* / / / / / armemu: Fix GE/Q flag setting semanticsLioncash2014-12-241-62/+56
|/ / / / /
* | | | | Merge pull request #328 from archshift/writeablebunnei2014-12-241-1/+18
|\ \ \ \ \ | |_|/ / / |/| | | | Stubbed IsSdmcWriteable to always return writeable.
| * | | | Stubbed IsSdmcWriteable to always return writeable.archshift2014-12-241-1/+18
| | | | |
* | | | | armemu: Set the Q flag correctly for much of the other opsLioncash2014-12-231-8/+8
| | | | | | | | | | | | | | | | | | | | They were setting the old S flag.
* | | | | armemu: Set the Q flag properly for SMLAD/SMUADLioncash2014-12-233-13/+28
| | | | |
* | | | | Merge pull request #334 from lioncash/cpsrbunnei2014-12-231-1/+1
|\ \ \ \ \ | | | | | | | | | | | | armemu: Fix retrieval of the CPSR in MRS instructions.
| * | | | | armemu: Fix retrieval of the CPSR in MRS instructions.Lioncash2014-12-231-1/+1
| | | | | |
* | | | | | Merge pull request #335 from lioncash/cpsrcreatebunnei2014-12-234-25/+78
|\ \ \ \ \ \ | |_|/ / / / |/| | | | | armemu: Emulate the GE and Q flags.
| * | | | | armemu: Properly set the Q flag for SSAT16/USAT16 upon saturation.Lioncash2014-12-231-9/+23
| | | | | |
| * | | | | armemu: Fix SELLioncash2014-12-231-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | Needs to use the updated state of the CPSR.
| * | | | | armemu: Fix construction of the CPSRLioncash2014-12-234-15/+54
| |/ / / /
* / / / / dyncom: Move over QADD16/QASX/QSAX/QSUB16Lioncash2014-12-221-7/+87
|/ / / /
* | | | Merge pull request #322 from chinhodado/masterbunnei2014-12-224-11/+8
|\ \ \ \ | |/ / / |/| | | More warning cleanups
| * | | More warning cleanupsChin2014-12-214-11/+8
| | | |
* | | | Merge pull request #332 from lioncash/selbunnei2014-12-221-1/+58
|\ \ \ \ | | | | | | | | | | dyncom: Move SEL over
| * | | | dyncom: Move SEL overLioncash2014-12-221-1/+58
| | | | |
* | | | | Merge pull request #312 from Subv/still_more_savedata_stuffbunnei2014-12-2214-30/+508
|\ \ \ \ \ | |/ / / / |/| | | | CFG: Implemented the GetConfigInfoBlk2 function.
| * | | | CFG: Fixed some warnings and errors in ClangSubv2014-12-222-4/+4
| | | | |
| * | | | CFG: More style changesSubv2014-12-221-5/+5
| | | | |
| * | | | CFGU: IndentationSubv2014-12-211-4/+3
| | | | |
| * | | | CFG: Some indentationSubv2014-12-211-11/+13
| | | | |
| * | | | CFG: Changed the CreateConfigInfoBlk search loopSubv2014-12-211-7/+4
| | | | |
| * | | | CFG: Corrected the licenses in cfg_i.cpp and cfg_u.cppSubv2014-12-212-2/+2
| | | | |
| * | | | CFG: Create a new subfolder cfg inside service to handle cfgSubv2014-12-2111-489/+617
| | | | | | | | | | | | | | | | | | | | Moved most of the shared CFG code there, implemented a few CFG:I functions
| * | | | CFGU: Some changesSubv2014-12-211-12/+33
| | | | |
| * | | | CFGU: Addressed some issues.Subv2014-12-211-43/+55
| | | | |
| * | | | CFGU: Addressed some comments.Subv2014-12-211-11/+13
| | | | |
| * | | | Style: Addressed some commentsSubv2014-12-212-6/+12
| | | | |
| * | | | CFG_U: Use Common::make_unique instead of the std versionSubv2014-12-211-1/+2
| | | | |
| * | | | CFG:U: Implemented some more blocksSubv2014-12-211-4/+30
| | | | |
| * | | | CFG: Implemented block 0x00070001 in the config savefileSubv2014-12-211-0/+5
| | | | |
| * | | | CFGU: Use an absolute offset in the config savefile blocksSubv2014-12-211-1/+3
| | | | |
| * | | | CFG: Load the Config savedata file if it already exists.Subv2014-12-211-3/+4
| | | | |
| * | | | CFGU: Added block 0x000A0002 to the default savegame fileSubv2014-12-211-0/+18
| | | | | | | | | | | | | | | | | | | | That's the language id block, we're using LANGUAGE_EN for now. This block allows some games to boot further
| * | | | CFG: Refactored how the config file works.Subv2014-12-212-56/+127
| | | | | | | | | | | | | | | | | | | | It is now kept in memory as per 3dbrew, all updates happen on memory, then they can be saved using UpdateConfigNANDSavegame.
| * | | | CFG:U: Add some data to the 0x00050005 config block.Subv2014-12-211-6/+11
| | | | | | | | | | | | | | | | | | | | Seems to allow some games to boot further, thanks @Normmatt for sharing this information
| * | | | CFG: Implemented the GetConfigInfoBlk2 function.Subv2014-12-215-15/+197
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Added a "config" file to the CFG process service (CFG:U), and added a few default blocks to it. Implemented GetSystemModel and GetModelNintendo2DS
* | | | | Merge pull request #324 from lioncash/dyncbunnei2014-12-221-7/+102
|\ \ \ \ \ | |/ / / / |/| | | | dyncom: Move over SASX/SSAX/SADD16/SSUB16
| * | | | dyncom: Move over SASX/SSAX/SADD16/SSUB16Lioncash2014-12-221-7/+102
| | | | |
* | | | | Merge pull request #291 from purpasmart96/licensebunnei2014-12-21130-137/+137
|\ \ \ \ \ | | | | | | | | | | | | License change
| * | | | | License changepurpasmart962014-12-21130-137/+137
| | | | | |
* | | | | | Merge pull request #271 from archshift/createfbunnei2014-12-218-1/+91
|\ \ \ \ \ \ | |_|/ / / / |/| | | | | Added CreateFile to the FS_USER service
| * | | | | Added CreateFile to the FS_USER servicearchshift2014-12-218-1/+91
| | | | | | | | | | | | | | | | | | | | | | | | Tested with hwtests.
* | | | | | Merge pull request #323 from lioncash/saddsubbunnei2014-12-211-14/+87
|\ \ \ \ \ \ | | | | | | | | | | | | | | armemu: Implement SADD8/SSUB8
| * | | | | | armemu: Implement SADD8/SSUB8Lioncash2014-12-211-14/+87
| | | | | | |
* | | | | | | Thread: Wait current thread on svc_SleepThreadbunnei2014-12-213-22/+35
| |_|_|/ / / |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | - Removed unused VBLANK sleep mode - Added error log for bad context switch - Renamed VerifyWait to CheckWaitType to be more clear
* | | | | | Merge pull request #316 from yuriks/thread-handlebunnei2014-12-203-2/+16
|\ \ \ \ \ \ | |/ / / / / |/| | | | | Kernel: Implement support for current thread pseudo-handle
| * | | | | Kernel: Implement support for current thread pseudo-handleYuri Kunde Schlesner2014-12-203-2/+16
| | | | | | | | | | | | | | | | | | | | | | | | This boots a few (mostly Nintendo 1st party) games further.
* | | | | | Merge pull request #296 from lioncash/dynbunnei2014-12-201-1/+47
|\ \ \ \ \ \ | | | | | | | | | | | | | | dyncom: Implement UMAAL
| * | | | | | dyncom: Implement UMAALLioncash2014-12-191-1/+47
| | | | | | |
* | | | | | | Merge pull request #310 from lioncash/ssat16bunnei2014-12-201-14/+20
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | armemu: Fix SSAT16.
| * | | | | | | armemu: Fix SSAT16Lioncash2014-12-191-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The lower-bound would never be negative like it should
| * | | | | | | armemu: Clean up naming and formatting for SSAT16Lioncash2014-12-191-14/+20
| | |_|_|/ / / | |/| | | | |
* | | | | | | armemu: Should be using labs for USAD8/USADA8Lioncash2014-12-201-4/+4
| | | | | | |
* | | | | | | Merge pull request #311 from lioncash/usadabunnei2014-12-201-1/+24
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | armemu: Implement USAD8 and USADA8
| * | | | | | | armemu: Implement USAD8 and USADA8Lioncash2014-12-191-1/+24
| | | | | | | |
* | | | | | | | Merge pull request #313 from lioncash/smlsdbunnei2014-12-201-6/+10
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | armemu: Implement SMLSD
| * | | | | | | | armemu: Implement SMLSDLioncash2014-12-191-6/+10
| | |_|/ / / / / | |/| | | | | |
* | | | | | | | Merge pull request #314 from lioncash/qsax-qasxbunnei2014-12-201-7/+20
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | armemu: Implement QASX and QSAX
| * | | | | | | | armemu: Implement QASX and QSAXLioncash2014-12-191-7/+20
| |/ / / / / / /
* | | | | | | | Merge pull request #315 from chinhodado/masterbunnei2014-12-204-9/+16
|\ \ \ \ \ \ \ \ | |_|_|_|_|/ / / |/| | | | | | | Clean up some warnings
| * | | | | | | Clean up some warningsChin2014-12-204-9/+16
| | | | | | | |
* | | | | | | | Common: Add a clone of std::make_uniqueYuri Kunde Schlesner2014-12-203-10/+14
| | | | | | | |
* | | | | | | | Merge pull request #306 from Subv/even_more_savedatabunnei2014-12-201-2/+31
|\ \ \ \ \ \ \ \ | |/ / / / / / / |/| | | | | | | SaveData: Added some documentation to FormatSaveData
| * | | | | | | FS_U: Added the command to the docs of SaveData functionsSubv2014-12-201-0/+2
| | | | | | | |
| * | | | | | | SaveData: Added some documentation to FormatSaveDataSubv2014-12-181-2/+29
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | We still don't know what the other parameters do, but they appear to be very similar to those of FormatThisUserSaveData. Most likely FormatThisUserSaveData is just an alias for FormatSaveData with LowPathType Empty
* | | | | | | | Merge pull request #294 from lioncash/varbunnei2014-12-191-12/+9
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | armemu: Narrow the scope of some variables in handle_v6_insn
| * | | | | | | | armemu: Narrow the scope of some variables in handle_v6_insnLioncash2014-12-171-12/+9
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | There's no reason to have these in the outer-most scope.
* | | | | | | | | Merge pull request #305 from lioncash/parenbunnei2014-12-191-4/+4
|\ \ \ \ \ \ \ \ \ | |_|_|/ / / / / / |/| | | | | | | | armemu: Get rid of bitwise parenthesis warnings
| * | | | | | | | armemu: Get rid of bitwise parenthesis warningsLioncash2014-12-181-4/+4
| | |_|/ / / / / | |/| | | | | |
* | | | | | | | Merge pull request #302 from purpasmart96/flushshutupbunnei2014-12-191-1/+25
|\ \ \ \ \ \ \ \ | |_|_|_|/ / / / |/| | | | | | | GSP_GPU: Shut up FlushDataCache
| * | | | | | | GSP_GPU: Shut up FlushDataCachepurpasmart962014-12-191-1/+25
| | | | | | | |
* | | | | | | | Merge pull request #308 from Subv/more_savedatabunnei2014-12-191-1/+1
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | SystemSaveData: Fixed a typo that was segfaulting
| * | | | | | | | SystemSaveData: Fixed a typo that was segfaultingSubv2014-12-191-1/+1
| | | | | | | | |
* | | | | | | | | Merge pull request #304 from lioncash/sflagsbunnei2014-12-181-4/+29
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | armemu: Set GE flags properly for SSUB16, SADD16, SSAX, and SASX.
| * | | | | | | | | armemu: Set GE flags correctly for SSUB16, SADD16, SSAX, and SASX.Lioncash2014-12-181-4/+29
| | |_|/ / / / / / | |/| | | | | | |
* | | | | | | | | Merge pull request #307 from lioncash/usat16bunnei2014-12-181-11/+20
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | armemu: Fix USAT16.
| * | | | | | | | | armemu: Fix lower-bounds clamping for USAT16Lioncash2014-12-181-1/+6
| | | | | | | | | |
| * | | | | | | | | armemu: More concise names for USAT16-related variablesLioncash2014-12-181-11/+15
| |/ / / / / / / /
* | | | | | | | | Merge pull request #301 from Subv/more_savedatabunnei2014-12-185-2/+78
|\ \ \ \ \ \ \ \ \ | |/ / / / / / / / |/| / / / / / / / | |/ / / / / / / SaveData: Implemented the SystemSaveData archive.
| * | | | | | | SystemSaveData: Added a TODO to move it to the NAND.Subv2014-12-181-1/+3
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Maybe sometime when we actually implement that
| * | | | | | | SaveData: Implemented the SystemSaveData archive.Subv2014-12-185-2/+76
| | |_|/ / / / | |/| | | | | | | | | | | | | | | | | | | It will be stored in the /syssavedata folder. This archive is user by various Services and possibly games via the FS:U service.
* | | | | | | Merge pull request #299 from lioncash/joinbunnei2014-12-181-34/+23
|\ \ \ \ \ \ \ | |_|/ / / / / |/| | | | | | Combine SSUB16, SADD16, SASX, and SSAX.
| * | | | | | armemu: Combine SSUB16, SADD16, SASX, and SSAX.Lioncash2014-12-181-34/+23
| | | | | | |
* | | | | | | Merge pull request #298 from lioncash/flagsbunnei2014-12-181-4/+22
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | armemu: Unset GE flags for UADD8 if results are < 0x100
| * | | | | | | armemu: Unset GE flags for UADD8 if results are < 0x100Lioncash2014-12-171-4/+22
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Reference manual states these must be set to zero if this case is true.
* | | | | | | | Merge pull request #295 from lioncash/umaalbunnei2014-12-181-3/+25
|\ \ \ \ \ \ \ \ | |_|/ / / / / / |/| | | | | | | armemu: Implement UMAAL
| * | | | | | | armemu: Implement UMAALLioncash2014-12-171-3/+25
| | |_|/ / / / | |/| | | | |
* | | | | | | Merge pull request #292 from lioncash/backportsbunnei2014-12-181-19/+30
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | Backport more skyeye fixes from 3dmoo
| * | | | | | | armemu: Fix PKHTBNormmatt2014-12-171-6/+12
| | | | | | | |
| * | | | | | | armemu: Implement REVSHNormmatt2014-12-171-5/+9
| | | | | | | |
| * | | | | | | armemu: Fix UXTAB/UXTAHNormmatt2014-12-171-4/+4
| | | | | | | |
| * | | | | | | armemu: Fix SXTABNormmatt2014-12-171-2/+2
| | | | | | | |
| * | | | | | | armemu: Fix SXTAHNormmatt2014-12-171-2/+3
| |/ / / / / /
* | | | | | | Merge pull request #297 from lioncash/ssub16bunnei2014-12-181-8/+8
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | armemu: Fix SSUB16
| * | | | | | | armemu: Fix SSUB16Lioncash2014-12-171-8/+8
| | |/ / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Broken from the same reason SADD16 was. The lo part of the result should only be constructed from the lo halfwords of rm and rn. The hi part of the result should only be constructed from the hi halfwords of rm and rn.
* | | | | | | Merge pull request #185 from purpasmart96/mem_permbunnei2014-12-182-5/+13
|\ \ \ \ \ \ \ | |_|_|/ / / / |/| | | | | | Kernel: Add missing permissions
| * | | | | | Kernel:Add missing permissions in shared memory & svcpurpasmart962014-11-192-5/+13
| | | | | | |
* | | | | | | Filesystem/Archives: Implemented the SaveData archiveSubv2014-12-1822-490/+454
| |/ / / / / |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The savedata for each game is stored in /savedata/<ProgramID> for NCCH files. ELF files and 3DSX files use the folder 0 because they have no ID information Got rid of the code duplication in File and Directory Files that deal with the host machine's file system now live in DiskFile, similarly for directories and DiskDirectory and archives with DiskArchive. FS_U: Use the correct error code when a file wasn't found
* | | | | | Merge pull request #293 from lioncash/sopsbunnei2014-12-171-8/+9
|\ \ \ \ \ \ | | | | | | | | | | | | | | armemu: Fix SADD16
| * | | | | | armemu: Fix SADD16Lioncash2014-12-171-8/+9
| | |/ / / / | |/| | | | | | | | | | | | | | | | The lo and hi parts of the result were being constructed as a result of hi and lo halfword intermixing from the rm and rn regs. However the lo part of the result should be constructed only from the lo halfwords of rm and rn, and the hi part of the result should only be constructed from the hi halfwords of rm and rn.
* | | | | | Merge pull request #287 from lioncash/qaddsub16bunnei2014-12-171-33/+37
|\ \ \ \ \ \ | |/ / / / / |/| | | | | armemu: Join QADD16/QSUB16 and fix saturation clamping.
| * | | | | armemu: Fix lower-bound signed saturation clamping for QADD16/QSUB16.Lioncash2014-12-161-2/+2
| | | | | |
| * | | | | armemu: Join QADD16 and QSUB16 together.Lioncash2014-12-161-33/+37
| | | | | | | | | | | | | | | | | | | | | | | | The only difference between these ops is one adds and one subtracts. Everything is literally the same.
* | | | | | Merge pull request #289 from lioncash/smopsbunnei2014-12-171-38/+35
|\ \ \ \ \ \ | | | | | | | | | | | | | | Join SMUAD, SMUSD, and SMLAD ops. Also fix them as well.
| * | | | | | armemu: Fix SMUAD, SMUSD, and SMLADLioncash2014-12-161-3/+3
| | | | | | | | | | | | | | | | | | | | | | | | | | | | Wrong values were being multiplied together.
| * | | | | | armemu: Join SMUAD, SMUSD, and SMLADLioncash2014-12-161-38/+35
| |/ / / / /
* | | | | | Merge pull request #290 from lioncash/vsubbunnei2014-12-171-2/+5
|\ \ \ \ \ \ | |_|_|/ / / |/| | | | | armemu: Backport some VFP fixes from 3dmoo.
| * | | | | armemu: Fix FTOUI NaN sign.Normmatt2014-12-161-1/+1
| | | | | |
| * | | | | armemu: Fix FSUBS bug where NaN shouldn't be negatedNormmatt2014-12-161-1/+4
| |/ / / /
* | | | | Merge pull request #286 from yuriks/msvc-fixbunnei2014-12-162-6/+8
|\ \ \ \ \ | | | | | | | | | | | | Comment out empty arrays causing compile errors in MSVC
| * | | | | Comment out empty arrays causing compile errors in MSVCYuri Kunde Schlesner2014-12-162-6/+8
| | | | | |
* | | | | | Merge pull request #285 from lioncash/uxtab16bunnei2014-12-161-10/+25
|\ \ \ \ \ \ | |/ / / / / |/| | | | | armemu: Implement UXTAB16
| * | | | | armemu: Implement UXTAB16Lioncash2014-12-161-10/+25
| |/ / / /
* | | | | Merge pull request #283 from yuriks/archive-refactorbunnei2014-12-1623-506/+320
|\ \ \ \ \ | | | | | | | | | | | | Archive refactor
| * | | | | Work around libstdc++'s lack of support for std::hash on enumsYuri Kunde Schlesner2014-12-161-0/+15
| | | | | |
| * | | | | FS.Archive: Clean up treatment of archives and their handlesYuri Kunde Schlesner2014-12-1611-387/+197
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | - Refactor FS::Archive internals to make Archive creation and lifetime management clearer. - Remove the "Archive as a File" hack. - Implement 64-bit Archive handles.
| * | | | | Service.FS: Rename FileSys::File to FileBackendYuri Kunde Schlesner2014-12-1610-17/+17
| | | | | |
| * | | | | Service.FS: Rename FileSys::Directory to DirectoryBackendYuri Kunde Schlesner2014-12-1610-18/+18
| | | | | |
| * | | | | Service.FS: Rename FileSys::Archive to ArchiveBackendYuri Kunde Schlesner2014-12-166-12/+12
| | | | | |
| * | | | | Service.FS: Do archive registration using IdCode instead of nameYuri Kunde Schlesner2014-12-167-42/+32
| | | | | |
| * | | | | HLE: Rename namespaces to match move & fix initialization orderYuri Kunde Schlesner2014-12-169-43/+43
| | | | | |
| * | | | | HLE: Move kernel/archive.* to service/fs/Yuri Kunde Schlesner2014-12-169-12/+11
| | | | | |
* | | | | | Merge pull request #282 from archshift/servicesbunnei2014-12-1610-0/+229
|\ \ \ \ \ \ | |_|/ / / / |/| | | | | Added stubs for ldr:ro, cecd:u, nim:aoc, and am:app services
| * | | | | Added stub for nim:aoc service...archshift2014-12-164-0/+62
| | | | | |
| * | | | | Added stub for cecd:u service...archshift2014-12-164-0/+54
| | | | | | | | | | | | | | | | | | | | | | | | I couldn't find any information about this service...
| * | | | | Added stub for ldr:ro service...archshift2014-12-164-0/+59
| | | | | |
| * | | | | Added am:app service stub.archshift2014-12-164-0/+54
| | | | | | | | | | | | | | | | | | | | | | | | Apparently nothing at all is known about this service...
* | | | | | Merge pull request #281 from lioncash/uxtb16bunnei2014-12-161-12/+12
|\ \ \ \ \ \ | |_|/ / / / |/| | | | | armemu: Fix UXTB16
| * | | | | armemu: Fix UXTB16Lioncash2014-12-151-12/+12
| |/ / / / | | | | | | | | | | | | | | | Rotation bits are 10 and 11, not 9 and 10.
* / / / / Remove SyncRequest from K::Object and create a new K::Session typeYuri Kunde Schlesner2014-12-1515-104/+129
|/ / / / | | | | | | | | | | | | | | | | | | | | | | | | This is a first step at fixing the conceptual insanity that is our handling of service and IPC calls. For now, interfaces still directly derived from Session because we don't have the infrastructure to do it properly. (That is, Processes and scheduling them.)
* | | | Merge pull request #276 from lioncash/decrappifybunnei2014-12-151-306/+169
|\ \ \ \ | | | | | | | | | | Clean up armdefs.h a little.
| * | | | Clean up armdefs.hLioncash2014-12-141-306/+169
| | |/ / | |/| |
* | | | Merge pull request #246 from Subv/cbranch_1bunnei2014-12-155-2/+160
|\ \ \ \ | | | | | | | | | | SVC: Implemented Semaphores
| * | | | Kernel/Semaphores: Fixed buildSubv2014-12-131-2/+2
| | | | |
| * | | | Kernel/Semaphore: Small style changeSubv2014-12-131-1/+1
| | | | |
| * | | | Kernel/Semaphores: Invert the available count checking.Subv2014-12-131-11/+9
| | | | | | | | | | | | | | | | | | | | Same semantics, idea by @yuriks
| * | | | Kernel/Semaphores: Addressed some issues.Subv2014-12-132-32/+18
| | | | |
| * | | | Semaphore: Removed an unneeded functionSubv2014-12-131-5/+0
| | | | |
| * | | | Semaphores: Addressed some style issuesSubv2014-12-131-6/+5
| | | | |
| * | | | Semaphore: Implemented the initial_count parameter.Subv2014-12-132-5/+7
| | | | |
| * | | | SVC: Implemented ReleaseSemaphore.Subv2014-12-134-19/+81
| | | | | | | | | | | | | | | | | | | | This behavior was tested on hardware, however i'm still not sure what use the "initial_count" parameter has
| * | | | SVC: Implemented svcCreateSemaphoreSubv2014-12-135-1/+117
| |/ / / | | | | | | | | | | | | | | | | ToDo: Implement svcReleaseSemaphore * Some testing against hardware needed
* | | | Merge pull request #273 from bunnei/more-skyeye-fixesbunnei2014-12-153-419/+485
|\ \ \ \ | |/ / / |/| | | ARM: Pull some SkyEye fixes from 3dmoo.
| * | | ARM: Pull some SkyEye fixes from 3dmoo.bunnei2014-12-153-419/+485
| | | |
* | | | kernel: Remove unused log argumentsLioncash2014-12-131-3/+3
|/ / /
* | | Add configurable per-class log filteringYuri Kunde Schlesner2014-12-131-1/+3
| | |
* | | Convert old logging calls to new logging macrosYuri Kunde Schlesner2014-12-1340-385/+336
| | |
* | | New logging systemYuri Kunde Schlesner2014-12-131-0/+1
| | |
* | | Merge pull request #267 from bunnei/apt-shared-fontbunnei2014-12-135-66/+132
|\ \ \ | | | | | | | | APT shared font loading
| * | | APT_U: Added GetSharedFont service function.bunnei2014-12-131-34/+100
| | | |
| * | | MemMap: Renamed "GSP" heap to "linear", as this is not specific to GSP.bunnei2014-12-124-32/+32
| | | | | | | | | | | | | | | | - Linear simply indicates that the mapped physical address is always MappedVAddr+0x0C000000, thus this memory can be used for hardware devices' DMA (such as the GPU).
* | | | DSP: Added stub for ReadPipeIfPossible.bunnei2014-12-121-1/+45
|/ / /
* | | Merge pull request #256 from Subv/mutexbunnei2014-12-113-37/+67
|\ \ \ | | | | | | | | Kernel/Mutex: Properly lock the mutex when a thread enters it
| * | | Mutex: Remove some forward declarationsSubv2014-12-071-16/+15
| | | | | | | | | | | | | | | | Moved Mutex::WaitSynchronization to the end of the file.
| * | | Mutex: Release all held mutexes when a thread exits.Subv2014-12-073-22/+56
| | | |
| * | | Mutex: Properly lock the mutex when a thread enters itSubv2014-12-061-12/+9
| | | | | | | | | | | | | | | | Also resume only the next immediate thread waiting for the mutex when it is released, instead of resuming them all.
* | | | CFG:U: Store country codes as u16 instead of char pointers, and return the correct error in GetCountryCodeID.Emmanuel Gil Peyrot2014-12-101-44/+48
| | | |
* | | | GSP: Trigger GPU interrupts at more accurate locations.bunnei2014-12-101-7/+6
| | | |
* | | | GSP: Updated TriggerCmdReqQueue to return success code.bunnei2014-12-101-0/+3
| | | |
* | | | GSP: Updated RegisterInterruptRelayQueue to return expected magic number.bunnei2014-12-101-1/+4
| | | |
* | | | GPU: Fixed bug in command list size decoding.bunnei2014-12-103-4/+3
| | | |
* | | | Remove unused NDMA moduleYuri Kunde Schlesner2014-12-094-88/+0
| | | |
* | | | Merge pull request #217 from archshift/cmd_buffbunnei2014-12-091-12/+12
|\ \ \ \ | | | | | | | | | | Log the cmd_buff arguments when citra comes across an unimplemented function
| * | | | Log the cmd_buff arguments when citra comes across an unimplemented functionarchshift2014-11-251-12/+12
| | | | |
* | | | | Thread: Fixed to wait on address when in arbitration.bunnei2014-12-093-11/+31
| | | | |
* | | | | Merge pull request #244 from bunnei/cleanup-memmapbunnei2014-12-092-31/+21
|\ \ \ \ \ | | | | | | | | | | | | MemMap: Updated memory map to subtract base address instead of mask.
| * | | | | MemMap: Updated memory map to subtract base address instead of mask.bunnei2014-12-032-31/+21
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | - More readable, a little less error prone. Conflicts: src/core/mem_map.h src/core/mem_map_funcs.cpp
* | | | | | Merge pull request #263 from lioncash/sasxbunnei2014-12-091-4/+4
|\ \ \ \ \ \ | | | | | | | | | | | | | | Fix emulation of SASX and SSAX instructions.
| * | | | | | armemu: Fix SSAXLioncash2014-12-081-1/+1
| | | | | | |
| * | | | | | armemu: Fix SASXLioncash2014-12-081-1/+1
| | | | | | |
| * | | | | | armemu: Fix parenthesis warnings regarding bitwise opsLioncash2014-12-081-4/+4
| | | | | | |
* | | | | | | Merge pull request #259 from ichfly/masterbunnei2014-12-095-0/+278
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | Loader: Add 3DSX support
| * | | | | | | Loader: Add 3DSX supportichfly2014-12-085-0/+278
| |/ / / / / /
* | | | | | | Merge pull request #264 from Subv/filesbunnei2014-12-091-3/+6
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | Kernel/File: Fixed file read/write hwtests
| * | | | | | | Kernel/File: Fixed file read/write hwtestsSubv2014-12-081-3/+6
| |/ / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The 3DS allows the user to read from files opened with the Write access modifier, even if he did not specify the Read access modifier. Open the files in binary mode so that we can prevent CR/LF problems in Windows, where a line-end is replaced by these two bytes instead of just 0xA, this was causing problems with the GetSize test
* | | | | | | Merge pull request #260 from archshift/opendirbunnei2014-12-097-3/+40
|\ \ \ \ \ \ \ | |/ / / / / / |/| | | | | | Make OpenDirectory fail if the directory doesn't exist
| * | | | | | Make OpenDirectory fail if the directory doesn't existarchshift2014-12-077-3/+40
| | |_|/ / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This is in line with what the hardware itself does. It does this by splitting the initial directory opening into Directory.Open(), which will return false if a stat fails. Then, Archive::OpenDirectory will return nullptr, and archive.cpp will return an error code .
* | | | | | Merge pull request #245 from rohit-n/null-nullptrbunnei2014-12-071-6/+6
|\ \ \ \ \ \ | |/ / / / / |/| | | | | Change NULLs to nullptrs.
| * | | | | Change NULLs to nullptrs.Rohit Nirmal2014-12-031-6/+6
| | | | | |
* | | | | | Merge pull request #250 from Subv/cbranch_2bunnei2014-12-053-4/+31
|\ \ \ \ \ \ | | | | | | | | | | | | | | SVC: Implemented GetThreadId.
| * | | | | | Threads: Remove a redundant function.Subv2014-12-041-9/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | Use the next_thread_id variable directly.
| * | | | | | Threads: Implemented a sequential thread idSubv2014-12-042-4/+19
| | | | | | |
| * | | | | | SVC: Implemented GetThreadId.Subv2014-12-043-4/+24
| |/ / / / / | | | | | | | | | | | | | | | | | | For now threads are using their Handle value as their Id, it should not really cause any problems because Handle values are unique in Citra, but it should be changed. I left a ToDo there because this is not correct behavior as per hardware.
* | | | | | Merge pull request #222 from archshift/renamexyzbunnei2014-12-058-38/+229
|\ \ \ \ \ \ | | | | | | | | | | | | | | Implemented RenameFile and RenameDirectory in FS:USER
| * | | | | | Updated archive.cpp functions for proper error handlingarchshift2014-12-045-94/+41
| | | | | | |
| * | | | | | Implemented RenameDirectory in FS:USERarchshift2014-11-258-1/+123
| | | | | | |
| * | | | | | Implemented RenameFile in FS:USERarchshift2014-11-258-1/+123
| | |_|/ / / | |/| | | |
* | | | | | Merge pull request #248 from lioncash/kernelbunnei2014-12-052-10/+7
|\ \ \ \ \ \ | | | | | | | | | | | | | | Misc minor kernel-related changes.
| * | | | | | kernel: Shorten GetCountLioncash2014-12-041-6/+3
| | | | | | |
| * | | | | | kernel: Make some functions constLioncash2014-12-042-4/+4
| | |_|/ / / | |/| | | |
* | | | | | Merge pull request #249 from lioncash/enumbunnei2014-12-041-1/+1
|\ \ \ \ \ \ | | | | | | | | | | | | | | mem_map: Make enum for addresses use u32 as the underlying type
| * | | | | | mem_map: Make enum for addresses use u32 as the underlying typeLioncash2014-12-041-1/+1
| |/ / / / /
* | | | | | Merge pull request #247 from lioncash/constbunnei2014-12-042-4/+4
|\ \ \ \ \ \ | | | | | | | | | | | | | | hid_user: Pass by reference with PadButtonPress/PadButtonRelease
| * | | | | | hid_user: Pass by reference with PadButtonPress/PadButtonReleaseLioncash2014-12-042-4/+4
| | |_|/ / / | |/| | | |
* | | | | | Merge pull request #238 from archshift/dspbunnei2014-12-042-26/+47
|\ \ \ \ \ \ | | | | | | | | | | | | | | Add stub for ConvertProcessFromDspDram
| * | | | | | Add stub for ConvertProcessFromDspDramarchshift2014-12-042-26/+47
| | |/ / / / | |/| | | | | | | | | | | | | | | | Should theoretically push retail stuff further along
* | | | | | PTM_U: Added a stub for GetBatteryLevel & GetBatteryChargeState & GetAdapterStatepurpasmart962014-12-041-3/+72
| |/ / / / |/| | | |
* | | | | Merge pull request #231 from purpasmart96/serv_ac_wifi_statusbunnei2014-12-031-1/+19
|\ \ \ \ \ | | | | | | | | | | | | AC_U: Added a stub for GetWifiStatus
| * | | | | AC_U: Added a stub for GetWifiStatuspurpasmart962014-12-031-1/+19
| | |_|_|/ | |/| | |
* | | | | Merge pull request #219 from Subv/ptmbunnei2014-12-031-1/+18
|\ \ \ \ \ | |_|/ / / |/| | | | PTM_U: Implemented the GetShellState function.
| * | | | PTM_U: Implemented the GetShellState function.Subv2014-12-011-1/+18
| | | | |
* | | | | Merge pull request #224 from bunnei/dsp-service-improvementsbunnei2014-12-012-26/+107
|\ \ \ \ \ | | | | | | | | | | | | Dsp service improvements
| * | | | | DSP: Added stubs for several commonly used DSP service functions.bunnei2014-12-011-25/+106
| | | | | |
| * | | | | DSP: Fixed typo in port name.bunnei2014-12-011-1/+1
| | |_|/ / | |/| | |
* | | | | Merge pull request #214 from Subv/masterbunnei2014-12-011-2/+86
|\ \ \ \ \ | | | | | | | | | | | | CFG:U: Implemented the GetCountryCodeID and GetCountryCodeString
| * | | | | CFG:U: Implemented the GetCountryCodeID and GetCountryCodeString.Subv2014-11-301-2/+86
| | | | | |
* | | | | | Merge pull request #225 from bunnei/fix-release-mutexbunnei2014-11-301-8/+7
|\ \ \ \ \ \ | | | | | | | | | | | | | | Mutex: Changed behavior to always release mutex for all threads.
| * | | | | | Mutex: Changed behavior to always release mutex for all threads.bunnei2014-11-261-8/+7
| | |/ / / / | |/| | | |
* | | | | | Merge pull request #226 from bunnei/svc-and-thread-fixesbunnei2014-11-302-1/+6
|\ \ \ \ \ \ | | | | | | | | | | | | | | Svc and thread fixes
| * | | | | | Thread: Check that thread is actually in "wait state" when verifying wait.bunnei2014-11-261-1/+1
| | | | | | |
| * | | | | | SVC: Add debug log to ArbitrateAddress.bunnei2014-11-261-0/+2
| | | | | | |
| * | | | | | SVC: SleepThread should yield to the next ready thread.bunnei2014-11-261-0/+3
| |/ / / / /
* | | | | | Merge pull request #235 from yuriks/dyncom-mapbunnei2014-11-301-33/+15
|\ \ \ \ \ \ | | | | | | | | | | | | | | dyncom: Use unordered_map rather than the terrible 2-level bb_map
| * | | | | | dyncom: Use unordered_map rather than the terrible 2-level bb_mapYuri Kunde Schlesner2014-11-291-33/+15
| | |/ / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | Seems (probably just placebo/wishful thinking) to make it slightly faster. Also reduces memory usage and makes shutdown when debugging from MSVC fast.
* / | | | | arm_dyncom_interpreter: Get rid of unused var warningsLioncash2014-11-291-4/+2
|/ / / / /
* | | / / Fixed formatting and switch statement warningsvaguilar2014-11-277-11/+13
| |_|/ / |/| | |
* | | | Remove unused includes to common/thread.hEmmanuel Gil Peyrot2014-11-251-2/+0
|/ / /
* | | Use pointers instead of passing handles around in some functions.Yuri Kunde Schlesner2014-11-241-19/+15
| | |
* | | Remove duplicated docs/update them for changed parameters.Yuri Kunde Schlesner2014-11-2410-88/+0
| | |
* | | HLE: Revamp error handling throrough the HLE codeYuri Kunde Schlesner2014-11-2423-310/+689
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | All service calls in the CTR OS return result codes indicating the success or failure of the call. Previous to this commit, Citra's HLE emulation of services and the kernel universally either ignored errors or returned dummy -1 error codes. This commit makes an initial effort to provide an infrastructure for error reporting and propagation which can be use going forward to make HLE calls accurately return errors as the original system. A few parts of the code have been updated to use the new system where applicable. One part of this effort is the definition of the `ResultCode` type, which provides facilities for constructing and parsing error codes in the structured format used by the CTR. The `ResultVal` type builds on `ResultCode` by providing a container for values returned by function that can report errors. It enforces that correct error checking will be done on function returns by preventing the use of the return value if the function returned an error code. Currently this change is mostly internal since errors are still suppressed on the ARM<->HLE border, as a temporary compatibility hack. As functionality is implemented and tested this hack can be eventually removed.
* | | Change some SkyEye defines to const intsYuri Kunde Schlesner2014-11-242-34/+16
| | | | | | | | | | | | | | | This prevents them from interfering with other constants defined in different namespaces.
* | | Merge pull request #191 from archshift/deletexyzbunnei2014-11-248-26/+194
|\ \ \ | |/ / |/| | Added DeleteFile and DeleteDirectory functions to FS:USER and the archives.
| * | Added DeleteFile and DeleteDirectory functions to FS:USER and the archives.archshift2014-11-238-26/+194
| | |
* | | Add more services and some fixes, along with more "override"purpasmart962014-11-2126-17/+464
| | | | | | | | | | | | in the service's headers
* | | Merge pull request #211 from linkmauve/masterbunnei2014-11-1945-142/+142
|\ \ \ | | | | | | | | Remove trailing spaces from the entire project
| * | | Remove tabs in all files except in skyeye imports and in generated GL codeEmmanuel Gil Peyrot2014-11-192-32/+32
| | | |
| * | | Remove trailing spaces in every file but the ones imported from SkyEye, AOSP or generatedEmmanuel Gil Peyrot2014-11-1944-111/+111
| | | |
* | | | Merge pull request #208 from lioncash/staticsbunnei2014-11-195-69/+69
|\ \ \ \ | |/ / / |/| | | Add static to some variables
| * | | Add static to some variablesLioncash2014-11-195-69/+69
| | | |
* | | | Merge pull request #207 from lioncash/docsTony Wasserka2014-11-183-3/+3
|\ \ \ \ | | | | | | | | | | Fix documentation of parameters
| * | | | Fix documentation of parametersLioncash2014-11-183-3/+3
| |/ / /
* | | | Merge pull request #209 from lioncash/warnTony Wasserka2014-11-181-1/+1
|\ \ \ \ | | | | | | | | | | directory_sdmc: Fix a signed/unsigned mismatch comparison
| * | | | directory_sdmc: Fix a signed/unsigned mismatch comparisonLioncash2014-11-181-1/+1
| |/ / /
* | | | Merge pull request #210 from lioncash/typedefTony Wasserka2014-11-181-10/+10
|\ \ \ \ | | | | | | | | | | system: Get rid of an unnecessary enum typedef
| * | | | system: Get rid of an unnecessary enum typedefLioncash2014-11-181-10/+10
| |/ / /
* / / / Remove extraneous semicolonsLioncash2014-11-186-6/+6
|/ / /
* / / core: Mark some hle functions as staticLioncash2014-11-186-48/+48
|/ / | | | | | | These functions are not referred to by their linkage name outside of the translation unit, so they can be marked as static.
* | Archive: Fixed to not destroy archive handle on close.bunnei2014-11-181-3/+3
| |
* | Archive: Fixed close archive before freeing.bunnei2014-11-181-1/+1
| |
* | FS_User: Support FileSye::Path in a more generic way.bunnei2014-11-182-42/+76
| | | | | | | | added a todo to kernel archive
* | FileSys: Updated backend code to use FileSys::Path instead of string for paths.bunnei2014-11-1812-38/+38
| |
* | FileSys: Added DebugStr method to Path class.bunnei2014-11-181-0/+29
| |
* | Merge pull request #201 from archshift/bossbunnei2014-11-174-0/+59
|\ \ | | | | | | Add missing boss:U service
| * | Add missing boss:U service, needed according to Nintendo Zone logs.archshift2014-11-174-0/+59
| | |
* | | mem_map: Add missing prototype for Write64Lioncash2014-11-171-0/+1
|/ /
* | Merge pull request #159 from SeannyM/enable_logTony Wasserka2014-11-151-0/+2
|\ \ | | | | | | Add support for disabling log from settings
| * | Add support for disabling log from settingsSean2014-11-031-0/+2
| | |
* | | Merge pull request #193 from lioncash/fmtbunnei2014-11-151-1/+1
|\ \ \ | | | | | | | | Fix two format strings.
| * | | Fix two format strings.Lioncash2014-11-141-1/+1
| | | |
* | | | Merge pull request #194 from lioncash/virtbunnei2014-11-151-1/+1
|\ \ \ \ | |/ / / |/| | | ARM_Interface: Make destructor virtual
| * | | ARM_Interface: Make destructor virtualLioncash2014-11-141-1/+1
| | | | | | | | | | | | | | | | Fixes some warnings on OSX.
* | | | Merge pull request #183 from archshift/lowpathbunnei2014-11-132-83/+180
|\ \ \ \ | | | | | | | | | | Add support for UTF-16 strings for LowPaths in FS:USER
| * | | | Use std::u16string for conversion between UTF-8 and UTF-16, FS:USER functionsarchshift2014-11-133-138/+139
| | | | |
| * | | | Add support for UTF-16 strings for LowPaths in FS:USERarchshift2014-11-102-86/+182
| | |_|/ | |/| |
* | | | Merge pull request #188 from bunnei/apt-fixesbunnei2014-11-121-19/+90
|\ \ \ \ | | | | | | | | | | APT_U: Various improvements and bug fixes.
| * | | | APT_U: Added stub for function AppletUtility.bunnei2014-11-121-1/+29
| | | | |
| * | | | APT_U: Set a valid parameter buffer size in GlanceParameter.bunnei2014-11-121-17/+39
| | | | | | | | | | | | | | | | | | | | - Also Clarified GlanceParameter/ReceiveParameter documentation.
| * | | | APT_U: Release service lock on initialization.bunnei2014-11-121-0/+4
| | | | |
| * | | | APT_U: Fixes for GetLockHandle to boot system titles.bunnei2014-11-121-1/+18
| |/ / / | | | | | | | | | | | | - Also added comment to GetLockHandle function.
* | | | ARM: Fixed dyncom to use reg15 for PC (this core doesn't use pc variable).bunnei2014-11-121-2/+2
| | | | | | | | | | | | | | | | - Fixes single stepping in debugger.
* | | | Core: Changed RunLoop iterations to 1000 (slightly better performance).bunnei2014-11-121-6/+6
| | | |
* | | | ARM: Removed unnecessary goto with each instruction.bunnei2014-11-121-43/+39
| | | |
* | | | ARM: Fixed several dyncom bugs.bunnei2014-11-123-17/+25
| | | | | | | | | | | | | | | | | | | | | | | | | | | | - Fixed NZCVT flags to properly save state when function returns. - Fixed counter to keep track of the actual number of instructions executed. - Fixed single-step mode to only execute one instruction at a time. - DefaultIni: Removed comment that no longer applied to dyncom.
* | | | Add FRD:U service and functionsarchshift2014-11-114-0/+66
|/ / /
* | | Fix compilation errorsSean Maas2014-11-031-2/+2
| | |
* | | Merge pull request #163 from archshift/create-directorybunnei2014-11-028-4/+103
|\ \ \ | | | | | | | | Added CreateDirectory function to service/fs.cpp, and in Archive.
| * | | Added CreateDirectory function to service/fs.cpp, and in Archive.archshift2014-11-028-4/+103
| | | |
* | | | Merge pull request #166 from bunnei/skyeye-vfp-fixesbunnei2014-11-025-2138/+2622
|\ \ \ \ | | | | | | | | | | SkyEye ARM/VFP fixes
| * | | | ARM: Merged additional ARMv6 instructions implemented by 3dmoo.bunnei2014-11-021-42/+234
| | | | |
| * | | | ARM: Merge latest VFP fixes from 3dmoo team.bunnei2014-11-024-2096/+2388
| |/ / /
* / / / Added ReceiveNotification, PublishToSubscriber unimplemented functions to SRVarchshift2014-11-021-0/+2
|/ / /
* | | Added stub err:f service.archshift2014-11-024-0/+58
| | |
* | | Merge pull request #135 from purpasmart96/masterbunnei2014-11-0218-0/+597
|\ \ \ | | | | | | | | Added a bunch of services
| * | | Added a bunch of servicespurpasmart962014-11-0118-0/+597
| | | |
* | | | Fix VFP compilation errors with gccYuri Kunde Schlesner2014-10-311-12/+12
|/ / /
* | | Merge pull request #162 from SeannyM/warning-fixesbunnei2014-10-307-14/+14
|\ \ \ | | | | | | | | Fix some warnings
| * | | Fix some warningsSean2014-10-307-14/+14
| | | |
* | | | FS:USER - Implemented IsSdmcDetectedarchshift2014-10-301-1/+17
| | | |
* | | | Renamed souce files of services to match port namesGareth Poole2014-10-2913-21/+21
|/ / /
* | | Merge pull request #151 from archshift/dyncom-enabledbunnei2014-10-285-6/+32
|\ \ \ | | | | | | | | Use configuration files to enable or disable the new dyncom interpreter.
| * | | Added `gpu_refresh_rate` config setting for the new interpreter speed hack.archshift2014-10-282-10/+2
| | | |
| * | | Use configuration files to enable or disable the new dyncom interpreter.archshift2014-10-285-6/+40
| | | |
* | | | Merge pull request #141 from archshift/crash-huntbunnei2014-10-281-0/+4
|\ \ \ \ | | | | | | | | | | hid.cpp: Fixed crash when updating pad data while null
| * | | | hid.cpp: Fixed crash when updating pad data while nullarchshift2014-10-141-0/+4
| | | | | | | | | | | | | | | | | | | | Fixes #137
* | | | | Merge pull request #153 from yuriks/add-overridebunnei2014-10-2815-64/+64
|\ \ \ \ \ | |_|_|_|/ |/| | | | Add override keyword where appropriate
| * | | | Add `override` keyword through the code.Yuri Kunde Schlesner2014-10-2615-64/+64
| | |/ / | |/| | | | | | | | | | This was automated using `clang-modernize`.
* / | | vfp_helper: Get rid of integer type redefinitionsLioncash2014-10-261-7/+1
|/ / /
* | | ARM: Removed unnecessary and unused SkyEye MMU code.bunnei2014-10-2522-7743/+326
| | | | | | | | | | | | Added license header back in. I originally removed this because I mostly rewrote the file, but meh
* | | ARM: Removed unused armos code from SkyEye.bunnei2014-10-254-747/+0
| | |
* | | ARM: Updated dyncom core to use fast label lookup table on clang.bunnei2014-10-251-3/+7
| | |
* | | ARM: Integrate SkyEye faster "dyncom" interpreter.bunnei2014-10-2520-75/+8230
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Fixed typo (make protected member public) Added license header back in. I originally removed this because I mostly rewrote the file, but meh ARM: Fixed a type error in dyncom interpreter. ARM: Updated dyncom to use unique_ptr for internal ARM state.
* | | ARM: Reorganized file structure to move shared SkyEye code to a more common area.bunnei2014-10-2533-79/+79
| | | | | | | | | | | | Removed s_ prefix
* | | Don’t fail on empty filename in OpenFileDirectly, return the archive handle insteadEmmanuel Gil Peyrot2014-10-251-8/+7
| | |
* | | Use config files to store whether SDMC is enabled or notarchshift2014-10-232-2/+10
|/ / | | | | | | Before, it used to use whether the directory actually existed. As a result, .citra-emu/sdmc was never auto-created (something quite confusing to me until I read through the logs).
* | Rename GPU::Regs::FramebufferFormat to PixelFormatYuri Kunde Schlesner2014-10-122-14/+10
| | | | | | | | | | | | This name better represents what the enum does, and is less overloaded in the context. (The whole register the enum is part of is also called 'format'.)
* | Merge pull request #119 from lioncash/warnbunnei2014-10-092-3/+3
|\ \ | | | | | | Fix warnings in video_core
| * | Fix warnings in video_coreLioncash2014-10-082-3/+3
| | |
* | | Merge pull request #128 from purpasmart96/masterbunnei2014-10-081-1/+31
|\ \ \ | | | | | | | | APT:U Added a stub fuction for "GlanceParameter"
| * | | APT: Added a stub for the "GlanceParameter" function.purpasmart962014-10-081-1/+31
| | | |
* | | | Merge pull request #108 from archshift/configbunnei2014-10-083-0/+42
|\ \ \ \ | | | | | | | | | | Configuration files
| * | | | Added configuration file system.archshift2014-10-083-0/+42
| | |/ / | |/| | | | | | | | | | Uses QSettings on citra-qt, and inih on citra-cli.
* | | | Common: Add a helper function to generate a 8.3 filename from a long one.Emmanuel Gil Peyrot2014-10-063-29/+27
| | | | | | | | | | | | | | | | Core: Fix the SDMC Directory implementation to make blargSnes work.
* | | | FileSys: Add static asserts for the Directory struct, and fix its fields position.Emmanuel Gil Peyrot2014-10-061-2/+8
| | | |
* | | | FileSys: split the constructor into an Open method, in order to notify the opener something went wrong.Emmanuel Gil Peyrot2014-10-067-14/+57
| | | | | | | | | | | | | | | | Kernel: Return an invalid handle to OpenFile when it failed to open.
* | | | FileSys/Kernel: Implement SetSize service call for File objects.Emmanuel Gil Peyrot2014-10-066-0/+49
| | | |
* | | | FileSys: Add forgotten docstrings.Emmanuel Gil Peyrot2014-10-067-4/+35
| |/ / |/| |
* | | Added some more names to the function tablepurpasmart962014-10-051-0/+2
| | | | | | | | | Added "SetApplicationCpuTimeLimit" and "GetApplicationCpuTimeLimit" to apt.cpp
* | | added "StoreDataCache" to the function tablepurpasmart962014-09-301-0/+1
| | | | | | | | | seems simple enough
* | | Fix warnings in core and commonLioncash2014-09-282-2/+2
|/ /
* | Use the citra user path for the sdmc directoryarchshift2014-09-211-2/+1
| |
* | Kernel: Implement the Close command for Archive, File and Directory.Emmanuel Gil Peyrot2014-09-172-0/+43
| |
* | FS: Implement OpenArchive, OpenDirectory, OpenFile and OpenFileDirectly calls.Emmanuel Gil Peyrot2014-09-171-20/+177
| |
* | Kernel: Add a Directory object and a getter for it from an Archive object.Emmanuel Gil Peyrot2014-09-173-0/+91
| |
* | Core: Add a method to obtain a Directory from an Archive.Emmanuel Gil Peyrot2014-09-175-0/+44
| |
* | Core: Add a Directory object, with both a stub and a passthrough implementations.Emmanuel Gil Peyrot2014-09-176-0/+264
| |
* | Kernel: Add a File object and a getter for it from an Archive object.Emmanuel Gil Peyrot2014-09-172-0/+118
| |
* | Core: Add a passthrough backend for the filesystem, exposed as SDMC.Emmanuel Gil Peyrot2014-09-175-0/+302
| |
* | Core: Add a new File class, obtainable from an Archive, and a stub implementation.Emmanuel Gil Peyrot2014-09-177-0/+208
| |
* | Common: Rename the File namespace to FileUtil, to match the filename and prevent collisions.Emmanuel Gil Peyrot2014-09-173-5/+5
| |
* | Merge pull request #107 from lioncash/sprintfbunnei2014-09-161-5/+7
|\ \ | | | | | | Core: Replace a sprintf in core_timing with StringFromFormat
| * | Core: Replace a sprintf in core_timing with StringFromFormatLioncash2014-09-131-5/+7
| | |
* | | Merge pull request #109 from lioncash/cruftbunnei2014-09-151-41/+2
|\ \ \ | | | | | | | | Core: Get rid of unnecessary switch statement in Kernel
| * | | Core: Get rid of unnecessary switch statement in KernelLioncash2014-09-151-41/+2
| |/ /
* | | Merge pull request #110 from lioncash/warningsbunnei2014-09-151-6/+6
|\ \ \ | | | | | | | | Core: Fix warnings in gpu.cpp
| * | | Core: Fix warnings in gpu.cppLioncash2014-09-141-6/+6
| |/ /
* | | Merge pull request #97 from archshift/cleanupbunnei2014-09-141-1/+1
|\ \ \ | |/ / |/| | Small, general code cleanup
| * | Dead code removal: video_core.cpp, load_symbol_map.cpparchshift2014-09-071-1/+1
| | |
* | | Added support for multiple input device types for KeyMap and connected Qt.Kevin Hartman2014-09-122-113/+127
| | |
* | | Initial HID PAD work, with GLFW only.Kevin Hartman2014-09-122-24/+197
| | |
* | | Created structure for PAD.Kevin Hartman2014-09-122-0/+28
| | |
* | | Merge pull request #99 from archshift/ext-checkbunnei2014-09-113-55/+56
|\ \ \ | | | | | | | | loader.cpp: improved file extension checking, made Upper/LowerStr useful, moved string_util into Common namespace
| * | | Added string_util to common, small changes in loader.cpparchshift2014-09-093-56/+55
| | | |
| * | | loader.cpp: improved file extension checking, made Upper/LowerStr usefularchshift2014-09-091-6/+8
| | |/ | |/| | | | | | | Instead of forcibly taking the last 4 characters, it now finds the last extension separator (the period) and takes a substr of its location.
* / | core: Prune redundant includesarchshift2014-09-0920-37/+0
|/ /
* | Merge pull request #95 from lioncash/disassemblerbunnei2014-09-083-189/+143
|\ \ | | | | | | core: Make the ARM disassembler use std::string internally
| * | core: Make the ARM disassembler use std::string internallyLioncash2014-09-063-189/+143
| | |
* | | Merge pull request #87 from archshift/remove-cruftbunnei2014-09-081-1/+1
|\ \ \ | |_|/ |/| | Removed redundant headers for std implementations
| * | Removed common/std_xyz, instead using the std headerarchshift2014-09-071-1/+1
| |/
* | Merge pull request #93 from lioncash/refbunnei2014-09-062-4/+4
|\ \ | | | | | | core: Pass string by reference in FetchFromPortName and DeleteService
| * | core: Pass string by reference in FetchFromPortName and DeleteServiceLioncash2014-09-062-4/+4
| |/
* | ncch: Remove C-style struct typedefsLioncash2014-09-061-4/+4
| | | | | | | | In C++ you can simply just declare it as is.
* | ncch: inline declare some variables in LZSS_DecompressLioncash2014-09-061-7/+5
|/
* Removed common/atomic, instead using std::atomicarchshift2014-09-031-4/+4
|
* Remove hand-crafted Visual Studio solution.Yuri Kunde Schlesner2014-09-012-592/+0
|
* CMake cleanupYuri Kunde Schlesner2014-09-011-47/+56
| | | | | | | | Several cleanups to the buildsystem: - Do better factoring of common libs between platforms. - Add support to building on Windows. - Remove Qt4 support. - Re-sort file lists and add missing headers.
* Merge pull request #84 from bunnei/fix-hw-synchronizationbunnei2014-08-313-33/+48
|\ | | | | Fix GPU/HW synchronization
| * GPU: Improve frame synchronization, increases compatibility with both homebrew and retail applications.bunnei2014-08-311-13/+31
| |
| * Core: Refactor core to use only one function for execution.bunnei2014-08-312-20/+17
| | | | | | | | | | | | Core: Cleaned up comment to be more readable. Citra: Changed loop to be more readable.
| * Loader: Added support for loading raw BIN executables.bunnei2014-08-312-0/+21
| | | | | | | | | | | | - Useful for debugging homebrew Qt: Updated GUI to support loading .bin files.
| * Threading: Fix thread starting to execute first instruction correctly.bunnei2014-08-312-1/+6
| |
| * srv::Initialize: Return "success" status code.bunnei2014-08-311-0/+4
| |
* | Merge pull request #82 from yuriks/addr-typesbunnei2014-08-312-31/+40
|\ \ | | | | | | Introduce VAddr and PAddr typedefs for ARM addresses.
| * | Introduce VAddr and PAddr typedefs for ARM addresses.Yuri Kunde Schlesner2014-08-312-31/+40
| |/
* | Loader: Added support for loading raw BIN executables.bunnei2014-08-282-0/+21
| | | | | | | | | | | | - Useful for debugging homebrew Qt: Updated GUI to support loading .bin files.
* | Threading: Fix thread starting to execute first instruction correctly.bunnei2014-08-282-1/+6
| |
* | srv::Initialize: Return "success" status code.bunnei2014-08-281-0/+4
|/
* VideoCore: Fixes rendering issues on Qt and corrects framebuffer output size.bunnei2014-08-261-9/+8
|
* GPU: Fix a compiler warning about redundant semicolons.Tony Wasserka2014-08-251-2/+2
|
* Pica/citra-qt: Replace command list view and command list debugging code with something more sophisticated.Tony Wasserka2014-08-251-5/+0
|
* GSP: Update framebuffer information when necessary.Tony Wasserka2014-08-252-2/+41
|
* GSP: Implement SetBufferSwap.Tony Wasserka2014-08-252-1/+47
|
* GSP: Add a helper function for convenience.Tony Wasserka2014-08-251-17/+22
|
* Merge pull request #68 from archshift/readfilebunnei2014-08-234-11/+88
|\ | | | | Added FS functions to Archive and Archive_RomFS
| * Added FS functions to Archive and Archive_RomFSarchshift2014-08-234-11/+88
| |
* | ARM: Remove a forgotten const in vfp.Emmanuel Gil Peyrot2014-08-202-2/+2
|/
* Core: Use std::array for managing kernel object spaceLioncash2014-08-192-5/+5
| | | | These avoid relying on memset for clearing the arrays.
* Merge pull request #55 from lioncash/stringbunnei2014-08-1916-41/+38
|\ | | | | Core: Alter the kernel string functions to use std::string instead of const char*.
| * Core: Alter the kernel string functions to use std::string instead of const char*.Lioncash2014-08-1816-41/+38
| | | | | | | | Most functions already operate on std::strings. This also removes the need to manually null terminate thread names.
* | SVC: Added support for svc_GetSystemTick.bunnei2014-08-192-19/+48
|/ | | | Changed HLE function return methods to be static inline functions.
* Merge pull request #53 from lioncash/memmapbunnei2014-08-181-4/+8
|\ | | | | Core: Fix undefined behavior in mem_map_funcs' WriteBlock function
| * Core: Fix undefined behavior in mem_map_funcs' WriteBlock functionLioncash2014-08-171-4/+8
| |
* | Core: Fix a formatting error in svc.cppLioncash2014-08-171-3/+2
|/ | | | | entry_point would not be added to the string. Also used StringFromFormat so that the buffer is unnecessary.
* Merge pull request #39 from bunnei/hid-minor-improvementsbunnei2014-08-132-6/+45
|\ | | | | Hid minor improvements
| * HID: Added new function entries from 3dbrew to FunctionTable.bunnei2014-08-131-0/+5
| | | | | | | | HID: Fix typo with DisableGyroscopeLow command.
| * HID: Implemented HID_User::GetIPCHandles service function.bunnei2014-08-081-5/+39
| |
| * SVC: Fixed typo with MapMemoryBlock DEBUG_LOG call.bunnei2014-08-081-1/+1
| |
* | Pica: Add command processor.Tony Wasserka2014-08-121-3/+5
| |
* | Pica/GPU: Change hardware registers to use physical addresses rather than virtual ones.Tony Wasserka2014-08-126-208/+72
| | | | | | | | | | This cleans up the mess that address reading/writing had become and makes the code a *lot* more sensible. This adds a physical<->virtual address converter to mem_map.h. For further accuracy, we will want to properly extend this to support a wider range of address regions. For now, this makes simply homebrew applications work in a good manner though.
* | GSP: Fix a major regression introduced in ffda035c, due to which no display transfers were triggered at all anymore.Tony Wasserka2014-08-121-4/+13
| |
* | Remove the fancy RegisterSet class introduced in 4c2bff61e.Tony Wasserka2014-08-123-150/+230
|/ | | | | While it was some nice and fancy template usage, it ultimately had many practical issues regarding length of involved expressions under regular usage as well as common code completion tools not being able to handle the structures. Instead, we now use a more conventional approach which is a lot more clean to use.
* GPU: Updated g_last_ticks variable to be more descriptive (represents CPU tick count of last vertical line).bunnei2014-08-071-5/+5
|
* GPU: Updated horizontal sync line counter to use framebuffer height.bunnei2014-08-071-2/+3
|
* Thread: Added more descriptive comment to WaitCurrentThread.bunnei2014-08-072-2/+10
|
* GSP: Cleaned up command buffer decoding.bunnei2014-08-072-61/+69
| | | | | | | | GSP: Cleaned up code and added additional comments. GSP: Removed unnecessary TODO comment. GSP: Changed u32 iterators in TriggerCmdReqQueue to unsigned.
* GSP: Added reinitialization of other state objects.bunnei2014-08-061-0/+3
|
* GSP: Removed dumb GX prefixes to functions/structs in GSP namespace.bunnei2014-08-063-79/+80
| | | | - Various other cleanups.
* GSP: Removed unnecessary GX_FinishCommand function.bunnei2014-08-061-13/+5
|
* GSP: Implements preliminary command synchronization via GPU interrupts.bunnei2014-08-064-29/+140
| | | | Core: Added a comment to explain the logic for the RunLoop iterations.
* MemMap: Fixed typo with GetPointer to VRAM address.bunnei2014-08-061-1/+1
|
* AddressArbiter: Removed unnecessary HLE::Reschedule.bunnei2014-08-061-1/+0
|
* AddressArbiter: Fixed bug with break statements missing from case statements.bunnei2014-08-061-0/+2
|
* SRV: Updated GetProcSemaphore to create an event instead of a mutex.bunnei2014-08-061-8/+10
|
* SVC: Removed ArbitrateAddress log message that spams to much.bunnei2014-08-061-2/+0
|
* Kernel: Updated Event and Mutex to specify handle that they are blocking for.bunnei2014-08-062-2/+2
|
* Merge pull request #36 from bunnei/fix-memory-unaligned-readsbunnei2014-08-062-16/+28
|\ | | | | Fix memory unaligned reads
| * MemMap: Added an error for unaligned 16-bit memory reads.bunnei2014-08-061-0/+7
| |
| * MemMap: Removed Read64 function.bunnei2014-08-061-6/+0
| | | | | | | | | | - Unused code - Was not correct for unaligned memory reads
| * FS: Fix port name (old port name was based on an unaligned memory read).bunnei2014-08-061-1/+1
| |
| * MemMap: Fix Read32 for unaligned memory reads.bunnei2014-08-061-12/+23
| | | | | | | | MemMap: Cleaned up Read32 unaligned memory access.
* | ARM: Synchronize Citra's SkyEye core with 3dmoo's.bunnei2014-07-246-5919/+5303
|/
* Use uniform formatting when printing hexadecimal numbers.Tony Wasserka2014-07-231-3/+3
|
* Fix a few warnings.Tony Wasserka2014-07-233-7/+7
| | | | Templates shouldn't be marked as inline if they aren't defined in the header.
* GPU: Clarify display transfer code.Tony Wasserka2014-07-231-12/+15
| | | | Also makes the illogical component order more obvious.
* GPU: Add documentation.Tony Wasserka2014-07-231-2/+14
|
* GSP: Add a few comments.Tony Wasserka2014-07-232-1/+15
|
* GSP: Clean up GX command processing a lot and treat command id as a u8 rather than a u32.Tony Wasserka2014-07-232-37/+79
| | | | Anonymous structs are not standard C++, hence don't use them.
* RegisterSet: Simplify code by using structs for register definition instead of unions.Tony Wasserka2014-07-232-133/+123
|
* GPU: Make use of RegisterSet.Tony Wasserka2014-07-233-327/+200
|
* GPU: Make framebuffer code format-aware.Tony Wasserka2014-07-231-6/+47
|
* GPU: Interface cleanup.Tony Wasserka2014-07-232-13/+20
|
* GPU: Initialize GPU registers to some sensible default state.Tony Wasserka2014-07-231-1/+16
|
* GPU: Emulate memory fills.Tony Wasserka2014-07-234-3/+89
|
* GPU: Add proper framebuffer register handling.Tony Wasserka2014-07-232-11/+105
|
* GPU: Properly implement display transfers.Tony Wasserka2014-07-231-1/+19
|
* GPU: Add display transfer configuration.Tony Wasserka2014-07-232-0/+92
|
* GSP: HLE GXCommandId::SET_DISPLAY_TRANSFER and GXCommandId::SET_TEXTURE_COPY.Tony Wasserka2014-07-232-2/+17
|
* GSP: Implement ReadHWRegs and WriteHWRegs properly.Tony Wasserka2014-07-231-27/+46
|
* Use a more compatible choice of initial framebuffer addresses.Tony Wasserka2014-07-221-10/+22
|
* core: Kill off type redefenitions in armdefs.hLioncash2014-07-201-7/+0
|
* Kernel: Added preliminary support for address arbiters.bunnei2014-07-097-9/+144
| | | | | | | | AddressArbiter: Added documentation comment, fixed whitespace issue. AddressArbiter: Fixed incorrect comment, reordered if-statement to be more clear. SVC: Removed trailing whitespace.
* Thread: Added functions to resume threads from address arbitration.bunnei2014-07-092-0/+44
| | | | | | Thread: Cleaned up arbitrate address functions. Thread: Cleaned up ArbitrateAllThreads function.
* function_wrappers: Fixed incorrect wrapper, added another.bunnei2014-07-081-2/+9
|
* SharedMemory: Updated MapSharedMemory to use an enum for permissions.bunnei2014-07-053-16/+36
| | | | - Also added some safety checks to MapSharedMemory.
* Memory: Removed deprecated MapBlock_Shared function.bunnei2014-07-052-30/+0
|
* GSP: Fixed to use real shared memory object, various cleanups.bunnei2014-07-052-30/+40
| | | | | | | | - Previously, used a hard-coded shared memory handle of 0x10002000 (as used by libctru homebrew) GSP: Added name for shared memory. GSP: Cleaned up assertion message.
* Kernel: Added support for shared memory objects.bunnei2014-07-055-0/+142
| | | | SharedMemory: Added optional name field for tracking known objects.
* mem_map: Updated interface to expose template functions to other modules.bunnei2014-07-052-10/+16
|
* NCCH: Updated ExeFS memory allocation to be safer.bunnei2014-07-052-1/+7
|
* Archive: Added Init/Shutdown methods to reset kernel archive state.bunnei2014-07-053-0/+19
|
* Marked AppLoader_ELF, AppLoader_NCCH, and Archive_RomFS virtual functions as "override".bunnei2014-07-053-13/+13
|
* Marked AppLoader_ELF, AppLoader_NCCH, and Archive_RomFS classes as "final"bunnei2014-07-053-3/+3
|
* Loader: Updated read methods to be constbunnei2014-07-055-68/+79
| | | | - Required "file" handle to be made local and explicitly opened/closed as needed
* FileSys: Added preliminary support for applications reading the RomFS archive.bunnei2014-07-0511-160/+311
| | | | | | | | | | Archive: Fixed brace ugliness for neobrain :) FS: Commented out unused local variables to prevent warnings. ...But keeping them here for future use. archive_romfs: Removed unused #include.
* APT: Added stubbed ReceiveParameter and various cleanups.bunnei2014-07-041-71/+93
| | | | | | APT: More cleanups. APT: Changed SignalType to be type u32.
* Loader: Refactored interface such that data is no longer stored by loader.bunnei2014-06-273-96/+73
| | | | NCCH: Removed extra qualification ‘Loader::AppLoader_NCCH::’.
* FS: Added stubbed code to intercept and decode file system service functions.bunnei2014-06-276-0/+164
| | | | FS: Added to CMakeLists.txt
* Kernel: Added stubbed code to support creation of kernel Archive objects.bunnei2014-06-276-0/+95
|
* Core: Removed unused directory_file_system and meta_file_system modules.bunnei2014-06-279-1477/+0
| | | | Core: Updated CMakeLists.txt to remove directory_file_system and meta_file_system modules.
* Loader: Refactored loading functions to only read data from binary if called.bunnei2014-06-253-74/+141
| | | | NCCH: Updated LoadExec to use Memory::WriteBlock function to load binary code.
* MemMap: Added a WriteBlock function to write a buffer of data to memory.bunnei2014-06-252-0/+14
|
* ELF: Refactored LoadInto(..) to use memcpy, removed unnecessary code.bunnei2014-06-251-19/+8
|
* Loader: Refactored use of const.bunnei2014-06-256-20/+19
|
* NCCH: Added RomFS loading.bunnei2014-06-252-1/+36
|
* NCCH: Fixes reduce unnecessary logging and load logo/banner/etc. sections correctly.bunnei2014-06-253-22/+29
| | | | Loader: Added ErrorNotUsed ReturnStatus type to specify when something is not used.
* Loader: Implemented AppLoader interface for abstracting application loading.bunnei2014-06-256-523/+672
| | | | | | | | | | | | | | | | | | - Various cleanups/refactorings to Loader, ELF, and NCCH modules. - Added AppLoader interface to ELF and NCCH. - Updated Qt/GLFW frontends to check AppLoader ResultStatus. NCCH: Removed extra qualification typos. Loader: Removed unnecessary #include's. NCCH: Improved readability of memcmp statements. NCCH: Added missing space. Elf: Removed unnecessary usage of unique_ptr. Loader: Removed unnecessary usage of unique_ptr.
* NCCH: Changed decompression to load .code directly into memory rather than an intermediate buffer.bunnei2014-06-171-9/+3
|
* Elf: Removed unused macros, changed #include of "common.h" to just "common_types.h".bunnei2014-06-171-117/+1
|
* Loader: Cleaned up and removed unused code, refactored ELF namespace.bunnei2014-06-174-209/+70
|
* Elf: Renamed modules to be consistent with new loader naming, fixed tabs -> spaces.bunnei2014-06-178-372/+342
|
* Loader: Added support for booting NCCH executables.bunnei2014-06-176-0/+384
| | | | NCCH: Fixed typo in printing NCCH filename.
* Loader: Moved elf and loader modules to a "loader" subdirectory.bunnei2014-06-178-30/+34
|
* Loader: Added stubbed detection of CXI and CCI files.bunnei2014-06-161-0/+6
|
* Loader: Removed unused CXI and DAT loading code.bunnei2014-06-161-76/+0
|
* Merge branch 'threading' of https://github.com/bunnei/citrabunnei2014-06-1436-1155/+1194
|\ | | | | | | | | | | Conflicts: src/core/hle/function_wrappers.h src/core/hle/service/gsp.cpp
| * Kernel: Removed unnecessary "#pragma once".bunnei2014-06-131-2/+0
| |
| * Kernel: Added freeing of kernel objects on emulator shutdown.bunnei2014-06-133-0/+13
| |
| * Event: Updated several log messages to be assertions.bunnei2014-06-131-16/+8
| |
| * HLE: Moved "PARAM" and "RETURN" macros to function_wrappers.h (this is only module where they are needed).bunnei2014-06-132-5/+6
| |
| * SVC: Renamed all function wrapper templates to Wrap, moved to HLE namespace.bunnei2014-06-132-157/+145
| |
| * Thread: Renamed occurrences of "t" to "thread" to improve readability.bunnei2014-06-131-48/+45
| |
| * Thread: Cleaned up VerifyWait, fixed issue where nullptr msg could unnecessarily be logged.bunnei2014-06-131-9/+7
| |
| * HLE: Removed usnused EatCycles function.bunnei2014-06-133-15/+0
| |
| * SVC: Cleaned up function wrappers to pass in correct argument types.bunnei2014-06-132-870/+201
| |
| * Thread: Moved position of * in arguments.bunnei2014-06-131-2/+2
| |
| * Thread: Updated VerifyWait to be more readable (but functionally the same).bunnei2014-06-131-4/+3
| |
| * SVC: Moved declaration of "wait" variable in SendSyncRequest for improved readability.bunnei2014-06-131-1/+1
| |
| * HLE: Updated all uses of NULL to nullptr (to be C++11 compliant)bunnei2014-06-1313-239/+239
| |
| * Kernel: Updated various kernel function "name" arguments to be const references.bunnei2014-06-134-6/+6
| |
| * HLE: Updated various handle debug assertions to be more clear.bunnei2014-06-134-10/+10
| |
| * Mutex: Moved ReleaseMutex iterator declaration to be inside while loop.bunnei2014-06-131-2/+1
| |
| * Kernel: Updated several member functions to be constbunnei2014-06-135-13/+13
| |
| * Core: Cleaned up SingleStep(), updated default LCD refresh to assume each instruction is ~3 cyclesbunnei2014-06-132-12/+14
| |
| * Core: Changed HW update/thread reschedule to occur more frequently (assume each instruction is ~3 cycles)bunnei2014-06-131-2/+2
| |
| * Thread: Fixed bug with ResetThread where cpu_registers[15] was being incorrectly setbunnei2014-06-131-1/+1
| |
| * Kernel: Made SyncRequest not pure virtual, with a default implementation of error (as this is not required for all kernel objects)bunnei2014-06-133-23/+4
| |
| * Kernel: Added real support for thread and event blockingbunnei2014-06-136-76/+196
| | | | | | | | | | | | | | | | | | | | | | | | | | - SVC: Added ExitThread support - SVC: Added SignalEvent support - Thread: Added WAITTYPE_EVENT for waiting threads for event signals - Thread: Added support for blocking on other threads to finish (e.g. Thread::Join) - Thread: Added debug function for printing current threads ready for execution - Thread: Removed hack/broken thread ready state code from Kernel::Reschedule - Mutex: Moved WaitCurrentThread from SVC to Mutex::WaitSynchronization - Event: Added support for blocking threads on event signalling Kernel: Added missing algorithm #include for use of std::find on non-Windows platforms.
| * hle: added a hokey way to force a thread reschedule during CPU single step mode (as used by the debugger)bunnei2014-06-053-1/+7
| |
| * arm: fixed a bug where ARM_Interpreter::ExecuteInstructions was actually executing one more instruction than expectedbunnei2014-06-051-1/+1
| |
| * kernel: changed current default thread priority back to 0x30 - I think this is more correctbunnei2014-06-051-1/+1
| |
| * arm: fixed bug in how thread context switch occurs with SkyEyebunnei2014-06-052-2/+9
| |
| * service: added a error log messages for unimplemented WaitSynchronizationbunnei2014-06-051-0/+1
| |
| * arm: reverting a change made with cb0663de - this has to have been a typo!bunnei2014-06-051-1/+1
| |
| * svc: added optional name field to Event and Mutex (used for debugging)bunnei2014-06-036-12/+25
| |
| * kernel: moved position of * for GetTypeName and GetNamebunnei2014-06-031-2/+2
| |
| * coprocessor: reenabled debug logbunnei2014-06-031-1/+1
| |
| * svc: updated WaitSynchronizationN to properly use first pointer argumentbunnei2014-06-022-4/+6
| |
| * svc: changed DuplicateHandle log message from "error" to "debug"bunnei2014-06-021-1/+1
| |
| * svc: added GetThreadPriority and SetThreadPriority, added (incomplete) DuplicateHandle supportbunnei2014-06-023-3/+77
| |
| * kernel: changed main thread priority to default, updated Kernel::Reschedule to use PrepareReschedulebunnei2014-06-026-9/+17
| |
| * arm: added option to prepare CPU core (while mid-instruction) for thread reschedulebunnei2014-06-023-0/+11
| |
| * svc: cleaned up function_wrappers, updated various SVCs to make use of pointer argumentsbunnei2014-06-022-31/+40
| |
| * svc: added missing function wrapper for SleepThreadbunnei2014-06-011-0/+4
| |
| * gsp: always pass through synchronization barrier for commandsbunnei2014-06-011-1/+16
| |
| * svc: updated waitSychronization to not overwrite handle on return, added stub for SleepThread (does nothing)bunnei2014-06-011-2/+21
| |
| * thread: updated Reschedule to sit at a synchronization barrier when no other threads are ready for executionbunnei2014-06-011-0/+18
| |
| * event: added a hackish ability to set an event as "locked" to its current state, cleaned up some commentsbunnei2014-06-012-4/+32
| |
| * hle: added stubbed service for ndm_ubunnei2014-05-305-0/+74
| |
| * service: cleaned up log messagesbunnei2014-05-301-2/+2
| |
| * service: removed PT_A from, as this was just an alias for APT_Ubunnei2014-05-301-2/+0
| |
| * srv: fix to log unimplemented service (instead of crash)bunnei2014-05-301-6/+2
| |
| * mutex: fixed typo in ReleaseMutexbunnei2014-05-301-1/+3
| |
| * hle: cleaned up log messagesbunnei2014-05-308-45/+49
| |
| * svc: updated OutputDebugString to use OS_LOGbunnei2014-05-301-1/+1
| |
| * arm: removed unnecessary code when calling SVC from skyeyebunnei2014-05-301-16/+0
| |
| * core: changed time delay before kernel reschedule to "approximate" a screen refreshbunnei2014-05-301-3/+12
| |
| * svc: changed unimplemented SVC log messages from "debug" messages to "error" messagesbunnei2014-05-301-8/+8
| |
| * svc: added svcClearEvent, stubbed function for svcArbitrateAddress, and various fixesbunnei2014-05-302-22/+38
| | | | | | | | | | | | - force kernel reschedule after svcWaitSynchronization - fixed some bugs with passing in pointer arguments - cleaned up some comments and log messages
| * event: added support for ClearEvent, fixed a bug with CreateEvent, fixed some commentsbunnei2014-05-302-9/+14
| |
| * service: added additional hack to return success on unimplemented service callsbunnei2014-05-301-2/+10
| |
| * srv: changed a NOTICE_LOG to DEBUG_LOGbunnei2014-05-301-1/+1
| |
| * svc: added ArbitrationType enumerationbunnei2014-05-301-0/+9
| |
| * apt: added stubbed function for InquireNotificationbunnei2014-05-291-78/+86
| |
| * hle: properly cast 64-bit function wrapper parameters to (u64)bunnei2014-05-291-2/+2
| |
| * hle: removed PARAM64 macro (this was incorrect), made several bug fixes accordingly for decoding U64 function parametersbunnei2014-05-292-3/+2
| |
| * lcd: moved kFrameTicks to lcd.h for use in other modulesbunnei2014-05-292-2/+2
| |
| * service: changed interface to return 0 (no error) when a service method is unimplemented - hack to make apps boot furtherbunnei2014-05-291-2/+2
| |
| * APT_U: added stubbed function for APT_U::Enable, fixed some log messages to be more consistentbunnei2014-05-281-3/+10
| |
| * mutex: added preliminary SyncRequest/WaitSynchronization, added some comments/assertionsbunnei2014-05-281-0/+6
| |
| * svc: implemented WaitSynchronization1, WaitSynchronizationN, and CreateEventbunnei2014-05-281-14/+54
| |
| * APT_U: added event creation to Initialize methodbunnei2014-05-281-1/+11
| |
| * event: fixed typos and updated CMakeListsbunnei2014-05-282-1/+2
| |
| * event: added SetEventLocked method to change status an events lockbunnei2014-05-282-0/+18
| |
| * kernel: added event module to support creation of CTR "Event" objectsbunnei2014-05-284-0/+127
| |
| * mutex: removed docstring comment that is no longer relevantbunnei2014-05-271-1/+0
| |
| * mutex: added additional docstringsbunnei2014-05-271-0/+2
| |
| * kernel: added WaitSynchronization method to Kernel::Objectbunnei2014-05-274-0/+39
| |
| * kernel: updated SyncRequest to take boolean thread wait result as a parameterbunnei2014-05-275-10/+33
| |
| * svc: added some assertionsbunnei2014-05-271-6/+4
| |
| * service: Renamed Sync to SyncRequestbunnei2014-05-271-1/+1
| |
| * kernel: added enum for known CurrentThread and CurrentProcess handlesbunnei2014-05-271-0/+5
| |
| * srv: added a real mutex for GetProcSemaphore (instead of stubbed)bunnei2014-05-271-3/+10
| |
| * svc: changed SendSyncRequest to use Kernel::Object SyncRequest (instead of just service Interface class)bunnei2014-05-271-2/+2
| |
| * kernel: add a SyncRequest method to KernelObject for use with svcSendSyncRequestbunnei2014-05-274-6/+11
| |
| * svc: added stub for DuplicateHandle SVC callbunnei2014-05-271-1/+8
| |
* | GPU debugger: Add functionality to inspect command lists.Tony Wasserka2014-06-121-0/+4
| |
* | GPU: Cleanup register definitions.Tony Wasserka2014-06-123-31/+31
| |
* | Rename LCD to GPU.Tony Wasserka2014-06-128-36/+36
| |
* | Add initial graphics debugger interface.Tony Wasserka2014-06-121-0/+6
| |
* | GSP: Define more GX commands.Tony Wasserka2014-06-122-14/+54
| |
* | Pica: Add command list registers.Tony Wasserka2014-06-122-5/+52
| |
* | Added 'this' reference to num_instructions field so it's properly updated,as before the method was affecting the local method parameter rather than the class fieldDisruption2014-06-011-1/+1
| |
* | service: fixed typo that MSVC did not catch as an errorbunnei2014-05-231-1/+1
| |
* | core: fixed headers in CMakeListsbunnei2014-05-231-1/+4
| |
* | Merge branch 'threading'bunnei2014-05-2337-189/+1330
|\|
| * core: added Kernel::Reschedule() call to check for thread changes, shortened delay time to 100 instructionsbunnei2014-05-231-1/+6
| |
| * svc: added a check to ensure that a service was implemented before attempting to connect to its portbunnei2014-05-231-1/+5
| |
| * lcd: added thread wait after (faked) vblank interrupt (would have) occurredbunnei2014-05-231-0/+4
| |
| * thread: renamed "WaitCurThread" to "WaitCurrentThread", removed unused "reason" argumentbunnei2014-05-233-6/+6
| |
| * thread: removed unused SwitchContext/Reschedule reason field, added missing arg parameter to SVC CreateThreadbunnei2014-05-233-12/+9
| |
| * kernel: refactored function naming to remove "__" prefixbunnei2014-05-236-65/+75
| |
| * core: moved armcopro.cpp to correct filter folder (arm/interpreter)bunnei2014-05-231-3/+3
| |
| * thread: moved ThreadStatus/WaitType to header, added support for arg on CreateThread, added correct CPSR resetbunnei2014-05-232-35/+40
| |
| * APT_U: added a debug log on calling GetLockHandlebunnei2014-05-231-0/+1
| |
| * arm_interpreter: fixed load context to currently resume a threadbunnei2014-05-231-1/+4
| |
| * thread: fixed bug where result of __NextThread was not being properly checked when NULLbunnei2014-05-221-1/+1
| |
| * svc: added Kernel::Reschedule to svc WaitSynchronization1, updated log messages to include newly created handlesbunnei2014-05-221-4/+7
| |
| * svc: enabled use of newly created kernel thread handlebunnei2014-05-211-5/+5
| |
| * mutex: refactored the interface to code to return a Mutex* handlebunnei2014-05-214-5/+16
| |
| * mutex: initial commit of HLE modulebunnei2014-05-217-10/+166
| |
| * svc: added some commentsbunnei2014-05-211-0/+7
| |
| * kernel: fixed include, in general include "common.h" not "common_types.h"bunnei2014-05-211-1/+1
| |
| * service: removed redundant include of common_types.hbunnei2014-05-211-1/+0
| |
| * arm: removed include of windows.h from armdefs.h to arminit.c (only module that uses it)bunnei2014-05-212-4/+3
| |
| * armemu: missed rename of "Syscall" to "SVC"bunnei2014-05-211-1/+1
| |
| * thread: added correct lowest thread priority, added a thread priority check, and added some commentsbunnei2014-05-212-6/+10
| |
| * thread: exposed ResumeThreadFromWait function for use in other kernel modulesbunnei2014-05-212-8/+11
| |
| * thread: moved threading calls to the Kernel namespacebunnei2014-05-214-103/+117
| |
| * ARM_Interpreter/ARM_Interface: Fixed member variable naming to be consistent with style guidebunnei2014-05-213-45/+45
| |
| * ARM_Interface: added SaveContext and LoadContext functions for HLE thread switchingbunnei2014-05-214-37/+65
| |
| * renamed "syscall" module to "svc" (more accurate naming)bunnei2014-05-219-26/+28
| |
| * thread: whitespace change - fixed * and & placementbunnei2014-05-212-27/+27
| |
| * - created a Kernel namespacebunnei2014-05-216-75/+87
| | | | | | | | | | - cleaned up Kernel code a bit (moved stuff into namespace, fixed whitespace issues) - added handle types for all different CTROS handles
| * apt: changed stubbed handle to be something other than 0xDEADBEEF (used as a magic value in other places) so that I can track how it propagates through the app codebunnei2014-05-201-1/+1
| |
| * thread: added declaration for __KernelReschedule to be used by syscall modulebunnei2014-05-201-0/+3
| |
| * VFP: disable DBG messages because they spam the console with unimportant skyeye junkbunnei2014-05-201-1/+1
| |
| * renamed "session" to "handle"bunnei2014-05-191-3/+3
| |
| * - renamed NewHandle to CreateHandlebunnei2014-05-192-8/+8
| | | | | | | | - updated CreateHandle/DeleteHandle to use KernelObject's
| * fix warningbunnei2014-05-191-1/+1
| |
| * - updated service(s) to be KernelObject'sbunnei2014-05-197-59/+31
| | | | | | | | - various cleanups
| * renamed "UID" to "Handle" where appropriatebunnei2014-05-194-24/+22
| |
| * - moved Handle/Result definitions to kernel.hbunnei2014-05-196-14/+19
| | | | | | | | - added ResetType enum
| * - added stub for CreateEventbunnei2014-05-181-8/+22
| | | | | | | | - changed some stubbed SVCs to return unique handle names for debugging purposes
| * added stubbed function for WaitSynchronizationNbunnei2014-05-182-4/+19
| |
| * ignore thumbemu 0xDEADCODE debugging catch on MCRbunnei2014-05-171-2/+1
| |
| * changed a commentbunnei2014-05-172-2/+2
| |
| * cleanups to SVC CreateThreadbunnei2014-05-171-8/+15
| |
| * Merge branch 'master' into threadingbunnei2014-05-176-23/+36
| |\
| * | - added enum ThreadProcessorIdbunnei2014-05-172-53/+107
| | | | | | | | | | | | | | | - reorganized some kernel thread functions - added placeholder __KernelWaitThread_Synchronization function
| * | - replaced KERNELOBJECT_MAX_NAME_LENGTH with KERNEL_MAX_NAME_LENGTHbunnei2014-05-173-8/+12
| | | | | | | | | | | | - added KERNEL_DEFAULT_STACK_SIZE definition (0x4000)
| * | added stubbed GetProcSemaphore - does nothing but avoids an exceptionbunnei2014-05-171-1/+7
| | |
| * | add kernel.* and thread.* to VS filtersbunnei2014-05-171-0/+15
| | |
| * | updated APT_U::GetLockHandle to return a valid handlebunnei2014-05-171-1/+5
| | |
| * | Merge master into threading to add support for VFPbunnei2014-05-1733-195/+14287
| |\ \
| * | | - added SVC stubs for QueryMemory and GetThreadIdbunnei2014-05-163-2/+30
| | | | | | | | | | | | | | | | - added SVC structs MemoryInfo and PageInfo
| * | | added memory mapped region for system mem - sdk demos load a segment here on ELF loadbunnei2014-05-163-1/+23
| | | |
| * | | added ability to load AXF files (same as ELF)bunnei2014-05-161-0/+3
| | | |
| * | | completely gutted/refactored threading code to be simplerbunnei2014-05-162-658/+230
| | | |
| * | | changed "UID" to "Handle" to be a little more consistent with CTR namingbunnei2014-05-162-18/+21
| | | |
| * | | - added ThreadContext structbunnei2014-05-162-8/+26
| | | | | | | | | | | | | | | | - cleaned up CreateThread svc
| * | | - added helper function for __KernelCreateThreadbunnei2014-05-152-4/+76
| | | | | | | | | | | | | | | | | | | | - added __KernelSwitchToThread for enabling a thread - added __KernelRotateThreadReadyQueue
| * | | changed primary thread priority to 0x30 - this is typical, not 0x31bunnei2014-05-151-1/+2
| | | |
| * | | added function stubs for EatCycles and ReSchedulebunnei2014-05-152-0/+15
| | | |
| * | | fixed thread reset to not set stack addressbunnei2014-05-141-1/+1
| | | |
| * | | various cleanups / remove unused codebunnei2014-05-142-65/+29
| | | |
| * | | added a bunch of threading code, recycled from PPSSPP, with lots of hacks in for 3DS... doesn't really do much yet. Just a jumping off pointbunnei2014-05-142-70/+543
| | | |
| * | | changed loader to use __KernelLoadExecbunnei2014-05-141-8/+9
| | | |
| * | | added CreateThread, CreateMutex, and ReleaseMutex SVC stubs (just parameter decoding for now)bunnei2014-05-142-7/+38
| | | |
| * | | - added __KernelLoadExec functionbunnei2014-05-142-13/+35
| | | | | | | | | | | | | | | | - fixed some logging
| * | | added option to set CPSR register to arm_interfacebunnei2014-05-123-0/+20
| | | |
| * | | added initial kernel/thread modulesbunnei2014-05-107-0/+548
| | | |
* | | | Merge pull request #2 from archshift/issue-7-fixbunnei2014-05-206-26/+54
|\ \ \ \ | |_|_|/ |/| | | Fixes issues with building Citra on OSX
| * | | CMakeLists: rename HEADS, improved commentsarchshift2014-05-201-2/+2
| | | | | | | | | | | | | | | | Changes for clarity of comments, removed redundant compiler flags.
| * | | Fixed vfp issuesarchshift2014-05-174-10/+10
| | | |
| * | | Updated cmakelistsarchshift2014-05-171-6/+12
| | | |
| * | | Merge remote-tracking branch 'upstream/master' into issue-7-fixarchshift2014-05-1751-473/+14858
| |\ \ \ | | | |/ | | |/|
| * | | Fixed indentsarchshift2014-05-011-2/+2
| | | |
| * | | Merge commit upstream/master into issue-7-fixarchshift2014-05-013-22/+43
| |\ \ \
| * | | | A bit of Cmake lovearchshift2014-05-011-1/+38
| | | | |
| * | | | Merge commit upstream/master into issue-7-fixarchshift2014-04-292-5/+11
| |\ \ \ \
| * | | | | Problematic template functionsarchshift2014-04-281-15/+0
| | | | | |
* | | | | | updated how we call ARM core to make things much fasterbunnei2014-05-176-23/+36
| |_|_|/ / |/| | | |
* | | | | same fix as last commit - just for vfpsingle.cppbunnei2014-05-171-2/+2
| | | | |
* | | | | another VFP fix for GCCbunnei2014-05-171-2/+2
| | | | |
* | | | | fixed VFP DBG log for GCCbunnei2014-05-171-1/+1
| | | | |
* | | | | fixed typo in CMakeLists.txtbunnei2014-05-171-1/+1
| | | | |
* | | | | - reenabled MCR and MRC functions now that VFP is attachedbunnei2014-05-174-116/+94
| | | | | | | | | | | | | | | | | | | | - removed HLE::CallMCR function (was pointless)
* | | | | - removed unused stubbed out codebunnei2014-05-175-33/+27
| | | | | | | | | | | | | | | | | | | | | | | | | - fixed some compiler issues with xscale_copro when porting code to Windows - fixed some #include's
* | | | | added maverick.cpp to ARM core from skyeyebunnei2014-05-164-1/+1212
| | | | |
* | | | | fixed includesbunnei2014-05-161-2/+2
| | | | |
* | | | | enabled CP_ACCESS_ALLOWEDbunnei2014-05-161-6/+4
| | | | |
* | | | | fixed include pathbunnei2014-05-161-1/+1
| | | | |
* | | | | removed undefined function ARMul_ConsolePrintbunnei2014-05-161-1/+1
| | | | |
* | | | | added missing armcopro from skyeyebunnei2014-05-166-251/+1098
| | | | |
* | | | | added missing skyeye mmu codebunnei2014-05-1612-44/+3333
| | | | |
* | | | | fixed armmmu importsbunnei2014-05-161-5/+5
| | | | |
* | | | | - moved mmu to arm/interpreter folderbunnei2014-05-1616-1/+8791
| |_|_|/ |/| | | | | | | | | | | - added initial VFP code from skyeye
* | | | removed unknown fields from GX_CmdBufferHeaderbunnei2014-05-081-5/+0
| | | |
* | | | removed unnecessary log messagebunnei2014-05-081-1/+1
| | | |
* | | | - removed HLE mem "hack" and replaced with kernel mem regionbunnei2014-05-088-116/+100
| | | | | | | | | | | | | | | | | | | | - added a helper function for getting command buffer for services - fixed bug where GSP DMA was incorrectly being done in DataSynchronizationBarrier (instead of gsp_TriggerCmdReqQueue)
* | | | added kernel memory to mem_mapbunnei2014-05-082-0/+9
| | | |
* | | | - added debug logging to syscall.cppbunnei2014-05-072-135/+173
| | | | | | | | | | | | | | | | - added stubbed HLE syscall functions for svc_GetResourceLimit and svc_GetResourceLimitCurrentValues
* | | | added mem_map read for config_membunnei2014-05-072-7/+17
| | | |
* | | | added config_mem module for HLE of firmware configuration memory settingsbunnei2014-05-075-0/+100
| | | |
* | | | - disable strict alignment on LDRD/STRDbunnei2014-05-071-17/+22
| | | | | | | | | | | | | | | | - handle RD in STREX/STREXB
* | | | commented out useless debug logs that just spammed consolebunnei2014-05-061-3/+3
| | | |
* | | | - added CallMCR function to coprocessor HLE modulebunnei2014-05-023-29/+43
| | | | | | | | | | | | | | | | - moved instruction decoding to coprocessor HLE module
* | | | fixed include in coprocessor.cppbunnei2014-05-021-1/+1
| | | |
* | | | renamed hle "mrc" module to "coprocessor"bunnei2014-05-026-17/+17
| | | |
* | | | - added some function wrappers for HLEbunnei2014-05-022-10/+29
| | | | | | | | | | | | | | | | | | | | - added stub for SVC CreateAddressArbiter - added OutputDebugString SVC
* | | | - added option to load a code.bin file extracted from a CXI filebunnei2014-05-012-14/+63
| | | | | | | | | | | | | | | | - updated load launcher.dat function to use ARM11 format hack
* | | | added a module to load symbol map files for debuggingbunnei2014-05-015-0/+55
| | | |
* | | | fixed a bug where ExeFs code was being incorrectly maskedbunnei2014-05-011-1/+1
| |_|/ |/| |
* | | added virtual memory map for ExeFS (where ARM11 code is supposed to be loaded)bunnei2014-05-013-1/+17
| | |
* | | reorganized memory regions enum, added regions for ExeFS codebunnei2014-05-012-21/+26
| |/ |/|
* | added virtual address conversion for firmware FW0Bbunnei2014-04-282-5/+11
|/
* removed DISALLOW_COPY_AND_ASSIGN in favor of NonCopyable classbunnei2014-04-285-12/+1
|
* fixed weird spacingbunnei2014-04-281-1/+1
|
* removed commented out line - this was for an unimplemented MRC call, no longer need to leave this herebunnei2014-04-281-1/+0
|
* hackish but working way to set the framebuffer location to VRAM (used in ARM11 demos tested thus far, e.g. yeti3DS)bunnei2014-04-271-3/+9
|
* added helper functions to mem_map to convert physical addresses to virtual addressesbunnei2014-04-272-1/+15
|
* added code to LCD modules keep track of framebuffer location in FCRAM or VRAMbunnei2014-04-272-15/+153
|
* - changed HW IO map to use virtual addressesbunnei2014-04-264-42/+64
| | | | - added hooks to catch LCD IO read/writes
* added simple GSP GPU ReadHWRegs function to support returning the framebuffer addressbunnei2014-04-261-1/+37
|
* added preliminary DataSynchronizationBarrier support with simple DMA copybunnei2014-04-261-7/+39
|
* added (fake) physical addresses for where to put framebuffer in VRAMbunnei2014-04-261-0/+10
|
* added vram to memory_mapbunnei2014-04-262-8/+15
|
* moved HLE::MRC to its own module, added support for catching data synchronization barrier commandbunnei2014-04-259-13/+66
|
* added disassembly to unimplemented instructionbunnei2014-04-251-1/+6
|
* removed some cruftbunnei2014-04-251-7/+1
|
* fixed bug where svc_ControlMemory was not properly getting passed in parametersbunnei2014-04-251-2/+2
|
* - added preliminary support for svc_MapMemoryBlockbunnei2014-04-254-14/+70
| | | | | - added shared memory region - moarrrr cleanups to memory_map
* added functions to map Heap and Shared memory spacebunnei2014-04-253-9/+76
|
* added GSP::RegisterInterruptRelayQueue functionbunnei2014-04-251-31/+40
|
* - refactored how service functions are calledbunnei2014-04-255-19/+39
| | | | - added option to create/delete service handles
* fixes to build on linuxbunnei2014-04-233-22/+24
|
* updated CMakeLists for missing filesShizZy2014-04-231-1/+9
|
* Add a quick way to load Launcher.dat filesMathieu Vaillancourt2014-04-222-5/+60
|
* Merge branch 'hle-interface'bunnei2014-04-1834-212/+2339
|\
| * renamed hw_lcd module to just lcdbunnei2014-04-186-12/+10
| |
| * added NDMA hardware interfacebunnei2014-04-185-2/+141
| |
| * added GSP heap memory allocationbunnei2014-04-183-1/+76
| |
| * fixed bug in Memory::GetPointerbunnei2014-04-181-2/+2
| |
| * moved enums into Memory:: namespacebunnei2014-04-181-4/+2
| |
| * added memory read/write to GSP heapbunnei2014-04-183-7/+16
| |
| * more various refactors to memory interfacebunnei2014-04-183-48/+58
| |
| * cleaned up memory interfaces a lot, removed some hackish stuffbunnei2014-04-183-106/+50
| |
| * added a new function wrapperbunnei2014-04-171-0/+5
| |
| * fixed bug with printing std::string in log messagesbunnei2014-04-171-2/+2
| |
| * changed unknown memory read/write to report the sizebunnei2014-04-171-2/+3
| |
| * added class stub for HID:User servicebunnei2014-04-175-0/+80
| |
| * updated service commentsbunnei2014-04-176-5/+17
| |
| * - fixed tabs in function_wrappers.hbunnei2014-04-174-395/+413
| | | | | | | | | | - fixed log message wording in hle.cpp - added syscall stubs for CloseHandle and WaitSynchronization1
| * - added stubbed out GSP::Gpu service interfacebunnei2014-04-169-7/+111
| | | | | | | | - various cleanups/refactors to HLE services
| * removed no longer used function headerbunnei2014-04-161-2/+0
| |
| * restructured hle:services completely to use function lookup tablesbunnei2014-04-165-137/+215
| |
| * fixed naming for APT_Ubunnei2014-04-163-9/+9
| |
| * - extracted srv: calls from service.cpp and put in its own modulebunnei2014-04-166-106/+113
| | | | | | | | | | - added function tables for service calls - lots of refactoring
| * added a stub for GetLockHandlebunnei2014-04-143-9/+44
| |
| * added framework for APT service (application and title launching service)bunnei2014-04-137-5/+126
| |
| * renamed class Interface_SRV to SRVbunnei2014-04-131-6/+6
| |
| * replace tabs with spacesbunnei2014-04-131-3/+3
| |
| * added some very initial command parsing for SRV Syncbunnei2014-04-131-5/+31
| |
| * added a GetPointer function for reading from HLE command bufferbunnei2014-04-132-0/+14
| |
| * fixed hw write declarations to not be constbunnei2014-04-131-4/+4
| |
| * added OS memory read/write for thread command bufferbunnei2014-04-134-12/+60
| |
| * cleanups to service HLEbunnei2014-04-132-8/+8
| |
| * - added HLE to connect to "srv:" servicebunnei2014-04-1311-168/+386
| | | | | | | | | | | | - added a manager for keeping track of services/ports - added a memory mapped region for memory accessed by HLE - added HLE for GetThreadCommandBuffer function
| * hacked CPU interpreter to ignore branch on SVC instruction (as we are HLEing this...)bunnei2014-04-121-2/+6
| |
| * added a SETABORT method that does not update LR (for HLE'd SVC that does not jump appcore CPU to an IRQ vector)bunnei2014-04-121-0/+11
| |
| * added a memory mapped option for HLEbunnei2014-04-121-5/+8
| |
| * - renamed hle_syscall to just syscallbunnei2014-04-127-106/+157
| | | | | | | | - added service.h as an initial service interface
| * replace tabs with spacesbunnei2014-04-121-6/+6
| |
| * moved hle.cpp into hle folder (due to mistake earlier)bunnei2014-04-123-2/+2
| |
| * added remaining known syscall functions to Syscall_Tablebunnei2014-04-111-0/+80
| |
| * base code to call a syscall from ARM11 appcorebunnei2014-04-115-9/+85
| |
| * updated logging messagebunnei2014-04-111-2/+2
| |
| * cleaned up some logging messagesbunnei2014-04-115-32/+19
| |
| * changed some naming/misc cleanupsbunnei2014-04-114-21/+20
| |
| * - removed syscall classes (will just use HLEFunction)bunnei2014-04-116-15/+54
| | | | | | | | | | - added hle.cpp and module registration - removed unused code
| * Merge branch 'master' into hle-interfacebunnei2014-04-111-8/+21
| |\
| * | added initial modules for setting up SysCall HLEbunnei2014-04-117-0/+862
| | |
| * | missed this file with commit 95e5436fbunnei2014-04-111-1/+10
| | |
| * | added Memory::GetCharPointer to read strings from HLE functionsbunnei2014-04-111-0/+4
| | |
| * | cleaned up arm_interface, added a setter to set registers for use with HLE return valuesbunnei2014-04-112-6/+70
| | |
* | | Implement simple LoadSymbols for ELF filesMathieu Vaillancourt2014-04-131-63/+13
| |/ |/|
* | fixed a bunch of errors in CMakeListsbunnei2014-04-101-1/+1
| |
* | updated CMakeListsbunnei2014-04-101-8/+21
|/
* fixed licensing and updated code style naming for arm_interface/arm_interpreter frontend modulebunnei2014-04-093-94/+57
|
* fixed project includes to use new directory structurebunnei2014-04-0934-251/+255
|
* got rid of 'src' folders in each sub-projectbunnei2014-04-0948-0/+0
|
* fixed some license headers that I missedbunnei2014-04-092-46/+6
|
* fixed all license file headers in corebunnei2014-04-0912-303/+44
|
* fixed licensing issue with core_timing being GPL v2+ instead of Dolphin's GPL v2bunnei2014-04-092-487/+455
|
* Merge branch 'hardware-interface'bunnei2014-04-0713-47/+386
|\ | | | | | | | | Conflicts: src/core/src/core.h
| * removed log message from hw_lcdbunnei2014-04-071-2/+0
| |
| * added hack physical memory reads with Memory::GetPointerbunnei2014-04-071-2/+9
| |
| * calling SwapBuffers from hw_lcd.cppbunnei2014-04-061-0/+2
| |
| * initialize VideoCorebunnei2014-04-061-2/+3
| |
| * added g_app_core->Step and HW::Update to Core::SingleStep to be consistent with other changes madebunnei2014-04-051-1/+5
| |
| * changed hw_lcd to use ARM core correct tick counter instead of [what was actually] just an instruction count. this seems to fix timing issues with the 3DS_Homebrew_Pong3Dv2 demo.bunnei2014-04-053-8/+48
| |
| * add hw_lcd.* to VS project filesbunnei2014-04-052-0/+8
| |
| * added an "Update" method to update all hardwarebunnei2014-04-052-0/+10
| |
| * added a module for interfacing to hardware LCDbunnei2014-04-052-0/+129
| |
| * added a tick counterbunnei2014-04-051-4/+12
| |
| * added initial support for hw.cpp modulebunnei2014-04-058-52/+69
| |
| * added hw module to interface h/w register reads/writesbunnei2014-04-055-3/+118
| |
| * renamed some functionsbunnei2014-04-051-11/+11
| |
* | Remove Core::GetState(). Use new ARM_Interface instead.Mathieu Vaillancourt2014-04-051-2/+0
|/
* added entry point loading from ELF filebunnei2014-04-051-2/+4
|
* - added an interface layer for ARM coresbunnei2014-04-057-77/+213
| | | | - cleaned up core.cpp a bit
* renamed ARM disassembler class from "Arm" to "ARM_Disasm"bunnei2014-04-052-27/+27
|
* got rid of some really poorly named macros in SkyEye corebunnei2014-04-053-9/+9
|
* moved arm core to interpreter directorybunnei2014-04-0517-65/+71
|
* added some commented out ARMulator functionsbunnei2014-04-041-20/+3
|
* added hack to allow physical mem read/writesbunnei2014-04-041-2/+20
|
* made memory #define's enum to make debugging easierbunnei2014-04-041-15/+21
|
* Add Core::GetState() for debuggerMathieu Vaillancourt2014-04-042-0/+9
|
* removed some useless log messagesbunnei2014-04-041-2/+0
|
* added thumb mode emulationbunnei2014-04-046-4/+522
|
* convert tabs to spacesbunnei2014-04-0210-6796/+6796
|
* -converted tabs to spacesbunnei2014-04-022-149/+145
| | | | -moved scratchpad memory out of MemArena
* added very hackish ARMulator core initialization and CPU steppingbunnei2014-04-011-6/+97
|
* added ELF loading support to loader.cppbunnei2014-04-011-69/+113
|
* commented out bswap stuff... ARM ELF files are little endian anywaybunnei2014-04-011-9/+10
|
* added support for reading/writing to stack membunnei2014-04-013-17/+40
|
* replaced some error logs with debug assertsbunnei2014-03-301-4/+2
|
* removed unnecessary debug assertbunnei2014-03-301-1/+0
|
* added ARM11 MMU from skyeyebunnei2014-03-306-145/+116
|
* initialize mem regionsbunnei2014-03-301-0/+2
|
* added various arm modules from skyeye to make project link OKbunnei2014-03-309-166/+2582
|
* added a GetPointer function to Memory for use with ELF loadingbunnei2014-03-253-30/+33
|
* updated Windows project files to include ELF filesbunnei2014-03-252-0/+7
|
* added Dolphin's ELF reader to the projectbunnei2014-03-253-0/+594
|
* renamed FILETYPE_CTR_DIRECTORY to FILETYPE_DIRECTORY_CXIShizZy2013-10-062-12/+10
|
* fixed a typo in declaration of meta file systemShizZy2013-10-061-2/+2
|
* moved some core functions over to system moduleShizZy2013-10-034-13/+11
|
* added core_timing and system modules to core vcprojShizZy2013-10-026-2/+823
|
* added an early function for booting from a directoryShizZy2013-10-022-16/+35
|
* added a message option to Core::Halt functionShizZy2013-10-022-2/+2
|
* upgraded proj files to vs 2013ShizZy2013-09-271-1/+5
|
* added system.h to projectShizZy2013-09-275-22/+87
|
* added meta_file_system to projectShizZy2013-09-264-0/+637
|
* renamed file_sys_directory.* to directory_file_system.*ShizZy2013-09-264-5/+5
|
* moved file_sys back to coreShizZy2013-09-265-0/+982
|
* removed <windows.h> include from common.h and added it only where neededShizZy2013-09-241-0/+4
|
* moved file_sys to commonShizZy2013-09-245-982/+0
|
* removed unused commented-out codeShizZy2013-09-241-154/+0
|
* renamed PSPFileInfo to just FileInfoShizZy2013-09-243-21/+21
|
* added PPSSPP's file system directory module for game loadingShizZy2013-09-243-10/+138
|
* ppsspp file system module - currently unusedShizZy2013-09-203-0/+1008
|
* added a module for loading bootable binariesShizZy2013-09-204-0/+203
|
* added mem_map hardware writingShizZy2013-09-203-75/+76
|
* added hw R/W/ memory functionsShizZy2013-09-195-3/+161
|
* refactored some mem_map stuffShizZy2013-09-192-19/+36
|
* added log msg to coreShizZy2013-09-191-0/+2
|
* added ARMulator/skyeye ARM11 core to the projectShizZy2013-09-1818-0/+11356
|
* renamed project to 'citrus'ShizZy2013-09-144-4/+4
|
* cleaned up VS project filesShizZy2013-09-091-52/+7
|
* updated common pathsShizZy2013-09-081-0/+2
|
* start of 3DS memory mapShizZy2013-09-062-4/+77
|
* added core and mem_map files to the projectShizZy2013-09-066-2/+232
|
* added an ARM disassembler from the android projectShizZy2013-09-054-0/+1175
|
* added missing filesShizZy2013-09-051-0/+2
|
* various fixes to be able to build projectShizZy2013-09-051-16/+19
|
* adding initial project layoutShizZy2013-08-302-0/+196