summaryrefslogtreecommitdiffstats
path: root/src (follow)
Commit message (Expand)AuthorAgeFilesLines
* qt: Add 'Install to NAND' option to menuZach Hilman2018-08-125-1/+99
* game_list: Modify game list to scan installed titlesZach Hilman2018-08-121-0/+45
* file_sys: Add RegisteredCacheZach Hilman2018-08-122-0/+543
* file_sys: Add support for parsing NCA metadata (CNMT)Zach Hilman2018-08-123-0/+238
* card_image: Add accessor for all NCAs in XCIZach Hilman2018-08-122-0/+5
* vfs_real: Add CreateFullPath to CreateFileZach Hilman2018-08-121-3/+6
* filesystem: Add Open and Register functions for BISFactoryZach Hilman2018-08-122-4/+23
* bis_factory: Add partial implementation of BISFactoryZach Hilman2018-08-122-0/+54
* loader: Join 0* files in directory if filename is 00Zach Hilman2018-08-121-1/+33
* loader: Recognize filename '00' as NCAZach Hilman2018-08-121-0/+2
* vfs: Add ConcatenatedVfsFileZach Hilman2018-08-122-0/+134
* crypto: Remove hex utilities from key_managerZach Hilman2018-08-122-36/+2
* file_util: Add getter for NAND registration directoryZach Hilman2018-08-122-0/+8
* common: Move hex string processing to separate fileZach Hilman2018-08-123-0/+64
* Merge pull request #1022 from bunnei/fix-splatbunnei2018-08-122-2/+103
|\
| * friend: Stub DeclareCloseOnlinePlaySession.bunnei2018-08-121-1/+10
| * friend: Fix CreateFriendService to return an IFriendService interface.bunnei2018-08-121-2/+86
| * server_session: Provide more useful information and don't crash on bad IPC request.bunnei2018-08-121-0/+8
* | Merge pull request #1020 from lioncash/namespacebunnei2018-08-1214-22/+44
|\ \
| * | core: Namespace EmuWindowLioncash2018-08-1214-22/+44
| |/
* | Merge pull request #1021 from lioncash/warnbunnei2018-08-121-1/+1
|\ \
| * | gl_rasterizer: Silence implicit truncation warning in SetupShaders()Lioncash2018-08-121-1/+1
| |/
* | Merge pull request #1024 from Subv/blend_glbunnei2018-08-122-0/+40
|\ \
| * | GPU/Maxwell3D: Implemented an alternative set of blend factors.Subv2018-08-122-0/+40
| |/
* | Merge pull request #1023 from Subv/invalid_attribsbunnei2018-08-122-1/+11
|\ \
| * | RasterizerGL: Ignore invalid/unset vertex attributes.Subv2018-08-122-1/+11
| |/
* / Implement R8_UINT RenderTargetFormat & PixelFormat (#1014)greggameplayer2018-08-124-55/+74
|/
* Merge pull request #1010 from bunnei/unk-vert-attrib-shaderbunnei2018-08-122-10/+11
|\
| * gl_shader_decompiler: Improve handling of unknown input/output attributes.bunnei2018-08-122-10/+11
* | Merge pull request #1009 from bunnei/rg8-rgba8-snormbunnei2018-08-124-64/+93
|\ \
| * | gl_rasterizer: Implement render target format RG8_SNORM.bunnei2018-08-124-8/+18
| * | gl_rasterizer: Implement render target format RGBA8_SNORM.bunnei2018-08-124-64/+83
| |/
* | Merge pull request #970 from DarkLordZach/loader-errorsbunnei2018-08-1217-179/+248
|\ \
| * | game_list: Reorder error checksZach Hilman2018-08-101-2/+1
| * | loader: Add more descriptive errorsZach Hilman2018-08-1017-179/+249
* | | Merge pull request #1018 from Subv/ssy_syncbunnei2018-08-122-8/+38
|\ \ \ | |_|/ |/| |
| * | GPU/Shader: Don't predicate instructions that don't have a predicate field (SSY).Subv2018-08-112-2/+13
| * | GPU/Shaders: Implemented SSY and SYNC as a way to modify control flow during shader execution.Subv2018-08-111-6/+25
* | | Merge pull request #1016 from lioncash/videobunnei2018-08-118-35/+44
|\ \ \
| * | | video_core; Get rid of global g_toggle_framelimit_enabled variableLioncash2018-08-118-30/+44
| * | | renderer_base: Remove unused kFramebuffer enumerationLioncash2018-08-111-3/+0
| * | | video_core: Remove unused Renderer enumerationLioncash2018-08-111-2/+0
* | | | Merge pull request #1003 from lioncash/varbunnei2018-08-112-4/+2
|\ \ \ \
| * | | | video_core: Use variable template variants of type_traits interfaces where applicableLioncash2018-08-102-4/+2
* | | | | Implement R16S & R16UI & R16I RenderTargetFormats & PixelFormats and more (R16_UNORM needed by Fate Extella) (#848)greggameplayer2018-08-114-19/+92
| |_|/ / |/| | |
* | | | qt/game_list: Resolve truncation warning within GameListItemPath's constructorLioncash2018-08-111-4/+4
* | | | gt/game_list: Use std::array in GameListItemPath's data() functionLioncash2018-08-111-7/+8
* | | | qt/game_list: Remove redundant base class constructor from initializer listLioncash2018-08-111-3/+1
| |/ / |/| |
* | | maxwell_to_gl: Implement VertexAttribute::Size::Size_8_8.bunnei2018-08-101-0/+1
* | | maxwell_to_gl: Implement VertexAttribute::Size::Size_32_32_32.bunnei2018-08-101-0/+2
* | | Merge pull request #1004 from lioncash/unusedbunnei2018-08-103-8/+6
|\ \ \
| * | | gl_rasterizer_cache: Remove unused viewport parameter of GetFramebufferSurfaces()Lioncash2018-08-103-8/+6
| |/ /
* | | Merge pull request #1008 from yuzu-emu/revert-697-disable-depth-cullbunnei2018-08-101-3/+1
|\ \ \
| * | | Revert "gl_state: Temporarily disable culling and depth test."bunnei2018-08-101-3/+1
| | |/ | |/|
* / | textures: Refactor out for Texture/Depth FormatFromPixelFormat.bunnei2018-08-105-181/+31
|/ /
* | Merge pull request #995 from bunnei/gl-buff-boundsbunnei2018-08-101-10/+12
|\ \ | |/ |/|
| * gl_rasterizer_cache: Add bounds checking for gl_buffer copies.bunnei2018-08-101-10/+12
* | Merge pull request #997 from lioncash/const-funcbunnei2018-08-104-4/+4
|\ \
| * | buffer_queue: Make reference parameter of SetPreallocatedBuffer constLioncash2018-08-092-2/+2
| * | hle_ipc: Make WriteToOutgoingCommandBuffer()'s reference parameter constLioncash2018-08-092-2/+2
* | | Merge pull request #989 from lioncash/logbunnei2018-08-102-0/+16
|\ \ \
| * | | common/logging: Add missing service log categoriesLioncash2018-08-082-0/+16
* | | | Merge pull request #990 from lioncash/entrybunnei2018-08-102-9/+12
|\ \ \ \
| * | | | fsp_srv: Use std::string_view's copy() function instead of strncpy()Lioncash2018-08-092-8/+10
| * | | | fsp_srv: Emplace entries first when building index instead of emplacing lastLioncash2018-08-091-2/+3
| |/ / /
* | | | Merge pull request #1001 from lioncash/reservebunnei2018-08-101-0/+2
|\ \ \ \
| * | | | gl_shader_decompiler: Reserve element memory beforehand in BuildRegisterList()Lioncash2018-08-091-0/+2
* | | | | Merge pull request #897 from DarkLordZach/vfs-accuracy-2bunnei2018-08-1021-129/+602
|\ \ \ \ \ | |_|_|_|/ |/| | | |
| * | | | vfs: Fix documentationZach Hilman2018-08-092-2/+4
| * | | | vfs: Fix typo in VfsFilesystem docsZach Hilman2018-08-092-4/+5
| * | | | file_util: Use enum instead of bool for specifing path behaviorZach Hilman2018-08-094-24/+37
| * | | | loader: Remove unused IdentifyFile overloadZach Hilman2018-08-092-12/+0
| * | | | vfs: Use RealVfsFilesystem for fs-operations in RealVfsDirectoryZach Hilman2018-08-091-2/+10
| * | | | file_sys: Add missing include in savedata_factoryZach Hilman2018-08-091-0/+1
| * | | | core: Port core to VfsFilesystem for file accessZach Hilman2018-08-0912-22/+52
| * | | | vfs: Add unreachable assert to file permissions converterZach Hilman2018-08-091-1/+3
| * | | | vfs: Add RealVfsFilesystem implementationZach Hilman2018-08-092-81/+290
| * | | | file_util: Add platform-specific slash option to SanitizePathZach Hilman2018-08-092-5/+16
| * | | | vfs: Add VfsFilesystem interface and default implementationZach Hilman2018-08-092-3/+211
| * | | | filesystem: Remove unnecessary if conditionsZach Hilman2018-08-091-1/+1
* | | | | Merge pull request #991 from bunnei/ignore-macbunnei2018-08-101-4/+9
|\ \ \ \ \
| * | | | | maxwell_3d: Ignore macros that have not been uploaded yet.bunnei2018-08-091-4/+9
| | |_|_|/ | |/| | |
* | | | | Implement SNORM for BC5/DXN2 (#998)Khangaroo2018-08-102-38/+55
* | | | | gl_rasterizer_cache: Avoid iterator invalidation issues within InvalidateRegion()Lioncash2018-08-091-2/+4
| |_|/ / |/| | |
* | | | Merge pull request #992 from bunnei/declr-predbunnei2018-08-091-4/+5
|\ \ \ \
| * | | | gl_shader_decompiler: Declare predicates on use.bunnei2018-08-091-4/+5
| |/ / /
* | | | Merge pull request #994 from lioncash/constbunnei2018-08-091-7/+9
|\ \ \ \
| * | | | gl_rasterizer_cache: Invert conditional in LoadGLBuffer()Lioncash2018-08-091-5/+5
| * | | | gl_rasterizer_cache: Use std::vector::assign in LoadGLBuffer() for the non-tiled caseLioncash2018-08-091-4/+6
| * | | | gl_rasterizer_cache: Make pointer const in LoadGLBuffer()Lioncash2018-08-091-1/+1
| |/ / /
* | | | Merge pull request #993 from bunnei/smo-vtx-ptsbunnei2018-08-091-0/+3
|\ \ \ \
| * | | | maxwell_to_gl: Implement VertexAttribute::Size::Size_16_16_16_16.bunnei2018-08-091-0/+1
| * | | | maxwell_to_gl: Implement PrimitiveTopology::Points.bunnei2018-08-091-0/+2
| |/ / /
* | | | Merge pull request #984 from bunnei/rt-nonebunnei2018-08-091-0/+5
|\ \ \ \
| * | | | gl_rasterizer: Do not render when no render target is configured.bunnei2018-08-091-0/+5
* | | | | Implement BC5/DXN2 (#996)Khangaroo2018-08-093-33/+45
* | | | | Merge pull request #988 from lioncash/colorbunnei2018-08-091-19/+31
|\ \ \ \ \
| * | | | | common/color: Remove unnecessary const qualifiers on return typesLioncash2018-08-081-7/+7
| * | | | | common/color: Get rid of undefined behaviorLioncash2018-08-081-12/+24
| | |_|_|/ | |/| | |
* | | | | Merge pull request #977 from bunnei/bgr565bunnei2018-08-092-0/+4
|\ \ \ \ \
| * | | | | gl_rasterizer_cached: Implement RenderTargetFormat::B5G6R5_UNORM.bunnei2018-08-082-0/+4
* | | | | | Merge pull request #987 from lioncash/vecbunnei2018-08-091-3/+3
|\ \ \ \ \ \ | |_|_|_|/ / |/| | | | |
| * | | | | vector_math: Use variable template version of is_signed in Vec classesLioncash2018-08-081-3/+3
| | |/ / / | |/| | |
* | | | | Merge pull request #982 from bunnei/stub-unk-63bunnei2018-08-092-0/+9
|\ \ \ \ \
| * | | | | gl_shader_decompiler: Stub input attribute Unknown_63.bunnei2018-08-082-0/+9
| | |/ / / | |/| | |
* | | | | Merge pull request #986 from mailwl/acc-loadimagebunnei2018-08-091-1/+22
|\ \ \ \ \ | |_|_|_|/ |/| | | |
| * | | | Service/Account: stub LoadImage functionmailwl2018-08-081-1/+22
* | | | | Merge pull request #976 from bunnei/shader-immbunnei2018-08-092-11/+6
|\ \ \ \ \
| * | | | | gl_shader_decompiler: Let OpenGL interpret floats.bunnei2018-08-082-11/+6
| | |/ / / | |/| | |
* | | | | Merge pull request #981 from bunnei/cbuf-corruptbunnei2018-08-094-3/+12
|\ \ \ \ \
| * | | | | maxwell_3d: Use correct const buffer size and check bounds.bunnei2018-08-084-3/+12
| |/ / / /
* | | | | Merge pull request #978 from bunnei/fixioctlbunnei2018-08-091-1/+1
|\ \ \ \ \ | |_|_|_|/ |/| | | |
| * | | | nvhost_gpu: Don't over copy IoctlSubmitGpfifo.bunnei2018-08-081-1/+1
| |/ / /
* | | | Merge pull request #985 from bunnei/rt-r11g11b10bunnei2018-08-091-0/+1
|\ \ \ \
| * | | | gpu: Add R11G11B10_FLOAT to RenderTargetBytesPerPixel.bunnei2018-08-081-0/+1
| |/ / /
* | | | Merge pull request #979 from bunnei/vtx88bunnei2018-08-091-0/+1
|\ \ \ \
| * | | | maxwell_to_gl: Implement VertexAttribute::Size::Size_8_8.bunnei2018-08-081-0/+1
| |/ / /
* | | | Merge pull request #975 from bunnei/am-stubbunnei2018-08-082-1/+9
|\ \ \ \
| * | | | am: Stub SetScreenShotImageOrientation.bunnei2018-08-082-1/+9
| |/ / /
* | | | Merge pull request #980 from bunnei/fix-logsbunnei2018-08-082-2/+2
|\ \ \ \ | |_|_|/ |/| | |
| * | | renderer_opengl: Use trace log in a few places.bunnei2018-08-082-2/+2
| |/ /
* | | Merge pull request #966 from lioncash/modernizebunnei2018-08-085-11/+11
|\ \ \
| * | | common: Convert type traits templates over to variable template versions where applicableLioncash2018-08-085-11/+11
| |/ /
* | | Merge pull request #850 from DarkLordZach/icon-metabunnei2018-08-0823-21/+484
|\ \ \
| * | | configure_gamelist: Use explicit QVariant constructorZach Hilman2018-08-071-2/+4
| * | | loader: Add icon and title support to XCIZach Hilman2018-08-077-5/+46
| * | | Use const where applicableZach Hilman2018-08-074-7/+7
| * | | Avoid parsing RomFS to directory in NCAZach Hilman2018-08-0718-19/+439
* | | | Merge pull request #968 from lioncash/vecbunnei2018-08-081-180/+182
|\ \ \ \
| * | | | vector_math: Remove unimplemented function prototypesLioncash2018-08-081-23/+0
| * | | | vector_math: Make functions constexpr where applicableLioncash2018-08-081-154/+179
| * | | | vector_math: Convert typedefs to type aliasesLioncash2018-08-081-3/+3
| | |/ / | |/| |
* | | | Merge pull request #958 from lioncash/nv-globalbunnei2018-08-085-11/+22
|\ \ \ \ | |_|_|/ |/| | |
| * | | nvdrv: Get rid of global std::weak_ptrLioncash2018-08-085-11/+22
| |/ /
* | | Merge pull request #972 from lioncash/catchbunnei2018-08-084-4/+4
|\ \ \
| * | | externals: Update catch to 2.3.0Lioncash2018-08-084-4/+4
| |/ /
* | | Merge pull request #965 from lioncash/unused-filesbunnei2018-08-083-126/+0
|\ \ \
| * | | hle: Remove unused romfs.cpp/.hLioncash2018-08-083-126/+0
| |/ /
* | | Merge pull request #974 from lioncash/accbunnei2018-08-082-2/+2
|\ \ \
| * | | acc: Add missing function table entries for GetUserCountLioncash2018-08-082-2/+2
* | | | hid: fix IsSixAxisSensorAtRest() responsemailwl2018-08-081-1/+1
|/ / /
* | | acc: Stub GetUserCount. (#973)bunnei2018-08-083-1/+9
* | | Merge pull request #967 from lioncash/signbunnei2018-08-081-4/+8
|\ \ \ | |/ / |/| |
| * | file_util: Avoid sign-conversions in WriteArray() and ReadArray()Lioncash2018-08-071-4/+8
* | | Merge pull request #964 from Hexagon12/lower-logsbunnei2018-08-081-4/+4
|\ \ \
| * | | Lowered down the logging for methodsHexagon122018-08-071-4/+4
* | | | Fixed the sRGB pixel format (#963)Hexagon122018-08-081-1/+2
* | | | Merge pull request #920 from DarkLordZach/titlekeybunnei2018-08-072-7/+39
|\ \ \ \
| * | | | content_archive: Add support for titlekey cryptographyZach Hilman2018-08-042-7/+39
* | | | | Merge pull request #957 from lioncash/eventbunnei2018-08-071-1/+1
|\ \ \ \ \
| * | | | | nvflinger: Correct typo in name of composition eventLioncash2018-08-071-1/+1
| | |_|_|/ | |/| | |
* | | | | Merge pull request #954 from lioncash/hidbunnei2018-08-071-0/+1
|\ \ \ \ \
| * | | | | services/hid: Add ActivateNpadWithRevision() to the hid function info arrayLioncash2018-08-071-0/+1
| |/ / / /
* | | | | Merge pull request #960 from lioncash/apmbunnei2018-08-073-0/+34
|\ \ \ \ \
| * | | | | service/apm: Add the apm:sys serviceLioncash2018-08-073-0/+34
| |/ / / /
* | | | | Merge pull request #950 from lioncash/hotkeybunnei2018-08-078-119/+159
|\ \ \ \ \
| * | | | | qt/hotkey: Get rid of global hotkey map instanceLioncash2018-08-078-119/+159
| |/ / / /
* | | | | Merge pull request #955 from lioncash/viewbunnei2018-08-072-3/+10
|\ \ \ \ \
| * | | | | nvflinger: Get rid of indirect inclusionsLioncash2018-08-072-1/+7
| * | | | | nvflinger: Use std::string_view in OpenDisplay()Lioncash2018-08-072-2/+3
| |/ / / /
* | | | | Merge pull request #953 from lioncash/timebunnei2018-08-071-2/+2
|\ \ \ \ \
| * | | | | service/time: Amend command IDs of ToPosixTime() and ToPosixTimeWithMyRule()Lioncash2018-08-071-2/+2
| |/ / / /
* | | | | Merge pull request #959 from KAMiKAZOW/cubeb-compilationbunnei2018-08-071-2/+2
|\ \ \ \ \
| * | | | | Make building cubeb optionalKAMiKAZOW2018-08-071-2/+2
| |/ / / /
* | | | | Merge pull request #956 from lioncash/nvbunnei2018-08-0713-16/+18
|\ \ \ \ \ | |_|_|_|/ |/| | | |
| * | | | nvdrv: Make Ioctl()'s definition match its prototypeLioncash2018-08-071-1/+1
| * | | | nvdrv: Get rid of indirect inclusionsLioncash2018-08-0712-15/+17
| |/ / /
* | | | Merge pull request #952 from lioncash/usbbunnei2018-08-076-0/+259
|\ \ \ \
| * | | | service: Add usb servicesLioncash2018-08-076-0/+259
| |/ / /
* | | | Merge pull request #949 from lioncash/privbunnei2018-08-073-7/+21
|\ \ \ \
| * | | | client_port: Make all data members privateLioncash2018-08-073-7/+21
| |/ / /
* / / / loader: Fix scope error in DeconstructedRomDirectoryZach Hilman2018-08-071-1/+1
|/ / /
* | | Merge pull request #931 from DarkLordZach/nca-as-drdbunnei2018-08-074-37/+24
|\ \ \
| * | | loader: Make AppLoader_NCA rely on directory loading codeZach Hilman2018-08-064-37/+24
* | | | Merge pull request #947 from lioncash/encodingbunnei2018-08-071-13/+17
|\ \ \ \
| * | | | game_list: Remove unnecessary conversion to std::string in ValidateEntry()Lioncash2018-08-061-8/+10
| * | | | game_list: Use QString::fromStdString() where applicable instead of c_str()Lioncash2018-08-061-5/+7
* | | | | GDBStub works with both Unicorn and Dynarmic now (#941)Hedges2018-08-075-9/+26
* | | | | Merge pull request #943 from lioncash/declbunnei2018-08-071-7/+7
|\ \ \ \ \
| * | | | | game_list: Join declarations and assignments in onTextChanged()Lioncash2018-08-061-7/+7
| |/ / / /
* | | | | Merge pull request #946 from lioncash/compressbunnei2018-08-071-10/+8
|\ \ \ \ \
| * | | | | qt/main: Avoid sign conversions in UpdateRecentFiles()Lioncash2018-08-061-4/+6
| * | | | | qt/main: Collapse if statement in UpdateRecentFiles()Lioncash2018-08-061-6/+2
| |/ / / /
* | | | | Merge pull request #944 from lioncash/menubunnei2018-08-071-2/+8
|\ \ \ \ \
| * | | | | qt: Don't show error dialog when canceling the Load Folder dialogLioncash2018-08-061-2/+8
| |/ / / /
* | | | | Merge pull request #942 from lioncash/defaultbunnei2018-08-0714-24/+26
|\ \ \ \ \
| * | | | | qt/game_list_p: Remove redundant base class constructor invocationsLioncash2018-08-061-1/+2
| * | | | | qt: Add missing override specifiers where applicableLioncash2018-08-065-7/+9
| * | | | | qt: Default destructors where applicableLioncash2018-08-069-16/+15
| |/ / / /
* | | | | Merge pull request #940 from lioncash/privatebunnei2018-08-072-5/+9
|\ \ \ \ \
| * | | | | kernel/event: Make data members privateLioncash2018-08-062-5/+9
| |/ / / /
* | | | | Merge pull request #936 from bunnei/avoid-copiesbunnei2018-08-073-6/+21
|\ \ \ \ \
| * | | | | maxwell_3d: Remove outdated assert.bunnei2018-08-061-2/+0
| * | | | | gl_rasterizer_cache: Avoid superfluous surface copies.bunnei2018-08-062-4/+21
* | | | | | Merge pull request #934 from lioncash/chronobunnei2018-08-074-16/+16
|\ \ \ \ \ \
| * | | | | | perf_stats: Correct literal used for MAX_LAG_TIME_USLioncash2018-08-061-2/+2
| * | | | | | core_timing: Make GetGlobalTimeUs() return std::chrono::microsecondsLioncash2018-08-064-14/+14
| | |_|/ / / | |/| | | |
* | | | | | qt/main: Better file-existence checking within OnMenuRecentFile() and UpdateUITheme()Lioncash2018-08-061-8/+6
| |_|/ / / |/| | | |
* | | | | Merge pull request #933 from lioncash/memorybunnei2018-08-061-12/+11
|\ \ \ \ \
| * | | | | memory: Make prototype parameter names match their definitionsLioncash2018-08-061-5/+5
| * | | | | memory: Correct prototype of ZeroBlockLioncash2018-08-061-1/+1
| * | | | | memory: Remove unnecessary const qualifiers in prototypesLioncash2018-08-061-9/+8
| |/ / / /
* | / / / Service/Audio: audout_a.cpp: remove pragma oncemailwl2018-08-061-2/+0
| |/ / / |/| | |
* | | | Merge pull request #932 from lioncash/funcbunnei2018-08-062-9/+9
|\ \ \ \
| * | | | core_timing: Convert typedef into a type aliasLioncash2018-08-061-4/+4
| * | | | core_timing: Use transparent functors where applicableLioncash2018-08-061-5/+5
| |/ / /
* | | | Merge pull request #929 from lioncash/addrbunnei2018-08-062-83/+89
|\ \ \ \
| * | | | gdbstub: Use type alias for breakpoint mapsLioncash2018-08-051-37/+42
| * | | | gdbstub: Move all file-static variables into the GDBStub namespaceLioncash2018-08-051-35/+36
| * | | | gdbstub: Replace PAddr alias with VAddrLioncash2018-08-052-14/+14
* | | | | Merge pull request #930 from lioncash/threadbunnei2018-08-061-15/+15
|\ \ \ \ \
| * | | | | address_arbiter: Return by value from GetThreadsWaitingOnAddress()Lioncash2018-08-051-15/+15
| |/ / / /
* | | | | Merge pull request #925 from bunnei/audrenbunnei2018-08-0619-294/+652
|\ \ \ \ \ | |_|/ / / |/| | | |
| * | | | audio_core: Implement audren_u audio playback.bunnei2018-08-055-218/+451
| * | | | audio_core: Use s16 where possible for audio samples.bunnei2018-08-059-36/+27
| * | | | audio_core: Port codec code from Citra for ADPCM decoding.bunnei2018-08-055-11/+126
| * | | | cubeb_sink: Support variable sample_rate and num_channels.bunnei2018-08-041-15/+25
| * | | | audio_core: Sinks need unique names as well.bunnei2018-08-045-9/+14
| * | | | audio_core: Streams need unique names for CoreTiming.bunnei2018-08-045-10/+14
| | |/ / | |/| |
* | | | Merge pull request #927 from bunnei/fix-texsbunnei2018-08-051-2/+5
|\ \ \ \
| * | | | gl_shader_decompiler: Fix TEXS mask and dest.bunnei2018-08-051-2/+5
| | |/ / | |/| |
* | | | Merge pull request #912 from lioncash/global-varbunnei2018-08-0519-80/+110
|\ \ \ \ | |/ / / |/| | |
| * | | renderer_base: Make Rasterizer() return the rasterizer by referenceLioncash2018-08-045-11/+15
| * | | video_core: Eliminate the g_renderer global variableLioncash2018-08-0419-74/+100
* | | | Merge pull request #926 from ogniK5377/vertex-attrib-formatbunnei2018-08-051-2/+8
|\ \ \ \
| * | | | added braces for conditionsDavid Marcec2018-08-051-2/+3
| * | | | fix the attrib format for intsDavid Marcec2018-08-051-2/+7
| | |/ / | |/| |
* | | | Merge pull request #924 from lioncash/arpbunnei2018-08-056-0/+97
|\ \ \ \
| * | | | service: Add arp servicesLioncash2018-08-056-0/+97
| |/ / /
* | | | Merge pull request #921 from lioncash/viewbunnei2018-08-055-35/+35
|\ \ \ \
| * | | | aes_util: Add static assertion to Transcode() and XTSTranscode() to ensure well-defined behaviorLioncash2018-08-041-0/+4
| * | | | aes_util: Make CalculateNintendoTweak() an internally linked functionLioncash2018-08-042-12/+10
| * | | | aes_util: Make Transcode() a const member functionLioncash2018-08-042-8/+9
| * | | | core/crypto: Remove unnecessary includesLioncash2018-08-044-5/+5
| * | | | key_manager: Use regular std::string instead of std::string_viewLioncash2018-08-042-10/+7
| |/ / /
* / / / service: Remove redundant #pragma once directivesLioncash2018-08-045-10/+0
|/ / /
* | | Merge pull request #849 from DarkLordZach/xcibunnei2018-08-0436-78/+1395
|\ \ \
| * | | Add missing parameter to files.push_back()Zach Hilman2018-08-011-5/+5
| * | | Fix merge conflicts with opus and update docsZach Hilman2018-08-014-6/+8
| * | | Use more descriptive error codes and messagesZach Hilman2018-08-019-34/+101
| * | | Use static const instead of const staticZach Hilman2018-08-011-2/+2
| * | | Use ErrorEncrypted where applicable and fix no keys crashZach Hilman2018-08-014-17/+37
| * | | Add missing includes and use const where applicableZach Hilman2018-08-0111-24/+40
| * | | Allow key loading from %YUZU_DIR%/keys in addition to ~/.switchZach Hilman2018-08-015-7/+23
| * | | Use SHGetKnownFolderPath instead of SHGetFolderPathAZach Hilman2018-08-011-3/+4
| * | | Make XCI comply to review and style guidelinesZach Hilman2018-08-0116-482/+223
| * | | Extract mbedtls to cpp fileZach Hilman2018-08-015-87/+127
| * | | Add missing string.h includeZach Hilman2018-08-011-0/+1
| * | | Update mbedtls and fix compile errorZach Hilman2018-08-011-0/+1
| * | | Remove files that are not usedZach Hilman2018-08-0133-43/+1455
* | | | Merge pull request #919 from lioncash/signbunnei2018-08-041-8/+9
|\ \ \ \ | |_|/ / |/| | |
| * | | gl_shader_manager: Invert conditional in SetShaderUniformBlockBinding()Lioncash2018-08-041-7/+9
| * | | gl_shader_manager: Amend sign differences in an assertion comparison in SetShaderUniformBlockBinding()Lioncash2018-08-041-3/+2
* | | | Merge pull request #911 from lioncash/prototypebunnei2018-08-041-3/+0
|\ \ \ \
| * | | | video_core: Remove unimplemented Start() function prototypeLioncash2018-08-031-3/+0
* | | | | Merge pull request #913 from lioncash/unused-funcbunnei2018-08-041-16/+0
|\ \ \ \ \
| * | | | | memory: Remove unused GetSpecialHandlers() functionLioncash2018-08-031-16/+0
| | |/ / / | |/| | |
* | | | | Merge pull request #914 from lioncash/codesetbunnei2018-08-045-20/+41
|\ \ \ \ \
| * | | | | kernel/process: Use std::array where applicableLioncash2018-08-031-1/+2
| * | | | | kernel/process: Use accessors instead of class members for referencing segment arrayLioncash2018-08-035-20/+40
| |/ / / /
* | | | | Merge pull request #917 from lioncash/crashbunnei2018-08-043-13/+38
|\ \ \ \ \
| * | | | | kernel/thread: Fix potential crashes introduced in 26de4bb521b1ace7af76eff4f6956cb23ac0d58cLioncash2018-08-043-13/+38
| |/ / / /
* | | | | Merge pull request #910 from lioncash/unusedbunnei2018-08-031-2/+0
|\ \ \ \ \ | |/ / / / |/| | | |
| * | | | gl_shader_decompiler: Remove unused variable in GenerateDeclarations()Lioncash2018-08-031-2/+0
| |/ / /
* | | | Merge pull request #908 from lioncash/memorybunnei2018-08-0316-559/+29
|\ \ \ \
| * | | | core/memory: Get rid of 3DS leftoversLioncash2018-08-0316-559/+29
* | | | | gl_shader_manager: Make ProgramManager's GetCurrentProgramStage() a const member functionLioncash2018-08-031-1/+1
| |/ / / |/| | |
* | | | Added ability to change username & language code in the settings ui. Added IProfile::Get and SET::GetLanguageCode for libnx tests (#851)David2018-08-039-8/+95
* | | | Merge pull request #895 from lioncash/sinkbunnei2018-08-031-5/+8
|\ \ \ \
| * | | | sink_details: Deduplicate long std::function repetitionLioncash2018-08-021-4/+6
| * | | | sink_details: std::move std::function instancesLioncash2018-08-021-1/+2
* | | | | Merge pull request #898 from lioncash/migbunnei2018-08-036-0/+55
|\ \ \ \ \
| * | | | | service: Add migration servicesLioncash2018-08-026-0/+55
* | | | | | Merge pull request #900 from lioncash/initbunnei2018-08-031-5/+5
|\ \ \ \ \ \ | |_|_|/ / / |/| | | | |
| * | | | | math_util: Always initialize members of RectangleLioncash2018-08-021-5/+5
| |/ / / /
* | | | | Merge pull request #892 from lioncash/globalbunnei2018-08-0313-64/+54
|\ \ \ \ \
| * | | | | video_core: Make global EmuWindow instance part of the base renderer classLioncash2018-08-0213-64/+54
* | | | | | Merge pull request #894 from lioncash/objectbunnei2018-08-0344-156/+186
|\ \ \ \ \ \
| * | | | | | kernel: Move object class to its own source filesLioncash2018-08-0244-156/+186
| | |_|/ / / | |/| | | |
* | | | | | Merge pull request #904 from lioncash/staticbunnei2018-08-031-8/+6
|\ \ \ \ \ \
| * | | | | | kernel/thread: Make GetFreeThreadLocalSlot()'s loop indices size_tLioncash2018-08-021-8/+5
| * | | | | | kernel/thread: Make GetFreeThreadLocalSlot() reference parameter a const referenceLioncash2018-08-021-1/+2
| * | | | | | kernel/thread: Make GetFreeThreadLocalSlot() internally linkedLioncash2018-08-021-1/+1
| | |_|/ / / | |/| | | |
* | | | | | Merge pull request #906 from lioncash/overridebunnei2018-08-033-19/+8
|\ \ \ \ \ \
| * | | | | | input_common: Use std::move where applicableLioncash2018-08-032-5/+6
| * | | | | | input_common: Add missing override specifiersLioncash2018-08-033-14/+2
| |/ / / / /
* | | | | | Merge pull request #907 from lioncash/slotbunnei2018-08-037-46/+49
|\ \ \ \ \ \
| * | | | | | yuzu: Use Qt 5 signal/slots where applicableLioncash2018-08-037-46/+49
| |/ / / / /
* | | | | | Merge pull request #905 from lioncash/vmabunnei2018-08-033-23/+23
|\ \ \ \ \ \
| * | | | | | kernel/vm_manager: Convert loop into std::any_of()Lioncash2018-08-021-4/+4
| * | | | | | kernel/vm_manager: Use const where applicableLioncash2018-08-023-19/+19
| * | | | | | kernel/vm_manager: Use the VAddr type alias in CarveVMA()Lioncash2018-08-021-2/+2
| |/ / / / /
* | | | | | Merge pull request #903 from lioncash/copybunnei2018-08-031-3/+6
|\ \ \ \ \ \
| * | | | | | vfs_vector: Remove unused variable in FindAndRemoveVectorElement()Lioncash2018-08-021-2/+2
| * | | | | | vfs_vector: Avoid unnecessary copies where applicableLioncash2018-08-021-2/+5
| |/ / / / /
* | | | | | Merge pull request #901 from lioncash/refbunnei2018-08-031-2/+2
|\ \ \ \ \ \
| * | | | | | gl_shader_manager: Take ShaderSetup instances by const reference in UseProgrammableVertexShader() and UseProgrammableFragmentShader()Lioncash2018-08-021-2/+2
| |/ / / / /
* | | | | | Merge pull request #899 from lioncash/unusedbunnei2018-08-027-334/+0
|\ \ \ \ \ \
| * | | | | | hw: Remove unused filesLioncash2018-08-027-334/+0
| |/ / / / /
* | | | | | Merge pull request #902 from lioncash/arraybunnei2018-08-021-2/+3
|\ \ \ \ \ \
| * | | | | | gl_state: Make texture_units a std::arrayLioncash2018-08-021-2/+3
| |/ / / / /
* | | | | | Merge pull request #891 from lioncash/nsbunnei2018-08-021-0/+447
|\ \ \ \ \ \
| * | | | | | service/ns: Add missing ns servicesLioncash2018-08-021-0/+447
| | |_|/ / / | |/| | | |
* | | | | | Implement RGB32F PixelFormat (#886) (used by Go Vacation)greggameplayer2018-08-023-9/+23
* | | | | | Merge pull request #893 from lioncash/pscbunnei2018-08-026-1/+99
|\ \ \ \ \ \ | |_|/ / / / |/| | | | |
| * | | | | logging/log: Remove incorrect description in PCV doc commentLioncash2018-08-021-1/+1
| * | | | | service: Add psc servicesLioncash2018-08-026-0/+98
| | |/ / / | |/| | |
* / | | | audio_out: Use Buffer::Tag alias in GetTagsAndReleaseBuffers()'s prototypeLioncash2018-08-022-2/+2
|/ / / /
* | | | Merge pull request #888 from lioncash/capsbunnei2018-08-026-0/+173
|\ \ \ \
| * | | | service: Add capture servicesLioncash2018-08-016-0/+173
| |/ / /
* | | | Merge pull request #890 from lioncash/loggerbunnei2018-08-021-4/+4
|\ \ \ \
| * | | | lm: Amend name of ILoggerLioncash2018-08-011-4/+4
| |/ / /
* | | | Merge pull request #889 from lioncash/fspbunnei2018-08-026-0/+89
|\ \ \ \
| * | | | service/filesystem: Add fsp:ldr and fsp:pr servicesLioncash2018-08-016-0/+89
| |/ / /
* / / / service: Add bpc and pcv servicesLioncash2018-08-018-0/+183
|/ / /
* | | Implement R32_FLOAT RenderTargetFormatUnknown2018-08-013-0/+5
* | | Merge pull request #882 from lioncash/unusedbunnei2018-08-011-6/+0
|\ \ \ | |/ / |/| |
| * | kernel/thread: Remove unimplemented function prototypeLioncash2018-08-011-6/+0
* | | Merge pull request #871 from bunnei/audio-configbunnei2018-08-0112-21/+330
|\ \ \ | |/ / |/| |
| * | audio_core: Add configuration settings.bunnei2018-08-0112-21/+330
* | | Merge pull request #877 from lioncash/removebunnei2018-08-016-104/+0
|\ \ \
| * | | kernel: Remove unused object_address_table.cpp/.hLioncash2018-07-316-104/+0
* | | | Merge pull request #880 from lioncash/audiobunnei2018-08-0114-2/+289
|\ \ \ \ | |_|/ / |/| | |
| * | | service/audio: Add missing servicesLioncash2018-08-0114-2/+289
* | | | Merge pull request #876 from lioncash/includebunnei2018-08-0123-28/+47
|\ \ \ \
| * | | | kernel: Remove unnecessary includesLioncash2018-07-3123-28/+47
| | |/ / | |/| |
* | | | Merge pull request #879 from lioncash/audiobunnei2018-08-011-1/+1
|\ \ \ \ | |_|/ / |/| | |
| * | | audout_u: Remove std::move in OpenAudioOutImpl()Lioncash2018-07-311-1/+1
* | | | Merge pull request #864 from FearlessTobi/port-3973bunnei2018-07-311-2/+30
|\ \ \ \
| * | | | remove polymorphism issueB3n302018-07-291-2/+30
* | | | | Merge pull request #869 from Subv/ubsanbunnei2018-07-314-8/+23
|\ \ \ \ \
| * | | | | MacroInterpreter: Avoid left shifting negative values.Subv2018-07-312-2/+6
| * | | | | nvhost_gpu: Added checks to ensure we don't read past the end of the entries when handling a GPU command list.Subv2018-07-311-3/+6
| * | | | | nvhost_ctrl_gpu: Only read the input parameters if they are actually there.Subv2018-07-311-3/+11
* | | | | | Merge pull request #875 from lioncash/fgmbunnei2018-07-316-0/+96
|\ \ \ \ \ \
| * | | | | | service: Add fgm servicesLioncash2018-07-316-0/+96
| | |_|_|/ / | |/| | | |
* | | | | | Merge pull request #874 from lioncash/ambunnei2018-07-318-0/+156
|\ \ \ \ \ \ | |_|_|_|/ / |/| | | | |
| * | | | | service/am: Add missing am servicesLioncash2018-07-318-0/+156
| |/ / / /
* | | | | Merge pull request #870 from lioncash/initbunnei2018-07-311-9/+7
|\ \ \ \ \
| * | | | | arm_dynarmic: Make SetTlsAddress() prototype and definition consistentLioncash2018-07-311-1/+1
| * | | | | arm_dynarmic: Remove unnecessary qualifying of ThreadContextLioncash2018-07-311-3/+3
| * | | | | arm_dynarmic: Correct initializer list orderLioncash2018-07-311-5/+3
| |/ / / /
* / / / / service: Add the pcie serviceLioncash2018-07-316-0/+85
|/ / / /
* | | | Merge pull request #855 from bunnei/cubebbunnei2018-07-3117-39/+462
|\ \ \ \
| * | | | audio_core: Implement Sink and SinkStream interfaces with cubeb.bunnei2018-07-318-6/+261
| * | | | audio_core: Add interfaces for Sink and SinkStream.bunnei2018-07-316-0/+163
| * | | | audio_core: Misc. improvements to stream/buffer/audio_out.bunnei2018-07-315-20/+32
| * | | | audio_core: Move to audout_u impl.bunnei2018-07-314-13/+6
* | | | | Port #3758 from Citra (#852): Add missing std::string import in text_formatterTobias2018-07-311-0/+1
|/ / / /
* | | | Implemented various hwopus functions (#853)David2018-07-313-6/+132
* | | | Merge pull request #861 from FearlessTobi/port-3972bunnei2018-07-302-81/+31
|\ \ \ \
| * | | | Port #3972 from Citra: "common/timer: use std::chrono, avoid platform-dependent code"zhupengfei2018-07-292-81/+31
| | |/ / | |/| |
* | | | Merge pull request #862 from FearlessTobi/port-3997bunnei2018-07-301-3/+5
|\ \ \ \
| * | | | common/string_utils: replace boost::transform with std counterpartzhupengfei2018-07-291-3/+5
| |/ / /
* | | | Merge pull request #859 from FearlessTobi/port-3837bunnei2018-07-302-3/+4
|\ \ \ \
| * | | | Port #3837 from Citra: "Add build date in about dialog"fearlessTobi2018-07-292-3/+4
| |/ / /
* | | | Port #3769 from Citra: "Update Dark theme to latest version"Tobias2018-07-301-1/+1
* | | | Merge pull request #858 from lioncash/castbunnei2018-07-301-3/+2
|\ \ \ \
| * | | | partition_filesystem: Remove dynamic_cast in PrintDebugInfo()Lioncash2018-07-291-3/+2
| |/ / /
* | | | Merge pull request #860 from FearlessTobi/port-3911bunnei2018-07-305-6/+3
|\ \ \ \
| * | | | Port #3911 from Citra: "Optimize settings application"fearlessTobi2018-07-295-6/+3
| |/ / /
* | | | Merge pull request #863 from FearlessTobi/port-3913bunnei2018-07-301-1/+0
|\ \ \ \
| * | | | Port #3913 from Citra: "citra_qt: Remove obsolete application attribute"fearlessTobi2018-07-291-1/+0
| |/ / /
* | | | Merge pull request #865 from FearlessTobi/port-3732bunnei2018-07-302-4/+2
|\ \ \ \
| * | | | Port #3732 from Citra: "common: Fix compilation on ARM"Cameron Cawley2018-07-292-4/+2
| |/ / /
* | | | Merge pull request #857 from lioncash/wlanbunnei2018-07-306-1/+194
|\ \ \ \
| * | | | service: Add wlan servicesLioncash2018-07-296-1/+194
| |/ / /
* | | | Merge pull request #856 from lioncash/btmbunnei2018-07-306-0/+142
|\ \ \ \
| * | | | service/btm: Add basic implementation of GetCoreImpl()Lioncash2018-07-291-1/+35
| * | | | service: Add btm servicesLioncash2018-07-296-0/+108
| |/ / /
* / / / Add some HID commands (#843)Hexagon122018-07-301-2/+16
|/ / /
* | | Merge pull request #847 from lioncash/ncmbunnei2018-07-286-0/+80
|\ \ \
| * | | service: Add ncm servicesLioncash2018-07-276-0/+80
* | | | Merge pull request #846 from lioncash/miibunnei2018-07-286-0/+128
|\ \ \ \
| * | | | service: Add mii servicesLioncash2018-07-276-0/+128
| | |_|/ | |/| |
* | | | Merge pull request #842 from bunnei/audio-corebunnei2018-07-2812-94/+459
|\ \ \ \
| * | | | audout: Implement IAudioOut interface with AudioCore.bunnei2018-07-282-93/+114
| * | | | core: Add AudioCore to global state.bunnei2018-07-282-0/+9
| * | | | audio_core: Add initial code for keeping track of audout state.bunnei2018-07-288-1/+336
| | |/ / | |/| |
* / | | RomFS ExtractionZach Hilman2018-07-2812-20/+351
|/ / /
* | | Merge pull request #845 from lioncash/nfcbunnei2018-07-276-0/+243
|\ \ \
| * | | service/nfc: Implement Create[x]Interface functionsLioncash2018-07-271-4/+43
| * | | service: Add nfc servicesLioncash2018-07-276-0/+204
| |/ /
* | | Merge pull request #839 from FearlessTobi/actually-port-3594bunnei2018-07-271-0/+16
|\ \ \
| * | | Port #3594 from CitrafearlessTobi2018-07-261-0/+16
| | |/ | |/|
* | | Merge pull request #844 from lioncash/lblbunnei2018-07-276-0/+111
|\ \ \
| * | | service/lbl: Implement EnableVrMode, DisableVrMode and GetVrModeLioncash2018-07-273-3/+37
| * | | service: Add the lbl serviceLioncash2018-07-274-0/+77
| | |/ | |/|
* | | Merge pull request #841 from lioncash/btdrvbunnei2018-07-274-1/+93
|\ \ \ | |/ / |/| |
| * | service: Add the btdrv serviceLioncash2018-07-274-1/+93
* | | Merge pull request #837 from lioncash/privbunnei2018-07-272-8/+20
|\ \ \
| * | | kernel/timer: Make data members private where applicableLioncash2018-07-262-8/+20
* | | | service/hid: Add the hidbus, hid:dbg, hid:sys, and hid:tmp servicesLioncash2018-07-261-0/+220
* | | | service/hid: Add the xcd:sys serviceLioncash2018-07-264-0/+57
* | | | service/hid: Add irs servicesLioncash2018-07-264-0/+75
| |/ / |/| |
* | | Merge pull request #836 from FearlessTobi/port-3594bunnei2018-07-262-0/+4
|\ \ \
| * | | Port #3665 from CitrafearlessTobi2018-07-262-0/+4
| | |/ | |/|
* | | Merge pull request #835 from FearlessTobi/port-minor-prsbunnei2018-07-261-1/+1
|\ \ \
| * | | Port #3641 from CitrafearlessTobi2018-07-261-1/+1
| |/ /
* | | Merge pull request #834 from lioncash/grcbunnei2018-07-264-0/+50
|\ \ \
| * | | service: Add the grc:c serviceLioncash2018-07-264-0/+50
| | |/ | |/|
* | | Merge pull request #832 from lioncash/nimbunnei2018-07-264-0/+143
|\ \ \
| * | | service: Add the nim servicesLioncash2018-07-264-0/+143
| |/ /
* | | Merge pull request #831 from lioncash/ldnbunnei2018-07-266-0/+164
|\ \ \
| * | | service: Add ldn servicesLioncash2018-07-266-0/+164
| |/ /
* | | Merge pull request #830 from lioncash/socketbunnei2018-07-266-0/+95
|\ \ \
| * | | service/sockets: Add ethc:c and ethc:i servicesLioncash2018-07-264-0/+66
| * | | service/sockets: Add missing bsdcfg socket serviceLioncash2018-07-263-0/+29
| |/ /
* | | Merge pull request #808 from lioncash/mem-dedupbunnei2018-07-261-14/+22
|\ \ \
| * | | video_core/memory_manager: Replace a loop with std::array's fill() function in PageSlot()Lioncash2018-07-241-3/+1
| * | | video_core/memory_manager: Avoid repeated unnecessary page slot lookupsLioncash2018-07-241-11/+21
* | | | GPU: Allow using R16F as a render target format.Subv2018-07-262-1/+4
| |_|/ |/| |
* | | Merge pull request #827 from lioncash/logbunnei2018-07-262-40/+35
|\ \ \
| * | | lm: Move LM's class declaration into the cpp fileLioncash2018-07-262-37/+31
| * | | lm: Amend names of Initialize() in Logger and Initialize() in LMLioncash2018-07-262-7/+7
| * | | lm: Add missing function entry to Logger's function tableLioncash2018-07-261-0/+1
* | | | Merge pull request #825 from greggameplayer/R16_G16bunnei2018-07-264-19/+100
|\ \ \ \ | |_|_|/ |/| | |
| * | | Implement R16_G16Unknown2018-07-264-19/+100
* | | | Merge pull request #828 from lioncash/ldrSebastian Valle2018-07-264-0/+101
|\ \ \ \
| * | | | service: Add ldr servicesLioncash2018-07-264-0/+101
* | | | | Merge pull request #826 from lioncash/erptSebastian Valle2018-07-266-0/+143
|\ \ \ \ \
| * | | | | service: Add eupld servicesLioncash2018-07-264-0/+72
| * | | | | service: Add the erpt servicesLioncash2018-07-264-0/+71
| | |_|/ / | |/| | |
* | | | | Merge pull request #823 from lioncash/nifmSebastian Valle2018-07-269-141/+30
|\ \ \ \ \ | |_|/ / / |/| | | |
| * | | | service/nifm: Deduplicate interface codeLioncash2018-07-259-141/+30
* | | | | Merge pull request #824 from lioncash/nvdrvbunnei2018-07-262-5/+7
|\ \ \ \ \
| * | | | | service/nvdrv: Take std::string in Open() by const referenceLioncash2018-07-252-2/+2
| * | | | | service/nvdrv: Use std::move where applicableLioncash2018-07-251-3/+5
| |/ / / /
* | | | | Merge pull request #822 from lioncash/pmbunnei2018-07-264-0/+90
|\ \ \ \ \ | |_|/ / / |/| | | |
| * | | | service: Add pm servicesLioncash2018-07-254-0/+90
| |/ / /
* | | | Merge pull request #820 from lioncash/esMat M2018-07-264-0/+77
|\ \ \ \
| * | | | service: Add the es serviceLioncash2018-07-254-0/+77
| |/ / /
* | | | Merge pull request #821 from lioncash/waitMat M2018-07-261-0/+4
|\ \ \ \ | |_|/ / |/| | |
| * | | wait_tree: Add missing switch case for WaitTreeThread::GetText()Lioncash2018-07-251-0/+4
| |/ /
* | | Merge pull request #819 from Subv/srgbbunnei2018-07-252-9/+17
|\ \ \ | |/ / |/| |
| * | GPU: Use the right texture format for sRGBA framebuffers.Subv2018-07-252-9/+17
* | | Merge pull request #801 from lioncash/timeMat M2018-07-256-64/+16
|\ \ \
| * | | time: Add the time:a serviceLioncash2018-07-253-10/+11
| * | | time: Simplify interface creationLioncash2018-07-246-64/+15
* | | | Merge pull request #804 from lioncash/logMat M2018-07-251-1/+3
|\ \ \ \
| * | | | svc: Log parameters in SetMemoryAttribute()Lioncash2018-07-241-1/+3
| | |_|/ | |/| |
* | | | Merge pull request #803 from MerryMage/core_timing_utilbunnei2018-07-2512-114/+146
|\ \ \ \
| * | | | core_timing: Split off utility functions into core_timing_utilMerryMage2018-07-2412-105/+137
| * | | | CMakeLists: Sort filenamesMerryMage2018-07-241-9/+9
* | | | | Merge pull request #802 from lioncash/unreachbunnei2018-07-251-0/+3
|\ \ \ \ \
| * | | | | wait_tree: Silence warning about all code paths not returning a valueLioncash2018-07-241-0/+3
| | |_|/ / | |/| | |
* | | | | Merge pull request #800 from lioncash/setbunnei2018-07-253-5/+33
|\ \ \ \ \
| * | | | | set_sys: Implement SetColorSetId()Lioncash2018-07-242-5/+25
| * | | | | ipc_helper: Add helper member function for popping enum values to RequestParserLioncash2018-07-241-0/+8
| |/ / / /
* | | | / GPU: Allow the use of Z24S8 as a texture format.Subv2018-07-251-0/+4
| |_|_|/ |/| | |
* | | | Merge pull request #816 from Subv/z32_s8bunnei2018-07-254-1/+16
|\ \ \ \
| * | | | GPU: Implemented the Z32_S8_X24 depth buffer format.Subv2018-07-254-1/+16
* | | | | Merge pull request #815 from Subv/z32f_texbunnei2018-07-251-0/+4
|\ \ \ \ \
| * | | | | GPU: Allow using Z32 as a texture format.Subv2018-07-251-0/+4
| |/ / / /
* | | | | Merge pull request #814 from Subv/rt_r8bunnei2018-07-252-0/+4
|\ \ \ \ \
| * | | | | GPU: Allow the usage of R8 as a render target format.Subv2018-07-252-0/+4
| |/ / / /
* | | | | Merge pull request #809 from lioncash/rasterizerbunnei2018-07-252-16/+13
|\ \ \ \ \
| * | | | | gl_rasterizer: Replace magic number with GL_INVALID_INDEX in SetupConstBuffers()Lioncash2018-07-241-3/+5
| * | | | | gl_rasterizer: Use std::string_view instead of std::string when checking for extensionsLioncash2018-07-241-1/+3
| * | | | | gl_rasterizer: Use in-class member initializers where applicableLioncash2018-07-242-12/+5
| | |_|_|/ | |/| | |
* | | | | Merge pull request #811 from Subv/code_address_assertbunnei2018-07-251-8/+0
|\ \ \ \ \ | |_|/ / / |/| | | |
| * | | | GPU: Remove the assert that required the CODE_ADDRESS to be 0.Subv2018-07-241-8/+0
| |/ / /
* | | | Merge pull request #806 from lioncash/friendbunnei2018-07-256-48/+15
|\ \ \ \
| * | | | friend: Add friend:m, friend:s, and friend:v servicesLioncash2018-07-241-0/+3
| * | | | friend/interface: Add missing CreateDaemonSuspendSessionService() to the function handler tableLioncash2018-07-241-0/+1
| * | | | friend: Deduplicate interfacesLioncash2018-07-246-48/+11
| |/ / /
* | | | Merge pull request #810 from Subv/r16bunnei2018-07-253-5/+32
|\ \ \ \
| * | | | GPU: Implemented the R16 and R16F texture formats.Subv2018-07-243-5/+32
| |/ / /
* | | | Merge pull request #805 from lioncash/signbunnei2018-07-241-4/+7
|\ \ \ \
| * | | | svc: Resolve sign comparison warnings in WaitSynchronization()Lioncash2018-07-241-4/+7
| |/ / /
* / / / deconstructed_rom_directory: Remove unused FindRomFS() functionLioncash2018-07-241-29/+0
|/ / /
* | | Merge pull request #798 from lioncash/constbunnei2018-07-242-3/+3
|\ \ \
| * | | arm_dynarmic: Make MakeJit() a const member functionLioncash2018-07-242-3/+3
| |/ /
* | | Merge pull request #797 from lioncash/explicitbunnei2018-07-245-5/+5
|\ \ \
| * | | core: Make converting constructors explicit where applicableLioncash2018-07-245-5/+5
| |/ /
* | | Merge pull request #795 from lioncash/declbunnei2018-07-241-3/+0
|\ \ \
| * | | apm/interface: Remove redundant declaration of InstallInterfaces()Lioncash2018-07-241-3/+0
| |/ /
* | | Merge pull request #799 from Subv/tex_r32fbunnei2018-07-243-6/+19
|\ \ \
| * | | GPU: Implement texture format R32F.Subv2018-07-243-6/+19
* | | | Merge pull request #794 from lioncash/refbunnei2018-07-241-1/+1
|\ \ \ \
| * | | | mutex: Pass SharedPtr to GetHighestPriorityMutexWaitingThread() by referenceLioncash2018-07-241-1/+1
* | | | | Merge pull request #796 from bunnei/gl-uintbunnei2018-07-241-0/+3
|\ \ \ \ \
| * | | | | maxwell_to_gl: Implement VertexAttribute::Type::UnsignedInt.bunnei2018-07-241-0/+3
* | | | | | Merge pull request #789 from bunnei/tex-wrap-borderbunnei2018-07-244-11/+13
|\ \ \ \ \ \ | |_|_|_|_|/ |/| | | | |
| * | | | | gl_rasterizer: Implement texture border color.bunnei2018-07-243-11/+11
| * | | | | maxwell_to_gl: Implement Texture::WrapMode::Border.bunnei2018-07-241-0/+2
| | |_|/ / | |/| | |
* | | | | Merge pull request #793 from lioncash/privbunnei2018-07-242-17/+19
|\ \ \ \ \
| * | | | | hle_ipc: Make constructors explicit where applicableLioncash2018-07-242-12/+13
| * | | | | ipc_helpers: Make member variables of ResponseBuilder privateLioncash2018-07-241-5/+6
| | |_|/ / | |/| | |
* | | | | Merge pull request #785 from lioncash/fsbunnei2018-07-241-3/+3
|\ \ \ \ \ | |_|/ / / |/| | | |
| * | | | partition_filesystem: Use std::move where applicableLioncash2018-07-241-3/+3
* | | | | Merge pull request #791 from bunnei/rg32f-rgba32f-bgra8bunnei2018-07-245-12/+70
|\ \ \ \ \ | |_|_|/ / |/| | | |
| * | | | gl_rasterizer_cache: Implement RenderTargetFormat RG32_FLOAT.bunnei2018-07-245-7/+25
| * | | | gl_rasterizer_cache: Implement RenderTargetFormat RGBA32_FLOAT.bunnei2018-07-242-10/+34
| * | | | gl_rasterizer_cache: Implement RenderTargetFormat BGRA8_UNORM.bunnei2018-07-244-8/+22
| * | | | gl_rasterizer_cache: Add missing log statements.bunnei2018-07-241-0/+2
* | | | | Merge pull request #792 from lioncash/retvalbunnei2018-07-241-2/+2
|\ \ \ \ \ | |_|_|_|/ |/| | | |
| * | | | gl_shader_decompiler: Correct return value of WriteTexsInstruction()Lioncash2018-07-241-2/+2
| | |_|/ | |/| |
* | | | Merge pull request #790 from bunnei/shader-print-instrbunnei2018-07-241-1/+2
|\ \ \ \
| * | | | gl_shader_decompiler: Print instruction value in shader comments.bunnei2018-07-241-1/+2
| | |/ / | |/| |
* | | | Merge pull request #788 from bunnei/shader-check-zerobunnei2018-07-241-0/+6
|\ \ \ \
| * | | | gl_shader_decompiler: Check if SetRegister result is ZeroIndex.bunnei2018-07-241-0/+6
| |/ / /
* | / / VFS Regression and Accuracy Fixes (#776)Zach Hilman2018-07-245-37/+75
| |/ / |/| |
* | | Merge pull request #787 from bunnei/tldsbunnei2018-07-241-29/+43
|\ \ \
| * | | gl_shader_decompiler: Implement shader instruction TLDS.bunnei2018-07-241-29/+43
* | | | Merge pull request #786 from lioncash/exclusivebunnei2018-07-243-22/+18
|\ \ \ \
| * | | | exclusive_monitor: Use consistent type alias for u64Lioncash2018-07-243-22/+18
| | |_|/ | |/| |
* | | | Merge pull request #784 from lioncash/loaderbunnei2018-07-241-1/+1
|\ \ \ \
| * | | | loader: Remove unnecessary constructor call in IdentifyFile()Lioncash2018-07-231-1/+1
| |/ / /
* | | | Merge pull request #783 from lioncash/linkerbunnei2018-07-242-7/+4
|\ \ \ \
| * | | | linker: Remove unused parameter from WriteRelocations()Lioncash2018-07-232-7/+4
| |/ / /
* | | | Merge pull request #782 from lioncash/filebunnei2018-07-242-14/+33
|\ \ \ \ | |_|/ / |/| | |
| * | | nro: Replace inclusion with a forward declarationLioncash2018-07-232-1/+8
| * | | nro: Make bracing consistentLioncash2018-07-231-10/+24
| * | | nro: Make constructor explicitLioncash2018-07-231-1/+1
| * | | nro: Remove unused forward declarationLioncash2018-07-231-2/+0
| |/ /
* | | Merge pull request #781 from lioncash/declbunnei2018-07-241-5/+5
|\ \ \
| * | | gl_shader_decompiler: Simplify GetCommonDeclarations()Lioncash2018-07-231-5/+5
| | |/ | |/|
* | | Merge pull request #780 from lioncash/movebunnei2018-07-241-11/+22
|\ \ \
| * | | vi: Add std::is_trivially_copyable checks to Read and Write functionsLioncash2018-07-231-2/+13
| * | | vi: std::move std::vector in constructors where applicableLioncash2018-07-231-9/+9
| |/ /
* | | Merge pull request #779 from lioncash/sharedbunnei2018-07-248-263/+0
|\ \ \ | |_|/ |/| |
| * | hle: Remove config_mem.h/.cppLioncash2018-07-236-102/+0
| * | hle: Remove shared_page.h/.cppLioncash2018-07-236-161/+0
| |/
* | Merge pull request #695 from DarkLordZach/nro-assetbunnei2018-07-235-1/+215
|\ \
| * | NRO Assets and NACP file formatZach Hilman2018-07-235-1/+215
* | | set: Add missing log call in GetAvailableLanguageCodeCount()Lioncash2018-07-231-0/+2
| |/ |/|
* | Merge pull request #775 from lioncash/strbunnei2018-07-232-30/+32
|\ \
| * | string_util: Get rid of separate resize() in CPToUTF16(), UTF16ToUTF8(), CodeToUTF8() and UTF8ToUTF16()Lioncash2018-07-221-20/+22
| * | string_util: Use emplace_back() in SplitString() instead of push_back()Lioncash2018-07-221-2/+3
| * | string_util: Remove unnecessary std::string instance in TabsToSpaces()Lioncash2018-07-222-8/+7
* | | Merge pull request #777 from lioncash/langbunnei2018-07-232-23/+31
|\ \ \ | |_|/ |/| |
| * | set: Implement GetAvailableLanguageCodeCount()Lioncash2018-07-232-21/+29
| * | set: Correct return code size of value in GetAvailableLanguageCodes()Lioncash2018-07-231-2/+2
| |/
* | Merge pull request #769 from bunnei/shader-mask-fixesbunnei2018-07-231-5/+9
|\ \
| * | shader_bytecode: Implement other TEXS masks.bunnei2018-07-221-5/+9
* | | Merge pull request #774 from Subv/atomic_signalbunnei2018-07-221-7/+31
|\ \ \ | |_|/ |/| |
| * | Kernel/SVC: Perform atomic accesses in SignalProcessWideKey as per the real kernel.Subv2018-07-221-7/+31
* | | Merge pull request #773 from Subv/gl_ext_checkbunnei2018-07-222-2/+24
|\ \ \
| * | | Frontend: Check for more required OpenGL extensions during startup.Subv2018-07-222-2/+24
| |/ /
* | | Merge pull request #768 from lioncash/string-viewbunnei2018-07-2210-133/+213
|\ \ \
| * | | vfs: Correct file_p variable usage within InterpretAsDirectory()Lioncash2018-07-221-2/+5
| * | | file_util, vfs: Use std::string_view where applicableLioncash2018-07-2210-131/+208
* | | | Merge pull request #770 from lioncash/constructbunnei2018-07-221-4/+8
|\ \ \ \ | |_|/ / |/| | |
| * | | gl_shader_decompiler: Remove redundant Subroutine construction in AddSubroutine()Lioncash2018-07-221-4/+8
| | |/ | |/|
* / | Implement exclusive monitorMerryMage2018-07-229-13/+160
|/ /
* | Merge pull request #765 from lioncash/filebunnei2018-07-221-24/+14
|\ \
| * | file_util: Remove goto usages from Copy()Lioncash2018-07-221-24/+14
* | | Merge pull request #767 from bunnei/shader-cleanupbunnei2018-07-221-78/+15
|\ \ \
| * | | gl_shader_decompiler: Remove unused state tracking and minor cleanup.bunnei2018-07-221-78/+15
* | | | Merge pull request #766 from bunnei/shader-selbunnei2018-07-222-0/+20
|\ \ \ \ | |_|_|/ |/| | |
| * | | gl_shader_decompiler: Implement SEL instruction.bunnei2018-07-222-0/+20
| |/ /
* | | Merge pull request #764 from lioncash/movebunnei2018-07-225-19/+19
|\ \ \ | |/ / |/| |
| * | file_util: Use a u64 to represent number of entriesLioncash2018-07-225-18/+18
| * | file_util: std::move FST entries in ScanDirectoryTree()Lioncash2018-07-221-1/+1
| |/
* | gl_rasterizer_cache: Blit surfaces on recreation instead of flush and load.bunnei2018-07-222-2/+86
* | gl_rasterizer_cache: Use GPUVAddr as cache key, not parameter set.bunnei2018-07-223-57/+46
* | gl_rasterizer_cache: Use zeta_width and zeta_height registers for depth buffer.bunnei2018-07-222-11/+11
* | gl_rasterizer: Use zeta_enable register to enable depth buffer.bunnei2018-07-221-2/+2
* | maxwell_3d: Add depth buffer enable, width, and height registers.bunnei2018-07-221-2/+14
|/
* Merge pull request #759 from lioncash/redundantbunnei2018-07-221-2/+1
|\
| * file_util: Remove explicit type from std::min() in GetPathWithoutTop()Lioncash2018-07-211-1/+1
| * file_util: Remove redundant duplicate return in GetPathWithoutTop()Lioncash2018-07-211-1/+0
* | Merge pull request #748 from lioncash/namespacebunnei2018-07-2211-48/+24
|\ \
| * | video_core: Use nested namespaces where applicableLioncash2018-07-2111-48/+24
* | | Merge pull request #758 from lioncash/syncbunnei2018-07-222-86/+0
|\ \ \
| * | | common: Remove synchronized_wrapper.hLioncash2018-07-212-86/+0
* | | | Merge pull request #760 from lioncash/pathbunnei2018-07-2211-73/+85
|\ \ \ \
| * | | | file_util: Use an enum class for GetUserPath()Lioncash2018-07-2111-73/+85
| | |_|/ | |/| |
* / | | GPU: Implement the NVGPU_IOCTL_CHANNEL_KICKOFF_PB ioctl2 command.Subv2018-07-213-6/+34
|/ / /
* | | Merge pull request #754 from lioncash/partbunnei2018-07-212-8/+20
|\ \ \
| * | | vfs_real: Remove redundant copying of std::vector instances in GetFiles() and GetSubdirectories()Lioncash2018-07-211-2/+3
| * | | partition_filesystem, vfs_real: Add missing standard includesLioncash2018-07-212-0/+4
| * | | partition_filesystem, vfs_real: Use std::move in ReplaceFileWithSubdirectory() where applicableLioncash2018-07-212-2/+3
| * | | partition_filesystem, vfs_real: Use std::distance() instead of subtractionLioncash2018-07-212-4/+10
* | | | Merge pull request #750 from lioncash/ctxbunnei2018-07-213-9/+0
|\ \ \ \ | |_|/ / |/| | |
| * | | arm_interface: Remove unused tls_address member of ThreadContextLioncash2018-07-213-9/+0
* | | | Merge pull request #746 from lioncash/testsbunnei2018-07-212-4/+12
|\ \ \ \
| * | | | arm_test_common: Get rid of truncation warningsLioncash2018-07-201-2/+5
| * | | | arm_test_common: Make file static variable a member variable of the testing environmentLioncash2018-07-202-2/+5
| * | | | arm_test_common: Add missing header guardLioncash2018-07-201-0/+2
| | |_|/ | |/| |
* | | | Merge pull request #747 from lioncash/unimplementedbunnei2018-07-212-3/+3
|\ \ \ \
| * | | | gl_shader_manager: Replace unimplemented function prototypeLioncash2018-07-212-3/+3
| |/ / /
* | | | Merge pull request #755 from lioncash/ctorbunnei2018-07-211-8/+8
|\ \ \ \
| * | | | file_sys/errors: Remove redundant object constructor callsLioncash2018-07-211-8/+8
| | |_|/ | |/| |
* | | | Merge pull request #749 from lioncash/consistencybunnei2018-07-214-14/+17
|\ \ \ \
| * | | | gpu: Rename Get3DEngine() to Maxwell3D()Lioncash2018-07-214-14/+17
| | |_|/ | |/| |
* | | | Merge pull request #751 from Subv/tpidr_el0bunnei2018-07-218-0/+39
|\ \ \ \
| * | | | CPU: Save and restore the TPIDR_EL0 system register on every context switch.Subv2018-07-218-0/+39
* | | | | Merge pull request #753 from lioncash/constbunnei2018-07-214-21/+15
|\ \ \ \ \
| * | | | | vfs_offset: Simplify TrimToFit()Lioncash2018-07-211-1/+2
| * | | | | vfs: Make WriteBytes() overload taking a std::vector pass the std::vector by const referenceLioncash2018-07-214-4/+4
| * | | | | vfs: Use variable template variants of std::is_trivially_copyableLioncash2018-07-211-13/+6
| * | | | | vfs: Amend constness on pointers in WriteBytes() and WriteArrays() member functions to be const qualifiedLioncash2018-07-211-3/+3
| | |_|/ / | |/| | |
* | | | | Merge pull request #752 from Subv/vfs_loadbunnei2018-07-211-5/+2
|\ \ \ \ \ | |/ / / / |/| | | |
| * | | | Loader: Only print the module names and addresses if they actually exist.Subv2018-07-211-5/+2
| |/ / /
* | | | Merge pull request #743 from lioncash/viewbunnei2018-07-214-57/+56
|\ \ \ \
| * | | | logging/filter: Use std::string_view in ParseFilterString()Lioncash2018-07-202-41/+40
| * | | | logging/backend: Add missing standard includesLioncash2018-07-202-4/+3
| * | | | logging/backend: Use std::string_view in RemoveBackend() and GetBackend()Lioncash2018-07-202-12/+13
| | |_|/ | |/| |
* | | | Merge pull request #745 from lioncash/packagebunnei2018-07-212-9/+12
|\ \ \ \ | |_|_|/ |/| | |
| * | | param_package: Take std::string by value in string-based Set() functionLioncash2018-07-202-4/+6
| * | | param_package: Use std::unordered_map's insert_or_assign instead of map indexingLioncash2018-07-201-3/+3
| * | | param_package: Get rid of file-static std::string constructionLioncash2018-07-201-3/+4
| |/ /
* | | Merge pull request #742 from bunnei/misc-apmbunnei2018-07-211-1/+16
|\ \ \
| * | | apm: Improve stub for GetPerformanceConfiguration.bunnei2018-07-201-1/+16
| |/ /
* / / ipc_helpers: Add PushEnum() member function to ResponseBuilderLioncash2018-07-201-0/+19
|/ /
* | Merge pull request #740 from Subv/acc_crashbunnei2018-07-201-6/+8
|\ \
| * | HLE/ACC: Stub IManagerForApplication::GetAccountId to return an error.Subv2018-07-201-6/+8
| |/
* | Merge pull request #738 from lioncash/signbunnei2018-07-201-16/+20
|\ \
| * | gl_state: Make references const where applicable in Apply()Lioncash2018-07-201-2/+3
| * | gl_state: Get rid of mismatched sign conversionsLioncash2018-07-201-14/+17
* | | Merge pull request #737 from lioncash/movebunnei2018-07-204-5/+9
|\ \ \
| * | | loader/{nca, nro}: std::move VirtualFile in the constructors where applicableLioncash2018-07-202-2/+4
| * | | vfs_offset: std::move file and name parameters of OffsetVfsFileLioncash2018-07-202-3/+5
| |/ /
* | | Merge pull request #736 from lioncash/nullbunnei2018-07-202-3/+6
|\ \ \
| * | | audren_u: Use a std::array instead of std::string for holding the audio interface/device nameLioncash2018-07-201-2/+4
| * | | audout_u: Use a std::array instead of std::string for holding the audio interface nameLioncash2018-07-201-1/+2
| |/ /
* | | Merge pull request #735 from lioncash/video-unusedbunnei2018-07-201-2/+0
|\ \ \
| * | | maxwell_3d: Remove unused variable within GetStageTextures()Lioncash2018-07-201-2/+0
| |/ /
* | | Merge pull request #734 from lioncash/threadbunnei2018-07-2010-93/+92
|\ \ \
| * | | thread: Convert ThreadStatus into an enum classLioncash2018-07-2010-93/+92
| |/ /
* | | Merge pull request #733 from lioncash/dirsbunnei2018-07-201-1/+1
|\ \ \
| * | | partition_filesystem: Return pfs_dirs member variable within GetSubdirectories()Lioncash2018-07-201-1/+1
| |/ /
* | | Merge pull request #732 from lioncash/unusedbunnei2018-07-201-17/+6
|\ \ \
| * | | nso: Silence implicit sign conversion warningsLioncash2018-07-201-4/+6
| * | | nso: Remove unused function ReadSegment()Lioncash2018-07-201-13/+0
| |/ /
* | | Merge pull request #731 from lioncash/shadowbunnei2018-07-201-6/+4
|\ \ \ | |_|/ |/| |
| * | gl_shader_decompiler: Eliminate variable and declaration shadowingLioncash2018-07-201-6/+4
| |/
* | Merge pull request #730 from lioncash/stringbunnei2018-07-201-2/+2
|\ \
| * | gl_shader_decompiler: Remove unnecessary const from return valuesLioncash2018-07-201-2/+2
| |/
* / pl_u: Simplify WriteBuffer() calls in GetSharedFontInOrderOfPriority()Lioncash2018-07-201-3/+3
|/
* Merge pull request #726 from lioncash/overloadbunnei2018-07-205-10/+25
|\
| * hle_ipc: Introduce generic WriteBuffer overload for multiple container typesLioncash2018-07-195-10/+25
* | Merge pull request #725 from lioncash/bytesbunnei2018-07-201-3/+3
|\ \
| * | pl_u: Specify correct size for buffers in GetSharedFontInOrderOfPriority()Lioncash2018-07-191-3/+3
| |/
* | Merge pull request #728 from Subv/acc_profilebunnei2018-07-201-7/+16
|\ \
| * | HLE/ACC: Return an IProfile that is consistent with what was requested.Subv2018-07-191-5/+15
| * | HLE/ACC: Change the default user id to be consistent with what we tell games on startup.Subv2018-07-191-2/+1
* | | Merge pull request #727 from Subv/acc_usersbunnei2018-07-201-4/+6
|\ \ \
| * | | HLE/ACC: Write a single whole user id in ListAllUsers and ListOpenUsers.Subv2018-07-191-4/+6
| |/ /
* | | Merge pull request #724 from lioncash/printfbunnei2018-07-201-1/+1
|\ \ \
| * | | pl_u: Remove printf specifier in log call in a log call in GetSharedFontInOrderOfPriority()Lioncash2018-07-191-1/+1
| | |/ | |/|
* | | Merge pull request #723 from lioncash/gdbbunnei2018-07-201-7/+7
|\ \ \
| * | | gdbstub: Get rid of a few signed/unsigned comparisonsLioncash2018-07-191-7/+7
* | | | Merge pull request #722 from lioncash/signedbunnei2018-07-202-8/+4
|\ \ \ \
| * | | | hid: Use a ranged-for loops in UpdatePadCallbackLioncash2018-07-191-7/+3
| * | | | hid: Use HID_NUM_LAYOUTS constant for indicating size of the layouts arrayLioncash2018-07-191-1/+1
| |/ / /
* | | | Merge pull request #721 from lioncash/svcbunnei2018-07-201-3/+4
|\ \ \ \
| * | | | svc: Correct always true assertion case in SetThreadCoreMaskLioncash2018-07-191-3/+4
* | | | | Merge pull request #719 from lioncash/docsbunnei2018-07-202-5/+5
|\ \ \ \ \
| * | | | | loader: Amend Doxygen commentsLioncash2018-07-192-5/+5
| |/ / / /
* | | | | Merge pull request #718 from lioncash/readbunnei2018-07-201-4/+6
|\ \ \ \ \
| * | | | | loader/nso: Check if read succeeded in IdentifyFile() before checking magic valueLioncash2018-07-191-4/+6
* | | | | | Merge pull request #717 from lioncash/explicitbunnei2018-07-2022-25/+25
|\ \ \ \ \ \
| * | | | | | hle/service: Make constructors explicit where applicableLioncash2018-07-1922-25/+25
| |/ / / / /
* | | | | | Merge pull request #716 from lioncash/constructbunnei2018-07-191-9/+4
|\ \ \ \ \ \
| * | | | | | nvflinger: Emplace Display instances directlyLioncash2018-07-191-9/+4
| |/ / / / /
* | | | | | Merge pull request #715 from lioncash/const-refbunnei2018-07-191-1/+1
|\ \ \ \ \ \ | |_|_|_|_|/ |/| | | | |
| * | | | | nvdrv: Take std::string by const reference in GetDevice()Lioncash2018-07-191-1/+1
| |/ / / /
* | | | | Merge pull request #720 from Subv/getentrytype_rootSebastian Valle2018-07-191-0/+4
|\ \ \ \ \ | |_|_|_|/ |/| | | |
| * | | | Filesystem: Return EntryType::Directory for the root directory.Subv2018-07-191-0/+4
* | | | | Merge pull request #714 from lioncash/indexSebastian Valle2018-07-191-1/+1
|\ \ \ \ \
| * | | | | hle_ipc: Amend usage of buffer_index within one of HLERequestContext's WriteBuffer() overloadsLioncash2018-07-191-1/+1
* | | | | | Merge pull request #712 from lioncash/fspbunnei2018-07-191-17/+22
|\ \ \ \ \ \ | |_|_|_|_|/ |/| | | | |
| * | | | | fsp_srv: Remove unnecessary vector construction in IFile's Write() functionLioncash2018-07-191-2/+3
| * | | | | fsp_srv: Remove unnecessary std::vector construction in IDirectory's Read() functionLioncash2018-07-191-10/+8
| * | | | | fsp_srv: Make IStorage constructor explicitLioncash2018-07-191-1/+1
| * | | | | fsp_srv: Add missing includesLioncash2018-07-191-0/+5
| * | | | | fsp_srv: Resolve sign-mismatch warnings in assertion comparisonsLioncash2018-07-191-3/+3
| * | | | | fsp_srv: Respect write length in Write()Lioncash2018-07-191-4/+5
| |/ / / /
* | | | | Merge pull request #713 from lioncash/filesysbunnei2018-07-191-3/+3
|\ \ \ \ \
| * | | | | filesystem: std::move VirtualDir instance in VfsDirectoryServiceWrapper's constructorLioncash2018-07-191-1/+3
| * | | | | filesystem: Use std::string's empty() function instead of comparing against a literalLioncash2018-07-191-1/+1
| * | | | | filesystem: Remove pragma disabling global optimizationsLioncash2018-07-191-2/+0
| |/ / / /
* | | | | Merge pull request #711 from lioncash/swapbunnei2018-07-191-50/+50
|\ \ \ \ \
| * | | | | common/swap: Remove unnecessary const on return value of swap()Lioncash2018-07-191-1/+1
| * | | | | common/swap: Use static_cast where applicableLioncash2018-07-191-16/+16
| * | | | | common/swap: Use using aliases where applicableLioncash2018-07-191-33/+33
| |/ / / /
* | | | | Merge pull request #710 from lioncash/unusedbunnei2018-07-191-38/+0
|\ \ \ \ \
| * | | | | common/common_funcs: Remove unused rotation functionsLioncash2018-07-191-38/+0
| |/ / / /
* | | | | Merge pull request #694 from lioncash/warnbunnei2018-07-192-6/+4
|\ \ \ \ \ | |_|_|_|/ |/| | | |
| * | | | loader/nro: Resolve sign mismatch warningsLioncash2018-07-191-1/+1
| * | | | loader/nso: Remove unnecessary vector resizesLioncash2018-07-191-4/+2
| * | | | loader/nso: Resolve sign mismatch warningsLioncash2018-07-191-1/+1
* | | | | Merge pull request #709 from lioncash/thread-localbunnei2018-07-192-12/+8
|\ \ \ \ \
| * | | | | common/misc: Deduplicate code in GetLastErrorMsg()Lioncash2018-07-192-12/+8
| | |/ / / | |/| | |
* | | | | Merge pull request #705 from lioncash/string-refbunnei2018-07-192-2/+2
|\ \ \ \ \
| * | | | | file_util: return string by const reference for GetExeDirectory()Lioncash2018-07-192-2/+2
| |/ / / /
* | | | | Merge pull request #704 from lioncash/stringbunnei2018-07-192-15/+0
|\ \ \ \ \
| * | | | | string_util: Remove AsciiToHex()Lioncash2018-07-192-15/+0
* | | | | | Merge pull request #703 from lioncash/constbunnei2018-07-192-2/+2
|\ \ \ \ \ \
| * | | | | | savedata_factory: Make SaveDataDescriptor's DebugInfo() function a const member functionLioncash2018-07-192-2/+2
| |/ / / / /
* | | | | | Merge pull request #702 from lioncash/initializebunnei2018-07-192-24/+15
|\ \ \ \ \ \ | |_|_|_|/ / |/| | | | |
| * | | | | partition_filesystem: Ensure all class members of PartitionFilesystem are initializedLioncash2018-07-192-24/+15
| |/ / / /
* | | | | Merge pull request #701 from lioncash/movingbunnei2018-07-192-2/+10
|\ \ \ \ \ | |_|_|_|/ |/| | | |
| * | | | content_archive: Make IsDirectoryExeFS() take a shared_ptr as a const referenceLioncash2018-07-191-1/+1
| * | | | content_archive: Add missing standard includesLioncash2018-07-191-0/+5
| * | | | content_archive: std::move VirtualFile in NCA's constructorLioncash2018-07-191-1/+4
| |/ / /
* | | | Merge pull request #699 from lioncash/vfsbunnei2018-07-191-6/+6
|\ \ \ \
| * | | | vfs: Deduplicate accumulation code in VfsDirectory's GetSize()Lioncash2018-07-191-6/+6
| |/ / /
* | | | Merge pull request #697 from bunnei/disable-depth-cullbunnei2018-07-191-1/+3
|\ \ \ \ | |_|/ / |/| | |
| * | | gl_state: Temporarily disable culling and depth test.bunnei2018-07-191-1/+3
| | |/ | |/|
* | | Merge pull request #692 from lioncash/assignbunnei2018-07-191-1/+1
|\ \ \
| * | | address_arbiter: Correct assignment within an assertion statement in WakeThreads()Lioncash2018-07-191-1/+1
* | | | Merge pull request #690 from lioncash/movebunnei2018-07-199-16/+26
|\ \ \ \ | |_|_|/ |/| | |
| * | | core/memory, core/hle/kernel: Use std::move where applicableLioncash2018-07-199-16/+26
* | | | Merge pull request #691 from lioncash/guardbunnei2018-07-191-0/+2
|\ \ \ \
| * | | | service/prepo: Add missing header guardLioncash2018-07-191-0/+2
| | |/ / | |/| |
* | | | Merge pull request #686 from lioncash/fmtbunnei2018-07-191-1/+1
|\ \ \ \ | |_|_|/ |/| | |
| * | | externals: update fmt to version 5.1.0Lioncash2018-07-181-1/+1
| | |/ | |/|
* | | Merge pull request #688 from lioncash/commabunnei2018-07-191-22/+12
|\ \ \
| * | | vm_manager: Add missing commas to string literal array elements in GetMemoryStateName()Lioncash2018-07-191-22/+12
| |/ /
* | | Merge pull request #693 from lioncash/unusedbunnei2018-07-191-7/+0
|\ \ \
| * | | core/memory: Remove unused function GetSpecialHandlers() and an unused variable in ZeroBlock()Lioncash2018-07-191-7/+0
| | |/ | |/|
* | | Merge pull request #687 from lioncash/instancebunnei2018-07-196-22/+26
|\ \ \
| * | | core: Make System's default constructor privateLioncash2018-07-192-0/+4
| * | | core: Don't construct instance of Core::System, just to access its live instanceLioncash2018-07-195-22/+22
| | |/ | |/|
* | | Merge pull request #680 from bunnei/fix-swizzbunnei2018-07-191-1/+4
|\ \ \
| * | | decoders: Fix calc of swizzle image_width_in_gobs.bunnei2018-07-191-1/+4
* | | | Merge pull request #684 from lioncash/nonmemberbunnei2018-07-192-2/+1
|\ \ \ \ | |/ / / |/| | |
| * | | game_list: Make ContainsAllWords an internally linked non-member functionLioncash2018-07-182-2/+1
| |/ /
* | / Virtual Filesystem 2: Electric Boogaloo (#676)Zach Hilman2018-07-1954-1959/+1926
| |/ |/|
* | Fill in more fields in TouchScreenEntryTouchZach Hilman2018-07-181-4/+9
* | Single touch supportZach Hilman2018-07-181-4/+19
|/
* Merge pull request #681 from lioncash/constbunnei2018-07-182-5/+7
|\
| * game_list: Upper-case containsAllWords to ContainsAllWords()Lioncash2018-07-182-3/+3
| * game_list: Make containsAllWords a const member functionLioncash2018-07-182-4/+6
* | Merge pull request #682 from lioncash/telemetrybunnei2018-07-181-20/+7
|\ \
| * | telemetry: Remove unnecessary Field constructorLioncash2018-07-181-4/+1
| * | telemetry: Make operator== and operator!= const member functions of FieldLioncash2018-07-181-2/+2
| * | telemetry: Default copy/move constructors and assignment operatorsLioncash2018-07-181-14/+4
| |/
* | Merge pull request #679 from lioncash/ctorbunnei2018-07-181-4/+1
|\ \
| * | game_list: Remove unnecessary QString initialization in KeyReleaseEaterLioncash2018-07-181-4/+1
| |/
* | Merge pull request #678 from lioncash/astcbunnei2018-07-181-78/+60
|\ \
| * | astc: Initialize vector size directly in DecompressLioncash2018-07-181-2/+1
| * | astc: Mark functions as internally linked where applicableLioncash2018-07-181-17/+20
| * | astc: const-correctness changes where applicableLioncash2018-07-181-14/+13
| * | astc: Delete Bits' copy contstructor and assignment operatorLioncash2018-07-181-8/+6
| * | astc: In-class initialize member variables where appropriateLioncash2018-07-181-39/+22
| |/
* | settings: Turn docked mode off by default.bunnei2018-07-183-3/+3
* | vi: Change TransactionId::CancelBuffer to LOG_CRITICAL.bunnei2018-07-181-1/+1
* | vi: Fix size for ListDisplays default display.bunnei2018-07-181-2/+2
* | vi: Partially implement buffer crop parameters.bunnei2018-07-189-14/+46
|/
* Merge pull request #675 from Subv/stencilbunnei2018-07-181-2/+25
|\
| * GPU: Added register definitions for the stencil parameters.Subv2018-07-171-2/+25
* | General Filesystem and Save Data Fixes (#670)Zach Hilman2018-07-1716-212/+256
* | Merge pull request #671 from MerryMage/clear-exclusive-statebunnei2018-07-176-0/+11
|\ \
| * | scheduler: Clear exclusive state when switching contextsMerryMage2018-07-166-0/+11
* | | Merge pull request #672 from SciresM/to_address_fixbunnei2018-07-171-2/+4
|\ \ \ | |_|/ |/| |
| * | Kernel/Arbiter: Fix bug in WaitIfLessThanMichael Scire2018-07-171-2/+4
| |/
* / nvflinger: Fix for BufferQueue event handling.bunnei2018-07-176-32/+21
|/
* Merge pull request #668 from jroweboy/controller-lagbunnei2018-07-151-3/+3
|\
| * HID: Update controllers less oftenJames Rowe2018-07-151-3/+3
* | Merge pull request #664 from jroweboy/logging-stuffbunnei2018-07-153-4/+17
|\ \ | |/ |/|
| * Logging: Dump all logs in the queue on close in debug modeJames Rowe2018-07-153-1/+12
| * Logging: Don't lock the queue for the duration of the writeJames Rowe2018-07-141-3/+5
* | gl_rasterizer_cache: Implement texture format G8R8.bunnei2018-07-153-9/+40
* | Merge pull request #665 from bunnei/fix-z24-s8bunnei2018-07-151-1/+2
|\ \
| * | gl_rasterizer_cache: Fix incorrect offset in ConvertS8Z24ToZ24S8.bunnei2018-07-151-1/+2
* | | gl_rasterizer_cache: Implement depth format Z16_UNORM.bunnei2018-07-153-1/+15
|/ /
* | Merge pull request #598 from bunnei/makedonecurrentbunnei2018-07-156-2/+39
|\ \
| * | OpenGL: Use MakeCurrent/DoneCurrent for multithreaded rendering.bunnei2018-07-146-2/+39
* | | Merge pull request #663 from Subv/bsdbunnei2018-07-151-2/+1
|\ \ \
| * | | Services/BSD: Corrected the return for StartMonitoring according to SwIPC.Subv2018-07-141-2/+1
* | | | Merge pull request #662 from Subv/delete_filebunnei2018-07-141-2/+4
|\ \ \ \
| * | | | FileSys: Append the requested path to the filesystem base path in DeleteFile.Subv2018-07-141-2/+4
| |/ / /
* / / / No need to use ASSERT_MSG with an empty messageDavid Marcec2018-07-141-2/+2
|/ / /
* / / GPU: Always enable the depth write when clearing the depth buffer.Subv2018-07-141-3/+8
|/ /
* | Merge pull request #657 from bunnei/dual-vsbunnei2018-07-137-89/+149
|\ \
| * | gl_rasterizer: Fix check for if a shader stage is enabled.bunnei2018-07-133-35/+11
| * | gl_shader_gen: Implement dual vertex shader mode.bunnei2018-07-135-55/+139
* | | More improvements to GDBStub (#653)Hedges2018-07-138-50/+173
|/ /
* | Merge pull request #656 from ogniK5377/audren-mem-initbunnei2018-07-131-3/+3
|\ \
| * | We only need to alert for memory pool changesDavid Marcec2018-07-131-2/+0
| * | initialized voice status and unused sizes in the update data headerDavid Marcec2018-07-131-1/+3
* | | Merge pull request #655 from bunnei/pred-lt-nanbunnei2018-07-132-5/+7
|\ \ \
| * | | gl_shader_decompiler: Implement PredCondition::LessThanWithNan.bunnei2018-07-132-5/+7
| |/ /
* / / gl_shader_decompiler: Use FlowCondition field in EXIT instruction.bunnei2018-07-132-8/+34
|/ /
* | Merge pull request #652 from Subv/fadd32iSebastian Valle2018-07-132-0/+32
|\ \
| * | GPU: Implement the FADD32I shader instruction.Subv2018-07-122-0/+32
* | | Merge pull request #651 from Subv/ffma_decodebunnei2018-07-121-1/+1
|\ \ \
| * | | GPU: Corrected the decoding of FFMA for immediate operands.Subv2018-07-121-1/+1
| |/ /
* | | Port #3335 and #3373 from Citra: "Small SDL fixes" and "Print the actual error preventing SDL from working" (#637)Tobias2018-07-122-6/+4
* | | Merge pull request #648 from ogniK5377/no-netbunnei2018-07-121-3/+21
|\ \ \
| * | | Added IsWirelessCommunicationEnabled, IsEthernetCommunicationEnabled, IsAnyInternetRequestAcceptedDavid Marcec2018-07-121-3/+21
* | | | Merge pull request #649 from ogniK5377/audout-autobunnei2018-07-122-14/+14
|\ \ \ \ | |_|_|/ |/| | |
| * | | Audout "Auto" functionsDavid Marcec2018-07-122-14/+14
| |/ /
* | | yuzu - Fix duplicate logsJames Rowe2018-07-122-2/+7
* | | yuzu-cmd Apply the filter string from settingsJames Rowe2018-07-121-2/+1
|/ /
* | Merge pull request #559 from Subv/mount_savedatabunnei2018-07-122-2/+12
|\ \
| * | Services/FS: Return the correct error code when trying to mount a nonexistent savedata.Subv2018-06-192-2/+12
* | | hid: Fix timestamps and controller type.bunnei2018-07-111-7/+5
* | | Merge pull request #644 from ogniK5377/getconfig-errbunnei2018-07-111-17/+2
|\ \ \
| * | | NvOsGetConfigU32 production implDavid Marcec2018-07-101-17/+2
* | | | Merge pull request #633 from FearlessTobi/port-definesbunnei2018-07-103-7/+7
|\ \ \ \
| * | | | Port #3579 from CitrafearlessTobi2018-07-073-7/+7
| | |_|/ | |/| |
* | | | Merge pull request #642 from bunnei/create-save-dirbunnei2018-07-101-0/+9
|\ \ \ \ | |_|/ / |/| | |
| * | | savedata_factory: Always create a save directory for games.bunnei2018-07-081-0/+9
* | | | Merge pull request #635 from FearlessTobi/port-crashfixbunnei2018-07-101-1/+1
|\ \ \ \
| * | | | Port #3474 from CitrafearlessTobi2018-07-071-1/+1
| | |/ / | |/| |
* | | | Merge pull request #634 from FearlessTobi/port-viewport-fixbunnei2018-07-101-6/+7
|\ \ \ \
| * | | | Port #3505 from CItrafearlessTobi2018-07-071-6/+7
| |/ / /
* | | | Merge pull request #640 from bunnei/flip-tris-viewportbunnei2018-07-091-1/+4
|\ \ \ \
| * | | | gl_rasterizer: Flip triangles when regs.viewport_transform[0].scale_y is negative.bunnei2018-07-081-1/+4
| | |/ / | |/| |
* / | | nvhost_ctrl: Fix NvOsGetConfigU32 for Snipper Clips.bunnei2018-07-081-1/+1
|/ / /
* | | Merge pull request #625 from Subv/imnmxbunnei2018-07-082-3/+31
|\ \ \
| * | | GPU: Implemented the IMNMX shader instruction.Subv2018-07-042-3/+31
* | | | Merge pull request #627 from Subv/bc7ubunnei2018-07-083-7/+21
|\ \ \ \
| * | | | GPU: Implemented the BC7U texture format.Subv2018-07-073-7/+21
| | |/ / | |/| |
* / | | Revert "Virtual Filesystem (#597)"bunnei2018-07-0845-1784/+1676
|/ / /
* | | Merge pull request #630 from FearlessTobi/remove-citra-referencesbunnei2018-07-063-3/+3
|\ \ \
| * | | Remove some references to CitrafearlessTobi2018-07-063-3/+3
* | | | Virtual Filesystem (#597)Zach Hilman2018-07-0645-1676/+1784
|/ / /
* | | Merge pull request #629 from Subv/depth_testbunnei2018-07-052-9/+29
|\ \ \
| * | | GPU: Allow using the old NV04 values for the depth test function.Subv2018-07-052-9/+29
* | | | Merge pull request #626 from Subv/shader_syncbunnei2018-07-052-0/+12
|\ \ \ \ | |/ / / |/| | |
| * | | GPU: Stub the shader SYNC and DEPBAR instructions.Subv2018-07-042-0/+12
| |/ /
* | | Merge pull request #624 from Subv/f2f_roundbunnei2018-07-051-0/+3
|\ \ \
| * | | GPU: Implemented the F2F 'round' rounding mode.Subv2018-07-041-0/+3
| |/ /
* | | Merge pull request #623 from Subv/vertex_typesbunnei2018-07-051-0/+8
|\ \ \
| * | | GPU: Implement the Size_16_16 and Size_10_10_10_2 vertex attribute types.Subv2018-07-041-0/+8
| |/ /
* | | Merge pull request #622 from Subv/unused_texbunnei2018-07-052-2/+5
|\ \ \
| * | | GPU: Ignore textures that the GLSL compiler deemed unused when binding textures to the shaders.Subv2018-07-041-1/+4
| * | | GPU: Corrected the decoding for the TEX shader instruction.Subv2018-07-041-1/+1
| |/ /
* | | Merge pull request #621 from Subv/psetp_bunnei2018-07-052-0/+43
|\ \ \
| * | | GPU: Implemented the PSETP shader instruction.Subv2018-07-042-0/+43
| |/ /
* | | Merge pull request #620 from Subv/depth_z32fbunnei2018-07-053-2/+15
|\ \ \
| * | | GPU: Implemented the 32 bit float depth buffer format.Subv2018-07-043-2/+15
| |/ /
* / / GPU: Flip the triangle front face winding if the GPU is configured to not flip the triangles.Subv2018-07-042-3/+29
|/ /
* | GPU: Only configure the used framebuffers during clear.Subv2018-07-044-17/+48
* | Merge pull request #609 from Subv/clear_buffersbunnei2018-07-045-16/+105
|\ \
| * | GPU: Factor out the framebuffer configuration code for both Clear and Draw commands.Subv2018-07-032-72/+39
| * | GPU: Support clears that don't clear the color buffer.Subv2018-07-032-6/+17
| * | GPU: Bind and clear the render target when the CLEAR_BUFFERS register is written to.Subv2018-07-034-0/+86
| * | GPU: Added registers for the CLEAR_BUFFERS and CLEAR_COLOR methods.Subv2018-07-031-2/+27
* | | gl_rasterizer_cache: Implement PixelFormat S8Z24.bunnei2018-07-033-11/+83
* | | Update AudioRenderer Voice Sections (#614)David2018-07-031-0/+87
* | | Merge pull request #607 from jroweboy/loggingbunnei2018-07-03116-887/+1261
|\ \ \
| * | | Fix build and address review feedbackbunnei2018-07-032-4/+5
| * | | Add configurable logging backendsJames Rowe2018-07-0314-22/+408
| * | | Update clang formatJames Rowe2018-07-0337-154/+141
| * | | Rename logging macro back to LOG_*James Rowe2018-07-03105-730/+730
| |/ /
* | | Merge pull request #612 from bunnei/fix-cullbunnei2018-07-031-2/+5
|\ \ \
| * | | gl_rasterizer: Only set cull mode and front face if enabled.bunnei2018-07-031-2/+5
| |/ /
* | | Merge pull request #611 from Subv/enabled_depth_testbunnei2018-07-032-9/+13
|\ \ \
| * | | GPU: Use only the least significant 3 bits when reading the depth test func.Subv2018-07-031-9/+9
| * | | GPU: Don't try to parse the depth test function if the depth test is disabled.Subv2018-07-031-0/+4
| |/ /
* | | Merge pull request #610 from Subv/mufu_8bunnei2018-07-032-0/+5
|\ \ \ | |/ / |/| |
| * | GPU: Implemented MUFU suboperation 8, sqrt.Subv2018-07-032-0/+5
* | | Merge pull request #608 from Subv/depthbunnei2018-07-039-32/+246
|\ \ \
| * | | GPU: Set up the culling configuration on each draw.Subv2018-07-031-6/+8
| * | | GPU: Set up the depth test state on every draw.Subv2018-07-022-0/+14
| * | | MaxwellToGL: Added conversion functions for depth test and cull mode.Subv2018-07-021-0/+50
| * | | GPU: Added registers for depth test and cull mode.Subv2018-07-021-3/+51
| * | | GPU: Implemented the Z24S8 depth format and load the depth framebuffer.Subv2018-07-027-24/+124
| |/ /
* | | Merge pull request #606 from Subv/base_vertexSebastian Valle2018-07-022-8/+15
|\ \ \
| * | | GPU: Implement offsetted rendering when using non-indexed drawing.Subv2018-07-021-1/+1
| * | | GPU: Fixed the index offset rendering, and implemented the base vertex functionality.Subv2018-07-021-6/+8
| * | | GPU: Added register definitions for the vertex buffer base element.Subv2018-07-021-1/+6
| |/ /
* | | Merge pull request #603 from Subv/nvmap_freeSebastian Valle2018-07-023-4/+16
|\ \ \
| * | | GPU: Remove a surface from the cache when its backing memory is being unmapped from the GPU's MMU.Subv2018-07-011-0/+5
| * | | nvmap: Return the address of the nvmap object when Freeing it for the last time.Subv2018-07-012-4/+11
* | | | Merge pull request #605 from Subv/dma_copySebastian Valle2018-07-021-1/+5
|\ \ \ \
| * | | | GPU: Directly copy the pixels when performing a same-layout DMA.Subv2018-07-021-1/+5
| |/ / /
* | | | Merge pull request #604 from Subv/invalid_texturesbunnei2018-07-023-3/+12
|\ \ \ \ | |_|/ / |/| | |
| * | | GPU: Ignore disabled textures and textures with an invalid address.Subv2018-07-022-1/+10
| * | | GPU: Allow GpuToCpuAddress to return boost::none for unmapped addresses.Subv2018-07-021-2/+2
| |/ /
* | | Merge pull request #602 from Subv/mufu_subopbunnei2018-07-012-6/+1
|\ \ \
| * | | GPU: Corrected the size of the MUFU subop field, and removed incorrect "min" operation.Subv2018-06-302-6/+1
| |/ /
* | | Merge pull request #601 from Subv/rgba32_uibunnei2018-07-014-25/+48
|\ \ \
| * | | GPU: Implemented the RGBA32_UINT rendertarget format.Subv2018-06-304-9/+28
| * | | GLCache: Specify the component type along the texture type in the format tuple.Subv2018-06-301-17/+21
| |/ /
* / / gl_shader_decompiler: Implement predicate NotEqualWithNan.bunnei2018-06-302-17/+24
|/ /
* | Merge pull request #595 from bunnei/raster-cachebunnei2018-06-2915-1454/+425
|\ \
| * | gl_rasterizer_cache: Only dereference color_surface/depth_surface if valid.bunnei2018-06-291-2/+6
| * | gl_rasterizer_cache: Implement caching for texture and framebuffer surfaces.bunnei2018-06-273-16/+168
| * | gl_rasterizer_cache: Various fixes for ASTC handling.bunnei2018-06-272-35/+39
| * | gl_rasterizer_cache: Use SurfaceParams as a key for surface caching.bunnei2018-06-272-43/+72
| * | maxwell_3d: Add a struct for RenderTargetConfig.bunnei2018-06-271-17/+19
| * | settings: Add a configuration for use_accurate_framebuffers.bunnei2018-06-277-0/+21
| * | gl_rasterizer: Implement AccelerateDisplay to forward textures to framebuffers.bunnei2018-06-276-8/+62
| * | gl_rasterizer_cache: Cache size_in_bytes as a const per surface.bunnei2018-06-272-9/+13
| * | gl_rasterizer_cache: Refactor to make SurfaceParams members const.bunnei2018-06-272-52/+37
| * | gl_rasterizer_cache: Remove Citra's rasterizer cache, always load/flush surfaces.bunnei2018-06-274-1494/+210
* | | Merge pull request #588 from mailwl/hwopusbunnei2018-06-284-0/+53
|\ \ \
| * | | Service/Audio: add hwopus service, stub GetWorkBufferSize functionmailwl2018-06-254-0/+53
* | | | gl_shader_decompiler: Add a return path for unknown instructions.bunnei2018-06-271-0/+1
| |/ / |/| |
* | | gl_rasterizer: Workaround for when exceeding max UBO size.bunnei2018-06-272-1/+7
* | | Merge pull request #593 from bunnei/fix-swizzlebunnei2018-06-275-12/+20
|\ \ \
| * | | gl_state: Fix state management for texture swizzle.bunnei2018-06-265-12/+20
* | | | Merge pull request #592 from bunnei/cleanup-gl-statebunnei2018-06-272-94/+0
|\ \ \ \
| * | | | gl_state: Remove unused state management from 3DS.bunnei2018-06-262-94/+0
| |/ / /
* / / / gl_rasterizer_cache: Fix inverted B5G6R5 format.bunnei2018-06-261-1/+1
|/ / /
* | | yuzu: Remove SSBOs check from Qt frontend.bunnei2018-06-261-2/+0
* | | Merge pull request #554 from Subv/constbuffer_ubobunnei2018-06-264-18/+39
|\ \ \
| * | | Rasterizer: Use UBOs instead of SSBOs for uploading const buffers.Subv2018-06-104-18/+39
* | | | Merge pull request #589 from mailwl/fix-crashbunnei2018-06-261-2/+4
|\ \ \ \
| * | | | Fix crash at exitmailwl2018-06-251-2/+4
| | |/ / | |/| |
* / | | Send the correct RequestUpdateAudioRenderer revision in the output header (#587)David2018-06-251-1/+1
|/ / /
* | | Removed duplicate structs, changed AudioRendererResponse -> UpdateDataHeader (#583)David2018-06-242-34/+21
* | | Fixed RequestUpdateAudioRenderer deadlocks and calculated section sizes properly (#580)David2018-06-232-44/+76
* | | Merge pull request #579 from SciresM/masterbunnei2018-06-2212-9/+312
|\ \ \
| * | | Kernel/Arbiters: Fix casts, cleanup comments/magic numbersMichael Scire2018-06-224-17/+27
| * | | Add additional missing format.Michael Scire2018-06-222-21/+27
| * | | Run clang-format on PR.Michael Scire2018-06-223-180/+181
| * | | Kernel/Arbiters: HLE is atomic, adjust code to reflect that.Michael Scire2018-06-222-37/+13
| * | | Kernel/Arbiters: Initialize arb_wait_address in thread struct.Michael Scire2018-06-213-1/+7
| * | | Kernel/Arbiters: Clear WaitAddress in SignalToAddressMichael Scire2018-06-211-0/+1
| * | | Kernel/Arbiters: Mostly implement SignalToAddressMichael Scire2018-06-215-11/+111
| * | | Kernel/Arbiters: Implement WaitForAddressMichael Scire2018-06-215-6/+71
| * | | Kernel/Arbiters: Add stubs for 4.x SignalToAddress/WaitForAddres SVCs.Michael Scire2018-06-217-9/+147
* | | | IPC: skip empty buffer writemailwl2018-06-221-0/+5
* | | | Merge pull request #577 from mailwl/audren-updatebunnei2018-06-222-49/+60
|\ \ \ \
| * | | | Service/Audio: update audren:u servicemailwl2018-06-212-49/+60
| |/ / /
* / / / Add support for decrypted NCA files (#567)Zach Hilman2018-06-2110-16/+453
|/ / /
* | | Build: Fixed some MSVC warnings in various parts of the code.Subv2018-06-2012-22/+24
* | | Implement GetAvailableLanguageCodes2 (#575)greggameplayer2018-06-191-4/+1
* | | Merge pull request #574 from Subv/shader_abs_negbunnei2018-06-191-7/+14
|\ \ \
| * | | GPU: Perform negation after absolute value in the float shader instructions.Subv2018-06-191-7/+14
* | | | Merge pull request #561 from DarkLordZach/fix-odyssey-input-crashbunnei2018-06-191-0/+4
|\ \ \ \
| * | | | Narrow down filter of layout configsZach Hilman2018-06-142-10/+5
| * | | | Move loop condition to free functionZach Hilman2018-06-131-4/+9
| * | | | Avoid initializing single-joycon layouts with handheld controllerZach Hilman2018-06-132-1/+5
* | | | | GPU: Don't mark uniform buffers and registers as used for instructions which don't have them.Subv2018-06-192-14/+18
| |/ / / |/| | |
* | | | Merge pull request #570 from bunnei/astcbunnei2018-06-196-1/+1709
|\ \ \ \
| * | | | gl_rasterizer: Implement texture format ASTC_2D_4X4.bunnei2018-06-186-1/+1709
* | | | | Merge pull request #562 from DarkLordZach/extracted-ncas-uibunnei2018-06-184-3/+50
|\ \ \ \ \
| * | | | | Bug fixes, testing, and review changesZach Hilman2018-06-142-7/+20
| * | | | | Add 'Load Folder' menu optionZach Hilman2018-06-143-0/+17
| * | | | | Add support for main files in file pickerZach Hilman2018-06-141-0/+2
| * | | | | Recognize main files in game listZach Hilman2018-06-141-2/+17
| | |/ / / | |/| | |
* | | | | Merge pull request #572 from Armada651/user-except-stubbunnei2018-06-181-0/+5
|\ \ \ \ \
| * | | | | svc: Add a stub for UserExceptionContextAddr.Jules Blok2018-06-181-0/+5
* | | | | | Merge pull request #571 from Armada651/loose-blendbunnei2018-06-181-1/+1
|\ \ \ \ \ \ | |_|_|/ / / |/| | | | |
| * | | | | gl_rasterizer: Get loose on independent blending.Jules Blok2018-06-181-1/+1
* | | | | | gl_rasterizer_cache: Loosen things up a bit.bunnei2018-06-181-26/+8
* | | | | | gl_shader_decompiler: Implement LOP instructions.bunnei2018-06-172-6/+42
* | | | | | gl_shader_decompiler: Refactor LOP32I instruction a bit in support of LOP.bunnei2018-06-172-57/+42
|/ / / / /
* | | | | gl_shader_decompiler: Implement integer size conversions for I2I/I2F/F2I.bunnei2018-06-162-14/+43
* | | | | Merge pull request #564 from bunnei/lop32i_passbbunnei2018-06-161-6/+12
|\ \ \ \ \
| * | | | | gl_shader_decompiler: Implement LOP32I LogicOperation PassB.bunnei2018-06-161-6/+12
| | |/ / / | |/| | |
* / | | | gl_shader_gen: Set position.w to 1.bunnei2018-06-161-0/+4
|/ / / /
* | | | Merge pull request #560 from Subv/crash_widgetbunnei2018-06-136-292/+0
|\ \ \ \
| * | | | Qt: Removed the Registers widget.Subv2018-06-136-292/+0
| | |_|/ | |/| |
* | | | Merge pull request #556 from Subv/dma_enginebunnei2018-06-127-1/+237
|\ \ \ \
| * | | | GPU: Partially implemented the Maxwell DMA engine.Subv2018-06-127-1/+237
* | | | | Merge pull request #558 from Subv/iadd32ibunnei2018-06-122-2/+31
|\ \ \ \ \
| * | | | | GPU: Implemented the iadd32i shader instruction.Subv2018-06-122-2/+31
| | |/ / / | |/| | |
* | | | | Merge pull request #557 from shinyquagsire23/libnx-hid-fixbunnei2018-06-122-2/+3
|\ \ \ \ \
| * | | | | hid: Update all layouts and only show handheld as connected, fixes libnx input for P1_AUTOshinyquagsire232018-06-122-2/+3
| |/ / / /
* / / / / gl_shader_decompiler: Implement saturate for float instructions.bunnei2018-06-122-39/+32
|/ / / /
* / / / GPU: Convert the gl_InstanceId and gl_VertexID variables to floats when reading from them.Subv2018-06-101-1/+1
|/ / /
* | | GPU: Implement the iset family of shader instructions.Subv2018-06-092-2/+46
* | | GPU: Added decodings for the ISET family of instructions.Subv2018-06-091-0/+7
| |/ |/|
* | Merge pull request #550 from Subv/ssybunnei2018-06-092-0/+7
|\ \
| * | GPU: Stub the SSY shader instruction.Subv2018-06-092-0/+7
* | | Merge pull request #551 from bunnei/shrbunnei2018-06-092-0/+17
|\ \ \
| * | | gl_shader_decompiler: Implement SHR instruction.bunnei2018-06-092-0/+17
| |/ /
* | | gl_shader_decompiler: Implement IADD instruction.bunnei2018-06-092-11/+37
* | | gl_shader_decompiler: Add missing asserts for saturate_a instructions.bunnei2018-06-092-8/+18
|/ /
* | Merge pull request #533 from mailwl/array-to-bufferbunnei2018-06-093-22/+15
|\ \
| * | Common/string_util: add StringFromBuffer functionmailwl2018-06-073-22/+15
* | | GPU: Synchronize the blend state on every draw call.Subv2018-06-092-16/+20
* | | GPU: Added registers for normal and independent blending.Subv2018-06-092-31/+27
* | | Merge pull request #547 from Subv/compressed_alignmentbunnei2018-06-081-2/+7
|\ \ \
| * | | GLCache: Align compressed texture sizes to their compression ratio, and then align that compressed size to the block height for tiled textures.Subv2018-06-081-2/+7
* | | | Rasterizer: Flush the written region when writing shader uniform data before copying it to the uniform buffers.Subv2018-06-081-0/+3
|/ / /
* | | Merge pull request #543 from Subv/uniformsbunnei2018-06-071-3/+4
|\ \ \ | |/ / |/| |
| * | GLRenderer: Write the shader stage configuration UBO data *before* copying it to the GPU.Subv2018-06-071-3/+4
* | | Merge pull request #522 from mailwl/mm-ubunnei2018-06-076-0/+85
|\ \ \
| * | | Remove unused header filesmailwl2018-06-061-2/+0
| * | | Small fixesmailwl2018-06-052-6/+8
| * | | Service/MM: add service and stub some functionsmailwl2018-06-056-0/+85
* | | | Merge pull request #542 from bunnei/bfe_immbunnei2018-06-072-7/+44
|\ \ \ \
| * | | | gl_shader_decompiler: Implement BFE_IMM instruction.bunnei2018-06-072-7/+44
* | | | | Merge pull request #541 from Subv/blittexturesbunnei2018-06-071-56/+9
|\ \ \ \ \ | |/ / / / |/| | | |
| * | | | GLCache: Use the full uncompressed size when blitting from one texture to another.Subv2018-06-071-3/+6
| * | | | GLCache: Simplify the logic to copy from one texture to another in BlitTextures.Subv2018-06-071-53/+3
| | |/ / | |/| |
* | | | Merge pull request #539 from bunnei/f2f-roundingbunnei2018-06-072-10/+35
|\ \ \ \
| * | | | gl_shader_decompiler: F2F: Implement rounding modes.bunnei2018-06-072-10/+35
* | | | | Merge pull request #503 from mailwl/nfp-stubsbunnei2018-06-071-7/+101
|\ \ \ \ \ | |/ / / / |/| | | |
| * | | | Stub IUser::AttachAvailabilityChangeEventmailwl2018-06-061-5/+23
| * | | | Correct function resultsmailwl2018-06-041-4/+16
| * | | | Service/nfp:user : stub some functions.mailwl2018-06-041-6/+70
* | | | | Merge pull request #537 from bunnei/misc-shaderbunnei2018-06-072-8/+24
|\ \ \ \ \
| * | | | | gl_shader_decompiler: Remove some attribute stuff that has nothing to do with TEX/TEXS.bunnei2018-06-071-8/+4
| * | | | | shader_bytecode: Add instruction decodings for BFE, IMNMX, and XMAD.bunnei2018-06-071-0/+20
| | |/ / / | |/| | |
* | | | | Merge pull request #535 from Subv/gpu_swizzlebunnei2018-06-076-0/+65
|\ \ \ \ \
| * | | | | GPU: Support changing the texture swizzles for Maxwell textures.Subv2018-06-073-0/+45
| * | | | | GLState: Support changing the GL_TEXTURE_SWIZZLE parameter of each texture unit.Subv2018-06-073-0/+20
| |/ / / /
* / / / / gl_shader_decompiler: Implement ISETP_IMM instruction.bunnei2018-06-071-8/+9
|/ / / /
* | | | Merge pull request #534 from Subv/multitexturingbunnei2018-06-079-69/+172
|\ \ \ \
| * | | | GPU: Implement sampling multiple textures in the generated glsl shaders.Subv2018-06-069-69/+172
* | | | | gl_shader_decompiler: Implement LD_C instruction.bunnei2018-06-072-0/+43
* | | | | gl_shader_gen: Add uniform handling for indirect const buffer access.bunnei2018-06-073-4/+40
* | | | | gl_shader_decompiler: Refactor uniform handling to allow different decodings.bunnei2018-06-062-26/+29
|/ / / /
* | | | nvdrv/devices/nvidia_ctrl_gpu : add IoctlCommands with their params (#524)greggameplayer2018-06-062-0/+53
* | | | Merge pull request #529 from bunnei/am-nifm-stubsSebastian Valle2018-06-063-2/+23
|\ \ \ \
| * | | | nifm: Stub out IRequest::SetConnectionConfirmationOption.bunnei2018-06-061-1/+10
| * | | | am: Stub out IApplicationFunctions::GetPseudoDeviceId.bunnei2018-06-062-1/+13
* | | | | Merge pull request #531 from bunnei/fix-shlSebastian Valle2018-06-061-1/+1
|\ \ \ \ \
| * | | | | gl_shader_decompiler: Fix un/signed mismatch with SHL.bunnei2018-06-061-1/+1
| |/ / / /
* | | | | Merge pull request #530 from bunnei/wrap-mirrorSebastian Valle2018-06-061-0/+2
|\ \ \ \ \
| * | | | | maxwell_to_gl: Implement WrapMode Mirror.bunnei2018-06-061-0/+2
| |/ / / /
* | | | | Merge pull request #527 from Subv/rgba32f_texcopybunnei2018-06-062-0/+5
|\ \ \ \ \
| * | | | | GPU: Allow the usage of RGBA16_FLOAT in the texture copy engine.Subv2018-06-061-0/+2
| * | | | | GPU: Allow the usage of RGBA32_FLOAT in the texture copy engine.Subv2018-06-062-0/+3
| | |_|/ / | |/| | |
* | | | | Merge pull request #528 from Subv/rg11b10fbunnei2018-06-064-12/+31
|\ \ \ \ \
| * | | | | GPU: Implemented the R11FG11FB10F texture and rendertarget formats.Subv2018-06-064-11/+30
| * | | | | GPU: Fixed the compression factor for RGBA16F textures.Subv2018-06-061-1/+1
| |/ / / /
* | / / / GDB Stub Improvements (#508)Hedges2018-06-064-27/+194
| |/ / / |/| | |
* | | | Merge pull request #516 from Subv/f2i_rbunnei2018-06-062-7/+64
|\ \ \ \
| * | | | GPU: Implemented the F2I_R shader instruction.Subv2018-06-052-7/+64
* | | | | Merge pull request #521 from Subv/brabunnei2018-06-051-4/+5
|\ \ \ \ \
| * | | | | GPU: Corrected the branch targets for the shader bra instruction.Subv2018-06-051-4/+5
| | |/ / / | |/| | |
* | | | | Merge pull request #520 from bunnei/shader-shlbunnei2018-06-052-15/+48
|\ \ \ \ \ | |/ / / / |/| | | |
| * | | | gl_shader_decompiler: Fix typo with ISCADD instruction.bunnei2018-06-051-1/+1
| * | | | gl_shader_decompiler: Implement SHL instruction.bunnei2018-06-052-14/+47
* | | | | Merge pull request #518 from Subv/incomplete_shadersbunnei2018-06-051-5/+16
|\ \ \ \ \ | |/ / / / |/| | | |
| * | | | GPU: Implement predicated exit instructions in the shader programs.Subv2018-06-051-4/+6
| * | | | GPU: Take into account predicated exits when performing shader control flow analysis.Subv2018-06-051-1/+10
* | | | | gl_shader_decompiler: Implement PredCondition::NotEqual.bunnei2018-06-051-3/+3
* | | | | GPU: Implement the ISCADD shader instructions.Subv2018-06-052-0/+40
* | | | | GPU: Added decodings for the ISCADD instructions.Subv2018-06-051-0/+7
| |/ / / |/| | |
* | | | Merge pull request #514 from Subv/lop32ibunnei2018-06-052-1/+58
|\ \ \ \
| * | | | GPU: Implemented the LOP32I instruction.Subv2018-06-042-1/+58
| | |/ / | |/| |
* | | | Merge pull request #510 from Subv/isetpbunnei2018-06-052-6/+63
|\ \ \ \
| * | | | GPU: Use explicit types when retrieving the uniform values for fsetp/fset and isetp instead of the type of an invalid output register.Subv2018-06-041-9/+18
| * | | | GPU: Implemented the ISETP_R and ISETP_C shader instructions.Subv2018-06-042-0/+48
* | | | | Merge pull request #512 from Subv/fsetbunnei2018-06-052-4/+19
|\ \ \ \ \ | |_|_|/ / |/| | | |
| * | | | GPU: Use the bf bit in FSET to determine whether to write 0xFFFFFFFF or 1.0f.Subv2018-06-042-2/+7
| * | | | GPU: Corrected the I2F_R implementation.Subv2018-06-041-2/+12
| | |/ / | |/| |
* | | | Merge pull request #501 from Subv/shader_brabunnei2018-06-052-1/+45
|\ \ \ \
| * | | | GPU: Partially implemented the shader BRA instruction.Subv2018-06-042-1/+43
| * | | | GPU: Added decoding for the BRA instruction.Subv2018-06-041-0/+2
| | |/ / | |/| |
* | | | Merge pull request #515 from Subv/viewport_fixbunnei2018-06-052-14/+30
|\ \ \ \
| * | | | GPU: Calculate the correct viewport dimensions based on the scale and translate registers.Subv2018-06-042-14/+30
| | |/ / | |/| |
* | | | Merge pull request #490 from BreadFish64/extension-checkbunnei2018-06-044-0/+53
|\ \ \ \
| * | | | sdl: add check for GL extension supportBreadFish642018-06-042-0/+26
| * | | | qt: add check for GL extension supportBreadFish642018-06-042-0/+27
* | | | | Merge pull request #513 from Subv/cache_alignmentbunnei2018-06-041-1/+2
|\ \ \ \ \
| * | | | | GLCache: Corrected a mismatch between storing compressed sizes and verifying the uncompressed alignment in GetSurface.Subv2018-06-041-1/+2
| | |/ / / | |/| | |
* | | | | Nvdrv/devices/nvhost_gpu : Add some IoctlCommands with their params (#511)greggameplayer2018-06-041-0/+47
* | | | | am: Implement ILibraryAppletAccessor::PopOutData.bunnei2018-06-041-1/+11
* | | | | am: ISelfController:LaunchableEvent should be sticky.bunnei2018-06-041-1/+1
* | | | | am: Stub out ILibraryAppletAccessor Start and GetResult methods.bunnei2018-06-041-2/+16
|/ / / /
* | | | Merge pull request #499 from bunnei/am-stuffbunnei2018-06-042-66/+105
|\ \ \ \ | |_|/ / |/| | |
| * | | am: Implement ILibraryAppletAccessor::PushInData.bunnei2018-06-041-43/+55
| * | | am: Implement IStorageAccessor::Write.bunnei2018-06-041-1/+17
| * | | am: Cleanup IStorageAccessor::Read.bunnei2018-06-041-5/+3
| * | | am: Implement ILibraryAppletCreator::CreateStorage.bunnei2018-06-042-21/+34
* | | | Merge pull request #500 from Subv/long_queriesbunnei2018-06-041-9/+24
|\ \ \ \
| * | | | GPU: Partial implementation of long GPU queries.Subv2018-06-041-9/+24
* | | | | gl_shader_decompiler: Implement TEXS component mask.bunnei2018-06-032-9/+26
| |/ / / |/| | |
* | | | Merge pull request #494 from bunnei/shader-texbunnei2018-06-032-2/+58
|\ \ \ \
| * | | | gl_shader_decompiler: Implement TEX instruction.bunnei2018-06-012-1/+36
| * | | | gl_shader_decompiler: Support multi-destination for TEXS.bunnei2018-06-012-2/+23
* | | | | Merge pull request #495 from bunnei/improve-rrobunnei2018-06-032-9/+18
|\ \ \ \ \
| * | | | | gl_shader_decompiler: Implement RRO as a register move.bunnei2018-06-032-9/+18
| |/ / / /
* | | | | Merge pull request #484 from mailwl/nvhost-nvdecbunnei2018-06-034-0/+74
|\ \ \ \ \
| * | | | | Services/nvdrv: add '/dev/nvhost-nvdec' devicemailwl2018-05-304-0/+74
* | | | | | Merge pull request #496 from Subv/waitprocesswidekey_timeoutbunnei2018-06-031-2/+5
|\ \ \ \ \ \
| * | | | | | Kernel/Threads: A thread waking up by timeout from a WaitProcessWideKey may already have an assigned lock owner.Subv2018-06-021-2/+5
| | |_|/ / / | |/| | | |
* / | | | | GPU: Implemented the DXN1 (BC4) texture format.Subv2018-06-023-3/+16
|/ / / / /
* | / / / Service/time: implement posix time to calendar conversionmailwl2018-06-012-14/+72
| |/ / / |/| | |
* | | | Merge pull request #488 from Subv/thread_masksbunnei2018-06-013-4/+31
|\ \ \ \
| * | | | Kernel/Thread: Corrected a typo that caused the affinity mask to never be changed.Subv2018-05-311-2/+2
| * | | | Kernel/SVC: Support special core values -2 and -3 in svcSetThreadCoreMask.Subv2018-05-312-1/+28
| * | | | Kernel/Thread: Corrected a typo in an assert about the processor id.Subv2018-05-301-1/+1
* | | | | gl_rasterizer_cache: Assert that component type is UNorm or format is RGBA16F.bunnei2018-05-311-1/+2
* | | | | gl_rasterizer_cache: Implement PixelFormat RGBA16F.bunnei2018-05-313-6/+22
* | | | | Merge pull request #489 from Subv/vertexidbunnei2018-05-302-1/+11
|\ \ \ \ \
| * | | | | Shaders: Implemented reading the gl_InstanceID and gl_VertexID variables in the vertex shader.Subv2018-05-302-1/+11
| |/ / / /
* | | / / add IPC CommandType & Some HID FunctionInfo (#487)greggameplayer2018-05-302-0/+33
| |_|/ / |/| | |
* | | | Merge pull request #483 from bunnei/sonicSebastian Valle2018-05-305-10/+35
|\ \ \ \ | |_|/ / |/| | |
| * | | gl_shader_decompiler: F2F_R instruction: Implement abs.bunnei2018-05-301-1/+7
| * | | gl_shader_decompiler: Partially implement F2F_R instruction.bunnei2018-05-302-4/+9
| * | | nvhost_ctrl: Stub out IocCtrlEventRegister.bunnei2018-05-302-0/+10
| * | | nvhost_ctrl: Stub out IocCtrlEventWaitAsyncCommand.bunnei2018-05-302-5/+9
| * | | gl_rasterize_cache: Invert order of tex format RGB565.bunnei2018-05-301-1/+1
| |/ /
* / / GPU: Implemented the R8 texture format (0x1D)Subv2018-05-303-5/+18
|/ /
* | Merge pull request #480 from mailwl/bcatbunnei2018-05-308-0/+120
|\ \
| * | Service/BCAT: add module and servicesmailwl2018-05-288-0/+120
* | | add all the known TextureFormat (#474)greggameplayer2018-05-291-2/+71
|/ /
* | Merge pull request #472 from bunnei/greater-equalbunnei2018-05-271-4/+3
|\ \
| * | gl_shader_decompiler: Implement GetPredicateComparison GreaterEqual.bunnei2018-05-261-4/+3
* | | Merge pull request #476 from Subv/a1bgr5bunnei2018-05-274-5/+21
|\ \ \
| * | | GPU: Implemented the A1B5G5R5 texture format (0x14)Subv2018-05-274-5/+21
| |/ /
* | | Merge pull request #475 from ogniK5377/nvos-getconfigbunnei2018-05-271-1/+1
|\ \ \
| * | | NvOsGetConfigU32 should return null instead of 0 for default outputDavid Marcec2018-05-271-1/+1
| |/ /
* | | Merge pull request #473 from bunnei/get-display-versionbunnei2018-05-272-1/+10
|\ \ \
| * | | am: Stub IApplicationFunctions GetDisplayVersion.bunnei2018-05-262-1/+10
| |/ /
* / / shader_bytecode: Implement other variants of FMNMX.bunnei2018-05-262-4/+10
|/ /
* | Add & correct miscellaneous things (#470)greggameplayer2018-05-264-4/+55
* | Merge pull request #466 from mailwl/nv-timeoutbunnei2018-05-262-0/+16
|\ \
| * | Stub NVGPU_IOCTL_CHANNEL_SET_TIMEOUTmailwl2018-05-242-0/+16
* | | GetAudioRendererWorkBufferSize impl (#465)David2018-05-262-2/+88
* | | Merge pull request #468 from Subv/compound_predsbunnei2018-05-261-46/+66
|\ \ \
| * | | Shader: Implemented compound predicates in fset.Subv2018-05-251-28/+12
| * | | Shader: Implemented compound predicates in fsetp.Subv2018-05-251-19/+55
| |/ /
* | | Merge pull request #469 from Subv/channel_rebindbunnei2018-05-261-1/+0
|\ \ \
| * | | GPU: Allow command lists to rebind a channel to another engine in the middle of the command list.Subv2018-05-251-1/+0
| |/ /
* / / Stubbed NVGPU_GPU_IOCTL_ZBC_SET_TABLE (#463)David2018-05-252-0/+22
|/ /
* | yuzu_cmd: Fix project for latest msvc.bunnei2018-05-241-14/+12
* | Fix deadlocks caused from HID having too many layoutsDavid Marcec2018-05-241-1/+1
* | Merge pull request #460 from greggameplayer/patch-6bunnei2018-05-231-2/+8
|\ \
| * | Add & correct some error modulesgreggameplayer2018-05-231-2/+8
* | | Merge pull request #459 from greggameplayer/patch-5bunnei2018-05-233-29/+117
|\ \ \
| * | | change some functionsgreggameplayer2018-05-231-6/+6
| * | | correct placement and add size checkgreggameplayer2018-05-231-21/+25
| * | | Add ioctl commands with their params and size checkgreggameplayer2018-05-231-2/+86
| |/ /
* | | Merge pull request #454 from Subv/signal_processwidebunnei2018-05-231-83/+74
|\ \ \ | |/ / |/| |
| * | Kernel/SVC: Signal the highest priority threads first in svcSignalProcessWideKey.Subv2018-05-191-51/+68
| * | Kernel/Threads: Reschedule the proper core when operating on that core's threads.Subv2018-05-191-2/+6
| * | SVC: Removed unused WaitSynchronization1 functionSubv2018-05-191-30/+0
* | | Implemented NVHOST_IOCTL_CHANNEL_GET_WAITBASE (#440)David2018-05-222-1/+20
* | | Merge pull request #456 from Subv/unmap_bufferbunnei2018-05-216-1/+118
|\ \ \
| * | | GPU: Implemented the nvmap Free ioctl.Subv2018-05-202-1/+48
| * | | GPU: Implemented nvhost-as-gpu's UnmapBuffer ioctl.Subv2018-05-204-0/+70
| |/ /
* | | Correct audio command numbers & add or rename some functions (#455)greggameplayer2018-05-215-34/+34
* | | Merge pull request #457 from Subv/mutex_waitersbunnei2018-05-211-1/+0
|\ \ \
| * | | Mutex: Do not assert when the mutex waiting threads list isn't empty on mutex release.Subv2018-05-201-1/+0
| |/ /
* | | Merge pull request #458 from Subv/fmnmxbunnei2018-05-212-6/+26
|\ \ \
| * | | Shaders: Implemented the FMNMX shader instruction.Subv2018-05-212-6/+26
| |/ /
* | | Merge pull request #445 from greggameplayer/patch-2bunnei2018-05-213-6/+7
|\ \ \
| * | | rename fatal:u functions & add ThrowFatalgreggameplayer2018-05-181-2/+3
| * | | Properly update fatal.h void namegreggameplayer2018-05-181-2/+2
| * | | Properly rename fatal module functionsgreggameplayer2018-05-181-2/+2
| |/ /
* | | Merge pull request #453 from Subv/thread_callstackSebastian Valle2018-05-212-0/+37
|\ \ \
| * | | Qt/WaitTree: Display the callstack for each thread in the wait tree widget.Subv2018-05-192-0/+37
| |/ /
* | | Merge pull request #452 from Subv/psetpSebastian Valle2018-05-211-0/+3
|\ \ \
| * | | ShadersDecompiler: Added decoding for the PSETP instruction.Subv2018-05-191-0/+3
| |/ /
* | | Merge pull request #451 from Subv/gl_array_sizeSebastian Valle2018-05-212-13/+3
|\ \ \
| * | | GLRenderer: Remove unused hw_vao_enabled_attributes variable.Subv2018-05-192-4/+0
| * | | GLRenderer: Remove unused vertex buffer and increase the size of the stream buffer to 128 MB.Subv2018-05-192-9/+3
| |/ /
* | | Merge pull request #450 from Subv/shader_link_errorSebastian Valle2018-05-201-0/+27
|\ \ \
| * | | GLRenderer: Log the shader source code when program linking fails.Subv2018-05-191-0/+27
| |/ /
* | | Merge pull request #443 from ogniK5377/ipc-500Sebastian Valle2018-05-203-1/+7
|\ \ \
| * | | Added RequestWithContext & ControlWithContextDavid Marcec2018-05-173-1/+7
| |/ /
* | | Add and correct some Error Modules (#444)greggameplayer2018-05-201-6/+40
* | | Updated nfp with more service namesHexagon122018-05-131-24/+24
|/ /
* | Merge pull request #436 from bunnei/multi-corebunnei2018-05-1124-189/+613
|\ \
| * | core: Add several missing docstrings.bunnei2018-05-111-0/+8
| * | thread: Rename mask to affinity_masks.bunnei2018-05-114-5/+6
| * | core: Run all CPU cores separately, even in single-thread mode.bunnei2018-05-112-13/+23
| * | thread: Support core change on ResumeFromWait and improve ChangeCore.bunnei2018-05-111-37/+68
| * | scheduler: Protect scheduling functions with a global mutex.bunnei2018-05-112-0/+18
| * | wait_tree: Add ideal core and affinity mask.bunnei2018-05-111-0/+2
| * | thread: Initialize ideal_core and mask members.bunnei2018-05-111-0/+2
| * | threading: Reschedule only on cores that are necessary.bunnei2018-05-114-3/+10
| * | svc: Implement GetThreadCoreMask and SetThreadCoreMask.bunnei2018-05-111-7/+22
| * | thread: Implement ChangeCore function.bunnei2018-05-112-1/+58
| * | svc: SignalProcessWideKey should apply to all cores.bunnei2018-05-111-43/+50
| * | svc: Implement GetCurrentProcessorNumber.bunnei2018-05-111-2/+2
| * | wait_tree: Show all threads on all schedulers.bunnei2018-05-111-6/+14
| * | core: Add a configuration setting for use_multi_core.bunnei2018-05-1110-17/+56
| * | core: Support session close with multicore.bunnei2018-05-114-16/+47
| * | core: Implement multicore support.bunnei2018-05-1113-78/+113
| * | core: Create a thread for each CPU core, keep in lock-step with a barrier.bunnei2018-05-114-18/+94
| * | core: Move common CPU core things to its own class.bunnei2018-05-115-58/+135
* | | More accurate GetTPCMasks implDavid Marcec2018-05-112-4/+8
|/ /
* | Stubs for QLaunch (#428)Hexagon122018-05-074-5/+221
* | hid: Tweaks, Analog Sticks (#435)Max Thomas2018-05-073-68/+224
* | Merge pull request #434 from lioncash/vdtorbunnei2018-05-033-1/+13
|\ \
| * | memory_hook: Default virtual destructor in the cpp fileLioncash2018-05-033-1/+13
* | | core_timing: Don't include the log header in core timing's headerLioncash2018-05-032-48/+55
|/ /
* | Merge pull request #431 from lioncash/fmtbunnei2018-05-0229-104/+105
|\ \
| * | general: Make formatting of logged hex values more straightforwardLioncash2018-05-0229-104/+105
* | | Merge pull request #430 from lioncash/vecbunnei2018-05-021-9/+9
|\ \ \
| * | | vector_math: Ensure members are always initializedLioncash2018-05-021-9/+9
| |/ /
* / / ipc: Add support for PopIpcInterface() method.bunnei2018-05-024-0/+23
|/ /
* | Merge pull request #429 from Subv/ioctl_corruptionbunnei2018-05-012-5/+0
|\ \
| * | GPU: Don't write to invalid memory locations when handling ioctls that don't have an output.Subv2018-05-012-5/+0
* | | GetSharedFontInOrderOfPriority (#381)David2018-05-014-24/+54
|/ /
* | core_timing: Namespace all functions and constants in core_timing's headerLioncash2018-04-309-14/+18
* | Merge pull request #424 from lioncash/stringbunnei2018-04-308-99/+19
|\ \
| * | string_util: Remove StringFromFormat() and related functionsLioncash2018-04-308-99/+19
* | | Merge pull request #422 from bunnei/shader-movbunnei2018-04-304-0/+30
|\ \ \
| * | | maxwell_3d: Reset vertex counts after drawing.bunnei2018-04-291-0/+10
| * | | gl_shader_decompiler: Implement MOV_R.bunnei2018-04-291-1/+2
| * | | maxwell_to_gl: Implement type SignedNorm, Size_8_8_8_8.bunnei2018-04-291-0/+12
| * | | shader_bytecode: Add decoding for FMNMX instruction.bunnei2018-04-291-0/+2
| * | | gl_shader_decompiler: Implement MOV_C.bunnei2018-04-291-0/+5
* | | | file_util: Make move constructor/assignment operator and related functions noexceptLioncash2018-04-302-6/+6
* | | | file_util: Add static assertions to ReadBytes() and WriteBytes()Lioncash2018-04-301-2/+6
| |/ / |/| |
* | | Shaders: Implemented predicate condition 3 (LessEqual) in the fset and fsetp instructions.Subv2018-04-291-0/+7
|/ /
* | Merge pull request #416 from bunnei/shader-ints-p3bunnei2018-04-292-114/+206
|\ \
| * | gl_shader_decompiler: Partially implement I2I_R, and I2F_R.bunnei2018-04-292-8/+34
| * | gl_shader_decompiler: More cleanups, etc. with how we handle register types.bunnei2018-04-291-44/+120
| * | GLSLRegister: Simplify register declarations, etc.bunnei2018-04-291-63/+31
| * | shader_bytecode: Add decodings for i2i instructions.bunnei2018-04-291-3/+20
| * | gl_shader_decompiler: Implement MOV32_IMM instruction.bunnei2018-04-292-2/+7
* | | Merge pull request #417 from bunnei/lang-codesbunnei2018-04-293-8/+49
|\ \ \
| * | | am: Fix GetDesiredLanguage implementation.bunnei2018-04-291-2/+4
| * | | set: Fix GetAvailableLanguageCodes implementation.bunnei2018-04-292-6/+45
| |/ /
* / / fermi_2d: Fix surface copy block height.bunnei2018-04-292-2/+7
|/ /
* | file_util: Remove compiler version checks around is_trivially_copyable()Lioncash2018-04-281-8/+0
* | log: Remove old logging macros and functionsLioncash2018-04-272-54/+1
* | Merge pull request #408 from bunnei/shader-ints-p2bunnei2018-04-271-154/+262
|\ \
| * | gl_shader_decompiler: Add GLSLRegisterManager class to track register state.bunnei2018-04-271-154/+262
* | | renderer_opengl: Replace usages of LOG_GENERIC with fmt-capable equivalentsLioncash2018-04-271-6/+7
* | | core: Replace usages of LOG_GENERIC with new fmt-capable equivalentsLioncash2018-04-273-6/+4
|/ /
* | general: Convert assertion macros over to be fmt-compatibleLioncash2018-04-2717-39/+39
* | Merge pull request #380 from ogniK5377/service-implbunnei2018-04-2713-13/+140
|\ \
| * | Switched to NGLOG_WARNINGDavid Marcec2018-04-274-5/+5
| * | Merge branch 'master' of https://github.com/yuzu-emu/yuzu into service-implDavid Marcec2018-04-26110-2244/+1811
| |\ \
| * | | Added PREPO to logging backend, Removed comments from SaveReportWithUserDavid Marcec2018-04-263-13/+3
| * | | GetIUserInterface->CreateUserInterface, Added todos and stub logs. Playreport->PlayReport.David Marcec2018-04-2310-25/+64
| * | | lioncash proposed changesDavid2018-04-221-2/+2
| * | | Implemented GetIUserInterface properly, Playreport and SSL::SetInterfaceVersion. Fixed ipc issues with IAudioDevice(wrong ids)David Marcec2018-04-2211-11/+109
* | | | Merge pull request #406 from lioncash/frontendbunnei2018-04-275-27/+26
|\ \ \ \
| * | | | frontends: Move logging macros over to new fmt-capable onesLioncash2018-04-275-27/+26
* | | | | Merge pull request #407 from lioncash/commonbunnei2018-04-274-67/+67
|\ \ \ \ \
| * | | | | common: Move logging macros over to new fmt-capable macros where applicableLioncash2018-04-274-67/+67
| |/ / / /
* / / / / input_common: Move old logging macros over to fmt-capable onesLioncash2018-04-271-3/+3
|/ / / /
* | | | Merge pull request #402 from lioncash/corebunnei2018-04-276-28/+28
|\ \ \ \
| * | | | core: Replace remaining old non-generic logger usages with fmt-capable equivalentsLioncash2018-04-266-28/+28
* | | | | Merge pull request #399 from bunnei/shader-intsbunnei2018-04-272-9/+120
|\ \ \ \ \ | |_|_|/ / |/| | | |
| * | | | gl_shader_decompiler: Boilerplate for handling integer instructions.bunnei2018-04-262-6/+111
| * | | | gl_shader_decompiler: Move color output to EXIT instruction.bunnei2018-04-261-6/+12
| |/ / /
* / / / common: Remove chunk_file.h and linear_disk_cache.hLioncash2018-04-263-792/+0
|/ / /
* | | core/gdbstub: Move logging macros to new fmt-compatible onesLioncash2018-04-261-38/+37
* | | core/hw: Move logging macros over to fmt-capable onesLioncash2018-04-262-8/+10
* | | Merge pull request #396 from Subv/shader_opsbunnei2018-04-262-9/+89
|\ \ \
| * | | Shaders: Added bit decodings for the I2I instruction.Subv2018-04-251-0/+6
| * | | Shaders: Implemented the FSET instruction.Subv2018-04-251-0/+53
| * | | Shaders: Added decodings for the FSET instructions.Subv2018-04-252-9/+30
* | | | Merge pull request #398 from lioncash/kernelbunnei2018-04-2611-107/+110
|\ \ \ \
| * | | | kernel/shared_memory: Remove unnecessary semicolon at end of ConvertPermissions()Lioncash2018-04-261-1/+1
| * | | | kernel: Migrate logging macros to fmt-compatible onesLioncash2018-04-2611-106/+109
* | | | | Merge pull request #387 from Subv/maxwell_2dbunnei2018-04-2610-52/+203
|\ \ \ \ \
| * | | | | GPU: Partially implemented the Fermi2D surface copy operation.Subv2018-04-252-0/+59
| * | | | | Memory: Added a missing shortcut for Memory::CopyBlock for the current process.Subv2018-04-251-0/+4
| * | | | | GPU: Make the Textures::CopySwizzledData function accessible from the outside of the file.Subv2018-04-252-3/+6
| * | | | | GPU: Added a function to retrieve the bytes per pixel of the render target formats.Subv2018-04-252-0/+15
| * | | | | GPU: Added surface copy registers to Fermi2DSubv2018-04-251-1/+57
| * | | | | GPU: Added boilerplate code for the Fermi2D engineSubv2018-04-253-3/+34
| * | | | | GPU: Reduce the number of registers of Maxwell3D to 0xE00.Subv2018-04-252-5/+5
| * | | | | GPU: Move the Maxwell3D macro uploading code to the inside of the Maxwell3D processor.Subv2018-04-254-40/+23
| * | | | | GPU: Corrected the upper bound of the PFIFO method ids in the command processor.Subv2018-04-251-1/+1
* | | | | | Merge pull request #395 from lioncash/file-sysbunnei2018-04-268-68/+59
|\ \ \ \ \ \ | |_|/ / / / |/| | | | |
| * | | | | file-sys: convert a StringFromFormat call into fmt::format in GetFullPath()Lioncash2018-04-251-4/+1
| * | | | | file-sys: Move logging macros over to the new fmt-capable onesLioncash2018-04-258-64/+58
| | |/ / / | |/| | |
* | | | | Merge pull request #390 from mailwl/pctl-modulebunnei2018-04-257-39/+71
|\ \ \ \ \
| * | | | | Service/PCTL: convert to module, add services, stubmailwl2018-04-257-39/+71
| |/ / / /
* | | | | Merge pull request #397 from lioncash/corebunnei2018-04-251-24/+26
|\ \ \ \ \ | |_|/ / / |/| | | |
| * | | | core/memory: Amend address widths in assertsLioncash2018-04-251-2/+2
| * | | | core/memory: Move logging macros over to new fmt-capable onesLioncash2018-04-251-22/+24
| |/ / /
* / / / video-core: Move logging macros over to new fmt-capable onesLioncash2018-04-255-18/+20
|/ / /
* | | Merge pull request #388 from bunnei/refactor-rasterizer-cachebunnei2018-04-2514-175/+334
|\ \ \
| * | | renderer_opengl: Use correct byte order for framebuffer pixel format ABGR8.bunnei2018-04-251-2/+1
| * | | gl_rasterizer_cache: Use CHAR_BIT for bpp conversions instead of 8.bunnei2018-04-252-4/+4
| * | | gl_rasterizer_cache: Use GPU PAGE_BITS/SIZE, not CPU.bunnei2018-04-251-5/+5
| * | | gl_rasterizer_cache: Use new logger.bunnei2018-04-251-4/+4
| * | | gl_rasterizer_cache: Add a function for finding framebuffer GPU address.bunnei2018-04-253-0/+31
| * | | gl_rasterizer_cache: Handle compressed texture sizes.bunnei2018-04-252-24/+65
| * | | gl_rasterizer_cache: Update to be based on GPU addresses, not CPU addresses.bunnei2018-04-2510-67/+122
| * | | memory_manager: Add implement CpuToGpuAddress.bunnei2018-04-242-0/+27
| * | | memory_manager: Make GpuToCpuAddress return an optional.bunnei2018-04-247-28/+37
| * | | memory_manager: Use GPUVAdddr, not PAddr, for GPU addresses.bunnei2018-04-247-60/+57
* | | | loader: Move old logging macros over to new fmt-capable onesLioncash2018-04-255-26/+25
|/ / /
* | | Merge pull request #386 from Subv/gpu_querybunnei2018-04-242-2/+53
|\ \ \
| * | | GPU: Added asserts to our code for handling the QUERY_GET GPU command.Subv2018-04-242-2/+53
* | | | Merge pull request #392 from lioncash/logbunnei2018-04-2438-297/+298
|\ \ \ \
| * | | | service: Move logging macros over to new fmt-compatible onesLioncash2018-04-241-5/+5
| * | | | vi: Move logging macros over to new fmt-compatible onesLioncash2018-04-241-26/+27
| * | | | time: Move logging macros over to new fmt-compatible onesLioncash2018-04-241-12/+12
| * | | | ssl: Move logging macros over to new fmt-compatible onesLioncash2018-04-241-3/+3
| * | | | spl: Move logging macros over to new fmt-compatible onesLioncash2018-04-241-1/+1
| * | | | sockets: Move logging macros over to new fmt-compatible onesLioncash2018-04-242-7/+8
| * | | | sm: Move logging macros over to new fmt-compatible onesLioncash2018-04-242-9/+8
| * | | | set: Move logging macros over to new fmt-compatible onesLioncash2018-04-242-2/+2
| * | | | pctl: Move logging macros over to new fmt-compatible onesLioncash2018-04-241-1/+1
| * | | | nvflinger: Move logging macros over to new fmt-compatible onesLioncash2018-04-242-3/+3
| * | | | nvdrv: Move logging macros over to new fmt-compatible onesLioncash2018-04-247-60/+61
| * | | | ns: Move logging macros over to new fmt-compatible onesLioncash2018-04-241-6/+6
| * | | | nifm: Move logging macros over to new fmt-compatible onesLioncash2018-04-241-11/+11
| * | | | nfp: Move logging macros over to new fmt-compatible onesLioncash2018-04-241-1/+1
| * | | | lm: Move logging macros over to new fmt-compatible onesLioncash2018-04-241-6/+6
| * | | | hid: Move logging macros over to new fmt-compatible onesLioncash2018-04-241-25/+25
| * | | | friend: Move logging macros over to new fmt-compatible onesLioncash2018-04-241-1/+1
| * | | | filesystem: Move logging macros over to new fmt-compatible onesLioncash2018-04-242-30/+29
| * | | | fatal: Move logging macros over to new fmt-compatible onesLioncash2018-04-241-2/+2
| * | | | audio: Move logging macros over to new fmt-compatible onesLioncash2018-04-242-21/+21
| * | | | apm: Move logging macros over to new fmt-compatible onesLioncash2018-04-241-3/+3
| * | | | aoc: Move logging macros over to new fmt-compatible onesLioncash2018-04-241-2/+2
| * | | | am: Move logging macros over to new fmt-compatible onesLioncash2018-04-243-50/+50
| * | | | acc: Move logging macros over to new fmt-compatible onesLioncash2018-04-241-10/+10
* | | | | renderer_opengl: Silence a -Wdangling-else warning in DrawScreenTriangles()Lioncash2018-04-241-1/+2
|/ / / /
* | | | Service/FS: implement IFileSystem::RenameFilemailwl2018-04-246-8/+36
* | | | Merge pull request #379 from Subv/multi_buffersbunnei2018-04-243-43/+89
|\ \ \ \
| * | | | GPU: Support multiple enabled vertex arrays.Subv2018-04-233-43/+89
| |/ / /
* | | | Merge pull request #370 from Subv/sync_primitivesbunnei2018-04-2316-525/+285
|\ \ \ \
| * | | | Kernel: Implemented mutex priority inheritance.Subv2018-04-234-10/+94
| * | | | Kernel: Use 0x2C as default main thread priority for homebrew and lone NRO/NSOsSubv2018-04-213-3/+3
| * | | | Qt: Update the WaitTree widget to show info about the current mutex of each thread.Subv2018-04-215-90/+55
| * | | | Kernel: Remove unused ConditionVariable class.Subv2018-04-216-150/+0
| * | | | Kernel: Remove old and unused Mutex code.Subv2018-04-214-209/+3
| * | | | Kernel: Properly implemented svcWaitProcessWideKey and svcSignalProcessWideKeySubv2018-04-211-83/+46
| * | | | Kernel: Corrected the implementation of svcArbitrateLock and svcArbitrateUnlock.Subv2018-04-216-22/+126
* | | | | Merge pull request #384 from Subv/nvhost-remapbunnei2018-04-232-0/+57
|\ \ \ \ \
| * | | | | NvDrv/nvhost-as-gpu: Ensure that the object passed to MapBufferEx has already been allocated.Subv2018-04-231-0/+10
| * | | | | Nvdrv/nvhost-as-gpu: Implemented the ioctl REMAP command.Subv2018-04-232-0/+47
| | |/ / / | |/| | |
* | | | | Merge pull request #385 from Subv/unimpl_ioctlsbunnei2018-04-235-5/+5
|\ \ \ \ \
| * | | | | Nvdrv: Assert when receiving an unimplemented ioctl in the nv* handlers.Subv2018-04-235-5/+5
| |/ / / /
* | | | | Merge pull request #383 from Subv/gpu_mmubunnei2018-04-232-34/+25
|\ \ \ \ \
| * | | | | GPU: Make the GPU virtual memory manager use 16 page bits and 10 page table bits.Subv2018-04-232-34/+25
| |/ / / /
* | | / / GPU: Implement the RGB10_A2 RenderTarget format, it will use the same format as the A2BGR10 texture format.Subv2018-04-232-0/+4
| |_|/ / |/| | |
* | | | GPU: Implement the A2BGR10 texture format.Subv2018-04-224-6/+18
|/ / /
* | | Merge pull request #377 from adityaruplaha/sdl2-fullscreenbunnei2018-04-213-4/+40
|\ \ \
| * | | SDL2: Implement fullscreen. (Original PR: citra-emu/citra#3607)adityaruplaha2018-04-213-4/+40
* | | | Merge pull request #376 from bunnei/shader-decoderbunnei2018-04-212-210/+249
|\ \ \ \
| * | | | gl_shader_decompiler: Skip RRO instruction.bunnei2018-04-211-0/+4
| * | | | gl_shader_decompiler: Cleanup error logging.bunnei2018-04-211-14/+6
| * | | | shader_bytecode: Add several more instruction decodings.bunnei2018-04-211-5/+52
| * | | | shader_bytecode: Decode instructions based on bit strings.bunnei2018-04-212-205/+201
* | | | | Merge pull request #375 from lioncash/headerbunnei2018-04-214-11/+0
|\ \ \ \ \ | |/ / / / |/| | | |
| * | | | opengl: Remove unnecessary header inclusionsLioncash2018-04-214-11/+0
* | | | | Merge pull request #369 from Subv/shader_instr2bunnei2018-04-212-4/+179
|\ \ \ \ \
| * | | | | ShaderGen: Implemented the KIL instruction, which is equivalent to 'discard'.Subv2018-04-211-1/+7
| * | | | | ShaderGen: Implemented predicated instruction execution.Subv2018-04-212-1/+40
| * | | | | ShaderGen: Implemented the fsetp instruction.Subv2018-04-212-3/+112
| * | | | | ShaderGen: Register id 255 is special and is hardcoded to return 0 (SR_ZERO).Subv2018-04-202-0/+5
| * | | | | ShaderGen: Ignore the 'sched' instruction when generating shaders.Subv2018-04-201-0/+16
| | |_|/ / | |/| | |
* | | | | Merge pull request #374 from lioncash/noexceptbunnei2018-04-211-20/+19
|\ \ \ \ \
| * | | | | gl_resource_manager: Add missing noexcept specifiers to move constructors and assignment operatorsLioncash2018-04-211-20/+19
| | |/ / / | |/| | |
* | | | | Merge pull request #373 from lioncash/enum2bunnei2018-04-211-4/+9
|\ \ \ \ \
| * | | | | gl_rasterizer_cache: Make MatchFlags an enum classLioncash2018-04-211-4/+9
| |/ / / /
* | | | | Merge pull request #372 from lioncash/enumbunnei2018-04-213-38/+38
|\ \ \ \ \
| * | | | | resource_limit: Make ResourceTypes an enum classLioncash2018-04-213-38/+38
| |/ / / /
* / / / / core: Relocate g_service_manager to the System classLioncash2018-04-216-38/+66
|/ / / /
* | | | Merge pull request #340 from mailwl/vi-updatebunnei2018-04-201-7/+27
|\ \ \ \ | |/ / / |/| | |
| * | | Service/VI: stub SetLayerVisibility, fix GetDisplayResolution outputmailwl2018-04-171-7/+27
* | | | Merge pull request #367 from lioncash/clampbunnei2018-04-205-24/+22
|\ \ \ \
| * | | | math_util: Remove the Clamp() functionLioncash2018-04-205-24/+22
* | | | | Merge pull request #361 from lioncash/commonbunnei2018-04-201-18/+12
|\ \ \ \ \
| * | | | | common_types: Convert typedefs to using aliasesLioncash2018-04-201-12/+12
| * | | | | common_types: Remove unnecessary check for whether or not__func__ is definedLioncash2018-04-201-6/+0
| |/ / / /
* | | | | Merge pull request #360 from lioncash/namespacesbunnei2018-04-20136-570/+273
|\ \ \ \ \
| * | | | | service: Use nested namespace specifiers where applicableLioncash2018-04-20136-570/+273
| |/ / / /
* | | | | Merge pull request #364 from lioncash/thread-localbunnei2018-04-201-19/+0
|\ \ \ \ \
| * | | | | common/thread: Remove unnecessary feature checking for thread_localLioncash2018-04-201-19/+0
| |/ / / /
* | | | | Merge pull request #362 from lioncash/snprintfbunnei2018-04-201-5/+0
|\ \ \ \ \
| * | | | | common_funcs: Remove check for VS versions that we don't even supportLioncash2018-04-201-5/+0
| |/ / / /
* | | | | Merge pull request #363 from lioncash/array-sizebunnei2018-04-203-5/+4
|\ \ \ \ \
| * | | | | common_funcs: Remove ARRAY_SIZE macroLioncash2018-04-203-5/+4
| |/ / / /
* | | | | Merge pull request #366 from lioncash/vecbunnei2018-04-201-30/+0
|\ \ \ \ \
| * | | | | vector_math: Remove AsArray() and Write() functions from Vec[2,3,4]Lioncash2018-04-201-30/+0
* | | | | | Merge pull request #365 from lioncash/codeblockbunnei2018-04-202-86/+0
|\ \ \ \ \ \
| * | | | | | common: Remove code_block.hLioncash2018-04-202-86/+0
| | |/ / / / | |/| | | |
* | | | | | Merge pull request #357 from lioncash/guardbunnei2018-04-202-0/+4
|\ \ \ \ \ \
| * | | | | | renderer_opengl: Add missing header guardsLioncash2018-04-202-0/+4
| |/ / / / /
* | | | | | Merge pull request #358 from lioncash/explicitbunnei2018-04-202-4/+3
|\ \ \ \ \ \
| * | | | | | disk_filesystem: Remove unused total_entries_in_directory member from Disk_DirectoryLioncash2018-04-201-1/+0
| * | | | | | disk_filesystem: Remove redundant initializer in Disk_Directory's constructorLioncash2018-04-201-1/+1
| * | | | | | disk_filesystem: Make constructors explicit where applicableLioncash2018-04-201-2/+2
| |/ / / / /
* / / / / / vi: Remove redundant initializers in the constructorsLioncash2018-04-201-9/+5
|/ / / / /
* | | | | Merge pull request #356 from lioncash/shaderbunnei2018-04-201-12/+30
|\ \ \ \ \ | |/ / / / |/| | | |
| * | | | glsl_shader_decompiler: Use std::string_view instead of std::string for AddLine()Lioncash2018-04-201-1/+2
| * | | | glsl_shader_decompiler: Add AddNewLine() function to ShaderWriterLioncash2018-04-201-6/+12
| * | | | glsl_shader_decompiler: Add char overload for ShaderWriter's AddLine()Lioncash2018-04-201-4/+11
| * | | | glsl_shader_decompiler: Append indentation without constructing a separate std::stringLioncash2018-04-201-1/+5
* | | | | Merge pull request #355 from Subv/shader_instrbunnei2018-04-202-11/+39
|\ \ \ \ \ | |/ / / / |/| | | |
| * | | | ShaderGen: Implemented the fmul32i shader instruction.Subv2018-04-192-9/+30
| * | | | ShaderGen: Fixed a case where the TEXS instruction would use the same registers for the input and the output.Subv2018-04-191-2/+9
* | | | | Implement Pull #3528 from citra: use nvidia graphics automatically on laptops with optimus (with AMD support) (#271)N00byKing2018-04-192-0/+18
* | | | | Merge pull request #352 from bunnei/fix-microprofileJames Rowe2018-04-191-0/+3
|\ \ \ \ \ | |/ / / / |/| | | |
| * | | | nvflinger: Call MicroProfileFlip on NVFlinger::Compose.bunnei2018-04-191-0/+3
* | | | | GPU: Add support for the DXT23 and DXT45 compressed texture formats.Subv2018-04-193-28/+35
* | | | | Merge pull request #351 from Subv/tex_formatsbunnei2018-04-194-8/+28
|\ \ \ \ \
| * | | | | GPU: Implemented the B5G6R5 format.Subv2018-04-194-8/+28
* | | | | | gl_shader_gen: Support vertical/horizontal viewport flipping. (#347)bunnei2018-04-184-5/+29
|/ / / / /
* | | | | GLCache: Added boilerplate code to make supporting configurable texture component types.Subv2018-04-183-9/+69
* | | | | GLCache: Unify texture and framebuffer formats when converting to OpenGL.Subv2018-04-182-26/+13
* | | | | GPU: Texture format 8 and framebuffer format 0xD5 are actually ABGR8.Subv2018-04-182-10/+10
* | | | | GPU: Pitch textures are now supported, don't assert when encountering them.Subv2018-04-181-2/+3
* | | | | GLCache: Take into account the texture's block height when caching and unswizzling.Subv2018-04-183-43/+43
* | | | | GLCache: Added a function to convert cached PixelFormats back to texture formats.Subv2018-04-181-0/+12
* | | | | GPU: Allow using a configurable block height when unswizzling textures.Subv2018-04-184-7/+23
* | | | | GPU/TIC: Added the pitch and block height fields to the TIC structure.Subv2018-04-181-1/+16
|/ / / /
* | | | Merge pull request #346 from bunnei/misc-gpu-improvementsbunnei2018-04-184-2/+11
|\ \ \ \
| * | | | gl_rasterizer_cache: Add missing LOG statements.bunnei2018-04-181-0/+3
| * | | | texture: Add missing formats.bunnei2018-04-181-1/+3
| * | | | gpu: Add several framebuffer formats to RenderTargetFormat.bunnei2018-04-181-0/+3
| * | | | maxwell3d: Allow Texture2DNoMipmap as Texture2D.bunnei2018-04-181-1/+2
* | | | | Merge pull request #344 from bunnei/shader-decompiler-p2bunnei2018-04-184-73/+180
|\ \ \ \ \
| * | | | | shader_bytecode: Make ctor's constexpr and explicit.bunnei2018-04-181-7/+7
| * | | | | bit_field: Remove is_pod check, add is_trivially_copyable_v.bunnei2018-04-181-6/+1
| * | | | | gl_shader_decompiler: Fix warnings with MarkAsUsed.bunnei2018-04-171-1/+2
| * | | | | gl_shader_decompiler: Cleanup logging, updating to NGLOG_*.bunnei2018-04-171-24/+22
| * | | | | gl_shader_decompiler: Implement several MUFU subops and abs_d.bunnei2018-04-171-7/+21
| * | | | | gl_shader_decompiler: Fix swizzle in GetRegister.bunnei2018-04-171-1/+1
| * | | | | gl_shader_decompiler: Implement FMUL/FADD/FFMA immediate instructions.bunnei2018-04-172-12/+53
| * | | | | gl_shader_decompiler: Allow vertex position to be used in fragment shader.bunnei2018-04-172-16/+18
| * | | | | gl_shader_decompiler: Implement IPA instruction.bunnei2018-04-171-0/+11
| * | | | | gl_shader_decompiler: Add support for TEXS instruction.bunnei2018-04-172-12/+43
| * | | | | gl_shader_decompiler: Use fragment output color for GPR 0-3.bunnei2018-04-171-0/+5
| * | | | | gl_shader_decompiler: Partially implement MUFU.bunnei2018-04-171-2/+11
| |/ / / /
* / / / / renderer_opengl: Implement BlendEquation and BlendFunc.bunnei2018-04-186-7/+140
|/ / / /
* | | | Merge pull request #341 from shinyquagsire23/pfs-hfs-implbunnei2018-04-173-0/+214
|\ \ \ \ | |/ / / |/| | |
| * | | file_sys: Use NGLOGshinyquagsire232018-04-171-5/+5
| * | | file_sys: tweaksshinyquagsire232018-04-162-6/+7
| * | | file_sys: Add HFS/PFS helper componentshinyquagsire232018-04-163-0/+213
* | | | Merge pull request #343 from Subv/tex_wrap_4bunnei2018-04-171-0/+7
|\ \ \ \
| * | | | MaxwellToGL: Implemented tex wrap mode 1 (Wrap, GL_REPEAT).Subv2018-04-171-0/+2
| * | | | MaxwellToGL: Added a TODO and partial implementation of maxwell wrap mode 4 (Clamp, GL_CLAMP).Subv2018-04-171-0/+5
| |/ / /
* | | | Various service name fixes - part 2 (rebased) (#322)Hexagon122018-04-1713-11/+207
* | | | gl_rendering: Use NGLOG* for changed code.bunnei2018-04-172-10/+11
* | | | gl_rasterizer: Implement indexed vertex mode.bunnei2018-04-175-23/+92
|/ / /
* | | Merge pull request #338 from bunnei/unrequire-shared-fontbunnei2018-04-151-17/+14
|\ \ \
| * | | pl_u: Use empty shared font if none is available.bunnei2018-04-151-17/+14
* | | | Merge pull request #337 from Subv/used_buffersbunnei2018-04-155-12/+59
|\ \ \ \
| * | | | GPU: Use the same buffer names in the generated GLSL and the buffer uploading code.Subv2018-04-154-17/+24
| * | | | GPU: Don't use explicit binding points when uploading the constbuffers to opengl.Subv2018-04-153-7/+47
* | | | | Merge pull request #335 from bunnei/delete-filebunnei2018-04-156-9/+27
|\ \ \ \ \ | |/ / / / |/| | | |
| * | | | fsp_srv: Implement DeleteFile.bunnei2018-04-156-9/+27
| |/ / /
* | | | GPU: Don't use GetPointer when uploading the constbuffer data to the GPU.Subv2018-04-151-3/+4
* | | | GPU: Use the buffer hints from the shader decompiler to upload only the necessary const buffers for each shader stage.Subv2018-04-153-31/+41
|/ / /
* | | shaders: Expose hints about used const buffers.bunnei2018-04-155-31/+146
* | | GPU: Upload the entirety of each constbuffer for each shader stage as SSBOs.Subv2018-04-154-14/+48
* | | GPU: Allow configuring ssbos in the opengl state manager.Subv2018-04-154-0/+30
* | | GPU: Added a function to determine whether a shader stage is enabled or not.Subv2018-04-153-3/+27
* | | Merge pull request #332 from bunnei/fix-total-mem-usagebunnei2018-04-151-1/+1
|\ \ \
| * | | vm_manager: Increase GetTotalMemoryUsage value.bunnei2018-04-151-1/+1
| |/ /
* | | Merge pull request #327 from adityaruplaha/fullscreen-fixbunnei2018-04-151-2/+4
|\ \ \
| * | | Fix the stuck in fullscreen bug (Original PR: citra-emu/citra#3611)adityaruplaha2018-04-141-2/+4
| |/ /
* | | Merge pull request #331 from bunnei/fsp-flushbunnei2018-04-151-1/+9
|\ \ \
| * | | fsp_srv: Implement IFile::Flush.bunnei2018-04-151-1/+9
| |/ /
* | | shaders: Add NumTextureSamplers const, remove unused #pragma.bunnei2018-04-154-4/+5
* | | shaders: Address PR review feedback.bunnei2018-04-142-7/+9
* | | gl_shader_decompiler: Cleanup log statements.bunnei2018-04-141-15/+15
* | | shaders: Fix GCC and clang build issues.bunnei2018-04-143-5/+5
* | | gl_shader_decompiler: Implement negate, abs, etc. and lots of cleanup.bunnei2018-04-142-40/+96
* | | shader_bytecode: Add FSETP and KIL to GetInfo.bunnei2018-04-141-0/+3
* | | shader_bytecode: Add SubOp decoding.bunnei2018-04-141-0/+10
* | | gl_shader_decompiler: Add shader stage hint.bunnei2018-04-142-5/+12
* | | renderer_opengl: Fix Morton copy byteswap, etc.bunnei2018-04-142-6/+6
* | | gl_shader_manager: Implement SetShaderSamplerBindings.bunnei2018-04-141-0/+8
* | | gl_rasterizer: Generate shaders and upload uniforms.bunnei2018-04-142-32/+77
* | | gl_shader_decompiler: Basic impl. for very simple vertex shaders.bunnei2018-04-142-16/+311
* | | gl_shader_manager: Cleanup and consolidate uniform handling.bunnei2018-04-142-26/+24
* | | maxwell_3d: Make memory_manager public.bunnei2018-04-141-2/+1
* | | maxwell_3d: Fix shader_config decodings.bunnei2018-04-141-6/+3
* | | gl_rasterizer: Use shader program manager, remove test shader.bunnei2018-04-142-196/+31
* | | renderer_opengl: Add gl_shader_manager class.bunnei2018-04-143-0/+209
* | | maxwell_to_gl: Add a few types, etc.bunnei2018-04-141-0/+10
* | | gl_shader_gen: Add hashable setup/config structs.bunnei2018-04-142-29/+50
* | | gl_shader_util: Add missing includes.bunnei2018-04-141-0/+2
* | | common: Port cityhash code from Citra.bunnei2018-04-145-147/+502
* | | renderer_opengl: Use OGLProgram instead of OGLShader.bunnei2018-04-146-6/+6
* | | gl_shader_util: Grab latest upstream.bunnei2018-04-142-149/+74
* | | gl_resource_manager: Grab latest upstream.bunnei2018-04-141-30/+86
* | | gl_shader_decompiler: Add skeleton code from Citra for shader analysis.bunnei2018-04-142-44/+142
* | | shader_bytecode: Add initial module for shader decoding.bunnei2018-04-142-0/+298
* | | bit_field: Make all methods constexpr.bunnei2018-04-141-5/+5
|/ /
* | Merge pull request #323 from Hexagon12/stub-hidbunnei2018-04-131-1/+7
|\ \
| * | Stubbed out GetPlayerLedPatternHexagon122018-04-131-1/+7
* | | Fixed normal params in GetDisplayResolutionHexagon122018-04-131-1/+1
|/ /
* | Merge pull request #319 from Hexagon12/service-name-fixbunnei2018-04-1321-65/+413
|\ \
| * | Various fixes and clangHexagon122018-04-116-115/+108
| * | Decimal changeHexagon122018-04-101-4/+4
| * | Updated pctl:a with new service names.Hexagon122018-04-101-4/+101
| * | Updated nvmemp with new service names.Hexagon122018-04-101-4/+4
| * | Updated nvdrv with more service names.Hexagon122018-04-101-0/+7
| * | Updated pl:u with more service names.Hexagon122018-04-101-1/+3
| * | Updated hid with more service names.Hexagon122018-04-101-0/+50
| * | Updated friend:u with more service names.Hexagon122018-04-101-1/+2
| * | Updated the unknown nameHexagon122018-04-101-1/+1
| * | Updated friend:a with more service names.Hexagon122018-04-101-1/+2
| * | Updated fsp-srv with more service names.Hexagon122018-04-101-4/+102
| * | Updated CodecCtl with more service names.Hexagon122018-04-101-3/+3
| * | Updated audren with more service names.Hexagon122018-04-101-10/+14
| * | Updated audrec with more service names.Hexagon122018-04-101-7/+9
| * | Updated audout with more service names.Hexagon122018-04-101-13/+16
| * | Updated audin with more service names.Hexagon122018-04-101-9/+16
| * | Updated AOC with more service names.Hexagon122018-04-101-0/+1
| * | Updated AppletOE with more service names.Hexagon122018-04-101-0/+1
| * | Updated AppletAE with more service names.Hexagon122018-04-101-0/+1
| * | Updated AM with more service names.Hexagon122018-04-101-2/+82
* | | Service/SSL: update service according switchbrewmailwl2018-04-112-1/+98
* | | Service/ACC: convert to module, add acc:aa, acc:su, acc:u1 servicesmailwl2018-04-1011-127/+342
|/ /
* | Merge pull request #314 from jroweboy/tegra-progress-3bbunnei2018-04-089-173/+274
|\ \
| * | Fix clang format issuesJames Rowe2018-04-071-1/+1
| * | GPU: Assert when finding a texture with a format type other than UNORM.Subv2018-04-072-4/+16
| * | GL: Set up the textures used for each draw call.Subv2018-04-072-2/+39
| * | GL: Bind the textures to the shaders used for drawing.Subv2018-04-071-2/+11
| * | GLCache: Specialize the MortonCopy function for the DXT1 texture format.Subv2018-04-071-1/+15
| * | GLCache: Implemented GetTextureSurface.Subv2018-04-071-3/+28
| * | GLCache: Support uploading compressed textures to the GPU.Subv2018-04-071-5/+17
| * | GL: Remove remaining references to 3DS-specific pixel formatsSubv2018-04-071-83/+22
| * | RasterizerCache: Remove 3DS-specific pixel formats.Subv2018-04-072-71/+32
| * | GL: Create the sampler objects when starting up the GL rasterizer.Subv2018-04-071-0/+6
| * | GL: Ported the SamplerInfo struct from citra.Subv2018-04-072-1/+59
| * | GL: Rename PicaTexture to MaxwellTexture.Subv2018-04-072-2/+2
| * | GL: Added functions to convert Maxwell tex filters and wrap modes to OpenGL.Subv2018-04-071-0/+23
| * | Textures: Added a helper function to know if a texture is blocklinear or pitch.Subv2018-04-071-0/+5
* | | Merge pull request #315 from jroweboy/spelling-fixbunnei2018-04-072-3/+3
|\ \ \
| * | | Fix spelling of InitializeJames Rowe2018-04-072-3/+3
| |/ /
* / / Prevent crash from uninitialized telemetryJames Rowe2018-04-071-2/+1
|/ /
* | Merge pull request #310 from N00byKing/patch-1bunnei2018-04-065-10/+10
|\ \
| * | rasterizer_interface.h: Update from citra to yuzuN00byKing2018-04-041-3/+3
| * | default_ini.h: Update from citra to yuzuN00byKing2018-04-041-1/+1
| * | gl_rasterizer_cache.cpp: Update from citra to yuzuN00byKing2018-04-041-1/+1
| * | gl_rasterizer_cache.h: Update from citra to yuzuN00byKing2018-04-041-3/+3
| * | renderer_opengl.h: Update from citra to yuzuN00byKing2018-04-041-2/+2
* | | core, main.h: Abort on 32Bit ROMs (#309)N00byKing2018-04-065-1/+17
* | | Update fmtlib to fix msvc warningsJames Rowe2018-04-062-5/+8
|/ /
* | svc: Stub out SetThreadActivity, GetThreadContext.bunnei2018-04-032-2/+19
* | audren_u: Stub out GetActiveAudioDeviceName.bunnei2018-04-031-1/+13
* | audout_u: Implement GetAudioOutState.bunnei2018-04-031-1/+8
* | nifm: GetResult does not return a data field.bunnei2018-04-031-2/+1
* | vi: Implement GetDisplayResolution.bunnei2018-04-032-0/+26
* | shared_memory: Remove incorrect 3ds-specific check.bunnei2018-04-031-12/+0
* | service: Add friend:u interface.bunnei2018-04-034-0/+41
* | logging: Change FmtLogMessage to use variadic template instead of FMT_VARIADICDaniel Lim Wee Soong2018-04-032-5/+11
* | Merge pull request #262 from daniellimws/fmtlib-macrosbunnei2018-04-0311-68/+112
|\ \
| * | Remove dependency chronoDaniel Lim Wee Soong2018-03-221-1/+0
| * | Change "yuzu starting..." to be logged with the new macroDaniel Lim Wee Soong2018-03-221-1/+1
| * | Logging: Create logging macros based on fmtlibDaniel Lim Wee Soong2018-03-2210-67/+112
* | | Merge pull request #267 from N00byKing/patch-1bunnei2018-04-032-14/+14
|\ \ \
| * | | yuzu.cpp: Update Link from citra to yuzuN00byKing2018-03-261-1/+1
| * | | main.cpp: Replace Citra with yuzu Wiki LinksN00byKing2018-03-251-4/+4
| * | | main.cpp: Update Dialog from citra to yuzuN00byKing2018-03-251-11/+11
* | | | Merge pull request #276 from N00byKing/acctoyuzubunnei2018-04-034-10/+10
|\ \ \ \
| * | | | telemetry.h: Reword comment from citra to yuzuN00byKing2018-03-271-1/+1
| * | | | telemetry_session.h: Reword Documentation Comment from citra to yuzuN00byKing2018-03-271-2/+2
| * | | | Remove Links to citra ServicesN00byKing2018-03-271-2/+2
| * | | | Change Telemetry Names to yuzuN00byKing2018-03-272-5/+5
* | | | | Merge pull request #304 from daniellimws/fix-openbsdbunnei2018-04-032-7/+19
|\ \ \ \ \
| * | | | | externals: Update fmt to 4d35f94Daniel Lim Wee Soong2018-04-021-6/+6
| * | | | | common: fix swap functions on Bitrig and OpenBSDDaniel Lim Wee Soong2018-04-021-1/+13
* | | | | | deconstructed_rom_directory.cpp: Fix TypoN00byKing2018-04-031-1/+1
|/ / / / /
* | | | | Merge pull request #297 from bunnei/hid-touch-statebunnei2018-04-021-5/+21
|\ \ \ \ \
| * | | | | hid: Write empty touch screen state.bunnei2018-04-011-5/+21
* | | | | | Merge pull request #296 from bunnei/misc-mem-fsp-fixesbunnei2018-04-0210-16/+49
|\ \ \ \ \ \
| * | | | | | hle_ipc, fsp_srv: Cleanup logging.bunnei2018-04-012-3/+3
| * | | | | | hid: Stub out GetSupportedNpadStyleSet.bunnei2018-03-311-0/+8
| * | | | | | hle_ipc: Do not ensure write buffer size.bunnei2018-03-311-2/+5
| * | | | | | fsp_srv: Implement GetSize and SetSize.bunnei2018-03-312-4/+24
| * | | | | | memory: Fix stack region.bunnei2018-03-316-10/+12
| |/ / / / /
* | | | | | Merge pull request #288 from Subv/macro_interpreterbunnei2018-04-025-121/+444
|\ \ \ \ \ \ | |/ / / / / |/| | | | |
| * | | | | GPU: Use the MacroInterpreter class to execute the GPU macros instead of HLEing them.Subv2018-04-012-121/+13
| * | | | | GPU: Implemented a gpu macro interpreter.Subv2018-04-015-0/+431
* | | | | | Merge pull request #293 from N00byKing/drkthmbunnei2018-03-317-0/+79
|\ \ \ \ \ \
| * | | | | | Port citra-emu/citra#3610 to yuzuN00byKing2018-03-302-3/+7
| * | | | | | Remove whitespacesN00byKing2018-03-301-1/+1
| * | | | | | Add Dark theme, Icon themingN00byKing2018-03-307-0/+75
* | | | | | | audren_u: Stub QueryAudioDeviceSystemEvent and GetActiveChannelCount.bunnei2018-03-301-8/+36
* | | | | | | svc: Stub GetThreadCoreMask.bunnei2018-03-302-3/+26
* | | | | | | service: Add NFP module interface.bunnei2018-03-308-0/+101
|/ / / / / /
* / / / / / result: Check against self-assignment in ResultVal's copy assignment operatorLioncash2018-03-291-0/+3
|/ / / / /
* | | | | Merge pull request #286 from N00byKing/citratoyuzuagainbunnei2018-03-281-5/+2
|\ \ \ \ \
| * | | | | main.h: Add pragma once, remove ifndefN00byKing2018-03-271-5/+2
* | | | | | Merge pull request #284 from bunnei/docked-configbunnei2018-03-279-61/+88
|\ \ \ \ \ \ | |_|/ / / / |/| | | | |
| * | | | | settings: Remove unused CpuCore class.bunnei2018-03-271-5/+0
| * | | | | config: Use simplified checkbox (from Citra) for CPU JIT.bunnei2018-03-278-46/+33
| * | | | | config: Rename is_docked to use_docked_mode to be consistent with other config bools.bunnei2018-03-277-14/+14
| * | | | | configure_general: Cleanup naming.bunnei2018-03-271-14/+14
| * | | | | qt: Add config option for is_docked.bunnei2018-03-272-0/+23
| * | | | | config: Add setting for whether the system is docked or not.bunnei2018-03-275-2/+24
* | | | | | Merge pull request #282 from N00byKing/patch-2bunnei2018-03-273-3/+3
|\ \ \ \ \ \ | |/ / / / / |/| | | | |
| * | | | | log.h: Change comment from citra to yuzuN00byKing2018-03-261-1/+1
| * | | | | file_util.h: Update Comment from citra to yuzuN00byKing2018-03-261-1/+1
| * | | | | cpu_detect.cpp: Change comment from citra to yuzuN00byKing2018-03-261-1/+1
| |/ / / /
* | | | | renderer_opengl: Use better naming for DrawScreens and DrawSingleScreen.bunnei2018-03-272-8/+8
* | | | | graphics_surface: Remove superfluous cast.bunnei2018-03-271-2/+1
* | | | | gl_rasterizer: Move code to bind framebuffer surfaces before draw to its own function.bunnei2018-03-272-22/+31
* | | | | gl_rasterizer: Add a SyncViewport method.bunnei2018-03-273-18/+30
* | | | | gl_rasterizer: Move PrimitiveTopology check to MaxwellToGL.bunnei2018-03-272-11/+12
* | | | | graphics_surface: Fix merge conflicts.bunnei2018-03-272-3/+4
* | | | | gl_rasterizer: Use ReadBlock instead of GetPointer for SetupVertexArray.bunnei2018-03-271-1/+1
* | | | | gl_rasterizer: Normalize vertex array data as appropriate.bunnei2018-03-272-1/+5
* | | | | memory: Fix cast for ReadBlock/WriteBlock/ZeroBlock/CopyBlock.bunnei2018-03-271-4/+8
* | | | | maxwel_to_gl: Fix string formatting in log statements.bunnei2018-03-271-2/+2
* | | | | rasterizer: Rename DrawTriangles to DrawArrays.bunnei2018-03-273-5/+5
* | | | | gl_rasterizer: Use passthrough shader for SetupVertexShader.bunnei2018-03-271-1/+2
* | | | | renderer_opengl: Logging, etc. cleanup.bunnei2018-03-276-33/+34
* | | | | renderer_opengl: Remove framebuffer RasterizerFlushVirtualRegion hack.bunnei2018-03-271-5/+0
* | | | | gl_rasterizer_cache: Implement UpdatePagesCachedCount.bunnei2018-03-272-8/+37
* | | | | memory: Add RasterizerMarkRegionCached code and cleanup.bunnei2018-03-272-200/+195
* | | | | gl_rasterizer: Implement SetupVertexArray.bunnei2018-03-271-20/+38
* | | | | gl_rasterizer_cache: Fix an ASSERT_MSG.bunnei2018-03-271-1/+1
* | | | | maxwell_to_gl: Add module and function for decoding VertexType.bunnei2018-03-272-0/+41
* | | | | maxwell_3d: Use names that match envytools for VertexType.bunnei2018-03-271-8/+8
* | | | | maxwell_3d: Add VertexAttribute struct and cleanup.bunnei2018-03-271-121/+160
* | | | | gl_rasterizer: Use 32 texture units instead of 3.bunnei2018-03-273-2/+3
* | | | | gl_rasterizer: Implement DrawTriangles.bunnei2018-03-271-1/+194
* | | | | Maxwell3D: Call AccelerateDrawBatch on DrawArrays.bunnei2018-03-271-1/+8
* | | | | gl_rasterizer: Implement AnalyzeVertexArray.bunnei2018-03-272-1/+56
* | | | | gl_rasterizer_cache: MortonCopy Switch-style.bunnei2018-03-271-72/+32
* | | | | gl_rasterizer_cache: Implement GetFramebufferSurfaces.bunnei2018-03-272-4/+104
* | | | | maxwell: Add RenderTargetFormat enum.bunnei2018-03-272-4/+5
* | | | | renderer_opengl: Only draw the screen if a framebuffer is specified.bunnei2018-03-271-6/+7
* | | | | GPU: Load the sampler info (TSC) when retrieving active textures.Subv2018-03-262-21/+67
* | | | | GPU: Added the TSC structure. It contains information about the sampler.Subv2018-03-261-0/+50
* | | | | GPU: Added more fields to the TIC structure.Subv2018-03-261-4/+30
|/ / / /
* | | | Merge pull request #280 from bunnei/misc-service-fixesbunnei2018-03-255-8/+66
|\ \ \ \
| * | | | audren_u: Fix GetAudioDevice.bunnei2018-03-252-7/+48
| * | | | hid: Stub out SetNpadJoyAssignmentModeDual.bunnei2018-03-251-1/+7
| * | | | pl_u: Add RequestLoad.bunnei2018-03-252-0/+11
* | | | | Merge pull request #273 from Subv/texturesbunnei2018-03-2521-10/+1464
|\ \ \ \ \
| * | | | | GPU: Make the debug_context variable a member of the frontend instead of a global.Subv2018-03-257-19/+40
| * | | | | GPU: Added a function to retrieve the active textures for a shader stage.Subv2018-03-242-50/+59
| * | | | | Frontend: Updated the surface view debug widget to work with Maxwell surfaces.Subv2018-03-243-19/+38
| * | | | | Frontend: Allow opening the Surface View widget in the Qt frontend.Subv2018-03-242-0/+8
| * | | | | GPU: Implement the Incoming/FinishedPrimitiveBatch debug breakpoints.Subv2018-03-241-0/+7
| * | | | | GPU: Implement the MaxwellCommandLoaded/Processed debug breakpoints.Subv2018-03-241-0/+10
| * | | | | Frontend: Ported the GPU breakpoints and surface viewer widgets from citra.Subv2018-03-2415-4/+1155
| * | | | | GPU: Added a method to unswizzle a texture without decoding it.Subv2018-03-244-5/+95
| * | | | | GPU: Preliminary work for texture decoding.Subv2018-03-245-0/+139
| |/ / / /
* / / / / Service/sockets: add bsd:s, nsd:a, nsd:u servicesmailwl2018-03-258-32/+96
|/ / / /
* | | | arm_dynarmic: Fix timingMerryMage2018-03-241-7/+3
* | | | GPU: Added viewport registers to Maxwell3D's reg structure.Subv2018-03-241-1/+18
* | | | Merge pull request #265 from bunnei/tegra-progress-2bunnei2018-03-2417-296/+591
|\ \ \ \
| * | | | gl_rasterizer: Fake render in green, because it's cooler.bunnei2018-03-241-1/+1
| * | | | gl_rasterizer: Log warning instead of sync'ing unimplemented funcs.bunnei2018-03-241-7/+1
| * | | | gl_rasterizer_cache: Add missing include for vm_manager.bunnei2018-03-231-0/+1
| * | | | renderer_opengl: Only invalidate the framebuffer region, not flush.bunnei2018-03-231-4/+3
| * | | | renderer_opengl: Fixes for properly flushing & rendering the framebuffer.bunnei2018-03-232-12/+12
| * | | | memory: Fix typo in RasterizerFlushVirtualRegion.bunnei2018-03-231-3/+3
| * | | | RasterizerCacheOpenGL: FlushAll should flush full memory region.bunnei2018-03-231-1/+1
| * | | | memory: RasterizerFlushVirtualRegion should also check process image region.bunnei2018-03-231-0/+1
| * | | | rasterizer: Flush and invalidate regions should be 64-bit.bunnei2018-03-235-12/+12
| * | | | renderer_opengl: Add framebuffer_transform_flags member variable.bunnei2018-03-231-2/+2
| * | | | renderer_opengl: Better handling of framebuffer transform flags.bunnei2018-03-234-6/+23
| * | | | renderer_opengl: Use accelerated framebuffer load with LoadFBToScreenInfo.bunnei2018-03-231-31/+25
| * | | | nvdisp_disp0: Always flush and invalidate framebuffer region.bunnei2018-03-231-0/+7
| * | | | gl_rasterizer: Implement AccelerateDisplay method from Citra.bunnei2018-03-232-2/+44
| * | | | LoadGLBuffer: Use bytes_per_pixel, not bits.bunnei2018-03-231-1/+2
| * | | | memory: Port RasterizerFlushVirtualRegion from Citra.bunnei2018-03-232-1/+58
| * | | | gl_rasterizer_cache: LoadGLBuffer should do a morton copy.bunnei2018-03-231-16/+5
| * | | | video_core: Move MortonCopyPixels128 to utils header.bunnei2018-03-232-111/+113
| * | | | video_core: Remove usage of PAddr and replace with VAddr.bunnei2018-03-235-39/+39
| * | | | video_core: Move FramebufferInfo to FramebufferConfig in GPU.bunnei2018-03-238-69/+77
| * | | | gl_rasterizer: Replace a bunch of UNIMPLEMENTED with ASSERT.bunnei2018-03-232-20/+20
| * | | | gl_rasterizer: Add a simple passthrough shader in lieu of shader generation.bunnei2018-03-232-5/+68
| * | | | gpu: Expose Maxwell3D engine.bunnei2018-03-231-0/+4
| * | | | maxwell_3d: Add some format decodings and string helper functions.bunnei2018-03-231-3/+107
| * | | | renderer: Create rasterizer and cleanup.bunnei2018-03-234-4/+16
* | | | | Merge pull request #255 from Subv/sd_cardbunnei2018-03-2412-48/+329
|\ \ \ \ \
| * | | | | FS: Move the file open mode calculation to a separate function.Subv2018-03-231-7/+14
| * | | | | FS: Implemented IFileSystem::CreateDirectory.Subv2018-03-216-7/+29
| * | | | | FS: Implemented IFileSystem's OpenDirectory function.Subv2018-03-201-0/+28
| * | | | | FS: Added the IDirectory IPC interface and implemented its two functions.Subv2018-03-201-0/+51
| * | | | | FS: Implement DiskFileSystem's OpenDirectory interface.Subv2018-03-205-6/+19
| * | | | | FS: Implement DiskFileSystem::GetEntryType for existing files/directories.Subv2018-03-201-2/+4
| * | | | | FS: Updated the Directory Entry structure to match the Switch.Subv2018-03-205-30/+84
| * | | | | FS: Support the file Append open mode.Subv2018-03-202-2/+23
| * | | | | FS: Implement MountSdCard.Subv2018-03-201-2/+6
| * | | | | FS: Added an SDMC archive factory and registered it to the SDMC archive on startup.Subv2018-03-205-0/+79
* | | | | | Merge pull request #268 from mailwl/sslbunnei2018-03-236-0/+45
|\ \ \ \ \ \
| * | | | | | Service/SSL: add ssl servicemailwl2018-03-236-0/+45
| | |_|/ / / | |/| | | |
* | | | | | Merge pull request #270 from N00byKing/patch-2bunnei2018-03-231-4/+0
|\ \ \ \ \ \
| * | | | | | Remove Option for N/3DS from default.iniN00byKing2018-03-231-4/+0
| |/ / / / /
* / / / / / CITRA_ICON -> YUZU_ICONN00byKing2018-03-231-1/+1
|/ / / / /
* | | | | yuzu_cmd: change default cpu core to dynarmicValentin Vanelslande2018-03-231-1/+1
* | | | | default_ini: change default cpu core to dynarmicValentin Vanelslande2018-03-231-1/+1
* | | | | Remove more N3DS ReferencesN00byKing2018-03-222-20/+0
* | | | | Service/spl: add module and servicesmailwl2018-03-2210-0/+176
| |/ / / |/| | |
* | | | Merge pull request #258 from Subv/gpu_attribsbunnei2018-03-221-3/+27
|\ \ \ \
| * | | | GPU: Added vertex attribute format registers.Subv2018-03-211-1/+14
| * | | | GPU: Added registers for the number of vertices to render.Subv2018-03-211-2/+13
* | | | | CMake: Set EMU_ARCH_BITS in CMakeLists.txtN00byKing2018-03-213-36/+0
* | | | | Service/vi: convert services to modulemailwl2018-03-218-212/+160
|/ / / /
* | | | Merge pull request #254 from bunnei/port-citra-rendererbunnei2018-03-2118-101/+2905
|\ \ \ \
| * | | | renderer_gl: Port boilerplate rasterizer code over from Citra.bunnei2018-03-205-1/+495
| * | | | gl_shader_util: Sync latest version with Citra.bunnei2018-03-203-46/+116
| * | | | renderer_gl: Port over gl_shader_gen module from Citra.bunnei2018-03-203-0/+88
| * | | | renderer_gl: Port over gl_shader_decompiler module from Citra.bunnei2018-03-203-0/+87
| * | | | renderer_gl: Port over gl_rasterizer_cache module from Citra.bunnei2018-03-203-0/+1714
| * | | | gl_resource_manager: Sync latest version with Citra.bunnei2018-03-201-8/+77
| * | | | renderer_gl: Port over gl_stream_buffer module from Citra.bunnei2018-03-203-0/+218
| * | | | gl_state: Sync latest version with Citra.bunnei2018-03-202-47/+111
* | | | | Service: add fatal:u, fatal:p servicesmailwl2018-03-2010-0/+146
* | | | | Merge pull request #253 from Subv/rt_depthMat M2018-03-201-1/+48
|\ \ \ \ \ | |/ / / / |/| | | |
| * | | | GPU: Added Z buffer registers to Maxwell3D's reg structure.Subv2018-03-191-1/+17
| * | | | GPU: Added the render target (RT) registers to Maxwell3D's reg structure.Subv2018-03-191-1/+32
| |/ / /
* | | | Clang FixesN00byKing2018-03-195-9/+11
* | | | oopsN00byKing2018-03-191-3/+3
* | | | More Warning cleanupsN00byKing2018-03-193-3/+3
* | | | Clean Warnings (?)N00byKing2018-03-1915-20/+20
|/ / /
* | | GPU: Added the TSC registers to the Maxwell3D register structure.Subv2018-03-191-1/+15
* | | GPU: Added the TIC registers to the Maxwell3D register structure.Subv2018-03-191-1/+16
* | | Merge pull request #193 from N00byKing/3184_2_robotic_boogaloobunnei2018-03-197-41/+41
|\ \ \
| * | | Implements citra-emu/citra#3184N00byKing2018-02-257-41/+41
* | | | Merge pull request #250 from bunnei/buffer-dequeue-waitbunnei2018-03-1910-51/+128
|\ \ \ \
| * | | | vi: Remove DequeueBuffer and wait until next available buffer.bunnei2018-03-193-12/+49
| * | | | hle_ipc: Add SleepClientThread to block current thread within HLE routines.bunnei2018-03-192-0/+47
| * | | | hle_ipc: Use shared_ptr instead of unique_ptr to allow copies.bunnei2018-03-192-9/+9
| * | | | hle_ipc: Remove GetPointer(..) usage with WriteToOutgoingCommandBuffer.bunnei2018-03-193-7/+14
| * | | | thread: Add THREADSTATUS_WAIT_HLE_EVENT, remove THREADSTATUS_WAIT_ARB.bunnei2018-03-194-23/+9
* | | | | GPU: Implement macro 0xE1A BindTextureInfoBuffer in HLE.Subv2018-03-192-1/+29
|/ / / /
* | | | GPU: Implement the BindStorageBuffer macro method in HLE.Subv2018-03-182-1/+36
* | | | GPU: Handle writes to the CB_DATA method.Subv2018-03-182-0/+39
* | | | GPU: Move the GPU's class constructor and destructors to a cpp file.Subv2018-03-183-10/+30
* | | | GPU: Store uploaded GPU macros and keep track of the number of method parameters.Subv2018-03-184-27/+74
* | | | GPU: Macros are specific to the Maxwell3D engine, so handle them internally.Subv2018-03-188-63/+55
* | | | GPU: Renamed ShaderType to ShaderStage as that is less confusing.Subv2018-03-182-19/+19
* | | | GPU: Store shader constbuffer bindings in the GPU state.Subv2018-03-182-5/+61
* | | | GPU: Corrected some register offsets and removed superfluous macro registers.Subv2018-03-181-9/+3
* | | | GPU: Make the SetShader macro call do the same as the real macro's code.Subv2018-03-182-3/+44
* | | | GPU: Corrected the parameter documentation for the SetShader macro call.Subv2018-03-172-11/+12
* | | | Merge pull request #242 from Subv/set_shaderbunnei2018-03-172-4/+38
|\ \ \ \
| * | | | GPU: Handle the SetShader method call (0xE24) and store the shader config.Subv2018-03-172-4/+38
* | | | | GPU: Added the vertex array registers.Subv2018-03-171-2/+33
|/ / / /
* | | | Merge pull request #241 from Subv/gpu_method_callbunnei2018-03-179-8/+97
|\ \ \ \
| * | | | GPU: Process command mode 5 (IncreaseOnce) differently from other commands.Subv2018-03-179-8/+97
* | | | | Merge pull request #239 from Subv/shadersbunnei2018-03-172-2/+63
|\ \ \ \ \
| * | | | | GPU: Assert that we get a 0 CODE_ADDRESS register in the 3D engine.Subv2018-03-171-0/+8
| * | | | | GPU: Added Maxwell registers for Shader Program control.Subv2018-03-171-2/+55
| |/ / / /
* | | | | nvflinger: Remove superfluous buffer format check.bunnei2018-03-171-3/+1
* | | | | process: MirrorMemory should use MemoryState::Mapped.bunnei2018-03-171-1/+1
* | | | | process: Unmap previously allocated heap.bunnei2018-03-161-1/+3
* | | | | arm_interface: Support unmapping previously mapped memory.bunnei2018-03-166-2/+18
* | | | | svc: Use more correct values for GetInfo MapRegion and NewMapRegion.bunnei2018-03-163-29/+5
* | | | | kernel: Move stack region outside of application heap.bunnei2018-03-166-11/+6
* | | | | memory: Add regions for map region, "new" map region, etc.bunnei2018-03-161-19/+29
* | | | | process: Fix stack memory state.bunnei2018-03-161-2/+4
* | | | | MemoryState: Add additional memory states and improve naming.bunnei2018-03-165-18/+45
* | | | | IGeneralService: fix function listmailwl2018-03-161-2/+3
* | | | | Service/NIFM: stub cancel functionmailwl2018-03-161-1/+6
* | | | | Service/NIFM: convert to modulemailwl2018-03-168-122/+75
|/ / / /
* | | | core: Move process creation out of global state.bunnei2018-03-1422-72/+87
* | | | Merge pull request #213 from Hexagon12/dynarmic-defaultbunnei2018-03-081-1/+1
|\ \ \ \
| * | | | pls, that was easyHexagon122018-02-141-1/+1
| |/ / /
* | | | GPU: Intercept writes to the VERTEX_END_GL register.Subv2018-03-052-1/+18
* | | | Merge pull request #229 from Subv/ensuresavedata_implbunnei2018-03-0412-43/+91
|\ \ \ \
| * | | | FS: Use the correct error code when trying to open files that don't exist.Subv2018-03-042-26/+6
| * | | | FS: Stubbed CreateSaveData. It currently does nothing.Subv2018-03-042-0/+15
| * | | | FS: Make EnsureSaveData create the savedata folder when called for the first time.Subv2018-03-048-17/+70
* | | | | CoreTiming: Unschedule the pending events when an Interface is destroyed.Subv2018-03-043-2/+10
|/ / / /
* | | | Merge pull request #226 from Subv/buffer_queue_eventbunnei2018-03-031-0/+3
|\ \ \ \
| * | | | Vi: Signal the BufferQueue's Native Handle right after ReleaseBuffer is called.Subv2018-03-031-0/+3
* | | | | Service/Set: add more servicesmailwl2018-03-0312-10/+348
|/ / / /
* | | | Merge pull request #216 from Subv/savedatabunnei2018-03-0222-44/+546
|\ \ \ \
| * | | | SaveData: Use the current titleid when opening the savedata archive.Subv2018-03-021-2/+3
| * | | | Kernel: Store the program id in the Process class instead of the CodeSet class.Subv2018-03-029-26/+25
| * | | | FS: Implement MountSaveData and some of the IFile interface.Subv2018-03-022-0/+189
| * | | | Filesystem: Added a SaveData Factory and associated Disk_FileSystem.Subv2018-03-0210-16/+329
| * | | | ResultCode: Mark any error code that isn't 0 as an error.Subv2018-02-271-2/+2
| | |_|/ | |/| |
* / | | thread: Clear the process list on shutdown.Jules Blok2018-02-271-1/+3
|/ / /
* | | Removes the use of QKeySequence::Cancel (#186)Vishal Sharma2018-02-271-1/+2
* | | Merge pull request #207 from mailwl/duplicatesessionbunnei2018-02-273-6/+12
|\ \ \ | |_|/ |/| |
| * | Add warning if Domain request has no domain message headermailwl2018-02-201-0/+3
| * | Fix: change check for domain order and existance of domain message headermailwl2018-02-203-3/+4
| * | IPC: add domain header to response if only it exists in requestmailwl2018-02-203-6/+8
* | | Merge pull request #215 from N00byKing/umapsharedmmrybunnei2018-02-262-1/+17
|\ \ \
| * | | (Hopefully) Fix MinGW BuildN00byKing2018-02-251-1/+1
| * | | Add UnmapSharedMemoryN00byKing2018-02-252-1/+17
* | | | file_sys: Style tweaksshinyquagsire232018-02-262-11/+5
* | | | loader: Check error on NPDM load, use TID for CodeSetshinyquagsire232018-02-253-6/+10
* | | | loader: Use NPDM information when loading NSOsshinyquagsire232018-02-252-4/+15
* | | | file_sys: Add support for parsing NPDM filesshinyquagsire232018-02-253-0/+276
* | | | Merge pull request #212 from mailwl/stubsbunnei2018-02-2410-9/+112
|\ \ \ \
| * | | | Stub more functionsmailwl2018-02-227-8/+90
| * | | | Stub am::SetScreenShotPermission, and bsd::StartMonitoring functionsmailwl2018-02-225-1/+22
| |/ / /
* | | | Merge pull request #217 from shinyquagsire23/time-s-missingbunnei2018-02-231-0/+4
|\ \ \ \
| * | | | time: Add missing time:s functions, used for libnxshinyquagsire232018-02-231-0/+4
| |/ / /
* | | | Merge pull request #210 from MerryMage/f/dynarmic/sysregbunnei2018-02-232-2/+33
|\ \ \ \ | |/ / / |/| | |
| * | | dynarmic: Update to 6b4c6b0MerryMage2018-02-211-2/+18
| * | | arm_dynarmic: LOG_INFO on unicorn fallbackMerryMage2018-02-211-0/+4
| * | | memory: LOG_ERROR when falling off end of page tableMerryMage2018-02-211-0/+11
| |/ /
* | | Merge pull request #211 from shinyquagsire23/time_localbunnei2018-02-223-0/+9
|\ \ \
| * | | time: Add GetStandardLocalSystemClock, used by libnxshinyquagsire232018-02-223-0/+9
| |/ /
* / / core: Fix scheduler-shutdown related crashMerryMage2018-02-211-5/+9
|/ /
* | Merge pull request #206 from mailwl/aoc-listaddoncontentbunnei2018-02-204-2/+28
|\ \
| * | Service/AOC: stub ListAddOnContent functionmailwl2018-02-204-2/+28
* | | acc_u0: Stub ListOpenUsers service function.bunnei2018-02-192-1/+11
* | | service: Add Friend service interface.bunnei2018-02-196-0/+100
* | | logging: Add category for Friend service.bunnei2018-02-192-0/+2
|/ /
* | Merge pull request #202 from bunnei/scheduler-cleanupbunnei2018-02-1911-379/+239
|\ \
| * | scheduler: Cleanup based on PR feedback.bunnei2018-02-193-5/+4
| * | kernel: Use Scheduler class for threading.bunnei2018-02-186-174/+26
| * | kernel: Add Scheduler, which encapsulates the scheduling loading from Thread module.bunnei2018-02-183-0/+210
| * | core: Use shared_ptr for cpu_core.bunnei2018-02-182-6/+4
| * | kernel: Remove unused address_arbiter code.bunnei2018-02-185-199/+0
* | | AM: Corrected the response in EnsureSaveData.Subv2018-02-191-1/+2
|/ /
* | Merge pull request #201 from Subv/ipc_delay_bunnei2018-02-184-50/+63
|\ \
| * | Kernel/IPC: Add a small delay after each SyncRequest to prevent thread starvation.Subv2018-02-184-50/+63
* | | Merge pull request #200 from Subv/bufferproducerfencebunnei2018-02-185-28/+68
|\ \ \ | |/ / |/| |
| * | nvmap: Make IocFromId return the same existing handle instead of creating a new one.Subv2018-02-171-5/+2
| * | Parcel: Ensure we don't read past the end of the parcels in Vi.Subv2018-02-171-0/+5
| * | Vi: Mark all fences as NO_FENCE in the DequeueBuffer response parcel.Subv2018-02-171-2/+2
| * | Vi: Always write the IGBPBuffer in the RequestBuffer response parcel.Subv2018-02-171-1/+2
| * | nvhost-ctrl: Stub NVHOST_IOCTL_CTRL_EVENT_WAIT.Subv2018-02-152-0/+25
| * | Vi: Mark the fences as valid in the DequeueBuffer response parcel.Subv2018-02-151-0/+3
| * | Vi: Added a missing u32 in the DequeueBuffer response parcel.Subv2018-02-151-0/+1
| * | Vi: Don't write the IGBPBuffer in the IGBPRequestBufferResponseParcel.Subv2018-02-151-4/+2
| * | Vi: Properly write the BufferProducerFence object in the DequeueBuffer response parcel.Subv2018-02-152-18/+28
* | | Service/hid: stub some functionsmailwl2018-02-164-1/+98
* | | shared_memory: Remove some checks.bunnei2018-02-151-13/+0
* | | pl_u: Implement basic shared font loading from RAM dump.bunnei2018-02-156-0/+182
* | | log: Add logging category for NS services.bunnei2018-02-152-0/+2
* | | hid: Stub GetVibrationDeviceInfo and SendVibrationValues.bunnei2018-02-151-0/+15
|/ /
* | Merge pull request #188 from bunnei/refactor-buffer-descriptorbunnei2018-02-1511-108/+102
|\ \
| * | hle_ipc: Remove const from WriteBuffer size.bunnei2018-02-142-2/+2
| * | hle_ipc: Add GetReadBufferSize and check write buffer size.bunnei2018-02-142-0/+10
| * | service: Remove remaining uses of BufferDescriptor*.bunnei2018-02-145-14/+8
| * | audio: Use WriteBuffer instead of BufferDescriptorB.bunnei2018-02-142-9/+3
| * | vi: Eliminate direct usage of BufferDescriptorB.bunnei2018-02-141-14/+3
| * | nvdrv: Use ReadBuffer/WriteBuffer functions for Ioctl.bunnei2018-02-141-17/+5
| * | vi: Use ReadBuffer/WriteBuffer functions for TransactParcel.bunnei2018-02-141-44/+19
| * | hle_ipc: Add helper functions for reading and writing buffers.bunnei2018-02-141-4/+2
| * | hle_ipc: Add helper functions for reading and writing buffers.bunnei2018-02-143-0/+55
| * | vi: Fix TransactParcelAuto to support both buffer formats.bunnei2018-02-141-25/+16
* | | Fix fps counter to correctly measure frame end when there was no frame to drawJames Rowe2018-02-141-0/+2
| |/ |/|
* | Merge pull request #190 from bunnei/fix-qt-waittreebunnei2018-02-141-1/+1
|\ \
| * | debugger: Fix wait_tree crash.bunnei2018-02-141-1/+1
| |/
* | Merge pull request #191 from lioncash/logbunnei2018-02-1412-57/+82
|\ \
| * | memory: Silence formatting sepecifier warningsLioncash2018-02-141-21/+30
| * | nso: Silence formatting specifier warningsLioncash2018-02-141-2/+4
| * | deconstructed_rom_directory: Silence formatting specifier warningsLioncash2018-02-141-3/+4
| * | nvdrv/interface: Silence formatting specifier warningsLioncash2018-02-141-1/+2
| * | nvmap: Silence formatting specifier warningsLioncash2018-02-141-1/+2
| * | nvhost_gpu: Silence formatting specifier warningsLioncash2018-02-141-6/+8
| * | nvhost_ctrl: Silence formatting specifier warningsLioncash2018-02-141-2/+2
| * | nvhost_ctrl_gpu: Silence formatting specifier warningsLioncash2018-02-141-3/+4
| * | nvhost_as_gpu: Silence formatting specifier warningsLioncash2018-02-141-5/+7
| * | thread: Silence formatting specifier warningsLioncash2018-02-141-2/+3
| * | vm_manager: Silence formatting specifier warningsLioncash2018-02-141-5/+7
| * | gdbstub: Silence formatting specifier warningsLioncash2018-02-141-6/+9
| |/
* / maxwell_3d: Make constructor explicitLioncash2018-02-141-1/+1
|/
* Merge pull request #187 from Subv/maxwell3d_querybunnei2018-02-143-3/+95
|\
| * GPU: Partially implemented the QUERY_* registers in the Maxwell3D engine.Subv2018-02-123-3/+95
* | audren_u: Schedule reoccuring event. (#183)bunnei2018-02-142-6/+36
* | Merge pull request #181 from bunnei/vi-fixes-2bunnei2018-02-141-17/+36
|\ \
| * | vi: Add FENCE_HACK, which is useful for booting BOTW.bunnei2018-02-131-7/+21
| * | vi: Stub TransactParcel CancelBuffer.bunnei2018-02-131-0/+2
| * | TransactParcel: Move WriteBlock to narrowest scope.bunnei2018-02-131-10/+13
* | | Merge pull request #184 from mailwl/lmbunnei2018-02-131-20/+49
|\ \ \ | |/ / |/| |
| * | Service/lm: add support to multiline logsmailwl2018-02-131-20/+49
* | | arm_dynarmic: Support direct page table accessMerryMage2018-02-122-10/+19
|/ /
* | Merge pull request #179 from gdkchan/audren_stubsbunnei2018-02-121-2/+76
|\ \
| * | Add RequestUpdateAudioRenderer, StartAudioRenderer and StopAudioRenderer stubs to audren:ugdkchan2018-02-121-2/+76
* | | Merge pull request #178 from Subv/command_buffersbunnei2018-02-1220-23/+364
|\ \ \ | |/ / |/| / | |/
| * Make a GPU class in VideoCore to contain the GPU state.Subv2018-02-1220-76/+125
| * GPU: Added a command processor to decode the GPU pushbuffers and forward the commands to their respective engines.Subv2018-02-1212-3/+285
| * nvdrv: Make the GPU memory manager available to nvhost-gpu.Subv2018-02-123-6/+16
* | renderer_opengl: Support framebuffer flip vertical.bunnei2018-02-123-5/+13
* | vi: Parse IGBPQueueBufferRequestParcel params and expose buffer flip vertical.bunnei2018-02-126-11/+46
* | vi: Fix OpenLayer and CreateStrayLayer.bunnei2018-02-111-6/+8
|/
* fsp_srv: Stub MountSdCard.bunnei2018-02-102-0/+9
* apm: Refactor service impl. to support multiple ports.bunnei2018-02-105-58/+102
* vi: Implement TransactParcelAuto.bunnei2018-02-101-32/+46
* nvflinger: (Hack) Use first available buffer if none are found.bunnei2018-02-101-1/+5
* IGBPQueueBufferRequestParcel: Don't enforce buffer length.bunnei2018-02-101-1/+0
* IGBPRequestBufferResponseParcel: Fix response for libnx.bunnei2018-02-101-7/+4
* Merge pull request #171 from bunnei/libnx-fixesbunnei2018-02-096-9/+38
|\
| * nvdrv: Fix QueryEvent for libnx.bunnei2018-02-092-4/+8
| * IApplicationDisplayService::CloseDisplay: Fix response params size.bunnei2018-02-091-1/+1
| * nvhost_ctrl_gpu: Implement ZCullGetInfo.bunnei2018-02-091-2/+14
| * acc_u0: Implement ListAllUsers.bunnei2018-02-092-2/+15
* | dynarmic: Update to 41ae12263MerryMage2018-02-092-31/+45
|/
* nvhost_as_gpu: Implement AllocateSpace and MapBufferEx.bunnei2018-02-082-10/+33
* nvdrv: Add MemoryManager class to track GPU memory.bunnei2018-02-083-0/+162
* nvmap: Refactor to expose nvmap objects.bunnei2018-02-082-19/+22
* nvhost_as_gpu: Add nvmap as a class member.bunnei2018-02-083-2/+9
* Service: stub some functions in am, audio, time, vi servicesmailwl2018-02-079-6/+191
* Service/hid: stub SetNpadHandheldActivationModemailwl2018-02-061-0/+7
* Merge pull request #165 from bunnei/puyo-fixesbunnei2018-02-064-2/+23
|\
| * mutex: Update hasWaiters on release.bunnei2018-02-061-0/+1
| * hid: Stub ActivateTouchScreen and SetNpadJoyHoldType.bunnei2018-02-061-2/+14
| * IApplicationFunctions: Stub out EnsureSaveData.bunnei2018-02-062-0/+8
* | Extra nvdrv support (#162)David2018-02-0617-37/+765
|/
* Merge pull request #164 from ogniK5377/libnx_sm_fixbunnei2018-02-051-0/+2
|\
| * Dont call UNIMPLEMENTED for 'empty services', just return error codeDavid Marcec2018-02-051-0/+2
* | Changed .istorage to .romfsDavid Marcec2018-02-052-5/+5
|/
* set: GetAvailableLanguageCodes should not return lang_codes size.bunnei2018-02-051-2/+3
* nvflinger: Signal BufferQueue native handle event.bunnei2018-02-051-0/+1
* logger: Add Time service logging category.bunnei2018-02-053-10/+12
* logger: Add SET service logging category.bunnei2018-02-053-16/+12
* logger: Add PCTL service logging category.bunnei2018-02-053-1/+3
* logger: Add LM service logging category.bunnei2018-02-053-2/+4
* logger: Add APM service logging category.bunnei2018-02-053-2/+5
* lm: Ensure log string is non-empty before checking back().bunnei2018-02-051-1/+1
* logger: Add NIFM service logging category.bunnei2018-02-056-11/+13
* logger: Add VI service logging category.bunnei2018-02-056-21/+22
* hid: Stub out several functions.bunnei2018-02-051-1/+39
* hid: Implement CreateActiveVibrationDeviceList.bunnei2018-02-041-0/+25
* logger: Use Service_HID category where applicable.bunnei2018-02-041-2/+2
* logger: Use Service_NVDRV category where applicable.bunnei2018-02-042-10/+10
* logger: Add AM service logging category.bunnei2018-02-045-42/+44
* logger: Add "account" service logging category.bunnei2018-02-043-8/+10
* acc_u0: Stub out GetLastOpenedUser.bunnei2018-02-042-0/+10
* Merge pull request #160 from bunnei/svc-improvementsbunnei2018-02-045-24/+32
|\
| * GetInfo: Implement IsCurrentProcessBeingDebugged.bunnei2018-02-041-0/+3
| * WaitProcessWideKeyAtomic: Handle case where condition variable was already created.bunnei2018-02-043-13/+17
| * svc: SharedMemory size should be 64-bits and cleanup.bunnei2018-02-033-11/+11
| * ArbitrateLock: Assert that requesting_thread is current_thread.bunnei2018-02-031-0/+1
* | acc:u0 : stub GetAccountIdmailwl2018-02-041-1/+9
|/
* Merge pull request #157 from bunnei/fix-duplicate-sessionbunnei2018-02-031-4/+9
|\
| * controller: DuplicateSession should return a ClientSession.bunnei2018-02-031-4/+9
* | Service:nifm: add nifm:a, nifm:s and nifm:u servicesmailwl2018-02-0310-0/+378
|/
* Service/am: Add AppletAE service (#153)mailwl2018-02-027-379/+571
* Merge pull request #154 from mailwl/vi_create_stray_arraybunnei2018-02-021-0/+1
|\
| * vi::CreateStrayLayer : add padding to requestmailwl2018-02-021-0/+1
* | Merge pull request #155 from mailwl/vi-servicesbunnei2018-02-026-0/+128
|\ \
| * | Services/vi: add vi:s and vi:u servicesmailwl2018-02-026-0/+128
| |/
* | Merge pull request #152 from shinyquagsire23/sharedmem-valid-boundsbunnei2018-02-021-1/+2
|\ \ | |/ |/|
| * shared_memory: Only mark addresses as invalid if they are within the heapshinyquagsire232018-01-301-1/+2
* | [WIP] sfdnsres: stub (#146)mailwl2018-01-305-2/+52
|/
* Merge pull request #148 from MerryMage/feature/special-memorybunnei2018-01-2711-441/+273
|\
| * memory: Replace all memory hooking with Special regionsMerryMage2018-01-2711-441/+273
* | time: Implement ISteadyClock::GetCurrentTimePoint.bunnei2018-01-262-1/+22
* | audout_u: Various cleanups.bunnei2018-01-251-29/+17
* | ResponseBuilder: Use a bit field for customizing instead of always_move_handles.bunnei2018-01-253-11/+21
* | time: Stub GetSystemClockContext function.bunnei2018-01-252-2/+17
* | server_session: Fix scenario where all domain handlers are closed.bunnei2018-01-251-3/+3
* | hle: Rename RequestBuilder to ResponseBuilder.bunnei2018-01-2519-128/+129
* | service: Fix all incorrect IPC response headers.bunnei2018-01-2514-82/+42
* | ipc_helpers: Make interface domain agnostic and add header validation.bunnei2018-01-252-25/+58
* | hle: Integrate Domain handling into ServerSession.bunnei2018-01-257-38/+74
* | hle: Remove Domain and SyncObject kernel objects.bunnei2018-01-2510-169/+2
* | handle_table: Remove ConvertSessionToDomain.bunnei2018-01-252-17/+0
* | audout:u OpenAudioOut and IAudioOut (#138)st4rk2018-01-254-14/+168
* | Fix time returning epoch time in milliseconds rather than in secondsgdkchan2018-01-241-1/+1
* | logging: add missing NVDRV subclass to macro listRozlette2018-01-241-0/+1
* | Correct SpellingN00byKing2018-01-231-2/+2
* | Merge pull request #135 from Subv/no_portsbunnei2018-01-235-65/+67
|\ \
| * | Services: Added a todo about returning interfaces as domain objects in lm, hid and time.Subv2018-01-233-0/+12
| * | Time: Don't create unnecessary ports when retrieving the clock service sessions.Subv2018-01-221-33/+27
| * | HID: Don't create an unnecessary port in CreateAppletResource.Subv2018-01-221-13/+13
| * | LM: Don't create an unnecessary port in Initialize.Subv2018-01-222-15/+10
| * | IPC: Don't create an unnecessary port when using PushIpcInterface outside of a domain.Subv2018-01-221-4/+5
* | | Merge pull request #133 from Subv/nvflinger2bunnei2018-01-229-17/+59
|\ \ \ | |/ / |/| |
| * | AppletOE: Stubbed CreateManagedDisplayLayer to create a new layer in the Default display.Subv2018-01-221-0/+14
| * | AppletOE: Make ISelfController keep a reference to nvflinger.Subv2018-01-225-10/+32
| * | Services: Vi shouldn't be responsible for creating nvflinger.Subv2018-01-225-7/+13
* | | Merge pull request #134 from gdkchan/audout_hid_fixbunnei2018-01-223-2/+21
|\ \ \ | |/ / |/| |
| * | Stub OpenAudioOut and fix a issue with HID IAppletResource being created more than oncegdkchan2018-01-223-2/+21
* | | VI: Move BufferQueue and NVFlinger to their own folder/namespace.Subv2018-01-229-363/+452
|/ /
* | Added stubs for audio services. (#116)st4rk2018-01-2212-5/+309
* | Merge pull request #131 from lioncash/enumbunnei2018-01-222-12/+13
|\ \
| * | nvmap: Add a return 0 underneath the UNIMPLEMENTED macroLioncash2018-01-211-0/+1
| * | nvmap: Make IoctlCommands an enum classLioncash2018-01-212-12/+12
* | | Added nvmemp, Added /dev/nvhost-ctrl, SetClientPID now stores pid (#114)David2018-01-219-5/+163
* | | Merge pull request #128 from Subv/parcel_querybunnei2018-01-212-0/+58
|\ \ \
| * | | VI: Implement the Query transaction of IHOSBinderDriver, and stubbed some results.Subv2018-01-212-0/+58
| | |/ | |/|
* | | file_sys: Clang format fixes.bunnei2018-01-213-4/+4
* | | fsp_srv: Various improvements to IStorage:Read implementation.bunnei2018-01-215-48/+79
* | | deconstructed_rom_directory: Implement istorage loading for RomFS.bunnei2018-01-212-2/+71
* | | filesystem: Implement basic IStorage functionality.David Marcec2018-01-216-0/+258
* | | file_sys: Cleanup to better match Switch file system constructs.bunnei2018-01-2110-63/+136
* | | file_sys: Remove disk_archive, savedata_archive, and title_metadata.bunnei2018-01-217-835/+0
* | | archive_backend: Minor changes to match Switch IFileSystem.bunnei2018-01-215-26/+26
* | | file_sys: Repurpose 3DS IVFC code for Switch ROMFS.bunnei2018-01-213-51/+43
| |/ |/|
* | Merge pull request #129 from Rozelette/masterbunnei2018-01-211-113/+155
|\ \
| * | gdbstub: Update registers and sizes for aarch64Rozlette2018-01-211-113/+155
| |/
* / Fix spelling error in CMakeListsMatthew Brener2018-01-211-1/+1
|/
* Merge pull request #72 from N00byKing/patch-2bunnei2018-01-211-1/+0
|\
| * Update core.cppN00byKing2018-01-171-1/+0
* | Merge pull request #92 from gdkchan/nro_refactorbunnei2018-01-211-2/+2
|\ \
| * | Fix NRO Entry Pointgdkchan2018-01-181-2/+2
* | | Merge pull request #122 from tgsm/time-remove-pragmabunnei2018-01-212-4/+0
|\ \ \
| * | | service/time: remove accidental #pragmastgsm2018-01-212-4/+0
* | | | loader: Minor style fix in deconstructed_rom_directoryRozlette2018-01-211-1/+0
|/ / /
* | | Merge pull request #117 from jroweboy/clang-formatbunnei2018-01-2174-117/+207
|\ \ \
| * | | Format: Run the new clang format on everythingJames Rowe2018-01-2174-117/+207
* | | | Merge pull request #120 from Rozelette/masterbunnei2018-01-201-0/+3
|\ \ \ \
| * | | | memory: Return false for large VAddr in IsValidVirtualAddressRozlette2018-01-201-0/+3
| |/ / /
* | | | loader: Clean up ctors and includes.bunnei2018-01-2010-18/+22
* | | | loader: Add DeconstructedRomDirectory for game dumps.bunnei2018-01-205-0/+156
* | | | loader: Refactor to also pass filepath into IdentifyType.bunnei2018-01-208-19/+19
* | | | nso: Remove code specific to directory loading.bunnei2018-01-202-17/+6
|/ / /
* | | Port citra #3352 to yuzu (#103)River City Ransomware2018-01-203-4/+25
* | | Added CreateSharedMemory & UNIMPLEMENTED() for non existent services. (#113)David2018-01-203-1/+23
* | | Fixes some cast warnings, partial port of citra #3064 (#106)River City Ransomware2018-01-206-21/+22
* | | Merge pull request #112 from Rozelette/masterbunnei2018-01-191-0/+16
|\ \ \
| * | | ISelfController: Stub LockExit and UnlockExitRozlette2018-01-191-0/+16
* | | | acc, set, applet_oe: stub various functions, add set service (#105)goaaats2018-01-198-0/+161
|/ / /
* | | Merge pull request #109 from bunnei/libnx-fixesbunnei2018-01-196-1/+26
|\ \ \
| * | | nvdrv: Stub SetClientPID.bunnei2018-01-192-0/+13
| * | | svc: Fix svcGetInfo MapRegionBaseAddr.bunnei2018-01-193-1/+9
| * | | svc: Add additional fields to MemoryInfo struct.bunnei2018-01-191-0/+4
* | | | Merge pull request #97 from bunnei/time-stubbunnei2018-01-192-4/+12
|\ \ \ \
| * | | | time: Stub out GetTotalLocationNameCount and some cleanup.bunnei2018-01-192-4/+12
* | | | | time: Add new line to ends of files.bunnei2018-01-194-4/+4
* | | | | applet_oe: Clang-format.bunnei2018-01-191-2/+1
|/ / / /
* / / / Fix dispdrv typogdkchan2018-01-191-1/+1
|/ / /
* | | Merge pull request #100 from Rozelette/masterbunnei2018-01-197-32/+113
|\ \ \
| * | | time: Fix use of CamelCase in ToCalendarTimeWithMyRuleRozlette2018-01-181-6/+6
| * | | time: Refactor time:* to use a single shared moduleRozlette2018-01-187-26/+107
* | | | Merge pull request #104 from RiverCityRansomware/resizedConfigWindowbunnei2018-01-191-1/+1
|\ \ \ \
| * | | | Port citra #3336 - Resizes the configuration window to not be so stretched outRiver City Ransomware2018-01-181-1/+1
| | |/ / | |/| |
* | | | qt: Migrate to Qt 5 signal/slot connection syntax where applicableLioncash2018-01-195-31/+31
* | | | ui: Rename almost all classes in configuration_input.ui (#99)Evgeni Danailov2018-01-181-66/+66
|/ / /
* | | Stub PopLaunchParameter and implement Buffer C Descriptors reading on hle_ipc (#96)gdkchan2018-01-185-7/+127
* | | Start to implement/stub BSD:U and SFDNSRES services (#78)flerovium^-^2018-01-187-0/+159
* | | Merge pull request #95 from bunnei/lm-skip-bytebunnei2018-01-181-0/+7
|\ \ \ | |/ / |/| |
| * | lm: Minor logging fix to skip a byte.bunnei2018-01-181-0/+7
* | | Merge pull request #84 from lioncash/cmakebunnei2018-01-187-360/+338
|\ \ \
| * | | CMakeLists: Derive the source directory grouping from targets themselvesLioncash2018-01-187-360/+338
* | | | Merge pull request #91 from lioncash/svcbunnei2018-01-181-9/+9
|\ \ \ \
| * | | | svc: Rename some entries to match their analogue on SwitchBrewLioncash2018-01-181-7/+7
| * | | | svc: Add CreateJitMemory and MapJitMemory svc stringsLioncash2018-01-181-2/+2
| |/ / /
* | | | Merge pull request #90 from lioncash/vi-overridebunnei2018-01-181-20/+21
|\ \ \ \
| * | | | vi: Make constructors explicit where applicableLioncash2018-01-181-13/+14
| * | | | vi: Add missing override specifiersLioncash2018-01-181-7/+7
| |/ / /
* | | | Merge pull request #89 from lioncash/vi-vectorbunnei2018-01-181-2/+3
|\ \ \ \
| * | | | vi: Copy data directly into the std::vector within Parcel's ReadBlock functionLioncash2018-01-181-2/+3
| |/ / /
* | | | Merge pull request #88 from lioncash/includebunnei2018-01-181-0/+1
|\ \ \ \
| * | | | hotkeys: Add missing <QTreeWidgetItem> includeLioncash2018-01-181-0/+1
| |/ / /
* | | | Merge pull request #87 from lioncash/overridebunnei2018-01-181-1/+1
|\ \ \ \
| * | | | game_list: Add missing override specifier for KeyReleaseEater's eventFilter functionLioncash2018-01-181-1/+1
| |/ / /
* | | | Merge pull request #86 from lioncash/doxygenbunnei2018-01-181-2/+2
|\ \ \ \
| * | | | game_list: Amend doxygen parameter identifiers for containsAllWords()Lioncash2018-01-181-2/+2
| |/ / /
* | | | Merge pull request #85 from lioncash/warnbunnei2018-01-181-2/+2
|\ \ \ \ | |_|/ / |/| | |
| * | | telemetry: Silence initialization order warningsLioncash2018-01-181-2/+2
| |/ /
* | | controller: Use DuplicateSession for DuplicateSessionEx.bunnei2018-01-182-1/+8
* | | Merge pull request #83 from lioncash/pessimizing-movebunnei2018-01-181-1/+1
|\ \ \
| * | | input_common/sdl: Silence a -Wpessimizing-move warningLioncash2018-01-181-1/+1
| |/ /
* | | Merge pull request #81 from lioncash/qt-bootmgrbunnei2018-01-182-7/+6
|\ \ \
| * | | bootmanager: Minor tidiness/correctness changesLioncash2018-01-182-7/+6
| |/ /
* | | Merge pull request #80 from gdkchan/nro_fixbunnei2018-01-181-20/+9
|\ \ \ | |/ / |/| |
| * | Fix NRO loadinggdkchan2018-01-181-20/+9
* | | Merge pull request #73 from N00byKing/3093bunnei2018-01-182-0/+2
|\ \ \ | |/ / |/| |
| * | Update CMakeLists.txtN00byKing2018-01-171-0/+1
| * | Update title_metadata.hN00byKing2018-01-171-0/+1
* | | Merge pull request #76 from Rozelette/masterbunnei2018-01-175-85/+164
|\ \ \
| * | | TIME: consolidate time:* interfaces, stub functions and structsRozlette2018-01-175-85/+164
* | | | Implement Pull #3306 from citra: citra_qt: Drop Qt 5 version checks in code (#41)N00byKing2018-01-171-13/+1
* | | | Remove relocation on NSO/NROgdkchan2018-01-173-19/+2
|/ / /
* | | Merge pull request #42 from N00byKing/3295bunnei2018-01-171-5/+1
|\ \ \
| * | | Update CMakeLists.txtN00byKing2018-01-161-5/+1
| |/ /
* | | Merge pull request #57 from nkatz565/fix-trbunnei2018-01-171-1/+2
|\ \ \
| * | | Fixed formattingnoah katz2018-01-171-2/+2
| * | | Fix non translated string (same as Citra PR 2949)noah katz2018-01-171-1/+1
* | | | Merge pull request #64 from shinyquagsire23/hid-timingbunnei2018-01-171-3/+3
|\ \ \ \
| * | | | hid: Adjust timing based on actual hardwareshinyquagsire232018-01-171-3/+3
* | | | | Merge pull request #70 from flerovii/nvdrv-closebunnei2018-01-174-0/+26
|\ \ \ \ \
| * | | | | nvdrv: stubbed Close(cmd 2)Frederic Meyer2018-01-174-0/+26
* | | | | | svc: Clang-format fix.bunnei2018-01-171-6/+4
| |_|_|_|/ |/| | | |
* | | | | Merge pull request #71 from N00byKing/patch-1bunnei2018-01-171-2/+2
|\ \ \ \ \
| * | | | | Update default_ini.hN00byKing2018-01-171-2/+2
| |/ / / /
* | | | | Merge pull request #62 from bunnei/domain-close-handlebunnei2018-01-175-4/+38
|\ \ \ \ \ | |/ / / / |/| | | |
| * | | | hle_ipc: Clang format.bunnei2018-01-171-2/+3
| * | | | ipc: Implement domain command CloseVirtualHandle.bunnei2018-01-173-3/+34
| * | | | loggin: Add IPC logging category.bunnei2018-01-172-1/+3
* | | | | Fix gdbstub typo, fixes Citra #3318River City Ransomware2018-01-171-1/+1
| |/ / / |/| | |
* | | | Merge pull request #60 from jroweboy/game-framebunnei2018-01-172-1/+4
|\ \ \ \ | |/ / / |/| | |
| * | | UI: Fix frame rate perf statsJames Rowe2018-01-172-1/+4
* | | | Merge pull request #34 from shinyquagsire23/hid-sharedmem-layouts-circbufs-metabunnei2018-01-172-88/+125
|\ \ \ \ | |/ / / |/| | |
| * | | hid: clang-formatshinyquagsire232018-01-171-3/+3
| * | | hid: Adjust for style guideshinyquagsire232018-01-172-63/+68
| * | | hid: Write to all layouts, implement circular buffers, set up controller metadata.shinyquagsire232018-01-162-39/+71
* | | | acc_u0: Add IPC interface and stub InitializeApplicationInfo.bunnei2018-01-176-0/+86
* | | | applet_oe: Fix GetOperationMode and GetPerformanceMode.bunnei2018-01-171-2/+2
* | | | NV: Implemented the nvdrv service, which uses the same interface as nvdrv:aSubv2018-01-174-16/+18
* | | | NV: Move the nvdrv classes into the Nvidia namespace, and move the functionality to a s single module that services call.Subv2018-01-1713-165/+95
* | | | VI: Stubbed GetNativeHandle, Create/DestroyStrayLayer and CloseDisplaySubv2018-01-172-3/+85
* | | | Services: Stubbed APM::OpenSession and the ISession interface.Subv2018-01-173-2/+53
* | | | AppletOE: Stub a bunch of functions required by libnx homebrew.Subv2018-01-171-4/+62
* | | | SVC: Correct some return values in svcGetInfo and added TitleId and PrivilegedProcessId stubs.Subv2018-01-171-6/+21
* | | | SVC: Add 4.0.0+ comment to GetInfoType enum values.Subv2018-01-171-0/+1
* | | | IPC: Push domain objects as move handles when not in a domain.Subv2018-01-172-2/+28
* | | | Merge pull request #52 from ogniK5377/fspbunnei2018-01-176-5/+90
|\ \ \ \
| * | | | Update memory.hDavid2018-01-171-2/+2
| * | | | SetThreadCoreMask stub, time to implement fspDavid Marcec2018-01-161-1/+6
| * | | | implemented more of ISelfController and IApplicationFunctionsDavid Marcec2018-01-161-0/+53
| * | | | Added more svcGetInfo pairsDavid Marcec2018-01-164-2/+29
| * | | | Increased heap size and changed tls area vaddrDavid Marcec2018-01-161-2/+2
| | |/ / | |/| |
* | | | Merge pull request #45 from FearlessTobi/patch-1bunnei2018-01-161-6/+6
|\ \ \ \
| * | | | Implement Pull #3030 from CitraTobias2018-01-161-6/+6
| |/ / /
* | | | Merge pull request #43 from N00byKing/3052bunnei2018-01-161-1/+1
|\ \ \ \
| * | | | Update game_list.cppN00byKing2018-01-161-1/+1
| | |_|/ | |/| |
* | | | Merge pull request #53 from nkatz565/nk-fixlabelsbunnei2018-01-161-25/+52
|\ \ \ \
| * | | | Use static functions instead of lambdasmuemart2018-01-161-49/+46
| * | | | Add translation support for button labelsmuemart2018-01-161-14/+15
| * | | | Add button labels for sdl joystick mappingsmuemart2018-01-161-17/+46
| | |/ / | |/| |
* | | | Merge pull request #44 from Rozelette/masterbunnei2018-01-161-3/+7
|\ \ \ \
| * | | | nso: Modify .bss size calculation logicRozlette2018-01-161-3/+7
| | |/ / | |/| |
* | | | clang-formatMerryMage2018-01-1625-63/+54
| |/ / |/| |
* | | Merge pull request #31 from jroweboy/fix-deploybunnei2018-01-161-1/+1
|\ \ \ | |/ / |/| |
| * | Build: Automagically handle unicornJames Rowe2018-01-161-1/+1
| * | Build: Add unicorn as a submodule and build it if neededJames Rowe2018-01-161-1/+1
| |/
* | Implement Pull #3333 from citra: citra_qt: Pause emulation on CoreError (#39)N00byKing2018-01-162-0/+2
* | Merge pull request #24 from nkatz565/nk-inputsbunnei2018-01-167-191/+524
|\ \
| * | Adding meumart's Citra SDL Joystick support. Citra PR #3116muemart2018-01-167-191/+524
* | | Merge citra-emu PR#3159 by FearlessTobi(citra-qt : Fix a bug in our fullscreen implementation)goaaats2018-01-162-15/+31
* | | Merge citra-emu PR#3001 by Styleoshin(citra-qt : Adding fullscreen mode)goaaats2018-01-165-1/+57
| |/ |/|
* | nso: Load subsdk4 if available.bunnei2018-01-151-1/+1
|/
* pctl: Clang format.bunnei2018-01-151-1/+1
* pctl: GetService should return an IParentalControlService interface.bunnei2018-01-151-3/+8
* applet_oe: Stub SetFocusHandlingMode, GetCurrentFocusState, SetTerminateResult.bunnei2018-01-151-2/+55
* settings: Fix button mappings array to have correct entries.bunnei2018-01-151-2/+6
* Merge pull request #20 from Andrix44/fixesbunnei2018-01-154-70/+8
|\
| * Clanggit rebase -i fixesunknown2018-01-151-10/+2
| * Clang formatunknown2018-01-152-4/+10
| * Change default log level to infounknown2018-01-151-1/+1
| * Update the internal resolution settingsunknown2018-01-153-67/+7
* | Merge pull request #16 from shinyquagsire23/hid-sharedmem-impl-startbunnei2018-01-157-115/+688
|\ \ | |/ |/|
| * yuzu_cmd: Fix default ini, add screenshot buttonshinyquagsire232018-01-151-1/+2
| * hid: Bare-minimum sharedmem inputshinyquagsire232018-01-152-2/+88
| * hid: Remove redundant HID prefix on structs/enumsshinyquagsire232018-01-151-73/+73
| * configure_input: update w/ Switch buttonsshinyquagsire232018-01-153-90/+221
| * settings: Screenshot buttonshinyquagsire232018-01-151-0/+2
| * yuzu_cmd: fix default inishinyquagsire232018-01-151-9/+17
| * settings: adjust button configs for Switch controllersshinyquagsire232018-01-151-17/+50
| * hid: Add sharedmem structsshinyquagsire232018-01-151-0/+312
* | vi: Add IManagerDisplayService::CloseDisplay functionbsaleil2018-01-151-0/+10
|/
* Merge pull request #14 from ogniK5377/masterbunnei2018-01-151-1/+1
|\
| * Games expect 15 for ICommonStateGetter::ReceiveMessage in order to continue executionDavid Marcec2018-01-151-1/+1
* | renderer_gl: Clear screen to black before rendering framebuffer.bunnei2018-01-152-5/+8
|/
* renderer: Render previous frame when no new one is available.bunnei2018-01-154-17/+22
* lm: Fix IPC header for Initialize.bunnei2018-01-151-1/+1
* time: Implement GetStandardUserSystemClock, GetCurrentTime.bunnei2018-01-156-1/+121
* audio: Add files to CMake.bunnei2018-01-152-1/+4
* hid: Remove unused registered_loggers.bunnei2018-01-151-3/+0
* audio: Stub out AudOutU::ListAudioOuts.bunnei2018-01-155-0/+84
* hid: Implement IAppletResource::GetSharedMemoryHandle.bunnei2018-01-153-14/+68
* qt: Update about dialog to show license for GPLv2 only.bunnei2018-01-141-1/+1
* shared_memory: Minor fixes and cleanup.bunnei2018-01-141-6/+6
* svc: Implement svcMapSharedMemory.bunnei2018-01-142-1/+38
* kernel: Increase default stack size to 64K.bunnei2018-01-141-1/+1
* Remove Surface Viewer stubJannik Vogel2018-01-143-13/+0
* Merge pull request #4 from spycrab/aboutdialogbunnei2018-01-146-3/+245
|\
| * Implement "About" dialogspycrab2018-01-146-3/+245
* | Add missing FileType declarations in GuessFromExtension and GetFileTypeStringThog2018-01-141-0/+8
|/
* yuzu qt copy windows deps renamedJames Rowe2018-01-141-2/+2
* Minor cleanupMerryMage2018-01-147-18/+18
* macOS: Update Info.plistMerryMage2018-01-141-34/+34
* Add new icons and fix up the linux paths for installJames Rowe2018-01-131-3/+1
* Update dynarmic to bc73004MerryMage2018-01-131-12/+17
* Fix build on macOS and linuxMerryMage2018-01-134-6/+7
* arm_unicorn: Log unmapped memory access address.bunnei2018-01-131-1/+1
* config: Default log filter to trace.bunnei2018-01-133-3/+3
* yuzu: Update license text to be consistent across project.bunnei2018-01-1361-61/+61
* Remove settings issues in sdl and fix a few files that broke in mingwJames Rowe2018-01-134-53/+1
* Removing unused settings and yuzu rebrandingJames Rowe2018-01-1317-485/+69
* Get yuzu sdl to start compilingJames Rowe2018-01-135-12/+12
* Remove gpu debugger and get yuzu qt to compileJames Rowe2018-01-1346-3245/+47
* Remove references to PICA and rasterizers in video_coreJames Rowe2018-01-1377-16444/+4
* Massive removal of unused modulesJames Rowe2018-01-13120-5227/+21
* config: Default CPU core to Unicorn.bunnei2018-01-133-3/+3
* core: Gut out cryptop, since it doesn't compile with C++17.bunnei2018-01-134-126/+7
* configuration: Add cpu_core configuration optionMerryMage2018-01-128-16/+40
* arm_dynarmic: Implement coreMerryMage2018-01-128-65/+166
* core: Include <algorithm> where used.bunnei2018-01-123-0/+6
* renderer_opengl: Fix LOG_TRACE in LoadFBToScreenInfo.bunnei2018-01-121-1/+1
* nv: Fix more broken asserts.bunnei2018-01-122-3/+3
* nvdisp_disp0: Fix broken assert.bunnei2018-01-121-1/+1
* core: Fix recent GCC build breaks.bunnei2018-01-122-2/+4
* svc: Implement GetSystemTick.bunnei2018-01-122-2/+21
* nvdisp_disp0: Call SwapBuffers to render framebuffer.bunnei2018-01-111-0/+7
* renderer_opengl: Support rendering Switch framebuffer.bunnei2018-01-113-138/+83
* render_base: Add a struct describing framebuffer metadata.bunnei2018-01-111-0/+26
* renderer_opengl: Add MortonCopyPixels function for Switch framebuffer.bunnei2018-01-111-0/+111
* renderer_opengl: Update DrawScreens for Switch.bunnei2018-01-112-23/+11
* CMakeLists: Add framebuffer_layout.cpp.bunnei2018-01-111-0/+1
* frontend: Update for undocked Switch screen layout.bunnei2018-01-118-279/+43
* NV: Move the nv device nodes to their own directory and namespace.Subv2018-01-1111-166/+430
* VI: Use a Pulse event instead of OneShot for the vblank events.Subv2018-01-111-1/+1
* vi: Use new CoreTiming::EventTypebunnei2018-01-111-1/+5
* NV: Expose the nvdisp_disp0 device and a weak reference to the nvdrv:a service.Subv2018-01-116-172/+252
* NV: Determine what buffer to draw for each layer of each display.Subv2018-01-112-13/+58
* NV: Signal all display's vsync event 60 times per second.Subv2018-01-112-1/+32
* NV: Give each display its own vsync event.Subv2018-01-112-12/+29
* NV: Keep track of Displays, Layers and BufferQueues in nvflinger.Subv2018-01-114-41/+261
* IPC: Allow passing arguments to the Interfaces when using PushIpcInterfaceSubv2018-01-111-3/+3
* NV: Implemented (with stubs) the vi:m service and some of its subservices.Subv2018-01-116-0/+726
* NV: Implemented the nvdrv:a service and the /dev/nvmap device.Subv2018-01-114-0/+354
* IPC: Corrected some definitions for the buffer C descriptor flags.Subv2018-01-113-3/+10
* svc: Stub ResetSignal and CreateTransferMemorySubv2018-01-112-3/+28
* svc: Stub SetMemoryAttributeSubv2018-01-112-0/+11
* Threads: Added enum values for the Switch's 4 cpu cores and implemented svcGetInfo(AllowedCpuIdBitmask)Subv2018-01-105-16/+28
* Services: Allow lm to log single-character messages.Subv2018-01-101-7/+3
* SVC: Fixed WaitSynchronization with multiple handles when none is immediately ready.Subv2018-01-091-7/+18
* SVC: Implemented CancelSynchronization.Subv2018-01-092-1/+19
* ErrorCodes: Updated the InvalidHandle and Timeout kernel error codes.Subv2018-01-091-2/+7
* SVC: Fixed WaitSynchronization with multiple handles when at least one of them is ready.Subv2018-01-092-3/+29
* kernel: Rename Semaphore to ConditionVariable.bunnei2018-01-0911-171/+180
* mutex: Remove unused call to VerifyGuestState.bunnei2018-01-091-3/+0
* Kernel: Actually wake up the requested number of threads in Semaphore::Release.Subv2018-01-094-21/+18
* Kernel: Properly keep track of mutex lock data in the guest memory. This fixes userland locking/unlocking.Subv2018-01-094-67/+63
* Kernel: Allow chaining WaitSynchronization calls inside a wakeup callback.Subv2018-01-094-30/+78
* fix macos buildMerryMage2018-01-092-5/+5
* core_timing: Use 1.020GHz for core clock rate.bunnei2018-01-091-5/+3
* CoreTiming: Reworked CoreTiming (cherry-picked from Citra #3119)B3n302018-01-0912-557/+638
* IPC: Make DuplicateSession return the Domain instead of the Session if the request was made on a Domain interface.Subv2018-01-072-2/+7
* AppletOE: Fixed command buffer structure for ReceiveMessage.Subv2018-01-071-2/+1
* IPC: Corrected some command headers in the IPC Controller interface.Subv2018-01-071-4/+2
* IPC: Corrected some command header sizes in appletOE.Subv2018-01-071-12/+21
* IPC: Take the number of domain objects as a parameter in MakeBuilder.Subv2018-01-072-4/+6
* SM: Fixed connecting to services with an 8-byte name, like appletOE.Subv2018-01-071-12/+4
* IPC: Fixed pushing ResultCodes into the command buffer.Subv2018-01-072-7/+9
* IPC: Add functions to read the input move/copy objects from an IPC request.Subv2018-01-073-2/+42
* IPC: Don't attempt to read the command buffer if it holds a Close request.Subv2018-01-071-0/+5
* IPC Cleanup: Remove 3DS-specific code and translate copy, move and domain objects in IPC requests.Subv2018-01-078-405/+118
* IPC: Skip the entire u64 of the command id when receiving an IPC request.Subv2018-01-072-15/+5
* IPC: Use the correct size when pushing raw data to the command buffer and fixed pushing domain objects.Subv2018-01-074-10/+29
* svc: Implement svcSignalProcessWideKey.bunnei2018-01-072-4/+23
* audio: Log dropping frames as trace to reduce spam.bunnei2018-01-071-1/+1
* semaphore: More changes for Switch.bunnei2018-01-072-11/+17
* wait_object: Refactor to allow waking up a single thread.bunnei2018-01-072-15/+28
* nso: Always load the filepath specified by the user.bunnei2018-01-071-1/+3
* core_timing: Increase clock speed for Switch docked.bunnei2018-01-073-3/+3
* svc: Implement svcWaitProcessWideKeyAtomic.bunnei2018-01-062-1/+54
* semaphore: Updates for Switch.bunnei2018-01-062-21/+31
* lm: Assert on unsupported multi-message.bunnei2018-01-061-0/+9
* svc: Implement WaitSynchronization for a single handle.bunnei2018-01-061-4/+24
* svc: Refactor LockMutex code to use WaitSynchronization1.bunnei2018-01-061-13/+45
* lm: Improve Log() to format a useful string.bunnei2018-01-051-10/+75
* svc: Add missing string_util include.bunnei2018-01-051-0/+1
* cmake: Don't compile Dynarmic as it's unused.bunnei2018-01-041-1/+1
* core: Increase tight_loop 100x for speed.bunnei2018-01-041-1/+1
* citra_qt: Remove VFP registers, since this isn't used anyways and caused an assert.bunnei2018-01-041-4/+0
* arm_unicorn: Load/release unicorn DLL.bunnei2018-01-041-0/+16
* externals: Use unicorn DLL instead of static lib.bunnei2018-01-042-0/+4
* unicorn: Use for arm interface on Windows.bunnei2018-01-044-9/+242
* arm_dynarmic: More cleanup.bunnei2018-01-041-6/+0
* core: Remove unicorn_dynload.bunnei2018-01-041-2/+0
* arm_dynarmic: Gut interface until dynarmic is ready for general use.bunnei2018-01-042-142/+44
* arm: Remove SkyEye/Dyncom code that is ARMv6-only.bunnei2018-01-0337-28101/+23
* vm_manager: Use a more reasonable MAX_ADDRESS size.bunnei2018-01-031-5/+4
* svc: Remove unnecessary "svc" prefix to naming scheme.bunnei2018-01-031-106/+106
* pctl: Remove duplicate InstallInterfaces function.bunnei2018-01-031-4/+0
* hle: Move SVC code to kernel namespace.bunnei2018-01-034-134/+121
* svc: Improve svcGetInfo.bunnei2018-01-012-35/+41
* vm_manager: Stub out a bunch of interfaces used by svcGetInfo.bunnei2018-01-012-1/+51
* svc: Fix string formatting for CreateThread.bunnei2018-01-011-1/+1
* cmake: Add missing object_address_table.bunnei2018-01-011-0/+2
* core/video_core: Fix a bunch of u64 -> u32 warnings.bunnei2018-01-018-26/+26
* svc: Stub out svcWaitSynchronization.bunnei2018-01-011-1/+9
* svc: Implement svcExitProcess.bunnei2018-01-013-11/+77
* svc: Implement svcUnlockMutex.bunnei2018-01-011-1/+11
* svc: Implement svcLockMutex.bunnei2018-01-013-24/+134
* kernel: Add ObjectAddressTable class.bunnei2018-01-013-2/+101
* thread: Keep track of the initially created handle.bunnei2017-12-313-2/+7
* svc: Implement svcExitThread.bunnei2017-12-311-1/+9
* svc: Implement svcCreateThread.bunnei2017-12-311-2/+57
* svc: Cleanup svcGetThreadPriority.bunnei2017-12-311-3/+5
* svc: Stub out svcGetCurrentProcessorNumber.bunnei2017-12-311-1/+7
* errors: Define missing kernel error codes.bunnei2017-12-311-0/+3
* svc: Implement svcSetThreadPriority.bunnei2017-12-311-1/+30
* svc: Change SignalProcessWideKey to a stub.bunnei2017-12-311-2/+2
* function_wrappers: Cleanup, fix warnings, remove unused code.bunnei2017-12-311-187/+35
* svc: Implement svcUnmapMemory.bunnei2017-12-313-1/+15
* svc: Minor cleanups.bunnei2017-12-301-8/+9
* svc: Implement svcStartThread.bunnei2017-12-301-0/+16
* thread: Main thread should set thread handle to reg 1.bunnei2017-12-301-1/+4
* thread: Remove THUMB mode flag.bunnei2017-12-301-1/+1
* thread: Main thread should be ready by default, all others dormant.bunnei2017-12-301-4/+3
* kernel: Various 64-bit fixes in memory/process/threadbunnei2017-12-295-14/+14
* applet_oe: Stub out a bunch of interfaces necessary for boot.bunnei2017-12-292-1/+159
* controller: Implement DuplicateSession.bunnei2017-12-292-9/+11
* kernel: Fix implementation of ConvertSessionToDomain.bunnei2017-12-2910-54/+90
* ap, aoc_u: Minor cleanup.bunnei2017-12-293-4/+1
* service: Add empty interface for pctl:a.bunnei2017-12-296-0/+90
* kernel: Add basic support for Domain object.bunnei2017-12-295-4/+112
* kernel: Add SyncObject primitive, use it for ClientSession.bunnei2017-12-294-10/+41
* svc: Implement MapMemory.bunnei2017-12-293-4/+17
* process: Add method to mirror a memory region.bunnei2017-12-292-0/+27
* svc: Implement SetHeapSize.bunnei2017-12-282-3/+19
* service: Clean up apm/lm/applet_oe/controller/sm ctor/dtor.bunnei2017-12-2810-20/+10
* service: Halt on ReportUnimplementedFunction and improve output log.bunnei2017-12-281-4/+2
* service: Add empty interface for aoc:u.bunnei2017-12-284-0/+44
* service: Return proper result code for IPC::CommandType::Close.bunnei2017-11-014-9/+12
* hle: Use Switch formatted result codes.bunnei2017-11-018-346/+110
* svc: Implement GetThreadId and GetProcessId.bunnei2017-10-232-2/+37
* logging: Rename category "Core_ARM11" to "Core_ARM".bunnei2017-10-2310-89/+89
* nso: Load more common submodules.bunnei2017-10-231-15/+11
* memory: Support 32-bit paging, move heap address space up.bunnei2017-10-232-3/+3
* hle: Fix QueryMemory response for MemoryInfo.bunnei2017-10-207-149/+31
* lm: Implement lm::Initialize and Logger::log.bunnei2017-10-192-3/+67
* hle_ipc: Only copy necessary fields for outgoing command buffer.bunnei2017-10-191-1/+1
* hle_ipc: Parse out buffer X/A/B/B descriptors from incoming command buffer.bunnei2017-10-192-14/+19
* service: Add CreatePort function (that does not register/install).bunnei2017-10-192-0/+12
* memory: Print addresses as 64-bit.bunnei2017-10-191-2/+2
* ipc_helpers: Fix alignment (was wrong as a result of a dynarmic bug).bunnei2017-10-181-3/+4
* service: Print correct command ID on unimplemented function.bunnei2017-10-181-1/+1
* hle: Implement ConvertSessionToDomain, various cleanups.bunnei2017-10-1510-33/+82
* core: Refactor MakeMagic usage and remove dead code.bunnei2017-10-1511-885/+18
* hle: Add service stubs for apm and appletOE.bunnei2017-10-1510-2/+136
* hle: Initial implementation of NX service framework and IPC.bunnei2017-10-1521-859/+574
* nso: Add a log for loading submodules.bunnei2017-10-141-0/+1
* svc: Some logging cleanup.bunnei2017-10-141-7/+5
* svc: Update MemoryInfo flags for 64-bit.bunnei2017-10-141-5/+5
* svc: Initial nx impl. for QueryMemory, ConnectToPort, SendSyncRequest, etc.bunnei2017-10-141-1185/+185
* Remove more 3DS-specific code.bunnei2017-10-135-48/+3
* Remove more 3DS-specific code.bunnei2017-10-137-1414/+2
* Remove more 3DS-specific code.bunnei2017-10-133-55/+0
* Remove lots more 3DS-specific code.bunnei2017-10-1350-6976/+8
* hle: Remove a large amount of 3ds-specific service code.bunnei2017-10-10200-22393/+2
* Merge remote-tracking branch 'upstream/master' into nxbunnei2017-10-10209-2333/+20476
|\
| * Change command header in nwm::UDS Initialize functionDragios2017-10-091-1/+1
| * Merge pull request #2991 from Subv/getpointerSebastian Valle2017-10-083-63/+61
| |\
| | * SVC: Removed GetPointer usage in the GetResourceLimit functions.Subv2017-10-041-10/+16
| | * SVC: Remove GetPointer usage in CreatePort.Subv2017-10-042-6/+4
| | * SVC: Replace GetPointer usage with ReadCString in ConnectToPort.Subv2017-10-042-20/+9
| | * SVC: Replace GetPointer usage with ReadBlock in OutputDebugString.Subv2017-10-042-4/+6
| | * SVC: Replace GetPointer usage with Read32 in ReplyAndReceive.Subv2017-10-042-7/+6
| | * SVC: Replace GetPointer usage with Read32 in WaitSynchronizationN.Subv2017-10-042-8/+8
| | * Memory: Remove all GetPointer usages from the GDB stub.Subv2017-10-041-8/+12
| * | Merge pull request #2975 from shinyquagsire23/archive-ncch-container-and-overrideSebastian Valle2017-10-067-78/+581
| |\ \
| | * | file_sys, loader: add support for reading TMDs to determine app pathsshinyquagsire232017-10-012-5/+27
| | * | file_sys: add class for Title Metadata (TMD)shinyquagsire232017-10-013-0/+338
| | * | file_sys/ncch_container: add RomFS, ExeFS override to allow for backward compatibility with existing .romfs system archive dumpsshinyquagsire232017-10-012-69/+206
| | * | file_sys/archive_ncch: use NCCHContainer instead of loading .romfs filesshinyquagsire232017-10-011-6/+12
| * | | Merge pull request #2953 from Subv/applet_launchSebastian Valle2017-10-042-30/+47
| |\ \ \
| | * | | HLE/APT: Always set up the APT parameter when starting a library applet.Subv2017-09-262-30/+47
| * | | | Extracted the attribute setup and draw commands into their own functionsHuw Pascoe2017-10-041-217/+222
| * | | | Merge pull request #2977 from Subv/shmem_createbunnei2017-10-031-15/+12
| |\ \ \ \ | | |_|_|/ | |/| | |
| | * | | Kernel/SharedMemory: Don't take over and unmap the source memory block when creating a shared memory, just reference it.Subv2017-10-021-15/+12
| | | |/ | | |/|
| * | | Merge pull request #2971 from Subv/per_process_memopsSebastian Valle2017-10-014-22/+61
| |\ \ \
| | * | | Memory: Make WriteBlock take a Process parameter on which to operateSubv2017-10-012-10/+19
| | * | | Memory: Make ReadBlock take a Process parameter on which to operateSubv2017-10-012-12/+30
| | * | | Kernel/Thread: Added a helper function to get a thread's command buffer VAddr.Subv2017-10-012-0/+12
| * | | | Merge pull request #2974 from Subv/nim_eventSebastian Valle2017-10-013-2/+29
| |\ \ \ \ | | |_|/ / | |/| | |
| | * | | Services/NIM: Implement CheckForSysUpdateEvent.Subv2017-09-303-2/+29
| * | | | Moved down_count to CoreTimingHuw Pascoe2017-09-309-43/+33
| |/ / /
| * | | Services/UDS: Handle the rest of the connection sequence. (#2963)B3n302017-09-303-19/+250
| * | | Merge pull request #2946 from Subv/home_menu_aptSebastian Valle2017-09-303-8/+45
| |\ \ \
| | * | | HLE/APT: Always return an error from PrepareToStartNewestHomeMenu so that the Home Menu doesn't try to reboot the system.Subv2017-09-243-2/+26
| | * | | HLE/APT: Prepare the APT Wakeup parameter when the game calls InitializeSubv2017-09-241-6/+19
| | | |/ | | |/|
| * | | Merge pull request #2967 from Subv/thread_wakeup_callbacksSebastian Valle2017-09-304-17/+91
| |\ \ \ | | |_|/ | |/| |
| | * | Kernel/Threads: When putting a thread to wait, specify a function to execute when it is awoken.Subv2017-09-284-17/+91
| * | | Fixed type conversion ambiguityHuw Pascoe2017-09-3032-91/+97
| * | | Merge pull request #2961 from Subv/load_titlesbunnei2017-09-2917-70/+157
| |\ \ \ | | |/ / | |/| |
| | * | Loaders: Don't automatically set the current process every time we load an application.Subv2017-09-278-37/+40
| | * | Kernel/Thread: Allow specifying which process a thread belongs to when creating it.Subv2017-09-274-17/+22
| | * | Tests: Added Memory::IsValidVirtualAddress tests.Subv2017-09-272-0/+57
| | * | Tests: Fixed ARM VFP testsSubv2017-09-271-9/+13
| | * | Memory: Allow IsValidVirtualAddress to be called with a specific process parameter.Subv2017-09-272-7/+25
| * | | Merge pull request #2907 from Subv/warnings3Sebastian Valle2017-09-272-5/+9
| |\ \ \
| | * | | Disable unary operator- on Math::Vec2/Vec3/Vec4 for unsigned types.Subv2017-09-272-5/+9
| * | | | Merge pull request #2954 from Subv/cache_unmapped_memJames Rowe2017-09-271-1/+16
| |\ \ \ \ | | |_|/ / | |/| | |
| | * | | Memory/RasterizerCache: Ignore unmapped memory regions when caching physical regions.Subv2017-09-261-1/+16
| | | |/ | | |/|
| * | | Merge pull request #2958 from Subv/audio_buffer_datatypeMerry2017-09-265-7/+9
| |\ \ \
| | * | | Audio: Use std::deque instead of std::vector for the audio buffer type (StereoBuffer16).Subv2017-09-265-7/+9
| | | |/ | | |/|
| * / | HLE/Archives: Allow multiple loaded applications to access their SelfNCCH archive independently.Subv2017-09-256-18/+65
| |/ /
| * | Merge pull request #2952 from MerryMage/page-tablesB3n302017-09-2512-27/+56
| |\ \
| | * | ARM_Interface: Implement PageTableChangedMerryMage2017-09-256-6/+39
| | * | memory: Remove GetCurrentPageTablePointersMerryMage2017-09-242-10/+0
| | * | memory: Add GetCurrentPageTable/SetCurrentPageTableMerryMage2017-09-247-13/+19
| * | | Merge pull request #2951 from huwpascoe/perf-4B3n302017-09-251-10/+4
| |\ \ \
| | * | | Optimized MortonHuw Pascoe2017-09-241-10/+4
| | |/ /
| * | | Merge pull request #2949 from wwylele/fix-trB3n302017-09-253-21/+22
| |\ \ \
| | * | | citra-qt: fix some untranslated stringswwylele2017-09-243-21/+22
| | |/ /
| * | | Merge pull request #2948 from Subv/register_serviceB3n302017-09-254-1/+33
| |\ \ \
| | * | | HLE/SRV: Implemented RegisterService.Subv2017-09-244-1/+33
| | | |/ | | |/|
| * | | Loader/NCCH: Add support for loading application updates (#2927)Max Thomas2017-09-258-439/+670
| * | | Services/UDS: Added a function to send EAPoL-Start packets (#2920)B3n302017-09-255-88/+250
| * | | Optimized Float<M,E> multiplicationHuw Pascoe2017-09-251-11/+7
| | |/ | |/|
| * | Merge pull request #2921 from jroweboy/batch-fix-2James Rowe2017-09-241-12/+17
| |\ \ | | |/ | |/|
| | * Remove pipeline.gpu_mode and fix minor issuesJames Rowe2017-09-231-12/+2
| | * GPU: Add draw for immediate and batch modesJames Rowe2017-09-111-2/+17
| * | Merge pull request #2928 from huwpascoe/masterYuri Kunde Schlesner2017-09-221-7/+18
| |\ \
| | * | Fixed framebuffer warningHuw Pascoe2017-09-171-7/+18
| * | | Merge pull request #2933 from huwpascoe/perf-1bunnei2017-09-191-1/+2
| |\ \ \
| | * | | Improved performance of FromAttributeBufferHuw Pascoe2017-09-171-1/+2
| | |/ /
| * / / WebService: Verify username and token (#2930)B3n302017-09-1915-38/+316
| |/ /
| * | Merge pull request #2906 from Subv/ns_new_frameworkYuri Kunde Schlesner2017-09-167-42/+77
| |\ \
| | * | Services/NS: Port ns:s to the new service framework.Subv2017-09-167-42/+77
| * | | Merge pull request #2900 from wwylele/clip-2Yuri Kunde Schlesner2017-09-165-46/+116
| |\ \ \
| | * | | SwRasterizer/Clipper: flip the sign convention to match PICA and OpenGLwwylele2017-08-251-9/+9
| | * | | gl_rasterizer: implement custom clip planewwylele2017-08-253-34/+83
| | * | | SwRasterizer: implement custom clip planewwylele2017-08-242-4/+25
| * | | | Merge pull request #2842 from Subv/switchable_page_tableB3n302017-09-1514-123/+191
| |\ \ \ \
| | * | | | CPU/Dynarmic: Disable the fast page-table access in dynarmic until it supports switching page tables at runtime.Subv2017-09-151-1/+3
| | * | | | Tests/VFP: Use a standalone pagetable for the TestEnvironment memory operations.Subv2017-09-151-4/+14
| | * | | | Kernel/Memory: Make IsValidPhysicalAddress not go through the current process' virtual memory mapping.Subv2017-09-151-2/+1
| | * | | | Kernel/Threads: Don't clear the CPU instruction cache when performing a context switch from an idle thread into a thread in the same process.Subv2017-09-151-1/+3
| | * | | | Kernel/Memory: Changed GetPhysicalPointer so that it doesn't go through the current process' page table to obtain a pointer.Subv2017-09-154-30/+69
| | * | | | Kernel/Memory: Switch the current page table when a new process is scheduled.Subv2017-09-101-0/+10
| | * | | | Kernel/Memory: Give each Process its own page table.Subv2017-09-109-87/+93
| * | | | | Merge pull request #2915 from wwylele/font-archive-2bunnei2017-09-123-135/+155
| |\ \ \ \ \ | | |_|_|_|/ | |/| | | |
| | * | | | APT: load different shared font depending on the regionwwylele2017-09-033-135/+155
| * | | | | Merge pull request #2865 from wwylele/gs++bunnei2017-09-0815-37/+594
| |\ \ \ \ \
| | * | | | | pica/command_processor: build geometry pipeline and run geometry shaderwwylele2017-08-196-28/+383
| | * | | | | pica/shader/jit: implement SETEMIT and EMITwwylele2017-08-192-2/+49
| | * | | | | pica/primitive_assembly: Handle winding for GS primitivewwylele2017-08-192-3/+19
| | * | | | | correct constnesswwylele2017-08-192-2/+4
| | * | | | | pica/shader/interpreter: implement SETEMIT and EMITwwylele2017-08-191-0/+16
| | * | | | | pica/shader: extend UnitState for GSwwylele2017-08-192-0/+84
| | * | | | | pica/regs: layout geometry shader configuration regswwylele2017-08-102-2/+39
| * | | | | | Merge pull request #2914 from wwylele/fresnel-fixbunnei2017-09-052-7/+9
| |\ \ \ \ \ \
| | * | | | | | pica/lighting: only apply Fresnel factor for the last lightwwylele2017-09-032-7/+9
| * | | | | | | Merge pull request #2831 from Subv/uds_authWeiyi Wang2017-09-057-53/+289
| |\ \ \ \ \ \ \
| | * | | | | | | Services/UDS: Remove an old duplicated declaration of WifiPacket.Subv2017-08-272-22/+0
| | * | | | | | | Services/UDS: Handle the connection sequence packets.Subv2017-08-271-17/+83
| | * | | | | | | Services/UDS: Store the received beacon frames until RecvBeaconBroadcastData is called, up to 15 beacons at the same time, removing any older beacon frames when the limit is exceeded.Subv2017-08-271-3/+62
| | * | | | | | | Services/UDS: Add functions to generate 802.11 auth and assoc response frames.Subv2017-08-275-11/+144
| * | | | | | | | Remove _flag in var namesmailwl2017-09-041-6/+6
| * | | | | | | | Mii Selector Applet: update Mii structuresmailwl2017-09-042-34/+29
| * | | | | | | | Fix icon for citra qtJames Rowe2017-09-031-1/+3
| * | | | | | | | Add manifestDaMan2017-09-032-0/+16
| | |_|_|/ / / / | |/| | | | | |
| * | | | | | | Merge pull request #2909 from wwylele/telemetry-gasbunnei2017-08-311-0/+6
| |\ \ \ \ \ \ \
| | * | | | | | | video_core: report telemetry for gas modewwylele2017-08-311-0/+6
| | | |/ / / / / | | |/| | | | |
| * | | | | | | Merge pull request #2858 from MerryMage/interp-on-a-frame-basisbunnei2017-08-313-88/+74
| |\ \ \ \ \ \ \ | | |/ / / / / / | |/| | | | | |
| | * | | | | | interpolate: Interpolate on a frame-by-frame basisMerryMage2017-08-283-88/+74
| * | | | | | | Merge pull request #2891 from wwylele/sw-bumpbunnei2017-08-314-10/+40
| |\ \ \ \ \ \ \
| | * | | | | | | gl_rasterizer/lighting: more accurate CP formulawwylele2017-08-221-2/+2
| | * | | | | | | SwRasterizer/Lighting: implement LUT input CPwwylele2017-08-221-0/+11
| | * | | | | | | SwRasterizer/Lighting: implement bump mappingwwylele2017-08-223-8/+27
| * | | | | | | | Merge pull request #2899 from wwylele/touch-refactorbunnei2017-08-298-43/+87
| |\ \ \ \ \ \ \ \
| | * | | | | | | | EmuWindow: refactor touch input into a TouchDevicewwylele2017-08-245-39/+72
| | * | | | | | | | HID: use TouchDevice for touch padwwylele2017-08-243-4/+15
| | | |_|_|_|_|/ / | | |/| | | | | |
| * | | | | | | | Merge pull request #2905 from danzel/fix-2902Sebastian Valle2017-08-294-5/+5
| |\ \ \ \ \ \ \ \ | | |_|_|_|_|_|_|/ | |/| | | | | | |
| | * | | | | | | Use recursive_mutex instead of mutex to fix #2902danzel2017-08-294-5/+5
| | |/ / / / / /
| * | | | | | | Merge pull request #2892 from Subv/warnings2Weiyi Wang2017-08-283-6/+10
| |\ \ \ \ \ \ \
| | * | | | | | | Warnings: Fixed a few missing-return warnings in video_core.Subv2017-08-263-6/+10
| | | |/ / / / / | | |/| | | | |
| * | | | | | | web_backend: Fix CPR bug where Winsock is not properly initializing.bunnei2017-08-271-15/+27
| * | | | | | | web_backend: Fix asynchronous JSON post by spawning new thread.bunnei2017-08-261-9/+18
| * | | | | | | web_services: Refactor to remove dependency on Core.bunnei2017-08-265-20/+35
| * | | | | | | qt: Add an option to view/regenerate telemetry ID.bunnei2017-08-264-7/+40
| * | | | | | | default_ini: Use correct telemetry endpoint URL.bunnei2017-08-261-1/+1
| * | | | | | | # This is a combination of 2 commits.bunnei2017-08-261-3/+30
| * | | | | | | qt: Add web configuration tab.bunnei2017-08-266-2/+217
| * | | | | | | web_backend: User config for username and token, support anonymous post.bunnei2017-08-262-40/+17
| * | | | | | | telemetry: Log frontend type.bunnei2017-08-262-0/+4
| * | | | | | | settings: Add enable_telemetry, citra_username, and citra_token.bunnei2017-08-264-0/+20
| * | | | | | | telemetry_session: Log telemetry ID.bunnei2017-08-261-0/+36
| * | | | | | | citra_qt: Show one-time callout messages to user.bunnei2017-08-264-0/+50
| * | | | | | | SidebySide Layout (#2859)ThaMighty902017-08-256-7/+61
| | |/ / / / / | |/| | | | |
| * | | | | | Merge pull request #2839 from Subv/global_kernel_lockJames Rowe2017-08-246-4/+46
| |\ \ \ \ \ \
| | * | | | | | Kernel/Memory: Acquire the global HLE lock when a memory read/write operation falls outside of the fast path, for it might perform an MMIO operation.Subv2017-08-221-1/+8
| | * | | | | | Kernel/HLE: Use a mutex to synchronize access to the HLE kernel state between the cpu thread and any other possible threads that might touch the kernel (network thread, etc).Subv2017-08-225-3/+38
| * | | | | | | Merge pull request #2893 from Subv/not_schedule_main_threadbunnei2017-08-221-5/+1
| |\ \ \ \ \ \ \
| | * | | | | | | Kernel/Threads: Don't immediately switch to the new main thread when loading a new process.Subv2017-08-221-5/+1
| | | |/ / / / / | | |/| | | | |
| * | | | | | | Merge pull request #2888 from Subv/warningsJames Rowe2017-08-2211-17/+22
| |\ \ \ \ \ \ \
| | * | | | | | | GPU/Warnings: Explicitly cast the screen refresh ticks to u64.Subv2017-08-211-1/+1
| | * | | | | | | Warnings: Add UNREACHABLE macros to switches that contemplate all possible values.Subv2017-08-213-2/+7
| | * | | | | | | HLE/Applets: Fixed some conversion warnings when creating the framebuffer shared memory objects.Subv2017-08-214-8/+8
| | * | | | | | | CPU/Dynarmic: Fixed a warning when incrementing the number of ticks in ExecuteInstructions.Subv2017-08-211-1/+1
| | * | | | | | | Dyncom: Use size_t instead of int to store the instruction offsets in the instruction cache.Subv2017-08-212-4/+4
| | * | | | | | | Dyncom: Fixed a conversion warning when decoding thumb instructions.Subv2017-08-211-1/+1
| | |/ / / / / /
| * | | | | | | motion_emu: fix initialization orderwwylele2017-08-221-1/+4
| * | | | | | | swrasterizer: remove invalid TODOwwylele2017-08-211-4/+2
| * | | | | | | swrasterizer/clipper: remove tested TODOwwylele2017-08-211-4/+0
| * | | | | | | gl_shader_gen: simplify and clarify the depth transformation between vertex shader and fragment shaderwwylele2017-08-211-2/+5
| * | | | | | | gl_rasterizer: add clipping plane z<=0 defined in PICAwwylele2017-08-214-0/+21
| |/ / / / / /
| * | | | | | Merge pull request #2872 from wwylele/sw-geo-factorYuri Kunde Schlesner2017-08-211-4/+16
| |\ \ \ \ \ \
| | * | | | | | SwRasterizer/Lighting: implement geometric factorwwylele2017-08-111-4/+16
| * | | | | | | Merge pull request #2861 from wwylele/motion-refactorJames Rowe2017-08-2020-277/+302
| |\ \ \ \ \ \ \
| | * | | | | | | HID: fix a comment and a warningwwylele2017-08-201-2/+2
| | * | | | | | | motion_emu: no need to include thread in headerwwylele2017-08-192-2/+7
| | * | | | | | | move MotionEmu from core/frontend to input_common as a InputDevicewwylele2017-08-1117-244/+221
| | * | | | | | | HID: use MotionDevice for Accelerometer and Gyroscopewwylele2017-08-113-5/+48
| * | | | | | | | Merge pull request #2871 from wwylele/sw-spotlightJames Rowe2017-08-201-3/+19
| |\ \ \ \ \ \ \ \ | | |_|_|_|_|_|_|/ | |/| | | | | | |
| | * | | | | | | SwRasterizer/Lighting: implement spot lightwwylele2017-08-111-3/+19
| | | |/ / / / / | | |/| | | | |
| * | | | | | | Added missing parts in libnetwork (#2838)B3n302017-08-199-37/+310
| * | | | | | | Merge pull request #2881 from MerryMage/dsp-firm-checkYuri Kunde Schlesner2017-08-161-3/+4
| |\ \ \ \ \ \ \
| | * | | | | | | dsp_dsp: Remove size assertion in LoadComponentMerryMage2017-08-151-3/+4
| * | | | | | | | Fix Spelling/English mistakesDave Leaver2017-08-131-1/+1
| * | | | | | | | Merge pull request #2843 from Subv/applet_slotsSebastian Valle2017-08-122-35/+200
| |\ \ \ \ \ \ \ \
| | * | | | | | | | Services/APT: Use the AppletAttributes union directly when dealing with applet attrs.Subv2017-08-071-19/+15
| | * | | | | | | | Services/APT: Use an array to hold data about the 4 possible concurrent applet types (Application, Library, HomeMenu, System).Subv2017-08-072-35/+204
| | |/ / / / / / /
| * | | / / / / / gl_shader_gen: don't call SampleTexture when bump map is not usedwwylele2017-08-111-4/+5
| | |_|/ / / / / | |/| | | | | |
| * | | | | | | Merge pull request #2874 from danzel/spelling-1Weiyi Wang2017-08-112-4/+4
| |\ \ \ \ \ \ \ | | |_|/ / / / / | |/| | | | | |
| | * | | | | | Fix some spelling mistakesdanzel2017-08-112-4/+4
| | | |_|_|_|/ | | |/| | | |
| * | | | | | Merge pull request #2863 from wwylele/pad-state-zeroWeiyi Wang2017-08-102-2/+2
| |\ \ \ \ \ \
| | * | | | | | HID: zero unused PadState bitswwylele2017-08-102-2/+2
| | | |/ / / / | | |/| | | |
| * | | | | | SwRasterizer/Lighting: use make_tuple instead of constructorwwylele2017-08-101-1/+1
| | |/ / / / | |/| | | |
| * | | | | Merge pull request #2862 from j-selby/update-cryptoppbunnei2017-08-091-1/+1
| |\ \ \ \ \
| | * | | | | Update cryptoppJames2017-08-081-1/+1
| | |/ / / /
| * | | | | Merge pull request #2822 from wwylele/sw_lighting-2Weiyi Wang2017-08-098-9/+315
| |\ \ \ \ \
| | * | | | | SwRasterizer/Lighting: shorten file namewwylele2017-08-034-4/+4
| | * | | | | SwRasterizer/Lighting: move to its own filewwylele2017-08-024-240/+271
| | * | | | | SwRasterizer/Lighting: reduce confusionwwylele2017-08-021-1/+1
| | * | | | | SwRasterizer/Lighting: move quaternion normalization to the callerwwylele2017-08-021-3/+3
| | * | | | | SwRasterizer/Lighting: dist atten lut input need to be clampwwylele2017-07-111-1/+1
| | * | | | | SwRasterizer/Lighting: unify float suffixwwylele2017-07-111-11/+13
| | * | | | | SwRasterizer/Lighting: get rid of nested returnwwylele2017-07-111-10/+11
| | * | | | | SwRasterizer/Lighting: refactor GetLutValue into a function.wwylele2017-07-111-83/+27
| | * | | | | SwRasterizer: only interpolate quat and view when lighting is enabledwwylele2017-07-111-14/+14
| | * | | | | vector_math: remove dead template parameterwwylele2017-07-111-1/+1
| | * | | | | SwRasterizer/Lighting: pass lighting state as parameterwwylele2017-07-111-13/+13
| | * | | | | vector_math: remove broken SFINAE stuffwwylele2017-07-111-3/+2
| | * | | | | SwRasterizer/Lighting: Move the clamp highlight calculation to the end of the per-light loop body.Subv2017-07-111-17/+17
| | * | | | | SwRasterizer/Lighting: Move the lighting enable check outside the ComputeFragmentsColors function.Subv2017-07-111-7/+6
| | * | | | | SwRasterizer/Lighting: Do not use global registers state in ComputeFragmentsColors.Subv2017-07-111-3/+3
| | * | | | | SwRasterizer/Lighting: Do not use global state in LookupLightingLut.Subv2017-07-112-13/+22
| | * | | | | SwRasterizer/Lighting: Fixed a bug where the distance attenuation bias was being set to the dist atten scale.Subv2017-07-111-3/+2
| | * | | | | SwRasterizer: Fixed a few conversion warnings and moved per-light values into the per-light loop.Subv2017-07-111-5/+6
| | * | | | | SwRasterizer: Run clang-formatSubv2017-07-111-45/+83
| | * | | | | SwRasterizer: Flip the vertex quaternions before clipping (if necessary).Subv2017-07-113-21/+16
| | * | | | | SwRasterizer: Corrected the light LUT lookups.Subv2017-07-111-6/+7
| | * | | | | SwRasterizer: Corrected the light LUT lookups.Subv2017-07-112-33/+48
| | * | | | | SwRasterizer: Fixed the lighting lut lookup function.Subv2017-07-111-2/+4
| | * | | | | SwRasterizer: Calculate fresnel for fragment lighting.Subv2017-07-111-1/+25
| | * | | | | SwRasterizer: Calculate specular_1 for fragment lighting.Subv2017-07-111-3/+59
| | * | | | | SwRasterizer: Calculate specular_0 for fragment lighting.Subv2017-07-111-13/+94
| | * | | | | SwRasterizer: Implement primary fragment color.Subv2017-07-111-4/+113
| * | | | | | Merge pull request #2856 from wwylele/shader-shareWeiyi Wang2017-08-092-26/+45
| |\ \ \ \ \ \
| | * | | | | | pica: upload shared shader code to both unitwwylele2017-08-072-26/+45
| * | | | | | | Service/dlp: Update function tables according 3dbrewmailwl2017-08-093-4/+44
| | |_|/ / / / | |/| | | | |
| * | | | | | Quickfix typo in OpenGL 3.3 error messageAndrea Pascal2017-08-051-1/+1
| * | | | | | telemetry: Add field for OsPlatform.bunnei2017-08-041-0/+9
| * | | | | | telemetry: Add field for BuildName.bunnei2017-08-041-0/+1
| * | | | | | telemetry: Add field for RequiresSharedFont.bunnei2017-08-041-0/+4
| * | | | | | telemetry_session: Log BuildDate and ProgramName fields.bunnei2017-08-041-0/+7
| * | | | | | common: Add build timestamp to scm_rev.bunnei2017-08-042-0/+3
| * | | | | | core: Expose AppLoader as a public interface.bunnei2017-08-041-4/+5
| * | | | | | loader: Expose program title.bunnei2017-08-043-12/+31
| | |_|_|/ / | |/| | | |
| * | | | | Handle invalid filenames when renaming files/directoriesJames2017-07-312-4/+78
| |/ / / /
| * | | | Merge pull request #2848 from wwylele/shader-loop-fixWeiyi Wang2017-07-291-1/+1
| |\ \ \ \
| | * | | | pica/shader_interpreter: fix off-by-one in LOOPwwylele2017-07-271-1/+1
| * | | | | Merge pull request #2679 from MerryMage/interp-testsbunnei2017-07-275-0/+13716
| |\ \ \ \ \
| | * | | | | tests: Add tests for vaddMerryMage2017-07-235-2/+13510
| | * | | | | tests: Arm testing frameworkMerryMage2017-07-233-0/+208
| | |/ / / /
| * | | | | Merge pull request #2840 from Subv/apt_parameterbunnei2017-07-272-33/+105
| |\ \ \ \ \
| | * | | | | Service/APT: Log Send/Cancel/Receive/GlanceParameter calls even if they return an error.Subv2017-07-211-7/+9
| | * | | | | Services/APT: Return the proper error code when calling SendParameter with an outstanding parameter already in memory.Subv2017-07-212-4/+17
| | * | | | | Services/APT: Reset the APT parameter inside CancelParameter if the conditions are met.Subv2017-07-211-6/+23
| | * | | | | Services/APT: Properly clear the apt parameter after a successful ReceiveParameter call.Subv2017-07-211-2/+8
| | * | | | | Services/APT: Use the right error codes in ReceiveParameter and GlanceParameter when the parameter doesn't exist.Subv2017-07-211-0/+28
| | * | | | | Services/APT: Use boost::optional for the APT parameter structure.Subv2017-07-211-20/+26
| | | |_|/ / | | |/| | |
| * | | | | Merge pull request #2837 from wwylele/shader-debugger-fixbunnei2017-07-261-23/+18
| |\ \ \ \ \
| | * | | | | debugger/shader: display LOOPwwylele2017-07-201-1/+3
| | * | | | | debugger/shader: print the invert flag for JMPUwwylele2017-07-201-0/+4
| | * | | | | debugger/shader: fix address register for reverted arithmetic opwwylele2017-07-201-20/+9
| | * | | | | debugger/shader: fix inverted uniform flow controlwwylele2017-07-201-2/+2
| * | | | | | Network: Moved NintendoOUI initalization to RoomMember constructorB3n302017-07-262-3/+4
| | |_|/ / / | |/| | | |
* | | | | | loader: Various improvements for NSO/NRO loaders.bunnei2017-10-108-58/+40
* | | | | | loader: Add support for NRO, as well as various fixes and shared linker.bunnei2017-10-069-146/+434
* | | | | | nso: Fixes to support homebrew NSOs without a MOD header.bunnei2017-10-042-17/+23
* | | | | | arm_interface: Set TLS address for dynarmic core.bunnei2017-09-305-0/+32
* | | | | | nso: Refactor and allocate .bss section.bunnei2017-09-309-132/+162
* | | | | | process: Support loading multiple codesets.bunnei2017-09-302-20/+27
* | | | | | loader: Add support for loading an NSO.bunnei2017-09-305-0/+342
* | | | | | externals: Add lz4.bunnei2017-09-301-1/+1
* | | | | | memory: Log with 64-bit values.bunnei2017-09-301-8/+8
* | | | | | kernel: Various threading fixes to support 64-bit addressing.bunnei2017-09-302-8/+8
* | | | | | core: Various changes to support 64-bit addressing.bunnei2017-09-305-54/+54
* | | | | | arm: Use 64-bit addressing in a bunch of places.bunnei2017-09-309-80/+113
* | | | | | elf: Check if machine is ARM.bunnei2017-09-301-2/+9
|/ / / / /
* | | | | Merge pull request #2816 from wwylele/proctex-lutlutlutSebastian Valle2017-07-235-70/+80
|\ \ \ \ \
| * | | | | gl_rasterizer: use texture buffer for proctex LUTwwylele2017-07-015-70/+80
* | | | | | Merge pull request #2834 from wwylele/depth-enable-fixSebastian Valle2017-07-231-4/+5
|\ \ \ \ \ \
| * | | | | | gl_rasterizer_cache: depth write is disabled if allow_depth_stencil_write is falsewwylele2017-06-101-4/+5
* | | | | | | Merge pull request #2799 from yuriks/virtual-cached-range-flushWeiyi Wang2017-07-226-68/+113
|\ \ \ \ \ \ \ | |_|_|_|/ / / |/| | | | | |
| * | | | | | Memory: Add function to flush a virtual range from the rasterizer cacheYuri Kunde Schlesner2017-06-224-47/+72
| * | | | | | Memory: Add TryVirtualToPhysicalAddress, returning a boost::optionalYuri Kunde Schlesner2017-06-222-7/+23
| * | | | | | Memory: Make PhysicalToVirtualAddress return a boost::optionalYuri Kunde Schlesner2017-06-224-14/+18
* | | | | | | telemetry: Log performance, configuration, and system data.bunnei2017-07-185-18/+96
| |_|_|/ / / |/| | | | |
* | | | | | Merge pull request #2804 from Kloen/themingbunnei2017-07-187-2/+73
|\ \ \ \ \ \
| * | | | | | citra-qt: Add option to configure the UI themeKloen2017-06-242-0/+37
| * | | | | | citra-qt: load ui theme at startup and config change.Kloen2017-06-242-0/+22
| * | | | | | citra-qt: Add Dark theme from https://github.com/ColinDuquesnoy/QDarkStyleSheetKloen2017-06-241-2/+5
| * | | | | | citra-qt: add new uisetting->themeKloen2017-06-242-0/+9
* | | | | | | Merge pull request #2818 from B3n30/networkWeiyi Wang2017-07-179-21/+1206
|\ \ \ \ \ \ \
| * | | | | | | Network: Changed timeout for receiving packets to 100msB3n302017-07-165-43/+50
| * | | | | | | Network: Propagate Room closing to connected membersB3n302017-07-163-3/+28
| * | | | | | | Network: Made send async in RoomMemberB3n302017-07-164-25/+70
| * | | | | | | Network: Send the game titleB3n302017-07-166-114/+185
| * | | | | | | Network: Enable sending and receiving chat messagesB3n302017-07-163-0/+79
| * | | | | | | Network: Handle the disconnect of a clientB3n302017-07-161-1/+18
| * | | | | | | Network: Enable to send WifiPacketsB3n302017-07-163-1/+82
| * | | | | | | Network: Init Network in SDL and QTB3n302017-07-162-1/+5
| * | | | | | | Network: Send JoinRequest and handle the answer in RoomMemberB3n302017-07-162-2/+125
| * | | | | | | Network: Handle join request in RoomB3n302017-07-162-1/+205
| * | | | | | | Network: Added Packet class for serializationB3n302017-07-163-0/+423
| * | | | | | | Network: Threads for Room and RoomMemberB3n302017-07-164-13/+119
* | | | | | | | stubbed frd::UnscrambleLocalFriendCode (#2827)B3n302017-07-173-1/+57
* | | | | | | | Merge pull request #2784 from wwylele/font-archiveWeiyi Wang2017-07-165-22/+264
|\ \ \ \ \ \ \ \ | |/ / / / / / / |/| | | | | | |
| * | | | | | | apt: load shared font from system archivewwylele2017-06-264-20/+260
| * | | | | | | apt/shared_font: don't relocate zero offsetwwylele2017-06-251-2/+4
| | |/ / / / / | |/| | | | |
* | | | | | | web_backend: Specify api-version on JSON post.bunnei2017-07-121-1/+3
* | | | | | | web_service: Add CMake flag to enable.bunnei2017-07-123-4/+15
* | | | | | | telemetry_session: Use TelemetryJson to submit real telemetry.bunnei2017-07-123-5/+3
* | | | | | | web_service: Implement JSON serialization of telemetry data.bunnei2017-07-122-0/+125
* | | | | | | web_backend: Add initial interface to POST data to Citra Web Services.bunnei2017-07-122-0/+63
* | | | | | | web_service: Add skeleton project.bunnei2017-07-107-1/+52
* | | | | | | settings: Add telemetry endpoint URL.bunnei2017-07-104-0/+23
* | | | | | | logging: Add WebService as a log cateogry.bunnei2017-07-102-1/+3
| |_|_|_|/ / |/| | | | |
* | | | | | Merge pull request #2815 from mailwl/bosspSebastian Valle2017-07-081-0/+3
|\ \ \ \ \ \
| * | | | | | Service/boss:P: Add some functions to FunctionTablemailwl2017-07-011-0/+3
| | |_|_|/ / | |/| | | |
* | | | | | Merge pull request #2797 from yuriks/cached-vma-free-crashbunnei2017-07-081-5/+20
|\ \ \ \ \ \
| * | | | | | Memory: Fix crash when unmapping a VMA covering cached surfacesYuri Kunde Schlesner2017-06-221-5/+20
| | |/ / / / | |/| | | |
* | | | | | Implement basic virtual Room support based on enet (#2803)B3n302017-07-0712-1/+357
| |_|_|_|/ |/| | | |
* | | | | Remove unnecessary WIN32_LEAN_AND_MEAN macro definitionKloen2017-06-301-1/+0
| |/ / / |/| | |
* | | | Merge pull request #2793 from Subv/replyandreceiveSebastian Valle2017-06-306-23/+161
|\ \ \ \
| * | | | Kernel/SVC: Pass the current thread as a parameter to ClientSession::SendSyncRequest.Subv2017-06-293-4/+7
| * | | | Kernel/Sessions: Clean up the list of pending request threads of a session when the client endpoint is closed.Subv2017-06-261-0/+5
| * | | | Kernel/SVC: Partially implemented svcReplyAndReceive.Subv2017-06-262-11/+121
| * | | | Kernel/ServerSession: Keep track of which threads have issued sync requests.Subv2017-06-253-9/+29
* | | | | Merge pull request #2809 from wwylele/texture-copy-fixYuri Kunde Schlesner2017-06-292-19/+24
|\ \ \ \ \
| * | | | | gpu: add comments for TextureCopywwylele2017-06-292-8/+8
| * | | | | gpu: fix edge cases for TextureCopywwylele2017-06-271-18/+23
* | | | | | Merge pull request #2800 from wwylele/fog-lutlutlutYuri Kunde Schlesner2017-06-297-31/+34
|\ \ \ \ \ \
| * | | | | | gl_rasterizer: use texture buffer for fog LUTwwylele2017-06-227-29/+32
| * | | | | | gl_rasterizer: create the texture before applying the statewwylele2017-06-221-2/+2
| | |_|/ / / | |/| | | |
* | | | | | configure_debug: Add label warning that CPU JIT needs to be disabled for gdbstub to workMerryMage2017-06-281-0/+7
| |/ / / / |/| | | |
* | | | | Merge pull request #2778 from Subv/uds_moreSebastian Valle2017-06-275-1/+436
|\ \ \ \ \
| * | | | | UDS: Use the ToDS and FromDS fields to properly calculate the AAD used during encryption.Subv2017-06-261-15/+32
| * | | | | UDS: Move the UDS keyslot used to generate the CCMP key to the AES::KeySlotID enum.Subv2017-06-262-4/+3
| * | | | | UDS: Run clang-format.Subv2017-06-263-51/+55
| * | | | | UDS: Added functions to encrypt and decrypt the data frames.Subv2017-06-263-12/+156
| * | | | | UDS: Clarify comment about the first 4 bytes of the SecureData header.Subv2017-06-152-1/+5
| * | | | | UDS: Return the correct error messages in SendTo when not connected to a network or trying to send to itself.Subv2017-06-151-6/+13
| * | | | | UDS: Stub SendTo to generate the unencrypted data frame with the right headers.Subv2017-06-154-1/+261
| | |/ / / | |/| | |
* | | | | Set global definition WIN32_LEAN_AND_MEAN (#2807)B3n302017-06-251-0/+3
* | | | | Kernel: Implement AcceptSession SVCYuri Kunde Schlesner2017-06-234-3/+38
* | | | | Kernel: Fix SVC wrapper for CreatePortYuri Kunde Schlesner2017-06-231-3/+2
* | | | | Kernel: Implement CreateSessionToPort SVCYuri Kunde Schlesner2017-06-231-1/+12
| |_|/ / |/| | |
* | | | Merge pull request #2798 from yuriks/svc-create-sessionYuri Kunde Schlesner2017-06-232-3/+26
|\ \ \ \
| * | | | Kernel: Implement CreateSession SVCYuri Kunde Schlesner2017-06-222-3/+26
| | |/ / | |/| |
* | | | Merge pull request #2795 from chris062689/masterbunnei2017-06-232-6/+6
|\ \ \ \
| * | | | Changing default values for bg_red, bg_green, and bg_blue from 1.0 to 0.0.chris0626892017-06-212-6/+6
* | | | | Merge pull request #2796 from yuriks/hle-null-handlesbunnei2017-06-232-8/+36
|\ \ \ \ \ | |_|/ / / |/| | | |
| * | | | Kernel: Fix typo in test nameYuri Kunde Schlesner2017-06-221-1/+1
| * | | | Kernel/IPC: Support translation of null handlesYuri Kunde Schlesner2017-06-212-7/+35
* | | | | Merge pull request #2792 from wwylele/lutlutlutYuri Kunde Schlesner2017-06-217-151/+175
|\ \ \ \ \ | |/ / / / |/| | | |
| * | | | gl_state: reset 1d textureswwylele2017-06-211-0/+14
| * | | | gl_rasterizer: fix glGetUniformLocation typewwylele2017-06-211-8/+8
| * | | | gl_rasterizer: manage texture ids in one placewwylele2017-06-213-31/+55
| * | | | gl_rasterizer/lighting: fix LUT interpolationwwylele2017-06-217-116/+102
* | | | | Merge pull request #2789 from yuriks/misc-kernelWeiyi Wang2017-06-212-1/+5
|\ \ \ \ \ | |_|/ / / |/| | | |
| * | | | Memory: Add enum definitions for the n3DS FCRAM sizeYuri Kunde Schlesner2017-06-211-1/+3
| * | | | Kernel: Add comment about the extended linear heap areaYuri Kunde Schlesner2017-06-191-0/+2
| |/ / /
* | | | Merge pull request #2790 from yuriks/remove-movefromYuri Kunde Schlesner2017-06-2124-56/+57
|\ \ \ \
| * | | | ResultVal: Remove MoveFrom()Yuri Kunde Schlesner2017-06-1924-57/+53
| * | | | ResultVal: Add an rvalue overload of Unwrap()Yuri Kunde Schlesner2017-06-191-1/+6
| |/ / /
* | | | Merge pull request #2779 from Subv/uds_more2Sebastian Valle2017-06-211-0/+36
|\ \ \ \
| * | | | UDS: Added a hook for updating the connection status when a client connects to the network.Subv2017-06-151-0/+36
| | |/ / | |/| |
* | | | Kernel/IPC: Add tests for HLERequestContext buffer translationYuri Kunde Schlesner2017-06-192-2/+196
* | | | Kernel/IPC: Make HLERequestContext usable from outside kernelYuri Kunde Schlesner2017-06-193-5/+10
| |/ / |/| |
* | | Merge pull request #2776 from wwylele/geo-factorYuri Kunde Schlesner2017-06-183-7/+26
|\ \ \
| * | | gl_rasterizer/lighting: use the formula from the paper for germetic factorwwylele2017-06-181-8/+8
| * | | gl_rasterizer/lighting: implement geometric factorwwylele2017-06-153-1/+20
* | | | Stop using reserved operator names (and/or/xor) with XbyakYuri Kunde Schlesner2017-06-171-13/+13
|/ / /
* | | Merge pull request #2762 from wwylele/light-cp-tangentYuri Kunde Schlesner2017-06-152-10/+38
|\ \ \
| * | | gl_rasterizer/lighting: Implement tangent mappingwwylele2017-06-111-7/+12
| * | | gl_rasterizer/lighting: implement lut input 5 (CP)wwylele2017-06-112-3/+26
* | | | Merge pull request #2743 from wwylele/wrap-fixYuri Kunde Schlesner2017-06-144-12/+48
|\ \ \ \ | |_|/ / |/| | |
| * | | pica/rasterizer: implement/stub texture wrap mode 4-7wwylele2017-06-044-12/+48
* | | | Services/UDS: Set the proper bit in the ConnectionStatus structure when creating a network. (#2738)Sebastian Valle2017-06-133-5/+15
* | | | Merge pull request #2767 from yuriks/quaternion-flip-commentYuri Kunde Schlesner2017-06-131-8/+11
|\ \ \ \
| * | | | OpenGL: Update comment on AreQuaternionsOpposite with new informationYuri Kunde Schlesner2017-06-101-8/+11
* | | | | Merge pull request #2774 from yuriks/hle-handlesYuri Kunde Schlesner2017-06-126-69/+360
|\ \ \ \ \ | |_|_|/ / |/| | | |
| * | | | Kernel/IPC: Use boost::small_vector for HLE context objectsYuri Kunde Schlesner2017-06-121-1/+3
| * | | | Kernel: Allow clearing request_objects to re-use buffer spaceYuri Kunde Schlesner2017-06-113-0/+14
| * | | | Kernel: Basic support for IPC translation for HLE servicesYuri Kunde Schlesner2017-06-113-18/+130
| * | | | Service/sm: Convert srv: to use IPC helpersYuri Kunde Schlesner2017-06-111-49/+56
| * | | | IPC: Add Pop/PushObjects methods to RequestParser/BuilderYuri Kunde Schlesner2017-06-111-10/+103
| * | | | IPC: Add basic HLERequestContext support to RequestParser/BuilderYuri Kunde Schlesner2017-06-111-1/+32
| * | | | Kernel: Add methods in HLERequestContext abstracting handle creationYuri Kunde Schlesner2017-06-112-0/+12
| * | | | ServiceFramework: Use separate copy of command bufferYuri Kunde Schlesner2017-06-113-9/+29
| |/ / /
* | | | Merge pull request #2727 from wwylele/spot-lightSebastian Valle2017-06-115-28/+128
|\ \ \ \ | |/ / / |/| | |
| * | | gl_rasterizer: implement spot lightwwylele2017-05-301-6/+24
| * | | gl_rasterizer: sync spot light statuswwylele2017-05-304-2/+61
| * | | pica: prepare registers for spotlightwwylele2017-05-301-20/+43
* | | | Remove unused import in break_points.cpp (#2763)Kloen Lansfiel2017-06-091-1/+0
* | | | Merge pull request #2756 from yuriks/service-frameworkYuri Kunde Schlesner2017-06-099-64/+355
|\ \ \ \
| * | | | Service/sm: Convert 'srv:' to ServiceFrameworkYuri Kunde Schlesner2017-06-095-51/+75
| * | | | Service: Remove a few redundant namespace qualifiersYuri Kunde Schlesner2017-06-081-5/+5
| * | | | Service: Add new ServiceFramework framework for writing HLE servicesYuri Kunde Schlesner2017-06-085-4/+269
| * | | | Kernel: Remove some unnecessary namespace qualificationsYuri Kunde Schlesner2017-06-061-4/+6
* | | | | Session: Remove/add some forward declarationsYuri Kunde Schlesner2017-06-083-2/+2
* | | | | Kernel: Ensure objects are kept alive during ClientSession disconnectionYuri Kunde Schlesner2017-06-081-7/+13
| |_|_|/ |/| | |
* | | | Merge pull request #2737 from Subv/decryptbeacondataJames Rowe2017-06-071-1/+97
|\ \ \ \ | |/ / / |/| | |
| * | | Services/UDS: Implement DecryptBeaconData.Subv2017-06-061-1/+97
* | | | Service: Remove unnecessary includes from service.hYuri Kunde Schlesner2017-06-0632-12/+80
* | | | Service: Make service registration part of the sm implementationYuri Kunde Schlesner2017-06-066-24/+147
* | | | Service/sm: Use an actual semaphore for the notification semaphoreYuri Kunde Schlesner2017-06-061-8/+9
* | | | Service: Move SRV interface to a new sm/ subdirectoryYuri Kunde Schlesner2017-06-064-9/+10
* | | | Kernel: Add a dedicated SetHleHandler method to ServerPort/ServerSessionYuri Kunde Schlesner2017-06-0611-62/+73
* | | | ResultVal: Add more convenience utils for creating and cascading resultsYuri Kunde Schlesner2017-06-061-0/+19
* | | | HLE: Move SessionRequestHandler from Service:: to Kernel::Yuri Kunde Schlesner2017-06-0614-73/+100
* | | | Edit Citra URLs (#2728)Alex Touchet2017-06-031-1/+1
* | | | Remove unused imports in game_list_p.hKloen2017-06-031-2/+0
* | | | Addressed Bunnei's review comments, and made some other tweaks:TheKoopaKingdom2017-06-037-29/+32
* | | | Fixed wiki URLs.TheKoopaKingdom2017-06-031-6/+8
* | | | Switched to the ERROR_NOT_FOUND constant from errors.h.TheKoopaKingdom2017-06-032-4/+3
* | | | Moved whitelist checks from FS_User to the Archive_NCCH handler.TheKoopaKingdom2017-06-032-53/+37
* | | | Created a whitelist of system archives to prevent false positives creating dialogs.TheKoopaKingdom2017-06-039-35/+70
* | | | Optimized messages that were repetitive and added ability for core errors to specify more details optionally.TheKoopaKingdom2017-06-035-39/+70
* | | | Added message to status bar to show core errors ignored by the user.TheKoopaKingdom2017-06-032-1/+11
* | | | Made some changes from review comments:TheKoopaKingdom2017-06-0310-53/+55
* | | | Added system for handling core errors in citra-qt.TheKoopaKingdom2017-06-039-26/+121
* | | | Fixed encrypted ROM error messages.TheKoopaKingdom2017-06-033-9/+19
* | | | Merge pull request #2722 from wwylele/cam-ipc-helperbunnei2017-06-012-293/+265
|\ \ \ \
| * | | | fixup!cam: use IPCHelperwwylele2017-05-272-30/+43
| * | | | cam: move u32->u8 trancation to IPCHelperwwylele2017-05-241-34/+33
| * | | | cam: use IPCHelperwwylele2017-05-241-278/+238
* | | | | Merge pull request #2739 from yuriks/kernel-reorgbunnei2017-06-0127-344/+430
|\ \ \ \ \
| * | | | | Kernel: Move HandleTable to a separate fileYuri Kunde Schlesner2017-05-3018-203/+242
| * | | | | Kernel: Move WaitObject to a separate fileYuri Kunde Schlesner2017-05-3015-135/+178
| * | | | | Kernel: Removed HandleTable::GetWaitObjectYuri Kunde Schlesner2017-05-302-11/+2
| * | | | | Kernel: Extract dynamic Object pointer cast into its own functionYuri Kunde Schlesner2017-05-291-11/+24
| | |/ / / | |/| | |
* | | | | Merge pull request #2721 from wwylele/texture-cubebunnei2017-05-302-3/+77
|\ \ \ \ \ | |_|_|_|/ |/| | | |
| * | | | swrasterizer: implement TextureCubewwylele2017-05-291-2/+51
| * | | | pica: add registers for texture cubewwylele2017-05-291-1/+26
* | | | | Merge pull request #2734 from yuriks/cmake-imported-libsYuri Kunde Schlesner2017-05-308-24/+12
|\ \ \ \ \ | |_|/ / / |/| | | |
| * | | | CMake: Create an INTERFACE target for CatchYuri Kunde Schlesner2017-05-281-4/+2
| * | | | CMake: Create INTERFACE targets for microprofile and nihstroYuri Kunde Schlesner2017-05-283-3/+3
| * | | | CMake: Remove unnecessary include_directories for dynarmicYuri Kunde Schlesner2017-05-281-3/+0
| * | | | CMake: Add cryptopp include path to target propertyYuri Kunde Schlesner2017-05-281-1/+0
| * | | | CMake: Add SoundTouch include path to target propertyYuri Kunde Schlesner2017-05-281-2/+0
| * | | | CMake: Define an interface target for SDL2 definitionsYuri Kunde Schlesner2017-05-283-8/+4
| * | | | CMake: Remove CITRA_QT_LIBS varYuri Kunde Schlesner2017-05-281-1/+1
| * | | | CMake: Stop using FindOpenGL, which seems to not be required anymoreYuri Kunde Schlesner2017-05-282-2/+2
| * | | | CMake: Use IMPORTED target for BoostYuri Kunde Schlesner2017-05-283-2/+3
| * | | | CMake: Use IMPORTED target for libpngYuri Kunde Schlesner2017-05-281-3/+2
* | | | | Merge pull request #2729 from yuriks/quaternion-fixYuri Kunde Schlesner2017-05-281-3/+5
|\ \ \ \ \ | |/ / / / |/| | | |
| * | | | OpenGL: Improve accuracy of quaternion interpolationYuri Kunde Schlesner2017-05-271-3/+5
| | |_|/ | |/| |
* | | | CMake: Correct inter-module dependencies and library visibilityYuri Kunde Schlesner2017-05-288-23/+27
* | | | Citra: Convert include into forward declarationYuri Kunde Schlesner2017-05-282-2/+6
* | | | Remove some unnecessary inclusions of video_core.hYuri Kunde Schlesner2017-05-284-4/+0
* | | | Move screen size constants from video_core to coreYuri Kunde Schlesner2017-05-289-51/+63
* | | | OpenGL: Remove unused RendererOpenGL fieldsYuri Kunde Schlesner2017-05-282-11/+2
* | | | Core: Fix some out-of-style includesYuri Kunde Schlesner2017-05-284-4/+4
* | | | Common: Fix some out-of-style includesYuri Kunde Schlesner2017-05-283-5/+5
* | | | Move framebuffer_layout from Common to CoreYuri Kunde Schlesner2017-05-285-4/+4
| |/ / |/| |
* | | Merge pull request #2725 from wwylele/texture-samplerYuri Kunde Schlesner2017-05-271-40/+39
|\ \ \
| * | | gl_shader: refactor texture sampler into its own functionwwylele2017-05-271-40/+39
| |/ /
* | | Merge pull request #2716 from yuriks/decentralized-resultbunnei2017-05-2633-300/+385
|\ \ \ | |/ / |/| |
| * | FS: Remove unused result definitionYuri Kunde Schlesner2017-05-251-5/+0
| * | Common: Clean up meta-template logic in BitFieldYuri Kunde Schlesner2017-05-251-3/+3
| * | Kernel: Centralize error definitions in errors.hYuri Kunde Schlesner2017-05-2523-132/+178
| * | GSP_GPU: Move error codes from result.h to local fileYuri Kunde Schlesner2017-05-252-17/+23
| * | FileSys: Move all result description to errors.hYuri Kunde Schlesner2017-05-2510-105/+115
| * | result: Make error description a generic integerYuri Kunde Schlesner2017-05-253-6/+18
| * | Make BitField and ResultCode constexpr-initializableYuri Kunde Schlesner2017-05-252-41/+57
* | | Merge pull request #2697 from wwylele/proctexYuri Kunde Schlesner2017-05-2515-11/+1048
|\ \ \
| * | | gl_rasterizer: implement procedural texturewwylele2017-05-206-7/+600
| * | | pica/swrasterizer: implement procedural texturewwylele2017-05-209-4/+448
* | | | telemetry: Log a few simple data fields throughout core.bunnei2017-05-253-1/+22
* | | | core: Keep track of telemetry for the current emulation session.bunnei2017-05-255-0/+83
* | | | common: Add a generic interface for logging telemetry fields.bunnei2017-05-253-0/+238
| |_|/ |/| |
* | | Merge pull request #2692 from Subv/vfp_ftzSebastian Valle2017-05-222-0/+26
|\ \ \ | |_|/ |/| |
| * | fixup! Dyncom/VFP: Convert denormal outputs into 0 when the FTZ flag is enabled.Subv2017-05-222-4/+0
| * | Dyncom/VFP: Convert denormal outputs into 0 when the FTZ flag is enabled.Subv2017-05-082-0/+30
* | | Merge pull request #2406 from Subv/session_disconnectYuri Kunde Schlesner2017-05-228-51/+84
|\ \ \
| * | | Kernel/Sessions: Remove the ClientSession::Create function.Subv2017-05-223-16/+3
| * | | Kernel: Remove a now unused enum and variable regarding a session's status.Subv2017-05-152-8/+0
| * | | Kernel: Use a Session object to keep track of the status of a Client/Server session pair.Subv2017-05-158-32/+86
* | | | Merge pull request #2694 from Subv/vfp_vsub_ftzMerry2017-05-221-2/+12
|\ \ \ \
| * | | | Dyncom/VFP: Perform flush-to-zero on the second operand of vsub before sending it to vadd.Subv2017-05-141-2/+12
| | |/ / | |/| |
* | | | swrasterizer: add missing tc0_w and fragment lighting attribute processingwwylele2017-05-212-5/+8
* | | | Merge pull request #2661 from Subv/uds5bunnei2017-05-195-33/+602
|\ \ \ \
| * | | | Services/UDS: Use the new IPC helper functions.Subv2017-05-151-21/+10
| * | | | Services/UDS: Implement RecvBeaconBroadcastData.Subv2017-05-151-19/+69
| * | | | Services/UDS: Generate the UDS beacons when the beacon callback fires.Subv2017-05-155-7/+537
* | | | | Merge pull request #2710 from emmauss/ptm_ipcbunnei2017-05-193-31/+45
|\ \ \ \ \
| * | | | | use IPCHelper for PTM servicesemmaus2017-05-193-31/+45
* | | | | | pica: use correct register value for shader bool_uniformswwylele2017-05-171-2/+2
|/ / / / /
* | | | | Merge pull request #2703 from wwylele/pica-reg-reviseYuri Kunde Schlesner2017-05-164-17/+25
|\ \ \ \ \
| * | | | | pica: correct bit field length for some registerswwylele2017-05-164-17/+25
* | | | | | Merge pull request #2687 from yuriks/address-mappingsYuri Kunde Schlesner2017-05-1411-80/+157
|\ \ \ \ \ \
| * | | | | | Kernel: Map special regions according to ExHeaderYuri Kunde Schlesner2017-05-105-52/+105
| * | | | | | DSP: Create backing memory for entire DSP RAMYuri Kunde Schlesner2017-05-105-32/+42
| * | | | | | Memory: Add constants for the n3DS additional RAMYuri Kunde Schlesner2017-05-102-2/+16
| | |_|_|_|/ | |/| | | |
* | | | | | Merge pull request #2695 from JayFoxRox/gs-regsWeiyi Wang2017-05-126-70/+171
|\ \ \ \ \ \ | |_|/ / / / |/| | | | |
| * | | | | Pica: Write GS registersJannik Vogel2017-05-121-0/+52
| * | | | | Pica: Write shader registers in functionsJannik Vogel2017-05-121-57/+103
| * | | | | Pica: Set program code / swizzle data limit to 4096Jannik Vogel2017-05-115-13/+16
| | |_|/ / | |/| | |
* | | | | Merge pull request #2669 from jroweboy/async_file_watcherYuri Kunde Schlesner2017-05-113-46/+35
|\ \ \ \ \
| * | | | | Frontend: Prevent FileSystemWatcher from blocking UI threadJames Rowe2017-05-103-46/+35
* | | | | | Merge pull request #2676 from wwylele/irrstbunnei2017-05-109-24/+208
|\ \ \ \ \ \ | |_|_|/ / / |/| | | | |
| * | | | | fixup!ir: implement new 3ds HID via ir:rstwwylele2017-05-071-31/+32
| * | | | | ir: implement new 3ds HID via ir:rstwwylele2017-05-049-24/+207
* | | | | | Merge pull request #2696 from Subv/vfp_revertYuri Kunde Schlesner2017-05-093-59/+30
|\ \ \ \ \ \ | |_|/ / / / |/| | | | |
| * | | | | Dyncom/VFP: Strip the VFP_NAN_FLAG sentinel value when setting vfp exceptions.Subv2017-05-092-2/+2
| * | | | | Revert "Remove `exceptions` parameter from `normaliseround` VFP functions"Subv2017-05-093-57/+28
| | |/ / / | |/| | |
* | | | | Dyncom: Remove disassembler codeYuri Kunde Schlesner2017-05-084-1589/+2
* | | | | Dyncom: Tweak types and log formattingYuri Kunde Schlesner2017-05-083-8/+10
* | | | | Remove unused symbols codeYuri Kunde Schlesner2017-05-086-124/+0
* | | | | Remove ability to load symbol mapsYuri Kunde Schlesner2017-05-085-55/+2
* | | | | citra-qt: Remove callstack widgetYuri Kunde Schlesner2017-05-086-168/+0
* | | | | citra-qt: Remove disassembler widgetYuri Kunde Schlesner2017-05-086-448/+0
|/ / / /
* | | | Merge pull request #2682 from nicoboss/filterYuri Kunde Schlesner2017-05-072-30/+35
|\ \ \ \
| * | | | Don’t focus the search field if the game is emptyNico Bosshard2017-05-061-3/+6
| * | | | Fixed some more typosNico Bosshard2017-05-032-4/+4
| * | | | citra-qt: game list search function fixed minor mistakesNico Bosshard2017-05-021-24/+26
* | | | | Merge pull request #2686 from wwylele/tex-coord-regYuri Kunde Schlesner2017-05-066-10/+32
|\ \ \ \ \
| * | | | | pica: shader_dirty if texture2 coord changedwwylele2017-05-055-7/+12
| * | | | | pica: use correct coordinates for texture 2wwylele2017-05-034-5/+22
| |/ / / /
* | / / / Create a random console_unique_id (#2668)B3n302017-05-065-7/+123
| |/ / / |/| | |
* | | | Merge pull request #2606 from wwylele/irbunnei2017-05-047-51/+762
|\ \ \ \ | |/ / / |/| | |
| * | | ir: implement circle pad prowwylele2017-05-036-44/+761
| * | | qt: enable config for circle pad prowwylele2017-04-091-7/+1
* | | | citra-qt: game list search function (#2673)Nico Bosshard2017-04-307-19/+299
* | | | Merge pull request #2671 from wwylele/dot3-rgbabunnei2017-04-214-22/+39
|\ \ \ \
| * | | | gl_shader_gen: remove TODO about Lerp behaviour verification. The implementation is verified against hardwarewwylele2017-04-201-2/+0
| * | | | rasterizer: implement combiner operation 7 (Dot3_RGBA)wwylele2017-04-194-20/+39
| | |_|/ | |/| |
* | | | Merge pull request #2666 from yuriks/gl-cleanupsYuri Kunde Schlesner2017-04-205-214/+215
|\ \ \ \
| * | | | OpenGL: Pass Pica regs via parameterYuri Kunde Schlesner2017-04-173-7/+5
| * | | | OpenGL: Move PicaShaderConfig to gl_shader_gen.hYuri Kunde Schlesner2017-04-174-202/+206
| * | | | OpenGL: Move Attributes enum to a more appropriate fileYuri Kunde Schlesner2017-04-173-12/+11
| |/ / /
* | | | Merge pull request #2532 from wwylele/ldrro-ipcYuri Kunde Schlesner2017-04-181-193/+138
|\ \ \ \
| * | | | ldr_ro: use IPC helperwwylele2017-04-171-193/+138
| | |/ / | |/| |
* | | | input_common/sdl: add support for binding button to axiswwylele2017-04-172-4/+59
| |/ / |/| |
* | | Merge pull request #2659 from MerryMage/dsp_dsp-correctionbunnei2017-04-131-0/+18
|\ \ \
| * | | dsp_dsp: Messages are modified by service before being sent to DSPMerryMage2017-04-121-0/+18
* | | | Better looking status bar under Linux Ubuntu (#2662)Cereal-Killa2017-04-131-0/+1
| |_|/ |/| |
* | | Merge pull request #2628 from Subv/udsSebastian Valle2017-04-122-45/+388
|\ \ \
| * | | Services/UDS: Fixed a style mistake in GetChannel.Sebastian Valle2017-03-271-2/+1
| * | | Services/UDS: Use consistent spelling for WiFi and simplify the GetChannel function.Subv2017-03-261-4/+4
| * | | Services/UDS: Signal the connection event when closing down the network.Subv2017-03-261-0/+1
| * | | Services/UDS: Do not allow trying to start up a network that only the host can connect to.Subv2017-03-261-0/+3
| * | | Service/UDS: Schedule an event to broadcast the beacon frames every 102.4ms.Subv2017-03-262-2/+58
| * | | Services/UDS: Store the entire NetworkInfo structure that was used to create the network.Subv2017-03-261-13/+5
| * | | Services/UDS: Initial support for hosting local-wlan networks.Subv2017-03-262-44/+336
* | | | Pica/Regs: Correct bit width for blend-equationsJannik Vogel2017-04-081-2/+2
| |_|/ |/| |
* | | Merge pull request #2533 from Lectem/apt_ipchelperbunnei2017-04-066-257/+386
|\ \ \
| * | | hopefully fix clang-format issues with old versionLectem2017-03-201-3/+2
| * | | address more commentsLectem2017-03-191-20/+20
| * | | Cast size_t to u32 for PushStaticBuffer usagesLectem2017-03-181-2/+2
| * | | IPCHelper Skip method + address comments for aptLectem2017-03-183-38/+46
| * | | fix #2560 and other commentsLectem2017-03-183-22/+22
| * | | move push out of class body and add u8 u16 bool specializationsLectem2017-03-184-55/+114
| * | | refactor APT service to use the new IPC helpersLectem2017-03-184-195/+258
* | | | Merge pull request #2634 from wwylele/batterybunnei2017-04-062-1/+16
|\ \ \ \
| * | | | shared_page: stub battery statewwylele2017-03-212-1/+16
* | | | | citra-qt: Move config dialog code to its own directoryLioncash2017-04-0425-41/+41
* | | | | error conversion fixes for soc_unoah the goodra2017-04-031-39/+32
* | | | | Fix OutputDebugString syscallMichael Theall2017-04-012-4/+4
* | | | | ptm: create SharedExtSave file before openning itwwylele2017-03-251-1/+1
* | | | | Merge pull request #2512 from SonofUgly/custom-layoutbunnei2017-03-229-13/+104
|\ \ \ \ \ | |/ / / / |/| | | |
| * | | | Add custom layout settings.SonofUgly2017-02-239-13/+104
* | | | | Merge pull request #2630 from wwylele/qt-focus-loss-2bunnei2017-03-205-3/+18
|\ \ \ \ \
| * | | | | citra-qt: remove dead codewwylele2017-03-173-5/+0
| * | | | | citra-qt: release all buttons when render window focus is lostwwylele2017-03-174-0/+20
| | |/ / / | |/| | |
* / | | | apt: fix RequestBuilder parameters for Unwrapwwylele2017-03-181-1/+1
|/ / / /
* | | | Merge pull request #2497 from wwylele/input-2bunnei2017-03-1740-574/+1244
|\ \ \ \
| * | | | qt/config_input: don't connect for null buttonwwylele2017-03-021-4/+7
| * | | | citra: update default ini with new input systemwwylele2017-03-011-28/+41
| * | | | Input: remove unused stuff & clean upwwylele2017-03-019-412/+3
| * | | | Qt: rework input configuration for new input systemwwylele2017-03-012-68/+144
| * | | | InputCommon: add SDL joystick supportwwylele2017-03-014-0/+241
| * | | | InputCommon: add AnalogFromButtonwwylele2017-03-018-0/+162
| * | | | InputCommon: add Keyboardwwylele2017-03-0117-85/+254
| * | | | HID: use AnalogDevicewwylele2017-03-013-2/+30
| * | | | HID: use ButtonDevicewwylele2017-03-015-1/+100
| * | | | Input: add device and factory templatewwylele2017-03-014-0/+100
| * | | | Common: add ParamPackagewwylele2017-03-015-0/+188
| | |/ / | |/| |
* | | | Merge pull request #2618 from wwylele/log-less-filenamebunnei2017-03-177-17/+20
|\ \ \ \
| * | | | file_util: Log when using local user directorywwylele2017-03-111-0/+2
| * | | | file_sys: lower log level for setting host pathwwylele2017-03-084-4/+4
| * | | | file_util: lower logging level for harmless caseswwylele2017-03-081-9/+7
| * | | | loader/ncch: less verbose log for loading game list. only log program ID when bootingwwylele2017-03-081-3/+6
| * | | | loader: lower file name logging levelwwylele2017-03-081-1/+1
| |/ / /
* | | | Merge pull request #2620 from FernandoS27/syscore_errorbunnei2017-03-161-5/+15
|\ \ \ \
| * | | | Refined thread launch on syscore error messagesFernando Sahmkow2017-03-091-5/+15
| |/ / /
* | | | Merge pull request #2625 from wwylele/hash-console-uniquebunnei2017-03-161-7/+24
|\ \ \ \
| * | | | cfg: implement GenHashConsoleUniquewwylele2017-03-121-7/+24
| |/ / /
* / / / common/cpu_detect: Add missing include and fix namespace scopeYuri Kunde Schlesner2017-03-131-5/+7
|/ / /
* | | Timer: restore missing signaled=true from #2421wwylele2017-02-271-0/+2
* | | Merge pull request #2594 from wwylele/ir-separatebunnei2017-02-276-147/+159
|\ \ \
| * | | IR: separate functions of each port to their own fileswwylele2017-02-266-147/+159
* | | | Fix log entry in timer::signal (#2600)B3n302017-02-271-1/+1
* | | | Doxygen: Amend minor issues (#2593)Mat M2017-02-2718-23/+31
* | | | Merge pull request #2587 from yuriks/status-barYuri Kunde Schlesner2017-02-2728-449/+321
|\ \ \ \ | |/ / / |/| | |
| * | | PerfStats: Re-order and document members betterYuri Kunde Schlesner2017-02-272-5/+14
| * | | Qt: Tweak status bar stylingYuri Kunde Schlesner2017-02-271-0/+2
| * | | Qt: Increase status bar update interval to 2 secondsYuri Kunde Schlesner2017-02-271-1/+1
| * | | Core: Re-write frame limiterYuri Kunde Schlesner2017-02-275-42/+53
| * | | Core: Make PerfStats internally lockedYuri Kunde Schlesner2017-02-277-16/+25
| * | | Qt: Add tooltips to status bar displaysYuri Kunde Schlesner2017-02-271-0/+7
| * | | Qt: Don't show fractional figures in the status barYuri Kunde Schlesner2017-02-271-2/+2
| * | | Remove built-in (non-Microprofile) profilerYuri Kunde Schlesner2017-02-279-382/+2
| * | | PerfStats: Add method to get the instantaneous time ratioYuri Kunde Schlesner2017-02-273-7/+22
| * | | Add performance statistics to status barYuri Kunde Schlesner2017-02-2711-3/+159
| * | | SynchronizedWrapper: Add Lock convenience methodYuri Kunde Schlesner2017-02-271-18/+25
| * | | Qt: Add (empty) status barYuri Kunde Schlesner2017-02-276-1/+35
| * | | Core: Remove unnecessary include in thread.hYuri Kunde Schlesner2017-02-274-1/+3
* | | | Merge pull request #2569 from wwylele/wrap-unwrapbunnei2017-02-2516-6/+567
|\ \ \ \
| * | | | APT: implement Wrap and Unwrapwwylele2017-02-215-6/+149
| * | | | HW: add AES engine & implement AES-CCMwwylele2017-02-2111-0/+418
* | | | | Merge pull request #2421 from Subv/timersYuri Kunde Schlesner2017-02-253-16/+36
|\ \ \ \ \
| * | | | | Timers: Return an error when calling SetTimer with negative timeouts.Subv2017-02-221-0/+5
| * | | | | Timers: Immediately signal the timer if it was started with an initial value of 0.Subv2017-02-222-16/+31
* | | | | | Use QFileSystemWatcher to reload the game list when a change is detected. (#2555)James Rowe2017-02-232-1/+51
* | | | | | Merge pull request #2441 from jroweboy/titlebarbunnei2017-02-236-5/+32
|\ \ \ \ \ \
| * | | | | | Gui: Change title bar to include build nameJames Rowe2017-02-236-5/+32
* | | | | | | [UI] Modify recursive scanning label (#2589)Anthony2017-02-231-1/+1
|/ / / / / /
* | | | | | Merge pull request #2585 from MerryMage/sxtb16-sxtab16bunnei2017-02-201-4/+4
|\ \ \ \ \ \ | |_|_|/ / / |/| | | | |
| * | | | | dyncom: Correct SXTAB16 and SXTB16MerryMage2017-02-181-4/+4
* | | | | | Merge pull request #2580 from yuriks/qt-cleanup2Yuri Kunde Schlesner2017-02-194-96/+83
|\ \ \ \ \ \ | |_|/ / / / |/| | | | |
| * | | | | Qt: Move some connections from .ui file to codeYuri Kunde Schlesner2017-02-182-38/+3
| * | | | | Qt: Reorganize connection of menu eventsYuri Kunde Schlesner2017-02-182-13/+23
| * | | | | Qt: Re-organize setup of debugging widgetsYuri Kunde Schlesner2017-02-184-39/+51
| * | | | | Qt: Fix action name to match conventionsYuri Kunde Schlesner2017-02-182-6/+6
* | | | | | OpenGL: Check if uniform block exists before updating it (#2581)Jannik Vogel2017-02-181-29/+30
|/ / / / /
* | | | | Qt: Make IsSingleFileDropEvent staticYuri Kunde Schlesner2017-02-181-1/+1
* | | | | Qt: Allow any file extension in Open dialogYuri Kunde Schlesner2017-02-181-2/+3
* | | | | Qt: Remove orpahned function declarationYuri Kunde Schlesner2017-02-181-6/+0
* | | | | Qt: Remove unnecessary std::string usageYuri Kunde Schlesner2017-02-182-14/+15
* | | | | HID: move enable_accelerometer/gyroscope_count initialization into Init() (#2574)Weiyi Wang2017-02-171-2/+5
* | | | | added drag n drop featurenoah the goodra2017-02-162-1/+41
* | | | | Merge pull request #2571 from wwylele/missing-fileMat M2017-02-151-0/+1
|\ \ \ \ \
| * | | | | core: add missing errors.h in CMakeLists.txtwwylele2017-02-151-0/+1
* | | | | | video_core: remove #pragma once in cpp file (#2570)Weiyi Wang2017-02-152-4/+0
|/ / / / /
* | | | | Merge pull request #2566 from yuriks/file-extension-suffixWeiyi Wang2017-02-141-1/+1
|\ \ \ \ \
| * | | | | Qt/GameList: Use suffix() to parse the file extensionYuri Kunde Schlesner2017-02-141-1/+1
| | |/ / / | |/| | |
* | | | | HLE/IPC: Fix uninitialized variables in helpers (#2568)Yuri Kunde Schlesner2017-02-141-3/+3
* | | | | applied the change suggested by @wwylelenoah the goodra2017-02-141-0/+1
* | | | | NWM changed to NIMnoah the goodra2017-02-141-1/+1
* | | | | turned clang format back onnoah the goodra2017-02-141-1/+1
* | | | | added http service enum to the log.h filenoah the goodra2017-02-141-0/+1
|/ / / /
* | | | Merge pull request #2562 from yuriks/pica-refactor3Yuri Kunde Schlesner2017-02-1312-563/+661
|\ \ \ \
| * | | | SWRasterizer: Move more framebuffer functions to fileYuri Kunde Schlesner2017-02-133-100/+105
| * | | | SWRasterizer: Move texturing functions to their own fileYuri Kunde Schlesner2017-02-134-210/+259
| * | | | SWRasterizer: Convert large no-capture lambdas to standalone functionsYuri Kunde Schlesner2017-02-131-315/+310
| * | | | SWRasterizer: Move framebuffer operation functions to their own fileYuri Kunde Schlesner2017-02-134-236/+285
| * | | | VideoCore: Move software rasterizer files to sub-directoryYuri Kunde Schlesner2017-02-138-12/+12
* | | | | Core: add cryptopp library (#2412)Weiyi Wang2017-02-131-1/+2
* | | | | Merge pull request #2561 from wwylele/fs-romYuri Kunde Schlesner2017-02-139-60/+295
|\ \ \ \ \ | |/ / / / |/| | | |
| * | | | loader: use self NCCH archivewwylele2017-02-136-90/+7
| * | | | file_sys: add Self NCCH archivewwylele2017-02-135-0/+318
| |/ / /
* | | | video_core/shader: Document sanitized MUL operationYuri Kunde Schlesner2017-02-121-0/+8
* | | | Merge pull request #2550 from yuriks/pica-refactor2Yuri Kunde Schlesner2017-02-1219-140/+133
|\ \ \ \
| * | | | VideoCore: Split u64 Pica reg unions into 2 separate u32 unionsYuri Kunde Schlesner2017-02-091-36/+42
| * | | | VideoCore: Force enum sizes to u32 in LightingRegsYuri Kunde Schlesner2017-02-091-4/+4
| * | | | OpenGL: Remove unused duplicate of IsPassThroughTevStageYuri Kunde Schlesner2017-02-091-12/+0
| * | | | VideoCore: Split regs.h inclusionsYuri Kunde Schlesner2017-02-0914-25/+47
| * | | | Pica/Regs: Use binary search to look up reg namesYuri Kunde Schlesner2017-02-093-16/+11
| * | | | VideoCore: Use union to index into Regs structYuri Kunde Schlesner2017-02-092-46/+28
| |/ / /
* | | | citra-qt: Don't attempt to scan files with unsupported extensions (#2402)Kloen Lansfiel2017-02-123-4/+20
* | | | core: Free AppLoader on shutdown to release file (#2558)Yuri Kunde Schlesner2017-02-111-9/+2
* | | | hid: remove the touch field from PadState (#2557)Weiyi Wang2017-02-112-6/+0
* | | | video_core: Fix benign out-of-bounds indexing of array (#2553)Yuri Kunde Schlesner2017-02-111-2/+1
|/ / /
* | | Merge pull request #2482 from yuriks/pica-refactorYuri Kunde Schlesner2017-02-0937-2427/+2635
|\ \ \
| * | | VideoCore: Move Regs to its own fileYuri Kunde Schlesner2017-02-0426-662/+681
| * | | VideoCore: Split shader regs from Regs structYuri Kunde Schlesner2017-02-049-102/+116
| * | | VideoCore: Split geometry pipeline regs from Regs structYuri Kunde Schlesner2017-02-049-264/+292
| * | | VideoCore: Split lighting regs from Regs structYuri Kunde Schlesner2017-02-046-312/+341
| * | | VideoCore: Split framebuffer regs from Regs structYuri Kunde Schlesner2017-02-0411-457/+503
| * | | VideoCore: Split texturing regs from Regs structYuri Kunde Schlesner2017-02-0417-507/+548
| * | | VideoCore: Split rasterizer regs from Regs structYuri Kunde Schlesner2017-02-0414-188/+219
* | | | Use std::array<u8,2> instead of u8[2] to fix MSVC buildLectem2017-02-051-1/+1
* | | | Merge pull request #2027 from Lectem/ipcrefactorWeiyi Wang2017-02-056-68/+364
|\ \ \ \ | |/ / / |/| | |
| * | | fix wwylele's comment and use typename in templatesLectem2017-02-051-4/+4
| * | | fix comments alignmentLectem2016-12-301-22/+22
| * | | move Pop methods out of class bodyLectem2016-12-261-72/+88
| * | | IPC helpers exampleLectem2016-12-263-35/+40
| * | | IPC helpersLectem2016-12-263-48/+323
* | | | Merge pull request #2476 from yuriks/shader-refactor3Yuri Kunde Schlesner2017-02-0420-181/+185
|\ \ \ \
| * | | | VideoCore: Make PrimitiveAssembler const-correctYuri Kunde Schlesner2017-01-302-3/+4
| * | | | VideoCore: Extract swrast-specific data from OutputVertexYuri Kunde Schlesner2017-01-305-58/+64
| * | | | VideoCore/Shader: Clean up OutputVertex::FromAttributeBufferYuri Kunde Schlesner2017-01-302-10/+16
| * | | | Common: Optimize BitSet iteratorYuri Kunde Schlesner2017-01-301-14/+19
| * | | | VideoCore: Split shader output writing from semantic loadingYuri Kunde Schlesner2017-01-303-24/+24
| * | | | VideoCore: Consistently use shader configuration to load attributesYuri Kunde Schlesner2017-01-307-47/+26
| * | | | VideoCore: Use correct register for immediate mode attribute countYuri Kunde Schlesner2017-01-302-7/+13
| * | | | VideoCore: Rename some types to more accurate namesYuri Kunde Schlesner2017-01-3010-21/+21
| * | | | VideoCore: Change misleading register namesYuri Kunde Schlesner2017-01-304-8/+9
* | | | | Pica/Texture: Move part of ETC1 decoding to new file and cleanupsYuri Kunde Schlesner2017-02-044-110/+159
* | | | | Pica/Texture: Simplify/cleanup texture tile addressingYuri Kunde Schlesner2017-02-045-44/+117
* | | | | VideoCore: Move LookupTexture out of debug_utils.hYuri Kunde Schlesner2017-02-049-308/+350
* | | | | Merge pull request #2496 from mailwl/cfg-memYuri Kunde Schlesner2017-02-041-5/+8
|\ \ \ \ \
| * | | | | Core: update Kernel Config Memory to latest version (11.2)mailwl2017-01-301-5/+8
* | | | | | Merge pull request #2520 from wwylele/shader-stack-boundaryYuri Kunde Schlesner2017-02-041-2/+5
|\ \ \ \ \ \
| * | | | | | ShaderJIT: add 16 dummy bytes at the bottom of the stackwwylele2017-02-031-2/+5
* | | | | | | Merge pull request #2518 from MerryMage/coprocYuri Kunde Schlesner2017-02-045-15/+140
|\ \ \ \ \ \ \
| * | | | | | | arm_dynarmic: Update memory interfaceMerryMage2017-02-031-10/+10
| * | | | | | | arm_dynarmic: CP15 supportMerryMage2017-02-035-5/+130
| | |_|_|_|_|/ | |/| | | | |
* | | | | | | Merge pull request #2509 from jfmherokiller/settingscastpatchbunnei2017-02-031-1/+1
|\ \ \ \ \ \ \
| * | | | | | | removed the possibly uneeded cast on values.gdbstub_portnoah the goodra2017-01-311-1/+1
| | |/ / / / / | |/| | | | |
* | | | | | | Merge pull request #2507 from jfmherokiller/keyidchangebunnei2017-02-031-1/+0
|\ \ \ \ \ \ \
| * | | | | | | removal of the -1 case in the configure_input switchnoah the goodra2017-01-311-1/+0
| |/ / / / / /
* / / / / / / GSP_GPU::StoreDataCache stubbed (#2428)mailwl2017-02-031-1/+28
|/ / / / / /
* | | | | | HLE/Applets: Stub Mint (eShop) Applet (#2463)mailwl2017-01-314-0/+108
* | | | | | Common/x64: remove legacy emitter and abi (#2504)Weiyi Wang2017-01-316-4202/+1
* | | | | | shader_jit_x64_compiler: esi and edi should be persistent (#2500)Merry2017-01-311-0/+2
* | | | | | file_util: Fixed implicit type conversion warning (#2503)noah the goodra2017-01-311-2/+2
|/ / / / /
* / / / / Support looping HLE audio (#2422)Jake Merdich2017-01-302-11/+35
|/ / / /
* | | | Merge pull request #2368 from wwylele/camera-2Yuri Kunde Schlesner2017-01-3014-172/+1520
|\ \ \ \
| * | | | CAM: implement basic camera functions with a blank camerawwylele2017-01-1114-172/+1520
| | |/ / | |/| |
* | | | Merge pull request #2429 from wwylele/auto-language-fixYuri Kunde Schlesner2017-01-301-36/+38
|\ \ \ \
| * | | | CFG: override language setting on bootwwylele2017-01-191-36/+38
* | | | | video_core: gl_rasterizer_cache.cpp removed unused type aliasKloen2017-01-301-1/+0
* | | | | video_core: gl_rasterizer.cpp removed unused type aliasKloen2017-01-301-2/+0
| |_|/ / |/| | |
* | | | Merge pull request #2494 from Kloen/killing-warnings-2-final-mixYuri Kunde Schlesner2017-01-301-1/+1
|\ \ \ \
| * | | | core: inline CPU, 132 warnings fixed on GCCKloen2017-01-301-1/+1
* | | | | Merge pull request #2492 from Kloen/killing-warnings-HD1.5ReMIXYuri Kunde Schlesner2017-01-305-0/+48
|\ \ \ \ \
| * | | | | citra: add missing control paths for ResultStatus on rom load. Fix warning about unhandled enumeration values on OSXKloen2017-01-291-0/+20
| * | | | | core: fix err_f.cpp warning about unhandled enumeration value on OSXKloen2017-01-291-0/+2
| * | | | | core: fix savedata_archive.cpp warnings about unhandled enumeration values on OSXKloen2017-01-291-0/+12
| * | | | | core: fix archive_sdmc.cpp warnings about unhandled enumeration value on OSXKloen2017-01-291-0/+12
| * | | | | core: fix archive_extsavedata.cpp warning on OSXKloen2017-01-291-0/+2
| | |_|_|/ | |/| | |
* | | | | Merge pull request #2493 from Kloen/killing-warnings-final-mixYuri Kunde Schlesner2017-01-301-0/+7
|\ \ \ \ \ | |_|/ / / |/| | | |
| * | | | video_core: silence unused-local-typedef boost related warning on GCCKloen2017-01-291-0/+7
| |/ / /
* / / / core: emu_window.cpp, fix conversion warnings from float to s16 on MSVCKloen2017-01-291-6/+6
|/ / /
* | | common: add <cstddef> to hash.hKloen2017-01-281-0/+1
* | | common: switch ComputeHash64 len param to size_t instead of int, fix warning on MSVC on dsp_dsp.cppKloen2017-01-282-6/+6
* | | fixed the override warningnoah the goodra2017-01-271-1/+1
* | | Merge pull request #2346 from yuriks/shader-refactor2Yuri Kunde Schlesner2017-01-2713-1110/+1189
|\ \ \
| * | | VideoCore/Shader: Move entry_point to SetupBatchYuri Kunde Schlesner2017-01-267-29/+29
| * | | VideoCore/Shader: Move per-batch ShaderEngine state into ShaderSetupYuri Kunde Schlesner2017-01-267-46/+43
| * | | Shader: Remove OutputRegisters structYuri Kunde Schlesner2017-01-264-22/+17
| * | | Shader: Initialize conditional_code in interpreterYuri Kunde Schlesner2017-01-262-3/+3
| * | | Shader: Don't read ShaderSetup from global stateYuri Kunde Schlesner2017-01-261-3/+3
| * | | shader_jit_x64: Don't read program from global stateYuri Kunde Schlesner2017-01-263-22/+22
| * | | VideoCore/Shader: Move ProduceDebugInfo to InterpreterEngineYuri Kunde Schlesner2017-01-265-19/+11
| * | | Debugger: Always use interpreter for shader debuggingYuri Kunde Schlesner2017-01-261-3/+5
| * | | VideoCore/Shader: Split interpreter and JIT into separate ShaderEnginesYuri Kunde Schlesner2017-01-268-97/+153
| * | | VideoCore/Shader: Rename shader_jit_x64{ => _compiler}.{cpp,h}Yuri Kunde Schlesner2017-01-264-4/+4
| * | | VideoCore/Shader: Split shader uniform state and shader engineYuri Kunde Schlesner2017-01-265-22/+57
| * | | VideoCore/Shader: Add constness to methodsYuri Kunde Schlesner2017-01-262-4/+4
| * | | VideoCore/Shader: Use only entry_point as ShaderSetup paramYuri Kunde Schlesner2017-01-264-12/+14
| * | | VideoCore/Shader: Use self instead of g_state.vs in ShaderSetupYuri Kunde Schlesner2017-01-263-13/+9
| * | | VideoCore/Shader: Extract input vertex loading code into functionYuri Kunde Schlesner2017-01-263-22/+26
* | | | SDL: Select audio device (#2403)Kloen Lansfiel2017-01-2614-18/+129
|/ / /
* | | Merge pull request #2434 from mailwl/nfc-amiiboYuri Kunde Schlesner2017-01-264-20/+249
|\ \ \
| * | | Service/NFC: stub some functionsmailwl2017-01-144-20/+249
* | | | video_core: fix shader.cpp signed / unsigned warningKloen2017-01-231-2/+2
* | | | video_core: gl_rasterizer float to int warningKloen2017-01-231-1/+2
* | | | video_core: fix gl_rasterizer warning on MSVCKloen2017-01-231-1/+1
* | | | core: fix mic_u warnings on MSVCKloen2017-01-231-4/+4
* | | | Removed unused and outdated external qhexeditKloen2017-01-222-2/+2
* | | | citra-qt: Removed unused and unimplemented ramview files.Kloen2017-01-224-32/+0
* | | | HID: reset acceleroeter and gyroscope index in Initwwylele2017-01-201-0/+2
* | | | loader: Add support for 3DSX special relocation types, fixes citra-emu/citra#2449Thomas Farr2017-01-181-9/+25
* | | | CoreTiming: use named constant for ARM11 clock ratewwylele2017-01-164-5/+6
* | | | HID: manages updating itself using correct tickswwylele2017-01-163-62/+93
|/ / /
* | | GSP::WriteHWRegsWithMask: fix register maskmailwl2017-01-141-1/+1
* | | Merge pull request #2423 from Kloen/floats-should-be-floatbunnei2017-01-131-1/+2
|\ \ \ | |/ / |/| |
| * | SDL2: Config.cpp fix double to float warningKloen2017-01-111-1/+2
* | | Merge pull request #2424 from Kloen/qt-ui-warnings-reallybunnei2017-01-123-24/+23
|\ \ \
| * | | QT: Fix ui file formatKloen2017-01-111-20/+20
| * | | QT: Fix some UI related warningsKloen2017-01-112-4/+3
| |/ /
* | | Merge pull request #2425 from Subv/cleanup_todosbunnei2017-01-124-32/+30
|\ \ \
| * | | Threads: Check the process' resource limit for the max allowed priority when creating a thread and remove the priority clamping code.Subv2017-01-112-13/+9
| * | | Thread: Added priority range checking to svcSetThreadPriority and removed priority clamping code from Thread::SetPriority.Subv2017-01-113-18/+18
| * | | Y2R: Use the proper error code when GetStandardCoefficient receives an invalid value.Subv2017-01-111-1/+3
| |/ /
* | | Merge pull request #2308 from mailwl/ac-ibunnei2017-01-129-297/+424
|\ \ \ | |/ / |/| |
| * | Service/AC: add ac:i servicemailwl2016-12-309-297/+424
* | | Merge pull request #2397 from Subv/pulsebunnei2017-01-105-13/+20
|\ \ \
| * | | Kernel: Implemented Pulse event and timers.Subv2017-01-055-13/+20
* | | | Merge pull request #2384 from bunnei/internal-res-optionbunnei2017-01-0810-25/+170
|\ \ \ \
| * | | | config: Add option for specifying screen resolution scale factor.bunnei2017-01-0710-25/+170
* | | | | Merge pull request #1951 from wwylele/motion-sensorbunnei2017-01-0714-16/+321
|\ \ \ \ \ | |/ / / / |/| | | |
| * | | | Frontend: make motion sensor interfaced thread-safewwylele2016-12-292-2/+8
| * | | | Frontend: emulate motion sensorwwylele2016-12-269-16/+239
| * | | | Common: add Quaternionwwylele2016-12-262-0/+45
| * | | | vector math: add implementation of Length and Normalizewwylele2016-12-261-0/+19
| * | | | MathUtil: add PI constantwwylele2016-12-261-0/+2
| * | | | Common::Event: add WaitUntilwwylele2016-12-261-0/+10
| | |_|/ | |/| |
* | | | Merge pull request #2410 from Subv/sleepthreadbunnei2017-01-073-0/+14
|\ \ \ \
| * | | | Kernel: Don't attempt to yield execution in SleepThread(0) if there are no available threads to run.Subv2017-01-063-0/+14
* | | | | Merge pull request #2396 from Subv/sema_acquirebunnei2017-01-071-1/+2
|\ \ \ \ \
| * | | | | Kernel/Semaphore: Fixed a regression in semaphore waits.Subv2017-01-051-1/+2
| |/ / / /
* | | | | Kernel: Fix SharedMemory objects always returning error when addr = 0 (#2404)Hyper2017-01-061-1/+5
* | | | | Merge pull request #2408 from Subv/priority_boostingbunnei2017-01-061-27/+0
|\ \ \ \ \
| * | | | | Kernel: Removed the priority boost code for starved threads.Subv2017-01-051-27/+0
| |/ / / /
* / / / / Kernel: Remove some unused functions.Subv2017-01-052-32/+0
|/ / / /
* | | | Merge pull request #2393 from Subv/synchSebastian Valle2017-01-0518-162/+227
|\ \ \ \
| * | | | Kernel: Add some asserts to enforce the invariants in the scheduler.Subv2017-01-052-2/+13
| * | | | Kernel: Remove a thread from all of its waiting objects' waiting_threads list when it is awoken.Subv2017-01-051-18/+4
| * | | | Kernel: Remove Thread::wait_objects_index and use wait_objects to hold all the objects that a thread is waiting on.Subv2017-01-054-21/+22
| * | | | Kernel: Use different thread statuses when a thread calls WaitSynchronization1 and WaitSynchronizationN with wait_all = true.Subv2017-01-044-19/+26
| * | | | Kernel/Mutex: Propagate thread priority changes to other threads inheriting the priority via mutexesSubv2017-01-045-42/+60
| * | | | Kernel/Mutex: Update a mutex priority when a thread stops waiting on it.Subv2017-01-045-24/+42
| * | | | Kernel/Mutex: Implemented priority inheritance.Subv2017-01-045-31/+51
| * | | | Kernel: Object ShouldWait and Acquire calls now take a thread as a parameter.Subv2017-01-0417-68/+56
| * | | | Kernel/Synch: Do not attempt a reschedule on every syscall.Subv2017-01-042-2/+18
| | |/ / | |/| |
* | | | Fix some warnings (#2399)Jonathan Hao2017-01-0413-35/+9
* | | | Merge pull request #2382 from mailwl/nfcYuri Kunde Schlesner2017-01-037-0/+44
|\ \ \ \ | |/ / / |/| | |
| * | | Service/NFC: stub GetTagInRangeEventmailwl2016-12-307-0/+44
| | |/ | |/|
* | | Merge pull request #2386 from bunnei/fix-bg-colorSebastian Valle2016-12-301-6/+6
|\ \ \ | |/ / |/| |
| * | config: SDL: Move background color setting to correct section.bunnei2016-12-301-6/+6
* | | Merge pull request #2240 from wwylele/auto-regionbunnei2016-12-3011-7/+108
|\ \ \ | |/ / |/| |
| * | Config: auto-select region and languagewwylele2016-12-0711-7/+108
* | | Merge pull request #2367 from JayFoxRox/lighting-lut-quickfixbunnei2016-12-291-10/+9
|\ \ \
| * | | Minor cleanup in GLSL codeJannik Vogel2016-12-251-3/+2
| * | | Offset lighting LUT samples correctlyJannik Vogel2016-12-251-7/+7
* | | | Core: remove unused hle.cppwwylele2016-12-271-58/+0
* | | | Core: reset cpu_core in Shutdown to make IsPoweredOn work properlywwylele2016-12-241-0/+1
| |_|/ |/| |
* | | Merge pull request #2369 from MerryMage/core-frontendbunnei2016-12-2314-16/+16
|\ \ \
| * | | core: Move emu_window and key_map into coreMerryMage2016-12-2314-16/+16
* | | | Merge pull request #2370 from wwylele/where-is-my-shared-fontYuri Kunde Schlesner2016-12-231-3/+1
|\ \ \ \ | |/ / / |/| | |
| * | | file_util: fix missing sysdata pathwwylele2016-12-231-3/+1
| |/ /
* / / Service/NWM: add nwm servicesmailwl2016-12-2218-10/+317
|/ /
* | Merge pull request #2366 from MerryMage/MemoryReadCodebunnei2016-12-221-0/+1
|\ \
| * | arm_dynarmic: Provide MemoryReadCode callbackMerryMage2016-12-221-0/+1
* | | Merge pull request #2343 from bunnei/core-cleanupbunnei2016-12-2245-591/+435
|\ \ \ | |/ / |/| |
| * | ThreadContext: Move from "core" to "arm_interface".bunnei2016-12-228-37/+26
| * | core: Replace "AppCore" nomenclature with just "CPU".bunnei2016-12-2211-105/+103
| * | Address clang-format issues.bunnei2016-12-228-49/+49
| * | core: Remove HLE module, consolidate code & various cleanups.bunnei2016-12-2219-107/+94
| * | core: Consolidate core and system state, remove system module & cleanups.bunnei2016-12-2222-336/+284
| * | file_util: Remove unused paths.bunnei2016-12-223-87/+3
| * | core: Consolidate top-level system state into a singleton.bunnei2016-12-228-103/+164
| * | loader: Remove duplicate docstrings.bunnei2016-12-223-56/+0
* | | Merge pull request #2285 from mailwl/csnd-formatbunnei2016-12-224-49/+94
|\ \ \
| * | | csnd:SND reformat source codemailwl2016-12-124-49/+94
* | | | Merge pull request #2361 from lioncash/disasmbunnei2016-12-221-3/+1
|\ \ \ \ | |_|/ / |/| | |
| * | | disassembler: Remove mutable specifier from breakpoints member variableLioncash2016-12-211-3/+1
* | | | citra-qt: Move graphics debugging code into its own folderLioncash2016-12-2117-32/+32
|/ / /
* | | Merge pull request #2319 from yuriks/profile-scopesbunnei2016-12-212-0/+15
|\ \ \
| * | | VideoCore: Make profiling scope more representativeYuri Kunde Schlesner2016-12-152-0/+15
* | | | Merge pull request #2357 from lioncash/uibunnei2016-12-212-67/+100
|\ \ \ \
| * | | | citra-qt: Move bits of constructor behavior to named functionsLioncash2016-12-192-67/+100
* | | | | Use GL_TRUE when setting color_maskAlbin Bernhardsson2016-12-191-4/+4
|/ / / /
* | | | Merge pull request #2318 from yuriks/trace-optbunnei2016-12-193-16/+15
|\ \ \ \
| * | | | VideoCore: Inline IsPicaTracingYuri Kunde Schlesner2016-12-153-16/+15
| |/ / /
* | | | Merge pull request #2351 from CaptV0rt3x/masterbunnei2016-12-181-0/+1
|\ \ \ \
| * | | | Fixed game_list focusing issue.Vamsi Krishna2016-12-181-0/+1
* | | | | Merge pull request #2347 from citra-emu/revert-2321-flush-pagesbunnei2016-12-181-10/+0
|\ \ \ \ \
| * | | | | Revert "Memory: Always flush whole pages from surface cache"bunnei2016-12-181-10/+0
| |/ / / /
* | | | | line fixup for travis ciCaptV0rt3x2016-12-181-1/+0
* | | | | screen swap - Hotkey mappingVamsi Krishna2016-12-182-5/+1
* | | | | Fixed GPLv2 license text in the start.Vamsi Krishna2016-12-181-1/+1
|/ / / /
* | | | Thread: remove the thread from the thread list when exitingwwylele2016-12-173-3/+15
* | | | Merge pull request #2335 from yuriks/shader-refactorYuri Kunde Schlesner2016-12-179-338/+336
|\ \ \ \
| * | | | VideoCore/Shader: Extract DebugData out from UnitStateYuri Kunde Schlesner2016-12-168-103/+99
| * | | | Remove unnecessary castYuri Kunde Schlesner2016-12-161-3/+1
| * | | | VideoCore/Shader: Extract evaluate_condition lambda to function scopeYuri Kunde Schlesner2016-12-161-26/+24
| * | | | VideoCore/Shader: Extract call lambda up a scope and remove unused paramYuri Kunde Schlesner2016-12-161-21/+17
| * | | | VideoCore/Shader: Remove dynamic control flow in (Get)UniformOffsetYuri Kunde Schlesner2016-12-162-18/+11
| * | | | VideoCore/Shader: Move DebugData to a separate fileYuri Kunde Schlesner2016-12-164-172/+189
* | | | | Merge pull request #2303 from freiro/citra-qt_missing_sdl2_dllbunnei2016-12-162-30/+10
|\ \ \ \ \
| * | | | | Modularized Qt and SDL file copyingfreiro2016-12-132-9/+8
| * | | | | Modularization of copy_msvc_libraries cmake functfreiro2016-12-111-20/+2
| * | | | | Removed redundant Qt check and other fixesfreiro2016-12-111-20/+19
| * | | | | [MSVC] Copy SDL2.dll to build folderfreiro2016-12-111-20/+20
* | | | | | Merge pull request #2337 from lioncash/gdbbunnei2016-12-161-9/+8
|\ \ \ \ \ \
| * | | | | | gdbstub: const correctness changesLioncash2016-12-161-9/+8
| | |/ / / / | |/| | | |
* | | | | | Merge pull request #2322 from MerryMage/ctx-mnuMerry2016-12-1610-4/+87
|\ \ \ \ \ \
| * | | | | | main: Open folder when open save folder location context menu is clickedMerryMage2016-12-152-0/+20
| * | | | | | game_list: Implement context menu for items in listMerryMage2016-12-153-4/+32
| * | | | | | loader: Implement ReadProgramIdMerryMage2016-12-153-0/+28
| * | | | | | archive_source_sd_savedata: Add static method to get a specific save data pathMerryMage2016-12-152-0/+7
* | | | | | | Kernel: remove object's waiting thread if it is deadwwylele2016-12-161-1/+2
| |/ / / / / |/| | | | |
* | | | | | Merge pull request #2260 from Subv/schedulingbunnei2016-12-168-196/+211
|\ \ \ \ \ \
| * | | | | | Fixed the codestyle to match our clang-format rules.Subv2016-12-144-28/+41
| * | | | | | Properly remove a thread from its wait_objects' waitlist when it is awoken by a timeout.Subv2016-12-103-2/+11
| * | | | | | WaitSynch: Removed unused variables and reduced SharedPtr copies.Subv2016-12-095-74/+57
| * | | | | | Use boost remove_erase_if instead of the erase-remove idiomSubv2016-12-071-2/+3
| * | | | | | Improved the algorithm for GetHighestPriorityReadyThread.Subv2016-12-071-14/+13
| * | | | | | Threading: Added some utility functions and const correctness.Subv2016-12-044-16/+36
| * | | | | | Threading: Reworked the way our scheduler works.Subv2016-12-048-190/+180
* | | | | | | Merge pull request #2316 from endrift/macos-gccbunnei2016-12-161-0/+11
|\ \ \ \ \ \ \
| * | | | | | | Common: Fix gcc build on macOSJeffrey Pfau2016-12-131-0/+11
| | |/ / / / / | |/| | | | |
* | | | | | | Merge pull request #2328 from wwylele/fix-traceYuri Kunde Schlesner2016-12-161-11/+9
|\ \ \ \ \ \ \
| * | | | | | | FS: fix debug build from #2249wwylele2016-12-151-11/+9
* | | | | | | | Merge pull request #2332 from lioncash/gdbYuri Kunde Schlesner2016-12-165-16/+23
|\ \ \ \ \ \ \ \
| * | | | | | | | gdbstub: Remove global variable from public interfaceLioncash2016-12-155-16/+23
* | | | | | | | | Merge pull request #2320 from mailwl/cecd-updateYuri Kunde Schlesner2016-12-168-13/+81
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | Service/CECD: Add cecd:ndm servicemailwl2016-12-158-13/+81
| | |_|_|_|_|/ / / | |/| | | | | | |
* | | | | | | | | Merge pull request #2331 from lioncash/truncbunnei2016-12-151-1/+2
|\ \ \ \ \ \ \ \ \ | |_|/ / / / / / / |/| | | | | | | |
| * | | | | | | | hid: Get rid of a double -> float truncation warningLioncash2016-12-151-1/+2
| | |/ / / / / / | |/| | | | | |
* | | | | | | | Merge pull request #2330 from lioncash/pragmaSebastian Valle2016-12-153-0/+6
|\ \ \ \ \ \ \ \
| * | | | | | | | core: Add missing #pragma once directives where applicableLioncash2016-12-153-0/+6
| |/ / / / / / /
* / / / / / / / act: Fix docstring typoLioncash2016-12-151-1/+1
|/ / / / / / /
* | | | | | | Merge pull request #2325 from yuriks/fix-indexYuri Kunde Schlesner2016-12-151-1/+1
|\ \ \ \ \ \ \
| * | | | | | | shader_jit_x64: Use LOOPCOUNT_REG as a 64-bit reg when indexingYuri Kunde Schlesner2016-12-151-1/+1
* | | | | | | | Merge pull request #2314 from mailwl/accountbunnei2016-12-158-10/+44
|\ \ \ \ \ \ \ \ | |/ / / / / / / |/| | | | | | |
| * | | | | | | Service/ACT: move ACT services to foldermailwl2016-12-148-10/+44
| | |/ / / / / | |/| | | | |
* | | | | | | Memory: Always flush whole pages from surface cacheYuri Kunde Schlesner2016-12-151-0/+10
| |/ / / / / |/| | | | |
* | | | | | VideoCore: Eliminate an unnecessary copy in the drawcall loopYuri Kunde Schlesner2016-12-153-5/+3
* | | | | | Merge pull request #2309 from yuriks/shader-jit-xbyakYuri Kunde Schlesner2016-12-156-224/+462
|\ \ \ \ \ \
| * | | | | | shader_jit_x64: Use Reg32 for LOOP* registers, eliminating castsYuri Kunde Schlesner2016-12-151-16/+16
| * | | | | | VideoCore: Convert x64 shader JIT to use Xbyak for assemblyYuri Kunde Schlesner2016-12-156-224/+462
| |/ / / / /
* | | | | | Merge pull request #2249 from Subv/sessions_v3Yuri Kunde Schlesner2016-12-1525-171/+591
|\ \ \ \ \ \ | |/ / / / / |/| | | | |
| * | | | | Fixed the codestyle to match our clang-format rules.Subv2016-12-1416-68/+108
| * | | | | Moved the HLE command buffer translation task to ServerSession instead of the HLE handler superclass.Subv2016-12-096-47/+38
| * | | | | Kernel/IPC: Small codestyle cleanupSubv2016-12-092-3/+1
| * | | | | Added a framework for partially handling Session disconnections.Subv2016-12-088-9/+67
| * | | | | Use std::move where appropriate.Subv2016-12-0812-177/+187
| * | | | | Return an error code when connecting to a saturated port.Subv2016-12-055-7/+20
| * | | | | HLE: Use a member variable instead of a virtual function to retrieve the max number of sessions that can be connected to an HLE service at the same time.Subv2016-12-055-8/+18
| * | | | | Split SessionRequestHandler::HandleSyncRequest into HandleSyncRequest, TranslateRequest and HandleSyncRequestImpl.Subv2016-12-056-22/+59
| * | | | | Kernel: Remove the Redirection handle type.Subv2016-12-051-2/+0
| * | | | | KServerPorts now have an HLE handler "template", which is inherited by all ServerSessions created from it.Subv2016-12-0512-69/+86
| * | | | | Declare empty ServerSession and ClientSession constructors as default.Subv2016-12-032-4/+4
| * | | | | Threads do not wait for the server endpoint to call AcceptSession before returning from a ConnectToPort or GetServiceHandle call.Subv2016-12-012-3/+5
| * | | | | Fixed the rebase mistakes.Subv2016-12-0111-83/+76
| * | | | | A bit of a redesign.Subv2016-12-0113-263/+266
| * | | | | IPC/HLE: Associate the ClientSessions with their parent port's HLE interface if it exists.Subv2016-12-016-26/+21
| * | | | | Kernel/HLE: Service::Interface no longer inherits from any Kernel object, and is now its own standalone class.Subv2016-12-014-24/+52
| * | | | | fixup! Kernel/IPC: Use Ports and Sessions as the fundamental building block of Inter Process Communication.Subv2016-12-014-5/+6
| * | | | | Kernel/IPC: Use Ports and Sessions as the fundamental building block of Inter Process Communication.Subv2016-12-0116-88/+314
* | | | | | Minor amendment of GSP_GPU::ImportDisplayCaptureInfo codeJamePeng2016-12-131-3/+5
* | | | | | Merge pull request #2312 from lioncash/guardYuri Kunde Schlesner2016-12-131-0/+2
|\ \ \ \ \ \ | |_|_|_|/ / |/| | | | |
| * | | | | time_stretch: Add missing #pragma once directiveLioncash2016-12-131-0/+2
* | | | | | Merge pull request #2275 from jbeich/pthreadSebastian Valle2016-12-111-1/+1
|\ \ \ \ \ \
| * | | | | | tests: add missing libcore dependency after 75ee2f8c6702Jan Beich2016-12-071-1/+1
| | |_|_|_|/ | |/| | | |
* | | | | | Merge pull request #2267 from JayFoxRox/fix-mingw-ccSebastian Valle2016-12-119-10/+11
|\ \ \ \ \ \
| * | | | | | gdbstub: Remove unused includeJannik Vogel2016-12-051-1/+0
| * | | | | | Unify Windows ICON resource nameJannik Vogel2016-12-052-2/+2
| * | | | | | Support mingw cross-compileJannik Vogel2016-12-059-9/+11
* | | | | | | APT::GetStartupArgument: force clear startup argumentmailwl2016-12-112-5/+11
* | | | | | | citra-qt: Make constructors explicit where applicableLioncash2016-12-1115-32/+35
| |_|/ / / / |/| | | | |
* | | | | | citra-qt: Add missing #pragma once directivesLioncash2016-12-115-0/+10
* | | | | | game_list: Make slots private functionsLioncash2016-12-111-7/+4
* | | | | | game_list: Make the constructor explicitLioncash2016-12-111-1/+1
* | | | | | game_list: Make the AddEntry argument a const referenceLioncash2016-12-112-2/+2
* | | | | | game_list: Replace 0 literals with nullptrLioncash2016-12-111-1/+1
* | | | | | game_list: Use QT5's new event connection syntaxLioncash2016-12-111-6/+6
* | | | | | game_list: Pass the parent constructor argument to the QWidget base classLioncash2016-12-111-1/+1
| |_|_|_|/ |/| | | |
* | | | | Merge pull request #2300 from lioncash/qtYuri Kunde Schlesner2016-12-111-18/+24
|\ \ \ \ \
| * | | | | graphics_cmdlists: Get rid of variable shadowingLioncash2016-12-111-14/+18
| * | | | | graphics_cmdlists: Get rid of an unused variableLioncash2016-12-111-1/+0
| * | | | | graphics_cmdlists: Make LoadTexture and TextureInfoWidget src arguments constLioncash2016-12-111-3/+4
| * | | | | graphics_cmdlists: Make LoadImage internally linkedLioncash2016-12-111-0/+2
* | | | | | Core: Add a forgotten #include <cstring> for memcpy.Emmanuel Gil Peyrot2016-12-111-0/+1
|/ / / / /
* | | | | Add all services to the Service namespaceLioncash2016-12-1150-499/+408
* | | | | configure_input: Modernize and cleanup input configuration tabMerryMage2016-12-112-115/+101
* | | | | Merge pull request #2296 from MerryMage/auto_is_autoYuri Kunde Schlesner2016-12-101-12/+7
|\ \ \ \ \
| * | | | | audio_core: SelectSink should default to auto if sink_id is invalidMerryMage2016-12-101-12/+7
* | | | | | Merge pull request #2291 from lioncash/svcbunnei2016-12-0910-12/+61
|\ \ \ \ \ \
| * | | | | | service: Add cfg:nor serviceLioncash2016-12-094-0/+49
| * | | | | | service: Drop '_Interface' from cfg service namesLioncash2016-12-097-12/+12
* | | | | | | Merge pull request #2292 from lioncash/boolYuri Kunde Schlesner2016-12-091-1/+1
|\ \ \ \ \ \ \ | |/ / / / / / |/| | | | | |
| * | | | | | ptm: Use boolean instead of integral valueLioncash2016-12-091-1/+1
* | | | | | | Merge pull request #2287 from lioncash/svcYuri Kunde Schlesner2016-12-0912-12/+170
|\ \ \ \ \ \ \
| * | | | | | | service: Add the ptm:s serviceLioncash2016-12-083-0/+14
| * | | | | | | service: Add common ptm:u commands to other ptm servicesLioncash2016-12-084-0/+54
| * | | | | | | service: Drop '_Interface' in ptm service class namesLioncash2016-12-087-14/+14
| * | | | | | | service: Add ptm::gets and ptm::sets servicesLioncash2016-12-086-0/+90
* | | | | | | | Merge pull request #2280 from Subv/citrace_sizeSebastian Valle2016-12-081-2/+2
|\ \ \ \ \ \ \ \ | |/ / / / / / / |/| | | | | | |
| * | | | | | | Fixed the gpu command list size when creating CiTraces.Subv2016-12-081-2/+2
| | |_|/ / / / | |/| | | | |
* | | | | | | Merge pull request #2286 from lioncash/svcYuri Kunde Schlesner2016-12-0814-0/+271
|\ \ \ \ \ \ \
| * | | | | | | service: Add mvd and qtm servicesLioncash2016-12-0814-0/+271
* | | | | | | | Merge pull request #2274 from degasus/masterYuri Kunde Schlesner2016-12-085-47/+8
|\ \ \ \ \ \ \ \ | |/ / / / / / / |/| | | | | | |
| * | | | | | | OpenGL: Drop framebuffer completeness check.Markus Wick2016-12-075-47/+8
| | |_|_|/ / / | |/| | | | |
* | | | | | | Merge pull request #2284 from lioncash/svcYuri Kunde Schlesner2016-12-088-30/+199
|\ \ \ \ \ \ \
| * | | | | | | service: Add nfc servicesLioncash2016-12-088-30/+199
* | | | | | | | Merge pull request #2277 from lioncash/explicitYuri Kunde Schlesner2016-12-088-10/+10
|\ \ \ \ \ \ \ \ | |/ / / / / / / |/| | | | | | |
| * | | | | | | file_sys: Make a few single-argument constructors explicitLioncash2016-12-078-10/+10
| |/ / / / / /
* | | | | | | Merge pull request #2283 from lioncash/svcYuri Kunde Schlesner2016-12-0821-28/+212
|\ \ \ \ \ \ \
| * | | | | | | ssl_c: Update function tableLioncash2016-12-081-0/+3
| * | | | | | | ptm: Update ptm_sysm function tableLioncash2016-12-083-6/+7
| * | | | | | | pm_app: Update function tableLioncash2016-12-081-6/+9
| * | | | | | | nwm_uds: Update function tableLioncash2016-12-081-5/+7
| * | | | | | | nim: Update function tablesLioncash2016-12-082-0/+2
| * | | | | | | http_c: Update function tableLioncash2016-12-081-0/+4
| * | | | | | | gsp_lcd: Update function tableLioncash2016-12-081-0/+4
| * | | | | | | fs_user: Update function tableLioncash2016-12-081-0/+2
| * | | | | | | dlp_srvr: Update function tableLioncash2016-12-081-0/+7
| * | | | | | | cfg: Update function tablesLioncash2016-12-083-0/+3
| * | | | | | | cecd_u: Update function tableLioncash2016-12-081-1/+13
| * | | | | | | boss_p: Update function tableLioncash2016-12-081-3/+68
| * | | | | | | act: Update function tablesLioncash2016-12-082-0/+10
| * | | | | | | apt: Update apt function tablesLioncash2016-12-082-7/+73
| | |_|/ / / / | |/| | | | |
* | | | | | | Merge pull request #2281 from lioncash/appletYuri Kunde Schlesner2016-12-088-30/+22
|\ \ \ \ \ \ \ | |/ / / / / / |/| | | | | |
| * | | | | | applet: Move common IsRunning underlying variable to the Applet classLioncash2016-12-078-28/+19
| * | | | | | applet: Make virtual destructor defaultedLioncash2016-12-071-1/+1
| * | | | | | applet: Make constructor protectedLioncash2016-12-071-1/+2
* | | | | | | Update AM service function tablesLioncash2016-12-086-113/+246
| |/ / / / / |/| | | | |
* | | | | | Merge pull request #2232 from wwylele/other-savebunnei2016-12-0711-80/+351
|\ \ \ \ \ \ | |/ / / / / |/| | | | |
| * | | | | FileSys: Implement OtherSaveDatawwylele2016-11-297-0/+214
| * | | | | FS: add missing MediaTypewwylele2016-11-291-1/+1
| * | | | | FileSys: abstract SD save data archive sourcewwylele2016-11-296-79/+136
* | | | | | Implement Frame rate limiter (#2223)emmauss2016-12-0610-0/+54
* | | | | | ASSERT that shader was linked successfullyJannik Vogel2016-12-051-0/+2
* | | | | | Report shader uniform block size in case of mismatchJannik Vogel2016-12-051-1/+3
* | | | | | Print broken shader code to logJannik Vogel2016-12-051-3/+9
| |/ / / / |/| | | |
* | | | | GSP: Downgrade log severity of SetAxiConfigQoSModeYuri Kunde Schlesner2016-12-041-1/+1
* | | | | OpenGL: Non-zero stride only makes sense for linear buffersYuri Kunde Schlesner2016-12-043-7/+11
* | | | | OpenGL: Ensure framebuffer binding is restored if completion check failsYuri Kunde Schlesner2016-12-041-10/+7
* | | | | OpenGL: Fix DisplayTransfer accel when input width != output widthYuri Kunde Schlesner2016-12-041-1/+10
* | | | | Merge pull request #2259 from JayFoxRox/fix-fallbackYuri Kunde Schlesner2016-12-041-1/+1
|\ \ \ \ \
| * | | | | shader_jit: Fix non-SSE4.1 path where FLR would not truncateJannik Vogel2016-12-041-1/+1
* | | | | | clang-format: Fix coding styleYuri Kunde Schlesner2016-12-031-1/+1
|/ / / / /
* | | | / shader_jit: Load LOOPCOUNT_REG and LOOPINC 4 bit left-shiftedJannik Vogel2016-12-021-6/+9
| |_|_|/ |/| | |
* | | | Remove unused version.hJannik Vogel2016-12-012-12/+0
| |_|/ |/| |
* | | Merge pull request #2228 from freiro/winver_fixYuri Kunde Schlesner2016-12-011-3/+0
|\ \ \ | |_|/ |/| |
| * | WINVER definition moved to CMake and cleanupfreiro2016-11-301-3/+0
* | | ClangFormat: Fixed the clang-format errorsSubv2016-11-302-6/+10
* | | Set client SDK version to Service APIsmailwl2016-11-308-16/+88
|/ /
* / Build: Fixed a few warnings.Subv2016-11-293-11/+11
|/
* Merge pull request #2196 from Subv/system_modeYuri Kunde Schlesner2016-11-2810-21/+66
|\
| * Kernel/Loader: Grab the system mode from the NCCH ExHeader.Subv2016-11-285-27/+27
| * Kernel/Loader: Grab the system mode from the NCCH ExHeader.Subv2016-11-2010-22/+67
* | Merge pull request #2222 from linkmauve/die-frameskip-dieYuri Kunde Schlesner2016-11-287-33/+1
|\ \
| * | GPU: Remove the broken frame_skip option.Emmanuel Gil Peyrot2016-11-277-33/+1
* | | Merge pull request #2132 from wwylele/fix-fs-errSebastian Valle2016-11-2830-304/+1234
|\ \ \
| * | | tests: add a work-around for macOS linking errorwwylele2016-11-192-0/+15
| * | | FileSys: rename SaveDataCheck archive to NCCH archivewwylele2016-11-195-23/+22
| * | | FileSys: remove unused DiskArchivewwylele2016-11-192-179/+0
| * | | PTM & CFG: use the correct path and error code according to the new FileSys policywwylele2016-11-192-5/+6
| * | | FileSys: w->rw permission lift only happens in SDMC archivewwylele2016-11-194-2/+14
| * | | FileSys: add SDMCWriteOnlyArchivewwylele2016-11-196-0/+140
| * | | FileSys: add SDMCArchivewwylele2016-11-193-1/+301
| * | | FileSys: add ExtSaveDataArchivewwylele2016-11-192-1/+115
| * | | FileSys: add SaveDataArchivewwylele2016-11-197-4/+368
| * | | FileSys: remove Open from FileBackendwwylele2016-11-194-64/+44
| * | | FileSys: remove Open from DirectoryBackendwwylele2016-11-194-25/+5
| * | | FileSys: add PathParserwwylele2016-11-195-0/+200
| * | | FileSys: make Archive interfaces return error codewwylele2016-11-016-87/+91
* | | | RasterizerGL: Use GL_TRUE and 0xFF in the stencil and depth masks instead of simply true and -1Subv2016-11-272-4/+4
* | | | Rasterizer/Memfill: Set the correct stencil write mask when clearing the stencil buffer.Subv2016-11-271-1/+1
| |/ / |/| |
* | | Merge pull request #2168 from mailwl/micSebastian Valle2016-11-274-16/+309
|\ \ \
| * | | Output parameters to logmailwl2016-11-251-4/+6
| * | | MIC_U: Stub service funcionsmailwl2016-11-254-16/+307
* | | | Merge pull request #2185 from freiro/local_folderYuri Kunde Schlesner2016-11-263-1/+18
|\ \ \ \
| * | | | Move to AppData/Roaming/Citra/freiro2016-11-261-1/+1
| * | | | Removed /user/ from pathfreiro2016-11-261-2/+1
| * | | | Switch to AppData/Roamingfreiro2016-11-242-4/+4
| * | | | Return by value and other fixesfreiro2016-11-192-14/+8
| * | | | Win32 move default user folder location to AppDatafreiro2016-11-192-0/+24
| | |_|/ | |/| |
* | | | dynarmic: Add ticks based on ticks executed, not ticks requestedMerryMage2016-11-261-2/+2
| |/ / |/| |
* | | Expose page table to dynarmic for optimized reads and writes to the JITJames Rowe2016-11-253-6/+18
* | | Cache Vertices instead of Output registers (#2165)jphalimi2016-11-241-6/+7
* | | Bravely Default/Second stuck #1822 (#2188)pippo29312016-11-244-2/+22
* | | Merge pull request #2186 from wwylele/config9Yuri Kunde Schlesner2016-11-241-2/+8
|\ \ \
| * | | cfg: add config block 0x00090000wwylele2016-11-171-2/+8
* | | | Merge pull request #1654 from JamePeng/errdispYuri Kunde Schlesner2016-11-241-118/+198
|\ \ \ \
| * | | | Rework the code of err:f serviceJamePeng2016-10-061-118/+198
* | | | | Fix format error from #2195wwylele2016-11-221-1/+1
* | | | | Improve verbosity of audio errors with SDL_GetError()freiro2016-11-221-2/+2
* | | | | Merge pull request #2195 from Subv/factor_checkbunnei2016-11-201-6/+5
|\ \ \ \ \
| * | | | | GPU/CiTrace: Avoid calling GetTextures() when not necessary.Subv2016-11-201-6/+5
| | |_|/ / | |/| | |
* | | | | Merge pull request #2193 from Subv/pulse_eventsbunnei2016-11-202-0/+10
|\ \ \ \ \
| * | | | | Kernel/Events: Log an error when trying to create Pulse events and timers.Subv2016-11-192-0/+10
| |/ / / /
* | | | | Merge pull request #2192 from Subv/applet_enumsSebastian Valle2016-11-205-16/+27
|\ \ \ \ \
| * | | | | APT/Applets: Renamed the members of the SignalType enum.Subv2016-11-195-16/+27
| |/ / / /
* | | | | Merge pull request #2194 from jroweboy/extremely-minor-clangformat-changeJames Rowe2016-11-191-1/+1
|\ \ \ \ \ | |/ / / / |/| | | |
| * | | | Minor formatting changeJames Rowe2016-11-191-1/+1
| | |/ / | |/| |
* | | | Merge pull request #2172 from jroweboy/fix-mingwbunnei2016-11-163-3/+8
|\ \ \ \
| * | | | Add mingw compile supportJames Rowe2016-11-143-3/+8
| |/ / /
* | | | Merge pull request #1753 from jroweboy/frame_layoutsbunnei2016-11-1619-127/+368
|\ \ \ \ | |/ / / |/| | |
| * | | Round the rectangle size to prevent float to int casting issuesJames Rowe2016-11-123-8/+9
| * | | Add default hotkey to swap primary screens.James Rowe2016-11-0510-13/+27
| * | | Rework frame layouts to use a max rectangle instead of hardcoded calculationsJames Rowe2016-11-052-250/+100
| * | | LargeFrameLayout + SwappedSonofUgly2016-11-051-50/+36
| * | | Support additional screen layouts.James Rowe2016-11-0516-127/+517
* | | | Minor Menu FixesPringo2016-11-112-2/+2
|/ / /
* | | Style fixmailwl2016-11-021-2/+2
* | | Rename AcConfig, change types u8 to u32mailwl2016-11-021-21/+25
* | | AC_U: Stub functions, used if EULA agreedmailwl2016-11-022-14/+190
| |/ |/|
* | Merge pull request #2126 from wwylele/stub-nwmbunnei2016-10-311-0/+11
|\ \
| * | NWM: stub Initialize with an errorwwylele2016-10-121-0/+11
| |/
* | Merge pull request #2123 from jbeich/freebsdbunnei2016-10-317-25/+39
|\ \
| * | build: add default install for DragonFly, Solaris, etc.Jan Beich2016-10-282-2/+2
| * | core: some errno values are uncommon on UnixJan Beich2016-10-281-0/+8
| * | common: use system bswap* functions on more BSDsJan Beich2016-10-281-2/+5
| * | common: use system CPUID routine on DragonFly as wellJan Beich2016-10-281-2/+2
| * | common: some FreeBSD headers are incomplete to avoid namespace pollutionJan Beich2016-10-281-1/+3
| * | common: convert to standard stat()/fstat() interfacesAnthony J. Bentley2016-10-281-15/+10
| * | common: stat64 is non-standard, hide on a random UnixJan Beich2016-10-281-1/+1
| * | common: only FreeBSD has thread affinity compatible with LinuxJan Beich2016-10-281-1/+5
| * | common: define routines to set thread name on more BSDsJan Beich2016-10-281-2/+4
* | | Small fix to let IDA see target.xmlmailwl2016-10-281-1/+1
|/ /
* | FRD: fix GetMyFriendKeymailwl2016-10-251-1/+1
* | Fix typosRicardo de Almeida Gonzaga2016-10-2013-16/+16
* | Merge pull request #2024 from JamePeng/update-boss-codebunnei2016-10-085-4/+1810
|\ \
| * | Update the stub code of BOSSJamePeng2016-10-025-4/+1810
* | | Merge pull request #2082 from yuriks/shader-interp-crashbunnei2016-10-073-38/+43
|\ \ \ | |_|/ |/| |
| * | VideoCore: Shader interpreter cleanupsYuri Kunde Schlesner2016-09-301-32/+42
| * | Common: Remove dangerous Vec[234] array constructorsYuri Kunde Schlesner2016-09-301-3/+0
| * | VideoCore: Fix out-of-bounds read in ShaderSetup::ProduceDebugInfoYuri Kunde Schlesner2016-09-301-3/+1
| |/
* | Merge pull request #1652 from wwylele/kernal-toolbunnei2016-10-0512-7/+646
|\ \
| * | move ResetType to kernel.hwwylele2016-09-223-7/+6
| * | name objectswwylele2016-09-221-0/+4
| * | implement wait tree widgetwwylele2016-09-229-0/+636
* | | Merge pull request #2106 from wwylele/delete-recursivebunnei2016-10-048-22/+93
|\ \ \
| * | | fs: clean up log formatwwylele2016-10-021-22/+24
| * | | fs: implement DeleteDirectoryRecursivelywwylele2016-10-028-1/+70
| | |/ | |/|
* | | Merge pull request #2103 from wwylele/gpu-reg-cleanupbunnei2016-10-045-247/+347
|\ \ \ | |/ / |/| |
| * | gpu: DisplayTransfer: a less amazing algorithm for flipwwylele2016-09-291-8/+11
| * | gpu: keep the old signal strategy for null pointerwwylele2016-09-291-4/+8
| * | gpu: add validity check for TextureCopy, DisplayTransfer and FillMemorywwylele2016-09-291-6/+88
| * | memory: fix IsValidVirtualAddress for RasterizerCachedMemorywwylele2016-09-291-0/+3
| * | gpu: move MemoryFill, TextureCopy and DisplayTransfer into functionswwylele2016-09-291-247/+249
| * | rasterizer: separate TextureCopy from DisplayTransferwwylele2016-09-293-6/+12
| |/
* | OpenGL: Take cached viewport sub-rect into account for scissorYuri Kunde Schlesner2016-09-303-29/+25
* | qt: shutdown system if errorwwylele2016-09-221-2/+3
|/
* Remove special rules for Windows.h and library includesYuri Kunde Schlesner2016-09-216-10/+8
* Use negative priorities to avoid special-casing the self-includeYuri Kunde Schlesner2016-09-21164-168/+170
* Remove empty newlines in #include blocks.Emmanuel Gil Peyrot2016-09-21289-731/+214
* Manually tweak source formatting and then re-run clang-formatYuri Kunde Schlesner2016-09-19169-812/+808
* Tweak formatting settingsYuri Kunde Schlesner2016-09-191-4/+3
* Sources: Run clang-format on everything.Emmanuel Gil Peyrot2016-09-18386-17707/+19187
* Dyncom: Disable clang-format on the decoding table.Emmanuel Gil Peyrot2016-09-181-0/+3
* Sources: Add a .clang-format configuration file.Emmanuel Gil Peyrot2016-09-181-0/+89
* VideoCore: Fix dangling lambda context in shader interpreterYuri Kunde Schlesner2016-09-161-1/+1
* arm_dynarmic: Implement GetVFPSystemReg/SetVFPSystemReg.bunnei2016-09-151-5/+12
* microprofile: Double buffer size to 16MB.bunnei2016-09-151-1/+1
* arm: ResetContext shouldn't be part of ARM_Interface.bunnei2016-09-156-30/+17
* arm_dynarmic/arm_dyncom: Remove unnecessary "virtual" keyword.bunnei2016-09-152-2/+2
* dyncom: Use VFP_FPSCR/VFP_FPEXC.bunnei2016-09-151-4/+4
* qt: Add UI configuration option to enable CPU JIT.bunnei2016-09-152-0/+25
* core: Add configuration option for CPU JIT.bunnei2016-09-155-7/+20
* dynarmic: Implement ARM CPU interface.bunnei2016-09-153-0/+233
* Merge pull request #2064 from linkmauve/remove-readdir_rYuri Kunde Schlesner2016-09-131-6/+2
|\
| * Common: readdir_r() is deprecated, switch to readdir().Emmanuel Gil Peyrot2016-09-131-6/+2
* | Qt: fix birthday combo box updatingwwylele2016-09-131-2/+3
* | audio_core: Tweak audio latencyMerryMage2016-09-072-2/+2
|/
* Merge pull request #2050 from MerryMage/adpcmYuri Kunde Schlesner2016-09-031-2/+2
|\
| * codec: Fix ADPCM distortion caused by incorrect nibble orderfincs2016-09-031-2/+2
* | Qt: unify running detectionwwylele2016-09-025-12/+9
|/
* Merge pull request #2032 from bunnei/qt-graphicsbunnei2016-09-0121-82/+251
|\
| * qt: Rename all "toogle" to "toggle".bunnei2016-09-016-24/+24
| * qt: Add an option to settings for enabling V-Sync.bunnei2016-08-301-0/+4
| * qt: Recreate GL context on startup to support changing V-Sync.bunnei2016-08-303-25/+39
| * system: Add a function to see if the emulator is running.bunnei2016-08-302-0/+11
| * config: Add a setting for graphics V-Sync.bunnei2016-08-309-1/+20
| * qt: Add a configuration tab for Graphics and move relevant fields.bunnei2016-08-308-48/+169
* | configure_audio: User-configuratble option to enable/disable audio stretchingMerryMage2016-08-317-0/+24
* | audio_core: Add EnableStretching to interface so that one can toggle stretching on and offMerryMage2016-08-314-9/+52
* | sink: Change EnqueueSamples to take a pointer to a buffer instead of a std::vectorMerryMage2016-08-315-9/+9
* | OpenGL: Avoid error on unsupported lighting LUTJannik Vogel2016-08-301-0/+1
* | Merge pull request #2023 from yuriks/autobase-bcfntbunnei2016-08-303-30/+68
|\ \ | |/ |/|
| * Auto-detect original shared_font.bin memory baseYuri Kunde Schlesner2016-08-273-30/+68
* | Merge pull request #1948 from wwylele/cro++Yuri Kunde Schlesner2016-08-2914-99/+3041
|\ \
| * | LDR: Implement CROwwylele2016-08-279-99/+3013
| * | ARM: add ClearInstructionCache functionwwylele2016-08-273-0/+11
| * | Memory: add ReadCString functionwwylele2016-08-272-0/+17
| |/
* | Merge pull request #1987 from Lectem/ipcdescriptorsYuri Kunde Schlesner2016-08-275-22/+110
|\ \ | |/ |/|
| * fix #1942 and adds a few IPC functions for descriptorsLectem2016-08-025-22/+110
* | dyncom: Read-after-write in SMLAMerryMage2016-08-221-2/+4
* | citra: Default to HW renderer.bunnei2016-08-163-4/+4
* | Dyncom: Correct implementation of STM for R15MerryMage2016-08-141-3/+4
|/
* Input GUI: Add tab to remap controls (#1900)Anon2016-07-299-8/+825
* Merge pull request #1950 from JamePeng/fix-apt-0x0055004-and-0x00560000bunnei2016-07-295-22/+31
|\
| * Correct APT::0x00550040 and APT::0x00560000 functionJamePeng2016-07-155-22/+31
* | Instead of segfaulting, log an error to remind the user to dump the shared font fileHenrik Rydgard2016-07-281-0/+7
* | Merge pull request #1959 from MerryMage/revsh-upstreambunnei2016-07-281-4/+13
|\ \
| * | dyncom: Fix translation of thumb REVSHMerryMage2016-07-281-4/+13
* | | Merge pull request #1966 from dwhinham/info_plist_fixbunnei2016-07-261-1/+1
|\ \ \
| * | | CMake: Fix Info.plist template for citra_qt/OSXDale Whinham2016-07-211-1/+1
| | |/ | |/|
* | | Protection against a resize of size 0Alexandre LittleWhite Laurent2016-07-231-4/+3
* | | CoreTiming: avoid overflowwwylele2016-07-231-1/+1
* | | HLE: implement system timewwylele2016-07-232-2/+60
|/ /
* | Merge pull request #1890 from LFsWang/fix-encode-problembunnei2016-07-151-0/+22
|\ \
| * | Fix boot_filename encode on WindowsLFsWang2016-06-081-0/+22
* | | Merge pull request #1894 from wwylele/set-config-blockYuri Kunde Schlesner2016-07-1014-41/+703
|\ \ \
| * | | Qt: add system settings config tabwwylele2016-07-108-4/+450
| * | | Service::CFG/FS: add and refactor out utilities for front-endwwylele2016-07-034-15/+146
| * | | Service::CFG: move known block ID to an enumwwylele2016-07-031-11/+25
| * | | Service::CFG: add SetConfigInfoBlk4wwylele2016-07-034-8/+73
| * | | Service::CFG: add missing languagewwylele2016-07-021-1/+2
| * | | Service::CFG: name sound output modeswwylele2016-07-022-2/+7
| | |/ | |/|
* | | Merge pull request #1940 from JamePeng/fix-archive-error-codebunnei2016-07-072-10/+15
|\ \ \
| * | | Fix the errorcode of archive handleJamePeng2016-07-042-10/+15
* | | | Merge pull request #1921 from Subv/fs_funcsSebastian Valle2016-07-051-11/+42
|\ \ \ \
| * | | | HLE/FS: Document some command parameters and implemented command 0x08560240 (CreateLegacySystemSaveData)Subv2016-07-031-11/+42
* | | | | HLE/Applets: Implement ErrEula appletmailwl2016-07-045-0/+118
| |/ / / |/| | |
* | | | Merge pull request #1935 from wwylele/fix-result-moduleSebastian Valle2016-07-031-6/+19
|\ \ \ \
| * | | | Result: fix and update ErrorModulewwylele2016-06-301-6/+19
| | |/ / | |/| |
* | | | Merge pull request #1933 from yuriks/scissorYuri Kunde Schlesner2016-07-026-3/+112
|\ \ \ \ | |/ / / |/| | |
| * | | OpenGL: Add scaled resolution support to scissorYuri Kunde Schlesner2016-06-284-3/+16
| * | | PICA: Scissor fixes and cleanupsYuri Kunde Schlesner2016-06-285-45/+39
| * | | PICA: Implement scissor testSubv2016-06-285-3/+105
* | | | Merge pull request #1869 from wwylele/dont-be-lazyYuri Kunde Schlesner2016-06-291-2/+6
|\ \ \ \
| * | | | Switch context on the same thread if necessarywwylele2016-05-301-2/+6
* | | | | Merge pull request #1867 from mailwl/srv-updatebunnei2016-06-292-15/+125
|\ \ \ \ \ | |_|/ / / |/| | | |
| * | | | Fix parameter name in EnableNotificationmailwl2016-05-312-2/+6
| * | | | Fix mistakes, add output header codesmailwl2016-05-311-8/+24
| * | | | remove ugly functionmailwl2016-05-311-35/+3
| * | | | srv: Update according 3dbrewmailwl2016-05-311-15/+137
* | | | | Remove superfluous std::move in return std::move(local_var)scurest2016-06-252-2/+2
* | | | | Merge pull request #1923 from yuriks/fix-recursivebunnei2016-06-223-22/+15
|\ \ \ \ \
| * | | | | Fix recursive scanning of directoriesYuri Kunde Schlesner2016-06-193-22/+15
* | | | | | Qt: Fix MicroProfile dpi scalingYuri Kunde Schlesner2016-06-191-7/+6
|/ / / / /
* | | | | Merge pull request #1877 from wwylele/wait-fix-timeoutbunnei2016-06-181-0/+49
|\ \ \ \ \
| * | | | | Thread: update timeout when rerunning WaitSynchwwylele2016-06-041-0/+49
* | | | | | Merge pull request #1898 from archshift/interpreter-split-take2bunnei2016-06-165-2727/+2729
|\ \ \ \ \ \
| * | | | | | Make arm_dyncom_trans* into a fully fledged compilation unitarchshift2016-06-124-53/+73
| * | | | | | arm_dyncom_interpreter: slightly change AllocBuffer to be intuitivearchshift2016-06-121-15/+15
| * | | | | | arm_dyncom_interpreter: Add specialized GetAddressingOpLoadStoreT funcarchshift2016-06-112-39/+19
| * | | | | | arm_dyncom_interpreter: rename operation functions to fit style guidearchshift2016-06-112-34/+34
| * | | | | | arm_dyncom_interpreter: Rename anonymous enum to TransExtDataarchshift2016-06-114-166/+164
| * | | | | | arm_dyncom_interpreter.cpp: #include translation info from inc filesarchshift2016-06-113-2648/+2652
* | | | | | | Merge pull request #1875 from JayFoxRox/fogbunnei2016-06-159-48/+253
|\ \ \ \ \ \ \ | |_|_|_|_|/ / |/| | | | | |
| * | | | | | OpenGL: Implement fogJannik Vogel2016-06-075-7/+124
| * | | | | | Rasterizer: Implement fogJannik Vogel2016-06-071-21/+52
| * | | | | | Pica: Add fog stateJannik Vogel2016-06-073-14/+69
| * | | | | | OpenGL: Avoid undefined behaviour for UNIFORM_BLOCK_DATA_SIZEJannik Vogel2016-06-072-6/+8
| | |_|_|_|/ | |/| | | |
* | | | | | Merge pull request #1842 from Subv/portsbunnei2016-06-128-3/+178
|\ \ \ \ \ \
| * | | | | | Kernel/SVC: Implemented svcCreatePort.Subv2016-06-116-3/+41
| * | | | | | Kernel: Added ClientPort and ServerPort classes.Subv2016-06-056-2/+139
* | | | | | | hid: add missing headerwwylele2016-06-111-0/+2
* | | | | | | Merge pull request #1897 from linkmauve/sdl2-config-fixMat M2016-06-111-1/+5
|\ \ \ \ \ \ \
| * | | | | | | SDL2: Add forgotten default config changes from 7129611e65096ba2cbe8266f6cb068a9b18981d8.Emmanuel Gil Peyrot2016-06-111-1/+5
* | | | | | | | Merge pull request #1789 from wwylele/input-refactorbunnei2016-06-1112-75/+315
|\ \ \ \ \ \ \ \ | |/ / / / / / / |/| | | | | | |
| * | | | | | | fixup! fixup! Refactor input systemwwylele2016-05-153-8/+8
| * | | | | | | fixup! Refactor input systemwwylele2016-05-152-20/+24
| * | | | | | | implement circle pad modifierwwylele2016-05-156-5/+37
| * | | | | | | Refactor input subsystemwwylele2016-05-1512-75/+279
* | | | | | | | Revert "Split huge interpreter source file into translation info and interpreter (+ some tiny misc style fixes)"archshift2016-06-115-2731/+2727
* | | | | | | | arm_dyncom_interpreter: rename operation functions to fit style guidearchshift2016-06-092-42/+42
* | | | | | | | arm_dyncom_interpreter.cpp: Split by translation and interpreter logicarchshift2016-06-095-2727/+2731
| |_|_|/ / / / |/| | | | | |
* | | | | | | gdbstub: E0 should be E00shinyquagsire232016-06-081-1/+1
* | | | | | | Merge pull request #1765 from JayFoxRox/debug-surface-viewerbunnei2016-06-089-583/+876
|\ \ \ \ \ \ \ | |_|_|/ / / / |/| | | | | |
| * | | | | | citra_qt: Replace 'Pica Framebuffer Debugger' with 'Pica Surface Viewer'Jannik Vogel2016-05-079-583/+876
* | | | | | | Merge pull request #1873 from archshift/remove-configbunnei2016-06-066-671/+0
|\ \ \ \ \ \ \
| * | | | | | | Remove unused and bitrotted "controller config" filesarchshift2016-06-026-671/+0
| | |_|_|/ / / | |/| | | | |
* | | | | | | service: Add other DLP servicesLioncash2016-06-0510-23/+150
| |_|_|/ / / |/| | | | |
* | | | | | Merge pull request #1863 from mailwl/gpu-threadid-resetbunnei2016-06-033-16/+23
|\ \ \ \ \ \ | |/ / / / / |/| | | | |
| * | | | | gsp::gpu: Reset g_thread_id in UnregisterInterruptRelayQueuemailwl2016-06-013-16/+23
* | | | | | AddFstEntriesToGameList - prevent loading a directoryLFsWang2016-06-011-3/+3
|/ / / / /
* | | | | Merge pull request #1812 from JayFoxRox/refactor-shaderbunnei2016-06-014-64/+81
|\ \ \ \ \ | |_|_|/ / |/| | | |
| * | | | Retrieve shader result from new OutputRegisters-typeJannik Vogel2016-05-164-64/+81
* | | | | Merge pull request #1751 from linkmauve/no-recursive-readdirbunnei2016-05-314-30/+43
|\ \ \ \ \ | |_|_|_|/ |/| | | |
| * | | | Common: Make recursive FileUtil functions take a maximum recursionEmmanuel Gil Peyrot2016-05-214-30/+43
* | | | | Merge pull request #1692 from Subv/rm_getpointer2bunnei2016-05-3018-139/+458
|\ \ \ \ \
| * | | | | Memory: Handle RasterizerCachedMemory and RasterizerCachedSpecial page types in the memory block manipulation functions.Subv2016-05-282-2/+60
| * | | | | Memory: Make ReadBlock and WriteBlock accept void pointers.Subv2016-05-285-21/+19
| * | | | | SOC_U: Remove usage of GetPointerSubv2016-05-281-27/+73
| * | | | | SSL_C: Remove use of Memory::GetPointerMerryMage2016-05-281-4/+3
| * | | | | GSP_GPU: Remove use of Memory::GetPointerMerryMage2016-05-281-33/+50
| * | | | | Memory: CopyBlockMerryMage2016-05-282-2/+43
| * | | | | DSP_DSP: Remove use of Memory::GetPointerMerryMage2016-05-281-7/+10
| * | | | | FS/Archive: Remove use of Memory::GetPointerMerryMage2016-05-281-7/+14
| * | | | | CFG: Remove use of Memory::GetPointerMerryMage2016-05-211-6/+10
| * | | | | APT: Remove use of Memory::GetPointerMerryMage2016-05-215-35/+36
| * | | | | Kernel/Thread: Remove use of Memory::GetPointerMerryMage2016-05-211-1/+1
| * | | | | Applets/swkdb: Remove use of Memory::GetPointerMerryMage2016-05-211-1/+1
| * | | | | Memory: ZeroBlockMerryMage2016-05-212-0/+39
| * | | | | FileSys/Path: Replace Memory::GetPointer with Memory::ReadBlockMerryMage2016-05-211-6/+6
| * | | | | Debugger/Callstack: Replace Memory::GetPointer with Memory::IsValidVirtualAddressMerryMage2016-05-211-1/+4
| * | | | | Memory: ReadBlock/WriteBlockMerryMage2016-05-213-4/+81
| * | | | | Memory: IsValidVirtualAddress/IsValidPhysicalAddressMerryMage2016-05-213-0/+26
| |/ / / /
* | | | | Merge pull request #1756 from wwylele/config-cleanupbunnei2016-05-291-29/+13
|\ \ \ \ \
| * | | | | clean up config blockwwylele2016-05-031-29/+13
* | | | | | Merge pull request #1857 from MerryMage/rotr-rotlbunnei2016-05-281-12/+18
|\ \ \ \ \ \
| * | | | | | common_funcs: Provide rotr and rotl for MSVCMerryMage2016-05-271-12/+18
| | |/ / / / | |/| | | |
* | | | | | Merge pull request #1568 from JayFoxRox/fix-printfMat M2016-05-273-26/+61
|\ \ \ \ \ \
| * | | | | | Fix ftoi behaviourJannik Vogel2016-05-162-22/+53
| * | | | | | Respect fpscr in ftoizJannik Vogel2016-05-162-4/+4
| * | | | | | Disable VFP3 instructionsJannik Vogel2016-05-161-0/+4
* | | | | | | Merge pull request #1810 from JayFoxRox/fix-float-exceptionsbunnei2016-05-273-91/+130
|\ \ \ \ \ \ \
| * | | | | | | Remove `exceptions` parameter from `normaliseround` VFP functionsJannik Vogel2016-05-183-28/+57
| * | | | | | | Fix exception propagation for VFP single precisionJannik Vogel2016-05-182-33/+38
| * | | | | | | Fix exception propagation for VFP double precisionJannik Vogel2016-05-182-34/+39
* | | | | | | | Merge pull request #1846 from JayFoxRox/missing-dirty-lightingbunnei2016-05-264-43/+140
|\ \ \ \ \ \ \ \
| * | | | | | | | OpenGL: Set shader_dirty on lighting changesJannik Vogel2016-05-231-0/+23
| * | | | | | | | Pica: Name LightSrc.config registerJannik Vogel2016-05-232-17/+15
| * | | | | | | | Pica: Name lighting.config0 and .config1 registersJannik Vogel2016-05-232-18/+18
| * | | | | | | | OpenGL: Use uniforms for dist_atten_bias and dist_atten_scaleJannik Vogel2016-05-233-8/+84
* | | | | | | | | Merge pull request #1855 from MerryMage/memory-headers-20160526Mat M2016-05-262-1/+2
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | Memory: Added necessary headers and removed unnecessary headerMerryMage2016-05-262-1/+2
| | |_|_|/ / / / / | |/| | | | | | |
* | | | | | | | | Merge pull request #1817 from linkmauve/smdh-stuffbunnei2016-05-2514-167/+229
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | Loader: Split SMDH into its own header and import helpers from QGameListEmmanuel Gil Peyrot2016-05-215-89/+149
| * | | | | | | | | CitraQt: Simplify the game list loader codeEmmanuel Gil Peyrot2016-05-215-34/+18
| * | | | | | | | | Loader: Add a GetFileType method to get the type of a loaded fileEmmanuel Gil Peyrot2016-05-214-0/+30
| * | | | | | | | | Loader, Frontends: Refactor loader creation and game loadingEmmanuel Gil Peyrot2016-05-216-49/+37
| |/ / / / / / / /
* | | | | | | | | New3DS: Minor style cleanup to #1520.bunnei2016-05-244-6/+6
* | | | | | | | | Merge pull request #1520 from JamePeng/checknew3dsbunnei2016-05-2411-14/+145
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | Implement CheckNew3DS and CheckNew3DSAppJamePeng2016-04-2011-14/+145
* | | | | | | | | | Merge pull request #1733 from lioncash/vert_loaderbunnei2016-05-243-11/+23
|\ \ \ \ \ \ \ \ \ \ | |_|_|/ / / / / / / |/| | | | | | | | |
| * | | | | | | | | vertex_loader: Correct forward declaration of InputVertexLioncash2016-05-091-1/+1
| * | | | | | | | | vertex_loader: Provide an assertion for ensuring the loader has been setupLioncash2016-05-092-0/+7
| * | | | | | | | | vertex_loader: Add constructors to facilitate immediate and two-step initializationLioncash2016-05-092-2/+6
| * | | | | | | | | vertex_loader: initialize_num_total_attributes.Lioncash2016-05-091-1/+1
| * | | | | | | | | vertex_loader: Use std::array instead of raw C arraysLioncash2016-05-091-6/+7
| * | | | | | | | | vertex_loader: Correct header orderingLioncash2016-05-091-1/+1
* | | | | | | | | | Merge pull request #1837 from wwylele/sync-trapbunnei2016-05-231-2/+3
|\ \ \ \ \ \ \ \ \ \ | |_|_|/ / / / / / / |/| | | | | | | | |
| * | | | | | | | | SVC::WaitSynchronizationN: Reschedule at the endwwylele2016-05-211-2/+3
* | | | | | | | | | Merge pull request #1564 from MerryMage/this-is-only-a-testbunnei2016-05-213-0/+26
|\ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | Tests: Run tests on CIMerryMage2016-05-191-0/+2
| * | | | | | | | | | tests: Infrastructure for unit testsMerryMage2016-05-193-0/+24
| | |_|_|_|_|_|_|_|/ | |/| | | | | | | |
* | | | | | | | | | Refactor Tev stage dumperJannik Vogel2016-05-212-115/+114
* | | | | | | | | | Extend Tev stage dumperJannik Vogel2016-05-211-14/+38
* | | | | | | | | | Config: Restore previously selected audio sink option (#1824)James Rowe2016-05-201-3/+3
| |/ / / / / / / / |/| | | | | | | |
* | | | | | | | | Merge pull request #1797 from MerryMage/audio-mixerbunnei2016-05-205-10/+317
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | DSP/HLE: Audio outputMerryMage2016-05-191-0/+7
| * | | | | | | | | DSP/HLE: Implement mixer processingMerryMage2016-05-195-11/+311
| |/ / / / / / / /
* | | | | | | | | Merge pull request #1785 from MerryMage/mp-dpibunnei2016-05-191-4/+12
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | Microprofile: DPI-aware drawingMerryMage2016-05-121-4/+12
* | | | | | | | | | Config: Audio sink configuration (#1798)Maribel2016-05-196-0/+134
| |_|_|_|/ / / / / |/| | | | | | | |
* | | | | | | | | Fix read-after-write in SMUAD, SMLAD, SMUSD, SMLSDJannik Vogel2016-05-181-4/+8
* | | | | | | | | Update ACT:U and create ACT:A (#1809)András Domonkos2016-05-185-0/+56
* | | | | | | | | Merge pull request #1800 from JayFoxRox/set-fpscrbunnei2016-05-183-0/+6
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | Set fpscr for new threadsJannik Vogel2016-05-173-0/+6
* | | | | | | | | | Merge pull request #1786 from JayFoxRox/blend-equationbunnei2016-05-174-0/+31
|\ \ \ \ \ \ \ \ \ \ | |_|_|_|_|_|_|_|/ / |/| | | | | | | | |
| * | | | | | | | | OpenGL: Support blend equationJannik Vogel2016-05-124-0/+31
| | |/ / / / / / / | |/| | | | | | |
* | | | | | | | | Merge pull request #1787 from JayFoxRox/refactor-jitlinkmauve2016-05-166-32/+50
|\ \ \ \ \ \ \ \ \ | |_|_|_|_|_|/ / / |/| | | | | | | |
| * | | | | | | | Use new shader-jit signature for interpreterJannik Vogel2016-05-133-8/+8
| * | | | | | | | Refactor access to state in shader-jitJannik Vogel2016-05-134-24/+42
* | | | | | | | | Merge pull request #1792 from JayFoxRox/avoid-uninitialisedbunnei2016-05-162-11/+24
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | OpenGL: Only update depth uniforms if the depth changedJannik Vogel2016-05-142-9/+22
| * | | | | | | | | OpenGL: value-initialize variables which cause uninitialised access otherwiseJannik Vogel2016-05-141-2/+2
| | |_|/ / / / / / | |/| | | | | | |
* | | | | | | | | DSP_DSP: Remove GetHeadphoneStatus logspam (#1799)Maribel2016-05-161-2/+2
| |_|_|/ / / / / |/| | | | | | |
* | | | | | | | AudioCore: Implement time stretcher (#1737)Maribel2016-05-154-0/+219
* | | | | | | | Memory: Fixed a regression caused by #1695 and #1689.Subv2016-05-141-0/+3
|/ / / / / / /
* | | | | | | Merge pull request #1689 from Subv/shmembunnei2016-05-1318-128/+417
|\ \ \ \ \ \ \ | |/ / / / / / |/| | | | | |
| * | | | | | HLE/Applets: Give each applet its own block of heap memory, and use that when creating the framebuffer shared memory block.Subv2016-05-135-5/+44
| * | | | | | Kernel: Account for automatically-allocated shared memories in the amount of used linear heap memory.Subv2016-05-131-0/+5
| * | | | | | APT: Move the shared font loading and relocation functions to their own subdirectory services/apt/bcfnt.Subv2016-05-134-66/+167
| * | | | | | Kernel/SharedMemory: Log an error when Map fails.Subv2016-05-131-1/+10
| * | | | | | Kernel: Implemented shared memory permissions.Subv2016-05-134-9/+50
| * | | | | | APT: Implement relocating the shared font to its true address.Subv2016-05-131-9/+74
| * | | | | | Kernel/Memory: Remove the Shared Memory region from the legacy memory map.Subv2016-05-131-1/+0
| * | | | | | Kernel/SharedMemory: Properly implemented shared memory support.Subv2016-05-1310-118/+147
| * | | | | | Kernel/SVC: Fixed the register order for svcCreateMemoryBlock.Subv2016-05-132-2/+3
| | |/ / / / | |/| | | |
* | | | | | Merge pull request #1695 from Subv/tls_allocbunnei2016-05-135-28/+74
|\ \ \ \ \ \
| * | | | | | Kernel/Threads: Dynamically allocate the TLS region for threads in the BASE region of the linear heap.Subv2016-05-075-28/+74
* | | | | | | Move program_counter and call_stack from UnitState to interpreterJannik Vogel2016-05-123-45/+42
* | | | | | | Move default_attributes into Pica stateJannik Vogel2016-05-125-5/+5
| |_|/ / / / |/| | | | |
* | | | | | Merge pull request #1690 from JayFoxRox/tex-type-3bunnei2016-05-127-38/+106
|\ \ \ \ \ \
| * | | | | | OpenGL: Implement texture type 3Jannik Vogel2016-05-114-35/+67
| * | | | | | Rasterizer: Implement texture type 3Jannik Vogel2016-05-111-2/+27
| * | | | | | Pica: Add tc0.w to OutputVertexJannik Vogel2016-05-111-1/+2
| * | | | | | Pica: Add texture type to stateJannik Vogel2016-05-111-0/+10
* | | | | | | Turn ShaderSetup into structJannik Vogel2016-05-115-58/+59
|/ / / / / /
* | | | | | Merge pull request #1621 from JayFoxRox/w-bufferbunnei2016-05-116-14/+65
|\ \ \ \ \ \
| * | | | | | OpenGL: Implement W-Buffers and fix depth-mappingJannik Vogel2016-05-103-4/+23
| * | | | | | Pica: Implement W-Buffer in SW rasterizerJannik Vogel2016-05-104-11/+43
* | | | | | | Merge pull request #1774 from lioncash/warnbunnei2016-05-101-3/+3
|\ \ \ \ \ \ \
| * | | | | | | gdbstub: Silence missing prototype warningsLioncash2016-05-101-3/+3
| |/ / / / / /
* / / / / / / gl_rasterizer: Fix compilation for debug buildsLioncash2016-05-101-1/+1
|/ / / / / /
* | | | | | Merge pull request #1704 from JayFoxRox/pod-configlinkmauve2016-05-103-122/+164
|\ \ \ \ \ \
| * | | | | | Pica: Use a union for PicaShaderConfigJannik Vogel2016-05-033-125/+139
| * | | | | | Pica: Add TevStageConfigRaw to PicaShaderConfig (MSVC workaround)Jannik Vogel2016-05-032-2/+23
| * | | | | | Pica: Make PicaShaderConfig trivially_copyable and clear it before useJannik Vogel2016-05-031-21/+28
| | |_|_|/ / | |/| | | |
* | | | | | Merge pull request #1771 from lioncash/userbunnei2016-05-101-1/+1
|\ \ \ \ \ \
| * | | | | | dyncom: Reset the context into user mode correctlyLioncash2016-05-091-1/+1
* | | | | | | source: Fix missing logging argumentsLioncash2016-05-091-2/+2
|/ / / / / /
* | | | | | swap: Get rid of pointer casting for swapping structsLioncash2016-05-091-5/+5
* | | | | | swap: Get rid of undefined behavior in swapf and swapdLioncash2016-05-091-14/+18
* | | | | | swap: Remove unused methodsLioncash2016-05-091-28/+0
| |_|/ / / |/| | | |
* | | | | Merge pull request #1766 from Subv/log_cpubunnei2016-05-083-0/+10
|\ \ \ \ \
| * | | | | Kernel/Threading: Warn when a thread can be scheduled in the Syscore (Core 1).Subv2016-05-073-0/+10
| | |/ / / | |/| | |
* | | | | Merge pull request #1718 from alex-laties/fixup-type-conversionsbunnei2016-05-0714-45/+55
|\ \ \ \ \
| * | | | | fixup simple type conversions where possibleAlexander Laties2016-05-0714-45/+55
* | | | | | Merge pull request #1761 from Subv/applets_fbbunnei2016-05-075-23/+44
|\ \ \ \ \ \ | |/ / / / / |/| | | | |
| * | | | | HLE/Applets: Use the correct size for the framebuffer SharedMemory in the swkbd and MiiSelector applets.Subv2016-05-075-23/+44
| | |/ / / | |/| | |
* | | | | Merge pull request #1736 from MerryMage/sdl2-sinkbunnei2016-05-078-3/+179
|\ \ \ \ \
| * | | | | AudioCore: SDL2 SinkMerryMage2016-05-078-3/+179
* | | | | | HLE: Fix recent DSP change for Visual Studio.bunnei2016-05-071-4/+2
* | | | | | Merge pull request #1544 from linkmauve/move-glad-initbunnei2016-05-073-6/+18
|\ \ \ \ \ \
| * | | | | | Frontends, VideoCore: Move glad initialisation to the frontendEmmanuel Gil Peyrot2016-05-063-6/+18
| | |_|_|_|/ | |/| | | |
* / | | | | fix:return proper errorwwylele2016-05-061-2/+3
|/ / / / /
* | | | | Merge pull request #1762 from bunnei/globalbunnei2016-05-064-8/+21
|\ \ \ \ \
| * | | | | HLE: Rename RescheduleIsPending to IsReschedulePending.bunnei2016-05-063-3/+3
| * | | | | hle: Get rid of global access to g_rescheduleLioncash2016-03-214-8/+21
* | | | | | Merge pull request #1700 from wwylele/gamelist-iconbunnei2016-05-0610-37/+260
|\ \ \ \ \ \
| * | | | | | add missing headerwwylele2016-05-041-0/+1
| * | | | | | make the name column larger as defaultwwylele2016-05-041-1/+5
| * | | | | | add icon & title to game listwwylele2016-05-049-36/+254
* | | | | | | Layout Mii parameters input/output, and return success as result of applet workmailwl2016-05-052-0/+49
* | | | | | | Merge pull request #1757 from JayFoxRox/rename-vertexloaded-bpbunnei2016-05-054-10/+8
|\ \ \ \ \ \ \
| * | | | | | | Pica: Rename VertexLoaded breakpoint to VertexShaderInvocationJannik Vogel2016-05-044-10/+8
| | |_|_|/ / / | |/| | | | |
* | | | | | | Merge pull request #1734 from MerryMage/dsp-hle-sourcebunnei2016-05-047-5/+496
|\ \ \ \ \ \ \ | |/ / / / / / |/| | | | | |
| * | | | | | DSP/HLE: Implement Source processingMerryMage2016-05-037-5/+496
| | |_|/ / / | |/| | | |
* | | | | | OpenGL: Don't copy const_color (Reverts #1745)Jannik Vogel2016-05-031-2/+3
* | | | | | Merge pull request #1750 from JayFoxRox/cleanup-shader-inputbunnei2016-05-031-34/+4
|\ \ \ \ \ \
| * | | | | | Pica: Replace logic in shader.cpp with loopJannik Vogel2016-05-031-34/+4
* | | | | | | Merge pull request #1732 from wwylele/config00170000bunnei2016-05-032-13/+4
|\ \ \ \ \ \ \ | |/ / / / / / |/| | | | | |
| * | | | | | remove duplicated function declarationwwylele2016-05-011-13/+0
| * | | | | | add config block 0x00170000wwylele2016-04-291-0/+4
* | | | | | | Merge pull request #1741 from linkmauve/iwyu-video_corebunnei2016-05-0146-88/+234
|\ \ \ \ \ \ \
| * | | | | | | VideoCore: Run include-what-you-use and fix most includes.Emmanuel Gil Peyrot2016-04-3045-86/+234
| * | | | | | | LCD: Remove unneeded #undef with no matching #define.Emmanuel Gil Peyrot2016-04-301-2/+0
* | | | | | | | OpenGL: Copy TevStageConfig using a loop. Fixes bug: const_color not copiedJannik Vogel2016-05-011-30/+11
* | | | | | | | OpenGL: border_color was never set. Fixed. (#1740)Jannik Vogel2016-04-301-0/+1
|/ / / / / / /
* | | | | | | Merge pull request #1735 from JayFoxRox/remove-tgalinkmauve2016-04-303-62/+0
|\ \ \ \ \ \ \ | |_|/ / / / / |/| | | | | |
| * | | | | | Remove TGA dumperJannik Vogel2016-04-303-62/+0
* | | | | | | Merge pull request #1729 from MerryMage/null-sinkbunnei2016-04-3013-4/+155
|\ \ \ \ \ \ \ | |/ / / / / / |/| | | | | |
| * | | | | | Audio: Add sink selection to configuration filesMerryMage2016-04-3010-4/+79
| * | | | | | AudioCore: List of sink typesMerryMage2016-04-303-0/+46
| * | | | | | AudioCore: Implement NullSinkMerryMage2016-04-302-0/+30
| | |/ / / / | |/| | | |
* | | | | | Merge pull request #1650 from JamePeng/update-the-ndm-codebunnei2016-04-303-27/+420
|\ \ \ \ \ \
| * | | | | | Update the stub code of NDM service!JamePeng2016-04-203-27/+420
* | | | | | | Merge pull request #1647 from mailwl/acu-closeasyncbunnei2016-04-302-1/+29
|\ \ \ \ \ \ \
| * | | | | | | ac:u: stub CloseAsync; check memory size aling in svc:GetProcessInfo(type=2)mailwl2016-04-212-1/+29
* | | | | | | | Merge pull request #1699 from mailwl/gpu-rightsbunnei2016-04-301-2/+38
|\ \ \ \ \ \ \ \ | |_|_|/ / / / / |/| | | | | | |
| * | | | | | | return checks if event and memory createdmailwl2016-04-231-1/+8
| * | | | | | | gsp::Gpu: implement AcquireRight, ReleaseRight functionsmailwl2016-04-221-8/+37
* | | | | | | | Merge pull request #1726 from MerryMage/read-write-regionbunnei2016-04-293-26/+31
|\ \ \ \ \ \ \ \
| * | | | | | | | AudioCore: CurrentRegion() -> ReadRegion(), WriteRegion()MerryMage2016-04-293-26/+31
* | | | | | | | | Merge pull request #1723 from MerryMage/audio-interpbunnei2016-04-293-0/+128
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | AudioCore: Implement interpolationMerryMage2016-04-293-0/+128
* | | | | | | | | | Merge pull request #1730 from hrydgard/vertex-loaderbunnei2016-04-296-121/+210
|\ \ \ \ \ \ \ \ \ \ | |_|_|_|_|_|/ / / / |/| | | | | | | | |
| * | | | | | | | | Move and rename the MemoryAccesses class to MemoryAccessTracker.Henrik Rydgard2016-04-294-32/+35
| * | | | | | | | | Debugger fixHenrik Rydgard2016-04-281-2/+2
| * | | | | | | | | Optimize the vertex loader, nearly doubling its speed.Henrik Rydgard2016-04-282-32/+54
| * | | | | | | | | Don't keep base_address in the loader, it doesn't belong there (with it, the loader can't be cached).Henrik Rydgard2016-04-283-11/+10
| * | | | | | | | | Move "&" to their proper place, add missing includes and make some properly relative.Henrik Rydgard2016-04-282-8/+11
| * | | | | | | | | Refactor: Extract VertexLoader from command_processor.cpp.Henrik Rydgard2016-04-285-125/+185
| * | | | | | | | | Remove late accesses to attribute_configHenrik Rydgard2016-04-281-5/+7
* | | | | | | | | | Common: Remove section measurement from profiler (#1731)Yuri Kunde Schlesner2016-04-2913-306/+8
* | | | | | | | | | Make Citra build with MICROPROFILE_ENABLED set to 0 (#1709)Henrik Rydgård2016-04-295-1/+30
* | | | | | | | | | Merge pull request #1727 from MerryMage/minor-commitbunnei2016-04-283-12/+11
|\ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | AudioCore: Move samples_per_frame and num_sources into hle/common.hMerryMage2016-04-283-12/+11
| | |_|/ / / / / / / | |/| | | | | | | |
* | | | | | | | | | Merge pull request #1722 from MerryMage/soundtouchbunnei2016-04-281-1/+4
|\ \ \ \ \ \ \ \ \ \ | |/ / / / / / / / / |/| | | | | | | | |
| * | | | | | | | | Externals: Add soundtouchMerryMage2016-04-281-1/+4
| | |/ / / / / / / | |/| | | | | | |
* | | | | | | | | Merge pull request #1708 from MerryMage/dsp_dspbunnei2016-04-276-76/+180
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | DSP_DSP: Fix log format strings and argumentsMerryMage2016-04-271-12/+20
| * | | | | | | | | AudioCore: Hack to prevent regressions: Trigger Binary pipe interrupt every audio frameMerryMage2016-04-271-0/+2
| * | | | | | | | | DSP_DSP: Add return IPC headersMerryMage2016-04-272-4/+27
| * | | | | | | | | DSP_DSP: Updated interrupt implementationMerryMage2016-04-274-46/+113
| * | | | | | | | | DSP/Pipe: There are 8 pipesMerryMage2016-04-252-13/+19
| * | | | | | | | | DSP_DSP: Remove unused variableMerryMage2016-04-241-2/+0
| | |/ / / / / / / | |/| | | | | | |
* | | | | | | | | y2r_u: Cleanup some formatting.bunnei2016-04-271-52/+89
* | | | | | | | | Merge pull request #1447 from JamePeng/update-y2r-servicebunnei2016-04-272-32/+357
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | Update the code of service y2r!JamePeng2016-04-202-32/+357
| | |_|_|_|/ / / / | |/| | | | | | |
* | | | | | | | | Qt Frontend: Add Threads::Threads import in CMakeLists.txt.Emmanuel Gil Peyrot2016-04-261-1/+1
| |_|/ / / / / / |/| | | | | | |
* | | | | | | | Merge pull request #1710 from hrydgard/optimize-event-breakpointsbunnei2016-04-263-9/+16
|\ \ \ \ \ \ \ \
| * | | | | | | | Replace std::map with std::array for graphics event breakpoints, and allow the compiler to inline. Saves 1%+ in vertex heavy situations.Henrik Rydgard2016-04-243-9/+16
| | |/ / / / / / | |/| | | | | |
* | | | | | | | shader: Shader size is long uint, not uint.Sam Spilsbury2016-04-241-1/+1
* | | | | | | | shader: Handle non-CALL opcodes with a breakSam Spilsbury2016-04-241-0/+2
* | | | | | | | shader: Format string must be provided inline and not as a variableSam Spilsbury2016-04-241-1/+1
* | | | | | | | am: title_id is long long uintSam Spilsbury2016-04-241-1/+1
* | | | | | | | assert: Allow UNREACHABLE_MSG to have just one argumentSam Spilsbury2016-04-241-1/+1
* | | | | | | | CMakeLists: Use imported version of Threads::ThreadsSam Spilsbury2016-04-241-1/+1
|/ / / / / / /
* | | | | | | Merge pull request #1576 from smspillaz/fix-build-errors-03272016bunnei2016-04-247-6/+19
|\ \ \ \ \ \ \
| * | | | | | | assert: Add _MSG variations for UNREACHABLE and UNIMPLEMENTEDSam Spilsbury2016-04-231-0/+2
| * | | | | | | pica: Handle default lighting caseSam Spilsbury2016-04-231-1/+6
| * | | | | | | ncch: Use correct format specifier (for long long uint)Sam Spilsbury2016-04-231-1/+1
| * | | | | | | fs: Fix what appears to be a typo (filename_size / file_size)Sam Spilsbury2016-04-231-1/+1
| * | | | | | | gdbstub: Don't check if unsigned int is > 0Sam Spilsbury2016-04-231-2/+2
| * | | | | | | debugger: Warn if we reach an unreachable formatSam Spilsbury2016-04-231-0/+6
| * | | | | | | CMakeLists: Use CMAKE_THREAD_LIBS_INITSam Spilsbury2016-04-231-1/+1
| | |/ / / / / | |/| | | | |
* / | | | | | Protect use of std::is_trivially_copyable to compile with GCC 4.9LittleWhite2016-04-231-0/+4
|/ / / / / /
* | | | | | HWRasterizer: reorder declarations to match defstfarley2016-04-221-9/+9
* | | | | | HWRasterizer: sync specular uniform for new shaderstfarley2016-04-221-0/+2
* | | | | | Merge pull request #1436 from tfarley/hw-tex-forwardingbunnei2016-04-2229-941/+1739
|\ \ \ \ \ \
| * | | | | | HWRasterizer: Texture forwardingtfarley2016-04-2120-940/+1719
| * | | | | | Config: Add scaled resolution optiontfarley2016-04-219-1/+20
| | |/ / / / | |/| | | |
* | | | | | Merge pull request #1655 from JayFoxRox/hw-dot3bunnei2016-04-211-0/+3
|\ \ \ \ \ \ | |/ / / / / |/| | | | |
| * | | | | OpenGL: Implement color combiner Operation::Dot3_RGBJannik Vogel2016-04-101-0/+3
* | | | | | SDL2 Frontend: Use argv[0], add a --version, and reorder options.Emmanuel Gil Peyrot2016-04-201-9/+20
| |/ / / / |/| | | |
* | | | | Merge pull request #1672 from wwylele/win-driver-fixbunnei2016-04-191-3/+12
|\ \ \ \ \
| * | | | | fix driver root identification on Windowswwylele2016-04-151-3/+12
* | | | | | Merge pull request #1612 from ObsidianX/get-set-sockoptbunnei2016-04-191-3/+97
|\ \ \ \ \ \
| * | | | | | Rework sockopt translation to match the error translation code already in placeRyan Loebs2016-04-021-22/+30
| * | | | | | Code styleRyan Loebs2016-03-301-2/+2
| * | | | | | Added GetSockOptNameRyan Loebs2016-03-301-15/+58
| * | | | | | Derp: win32: typedef int socklen_t;Ryan Loebs2016-03-291-4/+0
| * | | | | | But of course, Windows uses 'int' while Linux uses 'socklen_t'Ryan Loebs2016-03-291-0/+4
| * | | | | | Compiling on Windows nowRyan Loebs2016-03-291-3/+3
| * | | | | | Formatting...Ryan Loebs2016-03-291-1/+1
| * | | | | | Addressing PR commentsRyan Loebs2016-03-291-4/+4
| * | | | | | SOC UpdatesRyan Loebs2016-03-291-3/+46
* | | | | | | Merge pull request #1625 from JayFoxRox/sw-blend-funcbunnei2016-04-181-57/+42
|\ \ \ \ \ \ \ | |_|_|_|_|/ / |/| | | | | |
| * | | | | | Rasterizer: Allow all blend factors for alpha blend-funcJannik Vogel2016-04-171-57/+42
* | | | | | | core: Clean out some unnecessary header includesLioncash2016-04-163-14/+1
* | | | | | | Merge pull request #1667 from wwylele/ncch-loader-fixbunnei2016-04-151-2/+2
|\ \ \ \ \ \ \
| * | | | | | | ncch:only decompress .code sectionwwylele2016-04-141-2/+2
| | |_|/ / / / | |/| | | | |
* | | | | | | Merge pull request #1673 from MerryMage/config-minimumSizebunnei2016-04-151-12/+0
|\ \ \ \ \ \ \
| * | | | | | | Configure Dialog: Remove minimumSize propertyMerryMage2016-04-151-12/+0
| |/ / / / / /
* | | | | | | Merge pull request #1671 from lioncash/memMathew Maidment2016-04-151-1/+1
|\ \ \ \ \ \ \
| * | | | | | | debug_utils: use std::make_unique for initializing PicaTraceLioncash2016-04-151-1/+1
* | | | | | | | Y2R: num_tiles should be allowed when its value is 128 (#1669)JamePeng2016-04-151-1/+1
* | | | | | | | Merge pull request #1666 from MerryMage/barrierbunnei2016-04-151-24/+22
|\ \ \ \ \ \ \ \ | |/ / / / / / / |/| | | | | | |
| * | | | | | | Thread: Make Barrier reusableMerryMage2016-04-141-5/+5
| * | | | | | | common/thread: Correct code styleMerryMage2016-04-141-21/+19
| |/ / / / / /
* | | | | | | Merge pull request #1665 from lioncash/filebunnei2016-04-143-48/+38
|\ \ \ \ \ \ \
| * | | | | | | file_util: In-class initialize data membersLioncash2016-04-142-6/+4
| * | | | | | | file_util: const qualify IOFile's Tell and GetSize functionsLioncash2016-04-142-8/+8
| * | | | | | | file_util: Don't expose IOFile internals through the APILioncash2016-04-143-31/+20
| * | | | | | | file_util: Check for is_trivially_copyableLioncash2016-04-141-3/+5
| * | | | | | | file_util: Make IOFile data members privateLioncash2016-04-141-0/+1
| |/ / / / / /
* | | | | | | shader_jit_x64: Rename RuntimeAssert to Compile_Assert.bunnei2016-04-142-5/+5
* | | | | | | shader_jit_x64.cpp: Rename JitCompiler to JitShader.bunnei2016-04-143-92/+92
* | | | | | | shader_jit_x64: Free memory that's no longer needed after compilation.bunnei2016-04-141-0/+6
* | | | | | | shader_jit_x64: Use a sorted vector instead of a set for keeping track of return addresses.bunnei2016-04-142-5/+8
* | | | | | | shader_jit_x64: Use CALL/RET instead of JMP for subroutines.bunnei2016-04-141-17/+7
* | | | | | | emitter: Add CALL that can be fixed up.bunnei2016-04-142-0/+13
* | | | | | | shader_jit_x64: Separate initialization and code generation for readability.bunnei2016-04-141-9/+8
* | | | | | | shader_jit_x64: Get rid of unnecessary last_program_counter variable.bunnei2016-04-142-6/+2
* | | | | | | shader_jit_x64: Execute certain asserts at runtime.bunnei2016-04-142-5/+19
* | | | | | | shader: Remove unused 'state' argument from 'Setup' function.bunnei2016-04-143-5/+4
* | | | | | | shader_jit_x64: Specify shader main offset at runtime.bunnei2016-04-143-10/+6
* | | | | | | shader_jit_x64: Allocate each program independently and persist for emu session.bunnei2016-04-143-38/+28
* | | | | | | shader_jit_x64: Rewrite flow control to support arbitrary CALL and JMP instructions.bunnei2016-04-142-35/+119
* | | | | | | shader_jit_x64: Fix strict memory aliasing issues.bunnei2016-04-141-1/+3
* | | | | | | emitter: Support arbitrary FixupBranch targets.bunnei2016-04-142-0/+17
|/ / / / / /
* | | | | | FileUtil: Missing #include, Add const to IOFile methodsMerryMage2016-04-121-6/+7
* | | | | | Merge pull request #1613 from mailwl/anpbunnei2016-04-112-2/+7
|\ \ \ \ \ \
| * | | | | | Set Kernel config "Unknown Value" to 0x1mailwl2016-04-112-2/+7
| |/ / / / /
* | | | | | Use Settings::Apply in SDL frontendJannik Vogel2016-04-111-5/+4
* | | | | | CitraQt: Apply config at startupJannik Vogel2016-04-116-12/+19
|/ / / / /
* | | | | Merge pull request #1657 from JayFoxRox/remove-dump-geometryYuri Kunde Schlesner2016-04-114-71/+0
|\ \ \ \ \
| * | | | | Pica: Remove geometry dumper (PICA_DUMP_GEOMETRY)Jannik Vogel2016-04-104-71/+0
| | |/ / / | |/| | |
* | | | | Merge pull request #1368 from LittleWhite-tb/configure-widgetbunnei2016-04-1121-262/+807
|\ \ \ \ \ | |/ / / / |/| | | |
| * | | | Add more stuff to configure.LittleWhite2016-03-2215-120/+211
| * | | | Whole config is handled by Config class.LittleWhite2016-03-218-118/+181
| * | | | Add Configure widgetLittleWhite2016-03-2118-142/+533
* | | | | Merge pull request #1653 from mailwl/blx-lrMathew Maidment2016-04-091-2/+3
|\ \ \ \ \
| * | | | | Fix BLX LR opcode interpretationmailwl2016-04-091-2/+3
| | |_|_|/ | |/| | |
* | | | | Merge pull request #1624 from JayFoxRox/buffer-allow-writebunnei2016-04-094-12/+78
|\ \ \ \ \ | |/ / / / |/| | | |
| * | | | OpenGL: Respect buffer-write allow registersJannik Vogel2016-04-081-6/+28
| * | | | OpenGL: Split buffer-write mask sync into seperate functionsJannik Vogel2016-04-082-8/+39
| * | | | Rasterizer: Respect buffer-write allow registersJannik Vogel2016-04-082-4/+16
| * | | | OpenGL: Keep stencil-test and framebuffer.depth_format in syncJannik Vogel2016-04-081-0/+1
* | | | | Merge pull request #1644 from polaris-/gdb-fixesbunnei2016-04-082-28/+107
|\ \ \ \ \
| * | | | | Default to settings from ini for gdbstubpolaris-2016-04-071-6/+6
| * | | | | Adopted WinterMute's gdbstub changespolaris-2016-04-062-27/+106
* | | | | | update the code of AM service! (#1623)JamePeng2016-04-086-51/+289
* | | | | | cecd:u: stub GetCecStateAbbreviated (#1648)mailwl2016-04-084-1/+29
| |/ / / / |/| | | |
* | | | | Update cpsr (T)humb bit while creating threadmailwl2016-04-081-1/+1
* | | | | Merge pull request #1639 from linkmauve/fix-double-framebuffer-checkbunnei2016-04-081-4/+6
|\ \ \ \ \
| * | | | | OpenGL: Fix a double framebuffer completeness checks.Emmanuel Gil Peyrot2016-04-031-4/+6
* | | | | | Merge pull request #1577 from JamePeng/update-apta-funcbunnei2016-04-075-8/+47
|\ \ \ \ \ \
| * | | | | | append SetAppCpuTimeLimit and GetAppCpuTimeLimit to APT:AJamePeng2016-04-063-13/+16
| * | | | | | implement APT::GetStartupArgumentJamePeng2016-04-045-2/+37
| * | | | | | Append the missing function name"GetAppletInfo" to APT:AJamePeng2016-04-041-1/+2
| |/ / / / /
* | / / / / Fix thumb ADR instruction alignmentmailwl2016-04-061-6/+2
| |/ / / / |/| | | |
* | | | | Merge pull request #1435 from mailwl/frd_ubunnei2016-04-066-55/+236
|\ \ \ \ \
| * | | | | frd:u: Initial stub some functionsmailwl2016-03-276-55/+236
* | | | | | Merge pull request #1643 from MerryMage/make_uniqueMathew Maidment2016-04-0624-73/+46
|\ \ \ \ \ \
| * | | | | | Common: Remove Common::make_unique, use std::make_uniqueMerryMage2016-04-0524-73/+46
| | |_|_|_|/ | |/| | | |
* | | | | | Merge pull request #1620 from LFsWang/pathbunnei2016-04-056-33/+50
|\ \ \ \ \ \ | |_|_|/ / / |/| | | | |
| * | | | | remove debug codeLFsWang2016-03-312-2/+2
| * | | | | fix unicode url problem on windowsLFsWang2016-03-311-6/+18
| * | | | | Fix encode problem On WindowsLFsWang2016-03-315-27/+32
* | | | | | OpenGL: Check for framebuffer completenessJannik Vogel2016-04-031-0/+3
* | | | | | Merge pull request #1616 from exhalatio/dlp_dummybunnei2016-04-036-0/+65
|\ \ \ \ \ \
| * | | | | | Dummy implementation dlp:SRVR Service.exhalatio2016-04-026-0/+65
* | | | | | | Merge pull request #1619 from mailwl/cecdbunnei2016-04-025-3/+56
|\ \ \ \ \ \ \
| * | | | | | | cecd:u: stub GetCecInfoEventHandle, GetChangeStateEventHandlemailwl2016-03-315-3/+56
* | | | | | | | Merge pull request #1390 from purpasmart96/citra_gsp_error_codesbunnei2016-04-013-80/+97
|\ \ \ \ \ \ \ \
| * | | | | | | | GSP: Return proper error codes for register writespurpasmart962016-03-313-80/+97
| |/ / / / / / /
* | | | | | | | Avoid warnings by casting to size_t for ARRAY_SIZE() comparisonsJannik Vogel2016-04-011-6/+6
* | | | | | | | Merge pull request #1618 from MerryMage/one-stepMathew Maidment2016-03-311-26/+57
|\ \ \ \ \ \ \ \
| * | | | | | | | DynCom: Optimize single steppingMerryMage2016-03-301-26/+57
| | |_|_|/ / / / | |/| | | | | |
* | | | | | | | Merge pull request #1419 from mailwl/branch-gspbunnei2016-03-311-6/+41
|\ \ \ \ \ \ \ \ | |_|/ / / / / / |/| | | | | | |
| * | | | | | | Add gsp functions: SetAxiConfigQoSMode, UnregisterInterruptRelayQueuemailwl2016-03-311-6/+41
* | | | | | | | Merge pull request #1572 from MerryMage/audio-filterbunnei2016-03-315-7/+275
|\ \ \ \ \ \ \ \ | |_|_|_|/ / / / |/| | | | | | |
| * | | | | | | DSP: Implement audio filters (simple, biquad)MerryMage2016-03-285-7/+275
* | | | | | | | Add common methods to all cfg:* portsRyan Loebs2016-03-293-0/+21
| |_|_|_|_|_|/ |/| | | | | |
* | | | | | | Compilation fixLittleWhite2016-03-281-1/+1
| |/ / / / / |/| | | | |
* | | | | | Merge pull request #1541 from LFsWang/pathbunnei2016-03-282-3/+3
|\ \ \ \ \ \ | |_|_|_|/ / |/| | | | |
| * | | | | Fix Qt chinese words encode problem on WindowsLFsWang2016-03-172-3/+3
* | | | | | use reference instead of pointerwwylele2016-03-261-9/+9
* | | | | | remove unnecessary constwwylele2016-03-261-2/+2
* | | | | | Merge pull request #1549 from wwylele/acc_gyrobunnei2016-03-265-23/+235
|\ \ \ \ \ \ | |_|_|_|/ / |/| | | | |
| * | | | | implement GyroscopeCalibrateParamwwylele2016-03-252-9/+20
| * | | | | implement accel and gyro backendwwylele2016-03-225-23/+224
* | | | | | Merge pull request #1566 from MerryMage/audio-codecbunnei2016-03-243-0/+174
|\ \ \ \ \ \ | | |_|/ / / | |/| | | |
| * | | | | DSP: Implement audio codecs (PCM8, PCM16, ADPCM)MerryMage2016-03-243-0/+174
| | |_|/ / | |/| | |
* | | | | Pica: Improve accuracy of immediate-mode supportYuri Kunde Schlesner2016-03-245-29/+56
* | | | | OpenGL: Don't attempt to draw empty triangle batchesYuri Kunde Schlesner2016-03-241-0/+3
* | | | | Merge pull request #1508 from JayFoxRox/vs-output-mapbunnei2016-03-222-7/+19
|\ \ \ \ \
| * | | | | Respect vs output mapJannik Vogel2016-03-142-7/+19
* | | | | | Merge pull request #1560 from lioncash/savedatabunnei2016-03-221-1/+2
|\ \ \ \ \ \
| * | | | | | archive_extsavedata: Fix member initialization orderLioncash2016-03-211-1/+2
| | |/ / / / | |/| | | |
* | | | | | Merge pull request #1563 from lioncash/lolfiqbunnei2016-03-221-4/+3
|\ \ \ \ \ \ | |_|_|_|_|/ |/| | | | |
| * | | | | armstate: Correct FIQ register bankingLioncash2016-03-211-4/+3
| |/ / / /
* | | | | Merge pull request #1559 from lioncash/vecbunnei2016-03-211-8/+5
|\ \ \ \ \
| * | | | | soc_u: Get rid of explicit delete and newLioncash2016-03-211-8/+5
| |/ / / /
* | | | | session: Make helper functions constexprLioncash2016-03-211-6/+6
* | | | | loader: Make MakeMagic constexprLioncash2016-03-211-1/+1
|/ / / /
* | | | Merge pull request #1302 from Subv/save_fixbunnei2016-03-2024-143/+400
|\ \ \ \
| * | | | HLE/FS: Change the error code returned when an ExtSaveData archive is not found.Subv2016-03-205-33/+45
| * | | | HLE/FS: Corrected some style concerns.Subv2016-03-208-14/+12
| * | | | HLE/FS: Fixed creating the config savefile when it doesn't exist.Subv2016-03-201-1/+1
| * | | | HLE/FS: Implemented GetFormatInfoSubv2016-03-2019-62/+257
| * | | | HLE/FS: Don't return an error when deleting the ExtSaveData if it does not exist.Subv2016-03-201-1/+1
| * | | | HLE/FS: Return the proper error codes when opening files.Subv2016-03-207-28/+43
| * | | | HLE/FS: Fixed the OpenDirectory error codeSubv2016-03-201-1/+1
| * | | | HLE/FS: Return the proper error codes on file Read/Write operations.Subv2016-03-207-18/+40
| * | | | HLE/FS: Corrected the error codes for DeleteFileSubv2016-03-206-12/+22
| * | | | HLE/FS: Corrected the error codes for CreateFileSubv2016-03-202-2/+7
| * | | | HLE/FS: FS::CreateFile takes an u64 for the file size.Subv2016-03-208-10/+10
* | | | | Fix missing headerLittleWhite2016-03-201-0/+2
|/ / / /
* | | | Merge pull request #1538 from lioncash/dotbunnei2016-03-201-5/+3
|\ \ \ \ | |_|/ / |/| | |
| * | | shader_interpreter: use std::inner_product for the dot productLioncash2016-03-171-5/+3
* | | | Merge pull request #1543 from lioncash/zerobunnei2016-03-181-1/+4
|\ \ \ \
| * | | | vector_math: Add missing member in Vec4's SetZero functionLioncash2016-03-181-1/+4
* | | | | Merge pull request #1505 from pippo2931/fefbunnei2016-03-181-1/+25
|\ \ \ \ \ | |/ / / / |/| | | |
| * | | | Fix headerpippo29312016-03-121-1/+1
| * | | | GetArchiveResource stubpippo29312016-03-121-1/+25
* | | | | Merge pull request #1535 from JayFoxRox/fix-alignbunnei2016-03-181-6/+6
|\ \ \ \ \
| * | | | | PICA: Alignment happens locally in vertexJannik Vogel2016-03-171-6/+6
* | | | | | Merge pull request #1539 from lioncash/constbunnei2016-03-173-18/+19
|\ \ \ \ \ \ | |_|_|_|_|/ |/| | | | |
| * | | | | video_core: Don't cast away constLioncash2016-03-173-18/+19
| | |_|/ / | |/| | |
* | | | | Merge pull request #1466 from LittleWhite-tb/gamelist-update-recentYuri Kunde Schlesner2016-03-172-5/+4
|\ \ \ \ \ | |/ / / / |/| | | |
| * | | | Register ROM started through the gamelist in the list of ROM recently startedLittleWhite2016-03-162-5/+4
* | | | | core/video_core: Make NumIds functions constexprLioncash2016-03-173-3/+3
* | | | | core/video_core: Don't cast away const in subscript operatorsLioncash2016-03-173-9/+9
| |/ / / |/| | |
* | | | Merge pull request #1519 from JayFoxRox/vp-offset-fixbunnei2016-03-161-2/+2
|\ \ \ \
| * | | | PICA: Fix viewport offsetJannik Vogel2016-03-141-2/+2
| | |_|/ | |/| |
* | | | Merge pull request #1503 from bunnei/clear-jit-cachebunnei2016-03-163-7/+27
|\ \ \ \
| * | | | shader_jit_x64: Clear cache after code space fills up.bunnei2016-03-123-2/+19
| * | | | shader_jit_x64: Make assert outputs more useful & cleanup formatting.bunnei2016-03-121-4/+7
| * | | | shader: Update log message to use proper log class.bunnei2016-03-121-1/+1
| | |_|/ | |/| |
* | | | Merge pull request #1479 from JayFoxRox/mad-encodingbunnei2016-03-163-31/+43
|\ \ \ \
| * | | | PICA: Fix MAD/MADI encodingJannik Vogel2016-03-153-31/+43
* | | | | Merge pull request #1526 from bunnei/sdl-rgb8bunnei2016-03-151-0/+4
|\ \ \ \ \ | |/ / / / |/| | | |
| * | | | SDL2: Explicitly use RGB8 color buffer.bunnei2016-03-151-0/+4
* | | | | citra: Shutdown cleanly if ROM load failsMerryMage2016-03-151-8/+6
|/ / / /
* | / / Reorganize the ndm service path for dummy implement functionJamePeng2016-03-148-26/+124
| |/ / |/| |
* | | Merge pull request #1509 from lioncash/noncopybunnei2016-03-131-3/+3
|\ \ \
| * | | common_types: Make NonCopyable constructor constexprLioncash2016-03-131-1/+1
| * | | common_types: Specify const in deleted copy constructor/assignment operatorLioncash2016-03-131-2/+2
| |/ /
* | / hid: fix pad updatewwylele2016-03-131-1/+1
| |/ |/|
* | PICA: Align vertex attributesJannik Vogel2016-03-133-1/+28
* | svc: Move ResetType enum to the kernel event headerLioncash2016-03-1310-16/+17
* | svc: Remove unused ArbitrationType enumLioncash2016-03-121-9/+0
* | svc: Make ResetType an enum classLioncash2016-03-1211-24/+23
|/
* Merge pull request #1266 from Subv/miiappletbunnei2016-03-127-2/+156
|\
| * HLE/Applets: Implemented a dummy Mii Selector applet.Subv2016-03-127-2/+156
* | Merge pull request #1500 from lioncash/nullptrbunnei2016-03-121-1/+1
|\ \
| * | gsp_gpu: Change 0 literal to nullptrLioncash2016-03-121-1/+1
* | | hle: Update service function tablesLioncash2016-03-124-1/+16
|/ /
* | Merge pull request #1476 from lioncash/emitbunnei2016-03-101-59/+54
|\ \
| * | emitter: templatize ImmPtrLioncash2016-03-091-2/+6
| * | emitter: constexpr-ify helper functionsLioncash2016-03-091-19/+17
| * | emitter: Get rid of CanDoOpWithLioncash2016-03-091-7/+0
| * | emitter: constexpr-ify OpArgLioncash2016-03-091-30/+30
| * | emitter: friend class OpArg with XEmitterLioncash2016-03-091-3/+4
| * | emitter: Remove unimplemented prototypeLioncash2016-03-091-1/+0
* | | Merge pull request #1475 from lioncash/alignYuri Kunde Schlesner2016-03-102-13/+5
|\ \ \
| * | | Common: Get rid of alignment macrosLioncash2016-03-092-13/+5
| |/ /
* | | Merge pull request #1478 from JayFoxRox/masterYuri Kunde Schlesner2016-03-101-2/+2
|\ \ \
| * | | Fix attribute mapping in vs debuggerJannik Vogel2016-03-091-2/+2
* | | | Fix missing returnLittleWhite2016-03-091-0/+2
* | | | Merge pull request #1474 from lioncash/rendererbunnei2016-03-096-25/+25
|\ \ \ \ | |/ / / |/| | |
| * | | renderer_base: In-class initialize variablesLioncash2016-03-091-5/+2
| * | | render_base: Clarify/normalize getter functionsLioncash2016-03-091-2/+2
| * | | renderer_base: Don't directly expose the rasterizer unique_ptrLioncash2016-03-096-18/+21
| |/ /
* | | Merge pull request #1344 from LittleWhite-tb/error-outputbunnei2016-03-0912-24/+95
|\ \ \ | |/ / |/| |
| * | Improve error report from Init() functionsLittleWhite2016-03-0812-27/+72
| * | Display errors in GUI when loading ROM failedLittleWhite2016-03-032-3/+29
* | | Merge pull request #1441 from MerryMage/dsp-pipesbunnei2016-03-084-77/+345
|\ \ \
| * | | DSP: Implement Pipe 2MerryMage2016-03-064-77/+345
* | | | Merge pull request #1467 from LittleWhite-tb/bug-shader-objectbunnei2016-03-081-0/+4
|\ \ \ \
| * | | | Set the appropriate locale to get float conversion working using std::to_stringLittleWhite2016-03-071-0/+4
| |/ / /
* | | | Merge pull request #1462 from yuriks/depth-test-writebunnei2016-03-062-10/+12
|\ \ \ \ | |/ / / |/| | |
| * | | Pica: Write depth value even when depth test is disabledYuri Kunde Schlesner2016-03-062-10/+12
* | | | Memory: Do correct Phys->Virt address translation for non-APP linheapYuri Kunde Schlesner2016-03-063-3/+6
* | | | Merge pull request #1455 from yuriks/ResultVal-unionMathew Maidment2016-03-061-42/+16
|\ \ \ \ | |/ / / |/| | |
| * | | core: Use unrestricted union to hold storage of ResultVal valueYuri Kunde Schlesner2016-03-051-42/+16
* | | | DSP: Print hash of firmware to consoleMerryMage2016-03-061-8/+21
* | | | Loader/NCCH: Log the program ID during loadingYuri Kunde Schlesner2016-03-051-1/+2
|/ / /
* | | Merge pull request #1429 from mailwl/branch-acubunnei2016-03-051-2/+17
|\ \ \
| * | | ac:u: Stub IsConnectedmailwl2016-03-041-2/+17
| |/ /
* | | Merge pull request #1389 from yuriks/stub-cambunnei2016-03-043-20/+563
|\ \ \ | |/ / |/| |
| * | Service/CAM: Add doxycomments to all service functionsYuri Kunde Schlesner2016-03-011-0/+217
| * | Service/CAM: Dummy implementation of some functionsYuri Kunde Schlesner2016-02-133-20/+346
* | | Merge pull request #1394 from ds84182/immediate-mode-vtxbunnei2016-03-0321-61/+177
|\ \ \
| * | | Add immediate mode vertex submissionDwayne Slater2016-03-0321-61/+177
* | | | Merge pull request #1403 from MerryMage/sdlbunnei2016-03-0311-285/+290
|\ \ \ \ | |/ / / |/| | |
| * | | Config: Use unique_ptr instead of raw pointerMerryMage2016-03-022-14/+12
| * | | Dependencies: Remove GLFW, Add SDL2MerryMage2016-03-0211-275/+282
* | | | Merge pull request #1434 from Kloen/legendbunnei2016-03-021-0/+1
|\ \ \ \
| * | | | ThreadProcessorId_All on SVC::CreateThreadKloen2016-03-011-0/+1
* | | | | Merge pull request #1297 from Subv/savesbunnei2016-03-012-3/+5
|\ \ \ \ \
| * | | | | DiskDirectory: Initialize the directory member with valid info.Subv2016-01-162-3/+5
* | | | | | Service/CFG: Fix potential endianess issueYuri Kunde Schlesner2016-03-011-2/+3
* | | | | | Service/CFG: Add block 0x000A0000 (username) to default config fileYuri Kunde Schlesner2016-03-011-1/+14
| |/ / / / |/| | | |
* | | | | Merge pull request #1427 from MerryMage/emit-lbitYuri Kunde Schlesner2016-02-281-2/+2
|\ \ \ \ \
| * | | | | x64 Emitter: Fix L bit in VEX prefixMerryMage2016-02-271-2/+2
| | |/ / / | |/| | |
* | | | | Initial implementation ir:usermailwl2016-02-265-18/+144
* | | | | Merge pull request #1352 from LittleWhite-tb/exit_checkbunnei2016-02-262-0/+26
|\ \ \ \ \ | |/ / / / |/| | | |
| * | | | Add a configuration entry to enable/disable the checkLittleWhite2016-02-042-9/+10
| * | | | Add check before closure when emulation is runningLittleWhite2016-02-042-0/+25
* | | | | Merge pull request #1424 from MerryMage/lut_initbunnei2016-02-261-0/+4
|\ \ \ \ \
| * | | | | renderer_opengl: Initalise fragment shader LUT texturesMerryMage2016-02-261-0/+4
* | | | | | Merge pull request #1386 from MerryMage/audio-core-skeletonbunnei2016-02-2619-69/+873
|\ \ \ \ \ \
| * | | | | | AudioCore: Skeleton ImplementationMerryMage2016-02-2119-69/+873
| |/ / / / /
* | | | | | Merge pull request #1395 from ds84182/padding-attributesbunnei2016-02-251-7/+17
|\ \ \ \ \ \ | |/ / / / / |/| | | | |
| * | | | | Fix out of bounds array access when loading a component >= 12Dwayne Slater2016-02-211-1/+4
| * | | | | Add support for padding vertex attributesDwayne Slater2016-02-211-6/+13
* | | | | | BitField: Make trivially copyable and remove assignment operatorMerryMage2016-02-1212-60/+56
| |_|_|/ / |/| | | |
* | | | | pica: Cleanup lighting register definitions and documentation.bunnei2016-02-052-48/+51
* | | | | gl_rasterizer: Use alignas(16) instead of explicit padding.bunnei2016-02-051-13/+6
* | | | | renderer_opengl: Use GLvec3/GLvec4 aliases for commonly used types.bunnei2016-02-054-14/+18
* | | | | gl_rasterizer: Fix issue with interpolation of opposite quaternions.bunnei2016-02-052-4/+32
* | | | | pica_types: Fix typo in docstring.bunnei2016-02-051-1/+1
* | | | | pica_types: Replace float24/20/16 with a template class.bunnei2016-02-055-116/+82
* | | | | command_processor: Add an assertion to ensure LUTs are not written past their boundaries.bunnei2016-02-051-0/+3
* | | | | gl_rasterizer: Remove unnecessary casts.bunnei2016-02-051-6/+6
* | | | | gl_rasterizer: Fix PicaShaderConfig on GCC.bunnei2016-02-051-29/+27
* | | | | gl_rasterizer: Initial implementation of bump mapping.bunnei2016-02-053-5/+42
* | | | | gl_shader_gen: Fix bug in LUT range (should within range [0, 255] not [0, 256]).bunnei2016-02-051-3/+3
* | | | | gl_shader_gen: Implement lighting red, green, and blue reflection.bunnei2016-02-053-21/+77
* | | | | gl_shader_gen: View should be normalized.bunnei2016-02-051-2/+2
* | | | | gl_shader_gen: Implement fragment lighting fresnel effect.bunnei2016-02-053-9/+38
* | | | | gl_shader_gen: Implement fragment lighting specular 1 component.bunnei2016-02-053-11/+41
* | | | | gl_shader_gen: Add support for D0 LUT scaling.bunnei2016-02-053-3/+71
* | | | | gl_shader_gen: Refactor lighting config to match Pica register naming.bunnei2016-02-053-42/+50
* | | | | pica: Cleanup and add some comments to lighting registers.bunnei2016-02-052-19/+19
* | | | | gl_rasterizer: Minor naming refactor on Pica register naming.bunnei2016-02-052-20/+23
* | | | | gl_shader_gen: Reorganize and cleanup lighting code.bunnei2016-02-051-100/+107
* | | | | gl_shader_gen: Fix directional lights.bunnei2016-02-051-1/+1
* | | | | gl_shader_gen: Fix bug with lighting where clamp highlights was only applied to last light.bunnei2016-02-051-6/+6
* | | | | gl_shader_gen: View vector needs to be normalized when computing half angle vector.bunnei2016-02-051-3/+4
* | | | | renderer_opengl: Use textures for fragment shader LUTs instead of UBOs.bunnei2016-02-055-27/+64
* | | | | renderer_opengl: Initial implementation of basic specular lighting.bunnei2016-02-054-13/+165
* | | | | renderer_opengl: Implement HW fragment lighting distance attenuation.bunnei2016-02-052-17/+38
* | | | | renderer_opengl: Implement HW fragment lighting LUTs within our default UBO.bunnei2016-02-054-16/+67
* | | | | renderer_opengl: Implement diffuse component of HW fragment lighting.bunnei2016-02-056-15/+270
* | | | | pica: Implement decoding of basic fragment lighting components.bunnei2016-02-055-15/+120
* | | | | pica: Implement fragment lighting LUTs.bunnei2016-02-052-0/+34
* | | | | pica: Add decodings for distance attenuation and LUT registers.bunnei2016-02-051-1/+104
* | | | | pica: Add pica_types module and move float24 definition.bunnei2016-02-053-112/+127
|/ / / /
* | | | Merge pull request #1391 from tfarley/hw-fb-sync-fixbunnei2016-02-052-42/+34
|\ \ \ \
| * | | | hwrasterizer: Use proper cached fb addr/sizetfarley2016-02-032-42/+34
| |/ / /
* / / / backend: defaulted move constructor/assignmentLioncash2016-02-051-18/+2
|/ / /
* | | Merge pull request #1387 from lioncash/funcbunnei2016-02-0369-137/+43
|\ \ \
| * | | services: Get rid of unnecessary includesLioncash2016-02-0269-132/+32
| * | | services: Update function tablesLioncash2016-02-022-5/+11
* | | | OpenGL: Downgrade GL_DEBUG_SEVERITY_NOTIFICATION to Debug logging levelYuri Kunde Schlesner2016-02-031-2/+0
|/ / /
* | | Merge pull request #1377 from MerryMage/mmiobunnei2016-01-316-13/+127
|\ \ \
| * | | Memory: Implement MMIOMerryMage2016-01-306-13/+127
* | | | color: Make trivial helpers constexprLioncash2016-01-281-8/+8
* | | | Merge pull request #1367 from yuriks/jit-jmpbunnei2016-01-272-6/+6
|\ \ \ \
| * | | | Shader JIT: Fix off-by-one error when compiling JMPsYuri Kunde Schlesner2016-01-242-6/+6
* | | | | Merge pull request #1369 from yuriks/jmpu-invertedbunnei2016-01-262-2/+5
|\ \ \ \ \
| * | | | | Shader: Implement "invert condition" feature of IFU instructionYuri Kunde Schlesner2016-01-252-2/+5
| |/ / / /
* | | | | Merge pull request #1370 from yuriks/gpureg-namesbunnei2016-01-251-57/+465
|\ \ \ \ \
| * | | | | Debugger: Use 3dbrew names for GPU registersYuri Kunde Schlesner2016-01-251-57/+465
| |/ / / /
* | | | | Merge pull request #1373 from lioncash/castYuri Kunde Schlesner2016-01-251-3/+3
|\ \ \ \ \
| * | | | | elf: Don't cast away constLioncash2016-01-251-3/+3
* | | | | | Merge pull request #1372 from lioncash/tieYuri Kunde Schlesner2016-01-251-7/+7
|\ \ \ \ \ \ | |/ / / / / |/| | | | |
| * | | | | key_map: Use std::tie for comparisonsLioncash2016-01-251-7/+7
| |/ / / /
* / / / / archive_backend: Remove unnecessary const from return typesLioncash2016-01-252-8/+8
|/ / / /
* | | | Merge pull request #1334 from tfarley/hw-depth-modifiersbunnei2016-01-213-2/+24
|\ \ \ \
| * | | | hwrasterizer: Use depth offsettfarley2016-01-213-2/+24
| | |/ / | |/| |
* | | | ARM_Disasm::DisassembleMemHalf: actually use width in determining opcode namerob turner2016-01-191-9/+9
| |/ / |/| |
* | | command_processor: Get rid of variable shadowingLioncash2016-01-171-2/+1
|/ /
* | Merge pull request #1327 from Subv/unmap_memblockbunnei2016-01-155-5/+60
|\ \
| * | HLE/SVC: Implement UnmapMemoryBlock.Subv2016-01-145-5/+60
* | | Merge pull request #1196 from linkmauve/khr_debugbunnei2016-01-131-0/+57
|\ \ \
| * | | OpenGL: Log GL_KHR_debug messages we receiveEmmanuel Gil Peyrot2015-10-241-0/+57
* | | | Change default gameListRootDir from "" to "."archshift2016-01-071-1/+1
* | | | Merge pull request #1283 from Subv/soc_fixupbunnei2016-01-051-3/+13
|\ \ \ \
| * | | | HLE/Sockets: Fixed the buffer offset in recvfrom.Subv2015-12-241-3/+13
* | | | | Merge pull request #1330 from archshift/add-defaultsbunnei2016-01-031-1/+1
|\ \ \ \ \
| * | | | | Gamelist: supply default settings for QSettings configarchshift2016-01-011-1/+1
* | | | | | Merge pull request #1310 from lioncash/servicesbunnei2015-12-3125-113/+369
|\ \ \ \ \ \
| * | | | | | services: Update some function tablesLioncash2015-12-3025-113/+369
* | | | | | | Merge pull request #1316 from lioncash/decodebunnei2015-12-312-206/+202
|\ \ \ \ \ \ \ | |_|_|_|_|/ / |/| | | | | |
| * | | | | | arm_dyncom_dec: Fix decoding of VMLSLioncash2015-12-302-206/+202
| |/ / / / /
* / / / / / video_core: Make the renderer global a unique_ptrLioncash2015-12-302-6/+10
|/ / / / /
* | | | | Merge pull request #1306 from Subv/syncbunnei2015-12-301-3/+3
|\ \ \ \ \
| * | | | | HLE/Timers: Reset OneShot timers when they are acquired instead of when they're triggered.Subv2015-12-301-3/+3
* | | | | | Merge pull request #1303 from lioncash/uniquebunnei2015-12-304-20/+20
|\ \ \ \ \ \ | |_|/ / / / |/| | | | |
| * | | | | core: Use unique_ptr for holding the interpreter instancesLioncash2015-12-304-20/+20
| |/ / / /
* / / / / swrasterizer: Add missing override specifierLioncash2015-12-301-1/+1
|/ / / /
* | | | Merge pull request #1300 from Subv/arbitrateaddressbunnei2015-12-292-9/+18
|\ \ \ \
| * | | | SVC: Fixed ArbitrateAddress to behave as it does on hardware.Subv2015-12-282-9/+18
* | | | | dyncom: Handle modifying the APSR via an MRC instructionLioncash2015-12-281-12/+9
* | | | | Merge pull request #1296 from lioncash/warnbunnei2015-12-271-1/+1
|\ \ \ \ \
| * | | | | svc: Remove superfluous printf argumentLioncash2015-12-251-1/+1
| |/ / / /
* | | | | Merge pull request #1290 from LFsWang/masterbunnei2015-12-271-4/+14
|\ \ \ \ \ | |/ / / / |/| | | |
| * | | | Add missing return values in ForeachDirectoryEntryLFsWang2015-12-231-4/+14
* | | | | Merge pull request #1287 from lioncash/memoryMathew Maidment2015-12-231-97/+29
|\ \ \ \ \ | |/ / / / |/| | | |
| * | | | dyncom: Remove PC dispatch from several instructionsLioncash2015-12-211-94/+0
| * | | | dyncom: Handle unprivileged load/store variants correctlyLioncash2015-12-201-7/+33
* | | | | VideoCore: Sync state after changing rasterizersYuri Kunde Schlesner2015-12-211-0/+1
|/ / / /
* / / / svc: Fix compilation with LOG_TRACE enabledLioncash2015-12-131-1/+1
|/ / /
* | | Merge pull request #1267 from yuriks/flipped-framebufferYuri Kunde Schlesner2015-12-104-12/+17
|\ \ \
| * | | OpenGL: Flip framebuffers during transfer rather than when renderingYuri Kunde Schlesner2015-12-052-12/+11
| * | | OpenGL: Add support for glFrontFace in the state trackerYuri Kunde Schlesner2015-12-052-0/+6
* | | | Merge pull request #1269 from Subv/triangle_fanbunnei2015-12-081-5/+4
|\ \ \ \
| * | | | GPU/PrimitiveAssembler: Fixed drawing triangle fans.Subv2015-12-061-5/+4
| | |_|/ | |/| |
* | | | Merge pull request #1272 from yuriks/merge-rasterizerYuri Kunde Schlesner2015-12-0818-101/+138
|\ \ \ \
| * | | | VideoCore: Unify interface to OpenGL and SW rasterizersYuri Kunde Schlesner2015-12-0816-78/+116
| * | | | VideoCore: Rename HWRasterizer methods to be less confusingYuri Kunde Schlesner2015-12-077-22/+22
| * | | | OpenGL: Rename cache functions to better match what they actually doYuri Kunde Schlesner2015-12-073-12/+11
| | |/ / | |/| |
* | | | dyncom: Remove static keyword from header functionsLioncash2015-12-063-19/+19
* | | | arm_interface: Make GetNumInstructions constLioncash2015-12-061-1/+1
* | | | arm_interface: directly initialize class membersLioncash2015-12-061-7/+2
* | | | dyncom: const correctness changesLioncash2015-12-063-7/+7
|/ / /
* | | Merge pull request #1252 from Subv/cambunnei2015-12-043-0/+158
|\ \ \ | |/ / |/| |
| * | Services/Cam: Added new log type and camera enums from 3dbrew.Subv2015-11-233-0/+158
* | | PICA: Properly emulate 1-stage delay in the combiner bufferYuri Kunde Schlesner2015-12-012-12/+19
* | | Kernel: Implement svcGetSystemInfoYuri Kunde Schlesner2015-12-017-1/+95
* | | armstate: Zero out the registers on creationLioncash2015-11-291-11/+11
* | | Core/ARM11: Correct the size of the VFP register array in the ThreadContext structure.Subv2015-11-291-1/+1
* | | Merge pull request #1225 from lioncash/cleanbunnei2015-11-291-12/+13
|\ \ \
| * | | csnd_snd: Get rid of type punningLioncash2015-10-281-12/+13
* | | | Refactor ScanDirectoryTreeAndCallback to separate errors and retvalsarchshift2015-11-273-57/+62
* | | | renderer_opengl: Fix uniform issues introduced with kemenaran/avoid-explicit-uniform-location.bunnei2015-11-262-6/+8
* | | | Use regular uniform locationPierre de La Morinerie2015-11-253-15/+5
* | | | Merge pull request #1248 from polaris-/add-ssl-stubsbunnei2015-11-241-2/+51
|\ \ \ \ | |_|/ / |/| | |
| * | | Add stub functions for Initialize and GenerateRandomData in ssl:Cpolaris-2015-11-221-2/+51
* | | | Merge pull request #1246 from polaris-/patch-1bunnei2015-11-221-26/+31
|\ \ \ \ | |/ / / |/| | |
| * | | Fix read and write register blocks in gdbstubpolaris-2015-11-221-26/+31
* | | | Add Initialize and GenerateRandomData stubspolaris-2015-11-221-0/+2
|/ / /
* | | Merge pull request #1237 from Subv/ubosbunnei2015-11-196-13/+67
|\ \ \
| * | | FragShader: Use an UBO instead of several individual uniformsSubv2015-11-196-13/+67
* | | | fix failure on gcc and clangwwylele2015-11-121-3/+3
* | | | disable unary minus when the type is not signedwwylele2015-11-121-0/+4
* | | | Merge pull request #1122 from polaris-/gdbstubbunnei2015-11-1218-9/+1190
|\ \ \ \ | |/ / / |/| | |
| * | | Fix bug with reading addresses and lengthspolaris-2015-11-041-45/+55
| * | | Change headerspolaris-2015-10-291-2/+2
| * | | Add some headers so TravisCI will hopefully workpolaris-2015-10-221-0/+2
| * | | Use CHAR_BIT instead of 8polaris-2015-10-221-11/+11
| * | | Handle changes pointed out in comments on PRpolaris-2015-10-223-65/+36
| * | | Add a register variable to loopspolaris-2015-10-211-6/+9
| * | | Update register read loops to go with last commitpolaris-2015-10-211-6/+7
| * | | Pad responses to gdb for VFP registerspolaris-2015-10-211-0/+3
| * | | Try to add support for VFP registerspolaris-2015-10-211-4/+21
| * | | Fix buffer overflow commentspolaris-2015-10-211-2/+3
| * | | Remove unnecessary new lines, changed Deinit to Shutdownpolaris-2015-10-125-11/+8
| * | | Use BreakpointAddress struct instead of passing address directlypolaris-2015-10-043-8/+18
| * | | Toggle use_gdbstub in citra GLFWpolaris-2015-10-041-0/+1
| |\ \ \
| | * | | Implement gdbstubpolaris-2015-09-2018-9/+1182
| * | | | Implement gdbstubpolaris-2015-10-0418-9/+1174
* | | | | GPU/Loaders: Log an error when a loader tries to load from a component beyond the available ones (12).Subv2015-11-101-0/+2
| |_|/ / |/| | |
* | | | Merge pull request #1165 from esoteric-programmer/masterbunnei2015-10-282-4/+66
|\ \ \ \
| * | | | Added CSND stub.Matthias Ernst2015-10-282-4/+66
| | |/ / | |/| |
* | | | Merge pull request #1208 from archshift/free-bytesbunnei2015-10-288-1/+60
|\ \ \ \
| * | | | Implement FS_User::GetFreeBytesarchshift2015-10-288-1/+60
* | | | | Fix copy pasteFiliph Sandström2015-10-241-1/+1
* | | | | Fix wrong branchFiliph Sandström2015-10-231-0/+12
* | | | | Add GetTotalStepCount StubFiliph Sandström2015-10-231-1/+1
* | | | | Update ptm.hFiliph Sandström2015-10-231-0/+8
* | | | | Merge pull request #1209 from wwylele/file-path-encodingbunnei2015-10-232-5/+5
|\ \ \ \ \
| * | | | | change file path encoding to Local8bit()wwylele2015-10-202-5/+5
* | | | | | gl_shader_gen: Use explicit locations for vertex shader attributes.bunnei2015-10-222-15/+9
* | | | | | gl_shader_gen: Optimize code for AppendAlphaTestCondition.bunnei2015-10-221-16/+11
* | | | | | gl_rasterizer: Define enum types for each vertex texcoord attribute.bunnei2015-10-223-12/+14
* | | | | | gl_shader_gen: Various cleanups to shader generation.bunnei2015-10-223-48/+52
* | | | | | gl_rasterizer: Use MMH3 hash for shader cache hey.bunnei2015-10-225-101/+63
* | | | | | gl_shader_gen: Require explicit uniform locations.bunnei2015-10-223-56/+34
* | | | | | gl_shader_gen: Rename 'o' to 'attr' in vertex/fragment shaders.bunnei2015-10-221-11/+11
* | | | | | gl_shader_gen: AppendAlphaModifier default should be 0.0, not vec4(0.0).bunnei2015-10-221-1/+1
* | | | | | gl_shader_gen: Fix bug where TEV stage outputs should be clamped.bunnei2015-10-221-3/+3
* | | | | | gl_rasterizer: Add documentation to ShaderCacheKey.bunnei2015-10-221-0/+16
* | | | | | gl_shader_gen: Add additional function documentation.bunnei2015-10-222-0/+18
* | | | | | gl_shader_util: Cleanup header file + add docstring.bunnei2015-10-221-1/+7
* | | | | | gl_shader_gen: Various cleanups + moved TEV stage generation to its own function.bunnei2015-10-221-161/+170
* | | | | | renderer_opengl: Refactor shader generation/caching to be more organized + various cleanups.bunnei2015-10-2211-788/+527
* | | | | | gl_rasterizer: Move logic for creating ShaderCacheKey to a static function.bunnei2015-10-223-22/+50
* | | | | | gl_shader_util: Use vec3 constants for AppendColorCombiner.bunnei2015-10-221-6/+6
* | | | | | gl_rasterizer: Fix typo in uploading TEV const color uniforms.bunnei2015-10-221-5/+5
* | | | | | gl_shader_util: Fix precision bug with alpha testing.bunnei2015-10-222-9/+9
* | | | | | Initial implementation of fragment shader generation with caching.Subv2015-10-227-261/+568
|/ / / / /
* | | | | Merge pull request #1207 from kemenaran/persist-citra-settings-in-qtbunnei2015-10-201-0/+8
|\ \ \ \ \
| * | | | | citra-qt: persist hardware-rendering and shaders-jit settingsPierre de La Morinerie2015-10-181-0/+8
| |/ / / /
* | | | | Merge pull request #1204 from kemenaran/qt-add-mac-iconbunnei2015-10-201-1/+3
|\ \ \ \ \
| * | | | | citra-qt: Add icon to Mac appPierre de La Morinerie2015-10-141-1/+3
| |/ / / /
* | | | | Merge pull request #1199 from Gareth422/encryption-checkbunnei2015-10-203-20/+25
|\ \ \ \ \ | |/ / / / |/| | | |
| * | | | Loader: Change NCCH header types to be explicitly little-endianGareth Poole2015-10-112-18/+17
| * | | | Loader: Implement encryption checkGareth Poole2015-10-113-2/+8
* | | | | Merge pull request #1194 from linkmauve/no-newlinebunnei2015-10-107-55/+55
|\ \ \ \ \ | |/ / / / |/| | | |
| * | | | CitraQt, SkyEye, Loader, VideoCore: Remove newlines in LOG_* calls.Emmanuel Gil Peyrot2015-10-097-55/+55
| | |_|/ | |/| |
* / | | Fixed spelling errorsGareth Poole2015-10-091-2/+2
|/ / /
* | | Merge pull request #1189 from archshift/game-list-toggle-windowbunnei2015-10-071-0/+1
|\ \ \
| * | | Game list: propely hide on toggling window modearchshift2015-10-061-0/+1
* | | | Silence -Wsign-compare warnings.Rohit Nirmal2015-10-074-9/+9
|/ / /
* | | citra-qt: Fix mouse events coordinates on high-DPI screensPierre de La Morinerie2015-10-042-12/+21
* | | citra-qt: Enable high-DPI widgets on Mac appPierre de La Morinerie2015-10-041-0/+4
* | | citra-qt: Use custom Info.plist for Mac buildsPierre de La Morinerie2015-10-042-0/+38
| |/ |/|
* | Merge pull request #1176 from lioncash/vs2015-code-junking-daybunnei2015-10-031-11/+0
|\ \
| * | bit_field: Re-enable code on MSVCLioncash2015-10-011-11/+0
* | | Merge pull request #1095 from archshift/game-listbunnei2015-10-0213-123/+556
|\ \ \
| * | | Game list: save and load column sizes, sort order, to QSettingsarchshift2015-10-023-0/+24
| * | | Add menu item for selecting the game list folderarchshift2015-10-023-1/+23
| * | | Initial implementation of a game listarchshift2015-10-026-2/+356
| * | | Add helper function for creating a readable byte size string.archshift2015-10-022-0/+16
| * | | Don't show render window until a game is startedarchshift2015-10-022-4/+13
| * | | Split up FileUtil::ScanDirectoryTree to be able to use callbacks for custom behaviorarchshift2015-10-012-103/+83
| * | | Expose loader helper functions for identifying files.archshift2015-10-012-13/+41
* | | | Merge pull request #1180 from lioncash/symbolbunnei2015-10-012-35/+27
|\ \ \ \
| * | | | symbols: Replace an insert call with emplaceLioncash2015-09-301-1/+1
| * | | | symbols: Get rid of initial underscores in variable namesLioncash2015-09-302-20/+20
| * | | | symbols: Directly initialize TSymbol membersLioncash2015-09-301-8/+3
| * | | | symbols: Simplify GetSymbolLioncash2015-09-301-8/+5
| | |/ / | |/| |
* | | | Merge pull request #1177 from linkmauve/fix-msvc-todobunnei2015-09-301-4/+3
|\ \ \ \
| * | | | Service/CFG: Use a constexpr function for country initializationEmmanuel Gil Peyrot2015-09-301-4/+3
| |/ / /
* / / / ivfc_archive: Fix a printf specifierLioncash2015-09-301-1/+1
|/ / /
* | | Merge pull request #1172 from martinlindhe/fix-warningsbunnei2015-09-305-6/+8
|\ \ \
| * | | fix some xcode 7.0 warningsMartin Lindhe2015-09-295-6/+8
* | | | Fix for the refresh issue when no rendering is doneLittleWhite2015-09-242-4/+14
|/ / /
* | | Merge pull request #1160 from lioncash/clangbunnei2015-09-2213-41/+27
|\ \ \
| * | | hash: Get rid of unused functionsLioncash2015-09-161-16/+0
| * | | general: Silence some warnings when using clangLioncash2015-09-1612-25/+27
| | |/ | |/|
* | | Merge pull request #1106 from Kloen/fix-connectbunnei2015-09-222-5/+13
|\ \ \
| * | | citra-qt: Fix connect error on startupKloen2015-09-182-5/+13
| |/ /
* / / Implement 3dsx RomFSCruel2015-09-213-3/+61
|/ /
* | Service/CFG: Add default entry for block 0x000A0001 (birthday)Yuri Kunde Schlesner2015-09-141-0/+6
* | Service/CFG: Correct flags in 2 default blocksYuri Kunde Schlesner2015-09-141-2/+2
* | Service/CFG: Add additional blocks to default save dataYuri Kunde Schlesner2015-09-141-0/+34
* | Fix narrowing conversion warningYuri Kunde Schlesner2015-09-141-1/+1
* | Service/CFG: Move several private types from the header to the cppYuri Kunde Schlesner2015-09-142-63/+49
* | Service/CFG: Clean up default block creationYuri Kunde Schlesner2015-09-142-27/+17
|/
* Merge pull request #1123 from yuriks/gsp-flushYuri Kunde Schlesner2015-09-143-15/+36
|\
| * GSP: Implement command 0x05, used for flushing cachesYuri Kunde Schlesner2015-09-143-15/+36
* | Merge pull request #1111 from LittleWhite-tb/qt-close-renderwindowbunnei2015-09-143-0/+15
|\ \ | |/ |/|
| * Stop emulation when render window is closedLittleWhite2015-09-073-0/+15
* | memory_util: Remove unnecessary assignment in FreeMemoryPagesLioncash2015-09-121-3/+0
* | memory_util: Remove commented out printf statementsLioncash2015-09-121-10/+0
* | general: Replace 0 literals with nullptr where applicableLioncash2015-09-125-9/+9
* | synchronized_wrapper: Add missing return in SynchronizedRef move assignment operatorLioncash2015-09-121-0/+1
* | Merge pull request #1147 from lioncash/nullptrYuri Kunde Schlesner2015-09-1111-38/+38
|\ \
| * | General: Replace NULL and '0' usages with nullptr where applicableLioncash2015-09-1111-38/+38
* | | Merge pull request #1149 from lioncash/overrideYuri Kunde Schlesner2015-09-111-1/+1
|\ \ \
| * | | graphics_breakpoints_p: Add missing override specifierLioncash2015-09-111-1/+1
* | | | Merge pull request #1142 from lioncash/hdrqtYuri Kunde Schlesner2015-09-1124-100/+81
|\ \ \ \
| * | | | citra_qt: Reorganize headersLioncash2015-09-1124-100/+81
* | | | | Merge pull request #1143 from lioncash/vcore-hdrYuri Kunde Schlesner2015-09-1119-62/+56
|\ \ \ \ \ | |_|/ / / |/| | | |
| * | | | video_core: Reorganize headersLioncash2015-09-1119-62/+56
| | |/ / | |/| |
* | | | Merge pull request #1144 from lioncash/removebunnei2015-09-114-176/+0
|\ \ \ \
| * | | | common: Get rid of debug_interface.hLioncash2015-09-114-176/+0
| |/ / /
* / / / common: Get rid of a cast in swap.hLioncash2015-09-111-2/+2
|/ / /
* / / video_core: Remove unnecessary includes from headersLioncash2015-09-115-13/+3
|/ /
* | Merge pull request #1130 from lioncash/blockYuri Kunde Schlesner2015-09-101-14/+7
|\ \
| * | memory: Get rid of pointer castsLioncash2015-09-101-14/+7
* | | Merge pull request #1133 from lioncash/emplace-backbunnei2015-09-101-3/+3
|\ \ \
| * | | gl_rasterizer: Replace push_back calls with emplace_back in AddTriangleLioncash2015-09-101-3/+3
| |/ /
* | | Merge pull request #1136 from lioncash/protobunnei2015-09-101-3/+0
|\ \ \
| * | | renderer_opengl: Remove unimplemented function declarationLioncash2015-09-101-3/+0
* | | | Merge pull request #1137 from lioncash/docbunnei2015-09-107-11/+9
|\ \ \ \
| * | | | General: Fix up doxygen commentsLioncash2015-09-107-11/+9
| |/ / /
* / / / video_core: Remove unused variablesLioncash2015-09-103-4/+0
|/ / /
* | | Merge pull request #1131 from lioncash/uninitYuri Kunde Schlesner2015-09-101-3/+6
|\ \ \
| * | | y2r: Give local variables an initial valueLioncash2015-09-101-3/+6
| |/ /
* / / disk_archive: Remove unimplemented constructor declarationsLioncash2015-09-101-2/+0
|/ /
* | CMake: Add option to download Qt and GLFW binaries over HTTPYuri Kunde Schlesner2015-09-091-0/+3
* | Merge pull request #1125 from yuriks/uilayout-configYuri Kunde Schlesner2015-09-081-0/+7
|\ \
| * | citra-qt: Separate UI layout state in a separate section of the configYuri Kunde Schlesner2015-09-081-0/+7
* | | citra-qt: Trim recently used files list to size when insterting new itemYuri Kunde Schlesner2015-09-081-0/+4
|/ /
* | Merge pull request #1118 from Kloen/monospace-fontbunnei2015-09-072-1/+35
|\ \
| * | citra-qt: Use monospace font on Disassembler and ARM RegistersKloen2015-09-072-1/+35
| |/
* | Merge pull request #1121 from aroulin/shader-minor-fixesbunnei2015-09-072-16/+22
|\ \
| * | Shader JIT: Use SCALE constant from emitteraroulin2015-09-071-4/+4
| * | Shader: Fix size_t to int casts of register offsetsaroulin2015-09-072-15/+21
| |/
* | Shader Debugger: Allow editing of input vertex dataYuri Kunde Schlesner2015-09-071-0/+2
* | Shader Debugger: Highlight current instruction instead of focusingYuri Kunde Schlesner2015-09-071-4/+15
* | Shader Debugger: Remove useless signalYuri Kunde Schlesner2015-09-072-10/+2
* | Shader Debugger: Fix only first vertex attribute being loadedYuri Kunde Schlesner2015-09-071-7/+7
* | Shader Debugger: Fix freeze when double-clicking shader disassemblyYuri Kunde Schlesner2015-09-073-14/+4
* | Shader Debugger: Improve space efficiency of the layoutYuri Kunde Schlesner2015-09-071-9/+18
* | Shader Disassembly: Fix printing of jump offsetsYuri Kunde Schlesner2015-09-071-4/+4
* | Shader Disassembly: Fix disassembly of IFU/CALLU instructionsYuri Kunde Schlesner2015-09-071-0/+1
* | Shader Disassembly: Implement support for MAD/MADIYuri Kunde Schlesner2015-09-071-0/+31
* | Shader Disassembly: Introduce variables to hold common subexpressionsYuri Kunde Schlesner2015-09-071-16/+20
* | Shader Debugger: Initialize input_vertex to prevent crashesYuri Kunde Schlesner2015-09-071-0/+7
* | Shader Disassembly: Cleanup code and improve output alignmentYuri Kunde Schlesner2015-09-071-66/+79
|/
* Merge pull request #1114 from archshift/conditioncode_alLioncash2015-09-062-132/+132
|\
| * DynCom: Converted all 0xE condition code checks to ConditionCode::ALarchshift2015-09-062-132/+132
* | OpenGL: Use Sampler Objects to decouple sampler config from texturesYuri Kunde Schlesner2015-09-034-21/+76
* | OpenGL: Remove ugly and endian-unsafe color pointer castsYuri Kunde Schlesner2015-09-034-9/+13
* | OpenGL: Add support for Sampler Objects to state trackerYuri Kunde Schlesner2015-09-033-4/+42
* | citra-qt: Move system shutdown to run inside EmuThreadYuri Kunde Schlesner2015-09-032-3/+3
|/
* Merge pull request #1087 from yuriks/opengl-gladYuri Kunde Schlesner2015-09-0314-2817/+17
|\
| * Increase required OpenGL version to 3.3Yuri Kunde Schlesner2015-08-302-2/+2
| * Replace the previous OpenGL loader with a glad-generated 3.3 oneYuri Kunde Schlesner2015-08-3013-2815/+15
* | Merge pull request #1101 from archshift/camu-service-namesbunnei2015-09-031-3/+60
|\ \
| * | Add cam:u service function names to its function tablearchshift2015-09-031-3/+60
* | | Merge pull request #1088 from aroulin/x64-emitter-abi-callbunnei2015-09-027-452/+298
|\ \ \
| * | | x64: Proper stack alignment in shader JIT function callsaroulin2015-09-015-452/+108
| * | | Common: Import BitSet from Dolphinaroulin2015-09-012-0/+190
* | | | video_core: Fix format specifiers warningsaroulin2015-09-022-2/+3
|/ / /
* | | Merge pull request #1072 from yuriks/GetSystemTick-advance-timebunnei2015-09-011-1/+4
|\ \ \ | |/ / |/| |
| * | SVC: Advance time when calling GetSystemTick to escape busy-wait loopsYuri Kunde Schlesner2015-08-301-1/+4
* | | Merge pull request #1083 from yuriks/microprofile-vs2015bunnei2015-09-011-0/+5
|\ \ \
| * | | Common: Fix MicroProfile compilation in MSVC2015Yuri Kunde Schlesner2015-08-281-0/+5
* | | | Merge pull request #1092 from Subv/vertex_offsetTony Wasserka2015-08-312-1/+7
|\ \ \ \
| * | | | Pica: Added the primitive_restart register (0x25f) to the registers map.Subv2015-08-312-1/+5
| * | | | Pica: Add the vertex_offset register to the Pica registers map.Subv2015-08-312-0/+2
* | | | | Shader JIT: Fix SGE/SGEI NaN behavioraroulin2015-08-311-3/+3
|/ / / /
* | | | Merge pull request #1059 from Subv/vertex_offsetbunnei2015-08-302-2/+8
|\ \ \ \
| * | | | GPU: Implemented register 0x22A.Subv2015-08-302-2/+8
* | | | | Merge pull request #1085 from Subv/fs_statbunnei2015-08-301-1/+1
|\ \ \ \ \ | |_|_|_|/ |/| | | |
| * | | | Services/FS: Correctly tell the guest app whether a file was correctly opened or not.Subv2015-08-291-1/+1
| |/ / /
* | | | Merge pull request #1049 from Subv/stencilbunnei2015-08-306-28/+111
|\ \ \ \ | |_|/ / |/| | |
| * | | HWRenderer: Added a workaround for the Intel Windows driver bug that causes glTexSubImage2D to not change the stencil buffer.Subv2015-08-241-2/+9
| * | | HWRasterizer: Implemented stencil ops 6 and 7.Subv2015-08-211-1/+3
| * | | SWRasterizer: Implemented stencil ops 6 and 7.Subv2015-08-212-6/+14
| * | | HWRasterizer: Implemented stencil op 1 (GL_ZERO)Subv2015-08-211-1/+1
| * | | SWRasterizer: Implemented stencil action 1 (GL_ZERO).Subv2015-08-212-1/+4
| * | | SWRasterizer: Removed a todo. Verified with hwtests.Subv2015-08-211-1/+0
| * | | SWRenderer: The stencil depth_pass action is executed even if depth testing is disabled.Subv2015-08-211-7/+5
| * | | Rasterizer: Abstract duplicated stencil code into a lambda.Subv2015-08-211-6/+9
| * | | GLRasterizer: Implemented stencil testing in the hw renderer.Subv2015-08-204-2/+44
| * | | GPU/Rasterizer: Corrected the stencil implementation.Subv2015-08-202-18/+39
| |/ /
* | | Kernel: Fix wrong linear heap base on titles using newer kernelsYuri Kunde Schlesner2015-08-281-1/+1
* | | Merge pull request #1075 from yuriks/ControlMem-fixesbunnei2015-08-284-4/+37
|\ \ \
| * | | Kernel: Fix assertion failure when ControlMemory is called with size=0Yuri Kunde Schlesner2015-08-271-0/+8
| * | | Core: Improve APT Shared Font hackYuri Kunde Schlesner2015-08-273-4/+29
* | | | Merge pull request #1065 from yuriks/shader-fpYuri Kunde Schlesner2015-08-284-57/+100
|\ \ \ \
| * | | | fixup! Shaders: Fix multiplications between 0.0 and infYuri Kunde Schlesner2015-08-241-4/+4
| * | | | Shader JIT: Tiny micro-optimization in DPHYuri Kunde Schlesner2015-08-241-4/+4
| * | | | Shaders: Fix multiplications between 0.0 and infYuri Kunde Schlesner2015-08-243-40/+58
| * | | | Shaders: Explicitly conform to PICA semantics in MAX/MINYuri Kunde Schlesner2015-08-242-2/+10
| * | | | Shader JIT: Add name to second scratch register (XMM4)Yuri Kunde Schlesner2015-08-241-3/+5
| * | | | Shader JIT: Fix CMP NaN behavior to match hardwareYuri Kunde Schlesner2015-08-241-8/+23
* | | | | gl_rasterizer_cache: Detect and ignore unnecessary texture flushes.bunnei2015-08-283-8/+18
* | | | | Shader JIT: Fix float to integer rounding in MOVAaroulin2015-08-271-2/+2
| |/ / / |/| | |
* | | | Merge pull request #1074 from lioncash/boolbunnei2015-08-271-57/+39
|\ \ \ \
| * | | | dyncom: Simplify some comparisons in CondPassedLioncash2015-08-261-4/+4
| * | | | dyncom: Change return type of CondPassed to boolLioncash2015-08-261-57/+39
* | | | | Shader JIT: ifdef out reference to ifdef'd out shader_maparchshift2015-08-271-0/+2
|/ / / /
* | | / citra-qt: Add a missing header guard to util.hLioncash2015-08-261-0/+2
| |_|/ |/| |
* | | Integrate the MicroProfile profiling libraryYuri Kunde Schlesner2015-08-2519-0/+347
* | | citra-qt: Add helper function to get a monospace QFontYuri Kunde Schlesner2015-08-256-5/+32
* | | Merge pull request #1063 from Subv/hw_renderer_debug_fbbunnei2015-08-241-2/+6
|\ \ \
| * | | HWRenderer: Only reload the framebuffer from gpu memory if the hw renderer is in use during a breakpoint.Subv2015-08-231-2/+6
| | |/ | |/|
* | | shader_jit: Replace two MDisp usages with MatRLioncash2015-08-241-2/+2
| |/ |/|
* | Merge pull request #1062 from aroulin/shader-rcp-rsqbunnei2015-08-234-10/+12
|\ \
| * | Shader: Use std::sqrt for float instead of sqrtaroulin2015-08-231-1/+1
| * | Shader: RCP and RSQ computes only the 1st componentaroulin2015-08-232-10/+10
| * | x64-emitter: add RCPSS SSE instructionaroulin2015-08-232-0/+2
* | | Merge pull request #1057 from aroulin/shader-dph-dphibunnei2015-08-233-3/+44
|\ \ \ | |/ / |/| |
| * | Shader: implement DPH/DPHI in JITaroulin2015-08-222-2/+36
| * | Shader: implement DPH/DPHI in interpreteraroulin2015-08-221-1/+8
* | | Merge pull request #1058 from lioncash/ptrLioncash2015-08-232-4/+27
|\ \ \
| * | | emitter: Remove pointer castsLioncash2015-08-212-4/+27
| |/ /
* | | Fix broken boot introduced by last-minute change in #1025Yuri Kunde Schlesner2015-08-221-1/+1
* | | Merge pull request #1025 from yuriks/heap-managementYuri Kunde Schlesner2015-08-2229-316/+729
|\ \ \ | |/ / |/| |
| * | Kernel: Remove unused legacy heap MapBlock_* functionsYuri Kunde Schlesner2015-08-163-78/+0
| * | APT: Adjust shared font hack so it works with the new linear heap codeYuri Kunde Schlesner2015-08-161-10/+11
| * | Kernel: Implement svcGetProcessInfo in a basic wayYuri Kunde Schlesner2015-08-166-3/+73
| * | Kernel: Add more infrastructure to support different memory layoutsYuri Kunde Schlesner2015-08-1610-28/+148
| * | HLE: Remove empty ConfigMem and SharedPage Shutdown functionsYuri Kunde Schlesner2015-08-165-10/+0
| * | Move core/mem_map.{cpp,h} => core/hle/kernel/memory.{cpp,h}Yuri Kunde Schlesner2015-08-166-6/+5
| * | Memory: Move address type conversion routines to memory.cpp/hYuri Kunde Schlesner2015-08-169-53/+47
| * | Process: Store kernel compatibility version during loadingYuri Kunde Schlesner2015-08-162-3/+7
| * | Kernel: Properly implement ControlMemory FREE and COMMITYuri Kunde Schlesner2015-08-166-38/+338
| * | Memory: Move PAGE_MASK and PAGE_BITS to memory.hYuri Kunde Schlesner2015-08-162-3/+2
| * | VMManager: Introduce names for used ResultCodesYuri Kunde Schlesner2015-08-162-6/+11
| * | VMManager: Make LogLayout log level configurable as a parameterYuri Kunde Schlesner2015-08-164-13/+22
| * | VMManager: Change block offsets to size_tYuri Kunde Schlesner2015-08-162-3/+3
* | | emitter: Remove unnecessary definesLioncash2015-08-201-5/+1
* | | emitter: Remove unnecessary else keywordsLioncash2015-08-201-7/+7
* | | emitter: Remove unused codeLioncash2015-08-202-44/+0
* | | emitter: Remove unimplemented JMP prototypeLioncash2015-08-201-1/+0
* | | emitter: Pass OpArg by reference where possibleLioncash2015-08-202-763/+763
* | | emitter: Remove unnecessary inline specifiersLioncash2015-08-201-33/+33
* | | Merge pull request #1035 from darkf/mingw-fixbunnei2015-08-202-4/+10
|\ \ \
| * | | Fix building under MinGWdarkf2015-08-182-4/+10
* | | | Merge pull request #1055 from aroulin/shader-sge-sgei-sltbunnei2015-08-203-15/+50
|\ \ \ \
| * | | | Shader: implement SGE, SGEI and SLT in JITaroulin2015-08-192-15/+36
| * | | | Shader: implement SGE, SGEI in interpreteraroulin2015-08-191-0/+14
* | | | | Merge pull request #1045 from LittleWhite-tb/qt-recent-filesYuri Kunde Schlesner2015-08-192-11/+33
|\ \ \ \ \ | |/ / / / |/| | | |
| * | | | Improvements for MRULittleWhite2015-08-192-11/+33
| | |_|/ | |/| |
* | | | Merge pull request #996 from yuriks/texture-copyYuri Kunde Schlesner2015-08-194-36/+101
|\ \ \ \
| * | | | GPU: Implement TextureCopy-mode display transfersYuri Kunde Schlesner2015-08-164-36/+101
| | |_|/ | |/| |
* | | | Merge pull request #1047 from aroulin/shader-ex2-lg2bunnei2015-08-192-0/+33
|\ \ \ \
| * | | | Shader: Save caller-saved registers in JIT before a CALLaroulin2015-08-192-0/+33
* | | | | Merge pull request #1037 from aroulin/shader-ex2-lg2bunnei2015-08-193-2/+58
|\| | | | | |_|/ / |/| | |
| * | | Shader: implement EX2 and LG2 in JITaroulin2015-08-172-2/+22
| * | | Shader: implement EX2 and LG2 in interpreteraroulin2015-08-161-0/+36
* | | | Merge pull request #1034 from yuriks/rg8-texturesbunnei2015-08-174-2/+27
|\ \ \ \
| * | | | citra-qt: Give RG8 format a proper name in the texture viewerYuri Kunde Schlesner2015-08-161-1/+1
| * | | | videocore: Added RG8 texture supportPatrick Martin2015-08-163-1/+26
| | |_|/ | |/| |
* | | | Fix Linux GCC 4.9 build (complaining about undeclared memset)LittleWhite2015-08-161-1/+2
| |/ / |/| |
* | | Build fix for Debug configurations.Tony Wasserka2015-08-161-1/+1
* | | Merge pull request #997 from Lectem/cmdlist_full_debugTony Wasserka2015-08-164-50/+52
|\ \ \
| * | | citra-qt/debug_utils: Use lock_guard everywhereLectem2015-07-261-6/+5
| * | | citra-qt/command list: Do not recreate a widget after each selectionLectem2015-07-261-10/+10
| * | | citra-qt/command list: Add mask columnLectem2015-07-264-33/+34
| * | | citra-qt/command list: monospace font on windowsLectem2015-07-261-1/+3
* | | | citra-qt/VertexShader: Minor UI improvements.Tony Wasserka2015-08-162-10/+11
* | | | citra-qt: Fix comment style.Tony Wasserka2015-08-161-5/+6
* | | | Introduce a shader tracer to allow inspection of input/output values for each processed instruction.Tony Wasserka2015-08-1610-83/+587
* | | | Pica/DebugUtils: Include uniform information into shader dumps.Tony Wasserka2015-08-163-14/+53
* | | | citra-qt: Improve shader debugger.Tony Wasserka2015-08-166-16/+48
* | | | citra-qt: Print the correct swizzle mask for SRC2 in the shader disassembler.Tony Wasserka2015-08-161-3/+3
* | | | Merge pull request #1033 from bbarenblat/masterYuri Kunde Schlesner2015-08-161-0/+6
|\ \ \ \ | |_|/ / |/| | |
| * | | Properly indicate that CIA support is not implemented yetBenjamin Barenblat2015-08-151-0/+4
| * | | Give CIA file type a nameBenjamin Barenblat2015-08-151-0/+2
* | | | Merge pull request #1017 from LittleWhite-tb/qt-recent-filesbunnei2015-08-163-18/+91
|\ \ \ \
| * | | | Add menu and logic to save and load recently loaded files.LittleWhite2015-08-113-18/+91
* | | | | Merge pull request #1032 from lioncash/swapbunnei2015-08-162-12/+6
|\ \ \ \ \ | |_|_|_|/ |/| | | |
| * | | | vfp: use std::swap where applicableLioncash2015-08-162-12/+6
* | | | | Merge pull request #1031 from bbarenblat/masterYuri Kunde Schlesner2015-08-161-1/+2
|\ \ \ \ \ | | |_|/ / | |/| | |
| * | | | Handle invalid `Log::Class`Benjamin Barenblat2015-08-151-1/+2
| |/ / /
* | | | Shader: Use a POD struct for registers.bunnei2015-08-165-40/+43
* | | | Rename ARCHITECTURE_X64 definition to ARCHITECTURE_x86_64.bunnei2015-08-1610-21/+20
* | | | Common: Cleanup CPU capability detection code.bunnei2015-08-165-203/+146
* | | | Common: Move cpu_detect to x64 directory.bunnei2015-08-165-7/+6
* | | | x64: Refactor to remove fake interfaces and general cleanups.bunnei2015-08-1616-666/+52
* | | | JIT: Support negative address offsets.bunnei2015-08-161-26/+25
* | | | Shader: Initial implementation of x86_x64 JIT compiler for Pica vertex shaders.bunnei2015-08-1618-3/+967
* | | | Common: Added MurmurHash3 hash function for general-purpose use.bunnei2015-08-156-3/+159
* | | | Common: Ported over boilerplate x86 JIT code from Dolphin/PPSSPP.bunnei2015-08-1511-6/+4382
* | | | Common: Ported over Dolphin's code for x86 CPU capability detection.bunnei2015-08-154-17/+273
* | | | Shader: Define a common interface for running vertex shader programs.bunnei2015-08-157-186/+289
* | | | Shader: Move shader code to its own subdirectory, "shader".bunnei2015-08-1510-13/+13
* | | | GPU: Refactor "VertexShader" namespace to "Shader".bunnei2015-08-1514-51/+49
|/ / /
* | | Merge pull request #1027 from lioncash/debuggerbunnei2015-08-146-49/+225
|\ \ \
| * | | registers: Support viewing VFP registersLioncash2015-08-072-44/+172
| * | | arm_interface: Implement interface for retrieving VFP registersLioncash2015-08-074-1/+49
| * | | registers: Fix a typo with CPSR's nameLioncash2015-08-072-36/+36
* | | | Stop defining GCC always_inline attributes as __forceinlinearchshift2015-08-122-7/+8
* | | | Merge pull request #893 from linkmauve/remove-uint._t-int._tbunnei2015-08-118-346/+356
|\ \ \ \
| * | | | ARM Core, Video Core, CitraQt, Citrace: Use CommonTypes types instead of the standard u?int*_t types.Emmanuel Gil Peyrot2015-08-118-346/+356
* | | | | Merge pull request #1023 from yuriks/gl-state-bugsbunnei2015-08-116-26/+48
|\ \ \ \ \ | |/ / / / |/| | | |
| * | | | OpenGL: Fix state tracking in situations with reused object handlesYuri Kunde Schlesner2015-08-064-0/+45
| * | | | OpenGL: Remove redundant texture.enable_2d field from OpenGLStateYuri Kunde Schlesner2015-08-064-26/+3
| | |/ / | |/| |
* | | | arm_disasm: ARMv6 mul/div and abs media instructionsaroulin2015-08-112-1/+119
* | | | arm_disasm: ARMv6 parallel add/sub media instructionsaroulin2015-08-112-0/+167
* | | | arm_disasm: ARMv6 reversal media instructionsaroulin2015-08-092-0/+26
* | | | arm_disasm: ARMv6 saturation media instructionsaroulin2015-08-092-2/+55
* | | | arm_disasm: ARMv6 packing and sign-extend media instructionsaroulin2015-08-092-1/+181
* | | | Merge pull request #1026 from lioncash/disasmLioncash2015-08-071-12/+4
|\ \ \ \ | |_|/ / |/| | |
| * | | arm_disasm: Remove unnecessary codeLioncash2015-08-071-12/+4
* | | | Disassembler: ARMv6K REX instructionsaroulin2015-08-062-6/+97
* | | | Disassembler: ARMv6K hint instructionsaroulin2015-08-062-0/+56
| |/ / |/| |
* | | Merge pull request #1018 from bbarenblat/masterbunnei2015-08-052-1/+8
|\ \ \
| * | | Use UNREACHABLE macro for impossible cases in previous commitBenjamin Barenblat2015-08-032-4/+3
| * | | Handle invalid `Log::Level::Count`Benjamin Barenblat2015-08-022-1/+9
* | | | Videocore: Implement simple vertex cachingYuri Kunde Schlesner2015-08-051-62/+89
* | | | Common: Work around bug in MSVC2015 standard libraryYuri Kunde Schlesner2015-08-031-0/+14
|/ / /
* | | Save the path leading where the last file have been loadedLittleWhite2015-07-311-5/+20
* | | Merge pull request #1008 from lioncash/pcbunnei2015-07-302-21/+40
|\ \ \
| * | | dyncom: Handle the case where PC is the source register for STR/VSTM/VLDMLioncash2015-07-292-21/+40
| |/ /
* | | Merge pull request #1006 from yuriks/fb-commit-profilebunnei2015-07-301-0/+7
|\ \ \
| * | | OpenGL: Add a profiler category measuring framebuffer readbackYuri Kunde Schlesner2015-07-281-0/+7
* | | | Merge pull request #1014 from lioncash/unused-warnbunnei2015-07-292-3/+5
|\ \ \ \
| * | | | core: Eliminate some unused variable warningsLioncash2015-07-292-3/+5
* | | | | Merge pull request #1011 from lioncash/initializerbunnei2015-07-292-2/+2
|\ \ \ \ \
| * | | | | citra-qt: Adjust initializer list orderLioncash2015-07-292-2/+2
* | | | | | Merge pull request #963 from yuriks/gpu-fixesbunnei2015-07-292-42/+44
|\ \ \ \ \ \
| * | | | | | VideoCore: Fix values of unset components in input attribute arraysYuri Kunde Schlesner2015-07-231-42/+38
| * | | | | | VideoCore: Saturate vertex colors before interpolatingYuri Kunde Schlesner2015-07-231-0/+6
* | | | | | | Merge pull request #1013 from lioncash/unusedYuri Kunde Schlesner2015-07-291-3/+0
|\ \ \ \ \ \ \ | |_|_|/ / / / |/| | | | | |
| * | | | | | dyncom: Remove an unused variableLioncash2015-07-291-3/+0
| | |/ / / / | |/| | | |
* | | | | | Merge pull request #1012 from lioncash/prototypebunnei2015-07-292-0/+2
|\ \ \ \ \ \
| * | | | | | core: Fix missing prototype warningsLioncash2015-07-292-0/+2
| |/ / / / /
* / / / / / citra-qt: Pass string by const referenceLioncash2015-07-292-2/+2
|/ / / / /
* | | | | Merge pull request #1009 from lioncash/tableYuri Kunde Schlesner2015-07-291-1/+2
|\ \ \ \ \
| * | | | | am_net: Add missing function to the function tableLioncash2015-07-291-0/+1
| * | | | | am_net: Add correct function name to the function tableLioncash2015-07-291-1/+1
| | |_|/ / | |/| | |
* | | | | Merge pull request #982 from Subv/homebunnei2015-07-297-18/+84
|\ \ \ \ \ | |/ / / / |/| | | |
| * | | | Service/APT: Fixed a regression, PreloadLibraryApplet should also start an applet when called.Subv2015-07-246-5/+36
| * | | | Service/APT: Return proper parameters in GetLockHandle.Subv2015-07-244-14/+49
| |/ / /
* | | | dyncom: Handle left-operand PC correctly for data-processing opsLioncash2015-07-291-7/+33
* | | | Merge pull request #899 from zawata/Winsock-Deprecationbunnei2015-07-281-2/+8
|\ \ \ \
| * | | | SOC:U : Update deprecated function gethostbyname() to getaddrinfo()zawata2015-07-201-2/+8
* | | | | Update Start menu text to match with the real state of the emulator.LittleWhite2015-07-281-0/+3
| |_|/ / |/| | |
* | | | Settings: Fix saving wrong values for input configurationTrung Do2015-07-281-1/+2
* | | | Merge pull request #1003 from lioncash/armcruftbunnei2015-07-286-124/+91
|\ \ \ \
| * | | | dyncom: Remove an unnecessary typedefLioncash2015-07-282-7/+5
| * | | | dyncom: Use enum class for instruction decoding resultsLioncash2015-07-285-41/+40
| * | | | dyncom: Remove code duplication regarding thumb instructionsLioncash2015-07-283-23/+12
| * | | | dyncom: Migrate exclusive memory access control into armstateLioncash2015-07-282-50/+35
| * | | | dyncom: Remove duplicated typedef and externLioncash2015-07-281-4/+0
* | | | | Merge pull request #873 from jroweboy/input_arrayTony Wasserka2015-07-287-145/+80
|\ \ \ \ \ | |/ / / / |/| | | |
| * | | | Move input values into an arrayJames Rowe2015-07-287-145/+80
* | | | | Merge pull request #1001 from lioncash/armbunnei2015-07-2712-1109/+1028
|\ \ \ \ \
| * | | | | dyncom: Use std::array for register arraysLioncash2015-07-262-28/+29
| * | | | | dyncom: Use ARMul_State as an objectLioncash2015-07-2612-1105/+1023
* | | | | | Merge pull request #991 from yuriks/globjectsbunnei2015-07-263-143/+79
|\ \ \ \ \ \
| * | | | | | OpenGL: Make OpenGL object resource wrappers fully inlineYuri Kunde Schlesner2015-07-263-143/+79
| |/ / / / /
* | | | | | Merge pull request #992 from yuriks/hot-path-debugbunnei2015-07-265-13/+18
|\ \ \ \ \ \
| * | | | | | VideoCore: #ifdef out some debugging routinesYuri Kunde Schlesner2015-07-265-13/+18
| |/ / / / /
* | | | | | Merge pull request #987 from yuriks/regnamesTony Wasserka2015-07-262-65/+72
|\ \ \ \ \ \
| * | | | | | Videocore: Don't reinitialize register name map on every queryYuri Kunde Schlesner2015-07-262-65/+72
* | | | | | | Merge pull request #995 from linkmauve/remove-dead-optionYuri Kunde Schlesner2015-07-261-4/+0
|\ \ \ \ \ \ \ | |_|_|_|_|_|/ |/| | | | | |
| * | | | | | Citra: Remove dead gpu_refresh_rate option from the default ini file.Emmanuel Gil Peyrot2015-07-261-4/+0
| | |/ / / / | |/| | | |
* | | | | | Merge pull request #986 from Lectem/better_widgetsTony Wasserka2015-07-261-12/+22
|\ \ \ \ \ \
| * | | | | | citra-qt/command list: Enable uniform row heights and automatically resize columns.Lectem2015-07-251-0/+8
| * | | | | | citra-qt/command list: Split register and value columns.Lectem2015-07-251-12/+14
* | | | | | | Videocore: Simplify variables in vertex shader interpreterYuri Kunde Schlesner2015-07-261-24/+21
* | | | | | | Videocore: Replace std::stack in shader interpreter with static_vectorYuri Kunde Schlesner2015-07-261-6/+6
| |/ / / / / |/| | | | |
* | | | | | dyncom: Remove unnecessary initialization code.Lioncash2015-07-264-59/+2
* | | | | | dyncom: Remove unnecessary abort-related cruftLioncash2015-07-262-48/+1
* | | | | | dyncom: Rename armdefs.h to armstate.hLioncash2015-07-2616-34/+33
* | | | | | dyncom: Get rid of skyeye typedefsLioncash2015-07-268-62/+56
* | | | | | dyncom: Move helper functions to their own headerLioncash2015-07-2610-41/+57
* | | | | | dyncom: Move arminit.cpp and armsupp.cpp into skyeye_commonLioncash2015-07-263-2/+2
| |_|/ / / |/| | | |
* | | | | Merge pull request #989 from lioncash/externYuri Kunde Schlesner2015-07-261-25/+25
|\ \ \ \ \
| * | | | | armdefs: Remove unnecessary extern keywordsLioncash2015-07-261-25/+25
| |/ / / /
* / / / / loader: Remove unnecessary else usagesLioncash2015-07-261-9/+9
|/ / / /
* | | | Merge pull request #888 from zawata/Warning-Fixes-2Yuri Kunde Schlesner2015-07-252-3/+3
|\ \ \ \ | |/ / / |/| | |
| * | | Core\HLE : Fix Warningzawata2015-07-172-3/+3
| |/ /
* | | Address error that remained in last mergeYuri Kunde Schlesner2015-07-251-1/+1
* | | Merge pull request #892 from zawata/another-warning-fixesYuri Kunde Schlesner2015-07-259-24/+24
|\ \ \
| * | | Vertex Shader : Undo castingzawata2015-07-191-1/+1
| * | | Video_Core : Type fixeszawata2015-07-192-2/+2
| * | | Core : Change variable typezawata2015-07-191-1/+1
| * | | Video_Core: Finally fix pesky warningzawata2015-07-191-1/+1
| * | | Citra_QT : Another Conversion Warning Fixzawata2015-07-191-1/+1
| * | | Video_Core : Change Tabs to Spaceszawata2015-07-191-0/+15
| * | | Video_Core : Fix Conversion Warningszawata2015-07-193-18/+3
| * | | Core : Fix Conversion Warningszawata2015-07-191-1/+1
| * | | Common : Fix Conversion Warningszawata2015-07-191-1/+1
| * | | Citra_QT : Fix Conversion Warningszawata2015-07-192-2/+2
* | | | Merge pull request #981 from Subv/checkboxesYuri Kunde Schlesner2015-07-253-71/+40
|\ \ \ \
| * | | | Qt/GPU Breakpoints: Changed the widget so that we don't have to select and click the Enable button when enabling/disabling a breakpoint, now it is done via a checkbox next to the breakpoint's name.Subv2015-07-243-71/+40
* | | | | Merge pull request #983 from yuriks/null-memory-fillYuri Kunde Schlesner2015-07-241-13/+18
|\ \ \ \ \
| * | | | | GSP: Don't try to write memory fill registers if start address is 0Yuri Kunde Schlesner2015-07-241-13/+18
| | |_|_|/ | |/| | |
* | | | | Merge pull request #980 from Subv/more_breakpointsTony Wasserka2015-07-245-7/+24
|\ \ \ \ \ | |/ / / / |/| | | |
| * | | | Qt/GPU Breakpoints: Added three more breakpoint types:Subv2015-07-235-7/+24
| |/ / /
* | | | Merge pull request #977 from yuriks/glenable-tex2dbunnei2015-07-231-8/+5
|\ \ \ \
| * | | | GL Renderer: Remove erroneous glEnable(GL_TEXTURE_2D) callsYuri Kunde Schlesner2015-07-221-8/+5
* | | | | Rasterizer/GL: Set the border color when binding a texture.Subv2015-07-231-2/+9
| |/ / / |/| | |
* | | | Merge pull request #968 from Subv/texture_filteringbunnei2015-07-224-3/+37
|\ \ \ \
| * | | | GPU: Added registers for min and mag texture filters and implemented them in the hw renderer.Subv2015-07-214-3/+37
* | | | | Merge pull request #962 from Subv/am_appbunnei2015-07-223-3/+33
|\ \ \ \ \ | |_|/ / / |/| | | |
| * | | | Services/AM: Stubbed am:app::GetNumContentInfos to return 0 results.Subv2015-07-213-3/+33
| |/ / /
* | | | Merge pull request #966 from Subv/logbunnei2015-07-211-4/+8
|\ \ \ \
| * | | | Services/Logging: Log more useful information when some operations fail.Subv2015-07-211-4/+8
| |/ / /
* | | | Merge pull request #957 from Subv/hwtest_crashbunnei2015-07-211-0/+8
|\ \ \ \
| * | | | Kernel/Scheduling: Clean up a thread's wait_objects when its scheduled.Subv2015-07-211-0/+8
| |/ / /
* | | | Merge pull request #929 from neobrain/geoshader_definitionsTony Wasserka2015-07-216-150/+163
|\ \ \ \
| * | | | Pica/Shader: Add geometry shader definitions.Tony Wasserka2015-07-156-150/+163
* | | | | Merge pull request #964 from lioncash/svcLioncash2015-07-213-6/+6
|\ \ \ \ \
| * | | | | dyncom: Pass SVC immediates directly.Lioncash2015-07-213-6/+6
* | | | | | Resolve issue accidentally left unaddressed in PR #930Yuri Kunde Schlesner2015-07-211-1/+1
|/ / / / /
* | | | | Merge pull request #959 from Subv/homeSebastian Valle2015-07-211-1/+3
|\ \ \ \ \
| * | | | | Services/CFG: Added some missing functions to cfg:sSubv2015-07-211-1/+3
| | |/ / / | |/| | |
* | | | | Merge pull request #930 from neobrain/copypaste_commandlistYuri Kunde Schlesner2015-07-212-1/+31
|\ \ \ \ \ | |/ / / / |/| | | |
| * | | | citra-qt: Add support for copying the command list contents to clipboard.Tony Wasserka2015-07-152-1/+31
| |/ / /
* | | | Merge pull request #939 from Subv/queryprocmembunnei2015-07-202-6/+28
|\ \ \ \
| * | | | Kernel/SVC: Implemented svcQueryProcessMemorySubv2015-07-172-6/+28
* | | | | Merge pull request #951 from Subv/bit5bunnei2015-07-202-12/+31
|\ \ \ \ \
| * | | | | GPU/DisplayTransfer: Implemented bit 5 in the transfer flags.Subv2015-07-202-12/+31
* | | | | | Merge pull request #944 from Subv/spambunnei2015-07-201-3/+7
|\ \ \ \ \ \
| * | | | | | GLRasterizer: Don't try to get a pointer to the depth buffer if it doesn't exist.Subv2015-07-191-3/+7
* | | | | | | Merge pull request #946 from archshift/update-frdubunnei2015-07-201-1/+12
|\ \ \ \ \ \ \
| * | | | | | | Add more frd:u unknown service commands from 3dbrewarchshift2015-07-191-1/+12
| |/ / / / / /
* | / / / / / dyncom: Properly retrieve the PC value in BX if used.Lioncash2015-07-201-3/+5
| |/ / / / / |/| | | | |
* | | | | | Pica: Correct switched S/T texture wrapping registersYuri Kunde Schlesner2015-07-201-2/+2
* | | | | | Pica: Fix DP3 instruction, which wasn't assigning to the w componentYuri Kunde Schlesner2015-07-201-1/+1
* | | | | | Change trace/unimplemented service call logs to use hexarchshift2015-07-191-1/+1
|/ / / / /
* | | / / Rasterizer/Textures: Fixed a bug where the I4 format would get twice the real stride.Subv2015-07-192-1/+2
| |_|/ / |/| | |
* | | | Merge pull request #941 from citra-emu/armv6-thumb-movYuri Kunde Schlesner2015-07-181-10/+4
|\ \ \ \
| * | | | Dyncom: Support for a missing ARMv6 Thumb MOV encodingYuri Kunde Schlesner2015-07-181-10/+4
| |/ / /
* / / / Common: Remove the unused and commented GetThemeDir prototype from FileUtil.Emmanuel Gil Peyrot2015-07-181-3/+0
|/ / /
* | | Merge pull request #938 from Subv/querymemYuri Kunde Schlesner2015-07-172-4/+24
|\ \ \
| * | | Kernel/SVC: Implemented svcQueryMemory.Subv2015-07-172-4/+24
* | | | Merge pull request #937 from yuriks/codeset-leakbunnei2015-07-1712-8/+45
|\ \ \ \ | |/ / / |/| | |
| * | | Ensure all kernel objects are released during shutdownYuri Kunde Schlesner2015-07-1712-8/+45
* | | | arm_dyncom_interpreter: Simplify assignment in SMLAWLioncash2015-07-171-1/+1
|/ / /
* | | Merge pull request #918 from yuriks/romfsbunnei2015-07-1717-97/+111
|\ \ \
| * | | Loader: Fix variable type and remove unused variableYuri Kunde Schlesner2015-07-141-2/+1
| * | | Archive: Correct a few incorrect types in function signaturesYuri Kunde Schlesner2015-07-146-22/+22
| * | | Loader: Remove unnecessary pointer indirection to IOFileYuri Kunde Schlesner2015-07-1410-50/+50
| * | | FS: Stream RomFS from file instead of loading all of it to memorycondut2015-07-149-32/+47
* | | | Merge pull request #931 from neobrain/move_default_attr_handlerTony Wasserka2015-07-151-40/+40
|\ \ \ \
| * | | | Pica/CommandProcessor: Move default attribute setup to the proper position.Tony Wasserka2015-07-151-40/+40
| | |/ / | |/| |
* / | | Pica/Clipper: Output proper number of triangles in debugging logs.Tony Wasserka2015-07-151-1/+1
|/ / /
* | | VideoCore: Implement the DOT3_RGB combinerLectem2015-07-142-1/+13
* | | Merge pull request #904 from aroulin/y2r-narrowing-warningarchshift2015-07-141-1/+1
|\ \ \ | |/ / |/| |
| * | Y2R: Fix narrowing warningaroulin2015-07-121-1/+1
* | | Merge pull request #924 from aroulin/qt-disassembly-stepYuri Kunde Schlesner2015-07-132-2/+5
|\ \ \
| * | | Qt: Fix disassembly widget steppingaroulin2015-07-132-2/+5
* | | | Pica: Implement stencil testing.Tony Wasserka2015-07-133-13/+199
* | | | citra-qt: Add depth formats to framebuffer viewing widget.Tony Wasserka2015-07-132-6/+33
* | | | citra-qt: Properly specify the framebuffer format.Tony Wasserka2015-07-132-3/+28
* | | | CiTrace: Clean up initialization method.Tony Wasserka2015-07-133-79/+61
* | | | CiTrace: Record LCD registers. Cleanup recording code.Tony Wasserka2015-07-131-7/+11
* | | | CiTrace: Record default vertex attributes.Tony Wasserka2015-07-135-43/+65
* | | | Clean up command_processor.cpp.Tony Wasserka2015-07-131-22/+27
* | | | citra-qt: Properly disable the CiTrace widget upon starting/stopping emulation.Tony Wasserka2015-07-133-2/+39
* | | | Add CiTrace recording support.Tony Wasserka2015-07-1315-4/+641
* | | | GPU: Be robust against nullptr addresses; properly reset busy bits in the trigger registers.Tony Wasserka2015-07-131-27/+34
* | | | FileUtil: Add a WriteObject method for writing a single, POD-type object.Tony Wasserka2015-07-131-0/+10
* | | | HW: Fix a stupid issue which led to unknown register reads/writes.Tony Wasserka2015-07-131-0/+30
|/ / /
* | | Merge pull request #859 from Apology11/masterYuri Kunde Schlesner2015-07-131-2/+4
|\ \ \
| * | | don´t define snprintf on Visual Studio 2015Apology112015-07-121-2/+4
| |/ /
* | | Merge pull request #921 from linkmauve/fix-appletbunnei2015-07-127-7/+32
|\ \ \
| * | | Core: Fix applet includes using iwyu.Emmanuel Gil Peyrot2015-07-127-7/+32
| |/ /
* | | Kernel: Add CodeSet case to Object::IsWaitableYuri Kunde Schlesner2015-07-121-0/+1
* | | Implement new argument parsing using getopt and add the corresponding library to externalsGreg Wicks2015-07-122-3/+42
|/ /
* | Merge pull request #823 from Subv/applets_drawingbunnei2015-07-1211-58/+567
|\ \
| * | Applets: Reworked how the Applet update event is handled.Subv2015-07-127-35/+61
| * | Applets: Add infrastructure to allow custom drawing and input handling in Applets.Subv2015-07-127-39/+162
| * | HLE/APT: Initial HLE support for applets.Subv2015-07-129-50/+410
* | | Core: Properly configure address space when loading a binaryYuri Kunde Schlesner2015-07-1211-52/+223
* | | Memory: Fix unmapping of pagesYuri Kunde Schlesner2015-07-121-4/+2
* | | Loader: Clean up 3dsx loader a bit, fixing a potential buffer overrunYuri Kunde Schlesner2015-07-121-13/+16
* | | Loader: Make 3dsx loader logs a bit less confusingYuri Kunde Schlesner2015-07-121-6/+3
* | | Kernel: Remove unused member from EventYuri Kunde Schlesner2015-07-122-2/+1
|/ /
* | Merge pull request #914 from yuriks/bitfield-maskYuri Kunde Schlesner2015-07-121-2/+2
|\ \
| * | Common: Remove redundant masking in BitFieldYuri Kunde Schlesner2015-07-101-1/+1
| * | Common: Fix mask generation in BitFieldYuri Kunde Schlesner2015-07-101-1/+1
* | | Merge pull request #910 from linkmauve/installTony Wasserka2015-07-122-2/+6
|\ \ \
| * | | Citra, CitraQt: Tell cmake to install the compiled binaries.Emmanuel Gil Peyrot2015-07-092-2/+6
| |/ /
* | | Merge pull request #907 from Lectem/clamp_to_borderTony Wasserka2015-07-123-13/+28
|\ \ \
| * | | Added GL_CLAMP_TO_BORDER supportLectem2015-07-093-13/+28
* | | | Common: Remove thunk.hLioncash2015-07-112-43/+0
* | | | Merge pull request #876 from linkmauve/include-cleanupsYuri Kunde Schlesner2015-07-11108-402/+374
|\ \ \ \ | |_|/ / |/| | |
| * | | Core: Cleanup hw includes.Emmanuel Gil Peyrot2015-06-2813-11/+31
| * | | Core: Cleanup soc:U includes.Emmanuel Gil Peyrot2015-06-282-26/+36
| * | | Core, VideoCore: Replace or fix exit() calls.Emmanuel Gil Peyrot2015-06-283-10/+15
| * | | Core: Cleanup file_sys includes.Emmanuel Gil Peyrot2015-06-2822-38/+73
| * | | Core: Cleanup core includes.Emmanuel Gil Peyrot2015-06-289-15/+16
| * | | CitraQt: Cleanup includes.Emmanuel Gil Peyrot2015-06-2820-16/+45
| * | | Common: Cleanup emu_window includes.Emmanuel Gil Peyrot2015-06-285-13/+23
| * | | Common: Remove unused ROUND_UP_POW2 macro.Emmanuel Gil Peyrot2015-06-281-7/+0
| * | | Common: Cleanup key_map includes.Emmanuel Gil Peyrot2015-06-2813-19/+32
| * | | Common: Cleanup memory and misc includes.Emmanuel Gil Peyrot2015-06-2810-25/+22
| * | | Common: Cleanup profiler includes.Emmanuel Gil Peyrot2015-06-284-7/+10
| * | | Common: Cleanup thread includes.Emmanuel Gil Peyrot2015-06-282-18/+15
| * | | Common: Fix string_util includes.Emmanuel Gil Peyrot2015-06-282-3/+9
| * | | Common: Fix FileUtil includes, and everything relying on those.Emmanuel Gil Peyrot2015-06-2810-7/+21
| * | | Citra: Fix the includes a bit, thanks to include-what-you-use.Emmanuel Gil Peyrot2015-06-285-8/+19
| * | | Common: Remove now-unused EMU_PLATFORM define, fixes issue #373.Emmanuel Gil Peyrot2015-06-272-34/+0
| * | | Common: Remove unused SSE version checking and a GCC macro.Emmanuel Gil Peyrot2015-06-271-25/+0
| * | | Services: Use the standard _WIN32 define in soc:U instead of our own EMU_PLATFORM.Emmanuel Gil Peyrot2015-06-271-8/+7
| * | | Common: Remove unused fifo_queue.h.Emmanuel Gil Peyrot2015-06-272-112/+0
* | | | Loader: Remove log line causing warningaroulin2015-07-081-1/+0
| |/ / |/| |
* | | Merge pull request #797 from linkmauve/blended-downscalingbunnei2015-07-061-33/+46
|\ \ \
| * | | GPU: Implement blended downscaling for display transfers.Emmanuel Gil Peyrot2015-06-281-27/+40
| * | | GPU: Use shifts instead of multiplications to calculate the actual size of the output.Emmanuel Gil Peyrot2015-06-281-6/+6
| |/ /
* | | Merge pull request #885 from Subv/ipc_headersbunnei2015-07-061-5/+13
|\ \ \
| * | | Services/SOC: Added command headers to some of the soc commands.Subv2015-06-251-5/+13
| | |/ | |/|
* | | vfp: Change return type of VFPInit from unsigned int to void.Lioncash2015-06-292-4/+2
* | | vfp: Handle accesses to FPINST/FPINST2 system registersLioncash2015-06-294-42/+53
* | | Common: Remove unused type unions breaking aliasing rules in horrible ways.Emmanuel Gil Peyrot2015-06-281-26/+0
| |/ |/|
* | VideoCore: Fix floating point warningzawata2015-06-271-1/+1
|/
* Add helpers to create IPC command buffer headers and descriptorsYuri Kunde Schlesner2015-06-233-7/+43
* Merge pull request #860 from yuriks/y2r-colorYuri Kunde Schlesner2015-06-225-174/+734
|\
| * Y2R: Rework conversion process, enabling support for all formatsYuri Kunde Schlesner2015-06-225-163/+695
| * Y2R: Re-organize how params are stored. Support SetConversionParamsYuri Kunde Schlesner2015-06-211-72/+100
* | Merge pull request #855 from purpasmart96/service_rearrangmentbunnei2015-06-2175-637/+1190
|\ \ | |/ |/|
| * Services: Continue separation of services into their own folderspurpasmart962015-06-1275-637/+1190
* | Make the call stack entries not editableGreg Wicks2015-06-191-0/+3
* | Merge pull request #849 from bunnei/fix-waitsynch-2bunnei2015-06-189-113/+68
|\ \
| * | kernel: Fix svcWaitSynch to always acquire requested wait objects.bunnei2015-06-179-113/+68
* | | Merge pull request #864 from linkmauve/gl-infoLioncash2015-06-171-0/+2
|\ \ \ | |/ / |/| |
| * | VideoCore: Log the GL driver’s vendor and renderer.Emmanuel Gil Peyrot2015-06-161-0/+2
* | | Merge pull request #866 from lioncash/typoLioncash2015-06-161-1/+1
|\ \ \ | |/ / |/| |
| * | hw: Fix mismatched Write callLioncash2015-06-161-1/+1
| |/
* | video_core: add extra braces around initializerYuri Kunde Schlesner2015-06-141-3/+3
* | vfp: Handle accesses to the VFP media feature registersLioncash2015-06-133-4/+8
* | vfp: Implement VMOVBCR/VMOVBRCLioncash2015-06-122-5/+8
* | Merge pull request #835 from tfarley/hw-renderer-fixesbunnei2015-06-105-65/+140
|\ \
| * | Renderer formatting editstfarley2015-06-092-26/+29
| * | Render-to-texture flush, interval math fixtfarley2015-06-092-2/+14
| * | Liberal texture unbind (clout menu)tfarley2015-06-092-4/+40
| * | Depth format fix (crush3d intro/black screens)tfarley2015-06-091-46/+46
| * | Implemented glColorMasktfarley2015-06-093-0/+24
| |/
* / Robocopy doesn't like trailing slashesClienthax2015-06-091-4/+4
|/
* arm_dyncom_thumb: Fix handling of writeback for thumb LDMIALioncash2015-06-041-5/+19
* ExtSavedata: Save the icon passed to CreateExtSaveData to the correct folder.Subv2015-06-024-14/+38
* Merge pull request #838 from lioncash/thumbLioncash2015-06-011-3/+40
|\
| * arm_dyncom_thumb: Fix encoding of BKPT's immediateLioncash2015-06-011-1/+4
| * arm_dyncom_thumb: Implement CPS and SETENDLioncash2015-06-011-0/+13
| * arm_dyncom_thumb: Implement SXTH, SXTB, UXTH, and UXTB.Lioncash2015-06-011-0/+11
| * arm_dyncom_thumb: Implement REV, REV16, and REVSH.Lioncash2015-06-011-2/+12
* | Merge pull request #811 from archshift/commonifyarchshift2015-05-3113-16/+17
|\ \
| * | Move video_core/color.h to common/color.harchshift2015-05-308-6/+8
| * | Move video_core/math.h to common/vector_math.harchshift2015-05-309-10/+9
* | | Merge pull request #832 from yuriks/refresh-rate-optionbunnei2015-05-314-7/+2
|\ \ \
| * | | Remove gpu_refresh_rate configuration optionYuri Kunde Schlesner2015-05-304-7/+2
* | | | Pica: Use zero for the SecondaryFragmentColor source.bunnei2015-05-313-11/+21
* | | | rasterizer: Remove unnecessary 'using' for BlendEquation.bunnei2015-05-311-2/+1
* | | | Pica: Implement LogicOp function.bunnei2015-05-317-8/+135
* | | | rasterizer: Implement AddSigned combiner function for alpha channel.bunnei2015-05-311-0/+7
* | | | vertex_shader: Use address offset on src2 in inverted mode.bunnei2015-05-311-3/+3
* | | | Pica: Implement command buffer execution registers.bunnei2015-05-312-44/+76
* | | | vertex_shader: Implement SLT/SLTI instructions.bunnei2015-05-311-4/+10
* | | | vertex_shader: Implement MIN instruction.bunnei2015-05-311-0/+9
| |_|/ |/| |
* | | Merge pull request #830 from SeannyM/qt-noborderbunnei2015-05-301-2/+15
|\ \ \ | |_|/ |/| |
| * | QT: Remove border around widgetsSean Maas2015-05-291-2/+15
* | | Merge pull request #810 from yuriks/memmapYuri Kunde Schlesner2015-05-307-38/+491
|\ \ \
| * | | Memmap: Remove unused global pointers to memory areasYuri Kunde Schlesner2015-05-272-31/+8
| * | | Kernel: Add VMManager to manage process address spacesYuri Kunde Schlesner2015-05-276-16/+492
* | | | Remove every trailing whitespace from the project (but externals).Emmanuel Gil Peyrot2015-05-2958-140/+140
| |_|/ |/| |
* | | Merge pull request #817 from linkmauve/citra.icoYuri Kunde Schlesner2015-05-293-9/+9
|\ \ \ | |_|/ |/| |
| * | Assets: Move citra.ico from src/assets to dist.Emmanuel Gil Peyrot2015-05-253-9/+9
* | | hid: Get rid of undefined behaviorLioncash2015-05-271-2/+2
| |/ |/|
* | Merge pull request #826 from lioncash/tablesYuri Kunde Schlesner2015-05-271-22/+11
|\ \
| * | arm_dyncom_thumb: Merge STR/LDR table subsets.Lioncash2015-05-271-22/+11
| |/
* | Merge pull request #825 from lioncash/dyncLioncash2015-05-271-6/+1
|\ \
| * | arm_dyncom_interpreter: Remove unused variableLioncash2015-05-261-5/+1
| * | arm_dyncom_interpreter: Remove unused macroLioncash2015-05-251-1/+0
| |/
* | Merge pull request #821 from Subv/ImportDisplayCaptureInfobunnei2015-05-261-1/+47
|\ \
| * | Service/GSP: Implemented ImportDisplayCaptureInfo.Subv2015-05-261-1/+47
| |/
* / Core/SVC: Map the shared memory created in CreateMemoryBlock to the specified address.Subv2015-05-251-0/+2
|/
* dyncom: Get rid of armemu.hLioncash2015-05-245-50/+29
* Merge pull request #805 from lioncash/warnLioncash2015-05-234-6/+2
|\
| * gl_state: Remove unnecessary const specifier on ApplyLioncash2015-05-232-2/+2
| * y2r_u: Remove unused variable in StartConversionLioncash2015-05-231-1/+0
| * video_core/utils: Remove unused variables in GetMortonOffsetLioncash2015-05-231-3/+0
* | Merge pull request #806 from yuriks/annoying-qt-warningTony Wasserka2015-05-231-1/+7
|\ \ | |/ |/|
| * Qt: Silence a bogus warning printed when using the debug runtimeYuri Kunde Schlesner2015-05-231-1/+7
* | Merge pull request #804 from lioncash/dcleanLioncash2015-05-232-532/+372
|\ \ | |/ |/|
| * dyncom: Remove unused cpu parameter from decode_thumb_instrLioncash2015-05-231-3/+2
| * dyncom: remove load_r15 from arm_instLioncash2015-05-232-490/+331
| * dyncom: Remove unnecessary parameter for load/store operationsLioncash2015-05-231-39/+39
* | Merge pull request #776 from bunnei/pica-statebunnei2015-05-2315-438/+461
|\ \ | |/ |/|
| * Pica: Create 'State' structure and move state memory there.bunnei2015-05-2315-438/+461
* | Merge pull request #801 from purpasmart96/hid_stubsbunnei2015-05-234-9/+47
|\ \ | |/ |/|
| * HID: Stub DisableAccelerometer and DisableGyroscopeLowpurpasmart962015-05-234-9/+47
* | gl_state: Fix a condition typo in ApplyLioncash2015-05-231-1/+1
* | Merge pull request #802 from bunnei/vfp-trace-logLioncash2015-05-231-23/+23
|\ \
| * | VFP: Log as trace to get rid of spamming.bunnei2015-05-231-23/+23
| |/
* | Flush for y2r (moflex)tfarley2015-05-231-0/+11
* | MakeCurrent race condition fixtfarley2015-05-232-2/+3
* | OpenGL renderertfarley2015-05-2328-47/+2245
* | INI hw/sw renderer toggletfarley2015-05-224-0/+12
|/
* Merge pull request #798 from yuriks/y2r-bwYuri Kunde Schlesner2015-05-223-35/+267
|\
| * Service::Y2R: Support for grayscale decoding of specific formatsYuri Kunde Schlesner2015-05-223-35/+267
* | dyncom: Eliminate clang warningsLioncash2015-05-214-406/+404
|/
* Kernel: Fix a warning introduced with ResourceLimit, and remove the fallback code to prevent it from happening again.Emmanuel Gil Peyrot2015-05-211-2/+1
* y2r_u: Stub StartConversion to prevent moflex games from hanging.bunnei2015-05-211-1/+17
* Kernel: Move reschedules from SVCs to actual mechanisms that reschedule.bunnei2015-05-217-20/+22
* Merge pull request #783 from jroweboy/cond-waitbunnei2015-05-192-2/+14
|\
| * Use condition var to properly pause the CPU threadJames Rowe2015-05-182-2/+14
* | Merge pull request #766 from purpasmart96/cfg_service_updatebunnei2015-05-185-337/+304
|\ \
| * | CFG: Update the cfg service to be like other integrated servicespurpasmart962015-05-165-337/+304
* | | Merge pull request #772 from lioncash/warnbunnei2015-05-184-10/+10
|\ \ \
| * | | pica: Add the ULL specifier in IsDefaultAttributeLioncash2015-05-141-1/+1
| * | | vfp: Get rid of warningsLioncash2015-05-142-6/+6
| * | | process: Get rid of warningsLioncash2015-05-141-3/+3
* | | | Merge pull request #785 from archshift/breakbunnei2015-05-182-1/+17
|\ \ \ \
| * | | | Implement svcBreakarchshift2015-05-172-1/+17
| | |_|/ | |/| |
* | | | GPU/DefaultAttributes: Clear up a comment in command_processorSubv2015-05-171-2/+2
* | | | GPU/DefaultAttributes: Let the attribute data from the loaders overwrite the default attributes, if set.Subv2015-05-171-21/+23
|/ / /
* | | Merge pull request #781 from archshift/deletebunnei2015-05-161-33/+0
|\ \ \
| * | | Delete unused hle/coprocessor.cpparchshift2015-05-161-33/+0
* | | | Merge pull request #778 from purpasmart96/apt_assert_fixbunnei2015-05-162-5/+5
|\ \ \ \ | |/ / / |/| | |
| * | | APT/FS: Remove asserts that were causing false positivespurpasmart962015-05-162-5/+5
* | | | Merge pull request #758 from yuriks/sync-loggingYuri Kunde Schlesner2015-05-1612-393/+35
|\ \ \ \ | |/ / / |/| | |
| * | | Remove unused concurrent_ring_buffer.hYuri Kunde Schlesner2015-05-162-164/+0
| * | | Common: Use the log system to print assert messagesYuri Kunde Schlesner2015-05-121-7/+3
| * | | Common: Remove async loggingYuri Kunde Schlesner2015-05-129-222/+32
* | | | Merge pull request #774 from lioncash/decodingsYuri Kunde Schlesner2015-05-152-33/+191
|\ \ \ \
| * | | | dyncom: Add ARMv6K NOP and hint instructions to the decoding tableLioncash2015-05-142-12/+152
| * | | | dyncom: Handle some MSR variants individuallyLioncash2015-05-142-24/+41
| * | | | dyncom: Move exclusive load/stores above bbl and swi in the decoding tableLioncash2015-05-142-14/+15
| | |/ / | |/| |
* | | | Merge pull request #770 from lioncash/dyncom_cleanbunnei2015-05-152-275/+260
|\ \ \ \
| * | | | dyncom: Remove duplicate enums/prototypesLioncash2015-05-141-7/+1
| * | | | dyncom: Remove unnecessary definesLioncash2015-05-141-4/+4
| * | | | dyncom: Make translation-unit functions and variables staticLioncash2015-05-141-66/+64
| * | | | dyncom: Remove unnecessary typedefsLioncash2015-05-142-196/+197
| * | | | dyncom: Remove unused structsLioncash2015-05-141-8/+0
| |/ / /
* | | | Merge pull request #761 from Subv/resource_limitsbunnei2015-05-1512-14/+341
|\ \ \ \
| * | | | Core/ResourceLimits: Implemented the basic structure of ResourceLimits.Subv2015-05-1512-14/+341
* | | | | Merge pull request #675 from jroweboy/windows-build-fixesYuri Kunde Schlesner2015-05-151-0/+36
|\ \ \ \ \ | |/ / / / |/| | | |
| * | | | unsetting a few more variables that arent needed outside of this functionJames Rowe2015-03-261-0/+3
| * | | | Updated the copy commands to run on post_build and use generator expressions to simplify the code as wellJames Rowe2015-03-261-27/+26
| * | | | Changes to bring the previous commits in line with the comments on thepull request. Made the debug build a true debug build with no optimizxations and the RelWithDebInfo is what it says it is too. Changed the copying of the dlls to the build directories to happen at configuration time instead of build timeJames Rowe2015-03-261-22/+12
| * | | | More changes to the CMakeFiles for better MSVC compatibility. Added in the RelWithDebInfo target and setup copying the Qt 5 Dlls to the output directories.James Rowe2015-03-261-0/+44
* | | | | Memory: Use a table based lookup scheme to read from memory regionsYuri Kunde Schlesner2015-05-155-128/+174
* | | | | Memory: Read SharedPage directly from Memory::ReadYuri Kunde Schlesner2015-05-153-59/+37
* | | | | Memory: Read ConfigMem directly from Memory::ReadYuri Kunde Schlesner2015-05-153-50/+38
* | | | | Memmap: Re-organize memory function in two filesYuri Kunde Schlesner2015-05-1534-266/+254
* | | | | Memmap: Remove unused declarationsYuri Kunde Schlesner2015-05-152-20/+3
* | | | | Merge pull request #769 from lioncash/condbunnei2015-05-141-1/+1
|\ \ \ \ \
| * | | | | thread: Fix a conditional check in RescheduleLioncash2015-05-141-1/+1
| | |/ / / | |/| | |
* / | | | Common: Remove unused cruft from math_util, and remove a duplicated Rect class in common_types.Emmanuel Gil Peyrot2015-05-144-409/+3
|/ / / /
* | | | dyncom: Removed irrelevant log.bunnei2015-05-141-2/+0
* | | | Merge pull request #763 from bunnei/qt-fix-crashbunnei2015-05-141-1/+3
|\ \ \ \
| * | | | Qt: Shutdown emulation session only if EmuThread exists.bunnei2015-05-131-1/+3
* | | | | dyncom: Fix decoding of BKPT's immediateLioncash2015-05-131-1/+1
| |_|_|/ |/| | |
* | | | Merge pull request #756 from purpasmart96/ptm_service_changesbunnei2015-05-135-125/+112
|\ \ \ \ | |/ / / |/| | |
| * | | PTM: Changed the way the ptm services are handled to be like thepurpasmart962015-05-125-125/+112
* | | | GPU: Add more fine grained profiling for vertex shader and rasterizationYuri Kunde Schlesner2015-05-122-0/+10
| |_|/ |/| |
* | | Merge pull request #748 from Subv/tls_maxbunnei2015-05-124-10/+24
|\ \ \
| * | | Core/Memory: Add TLS support for creating up to 300 threadsSubv2015-05-124-10/+24
* | | | Merge pull request #751 from yuriks/idle-threadbunnei2015-05-123-46/+21
|\ \ \ \
| * | | | Thread: Remove the idle threadYuri Kunde Schlesner2015-05-123-46/+21
* | | | | Merge pull request #757 from Subv/schedulingbunnei2015-05-121-0/+2
|\ \ \ \ \
| * | | | | Core/Scheduling: Prepare the new priority in the thread queue when svcSetPriority is calledSubv2015-05-121-0/+2
| |/ / / /
* | | | | Merge pull request #752 from lioncash/flushbunnei2015-05-123-84/+98
|\ \ \ \ \
| * | | | | vfp: Handle flush-to-zero mode.Lioncash2015-05-113-84/+98
| |/ / / /
* | | | | Merge pull request #755 from lioncash/mcrr-mrrcbunnei2015-05-121-7/+68
|\ \ \ \ \ | |_|/ / / |/| | | |
| * | | | dyncom: Stub MCRR and MRRCLioncash2015-05-121-7/+68
| |/ / /
* | | | Merge pull request #750 from Subv/process_svcYuri Kunde Schlesner2015-05-126-4/+46
|\ \ \ \ | |_|/ / |/| | |
| * | | fixup!Subv2015-05-123-16/+12
| * | | Core/HLE: Implemented the SVCs GetProcessId and GetProcessIdOfThreadSubv2015-05-116-4/+50
* | | | NWM_UDS: Fix a typo in the nwm service port namepurpasmart962015-05-121-1/+1
| |/ / |/| |
* | | Merge pull request #749 from yuriks/stack-topbunnei2015-05-113-5/+4
|\ \ \
| * | | Thread: Correctly set main thread initial stack positionYuri Kunde Schlesner2015-05-113-5/+4
| |/ /
* / / Implement I4 texture formatarchshift2015-05-112-1/+12
|/ /
* | Merge pull request #740 from yuriks/gsp-shmemarchshift2015-05-117-34/+67
|\ \
| * | fixup! GSP: Small tweaks to shared memory initializationYuri Kunde Schlesner2015-05-111-1/+1
| * | GSP: Small tweaks to shared memory initializationYuri Kunde Schlesner2015-05-111-9/+11
| * | Kernel: Zero-fill shared memory blocks when mappingYuri Kunde Schlesner2015-05-111-0/+8
| * | Kernel: Capture SharedMemory attributes at creation, not when mappingYuri Kunde Schlesner2015-05-117-28/+51
* | | fixup! Set the TLS address in the schedulerSubv2015-05-116-11/+10
* | | Core/Memory: Give every emulated thread it's own TLS area.Subv2015-05-118-11/+31
* | | rasterizer: Implemented combiner output scaling.bunnei2015-05-102-2/+16
* | | rasterizer: Implemented AddSigned combiner op.bunnei2015-05-101-0/+10
* | | rasterizer: Fixed a depth testing bug.bunnei2015-05-102-6/+19
* | | rasterizer: Implement combiner buffer input.bunnei2015-05-102-4/+53
* | | rasterizer: Return zero'd vectors on error conditions.bunnei2015-05-101-3/+3
* | | vertex_shader: Implement FLR instruction.bunnei2015-05-101-0/+9
* | | vertex_shader: Implement MADI instruction.bunnei2015-05-101-4/+7
|/ /
* | Common: Remove the BIT macroYuri Kunde Schlesner2015-05-092-4/+2
* | Merge pull request #734 from yuriks/memmapTony Wasserka2015-05-0916-192/+195
|\ \
| * | Memory: Add GetPhysicalPointer helper functionYuri Kunde Schlesner2015-05-097-19/+28
| * | Memory: Support more regions in the VAddr-PAddr translation functionsYuri Kunde Schlesner2015-05-097-49/+43
| * | Memory: Sort memory region variables by VAddrYuri Kunde Schlesner2015-05-092-10/+10
| * | Memory: Re-organize and rename memory area address constantsYuri Kunde Schlesner2015-05-0910-132/+132
* | | Loader: Add missing includeYuri Kunde Schlesner2015-05-091-0/+1
|/ /
* | Loader: Remove .bin file supportYuri Kunde Schlesner2015-05-093-21/+1
* | Kernel: Remove unused g_main_thread variableYuri Kunde Schlesner2015-05-093-5/+1
* | Process: Rename StaticAddressMapping => AddressMappingYuri Kunde Schlesner2015-05-096-10/+10
* | Process: Add more documentation to the class membersYuri Kunde Schlesner2015-05-091-2/+16
* | Process: Use BitField to store process flagsYuri Kunde Schlesner2015-05-092-16/+24
* | Loader/NCCH: Fix formatting of bracesYuri Kunde Schlesner2015-05-091-9/+9
* | Process: Support parsing of exheader kernel capsYuri Kunde Schlesner2015-05-096-4/+77
* | Common: Add BIT macroYuri Kunde Schlesner2015-05-091-0/+2
* | Kernel: Remove g_program_idYuri Kunde Schlesner2015-05-096-21/+3
* | Kernel: Introduce skeleton Process class to hold process dataYuri Kunde Schlesner2015-05-0913-48/+191
* | Common: Add StringFromFixedZeroTerminatedBufferYuri Kunde Schlesner2015-05-082-0/+14
* | Core: Fix sorting in CMakeFiles.txtYuri Kunde Schlesner2015-05-081-21/+21
* | Merge pull request #728 from lioncash/varsLioncash2015-05-081-19/+17
|\ \
| * | dyncom: Remove an unnecessary variable in the interpreterLioncash2015-05-081-19/+17
* | | Remove unnecessary dyncom header filesLioncash2015-05-086-82/+2
|/ /
* | Merge pull request #725 from yuriks/remove-common-crapYuri Kunde Schlesner2015-05-087-1103/+31
|\ \
| * | Common: Remove mem_arena.cpp/hYuri Kunde Schlesner2015-05-085-560/+31
| * | Common: Remove hash.cpp/hYuri Kunde Schlesner2015-05-073-543/+0
* | | Merge pull request #723 from lioncash/commonstrbunnei2015-05-082-127/+0
|\ \ \
| * | | string_util: Get rid of UriDecode/UriEncodeLioncash2015-05-072-127/+0
* | | | Profiler: Fix off-by-one error when computing average.Yuri Kunde Schlesner2015-05-081-2/+1
| |/ / |/| |
* | | Common: Add proper macros to test for architecture pointer sizeYuri Kunde Schlesner2015-05-075-17/+11
|/ /
* | Merge pull request #721 from yuriks/more-cleanupsYuri Kunde Schlesner2015-05-07121-478/+428
|\ \
| * | Fix printf format warningYuri Kunde Schlesner2015-05-071-1/+1
| * | Common: Remove common.hYuri Kunde Schlesner2015-05-07102-96/+146
| * | Common: Move alignment macros to common_funcs.hYuri Kunde Schlesner2015-05-072-21/+21
| * | Common: Move SSE detection ifdefs to platform.hYuri Kunde Schlesner2015-05-073-16/+21
| * | Common: Remove more unused compatibility definesYuri Kunde Schlesner2015-05-071-45/+0
| * | Common: Move IO-specific compatibility macros to file_util.cppYuri Kunde Schlesner2015-05-072-26/+26
| * | Common: Remove many unnecessary cross-platform compatibility macrosYuri Kunde Schlesner2015-05-077-90/+12
| * | Clean-up includesYuri Kunde Schlesner2015-05-078-9/+14
| * | FileSys: De-inline Path membersYuri Kunde Schlesner2015-05-074-125/+139
| * | FileSys: Clean-up includes, de-inline destructorsYuri Kunde Schlesner2015-05-077-20/+35
| * | Move typedefs from kernel.h to more appropriate placesYuri Kunde Schlesner2015-05-073-10/+13
| * | Common: Move NonCopyable to common_types.hYuri Kunde Schlesner2015-05-072-10/+10
| * | Common: Use C++11 deleted functions for NonCopyableYuri Kunde Schlesner2015-05-071-8/+6
| * | Common: Remove unused enumsYuri Kunde Schlesner2015-05-071-17/+0
* | | Merge pull request #695 from Subv/crash_fbunnei2015-05-074-68/+137
|\ \ \ | |/ / |/| |
| * | GPU: Implemented default vertex shader attributes.Subv2015-05-074-68/+137
* | | HLE: Clean up SVC dispatch mechanismYuri Kunde Schlesner2015-05-065-79/+40
* | | Core: Remove some unused functions and typesYuri Kunde Schlesner2015-05-042-32/+1
* | | Merge pull request #698 from Zaneo/clip_stylus_inputTony Wasserka2015-05-024-8/+23
|\ \ \
| * | | EmuWindow: Clip mouse input coordinates to emulated screen dimensions.Zaneo2015-05-024-8/+23
* | | | Qt: Shutdown game on emulator close event.bunnei2015-05-021-0/+2
* | | | Qt: Disable "Start" unless we are paused (it otherwise has no meaning and causes a crash).bunnei2015-05-022-1/+4
* | | | Qt: Fixed a bug in shutdown procedure, various cleanups.bunnei2015-05-027-35/+26
* | | | Qt: Clear registers widget on shutdown.bunnei2015-05-023-8/+31
* | | | Qt: Use signals for emu_thread start/stop and fix disasm widget.bunnei2015-05-026-79/+138
* | | | Qt: Restructured to remove unnecessary shutdown event and various cleanups.bunnei2015-05-024-90/+40
* | | | Qt: Fix loading a new game without stopping emulation.bunnei2015-05-022-15/+25
* | | | CoreTiming: Initialize static variables at bootup.bunnei2015-05-021-0/+10
* | | | HLE: Properly initialize and shutdown remaining modules.bunnei2015-05-025-3/+20
* | | | Dyncom: Move cream cache to ARMul_State.bunnei2015-05-024-25/+18
* | | | Kernel: Properly initialize and shutdown all modules.bunnei2015-05-024-9/+20
* | | | HW: Properly initialize and shutdown all modules.bunnei2015-05-023-3/+8
* | | | Services: Initialize all state variables at bootup.bunnei2015-05-028-22/+38
* | | | Memory: Properly cleanup & shutdown.bunnei2015-05-023-38/+60
* | | | Qt: Create emu thread on bootup, kill it on shutdown.bunnei2015-05-023-31/+44
* | | | EmuThread: Remove unused filename attribute.bunnei2015-05-023-18/+2
* | | | Qt: Move EmuThread ownership from render window to main window.bunnei2015-05-026-69/+57
* | | | Merge pull request #717 from linkmauve/useless-autobunnei2015-04-291-1/+1
|\ \ \ \ | |/ / / |/| | |
| * | | VideoCore: Remove a superfluous auto variable declaration in debug_utils.Emmanuel Gil Peyrot2015-04-291-1/+1
* | | | ConfigMem: Remove duplicate retail bitpurpasmart962015-04-291-1/+0
* | | | Merge pull request #692 from purpasmart96/log_improvementsbunnei2015-04-284-22/+59
|\ \ \ \ | |/ / / |/| | |
| * | | Services/Loader: Use more sensible log formats for certain functionspurpasmart962015-04-284-22/+59
* | | | ptm_sysm: Add static specifier to IsLegacyPowerOffLioncash2015-04-251-1/+1
* | | | dyncom: Remove more unused/unnecessary codeLioncash2015-04-205-95/+1
* | | | Merge pull request #703 from lioncash/cruftbunnei2015-04-207-823/+15
|\ \ \ \
| * | | | dyncom: Remove unused/unnecessary VFP cruftLioncash2015-04-187-823/+15
* | | | | Merge pull request #691 from rohit-n/sign-comparebunnei2015-04-182-4/+4
|\ \ \ \ \
| * | | | | Silence some -Wsign-compare warnings.Rohit Nirmal2015-04-102-4/+4
| | |/ / / | |/| | |
* | | | | Common: thread.h cleanupsYuri Kunde Schlesner2015-04-161-65/+16
| |/ / / |/| | |
* | | | Merge pull request #696 from yuriks/interface-deinlinebunnei2015-04-153-50/+49
|\ \ \ \
| * | | | De-inline functions from Interface, removing them from service.hYuri Kunde Schlesner2015-04-143-50/+49
| | |/ / | |/| |
* | | | Core_ARM11: Replace debug prints with our own logging functions in vfpsingle.Emmanuel Gil Peyrot2015-04-142-39/+36
* | | | citra-qt: Use std::abs() to get the right absolute function for s64.Emmanuel Gil Peyrot2015-04-141-1/+2
* | | | Kernel: Use the correct format string for u64 hex.Emmanuel Gil Peyrot2015-04-141-1/+1
* | | | Headers: Add some forgotten overrides, thanks clang!Emmanuel Gil Peyrot2015-04-144-4/+4
|/ / /
* | | SVC: Assert on unsupported CreateThread processor ID.bunnei2015-04-101-3/+9
* | | SVC: Update various SVCs to cause a reschedule.bunnei2015-04-102-6/+22
* | | Kernel: Implemented priority inheritance for mutexes.bunnei2015-04-103-4/+22
* | | Thread: Implement priority boost for starved threads.bunnei2015-04-105-28/+92
* | | SVC: Reschedule on svcCreateThread.bunnei2015-04-101-0/+2
* | | APT: (Subv) Fix bug where start event was being incorrectly signaled.bunnei2015-04-101-6/+7
* | | Kernel: Fixed default thread priority.bunnei2015-04-102-5/+4
* | | Initialize base address to 0x0Gareth Higgins2015-04-091-0/+1
|/ /
* | Merge pull request #689 from lioncash/formatTony Wasserka2015-04-081-1/+1
|\ \
| * | gpu: Fix a missing format specifierLioncash2015-04-071-1/+1
* | | Merge pull request #688 from lioncash/unusedbunnei2015-04-085-50/+30
|\ \ \
| * | | dyncom: Remove unnecessary enum and typedefLioncash2015-04-075-50/+30
| |/ /
* | | Merge pull request #676 from purpasmart96/ir_service_refcbunnei2015-04-0811-59/+188
|\ \ \ | |/ / |/| |
| * | IR: Move The IR services to their own folder and implement "GetHandles"purpasmart962015-04-0411-59/+188
* | | vfp: Make the FPSID values match the MPCoreLioncash2015-04-061-7/+7
* | | vfp: Get rid of the VFP_OFFSET macroLioncash2015-04-065-64/+69
* | | Merge pull request #685 from lioncash/cpregsbunnei2015-04-069-134/+217
|\ \ \
| * | | core: Migrate 3DS-specific CP15 register setting into InitLioncash2015-04-062-8/+5
| * | | arm_interface: Support retrieval/storage to CP15 registersLioncash2015-04-063-0/+25
| * | | Move CP15 enum definitions into their own enum.Lioncash2015-04-065-168/+163
| * | | dyncom: Properly return the value of the user RO thread registerLioncash2015-04-062-4/+10
| * | | dyncom: Set CP15 reset values on initializationLioncash2015-04-061-0/+60
* | | | dyncom: Suppress uninitialized variable warningsLioncash2015-04-061-4/+4
|/ / /
* | | Merge pull request #682 from yuriks/virtmem2bunnei2015-04-063-27/+27
|\ \ \
| * | | Clean-up mem_map constants and fix framebuffer translation errorsYuri Kunde Schlesner2015-04-063-27/+27
* | | | Changed occurences of colour to color for consistencyGareth Higgins2015-04-052-4/+4
|/ / /
* | | Merge pull request #680 from archshift/bg-colorbunnei2015-04-045-1/+32
|\ \ \ | |/ / |/| |
| * | Allow the user to set the background clear color during emulationarchshift2015-04-045-1/+32
* | | Merge pull request #641 from purpasmart96/service_stubsbunnei2015-04-0420-68/+409
|\ \ \ | |/ / |/| |
| * | Services: Stubs and minor changespurpasmart962015-04-0320-68/+409
* | | Merge pull request #677 from lioncash/cp15bunnei2015-04-034-141/+525
|\ \ \
| * | | dyncom: Move CP15 register writing into its own function.Lioncash2015-04-024-88/+265
| * | | dyncom: Move CP15 register reading into its own function.Lioncash2015-04-024-49/+253
| * | | dyncom: Migrate InAPrivilegedMode to armsuppLioncash2015-03-263-4/+7
| | |/ | |/|
* | | Merge pull request #678 from lioncash/disasmbunnei2015-04-011-2/+1
|\ \ \
| * | | callstack: Remove unnecessary disassembler instantiationLioncash2015-03-301-2/+1
| |/ /
* / / disassembler: Get rid of a const_castLioncash2015-03-303-8/+5
|/ /
* | Merge pull request #672 from purpasmart96/citra_moar_app_membunnei2015-03-251-2/+2
|\ \
| * | ConfigMem: Set the app memory to be 96MB instead of the default 64MBpurpasmart962015-03-241-2/+2
| |/
* | Merge pull request #674 from lioncash/sys-instrsbunnei2015-03-251-2/+62
|\ \
| * | dyncom: Implement SRSLioncash2015-03-241-1/+32
| * | dyncom: Implement RFELioncash2015-03-241-1/+30
| |/
* / dyncom: Remove unused/unnecessary macros and macro constantsLioncash2015-03-242-39/+2
|/
* Merge pull request #656 from Subv/nzbunnei2015-03-227-26/+265
|\
| * Service/FS: Document and log some unknown values.Subv2015-03-191-1/+26
| * Services/FS: Implemented DeleteExtSaveData, CreateSystemSaveData and DeleteSystemSaveDataSubv2015-03-147-26/+240
* | armmmu: Remove unnecessary enum valuesLioncash2015-03-211-30/+20
* | Merge pull request #659 from lioncash/setendbunnei2015-03-207-83/+240
|\ \
| * | dyncom: Make Load/Store instructions support big endianLioncash2015-03-177-82/+205
| * | dyncom: Implement SETENDLioncash2015-03-151-1/+35
* | | Merge pull request #650 from Subv/scalingbunnei2015-03-182-5/+16
|\ \ \
| * | | GPU/DisplayTransfer: Made the scaling bits a single 2bit valueSubv2015-03-162-6/+17
| * | | GPU: Fixed the bit 25 in the display transfer flags.Subv2015-03-102-5/+5
* | | | Merge pull request #655 from purpasmart96/hid_fixesbunnei2015-03-174-12/+72
|\ \ \ \
| * | | | HID: Proper Signal Interrupts for EnableAccelerometer & EnableGyroscopeLow alongpurpasmart962015-03-174-12/+72
| | |_|/ | |/| |
* | | | Merge pull request #660 from purpasmart96/ncch_updatesbunnei2015-03-171-11/+14
|\ \ \ \
| * | | | NCCH: Minor updates to the ncch headerpurpasmart962015-03-151-11/+14
| |/ / /
* | | | Merge pull request #661 from linkmauve/cleanupbunnei2015-03-172-11/+6
|\ \ \ \
| * | | | Common: Fix logic for setting EMU_DATA_DIR.Emmanuel Gil Peyrot2015-03-161-6/+5
| * | | | Common: Make a #else more apparent.Emmanuel Gil Peyrot2015-03-161-5/+1
* | | | | Merge pull request #652 from neobrain/shader_output_fixbunnei2015-03-161-20/+24
|\ \ \ \ \
| * | | | | Pica/VertexShader: Fix a bug caused due to incorrect assumptions of consecutive output register tables.Tony Wasserka2015-03-121-20/+24
| | |/ / / | |/| | |
* | | | | Merge pull request #662 from linkmauve/video_core-warningsbunnei2015-03-162-4/+4
|\ \ \ \ \
| * | | | | VideoCore: Add static_cast around expressions where the compiler doesn’t deduce the right type.Emmanuel Gil Peyrot2015-03-162-4/+4
| | |/ / / | |/| | |
* / | | | arm_interface: Get rid of GetTicks.Lioncash2015-03-165-17/+6
|/ / / /
* | | | Merge pull request #657 from Subv/flipbunnei2015-03-152-6/+15
|\ \ \ \
| * | | | GPU: Implemented the flip_data (bit 0) bit in display transfers.Subv2015-03-142-6/+15
| |/ / /
* / / / EmuWindow: Fixed a reference to a temporary variableSubv2015-03-141-1/+1
|/ / /
* | | Merge pull request #642 from bunnei/touchpadbunnei2015-03-1210-159/+296
|\ \ \ | |_|/ |/| |
| * | hid_user: Removed unnecessary includes.bunnei2015-03-111-2/+0
| * | HID: Removed unnecessary global variables.bunnei2015-03-112-58/+42
| * | HID: Added additional variable comments and some code cleanups.bunnei2015-03-112-20/+29
| * | HID: Complete refactor of pad/touch input to fix threading issues.bunnei2015-03-117-204/+109
| * | EmuWindow: Made pad/touch functions non-static.bunnei2015-03-103-24/+20
| * | HID: Cleanup how `next_touch_index` is calculated for Pad and touch.bunnei2015-03-101-2/+2
| * | HID: Changed TouchDataEntry `valid` to a BitField and added some doc strings.bunnei2015-03-102-4/+4
| * | HID: Added static asserts to check register position in shared memory.bunnei2015-03-101-2/+16
| * | Qt: Implemented EmuWindow touchpad support.bunnei2015-03-102-0/+29
| * | GLFW: Implemented EmuWindow touchpad support.bunnei2015-03-102-0/+26
| * | EmuWindow: Added infrastructure code to enable touchpad support.bunnei2015-03-102-1/+93
| * | HID: Added functions to emulate the touchpad.bunnei2015-03-102-0/+61
| * | HID: Moved some docstrings to the header.bunnei2015-03-102-24/+16
| * | HID: Refactored shared memory decoding for touchpad support.bunnei2015-03-102-33/+64
* | | Merge pull request #629 from archshift/lcdfbbunnei2015-03-1012-52/+282
|\ \ \ | |/ / |/| |
| * | Added LCD registers, and implementation for color filling in OGL code.archshift2015-03-0911-37/+234
| * | Implement SetLcdForceBlack, move register enum to hw.harchshift2015-03-064-36/+69
* | | dyncom: Minor cleanupLioncash2015-03-101-26/+7
| |/ |/|
* | Merge pull request #643 from Subv/dem_feelsbunnei2015-03-105-20/+202
|\ \
| * | GPU: Added the stencil test structure to the Pica Regs struct.Subv2015-03-107-61/+76
| * | Frontend/Qt: Allow the framebuffer widget to inspect the depth bufferSubv2015-03-102-5/+66
| * | GPU: Implemented more depth buffer formats.Subv2015-03-105-14/+120
* | | Merge pull request #647 from neobrain/rip_culling_hackbunnei2015-03-101-6/+3
|\ \ \
| * | | Pica/PrimitiveAssembly: Fix triangle strips and fans being generated with incorrect winding order.Tony Wasserka2015-03-091-6/+3
* | | | Merge pull request #648 from Subv/fill_bitTony Wasserka2015-03-091-1/+1
|\ \ \ \
| * | | | GPU: Use the correct position for the finished bit in memory fillsSubv2015-03-091-1/+1
* | | | | Merge pull request #646 from Subv/24bit_fillsTony Wasserka2015-03-092-5/+5
|\ \ \ \ \ | |_|/ / / |/| | | |
| * | | | GPU: Corrected the 24 bit memory fills component orderSubv2015-03-092-5/+5
| |/ / /
* | | | Merge pull request #589 from kevinhartman/config-errorsbunnei2015-03-091-5/+10
|\ \ \ \
| * | | | Fix error message for bad config block request.Kevin Hartman2015-02-211-5/+10
* | | | | Merge pull request #634 from linkmauve/logging-performancesbunnei2015-03-097-9/+21
|\ \ \ \ \
| * | | | | Logging: check for filter before sending to the queue, to skip all heavy formatting on the other thread.Emmanuel Gil Peyrot2015-03-067-9/+21
* | | | | | Merge pull request #645 from lioncash/ldmbunnei2015-03-091-20/+19
|\ \ \ \ \ \
| * | | | | | dyncom: Fix an indexing bug in STMLioncash2015-03-091-5/+4
| * | | | | | dyncom: General cleanup of STMLioncash2015-03-091-16/+14
| * | | | | | dyncom: Increment addr when accessing LR in LDMLioncash2015-03-091-0/+2
* | | | | | | Merge pull request #644 from archshift/nihstrobunnei2015-03-092-57/+59
|\ \ \ \ \ \ \
| * | | | | | | Update nihstro submodule to the initial release version.archshift2015-03-082-57/+59
| |/ / / / / /
* | | | | | | Merge pull request #584 from yuriks/outline-assertsbunnei2015-03-091-6/+25
|\ \ \ \ \ \ \ | |/ / / / / / |/| | | | | |
| * | | | | | Asserts: Use lambdas to keep assertion code away from the main code pathYuri Kunde Schlesner2015-02-181-6/+25
* | | | | | | Merge pull request #639 from archshift/appbundlearchshift2015-03-081-1/+5
|\ \ \ \ \ \ \
| * | | | | | | Build app bundles on OS X. Fixes the issue where the menubar would not appear.archshift2015-03-081-1/+5
* | | | | | | | default_ini.h: Put comments on their own linesarchshift2015-03-081-4/+15
|/ / / / / / /
* | | | | | | Fixed EmuWindow typo (fixes OSX build)bunnei2015-03-082-2/+2
* | | | | | | Merge pull request #636 from bunnei/refactor-screen-winbunnei2015-03-087-60/+88
|\ \ \ \ \ \ \ | |_|_|_|_|/ / |/| | | | | |
| * | | | | | Set framebuffer layout from EmuWindow.bunnei2015-03-077-60/+88
| | |_|_|_|/ | |/| | | |
* | | | | | GPU/Textures: Fixed ETC texture decoding.Subv2015-03-071-1/+1
| |_|_|_|/ |/| | | |
* | | | | Merge pull request #538 from yuriks/perf-statTony Wasserka2015-03-0716-0/+798
|\ \ \ \ \ | |_|_|/ / |/| | | |
| * | | | Profiler: Implement QPCClock to get better precision on Win32Yuri Kunde Schlesner2015-03-022-1/+42
| * | | | Add profiling infrastructure and widgetYuri Kunde Schlesner2015-03-0216-0/+757
* | | | | Removed swap code redundancy and moved common swap code to swap.harchshift2015-03-063-127/+97
| |/ / / |/| | |
* | | | Merge pull request #615 from Subv/servicesbunnei2015-03-0540-1110/+1202
|\ \ \ \
| * | | | Services: Moved the PTM and APT services to their own folderSubv2015-03-0440-1110/+1202
* | | | | Merge pull request #625 from lioncash/warnbunnei2015-03-042-4/+4
|\ \ \ \ \
| * | | | | vfp: Get rid of warningsLioncash2015-03-042-4/+4
* | | | | | GPU: Added RGB565/RGB8 framebuffer support and various cleanups.bunnei2015-03-049-194/+213
| |/ / / / |/| | | |
* | | | | Merge pull request #622 from Subv/titlesYuri Kunde Schlesner2015-03-021-8/+45
|\ \ \ \ \
| * | | | | Services/AM: Stubbed TitleIDListGetTotal and GetTitleIDList.Subv2015-03-021-8/+45
* | | | | | Merge pull request #623 from Subv/cardbunnei2015-03-021-1/+25
|\ \ \ \ \ \
| * | | | | | Services/FS: Stubbed CardSlotIsInserted to always return falseSubv2015-03-011-1/+25
| |/ / / / /
* | | | | | Merge pull request #618 from lioncash/refbunnei2015-03-021-2/+2
|\ \ \ \ \ \ | |_|/ / / / |/| | | | |
| * | | | | result: Make comparison operators take referencesLioncash2015-02-281-2/+2
| |/ / / /
* | | | | Merge pull request #621 from Subv/powerbunnei2015-03-021-1/+13
|\ \ \ \ \ | |_|/ / / |/| | | |
| * | | | Services/PTM: Stubbed PTM_Sysm::IsLegacyPowerOff.Subv2015-03-011-1/+13
| |/ / /
* | | | Merge pull request #616 from archshift/5551archshift2015-02-284-3/+42
|\ \ \ \
| * | | | Added RGBA5551 compatibility in the rasterizerarchshift2015-02-284-3/+42
| |/ / /
* | | | Merge pull request #620 from lioncash/bkptbunnei2015-02-281-2/+3
|\ \ \ \
| * | | | arm_disasm: Show conditional code for BKPT instructions.Lioncash2015-02-281-2/+3
| |/ / /
* / / / arm_disasm: Remove unused variableLioncash2015-02-281-2/+1
|/ / /
* | | Merge pull request #599 from Subv/mortonbunnei2015-02-276-83/+171
|\ \ \
| * | | GPU: Implemented bits 3 and 1 from the display transfer flags.Subv2015-02-276-83/+171
* | | | arm: The CP15 Main ID register is not writeableLioncash2015-02-261-3/+1
|/ / /
* | | Video core: Fix A4 texture decodingYuri Kunde Schlesner2015-02-261-2/+2
* | | Merge pull request #604 from Subv/arc_ssdYuri Kunde Schlesner2015-02-264-45/+70
|\ \ \
| * | | Archives: Properly implemented the SystemSaveData archive.Subv2015-02-264-45/+70
* | | | Video core: Fix pixelation/blockiness in textures.Yuri Kunde Schlesner2015-02-261-3/+3
* | | | Merge pull request #575 from linkmauve/xdgbunnei2015-02-252-10/+69
|\ \ \ \
| * | | | Common: Switch to the XDG Base Directory Specification for directory selection.Emmanuel Gil Peyrot2015-02-252-10/+69
* | | | | arm: Remove unnecessary booleansLioncash2015-02-252-22/+5
|/ / / /
* | | | Merge pull request #601 from Subv/y2rbunnei2015-02-251-1/+18
|\ \ \ \
| * | | | Services: Implemented Y2R_U::GetTransferEndEventSubv2015-02-241-1/+18
| |/ / /
* / / / Rasterizer: Add support for RGBA4 framebuffer format.bunnei2015-02-251-0/+21
|/ / /
* | | Merge pull request #595 from linkmauve/new-3ds-inputbunnei2015-02-247-13/+82
|\ \ \
| * | | Frontends, HID: Add New 3DS specific pad buttons, and stub the touch one.Emmanuel Gil Peyrot2015-02-227-13/+82
* | | | Merge pull request #581 from archshift/tfebunnei2015-02-234-3/+166
|\ \ \ \
| * | | | Added information reporting from ThrowFatalErrorarchshift2015-02-224-3/+166
* | | | | GPU: Fixed RGBA8 as output format in a display transfer.Subv2015-02-221-8/+7
* | | | | Merge pull request #471 from archshift/pp3ports3bunnei2015-02-221-0/+37
|\ \ \ \ \
| * | | | | GPU: Add support for more framebuffer formats in display transfers.Tony Wasserka2015-02-221-0/+37
* | | | | | Rasterize with the correct color component order.bunnei2015-02-221-11/+24
* | | | | | Merge pull request #596 from kevinhartman/unaligned-cleanupbunnei2015-02-222-35/+2
|\ \ \ \ \ \
| * | | | | | Cleaned up unaligned access.Kevin Hartman2015-02-222-35/+2
| | |_|_|_|/ | |/| | | |
* | | | | | Merge pull request #594 from Subv/display_transferbunnei2015-02-221-8/+6
|\ \ \ \ \ \
| * | | | | | GPU: Fixed the RGBA8 input format and RGB8 output formatSubv2015-02-221-8/+6
| |/ / / / /
* | | | | | Merge pull request #593 from Subv/search_problemTony Wasserka2015-02-221-1/+4
|\ \ \ \ \ \ | |_|_|_|/ / |/| | | | |
| * | | | | Pica/VertexShader: Fixed LOOP with more than one iteration.Subv2015-02-211-1/+4
| |/ / / /
* | | | | Common: Change names containing “Dolphin” or “PPSSPP” to something more generic.Emmanuel Gil Peyrot2015-02-202-8/+8
* | | | | Merge pull request #588 from archshift/somebranchbunnei2015-02-2019-1422/+47
|\ \ \ \ \ | |/ / / / |/| | | |
| * | | | Misc cleanup of common and related functionsarchshift2015-02-204-81/+31
| * | | | Remove duplication of INSERT_PADDING_WORDS between pica.h and gpu.harchshift2015-02-204-25/+3
| * | | | Remove "super lame/broken" file_search compilation unit that was leftover from Dolphinarchshift2015-02-193-128/+0
| * | | | Remove redundant utf8 compilation unit that was leftover from Dolphinarchshift2015-02-193-528/+0
| * | | | Remove useless extended_trace compilation unit that was leftover from Dolphinarchshift2015-02-193-480/+0