summaryrefslogtreecommitdiffstats
path: root/src (follow)
Commit message (Expand)AuthorAgeFilesLines
* Merge pull request #3271 from bunnei/time-rewritebunnei2020-01-2043-534/+3665
|\
| * service: time: Implement GetStandardLocalSystemClock.bunnei2020-01-053-1/+9
| * time: Remove overflow error checking (currently breaks ADO builds).bunnei2020-01-042-18/+2
| * service: time: Implement GetClockSnapshotFromSystemClockContext.bunnei2020-01-043-3/+27
| * service: time: Implement IsStandardNetworkSystemClockAccuracySufficient.bunnei2020-01-045-1/+51
| * system_archive: Add a basic HLE implementation for time zone binary.bunnei2020-01-044-1/+675
| * service: time: Rewrite implementation of glue services.bunnei2020-01-0435-444/+2834
| * core: Initialize several structs that make use of Common::UUID.bunnei2020-01-045-100/+101
* | Merge pull request #3313 from ReinUsesLisp/vk-rasterizerbunnei2020-01-204-1/+1466
|\ \
| * | vk_rasterizer: Address feedbackReinUsesLisp2020-01-182-25/+32
| * | vk_rasterizer: Implement Vulkan's rasterizerReinUsesLisp2020-01-173-1/+1386
| * | renderer_vulkan: Add header as placeholderReinUsesLisp2020-01-172-0/+73
* | | GUI/gamelist: add "None" as an option for second row and remove dynamically duplicate row options (#3309)Bartosz Kaszubowski2020-01-193-14/+53
* | | Merge pull request #3317 from ReinUsesLisp/gl-decomp-cc-decompFernando Sahmkow2020-01-191-27/+5
|\ \ \
| * | | gl_shader_decompiler: Fix decompilation of condition codesReinUsesLisp2020-01-181-27/+5
* | | | gl_state: Use bool instead of GLbooleanReinUsesLisp2020-01-182-3/+3
* | | | Merge pull request #3298 from Simek/missing_hotkeysbunnei2020-01-182-0/+17
|\ \ \ \
| * | | | GUI: add few missing hotkeys to main menuBartosz Kaszubowski2020-01-132-0/+17
* | | | | core/memory: Create a special MapMemoryRegion for physical memory.Markus Wick2020-01-184-4/+31
* | | | | core/hle: Simplify PhysicalMemory usage in vm_manager.Markus Wick2020-01-181-23/+11
* | | | | core/loaders: Simplify PhysicalMemory usage.Markus Wick2020-01-183-8/+12
* | | | | Merge pull request #3305 from ReinUsesLisp/point-size-programbunnei2020-01-184-2/+13
|\ \ \ \ \
| * | | | | gl_state: Implement PROGRAM_POINT_SIZEReinUsesLisp2020-01-154-2/+13
* | | | | | Merge pull request #3312 from ReinUsesLisp/atoms-u32bunnei2020-01-185-3/+74
|\ \ \ \ \ \
| * | | | | | shader/memory: Implement ATOMS.ADD.U32ReinUsesLisp2020-01-165-3/+74
* | | | | | | Remove unused CPU Vendor string and telemtry fieldJames Rowe2020-01-183-114/+0
* | | | | | | Add headbar icon on LinuxTotalCaesar6592020-01-181-1/+1
* | | | | | | Merge pull request #3306 from ReinUsesLisp/gl-texturebunnei2020-01-171-9/+7
|\ \ \ \ \ \ \ | |_|_|_|/ / / |/| | | | | |
| * | | | | | gl_texture_cache: Use local variables to simplify DownloadTextureReinUsesLisp2020-01-141-6/+4
| * | | | | | gl_texture_cache: Fix format for RGBX16FReinUsesLisp2020-01-141-1/+1
| * | | | | | gl_texture_cache: Use Snorm internal format for RG8SReinUsesLisp2020-01-141-1/+1
| * | | | | | gl_texture_cache: Use Snorm internal format for ABGR8SReinUsesLisp2020-01-141-1/+1
| | |/ / / / | |/| | | |
* | | | | | Merge pull request #3311 from ReinUsesLisp/z32fx24s8bunnei2020-01-171-1/+1
|\ \ \ \ \ \ | |_|_|_|/ / |/| | | | |
| * | | | | format_lookup_table: Fix ZF32_X24S8 component typesReinUsesLisp2020-01-161-1/+1
| | |/ / / | |/| | |
* | | | | Merge pull request #3300 from ReinUsesLisp/vk-texture-cachebunnei2020-01-175-5/+724
|\ \ \ \ \ | |/ / / / |/| | | |
| * | | | vk_texture_cache: Address feedbackReinUsesLisp2020-01-162-22/+8
| * | | | vk_texture_cache: Fix typo in commentaryRodrigo Locatti2020-01-161-1/+1
| * | | | vk_texture_cache: Implement generic texture cache on VulkanReinUsesLisp2020-01-144-1/+733
| * | | | texture_cache/surface_params: Make GetNumLayers publicReinUsesLisp2020-01-141-4/+5
| | |/ / | |/| |
* | | | Merge pull request #3308 from lioncash/privatebunnei2020-01-161-2/+2
|\ \ \ \
| * | | | maxwell_3d: Make dirty_pointers privateLioncash2020-01-161-2/+2
| | |/ / | |/| |
* | | | Merge pull request #3304 from lioncash/fwd-declbunnei2020-01-162-15/+16
|\ \ \ \
| * | | | renderer_opengl/utils: Remove unused header inclusionsLioncash2020-01-151-3/+0
| * | | | renderer_opengl/utils: Forward declare private structsLioncash2020-01-152-12/+16
* | | | | Fix git version in scm_rev.cppJames Rowe2020-01-161-0/+5
| |/ / / |/| | |
* | | | Merge pull request #3303 from lioncash/reorderRodrigo Locatti2020-01-141-1/+1
|\ \ \ \
| * | | | control_flow: Silence -Wreorder warning for CFGRebuildStateLioncash2020-01-141-1/+1
| |/ / /
* | | | Merge pull request #3302 from lioncash/unused-varRodrigo Locatti2020-01-141-7/+4
|\ \ \ \
| * | | | gl_shader_cache: Remove unused STAGE_RESERVED_UBOS constantLioncash2020-01-141-3/+0
| * | | | gl_shader_cache: std::move entries in CachedShader constructorLioncash2020-01-141-3/+4
| * | | | gl_shader_cache: Remove unused entries variable in BuildShader()Lioncash2020-01-141-1/+0
| |/ / /
* | | | Merge pull request #3296 from Simek/hotkeys_resizebunnei2020-01-141-0/+1
|\ \ \ \ | |/ / / |/| | |
| * | | GUI/configure: resize hotkeys column to contentBartosz Kaszubowski2020-01-121-0/+1
| |/ /
* | | Merge pull request #3287 from ReinUsesLisp/ldg-stg-16bunnei2020-01-142-34/+52
|\ \ \
| * | | shader_ir/memory: Implement u16 and u8 for STG and LDGReinUsesLisp2020-01-092-34/+52
* | | | Merge pull request #3288 from ReinUsesLisp/uncurse-aoffibunnei2020-01-141-10/+6
|\ \ \ \
| * | | | shader_ir/texture: Simplify AOFFI codeReinUsesLisp2020-01-091-10/+6
| |/ / /
* | | | Merge pull request #3290 from ReinUsesLisp/gl-clampbunnei2020-01-143-6/+11
|\ \ \ \
| * | | | maxwell_to_vk: Implement GL_CLAMP hacking Nvidia's driverReinUsesLisp2020-01-103-6/+11
| |/ / /
* | | | Merge pull request #3292 from degasus/heap_space_fixbunnei2020-01-141-2/+2
|\ \ \ \ | |_|/ / |/| | |
| * | | core/kernel: Fix GetTotalPhysicalMemoryUsed.Markus Wick2020-01-111-2/+2
| |/ /
* | | vk_compute_pass: Address feedbackRodrigo Locatti2020-01-111-0/+2
* | | vk_compute_pass: Add compute passes to emulate missing Vulkan featuresReinUsesLisp2020-01-083-0/+416
* | | vk_shader_util: Add helper to build SPIR-V shadersReinUsesLisp2020-01-083-0/+53
|/ /
* | Merge pull request #3279 from ReinUsesLisp/vk-pipeline-cacheFernando Sahmkow2020-01-0810-10/+1172
|\ \
| * | vk_pipeline_cache: Initial implementationReinUsesLisp2020-01-072-1/+460
| * | vk_graphics_pipeline: Initial implementationReinUsesLisp2020-01-074-0/+395
| * | vk_compute_pipeline: Initial implementationReinUsesLisp2020-01-074-0/+219
| * | vk_pipeline_cache: Add file and define descriptor update template fillerReinUsesLisp2020-01-073-0/+67
| * | fixed_pipeline_state: Add depth clampReinUsesLisp2020-01-072-10/+18
| * | vk_rasterizer: Add placeholderReinUsesLisp2020-01-072-0/+14
* | | Merge pull request #3272 from bunnei/vi-close-layerbunnei2020-01-075-11/+48
|\ \ \ | |/ / |/| |
| * | service: vi: Implement CloseLayer.bunnei2020-01-045-11/+48
| |/
* | Merge pull request #3276 from ReinUsesLisp/pipeline-reqsbunnei2020-01-065-1/+345
|\ \
| * | vk_renderpass_cache: Initial implementationReinUsesLisp2020-01-063-0/+199
| * | vk_update_descriptor: Initial implementationReinUsesLisp2020-01-063-1/+146
* | | Merge pull request #3278 from ReinUsesLisp/vk-memory-managerbunnei2020-01-066-309/+415
|\ \ \
| * | | vk_stream_buffer/vk_buffer_cache: Avoid halting and use generic cacheReinUsesLisp2020-01-064-62/+340
| * | | vk_memory_manager: Misc changesReinUsesLisp2020-01-062-88/+142
| * | | vk_buffer_cache: Temporarily remove buffer cacheReinUsesLisp2020-01-062-226/+0
| |/ /
* | | Merge pull request #3277 from ReinUsesLisp/make-currentbunnei2020-01-061-9/+2
|\ \ \
| * | | yuzu/bootmanager: Remove {glx,wgl}MakeCurrent on SwapBuffersReinUsesLisp2020-01-061-9/+2
| |/ /
* | | Merge pull request #3261 from degasus/page_tablebunnei2020-01-062-9/+17
|\ \ \ | |/ / |/| |
| * | core/memory + arm/dynarmic: Use a global offset within our arm page table.Markus Wick2020-01-012-9/+17
* | | Merge pull request #3257 from degasus/no_busy_loopsbunnei2020-01-063-5/+9
|\ \ \
| * | | video_core: Block in WaitFence.Markus Wick2019-12-303-5/+9
* | | | Merge pull request #3264 from ReinUsesLisp/vk-descriptor-poolFernando Sahmkow2020-01-053-0/+147
|\ \ \ \
| * | | | Update src/video_core/renderer_vulkan/vk_descriptor_pool.cppRodrigo Locatti2020-01-031-1/+1
| * | | | vk_descriptor_pool: Initial implementationReinUsesLisp2020-01-013-0/+147
| | |/ / | |/| |
* | | | Merge pull request #2945 from FernandoS27/fix-bcatbunnei2020-01-051-3/+17
|\ \ \ \
| * | | | nifm: Only return that there's an internet connection when there's a BCATServerFernando Sahmkow2019-11-071-3/+17
* | | | | Merge pull request #3258 from FernandoS27/shader-amendbunnei2020-01-045-2/+52
|\ \ \ \ \ | |_|_|_|/ |/| | | |
| * | | | Shader_IR: Address FeedbackFernando Sahmkow2020-01-045-38/+19
| * | | | Shader_IR: add the ability to amend code in the shader ir.Fernando Sahmkow2019-12-305-3/+72
| | |_|/ | |/| |
* | | | Merge pull request #3247 from FernandoS27/remap-fixbunnei2020-01-032-3/+5
|\ \ \ \
| * | | | NvServices: Correct Ioctl Remap.Fernando Sahmkow2019-12-252-3/+5
* | | | | yuzu: Remove Maxwell debuggerReinUsesLisp2020-01-0314-640/+0
* | | | | Merge pull request #3243 from ReinUsesLisp/topologiesbunnei2020-01-021-4/+18
|\ \ \ \ \ | |_|_|_|/ |/| | | |
| * | | | maxwell_to_gl: Implement missing primitive topologiesReinUsesLisp2019-12-231-4/+18
* | | | | Merge pull request #3239 from ReinUsesLisp/p2rbunnei2020-01-012-17/+47
|\ \ \ \ \
| * | | | | shader/p2r: Implement P2R PrReinUsesLisp2019-12-201-1/+15
| * | | | | shader/r2p: Refactor P2R to support P2RReinUsesLisp2019-12-202-17/+33
* | | | | | Merge pull request #3248 from ReinUsesLisp/vk-imageFernando Sahmkow2019-12-303-0/+192
|\ \ \ \ \ \
| * | | | | | vk_image: Avoid unnecesary equalsRodrigo Locatti2019-12-301-1/+1
| * | | | | | vk_image: Add an image object abstractionReinUsesLisp2019-12-253-0/+192
| | |_|/ / / | |/| | | |
* | | | | | Merge pull request #3249 from ReinUsesLisp/vk-staging-buffer-poolFernando Sahmkow2019-12-303-0/+212
|\ \ \ \ \ \ | |_|_|_|/ / |/| | | | |
| * | | | | vk_staging_buffer_pool: Initialize last epoch to zeroRodrigo Locatti2019-12-291-1/+1
| * | | | | vk_staging_buffer_pool: Add a staging pool for temporary operationsReinUsesLisp2019-12-253-0/+212
| |/ / / /
* | | | | Merge pull request #3250 from ReinUsesLisp/empty-fragmentFernando Sahmkow2019-12-282-0/+7
|\ \ \ \ \
| * | | | | gl_rasterizer: Allow rendering without fragment shaderReinUsesLisp2019-12-262-0/+7
| |/ / / /
* | | | | Merge pull request #3228 from ReinUsesLisp/ptpbunnei2019-12-275-74/+142
|\ \ \ \ \ | |/ / / / |/| | | |
| * | | | shader/texture: Implement TLD4.PTPReinUsesLisp2019-12-165-56/+120
| * | | | shader/texture: Enable arrayed TLD4ReinUsesLisp2019-12-161-1/+0
| * | | | gl_shader_decompiler: Rename "sepparate" to "separate"ReinUsesLisp2019-12-161-3/+3
| * | | | shader/texture: Implement AOFFI for TLD4SReinUsesLisp2019-12-161-13/+18
| * | | | shader/texture: Remove unnecesary parenthesisReinUsesLisp2019-12-161-2/+2
* | | | | Merge pull request #3244 from ReinUsesLisp/vk-fpsFernando Sahmkow2019-12-254-6/+594
|\ \ \ \ \
| * | | | | fixed_pipeline_state: Define symetric operator!= and mark as noexceptReinUsesLisp2019-12-242-40/+92
| * | | | | fixed_pipeline_state: Define structure and loadersReinUsesLisp2019-12-233-0/+528
| * | | | | maxwell_3d: Add depth bounds registersReinUsesLisp2019-12-231-6/+14
* | | | | | Merge pull request #3236 from ReinUsesLisp/rasterize-enablebunnei2019-12-256-4/+28
|\ \ \ \ \ \ | |/ / / / / |/| | | | |
| * | | | | gl_rasterizer: Implement RASTERIZE_ENABLEReinUsesLisp2019-12-186-4/+28
* | | | | | Merge pull request #3241 from ReinUsesLisp/gl-shader-cachebunnei2019-12-221-19/+14
|\ \ \ \ \ \ | |_|_|_|/ / |/| | | | |
| * | | | | gl_shader_cache: Update commentary for shared memoryReinUsesLisp2019-12-211-9/+6
| * | | | | gl_shader_cache: Remove unused entry in GetPrimitiveDescriptionReinUsesLisp2019-12-211-11/+9
| | |_|/ / | |/| | |
* | | | | Merge pull request #3238 from ReinUsesLisp/vk-resource-managerbunnei2019-12-224-1/+82
|\ \ \ \ \
| * | | | | vk_resource_manager: Add entry to VKFence to test its usageReinUsesLisp2019-12-191-0/+8
| * | | | | vk_reosurce_manager: Add assert for releasing fencesReinUsesLisp2019-12-191-0/+1
| * | | | | vk_resource_manager: Implement VKFenceWatch move constructorReinUsesLisp2019-12-192-0/+32
| * | | | | vk_device: Add entry to catch device lossesReinUsesLisp2019-12-193-1/+40
| * | | | | vk_device: Add query for RGBA8UintReinUsesLisp2019-12-191-0/+1
* | | | | | Merge pull request #3203 from FernandoS27/tex-cache-fixesbunnei2019-12-224-1/+144
|\ \ \ \ \ \
| * | | | | | Texture Cache: Improve documentationFernando Sahmkow2019-12-222-4/+5
| * | | | | | Texture Cache: Address FeedbackFernando Sahmkow2019-12-222-11/+11
| * | | | | | Texture Cache: Add HLE methods for building 3D textures within the GPU in certain scenarios.Fernando Sahmkow2019-12-224-1/+143
* | | | | | | Merge pull request #3237 from ReinUsesLisp/vk-shader-decompilerFernando Sahmkow2019-12-222-38/+49
|\ \ \ \ \ \ \ | |/ / / / / / |/| | | | | |
| * | | | | | vk_shader_decompiler: Fix full decompilationReinUsesLisp2019-12-191-3/+5
| * | | | | | vk_shader_decompiler: Skip NDC correction when it is nativeReinUsesLisp2019-12-192-1/+2
| * | | | | | vk_shader_decompiler: Normalize output fragment attachmentsReinUsesLisp2019-12-192-12/+12
| * | | | | | vk_shader_decompiler: Update sirit and implement Texture AOFFIReinUsesLisp2019-12-191-22/+30
| |/ / / / /
* | | | | | Merge pull request #3230 from ReinUsesLisp/vk-emu-shadersFernando Sahmkow2019-12-224-0/+122
|\ \ \ \ \ \
| * | | | | | renderer_vulkan/shader: Add helper GLSL shadersReinUsesLisp2019-12-164-0/+122
* | | | | | | Merge pull request #3240 from ReinUsesLisp/decomp-cond-codeFernando Sahmkow2019-12-221-23/+1
|\ \ \ \ \ \ \
| * | | | | | | vk_shader_decompiler: Use Visit instead of reimplementing itReinUsesLisp2019-12-211-23/+1
| | |_|/ / / / | |/| | | | |
* | | | | | | Merge pull request #3235 from ReinUsesLisp/ldg-u8bunnei2019-12-221-6/+32
|\ \ \ \ \ \ \ | |/ / / / / / |/| | | | | |
| * | | | | | shader/memory: Implement LDG.U8 and unaligned U8 loadsReinUsesLisp2019-12-181-6/+32
| | |_|/ / / | |/| | | |
* | | | | | Merge pull request #3234 from ReinUsesLisp/i2f-u8-selectorbunnei2019-12-201-2/+13
|\ \ \ \ \ \
| * | | | | | shader/conversion: Implement byte selector in I2FReinUsesLisp2019-12-181-2/+13
| |/ / / / /
* | | | | | Merge pull request #3233 from ReinUsesLisp/mismatch-sizesbunnei2019-12-201-4/+9
|\ \ \ \ \ \
| * | | | | | shader/texture: Properly shrink unused entries in size mismatchesReinUsesLisp2019-12-181-4/+9
| |/ / / / /
* | | | | | Merge pull request #3232 from ReinUsesLisp/gl-decompiler-imagesbunnei2019-12-191-0/+1
|\ \ \ \ \ \
| * | | | | | gl_shader_decompiler: Add missing DeclareImagesReinUsesLisp2019-12-181-0/+1
| |/ / / / /
* | | | | | Merge pull request #3231 from ReinUsesLisp/tld4s-encodingbunnei2019-12-191-1/+1
|\ \ \ \ \ \ | |_|_|/ / / |/| | | | |
| * | | | | shader_bytecode: Fix TLD4S encodingReinUsesLisp2019-12-181-1/+1
| |/ / / /
* | | | | Merge pull request #3221 from ReinUsesLisp/vk-schedulerbunnei2019-12-192-37/+311
|\ \ \ \ \ | |/ / / / |/| | | |
| * | | | vk_scheduler: Delegate commands to a worker thread and state trackReinUsesLisp2019-12-132-37/+311
* | | | | Merge pull request #3173 from yuzu-emu/bunnei-spscqueuebunnei2019-12-171-2/+9
|\ \ \ \ \ | |_|/ / / |/| | | |
| * | | | common: SPSCQueue: Notify after incrementing queue size.bunnei2019-12-171-2/+9
* | | | | Merge pull request #3182 from ReinUsesLisp/renderer-openglbunnei2019-12-162-131/+115
|\ \ \ \ \ | |_|_|/ / |/| | | |
| * | | | renderer_opengl: Make ScreenRectVertex's constructor constexprReinUsesLisp2019-11-291-12/+7
| * | | | renderer_opengl: Remove C castsReinUsesLisp2019-11-291-4/+5
| * | | | renderer_opengl: Use explicit binding for presentation shadersReinUsesLisp2019-11-292-34/+20
| * | | | renderer_opengl: Drop macros for message decorationsReinUsesLisp2019-11-291-21/+26
| * | | | renderer_opengl: Move static definitions to anonymous namespaceReinUsesLisp2019-11-291-62/+66
| * | | | renderer_opengl: Move commentaries to header fileReinUsesLisp2019-11-292-20/+13
* | | | | Merge pull request #3219 from FernandoS27/fix-bindlessRodrigo Locatti2019-12-164-47/+124
|\ \ \ \ \
| * | | | | Shader_IR: Correct TLD4S Depth Compare.Fernando Sahmkow2019-12-122-9/+16
| * | | | | Shader_Ir: Correct TLD4S encoding and implement f16 flag.Fernando Sahmkow2019-12-123-11/+15
| * | | | | Gl_Shader_compiler: Correct Depth Compare for Texture Gather operations.Fernando Sahmkow2019-12-121-8/+21
| * | | | | Shader_Ir: default failed tracks on bindless samplers to null values.Fernando Sahmkow2019-12-122-24/+77
* | | | | | Merge pull request #3222 from ReinUsesLisp/maxwell-to-vkbunnei2019-12-153-111/+243
|\ \ \ \ \ \
| * | | | | | maxwell_to_vk: Improve image format table and add more formatsReinUsesLisp2019-12-132-89/+127
| * | | | | | maxwell_to_vk: Implement more vertex formatsReinUsesLisp2019-12-131-7/+81
| * | | | | | maxwell_to_vk: Implement more primitive topologiesReinUsesLisp2019-12-132-2/+11
| * | | | | | maxwell_to_vk: Approach GL_CLAMP closer to the GL specReinUsesLisp2019-12-133-9/+17
| * | | | | | maxwell_to_vk: Use VK_EXT_index_type_uint8 when availableReinUsesLisp2019-12-132-4/+7
| | |_|_|/ / | |/| | | |
* | | | | | Merge pull request #3213 from ReinUsesLisp/intel-mesabunnei2019-12-141-1/+4
|\ \ \ \ \ \
| * | | | | | gl_device: Enable compute shaders for Intel Mesa driversReinUsesLisp2019-12-111-1/+4
| | |_|_|/ / | |/| | | |
* | | | | | Merge pull request #3212 from ReinUsesLisp/fix-smem-lmembunnei2019-12-141-2/+2
|\ \ \ \ \ \
| * | | | | | gl_shader_cache: Add missing new-line on emitted GLSLReinUsesLisp2019-12-111-2/+2
* | | | | | | Merge pull request #3214 from lioncash/svc-funcbunnei2019-12-132-9/+6
|\ \ \ \ \ \ \ | |_|_|/ / / / |/| | | | | |
| * | | | | | kernel/svc: Correct function signature of SignalProcessWideKeyLioncash2019-12-112-9/+6
| | |/ / / / | |/| | | |
* | | | | | Merge pull request #3217 from jhol/fix-boost-includebunnei2019-12-121-0/+1
|\ \ \ \ \ \ | |_|_|/ / / |/| | | | |
| * | | | | Added missing includeJoel Holdsworth2019-12-111-0/+1
* | | | | | Gl_Rasterizer: Skip Tesselation Control and Eval stages as they are un implemented.Fernando Sahmkow2019-12-111-0/+8
* | | | | | Merge pull request #3210 from ReinUsesLisp/memory-barrierbunnei2019-12-115-1/+46
|\ \ \ \ \ \ | |/ / / / / |/| | | | |
| * | | | | shader: Implement MEMBAR.GLReinUsesLisp2019-12-105-1/+46
| | |/ / / | |/| | |
* | | | | Kernel: Correct behavior of Address Arbiter threads. (#3165)Fernando Sahmkow2019-12-113-24/+67
| |/ / / |/| | |
* | | | Merge pull request #3201 from lioncash/dumpbunnei2019-12-112-2/+24
|\ \ \ \
| * | | | kernel/svc: Provide implementations for svcDumpInfo/svcDumpInfoNewLioncash2019-12-082-2/+24
* | | | | Maxwell3D: Implement Depth Mode.Fernando Sahmkow2019-12-114-8/+15
| |/ / / |/| | |
* | | | vk_shader_decompiler: Fix build issues on old gcc versionsReinUsesLisp2019-12-101-2/+3
* | | | vk_shader_decompiler: Reduce YNegate's severityReinUsesLisp2019-12-101-1/+1
* | | | shader_ir/other: Implement S2R InvocationIdReinUsesLisp2019-12-104-0/+9
* | | | vk_shader_decompiler: Misc changesReinUsesLisp2019-12-102-697/+1648
* | | | shader: Keep track of shaders using warp instructionsReinUsesLisp2019-12-102-0/+8
* | | | shader_ir/memory: Implement patch storesReinUsesLisp2019-12-104-20/+38
* | | | vk_device: Misc changesReinUsesLisp2019-12-092-117/+276
* | | | Merge pull request #3198 from ReinUsesLisp/tessellation-maxwellbunnei2019-12-091-2/+37
|\ \ \ \
| * | | | maxwell_3d: Add tessellation tess level registersReinUsesLisp2019-12-071-1/+6
| * | | | maxwell_3d: Add tessellation mode registerReinUsesLisp2019-12-071-1/+28
| * | | | maxwell_3d: Add patch vertices registerReinUsesLisp2019-12-071-1/+4
* | | | | externals: Update Vulkan-HeadersReinUsesLisp2019-12-092-2/+14
* | | | | Merge pull request #3199 from ReinUsesLisp/vk-swapchainRodrigo Locatti2019-12-092-24/+31
|\ \ \ \ \
| * | | | | vk_swapchain: Add support for swapping sRGBReinUsesLisp2019-12-072-24/+31
| |/ / / /
* | / / / kernel: Remove unnecessary includesLioncash2019-12-0815-11/+17
| |/ / / |/| | |
* | | | Merge pull request #3195 from FernandoS27/clear-exclusivebunnei2019-12-072-1/+2
|\ \ \ \ | |/ / / |/| | |
| * | | CpuCore: Clear exclusive state after doing a run in dynarmic.Fernando Sahmkow2019-12-052-1/+2
* | | | shader_bytecode: Remove corrupted characterReinUsesLisp2019-12-071-1/+1
* | | | Merge pull request #3109 from FernandoS27/new-instrbunnei2019-12-076-8/+171
|\ \ \ \ | |/ / / |/| | |
| * | | Shader_IR: Address FeedbackFernando Sahmkow2019-11-183-11/+9
| * | | Shader_IR: Implement TXD instruction.Fernando Sahmkow2019-11-145-8/+120
| * | | Shader_IR: Implement FLO instruction.Fernando Sahmkow2019-11-145-0/+35
| * | | Shader_Bytecode: Add encodings for FLO, SHF and TXDFernando Sahmkow2019-11-141-0/+18
* | | | telemetry_session: Report renderer backendReinUsesLisp2019-12-021-0/+1
* | | | telemetry_session: Use temporary to avoid writing the same enumReinUsesLisp2019-12-021-16/+11
* | | | Merge pull request #2987 from FernandoS27/texture-invalidbunnei2019-12-023-32/+101
|\ \ \ \
| * | | | Texture_Cache: Redo invalid Surfaces handling.Fernando Sahmkow2019-11-203-32/+101
* | | | | Merge pull request #3177 from bunnei/new-ipc-reqbunnei2019-12-0119-167/+246
|\ \ \ \ \
| * | | | | kernel: Implement a more accurate IPC dispatch.bunnei2019-11-2819-167/+246
| | |_|/ / | |/| | |
* | | | | Merge pull request #3184 from ReinUsesLisp/framebuffer-cachebunnei2019-12-014-72/+69
|\ \ \ \ \
| * | | | | gl_framebuffer_cache: Optimize framebuffer keyReinUsesLisp2019-11-293-46/+60
| * | | | | gl_rasterizer: Re-enable framebuffer cache for clear buffersReinUsesLisp2019-11-293-32/+15
| |/ / / /
* / / / / texture_cache/surface_base: Fix out of bounds texture viewsReinUsesLisp2019-11-291-7/+4
|/ / / /
* | | | Merge pull request #3169 from lioncash/memorybunnei2019-11-2849-721/+1314
|\ \ \ \
| * | | | core/memory; Migrate over SetCurrentPageTable() to the Memory classLioncash2019-11-273-26/+34
| * | | | core/memory: Migrate over GetPointerFromVMA() to the Memory classLioncash2019-11-271-36/+36
| * | | | core/memory: Migrate over Write{8, 16, 32, 64, Block} to the Memory classLioncash2019-11-2714-153/+298
| * | | | core/memory: Migrate over Read{8, 16, 32, 64, Block} to the Memory classLioncash2019-11-2719-178/+305
| * | | | core/memory: Migrate over ZeroBlock() and CopyBlock() to the Memory classLioncash2019-11-272-91/+161
| * | | | core/memory: Migrate over RasterizerMarkRegionCached() to the Memory classLioncash2019-11-273-70/+79
| * | | | core/memory: Migrate over ReadCString() to the Memory classLioncash2019-11-273-18/+40
| * | | | core/memory: Migrate over GetPointer()Lioncash2019-11-277-25/+53
| * | | | core: Prepare various classes for memory read/write migrationLioncash2019-11-2724-61/+108
| * | | | core/memory: Move memory read/write implementation functions into an anonymous namespaceLioncash2019-11-271-97/+98
| * | | | core/memory: Migrate over address checking functions to the new Memory classLioncash2019-11-276-39/+70
| * | | | core/memory: Migrate over memory mapping functions to the new Memory classLioncash2019-11-276-128/+180
| * | | | core/memory: Introduce skeleton of Memory classLioncash2019-11-274-3/+56
* | | | | Merge pull request #3171 from lioncash/internal-linkbunnei2019-11-282-6/+5
|\ \ \ \ \
| * | | | | filesys/romfs: Remove unused includesLioncash2019-11-272-4/+2
| * | | | | filesys/romfs: Make ProcessFile and ProcessDirectory internally linkedLioncash2019-11-271-2/+3
* | | | | | patch_manager: Adds check for disabled cheats to prevent them from being enabled (#3178)Morph2019-11-281-5/+11
* | | | | | Merge pull request #3170 from lioncash/enumbunnei2019-11-282-3/+3
|\ \ \ \ \ \
| * | | | | | file_sys/directory: Make EntryType an enum classLioncash2019-11-272-3/+3
| |/ / / / /
* | | | | | Merge pull request #3174 from lioncash/optionalRodrigo Locatti2019-11-281-2/+1
|\ \ \ \ \ \
| * | | | | | video_core/gpu_thread: Tidy up SwapBuffers()Lioncash2019-11-271-2/+1
| | |/ / / / | |/| | | |
* | | | | | video_core/const_buffer_locker: Make use of std::tie in HasEqualKeys()Lioncash2019-11-271-2/+3
* | | | | | video_core/const_buffer_locker: Remove unused includesLioncash2019-11-272-2/+2
* | | | | | video_core/const_buffer_locker: Remove #pragma once from cpp fileLioncash2019-11-271-2/+0
|/ / / / /
* | | | | Merge pull request #3143 from ReinUsesLisp/indexing-bugbunnei2019-11-272-48/+2
|\ \ \ \ \
| * | | | | gl_device: Deduce indexing bug from device instead of heuristicReinUsesLisp2019-11-252-48/+2
* | | | | | core_timing: Use better reference tracking for EventType. (#3159)bunnei2019-11-2717-161/+103
| |/ / / / |/| | | |
* | | | | Merge pull request #3164 from ReinUsesLisp/half-cast-floatbunnei2019-11-261-1/+2
|\ \ \ \ \
| * | | | | gl_shader_decompiler: Fix casts from fp32 to f16ReinUsesLisp2019-11-261-1/+2
| |/ / / /
* / / / / kernel: Fix reference management for client/server session.bunnei2019-11-263-20/+18
|/ / / /
* | | | Merge pull request #3158 from ReinUsesLisp/srgb-blitbunnei2019-11-251-0/+1
|\ \ \ \
| * | | | gl_texture_cache: Apply sRGB on blitsReinUsesLisp2019-11-241-0/+1
* | | | | Merge pull request #3094 from lioncash/tablesbunnei2019-11-2533-7/+192
|\ \ \ \ \
| * | | | | service: Update function tablesLioncash2019-11-1233-7/+192
* | | | | | Merge pull request #3155 from bunnei/fix-asynch-gpu-waitbunnei2019-11-251-17/+15
|\ \ \ \ \ \
| * | | | | | gpu_thread: Don't spin wait if there are no GPU commands.bunnei2019-11-231-17/+15
| | |/ / / / | |/| | | |
* | | | | | kernel: Replace usage of boost::intrusive_ptr with std::shared_ptr for kernel objects. (#3154)bunnei2019-11-2574-378/+377
* | | | | | Merge pull request #3098 from ReinUsesLisp/shader-invalidationsbunnei2019-11-2531-744/+742
|\ \ \ \ \ \
| * | | | | | gl_device: Reserve base bindings on limited devicesReinUsesLisp2019-11-231-36/+76
| * | | | | | gl_state: Skip null texture bindsReinUsesLisp2019-11-231-1/+5
| * | | | | | gl_rasterizer: Disable compute shaders on IntelReinUsesLisp2019-11-233-0/+12
| * | | | | | gl_shader_cache: Hack shared memory sizeReinUsesLisp2019-11-231-2/+3
| * | | | | | gl_shader_decompiler: Normalize image bindingsReinUsesLisp2019-11-233-33/+19
| * | | | | | gl_shader_decompiler: Normalize cbuf bindingsReinUsesLisp2019-11-232-10/+6
| * | | | | | gl_rasterizer: Add missing cbuf counter reset on computeReinUsesLisp2019-11-231-0/+2
| * | | | | | gl_shader_cache: Remove dynamic BaseBinding specializationReinUsesLisp2019-11-2316-192/+200
| * | | | | | video_core: Unify ProgramType and ShaderStage into ShaderTypeReinUsesLisp2019-11-2322-289/+262
| * | | | | | gl_rasterizer: Bind graphics images to draw commandsReinUsesLisp2019-11-234-33/+54
| * | | | | | gl_shader_cache: Specialize local memory size for compute shadersReinUsesLisp2019-11-236-21/+32
| * | | | | | gl_shader_cache: Specialize shared memory sizeReinUsesLisp2019-11-235-29/+25
| * | | | | | gl_shader_cache: Specialize shader workgroupReinUsesLisp2019-11-236-68/+74
| * | | | | | shader/texture: Handle TLDS texture type mismatchesReinUsesLisp2019-11-231-1/+10
| * | | | | | shader/texture: Deduce texture buffers from lockerReinUsesLisp2019-11-239-174/+107
| | |_|/ / / | |/| | | |
* | | | | | Merge pull request #3105 from ReinUsesLisp/fix-stencil-regbunnei2019-11-241-3/+3
|\ \ \ \ \ \
| * | | | | | maxwell_3d: Fix stencil_back_func_mask offsetReinUsesLisp2019-11-131-3/+3
* | | | | | | Merge pull request #3156 from bunnei/sys-ticksbunnei2019-11-241-1/+4
|\ \ \ \ \ \ \
| * | | | | | | Update svc.cppbunnei2019-11-231-0/+1
| * | | | | | | svc: GetSystemTick should return cntpct_el0, not core ticks.bunnei2019-11-231-1/+3
| | |_|/ / / / | |/| | | | |
* | | | | | | Merge pull request #3153 from FearlessTobi/port-4964bunnei2019-11-241-2/+3
|\ \ \ \ \ \ \
| * | | | | | | fix clang-format and lambda captureWeiyi Wang2019-11-231-1/+2
| * | | | | | | unfold UNREACHABLE implementation for dumb compilersWeiyi Wang2019-11-231-2/+2
* | | | | | | | Merge pull request #3145 from ReinUsesLisp/buffer-cache-initbunnei2019-11-241-10/+10
|\ \ \ \ \ \ \ \ | |_|/ / / / / / |/| | | | | | |
| * | | | | | | buffer_cache: Remove brace initialized for objects with default constructorReinUsesLisp2019-11-201-10/+10
| | |_|/ / / / | |/| | | | |
* | | | | | | Merge pull request #3114 from FernandoS27/cond-varbunnei2019-11-235-22/+74
|\ \ \ \ \ \ \
| * | | | | | | Kernel: Optimize condition variable threads management.Fernando Sahmkow2019-11-214-24/+21
| * | | | | | | Kernel: Correct SignalProcessWideKeyFernando Sahmkow2019-11-211-6/+2
| * | | | | | | Kernel: Correct behavior of Condition Variables to be more similar to real hardware.Fernando Sahmkow2019-11-215-15/+74
| |/ / / / / /
* | | | | | | Merge pull request #3141 from ReinUsesLisp/gl-positionbunnei2019-11-231-0/+1
|\ \ \ \ \ \ \
| * | | | | | | gl_shader_gen: Apply default value to gl_PositionReinUsesLisp2019-11-201-0/+1
* | | | | | | | Merge pull request #3130 from FernandoS27/cancel-syncbunnei2019-11-233-2/+19
|\ \ \ \ \ \ \ \ | |_|_|/ / / / / |/| | | | | | |
| * | | | | | | Kernel: Correct Cancel Synchronization.Fernando Sahmkow2019-11-163-2/+19
* | | | | | | | Merge pull request #3140 from FearlessTobi/port-4953bunnei2019-11-211-13/+0
|\ \ \ \ \ \ \ \
| * | | | | | | | citra_qt/main.ui: remove unused actions "Load Symbol Map..." and...Tobias2019-11-191-13/+0
* | | | | | | | | Merge pull request #3112 from lioncash/skipbunnei2019-11-211-8/+16
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | service/am: Remove unnecessary Skip callsLioncash2019-11-141-8/+16
* | | | | | | | | | Merge pull request #3111 from lioncash/querybunnei2019-11-212-5/+14
|\ \ \ \ \ \ \ \ \ \ | |_|_|_|_|/ / / / / |/| | | | | | | | |
| * | | | | | | | | am: Stub QueryApplicationPlayStatisticsLioncash2019-11-142-5/+14
| |/ / / / / / / /
* | | | | | | | | shader/other: Reduce DEPBAR log severityReinUsesLisp2019-11-201-1/+1
* | | | | | | | | Merge pull request #3086 from ReinUsesLisp/format-lookupsbunnei2019-11-2012-555/+442
|\ \ \ \ \ \ \ \ \ | |_|_|_|/ / / / / |/| | | | | | | |
| * | | | | | | | format_lookup_table: Address feedbackReinUsesLisp2019-11-152-30/+24
| * | | | | | | | texture_cache: Use a table instead of switch for texture formatsReinUsesLisp2019-11-159-261/+290
| * | | | | | | | texture_cache: Drop abstracted ComponentTypeReinUsesLisp2019-11-148-294/+158
* | | | | | | | | common/logging: Silence no return value warningsReinUsesLisp2019-11-151-2/+6
* | | | | | | | | Merge pull request #3047 from ReinUsesLisp/clip-controlbunnei2019-11-159-82/+50
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | gl_rasterizer: Remove front facing hackReinUsesLisp2019-11-071-12/+0
| * | | | | | | | | gl_shader_decompiler: Fix typo "y_negate"->"y_direction"ReinUsesLisp2019-11-071-1/+1
| * | | | | | | | | gl_shader_manager: Remove unused variable in SetFromRegsReinUsesLisp2019-11-071-1/+0
| * | | | | | | | | yuzu_cmd: Use string_view instead of string for extensionsReinUsesLisp2019-11-071-3/+3
| * | | | | | | | | gl_rasterizer: Emulate viewport flipping with ARB_clip_controlReinUsesLisp2019-11-079-76/+57
| | |_|_|_|_|_|_|/ | |/| | | | | | |
* | | | | | | | | Merge pull request #3091 from lioncash/core-conversionbunnei2019-11-1535-170/+182
|\ \ \ \ \ \ \ \ \ | |_|_|_|_|/ / / / |/| | | | | | | |
| * | | | | | | | externals: Update httplibLioncash2019-11-121-1/+1
| * | | | | | | | service: Resolve sign conversion errorsLioncash2019-11-1215-58/+55
| * | | | | | | | perf_stats: Resolve implicit int to double conversion errorLioncash2019-11-121-1/+1
| * | | | | | | | loader; Resolve sign conversion/truncation errorsLioncash2019-11-123-6/+6
| * | | | | | | | gdbstub: Resolve sign conversion errorsLioncash2019-11-121-1/+2
| * | | | | | | | kernel: Resolve sign conversion warningsLioncash2019-11-124-72/+60
| * | | | | | | | file_sys: Resolve sign conversion warningsLioncash2019-11-124-12/+10
| * | | | | | | | result: Add default error code for the ResultCode(-1) caseLioncash2019-11-121-1/+9
| * | | | | | | | crypto: Resolve sign-conversion warningsLioncash2019-11-122-11/+12
| * | | | | | | | result: Resolve sign-coversion warningsLioncash2019-11-121-1/+1
| * | | | | | | | arm_unicorn: Resolve sign conversion warningsLioncash2019-11-123-8/+10
| * | | | | | | | CMakeLists: Make most implicit type conversion warnings errors on MSVCLioncash2019-11-121-0/+17
| | |_|_|_|_|/ / | |/| | | | | |
* | | | | | | | Merge pull request #3113 from lioncash/semiRodrigo Locatti2019-11-151-4/+6
|\ \ \ \ \ \ \ \ | |_|_|/ / / / / |/| | | | | | |
| * | | | | | | common_funcs: Remove semicolons from INSERT_PADDING_* macrosLioncash2019-11-141-4/+6
| | |_|/ / / / | |/| | | | |
* / | | | | | correct the implementation of RGBA16UIgreggameplayer2019-11-141-0/+2
|/ / / / / /
* | | | | | Merge pull request #3089 from SciresM/play_statisticsbunnei2019-11-142-0/+10
|\ \ \ \ \ \
| * | | | | | Implement stub for QueryApplicationPlayStatisticsByUidMichael Scire2019-11-112-0/+10
| |/ / / / /
* | | | | | Merge pull request #3093 from lioncash/mbedtlsbunnei2019-11-147-12/+12
|\ \ \ \ \ \
| * | | | | | core: Migrate off deprecated mbedtls functionsLioncash2019-11-127-12/+12
| |/ / / / /
* | | | | | Merge pull request #3092 from lioncash/utilbunnei2019-11-141-11/+15
|\ \ \ \ \ \ | |_|_|_|_|/ |/| | | | |
| * | | | | key_manager: Make use of IOFile in WriteKeyToFile()Lioncash2019-11-121-11/+15
| |/ / / /
* | | | | Merge pull request #3081 from ReinUsesLisp/fswzadd-shufflesFernando Sahmkow2019-11-148-125/+127
|\ \ \ \ \
| * | | | | gl_shader_cache: Enable extensions only when availableReinUsesLisp2019-11-081-6/+14
| * | | | | gl_shader_decompiler: Add safe fallbacks when ARB_shader_ballot is not availableReinUsesLisp2019-11-083-5/+28
| * | | | | shader_ir/warp: Implement FSWZADDReinUsesLisp2019-11-085-0/+44
| * | | | | gl_shader_decompiler: Reimplement shuffles with platform agnostic intrinsicsReinUsesLisp2019-11-085-122/+49
* | | | | | Merge pull request #3107 from lioncash/hashableRodrigo Locatti2019-11-131-35/+0
|\ \ \ \ \ \
| * | | | | | common/hash: Remove unused HashableStructLioncash2019-11-131-35/+0
| | |_|_|_|/ | |/| | | |
* | | | | | Merge pull request #3104 from lioncash/xtsRodrigo Locatti2019-11-131-2/+1
|\ \ \ \ \ \ | |/ / / / / |/| | | | |
| * | | | | xts_archive: Remove redundant std::string constructorLioncash2019-11-131-2/+1
| | |/ / / | |/| | |
* | | | | Merge pull request #3103 from lioncash/cfuncRodrigo Locatti2019-11-131-1/+1
|\ \ \ \ \
| * | | | | common_funcs: silence sign-conversion warnings in MakeMagic()Lioncash2019-11-131-1/+1
| |/ / / /
* | | | | Merge pull request #3084 from ReinUsesLisp/cast-warningsRodrigo Locatti2019-11-1310-53/+68
|\ \ \ \ \ | |/ / / / |/| | | |
| * | | | video_core: Enable sign conversion warningsRodrigo Locatti2019-11-111-1/+1
| * | | | video_core: Treat implicit conversions as errorsReinUsesLisp2019-11-081-0/+6
| * | | | video_core: Silence implicit conversion warningsReinUsesLisp2019-11-089-53/+62
| | |/ / | |/| |
* | | | Merge pull request #3085 from bunnei/web-token-b64bunnei2019-11-094-50/+110
|\ \ \ \
| * | | | web-service: Port citra's updated web_backend code.bunnei2019-11-092-18/+57
| * | | | yuzu: configure_web: Use Base64 encoded token for simplifying user experience.bunnei2019-11-092-32/+53
* | | | | Merge pull request #3082 from ReinUsesLisp/fix-lockersbunnei2019-11-091-2/+4
|\ \ \ \ \ | |/ / / / |/| | | |
| * | | | gl_shader_cache: Fix locker constructorsReinUsesLisp2019-11-081-2/+4
| | |/ / | |/| |
* | | | Merge pull request #3080 from FernandoS27/glsl-fixbunnei2019-11-081-1/+1
|\ \ \ \ | |/ / / |/| | |
| * | | GLSLDecompiler: Correct Texture Gather Offset.Fernando Sahmkow2019-11-071-1/+1
* | | | Merge pull request #3032 from ReinUsesLisp/simplify-control-flow-brxbunnei2019-11-071-103/+111
|\ \ \ \
| * | | | shader/control_flow: Specify constness on caller lambdasRodrigo Locatti2019-11-071-11/+12
| * | | | shader/control_flow: Use callable template instead of std::functionReinUsesLisp2019-11-071-6/+5
| * | | | shader/control_flow: Abstract repeated code chunks in BRX trackingReinUsesLisp2019-11-071-93/+101
| * | | | shader/control_flow: Silence Intellisense cast warningsReinUsesLisp2019-11-071-1/+1
| * | | | shader/control_flow: Remove brace initializer in std containersReinUsesLisp2019-11-071-9/+9
* | | | | buffer_cache: Add missing includes (#3079)Morph2019-11-071-0/+4
* | | | | Merge pull request #3070 from ReinUsesLisp/shader-warningsbunnei2019-11-077-51/+19
|\ \ \ \ \ | |_|_|/ / |/| | | |
| * | | | shader/decode: Reduce severity of arithmetic rounding warningsReinUsesLisp2019-11-076-15/+17
| * | | | shader/arithmetic: Reduce RRO stub severityReinUsesLisp2019-11-071-1/+2
| * | | | shader/texture: Remove NODEP warningsReinUsesLisp2019-11-071-35/+0
| |/ / /
* | | | Merge pull request #3057 from ReinUsesLisp/buffer-sub-databunnei2019-11-066-11/+70
|\ \ \ \
| * | | | gl_rasterizer: Re-enable stream buffer memory due to global memoryReinUsesLisp2019-11-021-14/+8
| * | | | gl_rasterizer: Upload constant buffers with glNamedBufferSubDataReinUsesLisp2019-11-026-19/+84
* | | | | Merge pull request #3076 from DarkLordZach/telem-namesbunnei2019-11-061-11/+2
|\ \ \ \ \
| * | | | | ci: Populate build repository from Azure environmentZach Hilman2019-11-061-11/+2
* | | | | | Merge pull request #3062 from bunnei/event-improvebunnei2019-11-0625-112/+53
|\ \ \ \ \ \ | |_|_|/ / / |/| | | | |
| * | | | | kernel: readable_event: Signal only once.bunnei2019-11-031-2/+4
| * | | | | kernel: events: Remove ResetType::Automatic.bunnei2019-11-0325-109/+48
| * | | | | kernel: readable_event: Initialize members.bunnei2019-11-031-1/+1
* | | | | | Merge pull request #3039 from ReinUsesLisp/cleanup-samplersRodrigo Locatti2019-11-068-142/+116
|\ \ \ \ \ \ | |_|/ / / / |/| | | | |
| * | | | | shader/node: Unpack bindless texture encodingReinUsesLisp2019-10-308-142/+116
* | | | | | Merge pull request #2859 from Morph1984/hidDavid2019-11-062-92/+126
|\ \ \ \ \ \
| * | | | | | hid: Stub SetNpadJoyAssignmentModeSingle and reorganize service commandsMorph2019-10-072-92/+126
* | | | | | | Merge pull request #2914 from FernandoS27/fermi-fixbunnei2019-11-061-3/+27
|\ \ \ \ \ \ \
| * | | | | | | Fermi2D: Use a different formula for delimiting blit areas.Fernando Sahmkow2019-10-181-14/+28
| * | | | | | | Fermi2D: limit blit area to only available areaFernando Sahmkow2019-10-171-4/+14
* | | | | | | | common_func: Use std::array for INSERT_PADDING_* macros.bunnei2019-11-0414-158/+166
* | | | | | | | Merge pull request #3059 from FearlessTobi/stub-am-commandsbunnei2019-11-032-3/+31
|\ \ \ \ \ \ \ \
| * | | | | | | | core/am: Stub InitializeApplicationCopyrightFrameBuffer, SetApplicationCopyrightImage and SetApplicationCopyrightVisibilityFearlessTobi2019-11-032-3/+31
| | |_|_|_|/ / / | |/| | | | | |
* | | | | | | | common/bit_field: Remove FORCE_INLINE calls Tobias2019-11-031-2/+2
| |_|_|_|/ / / |/| | | | | |
* | | | | | | citra_qt: add amiibo drag and drop supportFearlessTobi2019-11-032-4/+18
|/ / / / / /
* | | | / / Shader_IR: Fix regression on TLD4Fernando Sahmkow2019-10-312-5/+4
| |_|_|/ / |/| | | |
* | | | | Merge pull request #3050 from FernandoS27/fix-tld4Rodrigo Locatti2019-10-303-11/+55
|\ \ \ \ \
| * | | | | Shader_IR: Fix TLD4 and add Bindless Variant.Fernando Sahmkow2019-10-303-11/+55
* | | | | | Merge pull request #3038 from lioncash/docsRodrigo Locatti2019-10-302-91/+73
|\ \ \ \ \ \
| * | | | | | scheduler: Mark parameter of AskForReselectionOrMarkRedundant() as constLioncash2019-10-282-5/+5
| * | | | | | scheduler: Silence sign conversion warningsLioncash2019-10-281-5/+5
| * | | | | | scheduler: Initialize class members directly where applicableLioncash2019-10-282-6/+4
| * | | | | | scheduler: Amend documentation commentsLioncash2019-10-282-75/+59
* | | | | | | Merge pull request #3046 from ReinUsesLisp/clean-gl-statebunnei2019-10-303-291/+156
|\ \ \ \ \ \ \
| * | | | | | | gl_state: Use std::array::fill instead of std::fillRodrigo Locatti2019-10-301-1/+1
| * | | | | | | gl_state: Move dirty checks to individual apply calls instead of ApplyReinUsesLisp2019-10-302-66/+74
| * | | | | | | gl_state: Remove ApplyDefaultStateReinUsesLisp2019-10-303-17/+1
| * | | | | | | gl_state: Change SetDefaultViewports to use default constructorReinUsesLisp2019-10-301-13/+2
| * | | | | | | gl_state: Minor style changesReinUsesLisp2019-10-301-3/+5
| * | | | | | | gl_state: Remove unused Citra TextureUnitsReinUsesLisp2019-10-301-23/+0
| * | | | | | | gl_state: Move initializers from constructor to class declarationReinUsesLisp2019-10-302-170/+75
| | |_|_|_|/ / | |/| | | | |
* | | | | | | Merge pull request #3035 from ReinUsesLisp/rasterizer-acceleratedbunnei2019-10-305-45/+98
|\ \ \ \ \ \ \
| * | | | | | | rasterizer_accelerated: Add intermediary for GPU rasterizersReinUsesLisp2019-10-275-45/+98
* | | | | | | | Merge pull request #3007 from DarkLordZach/fsc-regressbunnei2019-10-301-0/+12
|\ \ \ \ \ \ \ \ | |_|/ / / / / / |/| | | | | | |
| * | | | | | | savedata_factory: Automatically create certain savedataZach Hilman2019-10-221-0/+12
* | | | | | | | Merge pull request #3004 from ReinUsesLisp/maxwell3d-cleanupRodrigo Locatti2019-10-306-81/+20
|\ \ \ \ \ \ \ \ | |_|_|_|/ / / / |/| | | | | | |
| * | | | | | | maxwell_3d/kepler_compute: Remove unused arguments in GetTextureReinUsesLisp2019-10-285-37/+20
| * | | | | | | video_core/textures: Remove unused index entry in FullTextureInfoReinUsesLisp2019-10-282-2/+0
| * | | | | | | maxwell_3d: Remove unused method GetStageTexturesReinUsesLisp2019-10-282-42/+0
| | |_|/ / / / | |/| | | | |
* | | | | | | Merge pull request #3037 from FernandoS27/new-formatsRodrigo Locatti2019-10-284-5/+22
|\ \ \ \ \ \ \ | |/ / / / / / |/| | | | | |
| * | | | | | Video_Core: Implement texture format E5B9G9R9_SHAREDEXP.Fernando Sahmkow2019-10-274-5/+22
| | |/ / / / | |/| | | |
* | | | | | Merge pull request #2971 from FernandoS27/new-scheduler-v2David2019-10-2819-435/+1022
|\ \ \ \ \ \
| * | | | | | Kernel Thread: Cleanup THREADPROCESSORID_DONT_UPDATE.Fernando Sahmkow2019-10-152-4/+1
| * | | | | | Kernel: Address Feedback 2Fernando Sahmkow2019-10-152-9/+6
| * | | | | | Kernel: Clang FormatFernando Sahmkow2019-10-152-5/+5
| * | | | | | Kernel: Reverse global accessor removal.Fernando Sahmkow2019-10-154-23/+9
| * | | | | | Kernel: Address Feedback.Fernando Sahmkow2019-10-156-67/+98
| * | | | | | Kernel Scheduler: Make sure the global scheduler shutdowns correctly.Fernando Sahmkow2019-10-157-0/+31
| * | | | | | Kernel_Thread: Eliminate most global accessors.Fernando Sahmkow2019-10-151-11/+11
| * | | | | | KernelSVC: Assert that condition variable address is aligned to 4 bytes.Fernando Sahmkow2019-10-151-0/+4
| * | | | | | Kernel: Correct Paused schedulingFernando Sahmkow2019-10-151-3/+1
| * | | | | | Kernel: Corrections to Wait Objects clearing in which a thread could still be signalled after a timeout or a cancel.Fernando Sahmkow2019-10-153-3/+4
| * | | | | | Kernel: Correct redundant yields to only advance time forward.Fernando Sahmkow2019-10-151-3/+5
| * | | | | | Kernel: Corrections to ModifyByWaitingCountAndSignalToAddressIfEqualFernando Sahmkow2019-10-151-5/+13
| * | | | | | Kernel: Correct Results in Condition Variables and MutexesFernando Sahmkow2019-10-153-24/+17
| * | | | | | Kernel: Clang FormatFernando Sahmkow2019-10-152-2/+3
| * | | | | | Kernel: Remove global system accessor from WaitObjectFernando Sahmkow2019-10-154-2/+17
| * | | | | | Scheduler: Implement Yield Count and Core migration on Thread Preemption.Fernando Sahmkow2019-10-152-5/+85
| * | | | | | Scheduler: Corrections to YieldAndBalanceLoad and Yield bombing protection.Fernando Sahmkow2019-10-152-8/+8
| * | | | | | Kernel: Initial implementation of thread preemption.Fernando Sahmkow2019-10-153-0/+30
| * | | | | | Scheduler: Add protections for Yield bombingFernando Sahmkow2019-10-155-24/+31
| * | | | | | Kernel: Style and CorrectionsFernando Sahmkow2019-10-1512-96/+137
| * | | | | | Correct PrepareRescheduleFernando Sahmkow2019-10-156-38/+29
| * | | | | | Comment and reorganize the schedulerFernando Sahmkow2019-10-152-98/+104
| * | | | | | Add PrepareReschedule where required.Fernando Sahmkow2019-10-153-16/+18
| * | | | | | Correct compiling errors and addapt to the new interface.Fernando Sahmkow2019-10-153-27/+15
| * | | | | | Correct Supervisor Calls to work with the new scheduler,Fernando Sahmkow2019-10-151-26/+41
| * | | | | | Redesign CPU Cores to work with the new schedulerFernando Sahmkow2019-10-152-13/+12
| * | | | | | Add interfacing to the Global SchedulerFernando Sahmkow2019-10-154-0/+34
| * | | | | | Addapt thread class to the new SchedulerFernando Sahmkow2019-10-152-60/+237
| * | | | | | Implement a new Core SchedulerFernando Sahmkow2019-10-152-258/+411
* | | | | | | Merge pull request #3034 from ReinUsesLisp/w4244-maxwell3dbunnei2019-10-272-24/+25
|\ \ \ \ \ \ \
| * | | | | | | maxwell_3d: Silence implicit conversion warningsReinUsesLisp2019-10-272-24/+25
| | |/ / / / / | |/| | | | |
* / | | | | | astc: Silence implicit conversion warningsReinUsesLisp2019-10-271-7/+8
|/ / / / / /
* | | | | | Merge pull request #2976 from FernandoS27/cache-fast-brx-rebasedRodrigo Locatti2019-10-2628-864/+1482
|\ \ \ \ \ \
| * | | | | | Shader_IR: Address Feedback.Fernando Sahmkow2019-10-269-56/+66
| * | | | | | Shader_IR: Clang formatFernando Sahmkow2019-10-251-2/+1
| * | | | | | gl_shader_cache: Implement locker variants invalidationReinUsesLisp2019-10-254-44/+104
| * | | | | | gl_shader_disk_cache: Store and load fast BRXReinUsesLisp2019-10-256-50/+210
| * | | | | | const_buffer_locker: Minor style changesReinUsesLisp2019-10-252-152/+76
| * | | | | | gl_shader_decompiler: Move entries to a separate functionReinUsesLisp2019-10-2515-722/+420
| * | | | | | Shader_IR: Implement Fast BRX and allow multi-branches in the CFG.Fernando Sahmkow2019-10-251-1/+1
| * | | | | | Shader_IR: Correct typo in Consistent method.Fernando Sahmkow2019-10-252-2/+2
| * | | | | | Shader_IR: allow lookup of texture samplers within the shader_ir for instructions that don't provide itFernando Sahmkow2019-10-259-46/+363
| * | | | | | Shader_IR: Implement Fast BRX and allow multi-branches in the CFG.Fernando Sahmkow2019-10-257-130/+258
| * | | | | | Shader_Cache: setup connection of ConstBufferLockerFernando Sahmkow2019-10-2510-43/+82
| * | | | | | VideoCore: Unify const buffer accessing along engines and provide ConstBufferLocker class to shaders.Fernando Sahmkow2019-10-2512-13/+183
| * | | | | | Shader_IR: Implement BRX tracking.Fernando Sahmkow2019-10-251-0/+113
* | | | | | | Merge pull request #3027 from lioncash/lookupRodrigo Locatti2019-10-261-53/+67
|\ \ \ \ \ \ \
| * | | | | | | shader_ir: Use std::array with pair instead of unordered_mapLioncash2019-10-241-53/+67
* | | | | | | | Merge pull request #3013 from FernandoS27/tld4s-fixRodrigo Locatti2019-10-262-5/+5
|\ \ \ \ \ \ \ \ | |_|/ / / / / / |/| | | | | | |
| * | | | | | | Shader_Ir: Fix TLD4S from using a component mask.Fernando Sahmkow2019-10-222-5/+5
* | | | | | | | Merge pull request #3028 from lioncash/constexprRodrigo Locatti2019-10-241-13/+13
|\ \ \ \ \ \ \ \
| * | | | | | | | shader_bytecode: Make Matcher constexpr capableLioncash2019-10-241-13/+13
| | |/ / / / / / | |/| | | | | |
* / | | | | | | video_core/shader: Resolve instances of variable shadowingLioncash2019-10-246-11/+12
|/ / / / / / /
* | | | | | | Merge pull request #2991 from lioncash/npadbunnei2019-10-232-51/+23
|\ \ \ \ \ \ \
| * | | | | | | hid/npad: Fix incorrect connection boolean value in ConnectAllDisconnectedControllers()Lioncash2019-10-181-1/+1
| * | | | | | | hid/npad: Add missing break in default caseLioncash2019-10-181-0/+1
| * | | | | | | hid/npad: Replace std::for_each with ranged for loopsLioncash2019-10-181-13/+12
| * | | | | | | hid/npad: Remove redundant non-const variant of IsControllerSupported()Lioncash2019-10-182-34/+5
| * | | | | | | hid/npad: Move function declarationsLioncash2019-10-181-5/+6
* | | | | | | | Merge pull request #2995 from ReinUsesLisp/ignore-gmemFernando Sahmkow2019-10-222-18/+26
|\ \ \ \ \ \ \ \
| * | | | | | | | shader_ir/memory: Ignore global memory when tracking failsReinUsesLisp2019-10-222-18/+26
| | |_|_|/ / / / | |/| | | | | |
* | | | | | | | Merge pull request #2983 from lioncash/fallthroughFernando Sahmkow2019-10-222-0/+6
|\ \ \ \ \ \ \ \ | |_|_|/ / / / / |/| | | | | | |
| * | | | | | | vk_shader_decompiler: Resolve fallthrough within ExprDecompiler's ExprCondCode operator()Lioncash2019-10-161-0/+3
| * | | | | | | gl_shader_decompiler: Resolve fallthrough within ExprDecompiler's ExprCondCode operator()Lioncash2019-10-161-0/+3
* | | | | | | | maxwell_3d: Reduce FlushMMEInlineDraw logging to TraceReinUsesLisp2019-10-201-1/+1
| |/ / / / / / |/| | | | | |
* | | | | | | core: Fix clang-format errors.bunnei2019-10-191-9/+10
* | | | | | | Fix null pointer deref.Nicolae-Andrei Cociorba2019-10-181-10/+12
* | | | | | | Merge pull request #2994 from lioncash/fmtRodrigo Locatti2019-10-182-40/+51
|\ \ \ \ \ \ \
| * | | | | | | video_core/shader/ast: Make ShowCurrentState() and SanityCheck() const member functionsLioncash2019-10-182-5/+5
| * | | | | | | video_core/shader/ast: Make ASTManager::Print a const member functionLioncash2019-10-182-3/+3
| * | | | | | | video_core/shader/ast: Make ExprPrinter members privateLioncash2019-10-181-1/+2
| * | | | | | | video_core/shader/ast: Make Indent() return a string_viewLioncash2019-10-181-14/+24
| * | | | | | | video_core/shader/ast: Make Indent() privateLioncash2019-10-181-9/+9
| * | | | | | | video_core/shader/ast: Rename Ident() to Indent()Lioncash2019-10-181-13/+13
| * | | | | | | video_core/shader/ast: Make use of fmt where applicableLioncash2019-10-181-14/+14
| | |/ / / / / | |/| | | | |
* | | | | | | Merge pull request #2993 from lioncash/vulkan-exprRodrigo Locatti2019-10-181-21/+23
|\ \ \ \ \ \ \
| * | | | | | | vk_shader_decompiler: Mark operator() function parameters as const referencesLioncash2019-10-181-21/+23
| |/ / / / / /
* | | | | | | Merge pull request #2992 from lioncash/dmntbunnei2019-10-181-2/+2
|\ \ \ \ \ \ \
| * | | | | | | dmnt_cheat_vm: Correct register Restore and ClearRegs behaviorLioncash2019-10-181-2/+2
| |/ / / / / /
* | | | | | | Merge pull request #2966 from FernandoS27/astc-formatsRodrigo Locatti2019-10-184-79/+211
|\ \ \ \ \ \ \
| * | | | | | | Surfaces: Implement R4G4B4A4U format.Fernando Sahmkow2019-10-094-24/+41
| * | | | | | | Surfaces: Implement ASTC 6x6 10x10 12x12 8x6 6x5Fernando Sahmkow2019-10-094-70/+185
* | | | | | | | Merge pull request #2979 from lioncash/macroRodrigo Locatti2019-10-182-72/+79
|\ \ \ \ \ \ \ \
| * | | | | | | | video_core/macro_interpreter: Make definitions of most private enums/unions hiddenLioncash2019-10-172-72/+79
| | |_|/ / / / / | |/| | | | | |
* | | | | | | | Merge pull request #2989 from lioncash/apmRodrigo Locatti2019-10-182-16/+36
|\ \ \ \ \ \ \ \
| * | | | | | | | apm/controller: Make SetPerformanceConfiguration() use an array of pairs over a mapLioncash2019-10-171-14/+34
| * | | | | | | | apm/controller: Make GetCurrentPerformanceMode() a const member functionLioncash2019-10-172-2/+2
| | |_|/ / / / / | |/| | | | | |
* | | | | | | | core/core: Resolve -Wreorder warningsLioncash2019-10-171-2/+2
* | | | | | | | core/memory/cheat_engine: Resolve -Wreorder warningsLioncash2019-10-171-4/+3
|/ / / / / / /
* | | | | | | Merge pull request #2980 from lioncash/warnbunnei2019-10-173-5/+6
|\ \ \ \ \ \ \ | |_|_|_|/ / / |/| | | | | |
| * | | | | | control_flow: Silence truncation warningsLioncash2019-10-162-4/+4
| * | | | | | maxwell_3d: Silence truncation warningsLioncash2019-10-151-1/+2
| |/ / / / /
* | | | | | Merge pull request #2978 from lioncash/doxygenRodrigo Locatti2019-10-171-57/+78
|\ \ \ \ \ \
| * | | | | | video_core/texture_cache: Amend Doxygen referencesLioncash2019-10-151-57/+78
| | |_|/ / / | |/| | | |
* | | | | | Merge pull request #2982 from lioncash/surfaceRodrigo Locatti2019-10-171-2/+2
|\ \ \ \ \ \
| * | | | | | texture_cache: Avoid unnecessary surface copies within PickStrategy() and TryReconstructSurface()Lioncash2019-10-161-2/+2
| | |/ / / / | |/| | | |
* | | | | | Merge pull request #2912 from FernandoS27/async-fixesbunnei2019-10-1616-52/+67
|\ \ \ \ \ \
| * | | | | | AsyncGpu: Address FeedbackFernando Sahmkow2019-10-112-2/+2
| * | | | | | GL_Renderer: Remove lefting snippet.Fernando Sahmkow2019-10-051-2/+0
| * | | | | | NvFlinger: Remove leftover from corrections and clang format.Fernando Sahmkow2019-10-051-4/+0
| * | | | | | Gl_Rasterizer: Protect CPU Memory mapping from multiple threads.Fernando Sahmkow2019-10-052-0/+4
| * | | | | | Core: Wait for GPU to be idle before shutting down.Fernando Sahmkow2019-10-057-0/+19
| * | | | | | Nvdrv: Correct Event setup in NvdrvFernando Sahmkow2019-10-052-23/+14
| * | | | | | NVFlinger: Reverse the change that only signaled events on buffer acquire.Fernando Sahmkow2019-10-052-20/+1
| * | | | | | Nvdrv: Do framelimiting only in the CPU ThreadFernando Sahmkow2019-10-052-3/+4
| * | | | | | NvFlinger: Don't swap buffers if a frame is missing and always trigger event in sync gpu.Fernando Sahmkow2019-10-051-1/+3
| * | | | | | GPU_Async: Correct fences, display events and more.Fernando Sahmkow2019-10-056-21/+38
| * | | | | | Nvdrv: Correct Async regression and avoid signaling empty buffer vsyncsFernando Sahmkow2019-10-052-3/+9
* | | | | | | Merge pull request #2984 from lioncash/fallthrough2Rodrigo Locatti2019-10-161-0/+1
|\ \ \ \ \ \ \
| * | | | | | | video_core/surface: Add missing break in PixelFormatFromTextureFormat()Lioncash2019-10-161-0/+1
| | |/ / / / / | |/| | | | |
* | | | | | | Merge pull request #2981 from lioncash/copyRodrigo Locatti2019-10-162-34/+32
|\ \ \ \ \ \ \
| * | | | | | | gl_shader_decompiler: Make ExprDecompiler's GetResult() a const member functionLioncash2019-10-161-1/+1
| * | | | | | | gl_shader_decompiler: Use a std::string_view with GetDeclarationWithSuffix()Lioncash2019-10-161-1/+1
| * | | | | | | gl_shader_decompiler: Fold flow_var constant into GetFlowVariable()Lioncash2019-10-161-3/+1
| * | | | | | | gl_shader_decompiler: Mark ASTDecompiler/ExprDecompiler parameters as const references where applicableLioncash2019-10-161-21/+21
| * | | | | | | gl_shader_decompiler: Pass by reference to GenerateTextureArgument()Lioncash2019-10-161-2/+2
| * | | | | | | gl_shader_decompiler: Use std::holds_alternative within GenerateTexture()Lioncash2019-10-161-1/+1
| * | | | | | | shader/node: std::move Meta instance within OperationNode constructorLioncash2019-10-161-1/+1
| * | | | | | | gl_shader_decompiler: Avoid unnecessary copies of MetaImageLioncash2019-10-161-4/+4
| |/ / / / / /
* | | | | | | Merge pull request #2972 from lioncash/systembunnei2019-10-1510-34/+64
|\ \ \ \ \ \ \ | |/ / / / / / |/| | | | | |
| * | | | | | video_core/gpu: Remove use of the global system accessorLioncash2019-10-151-1/+1
| * | | | | | bcat: Remove use of global system accessorsLioncash2019-10-156-29/+55
| * | | | | | nvflinger/buffer_queue: Remove use of a global system accessorLioncash2019-10-123-4/+8
* | | | | | | common/algorithm: Add description comment indicating intended algorithmsLioncash2019-10-151-0/+5
* | | | | | | common: Rename binary_find.h to algorithm.hLioncash2019-10-154-4/+5
| |_|/ / / / |/| | | | |
* | | | | | Merge pull request #2965 from FernandoS27/fair-core-timingbunnei2019-10-157-134/+147
|\ \ \ \ \ \
| * | | | | | Core_Timing: Address Remaining feedback.Fernando Sahmkow2019-10-121-5/+4
| * | | | | | Core_Timing: Fix tests.Fernando Sahmkow2019-10-121-2/+2
| * | | | | | Core_Timing: Address Feedback and suppress warnings.Fernando Sahmkow2019-10-115-13/+12
| * | | | | | Core Timing: Correct Idle and remove lefting pragmaFernando Sahmkow2019-10-091-2/+1
| * | | | | | Core Timing: General corrections and added tests.Fernando Sahmkow2019-10-093-7/+165
| * | | | | | Tests: Eliminate old Core Timing TestsFernando Sahmkow2019-10-091-193/+0
| * | | | | | Core Timing: Rework Core Timing to run all cores evenly.Fernando Sahmkow2019-10-096-38/+89
| | |_|/ / / | |/| | | |
* | | | | | Merge pull request #2897 from DarkLordZach/oss-ext-fonts-1bunnei2019-10-1418-123/+73480
|\ \ \ \ \ \
| * | | | | | pl_u: Fix mismatched rebase size error in font encryptionZach Hilman2019-10-133-19/+17
| * | | | | | pl_u: Use kernel physical memoryZach Hilman2019-10-132-4/+8
| * | | | | | pl_u: Remove excess static qualifierZach Hilman2019-10-131-1/+1
| * | | | | | pl_u: Use OSS system archives if real archives don't existZach Hilman2019-10-132-112/+48
| * | | | | | system_archive: Synthesize shared fonts system archivesZach Hilman2019-10-133-5/+101
| * | | | | | externals: Move OSS font data to file_sys in coreZach Hilman2019-10-1313-1/+73324
| | |/ / / / | |/| | | |
* | | | | | Merge pull request #2968 from FreddyFunk/fix-zl-zr-analog-triggersbunnei2019-10-141-4/+18
|\ \ \ \ \ \
| * | | | | | fixed clang format & addressed feedbackFreddyFunk2019-10-101-26/+24
| * | | | | | yuzu/configure_input_player: Fix input handling for ZL and ZR from controllers with analog triggersFreddyFunk2019-10-101-7/+23
| |/ / / / /
* | | | | | Merge pull request #2930 from DarkLordZach/gamecard-partitionsbunnei2019-10-144-26/+128
|\ \ \ \ \ \ | |/ / / / / |/| | | | |
| * | | | | card_image: Implement system update commands in XCIZach Hilman2019-10-132-3/+37
| * | | | | card_image: Add accessors for raw partitions in XCIZach Hilman2019-09-232-0/+36
| * | | | | card_image: Lazily load partitions in XCIZach Hilman2019-09-232-26/+41
| * | | | | pfs: Provide accessors for file sizes and offsetsZach Hilman2019-09-232-0/+17
* | | | | | Merge pull request #2910 from FearlessTobi/port-4930bunnei2019-10-106-0/+38
|\ \ \ \ \ \
| * | | | | | yuzu: Pause when in backgroundFearlessTobi2019-09-266-0/+38
| | |_|_|_|/ | |/| | | |
* | | | | | Merge pull request #2928 from ReinUsesLisp/dirty-depth-boundsbunnei2019-10-092-1/+10
|\ \ \ \ \ \
| * | | | | | maxwell_3d: Add dirty flags for depth bounds valuesReinUsesLisp2019-10-052-1/+10
* | | | | | | Merge pull request #2927 from ReinUsesLisp/polygon-offset-unitsbunnei2019-10-091-1/+3
|\ \ \ \ \ \ \ | |_|_|_|/ / / |/| | | | | |
| * | | | | | gl_rasterizer: Fix polygon offset unitsReinUsesLisp2019-10-011-1/+3
| |/ / / / /
* | | | | | Merge pull request #2921 from FreddyFunk/compiler-warnings-corebunnei2019-10-091-6/+6
|\ \ \ \ \ \
| * | | | | | Services::ES fix casting warningsFreddyFunk2019-09-291-6/+6
* | | | | | | Merge pull request #2654 from DarkLordZach/lm-log-rewritebunnei2019-10-0910-159/+367
|\ \ \ \ \ \ \
| * | | | | | | lm: Flush manager output on core shutdownZach Hilman2019-09-225-11/+15
| * | | | | | | lm: Rename Initialize to Log and implement with manager/reporterZach Hilman2019-09-221-140/+22
| * | | | | | | lm: Implement manager class to output to reporterZach Hilman2019-09-222-0/+233
| * | | | | | | core: Add LM::Manager to systemZach Hilman2019-09-226-19/+39
| * | | | | | | reporter: Add log output for packaged lm log dataZach Hilman2019-09-222-0/+69
* | | | | | | | Merge pull request #2959 from ReinUsesLisp/cbuf-hsetp2Fernando Sahmkow2019-10-081-1/+4
|\ \ \ \ \ \ \ \
| * | | | | | | | shader/half_set_predicate: Fix HSETP2 for constant buffersReinUsesLisp2019-10-071-0/+2
| * | | | | | | | shader/half_set_predicate: Reduce DEBUG_ASSERT to LOG_DEBUGReinUsesLisp2019-10-071-1/+2
* | | | | | | | | hid: Implement DeactivateNpadMorph2019-10-072-1/+13
| |_|_|_|_|_|_|/ |/| | | | | | |
* | | | | | | | Merge pull request #2951 from lioncash/globalZach Hilman2019-10-0718-65/+87
|\ \ \ \ \ \ \ \ | |/ / / / / / / |/| | | | | | |
| * | | | | | | core/core: Remove unused headerLioncash2019-10-061-1/+0
| * | | | | | | core: Remove Core::CurrentProcess()Lioncash2019-10-065-13/+11
| * | | | | | | hle/service: Replace global system instance calls with instance-based onesLioncash2019-10-0614-51/+76
* | | | | | | | Merge pull request #2952 from lioncash/warningRodrigo Locatti2019-10-074-12/+17
|\ \ \ \ \ \ \ \
| * | | | | | | | bcat/module: Silence truncation warningsLioncash2019-10-061-3/+3
| * | | | | | | | bcat: Take std::function instance by value in NullBackend's constructorLioncash2019-10-062-2/+2
| * | | | | | | | bcat: In-class initialize ProgressServiceBackend's impl memberLioncash2019-10-062-2/+2
| * | | | | | | | bcat: Make ProgressServiceBackend's constructor take a std::string_viewLioncash2019-10-062-3/+7
| * | | | | | | | bcat: Make ProgressServiceBackend's GetEvent() constLioncash2019-10-062-2/+2
| * | | | | | | | boxcat: Silence an unused variable warningLioncash2019-10-061-1/+2
| |/ / / / / / /
* | | | | | | | Merge pull request #2955 from lioncash/allocatorRodrigo Locatti2019-10-071-0/+10
|\ \ \ \ \ \ \ \
| * | | | | | | | alignment: Resolve allocator construction issues on debugLioncash2019-10-071-0/+5
| * | | | | | | | alignment: Specify trait definitions within the allocatorLioncash2019-10-071-0/+5
| |/ / / / / / /
* | | | | | | | Merge pull request #2954 from ReinUsesLisp/fix-invalidationFernando Sahmkow2019-10-062-16/+17
|\ \ \ \ \ \ \ \
| * | | | | | | | gl_shader_disk_cache: Properly ignore existing cacheReinUsesLisp2019-10-062-16/+17
| |/ / / / / / /
* / / / / / / / qt: Fix game name format errorZach Hilman2019-10-061-2/+2
|/ / / / / / /
* | | | | | | Merge pull request #2942 from ReinUsesLisp/clang-warningsbunnei2019-10-0636-58/+68
|\ \ \ \ \ \ \
| * | | | | | | audio/audout_u: Change formatting for old clang-format versionsReinUsesLisp2019-10-051-1/+1
| * | | | | | | yuzu/game_list_worker: Silence warningsReinUsesLisp2019-10-052-8/+9
| * | | | | | | yuzu/game_list: Silence -Wswitch and -Wunused-variableReinUsesLisp2019-10-052-5/+12
| * | | | | | | yuzu/configure_service: Silence -WswitchReinUsesLisp2019-10-051-0/+2
| * | | | | | | yuzu_tester: Remove unused variableReinUsesLisp2019-10-051-1/+0
| * | | | | | | service/nvdrv: Silence -WswitchReinUsesLisp2019-10-054-4/+10
| * | | | | | | service/nfp: Silence -Wunused and -WswitchReinUsesLisp2019-10-051-4/+5
| * | | | | | | service/hid: Silence -Wunused and -WswitchReinUsesLisp2019-10-0515-23/+18
| * | | | | | | service/am: Silence -WreorderReinUsesLisp2019-10-051-2/+1
| * | | | | | | service/hid: Remove unused system referenceReinUsesLisp2019-10-052-2/+1
| * | | | | | | service/friend: Remove unused fieldReinUsesLisp2019-10-051-1/+0
| * | | | | | | service/filesystem: Silence -Wunused-variableReinUsesLisp2019-10-051-1/+1
| * | | | | | | service/bcat: Silence -Wreorder and -WunusedReinUsesLisp2019-10-052-2/+2
| * | | | | | | service/audio: Silence -WunusedReinUsesLisp2019-10-051-1/+1
| * | | | | | | service/apm: Silence -Wunused and -WreorderReinUsesLisp2019-10-052-4/+5
| * | | | | | | common/file_util: Silence -WswitchReinUsesLisp2019-10-051-1/+2
| | |_|_|_|_|/ | |/| | | | |
* | | | | | | Merge pull request #2943 from DarkLordZach/azure-titlebars-v2bunnei2019-10-064-6/+36
|\ \ \ \ \ \ \
| * | | | | | | qt: Change titlebar formattingZach Hilman2019-10-051-6/+15
| * | | | | | | common: Add additional SCM revision fieldsZach Hilman2019-10-053-0/+21
* | | | | | | | video_core/control_flow: Eliminate variable shadowing warningsLioncash2019-10-051-6/+6
* | | | | | | | video_core/control_flow: Eliminate pessimizing movesLioncash2019-10-051-5/+8
* | | | | | | | video_core/ast: Unindent most of IsFullyDecompiled() by one levelLioncash2019-10-051-12/+12
* | | | | | | | video_core/ast: Make ShowCurrentState() take a string_view instead of std::stringLioncash2019-10-052-2/+2
* | | | | | | | video_core/ast: Eliminate variable shadowing warningsLioncash2019-10-051-3/+3
* | | | | | | | video_core/ast: Replace std::string with a constexpr std::string_viewLioncash2019-10-051-3/+1
* | | | | | | | video_core/ast: Default the move constructor and assignment operatorLioncash2019-10-052-26/+2
* | | | | | | | video_core/{ast, expr}: Organize forward declarationLioncash2019-10-052-10/+10
* | | | | | | | video_core/expr: Supply operator!= along with operator==Lioncash2019-10-052-1/+32
* | | | | | | | video_core/{ast, expr}: Use std::move where applicableLioncash2019-10-054-45/+47
* | | | | | | | video_core/ast: Supply const accessors for data where applicableLioncash2019-10-052-37/+41
* | | | | | | | Merge pull request #2888 from FernandoS27/decompiler2David2019-10-0516-160/+2293
|\ \ \ \ \ \ \ \ | |/ / / / / / / |/| | | | | | |
| * | | | | | | Shader_ir: Address feedbackFernando Sahmkow2019-10-056-65/+24
| * | | | | | | Shader_Ir: Address Feedback and clang format.Fernando Sahmkow2019-10-054-68/+68
| * | | | | | | vk_shader_decompiler: Correct Branches inside conditionals.Fernando Sahmkow2019-10-051-1/+11
| * | | | | | | vk_shader_decompiler: Clean code and be const correct.Fernando Sahmkow2019-10-052-8/+6
| * | | | | | | Shader_IR: clean up AST handling and add documentation.Fernando Sahmkow2019-10-051-2/+6
| * | | | | | | Shader_IR: Correct OutwardMoves for IfsFernando Sahmkow2019-10-051-22/+11
| * | | | | | | vk_shader_compiler: Don't enclose branches with if(true) to avoid crashing AMDFernando Sahmkow2019-10-051-16/+33
| * | | | | | | gl_shader_decompiler: Refactor and address feedback.Fernando Sahmkow2019-10-051-17/+18
| * | | | | | | Shader_IR: corrections and clang-formatFernando Sahmkow2019-10-052-70/+64
| * | | | | | | vk_shader_compiler: Correct SPIR-V AST DecompilingFernando Sahmkow2019-10-051-4/+11
| * | | | | | | Shader_IR: allow else derivation to be optional.Fernando Sahmkow2019-10-057-10/+18
| * | | | | | | vk_shader_compiler: Implement the decompiler in SPIR-VFernando Sahmkow2019-10-053-23/+301
| * | | | | | | Shader_IR: mark labels as unused for partial decompile.Fernando Sahmkow2019-10-052-3/+9
| * | | | | | | Shader_Ir: Refactor Decompilation process and allow multiple decompilation modes.Fernando Sahmkow2019-10-0514-82/+336
| * | | | | | | gl_shader_decompiler: Implement AST decompilingFernando Sahmkow2019-10-0511-63/+358
| * | | | | | | shader_ir: Declare Manager and pass it to appropiate programs.Fernando Sahmkow2019-10-057-104/+214
| * | | | | | | shader_ir: Corrections to outward movements and misc stuffsFernando Sahmkow2019-10-057-58/+310
| * | | | | | | shader_ir: Add basic goto eliminationFernando Sahmkow2019-10-052-38/+484
| * | | | | | | shader_ir: Initial Decompile SetupFernando Sahmkow2019-10-056-5/+510
| |/ / / / / /
* | | | | | | Texture_Cache: Blit Deduction corrections and simplifications.Fernando Sahmkow2019-10-051-18/+20
* | | | | | | TextureCache: Add the ability to deduce if two textures are depth on blit.Fernando Sahmkow2019-10-051-2/+142
|/ / / / / /
* | | | | | SDL: Fix missing headerFernando Sahmkow2019-10-051-0/+1
* | | | | | Merge pull request #2896 from FearlessTobi/port-4950bunnei2019-10-043-2/+17
|\ \ \ \ \ \
| * | | | | | Add FPS to SDL title barjroweboy2019-09-223-2/+17
* | | | | | | Merge pull request #2936 from VPeruS/use-isallzeroarraybunnei2019-10-041-1/+1
|\ \ \ \ \ \ \
| * | | | | | | [crypto] Use IsAllZeroArray helper functionvperus2019-10-021-1/+1
* | | | | | | | Merge pull request #2898 from FearlessTobi/port-4004bunnei2019-10-042-1/+3
|\ \ \ \ \ \ \ \
| * | | | | | | | qt_themes: add two colorful themesFearlessTobi2019-09-222-1/+3
* | | | | | | | | Merge pull request #2539 from DarkLordZach/bcatDavid2019-10-0336-41/+1985
|\ \ \ \ \ \ \ \ \ | |_|/ / / / / / / |/| | | | | | | |
| * | | | | | | | qt: Add service dialogZach Hilman2019-10-025-17/+20
| * | | | | | | | boxcat: Use updated game-asset API URL and tagsZach Hilman2019-10-011-6/+6
| * | | | | | | | bcat: Add FSC accessors for BCAT dataZach Hilman2019-10-0110-31/+51
| * | | | | | | | boxcat: Implement events global fieldZach Hilman2019-09-306-30/+43
| * | | | | | | | bcat: Implement DeliveryCacheProgressImpl structureZach Hilman2019-09-306-88/+314
| * | | | | | | | boxcat: Use Etag header names for file digestZach Hilman2019-09-302-24/+21
| * | | | | | | | boxcat: Add downloading and client for launch parameter dataZach Hilman2019-09-302-16/+77
| * | | | | | | | bcat: Add backend function for BCAT Indirect (launch parameter)Zach Hilman2019-09-302-0/+11
| * | | | | | | | bcat: Expose CreateBackendFromSettings helper functionZach Hilman2019-09-302-2/+2
| * | | | | | | | am: Unstub PopLaunchParameter and add bcat connection for app-specific dataZach Hilman2019-09-302-16/+52
| * | | | | | | | configure_service: Allow Qt to open external linksZach Hilman2019-09-301-0/+3
| * | | | | | | | yuzu: Add UI tab to configure BCAT servicesZach Hilman2019-09-306-0/+302
| * | | | | | | | bcat: Implement cmd 90201 ClearDeliveryCacheStorageZach Hilman2019-09-301-1/+23
| * | | | | | | | bcat: Implement cmd 30100 SetPassphraseZach Hilman2019-09-301-1/+33
| * | | | | | | | bcat: Implement cmd RequestSyncDeliveryCache and variantZach Hilman2019-09-301-2/+70
| * | | | | | | | bcat: Implement IDeliveryCacheProgressService commandsZach Hilman2019-09-301-0/+131
| * | | | | | | | bcat: Implement IDeliveryCacheFileService commandsZach Hilman2019-09-301-0/+117
| * | | | | | | | bcat: Implement IDeliveryCacheDirectoryService commandsZach Hilman2019-09-301-0/+99
| * | | | | | | | bcat: Implement IDeliveryCacheStorageService commandsZach Hilman2019-09-301-0/+58
| * | | | | | | | bcat: Add commands to create IDeliveryCacheStorageServiceZach Hilman2019-09-303-2/+32
| * | | | | | | | module: Create BCAT backend based upon Settings value on constructionZach Hilman2019-09-303-1/+36
| * | | | | | | | bcat: Add BCAT backend for Boxcat serviceZach Hilman2019-09-302-0/+407
| * | | | | | | | bcat: Add backend class to generify the functions of BCATZach Hilman2019-09-302-0/+100
| * | | | | | | | settings: Add option to set BCAT backendZach Hilman2019-09-306-0/+34
| * | | | | | | | nifm: Signal to applications that internet access is availableZach Hilman2019-09-301-3/+10
| * | | | | | | | core/loader: Track the NSO build ID of the current processZach Hilman2019-09-303-0/+14
| * | | | | | | | applets: Add accessor for AppletFrontendSetZach Hilman2019-09-302-0/+6
| * | | | | | | | filesystem: Add getter for BCAT temporary directoryZach Hilman2019-09-303-0/+16
| * | | | | | | | vfs: Add function to extract ZIP file into virtual filesystemZach Hilman2019-09-302-0/+96
| | |_|_|_|/ / / | |/| | | | | |
* | | | | | | | Merge pull request #2904 from ogniK5377/better-signal-hidbunnei2019-10-011-8/+2
|\ \ \ \ \ \ \ \ | |/ / / / / / / |/| | | | | | |
| * | | | | | | Signal styleset changes at a better timeDavid Marcec2019-09-241-8/+2
| | |_|_|_|/ / | |/| | | | |
* | | | | | | Revert "arm_dynarmic: Check if jit is nullptr when preparing reschedule"bunnei2019-09-301-3/+0
* | | | | | | Merge pull request #2574 from DarkLordZach/dynarmic-jit-nullptrbunnei2019-09-301-0/+3
|\ \ \ \ \ \ \ | |_|_|_|_|/ / |/| | | | | |
| * | | | | | arm_dynarmic: Check if jit is nullptr when preparing rescheduleZach Hilman2019-06-101-0/+3
* | | | | | | gl_shader_decompiler: Add tailing return for HUnpack2ReinUsesLisp2019-09-241-0/+2
* | | | | | | gl_shader_decompiler: Fix clang build issuesReinUsesLisp2019-09-241-26/+23
| |/ / / / / |/| | | | |
* | | | | | Merge pull request #2869 from ReinUsesLisp/suldbunnei2019-09-2411-229/+199
|\ \ \ \ \ \ | |_|_|_|_|/ |/| | | | |
| * | | | | gl_shader_decompiler: Use uint for images and fix SUATOMReinUsesLisp2019-09-217-188/+93
| * | | | | shader/image: Implement SULD and remove irrelevant codeReinUsesLisp2019-09-2110-47/+110
| * | | | | shader_bytecode: Add SULD encodingReinUsesLisp2019-09-211-0/+2
* | | | | | cmake: Add SCM detection for AzureZach Hilman2019-09-221-0/+3
| |_|_|_|/ |/| | | |
* | | | | Merge pull request #2683 from DarkLordZach/lock-exitDavid2019-09-228-8/+92
|\ \ \ \ \
| * | | | | main: Use const on all variable initializationsZach Hilman2019-09-221-2/+2
| * | | | | qt: Prompt user for confirmation if exit lock is activeZach Hilman2019-09-223-1/+44
| * | | | | am: Implement ISelfController ExitLock commandsZach Hilman2019-09-221-2/+6
| * | | | | am: Implement ISelfController ExitZach Hilman2019-09-224-4/+20
| * | | | | am: Add RequestExit event to AppletMessageQueueZach Hilman2019-09-222-0/+6
| * | | | | core: Track system exit lock statusZach Hilman2019-09-222-0/+15
* | | | | | Merge pull request #2889 from FearlessTobi/adwsawdawdDavid2019-09-221-0/+1
|\ \ \ \ \ \
| * | | | | | Add missing includeFearlessTobi2019-09-221-0/+1
| | |_|_|/ / | |/| | | |
* | | | | | Merge pull request #2876 from ogniK5377/AcquireNpadStyleSetUpdateEventHandle-fixZach Hilman2019-09-223-11/+18
|\ \ \ \ \ \
| * | | | | | removed commentDavid Marcec2019-09-221-1/+0
| * | | | | | RebasedDavid Marcec2019-09-223-11/+19
| |/ / / / /
* | | | | | Merge pull request #2877 from ogniK5377/framecount-rev7Zach Hilman2019-09-222-11/+24
|\ \ \ \ \ \
| * | | | | | Used revision 5 instead of 7, marked constexpr as staticDavid Marcec2019-09-211-2/+2
| * | | | | | Added frame_count for REV7 audio rendererDavid Marcec2019-09-202-11/+24
* | | | | | | Merge pull request #2895 from FearlessTobi/debug-logsDavid2019-09-221-7/+7
|\ \ \ \ \ \ \
| * | | | | | | service/acc: Lower log severity from INFO to DEBUGFearlessTobi2019-09-221-7/+7
* | | | | | | | Merge pull request #2873 from ogniK5377/new-ioctlsFernando Sahmkow2019-09-2224-73/+153
|\ \ \ \ \ \ \ \ | |_|_|/ / / / / |/| | | | | | |
| * | | | | | | server side clang format fix2David Marcec2019-09-221-18/+18
| * | | | | | | Use clang-format provided by build serverDavid Marcec2019-09-221-20/+18
| * | | | | | | disable clang-format tempDavid Marcec2019-09-201-0/+2
| * | | | | | | Initial implementation of Ioctl2 & Ioctl3David Marcec2019-09-1924-63/+143
| | |/ / / / / | |/| | | | |
* | | | | | | Merge pull request #2884 from ogniK5377/deglobal-sys-servicesFernando Sahmkow2019-09-2264-212/+291
|\ \ \ \ \ \ \
| * | | | | | | removed unneeded semicolonDavid Marcec2019-09-221-1/+1
| * | | | | | | Removed reference to core timing to nvflinger and used system insteadDavid Marcec2019-09-221-1/+1
| * | | | | | | marked controller constructors as explicitDavid Marcec2019-09-228-8/+8
| * | | | | | | RebaseDavid Marcec2019-09-2225-62/+75
| * | | | | | | RebaseDavid Marcec2019-09-225-20/+21
| * | | | | | | Deglobalize System: ViDavid Marcec2019-09-223-8/+8
| * | | | | | | Deglobalize System: TimeDavid Marcec2019-09-224-14/+21
| * | | | | | | RebaseDavid Marcec2019-09-222-8/+12
| * | | | | | | Deglobalize System: NvFlingerDavid Marcec2019-09-222-6/+7
| * | | | | | | RebaseDavid Marcec2019-09-224-8/+12
| * | | | | | | Deglobalize System: NimDavid Marcec2019-09-222-7/+12
| * | | | | | | Deglobalize System: NifmDavid Marcec2019-09-222-13/+23
| * | | | | | | Deglobalize System: NFPDavid Marcec2019-09-224-14/+16
| * | | | | | | Deglobalize System: LDRDavid Marcec2019-09-222-6/+7
| * | | | | | | Deglobalize System: IRSDavid Marcec2019-09-223-5/+6
| * | | | | | | Deglobalize System: HidDavid Marcec2019-09-2220-37/+44
| * | | | | | | Deglobalize System: FriendDavid Marcec2019-09-224-22/+24
| * | | | | | | Deglobalize System: FatalDavid Marcec2019-09-226-20/+29
| * | | | | | | Deglobalize System: BtmDavid Marcec2019-09-222-7/+13
| * | | | | | | Deglobalize System: BtdrvDavid Marcec2019-09-222-5/+9
| * | | | | | | Deglobalize System: AocDavid Marcec2019-09-222-11/+13
| * | | | | | | Deglobalize System: AmDavid Marcec2019-09-221-1/+1
* | | | | | | | Merge pull request #2870 from FernandoS27/multi-drawDavid2019-09-229-91/+273
|\ \ \ \ \ \ \ \
| * | | | | | | | Maxwell3D: Corrections and refactors to MME instance refactorFernando Sahmkow2019-09-224-44/+46
| * | | | | | | | Rasterizer: Correct introduced bug where a conditional render wouldn't stop a draw call from executingFernando Sahmkow2019-09-201-10/+16
| * | | | | | | | Rasterizer: Refactor and simplify DrawBatch Interface.Fernando Sahmkow2019-09-194-35/+16
| * | | | | | | | Rasterizer: Address Feedback and conscerns.Fernando Sahmkow2019-09-191-11/+11
| * | | | | | | | Rasterizer: Refactor draw calls, remove deadcode and clean up.Fernando Sahmkow2019-09-193-106/+68
| * | | | | | | | VideoCore: Corrections to the MME Inliner and removal of hacky instance management.Fernando Sahmkow2019-09-196-31/+81
| * | | | | | | | Video Core: initial Implementation of InstanceDraw PackagingFernando Sahmkow2019-09-197-11/+192
| | |/ / / / / / | |/| | | | | |
* | | | | | | | Merge pull request #2891 from FearlessTobi/rod-texFernando Sahmkow2019-09-228-24/+39
|\ \ \ \ \ \ \ \ | |_|_|_|_|_|_|/ |/| | | | | | |
| * | | | | | | Fix clang-formatFearlessTobi2019-09-222-2/+2
| * | | | | | | fermi_2d: Lower surface copy log severity to DEBUGFearlessTobi2019-09-221-1/+1
| * | | | | | | video_core: Implement RGBX16F PixelFormatFearlessTobi2019-09-227-22/+37
| | |_|/ / / / | |/| | | | |
* | | | | | | Merge pull request #2867 from ReinUsesLisp/configure-framebuffers-cleanDavid2019-09-224-121/+33
|\ \ \ \ \ \ \
| * | | | | | | gl_rasterizer: Remove unused code paths from ConfigureFramebuffersReinUsesLisp2019-09-174-121/+33
* | | | | | | | Revert "Merge pull request #2709 from DarkLordZach/oss-ext-fonts-1"David Marcec2019-09-2218-73477/+123
| |_|_|/ / / / |/| | | | | |
* | | | | | | Merge pull request #2535 from DarkLordZach/cheat-v2David2019-09-2215-760/+1962
|\ \ \ \ \ \ \
| * | | | | | | dmnt_cheat_vm: Default initialize structure valuesZach Hilman2019-09-223-89/+88
| * | | | | | | dmnt_cheat_vm: Make Cheat VM compliant to code styleZach Hilman2019-09-224-870/+862
| * | | | | | | core: Initialize cheats after load to avoid VMManager crashZach Hilman2019-09-221-0/+5
| * | | | | | | core: Update RegisterCheatList for new VMZach Hilman2019-09-222-11/+16
| * | | | | | | patch_manager: Update cheat parsing for new VMZach Hilman2019-09-222-15/+20
| * | | | | | | nso: Pass build ID directlyZach Hilman2019-09-221-2/+1
| * | | | | | | cheat_engine: Move to memory and strip VMZach Hilman2019-09-225-728/+325
| * | | | | | | memory: Port Atmosphere's DmntCheatVmZach Hilman2019-09-223-0/+1598
| * | | | | | | log: Add logging class for Cheat EngineZach Hilman2019-09-222-0/+2
* | | | | | | | Merge pull request #2709 from DarkLordZach/oss-ext-fonts-1David2019-09-2218-123/+73477
|\ \ \ \ \ \ \ \ | |_|_|_|_|/ / / |/| | | | | | |
| * | | | | | | pl_u: Use kernel physical memoryZach Hilman2019-09-222-4/+8
| * | | | | | | pl_u: Remove excess static qualifierZach Hilman2019-09-221-1/+1
| * | | | | | | pl_u: Use OSS system archives if real archives don't existZach Hilman2019-09-223-111/+42
| * | | | | | | system_archive: Synthesize shared fonts system archivesZach Hilman2019-09-223-5/+101
| * | | | | | | pl_u: Expose method to encrypt TTF to BFTTFZach Hilman2019-09-222-14/+14
| * | | | | | | externals: Move OSS font data to file_sys in coreZach Hilman2019-09-2213-1/+73324
| | |_|/ / / / | |/| | | | |
* | | | | | | Merge pull request #2612 from DarkLordZach/prepo-newDavid2019-09-225-30/+99
|\ \ \ \ \ \ \ | |_|/ / / / / |/| | | | | |
| * | | | | | prepo: Remove system global accessorsZach Hilman2019-09-223-15/+18
| * | | | | | prepo: Implement SaveReport New and System variantsZach Hilman2019-09-221-15/+71
| * | | | | | reporter: Differentiate between Old, New, and System play reportsZach Hilman2019-09-222-5/+15
| |/ / / / /
* | | | | | Merge pull request #2430 from DarkLordZach/fs-controllerDavid2019-09-2255-265/+1885
|\ \ \ \ \ \
| * | | | | | configure_debug: Move reporting option to loggingZach Hilman2019-09-2215-63/+64
| * | | | | | config: Remove Dump options from configure_debugZach Hilman2019-09-214-47/+39
| * | | | | | filesystem: Add const qualification to various accessorsZach Hilman2019-09-2110-83/+94
| * | | | | | yuzu: Add UI to manage filesystem paths and sizesZach Hilman2019-09-216-1/+627
| * | | | | | core: Store FileSystemController in coreZach Hilman2019-09-212-0/+32
| * | | | | | settings: Add options for managing gamecard emulationZach Hilman2019-09-214-2/+67
| * | | | | | settings: Add options for setting storage sizesZach Hilman2019-09-213-1/+57
| * | | | | | yuzu: Port old usages of Filesystem namespace to FilesystemControllerZach Hilman2019-09-2114-46/+106
| * | | | | | settings: Update LogSettings to show NAND/SDMC paths from FileUtilZach Hilman2019-09-211-2/+3
| * | | | | | card_image: Add accessors for gamecard certificateZach Hilman2019-09-212-0/+9
| * | | | | | card_image: Add functions to query gamecard update partitionZach Hilman2019-09-212-0/+24
| * | | | | | content_archive: Add accessors for Rights ID and SDK VersionZach Hilman2019-09-212-0/+10
| * | | | | | partition_data_manager: Add accessor for decrypted PRODINFO partitionZach Hilman2019-09-212-0/+5
| * | | | | | services: Pass FileSystemController as reference to services that need itZach Hilman2019-09-2111-20/+47
| * | | | | | am: Unstub IApplicationFunctions EnsureSaveData (20)Zach Hilman2019-09-211-8/+14
| * | | | | | filesystem: Pass Size Getter functions to IFileSystem for sizesZach Hilman2019-09-213-20/+31
| * | | | | | sdmc_factory: Add SD Card size gettersZach Hilman2019-09-212-0/+12
| * | | | | | bis_factory: Add getters for NAND partition sizesZach Hilman2019-09-212-0/+38
| * | | | | | filesystem: Add FileSystemController to deglobalize FS servicesZach Hilman2019-09-212-58/+359
| * | | | | | submisson_package: Fix edge case with improperly sized filenamesZach Hilman2019-09-211-1/+2
| * | | | | | sdmc_factory: Add accessor for SDMC Album directoryZach Hilman2019-09-212-0/+6
| * | | | | | sdmc_factory: Add accessor for SDMC PlaceholderCacheZach Hilman2019-09-212-1/+10
| * | | | | | sdmc_factory: Add accessor for content directoryZach Hilman2019-09-212-0/+7
| * | | | | | savedata_factory: Implement savedata creation and don't create dir on openZach Hilman2019-09-212-26/+40
| * | | | | | patch_manager: Add short-circuit edge-case to GetPatchVersionNamesZach Hilman2019-09-211-0/+2
| * | | | | | patch_manager: Add error checking to load dir to prevent crashesZach Hilman2019-09-211-0/+15
| * | | | | | registered_cache: Process *.cnmt.nca filesZach Hilman2019-09-211-16/+23
| * | | | | | registered_cache: Implement PlaceholderCache to manage placeholder and installing contentZach Hilman2019-09-212-0/+175
| * | | | | | bis_factory: Fix mod loader edge-case with homebrew title IDsZach Hilman2019-09-211-1/+1
| * | | | | | bis_factory: Add accessors for BIS placeholder cachesZach Hilman2019-09-212-1/+20
| * | | | | | bis_factory: Add accessor for NAND Image DirectoryZach Hilman2019-09-212-0/+6
| * | | | | | bis_factory: Add accessors for BIS content directoriesZach Hilman2019-09-212-0/+11
| * | | | | | bis_factory: Add accessors for BIS partitionsZach Hilman2019-09-212-0/+61
* | | | | | | Merge pull request #2883 from ogniK5377/log-gameZach Hilman2019-09-221-3/+3
|\ \ \ \ \ \ \ | |_|/ / / / / |/| | | | | |
| * | | | | | Swapped TID and Game name to make it easier to parseDavid Marcec2019-09-211-1/+1
| * | | | | | Log the current title id and game name which is bootingDavid Marcec2019-09-211-3/+3
* | | | | | | Merge pull request #2878 from FernandoS27/icmpRodrigo Locatti2019-09-212-0/+42
|\ \ \ \ \ \ \ | |_|/ / / / / |/| | | | | |
| * | | | | | Shader_IR: ICMP corrections and fixesFernando Sahmkow2019-09-212-6/+11
| * | | | | | Shader_IR: Implement ICMP.Fernando Sahmkow2019-09-202-0/+37
| | |_|/ / / | |/| | | |
* | | | | | Merge pull request #2885 from Hexagon12/port-4944David2019-09-211-0/+8
|\ \ \ \ \ \
| * | | | | | Added Host CPU and OS to logpbarilla2019-09-211-0/+8
| | |/ / / / | |/| | | |
* | | | | | Merge pull request #2806 from FearlessTobi/port-4882David2019-09-217-10/+93
|\ \ \ \ \ \
| * | | | | | Address review commentsFearlessTobi2019-09-102-6/+9
| * | | | | | Add frametime logging for tracking performance over timefearlessTobi2019-09-107-10/+90
* | | | | | | Merge pull request #2872 from FernandoS27/mem-gpu-optDavid2019-09-211-2/+7
|\ \ \ \ \ \ \
| * | | | | | | Core/Memory: Only FlushAndInvalidate GPU if the page is marked as RasterizerCachedMemoryFernando Sahmkow2019-09-191-2/+7
| | |_|/ / / / | |/| | | | |
* | | | | | | Merge pull request #2576 from DarkLordZach/nsp-fix-1David2019-09-212-14/+39
|\ \ \ \ \ \ \
| * | | | | | | nsp: Correct status codes for extracted NSPsZach Hilman2019-06-102-13/+17
| * | | | | | | nsp: Use title ID from NPDM metadata for extracted type NSPsZach Hilman2019-06-102-1/+22
| | |_|_|_|_|/ | |/| | | | |
* | | | | | | Merge pull request #2866 from Morph1984/checkbox_fixDavid2019-09-211-0/+2
|\ \ \ \ \ \ \
| * | | | | | | When docked mode is checked, uncheck "joycons docked"Morph2019-09-171-0/+2
* | | | | | | | Merge pull request #2868 from ReinUsesLisp/fix-mipmapsDavid2019-09-211-2/+2
|\ \ \ \ \ \ \ \ | |_|_|_|_|/ / / |/| | | | | | |
| * | | | | | | maxwell_to_gl: Fix mipmap filteringReinUsesLisp2019-09-171-2/+2
| | |_|_|_|/ / | |/| | | | |
* | | | | | | Merge pull request #2879 from ogniK5377/trace-submitgpfifoDavid2019-09-211-4/+4
|\ \ \ \ \ \ \
| * | | | | | | Mark KickOffPb & SubmitGPFIFO as traceDavid Marcec2019-09-211-4/+4
| | |_|_|_|_|/ | |/| | | | |
* / | | | | | Mark DrawArrays as LOG_TRACEDavid Marcec2019-09-211-1/+1
|/ / / / / /
* | | | | | Merge pull request #2846 from ReinUsesLisp/fixup-viewport-indexbunnei2019-09-201-10/+14
|\ \ \ \ \ \
| * | | | | | gl_shader_decompiler: Avoid writing output attribute when unimplementedReinUsesLisp2019-09-061-10/+14
* | | | | | | Merge pull request #2855 from ReinUsesLisp/shflbunnei2019-09-206-9/+182
|\ \ \ \ \ \ \ | |_|_|_|_|/ / |/| | | | | |
| * | | | | | shader_ir/warp: Implement SHFLReinUsesLisp2019-09-176-9/+182
| | |/ / / / | |/| | | |
* | | | | | Merge pull request #2784 from ReinUsesLisp/smembunnei2019-09-185-21/+81
|\ \ \ \ \ \ | |/ / / / / |/| | | | |
| * | | | | gl_shader_decompiler: Implement shared memoryReinUsesLisp2019-09-051-0/+23
| * | | | | shader_ir: Implement LD_SReinUsesLisp2019-09-051-10/+13
| * | | | | shader_ir: Implement ST_SReinUsesLisp2019-09-054-11/+45
* | | | | | Merge pull request #2851 from ReinUsesLisp/srgbFernando Sahmkow2019-09-156-30/+9
|\ \ \ \ \ \
| * | | | | | renderer_opengl: Fix rebase mistakeReinUsesLisp2019-09-111-1/+1
| * | | | | | gl_rasterizer: Correct sRGB Fix regressionFernando Sahmkow2019-09-111-0/+12
| * | | | | | renderer_opengl: Fix sRGB blitsReinUsesLisp2019-09-116-43/+10
* | | | | | | Merge pull request #2824 from ReinUsesLisp/mmeFernando Sahmkow2019-09-153-4/+20
|\ \ \ \ \ \ \ | |_|_|_|/ / / |/| | | | | |
| * | | | | | maxwell_3d: Update firmware 4 call stub commentaryRodrigo Locatti2019-09-151-1/+2
| * | | | | | Revert "Revert #2466" and stub FirmwareCall 4ReinUsesLisp2019-09-043-4/+19
* | | | | | | Merge pull request #2857 from ReinUsesLisp/surface-srgbFernando Sahmkow2019-09-142-0/+22
|\ \ \ \ \ \ \
| * | | | | | | video_core/surface: Add function to detect sRGB surfacesReinUsesLisp2019-09-132-0/+22
| | |/ / / / / | |/| | | | |
* | | | | | | Merge pull request #2858 from ReinUsesLisp/vk-deviceFernando Sahmkow2019-09-143-111/+258
|\ \ \ \ \ \ \
| * | | | | | | vk_device: Add miscellaneous features and minor style changesReinUsesLisp2019-09-133-111/+258
| |/ / / / / /
* | | | | | | Merge pull request #2667 from DarkLordZach/profile-editorbunnei2019-09-145-10/+130
|\ \ \ \ \ \ \
| * | | | | | | acc_su: Implement GetProfileEditor (205)Zach Hilman2019-07-033-1/+13
| * | | | | | | acc: Implement IProfileEditor-specific commands 'Store' and 'StoreWithImage'Zach Hilman2019-07-031-1/+73
| * | | | | | | profile_manager: Add setter for ProfileBase and ProfileDataZach Hilman2019-07-032-0/+13
| * | | | | | | acc: Add IProfileCommon for IProfile and IProfileEditorZach Hilman2019-07-031-8/+31
* | | | | | | | shader/image: Implement SUATOM and fix SUSTReinUsesLisp2019-09-117-69/+329
| |/ / / / / / |/| | | | | |
* | | | | | | Merge pull request #2823 from ReinUsesLisp/shr-clampbunnei2019-09-102-6/+17
|\ \ \ \ \ \ \
| * | | | | | | shader/shift: Implement SHR wrapped and clamped variantsReinUsesLisp2019-09-042-6/+17
| | |/ / / / / | |/| | | | |
* | | | | | | Merge pull request #2810 from ReinUsesLisp/mme-optbunnei2019-09-104-12/+24
|\ \ \ \ \ \ \
| * | | | | | | maxwell_3d: Avoid moving macro_paramsReinUsesLisp2019-09-044-12/+24
| |/ / / / / /
* | | | | | | Merge pull request #2759 from ReinUsesLisp/compute-imagesFernando Sahmkow2019-09-1020-229/+457
|\ \ \ \ \ \ \ | |_|_|_|_|_|/ |/| | | | | |
| * | | | | | gl_shader_decompiler: Keep track of written images and mark them as modifiedReinUsesLisp2019-09-067-62/+92
| * | | | | | texture_cache: Minor changesReinUsesLisp2019-09-064-19/+17
| * | | | | | gl_rasterizer: Apply textures and images stateReinUsesLisp2019-09-061-0/+2
| * | | | | | gl_rasterizer: Add samplers to compute dispatchesReinUsesLisp2019-09-062-3/+36
| * | | | | | gl_rasterizer: Minor code changesReinUsesLisp2019-09-062-20/+31
| * | | | | | gl_state: Split textures and samplers into two arraysReinUsesLisp2019-09-064-91/+39
| * | | | | | gl_rasterizer: Implement image bindingsReinUsesLisp2019-09-065-32/+106
| * | | | | | gl_state: Add support for glBindImageTexturesReinUsesLisp2019-09-062-0/+24
| * | | | | | texture_cache: Pass TIC to texture cacheReinUsesLisp2019-09-064-27/+25
| * | | | | | kepler_compute: Implement texture queriesReinUsesLisp2019-09-065-5/+99
| * | | | | | gl_rasterizer: Split SetupTexturesReinUsesLisp2019-09-062-22/+38
| | |_|_|/ / | |/| | | |
* | | | | | Merge pull request #2847 from VelocityRa/nro-nacp-fixDavid2019-09-092-0/+10
|\ \ \ \ \ \
| * | | | | | nro: Implement ReadControlDataNick Renieris2019-09-072-0/+10
* | | | | | | Merge pull request #2716 from lioncash/hle-globalDavid2019-09-0917-97/+143
|\ \ \ \ \ \ \
| * | | | | | | service/am: Remove usages of global system accessorsLioncash2019-09-0517-97/+143
* | | | | | | | Merge pull request #2763 from lioncash/map-physDavid2019-09-092-39/+41
|\ \ \ \ \ \ \ \ | |_|_|/ / / / / |/| | | | | | |
| * | | | | | | kernel/vm_manager: Correct doxygen comment parameter tags for MapPhysicalMemory/UnmapPhysicalMemoryLioncash2019-09-051-4/+4
| * | | | | | | kernel/vm_manager: Move variables closer to usage spots in MapPhysicalMemory/UnmapPhysicalMemoryLioncash2019-09-051-16/+10
| * | | | | | | kernel/vm_manager: Correct behavior in failure case of UnmapPhysicalMemory()Lioncash2019-08-301-0/+2
| * | | | | | | kernel/vm_manager: Reserve memory ahead of time for slow path in MergeAdjacentVMALioncash2019-08-301-1/+4
| * | | | | | | kernel/vm_manager: std::move shared_ptr instance in MergeAdjacentVMALioncash2019-08-301-1/+1
| * | | | | | | kernel/vm_manager: Deduplicate iterator creation in MergeAdjacentVMALioncash2019-08-301-7/+10
| * | | | | | | kernel/vm_manager: Simplify some std::vector constructor callsLioncash2019-08-301-2/+2
| * | | | | | | kernel/vm_manager: Simplify some assertion messagesLioncash2019-08-301-10/+10
* | | | | | | | Merge pull request #2804 from ReinUsesLisp/remove-gs-specialFernando Sahmkow2019-09-052-80/+9
|\ \ \ \ \ \ \ \
| * | | | | | | | gl_shader_cache: Remove special casing for geometry shadersReinUsesLisp2019-09-042-80/+9
| | |_|_|/ / / / | |/| | | | | |
* | | | | | | | Merge pull request #2833 from ReinUsesLisp/fix-stencilbunnei2019-09-051-11/+11
|\ \ \ \ \ \ \ \ | |_|_|_|_|_|/ / |/| | | | | | |
| * | | | | | | gl_rasterizer: Fix stencil testingReinUsesLisp2019-09-041-11/+11
| |/ / / / / /
* | | | | | | Merge pull request #2797 from FearlessTobi/port-4877David2019-09-051-0/+11
|\ \ \ \ \ \ \
| * | | | | | | Address review commentsFearlessTobi2019-09-051-1/+4
| * | | | | | | Guard unistd.h with MacOS only macroWeiyi Wang2019-08-221-1/+3
| * | | | | | | citra_qt: on osx chdir to bundle dir to allow detection of user folderB3n302019-08-221-0/+6
* | | | | | | | Merge pull request #2802 from ReinUsesLisp/hsetp2-predDavid2019-09-051-10/+9
|\ \ \ \ \ \ \ \
| * | | | | | | | half_set_predicate: Fix predicate assignmentsReinUsesLisp2019-09-041-10/+9
| | |/ / / / / / | |/| | | | | |
* | | | | | | | Merge pull request #2418 from DarkLordZach/srv-esDavid2019-09-053-51/+536
|\ \ \ \ \ \ \ \
| * | | | | | | | key_manager: Convert Ticket union to std::variantZach Hilman2019-07-083-57/+88
| * | | | | | | | es: Populate/synthesize tickets on constructionZach Hilman2019-07-083-15/+17
| * | | | | | | | key_manager: Add structure for Ticket parsingZach Hilman2019-07-083-44/+194
| * | | | | | | | es: Implement ETicket GetPersonalizedTicketData (17)Zach Hilman2019-07-081-1/+21
| * | | | | | | | es: Implement ETicket GetCommonTicketData (16)Zach Hilman2019-07-081-1/+20
| * | | | | | | | es: Implement ETicket GetPersonalizedTicketSize (15)Zach Hilman2019-07-081-1/+17
| * | | | | | | | es: Implement ETicket GetCommonTicketSize (14)Zach Hilman2019-07-081-1/+17
| * | | | | | | | es: Implement ETicket ListPersonalizedTicket (12)Zach Hilman2019-07-081-1/+24
| * | | | | | | | es: Implement ETicket ListCommonTicket (11)Zach Hilman2019-07-081-1/+24
| * | | | | | | | es: Implement ETicket CountPersonalizedTicket (10)Zach Hilman2019-07-081-1/+12
| * | | | | | | | es: Implement ETicket CountCommonTicket (9)Zach Hilman2019-07-081-1/+12
| * | | | | | | | es: Implement ETicket GetTitleKey (8)Zach Hilman2019-07-081-1/+27
| * | | | | | | | es: Implement ETicket ImportTicket (1)Zach Hilman2019-07-081-1/+45
| * | | | | | | | key_manager: Add accessors/helpers for ticket managementZach Hilman2019-07-082-14/+100
| * | | | | | | | key_manager: Add equality operator for RSAKeyPairZach Hilman2019-07-081-0/+7
* | | | | | | | | Merge pull request #2808 from FearlessTobi/port-4866David2019-09-051-20/+24
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | configure_dialog: reverse tab map to avoid logic based on user-facing/translatable textfearlessTobi2019-09-041-20/+24
| | |_|/ / / / / / | |/| | | | | | |
* | | | | | | | | Merge pull request #2707 from DarkLordZach/oss-miimodelDavid2019-09-054-1/+63
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | system_archive: Add open-source reimplementation of MiiModel dataZach Hilman2019-07-104-1/+63
* | | | | | | | | | yuzu/configure: move speed limiter to generalFearlessTobi2019-09-054-33/+36
| |_|_|_|_|/ / / / |/| | | | | | | |
* | | | | | | | | Merge pull request #2830 from FearlessTobi/port-4911David2019-09-051-7/+10
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | Add cancel option to analog stick configurationfearlessTobi2019-09-031-7/+10
| | |_|_|_|_|/ / / | |/| | | | | | |
* | | | | | | | | Merge pull request #2834 from Morph1984/audrenu_QueryAudioDeviceInputEventDavid2019-09-051-1/+15
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | Add Kernel::EventPair audio_input_device_switch_event;Morph19842019-09-041-0/+1
| * | | | | | | | | audren_u: Stub IAudioDevice::QueryAudioDeviceInputEventMorph19842019-09-041-1/+14
| |/ / / / / / / /
* | | | | | | | | Merge pull request #2836 from Morph1984/hid_vibrationDavid2019-09-054-2/+32
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | dittoMorph19842019-09-041-1/+1
| * | | | | | | | | IsVibrationEnabled() as a const member funcMorph19842019-09-041-1/+1
| * | | | | | | | | clang-formatMorph19842019-09-041-2/+2
| * | | | | | | | | Update npad.hMorph19842019-09-041-0/+1
| * | | | | | | | | Update npad.cppMorph19842019-09-041-0/+6
| * | | | | | | | | Update hid.hMorph19842019-09-041-0/+2
| * | | | | | | | | Update hid.cppMorph19842019-09-041-2/+23
| |/ / / / / / / /
* | | | | | | | | Merge pull request #2818 from MysticExile/fmtDavid2019-09-052-2/+2
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | Fix clang-formatEthan2019-09-041-1/+1
| * | | | | | | | | accommodate for fmt updateEthan2019-08-292-2/+2
* | | | | | | | | | Merge pull request #2801 from ReinUsesLisp/typed-decompilerbunnei2019-09-043-431/+548
|\ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | gl_shader_decompiler: Fixup slow pathReinUsesLisp2019-09-041-1/+1
| * | | | | | | | | | gl_device: Disable precise in fragment shaders on bugged driversReinUsesLisp2019-09-043-15/+43
| * | | | | | | | | | gl_shader_decompiler: Fixup AMD's slow path typeReinUsesLisp2019-09-041-1/+1
| * | | | | | | | | | gl_shader_decompiler: Rework GLSL decompiler type systemReinUsesLisp2019-09-041-416/+505
| | |_|_|_|_|/ / / / | |/| | | | | | | |
* | | | | | | | | | AM: Stub IApplicationFunctions::GetGpuErrorDetectedSystemEvent (#2827)mailwl2019-09-042-0/+16
* | | | | | | | | | Merge pull request #2829 from Morph1984/audiobunnei2019-09-041-2/+15
|\ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | remove <f32>Morph19842019-09-041-1/+1
| * | | | | | | | | | explicitly represent 1 as a float (1.0f instead of 1)Morph19842019-09-041-1/+1
| * | | | | | | | | | Change u32 -> f32Morph19842019-09-041-1/+1
| * | | | | | | | | | service/audio/audren_u: Stub IAudioDevice::GetAudioDeviceOutputVolumeMorph19842019-09-031-2/+15
| | |_|/ / / / / / / | |/| | | | | | | |
* | | | | | | | | | Fix uisettings includefearlessTobi2019-09-041-1/+1
* | | | | | | | | | Limit the size of directory icons, fix text when icon size is nonefearlessTobi2019-09-042-4/+3
* | | | | | | | | | Change QList to QVectorfearlessTobi2019-09-045-16/+19
* | | | | | | | | | Separate UserNand and Sdmc directoriesfearlessTobi2019-09-045-32/+59
* | | | | | | | | | Address more trivial review commentsfearlessTobi2019-09-044-25/+18
* | | | | | | | | | Address trivial review commentsfearlessTobi2019-09-047-53/+59
* | | | | | | | | | yuzu: Add support for multiple game directoriesfearlessTobi2019-09-0412-195/+666
| |/ / / / / / / / |/| | | | | | | |
* | | | | | | | | Merge pull request #2708 from DarkLordZach/mii-db-source-crashDavid2019-09-041-0/+4
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | mii: Handle logging of unknown database sourceZach Hilman2019-07-101-0/+4
| | |_|/ / / / / / | |/| | | | | | |
* | | | | | | | | Merge pull request #2793 from ReinUsesLisp/bgr565bunnei2019-09-0415-204/+71
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | renderer_opengl: Implement RGB565 framebuffer formatReinUsesLisp2019-08-213-3/+9
| * | | | | | | | | renderer_opengl: Use block linear swizzling for CPU framebuffersReinUsesLisp2019-08-213-150/+33
| * | | | | | | | | renderer_opengl: Use VideoCore pixel formatReinUsesLisp2019-08-213-23/+11
| * | | | | | | | | gpu: Change optional<reference_wrapper<T>> to T* for FramebufferConfigReinUsesLisp2019-08-2111-32/+22
* | | | | | | | | | Merge pull request #2812 from ReinUsesLisp/f2i-selectorbunnei2019-09-042-7/+23
|\ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | shader_ir/conversion: Split int and float selector and implement F2F H1ReinUsesLisp2019-08-282-19/+24
| * | | | | | | | | | shader_ir/conversion: Implement F2I F16 Ra.H1ReinUsesLisp2019-08-282-6/+17
| | |_|_|_|/ / / / / | |/| | | | | | | |
* | | | | | | | | | Merge pull request #2811 from ReinUsesLisp/fsetp-fixbunnei2019-09-042-4/+6
|\ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | float_set_predicate: Add missing negation bit for the second operandReinUsesLisp2019-08-282-4/+6
| |/ / / / / / / / /
* | | | | | | | | | Merge pull request #2826 from ReinUsesLisp/macro-bindingbunnei2019-09-042-10/+4
|\ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | maxwell_3d: Fix macro binding cursorReinUsesLisp2019-09-012-10/+4
* | | | | | | | | | | Merge pull request #2831 from FearlessTobi/port-4914bunnei2019-09-042-0/+22
|\ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | Fix to Windows sleep issuesfearlessTobi2019-09-032-0/+22
| | |_|_|_|/ / / / / / | |/| | | | | | | | |
* / | | | | | | | | | configuration/config: Add missing screenshot path readfearlessTobi2019-09-041-0/+1
|/ / / / / / / / / /
* | | | | | | | | | Merge pull request #2765 from FernandoS27/dma-fixbunnei2019-09-013-23/+36
|\ \ \ \ \ \ \ \ \ \ | |/ / / / / / / / / |/| | | | | | | | |
| * | | | | | | | | MaxwellDMA: Fixes, corrections and relaxations.Fernando Sahmkow2019-07-263-23/+36
* | | | | | | | | | video_core: Silent miscellaneous warnings (#2820)Rodrigo Locatti2019-08-3023-48/+22
| |_|_|_|_|_|/ / / |/| | | | | | | |
* | | | | | | | | gl_buffer_cache: Add missing includeReinUsesLisp2019-08-301-0/+1
* | | | | | | | | Merge pull request #2742 from ReinUsesLisp/fix-texture-buffersbunnei2019-08-294-4/+12
|\ \ \ \ \ \ \ \ \ | |_|_|_|_|/ / / / |/| | | | | | | |
| * | | | | | | | gl_shader_decompiler: Rename bufferImage to imageBufferReinUsesLisp2019-07-181-1/+1
| * | | | | | | | gl_shader_cache: Fix newline on buffer preprocessor definitionsReinUsesLisp2019-07-181-2/+6
| * | | | | | | | textures: Fix texture buffer size calculationReinUsesLisp2019-07-181-1/+1
| * | | | | | | | gl_texture_cache: Do not set texture parameters to buffersReinUsesLisp2019-07-181-0/+3
| * | | | | | | | gl_texture_cache: Add missing break in CreateTextureReinUsesLisp2019-07-181-0/+1
* | | | | | | | | Merge pull request #2783 from FernandoS27/new-buffer-cachebunnei2019-08-299-330/+684
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | Buffer Cache: Adress Feedback.Fernando Sahmkow2019-08-212-7/+6
| * | | | | | | | | Buffer_Cache: Implement flushing.Fernando Sahmkow2019-08-212-1/+30
| * | | | | | | | | Buffer_Cache: Implement barriers.Fernando Sahmkow2019-08-211-0/+4
| * | | | | | | | | Buffer_Cache: Optimize and track written areas.Fernando Sahmkow2019-08-212-12/+104
| * | | | | | | | | BufferCache: Rework mapping caching.Fernando Sahmkow2019-08-212-49/+76
| * | | | | | | | | Buffer_Cache: Fixes and optimizations.Fernando Sahmkow2019-08-212-68/+38
| * | | | | | | | | Video_Core: Implement a new Buffer CacheFernando Sahmkow2019-08-219-327/+560
| | |_|/ / / / / / | |/| | | | | | |
* | | | | | | | | Merge pull request #2758 from ReinUsesLisp/packed-tidbunnei2019-08-293-0/+15
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | shader/decode: Implement S2R TicReinUsesLisp2019-07-223-0/+15
* | | | | | | | | | shader_ir: Implement VOTEReinUsesLisp2019-08-2112-1/+163
| |/ / / / / / / / |/| | | | | | | |
* | | | | | | | | Merge pull request #2748 from FernandoS27/align-memorybunnei2019-08-2115-37/+119
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | Common/Alignment: Add noexcept where required.Fernando Sahmkow2019-07-201-5/+5
| * | | | | | | | | Kernel: Address FeedbackFernando Sahmkow2019-07-193-6/+11
| * | | | | | | | | Common: Correct alignment allocator to work on C++14 or higher.Fernando Sahmkow2019-07-191-37/+19
| * | | | | | | | | VM_Manager: Align allocated memory to 256bytesFernando Sahmkow2019-07-1915-36/+131
* | | | | | | | | | Merge pull request #2769 from FernandoS27/commands-flushbunnei2019-08-216-0/+15
|\ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | GPU: Flush commands on every dma pusher step.Fernando Sahmkow2019-07-266-0/+15
* | | | | | | | | | | Merge pull request #2777 from ReinUsesLisp/hsetp2-fe3h-fixbunnei2019-08-211-1/+1
|\ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | half_set_predicate: Fix HSETP2_C constant buffer offsetReinUsesLisp2019-08-041-1/+1
| |/ / / / / / / / / /
* | | | | | | | | | | Merge pull request #2753 from FernandoS27/float-convertbunnei2019-08-215-18/+75
|\ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | Shader_Ir: Implement F16 Variants of F2F, F2I, I2F.Fernando Sahmkow2019-07-205-18/+75
* | | | | | | | | | | | Merge pull request #2773 from lioncash/test-unusedbunnei2019-08-211-2/+1
|\ \ \ \ \ \ \ \ \ \ \ \ | |_|_|_|_|_|_|/ / / / / |/| | | | | | | | | | |
| * | | | | | | | | | | yuzu-tester/yuzu: Correct format stringLioncash2019-07-301-1/+1
| * | | | | | | | | | | yuzu-tester/yuzu: Remove unused variableLioncash2019-07-301-1/+0
| | |_|_|/ / / / / / / | |/| | | | | | | | |
* | | | | | | | | | | Merge pull request #2747 from lioncash/audiobunnei2019-08-187-108/+179
|\ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | service/audren_u: Handle audio USB output revision queries in ListAudioDeviceName()Lioncash2019-07-192-16/+45
| * | | | | | | | | | | service/audren_u: Move revision testing code out of AudRenULioncash2019-07-192-63/+63
| * | | | | | | | | | | service/audio: Remove global system accessorsLioncash2019-07-197-34/+54
| * | | | | | | | | | | service/audren_u: Remove unnecessary return value from GetActiveAudioDeviceName()Lioncash2019-07-191-2/+1
| * | | | | | | | | | | service/audren_u: Report proper device namesLioncash2019-07-191-6/+29
| | |_|_|/ / / / / / / | |/| | | | | | | | |
* | | | | | | | | | | Merge pull request #2778 from ReinUsesLisp/nopbunnei2019-08-182-0/+13
|\ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | shader_ir: Implement NOPReinUsesLisp2019-08-042-0/+13
| | |_|_|/ / / / / / / | |/| | | | | | | | |
* | | | | | | | | | | Merge pull request #2768 from ReinUsesLisp/hsetp2-fixbunnei2019-08-181-3/+3
|\ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | decode/half_set_predicate: Fix predicatesReinUsesLisp2019-07-261-3/+3
* | | | | | | | | | | | Fixup! #2772 missed this one fileJames Rowe2019-08-171-1/+1
* | | | | | | | | | | | Merge pull request #2766 from FearlessTobi/port-4849James Rowe2019-08-177-21/+21
|\ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | Qt: Fixed behaviour of buttons by connecting functors to correct signalsSilent2019-08-027-21/+21
| | |_|_|_|_|_|/ / / / / | |/| | | | | | | | | |
* | | | | | | | | | | | Merge pull request #2772 from lioncash/uiJames Rowe2019-08-1716-44/+39
|\ \ \ \ \ \ \ \ \ \ \ \ | |_|_|/ / / / / / / / / |/| | | | | | | | | | |
| * | | | | | | | | | | yuzu/CMakeLists: Remove qt5_wrap_ui macro usageLioncash2019-08-0916-44/+39
| | |_|_|/ / / / / / / | |/| | | | | | | | |
* | | | | | | | | | | Merge pull request #2592 from FernandoS27/sync1bunnei2019-07-2644-229/+732
|\ \ \ \ \ \ \ \ \ \ \ | |_|_|/ / / / / / / / |/| | | | | | | | | |
| * | | | | | | | | | NVServices: Correct delayed responses.Fernando Sahmkow2019-07-051-24/+19
| * | | | | | | | | | Nv_Host_Ctrl: Correct difference calculationFernando Sahmkow2019-07-051-5/+7
| * | | | | | | | | | NVServices: Address FeedbackFernando Sahmkow2019-07-058-21/+38
| * | | | | | | | | | NVServices: Styling, define constructors as explicit and correctionsFernando Sahmkow2019-07-0524-65/+73
| * | | | | | | | | | NVFlinger: Correct GCC compile errorFernando Sahmkow2019-07-058-23/+22
| * | | | | | | | | | NVServices: Make NVEvents Automatic according to documentation.Fernando Sahmkow2019-07-054-7/+13
| * | | | | | | | | | NVServices: Correct CtrlEventWaitSync to block the ipc until timeout.Fernando Sahmkow2019-07-0523-31/+104
| * | | | | | | | | | GPU: Correct Interrupts to interrupt on syncpt/value instead of event, mirroring hardwareFernando Sahmkow2019-07-0512-48/+45
| * | | | | | | | | | nvflinger: Make the force 30 fps still force 30 fpsFernando Sahmkow2019-07-051-1/+1
| * | | | | | | | | | nv_services: Fixes to event liberation.Fernando Sahmkow2019-07-051-6/+14
| * | | | | | | | | | nvflinger: Acquire buffers in the same order as they were queued.Fernando Sahmkow2019-07-052-3/+11
| * | | | | | | | | | nv_services: Deglobalize NvServicesFernando Sahmkow2019-07-0523-51/+65
| * | | | | | | | | | gpu_asynch: Simplify synchronization to a simpler consumer->producer scheme.Fernando Sahmkow2019-07-052-47/+3
| * | | | | | | | | | nv_host_ctrl: Make Sync GPU variant always return synced result.Fernando Sahmkow2019-07-055-5/+16
| * | | | | | | | | | Async GPU: do invalidate as synced operationFernando Sahmkow2019-07-051-6/+1
| * | | | | | | | | | Gpu: use an std mutex instead of a spin_lock to guard syncpointsFernando Sahmkow2019-07-052-6/+6
| * | | | | | | | | | nvhost_ctrl: Corrections to event handlingFernando Sahmkow2019-07-052-8/+12
| * | | | | | | | | | Gpu: Mark areas as protected.Fernando Sahmkow2019-07-053-0/+19
| * | | | | | | | | | nv_services: Stub CtrlEventSignalFernando Sahmkow2019-07-054-13/+48
| * | | | | | | | | | Gpu: Implement Hardware Interrupt Manager and manage GPU interruptsFernando Sahmkow2019-07-0513-13/+90
| * | | | | | | | | | nv_services: Implement NvQueryEvent, NvCtrlEventWait, NvEventRegister, NvEventUnregisterFernando Sahmkow2019-07-057-17/+192
| * | | | | | | | | | nv_services: Create GPU channels correctlyFernando Sahmkow2019-07-052-2/+5
| * | | | | | | | | | video_core: Implement GPU side SyncpointsFernando Sahmkow2019-07-056-9/+84
| * | | | | | | | | | nv_services: Correct buffer queue fencing and GPFifo fencingFernando Sahmkow2019-07-058-57/+70
| * | | | | | | | | | nvflinger: Implement swap intervalsFernando Sahmkow2019-07-055-8/+21
* | | | | | | | | | | Merge pull request #2739 from lioncash/cflowbunnei2019-07-254-33/+53
|\ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | video_core/control_flow: Provide operator!= for types with operator==Lioncash2019-07-191-4/+21
| * | | | | | | | | | | video_core/control_flow: Prevent sign conversion in TryGetBlock()Lioncash2019-07-191-1/+1
| * | | | | | | | | | | video_core/control_flow: Remove unnecessary BlockStack copy constructorLioncash2019-07-191-2/+1
| * | | | | | | | | | | video_core/control_flow: Use std::move where applicableLioncash2019-07-191-10/+15
| * | | | | | | | | | | video_core/control_flow: Use the prefix variant of operator++ for iteratorsLioncash2019-07-191-2/+2
| * | | | | | | | | | | video_core/control_flow: Use empty() member function for checking emptinessLioncash2019-07-191-2/+2
| * | | | | | | | | | | video_core: Resolve -Wreorder warningsLioncash2019-07-192-4/+3
| * | | | | | | | | | | video_core/control_flow: Make program_size for ScanFlow() a std::size_tLioncash2019-07-192-5/+4
| * | | | | | | | | | | video_core/control_flow: Place all internally linked types/functions within an anonymous namespaceLioncash2019-07-191-1/+2
| * | | | | | | | | | | video_core/shader/decode: Prevent sign-conversion warningsLioncash2019-07-191-2/+2
| | |_|_|/ / / / / / / | |/| | | | | | | | |
* | | | | | | | | | | Merge pull request #2737 from FernandoS27/track-fixbunnei2019-07-251-2/+2
|\ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | Shader_Ir: Correct tracking to track from right to leftFernando Sahmkow2019-07-161-2/+2
* | | | | | | | | | | | Merge pull request #2689 from lioncash/tlbunnei2019-07-251-7/+8
|\ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | yuzu/main: Make error messages within OnCoreError more localization-friendlyLioncash2019-07-071-7/+8
* | | | | | | | | | | | | Merge pull request #2743 from FernandoS27/surpress-assertbunnei2019-07-259-29/+36
|\ \ \ \ \ \ \ \ \ \ \ \ \ | |_|_|_|_|_|/ / / / / / / |/| | | | | | | | | | | |
| * | | | | | | | | | | | Shader_Ir: Change Debug Asserts for Log WarningsFernando Sahmkow2019-07-203-10/+17
| * | | | | | | | | | | | Shader_Ir: correct clang formatFernando Sahmkow2019-07-181-2/+2
| * | | | | | | | | | | | GPU: Add missing puller methods.Fernando Sahmkow2019-07-182-14/+15
| * | | | | | | | | | | | MaxwellDMA/KeplerCopy: Downgrade DMA log message to Trace.Fernando Sahmkow2019-07-181-1/+1
| * | | | | | | | | | | | Gl_Texture_Cache: Remove assert on component type in GetFormatTupleFernando Sahmkow2019-07-181-1/+0
| * | | | | | | | | | | | Shader_Ir: Downgrade precision and rounding asserts to debug asserts.Fernando Sahmkow2019-07-185-10/+10
* | | | | | | | | | | | | Merge pull request #2704 from FernandoS27/conditionalbunnei2019-07-243-2/+100
|\ \ \ \ \ \ \ \ \ \ \ \ \ | |_|_|_|_|_|/ / / / / / / |/| | | | | | | | | | | |
| * | | | | | | | | | | | maxwell3d: Implement Conditional RenderingFernando Sahmkow2019-07-173-2/+100
| | |_|_|_|_|_|/ / / / / | |/| | | | | | | | | |
* | | | | | | | | | | | Merge pull request #2734 from ReinUsesLisp/compute-shadersbunnei2019-07-2215-140/+357
|\ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | gl_shader_cache: Fix clang-format issuesReinUsesLisp2019-07-162-4/+2
| * | | | | | | | | | | | gl_shader_decompiler: Stub local memory sizeReinUsesLisp2019-07-151-8/+14
| * | | | | | | | | | | | gl_shader_cache: Address review commentariesReinUsesLisp2019-07-154-13/+12
| * | | | | | | | | | | | gl_shader_cache: Address CI issuesReinUsesLisp2019-07-152-3/+3
| * | | | | | | | | | | | gl_rasterizer: Implement compute shadersReinUsesLisp2019-07-1515-136/+350
* | | | | | | | | | | | | Merge pull request #2735 from FernandoS27/pipeline-reworkbunnei2019-07-2114-116/+528
|\ \ \ \ \ \ \ \ \ \ \ \ \ | |_|_|_|_|_|_|_|/ / / / / |/| | | | | | | | | | | |
| * | | | | | | | | | | | Maxwell3D: Reorganize and address feedbackFernando Sahmkow2019-07-203-20/+33
| * | | | | | | | | | | | GL_State: Feedback and fixesFernando Sahmkow2019-07-174-14/+27
| * | | | | | | | | | | | Maxwell3D: Address FeedbackFernando Sahmkow2019-07-175-17/+13
| * | | | | | | | | | | | Texture_Cache: Rebase FixesFernando Sahmkow2019-07-171-6/+0
| * | | | | | | | | | | | GL_Rasterizer: Corrections to Clearing.Fernando Sahmkow2019-07-174-12/+28
| * | | | | | | | | | | | Maxwell3D: Correct marking dirtiness on CB uploadFernando Sahmkow2019-07-171-0/+1
| * | | | | | | | | | | | GL_Rasterizer: Rework RenderTarget/DepthBuffer clearingFernando Sahmkow2019-07-173-7/+63
| * | | | | | | | | | | | Maxwell3D: Implement State Dirty Flags.Fernando Sahmkow2019-07-176-44/+199
| * | | | | | | | | | | | Maxwell3D: Rework CBData UploadFernando Sahmkow2019-07-172-8/+45
| * | | | | | | | | | | | Maxwell3D: Rework the dirty system to be more consistant and scaleableFernando Sahmkow2019-07-1710-80/+211
| | |/ / / / / / / / / / | |/| | | | | | | | | |
* | | | | | | | | | | | shader/half_set_predicate: Fix HSETP2 implementationReinUsesLisp2019-07-204-44/+23
* | | | | | | | | | | | shader/half_set_predicate: Implement missing HSETP2 variantsReinUsesLisp2019-07-202-19/+49
| |_|_|_|_|/ / / / / / |/| | | | | | | | | |
* | | | | | | | | | | Merge pull request #2687 from lioncash/tls-processbunnei2019-07-183-14/+30
|\ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | kernel/process: Allocate the process' TLS region during initializationLioncash2019-07-073-3/+14
| * | | | | | | | | | | kernel/process: Move main thread stack allocation to its own functionLioncash2019-07-072-12/+17
| | |_|_|/ / / / / / / | |/| | | | | | | | |
* | | | | | | | | | | Merge pull request #2738 from lioncash/shader-irbunnei2019-07-188-99/+103
|\ \ \ \ \ \ \ \ \ \ \ | |_|_|_|/ / / / / / / |/| | | | | | | | | |
| * | | | | | | | | | shader_ir: std::move Node instance where applicableLioncash2019-07-174-60/+67
| * | | | | | | | | | shader_ir: Rename Get/SetTemporal to Get/SetTemporaryLioncash2019-07-175-36/+36
| * | | | | | | | | | shader_ir: Remove unused includesLioncash2019-07-171-3/+0
| | |_|_|/ / / / / / | |/| | | | | | | |
* | | | | | | | | | Kernel: Downgrade WaitForAddress and SignalToAddress messages to Trace.Fernando Sahmkow2019-07-181-4/+4
| |_|/ / / / / / / |/| | | | | | | |
* | | | | | | | | Merge pull request #2740 from lioncash/braFernando Sahmkow2019-07-171-1/+1
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | shader/decode/other: Correct branch indirect argument within BRA handlingLioncash2019-07-161-1/+1
| | |_|/ / / / / / | |/| | | | | | |
* | | | | | | | | Merge pull request #2726 from lioncash/accessRodrigo Locatti2019-07-172-7/+6
|\ \ \ \ \ \ \ \ \ | |_|/ / / / / / / |/| | | | | | | |
| * | | | | | | | core: Remove CurrentArmInterface() global accessorLioncash2019-07-132-7/+6
* | | | | | | | | Merge pull request #2565 from ReinUsesLisp/track-indirectFernando Sahmkow2019-07-166-35/+36
|\ \ \ \ \ \ \ \ \ | |_|/ / / / / / / |/| | | | | | | |
| * | | | | | | | shader: Allow tracking of indirect buffers without variable offsetReinUsesLisp2019-07-156-35/+36
* | | | | | | | | Merge pull request #2695 from ReinUsesLisp/layer-viewportFernando Sahmkow2019-07-1510-40/+137
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | gl_shader_decompiler: Fix gl_PointSize redeclarationReinUsesLisp2019-07-111-1/+1
| * | | | | | | | | gl_shader_decompiler: Fix conditional usage of GL_ARB_shader_viewport_layer_arrayReinUsesLisp2019-07-111-2/+3
| * | | | | | | | | gl_shader_decompiler: Implement gl_ViewportIndex and gl_Layer in vertex shadersReinUsesLisp2019-07-0810-40/+136
| | |_|_|_|_|/ / / | |/| | | | | | |
* | | | | | | | | Merge pull request #2705 from FernandoS27/tex-cache-fixesbunnei2019-07-157-22/+58
|\ \ \ \ \ \ \ \ \ | |_|/ / / / / / / |/| | | | | | | |
| * | | | | | | | Texture_Cache: Address FeedbackFernando Sahmkow2019-07-143-13/+17
| * | | | | | | | Texture_Cache: Remove some unprecise fallback case and clang formatFernando Sahmkow2019-07-142-13/+5
| * | | | | | | | Texture_Cache: Force Framebuffer reset if an active render target is unregistered.Fernando Sahmkow2019-07-143-10/+36
| * | | | | | | | GPU: Add a microprofile for macro interpreterFernando Sahmkow2019-07-142-1/+6
| * | | | | | | | GL_State: Add a microprofile timer to OpenGL state.Fernando Sahmkow2019-07-141-0/+4
| * | | | | | | | Gl_Texture_Cache: Measure Buffer Copy TimesFernando Sahmkow2019-07-141-0/+2
| * | | | | | | | Texture_Cache: Correct Linear Structural Match.Fernando Sahmkow2019-07-141-3/+6
* | | | | | | | | Merge pull request #2675 from ReinUsesLisp/opengl-buffer-cachebunnei2019-07-1516-407/+537
|\ \ \ \ \ \ \ \ \ | |/ / / / / / / / |/| | | | | | | |
| * | | | | | | | buffer_cache: Avoid [[nodiscard]] to make clang-format happyReinUsesLisp2019-07-061-5/+4
| * | | | | | | | buffer_cache: Try to fix MinGW buildReinUsesLisp2019-07-061-1/+1
| * | | | | | | | gl_rasterizer: Fix nullptr dereference on disabled buffersReinUsesLisp2019-07-063-5/+5
| * | | | | | | | gl_rasterizer: Minor style changesReinUsesLisp2019-07-064-32/+22
| * | | | | | | | gl_rasterizer: Fix vertex and index data invalidationsReinUsesLisp2019-07-064-8/+67
| * | | | | | | | gl_buffer_cache: Implement with generic buffer cacheReinUsesLisp2019-07-068-291/+92
| * | | | | | | | buffer_cache: Implement a generic buffer cacheReinUsesLisp2019-07-062-0/+301
| * | | | | | | | gl_buffer_cache: Remove global system gettersReinUsesLisp2019-07-063-9/+14
| * | | | | | | | gl_device: Query SSBO alignmentReinUsesLisp2019-07-062-0/+6
| * | | | | | | | gl_buffer_cache: Implement flushingReinUsesLisp2019-07-062-2/+11
| * | | | | | | | gl_rasterizer: Drop gl_global_cache in favor of gl_buffer_cacheReinUsesLisp2019-07-067-206/+35
| * | | | | | | | gl_buffer_cache: Rework to support internalized buffersReinUsesLisp2019-07-063-65/+174
| * | | | | | | | gl_buffer_cache: Store in CachedBufferEntry the used buffer handleReinUsesLisp2019-07-062-23/+30
| * | | | | | | | gl_buffer_cache: Return used buffer from Upload functionReinUsesLisp2019-07-064-36/+35
| * | | | | | | | gl_rasterizer: Add some commentariesReinUsesLisp2019-07-061-0/+5
| * | | | | | | | gl_rasterizer: Make DrawParameters rasterizer instance constReinUsesLisp2019-07-061-1/+1
| * | | | | | | | gl_rasterizer: Move index buffer uploading to its own methodReinUsesLisp2019-07-062-7/+18
| | |_|_|/ / / / | |/| | | | | |
* | | | | | | | Merge pull request #2690 from SciresM/physmem_fixesFernando Sahmkow2019-07-1411-45/+507
|\ \ \ \ \ \ \ \
| * | | | | | | | Remove unicorn mappings/unmappingsMichael Scire2019-07-121-19/+0
| * | | | | | | | prefer system reference over global accessorMichael Scire2019-07-093-9/+13
| * | | | | | | | Prevent merging of device mapped memory blocks.Michael Scire2019-07-092-1/+28
| * | | | | | | | Remove unused member function declarationMichael Scire2019-07-071-9/+0
| * | | | | | | | physmem: add helpers, cleanup logic.Michael Scire2019-07-072-171/+170
| * | | | | | | | clang-format fixesMichael Scire2019-07-072-3/+3
| * | | | | | | | address review commentaryMichael Scire2019-07-075-36/+42
| * | | | | | | | Implement MapPhysicalMemory/UnmapPhysicalMemoryMichael Scire2019-07-078-21/+475
| | |_|_|/ / / / | |/| | | | | |
* | | | | | | | Merge pull request #2692 from ReinUsesLisp/tlds-f16Fernando Sahmkow2019-07-142-2/+9
|\ \ \ \ \ \ \ \ | |_|_|_|/ / / / |/| | | | | | |
| * | | | | | | shader/texture: Add F16 support for TLDSReinUsesLisp2019-07-072-2/+9
| |/ / / / / /
* | | | | | | Clang formatDavid Marcec2019-07-123-4/+8
* | | | | | | Addressed issuesDavid Marcec2019-07-122-2/+2
* | | | | | | "AudioRenderer" thread should have a unique nameDavid Marcec2019-07-124-7/+8
* | | | | | | Merge pull request #2609 from FernandoS27/new-scanbunnei2019-07-1115-122/+774
|\ \ \ \ \ \ \
| * | | | | | | shader_ir: Add comments on missing instruction.Fernando Sahmkow2019-07-092-2/+9
| * | | | | | | shader_ir: limit explorastion to best known program size.Fernando Sahmkow2019-07-091-1/+1
| * | | | | | | control_flow: Correct block breaking algorithm.Fernando Sahmkow2019-07-091-17/+17
| * | | | | | | control_flow: Assert shaders bigger than limit.Fernando Sahmkow2019-07-091-0/+2
| * | | | | | | control_flow: Address feedback.Fernando Sahmkow2019-07-091-89/+37
| * | | | | | | shader_ir: Correct parsing of scheduling instructions and correct sizingFernando Sahmkow2019-07-092-13/+30
| * | | | | | | shader_ir: Correct max sizingFernando Sahmkow2019-07-092-2/+2
| * | | | | | | shader_ir: Remove unnecessary constructors and use optional for ScanFlow resultFernando Sahmkow2019-07-093-28/+17
| * | | | | | | shader_ir: Corrections, documenting and asserting control_flowFernando Sahmkow2019-07-093-52/+54
| * | | | | | | shader_ir: Unify blocks in decompiled shaders.Fernando Sahmkow2019-07-097-58/+85
| * | | | | | | shader_ir: Decompile Flow StackFernando Sahmkow2019-07-094-11/+206
| * | | | | | | shader_ir: propagate shader size to the IRFernando Sahmkow2019-07-096-17/+28
| * | | | | | | shader_ir: Implement BRX & BRA.CCFernando Sahmkow2019-07-096-4/+76
| * | | | | | | shader_ir: Remove the old scanner.Fernando Sahmkow2019-07-092-77/+0
| * | | | | | | shader_ir: Implement a new shader scannerFernando Sahmkow2019-07-095-16/+475
| | |_|_|/ / / | |/| | | | |
* | | | | | | Merge pull request #2717 from SciresM/unmirror_memorybunnei2019-07-112-7/+34
|\ \ \ \ \ \ \
| * | | | | | | Restore memory perms on svcUnmapMemory/UnloadNroMichael Scire2019-07-112-7/+34
* | | | | | | | Merge pull request #2723 from lioncash/membunnei2019-07-1115-80/+6
|\ \ \ \ \ \ \ \
| * | | | | | | | yuzu: Remove setting for using UnicornLioncash2019-07-119-29/+6
| * | | | | | | | core/arm: Remove obsolete Unicorn memory mappingLioncash2019-07-116-51/+0
| |/ / / / / / /
* | | | | | | | service/am: Implement IsAutoSleepDisabledLioncash2019-07-112-1/+10
* | | | | | | | service/am: Implement SetAutoSleepDisabledLioncash2019-07-112-1/+23
|/ / / / / / /
* | | | | | | Merge pull request #2697 from lioncash/docbunnei2019-07-101-7/+9
|\ \ \ \ \ \ \
| * | | | | | | gl_rasterizer: Amend documentation comment for ConfigureFramebuffers()Lioncash2019-07-091-7/+9
| | |/ / / / / | |/| | | | |
* | | | | | | Merge pull request #2686 from ReinUsesLisp/vk-schedulerbunnei2019-07-106-50/+60
|\ \ \ \ \ \ \
| * | | | | | | vk_scheduler: Drop execution context in favor of viewsReinUsesLisp2019-07-076-50/+60
| |/ / / / / /
* | | | | | | Merge pull request #2700 from ogniK5377/GetFriendListbunnei2019-07-101-1/+34
|\ \ \ \ \ \ \
| * | | | | | | IFriendService::GetFriendListDavid Marcec2019-07-091-1/+34
| | |/ / / / / | |/| | | | |
* | | | | | | Merge pull request #2611 from DarkLordZach/pm-info-cmdbunnei2019-07-103-16/+116
|\ \ \ \ \ \ \
| * | | | | | | pm: Implement pm:shell and pm:dmnt GetApplicationPidZach Hilman2019-06-273-7/+33
| * | | | | | | pm: Implement pm:dmnt GetTitlePidZach Hilman2019-06-271-7/+36
| * | | | | | | pm: Implement pm:info GetTitleIdZach Hilman2019-06-271-2/+47
* | | | | | | | Merge pull request #2650 from DarkLordZach/mii-iface-verbunnei2019-07-101-1/+15
|\ \ \ \ \ \ \ \
| * | | | | | | | mii: Implement IDatabaseService SetInterfaceVersionZach Hilman2019-07-071-1/+15
* | | | | | | | | Merge pull request #2691 from lioncash/overridebunnei2019-07-102-7/+4
|\ \ \ \ \ \ \ \ \ | |_|_|/ / / / / / |/| | | | | | | |
| * | | | | | | | vk_sampler_cache: Remove unused includesLioncash2019-07-071-3/+0
| * | | | | | | | video_core: Add missing override specifiersLioncash2019-07-072-4/+4
| | |_|/ / / / / | |/| | | | | |
* | | | | | | | Merge pull request #2661 from ogniK5377/audren-loopZach Hilman2019-07-081-3/+5
|\ \ \ \ \ \ \ \
| * | | | | | | | addressed issueDavid Marcec2019-07-081-1/+1
| * | | | | | | | audren: Only manage wave buffers with a sizeDavid Marcec2019-07-011-3/+5
* | | | | | | | | Merge pull request #2657 from ogniK5377/npad-assignmentsZach Hilman2019-07-086-3/+100
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | addressed issuesDavid Marcec2019-07-081-6/+7
| * | | | | | | | | hid:StartLrAssignmentMode, hid:StopLrAssignmentMode, hid:SwapNpadAssignmentDavid Marcec2019-07-016-3/+99
| |/ / / / / / / /
* | | | | | | | | Merge pull request #2651 from DarkLordZach/apm-boost-mode-1bunnei2019-07-0814-57/+258
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | am: Implement SetCpuBoostMode in terms of APMZach Hilman2019-06-295-13/+26
| * | | | | | | | | core: Keep instance of APM ControllerZach Hilman2019-06-292-0/+20
| * | | | | | | | | apm: Implement SetCpuBoostModeZach Hilman2019-06-292-0/+14
| * | | | | | | | | apm: Add getters for performance config and modeZach Hilman2019-06-292-33/+49
| * | | | | | | | | apm: Add apm:am serviceZach Hilman2019-06-292-11/+9
| * | | | | | | | | apm: Add Controller class to manage speed data and applicationZach Hilman2019-06-293-0/+140
| | |_|_|/ / / / / | |/| | | | | | |
* | | | | | | | | Merge pull request #2642 from DarkLordZach/fsp-log-2bunnei2019-07-089-28/+99
|\ \ \ \ \ \ \ \ \ | |_|_|_|_|_|/ / / |/| | | | | | | |
| * | | | | | | | fsp-srv: Implement GetAccessLogVersionInfoZach Hilman2019-06-292-3/+14
| * | | | | | | | reporter: Add report class for filesystem access logsZach Hilman2019-06-292-0/+25
| * | | | | | | | fsp-srv: Implement OutputAccessLogToSdCardZach Hilman2019-06-297-27/+62
| |/ / / / / / /
* | | / / / / / Delete decode_integer_set.cppTobias2019-07-071-0/+0
| |_|/ / / / / |/| | | | | |
* | | | | | | Merge pull request #2674 from lioncash/reporterZach Hilman2019-07-072-15/+35
|\ \ \ \ \ \ \
| * | | | | | | core/reporter: Allow moves into SaveToFile()Lioncash2019-07-051-1/+1
| * | | | | | | core/reporter: Add missing includes and forward declarationsLioncash2019-07-052-1/+9
| * | | | | | | core/reporter: Remove unnecessary namespace qualifiersLioncash2019-07-052-3/+3
| * | | | | | | core/reporter: Remove pessimizing move in GetHLERequestContextData()Lioncash2019-07-051-1/+1
| * | | | | | | core/reporter: Make bracing consistentLioncash2019-07-051-8/+18
| * | | | | | | core/reporter: Return in error case in SaveToFile()Lioncash2019-07-051-1/+3
| | |_|_|/ / / | |/| | | | |
* | | | | | | Merge pull request #2677 from lioncash/assertZach Hilman2019-07-075-43/+48
|\ \ \ \ \ \ \
| * | | | | | | memory: Remove unused includesLioncash2019-07-061-2/+0
| * | | | | | | memory: Remove unused PageTable forward declarationLioncash2019-07-061-4/+0
| * | | | | | | kernel/vm_manager: Rename 'new map' to 'stack'Lioncash2019-07-063-37/+37
| * | | | | | | kernel/vm_manager: Handle stack/TLS IO region placement betterLioncash2019-07-061-2/+13
| |/ / / / / /
* | | | | | | clang-format fixesMichael Scire2019-07-061-4/+5
* | | | | | | am: Implement GetAccumulatedSuspendedTickValueMichael Scire2019-07-062-7/+19
|/ / / / / /
* | | | | | Merge pull request #2601 from FernandoS27/texture_cacheZach Hilman2019-07-0562-3269/+4195
|\ \ \ \ \ \
| * | | | | | texture_cache: Address FeedbackFernando Sahmkow2019-07-057-22/+35
| * | | | | | texture_cache: Correct Texture Buffer UploadingFernando Sahmkow2019-07-053-2/+18
| * | | | | | texture_cache: Pack sibling queries inside a methodReinUsesLisp2019-06-301-6/+8
| * | | | | | texture_cache: Use std::vector reservation for sampled_texturesReinUsesLisp2019-06-301-17/+10
| * | | | | | texture_cache: Style changesReinUsesLisp2019-06-303-17/+13
| * | | | | | texture_cache: Use std::array for siblings_tableReinUsesLisp2019-06-291-10/+13
| * | | | | | texture_cache: Address feedbackReinUsesLisp2019-06-294-30/+13
| * | | | | | texture_cache: Correct variable naming.Fernando Sahmkow2019-06-261-3/+3
| * | | | | | gl_texture_cache: Correct assertsFernando Sahmkow2019-06-262-2/+2
| * | | | | | texture_cache: Corrections, documentation and assertsFernando Sahmkow2019-06-261-42/+42
| * | | | | | surface_params: Corrections, asserts and documentation.Fernando Sahmkow2019-06-262-43/+58
| * | | | | | copy_params: use constexpr for constructorFernando Sahmkow2019-06-251-3/+4
| * | | | | | gl_texture_cache: Corrections and fixesFernando Sahmkow2019-06-252-13/+9
| * | | | | | gl_resource_manager: Correct MakeStreamCopyFernando Sahmkow2019-06-252-3/+2
| * | | | | | texture_cache: Query MemoryManager from the systemFernando Sahmkow2019-06-255-20/+7
| * | | | | | texture_cache: Include "core/core.h"ReinUsesLisp2019-06-241-4/+1
| * | | | | | gl_texture_cache: Explicitly add indirect includeReinUsesLisp2019-06-241-0/+1
| * | | | | | texture_cache/surface_view: Address feedbackReinUsesLisp2019-06-241-1/+0
| * | | | | | texture_cache/surface_base: Address feedbackReinUsesLisp2019-06-242-2/+10
| * | | | | | video_core/surface: Address feedbackReinUsesLisp2019-06-241-2/+2
| * | | | | | decode/texture: Address feedbackReinUsesLisp2019-06-241-0/+1
| * | | | | | renderer_opengl/utils: Remove unused includes and unused forward declarationReinUsesLisp2019-06-241-4/+0
| * | | | | | gl_texture_cache: Address some feedbackReinUsesLisp2019-06-241-2/+4
| * | | | | | gl_shader_disk_cache: Address feedbackReinUsesLisp2019-06-242-4/+8
| * | | | | | gl_shader_decompiler: Address feedbackReinUsesLisp2019-06-241-11/+12
| * | | | | | shader_bytecode: Include missing <array>ReinUsesLisp2019-06-241-0/+1
| * | | | | | common/alignment: Address feedbackReinUsesLisp2019-06-241-2/+3
| * | | | | | texture_cache: Style and CorrectionsFernando Sahmkow2019-06-217-71/+75
| * | | | | | shader_cache: Correct versioning and size calculation.Fernando Sahmkow2019-06-212-2/+7
| * | | | | | texture_cache: Eliminate linear textures fallthroughFernando Sahmkow2019-06-211-4/+0
| * | | | | | texture_cache: Correct format R16U as siblingFernando Sahmkow2019-06-212-1/+2
| * | | | | | texture_cache: Implement texception detection and texture barriers.Fernando Sahmkow2019-06-212-7/+40
| * | | | | | texture_cache: Corrections to buffers and shadow formats use.Fernando Sahmkow2019-06-211-10/+34
| * | | | | | texture_cache: Implement Irregular Views in surfacesFernando Sahmkow2019-06-212-4/+24
| * | | | | | surface: Correct format S8Z24Fernando Sahmkow2019-06-214-9/+5
| * | | | | | texture_cache: Initialize all siblings to invalid pixel format.Fernando Sahmkow2019-06-211-6/+15
| * | | | | | gl_texture_cache: Use Stream Buffers instead of Persistant for Buffer Copies.Fernando Sahmkow2019-06-213-5/+4
| * | | | | | gl_texture_cache: Correct Image BlitFernando Sahmkow2019-06-211-1/+1
| * | | | | | decoders: correct block calculationFernando Sahmkow2019-06-217-29/+41
| * | | | | | texture_cache: Use siblings textures on Rebuild and fix possible error on blittingFernando Sahmkow2019-06-212-11/+24
| * | | | | | texture_cache: Remove old rasterizer cacheFernando Sahmkow2019-06-212-1956/+0
| * | | | | | texture_cache: Implement siblings texture formats.Fernando Sahmkow2019-06-212-12/+31
| * | | | | | fermi2d: Correct Origin ModeFernando Sahmkow2019-06-211-5/+10
| * | | | | | texture_cache: correct texture buffer on surface paramsFernando Sahmkow2019-06-211-4/+11
| * | | | | | texture_cache: eliminate accelerated depth->color/color->depth copies due to driver instability.Fernando Sahmkow2019-06-214-22/+6
| * | | | | | texture_cache: correct mutex locksFernando Sahmkow2019-06-211-4/+4
| * | | | | | shader_ir: Fix image copy rebase issuesFernando Sahmkow2019-06-211-2/+7
| * | | | | | texture_cache: Don't Image Copy if component types differFernando Sahmkow2019-06-211-1/+2
| * | | | | | texture_cache: move some large methods to cpp filesFernando Sahmkow2019-06-214-139/+135
| * | | | | | texture_cache: Optimize GetSurface and use references on functions that don't change a surface.Fernando Sahmkow2019-06-213-12/+12
| * | | | | | texture_cache: Implement Buffer Copy and detect Turing GPUs Image CopiesFernando Sahmkow2019-06-218-12/+148
| * | | | | | texture_cache uncompress-compress is untopological.Fernando Sahmkow2019-06-215-19/+53
| * | | | | | texture_cache: Correct copying between compressed and uncompressed formatsFernando Sahmkow2019-06-213-10/+27
| * | | | | | texture_cache: Only load on recycle with accurate GPU.Fernando Sahmkow2019-06-211-2/+3
| * | | | | | Fix rebase errorsFernando Sahmkow2019-06-213-3/+13
| * | | | | | texture_cache: Handle uncontinuous surfaces.Fernando Sahmkow2019-06-214-21/+82
| * | | | | | texture_cache: return null surface on invalid addressFernando Sahmkow2019-06-211-0/+12
| * | | | | | texture_cache: Add checks for texture buffers.Fernando Sahmkow2019-06-211-2/+16
| * | | | | | texture_cache: Fermi2D reform and implement View MirageFernando Sahmkow2019-06-2111-77/+125
| * | | | | | gl_shader_decompiler: Implement image binding settingsReinUsesLisp2019-06-215-24/+52
| * | | | | | shader: Implement bindless imagesReinUsesLisp2019-06-213-2/+40
| * | | | | | shader: Decode SUST and implement backing image functionalityReinUsesLisp2019-06-219-3/+283
| * | | | | | gl_rasterizer: Track texture buffer usageReinUsesLisp2019-06-216-74/+119
| * | | | | | video_core: Make ARB_buffer_storage a required extensionReinUsesLisp2019-06-215-8/+12
| * | | | | | gl_rasterizer_cache: Use texture buffers to emulate texture buffersReinUsesLisp2019-06-215-11/+35
| * | | | | | maxwell_3d: Partially implement texture buffers as 1D texturesReinUsesLisp2019-06-214-10/+24
| * | | | | | gl_shader_decompiler: Allow 1D textures to be texture buffersReinUsesLisp2019-06-211-4/+38
| * | | | | | shader: Implement texture buffersReinUsesLisp2019-06-213-0/+62
| * | | | | | texture_cache: loose TryReconstructSurface when accurate GPU is not on.Fernando Sahmkow2019-06-213-4/+20
| * | | | | | texture_cache: Document the most important methods.Fernando Sahmkow2019-06-211-8/+87
| * | | | | | texture_cache: Try to Reconstruct Surface on bigger than overlap.Fernando Sahmkow2019-06-211-4/+11
| * | | | | | texture_cache: Implement Guard mechanismFernando Sahmkow2019-06-212-1/+12
| * | | | | | texture_cache: General FixesFernando Sahmkow2019-06-218-47/+170
| * | | | | | surface_params: Ensure pitch is always written to avoid surface leaksReinUsesLisp2019-06-211-0/+2
| * | | | | | gl_framebuffer_cache: Use a hashed struct to cache framebuffersReinUsesLisp2019-06-216-62/+148
| * | | | | | texture_cache return invalid buffer on deactivated color_maskFernando Sahmkow2019-06-212-2/+9
| * | | | | | engine_upload: Addapt to new Texture CacheFernando Sahmkow2019-06-212-5/+5
| * | | | | | surface_params: Optimize CreateForTextureReinUsesLisp2019-06-212-72/+76
| * | | | | | gl_texture_cache: Make main views be proxy textures instead of a full view.Fernando Sahmkow2019-06-212-11/+25
| * | | | | | texture_cache: Add ASync ProtectionsFernando Sahmkow2019-06-211-0/+10
| * | | | | | Remove Framebuffer reconfiguration and restrict rendertarget protectionFernando Sahmkow2019-06-214-39/+27
| * | | | | | texture_cache: Implement GPU Dirty FlagsFernando Sahmkow2019-06-211-15/+22
| * | | | | | texture_cache: Optimize GetMipBlockHeight and GetMipBlockDepthFernando Sahmkow2019-06-212-13/+50
| * | | | | | texture_cache: Implement L1_Inner_cacheFernando Sahmkow2019-06-211-13/+30
| * | | | | | video_core: Use un-shifted block sizes to avoid integer divisionsReinUsesLisp2019-06-2110-60/+78
| * | | | | | texture_cache: Change internal cache from lists to vectorsReinUsesLisp2019-06-211-6/+7
| * | | | | | Reduce amount of size calculations.Fernando Sahmkow2019-06-218-88/+97
| * | | | | | texture_cache: Correct premature texceptionsFernando Sahmkow2019-06-214-14/+51
| * | | | | | texture_cache: Implement guest flushingFernando Sahmkow2019-06-213-10/+29
| * | | | | | Fixes to mipmap's process and reconstruct processFernando Sahmkow2019-06-212-3/+3
| * | | | | | surface_base: Add parenthesis to EmplaceOverview's predicateReinUsesLisp2019-06-211-3/+2
| * | | | | | Texture Cache: Implement Blitting and Fermi CopiesFernando Sahmkow2019-06-217-100/+93
| * | | | | | surface_view: Add constructor for ViewParamsReinUsesLisp2019-06-213-39/+23
| * | | | | | surface_base: Split BreakDown into layered and non-layered variantsReinUsesLisp2019-06-211-45/+48
| * | | | | | surface_base: Silence truncation warnings and minor renames and reorderingReinUsesLisp2019-06-212-32/+37
| * | | | | | copy_params: Use constructor instead of C-like initializationReinUsesLisp2019-06-213-47/+39
| * | | | | | Correct Mipmaps View method in Texture CacheFernando Sahmkow2019-06-213-32/+29
| * | | | | | Change texture_cache chaching from GPUAddr to CacheAddrFernando Sahmkow2019-06-217-101/+60
| * | | | | | Corrections to Structural MatchingFernando Sahmkow2019-06-212-24/+53
| * | | | | | Implement Texture Cache V2Fernando Sahmkow2019-06-216-381/+568
| * | | | | | Correct Surface Base and Views for new Texture CacheFernando Sahmkow2019-06-217-380/+466
| * | | | | | Add OGLTextureViewFernando Sahmkow2019-06-212-0/+43
| * | | | | | Deglobalize Memory Manager on texture cahe and Implement Invalidation and Flushing using GPUVAddrFernando Sahmkow2019-06-214-1/+20
| * | | | | | texture_cache: Remove execution context copies from the texture cacheReinUsesLisp2019-06-217-168/+59
| * | | | | | gl_texture_cache: Implement fermi copiesReinUsesLisp2019-06-215-2/+105
| * | | | | | texture_cache: Split texture cache into different filesReinUsesLisp2019-06-2112-876/+965
| * | | | | | texture_cache: Move staging buffer into a generic implementationReinUsesLisp2019-06-214-181/+211
| * | | | | | texture_cache: Flush 3D textures in the order they are drawnReinUsesLisp2019-06-215-19/+44
| * | | | | | gl_texture_cache: Minor changesReinUsesLisp2019-06-215-140/+185
| * | | | | | gl_texture_cache: Add copy from multiple overlaps into a single surfaceReinUsesLisp2019-06-213-6/+84
| * | | | | | gl_texture_cache: Attach surface textures instead of viewsReinUsesLisp2019-06-213-20/+32
| * | | | | | gl_texture_cache: Add fast copy pathReinUsesLisp2019-06-214-7/+60
| * | | | | | gl_texture_cache: Initial implementationReinUsesLisp2019-06-219-47/+809
* | | | | | | Merge pull request #2669 from FearlessTobi/move-cpujit-settingZach Hilman2019-07-0411-36/+12
|\ \ \ \ \ \ \
| * | | | | | | yuzu: Remove CPU Jit setting from the UIfearlessTobi2019-07-0411-36/+12
* | | | | | | | Merge pull request #2555 from lioncash/tlsZach Hilman2019-07-046-81/+148
|\ \ \ \ \ \ \ \
| * | | | | | | | kernel/process: Default initialize all member variablesLioncash2019-07-041-2/+2
| * | | | | | | | kernel/process: Decouple TLS handling from threadsLioncash2019-07-044-66/+97
| * | | | | | | | kernel/vm_manager: Add overload of FindFreeRegion() that operates on a boundaryLioncash2019-07-042-13/+49
* | | | | | | | | Merge pull request #2670 from DarkLordZach/fix-merge-discrep-1bunnei2019-07-042-5/+5
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | gl_shader_cache: Make CachedShader constructor privateZach Hilman2019-07-042-5/+5
| |/ / / / / / / /
* | | | | | | | | Merge pull request #2658 from ogniK5377/QueryAudioDeviceOutputEventbunnei2019-07-041-3/+16
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | IAudioDevice::QueryAudioDeviceOutputEventDavid Marcec2019-07-011-3/+16
| | |_|_|_|/ / / / | |/| | | | | | |
* | | | | | | | | Merge pull request #2638 from DarkLordZach/quest-flagbunnei2019-07-048-2/+36
|\ \ \ \ \ \ \ \ \ | |_|/ / / / / / / |/| | | | | | | |
| * | | | | | | | set: Implement GetQuestFlagZach Hilman2019-06-292-1/+10
| * | | | | | | | settings: Add config option for kiosk (quest) modeZach Hilman2019-06-296-1/+26
| | |_|_|_|/ / / | |/| | | | | |
* | | | | | | | Merge pull request #2613 from ogniK5377/InitalizeApplicationInfoZach Hilman2019-07-045-6/+110
|\ \ \ \ \ \ \ \
| * | | | | | | | Added errors.h to cmakelistDavid Marcec2019-06-281-0/+1
| * | | | | | | | Addressed issuesDavid Marcec2019-06-282-17/+12
| * | | | | | | | Implemented InitializeApplicationInfo & InitializeApplicationInfoRestrictedDavid Marcec2019-06-274-6/+114
| | |_|_|_|/ / / | |/| | | | | |
* | | | | | | | Merge pull request #2608 from ogniK5377/Time_GetSharedMemoryNativeHandleZach Hilman2019-07-048-28/+260
|\ \ \ \ \ \ \ \
| * | | | | | | | Addressed issuesDavid Marcec2019-06-265-37/+53
| * | | | | | | | Implement Time::GetSharedMemoryNativeHandleDavid Marcec2019-06-258-29/+245
* | | | | | | | | Merge pull request #2563 from ReinUsesLisp/shader-initializersZach Hilman2019-07-042-52/+53
|\ \ \ \ \ \ \ \ \ | |_|_|_|_|/ / / / |/| | | | | | | |
| * | | | | | | | gl_shader_cache: Use static constructors for CachedShader initializationReinUsesLisp2019-06-082-52/+53
* | | | | | | | | Merge pull request #2604 from ogniK5377/INotificationServicebunnei2019-07-035-1/+130
|\ \ \ \ \ \ \ \ \ | |_|_|_|_|_|_|/ / |/| | | | | | | |
| * | | | | | | | Attemp clang format fix?David Marcec2019-06-281-1/+0
| * | | | | | | | Addressed issuesDavid Marcec2019-06-282-13/+13
| * | | | | | | | SizedNotificationInfo should be 0x10 bytes, user_uuid is incorrect, this should be the users account idDavid Marcec2019-06-251-1/+3
| * | | | | | | | fixed spelling errors and fixed issue with Pop not returning the SizedNotificationInfoDavid Marcec2019-06-251-6/+8
| * | | | | | | | Implemented INotificationServiceDavid Marcec2019-06-245-1/+127
| | |/ / / / / / | |/| | | | | |
* | | | | | | | Merge pull request #2659 from FernandoS27/safe-cachesbunnei2019-07-033-1/+5
|\ \ \ \ \ \ \ \
| * | | | | | | | rasterizer_cache: Protect inherited caches from submission levelFernando Sahmkow2019-07-013-1/+5
| |/ / / / / / /
* | | | | | | | file_sys: Rename other ContentRecordType membersBakugo2019-07-025-7/+8
* | | | | | | | file_sys/registered_cache: Improve missing metadata errorBakugo2019-07-011-2/+2
* | | | | | | | file_sys/submission_package: Don't warn about missing DeltaFragment NCAsBakugo2019-07-011-4/+7
* | | | | | | | file_sys/registered_cache: Ignore DeltaFragment NCAs during installationBakugo2019-07-011-0/+3
* | | | | | | | file_sys: Rename ContentRecordType::Patch to DeltaFragmentBakugo2019-07-011-1/+1
| |_|_|_|/ / / |/| | | | | |
* | | | | | | Merge pull request #2583 from FernandoS27/core-timing-safebunnei2019-06-305-60/+25
|\ \ \ \ \ \ \ | |_|_|_|/ / / |/| | | | | |
| * | | | | | Core_Timing: Make core_timing threadsafe by default.Fernando Sahmkow2019-06-165-60/+25
* | | | | | | Merge pull request #2533 from DarkLordZach/memory-frozenbunnei2019-06-284-0/+274
|\ \ \ \ \ \ \ | |_|_|_|/ / / |/| | | | | |
| * | | | | | freezer: Update documentationZach Hilman2019-06-211-1/+8
| * | | | | | core: Move Freezer class to tools namespaceZach Hilman2019-06-214-17/+17
| * | | | | | freezer: Add documentation for methodsZach Hilman2019-06-212-30/+49
| * | | | | | memory: Add class to manage and enforce memory freezingZach Hilman2019-06-214-0/+248
| | |_|_|/ / | |/| | | |
* | | | | | Merge pull request #2548 from DarkLordZach/applet-shopnbunnei2019-06-2620-129/+890
|\ \ \ \ \ \
| * | | | | | applets: Pass current process title ID to appletsZach Hilman2019-06-2511-41/+59
| * | | | | | general_frontend: Add documentation for parental controls and ecommerce appletsZach Hilman2019-06-255-27/+55
| * | | | | | web_browser: Only delete temporary directory if it was createdZach Hilman2019-06-251-1/+3
| * | | | | | web_browser: Take ECommerce applet frontend optionally in constructorZach Hilman2019-06-251-1/+6
| * | | | | | frontend: Add base class and default impl for ECommerce applet frontendZach Hilman2019-06-252-0/+102
| * | | | | | web_browser: Use function tables for execute and initializeZach Hilman2019-06-252-7/+285
| * | | | | | web_browser: Correct structures and properly parse TLVs/ShimKindZach Hilman2019-06-252-61/+168
| * | | | | | yuzu: Accept default applets for Parental Controls and ECommerceZach Hilman2019-06-251-5/+7
| * | | | | | applets: Track ECommerce and Parental Control applet frontendsZach Hilman2019-06-252-7/+29
| * | | | | | web_browser: Rename OpenPage to OpenPageLocalZach Hilman2019-06-254-11/+11
| * | | | | | frontend: Add base class and default impl of parent controls applet frontendZach Hilman2019-06-252-1/+52
| * | | | | | applets: Implement Auth applet backendZach Hilman2019-06-252-0/+146
| | |_|/ / / | |/| | | |
* | | | | | glue: Correct missing bytes in ApplicationLaunchParameterZach Hilman2019-06-267-37/+71
* | | | | | core: Keep track of ARPManager and register current application on bootZach Hilman2019-06-252-0/+76
* | | | | | glue: Implement arp:w and arp:r servicesZach Hilman2019-06-253-2/+330
* | | | | | glue: Add errors for glue/arp servicesZach Hilman2019-06-254-2/+65
* | | | | | glue: Add scaffolding for bgtc:t and bgtc:sc servicesZach Hilman2019-06-252-0/+73
* | | | | | arp: Move to glue servicesZach Hilman2019-06-252-91/+0
* | | | | | glue: Add manager to keep track of application registryZach Hilman2019-06-253-0/+121
* | | | | | registered_cache: Add getter to determine source slot in content provider unionZach Hilman2019-06-252-0/+17
* | | | | | patch_manager: Add getter for title versionZach Hilman2019-06-252-2/+14
|/ / / / /
* | | | | Update reporter.cppThomas May2019-06-221-5/+5
* | | | | Merge pull request #2579 from ReinUsesLisp/fix-aoffi-testbunnei2019-06-211-1/+2
|\ \ \ \ \
| * | | | | gl_device: Fix TestVariableAoffi testReinUsesLisp2019-06-121-1/+2
| | |/ / / | |/| | |
* | | | | Merge pull request #2602 from lioncash/castbunnei2019-06-211-3/+3
|\ \ \ \ \
| * | | | | service/acc: Silence truncation warningsLioncash2019-06-211-3/+3
| | |/ / / | |/| | |
* | | | | Merge pull request #2575 from DarkLordZach/process-id-typesbunnei2019-06-216-10/+29
|\ \ \ \ \
| * | | | | kernel: Differentiate kernel and user processes when picking IDZach Hilman2019-06-106-10/+29
| | |_|_|/ | |/| | |
* | | | | Merge pull request #2546 from DarkLordZach/kipsbunnei2019-06-2111-121/+522
|\ \ \ \ \
| * | | | | kernel_executable: Optimize BLZ decompressionZach Hilman2019-06-072-10/+13
| * | | | | game_list: Accept *.kip as a file extension of executablesZach Hilman2019-06-052-3/+2
| * | | | | loader: Add recognition for KIP file typeZach Hilman2019-06-052-0/+11
| * | | | | loader: Add KIP and INI file parser-specific errorsZach Hilman2019-06-052-1/+9
| * | | | | loader: Add AppLoader_KIP for KIP filesZach Hilman2019-06-053-0/+135
| * | | | | program_metadata: Add function to load meta from raw parametersZach Hilman2019-06-052-0/+20
| * | | | | partition_data_manager: Remove KIP processing and use FileSysZach Hilman2019-06-051-118/+13
| * | | | | file_sys: Add classes to parse KIP1 and INI1 filesZach Hilman2019-06-053-0/+330
* | | | | | Merge pull request #2482 from DarkLordZach/prepobunnei2019-06-2134-54/+825
|\ \ \ \ \ \
| * | | | | | loader: Move NSO module tracking to AppLoaderZach Hilman2019-05-2622-81/+148
| * | | | | | prepo: Save reports from PlayReport serviceZach Hilman2019-05-251-2/+23
| * | | | | | fatal: Save report on fatal:u callZach Hilman2019-05-251-21/+5
| * | | | | | service: Save report on unimplemented function callZach Hilman2019-05-251-0/+3
| * | | | | | applets/error: Save report on error appletZach Hilman2019-05-251-5/+14
| * | | | | | applets: Save report on stubbed appletZach Hilman2019-05-254-15/+49
| * | | | | | svc: Save report on call to svcBreakZach Hilman2019-05-251-1/+7
| * | | | | | core: Add Reporter class to take/save reportsZach Hilman2019-05-255-1/+416
| * | | | | | qt: Make UI option for 'Reporting Services' temporaryZach Hilman2019-05-252-0/+24
| * | | | | | settings: Add 'Reporting Services' config optionZach Hilman2019-05-253-10/+13
| * | | | | | arm_interface: Expand backtrace generationZach Hilman2019-05-252-7/+194
| * | | | | | core: Track load offsets of NSO modulesZach Hilman2019-05-253-0/+18
* | | | | | | Merge pull request #2291 from DarkLordZach/homebrew-testingbunnei2019-06-2112-0/+993
|\ \ \ \ \ \ \ | |_|_|_|/ / / |/| | | | | |
| * | | | | | yuzutest: Add minor commentsZach Hilman2019-06-102-8/+9
| * | | | | | yuzu_tester: Display results in table formatZach Hilman2019-06-103-12/+50
| * | | | | | yuzutest: Support multiple tests per executableZach Hilman2019-06-104-33/+41
| * | | | | | yuzu_tester: Add 'yuzutest' serviceZach Hilman2019-06-102-0/+123
| * | | | | | yuzu_tester: Add SDL2-based EmuWindow that doesn't show the windowZach Hilman2019-06-102-0/+164
| * | | | | | yuzu_tester: Use config, icon, and main from yuzu-cmdZach Hilman2019-06-106-0/+624
| * | | | | | yuzu_tester: Add project subdirectoryZach Hilman2019-06-102-0/+35
| | |_|/ / / | |/| | | |
* | | | | | Merge pull request #2596 from FernandoS27/revert-2590bunnei2019-06-201-1/+1
|\ \ \ \ \ \
| * | | | | | Revert PR 2590.Fernando Sahmkow2019-06-201-1/+1
* | | | | | | Merge pull request #2595 from jonsn0w/patch-1Hexagon122019-06-201-2/+2
|\ \ \ \ \ \ \ | |/ / / / / / |/| | | | | |
| * | | | | | Update content_archive.cppjonsn0w2019-06-201-2/+2
* | | | | | | Merge pull request #2591 from lioncash/recordbunnei2019-06-205-399/+0
|\ \ \ \ \ \ \
| * | | | | | | core: Remove unused CiTrace source filesLioncash2019-06-185-399/+0
* | | | | | | | Merge pull request #2590 from lioncash/eventbunnei2019-06-201-1/+1
|\ \ \ \ \ \ \ \ | |_|/ / / / / / |/| | | | | | |
| * | | | | | | service/audio/audren_u: Correct event reset type for the system eventLioncash2019-06-181-1/+1
| |/ / / / / /
* | | | | | | Merge pull request #2594 from FearlessTobi/very-important-changeZach Hilman2019-06-201-1/+1
|\ \ \ \ \ \ \
| * | | | | | | Change to a more descriptive nameTobias2019-06-191-1/+1
| * | | | | | | yuzu/configure_input: Add missing space in window nameTobias2019-06-191-1/+1
* | | | | | | | Added missing space between two wordsAlex Subaric2019-06-191-1/+1
* | | | | | | | Merge pull request #2584 from ogniK5377/cadenceZach Hilman2019-06-1918-37/+134
|\ \ \ \ \ \ \ \
| * | | | | | | | Addressed issuesDavid Marcec2019-06-174-9/+14
| * | | | | | | | Signalled accumulated_suspended_tick_changed_event on creation based on REDavid Marcec2019-06-161-0/+1
| * | | | | | | | CleanupDavid Marcec2019-06-1612-30/+39
| * | | | | | | | Impl'd IsUserAccountSwitchLocked, SetAudioOutVolume, GetAudioOutVolume & Partial impl of GetAccumulatedSuspendedTickChangedEventDavid Marcec2019-06-1610-11/+93
* | | | | | | | | Merge pull request #2562 from ReinUsesLisp/split-cbuf-uploadbunnei2019-06-186-56/+69
|\ \ \ \ \ \ \ \ \ | |/ / / / / / / / |/| | | | | | | |
| * | | | | | | | gl_rasterizer: Remove unused parameters in descriptor uploadsReinUsesLisp2019-06-082-8/+6
| * | | | | | | | video_core/engines: Move ConstBufferInfo out of Maxwell3DReinUsesLisp2019-06-086-49/+64
| | |_|_|_|_|_|/ | |/| | | | | |
* | | | | | | | Merge pull request #2538 from ReinUsesLisp/ssy-pbkZach Hilman2019-06-164-27/+78
|\ \ \ \ \ \ \ \
| * | | | | | | | shader: Split SSY and PBK stackReinUsesLisp2019-06-074-27/+78
* | | | | | | | | Merge pull request #2581 from lioncash/hexZach Hilman2019-06-1511-39/+45
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | common/hex_util: Reserve std::string memory ahead of timeLioncash2019-06-121-0/+5
| * | | | | | | | | common/hex_util: Combine HexVectorToString() and HexArrayToString()Lioncash2019-06-1211-39/+40
| | |_|_|_|_|_|_|/ | |/| | | | | | |
* | | | | | | | | Merge pull request #2582 from lioncash/reservedbunnei2019-06-141-1/+0
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | file_sys/ips_layer: Remove unnecessary reserve() callLioncash2019-06-131-1/+0
| |/ / / / / / / /
* | | | | | | | | Merge pull request #2580 from lioncash/redundantZach Hilman2019-06-131-3/+1
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | kernel/vm_manager: Remove redundant Reset call in destructorLioncash2019-06-121-3/+1
| |/ / / / / / / /
* | | | | | | | | Merge pull request #2577 from lioncash/fsZach Hilman2019-06-131-17/+29
|\ \ \ \ \ \ \ \ \ | |/ / / / / / / / |/| | | | | | | |
| * | | | | | | | file_sys/card_image: Remove obsolete TODOLioncash2019-06-121-1/+1
| * | | | | | | | file_sys/card_image: Deduplicate casts within AddNCAFromPartition()Lioncash2019-06-111-3/+6
| * | | | | | | | file_sys/card_image: Make bracing consistentLioncash2019-06-111-4/+8
| * | | | | | | | file_sys/card_image: Assign collapsed NCA contents directly to ncas memberLioncash2019-06-111-3/+1
| * | | | | | | | file_sys/card_image: Deduplicate type castLioncash2019-06-111-4/+6
| * | | | | | | | file_sys/card_image: Get rid of a magic numberLioncash2019-06-111-1/+1
| * | | | | | | | file_sys/card_image: Use std::array deduction guidesLioncash2019-06-111-1/+6
| | |_|_|_|/ / / | |/| | | | | |
* | | | | | | | Merge pull request #2578 from lioncash/cnmtbunnei2019-06-121-2/+7
|\ \ \ \ \ \ \ \
| * | | | | | | | file_sys/nca_metadata: Update CNMT structuresLioncash2019-06-111-2/+7
| |/ / / / / / /
* | | | | | | | Merge pull request #2572 from FernandoS27/gpu-membunnei2019-06-121-2/+2
|\ \ \ \ \ \ \ \ | |/ / / / / / / |/| | | | | | |
| * | | | | | | GPUVM: Correct GPU VM virtual address spaceFernando Sahmkow2019-06-091-2/+2
* | | | | | | | Merge pull request #2571 from lioncash/refZach Hilman2019-06-102-2/+2
|\ \ \ \ \ \ \ \
| * | | | | | | | kernel/process: Make Create()'s name parameter be taken by valueLioncash2019-06-102-2/+2
| | |_|_|_|/ / / | |/| | | | | |
* | | | | | | | kernel/svc: Implement TotalMemoryUsedWithoutMmHeap/TotalMemoryAvailableWithoutMmHeapLioncash2019-06-103-2/+42
* | | | | | | | kernel/svc: Amend naming for TotalMemoryUsage in svcGetInfo()Lioncash2019-06-103-6/+6
* | | | | | | | kernel/svc: Remove duplicate enum entry in svcGetInfo()Lioncash2019-06-101-2/+1
|/ / / / / / /
* | | | | | | Merge pull request #2564 from ReinUsesLisp/block-dim-x-fixZach Hilman2019-06-081-3/+4
|\ \ \ \ \ \ \ | |/ / / / / / |/| | | | | |
| * | | | | | kepler_compute: Use std::array for cbuf infoReinUsesLisp2019-06-081-2/+3
| * | | | | | kepler_compute: Fix block_dim_x encodingReinUsesLisp2019-06-081-1/+1
| | |/ / / / | |/| | | |
* | | | | | Merge pull request #2553 from lioncash/languageZach Hilman2019-06-0831-58/+326
|\ \ \ \ \ \
| * | | | | | yuzu/configuration: Make all widgets and dialogs aware of language changesLioncash2019-06-0631-58/+326
* | | | | | | constants: Extract backup JPEG used by account servicesZach Hilman2019-06-075-28/+43
| |/ / / / / |/| | | | |
* | | | | | Merge pull request #2514 from ReinUsesLisp/opengl-compatZach Hilman2019-06-0724-252/+45
|\ \ \ \ \ \ | |_|/ / / / |/| | | | |
| * | | | | gl_buffer_cache: Remove unused ReserveMemory methodReinUsesLisp2019-05-302-13/+0
| * | | | | maxwell_to_gl: Use GL_CLAMP to emulate Clamp wrap modeReinUsesLisp2019-05-303-7/+4
| * | | | | gl_rasterizer: Move alpha testing to the OpenGL pipelineReinUsesLisp2019-05-308-71/+33
| * | | | | gl_rasterizer: Use GL_QUADS to emulate quads renderingReinUsesLisp2019-05-306-132/+5
| * | | | | rasterizer_opengl: Remove OpenGL core profileReinUsesLisp2019-05-308-29/+3
* | | | | | cmake: Add missing shader hash file entriesReinUsesLisp2019-06-071-0/+3
* | | | | | shader/node: Minor changesReinUsesLisp2019-06-071-50/+54
* | | | | | shader: Move Node declarations out of the shader IR headerReinUsesLisp2019-06-074-493/+518
* | | | | | Merge pull request #2552 from ReinUsesLisp/shader-shared-ptrZach Hilman2019-06-0735-248/+296
|\ \ \ \ \ \
| * | | | | | shader: Use shared_ptr to store nodes and move initialization to fileReinUsesLisp2019-06-0635-248/+296
* | | | | | | Merge pull request #2549 from lioncash/headerZach Hilman2019-06-061-1/+0
|\ \ \ \ \ \ \
| * | | | | | | kernel/process: Remove unused boost header includeLioncash2019-06-051-1/+0
* | | | | | | | Merge pull request #2550 from lioncash/frontendZach Hilman2019-06-061-0/+9
|\ \ \ \ \ \ \ \
| * | | | | | | | yuzu/CMakeLists: Disable implicit QString->QUrl conversionsLioncash2019-06-051-0/+3
| * | | | | | | | yuzu/CMakeLists: Disable unsafe overloads of QProcess' start() functionLioncash2019-06-051-0/+3
| * | | | | | | | yuzu/CMakeLists: Disable implicit type narrowing in connect() callsLioncash2019-06-051-0/+3
* | | | | | | | | Merge pull request #2551 from lioncash/dtorbunnei2019-06-061-9/+9
|\ \ \ \ \ \ \ \ \ | |_|_|/ / / / / / |/| | | | | | | |
| * | | | | | | | service/ns: Add missing override specifiersLioncash2019-06-051-9/+9
* | | | | | | | | Merge pull request #2520 from ReinUsesLisp/vulkan-refreshbunnei2019-06-064-88/+218
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | vk_device: Let formats array type be deducedReinUsesLisp2019-05-261-33/+33
| * | | | | | | | | vk_shader_decompiler: Misc fixesReinUsesLisp2019-05-262-45/+67
| * | | | | | | | | vk_device: Enable features when available and misc changesReinUsesLisp2019-05-262-43/+151
* | | | | | | | | | Merge pull request #2540 from ReinUsesLisp/remove-guest-positionbunnei2019-06-062-36/+21
|\ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | gl_shader_decompiler: Remove guest "position" varyingReinUsesLisp2019-06-032-36/+21
| | |_|_|_|_|_|_|_|/ | |/| | | | | | | |
* | | | | | | | | | Merge pull request #2419 from DarkLordZach/srv-lr-ifacebunnei2019-06-061-3/+77
|\ \ \ \ \ \ \ \ \ \ | |_|_|_|_|_|_|/ / / |/| | | | | | | | |
| * | | | | | | | | ncm: Implement LR OpenAddOnContentLocationResolver (2)Zach Hilman2019-05-271-24/+21
| * | | | | | | | | ncm: Implement LR OpenRegisteredLocationResolver (1)Zach Hilman2019-05-271-0/+27
| * | | | | | | | | ncm: Implement LR OpenLocationResolver (0)Zach Hilman2019-05-271-0/+50
| | |/ / / / / / / | |/| | | | | | |
* | | | | | | | | Merge pull request #2521 from lioncash/namingbunnei2019-06-0633-213/+234
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | yuzu/configuration: Make function naming consistentLioncash2019-06-0533-213/+234
* | | | | | | | | | Merge pull request #2512 from ReinUsesLisp/comp-indexingbunnei2019-06-063-3/+80
|\ \ \ \ \ \ \ \ \ \ | |_|_|_|/ / / / / / |/| | | | | | | | |
| * | | | | | | | | gl_shader_decompiler: Use an if based cbuf indexing for broken driversReinUsesLisp2019-05-241-3/+20
| * | | | | | | | | gl_device: Add test to detect broken component indexingReinUsesLisp2019-05-242-0/+60
* | | | | | | | | | Merge pull request #2526 from lioncash/globalZach Hilman2019-06-059-75/+98
|\ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | core/core: Remove unnecessary includesLioncash2019-05-293-13/+37
| * | | | | | | | | | yuzu_cmd/yuzu: Correct formatting specifierLioncash2019-05-291-1/+1
| * | | | | | | | | | core/loader: Remove LoadKernelSystemModeLioncash2019-05-295-29/+0
| * | | | | | | | | | core/telemetry_session: Remove unnecessary web service nulling out in destructorLioncash2019-05-291-2/+1
| * | | | | | | | | | core/telemetry_session: Remove usages of the global system accessorLioncash2019-05-293-30/+54
| * | | | | | | | | | core/telemetry_session: Explicitly delete copy and move constructorsLioncash2019-05-291-1/+7
| * | | | | | | | | | core/telemetry_session: Remove unused includeLioncash2019-05-291-1/+0
| | |_|/ / / / / / / | |/| | | | | | | |
* | | | | | | | | | Merge pull request #2545 from lioncash/timingZach Hilman2019-06-057-78/+38
|\ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | core/core_timing_util: Amend casing of cyclesTo* functionsLioncash2019-06-053-6/+6
| * | | | | | | | | | core/core_timing_util: Use std::chrono types for specifying time unitsLioncash2019-06-057-36/+43
| * | | | | | | | | | core/core_timing_utils: Simplify overload setLioncash2019-06-052-49/+2
| | |_|_|_|_|/ / / / | |/| | | | | | | |
* | | | | | | | | | Merge pull request #2541 from lioncash/inputZach Hilman2019-06-053-78/+76
|\ \ \ \ \ \ \ \ \ \ | |_|_|_|_|_|/ / / / |/| | | | | | | | |
| * | | | | | | | | input_common/sdl/sdl_impl: Correct logging string in SDLState constructorLioncash2019-06-031-1/+1
| * | | | | | | | | input_common/sdl/sdl_impl: Move documentation comments to header where applicableLioncash2019-06-032-7/+6
| * | | | | | | | | input_common/sdl/sdl_impl: Amend names for axes for SDLAnalogPollerLioncash2019-06-031-13/+13
| * | | | | | | | | input_common/sdl/sdl_impl: Mark variables const where applicableLioncash2019-06-031-10/+11
| * | | | | | | | | input_common/sdl/sdl_impl: Mark SDLEventToButtonParamPackage() as staticLioncash2019-06-031-1/+1
| * | | | | | | | | input_common/sdl/sdl_impl: Convert reinterpret_cast into a static_castLioncash2019-06-031-2/+4
| * | | | | | | | | input_common/sdl/sdl_impl: Use insert_or_assign() where applicableLioncash2019-06-031-3/+3
| * | | | | | | | | input_common/sdl/sdl_impl: Simplify SDL_Joystick deleter handlingLioncash2019-06-031-15/+14
| * | | | | | | | | input_common/sdl/sdl_impl: Resolve two sign conversion warningsLioncash2019-06-031-10/+16
| * | | | | | | | | input_common/sdl: Remove unused header includes and forward declarationsLioncash2019-06-033-11/+5
| * | | | | | | | | input_common/sdl/sdl_impl: Use nested namespace specifiers where applicableLioncash2019-06-031-5/+2
| | |_|_|_|/ / / / | |/| | | | | | |
* | | | | | | | | Merge pull request #2510 from SciresM/desired_languageZach Hilman2019-06-0510-402/+1081
|\ \ \ \ \ \ \ \ \ | |_|_|_|_|/ / / / |/| | | | | | | |
| * | | | | | | | Fix bitmask logic inversionMichael Scire2019-05-231-2/+1
| * | | | | | | | fix introduced clang-format errorsMichael Scire2019-05-231-3/+2
| * | | | | | | | Address review commentsMichael Scire2019-05-236-47/+120
| * | | | | | | | clang-format fixesMichael Scire2019-05-234-31/+32
| * | | | | | | | Implement IApplicationFunctions::GetDesiredLanguageMichael Scire2019-05-239-403/+1010
* | | | | | | | | Merge pull request #2527 from lioncash/indexZach Hilman2019-06-055-34/+16
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | yuzu/software_keyboard: Remove unnecessary GetStatus() member functionLioncash2019-05-293-10/+1
| * | | | | | | | | profile_select: Remove unnecessary GetStatus() member functionLioncash2019-05-293-18/+8
| * | | | | | | | | profile_select: Return int instead of u32 for GetIndex()Lioncash2019-05-293-8/+9
| | |_|_|/ / / / / | |/| | | | | | |
* | | | | | | | | Merge pull request #2534 from ReinUsesLisp/shader-cleanupZach Hilman2019-06-052-31/+36
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | gl_shader_cache: Store a system class and drop global accessorsReinUsesLisp2019-05-302-7/+9
| * | | | | | | | | gl_shader_cache: Add commentaries explaining the intention in shaders creationReinUsesLisp2019-05-301-0/+2
| * | | | | | | | | gl_shader_cache: Flip if condition in GetStageProgram to reduce indentationReinUsesLisp2019-05-301-25/+26
| | |_|_|_|_|/ / / | |/| | | | | | |
* | | | | | | | | Merge pull request #2531 from ReinUsesLisp/qt-warningsZach Hilman2019-06-053-15/+15
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | qt: Silence name collision warningsReinUsesLisp2019-05-303-15/+15
* | | | | | | | | | Merge pull request #2515 from lioncash/narrowingZach Hilman2019-06-051-6/+5
|\ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | yuzu/configuration/configure_graphics: Eliminate type narrowing in a connect callLioncash2019-05-251-6/+5
* | | | | | | | | | | Merge pull request #2536 from lioncash/cacheZach Hilman2019-06-051-36/+26
|\ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | game_list_worker: Use QFile over our own IOFile instance or std streamsLioncash2019-05-311-28/+24
| * | | | | | | | | | | game_list_worker: Remove template specializationsLioncash2019-05-311-8/+2
* | | | | | | | | | | | Merge pull request #2529 from lioncash/bootRodrigo Locatti2019-06-054-44/+61
|\ \ \ \ \ \ \ \ \ \ \ \ | |_|_|_|_|_|_|_|/ / / / |/| | | | | | | | | | |
| * | | | | | | | | | | yuzu/bootmanager: Log out screenshot destination pathLioncash2019-06-031-6/+11
| * | | | | | | | | | | yuzu/bootmanager: Treat the resolution factor as a u32Lioncash2019-06-034-16/+25
| * | | | | | | | | | | yuzu/bootmanager: Default EmuThread's destructor in the cpp fileLioncash2019-06-032-1/+4
| * | | | | | | | | | | yuzu/bootmanager: unsigned -> u32Lioncash2019-06-032-11/+11
| * | | | | | | | | | | yuzu/bootmanager: Change false literal to 0 for setSwapInterval()Lioncash2019-06-031-1/+1
| * | | | | | | | | | | yuzu/bootmanager: Remove pointer downcast in GRenderWindow's constructorLioncash2019-06-032-4/+3
| * | | | | | | | | | | yuzu/bootmanager: Remove unnecessary pointer castsLioncash2019-06-031-5/+6
| | |_|_|_|_|_|/ / / / | |/| | | | | | | | |
* | | | | | | | | | | Merge pull request #2525 from FearlessTobi/remove-unused-settingsMat M2019-06-043-170/+44
|\ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | yuzu: Remove unused birthday settingfearlessTobi2019-05-293-170/+44
| | |_|_|/ / / / / / / | |/| | | | | | | | |
* | | | | | | | | | | shader_bytecode: Mark EXIT as flow instructionFernando Sahmkow2019-06-041-1/+1
| |/ / / / / / / / / |/| | | | | | | | |
* | | | | | | | | | input_common/sdl/sdl_impl: Silence sign conversion warningsLioncash2019-05-311-3/+3
* | | | | | | | | | common/math_util: Provide a template deduction guide for Common::RectangleLioncash2019-05-311-0/+3
| |/ / / / / / / / |/| | | | | | | |
* | | | | | | | | Merge pull request #1931 from DarkLordZach/mii-database-1bunnei2019-05-3018-127/+1157
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | mii_manager: Fix incorrect loop condition in mii UUID generation codeZach Hilman2019-04-253-2/+3
| * | | | | | | | | profile_select: Port Service::Account::UUID to Common::UUIDZach Hilman2019-04-259-29/+27
| * | | | | | | | | mii: Implement Delete and Destroy fileZach Hilman2019-04-254-13/+122
| * | | | | | | | | mii: Implement IsUpdated command (IPC 0)Zach Hilman2019-04-253-9/+34
| * | | | | | | | | mii_manager: Cleanup and optimizationZach Hilman2019-04-255-39/+55
| * | | | | | | | | mii: Implement IDatabaseService commands using MiiManagerZach Hilman2019-04-252-15/+244
| * | | | | | | | | mii: Add MiiManager class to manage Mii databaseZach Hilman2019-04-252-0/+622
| * | | | | | | | | common: Extract UUID to its own classZach Hilman2019-04-256-78/+108
* | | | | | | | | | Merge pull request #2431 from DarkLordZach/game-list-cachebunnei2019-05-305-7/+133
|\ \ \ \ \ \ \ \ \ \ | |_|_|_|/ / / / / / |/| | | | | | | | |
| * | | | | | | | | main: Remove extraneous commentZach Hilman2019-05-301-1/+0
| * | | | | | | | | game_list_worker: Add better error handling to cachingZach Hilman2019-05-262-23/+42
| * | | | | | | | | yuzu: Clear partial/full game list cache when data is updatedZach Hilman2019-05-262-0/+13
| * | | | | | | | | game_list: Implement caching for game listZach Hilman2019-05-261-7/+99
| * | | | | | | | | ui_settings: Add option to cache game listZach Hilman2019-05-262-0/+3
| | |_|_|/ / / / / | |/| | | | | | |
* | | | | | | | | Merge pull request #2446 from ReinUsesLisp/tidbunnei2019-05-294-22/+76
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | shader: Implement S2R Tid{XYZ} and CtaId{XYZ}ReinUsesLisp2019-05-204-15/+69
| * | | | | | | | | gl_shader_decompiler: Make GetSwizzle constexprReinUsesLisp2019-05-201-7/+7
* | | | | | | | | | Merge pull request #2518 from ReinUsesLisp/sdl2-windowbunnei2019-05-299-186/+216
|\ \ \ \ \ \ \ \ \ \ | |_|_|_|/ / / / / / |/| | | | | | | | |
| * | | | | | | | | emu_window: Pass OnMinimalClientAreaChangeRequest argument by copyReinUsesLisp2019-05-265-10/+5
| * | | | | | | | | yuzu_cmd: Split emu_window OpenGL implementation into its own fileReinUsesLisp2019-05-256-176/+211
| | |_|_|_|_|/ / / | |/| | | | | | |
* | | | | | | | | Merge pull request #2519 from lioncash/signbunnei2019-05-272-5/+5
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | core_timing_util: Silence sign-comparison warningsLioncash2019-05-251-4/+4
| * | | | | | | | | loader/nso: Silence sign-comparison warningLioncash2019-05-251-1/+1
| | |_|_|_|_|_|_|/ | |/| | | | | | |
* | | | | | | | | gl_device: Add commentary to AOFFI unit test source codeReinUsesLisp2019-05-271-0/+1
* | | | | | | | | gl_shader_gen: Always declare extensions after the version declarationReinUsesLisp2019-05-272-7/+5
| |_|_|/ / / / / |/| | | | | | |
* | | | | | | | Merge pull request #2516 from lioncash/labelbunnei2019-05-262-10/+10
|\ \ \ \ \ \ \ \
| * | | | | | | | renderer_opengl/utils: Use a std::string_view with LabelGLObject()Lioncash2019-05-252-10/+10
| |/ / / / / / /
* | | | | | | | Merge pull request #2509 from lioncash/aocbunnei2019-05-261-19/+50
|\ \ \ \ \ \ \ \
| * | | | | | | | service/aoc: Avoid allocating and discarding dataLioncash2019-05-231-8/+8
| * | | | | | | | service/aoc: Remove unnecessary includesLioncash2019-05-231-2/+0
| * | | | | | | | service/aoc: Pop all passed values where applicableLioncash2019-05-231-12/+45
| | |_|_|_|_|/ / | |/| | | | | |
* | | | | | | | Merge pull request #2511 from lioncash/file-strbunnei2019-05-263-45/+23
|\ \ \ \ \ \ \ \
| * | | | | | | | common/file_util: Remove unnecessary return at end of void StripTailDirSlashes()Lioncash2019-05-231-6/+8
| * | | | | | | | common/file_util: Make GetCurrentDir() return a std::optionalLioncash2019-05-232-3/+4
| * | | | | | | | common/file_util: Remove duplicated documentation commentsLioncash2019-05-231-25/+0
| * | | | | | | | common/file_util: Make ReadFileToString and WriteStringToFile consistentLioncash2019-05-233-7/+7
| * | | | | | | | common/file_util: Remove unnecessary c_str() callsLioncash2019-05-231-2/+2
| * | | | | | | | common/file_util: Make IOFile's WriteString take a std::string_viewLioncash2019-05-231-2/+2
| |/ / / / / / /
* | | | | | | | configure_hotkeys: Remove unnecessary Settings::Apply() callLioncash2019-05-251-1/+0
* | | | | | | | configure_hotkeys: Tidy up key sequence conflict error stringLioncash2019-05-251-2/+2
* | | | | | | | configure_hotkeys: Change critical error dialog into a warning dialogLioncash2019-05-251-2/+2
* | | | | | | | configure_hotkeys: Move conflict detection logic to IsUsedKey()Lioncash2019-05-252-14/+15
* | | | | | | | configure_hotkeys: Remove unused EmitHotkeysChanged()Lioncash2019-05-253-13/+0
* | | | | | | | sequence_dialog: Reorganize the constructorLioncash2019-05-251-4/+8
* | | | | | | | sequence_dialog: Remove unnecessary horizontal specifierLioncash2019-05-251-2/+1
| |/ / / / / / |/| | | | | |
* | | | | | | Merge pull request #2513 from lioncash/stringbunnei2019-05-255-126/+168
|\ \ \ \ \ \ \
| * | | | | | | yuzu/CMakeLists: Disable implicit QString conversionsLioncash2019-05-251-0/+4
| * | | | | | | yuzu/applets/software_keyboard: Remove unused assert headerLioncash2019-05-251-1/+0
| * | | | | | | yuzu/applets/software_keyboard: std::move argument in MainWindowFinishedText()Lioncash2019-05-251-1/+1
| * | | | | | | yuzu/applets/software_keyboard: Resolve sign mismatch comparisonLioncash2019-05-251-1/+1
| * | | | | | | yuzu/applets/software_keyboard: Specify string conversions explicitlyLioncash2019-05-252-10/+18
| * | | | | | | yuzu/applets/error: Specify string conversions explicitlyLioncash2019-05-251-2/+3
| * | | | | | | yuzu/main: Specify string conversions where applicableLioncash2019-05-251-115/+145
| | |_|_|_|/ / | |/| | | | |
* | | | | | | Merge pull request #2358 from ReinUsesLisp/parallel-shaderbunnei2019-05-259-62/+122
|\ \ \ \ \ \ \ | |/ / / / / / |/| | | | | |
| * | | | | | gl_shader_cache: Fix clang strict standard build issuesReinUsesLisp2019-05-213-9/+13
| * | | | | | gl_shader_cache: Use shared contexts to build shaders in parallelReinUsesLisp2019-05-217-56/+112
* | | | | | | Merge pull request #2485 from ReinUsesLisp/generic-memorybunnei2019-05-253-35/+73
|\ \ \ \ \ \ \
| * | | | | | | shader/memory: Implement ST (generic memory)ReinUsesLisp2019-05-212-21/+36
| * | | | | | | shader/memory: Implement LD (generic memory)ReinUsesLisp2019-05-213-15/+38
| |/ / / / / /
* | | | | | | Merge pull request #2504 from lioncash/configbunnei2019-05-252-33/+43
|\ \ \ \ \ \ \
| * | | | | | | yuzu/configuration/config: Make default hotkeys an internally-linked array in the cpp fileLioncash2019-05-212-4/+2
| * | | | | | | yuzu/configuration/config: Specify string conversions explicitlyLioncash2019-05-211-30/+42
| |/ / / / / /
* | | | | | | Merge pull request #2489 from FearlessTobi/port-4716bunnei2019-05-254-9/+10
|\ \ \ \ \ \ \ | |_|_|/ / / / |/| | | | | |
| * | | | | | Address review commentTobias2019-05-191-1/+1
| * | | | | | HLE/IPC: HLEContext can memorize the client thread and use it for SleepClientThreadWeiyi Wang2019-05-184-9/+10
* | | | | | | shader/shader_ir: Make Comment() take a std::string by valueLioncash2019-05-232-3/+3
* | | | | | | shader/decode/*: Add missing newline to files lacking themLioncash2019-05-2318-18/+18
* | | | | | | shader/decode/*: Eliminate indirect inclusionsLioncash2019-05-236-1/+5
| |_|/ / / / |/| | | | |
* | | | | | shader/decode/memory: Remove left in debug pragmaLioncash2019-05-221-2/+0
* | | | | | renderer_opengl/gl_shader_decompiler: Remove redundant name specification in format stringLioncash2019-05-211-1/+1
| |/ / / / |/| | | |
* | | | | Merge pull request #2455 from lioncash/configbunnei2019-05-212-315/+573
|\ \ \ \ \
| * | | | | configuration/config: Move config loading and saving to functions based off groupsLioncash2019-05-092-315/+573
* | | | | | Merge pull request #2503 from lioncash/utilbunnei2019-05-217-84/+92
|\ \ \ \ \ \
| * | | | | | yuzu/game_list: Specify string conversions explicitlyLioncash2019-05-202-50/+55
| * | | | | | yuzu/game_list_worker: Specify string conversions explicitlyLioncash2019-05-201-2/+2
| * | | | | | yuzu/game_list_p: Amend mentions of SMDH in commentsLioncash2019-05-201-3/+3
| * | | | | | yuzu/game_list_p: Specify string conversions explicitlyLioncash2019-05-201-10/+9
| * | | | | | yuzu/loading_screen: Specify string conversions explicitlyLioncash2019-05-201-9/+9
| * | | | | | yuzu/bootmanager: Specify string conversions explicitlyLioncash2019-05-201-2/+4
| * | | | | | yuzu/util: Specify string conversions explicitlyLioncash2019-05-201-8/+10
| | |_|/ / / | |/| | | |
* | | | | | Merge pull request #2494 from lioncash/shader-textbunnei2019-05-211-181/+195
|\ \ \ \ \ \ | |/ / / / / |/| | | | |
| * | | | | gl_shader_decompiler: Tidy up minor remaining cases of unnecessary std::string concatenationLioncash2019-05-201-21/+20
| * | | | | gl_shader_decompiler: Replace individual overloads with the fmt-based oneLioncash2019-05-201-28/+16
| * | | | | gl_shader_decompiler: Utilize fmt overload of AddLine() where applicableLioncash2019-05-201-136/+152
| * | | | | gl_shader_decompiler: Add AddLine() overload that forwards to fmtLioncash2019-05-191-0/+11
* | | | | | Merge pull request #2499 from lioncash/translatebunnei2019-05-2010-119/+192
|\ \ \ \ \ \
| * | | | | | yuzu/configuration/configure_web: Specify string conversions explicitlyLioncash2019-05-191-8/+16
| * | | | | | yuzu/configuration/configure_system: Specify string conversions explicitlyLioncash2019-05-191-2/+3
| * | | | | | yuzu/configuration/configure_profile_manager: Mark UI string as translatableLioncash2019-05-191-1/+1
| * | | | | | yuzu/configuration/configure_per_general: Specify string conversions explicitlyLioncash2019-05-191-6/+8
| * | | | | | yuzu/configuration/configure_mouse_advanced: Clean up array accessesLioncash2019-05-191-19/+22
| * | | | | | yuzu/configuration/configure_mouse_advanced: Specify string conversions explicitlyLioncash2019-05-191-11/+23
| * | | | | | yuzu/configuration/configure_input_player: Clean up array accessesLioncash2019-05-191-32/+48
| * | | | | | yuzu/configuration/configure_input_player: Specify string conversions explicitlyLioncash2019-05-191-24/+49
| * | | | | | yuzu/configuration/configure_input: Mark controller type names as translateableLioncash2019-05-191-5/+8
| * | | | | | yuzu/configuration/configure_general: Specify string conversions explicitlyLioncash2019-05-191-1/+2
| * | | | | | yuzu/configuration/configure_gamelist: Specify string conversions explicitlyLioncash2019-05-191-3/+5
| * | | | | | yuzu/configuration/configure_audio: Store power on query into a variableLioncash2019-05-191-2/+3
| * | | | | | yuzu/configuration/configure_audio: Tidy up function castLioncash2019-05-191-2/+1
| * | | | | | yuzu/configuration/configure_audio: Specify string conversions explicitlyLioncash2019-05-191-3/+3
* | | | | | | Revert #2466Fernando Sahmkow2019-05-191-1/+3
| |/ / / / / |/| | | | |
* | | | | | Merge pull request #2441 from ReinUsesLisp/al2pbunnei2019-05-1910-157/+310
|\ \ \ \ \ \
| * | | | | | shader_ir/other: Implement IPA.IDXReinUsesLisp2019-05-032-5/+9
| * | | | | | gl_shader_decompiler: Skip physical unused attributesReinUsesLisp2019-05-031-18/+27
| * | | | | | shader_ir/memory: Assert on non-32 bits ALD.PHYSReinUsesLisp2019-05-031-0/+3
| * | | | | | shader: Add physical attributes commentariesReinUsesLisp2019-05-034-4/+8
| * | | | | | gl_shader_decompiler: Implement GLSL physical attributesReinUsesLisp2019-05-032-66/+101
| * | | | | | shader_ir/memory: Implement physical input attributesReinUsesLisp2019-05-034-6/+32
| * | | | | | gl_shader_decompiler: Abstract generic attribute operationsReinUsesLisp2019-05-031-29/+26
| * | | | | | gl_shader_decompiler: Declare all possible varyings on physical attribute usageReinUsesLisp2019-05-034-27/+88
| * | | | | | shader: Remove unused AbufNode Ipa modeReinUsesLisp2019-05-036-35/+14
| * | | | | | shader_ir/memory: Emit AL2P IRReinUsesLisp2019-05-032-0/+22
| * | | | | | shader_bytecode: Add AL2P decodingReinUsesLisp2019-05-031-2/+15
| | |/ / / / | |/| | | |
* | | | | | Merge pull request #2410 from lioncash/affinitybunnei2019-05-192-42/+58
|\ \ \ \ \ \
| * | | | | | kernel/svc: Make svcCreateThread/svcStartThread/svcSleepThread/svcExitThread calls show up in the debug logLioncash2019-04-291-4/+4
| * | | | | | kernel/svc: Reorganize svcSetThreadCoreMask()Lioncash2019-04-291-32/+39
| * | | | | | kernel/thread: Update thread processor ID flagsLioncash2019-04-292-7/+16
* | | | | | | Merge pull request #2491 from FernandoS27/dma-fixHexagon122019-05-191-0/+7
|\ \ \ \ \ \ \
| * | | | | | | Dma_pusher: ASSERT on empty command_listFernando Sahmkow2019-05-191-0/+7
| | |_|_|/ / / | |/| | | | |
* | | | | | | Merge pull request #2452 from FernandoS27/raster-cache-fixHexagon122019-05-191-1/+2
|\ \ \ \ \ \ \
| * | | | | | | Correct possible error on Rasterizer CachesFernando Sahmkow2019-05-071-1/+2
* | | | | | | | Merge pull request #2497 from lioncash/shader-irHexagon122019-05-193-32/+28
|\ \ \ \ \ \ \ \
| * | | | | | | | shader/shader_ir: Remove unnecessary inline specifiersLioncash2019-05-191-2/+2
| * | | | | | | | shader/shader_ir: Simplify constructors for OperationNodeLioncash2019-05-191-15/+6
| * | | | | | | | shader/shader_ir: Remove unnecessary template parameter packs from Operation() overloads where applicableLioncash2019-05-191-2/+0
| * | | | | | | | shader/shader_ir: Mark tracking functions as const member functionsLioncash2019-05-192-8/+11
| * | | | | | | | shader/shader_ir: Place implementations of constructor and destructor in cpp fileLioncash2019-05-192-5/+9
| | |/ / / / / / | |/| | | | | |
* | | | | | | | Merge pull request #2495 from lioncash/cacheHexagon122019-05-192-34/+48
|\ \ \ \ \ \ \ \
| * | | | | | | | gl_shader_disk_cache: in-class initialize virtual file offset of ShaderDiskCacheOpenGLLioncash2019-05-192-5/+3
| * | | | | | | | gl_shader_disk_cache: Default ShaderDiskCacheOpenGL's destructor in the cpp fileLioncash2019-05-192-0/+3
| * | | | | | | | gl_shader_disk_cache: Make hash specializations noexceptLioncash2019-05-191-2/+2
| * | | | | | | | gl_shader_disk_cache: Remove redundant code string construction in LoadDecompiledEntry()Lioncash2019-05-191-2/+2
| * | | | | | | | gl_shader_disk_cache: Make variable non-const in decompiled entry caseLioncash2019-05-191-1/+1
| * | | | | | | | gl_shader_disk_cache: Special-case boolean handlingLioncash2019-05-192-24/+37
| |/ / / / / / /
* | | | | | | | Merge pull request #2439 from lioncash/audrenHexagon122019-05-192-51/+299
|\ \ \ \ \ \ \ \
| * | | | | | | | service/audren_u: Handle variadic command buffers in GetWorkBufferSize()Lioncash2019-05-012-17/+93
| * | | | | | | | service/audren_u: Handle version 2 of performance frame info in GetWorkBufferSize()Lioncash2019-05-012-6/+13
| * | | | | | | | service/audren_u: Clean up work buffer calculationsLioncash2019-05-011-49/+214
| | |_|_|_|_|/ / | |/| | | | | |
* | | | | | | | Merge pull request #2467 from lioncash/moveHexagon122019-05-191-6/+0
|\ \ \ \ \ \ \ \ | |_|_|_|_|_|/ / |/| | | | | | |
| * | | | | | | video_core/gpu_thread: Remove redundant copy constructor for CommandDataContainerLioncash2019-05-141-6/+0
* | | | | | | | Merge pull request #2463 from lioncash/setHexagon122019-05-191-34/+22
|\ \ \ \ \ \ \ \
| * | | | | | | | service/set: Correct and simplify behavior related to copying language codesLioncash2019-05-101-34/+22
* | | | | | | | | Merge pull request #2466 from yuzu-emu/mme-exit-delay-slotHexagon122019-05-191-3/+3
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | GPU/MMEInterpreter: Ignore the 'exit' flag when it's executed inside a delay slot.Sebastian Valle2019-05-121-3/+3
| |/ / / / / / / /
* | | | | | | | | Merge pull request #2468 from lioncash/deductionHexagon122019-05-193-3/+3
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | yuzu: Remove explicit types from locks where applicableLioncash2019-05-143-3/+3
| | |/ / / / / / / | |/| | | | | | |
* | | | | | | | | Merge pull request #2472 from FernandoS27/ticHexagon122019-05-191-1/+1
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | maxwell_3d: reduce sevirity of different component formats assert.Fernando Sahmkow2019-05-141-1/+1
| |/ / / / / / / /
* | | | | | | | | Merge pull request #2469 from lioncash/copyableHexagon122019-05-191-0/+2
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | video_core/engines/maxwell_3d: Add is_trivially_copyable_v check for RegsLioncash2019-05-141-0/+2
| |/ / / / / / / /
* | | | | | | | | Merge pull request #2470 from lioncash/ranged-forSebastian Valle2019-05-191-18/+18
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | video_core/engines/maxwell3d: Get rid of three magic values in CallMethod()Lioncash2019-05-141-3/+3
| * | | | | | | | | video_core/engines/maxwell_3d: Simplify for loops into ranged for loops within InitializeRegisterDefaults()Lioncash2019-05-141-15/+15
| |/ / / / / / / /
* | | | | | | | | Merge pull request #2487 from lioncash/service-returnHexagon122019-05-191-0/+2
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | service/am: Add missing return in error case for IStorageAccessor's Read()/Write().Lioncash2019-05-191-0/+2
| |/ / / / / / / /
* | | | | | | | | Merge pull request #2480 from ReinUsesLisp/fix-quadsHexagon122019-05-191-2/+2
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | gl_rasterizer: Pass the right number of array quad vertices countReinUsesLisp2019-05-171-2/+2
* | | | | | | | | | Merge pull request #2483 from ReinUsesLisp/fix-point-sizeHexagon122019-05-191-1/+3
|\ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | gl_rasterizer: Limit OpenGL point size to a minimum of 1ReinUsesLisp2019-05-181-1/+3
| |/ / / / / / / / /
* | | | | | | | | | Merge pull request #2471 from lioncash/engine-uploadSebastian Valle2019-05-192-6/+8
|\ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | video_core/engines/engine_upload: Amend constructor initializer list orderLioncash2019-05-141-1/+1
| * | | | | | | | | | video_core/engines/engine_upload: Default destructor in the cpp fileLioncash2019-05-142-1/+3
| * | | | | | | | | | video_core/engines/engine_upload: Remove unnecessary const on parameters in function declarationsLioncash2019-05-141-2/+2
| * | | | | | | | | | video_core/engines/engine_upload: Remove unnecessary includesLioncash2019-05-142-2/+2
| | |/ / / / / / / / | |/| | | | | | | |
* | | | | | | | | | Merge pull request #2484 from ReinUsesLisp/triangle-fanSebastian Valle2019-05-191-0/+2
|\ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | maxwell_to_gl: Add TriangleFan primitive topologyReinUsesLisp2019-05-181-0/+2
| | |/ / / / / / / / | |/| | | | | | | |
* | | | | | | | | | Merge pull request #2490 from lioncash/floatHexagon122019-05-191-1/+1
|\ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | ipc_helpers: Amend floating-point type in Pop<double> specializationLioncash2019-05-191-1/+1
| | |_|_|_|/ / / / / | |/| | | | | | | |
* | | | | | | | | | Merge pull request #2492 from lioncash/debuggerHexagon122019-05-193-17/+20
|\ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | yuzu/debugger/graphics/graphics_breakpoints: Specify string conversions explicitlyLioncash2019-05-191-1/+1
| * | | | | | | | | | yuzu/debugger/profiler: Specify string conversions explicitlyLioncash2019-05-191-2/+2
| * | | | | | | | | | yuzu/debugger/wait_tree: Specify string conversions explicitlyLioncash2019-05-191-14/+17
| |/ / / / / / / / /
* | | | | | | | | | Merge pull request #2486 from lioncash/resetnameSebastian Valle2019-05-1919-35/+36
|\ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | core/kernel/object: Rename ResetType enum membersLioncash2019-05-1819-35/+36
| | |_|/ / / / / / / | |/| | | | | | | |
* | | | | | | | | | Merge pull request #2488 from lioncash/static-fnSebastian Valle2019-05-191-4/+4
|\ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | kernel/svc: Mark GetThreadList() and UnmapProcessCodeMemory() as internally linkedLioncash2019-05-191-4/+4
| |/ / / / / / / / /
* | | | | | | | | | Merge pull request #2493 from lioncash/translateSebastian Valle2019-05-191-2/+2
|\ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | yuzu/applets/profile_select: Mark header string as translatableLioncash2019-05-191-2/+2
| | |/ / / / / / / / | |/| | | | | | | |
* | | | | | | | | | Merge pull request #2496 from lioncash/move-conSebastian Valle2019-05-191-7/+7
|\ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | gl_shader_gen: std::move objects where applicableLioncash2019-05-191-7/+7
| |/ / / / / / / / /
* | | | | | | | | | Merge pull request #2476 from ReinUsesLisp/fix-compatHexagon122019-05-191-0/+1
|\ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | yuzu/bootmanager: Explicitly enable deprecated OpenGL features on compatReinUsesLisp2019-05-171-0/+1
| | |/ / / / / / / / | |/| | | | | | | |
* | | | | | | | | | yuzu/util: Remove unused spinbox.cpp/.hLioncash2019-05-193-366/+0
| |/ / / / / / / / |/| | | | | | | |
* | | | | | | | | Merge pull request #2457 from lioncash/aboutbunnei2019-05-173-11/+23
|\ \ \ \ \ \ \ \ \ | |_|/ / / / / / / |/| | | | | | | |
| * | | | | | | | yuzu/main: Move window title updating logic to its own functionLioncash2019-05-092-7/+19
| * | | | | | | | yuzu/about_dialog: Specify string conversions explicitlyLioncash2019-05-091-4/+4
| | |_|_|_|_|/ / | |/| | | | | |
* | | | | | | | Merge pull request #2477 from ReinUsesLisp/fix-sdl2bunnei2019-05-171-0/+1
|\ \ \ \ \ \ \ \
| * | | | | | | | yuzu_cmd: Make OpenGL's context currentReinUsesLisp2019-05-171-0/+1
| | |/ / / / / / | |/| | | | | |
* | | | | | | | Merge pull request #2478 from ReinUsesLisp/sdl2-compatbunnei2019-05-171-1/+5
|\ \ \ \ \ \ \ \
| * | | | | | | | yuzu_cmd: Use OpenGL compat when asked in the settingsReinUsesLisp2019-05-171-1/+5
| |/ / / / / / /
* / / / / / / / qt/configure_graphics: Shadow options at runtimeReinUsesLisp2019-05-171-2/+6
|/ / / / / / /
* | | | | | | Merge pull request #2462 from lioncash/video-mmMat M2019-05-142-17/+20
|\ \ \ \ \ \ \
| * | | | | | | video_core/memory_manager: Mark IsBlockContinuous() as a const member functionLioncash2019-05-102-4/+4
| * | | | | | | video_core/memory_manager: Mark the constructor as explicitLioncash2019-05-101-1/+1
| * | | | | | | video_core/memory_manager: Default the destructor within the cpp fileLioncash2019-05-102-0/+3
| * | | | | | | video_core/memory_manager: Amend doxygen commentsLioncash2019-05-101-7/+7
| * | | | | | | video_core/memory_manager: Remove superfluous const from function declarationsLioncash2019-05-101-7/+7
| | |/ / / / / | |/| | | | |
* | | | | | | Merge pull request #2461 from lioncash/unused-varMat M2019-05-147-22/+4
|\ \ \ \ \ \ \
| * | | | | | | video_core/renderer_opengl/gl_shader_cache: Correct member initialization orderLioncash2019-05-101-1/+1
| * | | | | | | video_core/shader/decode/texture: Remove unused variable from GetTld4Code()Lioncash2019-05-101-1/+0
| * | | | | | | renderer_vulkan/vk_shader_decompiler: Remove unused variable from DeclareInternalFlags()Lioncash2019-05-101-1/+0
| * | | | | | | video_core/renderer_opengl/gl_shader_decompiler: Remove unused Composite() functionLioncash2019-05-101-11/+0
| * | | | | | | video_core/renderer_opengl/gl_rasterizer_cache: Remove unused variable in UploadGLMipmapTexture()Lioncash2019-05-101-1/+0
| * | | | | | | video_core/gpu_thread: Remove unused local variableLioncash2019-05-101-1/+1
| * | | | | | | video_core/textures/astc: Remove unused variablesLioncash2019-05-101-6/+2
| |/ / / / / /
* | | | | | | Merge pull request #2460 from lioncash/volatileMat M2019-05-141-0/+2
|\ \ \ \ \ \ \
| * | | | | | | CMakeLists: Specify /volatile:iso for MSVCLioncash2019-05-091-0/+2
| |/ / / / / /
* | | | | | | Merge pull request #2450 from lioncash/warn-levelMat M2019-05-141-1/+4
|\ \ \ \ \ \ \
| * | | | | | | CMakeLists: Explicitly specify -Wall for the non-MSVC caseLioncash2019-05-041-1/+4
| | |/ / / / / | |/| | | | |
* | | | | | | Merge pull request #2413 from FernandoS27/opt-gpuRodrigo Locatti2019-05-147-33/+54
|\ \ \ \ \ \ \ | |_|/ / / / / |/| | | | | |
| * | | | | | Rasterizer Cache: Use a temporal storage for Surfaces loading/flushing.Fernando Sahmkow2019-04-214-18/+30
| * | | | | | RasterizerCache Redesign: Flush Fernando Sahmkow2019-04-206-17/+26
* | | | | | | Merge pull request #2437 from lioncash/audctlbunnei2019-05-091-2/+2
|\ \ \ \ \ \ \
| * | | | | | | service/audctl: Update documentation comments to be relative to 8.0.0Lioncash2019-04-281-2/+2
| | |_|/ / / / | |/| | | | |
* | | | | | | Merge pull request #2454 from lioncash/cflagbunnei2019-05-091-9/+21
|\ \ \ \ \ \ \
| * | | | | | | src/CMakeLists: Add /Zc:externConstexpr to the MSVC build flagsLioncash2019-05-071-8/+10
| * | | | | | | src/CMakeLists: Vertically order compilation flagsLioncash2019-05-071-9/+19
| | |_|/ / / / | |/| | | | |
* | | | | | | Merge pull request #2442 from FernandoS27/astc-fixbunnei2019-05-091-1/+3
|\ \ \ \ \ \ \
| * | | | | | | Fix Layered ASTC TexturesFernando Sahmkow2019-05-011-1/+3
* | | | | | | | Merge pull request #2443 from ReinUsesLisp/skip-repeated-variantsbunnei2019-05-091-1/+4
|\ \ \ \ \ \ \ \
| * | | | | | | | gl_shader_disk_cache: Skip stored shader variants instead of assertingReinUsesLisp2019-05-011-1/+4
| |/ / / / / / /
* | | | | | | | Merge pull request #2445 from FearlessTobi/port-4749bunnei2019-05-092-9/+9
|\ \ \ \ \ \ \ \
| * | | | | | | | core/telemetry_session: Only create the backend when we really need itzhupengfei2019-05-042-9/+9
| | |/ / / / / / | |/| | | | | |
* | | | | | | | Merge pull request #2458 from lioncash/hotkeybunnei2019-05-091-2/+0
|\ \ \ \ \ \ \ \
| * | | | | | | | yuzu/hotkeys: Remove unnecessary constructorLioncash2019-05-091-2/+0
| |/ / / / / / /
* | | | | | | | Merge pull request #2456 from lioncash/qualifierbunnei2019-05-091-3/+3
|\ \ \ \ \ \ \ \
| * | | | | | | | yuzu/compatdb: Remove unnecessary qualifiersLioncash2019-05-091-3/+3
| |/ / / / / / /
* | | | | | | | Merge pull request #2459 from lioncash/whatbunnei2019-05-091-0/+4
|\ \ \ \ \ \ \ \
| * | | | | | | | configure_dialog: Remove the Whats This? button from the dialogLioncash2019-05-091-0/+4
| |/ / / / / / /
* | | | | | | | Merge pull request #2453 from lioncash/enumbunnei2019-05-091-9/+0
|\ \ \ \ \ \ \ \
| * | | | | | | | core/memory: Remove unused FlushMode enumLioncash2019-05-071-9/+0
| |/ / / / / / /
* | | | | | | | Merge pull request #2429 from FernandoS27/computebunnei2019-05-0913-142/+483
|\ \ \ \ \ \ \ \ | |_|_|_|_|/ / / |/| | | | | | |
| * | | | | | | Refactors and name corrections.Fernando Sahmkow2019-05-016-35/+35
| * | | | | | | Fixes and Corrections to DMA EngineFernando Sahmkow2019-04-232-37/+57
| * | | | | | | Add Swizzle Parameters to the DMA engineFernando Sahmkow2019-04-232-2/+27
| * | | | | | | Add Documentation Headers to all the GPU EnginesFernando Sahmkow2019-04-235-0/+29
| * | | | | | | Corrections and stylingFernando Sahmkow2019-04-235-6/+9
| * | | | | | | Implement Maxwell3D Data UploadFernando Sahmkow2019-04-232-3/+32
| * | | | | | | Introduce skeleton of the GPU Compute Engine.Fernando Sahmkow2019-04-233-8/+202
| * | | | | | | Revamp Kepler Memory to use a subegine to manage uploadsFernando Sahmkow2019-04-236-93/+134
* | | | | | | | Merge pull request #2447 from lioncash/dtorRodrigo Locatti2019-05-072-0/+4
|\ \ \ \ \ \ \ \
| * | | | | | | | core/frontend/emu_window: Make GraphicsContext's destructor virtualLioncash2019-05-042-0/+4
| | |/ / / / / / | |/| | | | | |
* | | | | | | | Merge pull request #2448 from lioncash/pragmaRodrigo Locatti2019-05-071-2/+0
|\ \ \ \ \ \ \ \
| * | | | | | | | common/zstd_compression: Remove #pragma once directive from source fileLioncash2019-05-041-2/+0
| |/ / / / / / /
* | | | | | | | shader/decode/texture: Remove unused variableLioncash2019-05-041-1/+0
* | | | | | | | gl_rasterizer: Silence unused variable warningLioncash2019-05-041-2/+2
|/ / / / / / /
* | / / / / / loader/nso: Remove left-in debug pragmaLioncash2019-05-011-2/+0
| |/ / / / / |/| | | | |
* | | | | | Merge pull request #2100 from FreddyFunk/disk-cache-precompiled-filebunnei2019-05-013-133/+170
|\ \ \ \ \ \
| * | | | | | Re added new lines at the end of filesFreddyFunk2019-04-232-2/+2
| * | | | | | gl_shader_disk_cache: Compress precompiled shader cache file with Zstandardunknown2019-04-231-6/+10
| * | | | | | gl_shader_disk_cache: Use VectorVfsFile for the virtual precompiled shader cache fileunknown2019-04-233-101/+168
| * | | | | | gl_shader_disk_cache: Remove per shader compressionunknown2019-04-232-45/+11
* | | | | | | Merge pull request #2435 from ReinUsesLisp/misc-vcbunnei2019-04-292-3/+4
|\ \ \ \ \ \ \
| * | | | | | | shader_ir: Move Sampler index entry in operand< to sort declarationsReinUsesLisp2019-04-261-2/+2
| * | | | | | | shader_ir: Add missing entry to Sampler operand< comparisonReinUsesLisp2019-04-261-2/+3
| * | | | | | | shader_ir/texture: Fix sampler const buffer key shiftReinUsesLisp2019-04-261-1/+1
| | |_|/ / / / | |/| | | | |
* | | | | | | Merge pull request #2412 from lioncash/systembunnei2019-04-293-7/+11
|\ \ \ \ \ \ \
| * | | | | | | kernel/vm_manager: Remove usages of global system accessorsLioncash2019-04-173-7/+11
* | | | | | | | Merge pull request #2322 from ReinUsesLisp/wswitchbunnei2019-04-2910-77/+106
|\ \ \ \ \ \ \ \
| * | | | | | | | video_core: Silent -Wswitch warningsReinUsesLisp2019-04-1810-77/+106
| | |_|_|_|_|/ / | |/| | | | | |
* | | | | | | | Merge pull request #2423 from FernandoS27/half-correctbunnei2019-04-292-15/+16
|\ \ \ \ \ \ \ \ | |_|_|/ / / / / |/| | | | | | |
| * | | | | | | Corrections Half Float operations on const buffers and implement saturation.Fernando Sahmkow2019-04-212-15/+16
* | | | | | | | Merge pull request #2416 from lioncash/waitbunnei2019-04-257-51/+54
|\ \ \ \ \ \ \ \
| * | | | | | | | kernel/thread: Unify wait synchronization typesLioncash2019-04-177-45/+38
| * | | | | | | | kernel/svc: Migrate svcCancelSynchronization behavior to a thread functionLioncash2019-04-173-7/+17
* | | | | | | | | Merge pull request #2424 from FernandoS27/compatbunnei2019-04-257-1/+21
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | Allow picking a Compatibility Profile for OpenGL.Fernando Sahmkow2019-04-207-1/+21
| | |_|_|_|_|_|/ / | |/| | | | | | |
* | | | | | | | | Merge pull request #2228 from DarkLordZach/applet-manager-p1bunnei2019-04-2526-115/+764
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | web_browser: Make OpenPage non-constZach Hilman2019-04-1713-25/+30
| * | | | | | | | | main: Add GMainWindow hooks for Error displayZach Hilman2019-04-174-3/+11
| * | | | | | | | | main: Switch to AppletManager for frontendZach Hilman2019-04-171-3/+9
| * | | | | | | | | qt: Add dialog implementation of Error appletZach Hilman2019-04-173-0/+94
| * | | | | | | | | general_backend: Move StubApplet and add backend PhotoViewerZach Hilman2019-04-172-1/+102
| * | | | | | | | | general_frontend: Add frontend scaffold for PhotoViewer appletZach Hilman2019-04-172-0/+55
| * | | | | | | | | frontend: Add frontend receiver for Error appletZach Hilman2019-04-173-2/+79
| * | | | | | | | | applets: Add Error appletZach Hilman2019-04-173-24/+224
| * | | | | | | | | applets: Port current applets to take frontend in constructorZach Hilman2019-04-176-14/+16
| * | | | | | | | | web_browser: Make OpenPage constZach Hilman2019-04-174-7/+7
| * | | | | | | | | core: Remove specific applets in favor of AppletManagerZach Hilman2019-04-172-47/+32
| * | | | | | | | | am: Delegate applet creation to AppletManagerZach Hilman2019-04-171-24/+3
| * | | | | | | | | applets: Add AppletManager class to control lifetimeZach Hilman2019-04-172-0/+137
| | |/ / / / / / / | |/| | | | | | |
* | | | | | | | | Merge pull request #2404 from lioncash/unicodebunnei2019-04-252-4/+9
|\ \ \ \ \ \ \ \ \ | |_|_|_|_|_|/ / / |/| | | | | | | |
| * | | | | | | | CMakeLists: Ensure we specify Unicode as the codepage on WindowsLioncash2019-04-172-4/+9
| | |_|_|/ / / / | |/| | | | | |
* | | | | | | | Merge pull request #2422 from ReinUsesLisp/fixup-samplersHexagon122019-04-231-3/+5
|\ \ \ \ \ \ \ \
| * | | | | | | | gl_state: Fix samplers memory corruptionReinUsesLisp2019-04-191-3/+5
* | | | | | | | | Merge pull request #2425 from FernandoS27/y-directionHexagon122019-04-231-0/+3
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | Apply Position Y DirectionFernando Sahmkow2019-04-201-0/+3
| | |_|_|/ / / / / | |/| | | | | | |
* | | | | | | | | Merge pull request #2383 from ReinUsesLisp/aoffi-testbunnei2019-04-2311-75/+163
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | gl_shader_decompiler: Use variable AOFFI on supported hardwareReinUsesLisp2019-04-1410-71/+102
| * | | | | | | | | gl_device: Implement interface and add uniform offset alignmentReinUsesLisp2019-04-105-13/+70
* | | | | | | | | | Merge pull request #2420 from lioncash/audctlbunnei2019-04-232-2/+32
|\ \ \ \ \ \ \ \ \ \ | |_|_|_|_|_|_|_|/ / |/| | | | | | | | |
| * | | | | | | | | service/audctl: Implement GetTargetVolumeMin() and GetTargetVolumeMax()Lioncash2019-04-182-2/+32
| | |_|/ / / / / / | |/| | | | | | |
* | | | | | | | | Merge pull request #2403 from FernandoS27/compressed-linearbunnei2019-04-221-2/+5
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | Support compressed formats on linear textures.Fernando Sahmkow2019-04-151-2/+5
| | |_|_|/ / / / / | |/| | | | | | |
* | | | | | | | | Merge pull request #2411 from FernandoS27/unsafe-gpubunnei2019-04-225-15/+99
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | make ReadBlockunsafe and WriteBlockunsafe, ignore invalid pages.Fernando Sahmkow2019-04-201-4/+12
| * | | | | | | | | Implement IsBlockContinousFernando Sahmkow2019-04-172-2/+13
| * | | | | | | | | Use ReadBlockUnsafe for fetyching DMA CommandListsFernando Sahmkow2019-04-162-4/+2
| * | | | | | | | | Document unsafe versions and add BlockCopyUnsafeFernando Sahmkow2019-04-163-16/+45
| * | | | | | | | | Use ReadBlockUnsafe for Shader CacheFernando Sahmkow2019-04-161-5/+7
| * | | | | | | | | Use ReadBlockUnsafe on TIC and TSC readingFernando Sahmkow2019-04-162-2/+4
| * | | | | | | | | GPU MemoryManager: Implement ReadBlockUnsafe and WriteBlockUnsafeFernando Sahmkow2019-04-162-0/+34
| |/ / / / / / / /
* | | | | | | | | Merge pull request #2400 from FernandoS27/corret-kepler-membunnei2019-04-224-17/+81
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | Apply Const correctness to SwizzleKepler and replace u32 for size_t on iterators.Fernando Sahmkow2019-04-162-9/+12
| * | | | | | | | | Use WriteBlock and ReadBlock.Fernando Sahmkow2019-04-161-10/+6
| * | | | | | | | | Implement Block Linear copies in Kepler Memory.Fernando Sahmkow2019-04-163-5/+38
| * | | | | | | | | Correct Kepler Memory on Linear Pushes.Fernando Sahmkow2019-04-152-16/+48
| |/ / / / / / / /
* | | | | | | | | Merge pull request #2407 from FernandoS27/f2fbunnei2019-04-202-23/+73
|\ \ \ \ \ \ \ \ \ | |_|_|_|_|_|/ / / |/| | | | | | | |
| * | | | | | | | Do some corrections in conversion shader instructions.Fernando Sahmkow2019-04-162-23/+73
| |/ / / / / / /
* | | | | | | | Merge pull request #2409 from ReinUsesLisp/half-floatsbunnei2019-04-209-136/+181
|\ \ \ \ \ \ \ \ | |_|_|_|/ / / / |/| | | | | | |
| * | | | | | | vk_shader_decompiler: Add missing operationsReinUsesLisp2019-04-161-0/+7
| * | | | | | | shader_ir/decode: Fix half float pre-operations and remove MetaHalfArithmeticReinUsesLisp2019-04-169-85/+72
| * | | | | | | gl_shader_decompiler: Fix MrgH0 decompilationReinUsesLisp2019-04-161-2/+2
| * | | | | | | shader_ir/decode: Implement half float saturationReinUsesLisp2019-04-165-8/+31
| * | | | | | | shader_ir/decode: Reduce severity of unimplemented half-float FTZReinUsesLisp2019-04-163-3/+9
| * | | | | | | renderer_opengl: Implement half float NaN comparisonsReinUsesLisp2019-04-163-36/+59
| * | | | | | | shader_ir: Avoid using static on heap-allocated objectsReinUsesLisp2019-04-161-5/+4
| |/ / / / / /
* | | | | | | Merge pull request #2415 from lioncash/constbunnei2019-04-202-2/+2
|\ \ \ \ \ \ \
| * | | | | | | kernel/wait_object: Make GetHighestPriorityReadyThread() a const member functionLioncash2019-04-172-2/+2
| | |_|_|/ / / | |/| | | | |
* | | | | | | Merge pull request #2414 from lioncash/reorderbunnei2019-04-202-5/+3
|\ \ \ \ \ \ \
| * | | | | | | yuzu/bootmanager: Replace unnnecessary constructor initializer list member of GGLContextLioncash2019-04-171-2/+2
| * | | | | | | yuzu/bootmanager: Remove unnecessary includesLioncash2019-04-171-1/+0
| * | | | | | | yuzu/bootmanager: Resolve constructor initializer list warningsLioncash2019-04-171-2/+1
| |/ / / / / /
* | | | | | | Merge pull request #2421 from lioncash/svc-callbunnei2019-04-201-1/+1
|\ \ \ \ \ \ \
| * | | | | | | kernel/svc: Name supervisor call 0x36Lioncash2019-04-191-1/+1
| | |_|/ / / / | |/| | | | |
* | | | | | | Merge pull request #2374 from lioncash/pagetablebunnei2019-04-2038-177/+253
|\ \ \ \ \ \ \ | |/ / / / / / |/| | | | | |
| * | | | | | core/core: Move process execution start to System's Load()Lioncash2019-04-1220-107/+144
| * | | | | | core/process: Remove unideal page table setting from LoadFromMetadata()Lioncash2019-04-121-5/+0
| * | | | | | core/core: Move main process creation into Load()Lioncash2019-04-121-4/+3
| * | | | | | video_core/gpu: Create threads separately from initializationLioncash2019-04-1210-25/+51
| * | | | | | core/cpu_core_manager: Create threads separately from initialization.Lioncash2019-04-1211-39/+58
* | | | | | | Merge pull request #2397 from lioncash/thread-unusedbunnei2019-04-183-18/+17
|\ \ \ \ \ \ \
| * | | | | | | svc: Specify handle value in thread's nameLioncash2019-04-152-2/+10
| * | | | | | | kernel/thread: Remove unused guest_handle member variableLioncash2019-04-143-16/+7
| | |_|/ / / / | |/| | | | |
* | | | | | | Merge pull request #2318 from ReinUsesLisp/sampler-cachebunnei2019-04-189-181/+183
|\ \ \ \ \ \ \
| * | | | | | | gl_sampler_cache: Port sampler cache to OpenGLReinUsesLisp2019-04-025-123/+82
| * | | | | | | video_core: Abstract vk_sampler_cache into a templated classReinUsesLisp2019-04-025-58/+101
* | | | | | | | Merge pull request #2348 from FernandoS27/guest-bindlessbunnei2019-04-188-44/+217
|\ \ \ \ \ \ \ \ | |_|_|_|/ / / / |/| | | | | | |
| * | | | | | | Adapt Bindless to work with AOFFIFernando Sahmkow2019-04-081-7/+18
| * | | | | | | Move ConstBufferAccessor to Maxwell3d, correct mistakes and clang format.Fernando Sahmkow2019-04-089-44/+25
| * | | | | | | Fix bad rebaseFernando Sahmkow2019-04-081-2/+1
| * | | | | | | Fix TMMLFernando Sahmkow2019-04-081-5/+7
| * | | | | | | Simplify ConstBufferAccessorFernando Sahmkow2019-04-085-53/+22
| * | | | | | | Refactor GetTextureCode and GetTexCode to use an optional instead of optional parametersFernando Sahmkow2019-04-082-34/+33
| * | | | | | | Implement TXQ_BFernando Sahmkow2019-04-082-2/+10
| * | | | | | | Implement TMML_BFernando Sahmkow2019-04-081-5/+10
| * | | | | | | Corrections to TEX_BFernando Sahmkow2019-04-082-4/+37
| * | | | | | | Fixes to Const Buffer Accessor and FormattingFernando Sahmkow2019-04-083-10/+10
| * | | | | | | Implement Bindless Handling on SetupTextureFernando Sahmkow2019-04-084-18/+34
| * | | | | | | Unify both sampler types.Fernando Sahmkow2019-04-084-22/+48
| * | | | | | | Implement Bindless Samplers and TEX_B in the IR.Fernando Sahmkow2019-04-084-16/+77
| * | | | | | | Implement Const Buffer AccessorFernando Sahmkow2019-04-085-2/+65
* | | | | | | | Merge pull request #2315 from ReinUsesLisp/severity-decompilerbunnei2019-04-172-5/+20
|\ \ \ \ \ \ \ \
| * | | | | | | | shader_ir/memory: Reduce severity of LD_L cache management and log itReinUsesLisp2019-04-032-2/+9
| * | | | | | | | shader_ir/memory: Reduce severity of ST_L cache management and log itReinUsesLisp2019-04-032-3/+11
* | | | | | | | | Merge pull request #2384 from ReinUsesLisp/gl-state-clearbunnei2019-04-171-4/+4
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | gl_rasterizer: Apply just the needed state on ClearReinUsesLisp2019-04-101-4/+4
| | |_|_|_|_|/ / / | |/| | | | | | |
* | | | | | | | | Merge pull request #2405 from lioncash/qtbunnei2019-04-172-1/+7
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | CMakeLists: Define QT_USE_QSTRINGBUILDER for the Qt targetLioncash2019-04-152-1/+7
| | |_|_|_|/ / / / | |/| | | | | | |
* | | | | | | | | Merge pull request #2092 from ReinUsesLisp/stgbunnei2019-04-1711-89/+186
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | shader_ir: Implement STG, keep track of global memory usage and flushReinUsesLisp2019-04-1411-89/+186
| |/ / / / / / / /
* | | | | | | | | Merge pull request #2376 from lioncash/constbunnei2019-04-173-12/+12
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | configure_hotkeys: Pass the dialog as a parent to SequenceDialog()Lioncash2019-04-101-1/+1
| * | | | | | | | | configure_hotkeys: Avoid dialog memory leak within Configure()Lioncash2019-04-101-3/+3
| * | | | | | | | | configure_hotkeys: Mark member variables as const where applicable in Configure()Lioncash2019-04-101-7/+7
| * | | | | | | | | configure_hotkeys: Make comparison check a little more self-documentingLioncash2019-04-101-1/+2
| * | | | | | | | | configure_dialog: Amend constructor initializer list orderLioncash2019-04-101-1/+1
| * | | | | | | | | configure_hotkey: Remove unnecessary includeLioncash2019-04-101-1/+0
| * | | | | | | | | configure_hotkey: Make IsUsedKey() a const member functionLioncash2019-04-102-2/+2
* | | | | | | | | | Merge pull request #2401 from lioncash/guardbunnei2019-04-172-0/+4
|\ \ \ \ \ \ \ \ \ \ | |_|_|_|_|_|_|_|/ / |/| | | | | | | | |
| * | | | | | | | | common/{lz4_compression, zstd_compression}: Add missing header guardsLioncash2019-04-152-0/+4
| | |/ / / / / / / | |/| | | | | | |
* | | | | | | | | Merge pull request #2382 from lioncash/tablebunnei2019-04-1627-57/+262
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | service: Update service function tablesLioncash2019-04-1127-57/+262
| | |/ / / / / / / | |/| | | | | | |
* | | | | | | | | Merge pull request #2393 from lioncash/svcbunnei2019-04-164-2/+274
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | kernel/svc: Implement svcUnmapProcessCodeMemoryLioncash2019-04-133-1/+143
| * | | | | | | | | kernel/svc: Implement svcMapProcessCodeMemoryLioncash2019-04-134-1/+131
| | |_|_|_|_|_|/ / | |/| | | | | | |
* | | | | | | | | Merge pull request #2398 from lioncash/boostbunnei2019-04-162-11/+0
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | kernel/thread: Remove BoostPriority()Lioncash2019-04-152-11/+0
| | |_|/ / / / / / | |/| | | | | | |
* / | | | | | | | Correct Pitch in Fermi2DFernando Sahmkow2019-04-151-4/+1
|/ / / / / / / /
* | | | | | | | Merge pull request #2378 from lioncash/robunnei2019-04-141-65/+85
|\ \ \ \ \ \ \ \
| * | | | | | | | ldr: Mark IsValidNROHash() as a const member functionLioncash2019-04-101-5/+4
| * | | | | | | | ldr: Amend parameters for LoadNro/UnloadNro LoadNrr/UnloadNrrLioncash2019-04-101-60/+81
| | |/ / / / / / | |/| | | | | |
* | | | | | | | Merge pull request #2373 from FernandoS27/z32bunnei2019-04-142-2/+19
|\ \ \ \ \ \ \ \
| * | | | | | | | Implement Texture Format ZF32_X24S8.Fernando Sahmkow2019-04-091-0/+2
| * | | | | | | | Correct depth compare with color formats for R32FFernando Sahmkow2019-04-091-2/+17
| | |_|_|_|/ / / | |/| | | | | |
* | | | | | | | Merge pull request #2357 from zarroboogs/force-30fps-modebunnei2019-04-145-6/+23
|\ \ \ \ \ \ \ \
| * | | | | | | | added a toggle to force 30fps modezarroboogs2019-04-095-6/+23
| |/ / / / / / /
* | | | | | | | Merge pull request #2381 from lioncash/fsbunnei2019-04-141-8/+7
|\ \ \ \ \ \ \ \
| * | | | | | | | fsp_srv: Remove unnecessary parameter popping in IDirectory's Read()Lioncash2019-04-101-4/+1
| * | | | | | | | fsp_srv: Log out option values in IFile's Read and Write functionsLioncash2019-04-101-4/+6
| | |/ / / / / / | |/| | | | | |
* | | | | | | | Merge pull request #2386 from ReinUsesLisp/shader-managerbunnei2019-04-142-34/+61
|\ \ \ \ \ \ \ \
| * | | | | | | | gl_shader_manager: Move code to source file and minor clean upReinUsesLisp2019-04-112-34/+61
| | |_|_|/ / / / | |/| | | | | |
* | | | | | | | Merge pull request #2017 from jroweboy/glwidgetbunnei2019-04-147-94/+240
|\ \ \ \ \ \ \ \
| * | | | | | | | bootmanager: Bypass input focus issuesReinUsesLisp2019-03-254-55/+78
| * | | | | | | | bootmanager: Bypass resizing issueReinUsesLisp2019-03-251-7/+12
| * | | | | | | | bootmanager: Delete container to avoid crash on game restartingReinUsesLisp2019-03-252-14/+10
| * | | | | | | | QT: Hide GLWidget immediately after showing.James Rowe2019-01-221-0/+2
| * | | | | | | | SDL Frontend: Add shared context supportJames Rowe2019-01-222-1/+38
| * | | | | | | | QT Frontend: Migrate to QOpenGLWindowJames Rowe2019-01-224-30/+113
* | | | | | | | | Merge pull request #2389 from FreddyFunk/rename-gamedirbunnei2019-04-145-20/+25
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | Fix Clang FormatFreddyFunk2019-04-122-5/+10
| * | | | | | | | | ui_settings: Rename game directory variablesFreddyFunk2019-04-115-20/+20
| | |/ / / / / / / | |/| | | | | | |
* | | | | | | | | Merge pull request #2391 from lioncash/scopebunnei2019-04-131-1/+1
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | common/scope_exit: Replace std::move with std::forward in ScopeExit()Lioncash2019-04-121-1/+1
| | |_|/ / / / / / | |/| | | | | | |
* | | | | | | | | Merge pull request #2392 from lioncash/swapbunnei2019-04-131-69/+27
|\ \ \ \ \ \ \ \ \ | |_|_|_|_|/ / / / |/| | | | | | | |
| * | | | | | | | common/swap: Improve codegen of the default swap fallbacksLioncash2019-04-121-3/+7
| * | | | | | | | common/swap: Mark byte swapping free functions with [[nodiscard]] and noexceptLioncash2019-04-121-11/+11
| * | | | | | | | common/swap: Simplify swap function ifdefsLioncash2019-04-121-48/+15
| * | | | | | | | common/swap: Remove 32-bit ARM pathLioncash2019-04-121-13/+0
| |/ / / / / / /
* | | | | | | | Merge pull request #2235 from ReinUsesLisp/spirv-decompilerbunnei2019-04-123-1/+1465
|\ \ \ \ \ \ \ \
| * | | | | | | | vk_shader_decompiler: Implement flow primitivesReinUsesLisp2019-04-101-5/+82
| * | | | | | | | vk_shader_decompiler: Implement most common texture primitivesReinUsesLisp2019-04-101-8/+65
| * | | | | | | | vk_shader_decompiler: Implement texture decompilation helper functionsReinUsesLisp2019-04-101-0/+32
| * | | | | | | | vk_shader_decompiler: Implement Assign and LogicalAssignReinUsesLisp2019-04-101-2/+64
| * | | | | | | | vk_shader_decompiler: Implement non-OperationCode visitsReinUsesLisp2019-04-101-7/+129
| * | | | | | | | vk_shader_decompiler: Implement OperationCode decompilation interfaceReinUsesLisp2019-04-101-1/+411
| * | | | | | | | vk_shader_decompiler: Implement VisitReinUsesLisp2019-04-101-1/+50
| * | | | | | | | vk_shader_decompiler: Implement labels tree and flowReinUsesLisp2019-04-101-0/+71
| * | | | | | | | vk_shader_decompiler: Implement declarationsReinUsesLisp2019-04-101-3/+457
| * | | | | | | | vk_shader_decompiler: Declare and stub interface for a SPIR-V decompilerReinUsesLisp2019-04-103-0/+127
| * | | | | | | | video_core: Add sirit as optional dependency with VulkanReinUsesLisp2019-04-101-1/+4
| | |/ / / / / / | |/| | | | | |
* | | | | | | | Merge pull request #2360 from lioncash/svc-globalbunnei2019-04-128-364/+413
|\ \ \ \ \ \ \ \
| * | | | | | | | kernel/svc: Deglobalize the supervisor call handlersLioncash2019-04-088-364/+413
| | |_|_|/ / / / | |/| | | | | |
* | | | | | | | Merge pull request #2388 from lioncash/constexprbunnei2019-04-1210-10/+10
|\ \ \ \ \ \ \ \
| * | | | | | | | kernel: Make handle type declarations constexprLioncash2019-04-1110-10/+10
| | |_|/ / / / / | |/| | | | | |
* | | | | | | | gl_rasterizer_cache: Relax restrictions on FastCopySurface and FastLayeredCopySurfaceFernando Sahmkow2019-04-111-4/+10
* | | | | | | | Merge pull request #2278 from ReinUsesLisp/vc-texture-cachebunnei2019-04-113-0/+974
|\ \ \ \ \ \ \ \
| * | | | | | | | video_core: Implement API agnostic view based texture cacheReinUsesLisp2019-03-223-0/+974
* | | | | | | | | Merge pull request #2372 from FernandoS27/fermi-fixbunnei2019-04-111-0/+4
|\ \ \ \ \ \ \ \ \ | |_|_|_|/ / / / / |/| | | | | | | |
| * | | | | | | | Correct Fermi Copy on Linear Textures.Fernando Sahmkow2019-04-091-0/+4
* | | | | | | | | Merge pull request #2345 from ReinUsesLisp/multibindbunnei2019-04-104-30/+69
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | renderer_opengl/utils: Skip empty bindsReinUsesLisp2019-04-061-0/+3
| * | | | | | | | | gl_rasterizer: Use ARB_multi_bind to update SSBOsReinUsesLisp2019-04-062-9/+9
| * | | | | | | | | gl_rasterizer: Use ARB_multi_bind to update UBOs across stagesReinUsesLisp2019-04-064-22/+58
* | | | | | | | | | Merge pull request #2377 from lioncash/todobunnei2019-04-101-7/+2
|\ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | kernel/server_session: Remove obsolete TODOsLioncash2019-04-101-7/+2
| | |_|_|/ / / / / / | |/| | | | | | | |
* | | | | | | | | | Merge pull request #2375 from FernandoS27/fix-ldcbunnei2019-04-101-2/+1
|\ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | Remove bounding in LD_CFernando Sahmkow2019-04-101-2/+1
| | |_|/ / / / / / / | |/| | | | | | | |
* | | | | | | | | | Merge pull request #2353 from lioncash/surfacebunnei2019-04-105-622/+0
|\ \ \ \ \ \ \ \ \ \ | |_|/ / / / / / / / |/| | | | | | | | |
| * | | | | | | | | yuzu/debugger: Remove graphics surface viewerLioncash2019-04-065-622/+0
* | | | | | | | | | Merge pull request #2354 from lioncash/headerbunnei2019-04-108-3/+10
|\ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | video_core/textures/convert: Replace include with a forward declarationLioncash2019-04-062-1/+5
| * | | | | | | | | | video_core/texures/texture: Remove unnecessary includesLioncash2019-04-066-2/+5
* | | | | | | | | | | Merge pull request #1957 from DarkLordZach/title-providerbunnei2019-04-1022-276/+461
|\ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | patch_manager: Dump NSO name with build IDZach Hilman2019-03-284-9/+11
| * | | | | | | | | | | game_list: Register content with ContentProviderZach Hilman2019-03-278-91/+102
| * | | | | | | | | | | core: Port current uses of RegisteredCache to ContentProviderZach Hilman2019-03-278-27/+32
| * | | | | | | | | | | core: Store system-wide ContentProvider for the emulatorZach Hilman2019-03-272-0/+40
| * | | | | | | | | | | file_sys: Create ContentProvider interface and default implementationsZach Hilman2019-03-272-152/+279
* | | | | | | | | | | | Merge pull request #2366 from FernandoS27/xmad-fixbunnei2019-04-102-9/+33
|\ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | Correct XMAD mode, psl and high_b on different encodings.Fernando Sahmkow2019-04-082-9/+33
| | |_|_|_|_|_|/ / / / / | |/| | | | | | | | | |
* | | | | | | | | | | | Merge pull request #2132 from FearlessTobi/port-4437bunnei2019-04-1023-208/+426
|\ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | yuzu: Make hotkeys configurable via the GUIAdityarup Laha2019-03-1623-208/+426
* | | | | | | | | | | | | Merge pull request #2370 from lioncash/qt-warnbunnei2019-04-091-1/+6
|\ \ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | | yuzu/loading_screen: Resolve runtime Qt string formatting warningsLioncash2019-04-091-1/+6
| | |/ / / / / / / / / / / | |/| | | | | | | | | | |
* | | | | | | | | | | | | Merge pull request #2369 from FernandoS27/mip-alignbunnei2019-04-092-4/+12
|\ \ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | | gl_backend: Align Pixel StorageFernando Sahmkow2019-04-082-4/+12
| |/ / / / / / / / / / / /
* | | | | | | | | | | | | Merge pull request #2368 from FernandoS27/fix-lopbunnei2019-04-091-1/+1
|\ \ \ \ \ \ \ \ \ \ \ \ \ | |_|_|_|_|_|/ / / / / / / |/| | | | | | | | | | | |
| * | | | | | | | | | | | Correct LOP_IMN encodingFernando Sahmkow2019-04-081-1/+1
| |/ / / / / / / / / / /
* / / / / / / / / / / / kernel/process: Set page table when page table resizes occur.Lioncash2019-04-091-0/+2
|/ / / / / / / / / / /
* | | | | | | | | | | Merge pull request #2300 from FernandoS27/null-shaderbunnei2019-04-072-0/+22
|\ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | Permit a Null Shader in case of a bad host_ptr.Fernando Sahmkow2019-04-072-0/+22
* | | | | | | | | | | | Merge pull request #2355 from ReinUsesLisp/sync-pointbunnei2019-04-071-2/+2
|\ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | maxwell_3d: Reduce severity of ProcessSyncPointReinUsesLisp2019-04-061-2/+2
| | |_|_|/ / / / / / / / | |/| | | | | | | | | |
* | | | | | | | | | | | Merge pull request #2306 from ReinUsesLisp/aoffibunnei2019-04-074-71/+205
|\ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | gl_shader_decompiler: Hide local definitions inside an anonymous namespaceReinUsesLisp2019-03-311-6/+8
| * | | | | | | | | | | | shader_ir/decode: Silent implicit sign conversion warningMat M2019-03-311-2/+2
| * | | | | | | | | | | | gl_shader_decompiler: Add AOFFI backing implementationReinUsesLisp2019-03-301-38/+85
| * | | | | | | | | | | | shader_ir/decode: Implement AOFFI for TEX and TLD4ReinUsesLisp2019-03-302-27/+94
| * | | | | | | | | | | | shader_ir: Implement immediate register trackingReinUsesLisp2019-03-302-1/+19
* | | | | | | | | | | | | Merge pull request #2361 from lioncash/pagetablebunnei2019-04-078-20/+4
|\ \ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | | core/memory: Remove GetCurrentPageTable()Lioncash2019-04-072-6/+1
| * | | | | | | | | | | | | arm/arm_dynarmic: Remove unnecessary current_page_table memberLioncash2019-04-072-8/+0
| * | | | | | | | | | | | | kernel: Handle page table switching within MakeCurrentProcess()Lioncash2019-04-074-6/+3
| | |/ / / / / / / / / / / | |/| | | | | | | | | | |
* | | | | | | | | | | | | Merge pull request #2321 from ReinUsesLisp/gl-state-reworkbunnei2019-04-073-339/+324
|\ \ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | | gl_state: Rework to enable individual appliesReinUsesLisp2019-04-043-339/+324
| | |_|_|_|_|_|_|_|_|/ / / | |/| | | | | | | | | | |
* | | | | | | | | | | | | Merge pull request #2098 from FreddyFunk/disk-cache-zstdbunnei2019-04-074-7/+104
|\ \ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | | common/zstd_compression: simplify decompression interfaceunknown2019-03-293-13/+11
| * | | | | | | | | | | | | gl_shader_disk_cache: Fixup clang formatunknown2019-03-291-2/+3
| * | | | | | | | | | | | | gl_shader_disk_cache: Use Zstandard for compressionunknown2019-03-291-6/+6
| * | | | | | | | | | | | | common/zstd_compression: Add Zstandard wrapperunknown2019-03-293-0/+98
| * | | | | | | | | | | | | common: Link libzstd_staticunknown2019-03-291-1/+1
| * | | | | | | | | | | | | Addressed feedbackunknown2019-03-291-1/+0
| * | | | | | | | | | | | | core: Do not link LZ4 to core. Use common/data_compression for nso segment decompression instead.unknown2019-03-291-0/+1
* | | | | | | | | | | | | | Merge pull request #2356 from lioncash/pairbunnei2019-04-076-18/+15
|\ \ \ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | | | kernel/server_session: Return a std::pair from CreateSessionPair()Lioncash2019-04-064-11/+8
| * | | | | | | | | | | | | | kernel/server_port: Return a std::pair from CreatePortPair()Lioncash2019-04-062-7/+7
| | |_|/ / / / / / / / / / / | |/| | | | | | | | | | | |
* | | | | | | | | | | | | | Merge pull request #2362 from lioncash/enumbunnei2019-04-071-10/+0
|\ \ \ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | | | core/memory: Remove unused enum constantsLioncash2019-04-071-10/+0
| |/ / / / / / / / / / / / /
* | | | | | | | | | | | | | Merge pull request #2352 from bunnei/mem-manager-fixesbunnei2019-04-073-12/+84
|\ \ \ \ \ \ \ \ \ \ \ \ \ \ | |/ / / / / / / / / / / / / |/| | | | | | | | | | | | |
| * | | | | | | | | | | | | memory_manager: Improved implementation of read/write/copy block.bunnei2019-04-063-12/+84
| | |_|_|_|_|_|/ / / / / / | |/| | | | | | | | | | |
* | | | | | | | | | | | | Merge pull request #2317 from FernandoS27/syncbunnei2019-04-062-1/+27
|\ \ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | | Implement SyncPoint Register in the GPU.Fernando Sahmkow2019-04-062-1/+27
| | |_|_|/ / / / / / / / / | |/| | | | | | | | | | |
* | | | | | | | | | | | | Merge pull request #2325 from lioncash/namebunnei2019-04-061-0/+4
|\ \ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | | kernel/server_session: Provide a GetName() overrideLioncash2019-04-031-0/+4
* | | | | | | | | | | | | | Merge pull request #2342 from lioncash/warningbunnei2019-04-062-9/+9
|\ \ \ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | | | common/multi_level_queue: Silence truncation warning in iterator operator++Lioncash2019-04-051-1/+1
| * | | | | | | | | | | | | | common/bit_util: Make CountLeading/CountTrailing functions have the same return typesLioncash2019-04-051-8/+8
| | |_|_|_|_|_|_|_|/ / / / / | |/| | | | | | | | | | | |
* | | | | | | | | | | | | | Merge pull request #2240 from FearlessTobi/port-4651bunnei2019-04-063-4/+5
|\ \ \ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | | | gdbstub: Fix some bugs in IsMemoryBreak() and ServeBreak. Add workaround to let watchpoints break into GDB. (#4651)Dimitri A2019-03-153-4/+5
* | | | | | | | | | | | | | | Merge pull request #2346 from lioncash/headerbunnei2019-04-0610-22/+39
|\ \ \ \ \ \ \ \ \ \ \ \ \ \ \ | |_|_|_|_|/ / / / / / / / / / |/| | | | | | | | | | | | | |
| * | | | | | | | | | | | | | video_core/engines: Make memory manager members privateLioncash2019-04-069-13/+14
| * | | | | | | | | | | | | | video_core/engines: Remove unnecessary inclusions where applicableLioncash2019-04-0610-9/+25
| | |/ / / / / / / / / / / / | |/| | | | | | | | | | | |
* | | | | | | | | | | | | | Merge pull request #2350 from lioncash/vmembunnei2019-04-062-22/+38
|\ \ \ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | | | video_core/memory_manager: Make Read() a const qualified member functionLioncash2019-04-062-6/+6
| * | | | | | | | | | | | | | video_core/memory_manager: Make ReadBlock() a const qualifier member functionLioncash2019-04-062-2/+2
| * | | | | | | | | | | | | | video_core/memory_manager: Add a const qualified variant of GetPointer()Lioncash2019-04-062-2/+17
| * | | | | | | | | | | | | | video_core/memory_manager: Make FindFreeRegion() a const member functionLioncash2019-04-062-10/+11
| * | | | | | | | | | | | | | video_core/memory_manager: Make GpuToCpuAddress() a const member functionLioncash2019-04-062-3/+3
| |/ / / / / / / / / / / / /
* | | | | | | | | | | | | | Merge pull request #2340 from lioncash/viewbunnei2019-04-061-1/+3
|\ \ \ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | | | file_sys/fsmitm_romfsbuild: Utilize a string_view in romfs_calc_path_hash()Lioncash2019-04-051-1/+3
| |/ / / / / / / / / / / / /
* | | | | | | | | | | | | | Merge pull request #2334 from lioncash/overridebunnei2019-04-0613-23/+9
|\ \ \ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | | | core: Add missing override specifiers where applicableLioncash2019-04-0413-23/+9
* | | | | | | | | | | | | | | Merge pull request #2347 from lioncash/truncbunnei2019-04-061-1/+1
|\ \ \ \ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | | | | video_core/gpu_thread: Silence truncation warning in ThreadManager's constructorLioncash2019-04-061-1/+1
| | |/ / / / / / / / / / / / / | |/| | | | | | | | | | | | |
* | | | | | | | | | | | | | | Merge pull request #2341 from lioncash/comparebunnei2019-04-062-11/+0
|\ \ \ \ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | | | | file_sys/nca_metadata: Remove unnecessary comparison operators for TitleTypeLioncash2019-04-052-11/+0
| |/ / / / / / / / / / / / / /
* | | | | | | | | | | | | | | Merge pull request #2339 from lioncash/rankbunnei2019-04-065-17/+29
|\ \ \ \ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | | | | service/fsp_srv: Don't pass SaveDataDescriptor instances by value.Lioncash2019-04-054-6/+6
| * | | | | | | | | | | | | | | service/fsp_srv: Remove unnecessary unknown member in OpenSaveDataFileSystemLioncash2019-04-051-7/+8
| * | | | | | | | | | | | | | | service/fsp_srv: Update SaveDataInfo and SaveDataDescriptor structsLioncash2019-04-053-4/+15
| | |/ / / / / / / / / / / / / | |/| | | | | | | | | | | | |
* | | | | | | | | | | | | | | Merge pull request #2327 from ReinUsesLisp/crash-safe-visitbunnei2019-04-061-1/+6
|\ \ \ \ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | | | | gl_shader_decompiler: Return early when an operation is invalidReinUsesLisp2019-04-031-1/+6
| | |_|_|_|_|_|/ / / / / / / / | |/| | | | | | | | | | | | |
* | | | | | | | | | | | | | | Merge pull request #2343 from lioncash/todobunnei2019-04-062-15/+14
|\ \ \ \ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | | | | file_sys/program_metadata: Remove obsolete TODOsLioncash2019-04-052-15/+14
| | |_|/ / / / / / / / / / / / | |/| | | | | | | | | | | | |
* | | | | | | | | | | | | | | Merge pull request #2337 from lioncash/temporarybunnei2019-04-061-12/+12
|\ \ \ \ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | | | | gl_shader_decompiler: Rename GenerateTemporal() to GenerateTemporary()Lioncash2019-04-051-12/+12
| | |_|/ / / / / / / / / / / / | |/| | | | | | | | | | | | |
* | | | | | | | | | | | | | | Merge pull request #2329 from lioncash/sanitizebunnei2019-04-061-0/+14
|\ \ \ \ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | | | | kernel/svc: Properly sanitize mutex address in WaitProcessWideKeyAtomicLioncash2019-04-041-0/+14
* | | | | | | | | | | | | | | | Merge pull request #2344 from lioncash/resultbunnei2019-04-061-4/+0
|\ \ \ \ \ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | | | | | hle/result: Remove unnecessary bitfield entry for ResultCodeLioncash2019-04-051-4/+0
| | |_|/ / / / / / / / / / / / / | |/| | | | | | | | | | | | | |
* | | | | | | | | | | | | | | | Merge pull request #2349 from lioncash/surfacebunnei2019-04-061-75/+131
|\ \ \ \ \ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | | | | | yuzu/debugger/graphics_surface: Display error messages for file I/O errorsLioncash2019-04-061-7/+25
| * | | | | | | | | | | | | | | | yuzu/debugger/graphics_surface: Tidy up SaveSurfaceLioncash2019-04-061-15/+14
| * | | | | | | | | | | | | | | | yuzu/debugger/graphics_surface: Clean up connection overload deductionLioncash2019-04-061-12/+10
| * | | | | | | | | | | | | | | | yuzu/debugger/graphics_surface: Fill in missing surface format listingsLioncash2019-04-061-43/+84
| |/ / / / / / / / / / / / / / /
* | | | | | | | | | | | | | | | Merge pull request #2351 from lioncash/macrobunnei2019-04-061-13/+7
|\ \ \ \ \ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | | | | | video_core/macro_interpreter: Remove assertion within FetchParameter()Lioncash2019-04-061-2/+1
| * | | | | | | | | | | | | | | | video_core/macro_interpreter: Simplify GetRegister()Lioncash2019-04-061-11/+6
| |/ / / / / / / / / / / / / / /
* | | | | | | | | | | | | | | | Merge pull request #2338 from lioncash/fsbunnei2019-04-051-5/+8
|\ \ \ \ \ \ \ \ \ \ \ \ \ \ \ \ | |/ / / / / / / / / / / / / / / |/| | | | | | | | | | | | | | |
| * | | | | | | | | | | | | | | filesystem: Use a std::string_view in OpenFile()Lioncash2019-04-051-5/+8
| | |/ / / / / / / / / / / / / | |/| | | | | | | | | | | | |
* | | | | | | | | | | | | | | Merge pull request #2282 from bunnei/gpu-asynch-v2bunnei2019-04-053-51/+65
|\ \ \ \ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | | | | gpu_thread: Improve synchronization by using CoreTiming.bunnei2019-04-023-51/+65
* | | | | | | | | | | | | | | | Merge pull request #2292 from lioncash/nacpbunnei2019-04-052-12/+24
|\ \ \ \ \ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | | | | | file_sys/control_metadata: Amend naming of membersLioncash2019-04-042-12/+24
| | |_|_|_|_|_|_|_|_|_|/ / / / / | |/| | | | | | | | | | | | | |
* | | | | | | | | | | | | | | | Merge pull request #2335 from lioncash/service-unusedbunnei2019-04-058-62/+58
|\ \ \ \ \ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | | | | | hle/service: Resolve unused variable warningsLioncash2019-04-048-62/+58
| | |_|/ / / / / / / / / / / / / | |/| | | | | | | | | | | | | |
* | | | | | | | | | | | | | | | Merge pull request #2336 from ReinUsesLisp/txqbunnei2019-04-051-2/+3
|\ \ \ \ \ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | | | | | gl_shader_decompiler: Fix TXQ typesReinUsesLisp2019-04-051-2/+3
| | |_|_|_|/ / / / / / / / / / / | |/| | | | | | | | | | | | | |
* | | | | | | | | | | | | | | | Merge pull request #2331 from lioncash/cachebunnei2019-04-051-9/+6
|\ \ \ \ \ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | | | | | yuzu/main: Use QStringLiteral where applicable within OnTransferableShaderCacheOpenFile()Lioncash2019-04-041-2/+2
| * | | | | | | | | | | | | | | | yuzu/main: Tidy up the error dialog string in OnTransferableShaderCacheOpenFile()Lioncash2019-04-041-3/+2
| * | | | | | | | | | | | | | | | yuzu/main: Remove unnecessary string concatenation in OnTransferableShaderCacheOpenFile()Lioncash2019-04-041-1/+1
| * | | | | | | | | | | | | | | | yuzu/main: Make open_target a QStringLioncash2019-04-041-4/+2
| * | | | | | | | | | | | | | | | yuzu/main: Use static variant of QFile's exists()Lioncash2019-04-041-1/+1
| | |/ / / / / / / / / / / / / / | |/| | | | | | | | | | | | | |
* | | | | | | | | | | | | | | | Merge pull request #2333 from lioncash/video-includebunnei2019-04-0513-24/+4
|\ \ \ \ \ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | | | | | video_core/renderer_opengl: Remove unnecessary includesLioncash2019-04-0413-24/+4
| |/ / / / / / / / / / / / / / /
* / / / / / / / / / / / / / / / yuzu/main: Remove unnecessary includesLioncash2019-04-041-5/+8
|/ / / / / / / / / / / / / / /
* | | | | | | | | | | | | | | common/lz4_compression: Remove #pragma once directive from the cpp fileLioncash2019-04-041-2/+0
* | | | | | | | | | | | | | | Merge pull request #2328 from lioncash/transferbunnei2019-04-043-17/+37
|\ \ \ \ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | | | | service/am: Correct behavior of CreateTransferMemoryStorage()Lioncash2019-04-031-6/+6
| * | | | | | | | | | | | | | | kernel/transfer_memory: Add accessors to data and sizesLioncash2019-04-032-11/+31
| | |_|_|/ / / / / / / / / / / | |/| | | | | | | | | | | | |
* | | | | | | | | | | | | | | Merge pull request #2095 from FreddyFunk/open-transferable-shader-cachebunnei2019-04-044-0/+44
|\ \ \ \ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | | | | Use QString instead of std::string where applicableunknown2019-02-081-17/+11
| * | | | | | | | | | | | | | | Use constexpr char array instead of string where applicableMat M2019-02-081-1/+1
| * | | | | | | | | | | | | | | frontend: Open transferable shader cache for a selected game in the gamelistunknown2019-02-084-0/+50
* | | | | | | | | | | | | | | | Merge pull request #2093 from FreddyFunk/disk-cache-better-compressionbunnei2019-04-047-50/+153
|\ \ \ \ \ \ \ \ \ \ \ \ \ \ \ \ | | |_|_|_|_|_|_|_|/ / / / / / / | |/| | | | | | | | | | | | | |
| * | | | | | | | | | | | | | | gl_shader_disk_cache: Use LZ4HC with compression level 9 instead of compression level 12 for less compression timeunknown2019-03-291-3/+3
| * | | | | | | | | | | | | | | Addressed feedbackunknown2019-03-297-91/+145
| * | | | | | | | | | | | | | | core: Do not link LZ4 to core. Use common/data_compression for nso segment decompression instead.unknown2019-03-292-11/+8
| * | | | | | | | | | | | | | | gl_shader_disk_cache: Use better compression for transferable and precompiled shader disk chache filesunknown2019-03-293-10/+26
| * | | | | | | | | | | | | | | data_compression: Move LZ4 compression from video_core/gl_shader_disk_cache to common/data_compressionunknown2019-03-295-39/+75
| | |_|_|_|_|_|_|/ / / / / / / | |/| | | | | | | | | | | | |
* | | | | | | | | | | | | | | Merge pull request #2299 from lioncash/maxwellbunnei2019-04-044-17/+15
|\ \ \ \ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | | | | gl_shader_manager: Remove unnecessary gl_shader_manager inclusionLioncash2019-03-281-2/+0
| * | | | | | | | | | | | | | | gl_shader_manager: Move using statement into the cpp fileLioncash2019-03-282-4/+4
| * | | | | | | | | | | | | | | gl_shader_manager: Remove reliance on global accessor within MaxwellUniformData::SetFromRegs()Lioncash2019-03-283-9/+9
| * | | | | | | | | | | | | | | gl_shader_manager: Amend Doxygen string for MaxwellUniformDataLioncash2019-03-271-3/+3
| | |_|_|_|_|_|_|_|/ / / / / / | |/| | | | | | | | | | | | |
* | | | | | | | | | | | | | | Merge pull request #2324 from lioncash/enum-unusedbunnei2019-04-042-2/+0
|\ \ \ \ \ \ \ \ \ \ \ \ \ \ \ | |_|_|_|_|/ / / / / / / / / / |/| | | | | | | | | | | | | |
| * | | | | | | | | | | | | | kernel/object: Remove unused handle type entryLioncash2019-04-032-2/+0
| | |_|_|_|_|_|_|/ / / / / / | |/| | | | | | | | | | | |
* | | | | | | | | | | | | | Merge pull request #2294 from lioncash/fatalbunnei2019-04-032-36/+63
|\ \ \ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | | | service/am: Implement EnterFatalSection and LeaveFatalSectionLioncash2019-03-262-2/+29
| * | | | | | | | | | | | | | service/am: Sort ISelfController's member functions according to table orderLioncash2019-03-262-36/+36
| | |/ / / / / / / / / / / / | |/| | | | | | | | | | | |
* | | | | | | | | | | | | | Merge pull request #2323 from lioncash/includebunnei2019-04-032-4/+6
|\ \ \ \ \ \ \ \ \ \ \ \ \ \ | |_|_|_|_|/ / / / / / / / / |/| | | | | | | | | | | | |
| * | | | | | | | | | | | | yuzu/debugger/profiler: Remove unnecessary includesLioncash2019-04-032-4/+6
| | |/ / / / / / / / / / / | |/| | | | | | | | | | |
* | | | | | | | | | | | | Merge pull request #2302 from ReinUsesLisp/vk-swapchainbunnei2019-04-033-1/+305
|\ \ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | | vk_swapchain: Implement a swapchain managerReinUsesLisp2019-03-293-1/+305
| | |_|/ / / / / / / / / / | |/| | | | | | | | | | |
* | | | | | | | | | | | | Merge pull request #2305 from lioncash/sharedbunnei2019-04-033-5/+18
|\ \ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | | kernel/shared_memory: Remove unused core/memory.h includeLioncash2019-03-291-1/+0
| * | | | | | | | | | | | | kernel/shared_memory: Sanitize supplied size when unmappingLioncash2019-03-293-4/+18
| |/ / / / / / / / / / / /
* | | | | | | | | | | | | Merge pull request #2314 from lioncash/constbunnei2019-04-0311-18/+18
|\ \ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | | kernel/thread: Make AllWaitObjectsReady() a const qualified member functionLioncash2019-04-022-2/+2
| * | | | | | | | | | | | | kernel/wait_object: Make ShouldWait() take thread members by pointer-to-constLioncash2019-04-0211-11/+11
| * | | | | | | | | | | | | kernel/thread: Avoid sign conversion within GetCommandBufferAddress()Lioncash2019-04-011-2/+2
| * | | | | | | | | | | | | kernel/thread: Make parameter of GetWaitObjectIndex() const qualifiedLioncash2019-04-012-3/+3
| | |_|_|_|_|/ / / / / / / | |/| | | | | | | | | | |
* | | | | | | | | | | | | yuzu/applets/software_keyboard: Use QDialogButtonBox standard buttons instead of custom buttonsLioncash2019-04-031-7/+7
* | | | | | | | | | | | | yuzu/applets/profile_select: Use QDialogButtonBox standard buttons instead of custom buttonsLioncash2019-04-031-4/+1
| |_|/ / / / / / / / / / |/| | | | | | | | | | |
* | | | | | | | | | | | Merge pull request #2270 from lioncash/plistbunnei2019-04-037-2/+123
|\ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | kernel/svc: Implement svcGetThreadListLioncash2019-04-024-1/+70
| * | | | | | | | | | | | kernel/svc: Implement svcGetProcessListLioncash2019-04-024-1/+53
| | |_|_|_|_|_|_|_|_|/ / | |/| | | | | | | | | |
* | | | | | | | | | | | Merge pull request #2313 from lioncash/reslimitbunnei2019-04-023-14/+6
|\ \ \ \ \ \ \ \ \ \ \ \ | |/ / / / / / / / / / / |/| | | | | | | | | | |
| * | | | | | | | | | | kernel/resource_limit: Remove the name member from resource limitsLioncash2019-04-013-14/+6
| |/ / / / / / / / / /
* | | | | | | | | | | process: Fix up compilationReinUsesLisp2019-04-021-1/+1
* | | | | | | | | | | Merge pull request #2281 from lioncash/memorybunnei2019-04-025-7/+8
|\ \ \ \ \ \ \ \ \ \ \ | |/ / / / / / / / / / |/| | | | | | | | | |
| * | | | | | | | | | kernel/codeset: Make CodeSet's memory data member a regular std::vectorLioncash2019-03-225-7/+8
* | | | | | | | | | | Merge pull request #2301 from FearlessTobi/remove-amiibo-settingbunnei2019-04-017-28/+1
|\ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | core/yuzu: Remove enable_nfc settingfearlessTobi2019-03-297-28/+1
| | |_|/ / / / / / / / | |/| | | | | | | | |
* | | | | | | | | | | general: Use deducation guides for std::lock_guard and std::unique_lockLioncash2019-04-0123-75/+77
* | | | | | | | | | | Merge pull request #2304 from lioncash/memsizebunnei2019-03-313-9/+28
|\ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | kernel/process: Report total physical memory used to svcGetInfoLioncash2019-03-293-4/+11
| * | | | | | | | | | | kernel/process: Store the total size of the code memory loadedLioncash2019-03-292-0/+5
| * | | | | | | | | | | kernel/process: Store the main thread stack size to a data memberLioncash2019-03-282-4/+7
| * | | | | | | | | | | kernel/process: Make Run's stack size parameter a u64Lioncash2019-03-282-2/+2
| * | | | | | | | | | | kernel/process: Ensure that given stack size is always page-alignedLioncash2019-03-281-0/+4
* | | | | | | | | | | | Merge pull request #2303 from lioncash/threadbunnei2019-03-312-41/+0
|\ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | common/thread: Remove unused functionsLioncash2019-03-292-41/+0
| |/ / / / / / / / / / /
* | | | | | | | | | | | Merge pull request #2297 from lioncash/reorderbunnei2019-03-316-14/+14
|\ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | video_core: Amend constructor initializer list order where applicableLioncash2019-03-276-14/+14
| | |/ / / / / / / / / / | |/| | | | | | | | | |
* | | | | | | | | | | | Merge pull request #2298 from lioncash/variablebunnei2019-03-315-14/+7
|\ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | gpu_thread: Remove unused dma_pusher class member variable from ThreadManagerLioncash2019-03-272-5/+2
| * | | | | | | | | | | | gl_rasterizer: Remove unused reference member variable from RasterizerOpenGLLioncash2019-03-273-9/+5
| |/ / / / / / / / / / /
* | | | | | | | | | | | Merge pull request #2308 from lioncash/deductionbunnei2019-03-313-12/+12
|\ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | kernel/scheduler: Remove unused parameter to AddThread()Lioncash2019-03-303-4/+4
| * | | | | | | | | | | | kernel/scheduler: Use deduction guides on mutex locksLioncash2019-03-301-8/+8
| | |_|_|/ / / / / / / / | |/| | | | | | | | | |
* | | | | | | | | | | | service/fatal: Mark local variables as const where applicableLioncash2019-03-301-6/+6
* | | | | | | | | | | | service/fatal: Remove unnecessary semicolonLioncash2019-03-301-1/+1
* | | | | | | | | | | | service/fatal: Name FatalInfo structure membersLioncash2019-03-301-31/+44
|/ / / / / / / / / / /
* | | | | | | | | | | Merge pull request #2266 from FernandoS27/arbitrationbunnei2019-03-296-14/+22
|\ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | Fix small bug that kept a thread as a condvar thread after being signalled.Fernando Sahmkow2019-03-202-6/+8
| * | | | | | | | | | | Add CondVar Thread State.Fernando Sahmkow2019-03-205-4/+10
| * | | | | | | | | | | Small fixes to address_arbiter to better match the IDB.Fernando Sahmkow2019-03-202-5/+5
* | | | | | | | | | | | Merge pull request #2265 from FernandoS27/multilevelqueuebunnei2019-03-298-19/+484
|\ \ \ \ \ \ \ \ \ \ \ \ | |_|_|/ / / / / / / / / |/| | | | | | | | | | |
| * | | | | | | | | | | Fixes and corrections on formatting.Fernando Sahmkow2019-03-275-41/+30
| * | | | | | | | | | | Fixes to multilevelqueue's iterator.Fernando Sahmkow2019-03-271-1/+5
| * | | | | | | | | | | Use MultiLevelQueue instead of old ThreadQueueListFernando Sahmkow2019-03-273-31/+34
| * | | | | | | | | | | Add MultiLevelQueue TestsFernando Sahmkow2019-03-272-0/+56
| * | | | | | | | | | | Implement intrinsics CountTrailingZeroes and test it.Fernando Sahmkow2019-03-273-12/+76
| * | | | | | | | | | | Implement a MultiLevelQueueFernando Sahmkow2019-03-273-0/+349
| | |/ / / / / / / / / | |/| | | | | | | | |
* | | | | | | | | | | Merge pull request #2284 from lioncash/heap-allocbunnei2019-03-283-59/+81
|\ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | kernel/vm_manager: Handle shrinking of the heap size within SetHeapSize()Lioncash2019-03-242-24/+46
| * | | | | | | | | | | kernel/vm_manager: Rename HeapAllocate to SetHeapSizeLioncash2019-03-243-4/+3
| * | | | | | | | | | | kernel/vm_manager: Handle case of identical calls to HeapAllocateLioncash2019-03-241-0/+5
| * | | | | | | | | | | kernel/vm_manager: Remove unused class variablesLioncash2019-03-241-3/+0
| * | | | | | | | | | | kernel/vm_manager: Remove unnecessary heap_used data memberLioncash2019-03-243-13/+2
| * | | | | | | | | | | kernel/vm_manager: Tidy up heap allocation codeLioncash2019-03-243-27/+37
* | | | | | | | | | | | Merge pull request #2296 from lioncash/overridebunnei2019-03-283-4/+4
|\ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | video_core: Add missing override specifiersLioncash2019-03-273-4/+4
| | |/ / / / / / / / / / | |/| | | | | | | | | |
* / | | | | | | | | | | video_core/gpu: Amend typo in GPU member variable nameLioncash2019-03-272-7/+8
|/ / / / / / / / / / /
* | | | | | | | | | | Merge pull request #2285 from lioncash/unused-structbunnei2019-03-261-8/+0
|\ \ \ \ \ \ \ \ \ \ \ | |_|_|_|_|/ / / / / / |/| | | | | | | | | |
| * | | | | | | | | | kernel/process: Remove unused AddressMapping structLioncash2019-03-241-8/+0
* | | | | | | | | | | Merge pull request #2287 from lioncash/coretiming-cbbunnei2019-03-267-12/+12
|\ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | core/core_timing: Make callback parameters consistentLioncash2019-03-247-12/+12
| |/ / / / / / / / / /
* | | | | | | | | | | Merge pull request #2286 from lioncash/fwdbunnei2019-03-261-3/+0
|\ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | kernel/kernel: Remove unnecessary forward declarationLioncash2019-03-241-3/+0
| |/ / / / / / / / / /
* / / / / / / / / / / core/cheat_engine: Make MemoryReadImpl and MemoryWriteImpl internally linkedLioncash2019-03-241-0/+2
|/ / / / / / / / / /
* | | | | | | | | | Merge pull request #2232 from lioncash/transfer-memorybunnei2019-03-246-6/+282
|\ \ \ \ \ \ \ \ \ \ | |/ / / / / / / / / |/| | | | | | | | |
| * | | | | | | | | core/hle/kernel/svc: Implement svcUnmapTransferMemoryLioncash2019-03-131-1/+48
| * | | | | | | | | core/hle/kernel/svc: Implement svcMapTransferMemoryLioncash2019-03-131-1/+57
| * | | | | | | | | core/hle/kernel: Split transfer memory handling out into its own classLioncash2019-03-136-4/+177
* | | | | | | | | | Merge pull request #2221 from DarkLordZach/firmware-versionbunnei2019-03-237-3/+154
|\ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | set_sys: Move constants to anonymous namespaceZach Hilman2019-03-111-1/+1
| * | | | | | | | | | set_sys: Use official nintendo version stringZach Hilman2019-03-114-19/+25
| * | | | | | | | | | system_version: Correct sizes on VectorVfsFile constructionZach Hilman2019-03-111-4/+4
| * | | | | | | | | | set_sys: Use correct error codes in GetFirmwareVersion*Zach Hilman2019-03-111-21/+41
| * | | | | | | | | | set_sys: Implement GetFirmwareVersion(2) for libnx hosversionZach Hilman2019-03-106-3/+128
* | | | | | | | | | | Merge pull request #2253 from lioncash/flagsbunnei2019-03-231-0/+61
|\ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | CMakeLists: Move off of modifying CMAKE_*-related flagsLioncash2019-03-171-20/+12
| * | | | | | | | | | | CMakeLists: Move compilation flags into the src directoryLioncash2019-03-171-0/+69
* | | | | | | | | | | | Merge pull request #2280 from lioncash/nsobunnei2019-03-233-73/+92
|\ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | loader/nso: Place translation unit specific functions into an anonymous namespaceLioncash2019-03-221-20/+21
| * | | | | | | | | | | | loader/nso: Clean up use of magic constantsLioncash2019-03-221-4/+6
| * | | | | | | | | | | | file_sys/patch_manager: Deduplicate NSO headerLioncash2019-03-223-64/+65
| * | | | | | | | | | | | loader/nso: Fix definition of the NSO header structLioncash2019-03-221-3/+15
| * | | | | | | | | | | | file_sys/patch_manager: Remove two magic valuesLioncash2019-03-221-2/+5
| | |_|_|_|/ / / / / / / | |/| | | | | | | | | |
* | | | | | | | | | | | Merge pull request #2279 from lioncash/cheat-globalbunnei2019-03-226-48/+57
|\ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | file_sys/cheat_engine: Silence truncation and sign-conversion warningsLioncash2019-03-222-5/+6
| * | | | | | | | | | | | file_sys/cheat_engine: Remove use of global system accessorsLioncash2019-03-226-43/+51
| |/ / / / / / / / / / /
* | | | | | | | | | | | Merge pull request #2256 from bunnei/gpu-vmmbunnei2019-03-2228-257/+550
|\ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | memory_manager: Cleanup FindFreeRegion.bunnei2019-03-212-12/+6
| * | | | | | | | | | | | memory_manager: Use Common::AlignUp in public interface as needed.bunnei2019-03-211-11/+22
| * | | | | | | | | | | | memory_manager: Bug fixes and further cleanup.bunnei2019-03-212-73/+72
| * | | | | | | | | | | | memory: Check that core is powered on before attempting to use GPU.bunnei2019-03-211-1/+1
| * | | | | | | | | | | | maxwell_dma: Check for valid source in destination before copy.bunnei2019-03-211-0/+10
| * | | | | | | | | | | | memory_manager: Add protections for invalid GPU addresses.bunnei2019-03-212-22/+43
| * | | | | | | | | | | | gl_rasterizer_cache: Check that backing memory is valid before creating a surface.bunnei2019-03-212-15/+12
| * | | | | | | | | | | | gpu: Rewrite virtual memory manager using PageTable.bunnei2019-03-2113-212/+481
| * | | | | | | | | | | | gpu: Move GPUVAddr definition to common_types.bunnei2019-03-2117-39/+31
* | | | | | | | | | | | | Merge pull request #2277 from bunnei/fix-smo-transitionsbunnei2019-03-223-8/+12
|\ \ \ \ \ \ \ \ \ \ \ \ \ | |_|/ / / / / / / / / / / |/| | | | | | | | | | | |
| * | | | | | | | | | | | Revert "Devirtualize Register/Unregister and use a wrapper instead."bunnei2019-03-223-8/+12
* | | | | | | | | | | | | Merge pull request #2234 from lioncash/mutexbunnei2019-03-225-29/+62
|\ \ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | | core/hle/kernel/mutex: Remove usages of global system accessorsLioncash2019-03-151-11/+15
| * | | | | | | | | | | | | core/hle/kernel: Make Mutex a per-process class.Lioncash2019-03-155-18/+47
* | | | | | | | | | | | | | Merge pull request #2274 from lioncash/includebunnei2019-03-221-3/+0
|\ \ \ \ \ \ \ \ \ \ \ \ \ \ | |_|/ / / / / / / / / / / / |/| | | | | | | | | | | | |
| * | | | | | | | | | | | | core/memory: Remove unnecessary includesLioncash2019-03-211-3/+0
| | |_|_|_|_|_|_|_|_|/ / / | |/| | | | | | | | | | |
* | | | | | | | | | | | | Merge pull request #2275 from lioncash/memflagsbunnei2019-03-224-22/+20
|\ \ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | | kernel/vm_manager: Rename CodeStatic/CodeMutable to Code and CodeData respectivelyLioncash2019-03-214-22/+20
| * | | | | | | | | | | | | kernel/vm_manager: Amend flag values for CodeMutableLioncash2019-03-211-1/+1
| |/ / / / / / / / / / / /
* | | | | | | | | | | | | Merge pull request #2276 from lioncash/ambunnei2019-03-221-1/+15
|\ \ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | | service/am: Add function table for IDebugFunctionsLioncash2019-03-211-1/+15
| |/ / / / / / / / / / / /
* | | | | | | | | | | | | Merge pull request #1933 from DarkLordZach/cheat-enginebunnei2019-03-2210-0/+813
|\ \ \ \ \ \ \ \ \ \ \ \ \ | |/ / / / / / / / / / / / |/| | | | | | | | | | | |
| * | | | | | | | | | | | vm_manager: Remove cheat-specific ranges from VMManagerZach Hilman2019-03-0510-77/+56
| * | | | | | | | | | | | core: Add support for registering and controlling ownership of CheatEngineZach Hilman2019-03-052-0/+13
| * | | | | | | | | | | | cheat_engine: Add parser and interpreter for game cheatsZach Hilman2019-03-053-0/+715
| * | | | | | | | | | | | loader/nso: Set main code region in VMManagerZach Hilman2019-03-053-2/+21
| * | | | | | | | | | | | vm_manager: Add support for storing and getting main code regionZach Hilman2019-03-052-0/+28
| * | | | | | | | | | | | patch_manager: Display cheats in game list add-onsZach Hilman2019-03-051-0/+2
| * | | | | | | | | | | | patch_manager: Add support for loading cheats listsZach Hilman2019-03-052-0/+56
| * | | | | | | | | | | | controllers/npad: Add accessor for current press stateZach Hilman2019-03-051-0/+1
* | | | | | | | | | | | | Merge pull request #2260 from lioncash/sdlbunnei2019-03-213-12/+14
|\ \ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | | input_common/sdl: Correct return values within implementations of GetPollers()Lioncash2019-03-182-2/+6
| * | | | | | | | | | | | | input_common/sdl: Use a type alias to shorten declaration of GetPollersLioncash2019-03-183-11/+9
* | | | | | | | | | | | | | common/bit_util: Fix bad merge duplicating the copy constructorLioncash2019-03-211-2/+0
* | | | | | | | | | | | | | Merge pull request #2090 from FearlessTobi/port-4599bunnei2019-03-2110-134/+337
|\ \ \ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | | | Make bitfield assignment operator publicfearlessTobi2019-02-131-6/+2
| * | | | | | | | | | | | | | remove all occurance of specifying endianness inside BitFieldWeiyi Wang2019-02-066-96/+96
| * | | | | | | | | | | | | | common/bitfield: make it endianness-awareWeiyi Wang2019-02-063-3/+100
| * | | | | | | | | | | | | | common/swap: remove default value for swap type internal storageWeiyi Wang2019-02-061-1/+1
| * | | | | | | | | | | | | | common/swap: use template and tag for LE/BE specificationWeiyi Wang2019-02-061-39/+91
| * | | | | | | | | | | | | | common/swap: add swap template for enumWeiyi Wang2019-02-061-0/+52
* | | | | | | | | | | | | | | Merge pull request #2262 from lioncash/enumbunnei2019-03-212-2/+15
|\ \ \ \ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | | | | file_sys/content_archive: Amend name of Data_Unknown5 enum entryLioncash2019-03-192-2/+15
| | |_|_|_|_|_|_|_|/ / / / / / | |/| | | | | | | | | | | | |
* | | | | | | | | | | | | | | Merge pull request #2273 from lioncash/guardbunnei2019-03-212-0/+9
|\ \ \ \ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | | | | common/uint128: Add missing header guardLioncash2019-03-211-0/+2
| * | | | | | | | | | | | | | | common/uint128: Add missing top-file source textLioncash2019-03-212-0/+7
| | |_|_|_|_|/ / / / / / / / / | |/| | | | | | | | | | | | |
* | | | | | | | | | | | | | | Merge pull request #2268 from lioncash/codesetbunnei2019-03-218-45/+111
|\ \ \ \ \ \ \ \ \ \ \ \ \ \ \ | |/ / / / / / / / / / / / / / |/| | | | | | | | | | | | | |
| * | | | | | | | | | | | | | kernel/process: Make MapSegment lambda reference parameter constLioncash2019-03-201-1/+1
| * | | | | | | | | | | | | | kernel: Move CodeSet structure to its own source filesLioncash2019-03-208-44/+110
* | | | | | | | | | | | | | | common/CMakeLists: Amend boost dependencyLioncash2019-03-211-1/+1
* | | | | | | | | | | | | | | Merge pull request #2267 from FernandoS27/fix-2238bunnei2019-03-211-1/+2
|\ \ \ \ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | | | | Fix crash caused by 2238.Fernando Sahmkow2019-03-201-1/+2
| | |/ / / / / / / / / / / / / | |/| | | | | | | | | | | | |
* | | | | | | | | | | | | | | Merge pull request #2247 from lioncash/includebunnei2019-03-212-4/+4
|\ \ \ \ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | | | | common/thread_queue_list: Remove unnecessary dependency on boostLioncash2019-03-162-4/+4
* | | | | | | | | | | | | | | | Merge pull request #2224 from lioncash/opusbunnei2019-03-211-34/+48
|\ \ \ \ \ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | | | | | hwopus: Leverage multistream API for decoding regular Opus packetsLioncash2019-03-111-34/+48
* | | | | | | | | | | | | | | | | Merge pull request #2239 from FearlessTobi/port-4684bunnei2019-03-211-3/+1
|\ \ \ \ \ \ \ \ \ \ \ \ \ \ \ \ \ | |_|_|_|/ / / / / / / / / / / / / |/| | | | | | | | | | | | | | | |
| * | | | | | | | | | | | | | | | frontend: qt: fix a freeze where if you click on entry in the game list too fast, citra will hangliushuyu2019-03-151-3/+1
| | |_|_|_|_|_|_|_|_|_|_|/ / / / | |/| | | | | | | | | | | | | |
* | | | | | | | | | | | | | | | Merge pull request #2264 from lioncash/linkerbunnei2019-03-205-189/+4
|\ \ \ \ \ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | | | | | loader: Remove Linker classLioncash2019-03-203-185/+0
| * | | | | | | | | | | | | | | | loader: Remove Linker inheritance from NRO and NSO loadersLioncash2019-03-202-4/+4
| | |_|_|/ / / / / / / / / / / / | |/| | | | | | | | | | | | | |
* / | | | | | | | | | | | | | | Fix getopt on systems where char is unsigned by defaultxperia642019-03-191-2/+2
|/ / / / / / / / / / / / / / /
* | | | | | | | | | | | | | | Merge pull request #2258 from lioncash/ambunnei2019-03-192-13/+73
|\ \ \ \ \ \ \ \ \ \ \ \ \ \ \ | |_|_|_|_|/ / / / / / / / / / |/| | | | | | | | | | | | | |
| * | | | | | | | | | | | | | service/am: Add basic implementation of ChangeMainAppletMasterVolumeLioncash2019-03-182-1/+29
| * | | | | | | | | | | | | | service/am: Unstub SetTransparentVolumeRate()Lioncash2019-03-182-1/+17
| * | | | | | | | | | | | | | service/am: Unstub SetExpectedMasterVolume()Lioncash2019-03-182-11/+27
* | | | | | | | | | | | | | | Merge pull request #2259 from lioncash/fspbunnei2019-03-182-1/+5
|\ \ \ \ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | | | | fsp_srv: Unstub SetCurrentProcessLioncash2019-03-182-1/+5
* | | | | | | | | | | | | | | | Merge pull request #2254 from lioncash/redundantbunnei2019-03-181-3/+2
|\ \ \ \ \ \ \ \ \ \ \ \ \ \ \ \ | |/ / / / / / / / / / / / / / / |/| | | | | | | | | | | | | | |
| * | | | | | | | | | | | | | | input_common/sdl_impl: Make lambda capture more specific in SDLState constructorLioncash2019-03-171-1/+1
| * | | | | | | | | | | | | | | input_common/sdl_impl: Remove unnecessary std::chrono::duration constructionLioncash2019-03-171-1/+1
| * | | | | | | | | | | | | | | input_common/sdl_impl: Remove unused variable in SDLState constructorLioncash2019-03-171-1/+0
| | |_|_|/ / / / / / / / / / / | |/| | | | | | | | | | | | |
* | | | | | | | | | | | | | | Merge pull request #2238 from lioncash/threadbunnei2019-03-182-21/+41
|\ \ \ \ \ \ \ \ \ \ \ \ \ \ \ | |_|/ / / / / / / / / / / / / |/| | | | | | | | | | | | | |
| * | | | | | | | | | | | | | kernel/thread: Expand documentation of nominal_priority and current_priorityLioncash2019-03-162-3/+11
| * | | | | | | | | | | | | | kernel/thread: Make bracing consistent within UpdatePriority()Lioncash2019-03-161-2/+4
| * | | | | | | | | | | | | | kernel/thread: Amend condition within UpdatePriority()Lioncash2019-03-161-3/+3
| * | | | | | | | | | | | | | kernel/thread: Maintain priority ordering of added mutex waiting threadsLioncash2019-03-161-14/+24
| | |_|_|_|_|_|_|_|/ / / / / | |/| | | | | | | | | | | |
* | | | | | | | | | | | | | Merge pull request #2252 from bunnei/move-page-tablebunnei2019-03-1716-171/+215
|\ \ \ \ \ \ \ \ \ \ \ \ \ \ | |_|_|_|_|_|_|_|/ / / / / / |/| | | | | | | | | | | | |
| * | | | | | | | | | | | | core: Move PageTable struct into Common.bunnei2019-03-1716-171/+215
* | | | | | | | | | | | | | Merge pull request #2251 from bunnei/skip-zero-flushbunnei2019-03-171-0/+6
|\ \ \ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | | | gl_rasterizer: Skip zero addr/sized regions on flush/invalidate.bunnei2019-03-171-0/+6
| |/ / / / / / / / / / / / /
* | | | | | | | | | | | | | Merge pull request #2249 from lioncash/ipcbunnei2019-03-171-0/+30
|\ \ \ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | | | ipc_helpers: Allow pushing and popping floating-point valuesLioncash2019-03-161-0/+30
| | |_|/ / / / / / / / / / / | |/| | | | | | | | | | | |
* | | | | | | | | | | | | | Merge pull request #2245 from lioncash/unused-defbunnei2019-03-171-6/+0
|\ \ \ \ \ \ \ \ \ \ \ \ \ \ | |_|/ / / / / / / / / / / / |/| | | | | | | | | | | | |
| * | | | | | | | | | | | | kernel/thread: Actually remove the definition of ExitCurrentThread()Lioncash2019-03-161-6/+0
| |/ / / / / / / / / / / /
* | | | | | | | | | | | | Merge pull request #2244 from bunnei/gpu-mem-refactorbunnei2019-03-1720-189/+196
|\ \ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | | video_core: Refactor to use MemoryManager interface for all memory access.bunnei2019-03-1620-189/+196
* | | | | | | | | | | | | | Merge pull request #2243 from bunnei/mem-simplify-cachebunnei2019-03-173-68/+22
|\ \ \ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | | | memory: Simplify rasterizer cache operations.bunnei2019-03-163-68/+22
| |/ / / / / / / / / / / / /
* | | | | | | | | | | | | | Merge pull request #2129 from FernandoS27/cntpctbunnei2019-03-176-2/+69
|\ \ \ \ \ \ \ \ \ \ \ \ \ \ | |_|/ / / / / / / / / / / / |/| | | | | | | | | | | | |
| * | | | | | | | | | | | | Corrections, documenting and fixes.Fernando Sahmkow2019-02-164-13/+14
| * | | | | | | | | | | | | Use u128 on Clock Cycles calculation.Fernando Sahmkow2019-02-165-27/+32
| * | | | | | | | | | | | | Implement 128 bits Unsigned Integer Multiplication and Division.Fernando Sahmkow2019-02-163-0/+50
| * | | | | | | | | | | | | Correct CNTPCT to use Clock Cycles instead of Cpu Cycles.Fernando Sahmkow2019-02-163-2/+13
* | | | | | | | | | | | | | Merge pull request #2242 from lioncash/thread-fnbunnei2019-03-164-33/+31
|\ \ \ \ \ \ \ \ \ \ \ \ \ \ | |_|/ / / / / / / / / / / / |/| | | | | | | | | | | | |
| * | | | | | | | | | | | | kernel/thread: Move thread exiting logic from ExitCurrentThread to svcExitThreadLioncash2019-03-162-8/+7
| * | | | | | | | | | | | | kernel/thread: Migrate WaitCurrentThread_Sleep into the Thread interfaceLioncash2019-03-164-25/+24
| | |/ / / / / / / / / / / | |/| | | | | | | | | | |
* | | | | | | | | | | | | Merge pull request #2237 from bunnei/cache-host-addrbunnei2019-03-1626-294/+394
|\ \ \ \ \ \ \ \ \ \ \ \ \ | |_|_|_|_|_|_|_|_|_|/ / / |/| | | | | | | | | | | |
| * | | | | | | | | | | | gpu: Use host address for caching instead of guest address.bunnei2019-03-1526-294/+394
| | |_|/ / / / / / / / / | |/| | | | | | | | | |
* | | | | | | | | | | | Merge pull request #2048 from FearlessTobi/port-3924bunnei2019-03-162-203/+250
|\ \ \ \ \ \ \ \ \ \ \ \ | |/ / / / / / / / / / / |/| | | | | | | | | | / | | |_|_|_|_|_|_|_|_|/ | |/| | | | | | | | |
| * | | | | | | | | | citra_qt: Settings (configuration) reworkzhupengfei2019-03-072-203/+250
* | | | | | | | | | | Merge pull request #2233 from ReinUsesLisp/morton-cleanupbunnei2019-03-154-187/+146
|\ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | video_core/morton: Use enum to describe MortonCopyPixels128 modeReinUsesLisp2019-03-133-7/+10
| * | | | | | | | | | | video_core/morton: Remove unused parameter in MortonSwizzleReinUsesLisp2019-03-133-8/+7
| * | | | | | | | | | | video_core/morton: Remove clang-format off when it's not neededReinUsesLisp2019-03-131-133/+129
| * | | | | | | | | | | video_core/morton: Remove unused functionsReinUsesLisp2019-03-131-39/+0
| | |/ / / / / / / / / | |/| | | | | | | | |
* | | | | | | | | | | Merge pull request #2229 from ReinUsesLisp/vk-sampler-cachebunnei2019-03-154-24/+168
|\ \ \ \ \ \ \ \ \ \ \ | |_|_|_|_|_|_|/ / / / |/| | | | | | | | | |
| * | | | | | | | | | vk_sampler_cache: Use operator== instead of memcmpMat M2019-03-131-1/+1
| * | | | | | | | | | vk_sampler_cache: Implement a sampler cacheReinUsesLisp2019-03-134-1/+140
| * | | | | | | | | | video_core/texture: Add a raw representation of TSCEntryReinUsesLisp2019-03-121-24/+29
* | | | | | | | | | | Merge pull request #2230 from lioncash/globalbunnei2019-03-152-8/+9
|\ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | kernel/process: Remove use of global system accessorsLioncash2019-03-132-8/+9
| | |/ / / / / / / / / | |/| | | | | | | | |
* | | | | | | | | | | Merge pull request #2216 from ReinUsesLisp/rasterizer-systembunnei2019-03-142-29/+31
|\ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | gl_rasterizer: Use system instance passed from argumentReinUsesLisp2019-03-112-29/+31
| | |_|_|_|/ / / / / / | |/| | | | | | | | |
* | | | | | | | | | | Merge pull request #2227 from lioncash/overridebunnei2019-03-132-5/+5
|\ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | renderer_opengl/gl_global_cache: Replace indexing for assignment with insert_or_assignLioncash2019-03-112-3/+3
| * | | | | | | | | | | renderer_opengl/gl_global_cache: Append missing override specifiersLioncash2019-03-111-2/+2
| |/ / / / / / / / / /
* | | | | | | | | | | Merge pull request #2226 from lioncash/privatebunnei2019-03-134-14/+36
|\ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | kernel/server_port: Make data members privateLioncash2019-03-114-14/+36
| |/ / / / / / / / / /
* | | | | | | | | | | Merge pull request #2223 from lioncash/errorbunnei2019-03-133-19/+5
|\ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | core/hle/result: Remove now-unnecessary manually defined copy assignment operatorLioncash2019-03-101-5/+0
| * | | | | | | | | | | core/hle/result: Amend error in comment description for ResultCodeLioncash2019-03-101-1/+1
| * | | | | | | | | | | core/hle/result: Remove now-unused constructor for ResultCodeLioncash2019-03-101-10/+0
| * | | | | | | | | | | core/hle/result: Relocate IPC error code to ipc_helpersLioncash2019-03-103-3/+4
| |/ / / / / / / / / /
* | | | | | | | | | | Merge pull request #2187 from FearlessTobi/port-sdl-thingsbunnei2019-03-139-691/+785
|\ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | fixup! Joystick: Allow for background events; Add deadzone to SDLAnalogB3n302019-03-021-6/+17
| * | | | | | | | | | | input/sdl: lock map mutex after SDL callWeiyi Wang2019-03-021-11/+17
| * | | | | | | | | | | Input: Remove global variables from SDL InputJames Rowe2019-03-029-809/+206
| * | | | | | | | | | | Input: Copy current SDL.h/cpp files to implJames Rowe2019-03-022-0/+680
* | | | | | | | | | | | Merge pull request #2166 from lioncash/vi-init-servicebunnei2019-03-139-40/+146
|\ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | service/vi: Unstub GetDisplayServiceLioncash2019-02-275-11/+49
| * | | | | | | | | | | | core/ipc_helper: Allow popping all signed value types with RequestParserLioncash2019-02-271-0/+15
| * | | | | | | | | | | | service/vi: Remove use of a module classLioncash2019-02-268-46/+99
* | | | | | | | | | | | | video_core/texture: Fix up sampler lod biasReinUsesLisp2019-03-131-1/+1
| |_|_|/ / / / / / / / / |/| | | | | | | | | | |
* | | | | | | | | | | | Merge pull request #2211 from lioncash/arbiterbunnei2019-03-129-65/+81
|\ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | kernel: Make the address arbiter instance per-processLioncash2019-03-088-28/+35
| * | | | | | | | | | | | kernel/svc: Move address arbiter signaling behind a unified API functionLioncash2019-03-083-22/+26
| * | | | | | | | | | | | kernel/svc: Move address arbiter waiting behind a unified API functionLioncash2019-03-083-19/+24
* | | | | | | | | | | | | Merge pull request #2222 from lioncash/cstrbunnei2019-03-121-4/+3
|\ \ \ \ \ \ \ \ \ \ \ \ \ | |_|_|_|_|/ / / / / / / / |/| | | | | | | | | | | |
| * | | | | | | | | | | | service/service: Remove unncessary calls to c_str()Lioncash2019-03-101-4/+3
| | |_|_|/ / / / / / / / | |/| | | | | | | | | |
* | | | | | | | | | | | Merge pull request #2215 from ReinUsesLisp/samplersbunnei2019-03-123-64/+72
|\ \ \ \ \ \ \ \ \ \ \ \ | |/ / / / / / / / / / / |/| | | | | | | | | | |
| * | | | | | | | | | | gl_rasterizer: Encapsulate sampler queries into methodsReinUsesLisp2019-03-093-64/+72
* | | | | | | | | | | | Merge pull request #2207 from lioncash/hwopusbunnei2019-03-101-69/+107
|\ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | service/audio/hwopus: Move decoder state to its own classLioncash2019-03-071-50/+85
| * | | | | | | | | | | | service/audio/hwopus: Provide a name for the second word of OpusPacketHeaderLioncash2019-03-071-2/+4
| * | | | | | | | | | | | service/audio/hwopus: Move Opus packet header out of the IHardwareOpusDecoderManagerLioncash2019-03-071-17/+17
| * | | | | | | | | | | | service/audio/hwopus: Enclose internals in an anonymous namespaceLioncash2019-03-071-2/+3
* | | | | | | | | | | | | Merge pull request #2193 from lioncash/globalbunnei2019-03-105-17/+23
|\ \ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | | kernel/scheduler: Pass in system instance in constructorLioncash2019-03-045-17/+23
| | |_|_|_|_|_|_|_|/ / / / | |/| | | | | | | | | | |
* | | | | | | | | | | | | Merge pull request #2147 from ReinUsesLisp/texture-cleanbunnei2019-03-108-527/+589
|\ \ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | | shader/decode: Remove extras from MetaTextureReinUsesLisp2019-02-264-40/+65
| * | | | | | | | | | | | | shader/decode: Split memory and texture instructions decodingReinUsesLisp2019-02-267-501/+538
* | | | | | | | | | | | | | Merge pull request #2143 from ReinUsesLisp/texviewbunnei2019-03-103-32/+42
|\ \ \ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | | | gl_rasterizer_cache: Create texture views for array discrepanciesReinUsesLisp2019-02-273-32/+42
* | | | | | | | | | | | | | | Merge pull request #2220 from lioncash/cubebbunnei2019-03-102-4/+4
|\ \ \ \ \ \ \ \ \ \ \ \ \ \ \ | |_|_|_|_|_|_|_|_|_|_|_|/ / / |/| | | | | | | | | | | | | |
| * | | | | | | | | | | | | | audio_core/cubeb_sink: Convert _MSC_VER ifdefs to _WIN32Lioncash2019-03-102-4/+4
| | |_|_|_|/ / / / / / / / / | |/| | | | | | | | | | | |
* | | | | | | | | | | | | | Merge pull request #2217 from ReinUsesLisp/rasterizer-loggerMat M2019-03-101-19/+13
|\ \ \ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | | | gl_rasterizer: Minor logger changesReinUsesLisp2019-03-091-19/+13
| |/ / / / / / / / / / / / /
* | | | | | | | | | | | | | Merge pull request #2219 from Hexagon12/log-settingsMat M2019-03-101-0/+3
|\ \ \ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | | | clang fixHexagon122019-03-091-1/+2
| * | | | | | | | | | | | | | Log 2 new setting valuesHexagon122019-03-091-0/+2
| |/ / / / / / / / / / / / /
* | | | | | | | | | | | | | yuzu_cmd/config: Replace C casts with static_castReinUsesLisp2019-03-091-4/+5
* | | | | | | | | | | | | | yuzu_cmd/config: Silent implicit cast warningReinUsesLisp2019-03-091-1/+1
|/ / / / / / / / / / / / /
* | | | | | | | | | | | | Merge pull request #2210 from lioncash/optionalbunnei2019-03-085-56/+54
|\ \ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | | kernel/hle_ipc: Convert std::shared_ptr IPC header instances to std::optionalLioncash2019-03-084-47/+47
| * | | | | | | | | | | | | common/bit_field: Make BitField trivially copyableLioncash2019-03-071-9/+7
| | |_|_|_|/ / / / / / / / | |/| | | | | | | | | | |
* | | | | | | | | | | | | Merge pull request #2209 from lioncash/reorderbunnei2019-03-081-5/+2
|\ \ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | | video_core/gpu_thread: Remove unimplemented WaitForIdle function prototypeLioncash2019-03-071-3/+0
| * | | | | | | | | | | | | video_core/gpu_thread: Amend constructor initializer list orderLioncash2019-03-071-2/+2
| |/ / / / / / / / / / / /
* | | | | | | | | | | | | Merge pull request #2208 from lioncash/gpubunnei2019-03-083-3/+3
|\ \ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | | video_core/gpu: Make GPU's destructor virtualLioncash2019-03-073-3/+3
| |/ / / / / / / / / / / /
* | | | | | | | | | | | | Merge pull request #2191 from ReinUsesLisp/maxwell-to-vkbunnei2019-03-084-3/+553
|\ \ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | | maxwell_to_vk: Initial implementationReinUsesLisp2019-03-044-3/+553
* | | | | | | | | | | | | | dma_pusher: Store command_list_header by copyReinUsesLisp2019-03-081-1/+1
* | | | | | | | | | | | | | Merge pull request #2195 from lioncash/shared-globalbunnei2019-03-071-3/+2
|\ \ \ \ \ \ \ \ \ \ \ \ \ \ | |_|/ / / / / / / / / / / / |/| | | | | | | | | | | | |
| * | | | | | | | | | | | | kernel/shared_memory: Get rid of the use of global accessor functions within Create()Lioncash2019-03-041-3/+2
| | |_|_|/ / / / / / / / / | |/| | | | | | | | | | |
* | | | | | | | | | | | | Merge pull request #2196 from DarkLordZach/web-applet-escbunnei2019-03-072-0/+7
|\ \ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | | web_browser: Add shortcut to Enter key to exit appletZach Hilman2019-03-052-0/+7
| |/ / / / / / / / / / / /
* | | | | | | | | | | | | Merge pull request #2202 from lioncash/port-privbunnei2019-03-076-36/+78
|\ \ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | | kernel/server_session: Make data members privateLioncash2019-03-065-32/+73
| * | | | | | | | | | | | | kernel/client_session: Make data members privateLioncash2019-03-061-4/+5
* | | | | | | | | | | | | | Merge pull request #2205 from FearlessTobi/docked-undocked-hotkeybunnei2019-03-071-0/+8
|\ \ \ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | | | yuzu: add a hotkey to switch between undocked and docked modefearlessTobi2019-03-061-0/+8
* | | | | | | | | | | | | | | Merge pull request #2206 from lioncash/audio-stopbunnei2019-03-071-1/+3
|\ \ \ \ \ \ \ \ \ \ \ \ \ \ \ | |_|_|_|_|_|_|_|_|_|/ / / / / |/| | | | | | | | | | | | | |
| * | | | | | | | | | | | | | service/audio/audout_u: Only actually stop the audio stream in StopAudioOut if the stream is playingLioncash2019-03-071-1/+3
| | |_|_|_|_|_|/ / / / / / / | |/| | | | | | | | | | | |
* | | | | | | | | | | | | | Merge pull request #2055 from bunnei/gpu-threadbunnei2019-03-0726-52/+529
|\ \ \ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | | | gpu_thread: Fix deadlock with threading idle state check.bunnei2019-03-072-7/+11
| * | | | | | | | | | | | | | gpu_thread: (HACK) Ignore flush on FlushAndInvalidateRegion.bunnei2019-03-071-3/+1
| * | | | | | | | | | | | | | gpu: Always flush.bunnei2019-03-072-13/+6
| * | | | | | | | | | | | | | gpu: Refactor a/synchronous implementations into their own classes.bunnei2019-03-078-65/+162
| * | | | | | | | | | | | | | gpu: Move command processing to another thread.bunnei2019-03-079-15/+358
| * | | | | | | | | | | | | | bootmanager: Ensure that we have a context for shader loading.bunnei2019-03-071-4/+6
| * | | | | | | | | | | | | | gpu: Refactor command and swap buffers interface for asynch.bunnei2019-03-075-17/+26
| * | | | | | | | | | | | | | gpu: Refactor to take RendererBase instead of RasterizerInterface.bunnei2019-03-073-18/+23
| * | | | | | | | | | | | | | settings: Add new graphics setting for use_asynchronous_gpu_emulation.bunnei2019-03-077-0/+24
| * | | | | | | | | | | | | | core: Set is_powered_on before GPU is initialized.bunnei2019-03-071-1/+3
| |/ / / / / / / / / / / / /
* | | | | | | | | | | | | | Merge pull request #2149 from ReinUsesLisp/decoders-stylebunnei2019-03-078-150/+183
|\ \ \ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | | | gl_rasterizer_cache: Move format conversion to its own fileReinUsesLisp2019-02-277-136/+175
| * | | | | | | | | | | | | | decoders: Minor style changesReinUsesLisp2019-02-272-14/+8
| | |_|_|_|_|_|/ / / / / / / | |/| | | | | | | | | | | |
* | | | | | | | | | | | | | Merge pull request #2197 from lioncash/includebunnei2019-03-076-8/+12
|\ \ \ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | | | core/hle/ipc: Remove unnecessary includesLioncash2019-03-056-8/+12
| | |_|_|/ / / / / / / / / / | |/| | | | | | | | | | | |
* | | | | | | | | | | | | | Merge pull request #2190 from lioncash/ogl-globalbunnei2019-03-077-26/+28
|\ \ \ \ \ \ \ \ \ \ \ \ \ \ | |_|_|/ / / / / / / / / / / |/| | | | | | | | | | | | |
| * | | | | | | | | | | | | core/core: Remove the global telemetry accessor functionLioncash2019-03-041-4/+0
| * | | | | | | | | | | | | yuzu: Remove usage of the global telemetry accessorLioncash2019-03-042-3/+3
| * | | | | | | | | | | | | yuzu-cmd/yuzu: Replace direct usage of the global system telemetry accessor in main()Lioncash2019-03-041-1/+1
| * | | | | | | | | | | | | core/core: Replace direct usage of the global system telemetry accessor from Shutdown()Lioncash2019-03-041-7/+7
| * | | | | | | | | | | | | video_core/renderer_opengl: Replace direct usage of global system object accessorsLioncash2019-03-042-11/+17
| | |_|_|_|_|_|_|/ / / / / | |/| | | | | | | | | | |
* | | | | | | | | | | | | Merge pull request #2199 from lioncash/arbiterbunnei2019-03-067-115/+187
|\ \ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | | kernel/address_arbiter: Pass in system instance to constructorLioncash2019-03-056-26/+45
| * | | | | | | | | | | | | kernel/address_arbiter: Minor tidying upLioncash2019-03-051-18/+18
| * | | | | | | | | | | | | kernel/address_arbiter: Convert the address arbiter into a classLioncash2019-03-055-82/+135
| | |/ / / / / / / / / / / | |/| | | | | | | | | | |
* | | | | | | | | | | | | Merge pull request #2201 from lioncash/audio-retvalbunnei2019-03-061-0/+1
|\ \ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | | hle/service/audio/audout_u: Correct lack of return in failure case of AppendAudioOutBufferImpl()Lioncash2019-03-061-0/+1
| | |_|_|/ / / / / / / / / | |/| | | | | | | | | | |
* | | | | | | | | | | | | Merge pull request #2204 from lioncash/wait-treebunnei2019-03-062-5/+6
|\ \ \ \ \ \ \ \ \ \ \ \ \ | |/ / / / / / / / / / / / |/| | | | | | | | | | | |
| * | | | | | | | | | | | yuzu/debugger/wait_tree: Remove use of global CurrentProcess accessorLioncash2019-03-062-5/+6
| |/ / / / / / / / / / /
* | | | | | | | | | | | Merge pull request #2194 from lioncash/membunnei2019-03-063-30/+66
|\ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | vm_manager: Use range helpers in HeapAlloc() and HeapFree()Lioncash2019-03-041-4/+2
| * | | | | | | | | | | | vm_manager: Provide address range checking functions for other memory regionsLioncash2019-03-042-4/+35
| * | | | | | | | | | | | svc: Migrate address range checking functions to VMManagerLioncash2019-03-043-23/+30
| | |_|_|/ / / / / / / / | |/| | | | | | | | | |
* | | | | | | | | | | | Merge pull request #2200 from lioncash/audiobunnei2019-03-064-10/+21
|\ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | hle/service/audio: Extract audio error codes to a headerLioncash2019-03-054-10/+21
| | |/ / / / / / / / / / | |/| | | | | | | | | |
* | | | | | | | | | | | Merge pull request #2203 from lioncash/engines-includebunnei2019-03-0610-11/+11
|\ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | video_core/engines: Remove unnecessary includesLioncash2019-03-0610-11/+11
| |/ / / / / / / / / / /
* | | | | | | | | | | | video_core/surface: Remove obsolete TODO in PixelFormatFromRenderTargetFormat()Lioncash2019-03-051-2/+0
* | | | | | | | | | | | kernel/thread: Remove obsolete TODO in Create()Lioncash2019-03-051-2/+0
|/ / / / / / / / / / /
* | | | | | | | | | | Merge pull request #2185 from FearlessTobi/port-4630bunnei2019-03-051-6/+0
|\ \ \ \ \ \ \ \ \ \ \ | |/ / / / / / / / / / |/| | | | | | | | | |
| * | | | | | | | | | Memory: don't lock hle mutex in memory read/writeWeiyi Wang2019-03-021-6/+0
| |/ / / / / / / / /
* | | | | | | | | | Merge pull request #2165 from ReinUsesLisp/unbind-texbunnei2019-03-042-14/+2
|\ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | gl_rasterizer: Remove texture unbinding after dispatching a draw callReinUsesLisp2019-02-281-12/+0
| * | | | | | | | | | gl_state: Fixup multibind bugReinUsesLisp2019-02-281-2/+2
* | | | | | | | | | | Merge pull request #2188 from lioncash/log-staticbunnei2019-03-042-29/+25
|\ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | logging/backend: Make time_origin a class variable instead of a local staticLioncash2019-03-021-2/+1
| * | | | | | | | | | | logging/backend: Move CreateEntry into the Impl classLioncash2019-03-022-29/+26
* | | | | | | | | | | | Merge pull request #2189 from lioncash/webbunnei2019-03-042-3/+0
|\ \ \ \ \ \ \ \ \ \ \ \ | |_|_|_|_|/ / / / / / / |/| | | | | | | | | | |
| * | | | | | | | | | | web_service: Remove unnecessary inclusionsLioncash2019-03-022-3/+0
| | |_|/ / / / / / / / | |/| | | | | | | | |
* | | | | | | | | | | Merge pull request #2154 from FearlessTobi/port-4647Mat M2019-03-021-1/+4
|\ \ \ \ \ \ \ \ \ \ \ | |_|/ / / / / / / / / |/| | | | | | | | | |
| * | | | | | | | | | citra_qt/main: make SPEED_LIMIT_STEP static constexprfearlessTobi2019-03-021-1/+4
* | | | | | | | | | | Merge pull request #2183 from ReinUsesLisp/vk-buffer-cache-clangMat M2019-03-021-3/+3
|\ \ \ \ \ \ \ \ \ \ \ | |_|/ / / / / / / / / |/| | | | | | | | | |
| * | | | | | | | | | vk_buffer_cache: Fix clang-formatReinUsesLisp2019-03-021-3/+3
* | | | | | | | | | | Merge pull request #2182 from bunnei/my-wasted-fridaybunnei2019-03-021-1/+1
|\ \ \ \ \ \ \ \ \ \ \ | |/ / / / / / / / / / |/| | | | | | | | | |
| * | | | | | | | | | fuck git for ruining my day, I will learn but I will not forgivebunnei2019-03-021-1/+1
* | | | | | | | | | | Merge pull request #2178 from ReinUsesLisp/vk-buffer-cachebunnei2019-03-023-0/+205
|\ \ \ \ \ \ \ \ \ \ \ | |/ / / / / / / / / / |/| | | | | | | | | |
| * | | | | | | | | | vk_buffer_cache: Implement a buffer cacheReinUsesLisp2019-03-013-0/+205
| | |/ / / / / / / / | |/| | | | | | | |
* | | | | | | | | | Merge pull request #2173 from lioncash/capturebunnei2019-03-011-1/+1
|\ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | yuzu/compatdb: Remove unused lambda captureLioncash2019-02-271-1/+1
* | | | | | | | | | | Merge pull request #2180 from lioncash/audrenbunnei2019-03-011-1/+12
|\ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | service/audio: Provide an implementation of ExecuteAudioRendererRenderingLioncash2019-03-011-1/+12
| | |/ / / / / / / / / | |/| | | | | | | | |
* / | | | | | | | | | service/audio/audren_u: Implement OpenAudioRendererAutoLioncash2019-03-012-7/+20
|/ / / / / / / / / /
* | | | | | | | | | Merge pull request #2174 from lioncash/fwdbunnei2019-02-281-1/+1
|\ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | service/hid: Amend forward declaration of ServiceManagerLioncash2019-02-271-1/+1
| | |_|_|/ / / / / / | |/| | | | | | | |
* | | | | | | | | | Merge pull request #2152 from ReinUsesLisp/vk-stream-bufferbunnei2019-02-285-8/+172
|\ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | vk_stream_buffer: Remove copy code pathReinUsesLisp2019-02-262-53/+18
| * | | | | | | | | | vk_stream_buffer: Implement a stream bufferReinUsesLisp2019-02-243-1/+200
| * | | | | | | | | | vk_resource_manager: Minor VKFenceWatch changesReinUsesLisp2019-02-242-7/+7
* | | | | | | | | | | Merge pull request #2121 from FernandoS27/texception2bunnei2019-02-284-16/+213
|\ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | Devirtualize Register/Unregister and use a wrapper instead.Fernando Sahmkow2019-02-283-12/+8
| * | | | | | | | | | | Corrections and redesign.Fernando Sahmkow2019-02-282-51/+51
| * | | | | | | | | | | Fix linux compile error.Fernando Sahmkow2019-02-281-1/+1
| * | | | | | | | | | | Remove NotifyFrameBuffer as we are doing a texception pass every drawcall.Fernando Sahmkow2019-02-282-25/+0
| * | | | | | | | | | | Remove certain optimizations that caused texception to fail in certain scenarios.Fernando Sahmkow2019-02-283-24/+1
| * | | | | | | | | | | Bug fixes and formattingFernando Sahmkow2019-02-282-3/+4
| * | | | | | | | | | | rasterizer_cache_gl: Implement Texception PassFernando Sahmkow2019-02-283-0/+51
| * | | | | | | | | | | rasterizer_cache_gl: Implement Partial Reinterpretation of Surfaces.Fernando Sahmkow2019-02-282-0/+100
| * | | | | | | | | | | rasterizer_cache: mark reinterpreted surfaces and add ability to reload marked surfaces on next use.Fernando Sahmkow2019-02-282-0/+78
| * | | | | | | | | | | rasterizer_cache_gl: Notify on framebuffer changeFernando Sahmkow2019-02-282-4/+23
| * | | | | | | | | | | rasterizer_cache: Expose FlushObject to Child classes and allow redefining of Register and UnregisterFernando Sahmkow2019-02-281-11/+11
* | | | | | | | | | | | Merge pull request #2172 from lioncash/reorderbunnei2019-02-282-3/+3
|\ \ \ \ \ \ \ \ \ \ \ \ | |/ / / / / / / / / / / |/| | | | | | | | | | |
| * | | | | | | | | | | vk_memory_manager: Reorder constructor initializer list in terms of member declaration orderLioncash2019-02-271-1/+1
| * | | | | | | | | | | gl_rasterizer: Reorder constructor initializer list in terms of member declaration orderLioncash2019-02-271-2/+2
* | | | | | | | | | | | Merge pull request #2163 from ReinUsesLisp/bitset-dirtybunnei2019-02-284-52/+51
|\ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | maxwell_3d: Use std::bitset to manage dirty flagsReinUsesLisp2019-02-264-52/+51
| | |_|_|_|_|/ / / / / / | |/| | | | | | | | | |
* | | | | | | | | | | | Speed up memory page mapping (#2141)Annomatg2019-02-271-6/+11
* | | | | | | | | | | | audio_core/cubeb_sink: Ensure COM is initialized on Windows prior to calling cubeb_initLioncash2019-02-272-0/+19
| |_|_|/ / / / / / / / |/| | | | | | | | | |
* | | | | | | | | | | Merge pull request #2169 from lioncash/namingbunnei2019-02-272-19/+21
|\ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | audio_core/audio_renderer: Name previously unknown parameters of AudioRendererParameterLioncash2019-02-272-19/+21
| | |/ / / / / / / / / | |/| | | | | | | | |
* | | | | | | | | | | Merge pull request #2170 from lioncash/emu-windowbunnei2019-02-272-2/+2
|\ \ \ \ \ \ \ \ \ \ \ | |_|_|_|/ / / / / / / |/| | | | | | | | | |
| * | | | | | | | | | core/frontend/emu_window: Make ClipToTouchScreen a const member functionLioncash2019-02-272-2/+2
| |/ / / / / / / / /
* | | | | | | | | | Merge pull request #2161 from lioncash/handle-tablebunnei2019-02-276-19/+63
|\ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | kernel/handle_table: Make local variables as const where applicableLioncash2019-02-251-4/+5
| * | | | | | | | | | kernel/handle_table: Allow process capabilities to limit the handle table sizeLioncash2019-02-256-10/+54
| * | | | | | | | | | kernel/handle-table: In-class initialize data membersLioncash2019-02-252-3/+2
| * | | | | | | | | | kernel/handle_table: Resolve truncation warningsLioncash2019-02-251-2/+2
| | |_|_|_|/ / / / / | |/| | | | | | | |
* | | | | | | | | | Merge pull request #2167 from lioncash/namespacebunnei2019-02-2723-81/+81
|\ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | common/math_util: Move contents into the Common namespaceLioncash2019-02-2718-40/+40
| * | | | | | | | | | common/vector_math: Move Vec[x] types into the Common namespaceLioncash2019-02-276-38/+38
| * | | | | | | | | | common/quaternion: Move Quaternion into the Common namespaceLioncash2019-02-272-6/+6
| | |/ / / / / / / / | |/| | | | | | | |
* / | | | | | | | | gl_shader_disk_cache: Remove #pragma once from cpp fileLioncash2019-02-271-2/+0
|/ / / / / / / / /
* | / / / / / / / renderer_opengl: Update pixel format trackingReinUsesLisp2019-02-261-0/+1
| |/ / / / / / / |/| | | | | | |
* | | | | | | | Merge pull request #2156 from FreddyFunk/patch-1bunnei2019-02-261-1/+1
|\ \ \ \ \ \ \ \
| * | | | | | | | file_sys/vfs_vector: Fix ignored offset on WriteFrederic L2019-02-251-1/+1
| | |_|/ / / / / | |/| | | | | |
* | | | | | | | Merge pull request #2158 from lioncash/tablebunnei2019-02-261-0/+1
|\ \ \ \ \ \ \ \
| * | | | | | | | service/vi: Update IManagerDisplayService's function tableLioncash2019-02-251-0/+1
| | |/ / / / / / | |/| | | | | |
* | | | | | | | Merge pull request #2160 from lioncash/audio-warnbunnei2019-02-262-6/+6
|\ \ \ \ \ \ \ \
| * | | | | | | | audio_core/cubeb_sink: Initialize CubebSinkStream's last_frame data memberLioncash2019-02-251-1/+1
| * | | | | | | | audio_core/cubeb_sink: Add override specifier to destructorLioncash2019-02-251-1/+1
| * | | | | | | | audio_core/cubeb_sink: Resolve variable shadowing warnings in SamplesInQueueLioncash2019-02-251-2/+2
| * | | | | | | | audio_core/codec: Resolve truncation warnings within DecodeADPCMLioncash2019-02-251-2/+2
| |/ / / / / / /
* / / / / / / / shader/track: Resolve variable shadowing warningsLioncash2019-02-251-5/+5
|/ / / / / / /
* | | | | | | Merge pull request #2118 from FernandoS27/ipa-improvebunnei2019-02-256-38/+74
|\ \ \ \ \ \ \
| * | | | | | | shader_decompiler: Improve Accuracy of Attribute Interpolation.Fernando Sahmkow2019-02-146-38/+74
* | | | | | | | Merge pull request #2119 from FernandoS27/fix-copybunnei2019-02-251-1/+5
|\ \ \ \ \ \ \ \
| * | | | | | | | rasterizer_cache_gl: Only do fast layered copy on the same format. AsFernando Sahmkow2019-02-131-1/+5
* | | | | | | | | Merge pull request #2155 from FearlessTobi/port-4655bunnei2019-02-251-3/+3
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | Remove GCC version checkstgsm2019-02-241-3/+3
| | |_|/ / / / / / | |/| | | | | | |
* | | | | | | | | Merge pull request #2144 from lioncash/factorbunnei2019-02-257-67/+209
|\ \ \ \ \ \ \ \ \ | |/ / / / / / / / |/| | | | | | | |
| * | | | | | | | service/nvflinger: Store BufferQueue instances as regular data membersLioncash2019-02-227-36/+39
| * | | | | | | | service/vi/vi_layer: Convert Layer struct into a classLioncash2019-02-216-10/+43
| * | | | | | | | service/nvflinger: Move display specifics over to vi_displayLioncash2019-02-214-35/+141
* | | | | | | | | Merge pull request #2139 from degasus/dma_pusherbunnei2019-02-242-28/+34
|\ \ \ \ \ \ \ \ \ | |_|_|_|/ / / / / |/| | | | | | | |
| * | | | | | | | video_core/dma_pusher: Simplyfy Step() logic.Markus Wick2019-02-192-81/+77
| * | | | | | | | video_core/dma_pusher: The full list of headers at once.Markus Wick2019-02-192-48/+58
* | | | | | | | | Merge pull request #2146 from ReinUsesLisp/vulkan-schedulerbunnei2019-02-243-1/+132
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | vk_scheduler: Implement a schedulerReinUsesLisp2019-02-223-1/+132
* | | | | | | | | | Merge pull request #2150 from ReinUsesLisp/fixup-layer-swizzlebunnei2019-02-241-1/+1
|\ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | gl_rasterizer_cache: Fixup parameter order in layered swizzleReinUsesLisp2019-02-241-1/+1
| |/ / / / / / / / /
* / / / / / / / / / vk_memory_manager: Fixup commit interval allocationReinUsesLisp2019-02-241-2/+1
|/ / / / / / / / /
* | | | | | | | | Merge pull request #2138 from ReinUsesLisp/vulkan-memory-managerbunnei2019-02-223-0/+342
|\ \ \ \ \ \ \ \ \ | |_|/ / / / / / / |/| | | | | | | |
| * | | | | | | | vk_memory_manager: Implement memory managerReinUsesLisp2019-02-193-0/+342
| |/ / / / / / /
* | | | | | | | Merge pull request #2125 from ReinUsesLisp/fixup-glstatebunnei2019-02-211-83/+61
|\ \ \ \ \ \ \ \
| * | | | | | | | gl_state: Synchronize gl_state even when state is disabledReinUsesLisp2019-02-151-83/+61
* | | | | | | | | Merge pull request #2130 from lioncash/system_enginebunnei2019-02-219-23/+49
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | video_core: Remove usages of System::GetInstance() within the enginesLioncash2019-02-169-23/+49
| | |_|_|_|/ / / / | |/| | | | | | |
* | | | | | | | | Fixes Unicode Key File Directories (#2120)Jungy2019-02-211-1/+2
* | | | | | | | | service/nvflinger: Relocate definitions of Layer and Display to the vi serviceLioncash2019-02-207-57/+123
| |_|/ / / / / / |/| | | | | | |
* | | | | | | | Merge pull request #2122 from ReinUsesLisp/vulkan-resource-managerbunnei2019-02-193-1/+468
|\ \ \ \ \ \ \ \
| * | | | | | | | vk_resource_manager: Implement a command buffer pool with VKFencedPoolReinUsesLisp2019-02-142-1/+59
| * | | | | | | | vk_resource_manager: Add VKFencedPool interfaceReinUsesLisp2019-02-142-0/+83
| * | | | | | | | vk_resource_manager: Implement VKResourceManager and fence allocatorReinUsesLisp2019-02-142-0/+85
| * | | | | | | | vk_resource_manager: Implement VKFenceWatchReinUsesLisp2019-02-142-0/+68
| * | | | | | | | vk_resource_manager: Implement VKFenceReinUsesLisp2019-02-142-0/+131
| * | | | | | | | vk_resource_manager: Add VKResource interfaceReinUsesLisp2019-02-143-1/+43
* | | | | | | | | Merge pull request #2134 from lioncash/namingbunnei2019-02-172-2/+2
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | audio_core/buffer: Make const and non-const getter for samples consistentLioncash2019-02-162-2/+2
| | |/ / / / / / / | |/| | | | | | |
* | | | | | | | | Merge pull request #2133 from lioncash/arbiterbunnei2019-02-162-8/+4
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | address_arbiter: Use nested namespaces where applicableLioncash2019-02-162-8/+4
| |/ / / / / / / /
* | | | | | | | | Merge pull request #2127 from FearlessTobi/fix-screenshot-srgbbunnei2019-02-161-1/+2
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | renderer_opengl: respect the sRGB colorspace for the screenshot featurefearlessTobi2019-02-151-1/+2
| | |_|/ / / / / / | |/| | | | | | |
* | | | | | | | | Merge pull request #2128 from FearlessTobi/port-4197bunnei2019-02-163-12/+26
|\ \ \ \ \ \ \ \ \ | |_|/ / / / / / / |/| | | | | | | |
| * | | | | | | | Adressed review commentsB3n302019-02-152-7/+9
| * | | | | | | | threadsafe_queue: Add WaitIfEmpty and use it in loggingB3n302019-02-153-14/+26
| |/ / / / / / /
* | | | | | | | Merge pull request #2123 from lioncash/coretiming-globalJames Rowe2019-02-1653-412/+548
|\ \ \ \ \ \ \ \ | |/ / / / / / / |/| | | | | | |
| * | | | | | | core_timing: Convert core timing into a classLioncash2019-02-1653-412/+548
| |/ / / / / /
* | | | | | | Merge pull request #2112 from lioncash/shadowingbunnei2019-02-151-7/+13
|\ \ \ \ \ \ \
| * | | | | | | gl_rasterizer_cache: Remove unnecessary newlineLioncash2019-02-121-2/+0
| * | | | | | | gl_rasterizer_cache: Get rid of variable shadowingLioncash2019-02-121-6/+14
* | | | | | | | Merge pull request #2111 from ReinUsesLisp/fetch-fixbunnei2019-02-152-22/+35
|\ \ \ \ \ \ \ \ | |_|/ / / / / / |/| | | | | | |
| * | | | | | | gl_shader_decompiler: Re-implement TLDS lodReinUsesLisp2019-02-122-22/+35
* | | | | | | | Merge pull request #2113 from ReinUsesLisp/vulkan-basebunnei2019-02-146-0/+404
|\ \ \ \ \ \ \ \ | |_|_|_|/ / / / |/| | | | | | |
| * | | | | | | vk_device: Abstract device handling into a classReinUsesLisp2019-02-133-1/+351
| * | | | | | | renderer_vulkan: Add declarations fileReinUsesLisp2019-02-122-0/+52
| * | | | | | | logging: Add Vulkan backend logging class typeReinUsesLisp2019-02-122-0/+2
| |/ / / / / /
* | | | | | | Merge pull request #2115 from lioncash/localbunnei2019-02-141-3/+3
|\ \ \ \ \ \ \
| * | | | | | | core_timing: Make EmptyTimedCallback a local variableLioncash2019-02-131-3/+3
* | | | | | | | Merge pull request #2116 from lioncash/sizebunnei2019-02-142-21/+18
|\ \ \ \ \ \ \ \ | |_|_|_|/ / / / |/| | | | | | |
| * | | | | | | threadsafe_queue: Use std::size_t for representing sizeLioncash2019-02-131-7/+6
| * | | | | | | threadsafe_queue: Remove NeedSize template parameterLioncash2019-02-132-15/+13
| |/ / / / / /
* | | | | | | Merge pull request #2099 from greggameplayer/BGRA8-Framebuffer-Realbunnei2019-02-133-0/+4
|\ \ \ \ \ \ \ | |/ / / / / / |/| | | | | |
| * | | | | | Implement BGRA8 framebuffer formatgreggameplayer2019-02-093-0/+4
| | |/ / / / | |/| | | |
* | | | | | renderer_opengl: Remove reference to global system instanceLioncash2019-02-131-3/+3
* | | | | | Merge pull request #2110 from lioncash/namespacebunnei2019-02-1335-174/+172
|\ \ \ \ \ \
| * | | | | | core_timing: Rename CoreTiming namespace to Core::TimingLioncash2019-02-1235-174/+172
| |/ / / / /
* | | | | | Merge pull request #2104 from ReinUsesLisp/compute-assertbunnei2019-02-136-52/+59
|\ \ \ \ \ \ | |_|/ / / / |/| | | | |
| * | | | | kepler_compute: Fixup assert and rename enginesReinUsesLisp2019-02-106-52/+59
| | |_|/ / | |/| | |
* | | | | Merge pull request #2108 from FernandoS27/fix-ccbunnei2019-02-121-2/+2
|\ \ \ \ \
| * | | | | Fix incorrect value for CC bit in IADDFernando Sahmkow2019-02-111-2/+2
| | |/ / / | |/| | |
* | | | | Merge pull request #2109 from FernandoS27/fix-f2ibunnei2019-02-122-4/+4
|\ \ \ \ \
| * | | | | Corrected F2I None mode to RoundEven.Fernando Sahmkow2019-02-112-4/+4
| |/ / / /
* | | | | Merge pull request #2068 from ReinUsesLisp/shader-cleanup-texturesbunnei2019-02-123-153/+123
|\ \ \ \ \ | |/ / / / |/| | | |
| * | | | shader_ir: Remove F4 prefix to texture operationsReinUsesLisp2019-02-073-26/+25
| * | | | shader_ir: Clean texture management codeReinUsesLisp2019-02-073-133/+104
| |/ / /
* | | | Merge pull request #1904 from bunnei/better-fermi-copybunnei2019-02-097-72/+206
|\ \ \ \
| * | | | gl_rasterizer_cache: Mark surface copy destinations as modified.bunnei2019-02-072-4/+18
| * | | | gl_rasterizer: Implement a more accurate fermi 2D copy.bunnei2019-02-077-68/+188
* | | | | Merge pull request #2096 from FearlessTobi/patch-3bunnei2019-02-091-3/+3
|\ \ \ \ \
| * | | | | nvdisp_disp0: change drawing message log level from Warning to TraceTobias2019-02-081-3/+3
| | |/ / / | |/| | |
* | | | | Implement linear textures (#2089)Fernando Sahmkow2019-02-092-5/+39
* | | | | gl_rasterizer_cache: Fixup texture view parametersReinUsesLisp2019-02-081-2/+2
|/ / / /
* | | | Merge pull request #2083 from ReinUsesLisp/shader-ir-cbuf-trackingbunnei2019-02-0730-127/+141
|\ \ \ \ | |/ / / |/| | |
| * | | shader/track: Search inside of conditional nodesReinUsesLisp2019-02-031-0/+11
| * | | shader_ir: Rename BasicBlock to NodeBlockReinUsesLisp2019-02-0330-122/+120
| * | | shader_ir: Pass decoded nodes as a whole instead of per basic blocksReinUsesLisp2019-02-0327-57/+62
* | | | Merge pull request #2091 from FearlessTobi/port-4603bunnei2019-02-071-4/+10
|\ \ \ \
| * | | | gdbstub: only let Execute breakpoints write/restore BKPT opcodes into target memoryDimitri ALBORA2019-02-061-4/+10
* | | | | cmake: Fix title bar issueReinUsesLisp2019-02-071-1/+14
* | | | | gl_shader_disk_cache: Check LZ4 size limitFrederic L2019-02-071-0/+4
* | | | | gl_shader_disk_cache: Consider compressed size zero as an errorFrederic L2019-02-071-2/+2
* | | | | cmake: Use CMAKE_COMMAND instead of "cmake"Frederic L2019-02-071-1/+1
* | | | | gl_shader_disk_cache: Use unordered containersReinUsesLisp2019-02-074-56/+64
* | | | | gl_shader_cache: Fixup GLSL unique identifiersReinUsesLisp2019-02-072-3/+3
* | | | | loading_screen: Unchunk progress barReinUsesLisp2019-02-071-1/+3
* | | | | gl_shader_cache: Link loading screen with disk shader cache loadReinUsesLisp2019-02-0710-12/+62
* | | | | gl_shader_cache: Set GL_PROGRAM_SEPARABLE to dumped shadersReinUsesLisp2019-02-071-0/+1
* | | | | gl_shader_disk_cache: Pass core system as argument and guard against games without title idsReinUsesLisp2019-02-0711-18/+58
* | | | | gl_shader_disk_cache: Guard reads and writes against failureReinUsesLisp2019-02-072-216/+339
* | | | | gl_shader_disk_cache: Address miscellaneous feedbackReinUsesLisp2019-02-075-43/+57
* | | | | gl_shader_disk_cache: Pass return values returning instead of by parametersReinUsesLisp2019-02-073-39/+37
* | | | | gl_shader_disk_cache: Compress program binaries using LZ4ReinUsesLisp2019-02-071-7/+28
* | | | | gl_shader_disk_cache: Compress GLSL code using LZ4ReinUsesLisp2019-02-072-6/+57
* | | | | gl_shader_disk_cache: Save GLSL and entries into the precompiled fileReinUsesLisp2019-02-079-135/+234
* | | | | settings: Hide shader cache behind a settingReinUsesLisp2019-02-078-0/+42
* | | | | gl_shader_disk_cache: Invalidate shader cache changes with CMake hashReinUsesLisp2019-02-074-46/+72
* | | | | gl_shader_cache: Refactor to support disk shader cacheReinUsesLisp2019-02-072-121/+388
* | | | | gl_shader_disk_cache: Add transferable cache invalidationReinUsesLisp2019-02-072-0/+8
* | | | | gl_shader_disk_cache: Add precompiled loadReinUsesLisp2019-02-072-0/+45
* | | | | gl_shader_disk_cache: Add precompiled saveReinUsesLisp2019-02-072-0/+57
* | | | | gl_shader_disk_cache: Add transferable loadReinUsesLisp2019-02-072-0/+56
* | | | | gl_shader_disk_cache: Add transferable storesReinUsesLisp2019-02-072-0/+194
* | | | | gl_shader_disk_cache: Add ShaderDiskCacheOpenGL class and helpersReinUsesLisp2019-02-072-0/+76
* | | | | gl_shader_disk_cache: Add file and move BaseBindings declarationReinUsesLisp2019-02-074-10/+58
* | | | | gl_shader_decompiler: Remove name entriesReinUsesLisp2019-02-072-28/+10
* | | | | gl_shader_util: Add parameter to handle retrievable programsReinUsesLisp2019-02-073-6/+10
* | | | | rasterizer_interface: Add disk cache entry for the rasterizerReinUsesLisp2019-02-076-0/+17
* | | | | file_util: Add shader directoryReinUsesLisp2019-02-073-0/+3
* | | | | shader_decode: Implement LDG and basic cbuf trackingReinUsesLisp2019-02-071-0/+33
* | | | | Merge pull request #2042 from ReinUsesLisp/nouveau-texbunnei2019-02-0711-79/+82
|\ \ \ \ \
| * | | | | video_core: Assert on invalid GPU to CPU address queriesReinUsesLisp2019-02-038-47/+67
| * | | | | maxwell_3d: Allow sampler handles with TSC id zeroReinUsesLisp2019-02-031-10/+6
| * | | | | maxwell_3d: Allow texture handles with TIC id zeroReinUsesLisp2019-02-033-21/+7
| * | | | | memory_manager: Check for reserved page statusReinUsesLisp2019-02-031-1/+2
| | |/ / / | |/| | |
* | | | | Merge pull request #2071 from ReinUsesLisp/dsa-texturebunnei2019-02-078-216/+153
|\ \ \ \ \ | |_|/ / / |/| | | |
| * | | | gl_rasterizer_cache: Fixup test clauseReinUsesLisp2019-01-301-6/+5
| * | | | gl_rasterizer_cache: Guard clause swizzle testingMat M2019-01-301-1/+3
| * | | | gl_state: Remove texture target trackingReinUsesLisp2019-01-302-5/+0
| * | | | gl_rasterizer_cache: Move swizzling to textures instead of stateReinUsesLisp2019-01-306-28/+35
| * | | | gl_state: Use DSA and multi bind to update texture bindingsReinUsesLisp2019-01-301-8/+22
| * | | | gl_rasterizer: Use DSA for texturesReinUsesLisp2019-01-305-185/+105
* | | | | Merge pull request #2057 from FearlessTobi/port-4586bunnei2019-02-062-7/+15
|\ \ \ \ \
| * | | | | Use QPixmap/QIcon for background color selection buttonxperia642019-01-262-7/+15
* | | | | | Merge pull request #2086 from FearlessTobi/port-4583bunnei2019-02-061-6/+10
|\ \ \ \ \ \
| * | | | | | Fix crash when no files are selectedxperia642019-02-051-6/+6
| * | | | | | Add file extension to screenshot filename if not providedxperia642019-02-051-3/+7
| | |_|_|/ / | |/| | | |
* | | | | | Merge pull request #2087 from lioncash/constbunnei2019-02-064-50/+136
|\ \ \ \ \ \
| * | | | | | service/nvflinger,service/vi: Handle failure cases with exposed APILioncash2019-02-064-47/+133
| * | | | | | service/nvflinger: Mark FindVsyncEvent() as a const member functionLioncash2019-02-052-2/+2
| * | | | | | service/nvflinger: Rename GetVsyncEvent() to FindVsyncEvent()Lioncash2019-02-053-3/+3
| |/ / / / /
* | | | | | Merge pull request #2088 from jroweboy/hbunnei2019-02-061-1/+4
|\ \ \ \ \ \
| * | | | | | QT: Fix the loading screen 'H' switch logo to not glitch outJames Rowe2019-02-061-1/+4
| | |/ / / / | |/| | | |
* | | | | | Merge pull request #2085 from ReinUsesLisp/cube-minus-onebunnei2019-02-051-1/+1
|\ \ \ \ \ \ | |_|/ / / / |/| | | | |
| * | | | | video_core/texture: Fix BitField size for depth_minus_oneReinUsesLisp2019-02-051-1/+1
* | | | | | Merge pull request #2081 from ReinUsesLisp/lmem-64bunnei2019-02-052-15/+46
|\ \ \ \ \ \ | |/ / / / / |/| | | | |
| * | | | | shader_ir/memory: Add ST_L 64 and 128 bits storesReinUsesLisp2019-02-031-3/+11
| * | | | | shader_ir/memory: Add LD_L 128 bits loadsReinUsesLisp2019-02-031-7/+19
| * | | | | shader_bytecode: Rename BytesN enums to BitsNReinUsesLisp2019-02-032-7/+7
| * | | | | shader_ir/memory: Add LD_L 64 bits loadsReinUsesLisp2019-02-031-6/+17
| | |_|/ / | |/| | |
* | | | | Merge pull request #2082 from FernandoS27/txq-stlbunnei2019-02-052-6/+13
|\ \ \ \ \ | |/ / / / |/| | | |
| * | | | Update src/video_core/engines/shader_bytecode.hMat M2019-02-041-1/+1
| * | | | Fix TXQ not using the component mask.Fernando Sahmkow2019-02-032-6/+13
* | | | | Merge pull request #2074 from ReinUsesLisp/shader-ir-unify-offsetbunnei2019-02-0117-25/+36
|\ \ \ \ \
| * | | | | shader_ir: Unify constant buffer offset valuesReinUsesLisp2019-01-3017-25/+36
* | | | | | Merge pull request #2073 from lioncash/opusbunnei2019-02-011-42/+75
|\ \ \ \ \ \
| * | | | | | hwopus: Implement DecodeInterleavedLioncash2019-01-301-4/+35
| * | | | | | hwopus: Deduplicate the decoding code within DecodeInterleavedOld and DecodeInterleavedWithPerfOldLioncash2019-01-301-19/+14
| * | | | | | hwopus: Replace std::optional<std::reference_wrapper<u64>> with u64*Lioncash2019-01-301-9/+6
| * | | | | | hwopus: Mark local variables as const where applicableLioncash2019-01-301-8/+16
| * | | | | | hwopus: Fill in the rest of the unknown service function namesLioncash2019-01-301-9/+11
| |/ / / / /
* | | | | | Merge pull request #2067 from ReinUsesLisp/workaround-fbbunnei2019-02-012-14/+19
|\ \ \ \ \ \
| * | | | | | gl_rasterizer: Workaround invalid zeta clearsReinUsesLisp2019-01-302-14/+19
* | | | | | | Merge pull request #2078 from lioncash/timerbunnei2019-02-019-259/+0
|\ \ \ \ \ \ \
| * | | | | | | kernel: Remove the Timer classLioncash2019-02-019-259/+0
| | |_|/ / / / | |/| | | | |
* | | | | | | rasterizer_interface: Remove unused AccelerateFill operationReinUsesLisp2019-02-013-11/+0
* | | | | | | video_core: Remove unused Fill surface typeReinUsesLisp2019-02-012-6/+1
|/ / / / / /
* | | | | | Merge pull request #2072 from lioncash/servicebunnei2019-01-3112-153/+281
|\ \ \ \ \ \
| * | | | | | service/ns: Update function tablesLioncash2019-01-301-14/+20
| * | | | | | service/ncm: Update function tablesLioncash2019-01-301-4/+4
| * | | | | | service/audio: Update function tablesLioncash2019-01-304-8/+23
| * | | | | | service/am/applet_ae: Update function tablesLioncash2019-01-301-1/+2
| * | | | | | service/fsp-srv: Update function tablesLioncash2019-01-302-17/+25
| * | | | | | service/btm: Update function tablesLioncash2019-01-301-55/+97
| * | | | | | service/btdrv: Update function tablesLioncash2019-01-301-46/+101
| * | | | | | service/psc: Update function tablesLioncash2019-01-301-8/+9
| |/ / / / /
* | | | | | Merge pull request #2077 from lioncash/virtbunnei2019-01-315-15/+3
|\ \ \ \ \ \
| * | | | | | kernel/wait_object: Devirtualize functions related to manipulating the thread list directlyLioncash2019-01-301-3/+3
| * | | | | | kernel/timer: Remove unnecessary WakeupAllWaitingThreads() overrideLioncash2019-01-302-6/+0
| * | | | | | kernel/readable_event: Remove unnecessary WakeupAllWaitingThreads() overrideLioncash2019-01-302-6/+0
* | | | | | | Merge pull request #2075 from lioncash/findbunnei2019-01-313-23/+47
|\ \ \ \ \ \ \ | |/ / / / / / |/| | | | | |
| * | | | | | service/nvflinger: Make FindBufferQueueId() a const member functionLioncash2019-01-302-2/+26
| * | | | | | service/nvflinger: Rename Get prefix on function to FindLioncash2019-01-303-23/+23
| | |/ / / / | |/| | | |
* | | | | | Merge pull request #2076 from lioncash/encHexagon122019-01-301-1/+1
|\ \ \ \ \ \ | |_|_|_|/ / |/| | | | |
| * | | | | video_core/dma_pusher: Silence C4828 warningsLioncash2019-01-301-1/+1
| |/ / / /
* | | | | Merge pull request #1485 from FernandoS27/render-infobunnei2019-01-302-2/+57
|\ \ \ \ \ | |/ / / / |/| | | |
| * | | | Add more info into textures' object labelsFernandoS272018-12-092-2/+57
* | | | | Merge pull request #2070 from ReinUsesLisp/cubearray-viewbunnei2019-01-304-3/+28
|\ \ \ \ \
| * | | | | gl_shader_cache: Fix texture view for cubemaps as cubemap arraysReinUsesLisp2019-01-304-3/+28
| | |/ / / | |/| | |
* | | | | Merge pull request #2069 from lioncash/vibunnei2019-01-302-21/+20
|\ \ \ \ \
| * | | | | nvflinger: Add the Null displayLioncash2019-01-301-1/+2
| * | | | | nvflinger: Change log message in OpenDisplay to be a debug log instead of a warningLioncash2019-01-301-1/+1
| * | | | | nvflinger: Remove unnecessary header inclusionsLioncash2019-01-301-2/+0
| * | | | | nvflinger: Mark locals const where applicableLioncash2019-01-301-11/+11
| * | | | | nvflinger: Use a std::array for the available displays instead of std::vectorLioncash2019-01-302-7/+7
| |/ / / /
* | | | | gl_shader_cache: Use explicit bindingsReinUsesLisp2019-01-307-249/+194
* | | | | gl_rasterizer: Implement global memory managementReinUsesLisp2019-01-306-4/+140
* | | | | shader_decode: Implement LDG and basic cbuf trackingReinUsesLisp2019-01-307-10/+240
* | | | | video_core/GPU Implemented the GPU PFIFO puller semaphore operations. (#1908)Kevin2019-01-302-12/+242
|/ / / /
* | | | hle/ipc_helpers: Fix clang-format warningsLioncash2019-01-301-1/+0
* | | | hle/ipc_helpers: Allow pushing signed valuesLioncash2019-01-291-0/+22
* | | | Merge pull request #2063 from lioncash/pessimizingbunnei2019-01-292-6/+6
|\ \ \ \
| * | | | shader/shader_ir: Amend three comment typosLioncash2019-01-281-3/+3
| * | | | shader/shader_ir: Amend constructor initializer ordering for AbufNodeLioncash2019-01-281-2/+2
| * | | | shader/decode: Avoid a pessimizing std::move within DecodeRange()Lioncash2019-01-281-1/+1
* | | | | service/pm: Implement SetMaintenanceBoot()Lioncash2019-01-281-1/+10
* | | | | service/pm: Tidy up functionality related to SystemBootModeLioncash2019-01-282-2/+9
* | | | | service/vi: Remove stubbed notifier from SetLayerVisibilityLioncash2019-01-281-2/+3
|/ / / /
* | | | Merge pull request #2060 from lioncash/exceptionbunnei2019-01-271-0/+4
|\ \ \ \
| * | | | kernel/svc: Log out uncaught C++ exceptions from svcBreakLioncash2019-01-271-0/+4
* | | | | Merge pull request #2058 from ReinUsesLisp/trunc-warningbunnei2019-01-271-3/+4
|\ \ \ \ \
| * | | | | video_core: Silent implicit conversion warningReinUsesLisp2019-01-261-3/+4
| |/ / / /
* / / / / dsp_interface: fix sound being played while volume is 0fearlessTobi2019-01-261-1/+1
|/ / / /
* | | | Merge pull request #1927 from ReinUsesLisp/shader-irbunnei2019-01-2639-3808/+5497
|\ \ \ \ | |_|/ / |/| | |
| * | | shader_ir: Fixup clang buildReinUsesLisp2019-01-161-4/+6
| * | | gl_shader_decompiler: replace std::get<> with std::get_if<> for macOS compatibilityReinUsesLisp2019-01-151-44/+58
| * | | gl_shader_decompiler: Inline textureGather componentReinUsesLisp2019-01-151-15/+16
| * | | shader_decode: Fixup XMADReinUsesLisp2019-01-151-1/+1
| * | | shader_ir: Pass to decoder functions basic block's codeReinUsesLisp2019-01-1527-82/+83
| * | | shader_decode: Improve zero flag implementationReinUsesLisp2019-01-1515-75/+79
| * | | shader_ir: Remove composite primitives and use temporals insteadReinUsesLisp2019-01-154-241/+224
| * | | gl_shader_decompiler: Fixup AssignCompositeHalfReinUsesLisp2019-01-151-1/+1
| * | | shader_decode: Use proper primitive namesReinUsesLisp2019-01-154-25/+21
| * | | shader_decode: Use BitfieldExtract instead of shift + andReinUsesLisp2019-01-158-48/+37
| * | | shader_ir: Remove Ipa primitiveReinUsesLisp2019-01-153-13/+2
| * | | gl_shader_decompiler: Use rasterizer's UBO size limitReinUsesLisp2019-01-151-1/+3
| * | | gl_shader_gen: Fixup code formattingReinUsesLisp2019-01-152-18/+22
| * | | video_core: Rename glsl_decompiler to gl_shader_decompilerReinUsesLisp2019-01-157-7/+7
| * | | shader_ir: Remove RZ and use Register::ZeroIndex insteadReinUsesLisp2019-01-153-12/+16
| * | | shader_decode: Implement TEXS.F16ReinUsesLisp2019-01-153-15/+57
| * | | shader_decode: Fixup R2PReinUsesLisp2019-01-151-2/+3
| * | | glsl_decompiler: Fixup TLDSReinUsesLisp2019-01-151-1/+0
| * | | glsl_decompiler: Fixup geometry shadersReinUsesLisp2019-01-152-15/+17
| * | | shader_decode: Fixup WriteLogicOperation zero comparisonReinUsesLisp2019-01-151-1/+1
| * | | glsl_decompiler: Fixup permissive member function declarationsReinUsesLisp2019-01-151-133/+133
| * | | shader_decode: Fixup PSETReinUsesLisp2019-01-151-2/+3
| * | | shader_decode: Fixup clang-formatReinUsesLisp2019-01-152-2/+4
| * | | video_core: Implement IR based geometry shadersReinUsesLisp2019-01-154-10/+102
| * | | shader_decode: Implement VMAD and VSETPReinUsesLisp2019-01-155-2/+129
| * | | shader_decode: Implement HSET2ReinUsesLisp2019-01-153-1/+50
| * | | shader_decode: Rework HSETP2ReinUsesLisp2019-01-154-47/+57
| * | | shader_decode: Implement R2PReinUsesLisp2019-01-151-1/+28
| * | | shader_decode: Implement CSETPReinUsesLisp2019-01-151-14/+37
| * | | shader_decode: Implement PSETReinUsesLisp2019-01-151-1/+16
| * | | shader_decode: Implement HFMA2ReinUsesLisp2019-01-154-5/+60
| * | | glsl_decompiler: Remove HNegate inliningReinUsesLisp2019-01-151-10/+0
| * | | shader_decode: Implement POPCReinUsesLisp2019-01-154-1/+22
| * | | shader_decode: Implement TLDS (untested)ReinUsesLisp2019-01-153-10/+92
| * | | shader_decode: Update TLD4 reflecting #1862 changesReinUsesLisp2019-01-152-52/+52
| * | | shader_ir: Fixup TEX and TEXS and partially fix TLD4 decompilingReinUsesLisp2019-01-153-60/+72
| * | | shader_decode: Fixup FSETReinUsesLisp2019-01-151-2/+2
| * | | shader_decode: Implement IADD32IReinUsesLisp2019-01-151-0/+11
| * | | shader_decode: Fixup clang-formatReinUsesLisp2019-01-151-1/+1
| * | | video_core: Return safe values after an assert hitsReinUsesLisp2019-01-158-8/+19
| * | | shader_decode: Implement FFMAReinUsesLisp2019-01-151-1/+36
| * | | video_core: Address feedbackReinUsesLisp2019-01-154-13/+16
| * | | shader_ir: Fixup file inclusions and clang-formatReinUsesLisp2019-01-153-2/+2
| * | | shader_ir: Move comment node stringMat M2019-01-151-2/+2
| * | | shader_ir: Address feedback to avoid UB in bit castingReinUsesLisp2019-01-151-2/+4
| * | | shader_decode: Fixup clang-formatReinUsesLisp2019-01-152-3/+2
| * | | shader_decode: Implement LEAReinUsesLisp2019-01-151-0/+55
| * | | shader_decode: Implement IADD3ReinUsesLisp2019-01-151-0/+61
| * | | shader_decode: Implement LOP3ReinUsesLisp2019-01-152-0/+62
| * | | shader_decode: Implement ST_LReinUsesLisp2019-01-151-0/+17
| * | | shader_decode: Implement LD_LReinUsesLisp2019-01-151-0/+18
| * | | shader_decode: Implement HSETP2ReinUsesLisp2019-01-151-1/+37
| * | | shader_decode: Implement HADD2 and HMUL2ReinUsesLisp2019-01-151-1/+48
| * | | shader_decode: Implement HADD2_IMM and HMUL2_IMMReinUsesLisp2019-01-151-1/+28
| * | | shader_decode: Implement MOV_SYSReinUsesLisp2019-01-151-0/+27
| * | | shader_decode: Implement IMNMXReinUsesLisp2019-01-151-0/+16
| * | | shader_decode: Implement F2F_CReinUsesLisp2019-01-151-2/+10
| * | | shader_decode: Implement I2IReinUsesLisp2019-01-151-0/+26
| * | | shader_decode: Implement BRA internal flagReinUsesLisp2019-01-151-4/+8
| * | | shader_decode: Implement ISCADDReinUsesLisp2019-01-151-0/+15
| * | | shader_decode: Implement XMADReinUsesLisp2019-01-151-1/+85
| * | | shader_decode: Implement PBK and BRKReinUsesLisp2019-01-151-1/+22
| * | | shader_decode: Implement LOPReinUsesLisp2019-01-151-0/+15
| * | | shader_decode: Implement SELReinUsesLisp2019-01-151-0/+8
| * | | shader_decode: Implement IADDReinUsesLisp2019-01-151-1/+28
| * | | shader_decode: Implement ISETPReinUsesLisp2019-01-151-1/+30
| * | | shader_decode: Implement BFIReinUsesLisp2019-01-151-1/+22
| * | | shader_decode: Implement ISETReinUsesLisp2019-01-151-1/+27
| * | | shader_decode: Implement LD_CReinUsesLisp2019-01-151-0/+31
| * | | shader_decode: Implement SHLReinUsesLisp2019-01-151-0/+8
| * | | shader_decode: Implement SHRReinUsesLisp2019-01-151-1/+26
| * | | shader_decode: Implement LOP32IReinUsesLisp2019-01-152-1/+72
| * | | shader_decode: Implement BFEReinUsesLisp2019-01-151-1/+25
| * | | shader_decode: Implement FSETReinUsesLisp2019-01-151-1/+36
| * | | shader_decode: Implement F2IReinUsesLisp2019-01-151-0/+37
| * | | shader_decode: Implement I2FReinUsesLisp2019-01-151-0/+23
| * | | shader_decode: Implement F2FReinUsesLisp2019-01-151-1/+37
| * | | shader_decode: Stub DEPBARReinUsesLisp2019-01-151-0/+4
| * | | shader_decode: Implement SSY and SYNCReinUsesLisp2019-01-151-0/+19
| * | | shader_decode: Implement PSETPReinUsesLisp2019-01-151-1/+21
| * | | shader_decode: Implement TMMLReinUsesLisp2019-01-151-3/+45
| * | | shader_decode: Implement TEX and TXQReinUsesLisp2019-01-152-0/+223
| * | | shader_decode: Implement TEXS (F32)ReinUsesLisp2019-01-152-0/+217
| * | | shader_decode: Implement FSETPReinUsesLisp2019-01-151-1/+33
| * | | shader_decode: Partially implement BRAReinUsesLisp2019-01-151-0/+12
| * | | shader_decode: Implement IPAReinUsesLisp2019-01-151-0/+12
| * | | shader_decode: Implement EXITReinUsesLisp2019-01-151-1/+32
| * | | shader_decode: Implement ST_AReinUsesLisp2019-01-151-0/+30
| * | | shader_decode: Implement LD_AReinUsesLisp2019-01-151-1/+39
| * | | shader_decode: Implement FADD32IReinUsesLisp2019-01-151-0/+12
| * | | shader_decode: Implement FMUL32_IMMReinUsesLisp2019-01-151-0/+10
| * | | shader_decode: Implement MOV32_IMMReinUsesLisp2019-01-151-1/+9
| * | | shader_decode: Stub RRO_C, RRO_R and RRO_IMMReinUsesLisp2019-01-151-0/+9
| * | | shader_decode: Implement FMNMX_C, FMNMX_R and FMNMX_IMMReinUsesLisp2019-01-151-0/+18
| * | | shader_decode: Implement MUFUReinUsesLisp2019-01-151-0/+29
| * | | shader_decode: Implement FADD_C, FADD_R and FADD_IMMReinUsesLisp2019-01-151-0/+15
| * | | shader_decode: Implement FMUL_C, FMUL_R and FMUL_IMMReinUsesLisp2019-01-151-0/+42
| * | | shader_decode: Implement MOV_C and MOV_RReinUsesLisp2019-01-151-1/+23
| * | | video_core: Replace gl_shader_decompilerReinUsesLisp2019-01-158-4185/+57
| * | | glsl_decompiler: ImplementationReinUsesLisp2019-01-153-0/+1483
| * | | shader_ir: Add condition code helperReinUsesLisp2019-01-152-0/+13
| * | | shader_ir: Add predicate combiner helperReinUsesLisp2019-01-152-0/+15
| * | | shader_ir: Add comparison helpersReinUsesLisp2019-01-152-0/+106
| * | | shader_ir: Add half float helpersReinUsesLisp2019-01-152-0/+44
| * | | shader_ir: Add integer helpersReinUsesLisp2019-01-152-0/+40
| * | | shader_ir: Add float helpersReinUsesLisp2019-01-152-0/+24
| * | | shader_ir: Add settersReinUsesLisp2019-01-152-0/+24
| * | | shader_ir: Add local memory gettersReinUsesLisp2019-01-152-0/+7
| * | | shader_ir: Add internal flag gettersReinUsesLisp2019-01-152-0/+10
| * | | shader_ir: Add attribute gettersReinUsesLisp2019-01-152-0/+26
| * | | shader_ir: Add constant buffer gettersReinUsesLisp2019-01-152-0/+25
| * | | shader_ir: Add register getterReinUsesLisp2019-01-152-0/+9
| * | | shader_ir: Add immediate node constructorsReinUsesLisp2019-01-152-1/+34
| * | | shader_ir: Initial implementationReinUsesLisp2019-01-1530-0/+1573
| * | | shader_bytecode: Fixup encodingReinUsesLisp2019-01-151-1/+1
| * | | shader_header: Make local memory size getter constantReinUsesLisp2019-01-151-1/+1
* | | | Merge pull request #2054 from bunnei/scope-context-refactorbunnei2019-01-247-36/+54
|\ \ \ \
| * | | | frontend: Refactor ScopeAcquireWindowContext out of renderer_opengl.bunnei2019-01-247-36/+54
* | | | | citra_qt: Log settings on launchzhupengfei2019-01-225-0/+35
|/ / / /
* | | | maxwell_3d: Set rt_separate_frag_data to 1 by defaultReinUsesLisp2019-01-222-4/+6
* | | | Merge pull request #2035 from lioncash/fwd-declbunnei2019-01-217-17/+14
|\ \ \ \ | |_|_|/ |/| | |
| * | | yuzu/configuration/configure_input_player: Forward declare types where applicableLioncash2019-01-172-2/+7
| * | | yuzu/configuration/configure_touchscreen_advanced: Remove unnecessary header inclusionsLioncash2019-01-171-2/+0
| * | | yuzu/configuration/configure_per_general: Remove unused header inclusionsLioncash2019-01-172-4/+3
| * | | yuzu/configuration/configure_debug: Remove unused header inclusionsLioncash2019-01-171-1/+0
| * | | yuzu/configuration/configure_system: Remove unused header inclusionsLioncash2019-01-171-8/+4
| |/ /
* | | Change const char* to const char[]James Rowe2019-01-211-4/+4
* | | Fix mingw compile error and warningsJames Rowe2019-01-212-6/+6
* | | Add fade out effect to the loading screenJames Rowe2019-01-214-94/+158
* | | Set Minimum Size to the same as renderwindowJames Rowe2019-01-211-0/+1
* | | Remove blue box around loading screenJames Rowe2019-01-211-1/+0
* | | Change the background color of Stage Complete to yuzu blueJames Rowe2019-01-211-1/+1
* | | Rename step 1 and step 2 to be a little more descriptiveJames Rowe2019-01-212-8/+8
* | | Prevent estimated time from flashing after slow shader compilation startsJames Rowe2019-01-211-1/+1
* | | Move progress bar style into constexpr stringsJames Rowe2019-01-211-28/+32
* | | Hide progress bar on Prepare stepJames Rowe2019-01-201-7/+8
* | | QT: Upgrade the Loading Bar to look much betterJames Rowe2019-01-204-11/+201
* | | Merge pull request #2034 from jroweboy/loading-widgetbunnei2019-01-208-10/+258
|\ \ \
| * | | Add a workaround if QMovie isn't availableJames Rowe2019-01-202-1/+20
| * | | QT Frontend: Add a Loading screen with progressbarJames Rowe2019-01-208-10/+239
* | | | Merge pull request #2008 from ReinUsesLisp/dirty-framebuffersbunnei2019-01-206-8/+78
|\ \ \ \
| * | | | gl_rasterizer: Skip framebuffer configuration if rendertargets have not been changedReinUsesLisp2019-01-072-1/+31
| * | | | gl_rasterizer_cache: Use dirty flags for the depth bufferReinUsesLisp2019-01-074-3/+23
| * | | | gl_rasterizer_cache: Use dirty flags for color buffersReinUsesLisp2019-01-074-4/+24
* | | | | Merge pull request #2002 from ReinUsesLisp/dsa-vao-bufferbunnei2019-01-209-103/+73
|\ \ \ \ \
| * | | | | gl_rasterizer: Workaround Intel VAO DSA bugReinUsesLisp2019-01-093-7/+16
| * | | | | gl_stream_buffer: Use DSA for buffer managementReinUsesLisp2019-01-063-17/+14
| * | | | | gl_rasterizer: Use DSA for vertex array objectsReinUsesLisp2019-01-066-79/+53
| * | | | | gl_state: Drop uniform buffer state trackingReinUsesLisp2019-01-063-10/+0
* | | | | | Merge pull request #2032 from lioncash/webbunnei2019-01-201-6/+5
|\ \ \ \ \ \
| * | | | | | yuzu/configuration/configure_web: Remove an unused lambda captureLioncash2019-01-171-5/+4
| * | | | | | yuzu/configuration/configure_web: Use an ellipsis with 'Verifying' textLioncash2019-01-171-1/+1
| | |_|_|/ / | |/| | | |
* | | | | | Merge pull request #2025 from DarkLordZach/loader-banner-logobunnei2019-01-2011-0/+77
|\ \ \ \ \ \ | |_|_|_|/ / |/| | | | |
| * | | | | loader: Propagate NCA logo section to ReadBanner and ReadLogoZach Hilman2019-01-159-0/+61
| * | | | | content_archive: Add getter for logo section of NCAZach Hilman2019-01-152-0/+16
| |/ / / /
* | | | | Merge pull request #2031 from lioncash/privbunnei2019-01-197-26/+36
|\ \ \ \ \
| * | | | | core/frontend/applets/web_browser: Include missing headersLioncash2019-01-171-2/+8
| * | | | | core/frontend/applets/web_browser: Make OpenPage() non-constLioncash2019-01-177-20/+25
| * | | | | yuzu/web_browser: std::move std::function instances in OpenPage()Lioncash2019-01-171-2/+2
| * | | | | yuzu/web_browser: Make slot functions privateLioncash2019-01-171-2/+1
| |/ / / /
* | | | | Merge pull request #2033 from ReinUsesLisp/fixup-clip-warningbunnei2019-01-191-1/+1
|\ \ \ \ \
| * | | | | gl_rasterizer: Silent unsafe mix warningReinUsesLisp2019-01-181-1/+1
| |/ / / /
* / / / / file_sys/directory: Remove unused DirectoryBackend classLioncash2019-01-181-23/+0
|/ / / /
* | | | audio_core: remove unnecessary spaces on commentsOtávio Pace2019-01-141-2/+2
* | | | Merge pull request #1848 from FreddyFunk/QJsonArraybunnei2019-01-121-2/+2
|\ \ \ \
| * | | | game_list: Remove a reference of a referenceFrederic Laing2018-12-031-2/+2
* | | | | Merge pull request #1959 from DarkLordZach/custom-rtcbunnei2019-01-108-39/+120
|\ \ \ \ \
| * | | | | settings: Fix comment structureZach Hilman2019-01-082-5/+7
| * | | | | settings: Use std::chrono::seconds instead of s64 for RTCZach Hilman2019-01-086-17/+21
| * | | | | time: Use custom RTC settings if applicable for gameZach Hilman2019-01-082-8/+12
| * | | | | core: Set custom RTC differential on game bootZach Hilman2019-01-081-0/+7
| * | | | | qt: Provide UI to edit custom RTC settingsZach Hilman2019-01-082-28/+66
| * | | | | settings: Add custom RTC settingsZach Hilman2019-01-084-4/+30
* | | | | | Merge pull request #1939 from DarkLordZach/web-appletbunnei2019-01-1025-586/+1343
|\ \ \ \ \ \
| * | | | | | travis: Use correct package for linux Qt5WebEngineZach Hilman2018-12-293-4/+3
| * | | | | | web_browser: Add bounds checking to applet interfaceZach Hilman2018-12-2910-146/+160
| * | | | | | main: Add main window integrations for QtWebBrowserAppletZach Hilman2018-12-283-0/+168
| * | | | | | qt: Implement Qt frontend to web browserZach Hilman2018-12-282-0/+154
| * | | | | | core: Add getter and setter for WebBrowserApplet frontendZach Hilman2018-12-284-2/+22
| * | | | | | frontend: Add frontend responder for web browserZach Hilman2018-12-282-0/+52
| * | | | | | applets: Implement LibAppletOff (Web) appletZach Hilman2018-12-284-0/+234
| * | | | | | loader: Add accessor for Manual RomFSZach Hilman2018-12-285-0/+30
| * | | | | | hid: Make Hid service accessible and add GetPressStateZach Hilman2018-12-284-459/+540
| * | | | | | romfs: Add SingleDiscard extraction typeZach Hilman2018-12-282-2/+6
| * | | | | | am: Add size parameter to am:IStorage loggingZach Hilman2018-12-281-4/+4
* | | | | | | gl_global_cache: Add dummy global cache managerReinUsesLisp2019-01-085-3/+96
| |/ / / / / |/| | | | |
* | | | | | Merge pull request #1999 from ReinUsesLisp/dirty-shaderbunnei2019-01-075-2/+23
|\ \ \ \ \ \ | | |_|_|/ / | |/| | | |
| * | | | | gl_shader_cache: Use dirty flags for shadersReinUsesLisp2019-01-075-2/+23
| | |_|/ / | |/| | |
* | | | | Merge pull request #1989 from lioncash/setbunnei2019-01-071-39/+58
|\ \ \ \ \
| * | | | | service/vi: Correct scaling mode conversionsLioncash2019-01-051-15/+13
| * | | | | service/vi: Factor out scaling mode conversions from the IPC function itselfLioncash2019-01-051-17/+21
| * | | | | service/vi: Unstub IApplicationDisplayService' SetLayerScalingMode()Lioncash2019-01-051-21/+38
* | | | | | Merge pull request #1992 from DarkLordZach/move-profile-manager-uibunnei2019-01-079-427/+565
|\ \ \ \ \ \
| * | | | | | qt: Move profile manager to own UI tabZach Hilman2019-01-049-427/+565
| |/ / / / /
* | | | | | Merge pull request #1990 from ReinUsesLisp/copy-surface-stream-copybunnei2019-01-071-1/+1
|\ \ \ \ \ \ | |_|/ / / / |/| | | | |
| * | | | | gl_rasterizer_cache: Use GL_STREAM_COPY for PBOsReinUsesLisp2019-01-051-1/+1
* | | | | | Merge pull request #1988 from lioncash/resbunnei2019-01-051-12/+8
|\ \ \ \ \ \ | |/ / / / / |/| | | | |
| * | | | | service/vi: Correct reported dimensions from IApplicationDisplayService's GetDisplayResolution()Lioncash2019-01-051-12/+8
| |/ / / /
* | | | | Merge pull request #1981 from ogniK5377/open-app-area-createbunnei2019-01-051-4/+4
|\ \ \ \ \
| * | | | | Return no application area when games try to open an application areaDavid Marcec2019-01-041-4/+4
* | | | | | Merge pull request #1980 from ogniK5377/applet-msg-updatebunnei2019-01-051-1/+10
|\ \ \ \ \ \ | |_|/ / / / |/| | | | |
| * | | | | Proper no message handling for AM::PopMessageDavid Marcec2019-01-041-1/+10
| |/ / / /
* | | | | Removed pulse event typeDavid Marcec2019-01-044-9/+0
* | | | | Merge pull request #1975 from lioncash/vibunnei2019-01-041-4/+15
|\ \ \ \ \
| * | | | | service/vi: Correct initial width and height valuesLioncash2019-01-021-2/+2
| * | | | | service/vi: Document unknown DisplayInfo struct membersLioncash2019-01-021-2/+13
* | | | | | Fixed botw deadlock(and possibly 30 fps games rendering too fast? needs testing to confirm)David Marcec2019-01-031-1/+1
| |/ / / / |/| | | |
* | | | | Merge pull request #1976 from lioncash/displaybunnei2019-01-031-4/+17
|\ \ \ \ \
| * | | | | service/vi: Implement OpenDefaultDisplay in terms of OpenDisplayLioncash2019-01-031-4/+17
| |/ / / /
* | | | | Merge pull request #1978 from lioncash/enabledbunnei2019-01-031-1/+10
|\ \ \ \ \
| * | | | | service/vi: Implement SetDisplayEnabled()Lioncash2019-01-031-1/+10
* | | | | | Merge pull request #1942 from DarkLordZach/profile-select-game-bootbunnei2019-01-036-0/+32
|\ \ \ \ \ \
| * | | | | | qt: Add setting to prompt for user on game bootZach Hilman2018-12-256-0/+32
* | | | | | | Merge pull request #1941 from DarkLordZach/profile-select-save-databunnei2019-01-031-22/+16
|\ \ \ \ \ \ \ | |_|/ / / / / |/| | | | | |
| * | | | | | qt: Use ProfileSelectionDialog when selecting user for save dataZach Hilman2018-12-251-22/+16
| |/ / / / /
* | | | | | Merge pull request #1977 from lioncash/vi-logbunnei2019-01-031-63/+74
|\ \ \ \ \ \
| * | | | | | service/vi: Log more information where applicableLioncash2019-01-031-63/+74
| | |/ / / / | |/| | | |
* | | | | | Merge pull request #1961 from ReinUsesLisp/tex-view-2dbunnei2019-01-023-14/+74
|\ \ \ \ \ \
| * | | | | | gl_rasterizer_cache: Texture view if shader samples array but OGL is notReinUsesLisp2018-12-303-14/+74
| | |/ / / / | |/| | | |
* | | | | | Merge pull request #1944 from FearlessTobi/port-4187bunnei2019-01-023-59/+124
|\ \ \ \ \ \
| * | | | | | Qt/Configure: Use sidebar to divide tabs into smaller groupsspycrab2018-12-283-59/+124
| |/ / / / /
* | | | | | Merge pull request #1969 from lioncash/castbunnei2019-01-022-3/+3
|\ \ \ \ \ \
| * | | | | | yuzu/configure_general: Silence truncation warnings in loadConfiguration()Lioncash2019-01-011-2/+2
| * | | | | | yuzu/config: Silence truncation warningsLioncash2019-01-011-1/+1
| | |/ / / / | |/| | | |
* / | | | | core/kernel: Remove unnecessary inclusionsLioncash2019-01-0116-16/+22
|/ / / / /
* | | | | Merge pull request #1966 from lioncash/backtracebunnei2018-12-312-7/+8
|\ \ \ \ \
| * | | | | arm_interface: Make include path relative for arm_interface.hLioncash2018-12-311-1/+1
| * | | | | arm_interface: Make LogBacktrace() a const member functionLioncash2018-12-312-2/+2
| * | | | | arm_interface: Mark variables as const where applicable in LogBacktrace()Lioncash2018-12-311-3/+4
| * | | | | arm_interface: Remove unnecessary semicolonLioncash2018-12-311-1/+1
* | | | | | kernel/svc: Correct misleading error message within CreateThread()Lioncash2018-12-311-2/+3
* | | | | | kernel/svc: Sanitize core number and thread priorities in CreateThread()Lioncash2018-12-311-6/+17
* | | | | | kernel/process: Rename GetAllowedProcessorMask() and GetAllowedThreadPriorityMask()Lioncash2018-12-312-11/+11
* | | | | | kernel/svc: Simplify thread core ID sanitizing in CreateThreadLioncash2018-12-311-7/+1
|/ / / / /
* | | | | Merge pull request #1956 from lioncash/process-threadSebastian Valle2018-12-316-59/+53
|\ \ \ \ \
| * | | | | kernel/process: Start the main thread using the specified ideal coreLioncash2018-12-281-2/+2
| * | | | | kernel: Rename 'default' CPU core to 'ideal' coreLioncash2018-12-285-23/+23
| * | | | | kernel/thread: Move process thread initialization into process.cppLioncash2018-12-283-36/+30
* | | | | | Merge pull request #1847 from ogniK5377/backtrace-breakbunnei2018-12-306-1/+41
|\ \ \ \ \ \
| * | | | | | Moved log backtrace to arm_interface.cpp. Added printing of error code to fatalDavid Marcec2018-12-294-18/+36
| * | | | | | Moved backtrace to ArmInterfaceDavid Marcec2018-12-198-47/+20
| * | | | | | Moved backtrace to ArmInterfaceDavid Marcec2018-12-036-14/+39
| * | | | | | Print backtrace on svcBreakDavid Marcec2018-12-033-0/+24
| | |_|_|/ / | |/| | | |
* | | | | | Merge pull request #1964 from lioncash/timebunnei2018-12-302-14/+18
|\ \ \ \ \ \
| * | | | | | service/time: Minor cleanup to GetClockSnapshot()Lioncash2018-12-301-7/+9
| * | | | | | service/time: Fill in some structures and remove padding where not necessaryLioncash2018-12-302-7/+9
* | | | | | | gpu: Remove PixelFormat G8R8U and G8R8S, as they do not seem to exist.bunnei2018-12-284-79/+46
|/ / / / / /
* | | | | | Merge pull request #1958 from lioncash/audiobunnei2018-12-283-10/+6
|\ \ \ \ \ \ | |_|_|_|/ / |/| | | | |
| * | | | | audio_core: Convert LOG_CRITICAL + UNREACHABLE over to UNIMPLEMENTED/UNIMPLEMENTED_MSGLioncash2018-12-283-10/+6
| | |/ / / | |/| | |
* | | | | Merge pull request #1954 from lioncash/npdmbunnei2018-12-281-3/+7
|\ \ \ \ \
| * | | | | file_sys/program_metadata: Print out more descriptive address space descriptionsLioncash2018-12-281-3/+7
| |/ / / /
* / / / / kernel/process: Remove most allocation functions from Process' interfaceLioncash2018-12-284-49/+35
|/ / / /
* | | | Add missing uintBitsToFloat to SetRegisterToHalfFloatRodolfo Bogado2018-12-271-2/+2
* | | | Merge pull request #1928 from lioncash/capsbunnei2018-12-2714-125/+732
|\ \ \ \
| * | | | kernel/process: Hook up the process capability parser to the process itselfLioncash2018-12-217-122/+44
| * | | | kernel/process_capability: Handle debug capability flagsLioncash2018-12-212-1/+18
| * | | | kernel/process_capability: Handle handle table capability flagsLioncash2018-12-212-1/+11
| * | | | kernel/process_capability: Handle kernel version capability flagsLioncash2018-12-212-1/+18
| * | | | kernel/process_capability: Handle program capability flagsLioncash2018-12-213-2/+29
| * | | | kernel/process_capability: Handle interrupt capability flagsLioncash2018-12-211-1/+21
| * | | | kernel/process_capability: Handle syscall capability flagsLioncash2018-12-212-1/+29
| * | | | kernel/process_capability: Handle the priority mask and core mask flagsLioncash2018-12-212-1/+40
| * | | | kernel/process: Introduce process capability parsing skeletonLioncash2018-12-215-3/+468
| * | | | common: Add basic bit manipulation utility function to CommonLioncash2018-12-212-0/+62
* | | | | Merge pull request #1892 from Tinob/masterbunnei2018-12-271-113/+122
|\ \ \ \ \
| * | | | | Apply CC test to the final value to be stored in the registerRodolfo Bogado2018-12-261-9/+12
| * | | | | Includde saturation in the evaluation of the control codeRodolfo Bogado2018-12-221-3/+4
| * | | | | Handle RZ cases evaluating the expression instead of the register value.Rodolfo Bogado2018-12-221-14/+22
| * | | | | complete emulation of ZeroFlagRodolfo Bogado2018-12-221-100/+97
* | | | | | Merge pull request #1929 from bunnei/fix-hidbunnei2018-12-271-44/+163
|\ \ \ \ \ \
| * | | | | | hid: Fix SetNpadJoyHoldType and improve logging.bunnei2018-12-211-44/+163
* | | | | | | Merge pull request #1945 from bunnei/fix-hid-horizbunnei2018-12-271-46/+0
|\ \ \ \ \ \ \
| * | | | | | | npad: Remove code to invert input in horizontal mode.bunnei2018-12-261-46/+0
| | |_|_|_|/ / | |/| | | | |
* | | | | | | Merge pull request #1949 from lioncash/unmapbunnei2018-12-271-0/+1
|\ \ \ \ \ \ \
| * | | | | | | kernel/vm_manager: Reset region attributes when unmapping a VMALioncash2018-12-271-0/+1
* | | | | | | | am: Implement GetSaveDataSize and ExtendSaveDataZach Hilman2018-12-276-8/+53
* | | | | | | | filesystem: Populate save data sizes from control dataZach Hilman2018-12-272-0/+53
* | | | | | | | savedata_factory: Partially implement IVFC save sizes using filesZach Hilman2018-12-272-0/+38
* | | | | | | | loader: Add accessor for game control dataZach Hilman2018-12-275-9/+14
* | | | | | | | control_metadata: Update NACP fields with latest Switchbrew dataZach Hilman2018-12-272-6/+29
* | | | | | | | control_metadata: Use value member instead of unique_ptr to store structZach Hilman2018-12-272-10/+13
* | | | | | | | vfs: Add reinterpret_casts to WriteArray and ObjectZach Hilman2018-12-271-2/+2
* | | | | | | | Merge pull request #1946 from lioncash/declbunnei2018-12-271-1/+1
|\ \ \ \ \ \ \ \
| * | | | | | | | renderer_opengl: Correct forward declaration of FramebufferLayoutLioncash2018-12-261-1/+1
* | | | | | | | | Merge pull request #1948 from lioncash/translatablebunnei2018-12-271-2/+2
|\ \ \ \ \ \ \ \ \ | |_|/ / / / / / / |/| | | | | | | |
| * | | | | | | | configure_per_general: Mark UI strings as translatable in the constructorLioncash2018-12-261-2/+2
| |/ / / / / / /
* / / / / / / / configure_input_simple: Make input profile array constexprLioncash2018-12-261-12/+7
|/ / / / / / /
* | | | | | | Fixed shader linking error due to TLDS (#1934)David2018-12-261-1/+1
* | | | | | | Merge pull request #1849 from encounter/svcSetThreadActivitybunnei2018-12-265-6/+77
|\ \ \ \ \ \ \
| * | | | | | | debugger: Set paused thread colorLuke Street2018-12-041-1/+2
| * | | | | | | svc: Implement SetThreadActivity (thread suspension)Luke Street2018-12-045-6/+76
* | | | | | | | shader_bytecode: Fixup TEXS.F16 encodingReinUsesLisp2018-12-261-1/+1
| |/ / / / / / |/| | | | | |
* | | | | | | Merge pull request #1886 from FearlessTobi/port-4164bunnei2018-12-2315-43/+228
|\ \ \ \ \ \ \
| * | | | | | | yuzu, video_core: Screenshot functionalityzhupengfei2018-12-1815-43/+228
| | |_|_|_|_|/ | |/| | | | |
* | | | | | | Merge pull request #1930 from lioncash/commonbunnei2018-12-231-1/+1
|\ \ \ \ \ \ \
| * | | | | | | common/quaternion: Ensure that w is always initializedLioncash2018-12-211-1/+1
| | |_|_|/ / / | |/| | | | |
* | | | | | | Merge pull request #1781 from DarkLordZach/applet-profile-selectbunnei2018-12-2313-0/+466
|\ \ \ \ \ \ \
| * | | | | | | applets: Correct event ResetTypes from OneShot to StickyZach Hilman2018-12-035-14/+6
| * | | | | | | qt: Implement GUI dialog frontend for ProfileSelectorZach Hilman2018-12-036-0/+269
| * | | | | | | am: Use ProfileSelect appletZach Hilman2018-12-031-0/+4
| * | | | | | | applets: Implement ProfileSelect appletZach Hilman2018-12-032-0/+130
| * | | | | | | qt: Register to use Qt ProfileSelector instead of defaultZach Hilman2018-12-031-0/+2
| * | | | | | | core: Add getter/setter for ProfileSelector in SystemZach Hilman2018-12-032-0/+16
| * | | | | | | frontend: Add frontend applet for ProfileSelectZach Hilman2018-12-033-0/+48
| * | | | | | | software_keyboard: Signal state changed event upon constructionZach Hilman2018-12-031-1/+6
* | | | | | | | Merge pull request #1780 from DarkLordZach/controller-profilesbunnei2018-12-2312-66/+401
|\ \ \ \ \ \ \ \ | |_|/ / / / / / |/| | | | | | |
| * | | | | | | configure_input_simple: Properly signal docked mode changeZach Hilman2018-12-053-33/+31
| * | | | | | | configure_input: Add ConfigureInputSimple as default input UI configZach Hilman2018-12-058-1/+293
| * | | | | | | configure_input: Convert into QDialogZach Hilman2018-12-053-7/+47
| * | | | | | | configure: Use ConfigureInputSimple for Input tabZach Hilman2018-12-051-26/+26
| * | | | | | | ui_settings: Add UI setting for input profile indexZach Hilman2018-12-052-0/+5
* | | | | | | | Merge pull request #1921 from ogniK5377/no-unitbunnei2018-12-2114-3/+34
|\ \ \ \ \ \ \ \
| * | | | | | | | hopefully fix clang format issueDavid Marcec2018-12-191-0/+1
| * | | | | | | | Fixed uninitialized memory due to missing returns in canaryDavid Marcec2018-12-1914-3/+33
* | | | | | | | | Merge pull request #1920 from heapo/texture_format_selectionbunnei2018-12-211-1/+11
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | Texture format fixes: Flag RGBA16UI as GL_RGBA_INTEGER format, and interpret R16U as Z16 when depth_compare is enabled.heapo2018-12-181-1/+11
| |/ / / / / / / /
* | | | | | | | | Merge pull request #1925 from lioncash/pidbunnei2018-12-217-28/+59
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | kernel/svc: Handle thread handles within GetProcessIdLioncash2018-12-191-10/+23
| * | | | | | | | | kernel/kernel: Use correct initial PID for userland Process instancesLioncash2018-12-192-4/+14
| * | | | | | | | | kernel/svc: Correct output parameter for svcGetThreadIdLioncash2018-12-191-1/+1
| * | | | | | | | | kernel/thread: Make thread_id a 64-bit valueLioncash2018-12-194-7/+7
| * | | | | | | | | kernel/svc: Correct output parameter for svcGetProcessIdLioncash2018-12-192-2/+10
| * | | | | | | | | kernel/process: Make process_id a 64-bit valueLioncash2018-12-193-6/+6
* | | | | | | | | | Merge pull request #1914 from lioncash/idbunnei2018-12-211-2/+5
|\ \ \ \ \ \ \ \ \ \ | |_|_|_|_|_|_|/ / / |/| | | | | | | | |
| * | | | | | | | | service/am: Unstub GetAppletResourceUserIdLioncash2018-12-181-2/+5
| |/ / / / / / / /
* | | | | | | | | Merge pull request #1923 from ogniK5377/nfp-device-listbunnei2018-12-191-2/+2
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | Device handle should not be a random id, instead it's the current npad idDavid Marcec2018-12-191-2/+2
| | |/ / / / / / / | |/| | | | | | |
* | | | | | | | | Merge pull request #1909 from heapo/shadow_sampling_fixesbunnei2018-12-191-16/+14
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | Fix arrayed shadow sampler array slice/depth comparison ordering, as well as invalid GLSL LOD selection.heapo2018-12-171-16/+14
| | |/ / / / / / / | |/| | | | | | |
* | | | | | | | | Merge pull request #1915 from lioncash/smbunnei2018-12-191-4/+5
|\ \ \ \ \ \ \ \ \ | |_|_|_|_|_|_|/ / |/| | | | | | | |
| * | | | | | | | service/sm: Improve debug log for RegisterServiceLioncash2018-12-191-4/+5
| |/ / / / / / /
* | | | | | | | Merge pull request #1907 from lioncash/attributebunnei2018-12-193-14/+279
|\ \ \ \ \ \ \ \ | |_|/ / / / / / |/| | | | | | |
| * | | | | | | svc: Implement svcSetMemoryAttributeLioncash2018-12-191-5/+46
| * | | | | | | vm_manager: Add member function for setting memory attributes across an address rangeLioncash2018-12-192-0/+41
| * | | | | | | vm_manager: Add member function for checking a memory range adheres to certain attributes, permissions and statesLioncash2018-12-192-0/+100
| * | | | | | | vm_manager: Rename meminfo_state to stateLioncash2018-12-162-10/+9
| * | | | | | | vm_manager: Add backing functionality for memory attributesLioncash2018-12-162-1/+85
* | | | | | | | Merge pull request #1913 from MerryMage/default-fpcrbunnei2018-12-181-0/+3
|\ \ \ \ \ \ \ \
| * | | | | | | | kernel/thread: Set default fpcrMerryMage2018-12-181-0/+3
| | |/ / / / / / | |/| | | | | |
* | | | | | | | Merge pull request #1918 from MerryMage/cntfrqbunnei2018-12-181-0/+1
|\ \ \ \ \ \ \ \
| * | | | | | | | arm_dynarmic: Set CNTFRQ valueMerryMage2018-12-181-0/+1
| |/ / / / / / /
* | | | | | | | Merge pull request #1917 from ReinUsesLisp/fixup-halfbunnei2018-12-181-1/+1
|\ \ \ \ \ \ \ \
| * | | | | | | | shader_bytecode: Fixup half float's operator B encodingReinUsesLisp2018-12-181-1/+1
* | | | | | | | | Merge pull request #1889 from DarkLordZach/swkbd-state-changedbunnei2018-12-183-6/+4
|\ \ \ \ \ \ \ \ \ | |/ / / / / / / / |/| | | | | | | |
| * | | | | | | | applets: Correct usage of SignalStateChanged eventZach Hilman2018-12-103-6/+4
| | |_|_|_|/ / / | |/| | | | | |
* | | | | | | | Merge pull request #1903 from heapo/fmul_postfactorbunnei2018-12-182-5/+21
|\ \ \ \ \ \ \ \ | |_|/ / / / / / |/| | | | | | |
| * | | | | | | Implement postfactor multiplication/division for fmul instructionsheapo2018-12-172-5/+21
* | | | | | | | Merge pull request #1905 from bunnei/ignore-empty-gpu-listsbunnei2018-12-151-0/+4
|\ \ \ \ \ \ \ \
| * | | | | | | | nvhost_gpu: Skip empty GPU command lists.bunnei2018-12-151-0/+4
* | | | | | | | | Merge pull request #1901 from jschmer/ServiceLeakbunnei2018-12-152-10/+12
|\ \ \ \ \ \ \ \ \ | |_|_|_|/ / / / / |/| | | | | | | |
| * | | | | | | | Fix Service object leak on emulation stopJens Schmer2018-12-132-10/+12
* | | | | | | | | Merge pull request #1732 from DarkLordZach/yield-typesbunnei2018-12-155-9/+181
|\ \ \ \ \ \ \ \ \ | |_|/ / / / / / / |/| | | | | | | |
| * | | | | | | | svc: Avoid incorrect fast yield conditionZach Hilman2018-12-051-6/+1
| * | | | | | | | scheduler: Avoid manual Reschedule callZach Hilman2018-12-042-11/+11
| * | | | | | | | scheduler: Only work steal higher priority threads from other coresZach Hilman2018-12-033-35/+24
| * | | | | | | | svc: Avoid performance-degrading unnecessary rescheduleZach Hilman2018-12-022-8/+6
| * | | | | | | | scheduler: Add explanations for YieldWith and WithoutLoadBalancingZach Hilman2018-11-226-79/+141
| * | | | | | | | svc: Implement yield types 0 and -1Zach Hilman2018-11-196-2/+130
* | | | | | | | | Merge pull request #1902 from lioncash/audiobunnei2018-12-157-36/+58
|\ \ \ \ \ \ \ \ \ | |_|_|/ / / / / / |/| | | | | | | |
| * | | | | | | | audio_core: Make g_sink_details internally linkedLioncash2018-12-137-36/+58
* | | | | | | | | Merge pull request #1899 from lioncash/statebunnei2018-12-147-84/+188
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | svc: Enable svcQueryProcessMemoryLioncash2018-12-122-1/+6
| * | | | | | | | | svc: Write out the complete MemoryInfo structure in QueryProcessMemoryLioncash2018-12-121-0/+3
| * | | | | | | | | svc: Handle memory writing explicitly within QueryProcessMemoryLioncash2018-12-122-26/+22
| * | | | | | | | | vm_manager: Correct ordering of last two struct members of MemoryInfoLioncash2018-12-121-2/+2
| * | | | | | | | | vm_manager: Amend the returned values for invalid memory queries in QueryMemory()Lioncash2018-12-122-4/+7
| * | | | | | | | | vm_manager: Migrate memory querying to the VMManager interfaceLioncash2018-12-124-18/+33
| * | | | | | | | | vm_manager: Migrate MemoryInfo and PageInfo to vm_manager.hLioncash2018-12-123-17/+16
| * | | | | | | | | vm_manager: Amend MemoryState enum membersLioncash2018-12-125-28/+111
| |/ / / / / / / /
* | | | | | | | | Merge pull request #1871 from lioncash/movebunnei2018-12-142-2/+2
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | yuzu/wait_tree: Pass QString by value and std::move in the initializer list for WaitTreeTextLioncash2018-12-062-2/+2
| | |_|_|_|/ / / / | |/| | | | | | |
* | | | | | | | | Merge pull request #1900 from lioncash/wrapperbunnei2018-12-141-1/+1
|\ \ \ \ \ \ \ \ \ | |_|_|_|/ / / / / |/| | | | | | | |
| * | | | | | | | svc_wrap: Correct register index for a wrapper specializationLioncash2018-12-121-1/+1
| | |/ / / / / / | |/| | | | | |
* | | | | | | | Fix Process object leak on emulation stopJens Schmer2018-12-123-13/+12
* | | | | | | | Merge pull request #1891 from DarkLordZach/istorage-getsizeMat M2018-12-121-2/+15
|\ \ \ \ \ \ \ \
| * | | | | | | | fsp_srv: Implement IStorage::GetSizeZach Hilman2018-12-101-2/+15
| | |_|_|/ / / / | |/| | | | | |
* | | | | | | | Merge pull request #1893 from lioncash/warnbunnei2018-12-121-3/+3
|\ \ \ \ \ \ \ \
| * | | | | | | | gl_shader_cache: Dehardcode constant in CalculateProgramSize()Lioncash2018-12-111-2/+2
| * | | | | | | | gl_shader_cache: Resolve truncation compiler warningLioncash2018-12-111-1/+1
| | |/ / / / / / | |/| | | | | |
* | | | | | | | Merge pull request #1895 from lioncash/uninitbunnei2018-12-121-4/+3
|\ \ \ \ \ \ \ \
| * | | | | | | | patch_manager: Prevent use of a dangling pointer within PatchRomFSLioncash2018-12-111-4/+3
| |/ / / / / / /
* | | | | | | | Merge pull request #1877 from heapo/audio_interpbunnei2018-12-112-4/+8
|\ \ \ \ \ \ \ \
| * | | | | | | | Avoid (expensive) audio interpolation when sample rates already matchheapo2018-12-062-4/+8
* | | | | | | | | Merge pull request #1888 from marcosvitali/glFrontFacingbunnei2018-12-111-1/+1
|\ \ \ \ \ \ \ \ \ | |_|/ / / / / / / |/| | | | | | | |
| * | | | | | | | gl_shader_decompiler: IPA FrontFacing: the right value when is the front face is 0xFFFFFFFF.Marcos Vitali2018-12-101-1/+1
* | | | | | | | | Merge pull request #1846 from lioncash/dirbunnei2018-12-111-2/+2
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | file_sys/directory: Amend path buffer size for directory entriesLioncash2018-12-031-2/+2
| | |_|_|_|_|_|_|/ | |/| | | | | | |
* | | | | | | | | Merge pull request #1819 from DarkLordZach/disable-addonsbunnei2018-12-1123-15/+691
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | qt: Add Properties menu to game list right-clickZach Hilman2018-12-049-22/+54
| * | | | | | | | | qt: Add UI to display game properties and disable add-onsZach Hilman2018-12-034-0/+501
| * | | | | | | | | loader: Add support for reading the name of game's developerZach Hilman2018-12-035-0/+26
| * | | | | | | | | aoc_u: Obey disabled add-ons list when listing DLCZach Hilman2018-12-031-0/+12
| * | | | | | | | | patch_manager: Obey disabled add-ons list when patching gameZach Hilman2018-12-032-11/+50
| * | | | | | | | | core: Make GetGameFileFromPath function externally accessibleZach Hilman2018-12-032-3/+9
| * | | | | | | | | config: Store and load disabled add-ons listZach Hilman2018-12-033-0/+55
| * | | | | | | | | settings: Store list of disabled add-ons per title IDZach Hilman2018-12-031-0/+5
| | |_|_|_|_|_|/ / | |/| | | | | | |
* | | | | | | | | Merge pull request #1887 from FearlessTobi/port-4476bunnei2018-12-111-8/+4
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | web_service: move telemetry condition from TelemetrySession constructor to destructorfearlessTobi2018-12-081-8/+4
| | |_|/ / / / / / | |/| | | | | | |
* | | | | | | | | Merge pull request #1883 from lioncash/log-fspbunnei2018-12-111-1/+10
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | service/fsp_srv: Correct returned value in GetGlobalAccessLogMode()Lioncash2018-12-101-1/+10
* | | | | | | | | | Merge pull request #1885 from lioncash/data_idbunnei2018-12-111-1/+3
|\ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | file_sys/save_data_factory: Update SaveDataSpaceId enumLioncash2018-12-081-1/+3
| |/ / / / / / / / /
* | | | | | | | | | Merge pull request #1740 from FernandoS27/shader_propsbunnei2018-12-104-0/+57
|\ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | Implemented a shader unique identifier.Fernando Sahmkow2018-12-094-0/+57
| | |_|_|_|_|/ / / / | |/| | | | | | | |
* | | | | | | | | | Merge pull request #1872 from lioncash/proc-infoHexagon122018-12-101-0/+1
|\ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | kernel/process: Set ideal core from metadataLioncash2018-12-051-0/+1
| | |_|_|_|_|_|/ / / | |/| | | | | | | |
* | | | | | | | | | Merge pull request #1880 from DarkLordZach/cache-storageHexagon122018-12-101-1/+7
|\ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | savedata_factory: Add support for CacheStorageZach Hilman2018-12-071-0/+2
| * | | | | | | | | | savedata_factory: Delete TemporaryStorage on startupZach Hilman2018-12-071-1/+5
| | |/ / / / / / / / | |/| | | | | | | |
* | | | | | | | | | Merge pull request #1876 from lioncash/vmabunnei2018-12-105-28/+41
|\ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | memory: Convert ASSERT into a DEBUG_ASSERT within GetPointerFromVMA()Lioncash2018-12-061-1/+1
| * | | | | | | | | | vm_manager: Make vma_map privateLioncash2018-12-065-28/+41
* | | | | | | | | | | Merge pull request #1862 from marcosvitali/tldsbunnei2018-12-101-106/+134
|\ \ \ \ \ \ \ \ \ \ \ | |_|_|_|_|/ / / / / / |/| | | | | | | | | |
| * | | | | | | | | | gl_shader_decompiler: TLDS/TLD4/TLD4S Reworked reflecting the source registers, bugs fixed and modularize.Marcos Vitali2018-12-071-106/+134
| | |/ / / / / / / / | |/| | | | | | | |
* | | | | | | | | | Merge pull request #1864 from lioncash/nrrbunnei2018-12-081-4/+5
|\ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | service/ldr: Amend layout of the NRO headerLioncash2018-12-051-3/+3
| * | | | | | | | | | service/ldr: Corrent padding within the NRR header layoutLioncash2018-12-051-1/+2
* | | | | | | | | | | Merge pull request #1874 from lioncash/bindingsbunnei2018-12-082-19/+8
|\ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | hle/service: Replace log + UNIMPLEMENTED with UNIMPLEMENTED_MSGLioncash2018-12-061-2/+1
| * | | | | | | | | | | hle/service: Remove unnecessary using declarationsLioncash2018-12-061-5/+1
| * | | | | | | | | | | hle/service, hle/sm: Compress usages of MakeResult()Lioncash2018-12-062-3/+3
| * | | | | | | | | | | hle/service, hle/sm: Use structured bindings where applicableLioncash2018-12-062-9/+3
| | |_|/ / / / / / / / | |/| | | | | | | | |
* | | | | | | | | | | Merge pull request #1882 from FearlessTobi/backport-4418-fixbunnei2018-12-081-2/+2
|\ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | Backport review comment from citra-emu/citra#4418Tobias2018-12-071-2/+2
| | |_|/ / / / / / / / | |/| | | | | | | | |
* | | | | | | | | | | Merge pull request #1873 from lioncash/constbunnei2018-12-0811-19/+25
|\ \ \ \ \ \ \ \ \ \ \ | |/ / / / / / / / / / |/| | | | | | | | | |
| * | | | | | | | | | yuzu/game_list_worker: Don't retrieve the file type twice in AddFstEntriesToGameList()Lioncash2018-12-051-5/+9
| * | | | | | | | | | yuzu/game_list_worker: Don't retrieve file type and file type strings twice in MakeGameListEntry()Lioncash2018-12-051-4/+6
| * | | | | | | | | | loaders: Make GetFileType() a const qualified member functionLioncash2018-12-0510-10/+10
| | |_|/ / / / / / / | |/| | | | | | | |
* | | | | | | | | | Merge pull request #1868 from lioncash/configbunnei2018-12-061-43/+38
|\ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | configuration/config: Use an intermediary variable for accessing playersLioncash2018-12-051-43/+38
| |/ / / / / / / / /
* | | | | | | | | | Merge pull request #1875 from DarkLordZach/oss-ngword2bunnei2018-12-063-1/+41
|\ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | system_archive: Implement open source NgWord2Zach Hilman2018-12-063-1/+41
| | |_|_|/ / / / / / | |/| | | | | | | |
* | | | | | | | | | Merge pull request #1861 from lioncash/resetbunnei2018-12-066-11/+101
|\ \ \ \ \ \ \ \ \ \ | |_|_|_|_|_|_|/ / / |/| | | | | | | | |
| * | | | | | | | | kernel/svc: Correct behavior of svcResetSignal()Lioncash2018-12-051-4/+11
| * | | | | | | | | kernel/process: Make Process a WaitObjectLioncash2018-12-053-6/+68
| * | | | | | | | | kernel/readable_event: Add member function for enforcing a strict reset contractLioncash2018-12-052-1/+22
* | | | | | | | | | Merge pull request #1824 from ReinUsesLisp/fbcachebunnei2018-12-062-40/+82
|\ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | gl_rasterizer: Implement a framebuffer cacheReinUsesLisp2018-11-292-40/+82
* | | | | | | | | | | Merge pull request #1863 from ReinUsesLisp/texs-f16bunnei2018-12-062-18/+55
|\ \ \ \ \ \ \ \ \ \ \ | |_|_|/ / / / / / / / |/| | | | | | | | | |
| * | | | | | | | | | gl_shader_decompiler: Implement TEXS.F16ReinUsesLisp2018-12-052-13/+51
| * | | | | | | | | | gl_shader_decompiler: Fixup inverted ifReinUsesLisp2018-12-051-6/+5
| | |_|/ / / / / / / | |/| | | | | | | |
* | | | | | | | | | Merge pull request #1867 from lioncash/allocbunnei2018-12-062-4/+3
|\ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | ng_word: Deduplicate use of a constant valueLioncash2018-12-051-1/+1
| * | | | | | | | | | system_archive: Use a regular function pointer instead of std::function for file-scope system archive arrayLioncash2018-12-051-3/+2
| |/ / / / / / / / /
* | | | | | | | | | Merge pull request #1866 from lioncash/cachebunnei2018-12-061-8/+2
|\ \ \ \ \ \ \ \ \ \ | |_|_|_|/ / / / / / |/| | | | | | | | |
| * | | | | | | | | service/ldr: Deduplicate instruction cache clearing code in LoadNro()Lioncash2018-12-051-8/+2
| | |_|_|/ / / / / | |/| | | | | | |
* | | | | | | | | Call shrink_to_fit after page-table vector resizing to cause crt to actually lower vector capacity. For 36-bit titles saves 800MB of commit.heapo2018-12-051-0/+8
| |/ / / / / / / |/| | | | | | |
* | | | | | | | Merge pull request #1859 from heapo/lut_array_codegenbunnei2018-12-051-275/+277
|\ \ \ \ \ \ \ \ | |/ / / / / / / |/| | | | | | |
| * | | | | | | Improve msvc codegen for hot-path array LUTsheapo2018-12-051-275/+277
* | | | | | | | Merge pull request #1704 from DarkLordZach/oss-sysarchivebunnei2018-12-058-1/+227
|\ \ \ \ \ \ \ \
| * | | | | | | | file_sys: Implement system archive synthesizer for NgWord (806)Zach Hilman2018-11-235-6/+61
| * | | | | | | | fsp_srv: Add support for using open source archive if not found in NANDZach Hilman2018-11-161-0/+10
| * | | | | | | | file_sys: Add framework for synthesizing open source archivesZach Hilman2018-11-163-0/+109
| * | | | | | | | vfs_vector: Add VFS backend for std::arrayZach Hilman2018-11-161-0/+52
* | | | | | | | | Merge pull request #1837 from lioncash/mapbunnei2018-12-051-59/+46
|\ \ \ \ \ \ \ \ \ | |_|_|_|/ / / / / |/| | | | | | | |
| * | | | | | | | yuzu/game_list_worker: Move std::string construction after the termination check in callbacksLioncash2018-12-051-7/+7
| * | | | | | | | yuzu/game_list_worker: Deduplicate game list entry creationLioncash2018-12-021-47/+33
| * | | | | | | | yuzu/game_list_worker: Tidy up string handling in FillControlMap()Lioncash2018-12-021-6/+7
* | | | | | | | | Merge pull request #1838 from lioncash/dedupbunnei2018-12-051-27/+26
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | file_sys/registered_cache: Eliminate variable shadowingLioncash2018-12-021-27/+26
| |/ / / / / / / /
* | | | | | | | | Merge pull request #1836 from lioncash/unusedbunnei2018-12-051-1/+0
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | crypto/key_manager: Remove unused variable in GetTicketblob()Lioncash2018-12-021-1/+0
| |/ / / / / / / /
* | | | | | | | | kernel/svc: Remove unused header inclusionLioncash2018-12-041-1/+0
* | | | | | | | | kernel/svc: Implement svcSignalEvent()Lioncash2018-12-041-1/+16
* | | | | | | | | kernel/svc: Implement svcCreateEvent()Lioncash2018-12-042-1/+42
| |_|/ / / / / / |/| | | | | | |
* | | | | | | | Merge pull request #1845 from lioncash/nrobunnei2018-12-045-19/+23
|\ \ \ \ \ \ \ \
| * | | | | | | | loader/nso: Remove dependency on the System classLioncash2018-12-033-8/+11
| * | | | | | | | loader/nro: Make the static LoadNro function internally linkedLioncash2018-12-032-7/+5
| * | | | | | | | loader/nro: Remove dependency on the System classLioncash2018-12-032-10/+13
| | |_|_|_|/ / / | |/| | | | | |
* | | | | | | | Merge pull request #1853 from lioncash/eventbunnei2018-12-046-11/+20
|\ \ \ \ \ \ \ \
| * | | | | | | | kernel/object: Amend handle types to distinguish between readable and writable eventsLioncash2018-12-046-11/+20
| | |_|_|_|_|_|/ | |/| | | | | |
* | | | | | | | Rewrited TEX/TEXS (TEX Scalar). (#1826)Marcos2018-12-041-259/+177
* | | | | | | | Merge pull request #1857 from lioncash/res-infobunnei2018-12-045-11/+37
|\ \ \ \ \ \ \ \
| * | | | | | | | kernel/handle_table: Amend reference to CTR-OS in Create()Lioncash2018-12-041-2/+3
| * | | | | | | | kernel/svc: Implement the resource limit svcGetInfo optionLioncash2018-12-044-9/+34
| |/ / / / / / /
* | | | | | | | Merge pull request #1854 from Subv/old_command_processorbunnei2018-12-042-142/+6
|\ \ \ \ \ \ \ \ | |/ / / / / / / |/| | | | | | |
| * | | | | | | Removed unused file.Subv2018-12-041-142/+0
| * | | | | | | GPU: Don't try to route PFIFO methods (0-0x40) to the other engines.Subv2018-12-041-0/+6
| | |/ / / / / | |/| | | | |
* | | | | | | [Kernel::CreateThread] Match format specifiers to LOG_TRACE's argumentsV.Kalyuzhny2018-12-041-1/+1
* | | | | | | Merge pull request #1840 from lioncash/infobunnei2018-12-041-50/+100
|\ \ \ \ \ \ \ | |_|_|_|_|/ / |/| | | | | |
| * | | | | | svc: Use the current process' handle table for retrieving the process instance to act uponLioncash2018-12-021-1/+2
| * | | | | | svc: Reorganize svcGetInfo, handle more error cases for existing implemented info categoriesLioncash2018-12-021-50/+99
| |/ / / / /
* | | | | | Merge pull request #1842 from lioncash/slotbunnei2018-12-039-14/+12
|\ \ \ \ \ \
| * | | | | | yuzu/configuration: Make slots private where applicableLioncash2018-12-025-7/+2
| * | | | | | yuzu/configuration: Add missing override specifiers to configuration-related classesLioncash2018-12-027-7/+7
| * | | | | | yuzu/configuration/configure_input: Default destructor in the cpp fileLioncash2018-12-022-0/+3
| | |/ / / / | |/| | | |
* | | | | | Merge pull request #1835 from lioncash/cache-globalbunnei2018-12-038-40/+26
|\ \ \ \ \ \
| * | | | | | filesystem: De-globalize registered_cache_unionLioncash2018-12-028-40/+26
| | |/ / / / | |/| | | |
* | | | | | Merge pull request #1822 from ReinUsesLisp/glsl-scopebunnei2018-12-031-250/+213
|\ \ \ \ \ \
| * | | | | | gl_shader_decompiler: Remove texture temporal in TLD4ReinUsesLisp2018-11-291-3/+1
| * | | | | | gl_shader_decompiler: Flip negated if else statementReinUsesLisp2018-11-291-3/+3
| * | | | | | gl_shader_decompiler: Use GLSL scope on instructions unrelated to texturesReinUsesLisp2018-11-291-35/+10
| * | | | | | gl_shader_decompiler: Move texture code generation into lambdasReinUsesLisp2018-11-291-97/+78
| * | | | | | gl_shader_decompiler: Clean up texture instructionsReinUsesLisp2018-11-291-87/+56
| * | | | | | gl_shader_decompiler: Scope GLSL variables with a scoped objectReinUsesLisp2018-11-291-32/+72
* | | | | | | Merge pull request #1803 from DarkLordZach/k-able-eventbunnei2018-12-0337-247/+410
|\ \ \ \ \ \ \
| * | | | | | | hle_ipc: Refactor SleepClientThread to avoid ReadableEventZach Hilman2018-11-299-14/+14
| * | | | | | | kernel/event: Reference ReadableEvent from WritableEventZach Hilman2018-11-2932-317/+175
| * | | | | | | core: Port all current usages of Event to Readable/WritableEventZach Hilman2018-11-2929-164/+287
| * | | | | | | hle_ipc: Use event pair for SleepClientThreadZach Hilman2018-11-292-19/+22
| * | | | | | | kernel: Add named event tableZach Hilman2018-11-292-0/+30
| * | | | | | | kernel: Divide Event into ReadableEvent and WritableEventZach Hilman2018-11-296-61/+210
| * | | | | | | kernel/object: Add descriptions to ResetTypesZach Hilman2018-11-291-3/+3
| | |_|_|_|/ / | |/| | | | |
* | | | | | | Merge pull request #1833 from lioncash/cleanbunnei2018-12-035-5/+97
|\ \ \ \ \ \ \
| * | | | | | | file_sys: Override missing mutating functions to be stubbed out for ReadOnlyVfsDirectory by defaultLioncash2018-12-012-0/+25
| * | | | | | | service/fsp_srv: Implement CleanDirectoryRecursivelyLioncash2018-12-015-5/+72
* | | | | | | | Merge pull request #1839 from lioncash/initbunnei2018-12-031-2/+2
|\ \ \ \ \ \ \ \
| * | | | | | | | service/audio/audout_u: Amend constructor initialization list orderLioncash2018-12-021-2/+2
| | |_|_|/ / / / | |/| | | | | |
* | | | | | | | Merge pull request #1841 from ogniK5377/npad-mode-fixbunnei2018-12-031-2/+3
|\ \ \ \ \ \ \ \
| * | | | | | | | Fixed crash with SetNpadModeDavid Marcec2018-12-021-2/+3
| | |_|_|_|/ / / | |/| | | | | |
* | | | | | | | service/usb: Update function tableLioncash2018-12-021-1/+1
* | | | | | | | service/erpt: Update function tableLioncash2018-12-021-5/+7
|/ / / / / / /
* | | | | | | Merge pull request #1827 from ReinUsesLisp/clip-and-shaderbunnei2018-12-025-13/+37
|\ \ \ \ \ \ \
| * | | | | | | gl_rasterizer: Enable clip distances when set in register and in shaderReinUsesLisp2018-11-295-13/+37
| | |_|/ / / / | |/| | | | |
* | | | | | | Merge pull request #1825 from ReinUsesLisp/shader-pipeline-cachebunnei2018-12-021-4/+17
|\ \ \ \ \ \ \
| * | | | | | | gl_shader_manager: Update pipeline when programs have changedReinUsesLisp2018-11-291-4/+17
| |/ / / / / /
* | | | | | | Merge pull request #1795 from ReinUsesLisp/vc-cleanupbunnei2018-12-025-32/+7
|\ \ \ \ \ \ \
| * | | | | | | gl_rasterizer: Signal UNIMPLEMENTED when rt_separate_frag_data is not zeroReinUsesLisp2018-11-291-1/+1
| * | | | | | | gl_rasterizer_cache: Use brackets for two-line single-expresion blocksReinUsesLisp2018-11-291-1/+2
| * | | | | | | gl_rasterizer: Remove unused struct declarationsReinUsesLisp2018-11-291-14/+0
| * | | | | | | gl_rasterizer: Remove extension booleansReinUsesLisp2018-11-294-16/+4
| | |_|_|/ / / | |/| | | | |
* | | | | | | Merge pull request #1823 from bunnei/fix-surface-copybunnei2018-12-021-145/+5
|\ \ \ \ \ \ \
| * | | | | | | gl_rasterizer_cache: Update AccurateCopySurface to flush complete source surface.bunnei2018-11-301-1/+4
| * | | | | | | gl_rasterizer_cache: Remove BlitSurface and replace with more accurate copy.bunnei2018-11-291-144/+1
| |/ / / / / /
* | | | | | | Merge pull request #1832 from Simek/remove-game-list-borderbunnei2018-12-021-0/+1
|\ \ \ \ \ \ \
| * | | | | | | remove border from GameListBartosz Kaszubowski2018-11-301-0/+1
| | |_|_|/ / / | |/| | | | |
* | | | | | | Merge pull request #1830 from Subv/vi_ubbunnei2018-12-021-0/+2
|\ \ \ \ \ \ \ | |_|_|_|/ / / |/| | | | | |
| * | | | | | Services/VI: Dereferencing an uninitialized std::optional is undefined behavior.Subv2018-11-301-0/+2
* | | | | | | Fix debug buildLioncash2018-12-012-5/+3
| |/ / / / / |/| | | | |
* | | | | | service/set: Convert GetLanguageCode over to using PushEnum()Lioncash2018-11-301-1/+1
* | | | | | service/set: Implement MakeLanguageCodeLioncash2018-11-302-1/+19
|/ / / / /
* | / / / configure_input: Amend clang-format discrepanciesLioncash2018-11-301-1/+1
| |/ / / |/| | |
* | | | Merge pull request #1768 from greggameplayer/patch-2bunnei2018-11-291-0/+4
|\ \ \ \
| * | | | correct clang-formatgreggameplayer2018-11-221-1/+1
| * | | | Automatically disable joycons dockedgreggameplayer2018-11-221-0/+4
* | | | | Merge pull request #1801 from ogniK5377/log-before-executebunnei2018-11-2951-390/+860
|\ \ \ \ \ | |_|/ / / |/| | | |
| * | | | Added comment on Main memory size for more clarityDavid Marcec2018-11-271-0/+1
| * | | | Made svcSetHeapSize and svcCreateSharedMemory more readableDavid Marcec2018-11-271-4/+4
| * | | | Reworked svcs slightly, improved error messages in AM and fsp_srvDavid Marcec2018-11-273-20/+30
| * | | | Fixed hwopus compile errorDavid Marcec2018-11-261-1/+1
| * | | | Improved error messages in AM, HwOpus and NvMapDavid Marcec2018-11-263-26/+39
| * | | | Improved error messages for SVCsDavid Marcec2018-11-261-76/+170
| * | | | Changed logging to be "Log before execution", Added more error logging, all services should now log on some levelDavid Marcec2018-11-2651-374/+726
* | | | | Merge pull request #1808 from Tinob/masterbunnei2018-11-283-15/+31
|\ \ \ \ \
| * | | | | remove viewport_transform_enabled as it seems to be inactive when valid transforms are used.Rodolfo Bogado2018-11-271-12/+5
| * | | | | Add support for Clip Distance enabled registerRodolfo Bogado2018-11-273-3/+26
* | | | | | Merge pull request #1786 from Tinob/DepthClampbunnei2018-11-285-10/+58
|\ \ \ \ \ \
| * | | | | | Implement depth clampRodolfo Bogado2018-11-275-10/+58
| |/ / / / /
* | | | | | Merge pull request #1817 from DarkLordZach/npad-idx-fixbunnei2018-11-281-2/+2
|\ \ \ \ \ \
| * | | | | | npad: Use NPadIdToIndex to prevent invalid array accessZach Hilman2018-11-281-2/+2
| |/ / / / /
* | | | | | Merge pull request #1792 from bunnei/dma-pusherbunnei2018-11-2818-110/+365
|\ \ \ \ \ \
| * | | | | | dma_pushbuffer: Optimize to avoid loop and copy on Push.bunnei2018-11-283-13/+23
| * | | | | | gpu: Move command list profiling to DmaPusher::DispatchCalls.bunnei2018-11-282-5/+5
| * | | | | | gpu: Rewrite GPU command list processing with DmaPusher class.bunnei2018-11-2718-108/+353
* | | | | | | Merge pull request #1735 from FernandoS27/tex-spacingbunnei2018-11-288-36/+55
|\ \ \ \ \ \ \
| * | | | | | | Implemented Tile Width SpacingFernandoS272018-11-268-36/+55
* | | | | | | | Merge pull request #1814 from lioncash/ptrbunnei2018-11-283-33/+31
|\ \ \ \ \ \ \ \
| * | | | | | | | file_sys/registered_cache: Remove unused <map> includeLioncash2018-11-271-1/+0
| * | | | | | | | file_sys/registered_cache: Use regular const references instead of std::shared_ptr for InstallEntry()Lioncash2018-11-273-32/+31
* | | | | | | | | Merge pull request #1811 from lioncash/inputbunnei2018-11-286-94/+72
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | yuzu/configure_input_player: Use std::size_t to represent the player index instead of u8Lioncash2018-11-272-3/+3
| * | | | | | | | | yuzu/configure_input: Make CallConfigureDialog a non-member template functionLioncash2018-11-273-21/+20
| * | | | | | | | | yuzu/configure_input_player: Use a lambda expression instead of std::bindLioncash2018-11-271-1/+1
| * | | | | | | | | yuzu/configure_input_player: Amend constructor initializer list orderLioncash2018-11-271-4/+3
| * | | | | | | | | yuzu/configure_input: Remove unused function MoveGridElementLioncash2018-11-271-7/+0
| * | | | | | | | | yuzu/configure_input*: Move data members after function declarationsLioncash2018-11-272-41/+42
| * | | | | | | | | yuzu/configure_input: Remove unnecessary includesLioncash2018-11-273-17/+3
| |/ / / / / / / /
* | | | | | | | | npad: Fix copy/paste error with LED position assignmentsZach Hilman2018-11-271-3/+3
* | | | | | | | | Merge pull request #1802 from DarkLordZach/user-data-storagebunnei2018-11-273-17/+19
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | profile_manager: Save and load ProfileData from diskZach Hilman2018-11-263-17/+19
* | | | | | | | | | Merge pull request #1812 from lioncash/nacpbunnei2018-11-271-7/+17
|\ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | control_metadata: Correct typo in language name (Portugese -> Portuguese)Lioncash2018-11-271-7/+17
| | |/ / / / / / / / | |/| | | | | | | |
* | | | | | | | | | gl_shader_decompiler: Fixup clip distance indexReinUsesLisp2018-11-271-1/+1
* | | | | | | | | | gl_rasterizer: Fixup for #1723.Markus Wick2018-11-271-1/+1
|/ / / / / / / / /
* | | | | | | | | Merge pull request #1806 from ReinUsesLisp/morton-fixupbunnei2018-11-271-1/+2
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | morton: Fixup compiler warningReinUsesLisp2018-11-271-1/+2
| | |_|_|/ / / / / | |/| | | | | | |
* | | | | | | | | Merge pull request #1804 from lioncash/castbunnei2018-11-271-1/+1
|\ \ \ \ \ \ \ \ \ | |_|_|_|/ / / / / |/| | | | | | | |
| * | | | | | | | gdbstub: Silence value truncation warning within FpuWrite()Lioncash2018-11-271-1/+1
| | |_|/ / / / / | |/| | | | | |
* | | | | | | | Merge pull request #1805 from lioncash/resourcebunnei2018-11-273-5/+130
|\ \ \ \ \ \ \ \ | |_|/ / / / / / |/| | | | | | |
| * | | | | | | svc: Implement svcSetResourceLimitLimitValue()Lioncash2018-11-271-1/+36
| * | | | | | | svc: Implement svcGetResourceLimitCurrentValue()Lioncash2018-11-271-16/+49
| * | | | | | | svc: Implement svcGetResourceLimitLimitValue()Lioncash2018-11-272-2/+33
| * | | | | | | svc: Implement svcCreateResourceLimit()Lioncash2018-11-272-1/+27
| |/ / / / / /
* | | | | | | Merge pull request #1794 from Tinob/masterbunnei2018-11-272-8/+32
|\ \ \ \ \ \ \
| * | | | | | | Limit the amount of viewports tested for state changes only to the usable onesRodolfo Bogado2018-11-251-2/+10
| * | | | | | | Add support for viewport_transfom_enable registerRodolfo Bogado2018-11-242-6/+22
| | |/ / / / / | |/| | | | |
* | | | | | | Merge pull request #1723 from degasus/dirty_flagsbunnei2018-11-279-6/+60
|\ \ \ \ \ \ \
| * | | | | | | gl_rasterizer: Skip VB upload if the state is clean.Markus Wick2018-11-179-6/+60
* | | | | | | | GPU States: Implement Polygon Offset. This is used in SMO all the time. (#1784)Marcos2018-11-275-5/+107
* | | | | | | | Merge pull request #1713 from FernandoS27/bra-ccbunnei2018-11-271-4/+14
|\ \ \ \ \ \ \ \
| * | | | | | | | Implemented BRA CC conditional and FSET CC SettingFernandoS272018-11-241-4/+14
| | |/ / / / / / | |/| | | | | |
* | | | | | | | Merge pull request #1798 from ReinUsesLisp/y-directionbunnei2018-11-275-16/+26
|\ \ \ \ \ \ \ \ | |_|_|/ / / / / |/| | | | | | |
| * | | | | | | gl_shader_decompiler: Implement S2R's Y_DIRECTIONReinUsesLisp2018-11-255-16/+26
| |/ / / / / /
* | | | | | | Merge pull request #1763 from ReinUsesLisp/bfibunnei2018-11-262-0/+23
|\ \ \ \ \ \ \
| * | | | | | | gl_shader_decompiler: Implement BFI_IMM_RReinUsesLisp2018-11-212-0/+23
* | | | | | | | Merge pull request #1793 from lioncash/refbunnei2018-11-262-2/+2
|\ \ \ \ \ \ \ \
| * | | | | | | | service/sm: Take std::string by const reference in UnregisterServiceLioncash2018-11-242-2/+2
| | |/ / / / / / | |/| | | | | |
* | | | | | | | Merge pull request #1760 from ReinUsesLisp/r2pbunnei2018-11-262-0/+42
|\ \ \ \ \ \ \ \
| * | | | | | | | gl_shader_decompiler: Implement R2P_IMMReinUsesLisp2018-11-212-0/+42
| | |/ / / / / / | |/| | | | | |
* | | | | | | | Merge pull request #1782 from FernandoS27/dcbunnei2018-11-261-116/+188
|\ \ \ \ \ \ \ \
| * | | | | | | | Fix Texture OverlappingFernandoS272018-11-241-43/+70
| * | | | | | | | Fix TEXS Instruction encodingsFernandoS272018-11-241-22/+48
| * | | | | | | | Fix one encoding in TEX InstructionFernandoS272018-11-241-3/+3
| * | | | | | | | Corrected inputs indexing in TEX instructionFernandoS272018-11-241-66/+85
* | | | | | | | | Merge pull request #1783 from ReinUsesLisp/clip-distancesbunnei2018-11-263-21/+58
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | gl_shader_decompiler: Implement clip distancesReinUsesLisp2018-11-233-21/+58
* | | | | | | | | | Merge pull request #1796 from ReinUsesLisp/morton-movebunnei2018-11-266-345/+391
|\ \ \ \ \ \ \ \ \ \ | |_|_|_|_|_|/ / / / |/| | | | | | | | |
| * | | | | | | | | morton: Style changesReinUsesLisp2018-11-251-12/+12
| * | | | | | | | | video_core: Move morton functions to their own fileReinUsesLisp2018-11-256-345/+391
| | |_|_|/ / / / / | |/| | | | | | |
* | | | | | | | | svc: Return ERR_INVALID_ENUM_VALUE from svcGetInfoLuke Street2018-11-251-1/+2
* | | | | | | | | Merge pull request #1791 from bunnei/nvdrv-stubbunnei2018-11-252-2/+18
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | nvdrv: Implement/stub DumpGraphicsMemoryInfo and GetStatus.bunnei2018-11-242-2/+18
| | |_|/ / / / / / | |/| | | | | | |
* | | | | | | | | Merge pull request #1787 from bunnei/fix-gpu-mmbunnei2018-11-252-1/+9
|\ \ \ \ \ \ \ \ \ | |_|/ / / / / / / |/| | | | | | | |
| * | | | | | | | memory_manager: Do not allow 0 to be a valid GPUVAddr.bunnei2018-11-232-1/+9
* | | | | | | | | Merge pull request #1641 from DarkLordZach/sm-register-unregisterbunnei2018-11-242-2/+55
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | sm: Implement RegisterService and UnregisterServiceZach Hilman2018-11-042-2/+55
* | | | | | | | | | Merge pull request #1731 from DarkLordZach/change-dir-crashbunnei2018-11-242-0/+6
|\ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | filesystem: Clear registered union paths on factory creationZach Hilman2018-11-192-0/+6
| | |_|_|_|_|_|_|_|/ | |/| | | | | | | |
* | | | | | | | | | Merge pull request #1725 from FernandoS27/gl43bunnei2018-11-248-52/+17
|\ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | Removed pre 4.3 ARB extensionsFernandoS272018-11-217-48/+13
| * | | | | | | | | | Update OpenGL's backend version from 3.3 to 4.3FernandoS272018-11-213-4/+4
* | | | | | | | | | | Merge pull request #1785 from Tinob/masterbunnei2018-11-245-28/+95
|\ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | Add support for clear_flags registerRodolfo Bogado2018-11-245-28/+95
| | |_|_|_|/ / / / / / | |/| | | | | | | | |
* | | | | | | | | | | Merge pull request #1692 from Hedges/GDBCleanbunnei2018-11-241-37/+86
|\ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | GDBStub improvements:Hedges2018-11-131-37/+86
* | | | | | | | | | | | Merge pull request #1708 from ogniK5377/res-scalebunnei2018-11-243-60/+78
|\ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | Removed hard coded values for width and heightDavid Marcec2018-11-191-2/+4
| * | | | | | | | | | | | Report resolution scaling support for vi and amDavid Marcec2018-11-163-60/+76
* | | | | | | | | | | | | Merge pull request #1747 from DarkLordZach/exefs-lfsbunnei2018-11-247-2/+65
|\ \ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | | patch_manager: Show LayeredExeFS patch in add-ons columnZach Hilman2018-11-212-4/+15
| * | | | | | | | | | | | | patch_manager: Apply LayeredExeFS patchesZach Hilman2018-11-201-0/+25
| * | | | | | | | | | | | | settings: Add option to dump ExeFS of games upon launchZach Hilman2018-11-207-0/+27
* | | | | | | | | | | | | | Merge pull request #1769 from ReinUsesLisp/ccbunnei2018-11-242-70/+81
|\ \ \ \ \ \ \ \ \ \ \ \ \ \ | |_|_|_|/ / / / / / / / / / |/| | | | | | | | | | | | |
| * | | | | | | | | | | | | gl_shader_decompiler: Add a message for unimplemented cc generationReinUsesLisp2018-11-221-23/+46
| * | | | | | | | | | | | | gl_shader_decompiler: Rename internal flag stringsReinUsesLisp2018-11-221-15/+20
| * | | | | | | | | | | | | gl_shader_decompiler: Rename control codes to condition codesReinUsesLisp2018-11-222-67/+50
| | |_|_|_|_|_|_|_|_|_|/ / | |/| | | | | | | | | | |
* | | | | | | | | | | | | Merge pull request #1744 from degasus/shader_cachebunnei2018-11-244-8/+24
|\ \ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | | shader_cache: Only lock covered instructions.Markus Wick2018-11-204-8/+24
| | |_|_|_|/ / / / / / / / | |/| | | | | | | | | | |
* | | | | | | | | | | | | Merge pull request #1741 from lioncash/kbdbunnei2018-11-242-12/+11
|\ \ \ \ \ \ \ \ \ \ \ \ \ | |_|_|_|_|_|_|_|/ / / / / |/| | | | | | | | | | | |
| * | | | | | | | | | | | yuzu/applets/software_keyboard: Override accept() and reject() instead of providing own differently named member functionsLioncash2018-11-202-8/+8
| * | | | | | | | | | | | yuzu/applets/software_keyboard: std::move std::function instances where applicableLioncash2018-11-201-2/+2
| * | | | | | | | | | | | yuzu/applets/software_keyboard: Make slots private functionsLioncash2018-11-201-2/+1
| |/ / / / / / / / / / /
* | | | | | | | | | | | Merge pull request #1770 from DarkLordZach/applet-stubbunnei2018-11-234-4/+102
|\ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | am: Return StubApplet instead of nullptr when AppletId not foundZach Hilman2018-11-223-11/+11
| * | | | | | | | | | | | applets: Add StubAppletZach Hilman2018-11-223-0/+98
| | |/ / / / / / / / / / | |/| | | | | | | | | |
* | | | | | | | | | | | Merge pull request #1777 from lioncash/core-mgrbunnei2018-11-234-97/+225
|\ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | core: Relocate CPU core management to its own classLioncash2018-11-224-97/+225
* | | | | | | | | | | | | Merge pull request #1773 from lioncash/threadbunnei2018-11-232-41/+14
|\ \ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | | common/thread: Drop Hungarian notation on SetCurrentThreadName's parameterLioncash2018-11-221-7/+7
| * | | | | | | | | | | | | common/thread: Make Barrier's 'count' member non-constLioncash2018-11-221-1/+1
| * | | | | | | | | | | | | common/thread: Initialize class member variables where applicableLioncash2018-11-221-6/+4
| * | | | | | | | | | | | | common/thread: Group non-member functions togetherLioncash2018-11-221-3/+2
| * | | | | | | | | | | | | common/thread: Remove SleepCurrentThread()Lioncash2018-11-222-12/+0
| * | | | | | | | | | | | | common/thread: Remove unused CurrentThreadId()Lioncash2018-11-222-12/+0
| | |/ / / / / / / / / / / | |/| | | | | | | | | | |
* | | | | | | | | | | | | Added predicate comparison LessEqualWithNan (#1736)Hexagon122018-11-232-5/+13
* | | | | | | | | | | | | Merge pull request #1756 from ReinUsesLisp/fix-texturesbunnei2018-11-231-60/+78
|\ \ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | | gl_shader_decompiler: Fix register overwriting on texture callsReinUsesLisp2018-11-221-60/+78
| |/ / / / / / / / / / / /
* | | | | | | | | | | | | Merge pull request #1766 from FernandoS27/fix-txqbunnei2018-11-231-2/+12
|\ \ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | | Properly Implemented TXQ InstructionFernandoS272018-11-211-2/+12
| | |_|/ / / / / / / / / / | |/| | | | | | | | | | |
* | | | | | | | | | | | | Merge pull request #1762 from bunnei/getgputimebunnei2018-11-232-0/+19
|\ \ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | | nvhost_ctrl_gpu: Implement IoctlGetGpuTime.bunnei2018-11-212-0/+19
* | | | | | | | | | | | | | debug_pad: Avoid loading input for nonexistent buttons (Home and Screenshot)Zach Hilman2018-11-221-2/+3
| |_|_|_|_|_|_|_|_|/ / / / |/| | | | | | | | | | | |
* | | | | | | | | | | | | Merge pull request #1775 from bunnei/blend-eqbunnei2018-11-222-0/+12
|\ \ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | | maxwell_3d: Implement alternate blend equations.bunnei2018-11-222-0/+12
| |/ / / / / / / / / / / /
* | | | | | | | | | | | | Merge pull request #1765 from bunnei/multi-audoutbunnei2018-11-222-9/+22
|\ \ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | | audout_u: Add support for multiple IAudioOut streams.bunnei2018-11-222-9/+22
| |/ / / / / / / / / / / /
* | | | | | | | | | | | | Merge pull request #1764 from bunnei/macrointerpreterbunnei2018-11-222-8/+25
|\ \ \ \ \ \ \ \ \ \ \ \ \ | |_|_|_|/ / / / / / / / / |/| | | | | | | | | | | |
| * | | | | | | | | | | | macro_interpreter: Implement AddWithCarry and SubtractWithBorrow.bunnei2018-11-222-8/+25
| |/ / / / / / / / / / /
* | | | | | | | | | | | Merge pull request #1737 from FernandoS27/layer-copybunnei2018-11-222-2/+30
|\ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | Implemented Fast Layered CopyFernandoS272018-11-202-2/+30
| | |_|_|_|_|_|/ / / / / | |/| | | | | | | | | |
* | | | | | | | | | | | Merge pull request #1771 from lioncash/bit-setbunnei2018-11-222-245/+0
|\ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | common: Remove bit_set.hLioncash2018-11-222-245/+0
| | |_|_|/ / / / / / / / | |/| | | | | | | | | |
* | | | | | | | | | | | Merge pull request #1767 from lioncash/handlebunnei2018-11-222-12/+14
|\ \ \ \ \ \ \ \ \ \ \ \ | |/ / / / / / / / / / / |/| | | | | | | | | | |
| * | | | | | | | | | | kernel/handle_table: Move private static functions into the cpp fileLioncash2018-11-222-7/+9
| * | | | | | | | | | | kernel/handle_table: Restrict handle table size to 1024 entriesLioncash2018-11-221-5/+2
| * | | | | | | | | | | kernel/handle_table: Default destructor in the cpp fileLioncash2018-11-222-0/+3
| | |_|_|_|_|_|_|/ / / | |/| | | | | | | | |
* | | | | | | | | | | Merge pull request #1753 from FernandoS27/ufbtypebunnei2018-11-212-0/+8
|\ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | Use default values for unknown framebuffer pixel formatFernandoS272018-11-212-0/+8
| | |_|_|/ / / / / / / | |/| | | | | | | | |
* | | | | | | | | | | Merge pull request #1752 from ReinUsesLisp/unimpl-decompilerbunnei2018-11-211-371/+258
|\ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | gl_shader_decompiler: Use UNIMPLEMENTED instead of LOG+UNREACHABLE when applicableReinUsesLisp2018-11-211-371/+258
* | | | | | | | | | | | Merge pull request #1742 from lioncash/hle-swkbdbunnei2018-11-215-44/+63
|\ \ \ \ \ \ \ \ \ \ \ \ | |_|_|_|_|/ / / / / / / |/| | | | | | | | | | |
| * | | | | | | | | | | am/applets: Make the applet data broker part of the applet itself.Lioncash2018-11-205-31/+36
| * | | | | | | | | | | am/applets: Replace includes with forward declarations where applicableLioncash2018-11-202-2/+9
| * | | | | | | | | | | am/applets: Relocate comments above the relevant data member in AppletDataBrokerLioncash2018-11-201-11/+18
| | |/ / / / / / / / / | |/| | | | | | | | |
* | | | | | | | | | | Merge pull request #1754 from ReinUsesLisp/zero-registerbunnei2018-11-211-2/+1
|\ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | gl_shader_decompiler: Remove UNREACHABLE when setting RZReinUsesLisp2018-11-211-2/+1
* | | | | | | | | | | | Merge pull request #1758 from lioncash/rectbunnei2018-11-211-11/+5
|\ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | common/math_util: Simplify std::make_signed usages to std::make_signed_tLioncash2018-11-211-2/+2
| * | | | | | | | | | | | common/math_util: Make Rectangle's constructors constexprLioncash2018-11-211-2/+2
| * | | | | | | | | | | | common/math_util: Remove unnecessary static from PILioncash2018-11-211-1/+1
| * | | | | | | | | | | | common/math_util: Remove unused IntervalsIntersect() functionLioncash2018-11-211-6/+0
| | |_|_|/ / / / / / / / | |/| | | | | | | | | |
* / | | | | | | | | | | common: Remove dependency on xbyakLioncash2018-11-213-274/+0
|/ / / / / / / / / / /
* | | | | | | | | | | Merge pull request #1751 from bunnei/color-mask-fixbunnei2018-11-211-0/+9
|\ \ \ \ \ \ \ \ \ \ \ | |/ / / / / / / / / / |/| | | | | | | | | |
| * | | | | | | | | | maxwell_3d: Initialize rasterizer color mask registers as enabled.bunnei2018-11-211-0/+9
| | |/ / / / / / / / | |/| | | | | | | |
* / | | | | | | | | am: Correct build failureLioncash2018-11-211-2/+2
|/ / / / / / / / /
* | | | | | | | | Merge pull request #1734 from lioncash/sharedbunnei2018-11-213-29/+45
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | kernel/shared_memory: Make Map() and Unmap() take the target process by reference rather than as a pointerLioncash2018-11-193-12/+12
| * | | | | | | | | kernel/shared_memory: Add a const qualified member function overload for GetPointer()Lioncash2018-11-192-1/+12
| * | | | | | | | | kernel/shared_memory: Use 64-bit types for offset and size in CreateForAppletLioncash2018-11-192-2/+2
| * | | | | | | | | kernel/shared_memory: Make GetPointer() take a std::size_t instead of a u32Lioncash2018-11-192-2/+2
| * | | | | | | | | kernel/shared_memory: Make data members privateLioncash2018-11-191-12/+17
| | |/ / / / / / / | |/| | | | | | |
* | | | | | | | | Merge pull request #1733 from lioncash/ldrbunnei2018-11-211-29/+12
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | ldr: Clean up error codesLioncash2018-11-191-29/+12
| |/ / / / / / / /
* | | | | | | | | Merge pull request #1746 from lioncash/randombunnei2018-11-212-1/+1
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | kernel/process: Move <random> include to the cpp fileLioncash2018-11-202-1/+1
| | |/ / / / / / / | |/| | | | | | |
* | | | | | | | | Merge pull request #1748 from lioncash/assertbunnei2018-11-211-1/+4
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | common/assert: Add UNIMPLEMENTED_IF and UNIMPLEMENTED_IF_MSG for conditional assertionsLioncash2018-11-211-0/+3
| * | | | | | | | | common/assert: Make the UNIMPLEMENTED macro properly assertLioncash2018-11-201-1/+1
| |/ / / / / / / /
* / / / / / / / / file_sys/card_image: Provide named members for the GamecardInfo structLioncash2018-11-211-1/+12
|/ / / / / / / /
* | | | | | | | Merge pull request #1667 from DarkLordZach/swkbdbunnei2018-11-2019-106/+1133
|\ \ \ \ \ \ \ \
| * | | | | | | | software_keyboard: Fix erroneous extra PushNormalDataZach Hilman2018-11-191-3/+2
| * | | | | | | | software_keyboard: Return correct result code on user cancel operationZach Hilman2018-11-193-5/+1
| * | | | | | | | applet: Add AppletDataBroker to manage HLE to AM service interactionZach Hilman2018-11-195-104/+194
| * | | | | | | | software_keyboard: Use correct offset for inital text stringZach Hilman2018-11-191-1/+2
| * | | | | | | | software_keyboard: Check for UTF-8 config flagZach Hilman2018-11-192-9/+23
| * | | | | | | | software_keyboard: Add max and current length display to dialogZach Hilman2018-11-182-1/+11
| * | | | | | | | software_keyboard: Push all data over all channels on dialog completionZach Hilman2018-11-181-18/+26
| * | | | | | | | applet: Use std::queue instead of std::vector for storage stackZach Hilman2018-11-185-18/+44
| * | | | | | | | applet: Add operation completed callbackZach Hilman2018-11-188-9/+34
| * | | | | | | | software_keyboard: Push buffer size to offset 0x4 in output dataZach Hilman2018-11-184-18/+39
| * | | | | | | | software_keyboard: Make GetText asynchronousZach Hilman2018-11-189-29/+64
| * | | | | | | | am: Allow applets to push multiple and different channels of dataZach Hilman2018-11-1810-64/+62
| * | | | | | | | am: Implement ILibraryAppletAccessor IsCompleted and GetResultZach Hilman2018-11-182-4/+9
| * | | | | | | | am: Implement text check software keyboard modeZach Hilman2018-11-186-14/+120
| * | | | | | | | am: Deglobalize software keyboard appletZach Hilman2018-11-1817-100/+180
| * | | | | | | | qt/main: Register Qt Software Keyboard frontend with AMZach Hilman2018-11-183-0/+6
| * | | | | | | | am: Construct and use proper applets with ILibraryAppletAccessorZach Hilman2018-11-181-1/+26
| * | | | | | | | qt/applets: Provide Qt frontend implementation of software keyboardZach Hilman2018-11-183-0/+171
| * | | | | | | | am/applets: Add connector between frontend and AM applet classesZach Hilman2018-11-183-0/+130
| * | | | | | | | frontend/applets: Add frontend software keyboard provider and defaultZach Hilman2018-11-183-0/+63
| * | | | | | | | am/applets: Add Applet superclass to describe a generic appletZach Hilman2018-11-183-0/+77
| * | | | | | | | am: Unstub ILibraryAppletAccessor::StartZach Hilman2018-11-181-5/+17
| * | | | | | | | am: Implement PopInteractiveOutData and PushInteractiveInDataZach Hilman2018-11-181-14/+24
| * | | | | | | | am: Convert storage stack to vectorZach Hilman2018-11-181-27/+59
| * | | | | | | | am: Move AM::IStorage to headerZach Hilman2018-11-181-0/+16
| * | | | | | | | am: Move IStorageAccessor to header and update backing bufferZach Hilman2018-11-182-64/+62
| * | | | | | | | am: Implement CreateTransferMemoryStorageZach Hilman2018-11-182-0/+26
| * | | | | | | | string_util: Implement buffer to UTF-16 string helper functionZach Hilman2018-11-182-0/+17
| * | | | | | | | svc: Implement svcCreateTransferMemoryZach Hilman2018-11-181-3/+33
| | |/ / / / / / | |/| | | | | |
* | | | | | | | Merge pull request #1739 from lioncash/lmbunnei2018-11-201-1/+12
|\ \ \ \ \ \ \ \
| * | | | | | | | lm: Implement SetDestination by doing nothingLioncash2018-11-201-1/+12
* | | | | | | | | kernel/resource_limit: Clean up interfaceLioncash2018-11-206-190/+81
|/ / / / / / / /
* | | | | | | | configure_input: Use Joycons Docked instead of Connected as labelZach Hilman2018-11-191-1/+1
* | | | | | | | configure_input_player: Set minimum width on controlsZach Hilman2018-11-192-23/+30
* | | | | | | | configure_input: Properly update UI components on removal of playerZach Hilman2018-11-191-0/+2
* | | | | | | | configure_input: Make None a controller option instead of checkboxZach Hilman2018-11-1911-152/+148
* | | | | | | | hid: Use player-defined controller type as PREFERRED_CONTROLLERZach Hilman2018-11-1916-296/+234
* | | | | | | | qt: Move controller button config to separate dialogZach Hilman2018-11-194-0/+1767
* | | | | | | | qt: Add UI to configure touchscreen parametersZach Hilman2018-11-194-0/+281
* | | | | | | | qt: Add UI to configure mouse buttonsZach Hilman2018-11-194-0/+542
* | | | | | | | configure_input: Add support for multiplayer and controller typesZach Hilman2018-11-193-998/+525
* | | | | | | | hid/npad: Update NPad to use player controller bindings and typeZach Hilman2018-11-192-55/+108
* | | | | | | | hid/touchscreen: Update Touchscreen to use advanced parametersZach Hilman2018-11-191-6/+6
* | | | | | | | hid: Add controller bindings for Mouse controllerZach Hilman2018-11-192-4/+30
* | | | | | | | hid: Add keyboard bindings for Keyboard controllerZach Hilman2018-11-192-2/+24
* | | | | | | | hid: Add controller bindings for DebugPad controllerZach Hilman2018-11-192-21/+43
* | | | | | | | yuzu/config: Add (de-)serialization for multiplayerZach Hilman2018-11-192-21/+331
* | | | | | | | yuzu_cmd/config: Add config deserialization for multiplayerZach Hilman2018-11-191-37/+254
* | | | | | | | settings: Add settings for multiple players and controllersZach Hilman2018-11-191-3/+48
* | | | | | | | settings: Add Native type for keyboardZach Hilman2018-11-191-0/+210
* | | | | | | | settings: Add Native type for mouse buttonsZach Hilman2018-11-192-0/+34
* | | | | | | | Added missing start/end touch attributes to touchscreenDavid Marcec2018-11-192-1/+18
* | | | | | | | Added debugpad skeletonDavid Marcec2018-11-192-2/+55
* | | | | | | | Added controller helper funcsDavid Marcec2018-11-192-0/+35
* | | | | | | | Changed polling rate of hid and Right joycon rotationDavid Marcec2018-11-191-2/+2
* | | | | | | | Left joycon rotation button remappingDavid Marcec2018-11-192-7/+21
* | | | | | | | Added automatic npad switch based on supported stylesetsDavid Marcec2018-11-192-4/+124
* | | | | | | | Added multi-input support and controller assignment at any portDavid Marcec2018-11-192-122/+181
| |/ / / / / / |/| | | | | |
* | | | | | | Merge pull request #1717 from FreddyFunk/swizzle-gobbunnei2018-11-191-37/+33
|\ \ \ \ \ \ \
| * | | | | | | textures/decoders: Replace magic numbersFrederic Laing2018-11-171-37/+33
* | | | | | | | Merge pull request #1693 from Tinob/masterbunnei2018-11-199-211/+315
|\ \ \ \ \ \ \ \
| * | | | | | | | drop support for non separate alpha as it seems to cause issues in some gamesRodolfo Bogado2018-11-183-61/+35
| * | | | | | | | fix sampler configuration, thanks to Marcos for his investigationRodolfo Bogado2018-11-173-19/+57
| * | | | | | | | small type fixRodolfo Bogado2018-11-171-6/+6
| * | | | | | | | small fix for alphaToOne bit locationRodolfo Bogado2018-11-171-2/+2
| * | | | | | | | fix for gcc compilationRodolfo Bogado2018-11-171-60/+61
| * | | | | | | | add AlphaToCoverage and AlphaToOneRodolfo Bogado2018-11-175-1/+39
| * | | | | | | | add support for fragment_color_clampRodolfo Bogado2018-11-175-1/+24
| * | | | | | | | add missing MirrorOnceBorder support where supportedRodolfo Bogado2018-11-171-0/+6
| * | | | | | | | set border color not depending on the wrap modeRodolfo Bogado2018-11-171-9/+9
| * | | | | | | | set default value for point size registerRodolfo Bogado2018-11-172-5/+4
| * | | | | | | | fix viewport and scissor behaviorRodolfo Bogado2018-11-176-64/+89
| | |/ / / / / / | |/| | | | | |
* | | | | | | | Eliminated unnessessary memory allocation and copy (#1702)Frederic L2018-11-193-9/+20
* | | | | | | | Merge pull request #1640 from DarkLordZach/game-list-reloadbunnei2018-11-195-1/+28
|\ \ \ \ \ \ \ \
| * | | | | | | | game_list: Only reload game list after relevant settings changedZach Hilman2018-11-045-1/+28
| | |_|_|_|/ / / | |/| | | | | |
* | | | | | | | Merge pull request #1620 from DarkLordZach/ldr-robunnei2018-11-197-23/+405
|\ \ \ \ \ \ \ \
| * | | | | | | | ldr_ro: Add error check for memory allocation failureZach Hilman2018-11-184-13/+27
| * | | | | | | | ldr_ro: Implement UnloadNro (command 1)Zach Hilman2018-11-151-22/+85
| * | | | | | | | ldr_ro: Fully Implement LoadNro (command 0)Zach Hilman2018-11-151-11/+110
| * | | | | | | | ldr_ro: Implement UnloadNrr (command 3)Zach Hilman2018-11-151-2/+84
| * | | | | | | | ldr_ro: Fully implement LoadNrr (command 2)Zach Hilman2018-11-151-0/+112
| * | | | | | | | process: Make MirrorMemory take state to map new memory asZach Hilman2018-11-152-3/+7
| * | | | | | | | pl_u: Resize buffers in shared font data getter to what game requestsZach Hilman2018-11-151-0/+8
* | | | | | | | | Merge pull request #1718 from ogniK5377/lets-go-softlockbunnei2018-11-193-1/+18
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | Implemented CalculateStandardUserSystemClockDifferenceByUserDavid Marcec2018-11-173-1/+18
| | |_|_|/ / / / / | |/| | | | | | |
* | | | | | | | | Correctly sets default system language for yuzu-CLI (#1727)Schplee2018-11-191-0/+2
* | | | | | | | | Merge pull request #1730 from ReinUsesLisp/fix-intelbunnei2018-11-191-2/+0
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | gl_rasterizer: Remove default clip distanceReinUsesLisp2018-11-191-2/+0
* | | | | | | | | | Merge pull request #1671 from DarkLordZach/vi-disconnectbunnei2018-11-191-0/+22
|\ \ \ \ \ \ \ \ \ \ | |/ / / / / / / / / |/| | | | | | | | |
| * | | | | | | | | vi: Implement TransactParcel for Disconnect and DetachBufferZach Hilman2018-11-171-0/+22
| | |_|/ / / / / / | |/| | | | | | |
* | | | | | | | | Merge pull request #1728 from FearlessTobi/reset-signalMat M2018-11-181-1/+1
|\ \ \ \ \ \ \ \ \ | |_|_|_|/ / / / / |/| | | | | | | |
| * | | | | | | | svc: ResetSignal is not stubbedTobias2018-11-181-1/+1
* | | | | | | | | Stubbed am:EnableApplicationCrashReportMysticExile2018-11-172-10/+18
| |_|_|_|_|_|/ / |/| | | | | | |
* | | | | | | | Merge pull request #1678 from FearlessTobi/amiibo-hotkeysbunnei2018-11-171-1/+9
|\ \ \ \ \ \ \ \
| * | | | | | | | yuzu: Add hotkey for Amiibo loadingfearlessTobi2018-11-131-1/+9
* | | | | | | | | Merge pull request #1711 from ogniK5377/bluetooth-lets-gobunnei2018-11-172-1/+145
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | Added various bluetooth based cmds for palmaDavid Marcec2018-11-162-1/+145
* | | | | | | | | | Merge pull request #1719 from bunnei/hwopus-fixbunnei2018-11-171-1/+1
|\ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | hwopus: DecodeInterleavedWithPerformance: Fix ordering of output parameters.bunnei2018-11-171-1/+1
| | |_|_|_|/ / / / / | |/| | | | | | | |
* | | | | | | | | | Merge pull request #1714 from lioncash/kern-errbunnei2018-11-172-62/+32
|\ \ \ \ \ \ \ \ \ \ | |/ / / / / / / / / |/| | | | | | | | |
| * | | | | | | | | kernel/errors: Clean up error codesLioncash2018-11-162-62/+32
* | | | | | | | | | Merge pull request #1712 from FearlessTobi/port-4426bunnei2018-11-161-9/+10
|\ \ \ \ \ \ \ \ \ \ | |/ / / / / / / / / |/| | | | | | | | |
| * | | | | | | | | Common/Bitfield: store value as unsigned typeWeiyi Wang2018-11-161-9/+10
| |/ / / / / / / /
* | | | | | | | | Merge pull request #1638 from FreddyFunk/SetMemoryPermission-StubbedMat M2018-11-162-1/+48
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | Implement SetMemoryPermissionFrederic Laing2018-11-061-3/+39
| * | | | | | | | | Stubbed SetMemoryPermissionFrederic Laing2018-11-032-1/+12
| | |_|_|/ / / / / | |/| | | | | | |
* | | | | | | | | Merge pull request #1700 from FreddyFunk/cleanupbunnei2018-11-161-3/+3
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | gl_rasterizer_chache: Minor cleanupFrederic Laing2018-11-151-3/+3
| | |_|_|_|/ / / / | |/| | | | | | |
* | | | | | | | | Merge pull request #1701 from FreddyFunk/decodersbunnei2018-11-161-16/+16
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | textures/decoders: Minor cleanupFrederic Laing2018-11-151-16/+16
| |/ / / / / / / /
* | | | | | | | | Merge pull request #1632 from DarkLordZach/keys-manager-optimizationsbunnei2018-11-1616-133/+200
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | game_list: Make add-ons column optionalZach Hilman2018-11-026-119/+166
| * | | | | | | | | filesystem: Cache RegisteredCacheUnion instead of constructing on demandZach Hilman2018-11-022-4/+11
| * | | | | | | | | file_sys: Use common KeyManager in NCA container typesZach Hilman2018-11-026-7/+18
| * | | | | | | | | content_archive: Add optional KeyManager parameter to constructorZach Hilman2018-11-022-3/+5
* | | | | | | | | | Merge pull request #1676 from lioncash/warnbunnei2018-11-162-3/+4
|\ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | gl_state: Amend compilation warningsLioncash2018-11-132-3/+4
| | |_|_|_|_|_|_|/ / | |/| | | | | | | |
* | | | | | | | | | Merge pull request #1706 from lioncash/file-errbunnei2018-11-164-33/+16
|\ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | file_sys/errors: Remove currently unused filesystem error codesLioncash2018-11-161-10/+0
| * | | | | | | | | | file_sys/errors: Get rid of the ErrCodes namespaceLioncash2018-11-161-17/+5
| * | | | | | | | | | file_sys/errors: Extract FS-related error codes to file_sys/errors.hLioncash2018-11-164-14/+19
| | |_|_|_|_|_|_|/ / | |/| | | | | | | |
* | | | | | | | | | Added SetIsPalmaAllConnectable, SetPalmaBoostModeDavid Marcec2018-11-161-2/+14
| |_|_|_|_|/ / / / |/| | | | | | | |
* | | | | | | | | Fixed switching operation modes when not running a gameDavid Marcec2018-11-161-0/+3
|/ / / / / / / /
* | | | | | | | Fixed priority switching edge case for handheld (#1675)David2018-11-161-12/+46
* | | | | | | | Merge pull request #1699 from DarkLordZach/deterministic-rng-3bunnei2018-11-161-1/+2
|\ \ \ \ \ \ \ \
| * | | | | | | | csrng: Use random integer distribution instead of raw engineZach Hilman2018-11-161-1/+2
| | |_|/ / / / / | |/| | | | | |
* | | | | | | | Merge pull request #1687 from lioncash/deduplicationbunnei2018-11-152-37/+13
|\ \ \ \ \ \ \ \
| * | | | | | | | kernel/thread: Deduplicate scheduler switching codeLioncash2018-11-142-37/+13
| | |/ / / / / / | |/| | | | | |
* | | | | | | | Merge pull request #1618 from DarkLordZach/dump-nsobunnei2018-11-1512-8/+75
|\ \ \ \ \ \ \ \
| * | | | | | | | patch_manager: Add support for dumping decompressed NSOsZach Hilman2018-10-292-1/+14
| * | | | | | | | settings: Add setting to control NSO dumpingZach Hilman2018-10-296-1/+28
| * | | | | | | | bis_factory: Add getter for mod dump root for a title IDZach Hilman2018-10-294-6/+33
* | | | | | | | | Merge pull request #1691 from lioncash/audrenbunnei2018-11-151-3/+3
|\ \ \ \ \ \ \ \ \ | |_|_|/ / / / / / |/| | | | | | | |
| * | | | | | | | service/audren_u: Forward RequestUpdateAuto through the same function as RequestUpdateLioncash2018-11-141-3/+3
* | | | | | | | | Merge pull request #1637 from FernandoS27/cachebunnei2018-11-151-18/+17
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | Improved GPU Caches lookup SpeedFernandoS272018-11-111-18/+17
* | | | | | | | | | Merge pull request #1697 from lioncash/accbunnei2018-11-152-15/+23
|\ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | profile_manager: Replace iterative loop with a ranged-for loop in ParseUserSaveFile()Lioncash2018-11-141-4/+5
| * | | | | | | | | | profile_manager: Move UUID Format function definitions into the cpp fileLioncash2018-11-142-11/+18
* | | | | | | | | | | Merge pull request #1696 from lioncash/acc-condbunnei2018-11-151-2/+4
|\ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | service/acc: Correct error case within TrySelectUserWithoutInteraction()Lioncash2018-11-141-2/+4
| |/ / / / / / / / / /
* | | | | | | | | | | Merge pull request #1695 from lioncash/trbunnei2018-11-151-1/+1
|\ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | yuzu/configure_system: Mark the entropy mask string as nontranslatableLioncash2018-11-141-1/+1
| |/ / / / / / / / / /
* | | | | | | | | | | Merge pull request #1690 from lioncash/nfpbunnei2018-11-141-1/+1
|\ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | nfp: Correct erroneous sizeof expression within GetTagInfo()Lioncash2018-11-141-1/+1
| | |_|_|_|/ / / / / / | |/| | | | | | | | |
* | | | | | | | | | | Merge pull request #1689 from lioncash/breakbunnei2018-11-141-0/+1
|\ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | hid/npad: Add missing break in switch statement within Controller_NPad::OnUpdate()Lioncash2018-11-141-0/+1
| |/ / / / / / / / / /
* | | | | | | | | | | Merge pull request #1688 from lioncash/unusedbunnei2018-11-141-2/+2
|\ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | service: Mark MakeFunctionString with the [[maybe_unused]] attribute.Lioncash2018-11-141-2/+2
| |/ / / / / / / / / /
* | | | | | | | | | | Merge pull request #1684 from lioncash/commonbunnei2018-11-142-88/+2
|\ \ \ \ \ \ \ \ \ \ \ | |_|/ / / / / / / / / |/| | | | | | | | | |
| * | | | | | | | | | string_util: Remove ArrayToString()Lioncash2018-11-142-21/+0
| * | | | | | | | | | string_util: Remove TryParse()Lioncash2018-11-142-54/+3
| * | | | | | | | | | string_util: Remove ThousandSeparate()Lioncash2018-11-131-14/+0
| |/ / / / / / / / /
* | | | | | | | | | Merge pull request #1679 from DarkLordZach/deterministic-rng-2bunnei2018-11-146-8/+33
|\ \ \ \ \ \ \ \ \ \ | |_|_|/ / / / / / / |/| | | | | | | | |
| * | | | | | | | | svc: Use proper random entropy generation algorithmZach Hilman2018-11-136-8/+33
| |/ / / / / / / /
* | | | | | | | | Merge pull request #1662 from FreddyFunk/CopySurface-Optimizationbunnei2018-11-141-10/+7
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | gl_rasterizer_cache: Remove unnecessary memory allocation and copy in CopySurfaceFrederic Laing2018-11-081-10/+7
* | | | | | | | | | Merge pull request #1686 from DarkLordZach/move-open-yuzu-folderbunnei2018-11-141-1/+2
|\ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | qt: Move Open yuzu Folder action from Help to FileZach Hilman2018-11-131-1/+2
| | |/ / / / / / / / | |/| | | | | | | |
* | | | | | | | | | Merge pull request #1685 from lioncash/basebunnei2018-11-141-1/+0
|\ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | video_core/renderer_base: Remove GL include from the renderer base class filesLioncash2018-11-131-1/+0
| |/ / / / / / / / /
* | | | | | | | | | Merge pull request #1677 from FreddyFunk/skip-vao-binding-cleanupbunnei2018-11-141-4/+2
|\ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | gl_rasterizer: Minor cleanupFrederic L2018-11-131-4/+2
| |/ / / / / / / / /
* | | | | | | | | | Merge pull request #1680 from lioncash/membunnei2018-11-144-86/+98
|\ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | vm_manager: Unstub GetTotalHeapUsage()Lioncash2018-11-131-2/+1
| * | | | | | | | | | kernel/process: Migrate heap-related memory management out of the process class and into the vm managerLioncash2018-11-134-84/+97
| |/ / / / / / / / /
* | | | | | | | | | Merge pull request #1682 from lioncash/audiobunnei2018-11-141-2/+23
|\ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | hle/audren_u: Implement Get/SetRenderingTimeLimitLioncash2018-11-131-2/+23
| |/ / / / / / / / /
* | | | | | | | | | Merge pull request #1683 from lioncash/typobunnei2018-11-141-1/+1
|\ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | audio_core/audio_renderer: Fix typo in AuxInfo member nameLioncash2018-11-131-1/+1
| |/ / / / / / / / /
* | | | | | | | | | Merge pull request #1608 from DarkLordZach/save-data-readerbunnei2018-11-1410-16/+260
|\ \ \ \ \ \ \ \ \ \ | |/ / / / / / / / / |/| | | | | | | | |
| * | | | | | | | | ns: Implement command 400: GetApplicationControlDataZach Hilman2018-10-294-17/+75
| * | | | | | | | | fsp_srv: Implement ISaveDataInfoReaderZach Hilman2018-10-291-0/+144
| * | | | | | | | | fsp_srv: Implement command 61: OpenSaveDataInfoReaderBySaveDataSpaceIdZach Hilman2018-10-292-1/+13
| * | | | | | | | | savedata_factory: Expose accessors for SaveDataSpaceZach Hilman2018-10-294-14/+32
| * | | | | | | | | loader/nro: Call RegisterRomFS from LoadZach Hilman2018-10-291-0/+5
| * | | | | | | | | control_metadata: Add GetRawBytes function to NACPZach Hilman2018-10-292-0/+7
| | |_|_|_|_|_|/ / | |/| | | | | | |
* | | | | | | | | Merge pull request #1628 from greggameplayer/Texture2DArraybunnei2018-11-131-0/+1
|\ \ \ \ \ \ \ \ \
| * \ \ \ \ \ \ \ \ Merge branch 'master' into Texture2DArraygreggameplayer2018-11-0623-195/+392
| |\ \ \ \ \ \ \ \ \
| * | | | | | | | | | correct syntaxgreggameplayer2018-11-021-4/+3
| * | | | | | | | | | Merge branch 'master' into Texture2DArraygreggameplayer2018-11-0227-1066/+1477
| |\ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | Implement SurfaceTarget Texture2DArraygreggameplayer2018-10-311-0/+1
| | |_|_|_|_|_|/ / / / | |/| | | | | | | | |
* | | | | | | | | | | Merge pull request #1670 from DarkLordZach/deterministic-rngbunnei2018-11-139-103/+187
|\ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | svc: Return random seed for svcGetInfo RandomEntropyZach Hilman2018-11-132-4/+8
| * | | | | | | | | | | settings: Add config option to set RNG seedZach Hilman2018-11-126-100/+171
| * | | | | | | | | | | csrng: Use std::mt19937 engine for random number generationZach Hilman2018-11-122-2/+11
| | |_|_|_|_|_|_|_|_|/ | |/| | | | | | | | |
* | | | | | | | | | | Merge pull request #1665 from ogniK5377/GetClockSnapshotbunnei2018-11-133-21/+132
|\ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | Added maybe_unusedDavid Marcec2018-11-102-2/+7
| * | | | | | | | | | | Added ToPosixTime & ToPosixTimeWithMyRuleDavid Marcec2018-11-101-2/+41
| * | | | | | | | | | | Added consts and staticDavid Marcec2018-11-101-6/+6
| * | | | | | | | | | | Implement GetClockSnapshotDavid Marcec2018-11-093-21/+88
* | | | | | | | | | | | Implement ASTC_2D_10X8 & ASTC_2D_10X8_SRGB (#1666)greggameplayer2018-11-134-71/+101
* | | | | | | | | | | | Merge pull request #1650 from FreddyFunk/castbunnei2018-11-131-1/+2
|\ \ \ \ \ \ \ \ \ \ \ \ | |_|_|_|_|_|_|_|_|_|_|/ |/| | | | | | | | | | |
| * | | | | | | | | | | yuzu/main: Fix compiler warningFrederic Laing2018-11-061-1/+2
* | | | | | | | | | | | Merge pull request #1674 from FearlessTobi/fullscreen-fixJames Rowe2018-11-121-1/+1
|\ \ \ \ \ \ \ \ \ \ \ \ | |_|_|/ / / / / / / / / |/| | | | | | | | | | |
| * | | | | | | | | | | yuzu: Add a missing "!" to fix the stuck-in-fullscreen bugTobias2018-11-121-1/+1
| | |_|_|_|_|/ / / / / | |/| | | | | | | | |
* | | | | | | | | | | Merge pull request #1660 from Tinob/masterbunnei2018-11-129-88/+138
|\ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | Use core extensions when available to set max anisotropic filtering levelRodolfo Bogado2018-11-111-2/+7
| * | | | | | | | | | | Improve state management by splitting some of the states id separated function to avoid a full apply overheadRodolfo Bogado2018-11-116-39/+40
| * | | | | | | | | | | Try to fix problems with stencil test in some games, relax translation to opengl enums to avoid crashing and only generate logs of the errors.Rodolfo Bogado2018-11-114-37/+61
| * | | | | | | | | | | set sampler max lod, min lod, lod bias and max anisotropyRodolfo Bogado2018-11-113-13/+33
| | |_|_|_|_|_|_|/ / / | |/| | | | | | | | |
* | | | | | | | | | | Merge pull request #1652 from FreddyFunk/static-castbunnei2018-11-112-3/+3
|\ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | configure_system: Fix compiler warningFrederic Laing2018-11-062-3/+3
| | |_|/ / / / / / / / | |/| | | | | | | | |
* | | | | | | | | | | Merge pull request #1664 from FreddyFunk/cast2bunnei2018-11-111-2/+2
|\ \ \ \ \ \ \ \ \ \ \ | |_|/ / / / / / / / / |/| | | | | | | | | |
| * | | | | | | | | | gl_rasterizer: Fix compiler warningsFrederic Laing2018-11-081-2/+2
| | |_|_|_|_|_|/ / / | |/| | | | | | | |
* | | | | | | | | | Merge pull request #1669 from ReinUsesLisp/fixup-gsbunnei2018-11-114-15/+24
|\ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | gl_shader_decompiler: Guard out of bound geometry shader input readsReinUsesLisp2018-11-104-15/+24
| | |_|_|/ / / / / / | |/| | | | | | | |
* | | | | | | | | | Merge pull request #1663 from lioncash/rasterbunnei2018-11-119-10/+25
|\ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | rasterizer_cache: Remove reliance on the System singletonLioncash2018-11-089-10/+25
| |/ / / / / / / / /
* | | | | | | | | | Merge pull request #1648 from FernandoS27/texs-3-arraybunnei2018-11-111-7/+11
|\ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | Correct issue where texturelod could not be applied to 2darrayshadowFernandoS272018-11-081-1/+5
| * | | | | | | | | | Implement 3 coordinate array in TEXS instructionFernandoS272018-11-071-6/+6
| | |/ / / / / / / / | |/| | | | | | | |
* | | | | | | | | | Merge pull request #1654 from degasus/dirty_flagsbunnei2018-11-114-7/+37
|\ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | gl_rasterizer: Skip VAO binding if the state is clean.Markus Wick2018-11-063-2/+21
| * | | | | | | | | | gl_rasterizer: Split VAO and VB setup functions.Markus Wick2018-11-062-5/+16
| | |_|_|_|_|_|/ / / | |/| | | | | | | |
* | | | | | | | | | Merge pull request #1656 from ogniK5377/message-queueJames Rowe2018-11-108-36/+170
|\ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | Renamed CheckIfOperationChanged to OnDockedModeChangedDavid Marcec2018-11-082-21/+23
| * | | | | | | | | | FixupsDavid Marcec2018-11-073-12/+17
| * | | | | | | | | | Ability to switch between docked and undocked mode in-gameDavid Marcec2018-11-077-36/+163
| |/ / / / / / / / /
* | | / / / / / / / rasterizer_cache: Add missing virtual destructor to RasterizerCacheObjectLioncash2018-11-083-0/+10
| |_|/ / / / / / / |/| | | | | | | |
* | | | | | | | | gl_resource_manager: Amend clang-format discrepanciesLioncash2018-11-081-4/+2
* | | | | | | | | Merge pull request #1658 from ogniK5377/holdtype-stylebunnei2018-11-081-0/+2
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | Updated npad styles on holdtype switchesDavid Marcec2018-11-071-0/+2
| | |/ / / / / / / | |/| | | | | | |
* | | | | | | | | svcBreak now dumps information from the debug buffer passed (#1646)David2018-11-081-0/+28
* | | | | | | | | Merge pull request #1655 from ogniK5377/shantaebunnei2018-11-085-3/+26
|\ \ \ \ \ \ \ \ \ | |/ / / / / / / / |/| | | | | | | |
| * | | | | | | | fixed spelling errorDavid Marcec2018-11-071-1/+1
| * | | | | | | | Added missing logDavid Marcec2018-11-071-0/+1
| * | | | | | | | Implement acc:TrySelectUserWithoutInteractionDavid Marcec2018-11-075-3/+25
| |/ / / / / / /
* | | | | | | | Merge pull request #1630 from bunnei/fix-mapbufferexbunnei2018-11-072-31/+52
|\ \ \ \ \ \ \ \
| * | | | | | | | memory_manager: Do not MapBufferEx over already in use memory.bunnei2018-11-012-31/+52
* | | | | | | | | Merge pull request #1635 from Tinob/masterbunnei2018-11-076-153/+338
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | Add support to color mask to avoid issues in blending caused by wrong values in the alpha channel in some render targets.Rodolfo Bogado2018-11-055-25/+79
| * | | | | | | | | Implement multi-target viewports and blendingRodolfo Bogado2018-11-056-128/+259
* | | | | | | | | | gl_rasterizer_cache: Add profiles for Copy and Blit.Markus Wick2018-11-061-2/+6
* | | | | | | | | | gl_resource_manager: Profile creation and deletion.Markus Wick2018-11-061-0/+42
* | | | | | | | | | gl_stream_buffer: Profile orphaning of stream buffer.Markus Wick2018-11-061-0/+5
* | | | | | | | | | microprofile: Drop ReleaseActiveBuffer scope.Markus Wick2018-11-061-4/+0
| |_|/ / / / / / / |/| | | | | | | |
* | | | | | | | | gl_resource_manager: Split implementations in .cpp file.Markus Wick2018-11-065-114/+167
| |_|/ / / / / / |/| | | | | | |
* | | | | | | | Merge pull request #1616 from FernandoS27/cube-arraybunnei2018-11-054-0/+20
|\ \ \ \ \ \ \ \
| * | | | | | | | Implement Cube ArraysFernandoS272018-11-014-0/+20
* | | | | | | | | Merge pull request #1633 from ogniK5377/reload-inputbunnei2018-11-052-0/+5
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | Fixed HID crash when launching more than 1 game & signaled syleset change eventDavid Marcec2018-11-022-0/+5
| | |_|_|_|_|/ / / | |/| | | | | | |
* | | | | | | | | Merge pull request #1441 from CarlKenner/DebuggerLogbunnei2018-11-054-2/+29
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | logging: Add DebuggerBackend for logging to Visual StudioCarl Kenner2018-10-074-2/+29
* | | | | | | | | | Merge pull request #1639 from DarkLordZach/open-yuzu-folderbunnei2018-11-053-0/+13
|\ \ \ \ \ \ \ \ \ \ | |_|_|_|/ / / / / / |/| | | | | | | | |
| * | | | | | | | | qt: Add help option to open yuzu folderZach Hilman2018-11-033-0/+13
| | |_|_|_|_|_|_|/ | |/| | | | | | |
* | | | | | | | | Merge pull request #1625 from FernandoS27/astcbunnei2018-11-059-75/+154
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | Fix ASTC Decompressor to support depth parameterFernandoS272018-11-027-65/+131
| * | | | | | | | | Fix ASTC formatsFernandoS272018-11-014-12/+21
| * | | | | | | | | Implemented ASTC 5x5FernandoS272018-11-011-1/+5
* | | | | | | | | | Merge pull request #1645 from dharmin/masterMat M2018-11-051-1/+1
|\ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | Fix quickstart linkDharmin K Shah2018-11-041-1/+1
| | |/ / / / / / / / | |/| | | | | | | |
* / | | | | | | | | Fix typo in BufferTransformFlagsFrederic Laing2018-11-041-2/+2
|/ / / / / / / / /
* | | / / / / / / Fixed incorrect hwopus assertDavid Marcec2018-11-021-1/+1
| |_|/ / / / / / |/| | | | | | |
* | | | | | | | Merge pull request #1615 from lioncash/inputbunnei2018-11-025-25/+113
|\ \ \ \ \ \ \ \ | |_|_|_|/ / / / |/| | | | | | |
| * | | | | | | configure_system: Contrain profile usernames to 32 charactersLioncash2018-10-315-25/+113
* | | | | | | | Merge pull request #1623 from Tinob/masterbunnei2018-11-013-105/+158
|\ \ \ \ \ \ \ \ | |_|/ / / / / / |/| | | | | | |
| * | | | | | | Improve OpenGL state handlingRodolfo Bogado2018-10-313-105/+158
| | |_|_|_|/ / | |/| | | | |
* | | | | | | Merge pull request #1527 from FernandoS27/assert-flowbunnei2018-11-012-2/+27
|\ \ \ \ \ \ \
| * | | | | | | Assert Control Flow Instructions using Control CodesFernandoS272018-10-292-3/+28
| | |/ / / / / | |/| | | | |
* | | | | | | maxwell_3d: Restructure macro upload to use a single macro code memory.bunnei2018-11-014-27/+55
* | | | | | | Merge pull request #1604 from FearlessTobi/port-4369bunnei2018-11-017-7/+65
|\ \ \ \ \ \ \
| * | | | | | | compatdb: Use a seperate endpoint for testcase submissionfearlessTobi2018-10-287-7/+65
* | | | | | | | Merge pull request #1528 from FernandoS27/assert-control-codesbunnei2018-11-012-1/+103
|\ \ \ \ \ \ \ \ | |_|_|_|_|/ / / |/| | | | | | |
| * | | | | | | Assert Control Codes GenerationFernandoS272018-10-302-1/+103
* | | | | | | | Merge pull request #1614 from ReinUsesLisp/surface-paramsbunnei2018-11-016-898/+954
|\ \ \ \ \ \ \ \
| * | | | | | | | video_core: Move surface declarations out of gl_rasterizer_cacheReinUsesLisp2018-10-306-898/+954
| | |_|_|/ / / / | |/| | | | | |
* / | | | | | | service/usb: Update IPdSession's function tableLioncash2018-10-301-3/+3
|/ / / / / / /
* | | | | | | Merge pull request #1624 from lioncash/boostbunnei2018-10-303-4/+0
|\ \ \ \ \ \ \
| * | | | | | | general: Remove unused boost inclusions where applicableLioncash2018-10-303-4/+0
* | | | | | | | Merge pull request #1595 from FreddyFunk/castbunnei2018-10-301-1/+1
|\ \ \ \ \ \ \ \ | |/ / / / / / / |/| | | | | | |
| * | | | | | | configure_system: Fix compiler warningFrederic Laing2018-10-281-1/+1
* | | | | | | | global: Use std::optional instead of boost::optional (#1578)Frederic L2018-10-3049-266/+274
* | | | | | | | Merge pull request #1621 from lioncash/ipcbunnei2018-10-303-6/+9
|\ \ \ \ \ \ \ \
| * | | | | | | | hle_ipc: Add member function for querying the existence of a domain headerLioncash2018-10-303-3/+6
| * | | | | | | | hle_ipc: Make GetDomainMessageHeader return a regular pointerLioncash2018-10-302-3/+3
| | |_|_|/ / / / | |/| | | | | |
* | | | | | | | Merge pull request #1611 from lioncash/constbunnei2018-10-304-13/+52
|\ \ \ \ \ \ \ \ | |_|_|/ / / / / |/| | | | | | |
| * | | | | | | core: Make System references const where applicableLioncash2018-10-282-3/+3
| * | | | | | | core: Add missing const variants of getters for the System classLioncash2018-10-282-10/+49
| |/ / / / / /
* | | | | | | Merge pull request #1580 from FernandoS27/mm-implbunnei2018-10-306-109/+254
|\ \ \ \ \ \ \
| * | | | | | | Fixed black textures, pixelation and we no longer require to auto-generate mipmapsFernandoS272018-10-291-14/+2
| * | | | | | | Fixed mipmap block autosizing algorithmFernandoS272018-10-293-13/+25
| * | | | | | | Fixed Invalid Image size and Mipmap calculationFernandoS272018-10-291-4/+7
| * | | | | | | Fixed Block Resizing algorithm and Clang FormatFernandoS272018-10-293-12/+19
| * | | | | | | Implement Mip FilterFernandoS272018-10-294-10/+33
| * | | | | | | Zero out memory region of recreated surface before flushingFernandoS272018-10-291-0/+2
| * | | | | | | Implement MipmapsFernandoS272018-10-282-101/+211
| |/ / / / / /
* | | | | | | Merge pull request #1617 from FearlessTobi/fix-stretch-delaybunnei2018-10-301-3/+3
|\ \ \ \ \ \ \ | |_|_|_|_|_|/ |/| | | | | |
| * | | | | | time_stretch: Switch to values of CitrafearlessTobi2018-10-291-3/+3
| | |_|_|_|/ | |/| | | |
* | | | | | Merge pull request #1613 from ReinUsesLisp/gl-utilsbunnei2018-10-296-30/+61
|\ \ \ \ \ \ | |/ / / / / |/| | | | |
| * | | | | video_core: Move OpenGL specific utils to its rendererReinUsesLisp2018-10-296-30/+61
| |/ / / /
* | | | | Merge pull request #1610 from slashiee/dxt1-alphabunnei2018-10-291-2/+2
|\ \ \ \ \
| * | | | | Enable alpha channel for DXT1 texture formatMichael2018-10-281-2/+2
| |/ / / /
* / / / / renderer_opengl: Correct bpp value for ASTC_2D_8X5_SRGBRodolfo Bogado2018-10-291-1/+1
|/ / / /
* / / / Correct bpp value for ASTC_2D_8X5Tobias2018-10-281-1/+1
|/ / /
* | | Merge pull request #1601 from FernandoS27/shader-precisionbunnei2018-10-281-20/+35
|\ \ \
| * | | Refactor precise usage and add FMNMX, MUFU, FMUL32 and FADD332FernandoS272018-10-282-74/+37
| * | | Improved Shader accuracy on Vertex and Geometry Shaders with FFMA, FMUL and FADDFernandoS272018-10-282-6/+58
| |/ /
* | | Merge pull request #1593 from lioncash/svcbunnei2018-10-286-35/+128
|\ \ \
| * | | svc: Localize the GetInfo enum class to the function itselfLioncash2018-10-262-32/+31
| * | | svc: Implement svcGetInfo command 0xF0000002Lioncash2018-10-266-4/+98
* | | | file_sys/patch_manager: Remove unnecessary if-statements (#1586)Frederic L2018-10-281-7/+6
* | | | Merge pull request #1598 from DeeJayBro/delete-directorybunnei2018-10-281-2/+26
|\ \ \ \
| * | | | service/filesystem: Add DirectoryDelete & DirectoryDeleteRecursivelyDeeJayBro2018-10-271-2/+26
| |/ / /
* | | | Merge pull request #1600 from DarkLordZach/nsp-secondary-loader-fixbunnei2018-10-281-17/+20
|\ \ \ \
| * | | | loader/nsp: Move secondary loader initialization to constructorZach Hilman2018-10-271-17/+20
| |/ / /
* | | | Implement sRGB Support, including workarounds for nvidia driver issues and QT sRGB supportRodolfo Bogado2018-10-288-40/+197
* | | | Merge pull request #1602 from DarkLordZach/key-derivation-isxdigitbunnei2018-10-281-1/+1
|\ \ \ \
| * | | | key_manager: Use isxdigit instead of isdigit when reading key fileZach Hilman2018-10-281-1/+1
| |/ / /
* | | | Merge pull request #1597 from lioncash/errorbunnei2018-10-281-51/+70
|\ \ \ \
| * | | | configure_system: Make GetIcon() return the scaled 64x64 iconLioncash2018-10-271-14/+7
| * | | | configure_system: Move entry formatting for the user account list entries to its own functionLioncash2018-10-271-18/+22
| * | | | configure_system: Display errors to the user if file operations fail when setting user imagesLioncash2018-10-271-24/+46
| |/ / /
* | | | Merge pull request #1594 from FreddyFunk/static-castbunnei2018-10-281-2/+2
|\ \ \ \ | |_|/ / |/| | |
| * | | gl_rasterizer_cache: Fix compiler warningFrederic Laing2018-10-271-2/+2
| |/ /
* | | Merge pull request #1596 from FearlessTobi/port-4367bunnei2018-10-271-1/+2
|\ \ \
| * | | cubeb_sink: ignore null-name device when selectingWeiyi Wang2018-10-271-1/+2
| |/ /
* | | Merge pull request #1592 from bunnei/prim-restartbunnei2018-10-275-1/+40
|\ \ \
| * | | gl_rasterizer: Implement primitive restart.bunnei2018-10-265-1/+40
| |/ /
* / / Implement Default Block Height for each formatFernandoS272018-10-271-0/+62
|/ /
* | Merge pull request #1533 from FernandoS27/lmembunnei2018-10-263-1/+138
|\ \
| * | Implemented LD_L and ST_LFernandoS272018-10-243-12/+112
| * | Implement Shader Local MemoryFernandoS272018-10-241-0/+37
* | | Merge pull request #1430 from DarkLordZach/remove-promote-dirbunnei2018-10-2617-95/+1
|\ \ \
| * | | vfs: Remove InterpretAsDirectory and related functionsZach Hilman2018-10-1917-95/+1
* | | | Merge pull request #1591 from bunnei/depth-rangebunnei2018-10-266-14/+41
|\ \ \ \
| * | | | maxwell_3d: Add code for initializing register defaults.bunnei2018-10-262-1/+21
| * | | | gl_rasterizer: Implement depth range.bunnei2018-10-264-13/+20
* | | | | Merge pull request #1569 from lioncash/amiibobunnei2018-10-263-17/+40
|\ \ \ \ \
| * | | | | yuzu/main: Notify user of loading errors with Amiibo dataLioncash2018-10-243-17/+40
* | | | | | Merge pull request #1587 from lioncash/privatebunnei2018-10-262-45/+46
|\ \ \ \ \ \
| * | | | | | configure_system: Make the file selector text translatableLioncash2018-10-251-1/+1
| * | | | | | configure_system: Make GetAccountUsername() an internal functionLioncash2018-10-252-25/+28
| * | | | | | configure_system: Default initialize member variablesLioncash2018-10-251-4/+5
| * | | | | | configure_system: Simplify UUID generation call in AddUser()Lioncash2018-10-251-2/+1
| * | | | | | configure_system: Amend function casingLioncash2018-10-252-6/+6
| * | | | | | configure_system: Add missing override specifier on the destructorLioncash2018-10-251-1/+1
| * | | | | | configure_system: Make public slots privateLioncash2018-10-251-7/+5
* | | | | | | ldr: Partially implement LoadNro.bunnei2018-10-261-3/+49
* | | | | | | process: LoadModule should clear JIT instruction cache.bunnei2018-10-261-0/+6
* | | | | | | Kernel/Memory: Added a function to first a suitable guest address at which to allocate a region of a given size.bunnei2018-10-262-0/+28
* | | | | | | nro: Make LoadNro method accessible outside of apploader code.bunnei2018-10-262-6/+18
| |_|/ / / / |/| | | | |
* | | | | | ips_layer: Use rle_size instead of data_size in RLE patch applicationZach Hilman2018-10-251-1/+1
|/ / / / /
* | | | | Merge pull request #1579 from lioncash/usbbunnei2018-10-251-21/+22
|\ \ \ \ \
| * | | | | service/usb: Update service function tablesLioncash2018-10-251-21/+22
* | | | | | Merge pull request #1576 from lioncash/acc-warnbunnei2018-10-251-25/+27
|\ \ \ \ \ \
| * | | | | | service/acc: Move fallback image to file scopeLioncash2018-10-251-14/+13
| * | | | | | service/acc: Silence compiler warningsLioncash2018-10-251-5/+8
| * | | | | | service/acc: Early return in failure case in LoadImage()Lioncash2018-10-251-8/+8
| |/ / / / /
* | | | | | Merge pull request #1577 from lioncash/errbunnei2018-10-255-34/+16
|\ \ \ \ \ \
| * | | | | | kernel/errors: Remove now-unused, unnecessary, error codesLioncash2018-10-242-13/+0
| * | | | | | kernel/shared_memory: Return ERR_INVALID_MEMORY_PERMISSIONS instead of ERR_INVALID_COMBINATIONLioncash2018-10-241-4/+3
| * | | | | | kernel/server_port: Simplify emptiness check within ShouldWait()Lioncash2018-10-241-1/+1
| * | | | | | kernel/server_port: Change error case return value in Accept() to ERR_NOT_FOUNDLioncash2018-10-242-3/+1
| * | | | | | kernel/error: Remove leftover 3DS error codesLioncash2018-10-241-5/+0
| * | | | | | kernel/svc: Amend returned error code for invalid priorities in CreateThreadLioncash2018-10-241-1/+1
| * | | | | | kernel/svc: Move and correct returned error code for invalid thread priorities in SetThreadPriority()Lioncash2018-10-241-5/+6
| * | | | | | kernel/error: Add error code for invalid pointersLioncash2018-10-241-1/+1
| * | | | | | kernel/error: Add error code for closed sessionsLioncash2018-10-241-1/+3
| |/ / / / /
* | | | | | Merge pull request #1524 from FernandoS27/layers-fixbunnei2018-10-253-72/+109
|\ \ \ \ \ \
| * | | | | | Fixed Layered Textures Loading and CubemapsFernandoS272018-10-233-72/+109
* | | | | | | Merge pull request #1575 from lioncash/qstringbunnei2018-10-251-4/+9
|\ \ \ \ \ \ \
| * | | | | | | game_list_worker: Use QString's formatting instead of fmt in FormatPatchNameVersions()Lioncash2018-10-241-4/+9
| | |/ / / / / | |/| | | | |
* | | | | | | Merge pull request #1570 from lioncash/optionalbunnei2018-10-255-48/+53
|\ \ \ \ \ \ \
| * | | | | | | profile_manager: Use std::optional instead of boost::optionalLioncash2018-10-245-48/+53
| |/ / / / / /
* | | | | | | Merge pull request #1558 from lioncash/ptrbunnei2018-10-252-13/+14
|\ \ \ \ \ \ \ | |_|_|_|_|/ / |/| | | | | |
| * | | | | | yuzu/configuration/config: Use a std::unique_ptr for qt_config instead of a raw pointerLioncash2018-10-242-8/+8
| * | | | | | yuzu/configuration/config: Reorganize member variable and function layoutLioncash2018-10-241-6/+7
| | |_|/ / / | |/| | | |
* | | | | | Merge pull request #1565 from lioncash/audiobunnei2018-10-242-3/+1
|\ \ \ \ \ \
| * | | | | | time_stretch: Remove unused m_channel_count member variableLioncash2018-10-242-3/+1
| |/ / / / /
* | | | | | Merge pull request #1554 from FernandoS27/pointsizebunnei2018-10-243-5/+28
|\ \ \ \ \ \
| * | | | | | Implement PointSizeFernandoS272018-10-233-5/+28
* | | | | | | Merge pull request #1571 from lioncash/debug-translatebunnei2018-10-242-15/+20
|\ \ \ \ \ \ \
| * | | | | | | graphic_breakpoints: Correct translation of strings in BreakpointModel's data() functionLioncash2018-10-242-15/+20
| | |_|/ / / / | |/| | | | |
* | | | | | | Merge pull request #1564 from lioncash/npadbunnei2018-10-241-2/+3
|\ \ \ \ \ \ \
| * | | | | | | npad: Remove unused controller variable from OnInit()Lioncash2018-10-241-2/+3
| | |_|/ / / / | |/| | | | |
* | | | | | | Merge pull request #1568 from lioncash/dirbunnei2018-10-241-4/+3
|\ \ \ \ \ \ \
| * | | | | | | game_list: Use QFileInfo instead of common's file functionsLioncash2018-10-241-4/+3
| | |_|/ / / / | |/| | | | |
* | | | | | | Merge pull request #1567 from lioncash/translatebunnei2018-10-241-5/+5
|\ \ \ \ \ \ \
| * | | | | | | game_list: Make game list column headers translatableLioncash2018-10-241-5/+5
| |/ / / / / /
* | | | | | | Merge pull request #1566 from lioncash/strbunnei2018-10-241-4/+2
|\ \ \ \ \ \ \
| * | | | | | | bootmanager: Use QStringLiteral instead of std::string to represent the window titleLioncash2018-10-241-4/+2
| |/ / / / / /
* | | | | | | Merge pull request #1563 from lioncash/framebunnei2018-10-241-4/+0
|\ \ \ \ \ \ \
| * | | | | | | perf_stats: Remove unused variable within DoFrameLimiting()Lioncash2018-10-241-4/+0
| | |/ / / / / | |/| | | | |
* | | | | | | Merge pull request #1562 from lioncash/aocbunnei2018-10-241-3/+3
|\ \ \ \ \ \ \
| * | | | | | | aoc_u: Make use of previously-unused CheckAOCTitleIDMatchesBase() functionLioncash2018-10-241-3/+3
| |/ / / / / /
* | | | | | | Merge pull request #1560 from lioncash/unusedbunnei2018-10-242-2/+0
|\ \ \ \ \ \ \
| * | | | | | | decoders: Remove unused variable within SwizzledData()Lioncash2018-10-241-1/+0
| * | | | | | | maxwell_3d: Remove unused variable within ProcessQueryGet()Lioncash2018-10-241-1/+0
| |/ / / / / /
* | | | | | | Merge pull request #1561 from lioncash/fsbunnei2018-10-242-3/+6
|\ \ \ \ \ \ \
| * | | | | | | vfs: Handle failure of file reading within VfsRawCopy()Lioncash2018-10-241-2/+6
| * | | | | | | key_manager: Remove unused variable in DeriveBase()Lioncash2018-10-241-1/+0
| |/ / / / / /
* | | | | | | Merge pull request #1559 from lioncash/logbunnei2018-10-242-0/+5
|\ \ \ \ \ \ \ | |_|_|/ / / / |/| | | | | |
| * | | | | | logging/backend: Add missing services to the log filtersLioncash2018-10-242-0/+5
| |/ / / / /
* | | | | | Merge pull request #1468 from DarkLordZach/profile-manager-uiMat M2018-10-2411-118/+742
|\ \ \ \ \ \ | |/ / / / / |/| | | | |
| * | | | | configure_system: Clear current username before overwritingZach Hilman2018-10-242-5/+15
| * | | | | profile_manager: Create save data if it doesn't exist on useZach Hilman2018-10-244-18/+42
| * | | | | acc: Fix account UUID duplication errorZach Hilman2018-10-248-80/+106
| * | | | | configure_system: Clear selection after user deleteZach Hilman2018-10-242-12/+18
| * | | | | profile_manager: Load user icons, names, and UUIDs from system saveZach Hilman2018-10-2411-133/+308
| * | | | | acc: Load user images from config dirZach Hilman2018-10-241-9/+45
| * | | | | qt: Allow user to select emu user on open save dataZach Hilman2018-10-241-3/+24
| * | | | | qt: Add Profile Manager UI to system settingsZach Hilman2018-10-243-76/+350
| * | | | | am: Pass current user UUID to launch parametersZach Hilman2018-10-241-7/+9
| * | | | | profile_manager: Load users from emulator settingsZach Hilman2018-10-242-5/+7
| * | | | | settings: Add users and current_user settings and remove usernameZach Hilman2018-10-243-6/+54
* | | | | | Merge pull request #1551 from ogniK5377/improved-svcbreakbunnei2018-10-241-5/+51
|\ \ \ \ \ \ | |/ / / / / |/| | | | |
| * | | | | Added assertion failed, reworked logging levelsDavid Marcec2018-10-231-16/+24
| * | | | | Added break types to svcBreakDavid Marcec2018-10-231-4/+42
* | | | | | Added Amiibo support (#1390)David2018-10-2412-80/+386
* | | | | | Merge pull request #1515 from DarkLordZach/dlc-lfsbunnei2018-10-246-16/+97
|\ \ \ \ \ \
| * | | | | | qt: Add support for dumping a DLC Data RomFSZach Hilman2018-10-184-11/+73
| * | | | | | registered_cache: Deduplicate results of ListEntry and ListEntryFilterZach Hilman2018-10-172-2/+16
| * | | | | | fsp_srv: Apply patches to Data storage in OpenDataStorageByDataIdZach Hilman2018-10-171-1/+5
| * | | | | | patch_manager: Add support for using LayeredFS with DataZach Hilman2018-10-171-2/+3
* | | | | | | Merge pull request #1542 from lioncash/projectbunnei2018-10-242-5/+5
|\ \ \ \ \ \ \
| * | | | | | | CMakeLists: Use PROJECT_SOURCE_DIR instead of CMAKE_SOURCE_DIRLioncash2018-10-202-5/+5
* | | | | | | | Merge pull request #1553 from lioncash/membunnei2018-10-243-200/+0
|\ \ \ \ \ \ \ \
| * | | | | | | | common: Remove memory_util.cpp/.hLioncash2018-10-233-200/+0
| | |_|_|/ / / / | |/| | | | | |
* | | | | | | | Merge pull request #1540 from lioncash/handlebunnei2018-10-249-100/+97
|\ \ \ \ \ \ \ \ | |/ / / / / / / |/| | | | | | |
| * | | | | | | kernel/process: Make the handle table per-processLioncash2018-10-209-100/+97
| |/ / / / / /
* | | | | | | Merge pull request #1552 from FearlessTobi/port-4336bunnei2018-10-231-5/+8
|\ \ \ \ \ \ \
| * | | | | | | only redefine 64 bit file operation for MSVCWeiyi Wang2018-10-231-5/+8
* | | | | | | | Merge pull request #1519 from ReinUsesLisp/vsetpbunnei2018-10-232-75/+108
|\ \ \ \ \ \ \ \
| * | | | | | | | gl_shader_decompiler: Implement VSETPReinUsesLisp2018-10-232-0/+26
| * | | | | | | | gl_shader_decompiler: Abstract VMAD into a video subsetReinUsesLisp2018-10-232-75/+82
* | | | | | | | | Merge pull request #1539 from lioncash/dmabunnei2018-10-233-19/+10
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | engines/maxwell_*: Use nested namespace specifiers where applicableLioncash2018-10-203-12/+6
| * | | | | | | | | maxwell_dma: Make variables const where applicable within HandleCopy()Lioncash2018-10-201-3/+3
| * | | | | | | | | maxwell_dma: Make FlushAndInvalidate's size parameter a u64Lioncash2018-10-201-1/+1
| * | | | | | | | | maxwell_dma: Remove unused variables in HandleCopy()Lioncash2018-10-201-3/+0
| | |_|/ / / / / / | |/| | | | | | |
* | | | | | | | | Merge pull request #1470 from FernandoS27/alpha_testingbunnei2018-10-237-20/+87
|\ \ \ \ \ \ \ \ \ | |_|_|/ / / / / / |/| | | | | | | |
| * | | | | | | | Assert that multiple render targets are not set while alpha testingFernandoS272018-10-223-3/+17
| * | | | | | | | Use standard UBO and fix/stylize the codeFernandoS272018-10-228-91/+51
| * | | | | | | | Cache uniform locations and restructure the implementationFernandoS272018-10-223-33/+29
| * | | | | | | | Remove SyncAlphaTest and clang formatFernandoS272018-10-224-8/+9
| * | | | | | | | Added Alpha FuncFernandoS272018-10-222-3/+43
| * | | | | | | | Implemented Alpha TestingFernandoS272018-10-226-3/+59
* | | | | | | | | Merge pull request #1512 from ReinUsesLisp/brkbunnei2018-10-232-22/+43
|\ \ \ \ \ \ \ \ \ | |_|_|/ / / / / / |/| | | | | | | |
| * | | | | | | | gl_shader_decompiler: Implement PBK and BRKReinUsesLisp2018-10-182-22/+43
| | |_|/ / / / / | |/| | | | | |
* | | | | | | | Merge pull request #1550 from FernandoS27/fmul32bunnei2018-10-232-3/+8
|\ \ \ \ \ \ \ \ | |_|_|_|/ / / / |/| | | | | | |
| * | | | | | | Added Saturation to FMUL32IFernandoS272018-10-232-3/+8
| | |/ / / / / | |/| | | | |
* | | | | | | Merge pull request #1543 from lioncash/targetbunnei2018-10-231-1/+1
|\ \ \ \ \ \ \
| * | | | | | | CMakeLists: Use target_compile_definitions instead of add_definitions to define YUZU_ENABLE_COMPATIBILITY_REPORTINGLioncash2018-10-201-1/+1
| | |_|/ / / / | |/| | | | |
* | | | | | | Merge pull request #1537 from lioncash/shaderbunnei2018-10-231-6/+7
|\ \ \ \ \ \ \
| * | | | | | | gl_shader_decompiler: Allow std::move to function in SetPredicateLioncash2018-10-201-1/+1
| * | | | | | | gl_shader_decompiler: Get rid of variable shadowing warningsLioncash2018-10-201-2/+2
| * | | | | | | gl_shader_decompiler: Fix a few comment typosLioncash2018-10-201-3/+4
| |/ / / / / /
* | | | | | | Merge pull request #1545 from DarkLordZach/psmbunnei2018-10-225-0/+91
|\ \ \ \ \ \ \ | |_|/ / / / / |/| | | | | |
| * | | | | | psm: Stub GetChargerTypeZach Hilman2018-10-222-24/+27
| * | | | | | psm: Stub GetBatteryChargePercentageZach Hilman2018-10-212-1/+14
| * | | | | | service: Add skeleton for psm serviceZach Hilman2018-10-215-0/+75
| |/ / / / /
* | | | | | Merge pull request #1541 from lioncash/definebunnei2018-10-221-1/+1
|\ \ \ \ \ \
| * | | | | | web_service/CMakeLists: Make the CPPHTTPLIB_OPENSSL_SUPPORT constrained to the web_service library onlyLioncash2018-10-201-1/+1
| |/ / / / /
* | | | | | Merge pull request #1538 from lioncash/querybunnei2018-10-221-1/+1
|\ \ \ \ \ \
| * | | | | | svc: Fix vma boundary check in svcQueryMemoryLioncash2018-10-201-1/+1
| |/ / / / /
* | | | | | Merge pull request #1547 from FernandoS27/fix-fsetbunnei2018-10-222-30/+12
|\ \ \ \ \ \
| * | | | | | Fixed FSETP and FSETFernandoS272018-10-222-30/+12
| | |_|/ / / | |/| | | |
* | | | | | Merge pull request #1546 from lioncash/svc-againbunnei2018-10-2213-53/+255
|\ \ \ \ \ \
| * | | | | | service: Add the basic skeleton for the NPNS servicesLioncash2018-10-214-2/+109
| * | | | | | hid: Update service function table for hidbusLioncash2018-10-211-0/+1
| * | | | | | am: Add the basic skeleton for the tcap serviceLioncash2018-10-214-0/+44
| * | | | | | am: Update service function tablesLioncash2018-10-214-15/+60
| * | | | | | prepo: Update service function table.Lioncash2018-10-211-8/+13
| * | | | | | lbl: Update service function table namesLioncash2018-10-211-28/+28
| |/ / / / /
* | | | | | Merge pull request #1548 from FernandoS27/fix-vaobunnei2018-10-221-2/+14
|\ \ \ \ \ \
| * | | | | | Fixed VAOs Float types only returning GL_FLOAT in cases that they had to return GL_HALF_FLOATFernandoS272018-10-221-2/+14
| |/ / / / /
* | | | | | Merge pull request #1544 from DarkLordZach/reinitialize-keys-toolsbunnei2018-10-221-1/+7
|\ \ \ \ \ \ | |/ / / / / |/| | | | |
| * | | | | qt: Move Reinitialize Keys to Tools menuZach Hilman2018-10-211-1/+7
| |/ / / /
* | | | | Merge pull request #1531 from ogniK5377/hid-fixesbunnei2018-10-212-4/+189
|\ \ \ \ \ | |/ / / / |/| | | |
| * | | | Added auto controller switching to supported controllers and single joycon button rotationDavid Marcec2018-10-202-4/+189
* | | | | gl_shader_decompiler: Move position varying declaration back to gl_shader_genReinUsesLisp2018-10-203-13/+9
|/ / / /
* | | | Merge pull request #1501 from ReinUsesLisp/half-floatbunnei2018-10-202-0/+458
|\ \ \ \
| * | | | gl_shader_decompiler: Implement HSET2_RReinUsesLisp2018-10-152-0/+62
| * | | | gl_shader_decompiler: Implement HSETP2_RReinUsesLisp2018-10-152-0/+65
| * | | | gl_shader_decompiler: Implement HFMA2 instructionsReinUsesLisp2018-10-152-0/+85
| * | | | gl_shader_decompiler: Implement HADD2_IMM and HMUL2_IMMReinUsesLisp2018-10-152-0/+73
| * | | | gl_shader_decompiler: Implement non-immediate HADD2 and HMUL2 instructionsReinUsesLisp2018-10-152-0/+75
| * | | | gl_shader_decompiler: Setup base for half float unpacking and settingReinUsesLisp2018-10-152-0/+98
* | | | | Merge pull request #1520 from lioncash/sanbunnei2018-10-203-3/+50
|\ \ \ \ \
| * | | | | svc: Add missing sanitizing checks for MapSharedMemory/UnmapSharedMemoryLioncash2018-10-183-3/+50
* | | | | | Merge pull request #1517 from bunnei/dmabunnei2018-10-209-23/+144
|\ \ \ \ \ \
| * | | | | | GPU: Improved implementation of maxwell DMA (Subv).bunnei2018-10-193-17/+66
| * | | | | | decoders: Introduce functions for un/swizzling subrects.bunnei2018-10-192-0/+49
| * | | | | | GPU: Invalidate destination address of kepler_memory writes.bunnei2018-10-193-3/+17
| * | | | | | fermi_2d: Add support for more accurate surface copies.bunnei2018-10-192-3/+12
* | | | | | | Merge pull request #1526 from lioncash/svc-idbunnei2018-10-208-53/+163
|\ \ \ \ \ \ \
| * | | | | | | es: Update service function tablesLioncash2018-10-191-7/+11
| * | | | | | | audio: Update service function tablesLioncash2018-10-191-17/+20
| * | | | | | | omm: Update service function tablesLioncash2018-10-191-16/+18
| * | | | | | | nifm: Update service function tablesLioncash2018-10-191-0/+1
| * | | | | | | hid: Update service function tablesLioncash2018-10-191-6/+45
| * | | | | | | nim: Add the basic skeleton of the nim:eca serviceLioncash2018-10-191-0/+17
| * | | | | | | ns: Update service function tableLioncash2018-10-191-6/+49
| * | | | | | | set_cal: Update service function tableLioncash2018-10-191-1/+2
| |/ / / / / /
* | | | | | | Merge pull request #1530 from DarkLordZach/aoc-8bunnei2018-10-202-1/+16
|\ \ \ \ \ \ \
| * | | | | | | aoc_u: Stub GetAddOnContentListChangedEventZach Hilman2018-10-202-1/+16
| | |_|_|_|/ / | |/| | | | |
* | | | | | | Merge pull request #1516 from lioncash/hidbunnei2018-10-2018-19/+33
|\ \ \ \ \ \ \
| * | | | | | | hid/controller: Remove unused header inclusionsLioncash2018-10-189-9/+0
| * | | | | | | hid/controller/npad: Remove unused dump_idx member variableLioncash2018-10-181-1/+0
| * | | | | | | hid/controller/npad: Remove unnecessary semicolon from the closing brace of LedPattern's constructorLioncash2018-10-181-1/+1
| * | | | | | | hid/controller/npad: Remove #pragma once from the cpp fileLioncash2018-10-181-2/+0
| * | | | | | | hid/controller/npad: Move npad_id_list into the cpp fileLioncash2018-10-182-2/+10
| * | | | | | | hid/controller/npad: Remove unnecessary const from void return typeLioncash2018-10-182-2/+2
| * | | | | | | hid/controller: Default the destructors of all controller types in the cpp fileLioncash2018-10-1816-0/+16
| * | | | | | | controller_base: Default the base class constructor and destructor in the cpp fileLioncash2018-10-182-2/+4
| | |_|/ / / / | |/| | | | |
* | | | | | | crypto: Use compressed sizes in offset calculation for KIP decompressionZach Hilman2018-10-201-1/+2
| |/ / / / / |/| | | | |
* | | | | | Stubbed home blockingDavid Marcec2018-10-192-4/+36
| |/ / / / |/| | | |
* | | | | Merge pull request #1523 from lioncash/lockbunnei2018-10-192-9/+27
|\ \ \ \ \
| * | | | | svc: Check for word alignment of addresses within svcArbitrateLock/svcArbitrateUnlockLioncash2018-10-181-0/+8
| * | | | | common: Add function for checking word alignment to alignment.hLioncash2018-10-181-0/+6
| * | | | | common: Move Is4KBAligned() to alignment.hLioncash2018-10-182-9/+13
* | | | | | Merge pull request #1511 from lioncash/contentbunnei2018-10-192-258/+292
|\ \ \ \ \ \
| * | | | | | content_archive: Simpify assignment of bktr_base_romfs in the constructorLioncash2018-10-161-2/+1
| * | | | | | content_archive: Make IsValidNCA() an internally linked functionLioncash2018-10-162-3/+1
| * | | | | | content_archive: Simplify rights ID checkLioncash2018-10-161-2/+2
| * | | | | | content_archive: Split loading into separate functionsLioncash2018-10-162-253/+290
| * | | | | | content_archive: Pass and take NCASectionHeader instance by referenceLioncash2018-10-162-3/+3
| | |_|_|/ / | |/| | | |
* | | | | | Merge pull request #1521 from ogniK5377/imp-mmubunnei2018-10-191-8/+42
|\ \ \ \ \ \
| * | | | | | Used better names for mm:u and fixed bad stubDavid Marcec2018-10-181-8/+42
| | |_|/ / / | |/| | | |
* | | | | | core: Remove unnecessary assert in ArmInterface()Lioncash2018-10-181-2/+1
| |_|/ / / |/| | | |
* | | | | Merge pull request #1510 from lioncash/xcibunnei2018-10-183-7/+8
|\ \ \ \ \
| * | | | | XCI: Add function for checking the existence of the program NCALioncash2018-10-163-7/+8
| | |/ / / | |/| | |
* | | | | Merge pull request #1505 from FernandoS27/tex-3dbunnei2018-10-184-2/+13
|\ \ \ \ \ | |_|/ / / |/| | | |
| * | | | Clang format and other fixesFernandoS272018-10-181-16/+0
| * | | | Implement Reinterpret Surface, to accurately blit 3D texturesFernandoS272018-10-181-2/+4
| * | | | Implement GetInRange in the Rasterizer CacheFernandoS272018-10-181-0/+16
| * | | | Implement 3D TexturesFernandoS272018-10-184-1/+10
* | | | | Merge pull request #1444 from ogniK5377/better-hidbunnei2018-10-1822-648/+1720
|\ \ \ \ \
| * | | | | Using dual joycons as the default controllerDavid Marcec2018-10-173-77/+59
| * | | | | WipDavid Marcec2018-10-122-3/+23
| * | | | | Dynamically decide handheld variant based on supported npad id priorityDavid Marcec2018-10-113-19/+62
| * | | | | Added BeginPermitVibrationSession and EndPermitVibrationSessionDavid Marcec2018-10-103-2/+26
| * | | | | Added GetLedPattern and HandheldVariantDavid Marcec2018-10-103-6/+63
| * | | | | Kirby expects handheld controllers to be at position 8David Marcec2018-10-101-2/+8
| * | | | | Added the ability to "disconnect" individual npadsDavid Marcec2018-10-103-16/+40
| * | | | | Removed unneeded forward declarationsDavid Marcec2018-10-102-13/+2
| * | | | | Addressed changes for better hidDavid Marcec2018-10-1019-167/+238
| * | | | | "Better Hid" rework part 1David Marcec2018-10-1022-644/+1500
* | | | | | Merge pull request #1489 from FernandoS27/fix-tldsbunnei2018-10-181-1/+5
|\ \ \ \ \ \ | |_|/ / / / |/| | | | |
| * | | | | Fix TLDSFernandoS272018-10-141-1/+5
| | |_|/ / | |/| | |
* | | | | Merge pull request #1497 from bunnei/flush-framebuffersbunnei2018-10-1815-188/+429
|\ \ \ \ \
| * | | | | gl_rasterizer_cache: Remove unnecessary block_depth=1 on Flush.bunnei2018-10-181-1/+0
| * | | | | gl_rasterizer_cache: Remove unnecessary temporary buffer with unswizzle.bunnei2018-10-181-5/+2
| * | | | | gl_rasterizer_cache: Use AccurateCopySurface for use_accurate_gpu_emulation.bunnei2018-10-162-2/+18
| * | | | | config: Rename use_accurate_framebuffers -> use_accurate_gpu_emulation.bunnei2018-10-1610-20/+20
| * | | | | rasterizer_cache: Refactor to support in-order flushing.bunnei2018-10-166-63/+116
| * | | | | gl_rasterizer_cache: Refactor to only call GetRegionEnd on surface creation.bunnei2018-10-162-16/+23
| * | | | | gl_rasterizer_cache: Only flush when use_accurate_framebuffers is enabled.bunnei2018-10-162-2/+13
| * | | | | gl_rasterizer_cache: Separate guest and host surface size managment.bunnei2018-10-162-92/+94
| * | | | | gl_rasterizer_cache: Rename GetGLBytesPerPixel to GetBytesPerPixel.bunnei2018-10-162-17/+18
| * | | | | gl_rasterizer_cache: Remove unused FlushSurface method.bunnei2018-10-162-7/+0
| * | | | | gl_rasterizer: Implement flushing.bunnei2018-10-161-1/+25
| * | | | | gl_rasterizer_cache: Remove usage of Memory::Read/Write functions.bunnei2018-10-161-13/+8
| * | | | | gl_rasterizer_cache: Clamp cached surface size to mapped GPU region size.bunnei2018-10-162-19/+37
| * | | | | memory_manager: Add a method for querying the end of a mapped GPU region.bunnei2018-10-162-0/+11
| * | | | | rasterizer_cache: Reintroduce method for flushing.bunnei2018-10-163-0/+23
| * | | | | gl_rasterizer_cache: Reintroduce code for handling swizzle and flush to guest RAM.bunnei2018-10-162-28/+119
| | |_|/ / | |/| | |
* | | | | Merge pull request #1498 from lioncash/aslrbunnei2018-10-184-28/+44
|\ \ \ \ \
| * | | | | svc: Clarify enum values for AddressSpaceBaseAddr and AddressSpaceSize in svcGetInfo()Lioncash2018-10-154-28/+44
* | | | | | Merge pull request #1496 from FernandoS27/tex-arraybunnei2018-10-181-14/+55
|\ \ \ \ \ \
| * | | | | | Implement Arrays on Tex InstructionFernandoS272018-10-141-14/+55
| | |_|/ / / | |/| | | |
* | | | | | Merge pull request #1509 from DarkLordZach/device-save-databunnei2018-10-181-1/+12
|\ \ \ \ \ \ | |_|_|/ / / |/| | | | |
| * | | | | savedata_factory: Add TemporaryStorage SaveDataSpaceIdZach Hilman2018-10-161-1/+4
| * | | | | savedata_factory: Add support for DeviceSaveDataZach Hilman2018-10-161-0/+8
* | | | | | Merge pull request #1443 from DarkLordZach/lower-loader-logs-1bunnei2018-10-162-3/+9
|\ \ \ \ \ \
| * | | | | | patch_manager: Move non-Program RomFS patch log to DebugZach Hilman2018-10-131-2/+8
| * | | | | | content_archive: Move get key log to Trace levelZach Hilman2018-10-131-1/+1
* | | | | | | Implement VI ConvertScalingMode (#1475)David2018-10-161-1/+49
* | | | | | | Merge pull request #1502 from lioncash/uniquebunnei2018-10-1612-60/+76
|\ \ \ \ \ \ \
| * | | | | | | core_cpu: Make Cpu scheduler instances unique_ptrs instead of shared_ptrsLioncash2018-10-1510-31/+50
| * | | | | | | core: Make the live Cpu instances unique_ptrs instead of shared_ptrsLioncash2018-10-151-9/+9
| * | | | | | | core: Make the exclusive monitor a unique_ptr instead of a shared_ptrLioncash2018-10-155-15/+13
| * | | | | | | core: Make CPUBarrier a unique_ptr instead of a shared_ptrLioncash2018-10-153-11/+10
* | | | | | | | file_sys/registered_cache: Use unique_ptr and regular pointers instead of shared_ptrs where applicableLioncash2018-10-1612-51/+53
| |_|/ / / / / |/| | | | | |
* | | | | | | Merge pull request #1473 from lioncash/cmakebunnei2018-10-167-199/+214
|\ \ \ \ \ \ \
| * | | | | | | core/CMakeLists: Make all web_service-related libraries privateLioncash2018-10-111-1/+1
| * | | | | | | web_backend: Make Client use the PImpl idiomLioncash2018-10-115-142/+154
| * | | | | | | telemetry_json: Use the PImpl idiom to avoid unnecessary dependency exposureLioncash2018-10-112-49/+55
| * | | | | | | telemetry_json: Add missing override specifier to the destructor of TelemetryJsonLioncash2018-10-111-1/+1
| * | | | | | | telemetry_json: Take std::string parameters by valueLioncash2018-10-112-3/+2
| * | | | | | | telemetry_json: Remove unnecessary includesLioncash2018-10-112-3/+1
| * | | | | | | core/CMakeLists: Use target_compile_definitions instead of add_definitions for specifying ENABLE_WEB_SERVICELioncash2018-10-111-1/+1
* | | | | | | | Merge pull request #1487 from lioncash/maybe-unusedbunnei2018-10-161-1/+1
|\ \ \ \ \ \ \ \
| * | | | | | | | yuzu/main: Apply the [[maybe_unused]] attribute to the parameter of SetDiscordEnabled()Lioncash2018-10-131-1/+1
| | |_|_|/ / / / | |/| | | | | |
* | | | | | | | file_sys/control_metadata: Get rid of magic constantsLioncash2018-10-161-3/+6
* | | | | | | | Merge pull request #1494 from DarkLordZach/aoc-signature-fixesbunnei2018-10-163-3/+20
|\ \ \ \ \ \ \ \
| * | | | | | | | aoc: Read DLC base title ID from RegisteredCacheZach Hilman2018-10-153-2/+18
| * | | | | | | | aoc: Return size in ListAddOnContentZach Hilman2018-10-141-1/+2
| |/ / / / / / /
* | | | | | | | Merge pull request #1499 from lioncash/nrobunnei2018-10-157-28/+39
|\ \ \ \ \ \ \ \
| * | | | | | | | nso: Return an optional address from LoadModuleLioncash2018-10-155-16/+29
| * | | | | | | | nso: Make LoadModule take a VfsFile by const referenceLioncash2018-10-153-11/+9
| * | | | | | | | nro: Make LoadNro take a VfsFile by const referenceLioncash2018-10-152-6/+6
| | |_|_|_|/ / / | |/| | | | | |
* | | | | | | | Merge pull request #1500 from DarkLordZach/key-derivation-6.0.0bunnei2018-10-152-4/+8
|\ \ \ \ \ \ \ \
| * | | | | | | | crypto: Various crypto fixes for quickstart guideZach Hilman2018-10-152-4/+8
| | |_|_|/ / / / | |/| | | | | |
* | | | | | | | shader_bytecode: Add Control Code enum 0xfReinUsesLisp2018-10-151-1/+1
* | | | | | | | gl_shader_decompiler: Fixup style inconsistenciesReinUsesLisp2018-10-151-5/+3
* | | | | | | | gl_rasterizer: Silence implicit cast warning in glBindBufferRangeReinUsesLisp2018-10-151-1/+2
|/ / / / / / /
* | | | | | | Merge pull request #1486 from lioncash/filebunnei2018-10-144-63/+72
|\ \ \ \ \ \ \
| * | | | | | | partition_data_manager: Reserve and insert data within output vector in DecryptPackage2()Lioncash2018-10-131-20/+16
| * | | | | | | partition_data_manager: Remove unused std::map instance within DecryptPackage2()Lioncash2018-10-131-2/+0
| * | | | | | | partition_data_manager: Take package2_keys by const referenceLioncash2018-10-132-2/+3
| * | | | | | | partition_data_manager: Move IV data to where it's needed in DecryptPackage2()Lioncash2018-10-131-3/+1
| * | | | | | | partition_data_manager: Remove commented out codeLioncash2018-10-131-2/+0
| * | | | | | | key_manager/partition_data_manager: Silence truncation compiler warningsLioncash2018-10-134-10/+15
| * | | | | | | partition_data_manager: Dehardcode array boundsLioncash2018-10-132-7/+12
| * | | | | | | partition_data_manager: Take VirtualFile by const reference in constructorLioncash2018-10-132-2/+2
| * | | | | | | partition_data_manager: Amend constructor initializer list orderLioncash2018-10-131-2/+3
| * | | | | | | partition_data_manager: Remove unused includesLioncash2018-10-132-4/+1
| * | | | | | | key_manager: Use std::vector's insert() instead of std::copy with a back_inserterLioncash2018-10-131-2/+2
| * | | | | | | key_manager: Brace long conditional bodyLioncash2018-10-131-1/+2
| * | | | | | | key_manager: Don't assume file seeks and reads will always succeedLioncash2018-10-131-7/+17
| * | | | | | | key_manager: Remove unnecessary seek in DeriveSDSeed()Lioncash2018-10-131-1/+0
| | |/ / / / / | |/| | | | |
* | | | | | | Merge pull request #1490 from lioncash/bootbunnei2018-10-141-14/+12
|\ \ \ \ \ \ \
| * | | | | | | yuzu/main: Simplify OnMenuLoadFile()Lioncash2018-10-131-14/+12
| |/ / / / / /
* | | | | | | Merge pull request #1488 from Hexagon12/astc-typesbunnei2018-10-143-6/+32
|\ \ \ \ \ \ \
| * | | | | | | Added ASTC 5x4; 8x5Hexagon122018-10-133-6/+32
* | | | | | | | Merge pull request #1491 from lioncash/referencebunnei2018-10-147-20/+19
|\ \ \ \ \ \ \ \
| * | | | | | | | filesystem: Make CreateFactories() and InstallInterface() take a VfsFilesystem instance by referenceLioncash2018-10-137-20/+19
| | |/ / / / / / | |/| | | | | |
* | | | | | | | Merge pull request #1480 from FernandoS27/neue-swizzlebunnei2018-10-148-107/+176
|\ \ \ \ \ \ \ \ | |_|_|/ / / / / |/| | | | | | |
| * | | | | | | Shorten the implementation of 3D swizzle to only 3 functionsFernandoS272018-10-141-70/+27
| * | | | | | | Fix a Crash on Zelda BotW and Splatoon 2, and simplified LoadGLBufferFernandoS272018-10-132-19/+2
| * | | | | | | Propagate depth and depth_block on modules using decodersFernandoS272018-10-138-54/+67
| * | | | | | | Remove old Swizzle algorithms and use 3d SwizzleFernandoS272018-10-131-93/+69
| * | | | | | | Implement Precise 3D SwizzleFernandoS272018-10-131-3/+71
| * | | | | | | Implement Fast 3D SwizzleFernandoS272018-10-131-2/+74
| |/ / / / / /
* | | | | | | Merge pull request #1492 from lioncash/procbunnei2018-10-143-4/+50
|\ \ \ \ \ \ \
| * | | | | | | svc: Implement svcGetProcessInfoLioncash2018-10-133-4/+50
| |/ / / / / /
* / / / / / / Stop all threads on svcBreakDavid Marcec2018-10-141-0/+6
|/ / / / / /
* | | | | | Merge pull request #1409 from DarkLordZach/key-derivationbunnei2018-10-1310-74/+1663
|\ \ \ \ \ \
| * | | | | | partition_data_manager: Rename system files for hekateZach Hilman2018-10-076-195/+247
| * | | | | | qt: Add rederive keyset menu optionZach Hilman2018-10-073-49/+89
| * | | | | | qt: Add key derivation progress bar on initial setupZach Hilman2018-10-071-0/+52
| * | | | | | crypto: Add PartitionDataManagerZach Hilman2018-10-073-0/+692
| * | | | | | key_manager: Add support for loading keys from partition dataZach Hilman2018-10-072-0/+88
| * | | | | | key_manager: Add ETicket key derivationZach Hilman2018-10-073-2/+277
| * | | | | | key_manager: Add base key derivationZach Hilman2018-10-072-4/+220
| * | | | | | key_manager: Add BIS key getterZach Hilman2018-10-072-2/+19
| * | | | | | key_manager: Add support for more keysZach Hilman2018-10-072-3/+99
| * | | | | | key_manager: Add keyblob supportZach Hilman2018-10-072-0/+14
| * | | | | | key_manager: Add support for crypto revisions past 04Zach Hilman2018-10-071-43/+63
| * | | | | | key_manager: Add support for comments in keyfilesZach Hilman2018-10-071-0/+3
| * | | | | | vfs: Move forward declarations to separate fileZach Hilman2018-10-072-9/+22
| * | | | | | key_manager: Add support for console-specific keyfileZach Hilman2018-10-072-3/+13
| * | | | | | key_manager: Rename KEK to KekZach Hilman2018-10-072-8/+9
* | | | | | | Merge pull request #1483 from lioncash/codesetbunnei2018-10-137-83/+45
|\ \ \ \ \ \ \
| * | | | | | | kernel/process: Make CodeSet a regular non-inherited objectLioncash2018-10-127-83/+45
* | | | | | | | Merge pull request #1484 from FernandoS27/calculate-sizebunnei2018-10-132-0/+22
|\ \ \ \ \ \ \ \
| * | | | | | | | Implemented helper function to correctly calculate a texture's sizeFernandoS272018-10-122-0/+22
| | |_|_|_|/ / / | |/| | | | | |
* | | | | | | | Merge pull request #1481 from lioncash/typobunnei2018-10-131-3/+3
|\ \ \ \ \ \ \ \ | |/ / / / / / / |/| | | | | | |
| * | | | | | | svc: Fix typos in sanitizing checks for MapMemory/UnmapMemoryLioncash2018-10-121-3/+3
| |/ / / / / /
* | | | | | | Merge pull request #1467 from ogniK5377/svcbreak-type-fixbunnei2018-10-122-28/+36
|\ \ \ \ \ \ \
| * | | | | | | Changed all casts in svc_wrap.h to be static_cast insteadDavid Marcec2018-10-101-25/+28
| * | | | | | | Use a better name than "dont_kill_application"David Marcec2018-10-101-2/+2
| * | | | | | | Fixed incorrect types for svcBreakDavid Marcec2018-10-102-3/+8
| | |_|_|_|/ / | |/| | | | |
* | | | | | | Merge pull request #1478 from ogniK5377/remap-invalidhandle-remapbunnei2018-10-121-3/+10
|\ \ \ \ \ \ \
| * | | | | | | Returned an error before processing other remapsDavid Marcec2018-10-121-6/+2
| * | | | | | | Passing an invalid nmap handle to Remap should throw an errorDavid Marcec2018-10-111-3/+14
| | |_|_|/ / / | |/| | | | |
* | | | | | | Merge pull request #1482 from lioncash/initbunnei2018-10-121-4/+1
|\ \ \ \ \ \ \
| * | | | | | | thread: Remove unnecessary memset from ResetThreadContext()Lioncash2018-10-121-4/+1
| | |_|/ / / / | |/| | | | |
* | | | | | | Merge pull request #1479 from ogniK5377/nmap-revampedbunnei2018-10-121-12/+60
|\ \ \ \ \ \ \ | |/ / / / / / |/| | | | | |
| * | | | | | Made the minimum alignment more clearDavid Marcec2018-10-121-2/+3
| * | | | | | Added error codes for nvmapDavid Marcec2018-10-111-12/+59
| |/ / / / /
* | | | | | Merge pull request #1474 from ogniK5377/hwopus-decodeinterleavedwithperformancebunnei2018-10-111-3/+34
|\ \ \ \ \ \
| * | | | | | HwOpus, Implemented DecodeInterleavedWithPerformanceDavid Marcec2018-10-111-3/+34
| |/ / / / /
* | | | | | Merge pull request #1472 from lioncash/sanbunnei2018-10-112-12/+81
|\ \ \ \ \ \
| * | | | | | svc: Add missing address range sanitizing checks to MapMemory/UnmapMemoryLioncash2018-10-112-12/+81
| | |_|_|/ / | |/| | | |
* | | | | | Merge pull request #1476 from bunnei/fix-unmap-flushbunnei2018-10-111-3/+4
|\ \ \ \ \ \
| * | | | | | nvhost_as_gpu: Flush CPU VAddr on UnmapBuffer.bunnei2018-10-111-3/+4
| | |/ / / / | |/| | | |
* / | | | | gl_shader_decompiler: Implement VMADReinUsesLisp2018-10-112-0/+118
|/ / / / /
* | | | | Merge pull request #1458 from FernandoS27/fix-render-target-block-settingsbunnei2018-10-115-18/+81
|\ \ \ \ \ | |/ / / / |/| | | |
| * | | | Add memory Layout to Render Targets and Depth BuffersFernandoS272018-10-103-21/+33
| * | | | Fixed block height settings for RenderTargets and Depth Buffers, and added block width and block depthFernandoS272018-10-105-12/+63
* | | | | Merge pull request #1460 from FernandoS27/scissor_testbunnei2018-10-103-1/+36
|\ \ \ \ \
| * | | | | Implement Scissor TestFernandoS272018-10-091-4/+9
| * | | | | Assert Scissor testsFernandoS272018-10-093-1/+31
| |/ / / /
* | | | | Merge pull request #1425 from ReinUsesLisp/geometry-shadersbunnei2018-10-1011-120/+543
|\ \ \ \ \
| * | | | | gl_shader_decompiler: Move position varying location from 15 to 0 and apply an offsetReinUsesLisp2018-10-071-6/+10
| * | | | | gl_shader_decompiler: Implement geometry shadersReinUsesLisp2018-10-0710-107/+522
| * | | | | video_core: Allow LabelGLObject to use extra info on any objectReinUsesLisp2018-10-071-10/+14
| | |_|/ / | |/| | |
* | | | | kernel/thread: Use a regular pointer for the owner/current processLioncash2018-10-1010-39/+41
* | | | | Merge pull request #1461 from lioncash/warnbunnei2018-10-101-3/+3
|\ \ \ \ \
| * | | | | ips_layer: Silence truncation and conversion warningsLioncash2018-10-091-3/+3
| | |/ / / | |/| | |
* | | | | Merge pull request #1464 from lioncash/uniquebunnei2018-10-107-21/+18
|\ \ \ \ \ | |_|_|/ / |/| | | |
| * | | | patch_manager: Return a std::unique_ptr from ParseControlNCA() and GetControlMetadata() instead of a std::shared_ptrLioncash2018-10-097-21/+18
| |/ / /
* | | | Merge pull request #1466 from lioncash/unusedbunnei2018-10-101-7/+3
|\ \ \ \
| * | | | gl_shader_decompiler: Remove unused variables in TMML's implementationLioncash2018-10-091-7/+3
| |/ / /
* | | | Merge pull request #1463 from FearlessTobi/port-4310bunnei2018-10-104-10/+131
|\ \ \ \
| * | | | implemented touch in Qt and SDLNeatNit2018-10-094-10/+131
| |/ / /
* | | | Merge pull request #1459 from ogniK5377/breakbunnei2018-10-091-5/+20
|\ \ \ \
| * | | | Added bitfield instead of manually checking if the bit is setDavid Marcec2018-10-091-4/+12
| * | | | Actual kill execution when the bit isn't set, not the other way aroundDavid Marcec2018-10-091-1/+1
| * | | | svcBreak, Signalling to the debugger should not kill executionDavid Marcec2018-10-091-5/+12
* | | | | Merge pull request #1465 from lioncash/telemetrybunnei2018-10-092-7/+9
|\ \ \ \ \
| * | | | | telemetry_session: Remove doxygen comment for a non-existent parameterLioncash2018-10-091-1/+0
| * | | | | telemetry_session: Add missing includesLioncash2018-10-092-2/+5
| * | | | | telemetry_session: Remove unimplemented FinalizeAsyncJob prototypeLioncash2018-10-091-2/+0
| * | | | | telemetry_session: Use a std::array in GenerateTelemetryId()Lioncash2018-10-091-2/+4
| | |/ / / | |/| | |
* | | | | Merge pull request #1462 from lioncash/movebunnei2018-10-092-20/+60
|\ \ \ \ \
| * | | | | ips_layer: Avoid constructing std::vector instances where not necessaryLioncash2018-10-091-6/+25
| * | | | | ips_layer: Remove unnecessary explicit std::pair constructor in std::arrayLioncash2018-10-091-5/+13
| * | | | | ips_layer: Add missing includesLioncash2018-10-092-7/+17
| * | | | | ips_layer: std::move data within PatchIPS() and Apply()Lioncash2018-10-091-2/+5
| |/ / / /
* | | | | Merge pull request #1455 from ogniK5377/smo-softlockfixbunnei2018-10-092-15/+123
|\ \ \ \ \ | |/ / / / |/| | | |
| * | | | EffectOutStatus padding is now in hexDavid Marcec2018-10-091-1/+1
| * | | | Fixups for softlockDavid Marcec2018-10-072-6/+7
| * | | | Fixed missing returnDavid Marcec2018-10-071-1/+1
| * | | | Fixed smo softlockDavid Marcec2018-10-072-13/+120
* | | | | Merge pull request #1423 from DarkLordZach/romfs-file-extsbunnei2018-10-085-10/+38
|\ \ \ \ \
| * | | | | patch_manager: Avoid romfs_ext requirement for patchingZach Hilman2018-10-041-4/+1
| * | | | | fsmitm_romfsbuild: Extract stubs and IPS to romfs_ext dirZach Hilman2018-10-045-21/+38
| * | | | | fsmitm_romfsbuild: Add support for stubbing and IPS patches in LFSZach Hilman2018-10-041-0/+14
* | | | | | Merge pull request #1424 from DarkLordZach/ips-witchbunnei2018-10-086-23/+323
|\ \ \ \ \ \ | |_|_|/ / / |/| | | | |
| * | | | | ips_layer: Fix inaccuracies with comments and flagsZach Hilman2018-10-043-16/+51
| * | | | | ips_layer: Deduplicate resource usageZach Hilman2018-10-045-33/+39
| * | | | | ips_layer: Add support for escape sequences and midline commentsZach Hilman2018-10-043-8/+41
| * | | | | patch_manager: Add support for IPSwitch format patchesZach Hilman2018-10-041-22/+56
| * | | | | ips_layer: Add IPSwitchCompiler to process IPSwitch formatZach Hilman2018-10-042-0/+168
| * | | | | hex_util: Add HexVectorToString and HexStringToVectorZach Hilman2018-10-042-0/+24
| |/ / / /
* | | | | Merge pull request #1456 from ogniK5377/aoc-u-fixupsbunnei2018-10-081-5/+5
|\ \ \ \ \
| * | | | | Fixed assertion due to CountAddOnContentDavid Marcec2018-10-071-5/+5
| | |_|/ / | |/| | |
* | | | | Merge pull request #1457 from ogniK5377/unmap-bufferbunnei2018-10-081-1/+6
|\ \ \ \ \
| * | | | | Unmapping an unmapped buffer should succeedDavid Marcec2018-10-081-1/+6
| |/ / / /
* | | | | nso/nro: Use default allocation size for arg_dataZach Hilman2018-10-074-14/+20
* | | | | cmd: Support passing game arguments from command lineZach Hilman2018-10-074-10/+14
* | | | | qt: Add UI option to configure argumentsZach Hilman2018-10-073-0/+27
* | | | | settings: Add program_args string settingZach Hilman2018-10-071-0/+1
* | | | | nso/nro: Add NSO arguments structure to data sectionZach Hilman2018-10-074-3/+38
|/ / / /
* | | | Merge pull request #1396 from DarkLordZach/packed-updatesbunnei2018-10-0716-21/+143
|\ \ \ \
| * | | | romfs_factory: Extract packed update setter to new functionZach Hilman2018-10-0510-9/+38
| * | | | patch_manager: Add support for NSP packed updatesZach Hilman2018-10-052-3/+10
| * | | | game_list: Add XCI update versioning to game listZach Hilman2018-10-051-4/+8
| * | | | patch_manager: Add support for packed updatesZach Hilman2018-10-054-5/+18
| * | | | loader: Add getter for packed updateZach Hilman2018-10-056-3/+58
| * | | | loader: Add ReadRomFSIVFCOffset to NSP, XCI, and NAX loadersZach Hilman2018-10-056-6/+20
| |/ / /
* | | | Merge pull request #1446 from bunnei/fast_fermi_copybunnei2018-10-0710-40/+121
|\ \ \ \
| * | | | yuzu/yuzu_cmd: Add checks for required extension ARB_copy_image.bunnei2018-10-062-0/+4
| * | | | fermi_2d: Implement simple copies with AccelerateSurfaceCopy.bunnei2018-10-063-24/+36
| * | | | gl_rasterizer: Add rasterizer cache code to handle accerated fermi copies.bunnei2018-10-065-16/+60
| * | | | gl_rasterizer_cache: Implement a simpler surface copy using glCopyImageSubData.bunnei2018-10-061-0/+21
| | |/ / | |/| |
* | | | Merge pull request #1437 from FernandoS27/tex-mode2bunnei2018-10-076-69/+265
|\ \ \ \
| * | | | Implemented Depth Compare and Shadow SamplersFernandoS272018-10-066-65/+224
| * | | | Implemented Texture Processing Modes in TEXS and TLDSFernandoS272018-10-031-5/+42
* | | | | Merge pull request #1453 from FearlessTobi/port-4311bunnei2018-10-071-1/+1
|\ \ \ \ \
| * | | | | Remove "#" in the version numberfearlessTobi2018-10-061-1/+1
| | |/ / / | |/| | |
* | | | | Merge pull request #1451 from FearlessTobi/port-4140bunnei2018-10-075-19/+119
|\ \ \ \ \ | |_|_|_|/ |/| | | |
| * | | | citra_qt/configuration: misc input tab improvementszhupengfei2018-10-065-19/+119
| |/ / /
* | | | Merge pull request #1448 from ogniK5377/frontend-accessbunnei2018-10-074-0/+26
|\ \ \ \
| * | | | Added forward define for ServerPortDavid Marcec2018-10-062-4/+6
| * | | | Ported #4296 from citraDavid Marcec2018-10-063-1/+25
* | | | | Merge pull request #1454 from ReinUsesLisp/fixup-drawMat M2018-10-071-0/+1
|\ \ \ \ \ | |_|/ / / |/| | | |
| * | | | gl_rasterizer: Fixup undefined behaviour in SetupDrawReinUsesLisp2018-10-071-0/+1
* | | | | qt: Update telemetry linksLioncash2018-10-062-2/+2
* | | | | Merge pull request #1332 from FearlessTobi/port-web-backendbunnei2018-10-0636-35/+1552
|\ \ \ \ \ | |_|/ / / |/| | | |
| * | | | Review comments - part 5fearlessTobi2018-10-024-8/+7
| * | | | Review comments -part 4fearlessTobi2018-10-023-2/+7
| * | | | Review comments - part 3fearlessTobi2018-10-026-25/+7
| * | | | web_backend: protect jwt cache with a mutexWeiyi Wang2018-10-022-1/+4
| * | | | Address more review commentsfearlessTobi2018-10-021-1/+1
| * | | | Address a bunch of review commentsfearlessTobi2018-10-0211-19/+27
| * | | | Port web_service from CitrafearlessTobi2018-10-0237-34/+1554
| | |/ / | |/| |
* | | | kernel/mutex: Amend behavior of TransferMutexOwnership()Lioncash2018-10-061-1/+1
| |/ / |/| |
* | | Merge pull request #1440 from lioncash/arraybunnei2018-10-063-5/+10
|\ \ \
| * | | ui_settings: Place definition of the theme array within the cpp fileLioncash2018-10-043-5/+10
* | | | Merge pull request #1438 from ReinUsesLisp/quadsbunnei2018-10-068-46/+236
|\ \ \ \
| * | | | gl_rasterizer: Implement quads topologyReinUsesLisp2018-10-048-46/+236
* | | | | thread: Make the scheduler pointer a regular pointerbalika0112018-10-052-4/+4
* | | | | Merge pull request #1439 from lioncash/threadbunnei2018-10-0515-227/+418
|\ \ \ \ \
| * | | | | kernel/thread: Make all instance variables privateLioncash2018-10-0415-227/+418
| | |/ / / | |/| | |
* | | | | Merge pull request #1442 from lioncash/formatbunnei2018-10-051-1/+1
|\ \ \ \ \ | |_|_|_|/ |/| | | |
| * | | | text_formatter: Avoid unnecessary string temporary creation in PrintMessage()Lioncash2018-10-051-1/+1
| |/ / /
* | | | Merge pull request #1415 from DarkLordZach/ipsbunnei2018-10-049-40/+258
|\ \ \ \
| * | | | nso: Optimize loading of IPS patchesZach Hilman2018-10-025-51/+43
| * | | | deconstructed_rom_directory: Force NSO loader to patch NSOsZach Hilman2018-10-011-1/+3
| * | | | nso: Add framework to support patching of uncompressed NSOsZach Hilman2018-10-012-2/+17
| * | | | patch_manager: Add PatchNSO functionZach Hilman2018-10-013-0/+104
| * | | | patch_manager: Use strings for patch type instead of enumZach Hilman2018-10-013-33/+36
| * | | | file_sys: Implement function to apply IPS patchesZach Hilman2018-10-012-0/+103
| * | | | nso: Replace NSOHeader padding bytes with build IDZach Hilman2018-10-011-2/+1
| | |_|/ | |/| |
* | | | Merge pull request #1434 from DarkLordZach/dlc-edge-casebunnei2018-10-041-1/+1
|\ \ \ \
| * | | | aoc_u: Fix edge case with DLC that causes breaksZach Hilman2018-10-031-1/+1
| |/ / /
* | | | Merge pull request #1428 from lioncash/qtbunnei2018-10-041-21/+23
|\ \ \ \
| * | | | configure_graphics: Make functions internally linked where applicableLioncash2018-10-031-21/+23
| | |/ / | |/| |
* | | | Merge pull request #1431 from lioncash/audiobunnei2018-10-042-16/+34
|\ \ \ \
| * | | | configure_audio: Move combo box index setting to their own functionsLioncash2018-10-032-11/+25
| * | | | configure_audio: Use QString::fromStdString() for converting audio device namesLioncash2018-10-031-3/+3
| * | | | configure_audio: Add disambiguation comment for the volume percentage stringLioncash2018-10-032-4/+8
| |/ / /
* | | | Merge pull request #1433 from lioncash/fsbunnei2018-10-041-0/+2
|\ \ \ \
| * | | | services/fsp_srv: Amend service function tableLioncash2018-10-031-0/+2
| |/ / /
* | | | Merge pull request #1429 from lioncash/translatebunnei2018-10-041-3/+3
|\ \ \ \
| * | | | configure_input: Make analog mapping strings translatableLioncash2018-10-031-3/+3
| |/ / /
* | | | Merge pull request #1436 from lioncash/viewbunnei2018-10-042-73/+101
|\ \ \ \
| * | | | submission_package: Avoid dangling std::string_view within SetTicketKeys()Lioncash2018-10-031-2/+5
| * | | | submission_package: Correct location of null check within SetTicketKeys()Lioncash2018-10-031-3/+6
| * | | | submission_package: Use std::string's rfind() when looking for the extension in InitializeExeFSAndRomFS()Lioncash2018-10-031-1/+1
| * | | | submission_package: Ensure the 'extracted' member variable is always initializedLioncash2018-10-032-3/+1
| * | | | submission_package: Move ExeFS and RomFS initialization to its own functionLioncash2018-10-032-10/+18
| * | | | submission_package: Move NCA reading code to its own functionLioncash2018-10-032-43/+48
| * | | | submission_package: Move ticket key setting to its own functionLioncash2018-10-031-21/+28
| * | | | submission_package: Invert conditionals within NSP's constructor to reduce nestingLioncash2018-10-031-45/+49
| |/ / /
* | | | Merge pull request #1432 from lioncash/lblbunnei2018-10-041-19/+19
|\ \ \ \
| * | | | service/lbl: Update service function tableLioncash2018-10-031-19/+19
| | |/ / | |/| |
* | | | Merge pull request #1426 from FearlessTobi/port-4253bunnei2018-10-043-150/+7
|\ \ \ \
| * | | | string_util: unify UTF8<->UTF16 conversion to codecvtWeiyi Wang2018-10-021-109/+6
| * | | | string_util: remove TString conversion for windowsWeiyi Wang2018-10-022-19/+1
| * | | | string_util: remove ShiftJIS/CP1252 conversion functionWeiyi Wang2018-10-022-22/+0
| |/ / /
* | | | Merge pull request #1435 from lioncash/xcibunnei2018-10-041-1/+3
|\ \ \ \ | |/ / / |/| | |
| * | | card_image: Ensure program_nca_status is always initializedLioncash2018-10-031-1/+3
| |/ /
* | | Merge pull request #1407 from DarkLordZach/dlcbunnei2018-10-015-34/+145
|\ \ \ | |_|/ |/| |
| * | aoc_u: Extract AccumulateAOCTitleIDs to separate functionZach Hilman2018-10-012-21/+28
| * | aoc_u: Implement GetAddOnContentBaseIdZach Hilman2018-10-013-5/+8
| * | aoc_u: Implement Count, List and Prepare AddOnContentZach Hilman2018-10-012-3/+78
| * | romfs_factory: Read from all locations with StorageId NoneZach Hilman2018-10-011-26/+25
| * | patch_manager: Add DLC recognition to PatchManagerZach Hilman2018-10-012-0/+27
* | | gl_rasterizer: Fixup unassigned point sizesReinUsesLisp2018-10-011-1/+4
| |/ |/|
* | Merge pull request #1330 from raven02/tldsbunnei2018-10-011-7/+15
|\ \
| * | Fix trailing whitespaceraven022018-09-301-1/+4
| * | Merge branch 'master' into tldsraven022018-09-19164-1068/+1657
| |\ \
| * | | Add 1D sampler for TLDS - TexelFetch (Mario Rabbids)raven022018-09-171-7/+12
* | | | Merge pull request #1322 from bunnei/tex-cubemapbunnei2018-10-015-129/+355
|\ \ \ \
| * | | | gl_rasterizer_cache: Fixes to how we do render to cubemap.bunnei2018-09-302-32/+5
| * | | | gl_rasterizer_cache: Add check for array rendering to cubemap texture.bunnei2018-09-301-0/+8
| * | | | gl_rasterizer_cache: Implement render to cubemap.bunnei2018-09-303-119/+218
| * | | | gl_shader_decompiler: TEXS: Implement TextureType::TextureCube.bunnei2018-09-301-0/+8
| * | | | gl_rasterizer_cache: Add support for SurfaceTarget::TextureCubemap.bunnei2018-09-302-1/+36
| * | | | gl_rasterizer_cache: Implement LoadGLBuffer for Texture2DArray.bunnei2018-09-301-0/+8
| * | | | gl_rasterizer_cache: Update BlitTextures to support non-Texture2D ColorTexture surfaces.bunnei2018-09-301-23/+88
| * | | | gl_rasterizer_cache: Track texture target and depth in the cache.bunnei2018-09-301-2/+3
| * | | | gl_rasterizer_cache: Workaround for Texture2D -> Texture2DArray scenario.bunnei2018-09-303-6/+21
| * | | | gl_rasterizer_cache: Keep track of surface 2D size separately from total size.bunnei2018-09-302-32/+46
* | | | | Merge pull request #1403 from DarkLordZach/install-sysnandbunnei2018-10-011-4/+14
|\ \ \ \ \ | |_|_|_|/ |/| | | |
| * | | | qt: Install System TitleTypes to System NANDZach Hilman2018-09-271-4/+14
* | | | | Merge pull request #1338 from raven02/service_vibunnei2018-09-301-1/+19
|\ \ \ \ \
| * | | | | Implement ISystemDisplayService::GetDisplayModeraven022018-09-301-1/+19
* | | | | | kernel/svc: Implement svcGetThreadContext()Lioncash2018-09-303-2/+37
* | | | | | kernel/process: Add a data member to determine if a process is 64-bit or not.Lioncash2018-09-302-0/+11
* | | | | | kernel/process: Make data member variables privateLioncash2018-09-3018-75/+120
* | | | | | arm_interface: Add missing fpsr/tpidr members to the ThreadContext structLioncash2018-09-303-5/+15
| |_|/ / / |/| | | |
* | | | | loader: Make the Load() function take a process as a regular reference, not a SharedPtrLioncash2018-09-2918-42/+28
* | | | | Merge pull request #1412 from lioncash/movebunnei2018-09-292-3/+2
|\ \ \ \ \
| * | | | | kernel/object: Remove unnecessary std::move from DynamicObjectCast()Lioncash2018-09-282-3/+2
* | | | | | Merge pull request #1411 from ReinUsesLisp/point-sizebunnei2018-09-295-1/+27
|\ \ \ \ \ \
| * | | | | | video_core: Implement point_size and add point state syncReinUsesLisp2018-09-285-1/+27
* | | | | | | Merge pull request #1406 from ReinUsesLisp/multibind-samplersbunnei2018-09-295-8/+25
|\ \ \ \ \ \ \
| * | | | | | | gl_state: Pack sampler bindings into a single ARB_multi_bindReinUsesLisp2018-09-285-8/+25
* | | | | | | | Merge pull request #1395 from lioncash/vmbunnei2018-09-2918-160/+418
|\ \ \ \ \ \ \ \ | |_|/ / / / / / |/| | | | | | |
| * | | | | | | memory: Dehardcode the use of fixed memory range constantsLioncash2018-09-2511-75/+60
| * | | | | | | svc: Report correct memory-related values within some of the cases in svcGetInfo()Lioncash2018-09-253-28/+41
| * | | | | | | memory: Dehardcode the use of a 36-bit address spaceLioncash2018-09-256-22/+61
| * | | | | | | process/vm_manager: Amend API to allow reading parameters from NPDM metadataLioncash2018-09-2410-38/+259
* | | | | | | | Merge pull request #1360 from FearlessTobi/port-3979bunnei2018-09-273-35/+51
|\ \ \ \ \ \ \ \
| * | | | | | | | game_list: move SearchField to game_list_p.h and fix untranslated textzhupengfei2018-09-213-35/+51
* | | | | | | | | Merge pull request #1394 from lioncash/streambunnei2018-09-275-12/+12
|\ \ \ \ \ \ \ \ \ | |_|_|_|/ / / / / |/| | | | | | | |
| * | | | | | | | stream: Preserve enum class type in GetState()Lioncash2018-09-245-12/+12
| | |/ / / / / / | |/| | | | | |
* | | | | | | | Merge pull request #1389 from PhiBabin/valgrindMat M2018-09-271-1/+1
|\ \ \ \ \ \ \ \
| * | | | | | | | FPCR register was uninitialized at start upPhilippe Babin2018-09-231-1/+1
* | | | | | | | | Merge pull request #1377 from FernandoS27/faster-swizzlebunnei2018-09-271-51/+66
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | Reverse stride align restriction on FastSwizzle due to lost performanceFernandoS272018-09-211-3/+2
| * | | | | | | | | Join both Swizzle methods within one interface functionFernandoS272018-09-211-11/+19
| * | | | | | | | | Standarized Legacy Swizzle to look alike FastSwizzle and use a Swizzling Table insteadFernandoS272018-09-211-42/+38
| * | | | | | | | | Remove same output bpp restriction on FastSwizzleFernandoS272018-09-211-4/+5
| * | | | | | | | | Improved Legacy Swizzler to be better documented and work betterFernandoS272018-09-211-15/+21
| * | | | | | | | | Improved fast swizzle and removed restrictions to itFernandoS272018-09-211-7/+12
* | | | | | | | | | fsmitm_romfsbuild: std::move std::vector instances in Build()Lioncash2018-09-261-2/+2
* | | | | | | | | | fsmitm_romfsbuild: Replace manual value aligning with Common::AlignUp()Lioncash2018-09-261-12/+11
| |_|_|_|/ / / / / |/| | | | | | | |
* | | | | | | | | Merge pull request #1399 from lioncash/schedbunnei2018-09-264-14/+14
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | core_cpu: Make arm_interface instances a std::unique_ptrLioncash2018-09-252-4/+4
| * | | | | | | | | kernel/scheduler: Take ARM_Interface instance by reference in the constructorLioncash2018-09-253-10/+10
| | |/ / / / / / / | |/| | | | | | |
* | | | | | | | | Merge pull request #1400 from lioncash/headerbunnei2018-09-265-1/+7
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | service: Add missing headers inclusions where applicableLioncash2018-09-255-1/+7
* | | | | | | | | | Merge pull request #1402 from ReinUsesLisp/assertsbunnei2018-09-265-3/+92
|\ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | video_core: Add asserts for CS, TFB and alpha testingReinUsesLisp2018-09-265-3/+92
| | |_|_|_|_|_|/ / / | |/| | | | | | | |
* | | | | | | | | | patch_manager: Invert conditionals within ApplyLayeredFS()Lioncash2018-09-261-27/+30
* | | | | | | | | | vfs_vector: Amend initializer list order in VectorVfsFile's constructor initializer listLioncash2018-09-261-1/+1
* | | | | | | | | | fsmitm_romfsbuild: Avoid type truncation warningsLioncash2018-09-261-7/+10
* | | | | | | | | | fsmitm_romfsbuild: Remove unnecessary constructors and initializers for RomFSBuildFileContext and RomFSBuildDirectoryContextLioncash2018-09-261-5/+3
* | | | | | | | | | fsmitm_romfsbuild: Remove unnecessary loops in Build()Lioncash2018-09-261-6/+0
* | | | | | | | | | fsmitm_romfsbuild: Make auto variable into a std::size_t variable within Build()Lioncash2018-09-261-1/+1
* | | | | | | | | | yuzu/main: Resolve precedence bug within CalculateRomFSEntrySize()Lioncash2018-09-261-1/+1
* | | | | | | | | | yuzu/main: Move functions stored into static std::function instances out of OnGameListDumpRomFS()Lioncash2018-09-261-42/+42
* | | | | | | | | | vfs/etc: Append std:: to size_t usagesLioncash2018-09-267-29/+30
* | | | | | | | | | vfs_concat/vfs_layered: Remove friend declarations from ConcatenatedVfsFileLioncash2018-09-268-61/+59
* | | | | | | | | | vfs_static: Remove template byte parameter from StaticVfsFileLioncash2018-09-254-42/+42
|/ / / / / / / / /
* | | | | | | | | Merge pull request #1365 from DarkLordZach/lfsbunnei2018-09-2531-36/+1203
|\ \ \ \ \ \ \ \ \ | |/ / / / / / / / |/| | | | | | | |
| * | | | | | | | fsmitm: Cleanup and modernize fsmitm portZach Hilman2018-09-2422-378/+378
| * | | | | | | | qt: Add UI elements for LayeredFS and related toolsZach Hilman2018-09-226-5/+162
| * | | | | | | | romfs: Implement CreateRomFSZach Hilman2018-09-222-4/+25
| * | | | | | | | file_sys: Port Atmosphere-NX fs_mitm implementationZach Hilman2018-09-222-0/+474
| * | | | | | | | filesystem: Add LayeredFS VFS directory getterZach Hilman2018-09-222-1/+14
| * | | | | | | | bis_factory: Add mod directory VFS getterZach Hilman2018-09-223-3/+18
| * | | | | | | | patch_manager: Add LayeredFS mods supportZach Hilman2018-09-222-1/+44
| * | | | | | | | vfs_concat: Rewrite and fix ConcatenatedVfsFileZach Hilman2018-09-222-14/+59
| * | | | | | | | vfs_layered: Add LayeredVfsDirectoryZach Hilman2018-09-222-0/+178
| * | | | | | | | vfs_vector: Add VectorVfsFileZach Hilman2018-09-222-0/+75
| * | | | | | | | vfs_static: Add StaticVfsFileZach Hilman2018-09-222-0/+78
| * | | | | | | | vfs: Add and rewite VfsRawCopy functionsZach Hilman2018-09-222-6/+36
| * | | | | | | | vfs: Add GetEntries methodZach Hilman2018-09-224-0/+32
| * | | | | | | | common_paths: Add Load and Dump dirsZach Hilman2018-09-223-0/+6
* | | | | | | | | Merge pull request #1393 from tech4me/svcbunnei2018-09-251-7/+7
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | svc: Updated svc namestech4me2018-09-241-7/+7
* | | | | | | | | | Implemented fatal:u properly (#1347)David2018-09-243-4/+140
* | | | | | | | | | Stubbed IRS (#1349)David2018-09-244-18/+169
* | | | | | | | | | Merge pull request #1354 from ogniK5377/ssl-versionbunnei2018-09-241-3/+3
|\ \ \ \ \ \ \ \ \ \ | |_|_|_|_|/ / / / / |/| | | | | | | | |
| * | | | | | | | | Corrected SSL::SetInterfaceVersionDavid Marcec2018-09-191-3/+3
| | |_|_|_|_|_|_|/ | |/| | | | | | |
* | | | | | | | | Added glObjectLabels for renderdoc for textures and shader programs (#1384)David2018-09-234-0/+48
* | | | | | | | | Merge pull request #1387 from FearlessTobi/port-4245bunnei2018-09-231-8/+0
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | common/thread: remove YieldCPU()Weiyi Wang2018-09-221-8/+0
* | | | | | | | | | Merge pull request #1391 from ogniK5377/GetAudioRendererStatebunnei2018-09-235-1/+21
|\ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | Added audren:u#GetAudioRendererStateDavid Marcec2018-09-235-1/+21
| | |_|_|_|/ / / / / | |/| | | | | | | |
* / | | | | | | | | correct BC6Hgreggameplayer2018-09-231-2/+2
|/ / / / / / / / /
* | | | | | | | | Merge pull request #1378 from lioncash/threadbunnei2018-09-235-100/+145
|\ \ \ \ \ \ \ \ \ | |/ / / / / / / / |/| | | | | | | |
| * | | | | | | | svc: Move most process termination code to its own function within ProcessLioncash2018-09-213-32/+56
| * | | | | | | | thread/process: Move TLS slot marking/freeing to the process classLioncash2018-09-214-68/+89
| | |_|_|_|/ / / | |/| | | | | |
* | | | | | | | Merge pull request #1380 from lioncash/constbunnei2018-09-221-8/+19
|\ \ \ \ \ \ \ \
| * | | | | | | | shader_bytecode: Lay out the Ipa-related enums betterLioncash2018-09-211-2/+12
| * | | | | | | | shader_bytecode: Make operator== and operator!= of IpaMode const qualifiedLioncash2018-09-211-6/+7
| | |_|_|_|/ / / | |/| | | | | |
* | | | | | | | Merge pull request #1382 from lioncash/incbunnei2018-09-222-4/+1
|\ \ \ \ \ \ \ \
| * | | | | | | | gl_state: Remove unused type aliasLioncash2018-09-222-4/+1
| |/ / / / / / /
* | | | | | | | Merge pull request #1376 from Subv/timestretch_tracebunnei2018-09-221-1/+1
|\ \ \ \ \ \ \ \
| * | | | | | | | Logging: Change the TimeStretch::Process log from debug to trace level.Subv2018-09-211-1/+1
| |/ / / / / / /
* | | | | | | | Merge pull request #1381 from valentinvanelslande/patch-1bunnei2018-09-221-1/+1
|\ \ \ \ \ \ \ \
| * | | | | | | | Update config.cppValentin Vanelslande2018-09-211-1/+1
| | |_|_|_|/ / / | |/| | | | | |
* / | | | | | | game_list: Add Qt SmoothTransformation to picture scalingZach Hilman2018-09-221-1/+1
|/ / / / / / /
* | | | | | | Merge pull request #1379 from lioncash/bitwisebunnei2018-09-211-1/+1
|\ \ \ \ \ \ \ | |_|/ / / / / |/| | | | | |
| * | | | | | gl_stream_buffer: Fix use of bitwise OR instead of logical OR in Map()Lioncash2018-09-211-1/+1
| |/ / / / /
* | | | | | Added support for uncompressed NSOs (#1374)David2018-09-211-3/+12
* | | | | | Merge pull request #1337 from DarkLordZach/create-fs-cmdbunnei2018-09-211-1/+3
|\ \ \ \ \ \
| * | | | | | yuzu-cmd: Add call to CreateFactoriesZach Hilman2018-09-191-1/+3
| | |_|_|_|/ | |/| | | |
* | | | | | Merge pull request #1372 from lioncash/threadbunnei2018-09-213-5/+5
|\ \ \ \ \ \
| * | | | | | kernel/thread: Use owner_process when setting the page table in SetupMainThread()Lioncash2018-09-213-5/+5
| | |/ / / / | |/| | | |
* | | | | | Merge pull request #1371 from lioncash/fwd-armbunnei2018-09-215-1/+11
|\ \ \ \ \ \
| * | | | | | arm_interface: Replace kernel vm_manager include with a forward declarationLioncash2018-09-215-1/+11
| |/ / / / /
* | | | | | Merge pull request #1375 from Subv/gl_clearbunnei2018-09-211-1/+1
|\ \ \ \ \ \
| * | | | | | RasterizerGL: Use the correct framebuffer when clearing via the CLEAR_BUFFERS register.Subv2018-09-211-1/+1
| |/ / / / /
* | | | | | Merge pull request #1364 from lioncash/contentbunnei2018-09-2125-1/+45
|\ \ \ \ \ \
| * | | | | | file-sys: Default heavy-weight class destructors in the cpp fileLioncash2018-09-2025-1/+45
| | |_|_|/ / | |/| | | |
* | | | | | Merge pull request #1367 from lioncash/pluralbunnei2018-09-211-9/+1
|\ \ \ \ \ \
| * | | | | | game_list: Handle plurals within setFilterResult() betterLioncash2018-09-201-9/+1
| |/ / / / /
* | | | | | Merge pull request #1368 from ogniK5377/nifm-fixbunnei2018-09-211-1/+7
|\ \ \ \ \ \
| * | | | | | Fixed submitDavid Marcec2018-09-201-2/+1
| * | | | | | Added IRequest::SubmitDavid Marcec2018-09-201-1/+8
* | | | | | | Merge pull request #1352 from lioncash/sharingbunnei2018-09-211-3/+11
|\ \ \ \ \ \ \
| * | | | | | | ring_buffer: Use std::atomic_size_t in a static assertLioncash2018-09-191-1/+1
| * | | | | | | ring_buffer: Use std::hardware_destructive_interference_size to determine alignment size for avoiding false sharingLioncash2018-09-191-2/+10
| | |_|_|_|/ / | |/| | | | |
* | | | | | | Revert GetRequestStateDavid Marcec2018-09-211-1/+1
| |_|_|/ / / |/| | | | |
* | | | | | Merge pull request #1370 from Hedges/GDBCleanMat M2018-09-201-1/+1
|\ \ \ \ \ \
| * | | | | | Correct endianness of BKPTJarek Syrylak2018-09-201-1/+1
| | |/ / / / | |/| | | |
* | | | | | Merge pull request #1362 from MerryMage/dynarmicMat M2018-09-201-0/+12
|\ \ \ \ \ \ | |/ / / / / |/| | | | |
| * | | | | arm_dynarmic: Halt when BRK encounteredMerryMage2018-09-201-0/+1
| * | | | | arm_dynarmic: Support BKPT instructionMerryMage2018-09-191-0/+11
| | |/ / / | |/| | |
* | | | | Merge pull request #1358 from DarkLordZach/temp-storagebunnei2018-09-201-4/+7
|\ \ \ \ \
| * | | | | savedata_factory: Add TemporaryStorage SaveDataTypeZach Hilman2018-09-191-4/+7
| | |_|/ / | |/| | |
* | | | | Merge pull request #1363 from lioncash/controlbunnei2018-09-202-14/+17
|\ \ \ \ \
| * | | | | control_metadata: Remove unnecessary else within GetLanguageEntry()Lioncash2018-09-201-8/+8
| * | | | | control_metadata: Move language name array definition to the cpp fileLioncash2018-09-202-6/+9
| | |/ / / | |/| | |
* | | | | Merge pull request #1361 from lioncash/naxbunnei2018-09-204-19/+26
|\ \ \ \ \
| * | | | | xts_archive: Remove unused variables from CalculateHMAC256()Lioncash2018-09-191-3/+0
| * | | | | xts_archive: Make AsNCA() return a std::unique_ptr instead of a std::shared_ptrLioncash2018-09-192-3/+3
| * | | | | nax: Avoid re-parsing NAX data with GetFileType()Lioncash2018-09-192-13/+19
| * | | | | nax: Avoid unnecessary calls to AsNCA() in IdentifyType()Lioncash2018-09-191-4/+8
| * | | | | xts_archive: Ensure NAX's type member is always initializedLioncash2018-09-191-1/+1
| * | | | | xts_archive: Amend initializer order of NAX's constructorLioncash2018-09-191-2/+2
| |/ / / /
* | | | | Removed unneeded event clearDavid Marcec2018-09-201-1/+0
* | | | | Implemented NTC & IEnsureNetworkClockAvailabilityServiceDavid Marcec2018-09-201-3/+100
|/ / / /
* | | | Reworked incorrect nifm stubs (#1355)David2018-09-191-3/+10
* | | | Merge pull request #1356 from degasus/hotfixbunnei2018-09-191-6/+7
|\ \ \ \
| * | | | gl_rasterizer: Fix StartAddress handling with indexed draw calls.Markus Wick2018-09-191-6/+7
| | |/ / | |/| |
* | | | Merge pull request #1359 from ogniK5377/nesbunnei2018-09-193-7/+12
|\ \ \ \
| * | | | Fixed GetAccountId stub, Added error code for OpenDirectory and added ActivateNpadWithRevisionDavid Marcec2018-09-193-7/+12
| |/ / /
* | | | Removed MakeBuilder as it's not needed anymoreDavid Marcec2018-09-191-7/+0
* | | | Removed the use of rp.MakeBuilderDavid Marcec2018-09-196-27/+26
|/ / /
* | | Merge pull request #1348 from ogniK5377/GetImageSizebunnei2018-09-191-1/+9
|\ \ \
| * | | Implemented GetImageSizeDavid Marcec2018-09-181-1/+9
* | | | Merge pull request #1319 from lioncash/audiobunnei2018-09-195-43/+59
|\ \ \ \
| * | | | time_stretch: Remove unused <array> includeLioncash2018-09-171-1/+0
| * | | | stream: Replace includes with forward declarations where applicableLioncash2018-09-172-3/+7
| * | | | audio_renderer: Replace includes with forward declarations where applicableLioncash2018-09-172-39/+52
* | | | | Merge pull request #1351 from ogniK5377/GetDefaultDisplayResolutionbunnei2018-09-192-1/+18
|\ \ \ \ \
| * | | | | Implemented GetDefaultDisplayResolutionDavid Marcec2018-09-182-1/+18
| | |/ / / | |/| | |
* | | | | Merge pull request #1341 from lioncash/dependencybunnei2018-09-192-2/+6
|\ \ \ \ \
| * | | | | core/core_cpu: Replace exclusive monitor include with forward declarationLioncash2018-09-182-2/+6
| | |/ / / | |/| | |
* | | | | Merge pull request #1346 from lioncash/svcbunnei2018-09-191-37/+36
|\ \ \ \ \
| * | | | | svc_wrap: Convert the PARAM macro into a functionLioncash2018-09-181-37/+36
| |/ / / /
* | | | | Merge pull request #1350 from ogniK5377/Six-Axis-Stubbunnei2018-09-191-4/+28
|\ \ \ \ \
| * | | | | Added ActivateGestureDavid Marcec2018-09-181-1/+7
| * | | | | Added StopSixAxisSensorDavid Marcec2018-09-181-1/+7
| * | | | | Stubbed ActivateConsoleSixAxisSensor & StartConsoleSixAxisSensorDavid Marcec2018-09-181-2/+14
| | |/ / / | |/| | |
* | | | | Merge pull request #1342 from lioncash/truncbunnei2018-09-191-4/+4
|\ \ \ \ \
| * | | | | gl_shader_decompiler: Avoid truncation warnings within LD_A and ST_A codeLioncash2018-09-181-4/+4
| | |/ / / | |/| | |
* | | | | Merge pull request #1279 from FernandoS27/csetpbunnei2018-09-192-21/+133
|\ \ \ \ \
| * | | | | Implemented Internal FlagsFernandoS272018-09-181-13/+35
| * | | | | Implemented I2I.CC on the NEU control code, used by SMOFernandoS272018-09-172-14/+18
| * | | | | Implemented CSETPFernandoS272018-09-172-14/+49
| * | | | | Implemented Control CodesFernandoS272018-09-172-0/+51
| |/ / / /
* | | | | Merge pull request #1299 from FernandoS27/texture-sanatizebunnei2018-09-192-3/+192
|\ \ \ \ \
| * | | | | Added asserts for texture misc modes to texture instructionsFernandoS272018-09-171-2/+45
| * | | | | Added texture misc modes to texture instructionsFernandoS272018-09-171-1/+147
| |/ / / /
* | | | | Invalid default value of username in yuzu_cmd (#1334)Philippe Babin2018-09-193-3/+8
* | | | | Merge pull request #1343 from lioncash/mutexbunnei2018-09-182-2/+10
|\ \ \ \ \
| * | | | | kernel/mutex: Replace ResultCode construction for invalid addresses with the named variantLioncash2018-09-181-2/+2
| * | | | | kernel/svc: Handle error cases for svcArbitrateLock() and svcArbitrateUnlock()Lioncash2018-09-181-0/+8
| |/ / / /
* | | | | Merge pull request #1344 from lioncash/armbunnei2018-09-187-99/+86
|\ \ \ \ \
| * | | | | arm_interface: Remove ARM11-isms from the CPU interfaceLioncash2018-09-187-99/+86
| |/ / / /
* | | | | Merge pull request #1345 from lioncash/writebunnei2018-09-181-2/+2
|\ \ \ \ \ | |_|/ / / |/| | | |
| * | | | arm_dynarmic: Correct ExclusiveWrite128()'s operationLioncash2018-09-181-2/+2
| |/ / /
* | | | Merge pull request #1290 from FernandoS27/shader-headerbunnei2018-09-183-24/+111
|\ \ \ \ | |/ / / |/| | |
| * | | Replace old FragmentHeader for the new HeaderFernandoS272018-09-112-31/+18
| * | | Implemented (Partialy) Shader HeaderFernandoS272018-09-113-2/+102
* | | | Merge pull request #1311 from FernandoS27/fast-swizzlebunnei2018-09-171-2/+49
|\ \ \ \
| * | | | Optimized Texture SwizzlingFernandoS272018-09-141-2/+49
* | | | | Merge pull request #1312 from lioncash/fwdbunnei2018-09-173-7/+9
|\ \ \ \ \
| * | | | | service/vi: Replace includes with forward declarations where applicableLioncash2018-09-133-7/+9
* | | | | | Merge pull request #1313 from lioncash/errorbunnei2018-09-171-1/+2
|\ \ \ \ \ \
| * | | | | | kernel/errors: Amend error code for ERR_NOT_FOUNDLioncash2018-09-131-1/+2
| |/ / / / /
* | | | | | Merge pull request #1314 from lioncash/castbunnei2018-09-171-2/+2
|\ \ \ \ \ \
| * | | | | | audio_core/time_stretch: Silence truncation warnings in Process()Lioncash2018-09-141-2/+2
| |/ / / / /
* | | | | | Merge pull request #1316 from lioncash/shadowbunnei2018-09-171-2/+0
|\ \ \ \ \ \
| * | | | | | gl_shader_decompiler: Get rid of variable shadowing within LEA instructionsLioncash2018-09-141-2/+0
| |/ / / / /
* | | | | | Merge pull request #1318 from lioncash/errors-smbunnei2018-09-172-8/+6
|\ \ \ \ \ \
| * | | | | | services/sm: Amend error code constantsLioncash2018-09-142-8/+6
| |/ / / / /
* | | | | | Merge pull request #1321 from lioncash/audio-shadowbunnei2018-09-171-4/+4
|\ \ \ \ \ \
| * | | | | | cubeb_sink: Get rid of variable shadowing within CubebSink's constructorLioncash2018-09-141-4/+4
| |/ / / / /
* | | | | | Merge pull request #1315 from lioncash/sizebunnei2018-09-172-19/+74
|\ \ \ \ \ \
| * | | | | | kernel/svc: Sanitize creation of shared memory via svcCreateSharedMemory()Lioncash2018-09-141-2/+18
| * | | | | | kernel/svc: Sanitize addresses, permissions, and sizes within svcMapSharedMemory() and svcUnmapSharedMemory()Lioncash2018-09-141-17/+25
| * | | | | | kernel/svc: Sanitize addresses and sizes within svcMapMemory() and svcUnmapMemory()Lioncash2018-09-141-0/+23
| * | | | | | kernel/svc: Sanitize heap sizes within svcSetHeapSize()Lioncash2018-09-142-0/+8
| |/ / / / /
* | | | | | Merge pull request #1320 from lioncash/namebunnei2018-09-171-1/+1
|\ \ \ \ \ \
| * | | | | | cubeb_sink: Correct context name in ListCubebSinkDevices()Lioncash2018-09-141-1/+1
| |/ / / / /
* | | | | | Merge pull request #1328 from FearlessTobi/port-4192bunnei2018-09-171-1/+1
|\ \ \ \ \ \
| * | | | | | Port # #4192 from Citra: "svc: change unknown to thread in CreateThread"Valentin Vanelslande2018-09-151-1/+1
| | |_|_|_|/ | |/| | | |
* | | | | | Merge pull request #1327 from FearlessTobi/port-4171bunnei2018-09-172-16/+0
|\ \ \ \ \ \
| * | | | | | Tests: Remove glad test OS X work-aroundYuri Kunde Schlesner2018-09-152-16/+0
| |/ / / / /
* | | | | | Merge pull request #1326 from FearlessTobi/port-4182bunnei2018-09-17146-751/+780
|\ \ \ \ \ \
| * | | | | | Port #4182 from Citra: "Prefix all size_t with std::"fearlessTobi2018-09-15146-751/+780
| |/ / / / /
* | | | | | Merge pull request #1329 from raven02/bgr5a1ubunnei2018-09-172-0/+4
|\ \ \ \ \ \
| * | | | | | Implement RenderTargetFormat::BGR5A1_UNORM (Pokken Tournament DX)raven022018-09-152-0/+4
| |/ / / / /
* | | | | | Merge pull request #1335 from lioncash/copybunnei2018-09-171-5/+5
|\ \ \ \ \ \
| * | | | | | game_list_p: Amend typo in GameListItemCompat's constructor parameterLioncash2018-09-171-4/+4
| * | | | | | game_list_p: Take map iterator contents by const referenceLioncash2018-09-171-1/+1
| | |/ / / / | |/| | | |
* | | | | | Merge pull request #1336 from lioncash/antialiasbunnei2018-09-171-1/+2
|\ \ \ \ \ \
| * | | | | | yuzu/util: Antialias game list compatibility pixmapsLioncash2018-09-171-1/+2
| |/ / / / /
* | | | | / Implement ASTC_2D_8X8 (Bayonetta 2)raven022018-09-163-6/+20
| |_|_|_|/ |/| | | |
* | | | | Merge pull request #1273 from Subv/ld_sizesbunnei2018-09-152-7/+58
|\ \ \ \ \
| * | | | | Shaders: Implemented multiple-word loads and stores to and from attribute memory.Subv2018-09-152-7/+58
| | |/ / / | |/| | |
* | | | | Merge pull request #1271 from Subv/kepler_enginebunnei2018-09-156-0/+146
|\ \ \ \ \ | |/ / / / |/| | | |
| * | | | GPU: Basic implementation of the Kepler Inline Memory engine (p2mf).Subv2018-09-126-0/+146
* | | | | Merge pull request #1310 from lioncash/kernel-nsbunnei2018-09-145-38/+39
|\ \ \ \ \
| * | | | | kernel/thread: Include thread-related enums within the kernel namespaceLioncash2018-09-135-38/+39
| | |/ / / | |/| | |
* | | | | Merge pull request #1309 from lioncash/nestedbunnei2018-09-143-12/+6
|\ \ \ \ \
| * | | | | service: Use nested namespace specifiers where applicableLioncash2018-09-133-12/+6
| |/ / / /
* | | | | Merge pull request #1307 from lioncash/plbunnei2018-09-141-2/+4
|\ \ \ \ \ | |/ / / / |/| | | |
| * | | | services/pl_u: Add missing Korean font to the fallback case for shared fontsLioncash2018-09-131-2/+4
* | | | | ipc: minor fixValentin Vanelslande2018-09-131-1/+1
* | | | | Use ARB_multi_bind for uniform buffers (#1287)ReinUsesLisp2018-09-134-3/+27
|/ / / /
* | | | Merge pull request #1298 from lioncash/viewbunnei2018-09-132-2/+4
|\ \ \ \
| * | | | audio_core/sink_details: Change std::string parameter into std::string_viewLioncash2018-09-122-2/+4
| | |_|/ | |/| |
* | | | Merge pull request #1302 from lioncash/configbunnei2018-09-132-36/+74
|\ \ \ \
| * | | | yuzu/configure_gamelist: Make combo box strings translatableLioncash2018-09-122-21/+47
| * | | | yuzu/configure_gamelist: Use std::array instead of std::vector for translatable stringsLioncash2018-09-121-6/+9
| * | | | yuzu/configure_gamelist: Move combo box initializtion to their own functionsLioncash2018-09-122-23/+32
* | | | | Merge pull request #1163 from FearlessTobi/add-audio-stretchingbunnei2018-09-1318-49/+456
|\ \ \ \ \
| * | | | | audio_core: Flush stream when not playing anythingMerryMage2018-09-126-0/+23
| * | | | | cubeb_sink: Downsample arbitrary number of channelsMerryMage2018-09-091-10/+9
| * | | | | cubeb_sink: Perform audio stretchingMerryMage2018-09-083-24/+26
| * | | | | audio_core: Add audio stretcherMerryMage2018-09-083-0/+101
| * | | | | cubeb_sink: Hold last available value instead of writing zerosMerryMage2018-09-081-5/+15
| * | | | | cubeb_sink: Use RingBufferMerryMage2018-09-081-40/+26
| * | | | | common: Implement a ring bufferMerryMage2018-09-084-0/+243
| * | | | | Add audio stretching supportfearlessTobi2018-09-0812-0/+43
* | | | | | gl_rasterizer_cache: B5G6R5U should use GL_RGB8 as an internal format.bunnei2018-09-131-1/+1
| |_|_|_|/ |/| | | |
* | | | | Merge pull request #1297 from lioncash/plbunnei2018-09-122-66/+88
|\ \ \ \ \
| * | | | | pl_u: Eliminate mutable file-scope stateLioncash2018-09-122-66/+88
| | |_|/ / | |/| | |
* | | | | Merge pull request #1263 from FernandoS27/tex-modebunnei2018-09-122-1/+43
|\ \ \ \ \ | |_|_|_|/ |/| | | |
| * | | | Implemented Texture Processing ModesFernandoS272018-09-122-1/+43
| |/ / /
* | | | Merge pull request #1303 from lioncash/errorbunnei2018-09-123-9/+11
|\ \ \ \
| * | | | svc: Return ERR_INVALID_PROCESSOR_ID in CreateThread() if an invalid processor ID is givenLioncash2018-09-121-2/+2
| * | | | kernel/errors: Correct error codes for invalid thread priority and invalid processor IDLioncash2018-09-123-7/+9
* | | | | svc: Do nothing if svcOutputDebugString() is given a length of zeroLioncash2018-09-121-0/+4
* | | | | svc: Correct parameter type for OutputDebugString()Lioncash2018-09-122-3/+3
|/ / / /
* | | | Merge pull request #1296 from lioncash/prepobunnei2018-09-122-39/+40
|\ \ \ \
| * | | | service/prepo: Move class into the cpp fileLioncash2018-09-122-39/+40
| |/ / /
* | | | Merge pull request #1301 from lioncash/qtbunnei2018-09-121-4/+4
|\ \ \ \ | |_|_|/ |/| | |
| * | | game_list: Resolve variable shadowing within LoadCompatibilityList()Lioncash2018-09-121-3/+3
| * | | game_list: Use QJsonValueRef() within LoadCompatibilityList()Lioncash2018-09-121-2/+2
| |/ /
* | | Merge pull request #1300 from lioncash/audiobunnei2018-09-127-17/+34
|\ \ \
| * | | service/audio: Replace includes with forward declarations where applicableLioncash2018-09-127-17/+34
| |/ /
* | | Merge pull request #1278 from tech4me/bg-color-fixbunnei2018-09-126-0/+46
|\ \ \
| * | | Port Citra #4047 & #4052: add change background color supporttech4me2018-09-096-0/+46
* | | | Merge pull request #1295 from bunnei/accurate-copiesbunnei2018-09-122-18/+12
|\ \ \ \
| * | | | gl_rasterizer_cache: Always blit on recreate, regardless of format.bunnei2018-09-121-6/+10
| * | | | gl_shader_cache: Remove cache_width/cache_height.bunnei2018-09-122-12/+2
| | |/ / | |/| |
* | | | Merge pull request #1294 from degasus/optimizationsbunnei2018-09-123-11/+12
|\ \ \ \
| * | | | gl_rasterizer: Use ARB_texture_storage.Markus Wick2018-09-113-11/+12
| |/ / /
* | | | Implemented LEA and PSETFernandoS272018-09-111-0/+91
* | | | Implemented encodings for LEA and PSETFernandoS272018-09-111-0/+64
|/ / /
* | | Merge pull request #1291 from lioncash/defaultbunnei2018-09-11148-45/+291
|\ \ \
| * | | hle/service: Default constructors and destructors in the cpp file where applicableLioncash2018-09-11148-45/+291
* | | | Merge pull request #1292 from ogniK5377/renderdoc-fixbunnei2018-09-112-2/+9
|\ \ \ \
| * | | | Fixed renderdoc input/output textures not working due to render targetsDavid Marcec2018-09-112-2/+9
| |/ / /
* / / / externals: Place font data within cpp filesLioncash2018-09-111-6/+6
|/ / /
* | | Use open-source shared fonts if no dumped file is available (#1269)Tobias2018-09-112-2/+26
* | | Port #4141 from citra: Joystick hotplug support (#1275)Tobias2018-09-117-101/+339
* | | Merge pull request #1286 from bunnei/multi-clearbunnei2018-09-112-50/+66
|\ \ \
| * | | gl_rasterizer: Implement clear for non-zero render targets.bunnei2018-09-102-50/+66
* | | | Merge pull request #1285 from bunnei/depth-fixbunnei2018-09-111-6/+22
|\ \ \ \
| * | | | gl_rasterizer_cache: Only use depth for applicable texture formats.bunnei2018-09-101-6/+22
| |/ / /
* | | | Merge pull request #1284 from bunnei/bgra8_srgbbunnei2018-09-113-0/+4
|\ \ \ \
| * | | | gl_rasterizer_cache: Implement RenderTargetFormat::BGRA8_SRGB.bunnei2018-09-103-0/+4
| |/ / /
* | | | Merge pull request #1288 from MysticExile/remove-multicoreJames Rowe2018-09-112-10/+0
|\ \ \ \
| * | | | Remove multicore configure_general.uiMysticExile2018-09-101-7/+0
| * | | | remove multicore in configure_general.cppMysticExile2018-09-101-3/+0
| |/ / /
* | | | video_core: Refactor command_processor.Markus Wick2018-09-102-44/+42
* | | | video_core: Move command buffer loop.Markus Wick2018-09-105-77/+84
* | | | rasterizer: Drop unused handler.Markus Wick2018-09-104-8/+0
|/ / /
* | | gl_rasterizer: Implement multiple color attachments.bunnei2018-09-105-132/+95
* | | Merge pull request #1258 from tgsm/fix-sdl-loggingbunnei2018-09-101-2/+3
|\ \ \
| * | | yuzu-cmd: fix SDL loggingtgsm2018-09-081-2/+3
* | | | Merge pull request #1282 from lioncash/compatbunnei2018-09-1010-33/+56
|\ \ \ \
| * | | | game_list: Make CompatibilityList parameter of NavigateToGamedbEntryRequested() a const referenceLioncash2018-09-103-3/+5
| * | | | yuzu: Move compatibility list specifics to their own source filesLioncash2018-09-1010-33/+54
| | |/ / | |/| |
* | | | Merge pull request #1276 from FearlessTobi/fix-stupid-stubbunnei2018-09-102-4/+6
|\ \ \ \
| * | | | hid: Implement ReloadInputDevicesfearlessTobi2018-09-092-4/+6
| |/ / /
* | | | Merge pull request #1283 from lioncash/unusedbunnei2018-09-101-2/+0
|\ \ \ \
| * | | | service: Remove unused g_kernel_named_ports variableLioncash2018-09-101-2/+0
* | | | | Merge pull request #1268 from FernandoS27/tmmlbunnei2018-09-102-5/+67
|\ \ \ \ \ | |/ / / / |/| | | |
| * | | | Implemented TMMLFernandoS272018-09-102-5/+67
* | | | | Merge pull request #1272 from Subv/dma_2dbunnei2018-09-101-2/+10
|\ \ \ \ \
| * | | | | GPU/DMA: Partially implemented the 'enable_2d' bit in the DMA engine.Subv2018-09-081-2/+10
| | |_|_|/ | |/| | |
* | | | | Merge pull request #1280 from zero334/improvementsbunnei2018-09-105-89/+101
|\ \ \ \ \ | |_|/ / / |/| | | |
| * | | | video_core: fixed arithmetic overflow warnings & improved code stylePatrick Elsässer2018-09-095-89/+101
| | |/ / | |/| |
* | | | Implemented TXQ dimension query type, used by SMO.FernandoS272018-09-092-1/+36
* | | | Change name of TEXQ to TXQ, in order to match NVIDIA's namingFernandoS272018-09-091-2/+2
|/ / /
* | | Merge pull request #1256 from bunnei/tex-target-supportbunnei2018-09-0811-229/+422
|\ \ \
| * | | gl_rasterizer_cache: Improve accuracy of RecreateSurface for non-2D textures.bunnei2018-09-082-27/+45
| * | | maxwell_3d: Remove assert that no longer applies.bunnei2018-09-081-4/+0
| * | | gl_rasterizer_cache: Partially implement several non-2D texture types.bunnei2018-09-081-30/+111
| * | | gl_shader_decompiler: Partially implement several non-2D texture types (Subv).bunnei2018-09-082-32/+143
| * | | gl_rasterizer: Implement texture wrap mode p.bunnei2018-09-082-2/+8
| * | | gl_rasterizer_cache: Track texture depth.bunnei2018-09-083-4/+15
| * | | gl_rasterizer_cache: Remove impl. of FlushGLBuffer.bunnei2018-09-081-34/+1
| * | | gl_rasterizer_cache: Keep track of texture type per surface.bunnei2018-09-083-32/+84
| * | | gl_rasterizer_cache: Remove unused DownloadGLTexture.bunnei2018-09-082-51/+0
| * | | gl_state: Keep track of texture target.bunnei2018-09-085-26/+28
* | | | Merge pull request #1265 from zhaowenlan1779/patch-1bunnei2018-09-081-2/+2
|\ \ \ \
| * | | | yuzu: fix title bar displayPengfei Zhu2018-09-081-2/+2
| | |/ / | |/| |
* / | | audio_renderer: Rename AudioOut instance to audio_outMerryMage2018-09-082-7/+7
|/ / /
* | | Merge pull request #1246 from degasus/instanced_renderingbunnei2018-09-083-21/+29
|\ \ \
| * | | gl_rasterizer: Use baseInstance instead of moving the buffer points.bunnei2018-09-083-21/+29
| | |/ | |/|
* | | Merge pull request #1259 from lioncash/relocatebunnei2018-09-085-286/+324
|\ \ \ | |/ / |/| |
| * | yuzu: Move GameListWorker to its own source filesLioncash2018-09-075-286/+324
* | | video_core: Arithmetic overflow warning fix for gl_rasterizer (#1262)Patrick Elsässer2018-09-081-12/+14
| |/ |/|
* | Merge pull request #1257 from lioncash/processbunnei2018-09-084-5/+34
|\ \ | |/ |/|
| * core: Migrate current_process pointer to the kernelLioncash2018-09-074-5/+34
* | For SDL FrontendCaptV0rt3x2018-09-071-2/+2
* | Better Title Bar DisplayCaptV0rt3x2018-09-075-8/+28
|/
* Merge pull request #1250 from lioncash/file-sysbunnei2018-09-074-4/+16
|\
| * file_sys/nca_patch: Amend constructor initializer list orderLioncash2018-09-061-2/+2
| * file_sys/nca_patch: Remove unnecessary includesLioncash2018-09-062-2/+9
| * file_sys/patch_manager: Add missing includesLioncash2018-09-062-0/+5
* | Merge pull request #1249 from FearlessTobi/disable-vsyncbunnei2018-09-072-0/+2
|\ \
| * | frontend: Set swap interval to 0fearlessTobi2018-09-062-0/+2
* | | Merge pull request #1251 from lioncash/core-incbunnei2018-09-075-2/+5
|\ \ \
| * | | core/core: Remove unnecessary sm/controller includeLioncash2018-09-065-2/+5
| | |/ | |/|
* | | Merge pull request #1252 from lioncash/headerbunnei2018-09-071-0/+1
|\ \ \
| * | | video_core/CMakeLists: Add missing gl_buffer_cache.hLioncash2018-09-061-0/+1
| |/ /
* | | Merge pull request #1253 from lioncash/explicitbunnei2018-09-072-8/+10
|\ \ \
| * | | gl_buffer_cache: Default initialize member variablesLioncash2018-09-061-3/+3
| * | | gl_buffer_cache: Make GetHandle() a const member functionLioncash2018-09-062-2/+2
| * | | gl_buffer_cache: Remove unnecessary includesLioncash2018-09-062-2/+4
| * | | gl_buffer_cache: Make constructor explicitLioncash2018-09-061-1/+1
| |/ /
* | | Merge pull request #1255 from bunnei/minor-optbunnei2018-09-071-4/+2
|\ \ \
| * | | gl_rasterizer: Call state.Apply only once on SetupShaders.bunnei2018-09-061-4/+2
| |/ /
* / / gl_shader_decompiler: Implement saturate mode for IPA.bunnei2018-09-061-1/+5
|/ /
* / gl_shader_gen: Initialize position.Markus Wick2018-09-061-0/+1
|/
* Merge pull request #1243 from degasus/VAO_cachebunnei2018-09-063-53/+60
|\
| * gl_rasterizer: Implement a VAO cache.Markus Wick2018-09-053-53/+60
* | Merge pull request #1244 from FernandoS27/ipabunnei2018-09-062-47/+98
|\ \
| * | Implemented IPA ProperlyFernandoS272018-09-062-47/+98
* | | Merge pull request #1242 from lioncash/file-sysbunnei2018-09-062-8/+17
|\ \ \
| * | | file_sys/submission_package: Correct constructor initialization list orderLioncash2018-09-051-2/+2
| * | | file_sys/submission_package: Replace includes with forward declarations where applicableLioncash2018-09-052-6/+15
| | |/ | |/|
* | | Merge pull request #1179 from DarkLordZach/bktrbunnei2018-09-0632-101/+1132
|\ \ \
| * | | bktr: Fix bucket overlap errorZach Hilman2018-09-048-9/+11
| * | | drd: Parse title ID from program metadataZach Hilman2018-09-042-4/+29
| * | | patch_manager: Centralize Control-type NCA parsingZach Hilman2018-09-046-80/+89
| * | | nsp: Fix error masking issue with XCI filesZach Hilman2018-09-043-6/+13
| * | | game_list: Fix version display on non-NAND titlesZach Hilman2018-09-044-30/+52
| * | | bktr: Add logging on successful patchZach Hilman2018-09-043-7/+24
| * | | game_list: Use friendly game versionsZach Hilman2018-09-041-13/+32
| * | | bktr: Implement IVFC offset shiftingZach Hilman2018-09-048-8/+36
| * | | bktr: Fix missing includes and optimize styleZach Hilman2018-09-0412-103/+109
| * | | main: Make game updates installableZach Hilman2018-09-041-1/+5
| * | | game_list: Display patch names and versions on listZach Hilman2018-09-042-0/+27
| * | | loader: Add BKTR-specific error messages and codesZach Hilman2018-09-043-7/+28
| * | | loader: Ignore patches on NRO and DRDZach Hilman2018-09-044-0/+11
| * | | patch_manager: Add usages of patches to ExeFSZach Hilman2018-09-045-9/+41
| * | | file_sys: Add class to manage game patchesZach Hilman2018-09-042-0/+132
| * | | file_sys: Add BKTR patching mechanismZach Hilman2018-09-042-0/+352
| * | | content_archive: Add BKTR header parsing to NCAZach Hilman2018-09-042-19/+160
| * | | registration: Add RegisteredCacheUnionZach Hilman2018-09-044-0/+164
| * | | game_list: Use RegisteredCacheUnion for installedZach Hilman2018-09-043-5/+3
| * | | aes_util: Fix error involving reads of less than 0x10Zach Hilman2018-09-041-0/+14
* | | | gl_rasterizer: Skip TODO log.Markus Wick2018-09-051-1/+1
| |/ / |/| |
* | | renderer_opengl: Implement a buffer cache.Markus Wick2018-09-055-86/+182
| |/ |/|
* | Merge pull request #1240 from degasus/optimizationsbunnei2018-09-054-15/+23
|\ \ | |/ |/|
| * gl_shader_cache: Use an u32 for the binding point cache.Markus Wick2018-09-044-15/+23
* | main: Only show DRD deprecation warning onceZach Hilman2018-09-047-6/+19
* | control_metadata: Use alternate language names if AmericanEnglish isn't availableZach Hilman2018-09-042-4/+17
* | card_image: Add program title ID getterZach Hilman2018-09-042-0/+6
* | qt: Add deprecation warnings for DRD formatZach Hilman2018-09-041-0/+10
* | registration: Fix NSP installation errorsZach Hilman2018-09-041-1/+1
* | nsp: Comply with style and performance guidelinesZach Hilman2018-09-047-29/+48
* | qt: Add UI support for NSP filesZach Hilman2018-09-043-2/+7
* | registration: Add support for installing NSP filesZach Hilman2018-09-043-16/+34
* | loader: Add AppLoader for NSP filesZach Hilman2018-09-042-0/+182
* | card_image: Parse XCI secure partition with NSPZach Hilman2018-09-044-11/+38
* | file_sys: Add Nintendo Submission Package (NSP)Zach Hilman2018-09-042-0/+296
* | drd: Load title ID from program metadataZach Hilman2018-09-041-3/+1
* | loader: Add NSP file type and NSP-specific errorsZach Hilman2018-09-042-2/+14
* | key_manager: Avoid autogeneration if key existsZach Hilman2018-09-041-3/+13
|/
* Merge pull request #1238 from lioncash/explicitbunnei2018-09-043-8/+8
|\
| * common/logging: Amend documentation commentsLioncash2018-09-042-6/+6
| * common/logging/filter: Replace C-style case with C++ static_castLioncash2018-09-041-1/+1
| * common/logging/filter: Make constructor explicitLioncash2018-09-041-1/+1
* | Merge pull request #1237 from degasus/optimizationsbunnei2018-09-044-7/+7
|\ \
| * | core: Use a raw pointer in GetGPUDebugContext.Markus Wick2018-09-042-3/+3
| * | command_processor: Use std::array for bound_engines.Markus Wick2018-09-042-4/+4
| |/
* | Merge pull request #1223 from DarkLordZach/custom-nand-sd-dirsbunnei2018-09-046-0/+79
|\ \
| * | qt: Add message about not moving contents on dir changeZach Hilman2018-09-042-6/+23
| * | qt: Add UI options to change NAND/SD dirsZach Hilman2018-09-043-0/+36
| * | settings: Save and load NAND/SD dirs from configZach Hilman2018-09-043-0/+26
* | | Merge pull request #1232 from lioncash/copybunnei2018-09-041-1/+1
|\ \ \
| * | | gl_shader_decompiler: Use used_shaders member variable directly within GenerateDeclarations()Lioncash2018-09-021-1/+1
| |/ /
* | | Merge pull request #1235 from lioncash/forward-declbunnei2018-09-0422-27/+64
|\ \ \
| * | | file_sys: Replace includes with forward declarations where applicableLioncash2018-09-0422-27/+64
| | |/ | |/|
* | | Merge pull request #1236 from degasus/microprofilebunnei2018-09-044-5/+21
|\ \ \
| * | | Update microprofile scopes.Markus Wick2018-09-044-5/+21
| |/ /
* | | Merge pull request #1230 from lioncash/sslbunnei2018-09-042-37/+39
|\ \ \ | |/ / |/| |
| * | ssl: Move SSL class to cpp fileLioncash2018-09-022-37/+39
* | | Merge pull request #1231 from lioncash/globalbunnei2018-09-045-19/+51
|\ \ \
| * | | service: Migrate global named port map to the KernelCore classLioncash2018-09-025-19/+51
| | |/ | |/|
* / | vfs_real: Forward declare IOFileLioncash2018-09-0213-15/+45
|/ /
* | Merge pull request #1213 from DarkLordZach/octopath-fsbunnei2018-09-023-4/+33
|\ \
| * | maxwell_3d: Use CoreTiming for query timestampZach Hilman2018-09-011-2/+3
| * | filesystem: Implement OpenReadOnlySaveDataFilesystemZach Hilman2018-09-012-1/+7
| * | filesystem: Add OpenFileSystemWithPatchZach Hilman2018-09-012-1/+23
| |/
* | Merge pull request #1215 from ogniK5377/texs-nodep-assertbunnei2018-09-022-0/+3
|\ \
| * | Added assert for TEXS nodepDavid Marcec2018-09-012-0/+3
| |/
* | Merge pull request #1220 from FearlessTobi/extensions-qolbunnei2018-09-022-8/+10
|\ \
| * | citra_qt: Display the unsupported GL extensions in the popupfearlessTobi2018-09-012-8/+10
| |/
* | Merge pull request #1214 from ogniK5377/ipa-assertbunnei2018-09-022-6/+13
|\ \
| * | Added better asserts to IPA, Renamed IPA modes to match mesaDavid Marcec2018-09-012-6/+13
| |/
* | Merge pull request #1216 from ogniK5377/ffma-assertbunnei2018-09-022-0/+9
|\ \
| * | Removed saturate assertDavid Marcec2018-09-012-2/+0
| * | Changed tab5980_0 default from 0 -> 1David Marcec2018-09-011-2/+2
| * | Added FFMA assertsDavid Marcec2018-09-012-0/+11
| |/
* | Merge pull request #1218 from ogniK5377/fmul-assertbunnei2018-09-022-0/+13
|\ \
| * | Removed saturate assertDavid Marcec2018-09-012-2/+0
| * | Added FMUL assertsDavid Marcec2018-09-012-0/+15
| |/
* / filesystem: Move dir retrieval after path checking in DeleteFile()Lioncash2018-09-021-2/+5
|/
* core/core: Replace includes with forward declarations where applicableLioncash2018-08-3129-66/+185
* gl_rasterizer_cache: Use accurate framebuffer setting for accurate copies.bunnei2018-08-312-73/+54
* gl_rasterizer_cache: Also use reserve cache for RecreateSurface.bunnei2018-08-312-24/+18
* rasterizer_cache: Use boost::interval_map for a more accurate cache.bunnei2018-08-311-33/+45
* gl_renderer: Cache textures, framebuffers, and shaders based on CPU address.bunnei2018-08-3111-138/+70
* gl_rasterizer: Fix issues with the rasterizer cache.bunnei2018-08-314-46/+57
* Implement BC6H_UF16 & BC6H_SF16 (#1092)greggameplayer2018-08-313-31/+55
* Merge pull request #1204 from lioncash/pimplbunnei2018-08-315-279/+387
|\
| * core: Make the main System class use the PImpl idiomLioncash2018-08-315-279/+387
* | Merge pull request #1207 from degasus/hotfixbunnei2018-08-311-1/+1
|\ \
| * | Report correct shader size.Markus Wick2018-08-311-1/+1
* | | Added predicate comparison GreaterEqualWithNanHexagon122018-08-312-3/+4
|/ /
* | Merge pull request #1195 from FearlessTobi/port-gamelist-compatbunnei2018-08-318-3/+174
|\ \
| * | Show game compatibility within yuzufearlessTobi2018-08-298-3/+174
* | | gl_shader_decompiler: Implement POPC (#1203)Laku2018-08-312-0/+19
* | | Merge pull request #1200 from bunnei/improve-ipabunnei2018-08-302-1/+39
|\ \ \ | |_|/ |/| |
| * | gl_shader_decompiler: Improve IPA for Pass mode with Position attribute.bunnei2018-08-292-1/+39
* | | Merge pull request #1198 from lioncash/kernelbunnei2018-08-3054-442/+671
|\ \ \
| * | | kernel: Eliminate kernel global stateLioncash2018-08-2954-442/+671
| |/ /
* / / Shaders: Implemented IADD3tech4me2018-08-292-1/+84
|/ /
* | Merge pull request #1193 from lioncash/privbunnei2018-08-287-26/+40
|\ \
| * | gpu: Make memory_manager privateLioncash2018-08-287-26/+40
* | | Merge pull request #1192 from lioncash/unusedbunnei2018-08-281-2/+0
|\ \ \
| * | | gl_rasterizer: Remove unused variablesLioncash2018-08-281-2/+0
| |/ /
* | | Merge pull request #1191 from lioncash/noexceptbunnei2018-08-281-1/+1
|\ \ \
| * | | hle/result: Make ResultVal's move constructor as noexceptLioncash2018-08-281-1/+1
| |/ /
* | | Merge pull request #1194 from lioncash/allocbunnei2018-08-281-2/+1
|\ \ \ | |_|/ |/| |
| * | gl_shader_cache: Remove unused program_code vector in GetShaderAddress()Lioncash2018-08-281-2/+1
| |/
* / Fix two stupid errors made in #1141fearlessTobi2018-08-282-1/+2
|/
* Merge pull request #1165 from bunnei/shader-cachebunnei2018-08-2812-417/+387
|\
| * renderer_opengl: Implement a new shader cache.bunnei2018-08-289-285/+250
| * gl_rasterizer_cache: Update to use RasterizerCache base class.bunnei2018-08-283-132/+20
| * video_core: Add RasterizerCache class for common cache management code.bunnei2018-08-282-0/+117
* | yuzu: Fix stick UI direction orderfearlessTobi2018-08-281-2/+2
* | Merge pull request #1177 from lioncash/errbunnei2018-08-284-12/+15
|\ \ | |/ |/|
| * kernel/error: Amend error code for ERR_MAX_CONNECTIONS_REACHEDLioncash2018-08-251-2/+4
| * kernel/error: Amend error code for ERR_PORT_NAME_TOO_LONGLioncash2018-08-251-2/+1
| * kernel/error: Add error code for the handle table being fullLioncash2018-08-253-4/+4
| * kernel/error: Add error code for invalid memory permissionsLioncash2018-08-252-3/+4
| * kernel/error: Correct kernel error code for invalid combinationLioncash2018-08-251-1/+2
* | Merge pull request #1169 from Lakumakkara/selbunnei2018-08-281-1/+1
|\ \
| * | fix SEL_IMM bitstringLaku2018-08-241-1/+1
* | | Merge pull request #1188 from lioncash/unusedbunnei2018-08-281-1/+0
|\ \ \
| * | | vfs_real: Remove unused variable in CreateDirectoryRelative()Lioncash2018-08-271-1/+0
* | | | Merge pull request #1170 from lioncash/retbunnei2018-08-281-1/+1
|\ \ \ \
| * | | | file_util: Correct return value in early exit of ReadFileToString()Lioncash2018-08-241-1/+1
* | | | | Merge pull request #1175 from lioncash/nsbunnei2018-08-2813-12/+42
|\ \ \ \ \
| * | | | | core: Namespace all code in the arm subdirectory under the Core namespaceLioncash2018-08-2513-12/+42
| |/ / / /
* | | | | Merge pull request #1187 from lioncash/shadowbunnei2018-08-281-3/+3
|\ \ \ \ \
| * | | | | registered_cache: Get rid of variable shadowing in ProcessFiles()Lioncash2018-08-271-3/+3
| | |/ / / | |/| | |
* | | | | Merge pull request #1128 from DarkLordZach/malformed-hex-crashbunnei2018-08-271-5/+17
|\ \ \ \ \
| * | | | | hex_util: Replace logic_errors with LOG_CRITICALZach Hilman2018-08-231-5/+17
* | | | | | Merge pull request #1176 from lioncash/infobunnei2018-08-271-2/+1
|\ \ \ \ \ \
| * | | | | | svc: Return process title ID if queried in GetInfo()Lioncash2018-08-251-2/+1
* | | | | | | Merge pull request #1174 from lioncash/debugbunnei2018-08-275-27/+7
|\ \ \ \ \ \ \
| * | | | | | | debug_utils: Remove unused includesLioncash2018-08-255-24/+4
| * | | | | | | debug_utils: Make BreakpointObserver class' constructor explicitLioncash2018-08-251-1/+1
| * | | | | | | debug_utils: Initialize active_breakpoint member of DebugContextLioncash2018-08-251-2/+2
| | |_|_|/ / / | |/| | | | |
* | | | | | | Merge pull request #1162 from ogniK5377/ttf-plubunnei2018-08-271-5/+51
|\ \ \ \ \ \ \
| * | | | | | | Addressed plu TTF changesDavid Marcec2018-08-231-6/+7
| * | | | | | | Added SharedFonts loading via TTFDavid Marcec2018-08-231-5/+50
* | | | | | | | Merge pull request #1168 from lioncash/headerbunnei2018-08-272-1/+4
|\ \ \ \ \ \ \ \
| * | | | | | | | hid: Move core include to cpp fileLioncash2018-08-242-1/+4
| | |/ / / / / / | |/| | | | | |
* | | | | | | | Merge pull request #1171 from lioncash/truebunnei2018-08-271-7/+4
|\ \ \ \ \ \ \ \
| * | | | | | | | core: Remove always true conditionals in Load()Lioncash2018-08-241-7/+4
| |/ / / / / / /
* | | | | / / / set: Fixed GetAvailableLanguageCodes() to follow the max_entriestech4me2018-08-262-8/+45
| |_|_|_|/ / / |/| | | | | |
* | | | | | | Merge pull request #1173 from lioncash/batchbunnei2018-08-251-4/+4
|\ \ \ \ \ \ \
| * | | | | | | maxwell3d: Move FinishedPrimitiveBatch event after AcceleratedDrawBatch()Lioncash2018-08-251-4/+4
| |/ / / / / /
* | | | | | | Merge pull request #1167 from lioncash/assertbunnei2018-08-251-1/+2
|\ \ \ \ \ \ \ | |_|_|_|_|_|/ |/| | | | | |
| * | | | | | gl_rasterizer: Correct assertion condition in SyncLogicOpState()Lioncash2018-08-241-1/+2
| |/ / / / /
* | | | | | Merge pull request #1166 from lioncash/typoSebastian Valle2018-08-251-1/+1
|\ \ \ \ \ \ | |_|_|/ / / |/| | | | |
| * | | | | filesystem: Fix typo in log messageLioncash2018-08-241-1/+1
| |/ / / /
* | | | | Merge pull request #1094 from DarkLordZach/nax0Mat M2018-08-2531-97/+821
|\ \ \ \ \
| * | | | | file_sys/crypto: Fix missing/unnecessary includesZach Hilman2018-08-259-5/+10
| * | | | | xci: Ignore NCA files with updates in secureZach Hilman2018-08-241-0/+3
| * | | | | content_archive: Add update title detectionZach Hilman2018-08-242-0/+11
| * | | | | key_manager: Eliminate indexed for loopZach Hilman2018-08-231-6/+13
| * | | | | key_manager: Create keys dir if it dosen't existZach Hilman2018-08-232-0/+2
| * | | | | file_sys: Cut down on includes and copiesZach Hilman2018-08-237-19/+30
| * | | | | crypto: Eliminate magic constantsZach Hilman2018-08-234-32/+38
| * | | | | key_manager: Add support for autogenerated keysZach Hilman2018-08-232-3/+45
| * | | | | key_manager: Add support for KEK and SD seed derivationZach Hilman2018-08-232-5/+135
| * | | | | key_manager: Switch to boost flat_map for keysZach Hilman2018-08-232-32/+14
| * | | | | game_list: Add SD registration loading to game listZach Hilman2018-08-232-12/+12
| * | | | | file_sys: Implement NAX containersZach Hilman2018-08-233-0/+238
| * | | | | registration: Add GetEntryUnparsed methodsZach Hilman2018-08-232-0/+15
| * | | | | sdmc_factory: Add SDMC RegisteredCache getterZach Hilman2018-08-232-1/+14
| * | | | | qt: Make default row data title name and title idZach Hilman2018-08-231-2/+2
| * | | | | vfs: Add GetOrCreateDirectoryRelative methodZach Hilman2018-08-233-9/+13
| * | | | | filesystem: Add CreateFactories methods to fsZach Hilman2018-08-233-10/+12
| * | | | | filesystem: Add logging to registration gettersZach Hilman2018-08-231-4/+25
| * | | | | loader: Add new NAX-specific errors and messagesZach Hilman2018-08-232-1/+27
| * | | | | nax: Add AppLoader_NAX and update loader to support itZach Hilman2018-08-234-2/+121
| * | | | | xts_encryption_layer: Implement XTSEncryptionLayerZach Hilman2018-08-233-1/+81
| * | | | | aes_util: Make XTSTranscode stricter about sizesZach Hilman2018-08-231-5/+2
| * | | | | ctr_encryption_layer: Fix bug when transcoding small dataZach Hilman2018-08-231-5/+3
| * | | | | xci: Fix error masking issueZach Hilman2018-08-233-5/+17
* | | | | | Merge pull request #1065 from DarkLordZach/window-titleZach Hilman2018-08-242-0/+18
|\ \ \ \ \ \ | |_|_|_|_|/ |/| | | | |
| * | | | | qt: Add filename and title id to window title while runningZach Hilman2018-08-232-0/+18
| | |_|_|/ | |/| | |
* | | | | Merge pull request #1164 from tech4me/decode_iadd3bunnei2018-08-241-0/+6
|\ \ \ \ \ | |_|_|/ / |/| | | |
| * | | | Shaders: Added decodings for IADD3 instructionstech4me2018-08-231-0/+6
| |/ / /
* | | | Port #4013 from Citra: "Init logging sooner so we dont miss some logs on startup" (#1142)Tobias2018-08-241-11/+11
* | | | Added GetBootMode (#1107)David2018-08-244-3/+25
|/ / /
* | | Merge pull request #1160 from bunnei/surface-reservebunnei2018-08-232-17/+91
|\ \ \
| * | | gl_rasterizer_cache: Blit when possible on RecreateSurface.bunnei2018-08-231-5/+12
| * | | gl_rasterizer_cache: Reserve surfaces that have already been created for later use.bunnei2018-08-232-3/+61
| * | | gl_rasterizer_cache: Remove assert for RecreateSurface type.bunnei2018-08-231-1/+0
| * | | gl_rasterizer_cache: Implement compressed texture copies.bunnei2018-08-231-8/+18
| |/ /
* | | gl_rasterizer: Implement stencil test.bunnei2018-08-233-4/+58
* | | gl_rasterizer: Implement partial color clear and stencil clear.bunnei2018-08-231-12/+42
* | | maxwell_3d: Update to include additional stencil registers.bunnei2018-08-231-20/+50
* | | gl_state: Update to handle stencil front/back face separately.bunnei2018-08-232-33/+38
|/ /
* | Merge pull request #1157 from lioncash/vecbunnei2018-08-232-11/+16
|\ \
| * | gl_shader_gen: Make ShaderSetup's constructor explicitLioncash2018-08-221-1/+1
| * | gl_shader_gen: Use a std::vector to represent program code instead of std::arrayLioncash2018-08-222-11/+16
* | | Merge pull request #1156 from Lakumakkara/lop3bunnei2018-08-232-0/+60
|\ \ \ | |_|/ |/| |
| * | more fixesLaku2018-08-221-6/+7
| * | fixesLaku2018-08-221-6/+12
| * | remove debug loggingLaku2018-08-221-2/+0
| * | implement lop3Laku2018-08-222-0/+55
* | | Swap "Plus" with "Minus" on the controller GUI (#1150)literalmente-game2018-08-231-8/+8
* | | Merge pull request #1137 from lioncash/namespacebunnei2018-08-2321-23/+70
|\ \ \ | |_|/ |/| |
| * | renderer_opengl: Namespace OpenGL codeLioncash2018-08-2221-23/+70
| |/
* / config: Fixed icon size get set to 0tech4me2018-08-221-1/+1
|/
* Merge pull request #1136 from tech4me/masterbunnei2018-08-226-11/+45
|\
| * qt/main: Port part of citra(#3411), open savedata workstech4me2018-08-216-11/+45
* | Merge pull request #840 from FearlessTobi/port-3353bunnei2018-08-2210-25/+94
|\ \
| * | Port #3353 from CitrafearlessTobi2018-08-2110-25/+94
* | | Merge pull request #1154 from OatmealDome/topology-linesbunnei2018-08-221-0/+2
|\ \ \
| * | | maxwell_to_gl: Implement PrimitiveTopology::LinesOatmealDome2018-08-221-0/+2
* | | | Merge pull request #1141 from FearlessTobi/port-3902bunnei2018-08-222-0/+18
|\ \ \ \
| * | | | Port #3902 from Citra: "Add restart hotkey & menu option"fearlessTobi2018-08-212-0/+18
| | |_|/ | |/| |
* | | | Merge pull request #1124 from Subv/logic_opsbunnei2018-08-226-7/+108
|\ \ \ \ | |_|/ / |/| | |
| * | | GPU: Implemented the logic op functionality of the GPU.Subv2018-08-213-0/+61
| * | | GLState: Allow enabling/disabling GL_COLOR_LOGIC_OP independently from blending.Subv2018-08-212-6/+19
| * | | GPU: Added registers for the logicop functionality.Subv2018-08-211-1/+28
| | |/ | |/|
* | | Merge pull request #1147 from lioncash/warnbunnei2018-08-221-1/+1
|\ \ \
| * | | logging/text_formatter: Use empty braces for initializing CONSOLE_SCREEN_BUFFER_INFO instanceLioncash2018-08-211-1/+1
* | | | Merge pull request #1151 from bunnei/revert-4a2ee191bunnei2018-08-222-153/+31
|\ \ \ \
| * | | | Revert "Shader: Use the right sampler type in the TEX, TEXS and TLDS instructions."bunnei2018-08-222-153/+31
* | | | | Added missing include for pl:uDavid Marcec2018-08-221-0/+1
* | | | | PL:U Added BFTTF loading(Loading from System NAND dumps) (#1088)David2018-08-221-25/+140
|/ / / /
* | | | Merge pull request #1145 from lioncash/fwd-declbunnei2018-08-225-4/+7
|\ \ \ \
| * | | | vfs: Replace mode.h include with forward declarations where applicableLioncash2018-08-215-4/+7
| |/ / /
* | | | Merge pull request #1146 from lioncash/ambunnei2018-08-221-3/+4
|\ \ \ \
| * | | | am: Utilize std::array within PopLaunchParameter()Lioncash2018-08-211-3/+4
| |/ / /
* | | | Merge pull request #1148 from lioncash/audio-warnbunnei2018-08-211-1/+1
|\ \ \ \
| * | | | audio_core/filter: Add explicit cast to assignment in Process()Lioncash2018-08-211-1/+1
| |/ / /
* / / / shader_bytecode: Parenthesize conditional expression within GetTextureType()Lioncash2018-08-211-1/+1
|/ / /
* | | Merge pull request #1143 from lioncash/incbunnei2018-08-212-1/+1
|\ \ \
| * | | sdmc_factory: Remove unnecessary core includeLioncash2018-08-212-1/+1
| | |/ | |/|
* | | Merge pull request #1139 from lioncash/bitfieldbunnei2018-08-211-2/+1
|\ \ \
| * | | bit_field: Convert ToBool() into explicit operator boolLioncash2018-08-211-2/+1
| |/ /
* | | Merge pull request #1140 from FearlessTobi/port-4056bunnei2018-08-212-0/+14
|\ \ \
| * | | Port #4056 from Citra: "Add Clear Recent Files menu action"fearlessTobi2018-08-212-0/+14
| |/ /
* / / perf_stats: Change MAX_LAG_TIME_US to an appropriate valueMerryMage2018-08-211-1/+1
|/ /
* | Merge pull request #1123 from lioncash/screenbunnei2018-08-217-30/+25
|\ \
| * | rasterizer_interface: Remove ScreenInfo from AccelerateDraw()'s signatureLioncash2018-08-215-17/+14
| * | renderer_base: Make creation of the rasterizer, the responsibility of the renderers themselvesLioncash2018-08-214-14/+12
| |/
* | Merge pull request #1129 from lioncash/headerbunnei2018-08-2111-8/+40
|\ \
| * | service/filesystem: Use forward declarations where applicableLioncash2018-08-219-5/+28
| * | romfs_factory: Remove unnecessary includes and use forward declarations where applicableLioncash2018-08-213-3/+12
* | | Merge pull request #1132 from Subv/gl_FragDepthbunnei2018-08-211-1/+6
|\ \ \
| * | | Shaders: Implement depth writing in fragment shaders.Subv2018-08-211-1/+6
* | | | Merge pull request #1134 from lioncash/logbunnei2018-08-211-1/+1
|\ \ \ \
| * | | | renderer_opengl: Use LOG_DEBUG for GL_DEBUG_SEVERITY_NOTIFICATION and GL_DEBUG_SEVERITY_LOW logsLioncash2018-08-211-1/+1
* | | | | Merge pull request #1121 from Subv/tex_reinterpretbunnei2018-08-214-16/+70
|\ \ \ \ \ | |/ / / / |/| | | |
| * | | | Rasterizer: Reinterpret the raw texture bytes instead of blitting (and thus doing format conversion) to a new texture when a game requests an old texture address with a different format.Subv2018-08-201-3/+49
| * | | | Rasterizer: Don't attempt to copy over the old texture's data when doing a format reinterpretation if we're only going to clear the framebuffer.Subv2018-08-204-13/+21
| | |_|/ | |/| |
* | | | Merge pull request #1133 from lioncash/guardbunnei2018-08-211-0/+2
|\ \ \ \ | |_|/ / |/| | |
| * | | gl_stream_buffer: Add missing header guardLioncash2018-08-211-0/+2
* | | | Merge pull request #1126 from lioncash/telembunnei2018-08-211-4/+4
|\ \ \ \
| * | | | telemetry_session: Don't allocate std::string instances for program lifetime in GetTelemetryId() and RegenerateTelemetryId()Lioncash2018-08-211-4/+4
* | | | | Merge pull request #1131 from bunnei/impl-tex3d-texcubebunnei2018-08-212-2/+21
|\ \ \ \ \
| * | | | | shader_bytecode: Replace some UNIMPLEMENTED logs.bunnei2018-08-211-2/+6
| * | | | | gl_shader_decompiler: Implement Texture3D for TEXS.bunnei2018-08-211-0/+7
| * | | | | gl_shader_decompiler: Implement TextureCube for TEX.bunnei2018-08-211-0/+8
* | | | | | Merge pull request #1106 from Subv/multiple_rendertargetsbunnei2018-08-212-6/+45
|\ \ \ \ \ \ | |/ / / / / |/| | | | |
| * | | | | Shaders: Write all the enabled color outputs when a fragment shader exits.Subv2018-08-212-6/+45
* | | | | | Merge pull request #1130 from Subv/tex_2dbunnei2018-08-211-6/+15
|\ \ \ \ \ \ | |_|_|/ / / |/| | | | |
| * | | | | Shaders: Fixed the coords in TEX with Texture2D.Subv2018-08-211-1/+1
| * | | | | Shaders: Log and crash when using an unimplemented texture type in a texture sampling instruction.Subv2018-08-211-5/+14
| | |/ / / | |/| | |
* | | | | Merge pull request #1122 from lioncash/accbunnei2018-08-214-57/+61
|\ \ \ \ \ | |_|_|_|/ |/| | | |
| * | | | acc: Replace profile_manager include with a forward declarationLioncash2018-08-212-2/+6
| * | | | acc: Simplify WriteBuffer call within LoadImage()Lioncash2018-08-211-3/+3
| * | | | acc: Correct IProfile's constructor initializer list orderLioncash2018-08-211-1/+1
| * | | | acc: Remove unused DEFAULT_USER_IDLioncash2018-08-211-3/+0
| * | | | profile_manager: Use INVALID_UUID in the initializer of last_opened_userLioncash2018-08-211-1/+1
| * | | | profile_manager: Remove unnecessary memcpy in GetProfileBaseAndData()Lioncash2018-08-211-1/+1
| * | | | profile_manager: Use type aliases for username data, profile data, and user arraysLioncash2018-08-212-19/+22
| * | | | profile_manager: Take ProfileInfo by const reference where applicableLioncash2018-08-212-8/+8
| * | | | profile_manager: Make array parameter to CreateNewUser a const referenceLioncash2018-08-212-2/+2
| * | | | profile_manager: Remove unnecessary staticLioncash2018-08-211-1/+1
| * | | | profile_manager: Simplify UUID's two param constructor, operator==, and operator boolLioncash2018-08-211-6/+4
| * | | | profile_manager: Move UUID generation function to the cpp fileLioncash2018-08-212-10/+12
| * | | | profile_manager: Remove unnecessary std::move in AddToProfiles() and CreateNewUser()Lioncash2018-08-201-2/+2
| | |_|/ | |/| |
* | | | Merge pull request #1095 from DarkLordZach/sysarchivesbunnei2018-08-218-20/+100
|\ \ \ \ | |_|/ / |/| | |
| * | | registration: Add Data_Unknown5 NCAContentTypeZach Hilman2018-08-203-2/+3
| * | | filesystem: Add support for loading of system archivesZach Hilman2018-08-197-20/+99
| | |/ | |/|
* | | Merge pull request #1064 from lioncash/telemetrybunnei2018-08-213-62/+84
|\ \ \ | |_|/ |/| |
| * | common/telemetry: Migrate core-independent info gathering to commonLioncash2018-08-153-62/+84
* | | Merge pull request #1104 from Subv/instanced_arraysbunnei2018-08-202-4/+30
|\ \ \
| * | | GLRasterizer: Implemented instanced vertex arrays.Subv2018-08-182-4/+30
| | |/ | |/|
* | | Merge pull request #1115 from Subv/texs_maskbunnei2018-08-201-18/+18
|\ \ \
| * | | Shaders/TEXS: Fixed the component mask in the TEXS instruction.Subv2018-08-201-18/+18
* | | | Merge pull request #1112 from Subv/sampler_typesbunnei2018-08-203-33/+250
|\ \ \ \
| * | | | Shader: Implemented the TLD4 and TLD4S opcodes using GLSL's textureGather.Subv2018-08-191-0/+51
| * | | | Shader: Use the right sampler type in the TEX, TEXS and TLDS instructions.Subv2018-08-192-29/+127
| * | | | Shader: Added bitfields for the texture type of the various sampling instructions.Subv2018-08-191-1/+65
| * | | | Shaders: Added decodings for TLD4 and TLD4SSubv2018-08-191-3/+7
* | | | | Merge pull request #1117 from ogniK5377/CheckFreeCommunicationPermissionbunnei2018-08-201-1/+8
|\ \ \ \ \
| * | | | | Added CheckFreeCommunicationPermissionDavid Marcec2018-08-201-1/+8
| | |/ / / | |/| | |
* | | | | Merge pull request #1017 from ogniK5377/better-accountbunnei2018-08-2013-74/+440
|\ \ \ \ \
| * | | | | Better UUID randomnessDavid Marcec2018-08-111-2/+7
| * | | | | Removed un-needed count from ListOpenUsers and ListAllUsersDavid Marcec2018-08-111-4/+2
| * | | | | Added better explanations in the profile managerDavid Marcec2018-08-112-1/+34
| * | | | | Code cleanup for profile managerDavid Marcec2018-08-113-40/+47
| * | | | | Removed const from ProfileBase InvalidateDavid Marcec2018-08-111-1/+1
| * | | | | fixed invalid uuid bool operatorDavid Marcec2018-08-111-1/+1
| * | | | | Added GetOpenUserCountDavid Marcec2018-08-113-3/+14
| * | | | | Removed all for loops from the profile managerDavid Marcec2018-08-111-9/+4
| * | | | | Added missing ListAllUsers countDavid Marcec2018-08-111-1/+2
| * | | | | If statement style changeDavid Marcec2018-08-111-11/+19
| * | | | | Second round of account changesDavid Marcec2018-08-113-18/+21
| * | | | | First round of account changesDavid Marcec2018-08-113-49/+55
| * | | | | Refactored profile manager sharingDavid Marcec2018-08-1110-20/+28
| * | | | | Merge remote-tracking branch 'origin/master' into better-accountDavid Marcec2018-08-1176-634/+1562
| |\ \ \ \ \
| * | | | | | Added IsUserRegistrationRequestPermittedDavid Marcec2018-08-117-3/+19
| * | | | | | Don't add user if the uuid already existsDavid Marcec2018-08-091-0/+4
| * | | | | | Open first user addedDavid Marcec2018-08-081-1/+3
| * | | | | | Inital pass of account backend implementationDavid Marcec2018-08-083-12/+22
| * | | | | | GetProfileBase and GetProfileBaseAndData addedDavid Marcec2018-08-083-44/+106
| * | | | | | began initial implementation of "ProfileManager"David Marcec2018-08-085-44/+202
| * | | | | | Switched uuids from u128 to new UUID structDavid Marcec2018-08-082-10/+49
* | | | | | | Merge pull request #1120 from ogniK5377/rgba8-uintbunnei2018-08-204-45/+58
|\ \ \ \ \ \ \
| * | | | | | | Implemented RGBA8_UINTDavid Marcec2018-08-204-45/+58
| | |_|/ / / / | |/| | | | |
* / | | | | | game_list: Avoid uninitialized variables when retrieving program IDLioncash2018-08-201-2/+2
|/ / / / / /
* | | | | | Merge pull request #1089 from Subv/neg_bitsbunnei2018-08-192-16/+38
|\ \ \ \ \ \
| * | | | | | Shaders: Corrected the 'abs' and 'neg' bit usage in the float arithmetic instructions.Subv2018-08-182-16/+38
* | | | | | | Merge pull request #1105 from Subv/convert_negbunnei2018-08-191-2/+0
|\ \ \ \ \ \ \
| * | | | | | | Shader: Remove an unneeded assert, the negate bit is implemented for conversion instructions.Subv2018-08-181-2/+0
| | |_|_|_|/ / | |/| | | | |
* | | | | | | Merge pull request #1113 from Subv/texs_maskbunnei2018-08-191-6/+11
|\ \ \ \ \ \ \
| * | | | | | | Shaders/TEXS: Fixed the component mask in the TEXS instruction.Subv2018-08-191-6/+11
| | |_|_|_|/ / | |/| | | | |
* | | | | | | Merge pull request #1102 from ogniK5377/mirror-clamp-edgebunnei2018-08-193-0/+6
|\ \ \ \ \ \ \
| * | | | | | | Added check to see if ARB_texture_mirror_clamp_to_edge is supportedDavid Marcec2018-08-192-0/+4
| * | | | | | | Added WrapMode MirrorOnceClampToEdgeDavid Marcec2018-08-181-0/+2
| | |/ / / / / | |/| | | | |
* | | | | | | Merge pull request #1101 from Subv/ssy_stackbunnei2018-08-191-3/+36
|\ \ \ \ \ \ \ | |_|/ / / / / |/| | | | | |
| * | | | | | Shaders: Implemented a stack for the SSY/SYNC instructions.Subv2018-08-181-3/+36
| |/ / / / /
* | | | | | Merge pull request #1109 from Subv/ldg_decodebunnei2018-08-191-0/+4
|\ \ \ \ \ \
| * | | | | | Shaders: Added decodings for the LDG and STG instructions.Subv2018-08-191-0/+4
| |/ / / / /
* | | | | | Merge pull request #1108 from Subv/front_facingbunnei2018-08-192-0/+7
|\ \ \ \ \ \
| * | | | | | Shaders: Implemented the gl_FrontFacing input attribute (attr 63).Subv2018-08-192-0/+7
| |/ / / / /
* / / / / / Shader: Implemented the predicate and mode arguments of LOP.Subv2018-08-182-11/+39
|/ / / / /
* | | | | Added predcondition GreaterThanWithNanDavid Marcec2018-08-182-5/+8
* | | | | Merge pull request #1096 from bunnei/supported-blitsbunnei2018-08-181-2/+0
|\ \ \ \ \
| * | | | | gl_rasterizer_cache: Remove asserts for supported blits.bunnei2018-08-171-2/+0
* | | | | | Merge pull request #1097 from bunnei/gl-criticalbunnei2018-08-171-1/+1
|\ \ \ \ \ \
| * | | | | | renderer_opengl: Treat OpenGL errors as critical.bunnei2018-08-171-1/+1
| |/ / / / /
* | | | | | Implement SetIdleTimeDetectionExtension & GetIdleTimeDetectionExtension (#1059)greggameplayer2018-08-172-2/+22
* | | | | | Merge pull request #1090 from lioncash/ctor-assignbunnei2018-08-171-0/+6
|\ \ \ \ \ \
| * | | | | | core: Delete System copy/move constructors and assignment operatorsLioncash2018-08-161-0/+6