summaryrefslogtreecommitdiffstats
path: root/src (follow)
Commit message (Collapse)AuthorAgeFilesLines
* arm: Implement native code execution backendLiam2023-11-2530-47/+1799
|
* device_memory: Enable direct mapped addresses for nceGPUCode2023-11-255-8/+21
|
* settings: Add cpu backend settingGPUCode2023-11-253-0/+17
|
* kernel: Manually specify aslr region startLiam2023-11-258-18/+25
|
* core: Respect memory permissions in MapGPUCode2023-11-256-58/+117
|
* host_memory: Switch to FreeRegionManagerLiam2023-11-252-29/+67
|
* host_memory: ensure map base is between 36 and 39 bitsLiam2023-11-251-2/+58
|
* common: Add free region manager--author=Liam2023-11-252-0/+56
| | | | * Abstraction for placeholder region tracking in host_memory
* common: Add libc sigaction hookGPUCode2023-11-253-0/+68
|
* Merge pull request #11889 from t895/ini-libCharles Lombardo2023-11-2562-3492/+2690
|\ | | | | configuration: Unify config handling across frontends
| * frontend_common: Don't specify default value for screenshot_patht8952023-11-231-2/+1
| |
| * frontend_common: Don't load config files that we fail to opent8952023-11-231-0/+10
| |
| * frontend_common: Add option to read unsigned integerst8952023-11-223-2/+34
| |
| * frontend_common: Set config array size to 0 if the array is ended without changing its indext8952023-11-211-4/+8
| |
| * frontend_common: Manually handle opening config filet8952023-11-211-2/+31
| | | | | | | | SimpleIni only has the ability to use ANSI strings for config paths so this breaks opening configs on paths with special characters. This ensures that we open the right path on each platform.
| * frontend_common: Add special config case for unmapped windows network drivest8952023-11-211-1/+9
| | | | | | | | Normally we save paths with '/' as the delimiter for each segment but when you manually select a network drive instead of using a mapped location, this would break. This ensures that if the read filesystem location starts with '//', we keep that pattern.
| * frontend_common: Disable UTF-8 BOM in configt8952023-11-211-1/+1
| |
| * android: Rework config lifecyclet8952023-11-216-6/+31
| | | | | | | | Exposes options for initializing, unloading, reloading, and saving settings that let us update the config much more granularly based on what's happening in the UI.
| * android: Remove ini4jt8952023-11-212-43/+0
| |
| * common: settings: Add ifdefs to define android's default settingst8952023-11-211-6/+36
| |
| * general: Remove iniht8952023-11-212-2/+2
| |
| * config: Unify config handling under frontend_commont8952023-11-2153-3435/+2539
| | | | | | | | | | | | Replaces every way of handling config for each frontend with SimpleIni. frontend_common's Config class is at the center where it saves and loads all of the cross-platform settings and provides a set of pure virtual functions for platform specific settings. As a result of making config handling platform specific, several parts had to be moved to each platform's own config class or to other parts. Default keys were put in platform specific config classes and translatable strings for Qt were moved to shared_translation. Default hotkeys, default_theme, window geometry, and qt metatypes were moved to uisettings. Additionally, to reduce dependence on Qt, QStrings were converted to std::strings where applicable.
* | Merge pull request #12140 from liamwhite/qcr-unreachableliamwhite2023-11-241-1/+1
|\ \ | | | | | | query_cache: demote report synced unreachable to assert
| * | query_cache: demote report synced unreachable to assertLiam2023-11-231-1/+1
| | |
* | | Merge pull request #12076 from german77/resourceliamwhite2023-11-2336-1415/+1625
|\ \ \ | |/ / |/| | service: hid: Create appropriate hid resources
| * | service: hid: Create appropriate hid resourcesNarr the Reg2023-11-2136-1415/+1625
| |/
* | game_list_worker: Explicit caputure of 'this'Merry2023-11-211-1/+1
| |
* | shared_widget: Explicit capture of 'this'Merry2023-11-211-2/+2
| |
* | Merge pull request #12107 from daisymlleung/patch-1liamwhite2023-11-211-1/+12
|\ \ | | | | | | Stub CheckBlockedUserListAvailability for Super Bomberman R 2
| * | Stub CheckBlockedUserListAvailabilitydaisymlleung2023-11-201-1/+12
| | |
* | | Merge pull request #12045 from liamwhite/codec-refactorliamwhite2023-11-2111-374/+705
|\ \ \ | | | | | | | | video_core: refactor video frame and packet parsing
| * | | video_core: refactor video frame and packet parsingLiam2023-11-1611-374/+705
| | | |
* | | | Merge pull request #11984 from lat9nq/lupdateliamwhite2023-11-212-258/+310
|\ \ \ \ | |_|_|/ |/| | | shared_translation: Call tr more directly
| * | | CMakeLists: Add option to call lupdate directlylat9nq2023-11-081-9/+42
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | qt_create_translation silently fails to run at all on my system. Since there is no error, I was unable to determine a fix. This sidesteps the convenience function by setting up the rules ourselves. This is left as an option since this path likely does not work on Windows.
| * | | shared_translation: Call tr for each stringlat9nq2023-11-081-249/+268
| | | | | | | | | | | | | | | | | | | | | | | | | | | | Qt can't parse tr called within a macro, so we must call it on each string. shared_translation: Remove redundant include
* | | | Merge pull request #12011 from Macj0rdan/controller-appletNarr the Reg2023-11-2016-89/+594
|\ \ \ \ | |_|_|/ |/| | | Implemented qlaunch version of the controller applet
| * | | Implemented qlaunch version of the controller appletFrozenAra2023-11-1916-89/+594
| | | |
* | | | Merge pull request #12093 from t895/zip-intentliamwhite2023-11-203-72/+33
|\ \ \ \ | | | | | | | | | | android: Use file picker intent for save exporter
| * | | | android: Use file picker intent for save exportert8952023-11-193-72/+33
| | | | |
* | | | | Merge pull request #12092 from t895/recent-games-defaultliamwhite2023-11-202-2/+3
|\ \ \ \ \ | | | | | | | | | | | | android: Select recently played games by default in search tab
| * | | | | android: Use path instead of programId for recently added / played keyt8952023-11-191-2/+2
| | | | | |
| * | | | | android: Select recently played games by default in search tabt8952023-11-191-0/+1
| |/ / / /
* | | | | Merge pull request #12091 from t895/silly-speedliamwhite2023-11-201-1/+1
|\ \ \ \ \ | | | | | | | | | | | | android: Allow up to 400% for the limit speed percent setting
| * | | | | android: Allow up to 400% for the limit speed percent settingt8952023-11-191-1/+1
| |/ / / /
* / / / / service: hid: Ensure resource manager is initializedSquall-Leonhart2023-11-201-1/+1
|/ / / / | | | | | | | | | | | | | | | | | | | | Ensures the proper initialization of the IActiveVibrationDeviceList. By using GetResourceManager() instead of resource_manager, we make sure that the IActiveVibrationDeviceListis initialized before it's used, preventing potential null issues. Fixes #12088
* | | | Merge pull request #12083 from liamwhite/viewportliamwhite2023-11-195-1/+11
|\ \ \ \ | | | | | | | | | | renderer_vulkan: ignore viewport stores on non-supporting drivers
| * | | | renderer_vulkan: ignore viewport stores on non-supporting driversLiam2023-11-195-1/+11
| | | | |
* | | | | qt: fix linux buildLiam2023-11-191-0/+3
|/ / / /
* | | | Merge pull request #12081 from FernandoS27/check-out-on-your-broke-crypto-friendsliamwhite2023-11-193-5/+31
|\ \ \ \ | | | | | | | | | | Vulkan: Be more generous with pipeline workers for Android
| * | | | Vulkan: Be more generous with pipeline workers for AndroidFernando Sahmkow2023-11-193-5/+31
| | | | |
* | | | | Merge pull request #12036 from FernandoS27/you-should-have-more-than-one-towelliamwhite2023-11-191-0/+13
|\ \ \ \ \ | | | | | | | | | | | | Query Cache: Disable write syncing on Android
| * | | | | Query Cache: Disable write syncing on AndroidFernando Sahmkow2023-11-151-0/+13
| | | | | |
* | | | | | Merge pull request #11792 from boludoz/new-shortcutliamwhite2023-11-195-208/+259
|\ \ \ \ \ \ | | | | | | | | | | | | | | Improved shortcut: add games in applist for Windows, question for sta…
| * | | | | | Fix out_icon_path = Common::FS::GetYuzuPath(Common::FS::YuzuPath::IconsDir);Franco M2023-11-091-1/+1
| | | | | | |
| * | | | | | Minor changesFranco M2023-11-091-2/+2
| | | | | | |
| * | | | | | Final change, i thinkFranco M2023-11-081-6/+5
| | | | | | |
| * | | | | | Fixed clangFranco M2023-11-071-2/+3
| | | | | | |
| * | | | | | modified: src/yuzu/main.cppFranco M2023-11-051-66/+7
| | | | | | |
| * | | | | | Merge branch 'master' into new-shortcutFranco M2023-11-05166-2990/+7647
| |\ \ \ \ \ \ | | | |_|_|/ / | | |/| | | |
| * | | | | | We dont need thatboludoz2023-10-271-15/+19
| | | | | | |
| * | | | | | Merge branch 'yuzu-emu:master' into new-shortcutFranco M2023-10-2731-107/+493
| |\ \ \ \ \ \
| * \ \ \ \ \ \ Merge branch 'yuzu-emu:master' into new-shortcutFranco M2023-10-2133-289/+588
| |\ \ \ \ \ \ \
| * | | | | | | | Reverted dirty code in main.boludoz2023-10-192-9/+2
| | | | | | | | |
| * | | | | | | | TODO: Implement shortcut creation for Apple.boludoz2023-10-183-2/+15
| | | | | | | | |
| * | | | | | | | Useless code removed related to admin privileges, if it is not an error we can add it later, that is what git is for.boludoz2023-10-182-7/+0
| | | | | | | | |
| * | | | | | | | Deleted admin requisite (maybe it was another mistake).boludoz2023-10-181-7/+1
| | | | | | | | |
| * | | | | | | | Merge branch 'yuzu-emu:master' into new-shortcutFranco M2023-10-1819-99/+120
| |\ \ \ \ \ \ \ \
| * | | | | | | | | Final refactorizationboludoz2023-10-171-86/+45
| | | | | | | | | |
| * | | | | | | | | Merge branch 'yuzu-emu:master' into new-shortcutFranco M2023-10-176-8/+91
| |\ \ \ \ \ \ \ \ \
| * | | | | | | | | | Moved check.boludoz2023-10-171-6/+8
| | | | | | | | | | |
| * | | | | | | | | | More @liamwhite suggestions applied.boludoz2023-10-172-122/+90
| | | | | | | | | | |
| * | | | | | | | | | shortcut_stream.close(); fixedboludoz2023-10-161-1/+1
| | | | | | | | | | |
| * | | | | | | | | | Comment using fmt instead qt.boludoz2023-10-161-2/+1
| | | | | | | | | | |
| * | | | | | | | | | .clear() instead = ""; and switch improved.boludoz2023-10-161-16/+8
| | | | | | | | | | |
| * | | | | | | | | | More missed suggestionsboludoz2023-10-161-6/+2
| | | | | | | | | | |
| * | | | | | | | | | Sugestions and fixes.boludoz2023-10-163-54/+56
| | | | | | | | | | |
| * | | | | | | | | | Merge branch 'new-shortcut' of https://github.com/boludoz/yuzu into new-shortcutboludoz2023-10-162-10/+1
| |\ \ \ \ \ \ \ \ \ \
| | * \ \ \ \ \ \ \ \ \ Merge branch 'yuzu-emu:master' into new-shortcutFranco M2023-10-162-10/+1
| | |\ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | Some improvements (suggestions)boludoz2023-10-163-91/+79
| |/ / / / / / / / / / /
| * | | | | | | | | | | Less code, simpler, better.boludoz2023-10-163-82/+15
| | | | | | | | | | | |
| * | | | | | | | | | | Typing and formatting errors fixed.boludoz2023-10-166-54/+43
| | | | | | | | | | | |
| * | | | | | | | | | | Unnecessary feature removedboludoz2023-10-154-99/+5
| | | | | | | | | | | |
| * | | | | | | | | | | Fixes and improvementsboludoz2023-10-153-11/+30
| | | | | | | | | | | |
| * | | | | | | | | | | Improved shortcut: add games in applist for Windows, question for start game at fullscreen & better unicode support for some Windows path funcs.boludoz2023-10-159-215/+515
| | | | | | | | | | | |
* | | | | | | | | | | | Merge pull request #12066 from ameerj/nvidia-nsanityliamwhite2023-11-194-0/+82
|\ \ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | | | shader_recompiler: add byteswap pattern workaround for Nvidia
| * | | | | | | | | | | | shader_recompiler: add byteswap pattern workaround for NvidiaAmeer J2023-11-184-0/+82
| | | | | | | | | | | | |
* | | | | | | | | | | | | Merge pull request #12068 from ameerj/glasm-xfb-fixesliamwhite2023-11-192-1/+6
|\ \ \ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | | | | | gl_graphics_pipeline: GLASM: Fix transform feedback attribs buffer mode
| * | | | | | | | | | | | | gl_graphics_pipeline: GLASM: Fix transform feedback attribs buffer modeAmeer J2023-11-182-1/+6
| |/ / / / / / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | GL_SEPARATE_ATTRIBS only applies when multiple buffers are being used, else GL_INTERLEAVED_ATTRIBS handles the cases for a single buffer with potentially more than one attribute
* | | | | | | | | | / / / Buffer Cache: Eliminate clears on Indirect buffersFernando Sahmkow2023-11-182-6/+1
| |_|_|_|_|_|_|_|_|/ / / |/| | | | | | | | | | |
* | | | | | | | | | | | shader_recompiler: Fix spelling of "derivate" (#12067)Ameer J2023-11-1810-60/+61
| | | | | | | | | | | |
* | | | | | | | | | | | Merge pull request #12058 from liamwhite/opus-againliamwhite2023-11-182-2/+2
|\ \ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | | | opus: fix stereo stream count check in multistream decoder object
| * | | | | | | | | | | | opus: fix stereo stream count check in multistream decoder objectLiam2023-11-172-2/+2
| | |_|_|_|_|_|_|_|_|/ / | |/| | | | | | | | | |
* | | | | | | | | | | | Merge pull request #11912 from liamwhite/nv-graphic-bufferliamwhite2023-11-1812-37/+71
|\ \ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | | | nvnflinger: use graphic buffer lifetime for map handle
| * | | | | | | | | | | | nvnflinger: use graphic buffer lifetime for map handleLiam2023-10-3012-37/+71
| | | | | | | | | | | | |
* | | | | | | | | | | | | Merge pull request #11917 from liamwhite/abandonmentliamwhite2023-11-188-21/+60
|\ \ \ \ \ \ \ \ \ \ \ \ \ | |_|/ / / / / / / / / / / |/| | | | | | | | | | | | nvnflinger: implement consumer abandonment
| * | | | | | | | | | | | nvnflinger: implement consumer abandonmentLiam2023-10-308-21/+60
| | | | | | | | | | | | |
* | | | | | | | | | | | | service: hid: Introduce firmware settings and update activate controller callsNarr the Reg2023-11-1712-54/+295
| |_|/ / / / / / / / / / |/| | | | | | | | | | |
* | | | | | | | | | | | service: hid: Implement xpad callsNarr the Reg2023-11-162-36/+139
| | | | | | | | | | | |
* | | | | | | | | | | | Merge pull request #11995 from FernandoS27/you-dont-need-the-new-iphoneliamwhite2023-11-166-30/+32
|\ \ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | | | Revert PR #11806 and do a proper fix to the memory handling.
| * | | | | | | | | | | | Memory: Fix invalidation handling from the CPU/ServicesFernando Sahmkow2023-11-123-7/+22
| | | | | | | | | | | | |
| * | | | | | | | | | | | Revert "renderer_vulkan: add locks to avoid scheduler flushes from CPU"Fernando Sahmkow2023-11-104-23/+10
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This reverts commit d9dde7e6f3a90f58d642808900ddd558da21f762.
* | | | | | | | | | | | | Merge pull request #12038 from german77/no_implementliamwhite2023-11-1617-3070/+3276
|\ \ \ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | | | | | service: hid: Split hid.cpp into individual interfaces
| * | | | | | | | | | | | | service: hid: Split hid.cpp into individual interfacesNarr the Reg2023-11-1517-3070/+3276
| | | | | | | | | | | | | |
* | | | | | | | | | | | | | Merge pull request #12007 from german77/moar_buttonsliamwhite2023-11-1613-185/+382
|\ \ \ \ \ \ \ \ \ \ \ \ \ \ | |_|_|_|_|_|_|_|_|_|_|_|_|/ |/| | | | | | | | | | | | | core: hid: Split SL and SR buttons
| * | | | | | | | | | | | | core: hid: Split SL and SR buttonsgerman772023-11-1213-185/+382
| | |_|_|_|_|_|_|_|_|_|_|/ | |/| | | | | | | | | | |
* | | | | | | | | | | | | android: Disable PiP by defaultt8952023-11-151-1/+1
| | | | | | | | | | | | |
* | | | | | | | | | | | | Merge pull request #12034 from t895/fps-outlineliamwhite2023-11-151-2/+3
|\ \ \ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | | | | | android: Add drop shadow to FPS counter
| * | | | | | | | | | | | | android: Add drop shadow to FPS countert8952023-11-141-2/+3
| | |/ / / / / / / / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Also let the style control the text size
* / | | | | | | | | | | | android: Don't enter PiP during startup or shutdownt8952023-11-151-1/+3
|/ / / / / / / / / / / /
* | | | | | | | | | | | Merge pull request #12032 from liamwhite/fruit-compilerliamwhite2023-11-141-2/+2
|\ \ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | | | fix apple clang build again
| * | | | | | | | | | | | fix apple clang build againLiam2023-11-141-2/+2
| | | | | | | | | | | | |
* | | | | | | | | | | | | Merge pull request #12030 from t895/blocking-fixliamwhite2023-11-142-24/+35
|\ \ \ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | | | | | android: Use suspend function for creating dynamic shortcuts
| * | | | | | | | | | | | | android: Use suspend function for creating dynamic shortcutst8952023-11-142-24/+35
| |/ / / / / / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | If the coil loader ever got stuck when creating a dynamic shortcut icon, the app would freeze. This would happen most notably when booting nca format games. This pushes that process to a separate coroutine that can be cancelled by the main activity's lifecycle.
* | | | | | | | | | | | | Merge pull request #12028 from liamwhite/coretiming-shutdownliamwhite2023-11-142-1/+3
|\ \ \ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | | | | | core_timing: lock event queue access
| * | | | | | | | | | | | | core_timing: lock event queue accessLiam2023-11-142-1/+3
| |/ / / / / / / / / / / /
* | | | | | | | | | | | | Merge pull request #12025 from liamwhite/kernel-shutdown-deadlockliamwhite2023-11-141-8/+8
|\ \ \ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | | | | | core: check for thread dpc before eret
| * | | | | | | | | | | | | core: check for thread dpc before eretLiam2023-11-131-8/+8
| |/ / / / / / / / / / / /
* | | | | | | | | | | | | Merge pull request #12019 from liamwhite/more-shutdown-deadlocksliamwhite2023-11-144-4/+18
|\ \ \ \ \ \ \ \ \ \ \ \ \ | |/ / / / / / / / / / / / |/| | | | | | | | | | | | audio_core: ignore renderer wait when stream is paused
| * | | | | | | | | | | | audio_core: ignore renderer wait when stream is pausedLiam2023-11-134-4/+18
| |/ / / / / / / / / / /
* | | | | | | | | | | | Merge pull request #11990 from german77/audioliamwhite2023-11-137-13/+26
|\ \ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | | | yuzu: Save mute when in background setting
| * | | | | | | | | | | | yuzu: Make mute audio persistentNarr the Reg2023-11-102-7/+7
| | | | | | | | | | | | |
| * | | | | | | | | | | | yuzu: Save mute when in background settingNarr the Reg2023-11-105-6/+19
| | |_|_|_|_|_|_|_|_|_|/ | |/| | | | | | | | | |
* | | | | | | | | | | | Merge pull request #12014 from t895/shrink-logoliamwhite2023-11-135-15/+249
|\ \ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | | | android: Shrink branding images
| * | | | | | | | | | | | android: Add a landscape-specific layout to the about paget8952023-11-121-0/+233
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Moves the logo to the side to fit more information on screen
| * | | | | | | | | | | | android: Shrink logo in about paget8952023-11-121-5/+5
| | | | | | | | | | | | |
| * | | | | | | | | | | | android: Shrink logo in settings tabt8952023-11-122-6/+7
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Adjusts padding between the cards and logo to fit appropriately
| * | | | | | | | | | | | android: Fix top app bar tint being cut off in the about fragmentt8952023-11-121-4/+4
| | |/ / / / / / / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Adjust margin on the toolbar, not the app bar
* | | | | | | | | | | | Merge pull request #12015 from t895/remove-autoliamwhite2023-11-131-2/+0
|\ \ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | | | android: Remove "auto" region option
| * | | | | | | | | | | | android: Remove "auto" region optiont8952023-11-121-2/+0
| |/ / / / / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This doesn't exist and if you clicked it, your region would be set to Taiwan.
* | | | | | | | | | | | android: Use the same transition animation between every fragment in settingst8952023-11-133-28/+4
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The animation that I used for entering search was prone to weird visual bugs and could appear visually jarring. This just makes things appear more consistent.
* | | | | | | | | | | | android: Use more padding on top of each settings headert8952023-11-131-1/+2
| | | | | | | | | | | |
* | | | | | | | | | | | android: Remove dividers between each settingt8952023-11-131-7/+0
| | | | | | | | | | | |
* | | | | | | | | | | | android: Add icons and descriptions to the first-level advanced settings paget8952023-11-1313-47/+165
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Additionally adjusts padding to place the icons in-line with the back button in the top app bar and makes the text for normal settings appear in-line with the expanded top app bar title.
* | | | | | | | | | | | android: Remove general section from settingst8952023-11-132-11/+3
|/ / / / / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Limit speed options were moved to system, cpu accuracy was moved to debug, and PiP was moved to graphics.
* | | | | | | | | | | Merge pull request #11980 from german77/momentliamwhite2023-11-126-17/+169
|\ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | service: irs: Implement moment image processor
| * | | | | | | | | | | service: irs: Implement moment image processorNarr the Reg2023-11-116-17/+169
| | | | | | | | | | | |
* | | | | | | | | | | | Merge pull request #12005 from german77/homebrew_idliamwhite2023-11-121-4/+5
|\ \ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | | | yuzu: Keep homebrew on the recently played list
| * | | | | | | | | | | | yuzu: Keep homebrew on the recently played listgerman772023-11-111-4/+5
| | | | | | | | | | | | |
* | | | | | | | | | | | | Merge pull request #12004 from liamwhite/fix-hblliamwhite2023-11-121-0/+3
|\ \ \ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | | | | | k_capabilities: ignore map region when KTrace is disabled
| * | | | | | | | | | | | | k_capabilities: ignore map region when KTrace is disabledLiam2023-11-111-0/+3
| |/ / / / / / / / / / / /
* | | | | | | | | | | | | Merge pull request #12003 from liamwhite/read-modulesliamwhite2023-11-121-47/+118
|\ \ \ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | | | | | gdbstub: read module information from memory layout
| * | | | | | | | | | | | | gdbstub: read module information from memory layoutLiam2023-11-111-47/+118
| |/ / / / / / / / / / / /
* | | | | | | | | | | | | Merge pull request #11992 from t895/frame-checkliamwhite2023-11-124-4/+13
|\ \ \ \ \ \ \ \ \ \ \ \ \ | |/ / / / / / / / / / / / |/| | | | | | | | | | | | android: Hide loading animation on first frame
| * | | | | | | | | | | | android: Hide loading animation on first framet8952023-11-104-4/+13
| | |_|/ / / / / / / / / | |/| | | | | | | | | |
* | | | | | | | | | | | k_page_table: fix shutdownLiam2023-11-101-7/+0
| | | | | | | | | | | |
* | | | | | | | | | | | k_page_table: use more precise icache invalidatesLiam2023-11-101-4/+9
| | | | | | | | | | | |
* | | | | | | | | | | | kernel: add KPageTableBaseLiam2023-11-1031-4879/+7204
| |/ / / / / / / / / / |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Co-authored-by: Kelebek1 <eeeedddccc@hotmail.co.uk>
* | | | | | | | | | | Allocate resources for test window before getting system infoLucas Reis2023-11-081-0/+1
|/ / / / / / / / / /
* | | | | | | | | | Update CMakeLists.txtSamay Navale2023-11-061-2/+2
| | | | | | | | | |
* | | | | | | | | | Update CMakeLists.txtSamay Navale2023-11-061-5/+5
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Updated Comments for better readability.
* | | | | | | | | | Merge pull request #11896 from liamwhite/cropliamwhite2023-11-064-68/+95
|\ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | renderer_vulkan: fix cropping for presentation
| * | | | | | | | | | renderer_vulkan: fix FSR croppingLiam2023-10-283-70/+86
| | | | | | | | | | |
| * | | | | | | | | | renderer_vulkan: fix cropping for presentationLiam2023-10-282-46/+57
| | |_|_|_|_|_|_|_|/ | |/| | | | | | | |
* | | | | | | | | | Merge pull request #11873 from liamwhite/buffer-controlliamwhite2023-11-0618-428/+407
|\ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | nvdrv: add ioctl command serialization wrapper
| * | | | | | | | | | nvdrv: rework to remove memcpyLiam2023-10-2516-225/+243
| | | | | | | | | | |
| * | | | | | | | | | nvdrv: fix up remaining copy callsLiam2023-10-253-17/+22
| | | | | | | | | | |
| * | | | | | | | | | nvdrv: convert nvmapLiam2023-10-253-60/+26
| | | | | | | | | | |
| * | | | | | | | | | nvdrv: convert codec devicesLiam2023-10-256-34/+29
| | | | | | | | | | |
| * | | | | | | | | | nvdrv: convert nvhost_gpuLiam2023-10-252-76/+49
| | | | | | | | | | |
| * | | | | | | | | | nvdrv: convert nvhost_ctrlLiam2023-10-252-34/+29
| | | | | | | | | | |
| * | | | | | | | | | nvdrv: convert nvhost_ctrl_gpuLiam2023-10-252-97/+43
| | | | | | | | | | |
| * | | | | | | | | | nvdrv: add ioctl command serialization, convert nvhost_as_gpuLiam2023-10-255-71/+152
| | | | | | | | | | |
* | | | | | | | | | | Merge pull request #11972 from t895/fps-counter-adjustmentsliamwhite2023-11-064-38/+11
|\ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | android: FPS counter adjustments
| * | | | | | | | | | | android: Simplify FPS counter paddingCharles Lombardo2023-11-062-24/+5
| | | | | | | | | | | |
| * | | | | | | | | | | android: Color the FPS counter whiteCharles Lombardo2023-11-061-2/+0
| | | | | | | | | | | |
| * | | | | | | | | | | android: Always update FPS counterCharles Lombardo2023-11-043-12/+6
| | | | | | | | | | | |
* | | | | | | | | | | | service: am: Set the correct album program idgerman772023-11-061-2/+2
| | | | | | | | | | | |
* | | | | | | | | | | | renderer_vulkan: render on bottom of surface clip when flipped (#11894)liamwhite2023-11-051-1/+1
| | | | | | | | | | | |
* | | | | | | | | | | | Merge pull request #11957 from liamwhite/null2liamwhite2023-11-051-3/+10
|\ \ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | | | renderer_null: fix
| * | | | | | | | | | | | renderer_null: fixLiam2023-11-041-3/+10
| | | | | | | | | | | | |
* | | | | | | | | | | | | Merge pull request #11969 from german77/profileliamwhite2023-11-052-12/+50
|\ \ \ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | | | | | service: acc: Ensure proper profile size
| * | | | | | | | | | | | | service: acc: Ensure proper profile sizegerman772023-11-052-12/+50
| | |_|_|_|/ / / / / / / / | |/| | | | | | | | | | |
* | | | | | | | | | | | | Merge pull request #11961 from german77/recentliamwhite2023-11-052-4/+31
|\ \ \ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | | | | | yuzu: Only store games in the recently played list
| * | | | | | | | | | | | | yuzu: Only store games in the recently played listgerman772023-11-052-4/+31
| | | | | | | | | | | | | |
* | | | | | | | | | | | | | Merge pull request #11965 from german77/colorliamwhite2023-11-055-16/+42
|\ \ \ \ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | core: hid: Signal color updates
| * | | | | | | | | | | | | | core: hid: Signal color updatesNarr the Reg2023-11-045-16/+42
| | |/ / / / / / / / / / / / | |/| | | | | | | | | | | |
* / | | | | | | | | | | | | Convert files to LF eolKelebek12023-11-0416-884/+884
|/ / / / / / / / / / / / /
* | | | | | | | | | | | | Merge pull request #11952 from liamwhite/opus_stereo_countliamwhite2023-11-042-3/+3
|\ \ \ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | | | | | opus: Allow 0 stereo count
| * | | | | | | | | | | | | Allow 0 stereo countKelebek12023-11-032-3/+3
| |/ / / / / / / / / / / /
* | | | | | | | | | | | | Merge pull request #11960 from german77/silenceliamwhite2023-11-041-7/+5
|\ \ \ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | | | | | service: hid: Silence EnableUnintendedHomeButtonInputProtection
| * | | | | | | | | | | | | service: hid: Silence EnableUnintendedHomeButtonInputProtectiongerman772023-11-041-7/+5
| |/ / / / / / / / / / / /
* | | | | | | | | | | | | Merge pull request #11959 from t895/firmware-reload-fixliamwhite2023-11-045-13/+18
|\ \ \ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | | | | | android: Don't reload log/system after loading firmware/backup
| * | | | | | | | | | | | | android: Don't reload log/system after loading firmware/backupCharles Lombardo2023-11-045-13/+18
| | |_|/ / / / / / / / / / | |/| | | | | | | | | | |
* | | | | | | | | | | | | Merge pull request #11881 from liamwhite/sockets-safe-accessliamwhite2023-11-042-41/+38
|\ \ \ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | | | | | sockets: use safe access helpers
| * | | | | | | | | | | | | sockets: use safe access helpersLiam2023-10-252-41/+38
| | |_|_|/ / / / / / / / / | |/| | | | | | | | | | |
* | | | | | | | | | | | | Merge pull request #11885 from liamwhite/stop-nagging-meliamwhite2023-11-043-8/+9
|\ \ \ \ \ \ \ \ \ \ \ \ \ | |_|/ / / / / / / / / / / |/| | | | | | | | | | | | qt: remove duplicate exit confirmation setting
| * | | | | | | | | | | | qt: remove duplicate exit confirmation settingLiam2023-10-313-8/+9
| | | | | | | | | | | | |
* | | | | | | | | | | | | Merge pull request #11954 from t895/log-hardwareCharles Lombardo2023-11-044-19/+31
|\ \ \ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | | | | | android: Log more system information
| * | | | | | | | | | | | | android: Log more system information during startupCharles Lombardo2023-11-032-0/+14
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Logs device manufacturer/model, SoC manufacturer/model where available, and the total system memory
| * | | | | | | | | | | | | android: Fix fetching system memory size from MemoryUtilCharles Lombardo2023-11-032-19/+17
| | |_|_|/ / / / / / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | We weren't rounding up the value at a unit before (GB, MB, etc) we were rounding up the total bytes and that would do nothing. This fixes that, and the check for total system memory during first emulation start where we tried to check the required system memory against 1 gigabyte.
* / | | | | | | | | | | | arm: NativeClock: Special handling for bad system counter clock frequency reportingCharles Lombardo2023-11-031-1/+20
|/ / / / / / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | On some devices, checking the system counter clock frequency will return 0. Substitute in the correct values to prevent issues.
* | | / / / / / / / / / android: Update surface parameters on emulation startCharles Lombardo2023-11-031-0/+9
| |_|/ / / / / / / / / |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This adds a quick update that notifies the render surface if there was a change between surface creation and emulation starting.
* | | | | | | | | | | Merge pull request #11948 from german77/hard_ringliamwhite2023-11-031-3/+3
|\ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | service: hid: Ensure GetNextEntryIndex can't fail
| * | | | | | | | | | | service: hid: Ensure GetNextEntryIndex can't failgerman772023-11-031-3/+3
| | | | | | | | | | | |
* | | | | | | | | | | | Merge pull request #11947 from german77/batteryliamwhite2023-11-033-15/+20
|\ \ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | | | core: hid: Fix wrong battery values
| * | | | | | | | | | | | core: hid: Fix wrong battery valuesgerman772023-11-033-15/+20
| |/ / / / / / / / / / /
* | | | | | | | | | | | Merge pull request #11943 from liamwhite/silence-logspamliamwhite2023-11-031-1/+5
|\ \ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | | | renderer_vulkan: minimize transform feedback support log
| * | | | | | | | | | | | renderer_vulkan: minimize transform feedback support logLiam2023-11-021-1/+5
| | | | | | | | | | | | |
* | | | | | | | | | | | | Merge pull request #11936 from liamwhite/romfs-nonsenseliamwhite2023-11-034-40/+18
|\ \ \ \ \ \ \ \ \ \ \ \ \ | |/ / / / / / / / / / / / |/| | | | | | | | | | | | romfs: fix extraction of single-directory root
| * | | | | | | | | | | | romfs: fix extraction of single-directory rootLiam2023-11-014-40/+18
| | |/ / / / / / / / / / | |/| | | | | | | | | |
* | | | | | | | | | | | Merge pull request #11942 from t895/log-versionliamwhite2023-11-017-40/+68
|\ \ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | | | android: Adjust log lifecycle
| * | | | | | | | | | | | android: Adjust log lifecycleCharles Lombardo2023-11-014-10/+30
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Now logging will start when the frontend starts like qt does. This also adjusts the share log button to follow where we share the current log if we just returned from a game or return the old log if we haven't started a game yet.
| * | | | | | | | | | | | android: Use yuzu logging systemCharles Lombardo2023-11-014-31/+39
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Now anything that's logged in the frontend will be printed into the log file
* | | | | | | | | | | | | android: Default to player number 0 if we get an input from an unrecognized controllerCharles Lombardo2023-11-011-1/+1
| | | | | | | | | | | | |
* | | | | | | | | | | | | android: Adjust driver manager source stringCharles Lombardo2023-11-011-1/+1
| | | | | | | | | | | | |
* | | | | | | | | | | | | android: Reorganize settings tabCharles Lombardo2023-11-011-33/+33
|/ / / / / / / / / / / /
* | | | | | | | | | | | android: Auto-generate locale configCharles Lombardo2023-11-014-18/+5
| | | | | | | | | | | |
* | | | | | | | | | | | android: Update translations from transifexCharles Lombardo2023-11-0119-687/+3425
| | | | | | | | | | | |
* | | | | | | | | | | | Merge pull request #11931 from t895/applet-launcherliamwhite2023-10-3125-18/+717
|\ \ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | | | android: Applet launcher UI
| * | | | | | | | | | | | android: Initialize filesystem components during application startCharles Lombardo2023-10-312-9/+14
| | | | | | | | | | | | |
| * | | | | | | | | | | | android: Implement applet launcherCharles Lombardo2023-10-3124-9/+703
| |/ / / / / / / / / / /
* | | | | | | | | | | | Merge pull request #11929 from dima-xd/swkbd-appletliamwhite2023-10-312-2/+80
|\ \ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | | | service: am: Add support for LLE Software Keyboard Applet
| * | | | | | | | | | | | service: am: Add support for LLE Software Keyboard AppletDzmitry Dubrova2023-10-312-2/+80
| |/ / / / / / / / / / /
* | | | | | | | | | | | Merge pull request #11925 from t895/controller-fixliamwhite2023-10-313-87/+54
|\ \ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | | | android: Fix controllers stuck on player 2
| * | | | | | | | | | | | android: Reorder controller indexes and only use controllersCharles Lombardo2023-10-312-6/+50
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Before we could ignore controller inputs by forwarding them to player two if a non-controller was connected before and recognized as an input device.
| * | | | | | | | | | | | android: InputHandler: Convert to objectCharles Lombardo2023-10-302-6/+4
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This doesn't need to be an instance of a class because it doesn't hold any data. It's just all helper functions.
| * | | | | | | | | | | | android: Removed unused ControllerMappingHelperCharles Lombardo2023-10-302-75/+0
| | | | | | | | | | | | |
* | | | | | | | | | | | | Merge pull request #11892 from german77/pkm_screenshotliamwhite2023-10-316-17/+82
|\ \ \ \ \ \ \ \ \ \ \ \ \ | |_|/ / / / / / / / / / / |/| | | | | | | | | | | | service: am: Implement ISelfController::SaveCurrentScreenshot
| * | | | | | | | | | | | service: am: Implement ISelfController::SaveCurrentScreenshotNarr the Reg2023-10-276-17/+82
| | |_|_|/ / / / / / / / | |/| | | | | | | | | |
* | | | | | | | | | | | Merge pull request #11922 from t895/simplify-card-layoutliamwhite2023-10-301-27/+18
|\ \ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | | | android: Simplify game card layout
| * | | | | | | | | | | | android: Simplify game card layoutCharles Lombardo2023-10-301-27/+18
| | |_|/ / / / / / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Using a material card view to shape the image was just a waste of a layout pass. A shapeable image view does what we want and does it faster.
* | | | | | | | | | | | Merge pull request #11903 from Macj0rdan/scrollable-volume-buttonliamwhite2023-10-302-2/+53
|\ \ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | | | Implemented wheel event for volume control in VolumeButton
| * | | | | | | | | | | | Implemented wheel event for volume control in VolumeButtonFrozenAra2023-10-292-2/+53
| | |/ / / / / / / / / / | |/| | | | | | | | | |
* | | | | | | | | | | | android: FileUtil: Add option to suppress log for native exists() callsCharles Lombardo2023-10-302-3/+5
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | We often check for the existence of files that only exist in ExeFS so this can spam logcat with useless messages when scanning for games.
* | | | | | | | | | | | android: Fix resolving android URIs in native codeCharles Lombardo2023-10-307-9/+115
| | | | | | | | | | | |
* | | | | | | | | | | | android: Refactor game metadata collection to new fileCharles Lombardo2023-10-3010-102/+154
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This also removes irrelevant data and adds new information from/to the Game data class and RomMetadata struct
* | | | | | | | | | | | android: Use header for EmulationSessionCharles Lombardo2023-10-303-406/+392
| |/ / / / / / / / / / |/| | | | | | | | | |
* | | | | | | | | | | Merge pull request #11920 from Termynat0r/masterliamwhite2023-10-301-3/+3
|\ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | Fix macOS build
| * | | | | | | | | | | Fix macOS buildTermynat0r2023-10-301-3/+3
| | |/ / / / / / / / / | |/| | | | | | | | | | | | | | | | | | | | Added missing preprocessor macros for macOS analog to linux and freebsd
* | | | | | | | | | | Merge pull request #11916 from t895/focus-fixliamwhite2023-10-301-0/+28
|\ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | android: Release touch on input overlay when opening in-game menu
| * | | | | | | | | | | android: Release touch on input overlay when opening in-game menuCharles Lombardo2023-10-301-0/+28
| | |_|_|/ / / / / / / | |/| | | | | | | | |
* | | | | | | | | | | Merge pull request #11915 from t895/startup-freezeliamwhite2023-10-301-16/+23
|\ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | android: Move game deserialization to another thread
| * | | | | | | | | | | android: Move game deserialization to another threadCharles Lombardo2023-10-301-16/+23
| | |_|_|_|/ / / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Deserializing games from the cache in shared preferences was done on the main thread and could cause a stutter on startup.
* | | | | | | | | | | Merge pull request #11910 from liamwhite/surface-lost-on-creationliamwhite2023-10-301-0/+6
|\ \ \ \ \ \ \ \ \ \ \ | |_|_|/ / / / / / / / |/| | | | | | | | | | renderer_vulkan: ensure exception on surface loss
| * | | | | | | | | | renderer_vulkan: ensure exception on surface lossLiam2023-10-291-0/+6
| |/ / / / / / / / /
* | | | | | | | | | Merge pull request #11689 from liamwhite/breakpadliamwhite2023-10-3012-265/+101
|\ \ \ \ \ \ \ \ \ \ | |_|/ / / / / / / / |/| | | | | | | | | qt: implement automatic crash dump support
| * | | | | | | | | qt: implement automatic crash dump supportLiam2023-10-0812-265/+101
| | | | | | | | | |
* | | | | | | | | | Merge pull request #11911 from german77/leak_eventliamwhite2023-10-306-5/+26
|\ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | core: Close all KEvents
| * | | | | | | | | | core: Close all KEventsgerman772023-10-296-5/+26
| | |_|/ / / / / / / | |/| | | | | | | |
* | | | | | | | | | Merge pull request #11909 from t895/card-gridliamwhite2023-10-302-3/+5
|\ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | android: Break home settings into grid with large screens
| * | | | | | | | | | android: Break home settings into grid with large screensCharles Lombardo2023-10-292-3/+5
| | |_|/ / / / / / / | |/| | | | | | | |
* | | | | | | | | | Merge pull request #11904 from ameerj/gl_threaded_opts_onliamwhite2023-10-301-0/+1
|\ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | nvidia_flags: Enable GL Threaded optimizations
| * | | | | | | | | | nvidia_flags: Enable GL Threaded optimizationsAmeer J2023-10-291-0/+1
| | |/ / / / / / / / | |/| | | | | | | |
* | | | | | | | | | Merge pull request #11893 from liamwhite/swizzleliamwhite2023-10-301-1/+1
|\ \ \ \ \ \ \ \ \ \ | |_|/ / / / / / / / |/| | | | | | | | | renderer_vulkan: fix viewport swizzle dirty state tracking
| * | | | | | | | | renderer_vulkan: fix viewport swizzle dirty state trackingLiam2023-10-271-1/+1
| |/ / / / / / / /
* | | | | | | | | Merge pull request #11866 from liamwhite/more-qt-nonsenseliamwhite2023-10-294-61/+112
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | qt: fix game list shutdown crash
| * | | | | | | | | qt: fix game list shutdown crashLiam2023-10-244-61/+112
| | | | | | | | | |
* | | | | | | | | | Merge pull request #11862 from liamwhite/pascal-robustliamwhite2023-10-291-1/+1
|\ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | Manually robust on Pascal and earlier
| * | | | | | | | | | Manually robust on Pascal and earlierLiam2023-10-231-1/+1
| | | | | | | | | | |
* | | | | | | | | | | Merge pull request #11859 from Kelebek1/compute_findbufferliamwhite2023-10-292-6/+9
|\ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | Add missing loop around compute FindBuffer calls
| * | | | | | | | | | | Add missing dowhile loops around FindBuffer callsKelebek12023-10-232-6/+9
| |/ / / / / / / / / /
* | | | | | | | | | | Merge pull request #11852 from german77/async_brrliamwhite2023-10-292-2/+19
|\ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | input_common: joycon: Move vibrations to a queue
| * | | | | | | | | | | input_common: joycon: Move vibrations to a queuegerman772023-10-222-2/+19
| |/ / / / / / / / / /
* | | | | | | | | | | Merge pull request #11843 from liamwhite/sync-processliamwhite2023-10-2939-1021/+1820
|\ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | kernel: update KProcess
| * | | | | | | | | | | kernel: make sure new process is in listLiam2023-10-251-0/+1
| | | | | | | | | | | |
| * | | | | | | | | | | kernel: fix extraneous refLiam2023-10-221-1/+0
| | | | | | | | | | | |
| * | | | | | | | | | | kernel: shutdown app before gpuLiam2023-10-221-1/+1
| | | | | | | | | | | |
| * | | | | | | | | | | kernel: signal thread on termination completedLiam2023-10-221-4/+7
| | | | | | | | | | | |
| * | | | | | | | | | | kernel: add missing TLR clearLiam2023-10-221-0/+1
| | | | | | | | | | | |
| * | | | | | | | | | | kernel: update KProcessLiam2023-10-2239-1016/+1811
| |/ / / / / / / / / /
* | | | | | | | | | | Merge pull request #11827 from liamwhite/preallocatedliamwhite2023-10-292-5/+6
|\ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | nvnflinger: fix reporting and freeing of preallocated buffers
| * | | | | | | | | | | nvnflinger: fix reporting and freeing of preallocated buffersLiam2023-10-202-5/+6
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Co-authored-by: Kelebek1 <eeeedddccc@hotmail.co.uk>
* | | | | | | | | | | | Merge pull request #11803 from flodavid/improve-controller-applet-clickNarr the Reg2023-10-295-40/+87
|\ \ \ \ \ \ \ \ \ \ \ \ | |_|_|_|/ / / / / / / / |/| | | | | | | | | | | yuzu: Improve behavior when clicking on controller box in Controller applet
| * | | | | | | | | | | yuzu: Improve behavior when clicking on controller box in Controller appletflodavid2023-10-175-40/+87
| | |_|_|_|_|/ / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | - Apply changes on Controller configuration of commit 9524d70 to Controller applet - Fix regression of this previous commit: Enabling a controller in its tab did not activate previous controllers Signed-off-by: flodavid <fl.david.53@gmail.com>
* | | | | | | | | | | Merge pull request #11880 from abouvier/unbundle-stbliamwhite2023-10-254-11/+31
|\ \ \ \ \ \ \ \ \ \ \ | |_|_|_|_|_|/ / / / / |/| | | | | | | | | | cmake: prefer system stb headers
| * | | | | | | | | | cmake: prefer system stb headersAlexandre Bouvier2023-10-254-11/+31
| | | | | | | | | | |
* | | | | | | | | | | Merge pull request #11876 from liamwhite/apiversionliamwhite2023-10-251-1/+1
|\ \ \ \ \ \ \ \ \ \ \ | |/ / / / / / / / / / |/| | | | | | | | | | vulkan_common: use highest API version
| * | | | | | | | | | vulkan_common: use highest API versionLiam2023-10-241-1/+1
| | |_|_|/ / / / / / | |/| | | | | | | |
* | | | | | | | | | Merge pull request #11812 from german77/save_captureliamwhite2023-10-258-13/+250
|\ \ \ \ \ \ \ \ \ \ | |/ / / / / / / / / |/| | | | | | | | | service: caps: Implement SaveScreenShotEx0 and variants
| * | | | | | | | | service: caps: Implement SaveScreenShotEx0 and variantsgerman772023-10-238-13/+250
| | |_|/ / / / / / | |/| | | | | | |
* | | | | | | | | service: ipc: Add third read buffer indexNarr the Reg2023-10-231-0/+6
| | | | | | | | |
* | | | | | | | | Merge pull request #11841 from german77/halpliamwhite2023-10-233-2/+10
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | yuzu: fix restore shortcuts button
| * | | | | | | | | yuzu: Fix restore shortcuts buttonNarr the Reg2023-10-223-2/+10
| | |_|_|_|_|_|_|/ | |/| | | | | | |
* | | | | | | | | Merge pull request #11846 from german77/cheatsliamwhite2023-10-231-7/+16
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | cheats: Clamp cheat names without failing
| * | | | | | | | | cheats: Clamp cheat names without failinggerman772023-10-221-7/+16
| |/ / / / / / / /
* | | | | | | | | Merge pull request #11847 from ameerj/glsl-shfl-fixliamwhite2023-10-232-4/+9
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | emit_glsl_warp: Fix shfl_in_bounds conditional
| * | | | | | | | | emit_glsl_warp: Fix shfl_in_bounds conditionalAmeer J2023-10-222-4/+9
| | |_|_|_|_|/ / / | |/| | | | | | |
* | | | | | | | | yuzu: Fix vibration reseting to 1%german772023-10-221-5/+5
| |_|/ / / / / / |/| | | | | | |
* | | | | | | | Merge pull request #11831 from liamwhite/hosversionbetweenliamwhite2023-10-222-19/+34
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | set: return version info from system archive
| * | | | | | | | set: return version info from system archiveLiam2023-10-202-19/+34
| | |/ / / / / / | |/| | | | | |
* | | | | | | | Merge pull request #11830 from liamwhite/ts-sessionliamwhite2023-10-222-6/+40
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | ts: add OpenSession
| * | | | | | | | ts: add OpenSessionLiam2023-10-202-6/+40
| |/ / / / / / /
* | | | | | | | Merge pull request #11828 from liamwhite/setthreadescriptionliamwhite2023-10-221-22/+2
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | common: use SetThreadDescription API for thread names
| * | | | | | | | common: use SetThreadDescription API for thread namesLiam2023-10-201-22/+2
| | |_|_|/ / / / | |/| | | | | |
* | | | | | | | Merge pull request #11789 from Kelebek1/spirv_shift_rightliamwhite2023-10-226-25/+97
|\ \ \ \ \ \ \ \ | |_|/ / / / / / |/| | | | | | | Manually robust on Maxwell and earlier
| * | | | | | | Manually robust on Maxwell and earlierKelebek12023-10-196-25/+97
| | | | | | | |
* | | | | | | | Merge pull request #11748 from liamwhite/kern_1700Fernando S2023-10-2016-227/+438
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | kernel: update for 17.0.0
| * | | | | | | | gdbstub: add PermissionLocked to mappings tableLiam2023-10-201-4/+6
| | | | | | | | |
| * | | | | | | | kernel: fix format string errorLiam2023-10-201-1/+1
| | | | | | | | |
| * | | | | | | | kernel: make check fully constexpr for broken msvc constant foldingLiam2023-10-201-1/+1
| | | | | | | | |
| * | | | | | | | k_page_table: add MapFirstGroupLiam2023-10-203-34/+49
| | | | | | | | |
| * | | | | | | | kernel: update KMemoryRegionType valuesLiam2023-10-202-48/+80
| | | | | | | | |
| * | | | | | | | k_page_table: implement PermissionLockedLiam2023-10-206-26/+128
| | | | | | | | |
| * | | | | | | | k_page_table: add new CheckMemoryState helperLiam2023-10-202-12/+40
| | | | | | | | |
| * | | | | | | | kernel: split Io memory state, add PermissionLocked attributeLiam2023-10-205-92/+116
| | | | | | | | |
| * | | | | | | | kernel: reshuffle ini1 size, add slab clear noteLiam2023-10-204-10/+18
| | |/ / / / / / | |/| | | | | |
* | | | | | | | Merge pull request #11825 from liamwhite/system-resourceFernando S2023-10-201-1/+1
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | kernel: fix incorrect calculation of used non system memory value
| * | | | | | | | kernel: fix incorrect calculation of used non system memory valueLiam2023-10-201-1/+1
| |/ / / / / / /
* | | | | | | | Merge pull request #11806 from liamwhite/needs-more-lockingliamwhite2023-10-204-10/+23
|\ \ \ \ \ \ \ \ | |/ / / / / / / |/| | | | | | | renderer_vulkan: add locks to avoid scheduler flushes from CPU
| * | | | | | | renderer_vulkan: add locks to avoid scheduler flushes from CPULiam2023-10-174-10/+23
| | | | | | | |
* | | | | | | | Merge pull request #11822 from german77/no-nameliamwhite2023-10-191-0/+1
|\ \ \ \ \ \ \ \ | |_|/ / / / / / |/| | | | | | | service: mii: Create random mii with name
| * | | | | | | service: mii: Create random mii with nameNarr the Reg2023-10-191-0/+1
| | |_|_|_|_|/ | |/| | | | |
* | | | | | | Merge pull request #11810 from liamwhite/clang-17liamwhite2023-10-192-4/+4
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | general: fix build failure on clang 17
| * | | | | | | general: fix build failure on clang 17Liam2023-10-182-4/+4
| |/ / / / / /
* | | | | | | Merge pull request #11795 from Squall-Leonhart/D32FToOtherliamwhite2023-10-186-1/+51
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | [Vulkan]Implement missing copy formats for D32, ARGB8_SRGB and BGRA8_Unorm/SRGB
| * | | | | | | Changes based on hardware testsSquall-Leonhart2023-10-166-37/+5
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Removes unnecessary d32f to bgra shader and blit functions, update vk_texture_cache to use abgr shader for d32f to BGRA formats updates abgr to d32f shader to comply with hardware tests
| * | | | | | | Make Clang happy.Squall Leonhart2023-10-161-1/+1
| | | | | | | |
| * | | | | | | Added missing BuildShader lineSquall Leonhart2023-10-161-0/+1
| | | | | | | | | | | | | | | | | | | | | | | | Adds `convert_abgr8_to_d32f_frag(BuildShader(device, CONVERT_ABGR8_TO_D32F_FRAG_SPV)),`
| * | | | | | | added missing trailing line.Squall Leonhart2023-10-151-1/+1
| | | | | | | |
| * | | | | | | meant to add the unorms as wellSquall Leonhart2023-10-151-1/+3
| | | | | | | |
| * | | | | | | use texelfetch instead of texturelodSquall-Leonhart2023-10-152-2/+2
| | | | | | | |
| * | | | | | | appease the format godsSquall Leonhart2023-10-151-1/+1
| | | | | | | |
| * | | | | | | Another missing copy connected to Bravely Default IISquall-Leonhart2023-10-155-0/+35
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | adds blit_image_helper.ConvertABGR8ToD32F and fragment shader for performing ABGR and BGRA to D32F copies
| * | | | | | | missed this line when editing the copypastaSquall-Leonhart2023-10-151-1/+1
| | | | | | | |
| * | | | | | | moved line to appease the format godsSquall-Leonhart2023-10-151-1/+1
| | | | | | | |
| * | | | | | | Implement missing formats for Bravely Default 2Squall-Leonhart2023-10-155-0/+44
| | | | | | | |
* | | | | | | | Merge pull request #11791 from german77/bufferxliamwhite2023-10-184-46/+70
|\ \ \ \ \ \ \ \ | |_|/ / / / / / |/| | | | | | | service: hle: Allow to access read buffer A and X directly
| * | | | | | | service: hle: Allow to access read buffer A and X directlygerman772023-10-174-46/+70
| | | | | | | |
* | | | | | | | Merge pull request #11774 from liamwhite/refcount-issueliamwhite2023-10-1710-85/+77
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | fsmitm_romfsbuild: avoid unnecessary copies of vfs pointers
| * | | | | | | | fsmitm_romfsbuild: avoid unnecessary copies of vfs pointersLiam2023-10-1310-85/+77
| | | | | | | | |
* | | | | | | | | Merge pull request #11747 from Kelebek1/image_alias_sample_namesliamwhite2023-10-174-4/+9
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | Small things
| * | | | | | | | | Get out of render pass before query barriers, fix image names with samples > 1, remove image alias bitKelebek12023-10-114-4/+9
| | | | | | | | | |
* | | | | | | | | | Merge pull request #11349 from vonchenplus/buffer_cache_crashliamwhite2023-10-174-8/+25
|\ \ \ \ \ \ \ \ \ \ | |_|_|_|_|/ / / / / |/| | | | | | | | | video_core: Fix moltenvk crash on macos
| * | | | | | | | | video_core: Fix d24r8/s8d24 convert shader build error in moltenvkFeng Chen2023-09-072-8/+8
| | | | | | | | | |
| * | | | | | | | | video_core: Add missing scissor update when viewport scale offset disableFeng Chen2023-09-071-0/+13
| | | | | | | | | |
| * | | | | | | | | video_core: set vertex buffer num to 16, because mvk have when using more than 16Feng Chen2023-08-231-0/+4
| | | | | | | | | |
* | | | | | | | | | Merge pull request #11788 from Squall-Leonhart/IFREMOVEDFernando S2023-10-171-2/+9
|\ \ \ \ \ \ \ \ \ \ | |_|_|_|_|_|_|_|_|/ |/| | | | | | | | | [crash fix]brings back the removed if statement in util.cpp and adds the num_level test to it like previous discontinued PR
| * | | | | | | | | brings back the removed If statement and adds the num_level testSquall Leonhart2023-10-141-2/+9
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This resolves the out of bounds read/writes in the linear swizzler, it brings back the scaled TOTK Recall bug however, pending further work in the block size calculation. Recall is not glitched in the Dynamic FPS resolution mod to the degree that it is in the native yuzu scaler, this can be a workaround for the time being. The recall effect is constructed from multiple 320x180 texture slices, it breaking may have a similar origin to https://github.com/Ryujinx/Ryujinx/pull/5640 but it may also be connected to the other deficiencies identified in the Yuzu size calculations, such as no apparent implementation of slice testing for end of slce depth as opposed to full aligned size as implemented in https://github.com/Ryujinx/Ryujinx/pull/5220
* | | | | | | | | | service: acc: Implement functions needed for profile select (#11653)Narr the Reg2023-10-176-8/+91
| |_|_|_|_|_|/ / / |/| | | | | | | |
* | | | | | | | | Merge pull request #11786 from v1993/cuda-on-linuxliamwhite2023-10-161-10/+0
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | host1x/codecs: enable CUDA on Linux
| * | | | | | | | | host1x/codecs: enable CUDA on LinuxValeri2023-10-141-10/+0
| | |_|_|_|_|_|/ / | |/| | | | | | |
* | | | | | | | | Merge pull request #11794 from german77/linemotliamwhite2023-10-161-0/+1
|\ \ \ \ \ \ \ \ \ | |/ / / / / / / / |/| | | | | | | | input_common: udp: Avoid crash when trying to map motion before client is ready
| * | | | | | | | input_common: udp: Avoid crash when trying to map motion before client is readygerman772023-10-151-0/+1
| | |_|_|_|/ / / | |/| | | | | |
* | | | | | | | Merge pull request #11780 from Darkness4/masterliamwhite2023-10-141-1/+1
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | qt: add network components when using discord
| * | | | | | | | Revert "cmake: only add network component if qt used"Nguyen Marc2023-10-141-4/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This reverts commit a94371f67b9da4fd1f421b2088b4366e3e58a1ad.
| * | | | | | | | cmake: only add network component if qt usedNguyen Marc2023-10-141-1/+4
| | | | | | | | |
| * | | | | | | | qt: add missing target_link_libraries for discordrpcNguyen Marc2023-10-141-1/+1
| | | | | | | | |
* | | | | | | | | Merge pull request #11779 from flodavid/improve-player-config-clickliamwhite2023-10-142-10/+27
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | yuzu: Improve behavior when clicking on controller box in Control configuration
| * | | | | | | | | yuzu: Improve behavior when clicking on controller box in Control Configurationflodavid2023-10-142-10/+27
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | When reducing the number of Connecter Controllers, keep the one clicked if it was not the last one of the list
* | | | | | | | | | Merge pull request #11778 from liamwhite/audren-shutdown-lockliamwhite2023-10-141-0/+4
|\ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | audio: fix shutdown deadlock in audio renderer
| * | | | | | | | | | audio: fix shutdown deadlock in audio rendererLiam2023-10-131-0/+4
| | |/ / / / / / / / | |/| | | | | | | |
* | | | | | | | | | Merge pull request #11775 from Kelebek1/draw_vertex_arrayliamwhite2023-10-142-1/+25
|\ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | Implement vertex array first and subsequent draws
| * | | | | | | | | | Implement vertex array first and subsequent drawsKelebek12023-10-142-1/+25
| |/ / / / / / / / /
* | | | | | | | | | Merge pull request #11159 from flodavid/master_bisliamwhite2023-10-148-43/+125
|\ \ \ \ \ \ \ \ \ \ | |/ / / / / / / / / |/| | | | | | | | | Enable to use controller to close a game
| * | | | | | | | | fix styleF David2023-10-121-2/+3
| | | | | | | | | |
| * | | | | | | | | yuzu: Enable to use controller to restart a gameflodavid2023-10-123-18/+29
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | - Show the right confirm dialog if wanted - Create generic method to ask close confirmation - Add "R + Plus + Minus" default shortcut to Restart emulation
| * | | | | | | | | yuzu: Use new setting method for stop emulationFlorian2023-10-126-9/+36
| | | | | | | | | |
| * | | | | | | | | yuzu: Enable to use controller to close a gameflodavid2023-10-125-32/+75
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | - Add General setting to choose if a confirm dialog is shown when stopping - Show the right confirm dialog if wanted - Reuse dialog window that ask to close the game - Add "L + Plus + Minus" default shortcut to Stop emulation - Create generic question dialog based on TAS dialog - It allows controller interaction on most dialogs
* | | | | | | | | | Merge pull request #11772 from v1993/polyfill-thread-fixesliamwhite2023-10-131-10/+11
|\ \ \ \ \ \ \ \ \ \ | |_|/ / / / / / / / |/| | | | | | | | | common/polyfill_thread: use std::forward where appropriate, qualify std::move calls
| * | | | | | | | | common/polyfill_thread: use std::forward where appropriate, qualify std::move callsValeri Ochinski2023-10-131-10/+11
| | |_|_|_|_|/ / / | |/| | | | | | |
* | | | | | | | | Merge pull request #11767 from t895/gradle-stuffCharles Lombardo2023-10-133-11/+10
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | android: Update dependencies
| * | | | | | | | | android: Remove unnecessary flag to extract native libs in AndroidManifest.xmlCharles Lombardo2023-10-131-1/+0
| | | | | | | | | |
| * | | | | | | | | android: Update dependenciesCharles Lombardo2023-10-131-7/+7
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Updates to androidx navigation, lifecycle, preference, fragment, recyclerview, and core
| * | | | | | | | | android: Update ndk to 26.1.10909125Charles Lombardo2023-10-131-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The new ndk uses LLVM 17.0.2 so we can remove the LLVM download and libc++ options for the android builds
| * | | | | | | | | android: Update AGP to 8.1.2Charles Lombardo2023-10-131-2/+2
| | | | | | | | | |
* | | | | | | | | | android: Fix incorrect assumption for driver installation validationCharles Lombardo2023-10-131-12/+13
| |_|_|/ / / / / / |/| | | | | | | | | | | | | | | | | | | | | | | | | | The driver was assumed to be installed at this point before I made a refactor. Now we just check if the copy operation was successful and delete the file if it fails.
* | | | | | | | | Improvement in Directory Path Detection for Shortcuts (#11749)DanielSvoboda2023-10-131-30/+38
| |/ / / / / / / |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * Improvement in Directory Path Detection for Shortcuts This pull request updates how the directory path for shortcuts is determined. The main changes are: 1. Replaced the use of environment variables to determine the path of the desktop and applications menu with `QStandardPaths::writableLocation`. This change addresses an issue where the desktop path was not correctly identified when its location was customized, as shown in the attached screenshot. 2. Added conversion from `QString` to `std::string` using `toUtf8()`, which correctly handles non-ASCII characters in directory paths. This change ensures that directory paths containing Portuguese words like "Área de trabalho" are supported. 3. Replaced directory checking using `Common::FS::IsDir()` with `QDir::exists()`. These changes should improve cross-platform compatibility and code robustness. Because it couldn't locate my desktop, which wasn't on the C drive, but on the F, and even though localization wouldn't work because it was setting it to find the 'Desktop' folder and in the computer's language it says 'Área de trabalho', that will fix for other languages too. * Update main.cpp * formatting * Update src/yuzu/main.cpp Co-authored-by: Tobias <thm.frey@gmail.com> * Update src/yuzu/main.cpp Co-authored-by: Tobias <thm.frey@gmail.com> * Update main.cpp * Update main.cpp * Update main.cpp desktopPath > desktop_Path applicationsPath > applications_Path * Update main.cpp * formatting * Update main.cpp This code will attempt to use QStandardPaths to find the applications directory. If that fails, it will resort to using the ~/.local/share/applications directory, which is a common location for application shortcuts in Linux. * Update main.cpp * formatting --------- Co-authored-by: Tobias <thm.frey@gmail.com>
* | | | | | | | Merge pull request #11769 from liamwhite/qt-ownership-issueliamwhite2023-10-133-6/+11
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | qt: ensure worker cancellation is complete before clearing
| * | | | | | | | qt: ensure worker cancellation is complete before clearingLiam2023-10-133-6/+11
| |/ / / / / / /
* | | | | | | | Merge pull request #11766 from liamwhite/open-sesameliamwhite2023-10-131-0/+5
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | k_page_table: add missing page group open when locking memory
| * | | | | | | | k_page_table: add missing page group open when locking memoryLiam2023-10-121-0/+5
| | | | | | | | |
* | | | | | | | | Merge pull request #11649 from t895/driver-managerliamwhite2023-10-1336-299/+1039
|\ \ \ \ \ \ \ \ \ | |_|/ / / / / / / |/| | | | | | | | android: Driver manager
| * | | | | | | | android: Add GPU driver management fragmentCharles Lombardo2023-10-1232-263/+1010
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Implements a GPU driver manager that saves all drivers to the user data directory and asynchronously installs drivers when they're needed.
| * | | | | | | | android: Use application context for all FileUtil functionsCharles Lombardo2023-10-018-41/+34
| | | | | | | | |
* | | | | | | | | Merge pull request #11746 from liamwhite/relrliamwhite2023-10-132-2/+42
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | jit: add support for relr-type relocations
| * | | | | | | | | jit: add support for relr-type relocationsLiam2023-10-112-2/+42
| | | | | | | | | |
* | | | | | | | | | Merge pull request #11763 from liamwhite/lto-noinlineliamwhite2023-10-132-8/+12
|\ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | kernel: mark TLS accessors as noinline for non-MSVC LTO
| * | | | | | | | | | kernel: mark TLS accessors as noinline for non-MSVC LTOLiam2023-10-122-8/+12
| | |_|_|/ / / / / / | |/| | | | | | | |
* | | | | | | | | | service: caps: Remove ambiguous callNarr the Reg2023-10-121-2/+2
| |_|_|/ / / / / / |/| | | | | | | |
* | | | | | | | | Merge pull request #11753 from german77/timex2liamwhite2023-10-125-51/+134
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | service: caps: Fix GetAlbumFileList3AaeAruid and GetAlbumFileList0AafeAruidDeprecated
| * | | | | | | | | service: caps: Fix GetAlbumFileList3AaeAruid and GetAlbumFileList0AafeAruidDeprecatedNarr the Reg2023-10-125-51/+134
| |/ / / / / / / /
* | | | | | | | | Merge pull request #11751 from Kelebek1/transition_msaa_imageliamwhite2023-10-124-0/+33
|\ \ \ \ \ \ \ \ \ | |/ / / / / / / / |/| | | | | | | | Transition MSAA images to general layout without uploading data
| * | | | | | | | Transition MSAA images to general layout without uploading dataKelebek12023-10-124-0/+33
| | |_|_|_|/ / / | |/| | | | | |
* | | | | | | | Merge pull request #11740 from german77/shorcutsliamwhite2023-10-111-28/+53
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | yuzu: Save multiple resolutions per icon
| * | | | | | | | yuzu: Save multiple resolutions per iconNarr the Reg2023-10-111-28/+53
| | | | | | | | |
* | | | | | | | | Merge pull request #11744 from Kelebek1/no_res_no_rescaledliamwhite2023-10-112-14/+16
|\ \ \ \ \ \ \ \ \ | |_|_|/ / / / / / |/| | | | | | | | Do not set rescaled flag when rescaling is disabled
| * | | | | | | | Do not set rescaled flag when rescaling is disabledKelebek12023-10-112-14/+16
| | | | | | | | |
* | | | | | | | | Merge pull request #11734 from Kelebek1/device_local_buffer_allocliamwhite2023-10-111-4/+4
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | Do not allocate DeviceLocal buffers as mapped
| * | | | | | | | | Not not allocate DeviceLocal buffers as mappedKelebek12023-10-101-4/+4
| |/ / / / / / / /
* | | | | | | | | Merge pull request #11735 from Kelebek1/clear_command_buffer_post_dspliamwhite2023-10-112-0/+11
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | Clear DSP buffer after each execution
| * | | | | | | | | Clear DSP buffer after each executionKelebek12023-10-102-0/+11
| |/ / / / / / / /
* | | | | | | | | Merge pull request #11683 from Kelebek1/do_not_sync_on_written_bufferliamwhite2023-10-111-22/+24
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | Do not double sync written buffers, move mark written to binding
| * | | | | | | | | Mark a buffer GPU modified after the buffers are confirmed, do not double synch themKelebek12023-10-051-22/+24
| | | | | | | | | |
* | | | | | | | | | Merge pull request #11144 from flodavid/masterliamwhite2023-10-113-7/+92
|\ \ \ \ \ \ \ \ \ \ | |_|_|_|/ / / / / / |/| | | | | | | | | Enable controller interaction in Controller Applet
| * | | | | | | | | yuzu: Enable controller interaction in Controller Appletflodavid2023-07-253-7/+92
| | | | | | | | | |
* | | | | | | | | | Merge pull request #11743 from Squall-Leonhart/IFREMOVEDFernando S2023-10-111-2/+2
|\ \ \ \ \ \ \ \ \ \ | | |_|_|_|_|/ / / / | |/| | | | | | | | Fix mistaken usage of info.block instead of level_info.block
| * | | | | | | | | Fix mistaken usage of info.block instead of level_info.blockSquall-Leonhart2023-10-111-2/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Fixed an error on my part, in the last change I had mistakenly passed unadjusted block info into FullUploadSwizzles and UnswizzleImage Revert (my mistaken changing of) the construction of SwizzleParameters in UnswizzleImage and FullUploadSwizzles to use level_info.block instead of info.block. This ensures that the block information used in the swizzling process is correctly adjusted for each mip level.
* | | | | | | | | | Merge pull request #11534 from Squall-Leonhart/IFREMOVEDliamwhite2023-10-101-21/+20
|\| | | | | | | | | | |_|_|_|/ / / / / |/| | | | | | | | Partial revert of #10433 (Texture Cache Util: Fix block depth adjustment on slices)
| * | | | | | | | Reuse part of my previous idea to to use num_levels to check within AdjustMipBlockSizeSquall-Leonhart2023-09-191-14/+20
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The partial revert was not enough for Tsukihime, this might do the trick
| * | | | | | | | Partial revert of #10433Squall Leonhart2023-09-181-9/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The If block in this change was causing some 2D textures to be treated as if their mip 0 was a 3D Slice, this could be ascertained as the same texture viewed from different distances would render fine, but then close up would look like a decoding failure. It also resulted in some 3D ASTC textures not being scaled appropriate leading to broken graphical effects such as the jagged TOTK recall animation being a circle, as the If block was only accepting the image based on its original info without any adjustments applied.
* | | | | | | | | Merge pull request #11718 from liamwhite/arm64-native-clockFernando S2023-10-104-1/+134
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | common: add arm64 native clock
| * | | | | | | | | common: add arm64 native clockLiam2023-10-084-1/+134
| | | | | | | | | |
* | | | | | | | | | Merge pull request #11650 from german77/lle_albumFernando S2023-10-1031-246/+1206
|\ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | service: am: Add support for LLE Album Applet
| * | | | | | | | | | service: caps: Implement album manager and reorganize serviceNarr the Reg2023-10-0820-521/+855
| | | | | | | | | | |
| * | | | | | | | | | service: Stub multiple functions to increase stability of album appletNarr the Reg2023-10-087-6/+144
| | | | | | | | | | |
| * | | | | | | | | | service: caps: Partially implement IAlbumAccessorServiceNarr the Reg2023-10-025-15/+450
| | | | | | | | | | |
| * | | | | | | | | | yuzu: Allow to launch album applet from firmwareNarr the Reg2023-10-025-0/+53
| | | | | | | | | | |
* | | | | | | | | | | Merge pull request #11686 from liamwhite/trmemFernando S2023-10-105-17/+160
|\ \ \ \ \ \ \ \ \ \ \ | |_|_|_|_|_|/ / / / / |/| | | | | | | | | | kernel: implement transfer memory
| * | | | | | | | | | kernel: implement transfer memoryLiam2023-10-055-17/+160
| | |_|_|_|_|_|_|_|/ | |/| | | | | | | |
* | | | | | | | | | Merge pull request #11716 from Squall-Leonhart/Z327444liamwhite2023-10-081-0/+2
|\ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | add Z32, FLOAT, UINT, UINT, UINT, LINEAR to format lookup table
| * | | | | | | | | | add Z32, FLOAT, UINT, UINT, UINT, LINEAR to format lookup tableSquall Leonhart2023-10-081-0/+2
| | |_|/ / / / / / / | |/| | | | | | | | | | | | | | | | | | Should fix and close #11711
* | | | | | | | | | Merge pull request #11705 from FearlessTobi/windows-scliamwhite2023-10-087-26/+157
|\ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | yuzu: Add desktop shortcut support for Windows (continuation of #11344)
| * | | | | | | | | | yuzu: Add desktop shortcut support for WindowsFearlessTobi2023-10-087-26/+157
| | |/ / / / / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Allows creating desktop shortcuts with icons for yuzu games. Co-Authored-By: Jeroen van Schijndel <13182141+roenyroeny@users.noreply.github.com>
* | | | | | | | | | Merge pull request #10519 from mdmrk/masterliamwhite2023-10-0816-14/+337
|\ \ \ \ \ \ \ \ \ \ | |_|/ / / / / / / / |/| | | | | | | | | yuzu-qt: Track play time
| * | | | | | | | | Address review commentsLiam2023-08-2811-270/+259
| | | | | | | | | |
| * | | | | | | | | yuzu-qt: Track play timeMario2023-08-2715-0/+334
| | | | | | | | | |
* | | | | | | | | | Merge pull request #11656 from liamwhite/recreate-surface-automaticallyliamwhite2023-10-076-52/+36
|\ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | vk_present_manager: recreate surface on any surface loss
| * | | | | | | | | | vk_present_manager: recreate surface on any surface lossLiam2023-10-036-52/+36
| | |/ / / / / / / / | |/| | | | | | | |
* | | | | | | | | | Merge pull request #11677 from Squall-Leonhart/D32FTOABGR8liamwhite2023-10-075-0/+31
|\ \ \ \ \ \ \ \ \ \ | | |_|_|_|_|_|_|_|/ | |/| | | | | | | | Implements D32_Float to A8B8G8R8_UNORM format copy
| * | | | | | | | | update shader to confirmed format copySquall Leonhart2023-10-071-1/+1
| | | | | | | | | |
| * | | | | | | | | lets not convert depth to greyscale since this makes the exhaust and tire smoke light gray/whiteSquall-Leonhart2023-10-041-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | tiresmoke should be a darker gray.
| * | | | | | | | | Fix CI Formatting checkSquall-Leonhart2023-10-041-2/+2
| | | | | | | | | |
| * | | | | | | | | Implements D32_Float to A8B8G8R8_UNORM format copySquall-Leonhart2023-10-045-0/+31
| |/ / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | Corrects some visual issues in games such as Disney SpeedStorm
* | | | | | | | | Merge pull request #11630 from Kelebek1/clear_stencil_requires_depth_testliamwhite2023-10-072-2/+5
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | Enable depth test on depthstencil clear path
| * | | | | | | | | Enable depth test on stencil clear pathKelebek12023-09-282-2/+5
| | | | | | | | | |
* | | | | | | | | | Merge pull request #11639 from liamwhite/no-program-id-changeliamwhite2023-10-073-1/+10
|\ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | loader: don't reassign program ID on npdm reparse
| * | | | | | | | | | loader: don't reassign program ID on npdm reparseLiam2023-09-303-1/+10
| | | | | | | | | | |
* | | | | | | | | | | Merge pull request #11648 from liamwhite/unicode-nonsenseliamwhite2023-10-073-2/+21
|\ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | gdbserver: use numeric character references for unicode
| * | | | | | | | | | | gdbserver: use numeric character references for unicodeLiam2023-10-023-2/+21
| | |_|_|_|_|_|_|_|/ / | |/| | | | | | | | |
* | | | | | | | | | | Merge pull request #11544 from Kelebek1/reduce_stream_buffer_renderdocliamwhite2023-10-074-14/+59
|\ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | Allow GPUs without rebar to open multiple RenderDoc captures
| * | | | | | | | | | | Allow GPUs without rebar to open multiple RenderDoc capturesKelebek12023-10-064-14/+59
| | |_|/ / / / / / / / | |/| | | | | | | | |
* | | | | | | | | | | Merge pull request #11669 from german77/settings2liamwhite2023-10-075-2/+11
|\ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | yuzu: Fix custom rtc and mute audio settings
| * | | | | | | | | | | core: Update clocks when settings are savedNarr the Reg2023-10-041-0/+4
| | | | | | | | | | | |
| * | | | | | | | | | | yuzu: Fix mute when in background settingNarr the Reg2023-10-044-2/+7
| | |_|_|_|_|/ / / / / | |/| | | | | | | | |
* | | | | | | | | | | Merge pull request #11688 from Kelebek1/x8d42liamwhite2023-10-0710-2/+21
|\ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | Implement X8_D24 pixel format
| * | | | | | | | | | | Implement X8_D24 formatKelebek12023-10-0610-2/+21
| | |_|_|_|/ / / / / / | |/| | | | | | | | |
* | | | | | | | | | | Merge pull request #11684 from Kelebek1/disable_push_descriptor_maxwellliamwhite2023-10-071-12/+43
|\ \ \ \ \ \ \ \ \ \ \ | |/ / / / / / / / / / |/| | | | | | | | | | Disable push descriptor for Pascal and older nVidia architectures
| * | | | | | | | | | Rework nvidia architecture detection, disable push descriptor for Pascal and olderKelebek12023-10-051-12/+43
| | |_|_|_|_|_|_|/ / | |/| | | | | | | |
* | | | | | | | | | ci: fix new codespell errorsLiam2023-10-0310-10/+10
| |/ / / / / / / / |/| | | | | | | |
* | | | | | | | | Merge pull request #11652 from liamwhite/shutdown-goes-brrrliamwhite2023-10-021-4/+8
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | k_page_table: skip page table clearing on finalization
| * | | | | | | | | k_page_table: skip page table clearing on finalizationLiam2023-10-021-4/+8
| | | | | | | | | |
* | | | | | | | | | Merge pull request #11655 from liamwhite/additional-dump-targetsliamwhite2023-10-021-9/+17
|\ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | qt: add additional romfs dump targets
| * | | | | | | | | | qt: add additional romfs dump targetsLiam2023-10-021-9/+17
| |/ / / / / / / / /
* / / / / / / / / / fsp-srv: enable auto save data creation on initLiam2023-10-021-0/+3
|/ / / / / / / / /
* | | | | | | | | Merge pull request #11632 from german77/hle_cabinetliamwhite2023-10-0223-60/+985
|\ \ \ \ \ \ \ \ \ | |_|_|/ / / / / / |/| | | | | | | | service: am: Add support for LLE Cabinet Applet
| * | | | | | | | service: nfc: Implement SetRegisterInfoPrivate mii supportNarr the Reg2023-10-011-7/+2
| | | | | | | | |
| * | | | | | | | service: am: Implement shared bufferNarr the Reg2023-10-012-10/+125
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Co-authored-by: Liam <byteslice@airmail.cc>
| * | | | | | | | service: nvnflinger: Implement shared bufferNarr the Reg2023-10-0112-22/+572
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Co-authored-by: Liam <byteslice@airmail.cc>
| * | | | | | | | service: ldn: Implement lp2p:m and stub IMonitorServiceNarr the Reg2023-10-011-2/+89
| | | | | | | | |
| * | | | | | | | service: am: Set push in arguments according to the launched appletNarr the Reg2023-10-017-17/+120
| | | | | | | | |
| * | | | | | | | yuzu: Allow to launch cabinet applet from firmwareNarr the Reg2023-10-013-2/+77
| |/ / / / / / /
* | | / / / / / Query Cache: Fix memory leak.Fernando Sahmkow2023-10-012-0/+2
| |_|/ / / / / |/| | | | | |
* | | | | | | Merge pull request #11493 from merryhime/evtFernando S2023-09-292-39/+52
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | core_timing: Replace queue with a fibonacci heap
| * | | | | | | core_timing: Attempt to reduce heap siftingMerry2023-09-161-11/+22
| | | | | | | |
| * | | | | | | core_timing: Use a fibonacci heapMerry2023-09-162-33/+35
| | | | | | | |
* | | | | | | | Merge pull request #11546 from Kelebek1/core_timing_mutexFernando S2023-09-293-6/+11
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | Reduce core timing mutex contention
| * | | | | | | | Reduce core timing mutex contentionKelebek12023-09-203-6/+11
| | |_|/ / / / / | |/| | | | | |
* | | | | | | | Merge pull request #11622 from liamwhite/qcr-reg1Fernando S2023-09-291-2/+4
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | renderer_vulkan: fix query cache for homebrew
| * | | | | | | | renderer_vulkan: fix query cache for homebrewLiam2023-09-281-2/+4
| | | | | | | | |
* | | | | | | | | Don't send a double focus change messageKelebek12023-09-291-3/+0
| |_|_|/ / / / / |/| | | | | | |
* | | | | | | | Merge pull request #11626 from german77/mii-fixliamwhite2023-09-285-4/+6
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | service: mii: Fix reported bugs
| * | | | | | | | service: mii: Fix reported bugsgerman772023-09-285-4/+6
| | | | | | | | |
* | | | | | | | | Merge pull request #11402 from FernandoS27/depth-bias-controlliamwhite2023-09-287-3/+69
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | Vulkan: Implement Depth Bias Control
| * | | | | | | | | Vulkan: add temporary workaround for AMDVLKFernando Sahmkow2023-09-165-2/+20
| | | | | | | | | |
| * | | | | | | | | Vulkan: Implement Depth Bias ControlFernando Sahmkow2023-09-164-3/+51
| | | | | | | | | |
* | | | | | | | | | Merge pull request #11590 from liamwhite/attributeliamwhite2023-09-281-0/+41
|\ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | fsp-srv: add GetFileSystemAttribute
| * | | | | | | | | | fsp-srv: add GetFileSystemAttributeLiam2023-09-261-0/+41
| | | | | | | | | | |
* | | | | | | | | | | Merge pull request #11604 from t895/only-install-nspliamwhite2023-09-283-12/+5
|\ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | Frontend: Remove ability to install xci files
| * | | | | | | | | | | Qt: Remove ability to install xci filesCharles Lombardo2023-09-272-8/+5
| | | | | | | | | | | |
| * | | | | | | | | | | android: Remove ability to install xci filesCharles Lombardo2023-09-271-4/+0
| | | | | | | | | | | |
* | | | | | | | | | | | Merge pull request #11556 from GPUCode/msaa-image-vkFernando S2023-09-287-36/+229
|\ \ \ \ \ \ \ \ \ \ \ \ | |_|_|_|_|/ / / / / / / |/| | | | | | | | | | | renderer_vulkan: Implement MSAA image copies
| * | | | | | | | | | | host_shaders: More proper handling of x2 MSAA copiesGPUCode2023-09-252-4/+10
| | | | | | | | | | | |
| * | | | | | | | | | | renderer_vulkan: Implement MSAA copiesGPUCode2023-09-255-32/+219
| | | | | | | | | | | |
* | | | | | | | | | | | Merge pull request #11613 from t895/fragment-exception-changeCharles Lombardo2023-09-283-17/+40
|\ \ \ \ \ \ \ \ \ \ \ \ | |_|_|_|_|/ / / / / / / |/| | | | | | | | | | | android: Various play store fixes
| * | | | | | | | | | | android: Prevent crash when trying to change pages in setup fragmentCharles Lombardo2023-09-271-2/+6
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Sometimes when we want to change the current setup page, the current view isn't available and we try to alter the current view. This adds a guard to prevent that issue.
| * | | | | | | | | | | android: Prevent setup fragment crash in backgroundCharles Lombardo2023-09-271-2/+4
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Sometimes during onSaveInstanceState, the SetupFragment would crash the app in the background if we tried to store the state of a view.
| * | | | | | | | | | | android: Don't update views if binding is null in onConfigurationChangedCharles Lombardo2023-09-271-0/+4
| | | | | | | | | | | |
| * | | | | | | | | | | android: Don't wait for post to update input overlay visibilityCharles Lombardo2023-09-271-9/+3
| | | | | | | | | | | |
| * | | | | | | | | | | android: Close activity with toast if emulation has no gameCharles Lombardo2023-09-272-4/+23
| | |/ / / / / / / / / | |/| | | | | | | | |
* | | | | | | | | | | Merge pull request #11616 from t895/save-errorCharles Lombardo2023-09-271-1/+2
|\ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | android: Correctly reload settings file during reset
| * | | | | | | | | | | android: Correctly reload settings file during resetCharles Lombardo2023-09-271-1/+2
| |/ / / / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Previously the config file wasn't being recreated when resetting all settings. Now just call into native code to recreate the settings file and reload all defaults.
* | | | | | | | | | | Merge pull request #11603 from t895/consolidate-installsCharles Lombardo2023-09-2733-421/+616
|\ \ \ \ \ \ \ \ \ \ \ | |/ / / / / / / / / / |/| | | | | | | | | | android: Consolidate installers to one fragment
| * | | | | | | | | | android: Adjust failure dialogs for user data and firmware installersCharles Lombardo2023-09-262-3/+13
| | | | | | | | | | |
| * | | | | | | | | | android: Fix cancel behavior on indeterminate progress dialog fragmentCharles Lombardo2023-09-261-4/+14
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The dialog would previously dismiss immediately when it should stay alive until the task is cancelled completely.
| * | | | | | | | | | android: Refactor zip code into FileUtilCharles Lombardo2023-09-264-91/+89
| | | | | | | | | | |
| * | | | | | | | | | android: Consolidate installers to one fragmentCharles Lombardo2023-09-2630-339/+516
| | |/ / / / / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | This also allows save imports to happen without starting a game at first.
* | | | | | | | | | Merge pull request #11602 from t895/case-fixCharles Lombardo2023-09-264-8/+21
|\ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | android: Content install lowercase fix
| * | | | | | | | | | android: Use a different string for the content install dialogCharles Lombardo2023-09-262-1/+2
| | | | | | | | | | |
| * | | | | | | | | | android: Fix case bug for installing game contentCharles Lombardo2023-09-263-7/+19
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The C++ side never made the filename lowercase when checking the extension. This just passes the pre-prepared extension to have it checked.
* | | | | | | | | | | settings_setting: Read audio enginelat9nq2023-09-261-0/+2
|/ / / / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This was mysteriously missing, likely from when I ported Citra fixes semi-recently.
* | | | | | | | | | Merge pull request #11594 from t895/rotation-fixCharles Lombardo2023-09-262-5/+7
|\ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | android: Prevent nav bar shade from laying out across screen
| * | | | | | | | | | android: Prevent nav bar shade from laying out across screenCharles Lombardo2023-09-262-5/+7
| |/ / / / / / / / /
* | | | | | | | | | android: Prevent click ripple from appearing on loading cardCharles Lombardo2023-09-261-1/+2
| | | | | | | | | |
* | | | | | | | | | android: Remove bottom attribute from navigation viewCharles Lombardo2023-09-261-1/+1
|/ / / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | Using the "bottom" attribute would break the navigation view and prevent things like rounded corners and lock modes from being applied properly.
* | | | | | | | | Merge pull request #11583 from t895/overlay-fix-2Charles Lombardo2023-09-251-6/+9
|\ \ \ \ \ \ \ \ \ | |/ / / / / / / / |/| | | | | | | | android: Use measured size of view for input overlay bounds
| * | | | | | | | android: Use measured size of view for input overlay boundsCharles Lombardo2023-09-251-6/+9
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Even after updating the androidx window library, this did not fix the issue for all devices. This ensures that the measured size of the overlay will be used instead of a potentially larger one seen by androidx.
* | | | | | | | | Merge pull request #11225 from FernandoS27/no-laxatives-in-santas-cookiesliamwhite2023-09-2545-366/+3553
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | Y.F.C: Rework the Query Cache.
| * | | | | | | | | Query Cache: Fix Prefix SumsFernando Sahmkow2023-09-235-132/+175
| | | | | | | | | |
| * | | | | | | | | Query Cache: Fix behavior in Normal AccuracyFernando Sahmkow2023-09-232-0/+23
| | | | | | | | | |
| * | | | | | | | | Query Cache: Simplify Prefix Sum compute shaderFernando Sahmkow2023-09-236-74/+253
| | | | | | | | | |
| * | | | | | | | | Query Cache: Implement host side sample counting.Fernando Sahmkow2023-09-235-48/+348
| | | | | | | | | |
| * | | | | | | | | Query Cache: Fix guest side sample countingFernando Sahmkow2023-09-235-46/+97
| | | | | | | | | |
| * | | | | | | | | Query Cache: address issuesFernando Sahmkow2023-09-2321-214/+270
| | | | | | | | | |
| * | | | | | | | | QueryCache: Implement dependant queries.Fernando Sahmkow2023-09-234-5/+180
| | | | | | | | | |
| * | | | | | | | | Macro HLE: Add DrawIndirectByteCountFernando Sahmkow2023-09-234-5/+40
| | | | | | | | | |
| * | | | | | | | | Query Cachge: Fully rework Vulkan's query cacheFernando Sahmkow2023-09-2335-337/+1555
| | | | | | | | | |
| * | | | | | | | | Query Cache: Setup Base reworkFernando Sahmkow2023-09-237-0/+1107
| |/ / / / / / / /
* | | | | | | | | Merge pull request #11569 from german77/lle_appletliamwhite2023-09-2411-33/+360
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | service: am: Add support for LLE Mii Edit Applet
| * | | | | | | | | service: mii: Limit checks to string sizegerman772023-09-241-1/+1
| | | | | | | | | |
| * | | | | | | | | service: hid: Set last connected controller as activegerman772023-09-241-0/+1
| | | | | | | | | |
| * | | | | | | | | service: am: Stub to exit applet cleanlygerman772023-09-242-3/+31
| | | | | | | | | |
| * | | | | | | | | service: am: Implement stuff needed for Mii Editgerman772023-09-243-22/+238
| | | | | | | | | |
| * | | | | | | | | service: fsp: Implement CreateSaveDataFileSystemBySystemSaveDataId and OpenSaveDataFileSystemBySystemSaveDataIdgerman772023-09-242-2/+24
| | | | | | | | | |
| * | | | | | | | | service: ns: Implement GetSharedFontInOrderOfPriorityForSystemgerman772023-09-241-4/+13
| | | | | | | | | |
| * | | | | | | | | yuzu: Add button to boot mii edit from firmwaregerman772023-09-243-1/+52
| | | | | | | | | |
* | | | | | | | | | Merge pull request #11562 from GPUCode/srgb-madnessliamwhite2023-09-241-15/+5
|\ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | vk_texture_cache: Limit srgb block to transcoding only
| * | | | | | | | | | vk_texture_cache: Limit srgb block to transcoding onlyGPUCode2023-09-211-15/+5
| | |_|_|/ / / / / / | |/| | | | | | | |
* | | | | | | | | | Merge pull request #11165 from Morph1984/ds_blitliamwhite2023-09-243-29/+47
|\ \ \ \ \ \ \ \ \ \ | |_|_|/ / / / / / / |/| | | | | | | | | vulkan_device: Return true if either depth/stencil format supports blit
| * | | | | | | | | vulkan_device: Test depth stencil blit support by formatMorph2023-08-013-29/+47
| | | | | | | | | |
| * | | | | | | | | vulkan_device: Return true if either depth/stencil format supports blitMorph2023-07-271-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | On devices that don't support D24S8 but supports D32S8, this should still return true if D32S8 supports src and dst blit
* | | | | | | | | | Merge pull request #11567 from liamwhite/fixing-my-errorFernando S2023-09-232-13/+9
|\ \ \ \ \ \ \ \ \ \ | |_|_|/ / / / / / / |/| | | | | | | | | emit_spirv: fix incorrect use of descriptor index in image atomics
| * | | | | | | | | emit_spirv: fix incorrect use of descriptor index in image atomicsLiam2023-09-222-13/+9
| | | | | | | | | |
* | | | | | | | | | android: Use smaller read buffer size for exporting user dataCharles Lombardo2023-09-221-1/+10
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The File.readBytes() extension attempts to load an entire file into a byte array. This would cause crashes when loading huge files into memory.
* | | | | | | | | | android: Adjust valid user data checkCharles Lombardo2023-09-221-1/+2
| | | | | | | | | |
* | | | | | | | | | Merge pull request #11561 from german77/hle_appletliamwhite2023-09-228-73/+139
|\ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | am: mii_edit: Implement DB operations
| * | | | | | | | | | am: mii_edit: Implement DB operationsNarr the Reg2023-09-228-73/+139
| | | | | | | | | | |
* | | | | | | | | | | Merge pull request #11557 from GPUCode/brr-formatliamwhite2023-09-224-3/+25
|\ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | renderer_vulkan: Correct component order for A4B4G4R4_UNORM
| * | | | | | | | | | | renderer_vulkan: Correct component order for A4B4G4R4_UNORMGPUCode2023-09-214-3/+25
| | |_|_|/ / / / / / / | |/| | | | | | | | |
* | | | | | | | | | | Merge pull request #11563 from Kelebek1/dma_regsliamwhite2023-09-222-28/+32
|\ \ \ \ \ \ \ \ \ \ \ | |_|_|/ / / / / / / / |/| | | | | | | | | | Fix DMA engine register offsets
| * | | | | | | | | | Fix DMA engine register offsetsKelebek12023-09-212-28/+32
| |/ / / / / / / / /
* | | | | | | | | | Merge pull request #11564 from t895/overlay-inset-fixCharles Lombardo2023-09-221-1/+1
|\ \ \ \ \ \ \ \ \ \ | |_|/ / / / / / / / |/| | | | | | | | | android: Update androidx window library to 1.2.0-beta03
| * | | | | | | | | android: Update androidx window library to 1.2.0-beta03Charles Lombardo2023-09-211-1/+1
| |/ / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | Fixes an issue with the input overlay on certain devices where the controls would appear offscreen.
* | | | | | | | | Merge pull request #11555 from yuzu-emu/revert-11551-allow-save-imports-alwaysliamwhite2023-09-2116-13/+48
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | Revert "android: Allow save imports always"
| * | | | | | | | | Revert "android: Allow save imports always"Charles Lombardo2023-09-2116-13/+48
| | | | | | | | | |
* | | | | | | | | | pfs: Fix reading filenames past the buffer endrkfg2023-09-211-0/+1
|/ / / / / / / / /
* | | | | | | | | android: Remove unused strings related to the save managerCharles Lombardo2023-09-2015-30/+0
| | | | | | | | |
* | | | | | | | | android: Allow importing saves even if no saves are foundCharles Lombardo2023-09-201-18/+13
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Exporting still won't be allowed on an empty save directory.
* | | | | | | | | android: Add import/export buttons for user dataCharles Lombardo2023-09-1913-40/+311
|/ / / / / / / /
* | | | | | | | Merge pull request #11542 from t895/touch-offset-fixliamwhite2023-09-194-28/+23
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | android: Screen orientation and aspect ratio fixes
| * | | | | | | | android: Ignore validation layers library in gitCharles Lombardo2023-09-191-0/+3
| | | | | | | | |
| * | | | | | | | android: Don't pause emulation when entering PiPCharles Lombardo2023-09-191-1/+1
| | | | | | | | |
| * | | | | | | | android: Fix showing input overlay in PiPCharles Lombardo2023-09-191-1/+1
| | | | | | | | |
| * | | | | | | | android: Properly update emulation surfaceCharles Lombardo2023-09-192-25/+11
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Previously the emulation surface wasn't being updated during configuration changes and only during specific view events. This would break input and the screen dimensions after each orientation/aspect ratio change. Now a new surface is provided every time and the display dimensions are updated as needed.
| * | | | | | | | android: Export PiP receiver on API 33 and laterCharles Lombardo2023-09-171-1/+7
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Could cause crashes on API 33+ devices
* | | | | | | | | Merge pull request #11526 from german77/mii_service_v2liamwhite2023-09-1919-244/+1861
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | service: mii: Update implementation Part2 - Mii database support
| * | | | | | | | | service: mii: Address review commentsgerman772023-09-187-22/+24
| | | | | | | | | |
| * | | | | | | | | service: mii: Implement the rest of the servicegerman772023-09-183-103/+751
| | | | | | | | | |
| * | | | | | | | | service: mii: Implement database managergerman772023-09-183-0/+480
| | | | | | | | | |
| * | | | | | | | | service: mii: Implement figurine databasegerman772023-09-183-0/+210
| | | | | | | | | |
| * | | | | | | | | service: mii: Add device crc16german772023-09-181-0/+26
| | | | | | | | | |
| * | | | | | | | | service: nfc: Fully Implement GetRegisterInfoPrivategerman772023-09-181-3/+5
| | | | | | | | | |
| * | | | | | | | | service: mii: Complete structs and fix mistakesgerman772023-09-189-138/+387
| | |_|_|_|_|/ / / | |/| | | | | | |
* | | | | | | | | Merge pull request #11536 from abouvier/renderdocliamwhite2023-09-191-1/+1
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | cmake: prefer system renderdoc header
| * | | | | | | | | cmake: prefer system renderdoc headerAlexandre Bouvier2023-09-181-1/+1
| | | | | | | | | |
* | | | | | | | | | Merge pull request #11538 from cathyjf/renderdoc-check-correct-win32-symbolliamwhite2023-09-191-1/+1
|\ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | renderdoc: Check for `_WIN32` symbol rather than `WIN32`
| * | | | | | | | | | renderdoc: Check for `_WIN32` symbol rather than `WIN32`Cathy J. Fitzpatrick2023-09-181-1/+1
| |/ / / / / / / / /
* / / / / / / / / / aoc: stub purchase info callsLiam2023-09-181-2/+18
|/ / / / / / / / /
* | | | | | | | | Merge pull request #11258 from Squall-Leonhart/Z16_Assert_Fixliamwhite2023-09-181-0/+2
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | Fix a logged assert in the format lookup table for Z16
| * | | | | | | | | Needed to make this an extra case so it didnt also start asserting in BOTW.Squall-Leonhart2023-08-111-0/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Thanks Liam
| * | | | | | | | | Fix an assert in the format lookup table fir Z16Squall Leonhart2023-08-111-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Came across this while looking into Asterix and Obelix XXL glitching
* | | | | | | | | | Merge pull request #11520 from Kelebek1/estimated_timeliamwhite2023-09-182-6/+8
|\ \ \ \ \ \ \ \ \ \ | |_|/ / / / / / / / |/| | | | | | | | | Do not consider voice commands in time estimation, fix adpcm estimate
| * | | | | | | | | Do not consider voice commands in time estimation, fix adpcm estimateKelebek12023-09-182-6/+8
| | |_|_|/ / / / / | |/| | | | | | |
* | | | | | | | | mii_types: Remove null terminator checklat9nq2023-09-171-4/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This is an OoB array access, causing a crash on at least the Linux Flatpak releases. Co-authored-by: german77 <juangerman-13@hotmail.com>
* | | | | | | | | Merge pull request #11524 from t895/signing-ciliamwhite2023-09-171-1/+18
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | android: Set up signing config for release builds
| * | | | | | | | | android: Set up signing config for release buildsCharles Lombardo2023-09-171-1/+18
| | |_|/ / / / / / | |/| | | | | | |
* | | | | | | | | Merge pull request #11522 from liamwhite/vfs-needs-resultsliamwhite2023-09-171-1/+3
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | registered_cache: correct file deletion case
| * | | | | | | | | registered_cache: correct file deletion caseLiam2023-09-171-1/+3
| | |/ / / / / / / | |/| | | | | | |
* | | | | | | | | Merge pull request #11460 from Kelebek1/hw_opusliamwhite2023-09-1727-411/+1898
|\ \ \ \ \ \ \ \ \ | |_|/ / / / / / / |/| | | | | | | | Reimplement HardwareOpus
| * | | | | | | | Reimplement HardwareOpusKelebek12023-09-1627-411/+1898
| |/ / / / / / /
* | | | | | | | android: Use 1 worker for shader compilation for all devicesCharles Lombardo2023-09-171-4/+5
| | | | | | | |
* | | | | | | | android: Collect task state once view is createdCharles Lombardo2023-09-161-9/+25
|/ / / / / / / | | | | | | | | | | | | | | | | | | | | | Before the viewLifecycleOwner wasn't ready and would cause a crash
* | | | | | | Merge pull request #11519 from german77/system-policyliamwhite2023-09-164-8/+52
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | service: hid: Implement ApplyNpadSystemCommonPolicy
| * | | | | | | service: hid: Implement ApplyNpadSystemCommonPolicygerman772023-09-164-8/+52
| | | | | | | |
* | | | | | | | Merge pull request #11518 from german77/bad-npadliamwhite2023-09-165-36/+42
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | service: hid: Implement last active Npad and fix some errors.
| * | | | | | | | hid: service: Remove outdated field from npadgerman772023-09-162-27/+14
| | | | | | | | |
| * | | | | | | | hid: service: Implement Last active Npadgerman772023-09-164-1/+20
| | | | | | | | |
| * | | | | | | | service: hid: Ensure state is correctgerman772023-09-161-8/+8
| |/ / / / / / /
* | | | | | | | Merge pull request #11517 from german77/amiibo-formatliamwhite2023-09-161-6/+8
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | service: nfc: Fix amiibo formatting
| * | | | | | | | service: nfc: Fix amiibo formattinggerman772023-09-161-6/+8
| |/ / / / / / /
* | | | | | | | Merge pull request #11500 from liamwhite/debug-stuffliamwhite2023-09-1612-17/+36
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | core: improve debug workflow
| * | | | | | | | core: improve debug workflowLiam2023-09-1412-17/+36
| | | | | | | | |
* | | | | | | | | Merge pull request #11499 from Squall-Leonhart/bitlockerfixliamwhite2023-09-161-6/+9
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | add std::error_code for std::filesystem exceptions
| * | | | | | | | | add std::error_code for std::filesystem exceptionsSquall-Leonhart2023-09-141-6/+9
| |/ / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Resolves a case on Windows where an unmounted bitlocker protected volume containing an assigned game directory would crash Yuzu at start. May also resolve cases where a disconnected SMB volume causes similar crashes (needs testing)
* | | | | | | | | Merge pull request #11492 from lat9nq/c-numeric-conversionsliamwhite2023-09-1611-65/+200
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | general: Remove uncaught usages of C++ string number conversions
| * | | | | | | | | shared_widget: Use default literals morelat9nq2023-09-142-21/+22
| | | | | | | | | |
| * | | | | | | | | settings_common: Fix typolat9nq2023-09-141-1/+1
| | | | | | | | | |
| * | | | | | | | | settings_setting: Don't remove the AudioEngine workaroundlat9nq2023-09-131-0/+3
| | | | | | | | | |
| * | | | | | | | | cmd/yuzu: Remove uncaught usage of stoilat9nq2023-09-131-2/+3
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Also fixes a style inconsistency
| * | | | | | | | | cmd/config: Remove uncaught usage of stoullat9nq2023-09-131-1/+1
| | | | | | | | | |
| * | | | | | | | | shared_widget: Forward-port Citra changeslat9nq2023-09-132-31/+134
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Seemed like a good time to move these over. Also remove usage of std::sto{l,ll,ul,f,d}
| * | | | | | | | | configure_ui: Remove unnecessary usage of stoullat9nq2023-09-131-5/+2
| | | | | | | | | |
| * | | | | | | | | cheat_engine: Remove uncaught usage of stoullat9nq2023-09-131-1/+1
| | | | | | | | | |
| * | | | | | | | | ips_layer: Remove uncaught usage of stoul/lllat9nq2023-09-131-2/+2
| | | | | | | | | |
| * | | | | | | | | key_manager: Remove uncaught usage of stoullat9nq2023-09-131-4/+4
| | | | | | | | | |
| * | | | | | | | | settings: Retro-port Citra Settings worklat9nq2023-09-132-8/+38
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This has yet to be PR'd on Citra, but regressions on yuzu that have been fixed in Citra needed to appear here.
| * | | | | | | | | android/config: Remove uncaught usage of stoullat9nq2023-09-131-1/+1
| | | | | | | | | |
* | | | | | | | | | Merge pull request #11483 from FearlessTobi/save-size-maxliamwhite2023-09-163-2/+15
|\ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | am: Stub GetSaveDataSizeMax
| * | | | | | | | | | am: Stub GetSaveDataSizeMaxFearlessTobi2023-09-122-1/+14
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Needed for Minecraft Legends.
| * | | | | | | | | | bsd: Demote "Select" log to dehugFearlessTobi2023-09-121-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This is very spammy in Minecraft Legends.
* | | | | | | | | | | Merge pull request #11475 from GPUCode/renderdoc-hotkeyliamwhite2023-09-1610-48/+165
|\ \ \ \ \ \ \ \ \ \ \ | |_|_|_|_|_|_|/ / / / |/| | | | | | | | | | debug: Add renderdoc capture hotkey
| * | | | | | | | | | debug: Add renderdoc capture hotkeyGPUCode2023-09-1410-48/+165
| | |_|/ / / / / / / | |/| | | | | | | |
* | | | | | | | | | android: Remove settings interface specifically for audio muteCharles Lombardo2023-09-154-31/+5
| | | | | | | | | |
* | | | | | | | | | Merge pull request #11507 from t895/emulation-stop-fixCharles Lombardo2023-09-151-2/+3
|\ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | android: Return the correct status code on emulation stop
| * | | | | | | | | | android: Return the correct status code on emulation stopCharles Lombardo2023-09-151-2/+3
| | | | | | | | | | |
* | | | | | | | | | | Merge pull request #11506 from t895/icon-fixCharles Lombardo2023-09-154-3/+43
|\ \ \ \ \ \ \ \ \ \ \ | |/ / / / / / / / / / |/| | | | | | | | | | android: Use resource as shortcut intermediary
| * | | | | | | | | | android: Use resource as shortcut intermediaryCharles Lombardo2023-09-154-3/+43
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Fixes issue where the shortcut icon would appear cropped on certain devices
* | | | | | | | | | | Merge pull request #11505 from t895/config-patchCharles Lombardo2023-09-151-3/+0
|\ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | android: Don't reinitialize settings on emulation start
| * | | | | | | | | | | android: Don't reinitialize settings on emulation startCharles Lombardo2023-09-151-3/+0
| |/ / / / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Config is already initialized on application start
* | | | | | | | | | | Merge pull request #11504 from t895/emu-argsCharles Lombardo2023-09-151-1/+1
|\ \ \ \ \ \ \ \ \ \ \ | |/ / / / / / / / / / |/| | | | | | | | | | android: Fix emulation to settings navigation args
| * | | | | | | | | | android: Fix emulation to settings navigation argsCharles Lombardo2023-09-151-1/+1
| | | | | | | | | | |
* | | | | | | | | | | android: Delay collecting UI state in games fragmentCharles Lombardo2023-09-151-4/+4
|/ / / / / / / / / /
* | | | | | | | | | android: Refactor menu tags to enumCharles Lombardo2023-09-149-46/+39
| | | | | | | | | |
* | | | | | | | | | android: Use StateFlow instead of LiveDataCharles Lombardo2023-09-1416-249/+367
|/ / / / / / / / /
* | | | | | | | | Merge pull request #11496 from liamwhite/ngcliamwhite2023-09-147-70/+158
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | ngc: implement service
| * | | | | | | | | ngc: implement serviceLiam2023-09-147-70/+158
| | |_|/ / / / / / | |/| | | | | | |
* | | | | | | | | Merge pull request #11479 from Kelebek1/check_all_fbsliamwhite2023-09-141-1/+14
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | Look for the most recently modified image for present
| * | | | | | | | | Look for the most recently modified image for presentKelebek12023-09-111-1/+14
| | | | | | | | | |
* | | | | | | | | | Merge pull request #11433 from liamwhite/shutdown-oopsieliamwhite2023-09-141-7/+13
|\ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | polyfill_thread: ensure mutex was locked before signaling stop
| * | | | | | | | | | polyfill_thread: ensure mutex was locked before signaling stopLiam2023-09-021-7/+13
| | | | | | | | | | |
* | | | | | | | | | | shader_recompiler: skip sampler for buffer textures (#11435)liamwhite2023-09-143-6/+2
| |_|/ / / / / / / / |/| | | | | | | | |
* | | | | | | | | | Merge pull request #11385 from liamwhite/acceptcancelliamwhite2023-09-133-3/+91
|\ \ \ \ \ \ \ \ \ \ | |_|_|_|/ / / / / / |/| | | | | | | | | internal_network: cancel pending socket operations on application process termination
| * | | | | | | | | internal_network: log error on interrupt pipe read failureLiam2023-09-081-1/+4
| | | | | | | | | |
| * | | | | | | | | internal_network: cancel pending socket operations on application process terminationLiam2023-08-273-3/+88
| | | | | | | | | |
* | | | | | | | | | Merge pull request #11486 from liamwhite/system-verificationliamwhite2023-09-137-1/+148
|\ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | qt: add verification for installed contents
| * | | | | | | | | | qt: add verification for installed contentsLiam2023-09-127-1/+148
| | |_|_|/ / / / / / | |/| | | | | | | |
* | | | | | | | | | Merge pull request #11480 from german77/mii_serviceliamwhite2023-09-1324-1943/+4466
|\ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | service: mii: Update implementation Part1
| * | | | | | | | | | service: mii: Remove most magic valuesNarr the Reg2023-09-1210-1069/+1537
| | | | | | | | | | |
| * | | | | | | | | | mii: service: Address reviewgerman772023-09-1113-104/+135
| | | | | | | | | | |
| * | | | | | | | | | mii: Prepare Interface for new implementationgerman772023-09-116-138/+210
| | | | | | | | | | |
| * | | | | | | | | | service: mii: Fix ver3 inconsistenciesgerman772023-09-119-217/+473
| | | | | | | | | | |
| * | | | | | | | | | service: mii: move char info operationsgerman772023-09-114-21/+576
| | | | | | | | | | |
| * | | | | | | | | | service: mii: Move store data operationsgerman772023-09-115-73/+512
| | | | | | | | | | |
| * | | | | | | | | | service: mii: Move core data operationsgerman772023-09-115-246/+730
| | | | | | | | | | |
| * | | | | | | | | | service: mii: Move ver3 operationsgerman772023-09-117-243/+241
| | | | | | | | | | |
| * | | | | | | | | | service: mii: separate mii types into their own filegerman772023-09-1120-542/+586
| | | | | | | | | | |
| * | | | | | | | | | service: mii: Move all raw data to it's filegerman772023-09-115-381/+479
| | | | | | | | | | |
| * | | | | | | | | | service: mii: Add mii util and resultgerman772023-09-115-11/+89
| | |_|_|/ / / / / / | |/| | | | | | | |
* | | | | | | | | | Merge pull request #11473 from liamwhite/fix-launch-paramliamwhite2023-09-1310-36/+71
|\ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | am: Implement UserChannel parameters
| * | | | | | | | | | am: Implement UserChannel parametersFearlessTobi2023-09-109-19/+70
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Used by the Super Mairo 3D All-Stars collection.
| * | | | | | | | | | am: Remove bcat from PopLaunchParameterFearlessTobi2023-09-102-21/+5
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This never belonged here and has no use anymore since the Boxcat backend was removed. .
* | | | | | | | | | | Merge pull request #11447 from xcfrg/portable-compile-outliamwhite2023-09-122-2/+8
|\ \ \ \ \ \ \ \ \ \ \ | |_|_|/ / / / / / / / |/| | | | | | | | | | common: add a compile time option to allow disabling portable mode
| * | | | | | | | | | add a compile time option to allow disabling portable modexcfrg2023-09-072-2/+8
| | | | | | | | | | |
* | | | | | | | | | | ci: fix msvc when used with LTO (#11459)liamwhite2023-09-111-0/+1
| |_|/ / / / / / / / |/| | | | | | | | |
* | | | | | | | | | Merge pull request #11450 from lat9nq/no-vk-device-fixliamwhite2023-09-102-13/+26
|\ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | configure_graphics: Fix handling of broken Vulkan
| * | | | | | | | | | yuzu-qt: Use Null when OpenGL is not compiledlat9nq2023-09-051-1/+9
| | | | | | | | | | |
| * | | | | | | | | | yuzu-qt: Update API Text for broken Vulkanlat9nq2023-09-051-0/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Otherwise caused a blue Vulkan badge to appear in the status bar.
| * | | | | | | | | | configure_graphics: Capture by referencelat9nq2023-09-051-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Small optimization.
| * | | | | | | | | | configure_graphics: Fix handling of broken Vulkanlat9nq2023-09-051-12/+16
| |/ / / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The VSync combobox wouldn't populate if there was no Vulkan device, which caused issues with trying to set VSync on other backends. This also adds another layer to GetCurrentGraphicsBackend to check for broken Vulkan and return OpenGL instead of Vulkan.
* | | | | | | | | | Merge pull request #11436 from liamwhite/bad-formatliamwhite2023-09-101-1/+6
|\ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | shader_recompiler: always declare image format for image buffers
| * | | | | | | | | | shader_recompiler: always declare image format for image buffersLiam2023-09-021-1/+6
| |/ / / / / / / / /
* | | | | | | | | | Merge pull request #11456 from liamwhite/worse-integrity-verificationliamwhite2023-09-1012-1/+220
|\ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | core: implement basic integrity verification
| * | | | | | | | | | core: implement basic integrity verificationLiam2023-09-0612-1/+220
| | | | | | | | | | |
* | | | | | | | | | | Merge pull request #11465 from Kelebek1/skip_remaining_resetliamwhite2023-09-105-27/+14
|\ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | [Audio] Do not reset the remaining command count each time
| * | | | | | | | | | | Do not reset the command buffer command count each timeKelebek12023-09-075-27/+14
| | | | | | | | | | | |
* | | | | | | | | | | | Merge pull request #11467 from Kelebek1/fix_decodeliamwhite2023-09-104-52/+72
|\ \ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | | | [audio] Fix data source version 1 command looping
| * | | | | | | | | | | | Fix data source version 1 command loopingKelebek12023-09-084-52/+72
| |/ / / / / / / / / / /
* | | | | | | | | | | | Merge pull request #11470 from GPUCode/bundle-vvlliamwhite2023-09-105-53/+6
|\ \ \ \ \ \ \ \ \ \ \ \ | |_|_|_|/ / / / / / / / |/| | | | | | | | | | | android: Add option to bundle validation layer
| * | | | | | | | | | | renderer_vulkan: Remove debug reportGPUCode2023-09-085-53/+6
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * VVL has implemented the more modern alternative, thus we don't need to support it anymore
* | | | | | | | | | | | vk_buffer_cache: Respect max vertex bindings in BindVertexBuffers (#11471)GPUCode2023-09-101-4/+7
| | | | | | | | | | | |
* | | | | | | | | | | | service: mii: Fix broken mii on MK8Narr the Reg2023-09-076-7/+118
| |/ / / / / / / / / / |/| | | | | | | | | |
* | | | | | | | | | | Merge pull request #11428 from Kelebek1/adsp_reworkliamwhite2023-09-06173-1257/+1051
|\ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | Rework ADSP into a wrapper for apps
| * | | | | | | | | | | Rework ADSP into a wrapper for appsKelebek12023-09-04173-1257/+1051
| |/ / / / / / / / / /
* | | | | | | | | | | Merge pull request #11434 from danilaml/fix-warningsliamwhite2023-09-0613-20/+17
|\ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | msvc: set warning level to /W4 globally
| * | | | | | | | | | | msvc: set warning level to /W4 globallyDanila Malyutin2023-09-0313-20/+17
| | |_|_|_|/ / / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | And fix a bunch of warnings
* | | | | | | | | | | Merge pull request #11437 from liamwhite/dump-shenanigansliamwhite2023-09-061-26/+50
|\ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | qt: measure romfs dump completion by bytes read
| * | | | | | | | | | | qt: measure romfs dump completion by bytes readLiam2023-09-031-26/+50
| | |_|_|/ / / / / / / | |/| | | | | | | | |
* | | | | | | | | | | Merge pull request #11451 from german77/mob_miiliamwhite2023-09-063-105/+3
|\ \ \ \ \ \ \ \ \ \ \ | |_|_|_|/ / / / / / / |/| | | | | | | | | | service: mii: Fix default mii database
| * | | | | | | | | | service: mii: Fix default mii databasegerman772023-09-053-105/+3
| |/ / / / / / / / /
* / / / / / / / / / core: Add support for loading NSPs with personalized tickets. (#10048)Steveice102023-09-055-145/+186
|/ / / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | Co-authored-by: Morph <39850852+Morph1984@users.noreply.github.com>
* | | | | | | | | Merge pull request #11381 from liamwhite/romfs-dumpliamwhite2023-09-022-51/+72
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | qt: fix romfs dumping for multiprogram applications
| * | | | | | | | | qt: ensure packed update nca is applied to the correct baseLiam2023-08-291-0/+7
| | | | | | | | | |
| * | | | | | | | | qt: fix romfs dumping for multiprogram applicationsLiam2023-08-292-51/+65
| | | | | | | | | |
* | | | | | | | | | Merge pull request #11383 from FernandoS27/are-you-a-wabbitliamwhite2023-09-0213-13/+141
|\ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | Fix regressions that damaged compute indirect & use reinterpret for copies with different byteblocksizes
| * | | | | | | | | | VideoCore: Implement DispatchIndirectFernando Sahmkow2023-08-2711-13/+119
| | | | | | | | | | |
| * | | | | | | | | | Shader Recompiler: Auto stub special registers and dump pipelines on exception.Fernando Sahmkow2023-08-272-1/+15
| | | | | | | | | | |
| * | | | | | | | | | DMA Pusher: Fix regression caused by guest memory optimizationsFernando Sahmkow2023-08-261-0/+8
| | |_|_|/ / / / / / | |/| | | | | | | |
* | | | | | | | | | Merge pull request #11384 from liamwhite/am-shutdownliamwhite2023-09-024-13/+41
|\ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | am: shorten shutdown timeout when lock is not held
| * | | | | | | | | | am: shorten shutdown timeout when lock is not heldLiam2023-08-264-13/+41
| |/ / / / / / / / /
* | | | | | | | | | Merge pull request #11393 from FernandoS27/bayo-got-busted-upliamwhite2023-09-021-1/+5
|\ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | Maxwell3D: Improve Index buffer size estimation.
| * | | | | | | | | | Maxwell3D: Improve Index buffer size estimation.Fernando Sahmkow2023-08-271-1/+5
| | | | | | | | | | |
* | | | | | | | | | | Merge pull request #11412 from liamwhite/key-area-keysliamwhite2023-09-021-4/+13
|\ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | vfs: ensure key area keys are validated
| * | | | | | | | | | | vfs: ensure key area keys are validatedLiam2023-08-291-4/+13
| | |_|/ / / / / / / / | |/| | | | | | | | |
* | | | | | | | | | | general: make -fwrapv generic to all architectures (#11379)liamwhite2023-09-021-1/+2
| |_|_|/ / / / / / / |/| | | | | | | | |
* | | | | | | | | | shader_recompiler: fix emulation of 3D textureGradLiam2023-09-022-3/+34
| |_|_|/ / / / / / |/| | | | | | | |
* | | | | | | | | android: Fix game content installerCharles Lombardo2023-08-312-85/+80
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Before this would run on the main thread and freeze the device. Additionally this fixes the result dialog not appearing if a config change happens during the installation by getting the activity's fragment manager when needed.
* | | | | | | | | android: Combine LongMessageDialogFragment with MessageDialogFragmentCharles Lombardo2023-08-315-98/+47
| | | | | | | | |
* | | | | | | | | android: Support dynamic app shortcutsCharles Lombardo2023-08-301-0/+21
| | | | | | | | |
* | | | | | | | | Merge pull request #11405 from t895/emulation-loadingCharles Lombardo2023-08-3028-237/+393
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | android: Emulation loading UI and fixes
| * | | | | | | | | android: Separate emulation states from emulation mutexCharles Lombardo2023-08-301-4/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Emulation states are repeatedly checked by input and performance stats. During startup and shutdown, this could lead to a long halt on the UI thread because the call to IsRunning will be waiting on the emulation mutex to be unlocked. Using atomics should replace the existing functionality without causing problems.
| * | | | | | | | | android: Game loading/shutting down indicatorsCharles Lombardo2023-08-3026-211/+312
| | | | | | | | | |
| * | | | | | | | | android: Create custom game icon loaderCharles Lombardo2023-08-302-22/+79
| | | | | | | | | |
* | | | | | | | | | hwopus: Implement GetWorkBufferSizeExExFearlessTobi2023-08-302-1/+6
|/ / / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Allows Sea of Stars to boot. Fixes https://github.com/yuzu-emu/yuzu/issues/11415.
* | | | | | | | | Merge pull request #11380 from t895/settings-integrationCharles Lombardo2023-08-3076-2109/+2219
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | android: Settings rework
| * | | | | | | | | android: Don't reload settings when stopping settings activityCharles Lombardo2023-08-301-2/+0
| | | | | | | | | |
| * | | | | | | | | android: Add optional androidDefault property to settingsCharles Lombardo2023-08-303-7/+15
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Certain settings have specific defaults for Android only. This lets us reflect them in the Kotlin side with very little code.
| * | | | | | | | | android: Proper state restoration on settings dialogsCharles Lombardo2023-08-309-198/+319
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | All dialog code (except for the Date/Time ones) has been extracted out into a generic settings dialog fragment that handles everything through a viewmodel. State for each dialog will now be retained and dialogs will stay shown through configuration changes. I won't be changing the current state of the date and time dialog fragments until Google decides to make their classes non-final or if/when we migrate to Jetpack Compose.
| * | | | | | | | | android: Add search for settingsCharles Lombardo2023-08-308-1/+372
| | | | | | | | | |
| * | | | | | | | | android: Implement paired settingsCharles Lombardo2023-08-309-241/+335
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Enables and disables editing on settings that rely on other boolean settings.
| * | | | | | | | | android: Prevent infinite switch toggle loopCharles Lombardo2023-08-301-1/+3
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | If something like a lifecycle event happens when this switch is toggled (Ex. whenever the black backgrounds switch is toggled), this could move the switch from the default position and trigger the checked changed listener and restart the loop. Here I just removed the listener at the start so we recycle the view properly still, set the checked state and then add the new listener.
| * | | | | | | | | android: Migrate settings to navigation componentCharles Lombardo2023-08-3028-567/+371
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Consolidates all of the settings components to the fragment and activity with no interfaces and only the settings fragment presenter. This also includes new material animations and new viewmodel usage to prevent the fragment and activity directly interacting with one another.
| * | | | | | | | | android: Trim settings enums and itemsCharles Lombardo2023-08-3016-321/+133
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Take advantage of the new settings interface to reduce the amount of code we need for each setting item. Additionally make all settings items non-null to improve brevity.
| * | | | | | | | | android: Expose interface for getting settings from native codeCharles Lombardo2023-08-3049-969/+869
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Completely removes code related to parsing the settings file on the java side. Now all settings are accessed via NativeConfig.kt and config.cpp has been modified to be closer to the core counterpart. Since the core currently uses QSettings, we can't remove reliance from Wini yet. This also includes simplifications to each settings interface to get closer to native code and prepare for per-game settings.
* | | | | | | | | | Merge pull request #11413 from t895/intentsCharles Lombardo2023-08-305-12/+45
|\ \ \ \ \ \ \ \ \ \ | |/ / / / / / / / / |/| | | | | | | | | android: Support intents to emulation activity
| * | | | | | | | | android: Support intents to emulation activityCharles Lombardo2023-08-295-12/+45
| | | | | | | | | |
* | | | | | | | | | Merge pull request #11408 from Kelebek1/fix_audio_node_idliamwhite2023-08-291-1/+1
|\ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | [Audio] Fix node id index in DropVoices
| * | | | | | | | | | Fix node id index in DropVoicesKelebek12023-08-281-1/+1
| | |_|_|_|_|_|_|_|/ | |/| | | | | | | |
* | | | | | | | | | Merge pull request #11409 from liamwhite/splatoon-nsd-v2liamwhite2023-08-292-2/+21
|\ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | sfdnsres: ensure lp1 is not resolved
| * | | | | | | | | | sfdnsres: ensure lp1 is not resolvedLiam2023-08-282-2/+21
| | |_|_|/ / / / / / | |/| | | | | | | |
* | | | | | | | | | Merge pull request #11112 from danilaml/nvdec-deinterlaceliamwhite2023-08-291-1/+2
|\ \ \ \ \ \ \ \ \ \ | |_|_|/ / / / / / / |/| | | | | | | | | Use initial_frame to check interlaced flag
| * | | | | | | | | Use initial_frame to check interlaced flagDanila Malyutin2023-08-271-1/+2
| |/ / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | If final frame was transferred from GPU, it won't carry the props. Fixes #11089
* | | | | | | | | Merge pull request #11392 from t895/layout-troublesCharles Lombardo2023-08-294-46/+33
|\ \ \ \ \ \ \ \ \ | |_|_|/ / / / / / |/| | | | | | | | android: Emulation activity fixes
| * | | | | | | | android: Don't set a default emulation orientationCharles Lombardo2023-08-271-1/+0
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Could cause unnecessary configuration change when setting an orientation other than "Landscape"
| * | | | | | | | android: Properly adjust emulation surface aspect ratioCharles Lombardo2023-08-273-45/+33
| | |_|_|_|_|/ / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Previously the emulation surface wouldn't respond properly to orientation changes. This would result in the screen appearing stretched when starting in one orientation and switching to another. The code for calculating the bounds of the view have been changed to match the expected behavior now. Before the view would just match parent in height and width. Now instead of using setLeftTopRightBottom (which is intended to be used for animations) we pass newly calculated bounds for the view into super. Now the view bounds match the emulation output. This also means that we don't need the overload for the SettingsActivity to launch it using an ActivityResultLauncher. We can just update the view in onResume.
* | | | | | | | Merge pull request #11390 from FearlessTobi/hwopus-multiliamwhite2023-08-292-3/+51
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | hwopus: Implement OpenHardwareOpusDecoderForMultiStreamEx and DecodeInterleavedForMultiStream
| * | | | | | | | hwopus: Implement OpenHardwareOpusDecoderForMultiStreamEx and DecodeInterleavedForMultiStreamFearlessTobi2023-08-272-3/+51
| |/ / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Allows MLB The Show 22 to boot. Fixes https://github.com/yuzu-emu/yuzu/issues/7911.
* | / / / / / / audio: allow more latency in cubeb initializationLiam2023-08-272-8/+3
| |/ / / / / / |/| | | | | |
* | | | | | | Merge pull request #11389 from FernandoS27/discard-fixFernando S2023-08-271-1/+9
|\ \ \ \ \ \ \ | |/ / / / / / |/| | | | | | Buffer Cache: fix discard writes.
| * | | | | | Buffer Cache: fix discard writes.Fernando Sahmkow2023-08-271-1/+9
| | |/ / / / | |/| | | |
* | | | | | Merge pull request #11356 from lat9nq/console-mode-pgliamwhite2023-08-2725-40/+162
|\ \ \ \ \ \ | | | | | | | | | | | | | | general,config-qt: Present Console Mode as an enum with separate options in game properties
| * | | | | | main: Fix docked mode button, clang 14 errorlat9nq2023-08-231-6/+6
| | | | | | |
| * | | | | | native: Use Docked Mode helperlat9nq2023-08-231-1/+1
| | | | | | |
| * | | | | | main: Access by referencelat9nq2023-08-231-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | Old Clang is fussy about this.
| * | | | | | config-android: Translate console mode settinglat9nq2023-08-231-1/+4
| | | | | | | | | | | | | | | | | | | | | | | | | | | | Translates the previous boolean to the enum.
| * | | | | | general: Use console mode helper across projectlat9nq2023-08-2313-49/+34
| | | | | | |
| * | | | | | settings: Add docked mode helper functionlat9nq2023-08-232-0/+7
| | | | | | |
| * | | | | | config(qt): Sanitize docked handheld controllerlat9nq2023-08-222-0/+13
| | | | | | |
| * | | | | | shared_translation: Define use_docked_mode textslat9nq2023-08-221-1/+4
| | | | | | |
| * | | | | | general: Convert use_docked_mode to an enumerationlat9nq2023-08-2217-35/+74
| | | | | | | | | | | | | | | | | | | | | | | | | | | | Allows some special interactions with it in the Qt frontend.
| * | | | | | shared_widget: Implement radio groupslat9nq2023-08-222-1/+73
| | |/ / / / | |/| | | |
* | | | | | Merge pull request #11359 from Kelebek1/check_suitable_backendliamwhite2023-08-275-38/+117
|\ \ \ \ \ \ | | | | | | | | | | | | | | Pre-test for valid audio backends
| * | | | | | Pre-test opening a stream for audio backends, fall back to null if not suitable.Kelebek12023-08-235-38/+117
| |/ / / / /
* | | | | | Merge pull request #11317 from Kelebek1/macro_dumpsliamwhite2023-08-272-11/+20
|\ \ \ \ \ \ | | | | | | | | | | | | | | Mark decompiled macros on dump, dump shaders after translation
| * | | | | | Mark decompiled macros as decompiled on dump, dump shaders after translationKelebek12023-08-262-11/+20
| | | | | | |
* | | | | | | Avoid `$<CXX_COMPILER_ID:Clang>` because it doesn't include AppleClang.comex2023-08-261-9/+11
| | | | | | |
* | | | | | | Warnings cleanup for GCC 13 and Clang 16comex2023-08-264-10/+7
| |_|/ / / / |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Note: For GCC there are still a huge number of `-Warray-bounds` warnings coming from `externals/dynarmic`. I could have added a workaround in `externals/CMakeLists.txt` similar to what this PR does for other externals, but given Dynarmic's close affiliation with Yuzu, it would be better to fix it upstream. Besides that, on my machine, this makes the build warning-free except for some warnings from glslangValidator and AutoMoc. Details: - Disable some warnings in externals. - Disable `-Wnullability-completeness`, which is a Clang warning triggered by the Vulkan SDK where if any pointers in the header are marked _Nullable, it wants all pointers to be marked _Nullable or _Nonnull. Most of them are, but some aren't. Who knows why. - `src/web_service/verify_user_jwt.cpp`: Disable another warning when including `jwt.hpp`. - `src/input_common/input_poller.cpp`: Add missing `override` specifiers. - src/common/swap.h: Remove redundant `operator&`. In general, this file declares three overloads of each operator. Using `+` as an example, the overloads are: - a member function for `swapped_t + integer` - a member function for `swapped_t + swapped_t` - a free function for `integer + swapped_t` But for `operator&`, there was an additional free function for `swapped_t + integer`, which was redundant with the member function. This caused a GCC warning saying "ISO C++ says that these are ambiguous".
* | | | | | Merge pull request #11377 from BenjaminHalko/reverse-slider-inputliamwhite2023-08-261-0/+1
|\ \ \ \ \ \ | | | | | | | | | | | | | | ui: Fixed inverted controls on ReverseSlider widgets
| * | | | | | ui: Fixed inverted controls on ReverseSlider widgetsBenjaminHalko2023-08-251-0/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | fixes: #11236
* | | | | | | Merge pull request #11378 from t895/game-flagliamwhite2023-08-261-0/+1
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | android: Use appCategory to specify the app is a game
| * | | | | | | android: Use appCategory to specify the app is a gameCharles Lombardo2023-08-251-0/+1
| | | | | | | |
* | | | | | | | Merge pull request #11370 from FearlessTobi/fix-filesizeliamwhite2023-08-261-1/+10
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | filesystem: Return correct error for RenameFile when dest_path already exists
| * | | | | | | | filesystem: Return correct error for RenameFile when dest_path already existsFearlessTobi2023-08-241-1/+10
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Allows Grid Autosport to boot. Fixes https://github.com/yuzu-emu/yuzu/issues/8287.
* | | | | | | | | Merge pull request #11371 from FearlessTobi/fix-cli-updatesliamwhite2023-08-262-0/+39
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | yuzu/main: Ensure NCAs are registered in content provider when launching from CLI
| * | | | | | | | | yuzu/main: Ensure NCAs are registered in content provider when launching from CLIFearlessTobi2023-08-242-0/+39
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Fixes updates and DLC not being loaded when launching yuzu from the command line. Similar to https://github.com/yuzu-emu/yuzu/pull/11357. Fixes https://github.com/yuzu-emu/yuzu/issues/8352,
* | | | | | | | | | ssl: tolerate handshake without hostname set (#11328)liamwhite2023-08-263-24/+14
| | | | | | | | | |
* | | | | | | | | | registered_cache: create fake CNMT entries for program updates of multiprogram applications (#11319)liamwhite2023-08-261-9/+28
| | | | | | | | | |
* | | | | | | | | | kernel: offset code entry point for 39-bit address space type (#11326)liamwhite2023-08-257-11/+33
| |_|/ / / / / / / |/| | | | | | | |
* | | | | | | | | Merge pull request #11357 from liamwhite/lime-vfsbunnei2023-08-251-0/+44
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | android: jni: ensure NCAs from loaded filepath are registered in manual content provider
| * | | | | | | | | android: jni: ensure NCAs from loaded filepath are registered in manual content providerLiam2023-08-231-0/+44
| | |_|_|_|/ / / / | |/| | | | | | |
* | | | | | | | | nvhost_as_gpu: ensure mappings are aligned to big page size when deallocatedLiam2023-08-251-1/+3
| |/ / / / / / / |/| | | | | | |
* | | | | | | | Merge pull request #11327 from liamwhite/skyline-2liamwhite2023-08-243-2/+10
|\ \ \ \ \ \ \ \ | |_|/ / / / / / |/| | | | | | | sockets: avoid locking around socket session calls
| * | | | | | | sockets: avoid locking around socket session callsLiam2023-08-203-2/+10
| | | | | | | |
* | | | | | | | game_list_worker: Display correct size for NAX gamesFearlessTobi2023-08-241-10/+13
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This was a regression from https://github.com/yuzu-emu/yuzu/pull/1837. Fixes https://github.com/yuzu-emu/yuzu/issues/1938.
* | | | | | | | Merge pull request #11352 from t895/recurse-subfoldersliamwhite2023-08-231-9/+26
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | android: Search game directory recursively
| * | | | | | | | android: Search game directory recursivelyCharles Lombardo2023-08-221-9/+26
| | |/ / / / / / | |/| | | | | |
* / | | | | | | android: Set default build variant to mainlineRelWithDebInfo (#11358)Charles Lombardo2023-08-231-0/+2
|/ / / / / / /
* | | | | | | Merge pull request #11302 from vonchenplus/vulkan_macosliamwhite2023-08-223-9/+27
|\ \ \ \ \ \ \ | |_|/ / / / / |/| | | | | | Add macos moltenvk bundle, Add copy moltevk dylib script
| * | | | | | Add macos moltenvk bundle, Add copy moltevk dylib scriptFeng Chen2023-08-223-9/+27
| | | | | | |
* | | | | | | Merge pull request #11303 from lat9nq/screenshots-configurableliamwhite2023-08-2214-27/+241
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | yuzu-qt: Add configuration for screenshot resolution
| * | | | | | | uisettings: Add TODO for stretched aspect being ignoredlat9nq2023-08-171-0/+1
| | | | | | | |
| * | | | | | | configure_ui: Silence MSVC warninglat9nq2023-08-161-1/+1
| | | | | | | |
| * | | | | | | yuzu-qt: Screenshots depend more on the graphics settingslat9nq2023-08-1612-142/+127
| | | | | | | |
| * | | | | | | yuzu-qt: Implement unspecified screenshot ratiolat9nq2023-08-164-11/+30
| | | | | | | |
| * | | | | | | bootmanager: Remove old pathlat9nq2023-08-161-8/+3
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Causes issues with different selected aspect ratios in graphics.
| * | | | | | | configure_ui: Update the screenshots datalat9nq2023-08-161-4/+13
| | | | | | | |
| * | | | | | | config: Read the entire screenshots categorylat9nq2023-08-161-2/+1
| | | | | | | |
| * | | | | | | bootmanager: Consider the default resolutionlat9nq2023-08-161-1/+5
| | | | | | | |
| * | | | | | | yuzu-qt: Enable specifying screenshot resolutionlat9nq2023-08-165-3/+198
| | | | | | | |
| * | | | | | | settings: Add AspectRatio enum, split res scale functionlat9nq2023-08-163-3/+10
| | | | | | | |
* | | | | | | | Merge pull request #11316 from FernandoS27/stop-premature-christmas-decoratingliamwhite2023-08-228-11/+261
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | Shader Recompiler: implement textureGrad 3D
| * | | | | | | | Shader Recomnpiler: implement textuzreGrad 3D emulation constant propagationFernando Sahmkow2023-08-198-11/+261
| | |_|_|/ / / / | |/| | | | | |
* | | | | | | | Merge pull request #11346 from t895/ktlint-fixliamwhite2023-08-221-0/+5
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | android: lint: Delete generated ktlint folder between builds
| * | | | | | | | android: lint: Delete generated ktlint folder between buildsCharles Lombardo2023-08-211-0/+5
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | There's a bug in ktlint where it will run into an error if you build the project, delete a source file, and then build again. It will be unable to find the file you deleted and can't recover until these files are deleted. This just deletes those files before every run.
* | | | | | | | | android: Show associated value in home settings (#11272)Charles Lombardo2023-08-216-4/+75
| | | | | | | | |
* | | | | | | | | Merge pull request #11309 from liamwhite/full-xciliamwhite2023-08-212-7/+42
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | file_sys/card_image: support dumps with prepended key area
| * | | | | | | | | file_sys/card_image: support dumps with prepended key areaLiam2023-08-182-7/+42
| | | | | | | | | |
* | | | | | | | | | Merge pull request #11342 from liamwhite/skyline-4liamwhite2023-08-211-1/+8
|\ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | patch_manager: apply manual HTML patches when present
| * | | | | | | | | | patch_manager: apply manual HTML patches when presentLiam2023-08-211-1/+8
| | | | | | | | | | |
* | | | | | | | | | | Merge pull request #11149 from ameerj/astc-perf-prodliamwhite2023-08-212-535/+454
|\ \ \ \ \ \ \ \ \ \ \ | |_|_|/ / / / / / / / |/| | | | | | | | | | host_shaders: ASTC compute shader optimizations
| * | | | | | | | | | flatten color_valuesAmeer J2023-08-101-14/+9
| | | | | | | | | | |
| * | | | | | | | | | flatten encoding_valuesAmeer J2023-08-101-11/+10
| | | | | | | | | | |
| * | | | | | | | | | flatten result vectorAmeer J2023-08-101-14/+5
| | | | | | | | | | |
| * | | | | | | | | | GetUnquantizedWeightVectorAmeer J2023-08-091-69/+63
| | | | | | | | | | |
| * | | | | | | | | | Revert "HACK: Avoid swizzling and reuploading ASTC image every frame"Ameer J2023-08-065-39/+4
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This reverts commit b18c1fb1bbbcc235e9a1cbbb2704fed2e5895e61.
| * | | | | | | | | | HACK: Avoid swizzling and reuploading ASTC image every frameAmeer J2023-08-065-4/+39
| | | | | | | | | | |
| * | | | | | | | | | Compute ReplicateAmeer J2023-08-061-85/+20
| | | | | | | | | | |
| * | | | | | | | | | minorAmeer J2023-08-061-12/+6
| | | | | | | | | | |
| * | | | | | | | | | undo uintAmeer J2023-08-061-3/+3
| | | | | | | | | | |
| * | | | | | | | | | Revert "vulkan dims specialization"Ameer J2023-08-065-198/+27
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This reverts commit e6243058f2269bd79ac8479d58e55feec2611e9d.
| * | | | | | | | | | vulkan dims specializationameerj2023-08-065-27/+198
| | | | | | | | | | |
| * | | | | | | | | | small_block optAmeer J2023-08-061-4/+3
| | | | | | | | | | |
| * | | | | | | | | | remove TexelWeightParamsAmeer J2023-08-061-46/+31
| | | | | | | | | | |
| * | | | | | | | | | error/void extent funcsAmeer J2023-08-061-48/+43
| | | | | | | | | | |
| * | | | | | | | | | more packingAmeer J2023-08-061-109/+109
| | | | | | | | | | |
| * | | | | | | | | | Revert "uint result index"Ameer J2023-08-061-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This reverts commit 0e978786b5a8e7382005d8b1e16cfa12f3eeb775.
| * | | | | | | | | | Revert "bfe instead of mod"Ameer J2023-08-061-15/+13
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This reverts commit 86006a3b09e8a8c17d2ade61be76736a79e3f58a.
| * | | | | | | | | | Revert "global endpoints"Ameer J2023-08-061-36/+40
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This reverts commit d8f5bfd1df2b7469ef6abcee182aa110602d1751.
| * | | | | | | | | | global endpointsAmeer J2023-08-061-40/+36
| | | | | | | | | | |
| * | | | | | | | | | bfe instead of modAmeer J2023-08-061-13/+15
| | | | | | | | | | |
| * | | | | | | | | | uint result indexAmeer J2023-08-061-1/+1
| | | | | | | | | | |
| * | | | | | | | | | amd optsAmeer J2023-08-061-16/+13
| | | | | | | | | | |
| * | | | | | | | | | glAmeer J2023-08-061-0/+1
| | | | | | | | | | |
| * | | | | | | | | | const, pack result_vector and replicate tables,Ameer J2023-08-061-227/+260
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | undo amd opts
| * | | | | | | | | | minor redundancy cleanupAmeer J2023-08-061-12/+2
| | | | | | | | | | |
| * | | | | | | | | | extractbits robustnessAmeer J2023-08-061-5/+8
| | | | | | | | | | |
| * | | | | | | | | | reuse vectors memoryAmeer J2023-08-061-33/+17
| | | | | | | | | | |
| * | | | | | | | | | EncodingData packAmeer J2023-08-061-44/+69
| | | | | | | | | | |
| * | | | | | | | | | flatteningAmeer J2023-08-061-43/+44
| | | | | | | | | | |
| * | | | | | | | | | weights refactorAmeer J2023-08-061-26/+22
| | | | | | | | | | |
| * | | | | | | | | | params.max_weightAmeer J2023-08-061-5/+2
| | | | | | | | | | |
| * | | | | | | | | | skip bitsAmeer J2023-08-061-9/+14
| | | | | | | | | | |
| * | | | | | | | | | restrictAmeer J2023-08-061-2/+2
| | | | | | | | | | |
* | | | | | | | | | | android: Use sensor landscape for landscape mode (#11337)Charles Lombardo2023-08-211-2/+2
| |/ / / / / / / / / |/| | | | | | | | |
* | | | | | | | | | Merge pull request #11284 from liamwhite/nca-releaseFernando S2023-08-2175-1026/+8017
|\ \ \ \ \ \ \ \ \ \ | |_|_|_|_|_|/ / / / |/| | | | | | | | | vfs: expand support for NCA reading
| * | | | | | | | | file_sys: tolerate empty NCALiam2023-08-163-3/+3
| | | | | | | | | |
| * | | | | | | | | fssystem: rework for yuzu styleLiam2023-08-1534-340/+345
| | | | | | | | | |
| * | | | | | | | | fssystem: reduce overalignment of unbuffered storage operationsLiam2023-08-155-54/+28
| | | | | | | | | |
| * | | | | | | | | vfs: expand support for NCA readingLiam2023-08-1575-1028/+8040
| | |_|_|_|/ / / / | |/| | | | | | |
* | | | | | | | | Masked depthstencil clearsKelebek12023-08-195-9/+132
| |_|_|/ / / / / |/| | | | | | |
* | | | | | | | Merge pull request #11278 from Kelebek1/dma_syncliamwhite2023-08-183-5/+15
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | Mark accelerated DMA destination buffers and images as GPU-modified
| * | | | | | | | Mark accelerted DMA destination buffers and images as GPU-modifiedKelebek12023-08-133-5/+15
| | | | | | | | |
* | | | | | | | | Merge pull request #11288 from liamwhite/svc-tickliamwhite2023-08-1811-33/+67
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | kernel: remove relative task registration
| * | | | | | | | | kernel: remove relative task registrationLiam2023-08-1511-33/+67
| | | | | | | | | |
* | | | | | | | | | video_core: Fix vulkan assert errorFeng Chen2023-08-182-1/+9
| |_|_|_|/ / / / / |/| | | | | | | |
* | | | | | | | | Merge pull request #10989 from comex/epipeliamwhite2023-08-174-7/+36
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | sockets: Improve behavior when sending to closed connection
| * | | | | | | | | Improve behavior when sending to closed connectioncomex2023-08-164-7/+36
| | |_|/ / / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | - On Unix, this would previously kill the Yuzu process with SIGPIPE. Send MSG_NOSIGNAL to opt out of this. - Add support for the proper error code in this situation, EPIPE. - Windows has nonstandard behavior in this situation; translate it to the standard behavior. Kind of pointless, but isn't it nice to be correct?
* / | | | | | | | cmake: mark warning disable for gcc 11 (#11301)liamwhite2023-08-171-1/+1
|/ / / / / / / /
* | | | | | | | Merge pull request #11287 from liamwhite/replaced-bytesFernando S2023-08-151-0/+17
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | gdbstub: fixup replaced instruction bytes in memory reads
| * | | | | | | | gdbstub: fixup replaced instruction bytes in memory readsLiam2023-08-141-0/+17
| |/ / / / / / /
* | | | | | | | Merge pull request #11256 from FearlessTobi/revert-10075bunnei2023-08-152-2/+15
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | Partially Revert "Silence nifm spam"
| * | | | | | | | Revert "Silence nifm spam"FearlessTobi2023-08-142-2/+15
| | |_|_|_|/ / / | |/| | | | | | | | | | | | | | | | | | | | | | This reverts commit 4da4ecb1ff79798fe245a0c6c483405f998cd093.
* | | | | | | | Merge pull request #11273 from t895/setup-completionbunnei2023-08-1511-184/+370
|\ \ \ \ \ \ \ \ | |_|_|_|_|/ / / |/| | | | | | | android: Setup additions
| * | | | | | | android: Page forward on setup step completionCharles Lombardo2023-08-133-0/+17
| | | | | | | |
| * | | | | | | android: Adjust setup fragment layoutCharles Lombardo2023-08-123-63/+88
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Fixes padding issues in small and large layouts and allows viewpager to reach into system insets.
| * | | | | | | android: Show complete indicator during setupCharles Lombardo2023-08-128-121/+265
| | |_|/ / / / | |/| | | | |
* | | | | | | Merge pull request #11271 from t895/settings-tweaksbunnei2023-08-1412-59/+106
|\ \ \ \ \ \ \ | |_|_|/ / / / |/| | | | | | android: Settings tweaks
| * | | | | | android: Remove redundant option from slider dialogCharles Lombardo2023-08-121-4/+0
| | | | | | | | | | | | | | | | | | | | | | | | | | | | You can already reset any setting by long pressing the settings item.
| * | | | | | android: Reduce opacity of non-editable settingsCharles Lombardo2023-08-127-3/+28
| | | | | | |
| * | | | | | android: Use string resource for slider value/unitsCharles Lombardo2023-08-122-13/+13
| | | | | | |
| * | | | | | android: Display setting value in setting list itemsCharles Lombardo2023-08-127-38/+64
| | | | | | |
| * | | | | | android: Set switch listener before assigning new valueCharles Lombardo2023-08-121-1/+1
| |/ / / / / | | | | | | | | | | | | | | | | | | Previously the switch could have its old listener triggered when recycled.
* | | | | | Merge pull request #11282 from ameerj/glasm-xfbliamwhite2023-08-142-15/+1
|\ \ \ \ \ \ | | | | | | | | | | | | | | gl_graphics_pipeline: GLASM: Fix transform feedback with multiple buffers
| * | | | | | gl_graphics_pipeline: GLASM: Fix transform feedback with multiple buffersAmeer J2023-08-132-15/+1
| |/ / / / /
* | | | | | Merge pull request #11283 from ameerj/glasm-pipeline-detectionliamwhite2023-08-141-2/+2
|\ \ \ \ \ \ | | | | | | | | | | | | | | gl_graphics_pipeline: Fix GLASM storage buffer detection
| * | | | | | gl_graphics_pipeline: Fix GLASM storage buffer detectionAmeer J2023-08-131-2/+2
| | | | | | |
* | | | | | | Merge pull request #11281 from liamwhite/vi-scale-modeliamwhite2023-08-142-0/+2
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | nvnflinger: add missing scale mode
| * | | | | | | nvnflinger: add missing scale modeLiam2023-08-132-0/+2
| | |/ / / / / | |/| | | | |
* | | | | | | Merge pull request #11259 from german77/hidliamwhite2023-08-143-24/+86
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | service: hid: Implement functions needed by QLaunch
| * | | | | | | service: hid: Implement functions needed by QLaunchNarr the Reg2023-08-113-24/+86
| | |_|/ / / / | |/| | | | |
* | | | | | | Merge pull request #11263 from liamwhite/my-feature-branchliamwhite2023-08-142-74/+114
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | vulkan_device: disable features associated with unloaded extensions
| * | | | | | | vulkan_device: disable features associated with unloaded extensionsLiam2023-08-112-74/+114
| |/ / / / / /
* | / / / / / ssl_backend_securetransport: remove stray .Code()Liam2023-08-121-1/+1
| |/ / / / / |/| | | | |
* | | | | | Merge pull request #11219 from zeltermann/title-id-searchliamwhite2023-08-111-2/+6
|\ \ \ \ \ \ | | | | | | | | | | | | | | Allow searching by a substring of the title ID
| * | | | | | Allow searching by a substring of the title IDzeltermann2023-08-101-2/+6
| |/ / / / /
* | | | | | Merge pull request #11253 from liamwhite/i-hate-this-toolchainliamwhite2023-08-115-73/+81
|\ \ \ \ \ \ | |/ / / / / |/| | | | | general: fix apple clang build
| * | | | | general: fix apple clang buildLiam2023-08-105-73/+81
| | | | | |
* | | | | | Merge pull request #11093 from liamwhite/result-ergonomicsbunnei2023-08-1039-600/+514
|\ \ \ \ \ \ | | | | | | | | | | | | | | core: remove ResultVal type
| * | | | | | fs: return result on null outputsLiam2023-08-081-4/+24
| | | | | | |
| * | | | | | general: fix incorrect conversionsLiam2023-08-084-5/+5
| | | | | | |
| * | | | | | ssl: remove ResultVal useLiam2023-08-087-124/+127
| | | | | | |
| * | | | | | core: remove ResultVal typeLiam2023-08-0832-475/+366
| |/ / / / /
* / / / / / service: pctl: Partially revert 11221Narr the Reg2023-08-091-9/+15
|/ / / / /
* | | | | Merge pull request #11216 from lat9nq/no-mesa-astcliamwhite2023-08-071-1/+42
|\ \ \ \ \ | | | | | | | | | | | | gl_device: Detect Mesa to disable their ASTC
| * | | | | gl_device: Filter more specifically for slow ASTClat9nq2023-08-051-1/+42
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Adds a check to find if the renderer is Intel DG (i.e. DG2). gl_device: Detect Mesa to disable their ASTC In our testing, our own ASTC decoder has shown itself to perform faster than the included one from the driver. Disable theirs when Mesa is detected. Mesa detection depends on the vendor string. Some drivers never appear outside of *nix contexts, so only check those in the *nix context. gl_device: Internalize Intel DG detection
* | | | | | Merge pull request #11217 from german77/olscliamwhite2023-08-071-6/+152
|\ \ \ \ \ \ | | | | | | | | | | | | | | service: olsc: Implement IOlscServiceForSystemService ITransferTaskListController interfaces for QLaunch
| * | | | | | service: olsc: Implement IOlscServiceForSystemService ITransferTaskListController interfaces for QLaunchgerman772023-08-051-6/+152
| |/ / / / /
* | | | | | Merge pull request #11221 from german77/pctlliamwhite2023-08-071-18/+134
|\ \ \ \ \ \ | | | | | | | | | | | | | | service: pctl: Implement functions needed for QLaunch
| * | | | | | service: pctl: Implement functions needed for QLaunchgerman772023-08-051-18/+134
| |/ / / / /
* | | / / / service: audctl: Stub functions needed by Qlaunchgerman772023-08-062-4/+64
| |_|/ / / |/| | | |
* | | | | Merge pull request #11212 from Kelebek1/shader_stuffliamwhite2023-08-057-26/+42
|\ \ \ \ \ | | | | | | | | | | | | Fix various misc pipeline/shader things
| * | | | | Fix shader dumps with nvdisasmKelebek12023-08-037-26/+42
| | |/ / / | |/| | | | | | | | | | | | | | | | | | skip fragment shaders when rasterizer is disabled initialize env_ptrs
* | | | | Merge pull request #11210 from german77/settingsliamwhite2023-08-055-119/+723
|\ \ \ \ \ | | | | | | | | | | | | service: set: Implement system settings for Qlaunch
| * | | | | service: set: Add more system settings and address commentsNarr the Reg2023-08-052-7/+100
| | | | | |
| * | | | | service: set: Implement system settings for QlaunchNarr the Reg2023-08-035-114/+625
| |/ / / /
* | | | | Merge pull request #11208 from german77/interfaceliamwhite2023-08-053-3/+55
|\ \ \ \ \ | |_|/ / / |/| | | | service: am: Fix wrong interface ILibraryAppletSelfAccessor
| * | | | service: am: Fix wrong interfaceNarr the Reg2023-08-023-3/+55
| |/ / /
* | | | vulkan_device: Fix subgroup_size_control detection on Vulkan 1.3Ameer J2023-08-032-3/+3
| | | |
* | | | vulkan_device: Fix VK_EXT_subgroup_size_control detectionAmeer J2023-08-031-1/+1
|/ / /
* | | Merge pull request #11202 from abouvier/vulkan-configliamwhite2023-08-0215-45/+36
|\ \ \ | | | | | | | | vulkan: centralize config
| * | | vulkan: centralize configAlexandre Bouvier2023-08-0215-45/+36
| | | |
* | | | Merge pull request #10839 from lat9nq/pgc-plusliamwhite2023-08-0277-4835/+4629
|\ \ \ \ | | | | | | | | | | general: Reimplement per-game configurations
| * | | | config(qt): Fix name of network categorylat9nq2023-08-021-2/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Turns out the network interface is in the Services category. Can't wait get rid of this whole config. Addresses yuzu-emu/yuzu/issues/11205
| * | | | config(qt): Use qt_config directly to read configlat9nq2023-08-021-2/+4
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | ReadSetting with the default is a convenience function reading settings, not for use in an internal environment. It tries to manage the default value of a setting.
| * | | | shared_widget: Only save global settings as neededlat9nq2023-07-301-2/+4
| | | | | | | | | | | | | | | | | | | | | | | | | Fixes a potential but not reproduced issue where the custom config is being applied to the global config.
| * | | | config(qt): Write the UiGeneral categorylat9nq2023-07-301-0/+1
| | | | |
| * | | | Merge branch 'pgc-plus' of github.com:lat9nq/yuzu into pgc-pluslat9nq2023-07-293-11/+29
| |\ \ \ \
| | * | | | (ui)settings: Add more runtime_modifiable settingslat9nq2023-07-262-10/+28
| | | | | |
| | * | | | backend: Remove usage of explicit operator overloadlat9nq2023-07-261-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Causes a crash on MSVC from a race condition on application quit. Intended to address yuzu-emu/yuzu/issues/11137
| * | | | | config(qt): Fix generic read settinglat9nq2023-07-291-7/+11
| |/ / / / | | | | | | | | | | | | | | | Previously was not respecting whether the setting was default.
| * | | | settings: Correct Linkage member impl locationlat9nq2023-07-252-3/+3
| | | | |
| * | | | settings: Set GPU as default ASTC decoderlat9nq2023-07-241-1/+1
| | | | |
| * | | | shared_widget: Determine default request earlierlat9nq2023-07-231-19/+22
| | | | | | | | | | | | | | | | | | | | | | | | | Fixes a bug where a restore button could be created for an unmanaged widget.
| * | | | settings_common: Document specializationslat9nq2023-07-231-9/+10
| | | | |
| * | | | shared_widget: Use QRegularExpressionlat9nq2023-07-221-3/+3
| | | | |
| * | | | config: Read the Network categorylat9nq2023-07-222-0/+12
| | | | |
| * | | | configure_audio/cpu: Sort settingslat9nq2023-07-222-3/+12
| | | | | | | | | | | | | | | | | | | | Was producing out of order settings as a result of the switch to vectors
| * | | | configure_dialog: Focus the button box on startlat9nq2023-07-221-0/+3
| | | | | | | | | | | | | | | | | | | | Without this, the Reset All Settings button would be selected by default
| * | | | qt/configuration: Use deleteLaterlat9nq2023-07-226-7/+7
| | | | |
| * | | | common,qt-config: Remove usage of forward_listlat9nq2023-07-2221-65/+64
| | | | |
| * | | | settings_common: Use a vector in category linkagelat9nq2023-07-212-2/+2
| | | | | | | | | | | | | | | | | | | | Improve storage requirements.
| * | | | settings: Remove sorting from loglat9nq2023-07-211-4/+0
| | | | | | | | | | | | | | | | | | | | Unecessary, and would run every time the settings are logged.
| * | | | configure_system: Use lambda template to group settingslat9nq2023-07-211-1/+1
| | | | |
| * | | | config-android: Update memory layout member namelat9nq2023-07-211-1/+1
| | | | |
| * | | | k_system_control: Always return some memory sizelat9nq2023-07-211-0/+2
| | | | |
| * | | | common: Move global configuration state modifiers back to settingslat9nq2023-07-215-13/+14
| | | | |
| * | | | settings_setting: Fix typolat9nq2023-07-211-4/+4
| | | | |
| * | | | common,configure_system: Rename method to GetCategorylat9nq2023-07-214-8/+8
| | | | | | | | | | | | | | | | | | | | Fixes essentially a shadowing issue.
| * | | | settings: Cleanuplat9nq2023-07-213-32/+51
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Addresses review feedback Co-authored-by: Morph <39850852+Morph1984@users.noreply.github.com>
| * | | | shared_translation: Update memory layout mode stringslat9nq2023-07-211-2/+7
| | | | |
| * | | | core,common: Give memory layout setting an enumlat9nq2023-07-214-9/+31
| | | | | | | | | | | | | | | | | | | | Allows for 6GB and 8GB layouts to be selected.
| * | | | settings: Require time zone setting value for stirnglat9nq2023-07-214-5/+7
| | | | |
| * | | | shared_translation: Add missing time zoneslat9nq2023-07-211-0/+3
| | | | |
| * | | | shared_translation: Add controller_applet_disabledlat9nq2023-07-211-0/+1
| | | | |
| * | | | shared_translation: Add barrier_feedback_loopslat9nq2023-07-211-0/+2
| | | | |
| * | | | cmake: Reposition preprocessor switch commenttoast29032023-07-211-1/+2
| | | | | | | | | | | | | | | | | | | | Co-authored-by: Morph <39850852+Morph1984@users.noreply.github.com>
| * | | | configuration: Use enum indexlat9nq2023-07-216-26/+31
| | | | |
| * | | | settings: Give indices to enumslat9nq2023-07-213-6/+36
| | | | |
| * | | | cmake: Use standard preprocessor on MSVClat9nq2023-07-211-0/+1
| | | | |
| * | | | settings_common: Remove unncessary enum speclat9nq2023-07-211-2/+2
| | | | |
| * | | | shared_translation: Deobfuscate auto time zonelat9nq2023-07-211-46/+52
| | | | |
| * | | | settings_enums: Remove castinglat9nq2023-07-211-55/+55
| | | | | | | | | | | | | | | | | | | | | | | | | Not sure how I missed this earlier, but these vectors can be constructed using the type of the enum.
| * | | | settings_setting: Silence shadowing warningslat9nq2023-07-211-17/+18
| | | | |
| * | | | settings,configuration: Add a default suffixlat9nq2023-07-219-74/+93
| | | | |
| * | | | configuration: Use paired settingslat9nq2023-07-212-12/+6
| | | | |
| * | | | settings: Define paired settingslat9nq2023-07-214-21/+49
| | | | | | | | | | | | | | | | | | | | settings_common: Remove unused optional
| * | | | shared_widget: Internalize component restoringlat9nq2023-07-213-61/+49
| | | | |
| * | | | configuration: Use specialization of settingslat9nq2023-07-214-18/+36
| | | | | | | | | | | | | | | | | | | | Reduces some ugliness in frontend code.
| * | | | settings: Define specializations for settingslat9nq2023-07-214-64/+130
| | | | | | | | | | | | | | | | | | | | Suggests to a frontend how to represent each setting.
| * | | | configuration: Use a builder to create widgetslat9nq2023-07-2118-209/+206
| | | | | | | | | | | | | | | | | | | | | | | | | This gets rid of some repeated code and sets us up to send more information to the new widget.
| * | | | shared_translation: Fix context usagelat9nq2023-07-211-1/+3
| | | | | | | | | | | | | | | | | | | | | | | | | Currently unused, but I don't want to start headaches when someone decides to use it the first time.
| * | | | settings,translation: Fix time zone enumlat9nq2023-07-212-28/+28
| | | | | | | | | | | | | | | | | | | | Renames enum values to conform to naming convention.
| * | | | settings,opengl,yuzu-qt: Fix AA, Filter maximumslat9nq2023-07-213-9/+8
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The new enum macros don't support setting values directly. For LastAA and LastFilter, this means we need a simpler approach to loop around the toggle in the frontend...
| * | | | settings_enums: More aggressively use macroslat9nq2023-07-211-351/+149
| | | | | | | | | | | | | | | | | | | | | | | | | This lets us define an enum and all the textual representations of its values in one swing. All for the price of some ugly macros.
| * | | | config_shared: Remove storing the group from tablat9nq2023-07-212-6/+2
| | | | |
| * | | | settings,uisettings: Remove leading underscorelat9nq2023-07-216-6/+6
| | | | |
| * | | | configuration: Move speed_limit to corelat9nq2023-07-213-10/+8
| | | | |
| * | | | settings: Move speed_limit to corelat9nq2023-07-211-4/+4
| | | | |
| * | | | android-config: Update enum labelslat9nq2023-07-211-4/+4
| | | | |
| * | | | common,yuzu-qt: Avoid explicit instantiation on old clanglat9nq2023-07-216-3/+22
| | | | | | | | | | | | | | | | | | | | | | | | | Clang versions < 15 have compile issues with explicit instantiation. Disable it for these versions.
| * | | | settings_setting: Fix MSVC errorlat9nq2023-07-211-1/+1
| | | | |
| * | | | shared_widget: Correct spellinglat9nq2023-07-211-1/+1
| | | | |
| * | | | (android)config: Clang formatlat9nq2023-07-211-2/+5
| | | | |
| * | | | common,yuzu-qt: GCC warning silenceslat9nq2023-07-219-34/+37
| | | | | | | | | | | | | | | | | | | | Fixes -Wshadow, -Wdeprecated, and catch by copy rather than by ref.
| * | | | configure_graphics: Simplify UpdateAPILayoutlat9nq2023-07-211-27/+16
| | | | | | | | | | | | | | | | | | | | Reduces branching/swictch cases for simplicity/code size
| * | | | configure_graphcs: Fix setting shader/device in custom configlat9nq2023-07-211-0/+3
| | | | |
| * | | | configuration: Use shorter constructor as neededlat9nq2023-07-213-10/+9
| | | | | | | | | | | | | | | | | | | | | | | | | Reduces some confusion hopefully, since some parameters specified were not specific to the setting in question.
| * | | | shared_widget: Some documentation, add shorter constructorlat9nq2023-07-212-8/+65
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The shorter constructor enables us to specify some options without needing to specify the default values of multiplier which wasn't always appropriate and could be confusing.
| * | | | config: Remove unused functionslat9nq2023-07-212-128/+0
| | | | |
| * | | | settings: Delete cpu_accuracy_first_timelat9nq2023-07-213-8/+0
| | | | | | | | | | | | | | | | | | | | Almost a 2 year old migration setting now
| * | | | shared_widget: Improve logging, use Setting::Rangedlat9nq2023-07-211-7/+19
| | | | |
| * | | | settings: Document BasicSetting, add Rangedlat9nq2023-07-212-9/+110
| | | | |
| * | | | settings: Move IsConfiguringGlobal to settings_commonlat9nq2023-07-214-12/+13
| | | | |
| * | | | configuration/shared: Clean up includes [IWYU]lat9nq2023-07-214-21/+36
| | | | |
| * | | | configure_graphics: Fix vulkan_device buglat9nq2023-07-211-4/+2
| | | | |
| * | | | settings: Move some simple data to BasicSettinglat9nq2023-07-215-108/+129
| | | | | | | | | | | | | | | | | | | | | | | | | Reduces the need for the compiler to duplicate this code, by about 100KB executable size.
| * | | | settings_setting: Fix errorslat9nq2023-07-211-2/+3
| | | | | | | | | | | | | | | | | | | | | | | | | ToString didn't have a constexpr if statement where needed. Canonicalize missed an else, causing unreachable code error on MSVC.
| * | | | (ui,)settings: Use explicit instantiationlat9nq2023-07-2110-477/+615
| | | | | | | | | | | | | | | | | | | | Reduces compile times a tad on clang.
| * | | | settings: Remove redundant false literalslat9nq2023-07-211-19/+16
| | | | |
| * | | | shared_widget: Avoid calling QWidgetPrivate::setVisiblelat9nq2023-07-211-2/+0
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This particular setVisible function is unnecessary. It also has horrible runtime performance, so much that it consumed maybe 80% of the time used to create a widget.
| * | | | FIXME configuration: Avoid unnecessary allocationslat9nq2023-07-215-2/+22
| | | | | | | | | | | | | | | | | | | | | | | | | ConfigurationShared::Widget needs to be created with a builder. This would avoid some duplicated code.
| * | | | shared_widget: Add SPDX headerlat9nq2023-07-212-0/+6
| | | | |
| * | | | general: Add typeinfo where neededlat9nq2023-07-216-0/+6
| | | | | | | | | | | | | | | | | | | | Using typeid without including typeinfo first produces an ill-formed program.
| * | | | settings_enums: Add const type where neededlat9nq2023-07-211-2/+2
| | | | |
| * | | | shared_widget: Use actionTriggered for user input signalslat9nq2023-07-211-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | Clicking the slider without directly interacting with the slider handle would change the value, but not trigger the restore button.
| * | | | shared_translation: Populate combobox enums with macrolat9nq2023-07-211-168/+158
| | | | |
| * | | | settings: yuzu is not capitalized why is it capitalized stop no badlat9nq2023-07-211-1/+1
| | | | |
| * | | | configuration: Document odd widget caseslat9nq2023-07-215-1/+25
| | | | | | | | | | | | | | | | | | | | | | | | | Explain why we need to do things differently at times, to serve as a reference.
| * | | | settings: Reorderlat9nq2023-07-211-75/+78
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Groups graphics audio and system settings together in a way that reflects the frontend. This also just conceptually groups them more nicely than they were.
| * | | | shared_translation: Add translation for use video framratelat9nq2023-07-211-0/+3
| | | | |
| * | | | settings: Report all contained settings valueslat9nq2023-07-211-45/+19
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Also adds a couple characters that denotes the state of the setting. M for modified, or not default. C for custom, in context of per-game settings.
| * | | | settings_enums: Cannonicalize settings nameslat9nq2023-07-211-2/+163
| | | | | | | | | | | | | | | | | | | | Gives every option of the enums a string literal via a macro.
| * | | | settings,general: Rename non-confirming enumslat9nq2023-07-2123-130/+136
| | | | |
| * | | | configuration: Use IDs to sort holdslat9nq2023-07-214-27/+16
| | | | |
| * | | | settings,general: Rename/reorder setting idslat9nq2023-07-211-1/+1
| | | | |
| * | | | shared_widget: Fix includeslat9nq2023-07-211-7/+4
| | | | |
| * | | | shared_widget: Complete refactoringlat9nq2023-07-212-378/+168
| | | | | | | | | | | | | | | | | | | | | | | | | Reduces code bloat a good bit by moving code specific to each sub widget to their own functions.
| * | | | shared_widget: Refactor againlat9nq2023-07-212-52/+121
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Starting with combobox Putting code specific to the sub-widget in their own function.
| * | | | android-config: Adapt settings reworklat9nq2023-07-211-4/+6
| | | | |
| * | | | c_per_game: Inform when settings might not be configurablelat9nq2023-07-211-14/+33
| | | | |
| * | | | shared_translation: Fix pragma oncelat9nq2023-07-211-0/+2
| | | | |
| * | | | shared_translation: Add translation for AstcRecompressionlat9nq2023-07-211-0/+9
| | | | |
| * | | | configure_system: Hide locale warn at startlat9nq2023-07-211-1/+4
| | | | |
| * | | | shared_widget: Force min width of 100 for restore buttonlat9nq2023-07-211-2/+13
| | | | | | | | | | | | | | | | | | | | | | | | | Dark theme mandates a 100px minimum width for QAbstractButton, even though this is not desired here.
| * | | | configuration: Workaround for Windows Qt buglat9nq2023-07-213-53/+58
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Odd issue happens that dragging the cpu or system tabs in custom configs would cause the window to take up the entire verticle space of the screen.
| * | | | shared_translation: Add missing tooltipslat9nq2023-07-211-7/+21
| | | | |
| * | | | settings: Make volume runtime-configurablelat9nq2023-07-211-1/+1
| | | | |
| * | | | configuration: Clean up includes a bitlat9nq2023-07-2114-51/+26
| | | | |
| * | | | configuration_shared: Remove old custom config setup functionslat9nq2023-07-212-144/+0
| | | | |
| * | | | configure_cpu: Generate UIlat9nq2023-07-215-190/+94
| | | | |
| * | | | configuration: Use a mapping of setting value to namelat9nq2023-07-2118-229/+355
| | | | | | | | | | | | | | | | | | | | | | | | | Makes comboboxes always correspond to the value of the setting they're modifying.
| * | | | settings, shared_widget: typo fixeslat9nq2023-07-211-2/+8
| | | | |
| * | | | configure_audio: Implement ui generationlat9nq2023-07-2114-329/+219
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Needs a considerable amount of management specific to some of the comoboboxes due to the audio engine configuration. general: Partial audio config implmentation configure_audio: Implement ui generation Needs a considerable amount of management specific to some of the comoboboxes due to the audio engine configuration. general: Partial audio config implmentation settings: Make audio settings as enums
| * | | | settings: Split enums to new filelat9nq2023-07-213-186/+241
| | | | |
| * | | | shared_widget: Use a better iconlat9nq2023-07-211-7/+5
| | | | | | | | | | | | | | | | | | | | This one looks more relevant on Windows.
| * | | | shared_widget: Refactor helperslat9nq2023-07-216-220/+254
| | | | | | | | | | | | | | | | | | | | Makes checkbox creation an option as opposed to a label.
| * | | | settings, uisettings: Initialize linkage counterlat9nq2023-07-213-3/+3
| | | | |
| * | | | configure_system: Implement with for looplat9nq2023-07-2118-648/+508
| | | | |
| * | | | per_game: Remove general tablat9nq2023-07-212-5/+0
| | | | | | | | | | | | | | | | | | | | It's empty.
| * | | | shared_widget: Internalize extra setting configurationlat9nq2023-07-213-48/+66
| | | | |
| * | | | settings: Move runtime and save to parameterslat9nq2023-07-212-68/+89
| | | | | | | | | | | | | | | | | | | | These don't need to be whole new types.
| * | | | graphics: Set speed limit to spinboxlat9nq2023-07-211-2/+2
| | | | |
| * | | | shared_widget: Support checkbox + spinboxlat9nq2023-07-213-10/+55
| | | | |
| * | | | configure_debug: Reorganizelat9nq2023-07-211-336/+522
| | | | |
| * | | | configure_graphics: Reimplement bg_colorlat9nq2023-07-213-15/+111
| | | | | | | | | | | | | | | | | | | | | | | | | To specialized a setting to be worth adding to the shared_widget imo, so add it roughly like before.
| * | | | shared_widget: Make button creation staticlat9nq2023-07-212-10/+12
| | | | |
| * | | | configure_general: Hide reset button in custom configslat9nq2023-07-211-0/+4
| | | | |
| * | | | configure_general: Sort datalat9nq2023-07-211-1/+7
| | | | |
| * | | | configure_general: Generate UI using containerslat9nq2023-07-215-163/+41
| | | | | | | | | | | | | | | | | | | | This leaves per-game config's General tab empty?
| * | | | shared_translation: Add UI widget translationslat9nq2023-07-211-55/+73
| | | | |
| * | | | shared_widget: Fix headerlat9nq2023-07-211-0/+2
| | | | |
| * | | | settings: Add UiGeneral classlat9nq2023-07-214-7/+16
| | | | |
| * | | | config: Don't merge the mapslat9nq2023-07-212-11/+10
| | | | | | | | | | | | | | | | | | | | Me shooting myself in the foot 3 days in advance.
| * | | | configure_graphics: Remove redundant loglat9nq2023-07-211-1/+0
| | | | |
| * | | | configuration: Move CreateWidget to a classlat9nq2023-07-2110-453/+507
| | | | | | | | | | | | | | | | | | | | | | | | | We were passing so many objects between the function and the caller that it needed to be redesigned.
| * | | | configuration: Implement sliderlat9nq2023-07-217-71/+188
| | | | |
| * | | | configuration: Use buttons instead of highlightslat9nq2023-07-219-103/+204
| | | | | | | | | | | | | | | | | | | | Only for updated configs at the moment
| * | | | shared_translations: Re flow stringslat9nq2023-07-211-6/+6
| | | | |
| * | | | configure_graphics: More complete reimplementationlat9nq2023-07-214-348/+116
| | | | |
| * | | | settings: Define base renderer runtime modifiable settingslat9nq2023-07-212-25/+27
| | | | |
| * | | | configuration_shared: Fix blank state hiding check boxlat9nq2023-07-211-2/+1
| | | | |
| * | | | settings: Add anisotropy mode enumlat9nq2023-07-212-0/+15
| | | | |
| * | | | shared_translation: Finish using int idslat9nq2023-07-216-158/+117
| | | | |
| * | | | settings,uisettings: Add IDs to settingslat9nq2023-07-211-3/+13
| | | | |
| * | | | configure_graphics: Partial runtime implementationlat9nq2023-07-2110-1148/+513
| | | | |
| * | | | settings: Recategorize a bitlat9nq2023-07-216-45/+77
| | | | | | | | | | | | | | | | | | | | Will help with generating config UI later.
| * | | | shared_translation: Add the rest of the settingslat9nq2023-07-211-1/+80
| | | | |
| * | | | shared_translation: Add copyright and licenselat9nq2023-07-212-0/+6
| | | | |
| * | | | configure_graphics_advance: Generate UI at runtimelat9nq2023-07-2115-402/+451
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | We can iterate through the AdvancedGraphics settings and generate the UI during runtime. This doesn't help runtime efficiency, but it helps a ton in reducing the amount of work a developer needs in order to add a new setting.
| * | | | configure_per_game: Rename group to tab_grouplat9nq2023-07-212-10/+11
| | | | |
| * | | | configuration: Add base class to tabslat9nq2023-07-2118-101/+110
| | | | | | | | | | | | | | | | | | | | | | | | | Tabs that largely configure SwitchableSetting's are now Tabs and grouped together.
| * | | | configuration_shared: Create Tab base classlat9nq2023-07-212-0/+22
| | | | |
| * | | | settings: Add a registry of settingslat9nq2023-07-219-870/+700
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | LoadString: Sanitize input settings: Handle empty string, remove redundant category settings: Rename Input to Controls, FS to DataStorage settings: Fix Controls groups information settings: Move use_docked_mode to System (again) settings: Document settings: Add type identification function settings: Move registry into values settings: Move global_reset_registry into values settings: Separate AdvGraphics from Renderer settings: More document squash settings: Use linkage object uisettings: Move registry into settings Probably wont build without uisettings: Use settings linkage object config: Load settings with a map Uses the new all_settings vector to load settings. qt-config: Rename settings category qt config: Rename to read category config: Read/write contols category with for_each This is extremely limited due to the complexity of the Controls group, but this handles the the settings that use the interface. qt-config: Use new settings registry qt-config: Read/write advgrphics qt-config: Use settings linkage object yuzu_cmd: Load setting off of vector cmd-config: Finish settings rename config: Read controls settings group with for_each cmd/config: Move registry into values cmd: Read adv graphics cmd-config: Use settings linkage object
| * | | | uisettings: Fix typingslat9nq2023-07-214-57/+63
| | | | |
| * | | | settings,core,config_sys: Remove optional type from custom_rtc, rng_seedlat9nq2023-07-216-26/+33
| | | | | | | | | | | | | | | | | | | | core: Fix MSVC errors
| * | | | settings: Pool SetGlobal functionslat9nq2023-07-212-61/+14
| | | | |
| * | | | settings,video_core: Consolidate ASTC decoding optionslat9nq2023-07-2112-52/+105
| | | | | | | | | | | | | | | | | | | | Just puts them all neatly into one place.
* | | | | vulkan_device: disable EDS3 blending on all AMD driversLiam2023-08-021-8/+7
| |/ / / |/| | |
* | | | audren_u: Fix parameter alignmentMorph2023-08-011-2/+3
| | | | | | | | | | | | | | | | The reduction in size from 0x38 to 0x34 caused the parameter to be misaligned. Skipping 1 word fixes this.
* | | | Merge pull request #11188 from abouvier/vma-fixliamwhite2023-07-318-19/+32
|\ \ \ \ | | | | | | | | | | vma: enable options everywhere
| * | | | vma: enable options everywhereAlexandre Bouvier2023-07-318-19/+32
| | | | |
* | | | | Merge pull request #11181 from Kelebek1/audrenparaminternalliamwhite2023-07-311-3/+3
|\ \ \ \ \ | | | | | | | | | | | | Fix AudioRendererParameterInternal's size
| * | | | | Fix AudioRendererParameterInternal's sizeKelebek12023-07-301-3/+3
| |/ / / /
* | | | | Merge pull request #11169 from GPUCode/desc-stuffliamwhite2023-07-314-5/+5
|\ \ \ \ \ | | | | | | | | | | | | vk_descriptor_pool: Disallow descriptor set free
| * | | | | vk_descriptor_pool: Disallow descriptor set freeGPUCode2023-07-274-5/+5
| | |_|/ / | |/| | |
* | | | | Merge pull request #11173 from Morph1984/atleast_nanosecond_precisionliamwhite2023-07-311-2/+2
|\ \ \ \ \ | | | | | | | | | | | | wall_clock: Increase precision requirements
| * | | | | wall_clock: Increase precision requirementsMorph2023-07-281-2/+2
| |/ / / / | | | | | | | | | | | | | | | We are providing a conversion to nanoseconds in NativeClock, which is more precise than the GPU tick.
* | | | | Merge pull request #11186 from lat9nq/tz-gen-onceliamwhite2023-07-312-8/+11
|\ \ \ \ \ | | | | | | | | | | | | tz_content_man: Generate the time zone binary once
| * | | | | tz_content_man: Generate the time zone binary oncelat9nq2023-07-302-8/+11
| | |/ / / | |/| | | | | | | | | | | | | Fixes a memory leak with time zone binaries accumulating on theirselves.
* | | | | Formatting fixMoonlacer2023-07-311-2/+1
| | | | |
* | | | | Match log warningMoonlacer2023-07-311-1/+1
| | | | |
* | | | | Formatting fixMoonlacer2023-07-301-1/+2
| | | | |
* | | | | Address feedback and change log warningMoonlacer2023-07-301-3/+3
| | | | |
* | | | | Revert "Revert "Blacklist EDS3 blending from new AMD drivers""Moonlacer2023-07-301-0/+8
|/ / / /
* | | | Merge pull request #11155 from liamwhite/memory3liamwhite2023-07-281-3/+18
|\ \ \ \ | | | | | | | | | | memory: check page against address space size
| * | | | memory: check page against address space sizeLiam2023-07-251-3/+18
| | |_|/ | |/| |
* | | | Merge pull request #11156 from 8bitDream/localizeliamwhite2023-07-2815-272/+18
|\ \ \ \ | | | | | | | | | | android: Only label language with language
| * | | | android: Only label language with languageAbandoned Cart2023-07-2515-272/+18
| |/ / /
* | / / Revert "Blacklist EDS3 blending from new AMD drivers"Moonlacer2023-07-261-8/+0
| |/ / |/| |
* | | Merge pull request #11128 from german77/discordliamwhite2023-07-262-36/+53
|\ \ \ | | | | | | | | yuzu: Replace httplib with QtNetworkRequest
| * | | Address feedbackMorph2023-07-261-10/+8
| | | |
| * | | yuzu: Replace httplib with QtNetworkRequestNarr the Reg2023-07-222-36/+55
| | | |
* | | | Merge pull request #10990 from comex/ubsanliamwhite2023-07-2611-32/+42
|\ \ \ \ | | | | | | | | | | Fixes and workarounds to make UBSan happier on macOS
| * | | | Fixes and workarounds to make UBSan happier on macOScomex2023-07-1511-32/+42
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | There are still some other issues not addressed here, but it's a start. Workarounds for false-positive reports: - `RasterizerAccelerated`: Put a gigantic array behind a `unique_ptr`, because UBSan has a [hardcoded limit](https://stackoverflow.com/questions/64531383/c-runtime-error-using-fsanitize-undefined-object-has-a-possibly-invalid-vp) of how big it thinks objects can be, specifically when dealing with offset-to-top values used with multiple inheritance. Hopefully this doesn't have a performance impact. - `QueryCacheBase::QueryCacheBase`: Avoid an operation that UBSan thinks is UB even though it at least arguably isn't. See the link in the comment for more information. Fixes for correct reports: - `PageTable`, `Memory`: Use `uintptr_t` values instead of pointers to avoid UB from pointer overflow (when pointer arithmetic wraps around the address space). - `KScheduler::Reload`: `thread->GetOwnerProcess()` can be `nullptr`; avoid calling methods on it in this case. (The existing code returns a garbage reference to a field, which is then passed into `LoadWatchpointArray`, and apparently it's never used, so it's harmless in practice but still triggers UBSan.) - `KAutoObject::Close`: This function calls `this->Destroy()`, which overwrites the beginning of the object with junk (specifically a free list pointer). Then it calls `this->UnregisterWithKernel()`. UBSan complains about a type mismatch because the vtable has been overwritten, and I believe this is indeed UB. `UnregisterWithKernel` also loads `m_kernel` from the 'freed' object, which seems to be technically safe (the overwriting doesn't extend as far as that field), but seems dubious. Switch to a `static` method and load `m_kernel` in advance.
* | | | | Merge pull request #11142 from german77/avoid_crashliamwhite2023-07-261-1/+5
|\ \ \ \ \ | |_|_|/ / |/| | | | yuzu: Avoid reading broken games
| * | | | yuzu: Avoid reading broken gamesgerman772023-07-241-1/+5
| | | | |
* | | | | Merge pull request #11095 from liamwhite/memory2liamwhite2023-07-245-85/+74
|\ \ \ \ \ | | | | | | | | | | | | memory: cleanup
| * | | | | core: reduce TOCTTOU memory accessLiam2023-07-223-20/+11
| | | | | |
| * | | | | memory: minimize dependency on processLiam2023-07-222-65/+63
| |/ / / /
* | | | | Merge pull request #11135 from liamwhite/getaddrinfoliamwhite2023-07-2410-5/+115
|\ \ \ \ \ | | | | | | | | | | | | core: implement GetGaiStringErrorRequest, IContextRegistrar
| * | | | | core: implement GetGaiStringErrorRequest, IContextRegistrarLiam2023-07-2310-5/+115
| |/ / / /
* / / / / ssa_rewrite_pass: use proper mapsLiam2023-07-231-6/+5
|/ / / /
* | | | Merge pull request #11094 from liamwhite/getliamwhite2023-07-2228-171/+98
|\ \ \ \ | | | | | | | | | | kernel: misc cleanup of page table accessors
| * | | | kernel: reduce page table region checkingLiam2023-07-158-87/+23
| | | | |
| * | | | k_process: PageTable -> GetPageTableLiam2023-07-1527-90/+81
| |/ / /
* | | | Merge pull request #11098 from GPUCode/texel-buffersliamwhite2023-07-222-1/+11
|\ \ \ \ | | | | | | | | | | buffer_cache: Increase number of texture buffers
| * | | | buffer_cache: Increase number of texture buffersGPUCode2023-07-152-1/+11
| |/ / /
* | | | Merge pull request #11113 from liamwhite/nsd1bunnei2023-07-222-1/+17
|\ \ \ \ | | | | | | | | | | nsd: add GetApplicationServerEnvironmentType
| * | | | nsd: add GetApplicationServerEnvironmentTypeLiam2023-07-182-1/+17
| | | | |
* | | | | core: remove remaining uses of dynamic_castLiam2023-07-226-16/+21
| | | | |
* | | | | general: reduce use of dynamic_castLiam2023-07-224-2/+13
| | | | |
* | | | | Merge pull request #11069 from lat9nq/mingw-no-tzdbliamwhite2023-07-212-29/+21
|\ \ \ \ \ | |_|_|_|/ |/| | | | common: Use arithmetic instead of string ops to get time zone
| * | | | time_zone: Clean up includeslat9nq2023-07-121-1/+1
| | | | |
| * | | | time_zone: Swap subtraction orderlat9nq2023-07-121-1/+1
| | | | |
| * | | | time_zone: Account for leap yearslat9nq2023-07-121-4/+6
| | | | | | | | | | | | | | | | | | | | | | | | | Protects against invalid hour offsets during transitions to years following leap years.
| * | | | settings: Disable C++20 tzdb path on MinGWlat9nq2023-07-101-1/+2
| | | | | | | | | | | | | | | | | | | | | | | | | This path always results in Etc/UTC on MinGW, which often is not close to the local time zone.
| * | | | time_zone: Remove string ops for determing zonelat9nq2023-07-101-27/+16
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | MinGW's strftime implementation does not work and cannot be used to determine the time zone. Besides that, the string operations are actually unnecessary since we can get the offset from std::localtime. Compare localtime to gmtime to find the zone offset on all platforms.
* | | | | Merge pull request #11096 from german77/amiiboooliamwhite2023-07-217-54/+143
|\ \ \ \ \ | | | | | | | | | | | | service: nfc: Update Implementation to match with latest RE
| * | | | | service: nfc: Update Implementation to match with latest RENarr the Reg2023-07-177-54/+143
| | |_|/ / | |/| | |
* | | | | Merge pull request #11116 from lat9nq/clang-shadowingliamwhite2023-07-1912-56/+59
|\ \ \ \ \ | | | | | | | | | | | | general: Silence -Wshadow{,-uncaptured-local} warnings
| * | | | | vk_buffer_cache: Formatlat9nq2023-07-191-2/+2
| | | | | |
| * | | | | general: Silence -Wshadow{,-uncaptured-local} warningslat9nq2023-07-1912-58/+61
| | |_|_|/ | |/| | | | | | | | | | | | | These occur in the latest commits in LLVM Clang.
* | | | | Merge pull request #11114 from Kelebek1/warningsliamwhite2023-07-191-2/+2
|\ \ \ \ \ | |/ / / / |/| | | | Mark SetIdleTimeDetectionExtension logging as debug
| * | | | Debug SetIdleTimeDetectionExtensionKelebek12023-07-181-2/+2
| |/ / /
* | | | ssl: Link with crypt32 for secure channel backendMorph2023-07-172-1/+2
| | | |
* | | | ssl: Reorder inclusionsMorph2023-07-176-26/+30
| | | |
* | | | network: Forward declarationsMorph2023-07-175-5/+11
| |_|/ |/| |
* | | Merge pull request #10934 from abouvier/cmake-vmaliamwhite2023-07-172-1/+13
|\ \ \ | | | | | | | | cmake: allow using system VMA library
| * | | cmake: allow using system VMA libraryAlexandre Bouvier2023-07-122-1/+13
| | | |
* | | | Merge pull request #11102 from v1993/your-mom-is-encryptedliamwhite2023-07-171-1/+1
|\ \ \ \ | | | | | | | | | | android: fix links to re-dumping guides
| * | | | android: fix links to re-dumping guidesValeri Ochinski2023-07-161-1/+1
| | |/ / | |/| |
* | | | Merge pull request #10912 from comex/sslliamwhite2023-07-1622-282/+2397
|\ \ \ \ | |/ / / |/| | | Implement SSL service
| * | | Rename variables to avoid -Wshadow warnings under GCCcomex2023-07-021-5/+5
| | | |
| * | | ...actually add the SecureTransport backend to Git.comex2023-07-021-0/+219
| | | |
| * | | Updates:comex2023-07-027-211/+276
| | | | | | | | | | | | | | | | | | | | - Address PR feedback. - Add SecureTransport backend for macOS.
| * | | Merge remote-tracking branch 'origin/master' into sslcomex2023-07-02266-2810/+4819
| |\ \ \
| * | | | PR feedback + constificationcomex2023-06-268-60/+62
| | | | |
| * | | | network.cpp: include expected.hcomex2023-06-261-0/+1
| | | | |
| * | | | re-formatcomex2023-06-261-4/+5
| | | | |
| * | | | Fix more Windows build errorscomex2023-06-265-28/+35
| | | | | | | | | | | | | | | | | | | | | | | | | I did test this beforehand, but not on MinGW, and the error that showed up on the msvc builder didn't happen for me...
| * | | | ssl: fix compatibility with OpenSSL 1.1.1comex2023-06-261-1/+10
| | | | | | | | | | | | | | | | | | | | Turns out changes were needed after all.
| * | | | Fixes:comex2023-06-263-4/+12
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | - Add missing virtual destructor on `SSLBackend`. - On Windows, filter out `POLLWRBAND` (one of the new flags added) when calling `WSAPoll`, because despite the constant being defined on Windows, passing it calls `WSAPoll` to yield `EINVAL`. - Reduce OpenSSL version requirement to satisfy CI; I haven't tested whether it actually builds (or runs) against 1.1.1, but if not, I'll figure it out. - Change an instance of memcpy to memmove, even though the arguments cannot overlap, to avoid a [strange GCC error](https://github.com/yuzu-emu/yuzu/pull/10912#issuecomment-1606283351).
| * | | | ssl: rename argument to avoid false positive codespell warningcomex2023-06-251-2/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The original name `larg` was copied from the OpenSSL documentation and is not a typo of 'large' but rather an abbreviation of '`long` argument'. But whatever, no harm in adding an underscore.
| * | | | socket_types: Improve commentcomex2023-06-251-3/+3
| | | | |
| * | | | Implement SSL servicecomex2023-06-2521-277/+2080
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This implements some missing network APIs including a large chunk of the SSL service, enough for Mario Maker (with an appropriate mod applied) to connect to the fan server [Open Course World](https://opencourse.world/). Connecting to first-party servers is out of scope of this PR and is a minefield I'd rather not step into. ## TLS TLS is implemented with multiple backends depending on the system's 'native' TLS library. Currently there are two backends: Schannel for Windows, and OpenSSL for Linux. (In reality Linux is a bit of a free-for-all where there's no one 'native' library, but OpenSSL is the closest it gets.) On macOS the 'native' library is SecureTransport but that isn't implemented in this PR. (Instead, all non-Windows OSes will use OpenSSL unless disabled with `-DENABLE_OPENSSL=OFF`.) Why have multiple backends instead of just using a single library, especially given that Yuzu already embeds mbedtls for cryptographic algorithms? Well, I tried implementing this on mbedtls first, but the problem is TLS policies - mainly trusted certificate policies, and to a lesser extent trusted algorithms, SSL versions, etc. ...In practice, the chance that someone is going to conduct a man-in-the-middle attack on a third-party game server is pretty low, but I'm a security nerd so I like to do the right security things. My base assumption is that we want to use the host system's TLS policies. An alternative would be to more closely emulate the Switch's TLS implementation (which is based on NSS). But for one thing, I don't feel like reverse engineering it. And I'd argue that for third-party servers such as Open Course World, it's theoretically preferable to use the system's policies rather than the Switch's, for two reasons 1. Someday the Switch will stop being updated, and the trusted cert list, algorithms, etc. will start to go stale, but users will still want to connect to third-party servers, and there's no reason they shouldn't have up-to-date security when doing so. At that point, homebrew users on actual hardware may patch the TLS implementation, but for emulators it's simpler to just use the host's stack. 2. Also, it's good to respect any custom certificate policies the user may have added systemwide. For example, they may have added custom trusted CAs in order to use TLS debugging tools or pass through corporate MitM middleboxes. Or they may have removed some CAs that are normally trusted out of paranoia. Note that this policy wouldn't work as-is for connecting to first-party servers, because some of them serve certificates based on Nintendo's own CA rather than a publicly trusted one. However, this could probably be solved easily by using appropriate APIs to adding Nintendo's CA as an alternate trusted cert for Yuzu's connections. That is not implemented in this PR because, again, first-party servers are out of scope. (If anything I'd rather have an option to _block_ connections to Nintendo servers, but that's not implemented here.) To use the host's TLS policies, there are three theoretical options: a) Import the host's trusted certificate list into a cross-platform TLS library (presumably mbedtls). b) Use the native TLS library to verify certificates but use a cross-platform TLS library for everything else. c) Use the native TLS library for everything. Two problems with option a). First, importing the trusted certificate list at minimum requires a bunch of platform-specific code, which mbedtls does not have built in. Interestingly, OpenSSL recently gained the ability to import the Windows certificate trust store... but that leads to the second problem, which is that a list of trusted certificates is [not expressive enough](https://bugs.archlinux.org/task/41909) to express a modern certificate trust policy. For example, Windows has the concept of [explicitly distrusted certificates](https://learn.microsoft.com/en-us/previous-versions/windows/it-pro/windows-server-2012-r2-and-2012/dn265983(v=ws.11)), and macOS requires Certificate Transparency validation for some certificates with complex rules for when it's required. Option b) (using native library just to verify certs) is probably feasible, but it would miss aspects of TLS policy other than trusted certs (like allowed algorithms), and in any case it might well require writing more code, not less, compared to using the native library for everything. So I ended up at option c), using the native library for everything. What I'd *really* prefer would be to use a third-party library that does option c) for me. Rust has a good library for this, [native-tls](https://docs.rs/native-tls/latest/native_tls/). I did search, but I couldn't find a good option in the C or C++ ecosystem, at least not any that wasn't part of some much larger framework. I was surprised - isn't this a pretty common use case? Well, many applications only need TLS for HTTPS, and they can use libcurl, which has a TLS abstraction layer internally but doesn't expose it. Other applications only support a single TLS library, or use one of the aforementioned larger frameworks, or are platform-specific to begin with, or of course are written in a non-C/C++ language, most of which have some canonical choice for TLS. But there are also many applications that have a set of TLS backends just like this; it's just that nobody has gone ahead and abstracted the pattern into a library, at least not a widespread one. Amusingly, there is one TLS abstraction layer that Yuzu already bundles: the one in ffmpeg. But it is missing some features that would be needed to use it here (like reusing an existing socket rather than managing the socket itself). Though, that does mean that the wiki's build instructions for Linux (and macOS for some reason?) already recommend installing OpenSSL, so no need to update those. ## Other APIs implemented - Sockets: - GetSockOpt(`SO_ERROR`) - SetSockOpt(`SO_NOSIGPIPE`) (stub, I have no idea what this does on Switch) - `DuplicateSocket` (because the SSL sysmodule calls it internally) - More `PollEvents` values - NSD: - `Resolve` and `ResolveEx` (stub, good enough for Open Course World and probably most third-party servers, but not first-party) - SFDNSRES: - `GetHostByNameRequest` and `GetHostByNameRequestWithOptions` - `ResolverSetOptionRequest` (stub) ## Fixes - Parts of the socket code were previously allocating a `sockaddr` object on the stack when calling functions that take a `sockaddr*` (e.g. `accept`). This might seem like the right thing to do to avoid illegal aliasing, but in fact `sockaddr` is not guaranteed to be large enough to hold any particular type of address, only the header. This worked in practice because in practice `sockaddr` is the same size as `sockaddr_in`, but it's not how the API is meant to be used. I changed this to allocate an `sockaddr_in` on the stack and `reinterpret_cast` it. I could try to do something cleverer with `aligned_storage`, but casting is the idiomatic way to use these particular APIs, so it's really the system's responsibility to avoid any aliasing issues. - I rewrote most of the `GetAddrInfoRequest[WithOptions]` implementation. The old implementation invoked the host's getaddrinfo directly from sfdnsres.cpp, and directly passed through the host's socket type, protocol, etc. values rather than looking up the corresponding constants on the Switch. To be fair, these constants don't tend to actually vary across systems, but still... I added a wrapper for `getaddrinfo` in `internal_network/network.cpp` similar to the ones for other socket APIs, and changed the `GetAddrInfoRequest` implementation to use it. While I was at it, I rewrote the serialization to use the same approach I used to implement `GetHostByNameRequest`, because it reduces the number of size calculations. While doing so I removed `AF_INET6` support because the Switch doesn't support IPv6; it might be nice to support IPv6 anyway, but that would have to apply to all of the socket APIs. I also corrected the IPC wrappers for `GetAddrInfoRequest` and `GetAddrInfoRequestWithOptions` based on reverse engineering and hardware testing. Every call to `GetAddrInfoRequestWithOptions` returns *four* different error codes (IPC status, getaddrinfo error code, netdb error code, and errno), and `GetAddrInfoRequest` returns three of those but in a different order, and it doesn't really matter but the existing implementation was a bit off, as I discovered while testing `GetHostByNameRequest`. - The new serialization code is based on two simple helper functions: ```cpp template <typename T> static void Append(std::vector<u8>& vec, T t); void AppendNulTerminated(std::vector<u8>& vec, std::string_view str); ``` I was thinking there must be existing functions somewhere that assist with serialization/deserialization of binary data, but all I could find was the helper methods in `IOFile` and `HLERequestContext`, not anything that could be used with a generic byte buffer. If I'm not missing something, then maybe I should move the above functions to a new header in `common`... right now they're just sitting in `sfdnsres.cpp` where they're used. - Not a fix, but `SocketBase::Recv`/`Send` is changed to use `std::span<u8>` rather than `std::vector<u8>&` to avoid needing to copy the data to/from a vector when those methods are called from the TLS implementation.
* | | | | file_sys/content_archive: Detect compressed NCAs (#11047)Tobias2023-07-122-1/+40
| |_|/ / |/| | |
* | | | Merge pull request #10985 from liamwhite/handle-translatebunnei2023-07-123-7/+771
|\ \ \ \ | | | | | | | | | | k_server_session: translate special header for non-HLE requests
| * | | | k_server_session: translate special header for non-HLE requestsLiam2023-07-083-7/+771
| | | | |
* | | | | Merge pull request #11070 from t895/home-setting-warningbunnei2023-07-124-53/+84
|\ \ \ \ \ | | | | | | | | | | | | android: Visualize disabled home options
| * | | | | android: Visualize disabled home optionsCharles Lombardo2023-07-114-53/+84
| | |_|_|/ | |/| | | | | | | | | | | | | | | | | | | | | | | Allow for displaying options in the home options that are disabled with messages that explain why they are disabled. This includes reasoning for the GPU driver installation button.
* | | | | Merge pull request #10996 from Kelebek1/readblock_optimisationbunnei2023-07-1123-236/+478
|\ \ \ \ \ | | | | | | | | | | | | Use spans over guest memory where possible instead of copying data
| * | | | | Fix ScratchBuffer movesKelebek12023-07-041-2/+15
| | | | | |
| * | | | | Use spans over guest memory where possible instead of copying data.Kelebek12023-07-0322-234/+463
| | | | | |
* | | | | | Merge pull request #11050 from SuperSamus/sdl-button-labelsbunnei2023-07-112-42/+11
|\ \ \ \ \ \ | |_|/ / / / |/| | | | | input_common: set `SDL_HINT_GAMECONTROLLER_USE_BUTTON_LABELS` to 0
| * | | | | input_common: set `SDL_HINT_GAMECONTROLLER_USE_BUTTON_LABELS` to 0Martino Fontana2023-07-072-42/+11
| | |/ / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | This allows to share the mappings between Nintendo and non-Nintendo controllers. Breaks the controller configuration for existing users who are using a Nintendo controller. (Documentation of the hint https://github.com/libsdl-org/SDL/blob/92b3c53c92971e685254fd89f89ce6bde8cea60e/include/SDL_hints.h#L512-L532)
* | | | | Merge pull request #11067 from t895/fragile-databunnei2023-07-101-1/+1
|\ \ \ \ \ | | | | | | | | | | | | android: Don't prompt to save user data on uninstall
| * | | | | android: Don't prompt to save user data on uninstallCharles Lombardo2023-07-101-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | While this can be convenient in some scenarios, this will be a big problem for users trying to sideload different APK versions. If they forget the last one they had installed, they could have problems installing a new copy.
* | | | | | Merge pull request #11055 from lat9nq/tzdb-catch-Morph2023-07-101-3/+2
|\ \ \ \ \ \ | |/ / / / / |/| | | | | settings: Catch runtime error from STL
| * | | | | settings: Catch runtime error from STLlat9nq2023-07-091-3/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This function throws a runtime error we can catch on old Windows 10 installs, so we can catch it here rather than disable this path for everybody.
* | | | | | Merge pull request #11063 from liamwhite/oopsMorph2023-07-091-1/+1
|\ \ \ \ \ \ | |/ / / / / |/| | | | | arm_interface: correct breakpoint rewind condition
| * | | | | arm_interface: correct breakpoint rewind conditionLiam2023-07-091-1/+1
| |/ / / /
* | | | | Merge pull request #11030 from lat9nq/tz-restrict-msvcMorph2023-07-091-1/+2
|\ \ \ \ \ | |/ / / / |/| | | | settings: Disable C++20 time zone path on MSVC
| * | | | settings: Disable C++20 path on MSVClat9nq2023-07-051-1/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Even though it compiles and runs fine on the latest Windows versions, older LTSC builds will crash due to lacking support somewhere in the OS. For now just disable it for MSVC until either Microsoft fixes this or we no longer support 1809 LTSC.
* | | | | Merge pull request #10999 from Morph1984/fix-install-progressliamwhite2023-07-071-4/+6
|\ \ \ \ \ | | | | | | | | | | | | main: Fix install progress calculation
| * | | | | main: Use 1_MiB as a constant for copy buffer sizeMorph2023-07-061-3/+5
| | | | | |
| * | | | | main: Fix install progress calculationMorph2023-07-061-3/+3
| | | | | | | | | | | | | | | | | | | | | | | | The increased buffer size means that that progress bar size has to be adjusted
* | | | | | Merge pull request #11031 from german77/zeroliamwhite2023-07-071-2/+3
|\ \ \ \ \ \ | | | | | | | | | | | | | | input_common: Avoid potential division by zero
| * | | | | | input_common: Avoid potential division by zeroNarr the Reg2023-07-061-2/+3
| |/ / / / /
* / / / / / vfs_real: use open file size for getting size (#11016)liamwhite2023-07-061-1/+2
|/ / / / /
* | | | | Merge pull request #10994 from liamwhite/ue4-preferredliamwhite2023-07-051-2/+2
|\ \ \ \ \ | | | | | | | | | | | | vulkan_common: use device local preferred for image memory
| * | | | | vulkan_common: use device local preferred for image memoryLiam2023-07-021-2/+2
| | | | | |
* | | | | | Merge pull request #11006 from german77/nfc_nfcliamwhite2023-07-054-11/+42
|\ \ \ \ \ \ | | | | | | | | | | | | | | service: nfc: Ensure controller is in the correct mode
| * | | | | | android: Reintroduce launch mode as single topgerman772023-07-031-0/+1
| | | | | | |
| * | | | | | service: nfc: Ensure controller is in the correct modegerman772023-07-033-11/+41
| | |_|/ / / | |/| | | |
* | | | | | Merge pull request #11012 from gidoly/metroid-fixliamwhite2023-07-051-0/+4
|\ \ \ \ \ \ | |_|_|/ / / |/| | | | | Fix regression by unreal engine fix pr #11009
| * | | | | oops re opengidoly2023-07-031-0/+4
| |/ / / /
* | | | | video_core: vulkan_device: Disable timeline semaphore on Turnip, fix qcom version check.bunnei2023-07-042-9/+16
| | | | |
* | | | | Merge pull request #10964 from bunnei/gpu-remove-qcom-checkbunnei2023-07-041-3/+27
|\ \ \ \ \ | | | | | | | | | | | | video_core: vulkan_device: Fix S8Gen2 dynamic state checks.
| * | | | | video_core: vulkan_device: Change to driver version check.bunnei2023-07-031-15/+23
| | | | | |
| * | | | | video_core: vulkan_device: Scope S8Gen2 checks to just Qualcomm.bunnei2023-06-301-2/+2
| | | | | |
| * | | | | video_core: vulkan_device: Fix S8Gen2 dynamic state checks.bunnei2023-06-301-3/+19
| | | | | |
* | | | | | Merge pull request #10943 from t895/stick-modifiersbunnei2023-07-0311-170/+751
|\ \ \ \ \ \ | | | | | | | | | | | | | | android: Input overlay updates
| * | | | | | android: Version the input overlayCharles Lombardo2023-07-0311-170/+751
| | |/ / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | Now within the Input Overlay file, there is a version that will determine when the overlay will be reset. This is intended for breaking changes like the ones we had with the additions of percentage based layouts or the addition of foldable/portrait layouts. This also includes versions for each individual layout so we don't have to reset every layout if only one is broken. Additionally, this includes new L3/R3 buttons.
* / | | | | Use `toUtf8()` for string passed to DBuszeltermann2023-07-031-1/+1
|/ / / / /
* | | | | Merge pull request #10998 from Morph1984/qt-stop-messing-with-meliamwhite2023-07-024-5/+22
|\ \ \ \ \ | | | | | | | | | | | | core_timing: Remove GetCurrentTimerResolution in CoreTiming loop
| * | | | | core_timing: Remove GetCurrentTimerResolution in CoreTiming loopMorph2023-07-024-5/+22
| | | | | | | | | | | | | | | | | | | | | | | | Other programs may change this value, but if thousands of syscalls in this loop is undesirable, then we can just set this once.
* | | | | | Merge pull request #10479 from GPUCode/format-listliamwhite2023-07-026-14/+58
|\ \ \ \ \ \ | | | | | | | | | | | | | | Add support for VK_KHR_image_format_list
| * | | | | | renderer_vulkan: Fix some missing view formatsGPUCode2023-07-012-3/+8
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * Many times the format itself wouldn't have been added to the list causing device losses for nvidia GPUs * Also account for ASTC acceleration storage views
| * | | | | | renderer_vulkan: Add support for VK_KHR_image_format_listGPUCode2023-07-015-14/+53
| | |_|_|_|/ | |/| | | |
* | | | | | Merge pull request #10969 from Morph1984/k-synchronizeliamwhite2023-07-023-36/+52
|\ \ \ \ \ \ | |_|/ / / / |/| | | | | kernel: Synchronize
| * | | | | kernel: SynchronizeMorph2023-07-013-36/+52
| | | | | |
* | | | | | Merge pull request #10949 from t895/memory-requirementsliamwhite2023-07-024-44/+114
|\ \ \ \ \ \ | | | | | | | | | | | | | | android: Rework MemoryUtil
| * | | | | | android: Show memory warning onceCharles Lombardo2023-06-302-13/+24
| | | | | | |
| * | | | | | android: Rework MemoryUtilCharles Lombardo2023-06-303-25/+85
| | | | | | | | | | | | | | | | | | | | | | | | | | | | Uses string templates and rounds up memory amount for potentially inaccurate checks now
| * | | | | | android: Make MemoryUtil an objectCharles Lombardo2023-06-292-13/+12
| | |_|/ / / | |/| | | |
* | | | | | Merge pull request #10942 from FernandoS27/android-is-a-pain-in-the-a--liamwhite2023-07-0220-41/+329
|\ \ \ \ \ \ | | | | | | | | | | | | | | Memory Tracking: Add mechanism to register small writes when gpu page is contested by GPU
| * | | | | | Memory Tracker: Use 64 bit atomics instead of 128 bitsFernando Sahmkow2023-06-291-9/+13
| | | | | | |
| * | | | | | Memory Tracking: Optimize tracking to only use atomic writes when contested with the host GPUFernando Sahmkow2023-06-2819-38/+153
| | | | | | |
| * | | | | | MemoryTracking: Initial setup of atomic writes.Fernando Sahmkow2023-06-288-14/+183
| | | | | | |
* | | | | | | Merge pull request #10710 from liamwhite/romfs2liamwhite2023-07-021-21/+17
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | fsmitm_romfsbuild: avoid full path lookups
| * | | | | | | fsmitm_romfsbuild: avoid full path lookupsLiam2023-06-281-21/+17
| | | | | | | |
* | | | | | | | Revert "texture_cache: Fix incorrect logic for AccelerateDMA"Liam2023-07-021-4/+8
| |_|_|_|_|/ / |/| | | | | | | | | | | | | | | | | | | | This reverts commit 1fc47361a12afd91d8ea0b76378e0b3d4feb93a6.
* | | | | | | Merge pull request #10984 from comex/cobliamwhite2023-07-021-2/+1
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | Minor cleanup in BufferCacheRuntime::ReserveNullBuffer
| * | | | | | | Minor cleanup in BufferCacheRuntime::ReserveNullBuffercomex2023-07-011-2/+1
| | |_|_|_|/ / | |/| | | | | | | | | | | | | | | | | | | As far as I can tell, there is no reason to OR this bit in separately.
* | | | | | | Merge pull request #10974 from Steveice10/macos_vkliamwhite2023-07-025-16/+23
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | vulkan: Improvements to macOS surface creation
| * | | | | | | yuzu: Use test window with VulkanSurface to check for present modes.Steveice102023-07-011-1/+4
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | It is probably not correct to create a surface on a non-VulkanSurface window. On macOS this causes a preferences crash due to missing CAMetalLayer.
| * | | | | | | vulkan: Use newer VK_EXT_metal_surface to create surface for MoltenVK.Steveice102023-07-014-15/+19
| |/ / / / / /
* | | | | | | Merge pull request #10970 from Morph1984/thingliamwhite2023-07-0218-100/+124
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | general: Misc changes that did not deserve their own PRs
| * | | | | | | parcel: Optimize small_vector sizesMorph2023-07-011-11/+13
| | | | | | | |
| * | | | | | | maxwell_dma: Specify dst_operand.pitch instead of a temp varMorph2023-07-011-4/+3
| | | | | | | |
| * | | | | | | general: Use ScratchBuffer where possibleMorph2023-07-0114-64/+81
| | | | | | | |
| * | | | | | | ring_buffer: Fix const usage on std::spanMorph2023-06-301-1/+1
| | | | | | | |
| * | | | | | | scratch_buffer: Add member types to ScratchBufferMorph2023-06-301-20/+26
| | |_|_|_|/ / | |/| | | | | | | | | | | | | | | | | | | Allows for implicit conversion to std::span<T>.
* | | | | | | Merge pull request #10966 from Morph1984/heap-corruptionliamwhite2023-07-022-17/+20
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | sink_stream: Resolve heap buffer corruption due to out of bounds write
| * | | | | | | sink_stream: Resolve heap buffer corruption due to out of bounds writeMorph2023-06-302-17/+20
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Also, remove the use of ScratchBuffer when upmixing, as other channels may not be initialized with zeroed out data.
* | | | | | | | Merge pull request #10950 from german77/mouse_tuneliamwhite2023-07-027-116/+88
|\ \ \ \ \ \ \ \ | |_|_|/ / / / / |/| | | | | | | input_common: Tune mouse controls
| * | | | | | | yuzu: Ensure mouse panning can't be enabled with real mouse emulationgerman772023-07-015-30/+39
| | | | | | | |
| * | | | | | | input_common: Tune mouse controlsNarr the Reg2023-06-295-88/+51
| | |_|/ / / / | |/| | | | |
* | | | | | | Merge pull request #10953 from FernandoS27/oh-oopsies-yfcFernando S2023-06-301-9/+0
|\ \ \ \ \ \ \ | |_|_|/ / / / |/| | | | | | Texture cache: Fix YFC regression due to code testing
| * | | | | | Texture cache: Fix YFC regression due to code testingFernando Sahmkow2023-06-291-9/+0
| | |_|/ / / | |/| | | |
* | | | | | Merge pull request #10956 from FernandoS27/pikmin-another-game-ill-hateFernando S2023-06-301-0/+4
|\ \ \ \ \ \ | |_|_|/ / / |/| | | | | AccelerateDMA: Don't accelerate 3D texture DMA operations
| * | | | | AccelerateDMA: Don't accelerate 3D texture DMA operationsFernando Sahmkow2023-06-291-0/+4
| |/ / / /
* | | | | Merge pull request #10955 from 8bitDream/gradleCharles Lombardo2023-06-291-0/+3
|\ \ \ \ \ | | | | | | | | | | | | android: Suppress a known incompatibility
| * | | | | android: Suppress a known incompatibilityAbandoned Cart2023-06-291-0/+3
| | |_|/ / | |/| | | | | | | | | | | | | Android Gradle plugin 8.0.2 is designed for API 33, but a newer plugin hasn't been released yet. The warning message is rather extravagant, but also suggests adding this property if you are aware of the risks.
* | | | | Merge pull request #10935 from Morph1984/mwaitxliamwhite2023-06-294-14/+41
|\ \ \ \ \ | | | | | | | | | | | | x64: Make use of monitorx instructions for power efficient sleeps (AMD)
| * | | | | x64: cpu_wait: Implement MWAITX for non-MSVC compilersMorph2023-06-281-0/+10
| | | | | |
| * | | | | x64: cpu_wait: Remove magic valuesMorph2023-06-281-3/+8
| | | | | |
| * | | | | x64: cpu_wait: Make use of MWAITX in MicroSleepMorph2023-06-281-12/+21
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | MWAITX is equivalent to UMWAIT on Intel's Alder Lake CPUs. We can emulate TPAUSE by using MONITORX in conjunction with MWAITX to wait for 100K cycles.
| * | | | | x64: Add detection of monitorx instructionsMorph2023-06-283-0/+3
| | |_|/ / | |/| | | | | | | | | | | | | monitorx introduces 2 instructions: MONITORX and MWAITX.
* | | | | Merge pull request #10937 from german77/ringliamwhite2023-06-2921-481/+526
|\ \ \ \ \ | | | | | | | | | | | | input_common: Remove duplicated enum and fix ring detection
| * | | | | input_common: Allow timeouts to happen while scanning for a ringgerman772023-06-292-3/+4
| | | | | |
| * | | | | input_common: Remove duplicated DriverResult enumgerman772023-06-2821-479/+523
| |/ / / /
* | | | | Merge pull request #10946 from goldenx86/amdBlendingliamwhite2023-06-291-0/+8
|\ \ \ \ \ | |_|/ / / |/| | | | Blacklist EDS3 blending from new AMD drivers
| * | | | Blacklist EDS3 blending from new AMD driversMatías Locatti2023-06-291-0/+8
| | |/ / | |/| |
* / | | android: Android 14 supportCharles Lombardo2023-06-282-3/+6
|/ / / | | | | | | | | | Specifies the permissions needed for the changes to foreground services in Android 14.
* | | renderer_vulkan: Prevent crashes when blitting depth stencilGPUCode2023-06-281-0/+3
| | |
* | | video_core: Add BCn decoding supportGPUCode2023-06-2813-120/+221
| | |
* | | renderer_vulkan: Add more feature checkingGPUCode2023-06-283-3/+24
| | |
* | | renderer_vulkan: Don't assume debug tool with debug rendererGPUCode2023-06-281-1/+1
| | | | | | | | | | | | * Causes crashes because mali drivers don't support debug utils
* | | renderer_vulkan: Bump minimum SPIRV versionGPUCode2023-06-281-1/+1
| | | | | | | | | | | | * 1.3 is guaranteed on all 1.1 drivers
* | | renderer_vulkan: Respect viewport limitGPUCode2023-06-283-6/+19
| | |
* | | renderer_vulkan: Don't add transform feedback flag if unsupportedGPUCode2023-06-282-7/+12
| | |
* | | renderer_vulkan: Add suport for debug report callbackGPUCode2023-06-288-37/+113
|/ /
* | Merge pull request #10933 from merryhime/dunnoliamwhite2023-06-281-5/+0
|\ \ | | | | | | arm_dynarmic_32: Remove disabling of block linking on arm64
| * | arm_dynarmic_32: Remove disabling of block linking on arm64Merry2023-06-281-5/+0
| | |
* | | settings: Clean up includeslat9nq2023-06-281-2/+3
| | | | | | | | | | | | | | | | | | Adds <version> since we are looking at C++ implementation version details. Also moves exception header includes into the if preprocessor command since we only use it there.
* | | settings: Catch runtime_error, fallback time zonelat9nq2023-06-281-3/+15
|/ / | | | | | | | | | | Windows will let you select time zones that will fail in their own C++ implementation library. Evidently from the stack trace, we get a runtime error to work with, so catch it and use the fallback.
* | yuzu: Fix clang formatgerman772023-06-272-12/+15
| |
* | Merge pull request #9663 from EBADBEEF/disable-controller-appletNarr the Reg2023-06-275-0/+16
|\ \ | | | | | | qt: add option to disable controller applet
| * | qt: add option to disable controller appletEBADBEEF2023-01-235-0/+16
| | | | | | | | | | | | | | | | | | | | | - add checkbox to disable the controller applet UI - when controller applet is disabled, use the yuzu-cmd fallback controller applet that applies controller config based on rules - See https://github.com/yuzu-emu/yuzu/issues/8552 for some discussion
* | | Merge pull request #10867 from Kelebek1/dma_safeliamwhite2023-06-271-5/+6
|\ \ \ | | | | | | | | Use safe reads in DMA engine
| * | | Use safe reads in DMA engineKelebek12023-06-261-5/+6
| | | |
* | | | Merge pull request #10473 from GPUCode/vmaliamwhite2023-06-2723-366/+398
|\ \ \ \ | | | | | | | | | | Use vulkan memory allocator
| * | | | externals: Use cmake subdirectoryGPUCode2023-06-263-6/+0
| | | | |
| * | | | vulkan_common: Remove required flagsGPUCode2023-06-221-15/+1
| | | | | | | | | | | | | | | | | | | | * Allows VMA to fallback to system RAM instead of crashing
| * | | | renderer_vulkan: Add missing initializersGPUCode2023-06-182-5/+13
| | | | |
| * | | | renderer_vulkan: Use VMA for buffersGPUCode2023-06-1816-211/+262
| | | | |
| * | | | renderer_vulkan: Use VMA for imagesGPUCode2023-06-1816-91/+119
| | | | |
| * | | | memory_allocator: Remove OpenGL interopGPUCode2023-06-184-67/+8
| | | | | | | | | | | | | | | | | | | | * Appears to be unused atm
| * | | | externals: Add vma and initialize itlat9nq2023-06-183-2/+26
| | | | | | | | | | | | | | | | | | | | video_core: Move vma implementation to library
* | | | | Merge pull request #10495 from bm01/masterliamwhite2023-06-2714-103/+581
|\ \ \ \ \ | | | | | | | | | | | | input_common: Redesign mouse panning
| * | | | | input_common: Redesign mouse panningBaptiste Marie2023-06-1214-103/+581
| | | | | |
* | | | | | Merge pull request #10679 from zeltermann/wakelock-reasonliamwhite2023-06-273-52/+12
|\ \ \ \ \ \ | | | | | | | | | | | | | | Only use SDL wakelock on Linux
| * | | | | | Only use SDL wakelock on Linuxzeltermann2023-06-243-52/+12
| | |_|/ / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | SDL has internally fixed shenanigans related to wakelocking through DBus from inside sandboxes from around August 2022, so we can now remove the workaround we used since 2021.
* | | | | | Merge pull request #10916 from ameerj/lolmemliamwhite2023-06-2714-1/+94
|\ \ \ \ \ \ | | | | | | | | | | | | | | OpenGL: Add Local Memory warmup shader for Nvidia
| * | | | | | OpenGL: Limit lmem warmup to NVIDIAameerj2023-06-263-4/+15
| | | | | | | | | | | | | | | | | | | | | | | | | | | | :frog:
| * | | | | | shaders: Track local memory usageameerj2023-06-267-2/+23
| | | | | | |
| * | | | | | emit_glasm: Fix lmem size computationameerj2023-06-261-1/+1
| | | | | | |
| * | | | | | OpenGL: Add Local Memory warmup shaderameerj2023-06-265-1/+62
| |/ / / / /
* | | | | | android: Fix size check for content urisCharles Lombardo2023-06-271-0/+6
| | | | | | | | | | | | | | | | | | | | | | | | Fix for checking file size for android content uris
* | | | | | Merge pull request #10908 from kiri11/clarify-ring-uiliamwhite2023-06-261-1/+1
|\ \ \ \ \ \ | | | | | | | | | | | | | | Clarify Ring-Con configuration message in UI
| * | | | | | Hyphenate Joy-Con and clarify furtherKirill Ignatev2023-06-251-1/+1
| | | | | | |
| * | | | | | Clarify Ring-Con configuration message in UIKirill Ignatev2023-06-251-1/+1
| |/ / / / / | | | | | | | | | | | | | | | | | | Not obvious how left controller should be set up Mention that it should be left physical dual emulated
* | | | | | Merge pull request #10903 from german77/nfc_stateliamwhite2023-06-264-18/+52
|\ \ \ \ \ \ | | | | | | | | | | | | | | input_common: Improve nfc state handling and 3rd party support
| * | | | | | core: hid: Allow to read bin files while switch controller is availablegerman772023-06-251-4/+10
| | | | | | |
| * | | | | | input_common: Dont try to read/write data from 3rd party controllersgerman772023-06-254-14/+42
| |/ / / / /
* | | | | | Merge pull request #10901 from german77/sdl_fixliamwhite2023-06-261-8/+20
|\ \ \ \ \ \ | | | | | | | | | | | | | | input_common: Make use of new SDL features
| * | | | | | input_common: Make use of new SDL featuresgerman772023-06-251-8/+20
| |/ / / / /
* | | | | | Merge pull request #10888 from 8bitDream/nativeliamwhite2023-06-261-44/+47
|\ \ \ \ \ \ | | | | | | | | | | | | | | android: (native) Parameter types from Android Studio
| * | | | | | android: define [[maybe_unused]] (const) autoAbandoned Cart2023-06-231-41/+43
| | | | | | |
| * | | | | | android: Parameter types from Android StudioAbandoned Cart2023-06-231-4/+5
| |/ / / / / | | | | | | | | | | | | | | | | | | Android Studio marked these parameters as errors because it is an instance, not a class, that is being passed from Java.
* | | | | | Merge pull request #10865 from t895/extension-memeliamwhite2023-06-265-50/+19
|\ \ \ \ \ \ | |/ / / / / |/| | | | | android: Clean up file extension checks
| * | | | | android: Clean up file extension checksCharles Lombardo2023-06-265-50/+19
| | | | | |
* | | | | | Merge pull request #10811 from 8bitDream/pip_muteliamwhite2023-06-239-255/+148
|\ \ \ \ \ \ | | | | | | | | | | | | | | android: Add a PiP interface to mute / unmute
| * | | | | | android: Refactor native and corresponding variablesAbandoned Cart2023-06-226-22/+25
| | | | | | |
| * | | | | | Fix JNI and expose mute settings to AndroidAbandoned Cart2023-06-227-277/+99
| | | | | | |
| * | | | | | android: Add a PiP interface to mute / unmuteAbandoned Cart2023-06-214-0/+68
| | | | | | |
* | | | | | | Merge pull request #10859 from liamwhite/no-more-atomic-waitliamwhite2023-06-239-40/+26
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | general: remove atomic signal and wait
| * | | | | | | general: remove atomic signal and waitLiam2023-06-229-40/+26
| | | | | | | |
* | | | | | | | Merge pull request #10842 from german77/native_mifareliamwhite2023-06-2325-193/+1165
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | input_common: Implement native mifare/skylander support for joycons/pro controller
| * | | | | | | | input_common: Implement native mifare supportNarr the Reg2023-06-2225-193/+1165
| | | | | | | | |
* | | | | | | | | vfs_real: lock concurrent accessesLiam2023-06-232-25/+45
| | | | | | | | |
* | | | | | | | | Merge pull request #10457 from Kelebek1/optimisebunnei2023-06-2384-460/+503
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | Remove memory allocations in some hot paths
| * | | | | | | | | Remove memory allocations in some hot pathsKelebek12023-06-2284-460/+503
| | |/ / / / / / / | |/| | | | | | |
* | | | | | | | | Merge pull request #10806 from liamwhite/worst-fs-implementation-everbunnei2023-06-235-29/+47
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | vfs_real: misc optimizations
| * | | | | | | | | vfs_real: ensure size cache is reset on writeLiam2023-06-161-0/+2
| | | | | | | | | |
| * | | | | | | | | patch_manager: remove unnecessary GetSize callsLiam2023-06-161-5/+4
| | | | | | | | | |
| * | | | | | | | | vfs_real: misc optimizationsLiam2023-06-164-24/+41
| | | | | | | | | |
* | | | | | | | | | Merge pull request #10794 from 8bitDream/multiplesbunnei2023-06-223-40/+154
|\ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | android: Add support for multiple installs
| * | | | | | | | | | android: Generalize string message dialogAbandoned Cart2023-06-222-11/+11
| | | | | | | | | | |
| * | | | | | | | | | android: Add support for concurrent installsAbandoned Cart2023-06-223-40/+154
| | |_|_|/ / / / / / | |/| | | | | | | |
* | | | | | | | | | Merge pull request #10878 from GPUCode/log-droidMorph2023-06-221-0/+1
|\ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | android: Log settings
| * | | | | | | | | | android: Log settingsGPUCode2023-06-221-0/+1
| | |_|/ / / / / / / | |/| | | | | | | |
* | | | | | | | | | Merge pull request #10869 from 8bitDream/memorybunnei2023-06-223-1/+85
|\ \ \ \ \ \ \ \ \ \ | |/ / / / / / / / / |/| | | | | | | | | android: Add a notice when RAM inadequate
| * | | | | | | | | android: Convert memory sizes to resourceAbandoned Cart2023-06-223-11/+21
| | | | | | | | | |
| * | | | | | | | | android: Add a notice when RAM inadequateAbandoned Cart2023-06-223-1/+75
| |/ / / / / / / /
* | | | | | | | | Merge pull request #10086 from Morph1984/coretiming-ng-1bunnei2023-06-2231-429/+280
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | core_timing: Use CNTPCT as the guest CPU tick
| * | | | | | | | | nvdisp: Fix SingleCore frametime reportingMorph2023-06-081-1/+1
| | | | | | | | | |
| * | | | | | | | | core_timing: Fix SingleCore cycle timerMorph2023-06-084-43/+31
| | | | | | | | | |
| * | | | | | | | | (wall, native)_clock: Add GetGPUTickMorph2023-06-087-12/+47
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Allows us to directly calculate the GPU tick without double conversion to and from the host clock tick.
| * | | | | | | | | time: Use compile time division for TimeSpanType conversionMorph2023-06-085-11/+15
| | | | | | | | | |
| * | | | | | | | | core_timing: Use CNTPCT as the guest CPU tickMorph2023-06-0814-122/+47
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Previously, we were mixing the raw CPU frequency and CNTFRQ. The raw CPU frequency (1020 MHz) should've never been used as CNTPCT (whose frequency is CNTFRQ) is the only counter available.
| * | | | | | | | | nvnflinger: Acquire lock prior to signaling the vsync variableMorph2023-06-081-1/+2
| | | | | | | | | |
| * | | | | | | | | (wall, native)_clock: Rework NativeClockMorph2023-06-085-259/+94
| | | | | | | | | |
| * | | | | | | | | x64: Deduplicate RDTSC usageMorph2023-06-085-19/+82
| | | | | | | | | |
* | | | | | | | | | Merge pull request #10777 from liamwhite/no-barrierbunnei2023-06-226-0/+28
|\ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | video_core: optionally skip barriers on feedback loops
| * | | | | | | | | | video_core: optionally skip barriers on feedback loopsLiam2023-06-146-0/+28
| | | | | | | | | | |
* | | | | | | | | | | Merge pull request #10841 from liamwhite/math-is-hardbunnei2023-06-221-4/+10
|\ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | vfs_concat: fix offset calculation when not aligned to file boundary
| * | | | | | | | | | | vfs_concat: verify short readLiam2023-06-191-0/+5
| | | | | | | | | | | |
| * | | | | | | | | | | vfs_concat: fix offset calculation when not aligned to file boundaryLiam2023-06-191-4/+5
| | |_|_|_|_|_|_|_|_|/ | |/| | | | | | | | |
* | | | | | | | | | | Merge pull request #10863 from lat9nq/tz-end-of-stringbunnei2023-06-221-1/+5
|\ \ \ \ \ \ \ \ \ \ \ | |_|_|_|/ / / / / / / |/| | | | | | | | | | time_zone_manager: Stop on comma
| * | | | | | | | | | time_zone_manager: Add null terminatorlat9nq2023-06-201-2/+4
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | We aren't null-terminating this string after the copy, and we need to.
| * | | | | | | | | | time_zone_manager: Stop on commalat9nq2023-06-201-1/+3
| | |_|_|_|_|/ / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This is a deviation from the reference time zone implementation. The actual code will set a pointer to the time zone name here, but for us we have a limited number of characters to work with, and the name of the time zone here could be larger than 8 characters. We can make the assumption that time zone names greater than five characters in length include a comma that denotes more data. Nintendo just truncates that data for the name, so we can do the same. time_zone_manager: Check for length of array Just to be double sure that we never break past the array length, directly compare against it.
* / | | | | | | | | android: Don't show custom driver button on mali and x86Charles Lombardo2023-06-213-71/+123
|/ / / / / / / / /
* | | | | | | | | Merge pull request #10818 from vonchenplus/render_target_samplesliamwhite2023-06-202-18/+14
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | video_core: add samples check when find render target
| * | | | | | | | | video_core: add samples check when find render targetFengChen2023-06-172-18/+14
| | |_|_|_|/ / / / | |/| | | | | | |
* | | | | | | | | Merge pull request #10835 from lat9nq/intel-restrict-compute-disableliamwhite2023-06-206-12/+38
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | vulkan_device: Restrict compute disable only to affected Intel drivers
| * | | | | | | | | vulkan_device: Remove brace initializertoast29032023-06-191-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Co-authored-by: Tobias <thm.frey@gmail.com>
| * | | | | | | | | video_core: Check broken compute earlierlat9nq2023-06-192-2/+3
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Checks it as the system is determining what settings to enable. Reduces the need to check settings while the system is running.
| * | | | | | | | | vk_device_info: Check only affected Intel driverslat9nq2023-06-183-8/+11
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Renames is_intel_proprietary to has_broken_compute for accuracy. vk_device_info: Use vulkan::device to check compute
| * | | | | | | | | video_core: Formalize HasBrokenComputelat9nq2023-06-183-4/+26
| | |/ / / / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Also limits it to only affected Intel proprietrary driver versions. vulkan_device: Move broken compute determination vk_device: Remove errant back quote
* | | | | | | | | Merge pull request #10840 from Kelebek1/unbug_blinks_brainliamwhite2023-06-201-2/+2
|\ \ \ \ \ \ \ \ \ | |/ / / / / / / / |/| | | | | | | | Use current GPU address when unmapping GPU pages, not the base
| * | | | | | | | Use current GPU address when unmapping GPU pages, not the baseKelebek12023-06-191-2/+2
| | |_|_|/ / / / | |/| | | | | |
* | | | | | | | Merge pull request #10829 from lat9nq/remove-external-memliamwhite2023-06-182-19/+0
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | vulkan_device: Remove external memory extension
| * | | | | | | | vulkan_device: Remove external memory extensionlat9nq2023-06-182-19/+0
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Unused in yuzu. Enables yuzu to boot games in Wine using Vulkan.
* | | | | | | | | Merge pull request #10486 from lat9nq/vk-device-find-onceliamwhite2023-06-1811-50/+138
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | yuzu-qt: Load Vulkan device info at startup
| * | | | | | | | | vk_device_info: Clean up includes [IWYU]lat9nq2023-06-062-3/+11
| | | | | | | | | |
| * | | | | | | | | vk_device_info: Add SPDX datalat9nq2023-06-062-0/+6
| | | | | | | | | |
| * | | | | | | | | yuzu-qt: Load Vulkan device info at startuplat9nq2023-06-0611-50/+124
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Loading it when the configuration opens now incurs a noticeable delay. We also don't need to rediscover the same data repeatedly each time the configuration opens. Moves vulkan device info discovery to yuzu's startup as opposed to the configure_graphics constructor.
* | | | | | | | | | Merge pull request #10798 from vonchenplus/draw_texture_scaleliamwhite2023-06-181-3/+7
|\ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | video_core: drawtexture support upscale
| * | | | | | | | | | video_core: drawtexture support upscaleFeng Chen2023-06-161-3/+7
| | | | | | | | | | |
* | | | | | | | | | | Merge pull request #10809 from Kelebek1/reduce_vertex_bindingsliamwhite2023-06-182-13/+16
|\ \ \ \ \ \ \ \ \ \ \ | |_|_|_|_|_|_|_|_|/ / |/| | | | | | | | | | Synchronize vertex buffer even when it doesn't require binding
| * | | | | | | | | | Synchronize vertex buffer even when it doesn't require bindingKelebek12023-06-172-13/+16
| | |_|_|/ / / / / / | |/| | | | | | | |
* | | | | | | | | | Merge pull request #10797 from lat9nq/tzdb-patchbunnei2023-06-183-11/+6
|\ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | time: Various time zone fixes
| * | | | | | | | | | time_zone_service: Always write time zone rule datalat9nq2023-06-181-8/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Switch firmware will initialize this data even if the given parameters are invalid. We should do the same.
| * | | | | | | | | | time_zone_manager: Compare to the correct booleanlat9nq2023-06-161-2/+3
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Reference implementation does not compare the booleans as we had them. Use the correct ones as in the reference. Also adds an assert. I have been made aware of a crash here and am not able to reproduce currently.
| * | | | | | | | | | nx_tzdb: Correct Antarctica spellinglat9nq2023-06-161-1/+1
| | | | | | | | | | |
* | | | | | | | | | | renderer_vulkan: add missing includeLiam2023-06-181-0/+1
| | | | | | | | | | |
* | | | | | | | | | | Merge pull request #10813 from lat9nq/no-atomic-boolMorph2023-06-182-5/+14
|\ \ \ \ \ \ \ \ \ \ \ | |_|_|_|_|/ / / / / / |/| | | | | | | | | | k_thread: Use a mutex and cond_var to sync bool
| * | | | | | | | | | k_thread: Use a mutex and cond_var to sync boollat9nq2023-06-172-5/+14
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | std::atomic<bool> is broken on MinGW and causes deadlocks there. Use a normal cond var in its stead.
* | | | | | | | | | | Merge pull request #10744 from Wollnashorn/af-for-allFernando S2023-06-1814-80/+243
|\ \ \ \ \ \ \ \ \ \ \ | |_|_|_|_|_|/ / / / / |/| | | | | | | | | | video_core: Improved anisotropic filtering heuristics
| * | | | | | | | | | video_core: Only apply AF to 2D (array) image typesWollnashorn2023-06-171-2/+7
| | | | | | | | | | |
| * | | | | | | | | | video_core: Removed AF for all mip modes option as it's default nowWollnashorn2023-06-179-40/+3
| | | | | | | | | | |
| * | | | | | | | | | video_core: Use sampler IDs instead pointers in the pipeline configWollnashorn2023-06-168-23/+68
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The previous approach of storing pointers returned by `GetGraphicsSampler`/`GetComputeSampler` caused UB, as these functions can cause reallocation of the sampler slot vector and therefore invalidate the pointers
| * | | | | | | | | | video_core: Fallback to default anisotropy instead to 1x anisotropyWollnashorn2023-06-157-16/+20
| | | | | | | | | | |
| * | | | | | | | | | video_core: Disable AF for non-color image formatsWollnashorn2023-06-151-0/+9
| | | | | | | | | | |
| * | | | | | | | | | video_core: Fixed compilation errors because of name shadowingWollnashorn2023-06-152-9/+9
| | | | | | | | | | |
| * | | | | | | | | | video_core: Add per-image anisotropy heuristics (format & mip count)Wollnashorn2023-06-1511-71/+168
| | | | | | | | | | |
| * | | | | | | | | | video_core: Apply AF only to samplers with normal LOD range [0, 1+x]Wollnashorn2023-06-141-4/+6
| | | | | | | | | | |
| * | | | | | | | | | video_core: Fix default anisotropic heuristicWollnashorn2023-06-141-4/+4
| | | | | | | | | | |
| * | | | | | | | | | video_core: Never apply AF to None mipmap modeWollnashorn2023-06-141-3/+4
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Should fix some artifacts with the "apply anisotropic filtering for all mipmap modes" option
| * | | | | | | | | | video_core: Disable anisotropic filtering for samplers with depth compareWollnashorn2023-06-131-2/+3
| | | | | | | | | | |
| * | | | | | | | | | video_core: Option to apply anisotropic filtering for all mipmap modesWollnashorn2023-06-139-1/+37
| | | | | | | | | | |
* | | | | | | | | | | Merge pull request #10783 from liamwhite/memorybunnei2023-06-172-6/+6
|\ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | video_core: preallocate fewer IR blocks
| * | | | | | | | | | | video_core: preallocate fewer IR blocksLiam2023-06-152-6/+6
| | | | | | | | | | | |
* | | | | | | | | | | | Merge pull request #10808 from t895/settings-stuffsbunnei2023-06-1712-74/+165
|\ \ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | | | android: Expose settings
| * | | | | | | | | | | | android: Expose audio output engine settingCharles Lombardo2023-06-167-21/+59
| | | | | | | | | | | | |
| * | | | | | | | | | | | android: Expose CPU debugging optionCharles Lombardo2023-06-165-23/+30
| | | | | | | | | | | | |
| * | | | | | | | | | | | android: Expose fastmem optionCharles Lombardo2023-06-164-29/+59
| | | | | | | | | | | | |
| * | | | | | | | | | | | android: Support changing multiple settings at onceCharles Lombardo2023-06-162-1/+17
| | |_|_|_|/ / / / / / / | |/| | | | | | | | | |
* | | | | | | | | | | | Merge pull request #10807 from t895/ktlint-fixesbunnei2023-06-171-2/+3
|\ \ \ \ \ \ \ \ \ \ \ \ | |_|_|_|/ / / / / / / / |/| | | | | | | | | | | android: Ktlint fixes
| * | | | | | | | | | | android: Bump ktlint version to 0.47.1Charles Lombardo2023-06-161-1/+1
| | | | | | | | | | | |
| * | | | | | | | | | | android: Disable import-ordering ktlint checkCharles Lombardo2023-06-161-1/+2
| |/ / / / / / / / / /
* | | | | | | | | | | Merge pull request #10731 from german77/misc_fixesliamwhite2023-06-1710-115/+198
|\ \ \ \ \ \ \ \ \ \ \ | |/ / / / / / / / / / |/| | | | | | | | | | service: nfc: Accuracy fixes
| * | | | | | | | | | service: nfc: Read tag protocol only for nfc backendNarr the Reg2023-06-152-5/+6
| | | | | | | | | | |
| * | | | | | | | | | service: nfc: Accuracy fixesNarr the Reg2023-06-1510-110/+192
| | | | | | | | | | |
* | | | | | | | | | | android: Fix aspect ratio when rotating screenAbandoned Cart2023-06-162-28/+20
| |_|_|_|/ / / / / / |/| | | | | | | | |
* | | | | | | | | | Merge pull request #10795 from german77/foomiiboliamwhite2023-06-162-0/+3
|\ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | input_common: Add foomiibo support
| * | | | | | | | | | input_common: Add amiibo with originality signature supportNarr the Reg2023-06-162-0/+3
| |/ / / / / / / / /
* | | | | | | | | | android: Apply ktlint codestyleCharles Lombardo2023-06-1653-278/+476
| | | | | | | | | |
* | | | | | | | | | Android: Use ktlint for Kotlin code styleCharles Lombardo2023-06-161-0/+20
| | | | | | | | | |
* | | | | | | | | | android: Enable android lintingCharles Lombardo2023-06-162-11/+1
| |_|_|/ / / / / / |/| | | | | | | |
* | | | | | | | | Merge pull request #10796 from bunnei/fix-safbunnei2023-06-164-1/+54
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | android: fs: Fix Exists / IsFile for SAF.
| * | | | | | | | | android: fs: Fix Exists / IsFile for SAF.bunnei2023-06-164-1/+54
| | | | | | | | | |
* | | | | | | | | | Merge pull request #10790 from liamwhite/arm-driver-momentbunnei2023-06-161-5/+10
|\ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | vulkan_device: disable extended_dynamic_state2 on ARM drivers
| * | | | | | | | | | vulkan_device: disable extended_dynamic_state2 on ARM driversLiam2023-06-151-5/+10
| | |_|/ / / / / / / | |/| | | | | | | |
* | | | | | | | | | Merge pull request #10775 from liamwhite/cb2bunnei2023-06-161-0/+1
|\ \ \ \ \ \ \ \ \ \ | |_|/ / / / / / / / |/| | | | | | | | | renderer_vulkan: propagate conditional barrier support
| * | | | | | | | | renderer_vulkan: propagate conditional barrier supportLiam2023-06-141-0/+1
| | |_|_|_|/ / / / | |/| | | | | | |
* | | | | | | | | Merge pull request #10639 from 8bitDream/pictureinpicturebunnei2023-06-1618-159/+647
|\ \ \ \ \ \ \ \ \ | |_|/ / / / / / / |/| | | | | | | | android: Support for Picture in Picture / Portrait
| * | | | | | | | android: Move overlays to their own layoutAbandoned Cart2023-06-145-108/+117
| | | | | | | | |
| * | | | | | | | android: Initialize defaults for each orientationsAbandoned Cart2023-06-146-173/+187
| | | | | | | | |
| * | | | | | | | android: Display FPS with emulation on hingeAbandoned Cart2023-06-142-17/+13
| | | | | | | | |
| * | | | | | | | android: Remove PiP reliance on fragmentAbandoned Cart2023-06-145-63/+69
| | | | | | | | |
| * | | | | | | | android: Set layout by fragment, not viewAbandoned Cart2023-06-143-63/+63
| | | | | | | | |
| * | | | | | | | android: Add a separate foldable layout setAbandoned Cart2023-06-143-206/+222
| | | | | | | | |
| * | | | | | | | android: Set portrait default control paramsAbandoned Cart2023-06-144-17/+186
| | | | | | | | |
| * | | | | | | | android: Actually implement portrait controlsAbandoned Cart2023-06-142-33/+82
| | | | | | | | |
| * | | | | | | | android: Enable automated portrait controlsAbandoned Cart2023-06-142-81/+40
| | | | | | | | |
| * | | | | | | | android: Add Picture in Picture / OrientationAbandoned Cart2023-06-1415-66/+336
| | | | | | | | |
* | | | | | | | | Merge pull request #10729 from liamwhite/windows-is-a-memebunnei2023-06-152-99/+118
|\ \ \ \ \ \ \ \ \ | |_|_|/ / / / / / |/| | | | | | | | vfs_real: add file LRU cache for open file limits
| * | | | | | | | vfs_real: require file existence on openLiam2023-06-131-0/+4
| | | | | | | | |
| * | | | | | | | vfs_real: add simplified open file cacheLiam2023-06-132-1/+18
| | | | | | | | |
| * | | | | | | | vfs_real: lazily open filesLiam2023-06-132-11/+3
| | | | | | | | |
| * | | | | | | | vfs_real: add file LRU cache for open file limitsLiam2023-06-132-100/+106
| | | | | | | | |
* | | | | | | | | Merge pull request #10749 from Morph1984/strong-typingMorph2023-06-156-37/+35
|\ \ \ \ \ \ \ \ \ | |_|/ / / / / / / |/| | | | | | | | buffer_cache_base: Specify buffer type in HostBindings
| * | | | | | | | buffer_cache_base: Specify buffer type in HostBindingsMorph2023-06-136-37/+35
| |/ / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | Avoid reinterpret-casting from void pointer since the type is already known at compile time.
* | / / / / / / android: Adapt EmulationActivity to navigation componentCharles Lombardo2023-06-149-74/+86
| |/ / / / / / |/| | | | | |
* | | | | | | Merge pull request #10603 from lat9nq/tz-more-completebunnei2023-06-1313-710/+383
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | core,common: Implement missing time zone data/computations
| * | | | | | | tz_manager: Fix comparison to wrong integerlat9nq2023-06-051-1/+1
| | | | | | | |
| * | | | | | | tz_manager: Implement missing transition timeslat9nq2023-06-051-1/+59
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | time_zone_manager: Use s64 storage
| * | | | | | | tz_manager: Warn on unimplemented codelat9nq2023-06-051-0/+7
| | | | | | | |
| * | | | | | | tz_manager: Fix character offset not advancinglat9nq2023-06-051-0/+1
| | | | | | | |
| * | | | | | | tz_manager: Fix off-by-one errorlat9nq2023-06-051-4/+4
| | | | | | | |
| * | | | | | | time_zone: Handle offset time zoneslat9nq2023-06-051-38/+26
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | time_zone: Remove maybe_unused time_zone: Use s64 storages time_zone: Catch by reference
| * | | | | | | time_zone_binary: Add zoneinfo datalat9nq2023-06-052-643/+65
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Adds the basic time zone data for the system archive. time_zone_binary: Implement full system archive time_zone_binary: Remove unneeded template tz_binary: Make GenerateFiles static
| * | | | | | | time: Implement missing servicesNarr the Reg2023-06-057-11/+106
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Implements GetTotalLocationNameCount LoadLocationNameList and GetTimeZoneRuleVersion. tz-manager: Fix sign issue
| * | | | | | | time_zone_manager: Implement go_ahead/go_backlat9nq2023-06-051-1/+39
| | | | | | | |
| * | | | | | | tz_content_manager: Try the system time zone firstlat9nq2023-06-051-2/+9
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | If we can't find the normal time zone string, try searching for the closest one.
| * | | | | | | common: Move system time zone string detectionlat9nq2023-06-053-76/+84
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Moves it from Settings to Common::TimeZone, since this algorithm doesn't depend on the setting. It also lets us use it in other libraries. common: Various fixes time_zone: Don't double up the std::abs Too many absolute values were causing mirrored time zones to resolve as the same.
| * | | | | | | configure_system: Remove external offset on custom rtclat9nq2023-06-051-2/+1
| | | | | | | |
| * | | | | | | time: Remove auto timezone considerationlat9nq2023-06-053-33/+3
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | GetTimeZoneString no longer reports a setting unique to yuzu, so we can assume a valid timezone string in core.
| * | | | | | | settings: Always report a valid time zonelat9nq2023-06-051-2/+76
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Prevents needing to deduce the non-Switch setting in core. Instead, we deduce the meaning of this setting where the heresy is committed, in common. settings: Remove strftime usage GetTimeZoneString: Use standard features Also forces GMT on MinGW due to broken strftime.
| * | | | | | | time_manager: Don't offset RTC by system time zonelat9nq2023-06-051-5/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This causes the emulated system's universal time to be on the user's clock, and the user time to be off if they set a time zone. time_manager: Remove GetExternalRtcTime
| * | | | | | | tz_content_manager: Detect system time zonelat9nq2023-06-051-1/+11
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Uses C++20 tzdb to determine the system timezone. The switch uses the 597 posix time zones, so this needs tests if the system time zone isn't posix-compliant.
* | | | | | | | Merge pull request #10760 from FearlessTobi/translationsCharles Lombardo2023-06-132-0/+18
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | android: Declare languages in locales_config.xml
| * | | | | | | | android: Declare languages in locales_config.xmlFearlessTobi2023-06-132-0/+18
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This is required to make per-app language swithcing possible on Android 13.
* | | | | | | | | Merge pull request #10751 from german77/touchCharles Lombardo2023-06-131-2/+4
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | android: Fix touch input
| * | | | | | | | | android: Fix touch inputgerman772023-06-131-2/+4
| | | | | | | | | |
* | | | | | | | | | Merge pull request #10747 from liamwhite/arm-interface-decouplebunnei2023-06-1315-172/+189
|\ \ \ \ \ \ \ \ \ \ | |_|_|_|/ / / / / / |/| | | | | | | | | core: decouple ARM interface from Dynarmic
| * | | | | | | | | core: decouple ARM interface from DynarmicLiam2023-06-1315-172/+189
| |/ / / / / / / /
* | | | | | | | | Merge pull request #10746 from bunnei/update-android-settingsbunnei2023-06-1319-110/+28
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | android: Update settings, remove unused translations
| * | | | | | | | | android: settings: Disable force_max_clock by default.bunnei2023-06-133-5/+5
| | | | | | | | | |
| * | | | | | | | | android: settings: Add reactive flushing as a default-disabled setting.bunnei2023-06-135-0/+24
| | | | | | | | | |
| * | | | | | | | | android: res: Remove translated strings that no longer exist.bunnei2023-06-1314-106/+0
| |/ / / / / / / /
* | | | | | | | | Merge pull request #10675 from liamwhite/scalerliamwhite2023-06-131-8/+12
|\ \ \ \ \ \ \ \ \ | |/ / / / / / / / |/| | | | | | | | image_info: adjust rescale thresholds and refactor constant use
| * | | | | | | | image_info: adjust rescale thresholds and refactor constant useLiam2023-06-081-8/+12
| | |_|_|_|/ / / | |/| | | | | |
* | | | | | | | Merge pull request #10743 from FearlessTobi/translationsbunnei2023-06-1314-0/+4816
|\ \ \ \ \ \ \ \ | | |/ / / / / / | |/| | | | | | android: Add translation files manually
| * | | | | | | android: Add translation files manuallyFearlessTobi2023-06-1314-0/+4816
| | | | | | | |
* | | | | | | | Merge pull request #10705 from german77/updatesbunnei2023-06-137-5/+183
|\ \ \ \ \ \ \ \ | |/ / / / / / / |/| | | | | | | android: Add update and DLC support
| * | | | | | | android: Add update supportNarr the Reg2023-06-127-5/+183
| | | | | | | |
* | | | | | | | Merge pull request #10728 from t895/game-hashbunnei2023-06-121-7/+12
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | android: Use autogenerated hash code function for Game class
| * | | | | | | | android: Use autogenerated hash code function for Game classCharles Lombardo2023-06-121-7/+12
| | |_|_|_|_|/ / | |/| | | | | |
* | | | | | | | Merge pull request #10724 from t895/auto-version-propertybunnei2023-06-121-1/+15
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | android: Use autoVersion when gradle property is set
| * | | | | | | | android: Use autoVersion when gradle property is setCharles Lombardo2023-06-121-1/+15
| |/ / / / / / /
* | | | | | | | Merge pull request #10699 from liamwhite/conditional-barrierMatías Locatti2023-06-1210-0/+65
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | shader_recompiler: remove barriers in conditional control flow when device lacks support
| * | | | | | | | shader_recompiler: remove barriers in conditional control flow when device lacks supportLiam2023-06-1010-0/+65
| | | | | | | | |
* | | | | | | | | Merge pull request #10693 from liamwhite/f64-to-f32bunnei2023-06-128-0/+198
|\ \ \ \ \ \ \ \ \ | |_|_|_|_|_|/ / / |/| | | | | | | | shader_recompiler: translate f64 to f32 when unsupported on host
| * | | | | | | | shader_recompiler: translate f64 to f32 when unsupported on hostLiam2023-06-108-0/+198
| | | | | | | | |
* | | | | | | | | Merge pull request #10718 from liamwhite/buffered-ioMorph2023-06-121-1/+1
|\ \ \ \ \ \ \ \ \ | |_|_|/ / / / / / |/| | | | | | | | qt: use larger buffer for update install
| * | | | | | | | qt: use larger buffer for update installLiam2023-06-111-1/+1
| | | | | | | | |
* | | | | | | | | Merge pull request #10668 from Kelebek1/reduce_vertex_bindingsbunnei2023-06-116-24/+148
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | Combine vertex/transform feedback buffer binding into a single call
| * | | | | | | | | Combine vertex/transform feedback buffer binding into a single callKelebek12023-06-086-24/+148
| | | | | | | | | |
* | | | | | | | | | Merge pull request #10713 from t895/gradle-updatesbunnei2023-06-112-16/+11
|\ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | android: Gradle updates
| * | | | | | | | | | android: Update dependenciesCharles Lombardo2023-06-111-4/+4
| | | | | | | | | | |
| * | | | | | | | | | android: Differentiate build types with new namesCharles Lombardo2023-06-112-2/+7
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Change the applicationIdSuffix and app launcher title based on build type
| * | | | | | | | | | Android: Remove unused relWithVersionCode build typeCharles Lombardo2023-06-111-10/+0
| | |_|_|_|/ / / / / | |/| | | | | | | |
* / | | | | | | | | android: Use ContentResolver to get file extensionCharles Lombardo2023-06-113-11/+28
|/ / / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | Fixes an issue where we try to resolve file extension from URIs. Sometimes the URI will not contain the file name at all and instead a string of numbers. Here we query the content resolver and guarantee that we get a file name every time.
* | / / / / / / / android: Fix screen orientation & blurriness.bunnei2023-06-114-95/+5
| |/ / / / / / / |/| | | | | | |
* | | | | | | | Merge pull request #10670 from liamwhite/fxaa2bunnei2023-06-101-4/+4
|\ \ \ \ \ \ \ \ | |_|_|/ / / / / |/| | | | | | | vk_blit_screen: use higher bit depth for fxaa
| * | | | | | | vk_blit_screen: use higher bit depth for fxaaLiam2023-06-081-4/+4
| | |_|/ / / / | |/| | | | |
* | | | | | | Merge pull request #10685 from liamwhite/serialization-is-hardMorph2023-06-101-0/+2
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | qt: persist framerate sync option
| * | | | | | | qt: persist framerate sync optionLiam2023-06-091-0/+2
| | | | | | | |
* | | | | | | | Merge pull request #10691 from t895/nro-checkbunnei2023-06-108-13/+51
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | android: Add proper homebrew check
| * | | | | | | | android: Add proper homebrew checkCharles Lombardo2023-06-108-13/+51
| | |_|_|/ / / / | |/| | | | | |
* / | | | | | | android: Fix input overlay version checkCharles Lombardo2023-06-091-12/+14
|/ / / / / / /
* | | | | | | Merge pull request #10614 from xcfrg/shader-backend-status-barliamwhite2023-06-093-1/+14
|\ \ \ \ \ \ \ | |/ / / / / / |/| | | | | | yuzu: add opengl shader backend info in status bar
| * | | | | | yuzu: add opengl shader backend info in status barxcfrg2023-06-043-1/+14
| | | | | | |
* | | | | | | Merge pull request #10623 from german77/backupliamwhite2023-06-0910-39/+184
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | service: nfc: Add backup support
| * | | | | | | service: nfc: Add backup supportgerman772023-06-0710-39/+184
| | | | | | | |
* | | | | | | | Merge pull request #10666 from liamwhite/my-framerate-is-fineliamwhite2023-06-0911-24/+48
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | nvnflinger: allow locking framerate during video playback
| * | | | | | | | nvnflinger: allow locking framerate during video playbackLiam2023-06-0811-24/+48
| | |_|/ / / / / | |/| | | | | |
* | | | | | | | Merge pull request #10676 from bunnei/fix-mi-5-androidliamwhite2023-06-091-1/+2
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | android: EmulationActivity: Fix orientation on Mi Pad 5.
| * | | | | | | | android: EmulationActivity: Fix orientation on Mi Pad 5.bunnei2023-06-091-1/+2
| |/ / / / / / /
* / / / / / / / Fix potentially uninitialized local variable warningTokarev Artem2023-06-091-1/+1
|/ / / / / / /
* | | | | | | Merge pull request #10650 from qurious-pixel/android_tvbunnei2023-06-082-14/+8
|\ \ \ \ \ \ \ | |_|_|/ / / / |/| | | | | | Android TV banner
| * | | | | | remove version code declarationqurious-pixel2023-06-071-1/+0
| | | | | | |
| * | | | | | Android TV bannerLive session user2023-06-063-14/+9
| | | | | | |
* | | | | | | Merge pull request #10655 from Morph1984/msvc-cxx20liamwhite2023-06-071-2/+4
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | CMakeLists: Force C++20 on MSVC due to conflicts with C++23 modules
| * | | | | | | CMakeLists: Force C++20 on MSVC due to conflicts with C++23 modulesMorph2023-06-071-2/+4
| | |/ / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | The latest version of MSVC STL brings C++23 standard library modules, which conflict with precompiled headers. Disabling with /experimental:module- has no effect, so force C++20 in the meantime while we wait for module support in other compilers.
* | | | | | | Merge pull request #10635 from mrcmunir/l4t-tx1-nvidialiamwhite2023-06-071-4/+4
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | Make VK_EXT_robustness2 optional
| * | | | | | | Updated to lexicographical order suggestionsCarlos Estrague / Mrc_munir2023-06-061-3/+3
| | | | | | | |
| * | | | | | | Make VK_EXT_robustness2 optionalCarlos Estrague / Mrc_munir2023-06-061-4/+4
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | For some reason nvidia implemented Vulkan 1.2 supported without support for VK_EXT_robustness2 in tegra X1/X2 . Fix vulkan work in TX1/TX2 L4T drivers .
* | | | | | | | Merge pull request #10476 from ameerj/gl-memory-mapsliamwhite2023-06-0715-204/+316
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | OpenGL: Make use of persistent buffer maps in buffer cache
| * | | | | | | | gl_staging_buffers: Optimization to reduce fence waitingameerj2023-05-282-4/+22
| | | | | | | | |
| * | | | | | | | OpenGL: Make use of persistent buffer maps in buffer cache downloadsameerj2023-05-2815-204/+298
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Persistent buffer maps were already used by the texture cache, this extends their usage for the buffer cache. In my testing, using the memory maps for uploads was slower than the existing "ImmediateUpload" path, so the memory map usage is limited to downloads for the time being.
* | | | | | | | | Merge pull request #10583 from ameerj/ill-logicliamwhite2023-06-071-8/+4
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | AccelerateDMA: Fix incorrect check in Buffer<->Texture copies
| * | | | | | | | | texture_cache: Fix incorrect logic for AccelerateDMAameerj2023-06-031-8/+4
| | | | | | | | | |
* | | | | | | | | | Merge pull request #10591 from keve1227/localized-game-iconsliamwhite2023-06-074-10/+42
|\ \ \ \ \ \ \ \ \ \ | |_|_|_|/ / / / / / |/| | | | | | | | | Localize game icons
| * | | | | | | | | Fix typoKevin Sundqvist Norlén2023-06-031-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Co-authored-by: liamwhite <liamwhite@users.noreply.github.com>
| * | | | | | | | | Update Chinese NX language namesKeve12272023-06-032-8/+8
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | ... as per the TLoZ: TotK icon files. Would this conflict with older games?
| * | | | | | | | | Issue a reload if the system language changedKeve12272023-06-031-1/+2
| | | | | | | | | |
| * | | | | | | | | Pick game icon based on the configured system languageKeve12272023-06-031-1/+32
| |/ / / / / / / /
* | | | / / / / / android: Set version codeNarr the Reg2023-06-061-0/+1
| |_|_|/ / / / / |/| | | | | | |
* | | | | | | | android: Improve Gradle build configurationAbandoned Cart2023-06-061-1/+2
| |_|_|_|_|/ / |/| | | | | |
* | | | | | | android: audio_core: sink_stream: Remove unnecessary check.bunnei2023-06-061-3/+0
| | | | | | |
* | | | | | | Merge pull request #10508 from yuzu-emu/limebunnei2023-06-06328-176/+21104
|\ \ \ \ \ \ \ | |_|_|/ / / / |/| | | | | | Project Lime - yuzu Android Port
| * | | | | | Merge pull request #10633 from t895/variable-surface-ratiobunnei2023-06-063-1/+62
| |\ \ \ \ \ \ | | | | | | | | | | | | | | | | android: Use a custom view for changing emulation aspect ratio
| | * | | | | | android: Use a custom view for changing emulation aspect ratioCharles Lombardo2023-06-063-1/+62
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Credit to the Skyline team for the FixedRatioSurfaceView.
| * | | | | | | Merge pull request #10578 from PabloG02/lime-firmware&logsbunnei2023-06-069-33/+270
| |\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | Add UI to import firmware and share logs
| | * | | | | | | android: HomeSettingsFragment: Use string resource for "Share log".bunnei2023-06-061-1/+1
| | | | | | | | |
| | * | | | | | | Address feedbackPabloG022023-06-064-19/+28
| | | | | | | | |
| | * | | | | | | Attempt to move the unzip coroutine to a ViewModelPabloG022023-06-043-27/+94
| | | | | | | | |
| | * | | | | | | android: update stringsPabloG022023-06-041-5/+5
| | | | | | | | |
| | * | | | | | | android: add option to share logPabloG022023-06-043-0/+36
| | | | | | | | |
| | * | | | | | | android: add option to install firmwarePabloG022023-06-045-1/+124
| | | | | | | | |
| | * | | | | | | android: move unzip function to FileUtil and use SecurityExceptionPabloG022023-06-042-32/+34
| | | | | | | | |
| * | | | | | | | Merge pull request #10618 from t895/licensesbunnei2023-06-0610-4/+918
| |\ \ \ \ \ \ \ \ | | |_|/ / / / / / | |/| | | | | | | android: Add licenses page
| | * | | | | | | android: Create licenses pageCharles Lombardo2023-06-0510-4/+918
| | | | | | | | |
| * | | | | | | | Merge pull request #10613 from t895/settings-changesbunnei2023-06-057-104/+116
| |\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | android: String and settings organization changes
| | * | | | | | | | android: Move settings to debug submenuCharles Lombardo2023-06-054-26/+38
| | | | | | | | | |
| | * | | | | | | | android: Several string changesCharles Lombardo2023-06-045-78/+78
| | | | | | | | | |
| * | | | | | | | | android: Load settings at the start of each activityCharles Lombardo2023-06-054-6/+19
| | |/ / / / / / / | |/| | | | | | |
| * | | | | | | | android: Resolve a couple Gradle warningsAbandoned Cart2023-06-041-1/+4
| |/ / / / / / /
| * | | | | | | android: Add support for split foldable viewAbandoned Cart2023-06-043-1/+55
| | | | | | | |
| * | | | | | | android: Replace deprecated and Java codeAbandoned Cart2023-06-031-27/+20
| |/ / / / / /
| * | | | | | android: Fix crash on importing invalid saveCharles Lombardo2023-06-031-3/+5
| | | | | | |
| * | | | | | android: vk_presentation_manager: Fix unusued needs_recreation.bunnei2023-06-031-3/+3
| | | | | | |
| * | | | | | android: Rename "Input Overlay" to "Overlay Options"Charles Lombardo2023-06-031-1/+1
| | | | | | |
| * | | | | | android: Adjust import/export saves dialogCharles Lombardo2023-06-033-15/+21
| | | | | | |
| * | | | | | android: Warning dialogs for key errorsCharles Lombardo2023-06-033-31/+95
| | | | | | |
| * | | | | | android: vk_turbo_mode: Remove unnecessary device recreation.bunnei2023-06-032-2/+11
| | | | | | | | | | | | | | | | | | | | | | | | | | | | - Fixes a rare crash.
| * | | | | | android: EmulationFragment: Remove unnecessary surface destroy on pause.bunnei2023-06-031-3/+0
| | | | | | |
| * | | | | | android: renderer_vulkan: Fix crash with surface recreation.bunnei2023-06-035-1/+36
| | | | | | |
| * | | | | | android: Fix presentation layout on foldable and tablet devices.bunnei2023-06-035-22/+94
| | | | | | |
| * | | | | | android: Enable overlay scale/opacity dialogCharles Lombardo2023-06-0310-65/+182
| | | | | | |
| * | | | | | Add image to card_game.xml to preview in the Layout EditorPabloG022023-06-031-1/+2
| | | | | | |
| * | | | | | Save the position of buttons as a percentagePabloG022023-06-031-80/+136
| | | | | | |
| * | | | | | android: Don't crash the app when selecting a zip that causes a SecurityExceptionCharles Lombardo2023-06-031-1/+5
| | | | | | |
| * | | | | | input_common: Fix virtual amiibosbunnei2023-06-031-4/+4
| | | | | | |
| * | | | | | android: audio_core: Avoid shutdown hang.bunnei2023-06-031-0/+3
| | | | | | |
| * | | | | | android: ForegroundService: Handle null intent.bunnei2023-06-031-1/+4
| | | | | | |
| * | | | | | android: ImportExportSavesFragment: Cleanup strings.bunnei2023-06-032-7/+10
| | | | | | |
| * | | | | | Update src/android/app/src/main/java/org/yuzu/yuzu_emu/fragments/ImportExportSavesFragment.ktbunnei2023-06-031-1/+1
| | | | | | |
| * | | | | | Remove `?.`PabloG022023-06-031-1/+1
| | | | | | |
| * | | | | | Check if folder exists before letting the user import/export savesPabloG022023-06-031-9/+17
| | | | | | |
| * | | | | | Add save import/export in UIPabloG022023-06-035-0/+247
| | | | | | |
| * | | | | | android: Fix FPS text getting cut off by rounded display cornersCharles Lombardo2023-06-032-7/+20
| | | | | | |
| * | | | | | android: Prevent deleting the settings file while a game is runningCharles Lombardo2023-06-033-2/+7
| | | | | | |
| * | | | | | android: Fix link text color for base theme dialogCharles Lombardo2023-06-031-0/+1
| | | | | | |
| * | | | | | android: Various fixes for CI.bunnei2023-06-0326-60/+121
| | | | | | |
| * | | | | | android: externals: Update libadrenotools, use useLegacyPackaging.bunnei2023-06-031-0/+5
| | | | | | |
| * | | | | | android: Re-enable service notificationCharles Lombardo2023-06-034-24/+29
| | | | | | |
| * | | | | | android: Ensure keys are loaded before populating games listCharles Lombardo2023-06-031-0/+3
| | | | | | |
| * | | | | | android: Use dialog fragment for the reset settings dialogCharles Lombardo2023-06-032-12/+37
| | | | | | |
| * | | | | | android: Upgrade AGP to 8.0.2Charles Lombardo2023-06-031-2/+2
| | | | | | |
| * | | | | | android: Show notification permission page during setupCharles Lombardo2023-06-034-59/+151
| | | | | | |
| * | | | | | android: DIsable FPS counter by defaultCharles Lombardo2023-06-031-1/+1
| | | | | | |
| * | | | | | android: Improve searches with one characterCharles Lombardo2023-06-031-1/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | The Jaccard algorithm is great for searches with 2 or more characters but nothing is returned for searches with one character. To get around this, just search with JaroWinkler for single character searches.
| * | | | | | android: Stop building x86 packages in APKsCharles Lombardo2023-06-031-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | This was really only meant for building the app to run in an emulator. If this is necessary, just add manually.
| * | | | | | android: Add FPS toggleCharles Lombardo2023-06-034-10/+37
| | | | | | |
| * | | | | | android: Clean up app build.gradleCharles Lombardo2023-06-031-22/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | Removes the conflicting declaration of "version" and changes to versionCode that did nothing.
| * | | | | | video_core: vk_rasterizer: Decrease draw dispatch count for Android.bunnei2023-06-031-0/+4
| | | | | | |
| * | | | | | android: config: Expose VSync as a configurable setting.bunnei2023-06-035-9/+44
| | | | | | |
| * | | | | | android: GPU: Enable async presentation, increase frames in flight.bunnei2023-06-032-2/+4
| | | | | | |
| * | | | | | android: Enable onBackInvokedCallbackCharles Lombardo2023-06-031-1/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | For now this enables the ability to see the new Android 13 back gesture animations but later we can create custom animations that follow the back gesture.
| * | | | | | android: Remove deprecated use of onBackPressed()Charles Lombardo2023-06-031-1/+16
| | | | | | |
| * | | | | | android: Add option for touch overlay hapticsCharles Lombardo2023-06-036-4/+51
| | | | | | | | | | | | | | | | | | | | | | | | | | | | Disabled by default
| * | | | | | android: Improve missing game handlingCharles Lombardo2023-06-032-1/+19
| | | | | | | | | | | | | | | | | | | | | | | | | | | | Previously the app would crash if you selected a game that no longer existed. Now we show an error message and reload the games list to remove any invalid games from the list.
| * | | | | | android: Clean up dependenciesCharles Lombardo2023-06-031-7/+3
| | | | | | | | | | | | | | | | | | | | | | | | | | | | Additionally updates material and androidx core libraries
| * | | | | | android: Delete java code style fileCharles Lombardo2023-06-031-241/+0
| | | | | | |
| * | | | | | android: Settings UI tweaksCharles Lombardo2023-06-036-23/+24
| | | | | | | | | | | | | | | | | | | | | | | | | | | | New spacing and fonts for list items
| * | | | | | android: Simplify setup in search and games fragmentsCharles Lombardo2023-06-032-57/+62
| | | | | | |
| * | | | | | android: Use collapsing toolbar layout in settingsCharles Lombardo2023-06-033-11/+26
| | | | | | |
| * | | | | | android: Remove unnecessary JvmStatic/JvmField annotationsCharles Lombardo2023-06-0311-17/+0
| | | | | | |
| * | | | | | android: Fix navigation rail animation in rtl layoutCharles Lombardo2023-06-031-4/+14
| | | | | | |
| * | | | | | android: Use cutout insets on setup fragmentCharles Lombardo2023-06-031-5/+6
| | | | | | |
| * | | | | | android: Button to reset all settingsCharles Lombardo2023-06-0321-23/+138
| | | | | | |
| * | | | | | android: Use proguard file in relWithDebInfoCharles Lombardo2023-06-031-0/+4
| | | | | | |
| * | | | | | android: Fix background color within inset areasCharles Lombardo2023-06-032-2/+4
| | | | | | |
| * | | | | | android: Shortcut to settings activity on reselectionCharles Lombardo2023-06-031-2/+11
| | | | | | |
| * | | | | | android: Expose custom RTC settingCharles Lombardo2023-06-039-31/+72
| | | | | | |
| * | | | | | android: Reset setting on long pressCharles Lombardo2023-06-0316-7/+89
| | | | | | |
| * | | | | | android: Fix issues with ea/main icons and version codesCharles Lombardo2023-06-037-28/+19
| | | | | | | | | | | | | | | | | | | | | | | | | | | | Now all yuzu icon variants are taken care of and now we have a build variant that uses the versioning we need for the play store.
| * | | | | | android: Move theme options out of advanced settingsCharles Lombardo2023-06-034-9/+17
| | | | | | |
| * | | | | | android: Check if cached games are validCharles Lombardo2023-06-031-1/+9
| | | | | | | | | | | | | | | | | | | | | | | | | | | | Fixes bug when you close yuzu, delete games, and reopen to an instant crash.
| * | | | | | android: Invert rotation to match phone orientationgerman772023-06-031-5/+27
| | | | | | |
| * | | | | | android: vulkan_device: Skip BGR565 emulation on S8gen2.bunnei2023-06-031-1/+3
| | | | | | |
| * | | | | | android: config: Use default anisotropic filtering.bunnei2023-06-031-1/+4
| | | | | | |
| * | | | | | android: Remove top padding from in game menu itemsCharles Lombardo2023-06-031-20/+12
| | | | | | |
| * | | | | | android: Use different icons for mainline/eaCharles Lombardo2023-06-0310-5/+835
| | | | | | |
| * | | | | | android: Add early access upgrade fragmentCharles Lombardo2023-06-0313-2/+419
| | | | | | | | | | | | | | | | | | | | | | | | | | | | We now have a second build flavor that will determine whether the "Get Early Access" button appears.
| * | | | | | android: vulkan_device: Only compile OverrideBcnFormats when used.bunnei2023-06-031-0/+2
| | | | | | |
| * | | | | | android: remove spurious warnings about BCn formats when patched with adrenotoolsLiam2023-06-031-1/+27
| | | | | | |
| * | | | | | android: video_core: Disable some problematic things on GPU Normal.bunnei2023-06-033-0/+40
| | | | | | |
| * | | | | | android: settings: Use mailbox vsync by default.bunnei2023-06-032-2/+5
| | | | | | |
| * | | | | | android: video_core: Disable problematic compute shaders.bunnei2023-06-035-5/+17
| | | | | | | | | | | | | | | | | | | | | | | | | | | | - Fixes #104.
| * | | | | | android: Update progard to fix settings crashCharles Lombardo2023-06-031-0/+8
| | | | | | | | | | | | | | | | | | | | | | | | | | | | R8 full mode was removing important classes from Wini that would cause a crash on saving settings. This keeps the relevant classes and suppresses warnings about irrelevant ones.
| * | | | | | android: vulkan: Recreate surface after suspension & adapt to async. presentation.bunnei2023-06-038-26/+39
| | | | | | |
| * | | | | | android: Game data cacheCharles Lombardo2023-06-038-17/+63
| | | | | | |
| * | | | | | android: Update to Kotlin 1.8.21Charles Lombardo2023-06-031-1/+1
| | | | | | |
| * | | | | | android: Disable jetifierCharles Lombardo2023-06-031-2/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | We no longer depend on any legacy libraries that required this flag
| * | | | | | android: Update dependenciesCharles Lombardo2023-06-031-2/+2
| | | | | | |
| * | | | | | android: Migrate to AGP 8.0.1Charles Lombardo2023-06-034-6/+17
| | | | | | |
| * | | | | | android: Enable non-transitive R classesCharles Lombardo2023-06-034-5/+15
| | | | | | | | | | | | | | | | | | | | | | | | | | | | New default going forward for new android projects. Best to follow the new standard.
| * | | | | | android: config: Enable asynchronous presentation by default on Android.bunnei2023-06-032-0/+8
| | | | | | |
| * | | | | | video_core: Enable support_descriptor_aliasing on Turnip, disable storage atomic otherwise.bunnei2023-06-033-5/+16
| | | | | | |
| * | | | | | android: fix deadzone calculationgerman772023-06-031-4/+12
| | | | | | |
| * | | | | | android: Fix background color when starting emulationCharles Lombardo2023-06-031-0/+1
| | | | | | |
| * | | | | | android: Persistent scrollbars on home settings fragmentCharles Lombardo2023-06-032-5/+14
| | | | | | |
| * | | | | | android: Use short build hashCharles Lombardo2023-06-031-1/+1
| | | | | | |
| * | | | | | android: Use navigation bar shade viewCharles Lombardo2023-06-034-49/+54
| | | | | | |
| * | | | | | android: About fragmentCharles Lombardo2023-06-0310-3/+415
| | | | | | |
| * | | | | | android: Use x-axis animation for navigation railCharles Lombardo2023-06-033-3/+23
| | | | | | |
| * | | | | | android: Sort games alphabetically by defaultCharles Lombardo2023-06-031-2/+9
| | | | | | |
| * | | | | | android: New icons for navigation barCharles Lombardo2023-06-037-4/+47
| | | | | | |
| * | | | | | android: New icons for home settings fragmentCharles Lombardo2023-06-034-21/+11
| | | | | | |
| * | | | | | android: Add navigation railCharles Lombardo2023-06-0314-93/+208
| | | | | | |
| * | | | | | android: Search FragmentCharles Lombardo2023-06-0320-189/+551
| | | | | | |
| * | | | | | android: Fix potential zip traversal exploitCharles Lombardo2023-06-031-3/+9
| | | | | | |
| * | | | | | android: Add dedicated show overlay checkboxgerman772023-06-033-6/+30
| | | | | | |
| * | | | | | android: Add user directory shortcutCharles Lombardo2023-06-036-25/+140
| | | | | | |
| * | | | | | android: Fix inline keyboard inputgerman772023-06-031-5/+7
| | | | | | |
| * | | | | | android: Fix grammatical mistake in video core error messageCharles Lombardo2023-06-031-1/+1
| | | | | | |
| * | | | | | android: Adjust wording on GPU driver install buttonCharles Lombardo2023-06-031-1/+1
| | | | | | |
| * | | | | | android: Add deadzone to stick inputNarr the Reg2023-06-031-19/+45
| | | | | | |
| * | | | | | android: Move motion listener to emulation activitygerman772023-06-032-64/+71
| | | | | | |
| * | | | | | core: hid: Finish linking motion from virtual controllersNarr the Reg2023-06-035-9/+57
| | | | | | |
| * | | | | | android: Change wording for "Add Games" button (#100)Charles Lombardo2023-06-032-4/+6
| | | | | | | | | | | | | | | | | | | | | Co-authored-by: bunnei <bunneidev@gmail.com>
| * | | | | | android: Scroll shortcut for games listCharles Lombardo2023-06-033-1/+34
| | | | | | | | | | | | | | | | | | | | | | | | | | | | If you reselect the "Games" menu item in the bottom navigation menu, the list smoothly scrolls to the top.
| * | | | | | android: Setup screen hotfixCharles Lombardo2023-06-033-12/+32
| | | | | | | | | | | | | | | | | | | | | | | | | | | | Added help button link for add games warning and a check for whether a task was completed on a given screen.
| * | | | | | android: Swap Default and Install buttons for GPU driver installation dialogCharles Lombardo2023-06-031-2/+2
| | | | | | |
| * | | | | | android: Add warnings to setup screensCharles Lombardo2023-06-034-13/+149
| | | | | | |
| * | | | | | android: Allow search bar to scroll offscreenCharles Lombardo2023-06-033-15/+8
| | | | | | |
| * | | | | | android: Update app iconCharles Lombardo2023-06-032-34/+30
| | | | | | | | | | | | | | | | | | | | | | | | | | | | Small icon updates from Flam
| * | | | | | android: Change organization of the settings tab in the home screenCharles Lombardo2023-06-037-44/+44
| | | | | | |
| * | | | | | android: Properly pop setup fragment from the back stackCharles Lombardo2023-06-031-1/+3
| | | | | | |
| * | | | | | android: Vertically scalable setup pagesCharles Lombardo2023-06-032-23/+45
| | | | | | | | | | | | | | | | | | | | | | | | | | | | Previously the setup pages would remain at a fixed height but now the icon and two text boxes will give up space as a device gets shorter. This eliminates the need for a scrolling view further problems with padding.
| * | | | | | android: Fix setup rotation bugCharles Lombardo2023-06-032-4/+26
| | | | | | | | | | | | | | | | | | | | | | | | | | | | If you rotated the device at the "Add Games" screen the buttons would disappear until you trigged them from the beginning page swap. Now button state is saved across recreation.
| * | | | | | android: Temporarily switch for a fixed version code for testingCharles Lombardo2023-06-031-1/+1
| | | | | | |
| * | | | | | android: Fix alignment of SwipeRefreshLayoutCharles Lombardo2023-06-031-5/+9
| | | | | | |
| * | | | | | android: Shape/spacing adjustments to game cardCharles Lombardo2023-06-033-58/+64
| | | | | | | | | | | | | | | | | | | | | | | | | | | | Ripple effect now reaches into rounded corners, icon size changed, company text removed, title font adjusted, and spacing around the card was adjusted as well. Text also doesn't get cut off anymore and instead scrolls indefinitely on one line.
| * | | | | | android: Manual tweaks for dialog colorsCharles Lombardo2023-06-036-2/+21
| | | | | | | | | | | | | | | | | | | | | | | | | | | | Small fix for Flam
| * | | | | | android: Fix black backgrounds bugCharles Lombardo2023-06-031-6/+18
| | | | | | | | | | | | | | | | | | | | | | | | | | | | Start using a specific night mode check because black backgrounds could apply incorrectly when using the light app mode, dark system mode, and black backgrounds. Launching the settings activity will show light mode colors/navigation bars but with black backgrounds.
| * | | | | | android: Use navigation bar shade view for settings activityCharles Lombardo2023-06-032-3/+20
| | | | | | |
| * | | | | | android: Disable editing themes during emulationCharles Lombardo2023-06-031-3/+3
| | | | | | |
| * | | | | | android: Prevent situation where binding is called on a null viewCharles Lombardo2023-06-031-0/+3
| | | | | | |
| * | | | | | android: Add black backgrounds toggleCharles Lombardo2023-06-036-1/+42
| | | | | | |
| * | | | | | android: Add theme mode pickerCharles Lombardo2023-06-035-11/+76
| | | | | | |
| * | | | | | android: Add theme pickerCharles Lombardo2023-06-037-3/+127
| | | | | | |
| * | | | | | android: Prevent potential abstract settings crashCharles Lombardo2023-06-031-0/+4
| | | | | | |
| * | | | | | android: Fix cast for abstract settingsCharles Lombardo2023-06-034-5/+5
| | | | | | |
| * | | | | | android: Create xml for Material You themeCharles Lombardo2023-06-032-0/+58
| | | | | | |
| * | | | | | android: Remove check for API 29 in themesCharles Lombardo2023-06-032-15/+4
| | | | | | |
| * | | | | | android: Adjustments to home option cardCharles Lombardo2023-06-031-4/+10
| | | | | | | | | | | | | | | | | | | | | | | | | | | | Several spacing/color adjustments provided by Flam
| * | | | | | android: Use different colors for logo in options menuCharles Lombardo2023-06-032-3/+3
| | | | | | | | | | | | | | | | | | | | | | | | | | | | Reverting to the official logo colors
| * | | | | | android: New default theme colorsCharles Lombardo2023-06-032-30/+34
| | | | | | |
| * | | | | | android: Use libnx default iconCharles Lombardo2023-06-034-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | Credit to jaames for the original icon
| * | | | | | android: enable LTOLiam2023-06-031-1/+2
| | | | | | |
| * | | | | | android: Show error if invalid keys file is selectedCharles Lombardo2023-06-032-0/+23
| | | | | | | | | | | | | | | | | | | | | | | | | | | | There aren't MIME types specific enough for filtering out files that aren't amiibo or production keys. So here we just check for the extensions "bin" or "keys" where appropriate and stop the process if incorrect. Previously you could select any document and it could cause the app to hang.
| * | | | | | android: Fix first time setup scrolling bugCharles Lombardo2023-06-032-18/+17
| | | | | | | | | | | | | | | | | | | | | | | | | | | | If you quickly scrolled from the second page to the first and then back, the next/back buttons would disappear.
| * | | | | | android: Fix A button preference keyCharles Lombardo2023-06-031-1/+1
| | | | | | |
| * | | | | | android: First time setup screenCharles Lombardo2023-06-0319-163/+769
| | | | | | |
| * | | | | | android: Prevent editing unsafe settings at runtimeCharles Lombardo2023-06-035-14/+35
| | | | | | | | | | | | | | | | | | | | | | | | | | | | There currently isn't a visual "disabled" cue for any of the view holders that aren't the switch setting. This will be improved in the future.
| * | | | | | android: Abstract settingsCharles Lombardo2023-06-0324-363/+418
| | | | | | | | | | | | | | | | | | | | | | | | | | | | Previously we could only add settings that would change our ini file. Now we can create abstract settings in our presenter to alter things like shared preferences for theme support!
| * | | | | | android: Implement gamepad inputgerman772023-06-036-11/+510
| | | | | | |
| * | | | | | android: Bump minimum version to Android 11Charles Lombardo2023-06-031-1/+1
| | | | | | |
| * | | | | | android: Decouple status bar shade from navigation bar visibilityCharles Lombardo2023-06-033-14/+34
| | | | | | |
| * | | | | | android: Enable code minificationCharles Lombardo2023-06-035-22/+18
| | | | | | |
| * | | | | | android: Switch from a colored status bar to a custom viewCharles Lombardo2023-06-034-23/+35
| | | | | | | | | | | | | | | | | | | | | | | | | | | | Allows for smoother transitions with the search bar
| * | | | | | android: Adjustments to card_gameCharles Lombardo2023-06-031-20/+5
| | | | | | | | | | | | | | | | | | | | | | | | | | | | Removed a currently unused text view and moved to material text views.
| * | | | | | android: MainActivity overhaulCharles Lombardo2023-06-0332-626/+1031
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This moves several parts of the main activity into fragments that manage themselves to react to changes. UI changes like the appearance of a new search view or when the games list changes now gets updated via multiple view models. This also starts a conversion to the androidx navigation component which furthers the goals mentioned previously with more fragment responsibility. This will eventually allow us to use one activity with interchanging fragments and multiple view models that are stored within that central activity. fdas
| * | | | | | android: Enforce Vulkan 1.1 support as minimumCharles Lombardo2023-06-031-3/+4
| | | | | | |
| * | | | | | android: Update gradle version to 8.1Charles Lombardo2023-06-031-1/+1
| | | | | | |
| * | | | | | android: Update app dependenciesCharles Lombardo2023-06-031-5/+5
| | | | | | |
| * | | | | | android: Convert gradle scripts to Kotlin DSLCharles Lombardo2023-06-035-201/+241
| | | | | | |
| * | | | | | android: vulkan: Disable vertex_input_dynamic_state on Qualcomm.bunnei2023-06-031-1/+2
| | | | | | |
| * | | | | | android: settings: Add scaling filter & anti-aliasing options. (#66)bunnei2023-06-034-0/+75
| | | | | | |
| * | | | | | android: video_core: Add support for disk shader cache. (#64)bunnei2023-06-0312-4/+258
| | | | | | |
| * | | | | | android: vulkan_debug_callback: Ignore many innocuous errors.bunnei2023-06-031-0/+28
| | | | | | |
| * | | | | | android: config: Change docked mode and GPU accuracy to favor performance on Android.bunnei2023-06-033-7/+11
| | | | | | |
| * | | | | | service: account: Save user profile folder on first user creationgerman772023-06-031-0/+1
| | | | | | |
| * | | | | | android: Initialize account managergerman772023-06-031-0/+5
| | | | | | |
| * | | | | | android: Remove unsafe null checkgerman772023-06-031-4/+2
| | | | | | |
| * | | | | | android: Scale input overlay independently of system display scaleCharles Lombardo2023-06-032-30/+41
| | | | | | |
| * | | | | | android: Use apply instead of commit for shared preferencesCharles Lombardo2023-06-033-4/+3
| | | | | | | | | | | | | | | | | | | | | | | | | | | | Previously we were operating on the assumption that apply'd settings wouldn't be visible immediately. This isn't true and settings will be accessible via memory before being stored to disk. This reduces any potential stutters caused by saving to shared preferences.
| * | | | | | android: Add DPad slide toggleCharles Lombardo2023-06-035-2/+14
| | | | | | |
| * | | | | | android: Add relative stick center toggleCharles Lombardo2023-06-033-0/+13
| | | | | | |
| * | | | | | android: Make hash and branch accessible from BuildConfigCharles Lombardo2023-06-031-0/+25
| | | | | | |
| * | | | | | android: Backup shared preferences where applicableCharles Lombardo2023-06-032-0/+12
| | | | | | |
| * | | | | | android: Enable retaining app data after uninstallCharles Lombardo2023-06-031-1/+2
| | | | | | |
| * | | | | | android: Remove unused doFrame functionCharles Lombardo2023-06-031-2/+0
| | | | | | |
| * | | | | | android: Convert NativeLibrary to KotlinCharles Lombardo2023-06-0315-766/+523
| | | | | | |
| * | | | | | android: Remove LocalBroadcastManagerCharles Lombardo2023-06-0311-225/+17
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This causes a couple of minor changes to directory initialization. We don't have a lengthy initialization step so we could spend less time creating state receivers and just run initialization on the main thread. We also don't have a situation where external storage will be a concern so checks are removed in favor of a binary check to see if initialization is ready. This additionally removes the unused DoFrame callback.
| * | | | | | android: Remove game databaseCharles Lombardo2023-06-0318-773/+154
| | | | | | | | | | | | | | | | | | | | | | | | | | | | The content provider + database solution was excessive and is now replaced with the simple file checks from before but turned into an array list held within a viewmodel.
| * | | | | | android: Adjust game icon loadingCharles Lombardo2023-06-031-15/+9
| | | | | | |
| * | | | | | android: Remove unused dimensions filesCharles Lombardo2023-06-032-9/+0
| | | | | | |
| * | | | | | android: Slightly reduce game card sizeCharles Lombardo2023-06-032-3/+3
| | | | | | |
| * | | | | | android: Only show company text view if it has contentCharles Lombardo2023-06-031-5/+8
| | | | | | |
| * | | | | | android: Fix check for ok text in software keyboardCharles Lombardo2023-06-031-1/+1
| | | | | | |
| * | | | | | android: Implement amiibo reading from nfc tagNarr the Reg2023-06-0315-8/+327
| | | | | | |
| * | | | | | android: vulkan_device: Disable VK_EXT_custom_border_color on Adreno.bunnei2023-06-031-0/+7
| | | | | | | | | | | | | | | | | | | | | | | | | | | | - Causes crashes on sampler creation with Super Mario Odyssey.
| * | | | | | android: Add toggle controls option to input overlayCharles Lombardo2023-06-035-6/+62
| | | | | | |
| * | | | | | android: Do not update FPS text on null viewCharles Lombardo2023-06-031-1/+1
| | | | | | |
| * | | | | | android: Convert keyboard applet to kotlin and refactorCharles Lombardo2023-06-036-279/+255
| | | | | | |
| * | | | | | android: Implement basic software keyboard applet.bunnei2023-06-0312-152/+625
| | | | | | |
| * | | | | | android: config: Disable shader cache by default on Android.bunnei2023-06-031-0/+4
| | | | | | |
| * | | | | | android: Fix fps counter not showing upgerman772023-06-034-11/+13
| | | | | | |
| * | | | | | android: Prevent showing games on an invalid viewCharles Lombardo2023-06-031-0/+3
| | | | | | |
| * | | | | | android: Re-implement overlay editingCharles Lombardo2023-06-035-25/+245
| | | | | | |
| * | | | | | android: Fix popup menu going out of boundsCharles Lombardo2023-06-032-20/+11
| | | | | | |
| * | | | | | android: Use autofit grid for games fragmentCharles Lombardo2023-06-033-28/+72
| | | | | | |
| * | | | | | android: Prevent updating empty game list text on invalid viewCharles Lombardo2023-06-031-0/+3
| | | | | | |
| * | | | | | android: Persist settings across configuration changesCharles Lombardo2023-06-039-93/+51
| | | | | | | | | | | | | | | | | | | | | | | | | | | | Mostly things get refactored here to remove previous assumptions made about how the activity/fragment lifecycles would operate. The important change for persistence is removing the assumption that the user will be at the first settings fragment on recreation when deciding whether or not to reload settings. Now we check a flag in Settings to know if we loaded the settings within this lifecycle.
| * | | | | | android: Store settings object in viewmodelCharles Lombardo2023-06-037-57/+45
| | | | | | |
| * | | | | | android: Remove configChanges exceptionsCharles Lombardo2023-06-031-1/+0
| | | | | | |
| * | | | | | Android: Enable resizeable activitiesCharles Lombardo2023-06-031-6/+2
| | | | | | |
| * | | | | | android: Fix emulation fragment commentsCharles Lombardo2023-06-031-2/+2
| | | | | | |
| * | | | | | android: Use modal navigation drawer as in game menuCharles Lombardo2023-06-0317-373/+343
| | | | | | |
| * | | | | | android: Make Game class parcelableCharles Lombardo2023-06-031-1/+4
| | | | | | |
| * | | | | | android: Add kotlin parcelize pluginCharles Lombardo2023-06-031-0/+1
| | | | | | |
| * | | | | | android: Remove deprecated use of onActivityResultCharles Lombardo2023-06-032-139/+107
| | | | | | |
| * | | | | | android: Fix RTL layoutsCharles Lombardo2023-06-033-1/+6
| | | | | | |
| * | | | | | android: Use ellipsis characterCharles Lombardo2023-06-031-1/+1
| | | | | | |
| * | | | | | android: Move all array strings to main strings fileCharles Lombardo2023-06-032-48/+109
| | | | | | |
| * | | | | | android: Remove unused stringsCharles Lombardo2023-06-031-9/+0
| | | | | | |
| * | | | | | android: Remove unused colorsCharles Lombardo2023-06-032-6/+0
| | | | | | |
| * | | | | | android: Remove citra date time pickerCharles Lombardo2023-06-031-22/+0
| | | | | | |
| * | | | | | android: Remove unused premium header layoutCharles Lombardo2023-06-031-42/+0
| | | | | | |
| * | | | | | android: Remove unused fragment animationsCharles Lombardo2023-06-032-41/+0
| | | | | | |
| * | | | | | android: Remove unused string arraysCharles Lombardo2023-06-031-34/+0
| | | | | | |
| * | | | | | android: Remove unused integer xmlsCharles Lombardo2023-06-034-13/+0
| | | | | | |
| * | | | | | android: Refactor ic_launcher.xml to drawablesCharles Lombardo2023-06-033-3/+3
| | | | | | |
| * | | | | | android: Suppress lint in InsetsHelperCharles Lombardo2023-06-031-0/+2
| | | | | | |
| * | | | | | android: Add data extraction rulesCharles Lombardo2023-06-033-2/+56
| | | | | | |
| * | | | | | android: Remove requestLegacyExternalStorage attributeCharles Lombardo2023-06-031-3/+1
| | | | | | |
| * | | | | | android: Remove unused permissionsCharles Lombardo2023-06-031-3/+0
| | | | | | |
| * | | | | | android: Inset input overlay based on system cutoutsCharles Lombardo2023-06-035-59/+94
| | | | | | |
| * | | | | | Use yuzu as category instead of citraNarr the Reg2023-06-031-1/+1
| | | | | | |
| * | | | | | android: Stop updating fps counter when emulation stopsCharles Lombardo2023-06-031-1/+4
| | | | | | |
| * | | | | | android: Move driver installation off of main threadCharles Lombardo2023-06-034-21/+42
| | | | | | | | | | | | | | | | | | | | | | | | | | | | Additionally creates an indeterminate loading dialog during installation
| * | | | | | android: Fix crash when decodeGameIcon creates a null BitmapCharles Lombardo2023-06-031-1/+1
| | | | | | |
| * | | | | | android: Use view bindingCharles Lombardo2023-06-0316-284/+189
| | | | | | |
| * | | | | | android: Enable view bindingCharles Lombardo2023-06-031-0/+2
| | | | | | |
| * | | | | | android: Refactor CheckBoxSetting to SwitchSettingCharles Lombardo2023-06-035-14/+14
| | | | | | |
| * | | | | | android: EmulationActivity: Fix variable shadowing in fragment creation.bunnei2023-06-031-2/+2
| | | | | | |
| * | | | | | android: res: fragment_emulation: Ensure FPS counter is shown.bunnei2023-06-031-7/+7
| | | | | | |
| * | | | | | common: link libandroid on androidLiam2023-06-031-0/+5
| | | | | | |
| * | | | | | build: only enable adrenotools on arm64Liam2023-06-037-10/+18
| | | | | | |
| * | | | | | android: Use Skyline's document providerCharles Lombardo2023-06-033-4/+319
| | | | | | |
| * | | | | | android: Use androidx splash screenCharles Lombardo2023-06-034-2/+12
| | | | | | |
| * | | | | | android: Replace Picasso with CoilCharles Lombardo2023-06-037-138/+41
| | | | | | |
| * | | | | | android: New swipe to refresh color schemeCharles Lombardo2023-06-031-1/+9
| | | | | | |
| * | | | | | android: New settings fragment animationsCharles Lombardo2023-06-0312-163/+80
| | | | | | |
| * | | | | | android: Use edge to edgeCharles Lombardo2023-06-039-21/+110
| | | | | | |
| * | | | | | android: Use Material 3 componentsCharles Lombardo2023-06-0323-174/+268
| | | | | | |
| * | | | | | android: Modernize theme systemCharles Lombardo2023-06-038-94/+130
| | | | | | |
| * | | | | | android: Use vector iconsCharles Lombardo2023-06-0342-9/+27
| | | | | | |
| * | | | | | android: Use adaptive iconCharles Lombardo2023-06-0313-3/+24
| | | | | | |
| * | | | | | android: settings: Dynamically evaluate valueAsStringbunnei2023-06-034-4/+4
| | | | | | | | | | | | | | | | | | | | | | | | | | | | Co-Authored-By: bunnei <bunneidev@gmail.com>
| * | | | | | android: Add license identifierCharles Lombardo2023-06-0366-5/+199
| | | | | | |
| * | | | | | android: Convert YuzuApplication to KotlinCharles Lombardo2023-06-032-59/+56
| | | | | | |
| * | | | | | android: Convert Action1 to KotlinCharles Lombardo2023-06-032-5/+5
| | | | | | |
| * | | | | | android: Convert GameViewHolder to KotlinCharles Lombardo2023-06-032-44/+32
| | | | | | |
| * | | | | | android: Remove ThemeUtilCharles Lombardo2023-06-031-34/+0
| | | | | | |
| * | | | | | android: Convert StartupHandler to KotlinCharles Lombardo2023-06-032-45/+45
| | | | | | |
| * | | | | | android: Convert Log to KotlinCharles Lombardo2023-06-032-39/+42
| | | | | | |
| * | | | | | android: Convert GpuDriverMetadata to KotlinCharles Lombardo2023-06-032-45/+44
| | | | | | |
| * | | | | | android: Convert GpuDriverHelper to KotlinCharles Lombardo2023-06-032-130/+145
| | | | | | |
| * | | | | | android: Convert GameIconRequestHandler to KotlinCharles Lombardo2023-06-032-29/+22
| | | | | | |
| * | | | | | android: Convert ForegroundService to KotlinCharles Lombardo2023-06-032-63/+56
| | | | | | |
| * | | | | | android: Convert FileUtil to KotlinCharles Lombardo2023-06-032-296/+292
| | | | | | |
| * | | | | | android: Convert FileBrowserHelper to KotlinCharles Lombardo2023-06-032-25/+26
| | | | | | |
| * | | | | | android: Convert EmulationMenuSettings to KotlinCharles Lombardo2023-06-032-78/+59
| | | | | | |
| * | | | | | android: Convert DocumentsTree to KotlinCharles Lombardo2023-06-032-125/+110
| | | | | | |
| * | | | | | android: Convert DirectoryStateReceiver to KotlinCharles Lombardo2023-06-032-22/+15
| | | | | | |
| * | | | | | android: Convert DirectoryInitialization to KotlinCharles Lombardo2023-06-032-72/+66
| | | | | | |
| * | | | | | android: Convert ControllerMappingHelper to KotlinCharles Lombardo2023-06-031-25/+24
| | | | | | |
| * | | | | | android: Convert BiMap to KotlinCharles Lombardo2023-06-032-22/+22
| | | | | | |
| * | | | | | android: Convert AddDirectoryHelper to KotlinCharles Lombardo2023-06-032-38/+27
| | | | | | |
| * | | | | | android: Convert PlatformGamesView to KotlinCharles Lombardo2023-06-031-6/+6
| | | | | | |
| * | | | | | android: Convert PlatformGamesPresenter to KotlinCharles Lombardo2023-06-032-42/+30
| | | | | | |
| * | | | | | android: Convert PlatformGamesFragment to KotlinCharles Lombardo2023-06-032-105/+94
| | | | | | |
| * | | | | | android: Convert MainView to KotlinCharles Lombardo2023-06-031-8/+6
| | | | | | |
| * | | | | | android: Convert MainPresenter to KotlinCharles Lombardo2023-06-032-81/+66
| | | | | | |
| * | | | | | android: Convert InputOverlayDrawableJoystick to KotlinCharles Lombardo2023-06-032-243/+205
| | | | | | |
| * | | | | | android: Convert MainActivity to KotlinCharles Lombardo2023-06-033-250/+229
| | | | | | |
| * | | | | | android: Remove ExampleInstrumentedTestCharles Lombardo2023-06-031-3/+0
| | | | | | |
| * | | | | | android: Remove TwoPaneOnBackPressedCallbackCharles Lombardo2023-06-031-37/+0
| | | | | | | | | | | | | | | | | | | | | | | | | | | | Leftover UI code for dolphin's cheat system. Removing for now.
| * | | | | | android: Convert InputOverlayDrawableDpad to KotlinCharles Lombardo2023-06-032-276/+232
| | | | | | |
| * | | | | | android: Convert InputOverlayDrawableButton to KotlinCharles Lombardo2023-06-032-139/+118
| | | | | | |
| * | | | | | android: Convert InputOverlay to KotlinCharles Lombardo2023-06-032-656/+886
| | | | | | |
| * | | | | | android: Remove DividerItemDecorationCharles Lombardo2023-06-031-130/+0
| | | | | | | | | | | | | | | | | | | | | | | | | | | | Removed in favor of material components version
| * | | | | | android: Inherit from Material 3 themesCharles Lombardo2023-06-031-8/+4
| | | | | | | | | | | | | | | | | | | | | | | | | | | | Partially breaks the UI for now but is necessary to use new material components.
| * | | | | | android: Convert MinimalDocumentFile to KotlinCharles Lombardo2023-06-032-28/+8
| | | | | | |
| * | | | | | android: Convert GameProvider to KotlinCharles Lombardo2023-06-032-138/+127
| | | | | | |
| * | | | | | android: Convert GameDatabase to KotlinCharles Lombardo2023-06-032-275/+260
| | | | | | |
| * | | | | | android: Convert Game to KotlinCharles Lombardo2023-06-032-76/+56
| | | | | | |
| * | | | | | android: Convert EmulationFragment to KotlinCharles Lombardo2023-06-032-375/+348
| | | | | | |
| * | | | | | android: Convert SettingsFile to KotlinCharles Lombardo2023-06-032-272/+245
| | | | | | |
| * | | | | | android: Convert SettingsFrameLayout to KotlinCharles Lombardo2023-06-032-48/+43
| | | | | | |
| * | | | | | android: Convert SettingsFragmentView to KotlinCharles Lombardo2023-06-031-18/+15
| | | | | | |
| * | | | | | android: Convert SettingsFragmentPresenter to KotlinCharles Lombardo2023-06-032-184/+333
| | | | | | |
| * | | | | | android: Convert SettingsFragment to KotlinCharles Lombardo2023-06-032-136/+120
| | | | | | |
| * | | | | | android: Convert SettingsActivityView to KotlinCharles Lombardo2023-06-031-27/+20
| | | | | | |
| * | | | | | android: Convert SettingsActivityPresenter to KotlinCharles Lombardo2023-06-032-122/+99
| | | | | | |
| * | | | | | android: Convert SettingsActivity to KotlinCharles Lombardo2023-06-032-209/+186
| | | | | | |
| * | | | | | android: Convert SubmenuViewHolder to KotlinCharles Lombardo2023-06-032-45/+35
| | | | | | |
| * | | | | | android: Convert SliderViewHolder to KotlinCharles Lombardo2023-06-032-45/+34
| | | | | | |
| * | | | | | android: Convert SingleChoiceViewHolder to KotlinCharles Lombardo2023-06-032-62/+54
| | | | | | |
| * | | | | | android: Convert SettingViewHolder to KotlinCharles Lombardo2023-06-032-49/+38
| | | | | | |
| * | | | | | android: Convert HeaderViewHolder to KotlinCharles Lombardo2023-06-032-32/+28
| | | | | | |
| * | | | | | android: Convert DateTimeViewHolder to KotlinCharles Lombardo2023-06-032-47/+35
| | | | | | |
| * | | | | | android: Convert CheckBoxSettingViewHolder to KotlinCharles Lombardo2023-06-032-54/+41
| | | | | | |
| * | | | | | android: Convert StringSetting to KotlinCharles Lombardo2023-06-032-23/+9
| | | | | | |
| * | | | | | android: Convert SettingSection to KotlinCharles Lombardo2023-06-032-55/+34
| | | | | | |
| * | | | | | android: Convert Setting to KotlinCharles Lombardo2023-06-031-24/+6
| | | | | | |
| * | | | | | android: Convert IntSetting to KotlinCharles Lombardo2023-06-032-23/+9
| | | | | | |
| * | | | | | android: Convert FloatSetting to KotlinCharles Lombardo2023-06-032-23/+9
| | | | | | |
| * | | | | | android: Convert BooleanSetting to KotlinCharles Lombardo2023-06-032-23/+9
| | | | | | |
| * | | | | | android: Convert SubmenuSetting to KotlinCharles Lombardo2023-06-032-21/+15
| | | | | | |
| * | | | | | android: Convert StringSingleChoiceSetting to KotlinCharles Lombardo2023-06-032-82/+61
| | | | | | |
| * | | | | | android: Convert SliderSetting to KotlinCharles Lombardo2023-06-032-101/+72
| | | | | | |
| * | | | | | android: Convert SingleChoiceSetting to KotlinCharles Lombardo2023-06-032-60/+44
| | | | | | |
| * | | | | | android: Convert SettingsItem to KotlinCharles Lombardo2023-06-032-100/+30
| | | | | | |
| * | | | | | android: Convert HeaderSetting to KotlinCharles Lombardo2023-06-032-14/+12
| | | | | | |
| * | | | | | android: Convert DateTimeSetting to KotlinCharles Lombardo2023-06-032-40/+35
| | | | | | |
| * | | | | | android: Convert CheckBoxSetting to KotlinCharles Lombardo2023-06-032-80/+91
| | | | | | |
| * | | | | | android: Convert GameAdapter to KotlinCharles Lombardo2023-06-032-244/+178
| | | | | | |
| * | | | | | android: Convert SettingsAdapter to KotlinCharles Lombardo2023-06-033-366/+315
| | | | | | | | | | | | | | | | | | | | | | | | | | | | Update SettingsAdapter.kt
| * | | | | | android: Convert EmulationActivity to KotlinCharles Lombardo2023-06-032-347/+286
| | | | | | |
| * | | | | | android: Use material slider in settings dialogCharles Lombardo2023-06-031-20/+20
| | | | | | |
| * | | | | | android: Convert Settings to KotlinCharles Lombardo2023-06-032-127/+145
| | | | | | |
| * | | | | | android: Use androidx preferencesCharles Lombardo2023-06-031-0/+2
| | | | | | |
| * | | | | | android: frontend: Add unique error strings for Vulkan initialization errors.bunnei2023-06-032-19/+25
| | | | | | |
| * | | | | | android: Use the center of the object and reduce draw callsgerman772023-06-038-59/+76
| | | | | | |
| * | | | | | android: Replace old buttons with vectorsgerman772023-06-03149-71/+613
| | | | | | |
| * | | | | | android: Enable Kotlin supportCharles Lombardo2023-06-034-26/+30
| | | | | | |
| * | | | | | android: Upgrade java version to 11Charles Lombardo2023-06-031-2/+2
| | | | | | |
| * | | | | | android: Upgrade dependenciesCharles Lombardo2023-06-031-4/+4
| | | | | | |
| * | | | | | android: Upgrade to AGP 7.4.2Charles Lombardo2023-06-031-1/+1
| | | | | | |
| * | | | | | android: Replace lintOptions with lintCharles Lombardo2023-06-031-1/+1
| | | | | | |
| * | | | | | android: Move namespace to app module build.gradleCharles Lombardo2023-06-032-2/+3
| | | | | | |
| * | | | | | android: bump compile/target sdk to 33Charles Lombardo2023-06-031-2/+2
| | | | | | |
| * | | | | | android: Upgrade gradle to 8.0.1Charles Lombardo2023-06-031-1/+1
| | | | | | |
| * | | | | | video_core: fix clang-format errorsliushuyu2023-06-032-4/+3
| | | | | | |
| * | | | | | CMake: fix pkg-config behavior when building for Androidliushuyu2023-06-031-0/+1
| | | | | | |
| * | | | | | CI: add Android build systemsliushuyu2023-06-031-0/+0
| | | | | | |
| * | | | | | android: build.gradle: Cleanup build types.bunnei2023-06-031-7/+1
| | | | | | |
| * | | | | | android: frontend: settings: Add graphics debugging.bunnei2023-06-034-6/+18
| | | | | | |
| * | | | | | android: jni: Ensure system is only initialized once.bunnei2023-06-034-8/+8
| | | | | | | | | | | | | | | | | | | | | | | | | | | | - Fixes likelihood that fastmem allocation succeeds.
| * | | | | | video_core: vulkan_device: Correct error message for unsuitable driver.bunnei2023-06-031-1/+1
| | | | | | |
| * | | | | | android: frontend: Cleanup framerate counter.bunnei2023-06-032-4/+3
| | | | | | |
| * | | | | | android: vulkan: Implement adrenotools turbo mode.bunnei2023-06-037-3/+27
| | | | | | |
| * | | | | | android: vulkan_device: Disable VK_EXT_extended_dynamic_state2 on Qualcomm.bunnei2023-06-031-3/+3
| | | | | | | | | | | | | | | | | | | | | | | | | | | | - Newer drivers report this as supported, but it is broken.
| * | | | | | android: frontend: Add support for GPU driver selection.bunnei2023-06-039-3/+251
| | | | | | |
| * | | | | | android: native: Add support for custom Vulkan driver loading.bunnei2023-06-0314-76/+146
| | | | | | |
| * | | | | | core: frontend: Refactor GraphicsContext to its own module.bunnei2023-06-0313-50/+84
| | | | | | |
| * | | | | | common: dynamic_library: Add ctor for existing handle.bunnei2023-06-032-0/+5
| | | | | | |
| * | | | | | android: EmulationFragment: Always reset overlay.bunnei2023-06-031-1/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | - Ensures correct placement until we have better overlay configuration.
| * | | | | | Avoid using VectorExtractDynamic for subgroup mask on Adreno GPUsBilly Laws2023-06-033-1/+19
| | | | | | | | | | | | | | | | | | | | | | | | | | | | This crashes their shader compiler for some reason.
| * | | | | | Implement scaled vertex buffer format emulationBilly Laws2023-06-039-51/+97
| | | | | | | | | | | | | | | | | | | | | | | | | | | | These formats are unsupported by mobile GPUs so they need to be emulated in shaders instead.
| * | | | | | Disable push descriptors on adreno driversBilly Laws2023-06-031-0/+4
| | | | | | | | | | | | | | | | | | | | | | | | | | | | Regular descriptors are around 1.5x faster to update.
| * | | | | | Disable VK_EXT_extended_dynamic_state on maliBilly Laws2023-06-031-0/+7
| | | | | | |
| * | | | | | Disable multithreaded pipeline compilation on Qualcomm driversBilly Laws2023-06-031-1/+4
| | | | | | | | | | | | | | | | | | | | | | | | | | | | This causes crashes during compilation on several 6xx and 5xx driver versions.
| * | | | | | android: Add motion sensorNarr the Reg2023-06-034-21/+92
| | | | | | |
| * | | | | | android: Hook jni input properlyNarr the Reg2023-06-035-90/+104
| | | | | | |
| * | | | | | android: cleanup touch update loopNarr the Reg2023-06-031-28/+50
| | | | | | |
| * | | | | | android: Clean joystick overlayNarr the Reg2023-06-033-135/+131
| | | | | | |
| * | | | | | android: Clean dpad overlayNarr the Reg2023-06-032-192/+174
| | | | | | |
| * | | | | | android: Clean button overlayNarr the Reg2023-06-032-195/+65
| | | | | | |
| * | | | | | android: Add all buttons to screen controllerNarr the Reg2023-06-034-209/+104
| | | | | | |
| * | | | | | android: Apply clang formatNarr the Reg2023-06-032-9/+9
| | | | | | |
| * | | | | | android: frontend: Implement game grid view. (#9)bunnei2023-06-0315-174/+272
| | | | | | |
| * | | | | | android: Replace notification icon with yuzugerman772023-06-033-0/+0
| | | | | | |
| * | | | | | android: strings: Refresh key dumping URL.bunnei2023-06-031-1/+1
| | | | | | |
| * | | | | | android: frontend: Modify ROM load messaging for invalid keys.bunnei2023-06-032-7/+11
| | | | | | |
| * | | | | | android: frontend: Integrate key installation for SAF.bunnei2023-06-0320-21/+102
| | | | | | |
| * | | | | | android: jni: Add function to reload keys.bunnei2023-06-033-2/+14
| | | | | | |
| * | | | | | core: crypto: key_manager: Add methods to reload & validate keys.bunnei2023-06-032-0/+11
| | | | | | |
| * | | | | | android: EmulationActivity: Temporarily disable running notification.bunnei2023-06-032-7/+12
| | | | | | |
| * | | | | | android: Implement SAF support & migrate to SDK 31. (#4)bunnei2023-06-0338-697/+851
| | | | | | |
| * | | | | | android: Harden emulation shutdown when loader fails.bunnei2023-06-031-6/+12
| | | | | | |
| * | | | | | android: SettingsFragmentPresenter: Fix default renderer backend.bunnei2023-06-031-1/+1
| | | | | | |
| * | | | | | android: jni: native: Add lock around HaltEmulation, tighten run loop.bunnei2023-06-031-1/+3
| | | | | | |
| * | | | | | android: jni: native: Refactor locking for is_running.bunnei2023-06-031-8/+21
| | | | | | |
| * | | | | | android: jni: native: Remove unnecessary atomic for is_running.bunnei2023-06-031-6/+5
| | | | | | |
| * | | | | | android: jni: native: Tighten up emulation start/stop signaling.bunnei2023-06-031-58/+64
| | | | | | |
| * | | | | | android: jni: native: Consolidate emulation state into EmulationSession singleton.bunnei2023-06-031-67/+164
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | - Fixes state management issues across multiple boots. - Fixes crashes related to unsafe access of perf stats.
| * | | | | | android: Frontend: Fix rendering aspect ratio & add a setting for it.bunnei2023-06-037-2/+25
| | | | | | |
| * | | | | | android: Integrate settings frontend with yuzu & remove unused code.bunnei2023-06-0325-1759/+949
| | | | | | |
| * | | | | | externals: add adrenotools for bcenablerLiam2023-06-032-0/+34
| | | | | | |
| * | | | | | device_memory: Use smaller virtual reservation size for compatibility with 39-bit pagingLiam2023-06-032-1/+12
| | | | | | |
| * | | | | | video_core: vulkan_device: Device initialization for Adreno.bunnei2023-06-031-3/+4
| | | | | | |
| * | | | | | video_core: vk_pipeline_cache: Disable support_descriptor_aliasing on Android.bunnei2023-06-031-0/+4
| | | | | | |
| * | | | | | video_core: vk_swapchain: Fix image format for Android.bunnei2023-06-032-0/+10
| | | | | | |
| * | | | | | android: Minimize frontend & convert to yuzu.bunnei2023-06-03128-2509/+934
| | | | | | |
| * | | | | | video_core: vk_blit_screen: Rotate viewport for Android landscape.bunnei2023-06-031-0/+8
| | | | | | |
| * | | | | | common: error: Fix for Android.bunnei2023-06-031-1/+2
| | | | | | |
| * | | | | | common: fs: Implement for Android.bunnei2023-06-031-0/+7
| | | | | | |
| * | | | | | common: logging: Implement Android logcat backend.bunnei2023-06-033-0/+63
| | | | | | |
| * | | | | | common: host_memory: Implement for Android.bunnei2023-06-031-2/+10
| | | | | | |
| * | | | | | android: Minimal JNI for yuzu.bunnei2023-06-038-0/+645
| | | | | | |
| * | | | | | android: Add Citra frontend.bunnei2023-06-03319-0/+13799
| | | | | | |
| * | | | | | cmake: Integrate bundled FFmpeg for Android.bunnei2023-06-031-1/+1
| |/ / / / /
* | | | | | Merge pull request #10611 from liamwhite/audio-deadlockbunnei2023-06-064-10/+12
|\ \ \ \ \ \ | |_|_|_|/ / |/| | | | | audio_renderer: resolve adsp thread deadlock shutdown
| * | | | | audio_renderer: resolve adsp thread deadlock shutdownLiam2023-06-044-10/+12
| | |_|/ / | |/| | |
* | | | | Merge pull request #10594 from liamwhite/double-patchbunnei2023-06-041-8/+12
|\ \ \ \ \ | |/ / / / |/| | | | fsp-srv: avoid patching romfs multiple times
| * | | | fsp-srv: avoid patching romfs multiple timesLiam2023-06-031-8/+12
| |/ / /
* | | | Merge pull request #10588 from liamwhite/vfs-cachedbunnei2023-06-047-26/+101
|\ \ \ \ | | | | | | | | | | vfs: add vfs_cached for romfs build
| * | | | romfs: use vfs_cached for romfs outputLiam2023-06-033-24/+2
| | | | |
| * | | | vfs: add vfs_cached for romfs buildLiam2023-06-034-2/+99
| |/ / /
* / / / host_memory: merge adjacent placeholder mappings on Linuxkkoniuszy2023-06-011-0/+22
|/ / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Track the private anonymous placeholder mappings created by Unmap() and wherever possible, replace existing placeholders with larger ones instead of creating many small ones. This helps with the buildup of mappings in /proc/YUZU_PID/maps after a longer gaming session, improving stability without having to increase vm.max_map_count to a ridiculous value. The amount of placeholder mappings will no longer outgrow the amount of actual memfd mappings in cases of high memory fragmentation.
* | | Merge pull request #10091 from Kelebek1/bc_buggggggliamwhite2023-06-011-3/+3
|\ \ \ | | | | | | | | Fix buffer overlap checking skipping a page for stream score right expand
| * | | Fix buffer overlap checking skipping a page for stream score right expandKelebek12023-05-261-3/+3
| | | |
* | | | Merge pull request #10530 from Kelebek1/syncpt_oobliamwhite2023-06-011-1/+1
|\ \ \ \ | | | | | | | | | | Fix incorrect syncpt id bounds check and potential out of bounds lookup
| * | | | Fix incorrect id check and potential out of bounds lookupKelebek12023-05-311-1/+1
| | | | |
* | | | | Merge pull request #10474 from GPUCode/you-left-me-waitingliamwhite2023-06-011-7/+4
|\ \ \ \ \ | | | | | | | | | | | | Remove timeline semaphore wait
| * | | | | renderer_vulkan: Remove timeline semaphore waitGPUCode2023-05-281-7/+4
| | |/ / / | |/| | |
* | | | | Merge pull request #10352 from grimkor/add-context-menu-status-bar-settingsliamwhite2023-06-013-71/+152
|\ \ \ \ \ | | | | | | | | | | | | add context menu for status bar settings
| * | | | | add context menu for filter and anti-aliasing status buttonsgrimkor2023-05-243-71/+152
| | | | | |
* | | | | | Merge pull request #10482 from german77/gamelistliamwhite2023-06-011-0/+4
|\ \ \ \ \ \ | | | | | | | | | | | | | | yuzu: Disable game list while game is running
| * | | | | | yuzu: Disable game list while game is runninggerman772023-05-291-0/+4
| | | | | | |
* | | | | | | Skip BufferCache tickframe with no channel state setKelebek12023-05-301-1/+5
| |_|_|/ / / |/| | | | |
* | | | | | input_common: rename PAGE_SIZE to avoid conflict121011112023-05-301-3/+3
|/ / / / / | | | | | | | | | | | | | | | See also: https://github.com/yuzu-emu/yuzu/issues/8779
* | | | | externals: Update to fmt 10 and add format_as formatter for BitFieldMorph2023-05-281-0/+5
| | | | | | | | | | | | | | | | | | | | Implicit conversions are now disallowed in fmt 10. Use format_as to convert to the underlying type.
* | | | | Merge pull request #10483 from ameerj/gl-cpu-astcliamwhite2023-05-281-2/+7
|\ \ \ \ \ | | | | | | | | | | | | gl_texture_cache: Fix ASTC CPU decoding with compression disabled
| * | | | | gl_texture_cache: Fix ASTC CPU decoding with compression disabledameerj2023-05-281-2/+7
| | |_|/ / | |/| | | | | | | | | | | | | gl_format was incorrectly being overwritten when compression was disabled
* | | | | Merge pull request #10280 from danilaml/cmake-bin-dirliamwhite2023-05-281-5/+1
|\ \ \ \ \ | | | | | | | | | | | | Use TARGET_FILE_DIR generator expression
| * | | | | Use TARGET_FILE_DIR generator expressionDanila Malyutin2023-05-131-5/+1
| | | | | | | | | | | | | | | | | | | | | | | | Use $<TARGET_FILE_DIR:...> where appropriate instead of trying to guess where the binary will end up.
* | | | | | Merge pull request #10283 from danilaml/support-interlaced-videosliamwhite2023-05-282-2/+99
|\ \ \ \ \ \ | | | | | | | | | | | | | | Add support for deinterlaced video playback
| * | | | | | Add support for deinterlaced videos playbackDanila Malyutin2023-05-212-2/+99
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This is a follow up to #10254 to improve the playback of cut scenes in Layton's Mystery Journey. It uses ffmpeg's yadif filter for deinterlacing.
* | | | | | | Merge pull request #10463 from liamwhite/this-is-why-we-need-gliamwhite2023-05-284-70/+125
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | vfs_concat: fix time complexity of read
| * | | | | | | vfs_concat: fix time complexity of readLiam2023-05-264-70/+125
| | | | | | | |
* | | | | | | | Merge pull request #10464 from liamwhite/clear-cacheliamwhite2023-05-284-0/+26
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | qt: add menu item to remove cache storage
| * | | | | | | | qt: add menu item to remove cache storageLiam2023-05-274-0/+26
| | |_|_|/ / / / | |/| | | | | |
* | | | | | | | Merge pull request #10469 from Kelebek1/bc_stateliamwhite2023-05-284-210/+228
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | Move buffer bindings to per-channel state
| * | | | | | | | Move buffer bindings to per-channel stateKelebek12023-05-274-210/+228
| |/ / / / / / /
* / / / / / / / Audren wait as suggested by ByLawsKelebek12023-05-271-0/+3
|/ / / / / / /
* | | | | | | Merge pull request #10414 from liamwhite/anv-push-descriptorMatías Locatti2023-05-261-2/+3
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | vulkan_device: Enable VK_KHR_push_descriptor on newer ANV
| * | | | | | | vulkan_device: Enable VK_KHR_push_descriptor on newer ANVLiam2023-05-231-2/+3
| | |_|_|/ / / | |/| | | | |
* | | | | | | Merge pull request #10418 from liamwhite/blink-and-youll-miss-itMatías Locatti2023-05-264-61/+105
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | texture_cache: process aliases and overlaps in the correct order
| * | | | | | | texture_cache: process aliases and overlaps in the correct orderFernando Sahmkow2023-05-244-61/+105
| |/ / / / / /
* | / / / / / shader_recompiler: fix copy-paste errorLiam2023-05-261-1/+1
| |/ / / / / |/| | | | |
* | | | | | Merge pull request #10221 from Kelebek1/partial_dsp_revertbunnei2023-05-264-16/+12
|\ \ \ \ \ \ | | | | | | | | | | | | | | Add a 5ms tiemout to the DSP processing wait
| * | | | | | Smooth out the DSP callback by adding a 5ms wait time limitKelebek12023-05-184-16/+12
| | | | | | |
* | | | | | | Merge pull request #10396 from german77/amiibo_writebunnei2023-05-258-68/+387
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | input_common: Implement amiibo writing
| * | | | | | | input_common: Implement amiibo writtingNarr the Reg2023-05-228-68/+387
| | |_|/ / / / | |/| | | | |
* | | | | | | Merge pull request #10454 from 521337/fix-u-optionliamwhite2023-05-251-1/+1
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | Don't exit when using "-u" option in yuzu-cmd
| * | | | | | | Don't exit when using "-u" option in yuzu-cmdAriel Cabello2023-05-251-1/+1
| | | | | | | |
* | | | | | | | Merge pull request #10452 from liamwhite/ibgcFernando S2023-05-252-6/+0
|\ \ \ \ \ \ \ \ | |/ / / / / / / |/| | | | | | | video_core: don't garbage collect during configuration
| * | | | | | | video_core: don't garbage collect during configurationLiam2023-05-252-6/+0
| | | | | | | |
* | | | | | | | Add short "-u" option for yuzu_cmd.Ariel Cabello2023-05-251-1/+1
|/ / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | The -u short option was documented but not implemented in yuzu_cmd. The same long option --user worked before.
* | | | | | | Merge pull request #10415 from german77/amiibo-no-keybunnei2023-05-253-21/+52
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | service: nfc: Remove encryption key requirement
| * | | | | | | service: nfc: Remove encryption key requirementNarr the Reg2023-05-233-21/+52
| |/ / / / / /
* | | | | | | Merge pull request #10435 from FernandoS27/gotta-clean-mess-upsbunnei2023-05-251-1/+1
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | Texture cache: revert wrong acceleration assumption
| * | | | | | | Texture cache: revert wrong acceleration assumptionFernando Sahmkow2023-05-241-1/+1
| | |_|_|_|/ / | |/| | | | |
* / | | | | | Texture Cache Util: Fix block depth adjustment on slices.Fernando Sahmkow2023-05-241-2/+13
|/ / / / / /
* | | | | | Merge pull request #10422 from liamwhite/gcFernando S2023-05-242-6/+8
|\ \ \ \ \ \ | | | | | | | | | | | | | | video_core: tune garbage collection aggressiveness
| * | | | | | video_core: tune garbage collection aggressivenessLiam2023-05-232-6/+8
| | |_|/ / / | |/| | | |
* | | | | | Merge pull request #10417 from liamwhite/check-stateFernando S2023-05-241-6/+2
|\ \ \ \ \ \ | | | | | | | | | | | | | | k_memory_block_manager: remove auditing calls
| * | | | | | k_memory_block_manager: remove auditing callsLiam2023-05-231-6/+2
| |/ / / / /
* | | | | | Merge pull request #10398 from liamwhite/bcnFernando S2023-05-2420-26/+344
|\ \ \ \ \ \ | | | | | | | | | | | | | | video_core: add ASTC recompression
| * | | | | | textures: add BC1 and BC3 compressors and recompression settingLiam2023-05-2320-26/+344
| | |/ / / / | |/| | | |
* | | | | | Merge pull request #10388 from GPUCode/fence-waitliamwhite2023-05-232-3/+58
|\ \ \ \ \ \ | | | | | | | | | | | | | | vk_master_semaphore: Move fence wait on separate thread
| * | | | | | vk_master_semaphore: Move fence wait on separate threadGPUCode2023-05-202-3/+58
| |/ / / / /
* | | | | | Merge pull request #10402 from liamwhite/uhliamwhite2023-05-236-1/+51
|\ \ \ \ \ \ | | | | | | | | | | | | | | renderer_vulkan: barrier attachment feedback loops
| * | | | | | renderer_vulkan: barrier attachment feedback loopsLiam2023-05-236-1/+51
| |/ / / / /
* | | | | | Merge pull request #10411 from scorpion81/gc-steamdeck-fix-attemptliamwhite2023-05-231-1/+1
|\ \ \ \ \ \ | |_|/ / / / |/| | | | | Limit device access memory for integrated devices to 4 GB
| * | | | | Limit the device access memory to 4 GBscorpion812023-05-221-1/+1
| |/ / / / | | | | | | | | | | | | | | | | | | | | Hardly limiting the device access memory to 4 GB for integrated vulkan devices here. This works for the Steam Deck in order not to go above 4 GB VRAM usage any more (above this value the likelihood to crash when the RAM exceeds 12 GB as well raises). But there will be perhaps a detection mechanism necessary for detecting the real memory limit for integrated vulkan devices. Those likely might have small limits anyway, but what about integrated GPUs on machines with > 16 GB RAM, aka larger amounts ?
* / / / / input_common: Map motion with relative values not absolute onesgerman772023-05-201-4/+7
|/ / / /
* | | | Merge pull request #10344 from german77/pro-amiibobunnei2023-05-196-103/+70
|\ \ \ \ | | | | | | | | | | input_common: Fix pro controller amiibo support
| * | | | input_common: Fix pro controller amiibo supportNarr the Reg2023-05-176-103/+70
| | | | |
* | | | | renderer_vulkan: remove wrong constexprLiam2023-05-191-2/+2
| |/ / / |/| | |
* | | | vulkan_device: Disable VK_KHR_push_descriptor on ANVlat9nq2023-05-181-0/+11
| | | | | | | | | | | | | | | | | | | | | | | | Mesa commit ff91c5ca42bc80aa411cb3fd8f550aa6fdd16bdc breaks VK_KHR_push_descriptor usage on ANV drivers 22.3.0, so disable it and allow games to boot.
* | | | Merge pull request #10262 from liamwhite/depth-clampbunnei2023-05-171-0/+8
|\ \ \ \ | | | | | | | | | | vulkan_common: disable depth clamp dynamic state for older radv
| * | | | vulkan_common: disable depth clamp dynamic state for older radvLiam2023-05-131-0/+8
| | |/ / | |/| |
* | | | Merge pull request #10217 from Kelebek1/clear_valueliamwhite2023-05-161-19/+6
|\ \ \ \ | | | | | | | | | | Use the rendertarget format of the correct RT rather than the first valid
| * | | | Use the rendertarget format of the correct RT rather than the first validKelebek12023-05-091-19/+6
| | | | |
* | | | | Merge pull request #10107 from grimkor/allow-fully-customised-hotkeysliamwhite2023-05-164-32/+56
|\ \ \ \ \ | |_|_|/ / |/| | | | Allow fully customised controller hotkeys
| * | | | Allow fully customisable controller hotkeysgrimkor2023-05-104-32/+56
| | | | |
* | | | | Merge pull request #10181 from lat9nq/intel-compute-toggleliamwhite2023-05-1513-10/+67
|\ \ \ \ \ | | | | | | | | | | | | configure_graphics: Add option to enable compute pipelines for Intel proprietary
| * | | | | configure_graphics_advanced: Hide input compute toggle a little laterlat9nq2023-05-081-2/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | SetColoredTristate causes the setting to become visible as it calls `show()` on it.
| * | | | | yuzu-qt/config: Add option to disable compute on Intellat9nq2023-05-0710-9/+63
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This option is only visible if an Intel GPU using the proprietary driver is found during Vulkan device enumeration. configure_graphics: More directly get driver id Vulkan::Device does quite a bit more than we need just to see the driver ID here.
| * | | | | vk_pipeline_cache: Use setting to disable intel computelat9nq2023-05-071-1/+2
| | | | | |
| * | | | | settings: Add enable compute pipelineslat9nq2023-05-072-0/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | For the Intel proprietary driver's deficiencies. settings: Restore compute option global state
* | | | | | Merge pull request #10234 from Kelebek1/clouds_depthliamwhite2023-05-152-12/+3
|\ \ \ \ \ \ | | | | | | | | | | | | | | Fix Tears of the Kingdom flickering clouds and depths geometry.
| * | | | | | Fix Tears of the Kingdom flickering clouds and depths.Kelebek12023-05-112-12/+3
| | | | | | |
* | | | | | | Merge pull request #10249 from FernandoS27/sorry-i-am-lateliamwhite2023-05-152-28/+4
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | Buffer Cache: Clear sync code.
| * | | | | | | Buffer Cache: Clear sync code.Fernando Sahmkow2023-05-152-28/+4
| | |_|_|_|/ / | |/| | | | |
* | | | | | | Merge pull request #10254 from danilaml/fix-h264-decodeliamwhite2023-05-151-2/+2
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | Fix missing pic_order_present_flag in h264 header
| * | | | | | | Fix missing pic_order_present_flag in h264 headerDanila Malyutin2023-05-121-2/+2
| | |/ / / / / | |/| | | | | | | | | | | | | | | | | | | Fixes #9635
* | | | | | | Merge pull request #10265 from german77/amiibo-lagliamwhite2023-05-153-4/+13
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | input_common: Make amiibo scanning less demanding
| * | | | | | | input_common: Make amiibo scanning less demandinggerman772023-05-143-4/+13
| | |/ / / / / | |/| | | | |
* | | | | | | Merge pull request #10294 from german77/vibration_spanliamwhite2023-05-153-14/+14
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | service: hid: Use span instead of vector reference
| * | | | | | | service: hid: Use span instead of vector referencegerman772023-05-153-14/+14
| | | | | | | |
* | | | | | | | Merge pull request #10288 from liamwhite/vram-limitsliamwhite2023-05-141-0/+2
|\ \ \ \ \ \ \ \ | |/ / / / / / / |/| | | | | | | vulkan_device: reserve extra memory to prevent swaps
| * | | | | | | vulkan_device: reserve extra memory to prevent swapsLiam2023-05-141-0/+2
| |/ / / / / /
* / / / / / / vulkan_common: fix incompatible property flagsLiam2023-05-141-1/+1
|/ / / / / /
* | | | | | Merge pull request #10244 from liamwhite/lower-upperFernando S2023-05-133-2/+34
|\ \ \ \ \ \ | | | | | | | | | | | | | | time: implement ContinuousAdjustmentTimePoint
| * | | | | | time: implement ContinuousAdjustmentTimePointLiam2023-05-123-2/+34
| |/ / / / /
* | | | | | Merge pull request #10243 from Kelebek1/red_dotFernando S2023-05-132-1/+3
|\ \ \ \ \ \ | | | | | | | | | | | | | | Correctly track render target index in the framebuffer for image aspects
| * | | | | | Correctly track RT indexes for image aspect lookup during clearsKelebek12023-05-122-1/+3
| |/ / / / /
* | | | | | Merge pull request #10237 from liamwhite/cache-storagebunnei2023-05-135-6/+50
|\ \ \ \ \ \ | | | | | | | | | | | | | | fs: stub cache storage
| * | | | | | fs: adjust future save pathLiam2023-05-112-4/+4
| | | | | | |
| * | | | | | am: stub CreateCacheStorageLiam2023-05-112-1/+33
| | | | | | |
| * | | | | | fs: stub cache storage and fix params alignmentLiam2023-05-112-5/+17
| |/ / / / /
* | | | | | nvnflinger: fix Parcel serializationLiam2023-05-113-39/+49
| | | | | |
* | | | | | nvnflinger: fix producer slot fence initLiam2023-05-111-0/+1
|/ / / / /
* | | | | Merge pull request #10132 from Kelebek1/fermi_blit2liamwhite2023-05-113-12/+24
|\ \ \ \ \ | | | | | | | | | | | | Allow Fermi blit accelerate to work without images in cache
| * | | | | Allow Fermi blit accelerate to add src/dst to the cache if they don't exist already. Use ScratchBuffers in the software blit path.Kelebek12023-05-113-12/+24
| | |_|/ / | |/| | |
* | | | | Merge pull request #10216 from Kelebek1/buffer_cache_region_checksliamwhite2023-05-111-4/+4
|\ \ \ \ \ | | | | | | | | | | | | Swap order of checking/setting region modifications in the buffer_cache
| * | | | | Swap order of checking/setting region modifications in the buffer_cacheKelebek12023-05-091-4/+4
| |/ / / /
* | | | | renderer_vulkan: separate guest and host compute descriptor queuesLiam2023-05-1016-75/+81
| | | | |
* | | | | Merge pull request #10207 from german77/amiibo_cheaterliamwhite2023-05-107-13/+53
|\ \ \ \ \ | | | | | | | | | | | | service: nfp: Allow to load with a different amiibo id
| * | | | | service: nfc: Seed all random valuesNarr the Reg2023-05-102-6/+14
| | | | | |
| * | | | | service: nfp: Allow to load with a different amiibo idgerman772023-05-106-7/+39
| |/ / / /
* | | | | Merge pull request #10119 from marius851000/improved_non_hd_feebackNarr the Reg2023-05-101-6/+29
|\ \ \ \ \ | |/ / / / |/| | | | Attempt at improving HD Rumble emulation
| * | | | Improve emulation of HD Rumblemarius david2023-05-051-6/+29
| | | | |
* | | | | Merge pull request #10183 from liamwhite/modsliamwhite2023-05-093-3/+29
|\ \ \ \ \ | | | | | | | | | | | | vfs_vector: avoid n^2 lookup in layeredfs building
| * | | | | vfs_layered: avoid n^2 lookup in layeredfs buildingLiam2023-05-081-3/+6
| | | | | |
| * | | | | vfs_vector: avoid n^2 lookup in layeredfs buildingLiam2023-05-072-0/+23
| | | | | |
* | | | | | Merge pull request #10203 from german77/calibrationliamwhite2023-05-096-11/+53
|\ \ \ \ \ \ | | | | | | | | | | | | | | core: hid: Allow to calibrate gyro sensor
| * | | | | | yuzu: Make 3d cube with joycon shapeNarr the Reg2023-05-081-10/+10
| | | | | | |
| * | | | | | core: hid: Allow to calibrate gyro sensorNarr the Reg2023-05-085-1/+43
| | | | | | |
* | | | | | | Merge pull request #10206 from FernandoS27/astc-3dliamwhite2023-05-093-7/+7
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | Texture Cache: Fix 3D ASTC textures
| * | | | | | | Texture Cache: Fix ASTC texturesFernando Sahmkow2023-05-093-7/+7
| | | | | | | |
* | | | | | | | input_common: Fix nfc detection for joyconsgerman772023-05-094-19/+21
|/ / / / / / /
* / / / / / / qt_common: consistently ifdef QPlatform after cbd79df23375Jan Beich2023-05-081-1/+1
|/ / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | src/yuzu/qt_common.cpp:45:33: error: member access into incomplete type 'QPlatformNativeInterface' wsi.display_connection = pni->nativeResourceForWindow("display", window); ^ /usr/include/qt6/QtGui/qguiapplication.h:20:7: note: forward declaration of 'QPlatformNativeInterface' class QPlatformNativeInterface; ^ src/yuzu/qt_common.cpp:47:42: error: member access into incomplete type 'QPlatformNativeInterface' wsi.render_surface = window ? pni->nativeResourceForWindow("surface", window) : nullptr; ^ /usr/include/qt6/QtGui/qguiapplication.h:20:7: note: forward declaration of 'QPlatformNativeInterface' class QPlatformNativeInterface; ^
* | | | | | Merge pull request #10075 from Kelebek1/silence_nifm_spambunnei2023-05-083-5/+5
|\ \ \ \ \ \ | | | | | | | | | | | | | | Silence network spam
| * | | | | | Silence nifm spamKelebek12023-04-223-5/+5
| | | | | | |
* | | | | | | bootmanager: remove stop_token headerLiam2023-05-081-1/+0
| | | | | | |
* | | | | | | Merge pull request #10195 from german77/mutexliamwhite2023-05-085-22/+20
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | core: hid: Update motion on a better place
| * | | | | | | core: hid: Update motion on a better placegerman772023-05-085-22/+20
| | | | | | | |
* | | | | | | | Texture cache: Only force flush the dma downloadsFernando Sahmkow2023-05-075-6/+6
| | | | | | | |
* | | | | | | | Buffer Cache: disable reactive flushing in it.Fernando Sahmkow2023-05-073-18/+8
| | | | | | | |
* | | | | | | | Texture cache: reverse inmediate flush changesFernando Sahmkow2023-05-073-28/+14
| | | | | | | |
* | | | | | | | Buffer cache: always use async buffer downloads and fix regression.Fernando Sahmkow2023-05-074-63/+70
| | | | | | | |
* | | | | | | | Address feedback, add CR notice, etcFernando Sahmkow2023-05-075-10/+18
| | | | | | | |
* | | | | | | | Query cache: stop updating pages as it's not affected by cpu writesFernando Sahmkow2023-05-071-2/+0
| | | | | | | |
* | | | | | | | Settings: add option to enable / disable reactive flushingFernando Sahmkow2023-05-0711-5/+38
| | | | | | | |
* | | | | | | | Texture cache: sync the first flush.Fernando Sahmkow2023-05-072-3/+30
| | | | | | | |
* | | | | | | | GPU: Add Reactive flushingFernando Sahmkow2023-05-0724-30/+240
|/ / / / / / /
* | | | | | | Merge pull request #10097 from german77/nfp_fullbunnei2023-05-0734-2632/+2254
|\ \ \ \ \ \ \ | |_|/ / / / / |/| | | | | | service: nfc: Merge device interfaces and create the device manager
| * | | | | | service: nfc: Merge device interfaces and create the device managerNarr the Reg2023-05-0632-2410/+2031
| | | | | | |
| * | | | | | core: service: Add FunctionInfoTyped to allow expanding existing interfacesgerman772023-04-261-8/+12
| | | | | | |
| * | | | | | service: nfc: Create mifare interfaceNarr the Reg2023-04-243-50/+58
| | | | | | |
| * | | | | | service: nfc: Create interfaceNarr the Reg2023-04-245-115/+104
| | | | | | |
* | | | | | | Merge pull request #10081 from Kelebek1/copy_overlap_tickliamwhite2023-05-071-0/+6
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | Sort overlap_ids by modification tick before copy
| * | | | | | | Sort overlap_ids by modification tick before copyKelebek12023-04-221-0/+6
| | |/ / / / / | |/| | | | |
* | | | | | | Merge pull request #10172 from Kelebek1/debug_validation_namesliamwhite2023-05-0710-30/+35
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | Log object names with debug renderer, add a GPU address to ImageViews
| * | | | | | | Log object names with debug renderer, add a GPU address to ImageViewsKelebek12023-05-0610-30/+35
| | | | | | | |
* | | | | | | | yuzu/applets/qt_profile_select: connect double-click to accept()QGJ2023-05-071-0/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | In the profile selection window: Allow the user to start the game by double-clicking a profile to avoid having to additionally click the OK button. This avoids an unnecessary "step" to the start of the game...
* | | | | | | | Fix address space allocator slow path to avoid OOBKelebek12023-05-071-1/+1
| | | | | | | |
* | | | | | | | Merge pull request #10180 from german77/debugbunnei2023-05-071-2/+0
|\ \ \ \ \ \ \ \ | |_|_|_|_|/ / / |/| | | | | | | input_common: Revert debugging changes
| * | | | | | | input_common: Revert debugging changesgerman772023-05-071-2/+0
| | | | | | | |
* | | | | | | | Merge pull request #10125 from lat9nq/vsync-selectbunnei2023-05-0722-129/+456
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | configuration: Expose separate swap present modes
| * | | | | | | | qt_common: Remove yuzu prefixlat9nq2023-05-044-7/+7
| | | | | | | | |
| * | | | | | | | configure_graphics: No there isn't a hyphen in VSynclat9nq2023-05-032-5/+5
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Most sources seem to suggest VSync and not V-Sync
| * | | | | | | | configure_input_player: Add missing includelat9nq2023-05-031-0/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Cleaning up includes in bootmanager and configure_graphics has exposed a missing include here.
| * | | | | | | | configure_graphics: Clean up includes [IWYU]lat9nq2023-05-032-6/+31
| | | | | | | | |
| * | | | | | | | bootmanager: Clean up includes [IWYU]lat9nq2023-05-032-15/+50
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | bootmanager: Remove system-specific headers IWYU can be too complete I suppose.
| * | | | | | | | configure_graphics: Actively find present modeslat9nq2023-05-033-27/+161
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | When Vulkan devices are enumerated, this also determines the available present modes for each device, maps them to a vector, and gives those options to the user. OpenGL options are limited to On/Off. Required creating a VkSurfaceKHR during device enumeration, which may or may not be desireable. For the sake of a less confusing UI. Also fixes a bug where if a graphics device disappears on the host, we don't try and select the non-existant devices. configure_graphics: Remove vsync runtime lock for Vulkan configure_graphics: Recommend Mailbox present mode configure_graphics: Fix type-limits warning configure_graphics: Clean up includes configure_graphics: Add tooltip
| * | | | | | | | vk_swapchain: Use certain modes for unlockedlat9nq2023-05-032-26/+50
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Uses mailbox, then immediate for unlocked framerate depending on support for either. Also adds support for FIFO_RELAXED. This function now assumes vsync_mode was originially configured to a value that the driver supports. vk_swapchain: ChooseSwapPresentMode determines updates Simplifies swapchain a bit and allows us to change the present mode during guest runtime. vk_swapchain: Fix MSVC error vk_swapchain: Enforce available present modes Some frontends don't check the value of vsync_mode before comitting it. Just as well, since a driver update or misconfiguration could problems in the swap chain. vk_swapchain: Silence warnings Silences GCC warnings implicit-fallthrough and shadow, which apparently are not enabled on clang.
| * | | | | | | | bootmanager: Remove inaccurate switchlat9nq2023-05-032-11/+3
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Those vulkan settings do not correspond 1:1 to the swap intervals that they set for OpenGL, so remove it. bootmanager: Add missing include I didn't add this log why did it break
| * | | | | | | | qt_common: Move window info function out of bootmanagerlat9nq2023-05-034-44/+75
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Function is useful outside of bootmanager, so put it in a common place. qt_common: Add missing include qt_common: Add some newlines qt_common: Add trailing newline qt_common: Add trainline newline
| * | | | | | | | vulkan_surface: Pass only window info for surface creationlat9nq2023-05-033-10/+7
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | We don't need the whole EmuWindow when creating a surface, and it creates onerous requirements outside of typical usage for creating a surface elsewhere.
| * | | | | | | | settings: Enable FIFO relaxedlat9nq2023-05-032-7/+10
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Not entirely sure if we need this, but there's also no reason not to support it. settings: Give VSyncMode values
| * | | | | | | | configure_graphics: Fix another typolat9nq2023-05-031-1/+1
| | | | | | | | |
| * | | | | | | | telemetry_session: Make translate function staticlat9nq2023-05-031-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Addresses review feedback Co-authored-by: Lioncash <mathew1800@gmail.com>
| * | | | | | | | bootmanager: Return value in impossible caselat9nq2023-05-031-0/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The setting is ranged, so this return statement is unreachable. But GCC can't tell I guess.
| * | | | | | | | configure_graphics: Fix typolat9nq2023-05-031-1/+1
| | | | | | | | |
| * | | | | | | | default_ini: Update V-Sync descriptionlat9nq2023-05-031-2/+8
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | default_ini: Update vsync text default_ini: Add tooltip from configure_graphics
| * | | | | | | | configuration: Expose separate swap present modeslat9nq2023-05-0311-37/+115
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Previously, yuzu would try and guess which vsync mode to use given different scenarios, but apparently we didn't always get it right. This exposes the separate modes in a drop-down the user can select. If a mode isn't available in Vulkan, it defaults to FIFO.
* | | | | | | | | Merge pull request #10174 from german77/motriodbunnei2023-05-072-0/+10
|\ \ \ \ \ \ \ \ \ | |_|/ / / / / / / |/| | | | | | | | input_common: Add experimental motion to button
| * | | | | | | | input_common: Add experimental motion to buttongerman772023-05-062-0/+10
| | | | | | | | |
* | | | | | | | | Merge pull request #10162 from lat9nq/sdl-remove-oldliamwhite2023-05-072-21/+2
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | yuzu-sdl,audio_core: Remove antiquated warning ignore
| * | | | | | | | | yuzu-sdl,audio_core: Remove antiquated warning ignorelat9nq2023-05-052-21/+2
| | |/ / / / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Issue was fixed a long time ago, both by SDL2 and in yuzu by including SDL2 as a system library.
* | | | | | | | | Merge pull request #10167 from german77/motion_previewliamwhite2023-05-0712-6/+165
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | yuzu: Add motion preview to controller input
| * | | | | | | | | input_common: Add property to invert an axis buttonNarr the Reg2023-05-066-3/+15
| | | | | | | | | |
| * | | | | | | | | yuzu: Add motion preview to controller inputNarr the Reg2023-05-057-4/+151
| | |/ / / / / / / | |/| | | | | | |
* | | | | | | | | Fix read access violationRoni Kirla2023-05-061-1/+1
| |_|/ / / / / / |/| | | | | | |
* | | | | | | | Merge pull request #10159 from german77/home_screenshotbunnei2023-05-051-0/+4
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | core: hid: Fix state of capture and home buttons
| * | | | | | | | core: hid: Fix state of capture and home buttonsgerman772023-05-051-0/+4
| |/ / / / / / /
* | | | | | | | Merge pull request #10128 from Kelebek1/audren_terminateliamwhite2023-05-041-4/+1
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | Wait for the terminate event before destroying a system instance
| * | | | | | | | Wait for the terminate event before destroying a system instanceKelebek12023-05-011-4/+1
| | | | | | | | |
* | | | | | | | | Merge pull request #10145 from Kelebek1/code_sizeliamwhite2023-05-043-10/+16
|\ \ \ \ \ \ \ \ \ | |_|/ / / / / / / |/| | | | | | | | Fix shader code resize to use word size rather than byte size
| * | | | | | | | Fix code resize to use word size rather than byte sizeKelebek12023-05-033-10/+16
| | | | | | | | |
* | | | | | | | | Merge pull request #10153 from FernandoS27/a-quickie-fixieFernando S2023-05-041-4/+5
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | Memory manager: Fix possible softlock
| * | | | | | | | | Memory manager: Fix possible softlockFernando Sahmkow2023-05-041-4/+5
| | | | | | | | | |
* | | | | | | | | | Merge pull request #10154 from liamwhite/optimisticFernando S2023-05-048-28/+0
|\ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | settings: remove pessimistic flushing
| * | | | | | | | | | settings: remove pessimistic flushingLiam2023-05-048-28/+0
| |/ / / / / / / / /
* | | | | | | | | | Merge pull request #10142 from FernandoS27/missing-astcbunnei2023-05-048-9/+49
|\ \ \ \ \ \ \ \ \ \ | |/ / / / / / / / / |/| | | | | | | | | GPU: implement missing ASTC
| * | | | | | | | | GPU: implement missing ASTCFernando Sahmkow2023-05-038-9/+49
| | | | | | | | | |
* | | | | | | | | | Merge pull request #10088 from FernandoS27/100-gelato-flavor-test-builds-laterbunnei2023-05-0414-80/+286
|\ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | Y.F.C Implement Asynchronous Fence manager and Rework Query async downloads
| * | | | | | | | | | QueryCache: Fix write invalidation.Fernando Sahmkow2023-04-282-6/+13
| | | | | | | | | | |
| * | | | | | | | | | MemoryManager: Fix race conditions.Fernando Sahmkow2023-04-282-3/+11
| | | | | | | | | | |
| * | | | | | | | | | Clang format and ddress feedbackFernando Sahmkow2023-04-243-16/+30
| | | | | | | | | | |
| * | | | | | | | | | QueryCache: rework async downloads.Fernando Sahmkow2023-04-237-45/+118
| | | | | | | | | | |
| * | | | | | | | | | Accuracy Normal: reduce accuracy further for perf improvements in Project LimeFernando Sahmkow2023-04-234-5/+11
| | | | | | | | | | |
| * | | | | | | | | | Fence Manager: implement async fence management in a sepparate thread.Fernando Sahmkow2023-04-235-35/+133
| | |_|_|_|_|/ / / / | |/| | | | | | | |
* | | | | | | | | | Merge pull request #10117 from liamwhite/sync-registerbunnei2023-05-039-5/+50
|\ \ \ \ \ \ \ \ \ \ | |_|/ / / / / / / / |/| | | | | | | | | kernel: match calls to Register and Unregister
| * | | | | | | | | kernel: match calls to Register and UnregisterLiam2023-04-309-5/+50
| | |_|/ / / / / / | |/| | | | | | |
* | | | | | | | | Merge pull request #10151 from GPUCode/no-softlocks-pleaseliamwhite2023-05-033-6/+9
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | Fix softlocks when disabling async present
| * | | | | | | | | vk_present_manager: Fix softlocks when disabling async presentGPUCode2023-05-033-6/+9
| | |_|_|/ / / / / | |/| | | | | | |
* | | | | | | | | Merge pull request #10144 from liamwhite/dont-turboMorph2023-05-031-1/+3
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | vulkan: disable turbo when debugging tool is attached
| * | | | | | | | | vulkan: disable turbo when debugging tool is attachedLiam2023-05-031-1/+3
| | | | | | | | | |
* | | | | | | | | | Merge pull request #10143 from liamwhite/fruit-company-momentMorph2023-05-033-4/+6
|\ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | video_core: fix build on Apple Clang
| * | | | | | | | | | video_core: fix build on Apple ClangLiam2023-05-033-4/+6
| |/ / / / / / / / /
* | | | | | | | | | Merge pull request #10124 from liamwhite/pebkacMorph2023-05-0313-30/+34
|\ \ \ \ \ \ \ \ \ \ | |_|/ / / / / / / / |/| | | | | | | | | settings: rename extended memory layout to unsafe, move from general to system
| * | | | | | | | | settings: rename extended memory layout to unsafe, move from general to systemLiam2023-04-3013-30/+34
| | |_|_|_|_|/ / / | |/| | | | | | |
* | | | | | | | | Merge pull request #9973 from GPUCode/async-presentbunnei2023-05-0321-226/+772
|\ \ \ \ \ \ \ \ \ | |_|_|_|_|/ / / / |/| | | | | | | | Implement asynchronous presentation
| * | | | | | | | vk_present_manager: Add toggle for async presentationGPUCode2023-05-0110-6/+45
| | | | | | | | |
| * | | | | | | | vk_blit_screen: Recreate FSR when frame is recreatedGPUCode2023-05-011-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * Depends on the layout dimentions and thus should be recreated as well
| * | | | | | | | renderer_vulkan: Fix crashing when updating descriptorsGPUCode2023-05-012-4/+17
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * During pipeline configure the function would acquire some payload space from the descriptor update queue, write the descriptor data on the GPU thread and give the scheduler a pointer to the beginning of said space to update it later. TickFrame resets the payload cursor, used to track acquires, back to the beginning of the buffer. This wasn't a problem before since WaitWorker was called at the end of the frame but now it is. If a frame writes to a cursor before the scheduler catches up, it will crash * To fix this the payload buffer has been increased to account for the in flight frames that are allowed to exist now. TickFrame will switch between the payload spaces instead of resetting
| * | | | | | | | renderer_vulkan: Async presentationGPUCode2023-05-0111-218/+712
| | |/ / / / / / | |/| | | | | |
* | | | | | | | Merge pull request #10133 from lat9nq/clang-shadow-and-fallthroughliamwhite2023-05-031-0/+3
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | CMakeLists: Enable more checks on Clang
| * | | | | | | | CMake: Enable type limits on Clanglat9nq2023-05-021-0/+1
| | | | | | | | |
| * | | | | | | | CMakeLists: Enable checks on Clanglat9nq2023-05-021-0/+2
| |/ / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Enables shadow-uncaptured-locals and implicit-fallthrough for Clang. implicit-fallthrough is not enabled by default in -Wall or -Wextra, and shadow-uncaptured-local doesn't seem to be enabled by default by -Wshadow, even though GCC has both of these by their respective cases.
* | | | | | | | Merge pull request #10130 from liamwhite/keysliamwhite2023-05-032-0/+34
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | qt: warn on inoperable keys
| * | | | | | | | qt: warn on inoperable keysLiam2023-05-012-0/+34
| | |/ / / / / / | |/| | | | | |
* | | | | | | | Merge pull request #10123 from Kelebek1/sample_maskliamwhite2023-05-032-2/+4
|\ \ \ \ \ \ \ \ | |_|/ / / / / / |/| | | | | | | Define SampleMask as an array
| * | | | | | | Define SampleMask as an arrayKelebek12023-04-302-2/+4
| | |/ / / / / | |/| | | | |
* | | | | | | Merge pull request #10084 from FernandoS27/yuzu-goes-broom-broomMorph2023-05-0115-1727/+2255
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | Y.F.C Buffer Cache Revamp
| * | | | | | | BufferCache: Fixes and address feedbackFernando Sahmkow2023-05-016-322/+243
| | | | | | | |
| * | | | | | | Buffer Cache: Release stagging buffers on tick frameFernando Sahmkow2023-04-292-12/+22
| | | | | | | |
| * | | | | | | Tests: Add memory tracker tests.Fernando Sahmkow2023-04-293-550/+548
| | | | | | | |
| * | | | | | | Clang: format and ficx compile errors.Fernando Sahmkow2023-04-295-68/+78
| | | | | | | |
| * | | | | | | Implement Async downloads in normal and fix a few issues.Fernando Sahmkow2023-04-293-39/+61
| | | | | | | |
| * | | | | | | Buffer Cache rework: Setup async downloads.Fernando Sahmkow2023-04-292-140/+154
| | | | | | | |
| * | | | | | | Buffer Cache: Fully rework the buffer cache.Fernando Sahmkow2023-04-2912-1091/+1644
| | |_|_|_|/ / | |/| | | | |
* | | | | | | Merge pull request #10116 from liamwhite/deboostliamwhite2023-05-018-19/+657
|\ \ \ \ \ \ \ | |_|_|/ / / / |/| | | | | | kernel: remove boost intrusive lists
| * | | | | | kernel: remove general boost listsLiam2023-04-307-19/+26
| | | | | | |
| * | | | | | common: add intrusive list typeLiam2023-04-291-0/+631
| |/ / / / /
* | | | | | Merge pull request #10110 from Morph1984/intel-disable-computebunnei2023-04-301-0/+7
|\ \ \ \ \ \ | |_|/ / / / |/| | | | | vk_pipeline_cache: Skip compute pipelines on Intel proprietary drivers
| * | | | | vk_pipeline_cache: Skip compute pipelines on Intel proprietary driversMorph2023-04-281-0/+7
| |/ / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Intel's SPIR-V shader compiler is broken. For now, skip compiling any compute pipelines until they fix this issue. This is not a perfect workaround, as there are a small subset of non-compute pipelines that still cause it to crash, but this should cover the majority of crashes. It is unfortunate that even with a test case reported 6 months ago the issue has not been fixed in favor of fixing "the most popular games and apps". Intel, you can do better than this.
* | | | | Texture Cache: Release stagging buffers on tick frameFernando Sahmkow2023-04-296-19/+46
| | | | |
* | | | | Address Feedback & Clang FormatFernando Sahmkow2023-04-292-17/+14
| | | | |
* | | | | Maxwell3D: only update parameters on HighFernando Sahmkow2023-04-291-0/+3
| | | | |
* | | | | Accelerate DMA: Use texture cache async downloads to perform the copiesFernando Sahmkow2023-04-296-53/+123
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | to host. WIP
* | | | | TextureCache: refactor DMA downloads to allow multiple buffers.Fernando Sahmkow2023-04-298-41/+75
|/ / / /
* | | | Merge pull request #10051 from liamwhite/surface-capabilitiesFernando S2023-04-241-1/+14
|\ \ \ \ | | | | | | | | | | vulkan: pick alpha composite flags based on available values
| * | | | vulkan: pick alpha composite flags based on available valuesLiam2023-04-131-1/+14
| | | | |
* | | | | Merge pull request #10056 from vonchenplus/audout_uFernando S2023-04-241-6/+8
|\ \ \ \ \ | | | | | | | | | | | | core: audio: return result when audio_out initialize failed
| * | | | | core: audio: return result when audio_out initialize failedFengChen2023-04-161-6/+8
| | | | | |
* | | | | | Merge pull request #10069 from liamwhite/logFernando S2023-04-241-4/+6
|\ \ \ \ \ \ | |_|_|/ / / |/| | | | | maxwell_3d: fix out of bounds array access in size estimation
| * | | | | maxwell_3d: fix out of bounds array access in size estimationLiam2023-04-221-4/+6
| | |_|/ / | |/| | |
* | | | | Merge pull request #10074 from Kelebek1/fermi_blitFernando S2023-04-221-4/+12
|\ \ \ \ \ | | | | | | | | | | | | Account for a pre-added offset when using Corner sample mode for 2D blits
| * | | | | Account for a pre-added offset when using Corner sample mode for 2D blitsKelebek12023-04-211-4/+12
| |/ / / /
* | | | | Merge pull request #10076 from german77/TryPopMyFriendbunnei2023-04-221-1/+1
|\ \ \ \ \ | | | | | | | | | | | | core: am: Demote TryPopFromFriendInvitationStorageChannel Log level
| * | | | | core: am: Demote TryPopFromFriendInvitationStorageChannel Log levelgerman772023-04-221-1/+1
| |/ / / /
* | | | | Merge pull request #10068 from twitchax/twitchax/dr_bind_addressbunnei2023-04-221-3/+13
|\ \ \ \ \ | | | | | | | | | | | | Allow passing `--bind-address` to dedicated room.
| * | | | | Run clang-format to fix all.Aaron Roney2023-04-191-1/+2
| | | | | |
| * | | | | Fix formatting.Aaron Roney2023-04-191-2/+2
| | | | | |
| * | | | | Allow passing `bind_address` to dedicated room.Aaron Roney2023-04-191-2/+11
| | |/ / / | |/| | |
* | | | | Merge pull request #10060 from german77/no_deadbunnei2023-04-221-0/+4
|\ \ \ \ \ | |_|/ / / |/| | | | core: hid: Remove deadzone of virtual controller
| * | | | core: hid: Remove deadzone of virtual controllergerman772023-04-161-0/+4
| |/ / /
* | | | Merge pull request #10057 from liamwhite/its-not-in-the-timelinebunnei2023-04-204-68/+161
|\ \ \ \ | | | | | | | | | | vulkan: use plain fences when timeline semaphores are not available
| * | | | vulkan: use plain fences when timeline semaphores are not availableLiam2023-04-154-68/+161
| |/ / /
* | | | Merge pull request #10053 from german77/nfp_fullbunnei2023-04-197-74/+938
|\ \ \ \ | |/ / / |/| | | service: nfp: Implement all interfaces
| * | | service: nfp: Implement debug InterfaceNarr the Reg2023-04-156-8/+444
| | | |
| * | | service: nfp: Implement system interfaceNarr the Reg2023-04-156-17/+289
| | | |
| * | | service: nfp: Use an unique interfaceNarr the Reg2023-04-144-71/+227
| |/ /
* | | Merge pull request #10030 from Wollnashorn/botw-amd-fixbunnei2023-04-156-0/+73
|\ \ \ | | | | | | | | shader_recompiler: Fix ImageGather rounding on AMD/Intel
| * | | video_core: Enable ImageGather rounding fix on AMD open source driversWollnashorn2023-04-121-0/+2
| | | |
| * | | shader_recompiler: Use vector arithmetic rather than component-wise in ImageGatherSubpixelOffsetWollnashorn2023-04-081-18/+9
| | | | | | | | | | | | | | | | Should be more efficient and better readable
| * | | video_core: Enable ImageGather with subpixel offset on IntelWollnashorn2023-04-087-17/+11
| | | |
| * | | shader_recompiler: Add subpixel offset for correct rounding at `ImageGather`Wollnashorn2023-04-089-0/+86
| | | | | | | | | | | | | | | | | | | | | | | | | | | | On AMD a subpixel offset of 1/512 of the texel size is applied to the texture coordinates at a ImageGather call to ensure the rounding at the texel centers is done the same way as in Maxwell or other Nvidia architectures. See https://www.reedbeta.com/blog/texture-gathers-and-coordinate-precision/ for more details why this might be necessary. This should fix shadow artifacts at object edges in Zelda: Breath of the Wild (#9957, #6956).
* | | | input_common: minor fix to mouse movementValeri2023-04-141-1/+1
| |/ / |/| |
* | | Merge pull request #10008 from vonchenplus/texture_cacheliamwhite2023-04-114-50/+57
|\ \ \ | | | | | | | | video_core: update imageinfo implement
| * | | video_core: Keep the definition of DimensionControl consistent with nvidia open docFeng Chen2023-03-312-19/+22
| | | |
| * | | video_core: Better defined ImageInfo parametersFengChen2023-03-143-39/+43
| | | |
* | | | Merge pull request #10027 from bylaws/masterliamwhite2023-04-102-5/+5
|\ \ \ \ | | | | | | | | | | Add some explicit latency to sample count reporting
| * | | | Use GetGlobalTimeNs as opposed to clock ticksBilly Laws2023-04-082-4/+3
| | | | |
| * | | | Add some explicit latency to sample count reportingBilly Laws2023-04-041-1/+2
| | |/ / | |/| | | | | | | | | | Some games have very tight scheduling requirements for their audio which can't really be matched on the host, adding a constant to the reported value helps to provide some leeway.
* | | | kernel: move more memory to application in 8GB arrangementLiam2023-04-101-2/+4
| | | |
* | | | kernel: switch extended memory setting to 8GB arrangementLiam2023-04-083-4/+4
| | | |
* | | | Merge pull request #10022 from liamwhite/gcc-13bunnei2023-04-086-28/+14
|\ \ \ \ | |/ / / |/| | | general: fixes for gcc 13
| * | | general: fixes for gcc 13Liam2023-04-036-28/+14
| | | |
* | | | Merge pull request #10024 from german77/crysisliamwhite2023-04-031-5/+1
|\ \ \ \ | | | | | | | | | | service: hid: Fix handle validation
| * | | | service: hid: Fix handle validationgerman772023-04-021-5/+1
| | | | |
* | | | | Merge pull request #10004 from Kelebek1/cubemapliamwhite2023-04-031-15/+15
|\ \ \ \ \ | |/ / / / |/| | | | [texture_cache] Only upload GPU-modified overlaps
| * | | | Only upload GPU-modified overlapsKelebek12023-03-281-15/+15
| | | | |
* | | | | Merge pull request #10020 from merryhime/update-dynarmicbunnei2023-04-021-13/+10
|\ \ \ \ \ | | | | | | | | | | | | externals: Update dynarmic to 6.4.6
| * | | | | core: arm_dynarmic_32: Update SaveContext/LoadContext.bunnei2023-04-021-13/+10
| | |/ / / | |/| | |
* | | | | Merge pull request #9969 from bylaws/masterbunnei2023-04-019-79/+55
|\ \ \ \ \ | | | | | | | | | | | | Audio synchronisation improvements
| * | | | | audio_core: No longer stall when sink queue is fullBilly Laws2023-03-274-64/+1
| | | | | | | | | | | | | | | | | | | | | | | | Now the audout and audren update rates are tied to the sink status stalling is no longer necessary.
| * | | | | Run clang-formatBilly Laws2023-03-273-7/+6
| | | | | |
| * | | | | audio: Wait for samples on the emulated DSP side to avoid desyncsBilly Laws2023-03-276-24/+28
| | | | | | | | | | | | | | | | | | | | | | | | Waiting on the host side is inaccurate and leads to desyncs in the event of the sink missing a deadline that require stalls to fix. By waiting for the sink to have space before even starting rendering such desyncs can be avoided.
| * | | | | audio: Interpolate system manager sample count using host sink sample infoBilly Laws2023-03-264-3/+39
| | | | | | | | | | | | | | | | | | | | | | | | This avoids the need to stall if the host sink sporadically misses the deadline, in such a case the previous implementation would report them samples as being played on-time, causing the guest to send more samples and leading to a gradual buildup.
* | | | | | Merge pull request #10006 from german77/profile_selectliamwhite2023-04-018-34/+270
|\ \ \ \ \ \ | | | | | | | | | | | | | | service: am: Improve profile select applet
| * | | | | | service: am: Improve profile select appletNarr the Reg2023-03-298-34/+270
| | | | | | |
* | | | | | | Merge pull request #9997 from german77/cancel_controllerliamwhite2023-04-019-19/+33
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | applet: controller: Implement cancel button
| * | | | | | | applet: controller: Implement cancel buttongerman772023-03-309-19/+33
| |/ / / / / /
* | | | | | | Merge pull request #9999 from german77/new_hid_hurraliamwhite2023-04-014-22/+56
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | service: hid: Implement SetNpadJoyAssignmentModeSingleWithDestination
| * | | | | | | service: hid: Implement SetNpadJoyAssignmentModeSingleWithDestinationgerman772023-03-304-22/+56
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Used by Let's Get Fit
* | | | | | | | Merge pull request #10017 from jbeich/vk-246liamwhite2023-04-011-0/+2
|\ \ \ \ \ \ \ \ | |_|_|_|/ / / / |/| | | | | | | externals: update Vulkan-Headers to v1.3.246 to fix -Werror=switch with system package
| * | | | | | | externals: update Vulkan-Headers to v1.3.246Jan Beich2023-04-011-0/+2
| | | | | | | |
* | | | | | | | Merge pull request #10005 from liamwhite/kernel-atomicsbunnei2023-04-012-39/+56
|\ \ \ \ \ \ \ \ | |/ / / / / / / |/| | | | | | | kernel: fix unbounded stack usage in atomics
| * | | | | | | kernel: fix unbounded stack usage in atomicsLiam2023-03-292-39/+56
| | | | | | | |
* | | | | | | | Fixes 'Continous' typoMax Dunbar2023-03-306-38/+38
| |_|/ / / / / |/| | | | | |
* | | | | | | Merge pull request #9505 from liamwhite/request-exitliamwhite2023-03-2948-61/+312
|\ \ \ \ \ \ \ | |/ / / / / / |/| | | | | | applets: implement RequestExit
| * | | | | | qt: implement RequestExit for appletsLiam2023-03-2538-69/+250
| | | | | | |
| * | | | | | applets: implement RequestExitLiam2023-03-2518-1/+71
| | | | | | |
* | | | | | | Merge pull request #10003 from german77/disconnectliamwhite2023-03-281-1/+2
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | service: hid: Silence warning on MergeSingleJoyAsDualJoy
| * | | | | | | service: hid: Silence warning on MergeSingleJoyAsDualJoyNarr the Reg2023-03-271-1/+2
| | |/ / / / / | |/| | | | |
* | | | | | | telemetry: Add waitpkg instructionMorph2023-03-271-0/+1
| | | | | | |
* | | | | | | x64: Simplify RDTSC on non-MSVC compilersMorph2023-03-272-16/+10
| | | | | | | | | | | | | | | | | | | | | | | | | | | | Co-Authored-By: liamwhite <liamwhite@users.noreply.github.com>
* | | | | | | core_timing: Make use of MicroSleep for x64 CPUsMorph2023-03-271-0/+8
| | | | | | | | | | | | | | | | | | | | | | | | | | | | For CPUs that support tpause, this should result in significant CPU power savings over thread yield in this spin wait.
* | | | | | | x64: Add MicroSleepMorph2023-03-273-0/+84
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | MicroSleep allows the processor to pause for a "short" amount of time (in the microsecond range). This is useful for spin-waiting that does not require nanosecond precision. This uses the new TPAUSE instruction introduced on Intel's newest processors as part of the waitpkg instructions. For CPUs that do not support waitpkg instructions, this is equivalent to yield(). Co-Authored-By: liamwhite <liamwhite@users.noreply.github.com>
* | | | | | | x64: cpu_detect: Add detection of waitpkg instructionsMorph2023-03-272-0/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | waitpkg introduces 3 instructions, UMONITOR, UMWAIT and TPAUSE.
* | | | | | | Merge pull request #10002 from german77/logliamwhite2023-03-271-2/+2
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | qt: Fix log softlock
| * | | | | | | qt: Fix log softlockNarr the Reg2023-03-271-2/+2
| |/ / / / / /
* | | | | | | Merge pull request #9984 from liamwhite/global-memoryliamwhite2023-03-2744-226/+185
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | memory: rename global memory references to application memory
| * | | | | | | memory: rename global memory references to application memoryLiam2023-03-2444-226/+185
| | | | | | | |
* | | | | | | | Merge pull request #9995 from german77/plainliamwhite2023-03-275-8/+37
|\ \ \ \ \ \ \ \ | |_|_|_|/ / / / |/| | | | | | | service: nfp: Add plain amiibo support
| * | | | | | | service: nfp: Add plain amiibo supportgerman772023-03-265-8/+37
| | |/ / / / / | |/| | | | |
* / | | | | | tests: mark integer literals as unsignedLiam2023-03-261-17/+20
|/ / / / / /
* | | / / / container_hash: use climitsLiam2023-03-261-0/+1
| |_|/ / / |/| | | |
* | | | | video_core/macro: Make use of Common::HashValueMorph2023-03-261-3/+3
| | | | |
* | | | | tests: Implement tests for verifying HashValueMorph2023-03-262-0/+42
| | | | | | | | | | | | | | | | | | | | Values were randomly generated and the verification was done against boost 1.79.
* | | | | common: Port boost's hash_value implementationMorph2023-03-262-0/+92
| |/ / / |/| | | | | | | | | | | Ports a small subset of boost's hash_value implementation (<= 1.80.0).
* | | | Merge pull request #9985 from liamwhite/funny-memebunnei2023-03-251-1/+1
|\ \ \ \ | | | | | | | | | | vulkan: fix scheduler chunk reserve
| * | | | vulkan: fix scheduler chunk reserveLiam2023-03-241-1/+1
| | | | |
* | | | | Pass GPU page table by referenceRoss Schlaikjer2023-03-251-31/+32
| | | | |
* | | | | Merge pull request #9983 from Morph1984/boostliamwhite2023-03-241-1/+1
|\ \ \ \ \ | | | | | | | | | | | | CMakeLists: Update boost to 1.81.0
| * | | | | zstd: Use ZSTD_getFrameContentSize instead of ZSTD_getDecompressedSizeMorph2023-03-241-1/+1
| | |/ / / | |/| | |
* | | | | Merge pull request #9981 from german77/nfp_connectliamwhite2023-03-244-4/+30
|\ \ \ \ \ | |_|/ / / |/| | | | nfc: Initialize device when controller is connected
| * | | | nfc: Initialize device when controller is connectedNarr the Reg2023-03-224-4/+30
| | | | |
* | | | | Merge pull request #9975 from liamwhite/more-waitingMorph2023-03-241-4/+5
|\ \ \ \ \ | |_|/ / / |/| | | | vulkan: fix more excessive waiting in scheduler
| * | | | vulkan: fix more excessive waiting in schedulerLiam2023-03-191-4/+5
| |/ / /
* | | | Merge pull request #9971 from Morph1984/qliamwhite2023-03-233-124/+215
|\ \ \ \ | | | | | | | | | | bounded_threadsafe_queue: Use simplified impl of bounded queue
| * | | | bounded_threadsafe_queue: Refactor PopMorph2023-03-221-140/+62
| | | | | | | | | | | | | | | | | | | | Introduces PopModes to bring waiting logic into Pop, similar to Push.
| * | | | bounded_threadsafe_queue: Add producer cv to avoid busy waitingMorph2023-03-221-17/+29
| | | | |
| * | | | bounded_threadsafe_queue: Deduplicate and add PushModesMorph2023-03-223-88/+86
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Adds the PushModes Try and Wait to allow producers to specify how they want to push their data to the queue if the queue is full. If the queue is full: - Try will fail to push to the queue, returning false. Try only returns true if it successfully pushes to the queue. This may result in items not being pushed into the queue. - Wait will wait until a slot is available to push to the queue, resulting in potential for deadlock if a consumer is not running.
| * | | | bounded_threadsafe_queue: Add TryPushMorph2023-03-221-0/+71
| | | | |
| * | | | logging: Make use of bounded queueMorph2023-03-221-8/+8
| | | | |
| * | | | bounded_threadsafe_queue: Use simplified impl of bounded queueMorph2023-03-222-115/+203
| | | | | | | | | | | | | | | | | | | | Provides a simplified SPSC, MPSC, and MPMC bounded queue implementation using mutexes.
* | | | | Merge pull request #9964 from liamwhite/typed-addressliamwhite2023-03-23101-1102/+1574
|\ \ \ \ \ | | | | | | | | | | | | kernel: use KTypedAddress for addresses
| * | | | | kernel: use KTypedAddress for addressesLiam2023-03-22101-1102/+1574
| | | | | |
* | | | | | Merge pull request #9962 from Kelebek1/disable_srgbMorph2023-03-231-6/+8
|\ \ \ \ \ \ | | | | | | | | | | | | | | [video_core] Disable SRGB border color conversion in samplers
| * | | | | | Disable SRGB border color conversion for now, to fix shadows in Xenoblade.Kelebek12023-03-171-6/+8
| |/ / / / /
* | | | | | Merge pull request #9965 from german77/thankYouEpicBoybunnei2023-03-221-0/+3
|\ \ \ \ \ \ | |_|/ / / / |/| | | | | config: Fix controller config from resetting
| * | | | | config: Fix controller config from resettingNarr the Reg2023-03-181-0/+3
| |/ / / /
* | | | | Merge pull request #9970 from bunnei/string-util-viewbunnei2023-03-192-11/+11
|\ \ \ \ \ | | | | | | | | | | | | common: string_util: Use std::string_view for UTF16ToUTF8/UTF8ToUTF16W.
| * | | | | common: string_util: Use std::string_view for UTF16ToUTF8/UTF8ToUTF16W.bunnei2023-03-192-11/+11
| | |/ / / | |/| | |
* / | | | kernel: fix LOG_TRACE in ipcLiam2023-03-191-1/+1
|/ / / /
* | | | common: bounded_threadsafe_queue: Use polyfill_thread.bunnei2023-03-181-2/+3
| | | |
* | | | Merge pull request #9778 from behunin/my-box-chevybunnei2023-03-182-3/+4
|\ \ \ \ | | | | | | | | | | gpu_thread: Use bounded queue
| * | | | gpu_thread: Use bounded queueBehunin2023-03-042-3/+4
| | | | |
* | | | | Merge pull request #9953 from german77/amiibo_crcbunnei2023-03-187-52/+157
|\ \ \ \ \ | |_|/ / / |/| | | | service: nfp: Actually write correct crc
| * | | | service: nfp: Replace crc function with boost equivalentNarr the Reg2023-03-172-28/+17
| | | | |
| * | | | service: nfp: Close app area and recreate crcNarr the Reg2023-03-161-0/+10
| | | | |
| * | | | service: nfp: Convert mii colors to v3Narr the Reg2023-03-166-15/+100
| | | | |
| * | | | service: nfp: Actually write correct crcNarr the Reg2023-03-156-23/+44
| | | | |
* | | | | Merge pull request #9955 from liamwhite/color-blend-equationliamwhite2023-03-161-0/+6
|\ \ \ \ \ | | | | | | | | | | | | vulkan: disable extendedDynamicState3ColorBlendEquation on radv
| * | | | | vulkan: disable extendedDynamicState3ColorBlendEquation on radvLiam2023-03-151-0/+6
| |/ / / /
* | | | | Merge pull request #9931 from liamwhite/schedliamwhite2023-03-162-28/+62
|\ \ \ \ \ | |/ / / / |/| | | | vk_scheduler: split work queue waits and execution waits
| * | | | vk_scheduler: split work queue waits and execution waitsLiam2023-03-122-28/+62
| | | | |
* | | | | Merge pull request #9933 from vonchenplus/texture_formatliamwhite2023-03-143-72/+67
|\ \ \ \ \ | |_|_|/ / |/| | | | video_core: Update texture format
| * | | | video_core: Update texture formatFeng Chen2023-03-103-72/+67
| |/ / /
* | | | configure_audio: Fix output mode setting not savingMorph2023-03-132-9/+9
| | | |
* | | | Merge pull request #9939 from german77/vibrationliamwhite2023-03-131-1/+16
|\ \ \ \ | | | | | | | | | | input_common: sdl: Only send last vibration command
| * | | | input_common: sdl: Only send last vibration commandgerman772023-03-131-1/+16
| | | | |
* | | | | Merge pull request #9941 from german77/settingsliamwhite2023-03-137-98/+62
|\ \ \ \ \ | | | | | | | | | | | | yuzu: Move audio settings to audio section
| * | | | | yuzu: Move audio settings to audio sectiongerman772023-03-126-45/+56
| | | | | |
| * | | | | yuzu: Remove console id settinggerman772023-03-123-53/+6
| | | | | |
* | | | | | Merge pull request #9943 from vonchenplus/gentlemanliamwhite2023-03-133-2/+3
|\ \ \ \ \ \ | | | | | | | | | | | | | | video_core: Fix inline_index and draw_texture error
| * | | | | | video_core: Fix ogl status error when draw_textureFengChen2023-03-122-2/+2
| | | | | | |
| * | | | | | video_core: Invalid index_buffer flag when inline_index drawFengChen2023-03-121-0/+1
| | |_|/ / / | |/| | | |
* | | | | | kernel: additional style fixes to KThread, KProcessLiam2023-03-132-27/+27
| | | | | |
* | | | | | kernel: fix clang buildLiam2023-03-131-2/+2
| | | | | |
* | | | | | kernel: remove unnecessary finalize callsLiam2023-03-132-7/+1
| | | | | |
* | | | | | kernel: convert KProcess to new styleLiam2023-03-1310-240/+254
| | | | | |
* | | | | | kernel: convert KThread to new styleLiam2023-03-1315-670/+519
| | | | | |
* | | | | | kernel: prefer std::addressofLiam2023-03-1321-134/+139
| | | | | |
* | | | | | kernel: convert KResourceLimitLiam2023-03-132-59/+59
| | | | | |
* | | | | | kernel: remove kernel_Liam2023-03-1341-295/+290
| | | | | |
* | | | | | kernel: remove gratitutous attribute usageLiam2023-03-138-29/+24
| | | | | |
* | | | | | kernel/svc: convert to new styleLiam2023-03-1321-304/+192
| | | | | |
* | | | | | kernel: convert miscellaneousLiam2023-03-137-94/+81
| | | | | |
* | | | | | kernel: conver KScopedLock, KScopedResourceReservation, KSessionRequest, KSharedMemory, KSpinLockLiam2023-03-139-97/+99
| | | | | |
* | | | | | kernel: convert KAbstractSchedulerLockLiam2023-03-131-31/+24
| | | | | |
* | | | | | kernel: convert KMemoryLayout, KMemoryRegion*, KPageTableSlabHeap, KPriorityQueueLiam2023-03-136-121/+121
| | | | | |
* | | | | | kernel: move KMemoryLayout for NX boardLiam2023-03-132-1/+1
| | | | | |
* | | | | | kernel: remove KLinkedListLiam2023-03-135-245/+0
| | | | | |
* | | | | | kernel: convert KConditionVariable, KLightConditionVariable, KLightLockLiam2023-03-137-75/+77
| | | | | |
* | | | | | kernel: convert KPort, KSessionLiam2023-03-1328-226/+196
| | | | | |
* | | | | | kernel: convert GlobalSchedulerContext, KAddressArbiter, KScopedSchedulerLockAndSleep, KThreadQueue to new styleLiam2023-03-138-142/+130
| |_|/ / / |/| | | |
* | | | | general: fix spelling mistakesLiam2023-03-12102-206/+206
| | | | |
* | | | | Merge pull request #9913 from ameerj/acc-dma-refactorFernando S2023-03-1110-260/+208
|\ \ \ \ \ | | | | | | | | | | | | AccelerateDMA: Refactor Buffer/Image copy code and implement for OGL
| * | | | | gl_rasterizer: Implement AccelerateDMA DmaBufferImageCopyameerj2023-03-072-9/+52
| | | | | |
| * | | | | Refactor AccelerateDMA codeameerj2023-03-078-251/+156
| | | | | |
* | | | | | Merge pull request #9923 from liamwhite/khtliamwhite2023-03-108-15/+42
|\ \ \ \ \ \ | | | | | | | | | | | | | | kernel: add timer pointer to KThreadQueue
| * | | | | | kernel: add timer pointer to KThreadQueueLiam2023-03-088-15/+42
| | | | | | |
* | | | | | | Merge pull request #9928 from german77/super_nfpliamwhite2023-03-105-52/+234
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | service: nfp: Improve implementation
| * | | | | | | service: nfp: Improve implementationNarr the Reg2023-03-105-52/+234
| | |_|_|/ / / | |/| | | | |
* | | | | | | Merge pull request #9925 from ameerj/gl-sync-signalliamwhite2023-03-105-10/+16
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | OpenGL: Prefer glClientWaitSync for OGLSync objects
| * | | | | | | OpenGL: Prefer glClientWaitSync for OGLSync objectsameerj2023-03-095-10/+16
| | |_|/ / / / | |/| | | | | | | | | | | | | | | | | | | At least on Nvidia, glClientWaitSync with a timeout of 0 (non-blocking) is faster than glGetSynciv of GL_SYNC_STATUS.
* | | | | | | Merge pull request #9917 from Morph1984/the-real-timeliamwhite2023-03-1011-18/+83
|\ \ \ \ \ \ \ | |_|_|_|/ / / |/| | | | | | native_clock: Re-adjust the RDTSC frequency to its real frequency
| * | | | | | perf_stats: Check multicore firstMorph2023-03-081-2/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | SpeedLimiting is SC only. Since MC is performance oriented we should check for it first to skip checking use_speed_limit.
| * | | | | | hid: Use nanosecond timestamps instead of ticksMorph2023-03-082-5/+5
| | | | | | |
| * | | | | | core: Promote CPU/GPU threads to time criticalMorph2023-03-084-4/+4
| | | | | | | | | | | | | | | | | | | | | | | | | | | | And also demote Audren and CoreTiming to High thread priority.
| * | | | | | native_clock: Wait for 10 seconds instead of 30Morph2023-03-081-3/+3
| | | | | | | | | | | | | | | | | | | | | | | | | | | | It was experimentally determined to be sufficient.
| * | | | | | native_clock: Use RealTimeClock instead of SteadyClockMorph2023-03-081-4/+4
| | | | | | | | | | | | | | | | | | | | | | | | | | | | We want to synchronize RDTSC to real time.
| * | | | | | steady_clock: Introduce a real time clockMorph2023-03-082-0/+36
| | | | | | |
| * | | | | | native_clock: Re-adjust the RDTSC frequencyMorph2023-03-082-5/+34
| | |_|/ / / | |/| | | | | | | | | | | | | | | | | | | | | | The RDTSC frequency reported by CPUID is not accurate to its true frequency. We will spawn a separate thread to calculate the true RDTSC frequency after a measurement period of 30 seconds has elapsed.
* | | | | | Merge pull request #9916 from liamwhite/fpuliamwhite2023-03-093-1/+28
|\ \ \ \ \ \ | | | | | | | | | | | | | | kernel: clone fpu status on CreateThread
| * | | | | | kernel: clone fpu status on CreateThreadLiam2023-03-083-1/+28
| |/ / / / /
* | | | | | Merge pull request #9822 from ameerj/buffcache-ssbo-addrliamwhite2023-03-092-5/+27
|\ \ \ \ \ \ | |_|_|/ / / |/| | | | | buffer_cache: Add logic for non-NVN storage buffer tracking
| * | | | | buffer_cache: Add logic for non-NVN storage buffer trackingameerj2023-02-252-5/+27
| | | | | |
* | | | | | Merge pull request #9906 from german77/metroid2bunnei2023-03-083-10/+20
|\ \ \ \ \ \ | | | | | | | | | | | | | | input_common: Increase mouse sensitivity range
| * | | | | | input_common: Increase mouse sensitivity rangegerman772023-03-083-10/+20
| | | | | | |
* | | | | | | Merge pull request #9912 from liamwhite/errliamwhite2023-03-0835-183/+169
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | hle: rename legacy errors to Results
| * | | | | | | hle: rename legacy errors to ResultsLiam2023-03-0735-183/+169
| | |_|_|/ / / | |/| | | | |
* | | | | | | Merge pull request #9904 from liamwhite/wsliamwhite2023-03-081-16/+29
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | kernel: fix WaitSynchronization
| * | | | | | | kernel: fix WaitSynchronizationLiam2023-03-051-16/+29
| | |/ / / / / | |/| | | | |
* | | | | | | Merge pull request #9896 from Kelebek1/d24s8liamwhite2023-03-083-10/+16
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | Check all swizzle components for red, not just [0]
| * | | | | | | Check all swizzle components for red, not just [0], pass float border color rather than intKelebek12023-03-043-10/+16
| | | | | | | |
* | | | | | | | Merge pull request #9921 from liamwhite/overrideMorph2023-03-084-7/+7
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | general: fix type inconsistencies
| * | | | | | | | general: fix type inconsistenciesLiam2023-03-084-7/+7
| | |_|_|_|/ / / | |/| | | | | |
* | | | | | | | Merge pull request #9918 from liamwhite/fwrapvMorph2023-03-083-1/+25
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | kernel: avoid signed overflow UB on MSVC
| * | | | | | | | kernel: avoid signed overflow UB on MSVCLiam2023-03-083-1/+25
| |/ / / / / / /
* | | | | | | | Merge pull request #9920 from liamwhite/constexpr-bit-castMorph2023-03-081-9/+11
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | common: make BitCast constexpr
| * | | | | | | | common: make BitCast constexprLiam2023-03-081-9/+11
| |/ / / / / / /
* / / / / / / / input_common: Minor typo issues (#9922)Narr the Reg2023-03-088-48/+48
|/ / / / / / /
* | | | | | | Merge pull request #9889 from Morph1984/time-is-tickingliamwhite2023-03-0714-57/+322
|\ \ \ \ \ \ \ | |_|_|/ / / / |/| | | | | | core_timing: Reduce CPU usage on Windows
| * | | | | | native_clock: Round RDTSC frequency to the nearest 1000Morph2023-03-051-5/+12
| | | | | | |
| * | | | | | timer_resolution: Set current process to High QoSMorph2023-03-051-0/+22
| | | | | | | | | | | | | | | | | | | | | | | | | | | | Ensures that this process is treated as a high performance process by the Windows scheduler.
| * | | | | | hardware_properties: Update BASE_CLOCK_RATE to exactly 1020 MHzMorph2023-03-051-5/+3
| | | | | | |
| * | | | | | core_timing: Use higher precision sleeps on WindowsMorph2023-03-055-24/+47
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The precision of sleep_for and wait_for is limited to 1-1.5ms on Windows. Using SleepForOneTick() allows us to sleep for exactly one interval of the current timer resolution. This allows us to take advantage of systems that have a timer resolution of 0.5ms to reduce CPU overhead in the event loop.
| * | | | | | main: (Windows) Set the current timer resolution to the maximumMorph2023-03-052-0/+13
| | | | | | | | | | | | | | | | | | | | | | | | | | | | Increases the precision of thread sleeps on Windows.
| * | | | | | wall_clock: Make use of SteadyClockMorph2023-03-051-23/+11
| | | | | | |
| * | | | | | common: Implement a method to change the Windows timer resolutionMorph2023-03-053-0/+133
| | | | | | | | | | | | | | | | | | | | | | | | | | | | This utilizes undocumented NtDll functions to change the current timer resolution from the default of 1ms.
| * | | | | | common: Implement a high resolution steady clockMorph2023-03-053-0/+81
| | | | | | | | | | | | | | | | | | | | | | | | | | | | This implementation provides a consistent, high performance, and high resolution clock where/when std::chrono::steady_clock does not provide sufficient precision.
* | | | | | | Merge pull request #9890 from Kelebek1/reverb_fixliamwhite2023-03-063-6/+8
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | Fix a bug with the Reverb command in reading from the pre delay line
| * | | | | | | Fix a bug with the Reverb command in reading from the pre_delay line.Kelebek12023-03-023-6/+8
| | |/ / / / / | |/| | | | |
* | | | | | | Merge pull request #9910 from jbeich/libc++liamwhite2023-03-061-0/+1
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | kernel: add missing header for libc++
| * | | | | | | kernel: add missing header for libc++Jan Beich2023-03-061-0/+1
| | |_|/ / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | In file included from src/core/hle/kernel/k_light_lock.cpp:4: In file included from src/./core/hle/kernel/k_light_lock.h:8: src/./core/hle/kernel/k_scoped_lock.h:25:51: error: no member named 'addressof' in namespace 'std' explicit KScopedLock(T& l) : KScopedLock(std::addressof(l)) {} ~~~~~^
* | | | | | | Merge pull request #9905 from german77/usbsslliamwhite2023-03-063-62/+102
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | Service: USB, SSL, PSC: Update
| * | | | | | | service: psc: Update namesNarr the Reg2023-03-051-9/+9
| | | | | | | |
| * | | | | | | service: ssl: Add missing properties and update namesNarr the Reg2023-03-051-18/+58
| | | | | | | |
| * | | | | | | service: usb: Update namesNarr the Reg2023-03-051-35/+35
| |/ / / / / /
* | | | | | | Merge pull request #9907 from german77/joyconliamwhite2023-03-063-32/+84
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | input_common: joycon: Add stick input from passive reports
| * | | | | | | input_common: joycon: Add stick input from passive reportsgerman772023-03-053-32/+84
| |/ / / / / /
* | | | | | | Merge pull request #9908 from german77/pfpliamwhite2023-03-062-9/+20
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | service: acc: Replace default image with a 32x32 image
| * | | | | | | service: acc: Replace default image with a 32x32 imageNarr the Reg2023-03-052-9/+20
| |/ / / / / /
* / / / / / / fix typo in settings.hIkko Eltociear Ashimine2023-03-061-4/+4
|/ / / / / / | | | | | | | | | | | | Intial -> Initial
* | / / / / Engines: Implement Accelerate DMA Texture.Fernando Sahmkow2023-03-0515-97/+658
| |/ / / / |/| | | |
* | | | | Merge pull request #9884 from liamwhite/service-cleanupMorph2023-03-04181-2179/+2112
|\ \ \ \ \ | |_|_|/ / |/| | | | service: miscellaneous cleanups
| * | | | nvnflinger: fix nameLiam2023-03-0154-444/+443
| | | | |
| * | | | service: move hle_ipc from kernelLiam2023-03-01148-1734/+1669
| | | | |
| * | | | sm:: remove unused memberLiam2023-03-011-1/+0
| |/ / /
* | | | Merge pull request #9855 from liamwhite/kern-16-supportbunnei2023-03-0313-288/+510
|\ \ \ \ | | | | | | | | | | kernel: support for 16.0.0
| * | | | kernel: be more careful about kernel address keysLiam2023-03-015-11/+23
| | | | |
| * | | | kernel: refactor priority inheritance to represent locks as C++ objectsLiam2023-03-018-190/+436
| | | | |
| * | | | kernel: simplify AddressSpaceInfo, update valuesLiam2023-03-011-66/+13
| | | | |
| * | | | kernel: barrier memory before condition variable writeLiam2023-03-011-15/+15
| | | | |
| * | | | kernel: document previous location of interrupt disables in arbiter/condvarLiam2023-03-012-3/+9
| | | | |
| * | | | kernel: adjust pool allocationsLiam2023-03-012-7/+16
| | | | |
| * | | | kernel: simplify KAbstractSchedulerLock::LockLiam2023-03-011-5/+6
| | | | |
| * | | | kernel: add InfoType::IoRegionHintLiam2023-03-011-0/+1
| |/ / /
* / / / vulkan_common: disable vertexInputDynamicState on unsupported driverLiam2023-03-021-0/+1
|/ / /
* | | Merge pull request #9832 from liamwhite/hle-mpliamwhite2023-03-01141-1153/+1569
|\ \ \ | | | | | | | | service: HLE multiprocess
| * | | sm:: fix lingering session initialization issuesLiam2023-02-212-2/+19
| | | |
| * | | cheat_engine: add check for hid initializationLiam2023-02-211-2/+7
| | | |
| * | | sm:: support service registration deferralLiam2023-02-215-8/+151
| | | |
| * | | service: refactor server architectureLiam2023-02-21140-1143/+1393
| | | | | | | | | | | | | | | | Converts services to have their own processes
| * | | core: defer cpu shutdownLiam2023-02-211-3/+4
| | | |
* | | | cmake: use correct boost imported targetsAlexandre Bouvier2023-02-285-5/+5
| | | |
* | | | Merge pull request #9859 from liamwhite/tmem-useliamwhite2023-02-2821-75/+95
|\ \ \ \ | | | | | | | | | | service: avoid direct pointer access of transfer memory objects
| * | | | am: avoid direct pointer access of transfer memory objectsLiam2023-02-241-6/+4
| | | | |
| * | | | hid: avoid direct pointer access of transfer memory objectsLiam2023-02-2420-69/+91
| | | | |
* | | | | Merge pull request #9874 from german77/violetliamwhite2023-02-281-4/+8
|\ \ \ \ \ | | | | | | | | | | | | service: btm: Fix handle functions
| * | | | | service: btm: Fix handle functionsNarr the Reg2023-02-271-4/+8
| | | | | |
* | | | | | Merge pull request #9872 from goldenx86/partialLTOMatías Locatti2023-02-272-0/+8
|\ \ \ \ \ \ | |/ / / / / |/| | | | | Partial LTO
| * | | | | Partially apply LTO to only core and video_core projects.Matías Locatti2023-02-272-0/+8
| | | | | |
* | | | | | Revert "yuzu: config: Remove player 8 and 9 from config file"Narr the Reg2023-02-268-104/+38
|/ / / / /
* | | | | Merge pull request #9849 from ameerj/async-astcliamwhite2023-02-2615-8/+138
|\ \ \ \ \ | | | | | | | | | | | | texture_cache: Add asynchronous ASTC texture decoding
| * | | | | configuration: Add async ASTC decode settingameerj2023-02-2312-8/+49
| | | | | |
| * | | | | texture_cache: Add async texture decodingameerj2023-02-224-0/+89
| | | | | |
* | | | | | yuzu: config: Remove player 8 and 9 from config fileNarr the Reg2023-02-268-38/+104
| |_|_|/ / |/| | | |
* | | | | Merge pull request #9848 from german77/metroid_motionliamwhite2023-02-256-26/+115
|\ \ \ \ \ | | | | | | | | | | | | input_common: Implement dedicated motion from mouse
| * | | | | core: hid: Restore motion state on refresh and clamp motion valuesNarr the Reg2023-02-223-2/+30
| | | | | |
| * | | | | input_common: Implement dedicated motion from mouseNarr the Reg2023-02-223-24/+85
| |/ / / /
* | | | | Merge pull request #9857 from german77/fwupdateliamwhite2023-02-2513-2/+63
|\ \ \ \ \ | | | | | | | | | | | | core: Update service function tables to 16.0.0+
| * | | | | core: Update service function tables to 16.0.0+Narr the Reg2023-02-2513-2/+63
| | |/ / / | |/| | |
* | | | | Merge pull request #9861 from german77/bustypeliamwhite2023-02-252-15/+15
|\ \ \ \ \ | | | | | | | | | | | | core: hidbus: Fix BusType size
| * | | | | core: hidbus: Fix BusType sizeNarr the Reg2023-02-252-15/+15
| |/ / / /
* / / / / config: Fix per game Force max clockgerman772023-02-252-5/+1
|/ / / /
* | | | settings: Add more input settings to the logNarr the Reg2023-02-221-0/+7
| | | |
* | | | core: hid: Fix native mouse mappingsNarr the Reg2023-02-225-63/+62
|/ / /
* | | Merge pull request #9847 from german77/timeoutliamwhite2023-02-221-0/+2
|\ \ \ | | | | | | | | yuzu: Set a lower timeout for discord presence
| * | | yuzu: Set a lower timeout for discord presenceNarr the Reg2023-02-221-0/+2
| |/ /
* | | Merge pull request #9846 from merryhime/type-constliamwhite2023-02-2214-54/+54
|\ \ \ | | | | | | | | svc: Fix type consistency (exposed on macOS)
| * | | svc: Fix type consistency (exposed on macOS)Merry2023-02-2114-54/+54
| |/ /
* | | Merge pull request #9841 from abouvier/httplib-updateliamwhite2023-02-222-2/+2
|\ \ \ | | | | | | | | externals: Update cpp-httplib to latest
| * | | externals: Update cpp-httplib to latestAlexandre Bouvier2023-02-212-2/+2
| |/ /
* / / net: translate ECONNRESET network errorMonsterDruide12023-02-214-0/+8
|/ /
* | Qt: Reintroduce scaling for touch inputgerman772023-02-202-6/+16
| |
* | Merge pull request #9771 from ameerj/host-thread-idliamwhite2023-02-191-27/+18
|\ \ | | | | | | kernel: Refactor thread_local variable usage
| * | kernel: Refactor thread_local variable usageameerj2023-02-111-27/+18
| | | | | | | | | | | | | | | | | | On MSVC at least, there seems to be a non-trivial overhead to calling GetHostThreadId(). This slightly reworks the host_thread_id variable to reduce some of the complexity around its usage, along with some small refactors around current_thread and dummy thread
* | | Merge pull request #9588 from liamwhite/bylaws-revertsliamwhite2023-02-1910-34/+9
|\ \ \ | | | | | | | | Revert "shader_recompiler: Align SSBO offsets to meet host requirements"
| * | | Revert "shader_recompiler: Align SSBO offsets to meet host requirements"Liam2023-01-074-12/+6
| | | | | | | | | | | | | | | | This reverts commit 8804a4eb23e0c4f3e4bab03dee7c204bd38bf21e.
| * | | Revert "Vulkan, OpenGL: Hook up storage buffer alignment code"Liam2023-01-076-22/+3
| | | | | | | | | | | | | | | | This reverts commit 9e2997c4b6456031622602002924617690e32a13.
* | | | Merge pull request #9815 from german77/qt-mouseliamwhite2023-02-1811-47/+120
|\ \ \ \ | | | | | | | | | | Qt: Fix mouse scalling
| * | | | input_common: Split mouse input into individual devicesNarr the Reg2023-02-1610-31/+114
| | | | |
| * | | | Qt: Fix mouse scallinggerman772023-02-162-18/+8
| | | | |
* | | | | Merge pull request #9825 from liamwhite/object-nameMorph2023-02-187-3/+265
|\ \ \ \ \ | | | | | | | | | | | | kernel: add KObjectName
| * | | | | kernel: add KObjectNameLiam2023-02-177-3/+265
| | | | | |
* | | | | | Merge pull request #9810 from Kelebek1/nvdec_threadsbunnei2023-02-171-0/+2
|\ \ \ \ \ \ | | | | | | | | | | | | | | Allow >1 cpu threads on video decoding, disable multi-frame decoding
| * | | | | | Allow >1 cpu threads on video decoding, disable multi-frame decodingKelebek12023-02-141-0/+2
| | | | | | |
* | | | | | | Merge pull request #9817 from german77/saveMai2023-02-174-2/+11
|\ \ \ \ \ \ \ | |_|/ / / / / |/| | | | | | yuzu: Write to config file on important config changes
| * | | | | | yuzu: Shutdown game on restart to reload per game configNarr the Reg2023-02-171-2/+4
| | | | | | |
| * | | | | | yuzu: Write to config file on important config changesNarr the Reg2023-02-174-0/+7
| | |/ / / / | |/| | | |
* | | | | | Merge pull request #9802 from Kelebek1/wait_data_cachebunnei2023-02-161-0/+4
|\ \ \ \ \ \ | | | | | | | | | | | | | | Re-add the invalidate_texture_data_cache register
| * | | | | | Reimplement the invalidate_texture_data_cache registerKelebek12023-02-141-0/+4
| | |/ / / / | |/| | | |
* | | | | | Merge pull request #9769 from Kelebek1/audio_oobbunnei2023-02-162-40/+92
|\ \ \ \ \ \ | |_|/ / / / |/| | | | | [audio_core] Fix depop prepare
| * | | | | Add fallback for memory read/write in case the address goes over a 4K pageKelebek12023-02-111-12/+64
| | | | | |
| * | | | | Fix depop prepare receiving bad mix infos and writing out of bounds, and update aux a bit, may helpKelebek12023-02-112-40/+40
| | | | | |
* | | | | | Merge pull request #9796 from liamwhite/currentliamwhite2023-02-1572-291/+315
|\ \ \ \ \ \ | | | | | | | | | | | | | | general: rename CurrentProcess to ApplicationProcess
| * | | | | | general: rename CurrentProcess to ApplicationProcessLiam2023-02-1441-164/+169
| | | | | | |
| * | | | | | kernel: use GetCurrentProcessLiam2023-02-1334-128/+147
| | |/ / / / | |/| | | |
* | | | | | Merge pull request #9782 from arades79/fix-consexpr-value-declaration-usageliamwhite2023-02-1526-60/+54
|\ \ \ \ \ \ | | | | | | | | | | | | | | Fix consexpr value declaration usage
| * | | | | | remove constexpr from virtual functionarades792023-02-152-5/+5
| | | | | | | | | | | | | | | | | | | | | | | | | | | | Signed-off-by: arades79 <scravers@protonmail.com>
| * | | | | | use a string view to skip allocationarades792023-02-142-13/+7
| | | | | | | | | | | | | | | | | | | | | | | | | | | | Signed-off-by: arades79 <scravers@protonmail.com>
| * | | | | | remove static from pointer sized or smaller types for aesthetics, change constexpr static to static constexpr for consistencyarades792023-02-14102-307/+300
| | | | | | | | | | | | | | | | | | | | | | | | | | | | Signed-off-by: arades79 <scravers@protonmail.com>
| * | | | | | apply clang-formatarades792023-02-142-4/+5
| | | | | | | | | | | | | | | | | | | | | | | | | | | | Signed-off-by: arades79 <scravers@protonmail.com>
| * | | | | | don't use static inside constexpr functionarades792023-02-141-6/+6
| | | | | | | | | | | | | | | | | | | | | | | | | | | | Signed-off-by: arades79 <scravers@protonmail.com>
| * | | | | | add static lifetime to constexpr values to force compile time evaluation where possiblearades792023-02-14101-303/+309
| | | | | | | | | | | | | | | | | | | | | | | | | | | | Signed-off-by: arades79 <scravers@protonmail.com>
* | | | | | | Merge pull request #9809 from liamwhite/unused-servicebunnei2023-02-1524-621/+0
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | service: remove deleted services
| * | | | | | | service: remove deleted servicesLiam2023-02-1424-621/+0
| |/ / / / / /
* / / / / / / Revert "main: Fix borderless fullscreen for high dpi scaled displays"liamwhite2023-02-141-13/+1
|/ / / / / /
* | | | | | Merge pull request #9795 from Kelebek1/biquad_fixliamwhite2023-02-141-2/+2
|\ \ \ \ \ \ | | | | | | | | | | | | | | [audio_core] Use different state offset for each biquad filter channel
| * | | | | | Fix biquad filter command's state buffer offsetKelebek12023-02-131-2/+2
| |/ / / / /
* | | | | | Merge pull request #9793 from Morph1984/borderless-hidpiliamwhite2023-02-141-1/+13
|\ \ \ \ \ \ | |/ / / / / |/| | | | | main: Fix borderless fullscreen for high dpi scaled displays
| * | | | | main: Fix borderless fullscreen for high dpi scaled displaysMorph2023-02-131-1/+13
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | On Windows, a borderless window will be treated the same as exclusive fullscreen when the window geometry matches the physical dimensions of the screen. However, with High DPI scaling, when the devicePixelRatioF() is > 1, the borderless window apparently is not treated as exclusive fullscreen and functions correctly. One can verify and replicate this behavior by using a high resolution (4K) display, and switching between 100% and 200% scaling in Windows' display settings. At 100%, without the addition of 1, it is treated as exclusive fullscreen. At 200%, with or without the addition of 1, it is treated as borderless windowed. Therefore, we can use (read: abuse) this difference in behavior to fix this issue for those with higher resolution displays when the Qt scaling ratio is > 1. Should this behavior be changed in the future, please revisit this workaround.
* | | | | | Merge pull request #9784 from m-HD/masterbunnei2023-02-131-0/+4
|\ \ \ \ \ \ | |/ / / / / |/| | | | | settings: added missing graphical settings to RestoreGlobalState()
| * | | | | Update settings.cppm-HD2023-02-121-0/+4
| | | | | | | | | | | | | | | | | | added missing graphical settings to RestoreGlobalState()
* | | | | | Merge pull request #9757 from german77/gyrobunnei2023-02-128-21/+67
|\ \ \ \ \ \ | | | | | | | | | | | | | | core: hid: Use gyro thresholds modes set by the game
| * | | | | | core: hid: Use gyro thresholds modes set by the gameNarr the Reg2023-02-108-21/+67
| | | | | | |
* | | | | | | Merge pull request #9746 from ameerj/ogl-msaa-texcachebunnei2023-02-1212-14/+136
|\ \ \ \ \ \ \ | |_|/ / / / / |/| | | | | | texture_cache: OpenGL: Implement MSAA uploads and copies
| * | | | | | texture_cache: OpenGL: Implement MSAA uploads and copiesameerj2023-02-1112-14/+136
| | | | | | |
* | | | | | | kernel/svc: Fix undefined info_idColin Kinloch2023-02-111-2/+2
| | | | | | |
* | | | | | | Merge pull request #9777 from vonchenplus/speed_up_video_copyliamwhite2023-02-111-9/+5
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | video_core: Speed up video frame data copy
| * | | | | | | video_core: Speed up video frame data copyFengChen2023-02-111-9/+5
| | | | | | | |
* | | | | | | | Merge pull request #9773 from bunnei/fix-process-resourceliamwhite2023-02-113-1/+15
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | core: kernel: k_process: Use application system resource.
| * | | | | | | | core: kernel: k_process: Use application system resource.bunnei2023-02-113-1/+15
| |/ / / / / / /
* | | | | | | | Merge pull request #9768 from merryhime/biquad-roundingliamwhite2023-02-112-27/+19
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | biquad_filter: Fix rounding in ApplyBiquadFilterInt
| * | | | | | | | biquad_filter: Clamp f64 in ApplyBiquadFilterFloatMerry2023-02-101-3/+3
| | | | | | | | |
| * | | | | | | | biquad_filter: Fix rounding in ApplyBiquadFilterIntMerry2023-02-102-24/+16
| |/ / / / / / /
* | | | | | | | Merge pull request #9744 from behunin/quick-releaseliamwhite2023-02-113-14/+2
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | gpu_thread: Remove OnCommandListEndCommand
| * | | | | | | | Remove OnCommandListEndCommandBehunin2023-02-083-14/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Call rasterizer->ReleaseFences() directly
* | | | | | | | | Merge pull request #9742 from liamwhite/svc-wrap-onlybunnei2023-02-1145-1570/+7468
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | kernel/svc: switch to generated wrappers
| * | | | | | | | | kernel/svc: switch to generated wrappersLiam2023-02-0745-1570/+7468
| | | | | | | | | |
* | | | | | | | | | Merge pull request #9759 from german77/pro_controllerbunnei2023-02-119-7/+92
|\ \ \ \ \ \ \ \ \ \ | |_|_|/ / / / / / / |/| | | | | | | | | input_common: Reintroduce custom pro controller support
| * | | | | | | | | input_common: Reintroduce custom pro controller supportNarr the Reg2023-02-109-7/+92
| | |_|_|_|_|_|/ / | |/| | | | | | |
* | | | | | | | | Merge pull request #9761 from Morph1984/oopsliamwhite2023-02-101-0/+2
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | main: Re-add QtWebEngine zoom factor
| * | | | | | | | | main: Re-add QtWebEngine zoom factorMorph2023-02-101-0/+2
| | |_|_|_|_|/ / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | For some reason, I had removed this in https://github.com/yuzu-emu/yuzu/pull/4949/commits/ad6cec71ecd61aa2533d9efa89b68837516f8464 This should fix any improperly scaled web applets.
* / | | | | | | | kernel: avoid usage of bit_castLiam2023-02-101-2/+2
|/ / / / / / / /
* | | | | | | | Merge pull request #9736 from Kelebek1/dynamic_vertex_attribsliamwhite2023-02-101-25/+1
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | Remove fake vertex bindings when dynamic state is enabled
| * | | | | | | | Remove fake vertex bindings when dynamic state is enabledKelebek12023-02-051-25/+1
| | | | | | | | |
* | | | | | | | | Merge pull request #9750 from ameerj/glsl-sample-id-maskliamwhite2023-02-101-6/+0
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | glsl_emit_context: Remove redeclarations of gl_SampleID and gl_SampleMask
| * | | | | | | | | glsl_emit_context: Remove redeclarations of gl_SampleID and gl_SampleMaskameerj2023-02-091-6/+0
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | These built-ins seem to be available without needing to be declared for fragment shaders, similar i.e. to gl_FragDepth
* | | | | | | | | | audio: cubeb: Fix yuzu crashing when it test for latencyNarr the Reg2023-02-101-0/+20
| |_|/ / / / / / / |/| | | | | | | |
* | | | | | | | | buffer_base: Partially revert changes from #9559ameerj2023-02-092-7/+9
|/ / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | This fixes a regression where Yoshi's Crafted World (and potentially other titles) would enter an infinite loop when GPU Accuracy was set to "Normal"
* | | | | | | | Merge pull request #9747 from german77/SetSupportedNpadIdTypesliamwhite2023-02-084-6/+15
|\ \ \ \ \ \ \ \ | | |_|_|_|/ / / | |/| | | | | | service: hid: Return error if arguments of SetSupportedNpadIdType is invalid
| * | | | | | | service: hid: Return error if arguments of SetSupportedNpadIdType is invalidNarr the Reg2023-02-084-6/+15
| | |_|/ / / / | |/| | | | |
* | | | | | | Merge pull request #9739 from liamwhite/old-gcc-fixMai2023-02-082-4/+5
|\ \ \ \ \ \ \ | |/ / / / / / |/| | | | | | kernel: fix compilation with older gcc
| * | | | | | kernel: fix compilation with older gccLiam2023-02-062-4/+5
| | | | | | |
* | | | | | | Merge pull request #4949 from Morph1984/hidpi-temp-fixliamwhite2023-02-073-8/+65
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | main: Enable High DPI fixes for Qt >= 5.14
| * | | | | | | main: Convert to device independent coordinates for scalingMorph2023-01-263-8/+13
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | devicePixelRatioF() returns the scaling ratio when high dpi scaling is enabled. When high dpi scaling is enabled, the raw screen coordinate system is scaled to device independent coordinates.
| * | | | | | | main: Use passthrough scaling for non-windows OSesMorph2023-01-261-3/+12
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | They should be better than windows when handling fractional scaling ratios.
| * | | | | | | main: Enable High DPI fixes for Qt >= 5.14Morph2023-01-261-0/+43
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This uses Qt's new high DPI application attributes for scaling the current window. However, these aren't perfect as scaling with non integer scales will cause artifacts in UI, icons and other elements. Therefore, we use a heuristic to select an appropriate integer scale value depending on the current screen resolution and applies this to the application.
* | | | | | | | Merge pull request #9644 from SaiKai/volume_quicksettingbunnei2023-02-072-24/+90
|\ \ \ \ \ \ \ \ | |_|/ / / / / / |/| | | | | | | add volume quicksetting with volume slider
| * | | | | | | remove disambiguation argument from mute textJonas Gutenschwager2023-02-041-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | Co-authored-by: Morph <39850852+Morph1984@users.noreply.github.com>
| * | | | | | | add volume quicksetting with volume sliderJonas Gutenschwager2023-01-192-24/+90
| | | | | | | |
* | | | | | | | Update yuzu_cmd's default_ini.hMatías Locatti2023-02-061-7/+10
| |_|_|/ / / / |/| | | | | | | | | | | | | Rename FSR, add missing resolution multipliers, and SMAA
* | | | | | | kernel/svc: Split implementations into separate filesLiam2023-02-0540-2688/+3196
| | | | | | |
* | | | | | | Merge pull request #9720 from SoRadGaming/discordPresenceUpdatebunnei2023-02-052-8/+61
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | Game Image with Discord RPC
| * | | | | | | Add Game Icon for Discord RPCSorab2023-02-052-8/+61
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Connected to Yuzu Compatibility Page
* | | | | | | | Merge pull request #9730 from german77/cmd_argliamwhite2023-02-041-19/+36
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | yuzu_cmd: Order arguments alphabetically and port arguments from Qt
| * | | | | | | | yuzu_cmd: Order arguments alphabetically and port arguments from Qtgerman772023-02-041-19/+36
| | | | | | | | |
* | | | | | | | | Merge pull request #9729 from german77/sdl_inputliamwhite2023-02-044-35/+39
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | yuzu_cmd: Fix touch and controller input
| * | | | | | | | | yuzu_cmd: Fix mismatching controller inputgerman772023-02-043-2/+18
| | | | | | | | | |
| * | | | | | | | | yuzu_cmd: Fix touch inputgerman772023-02-042-33/+21
| |/ / / / / / / /
* | | | | / / / / shader_recompiler/value.h: Remove lingering references to S32ameerj2023-02-041-11/+0
| |_|_|_|/ / / / |/| | | | | | |
* | | | | | | | Merge pull request #9717 from german77/less_is_betterbunnei2023-02-041-32/+13
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | input_common: Simplify stick from button
| * | | | | | | | input_common: Simplify stick from buttonNarr the Reg2023-02-021-32/+13
| |/ / / / / / /
* | | | | | | | fsp_srv: Copy HLE Read Buffer for OutputAccessLogToSdCardameerj2023-02-031-1/+1
| | | | | | | |
* | | | | | | | Revert "Merge pull request #9718 from yuzu-emu/revert-9508-hle-ipc-buffer-span"ameerj2023-02-0361-326/+368
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This reverts commit 25fc5c0e1158cb8e81cbc769b24ad84032a1fbfd, reversing changes made to af20e25081f97d55b451606c87922e2b49f0d363.
* | | | | | | | Merge pull request #9713 from unfamiliarplace/masterMai2023-02-033-0/+25
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | Added 'Hide empty rooms' toggle to lobby
| * | | | | | | | added 'Hide empty rooms' toggle to lobbyLuke Sawczak2023-02-033-0/+25
| |/ / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | fixed typo fixed typo fixed typo clang
* | | | | | | | Merge pull request #9718 from yuzu-emu/revert-9508-hle-ipc-buffer-spanbunnei2023-02-0361-368/+326
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | Revert "hle_ipc: Use std::span to avoid heap allocations/copies when calling ReadBuffer"
| * | | | | | | | Revert "hle_ipc: Use std::span to avoid heap allocations/copies when calling ReadBuffer"liamwhite2023-02-0261-368/+326
| |/ / / / / / /
* | | | | | | | Merge pull request #9704 from liamwhite/dasbunnei2023-02-036-0/+232
|\ \ \ \ \ \ \ \ | |/ / / / / / / |/| | | | | | | kernel: add KDeviceAddressSpace
| * | | | | | | kernel: add KDeviceAddressSpaceLiam2023-02-016-0/+232
| | | | | | | |
* | | | | | | | Merge pull request #9708 from ameerj/gl-context-flushliamwhite2023-02-026-16/+49
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | gl_shader_cache: Force context flush when loading disk shader cache
| * | | | | | | | gl_compute_pipeline: Force context flush when loading shader cacheameerj2023-01-304-7/+37
| | | | | | | | |
| * | | | | | | | gl_graphics_pipeline: Force context flush when loading shader cacheameerj2023-01-304-9/+12
| | | | | | | | |
* | | | | | | | | Merge pull request #9703 from ameerj/txq-msliamwhite2023-02-025-18/+51
|\ \ \ \ \ \ \ \ \ | |_|/ / / / / / / |/| | | | | | | | shaders: Fix TXQ with MSAA textures
| * | | | | | | | spirv: Fix TXQ with MSAA texturesameerj2023-01-293-8/+19
| | | | | | | | |
| * | | | | | | | emit_glasm_image: Fix TXQ with MSAA texturesameerj2023-01-291-1/+9
| | | | | | | | |
| * | | | | | | | emit_glsl_image: Implement TXQ with MSAA texturesameerj2023-01-291-9/+23
| |/ / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | Also fixes for texture buffers, which do not have mips eithers.
* | | | | | | | Merge pull request #9696 from german77/please_forgive_me_for_this_sinbunnei2023-02-018-32/+138
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | input_common: Implement turbo buttons
| * | | | | | | | yuzu: config: Draw turbo buttons with a different colorgerman772023-02-012-14/+23
| | | | | | | | |
| * | | | | | | | input_common: Implement turbo buttonsgerman772023-02-016-18/+115
| | | | | | | | |
* | | | | | | | | Merge pull request #9697 from liamwhite/kcapbunnei2023-01-316-0/+738
|\ \ \ \ \ \ \ \ \ | |_|_|_|_|_|/ / / |/| | | | | | | | kernel: add KCapabilities
| * | | | | | | | kernel: add KCapabilitiesLiam2023-01-306-0/+738
| | |_|/ / / / / | |/| | | | | |
* | | | | | | | Merge pull request #9508 from ameerj/hle-ipc-buffer-spanbunnei2023-01-3061-326/+368
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | hle_ipc: Use std::span to avoid heap allocations/copies when calling ReadBuffer
| * | | | | | | | hle_ipc: Use thread_local ReadBufferameerj2022-12-291-4/+14
| | | | | | | | |
| * | | | | | | | hle_ipc: Rename ReadBufferSpan to ReadBufferameerj2022-12-2933-97/+97
| | | | | | | | |
| * | | | | | | | hle_ipc: Rename ReadBuffer to ReadBufferCopyameerj2022-12-293-4/+6
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Indicates explicitly that a copy is occurring
| * | | | | | | | bsd: Use std::span for read payloadsameerj2022-12-296-36/+38
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Allows the use of HLERequestContext::ReadBufferSpan
| * | | | | | | | nvdrv: Use std::span for inputsameerj2022-12-2924-211/+209
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Allows the use of HLERequestContext::ReadBufferSpan
| * | | | | | | | hidbus: Use ReadBufferSpanameerj2022-12-2911-12/+16
| | | | | | | | |
| * | | | | | | | nvflinger: Split Parcel class into InputParcel and OutputParcelameerj2022-12-255-48/+53
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The usages of the Parcel class were already unique to either Read or Write operations. Avoids needing a vector of the input payload for the InputParcel use-case, instead it can remain as a span.
| * | | | | | | | service: Use ReadBufferSpan where it is trivial to do soameerj2022-12-2531-77/+78
| | | | | | | | |
| * | | | | | | | fsp_srv: Use ReadBufferSpanameerj2022-12-253-19/+17
| | | | | | | | |
| * | | | | | | | hle_ipc: Add ReadBufferSpan functionameerj2022-12-252-0/+22
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Returns a std::span to the buffer address, rather than create a copy of the memory into a std::vector
* | | | | | | | | Merge pull request #9701 from german77/common_protocolliamwhite2023-01-3012-190/+269
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | input_common: joycon: Remove Magic numbers from common protocol
| * | | | | | | | | input_common: joycon: Remove Magic numbers from common protocolNarr the Reg2023-01-309-154/+221
| | | | | | | | | |
| * | | | | | | | | input_common: joycon: Fill missing enum dataNarr the Reg2023-01-306-41/+53
| | |_|/ / / / / / | |/| | | | | | |
* | | | | | | | | Merge pull request #9631 from vonchenplus/vulkan_clearliamwhite2023-01-306-20/+152
|\ \ \ \ \ \ \ \ \ | |/ / / / / / / / |/| | | | | | | | video_core: Implement vulkan clear specified channel
| * | | | | | | | video_core: Implement vulkan clear specified channelFengChen2023-01-286-20/+152
| | | | | | | | |
* | | | | | | | | Move to Clang Format 15Levi Behunin2023-01-3025-189/+185
| |_|_|/ / / / / |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Depends on https://github.com/yuzu-emu/build-environments/pull/69 clang-15 primary run
* | | | | | | | Merge pull request #9699 from ameerj/texture-pass-descliamwhite2023-01-291-2/+9
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | texture_pass: Fix texture descriptors comparisons
| * | | | | | | | texture_pass: Fix texture descriptors comparisonsameerj2023-01-291-2/+9
| | | | | | | | |
* | | | | | | | | Merge pull request #9698 from ameerj/texture-pass-handleliamwhite2023-01-291-7/+7
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | texture_pass: Refactor texture handle retrieval
| * | | | | | | | | texture_pass: Refactor texture handle retrievalameerj2023-01-291-7/+7
| | | | | | | | | |
* | | | | | | | | | Merge pull request #9694 from ameerj/txq-mipsliamwhite2023-01-2911-29/+37
|\ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | shader_recompiler: TXQ: Skip QueryLevels when possible
| * | | | | | | | | | shader_recompiler: TXQ: Skip QueryLevels when possibleameerj2023-01-2811-29/+37
| | |/ / / / / / / / | |/| | | | | | | |
* | | | | | | | | | Merge pull request #9684 from liamwhite/read-the-specliamwhite2023-01-291-37/+46
|\ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | polyfill_thread: satisfy execution ordering requirements of stop_callback
| * | | | | | | | | | polyfill_thread: satisfy execution ordering requirements of stop_callbackLiam2023-01-281-37/+46
| | |_|/ / / / / / / | |/| | | | | | | |
* | | | | | | | | | Merge pull request #9689 from german77/joycon-calibrationbunnei2023-01-296-114/+215
|\ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | input_common: joycon: Remove magic numbers from calibration protocol
| * | | | | | | | | | input_common: joycon: Replace ReadSPI vector with spanNarr the Reg2023-01-283-20/+26
| | | | | | | | | | |
| * | | | | | | | | | input_common: joycon: Remove magic numbers from calibration protocolNarr the Reg2023-01-286-107/+202
| | |/ / / / / / / / | |/| | | | | | | |
* | | | | | | | | | Merge pull request #9691 from ameerj/msaa-texcachebunnei2023-01-292-0/+48
|\ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | texture_cache: Fix tracking of MSAA image views
| * | | | | | | | | | texture_cache: Adjust image view sizes by MSAA samplesameerj2023-01-282-0/+48
| |/ / / / / / / / /
* | | | | | | | | | Merge pull request #9690 from german77/whoopsliamwhite2023-01-291-2/+5
|\ \ \ \ \ \ \ \ \ \ | |_|_|/ / / / / / / |/| | | | | | | | | yuzu: config: Avoid reading deleted object
| * | | | | | | | | yuzu: config: Avoid reading deleted objectNarr the Reg2023-01-281-2/+5
| |/ / / / / / / /
* | | | | | | | | Merge pull request #9687 from ameerj/ogl-shader-msbunnei2023-01-294-33/+46
|\ \ \ \ \ \ \ \ \ | |_|_|_|/ / / / / |/| | | | | | | | glasm, glsl: Implement multisampled Image Fetch
| * | | | | | | | emit_glsl_image: Fix ImageFetch for MSAA texturesameerj2023-01-281-6/+11
| | | | | | | | |
| * | | | | | | | glasm: Add MS sampler typesameerj2023-01-272-5/+8
| | | | | | | | |
| * | | | | | | | glsl: Add MS sampler typesameerj2023-01-271-22/+27
| |/ / / / / / /
* | | | | | | | Merge pull request #9682 from ameerj/shader-s32bunnei2023-01-2813-46/+19
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | shader_recompiler: Remove S32 IR type
| * | | | | | | | shader_recompiler: Remove S32 IR typeameerj2023-01-2613-46/+19
| | |_|_|_|_|_|/ | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The frontend IR opcodes do not distinguish between signed and unsigned integer types. Fixes broken shaders when IR validation/graphics debugging is enabled for shaders that used BitCastS32F32
* | | | | | | | Merge pull request #9661 from SoRadGaming/LDNhostnameSupportliamwhite2023-01-283-31/+38
|\ \ \ \ \ \ \ \ | |_|_|/ / / / / |/| | | | | | | LDN hostname support in direct connect
| * | | | | | | LDN Hostname Support in Direct ConnectSoRadGaming2023-01-283-31/+38
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | - Added IPv6 & Namespace support in direct connection Regex - Updated Tooltip for Direct Connect UI - Removed Dropdown Connection Type in Direct Connect
* | | | | | | | Merge pull request #9677 from Morph1984/sleep-onebunnei2023-01-283-5/+42
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | polyfill_thread: Implement StoppableTimedWait
| * | | | | | | | input_common: Make use of StoppableTimedWaitMorph2023-01-252-5/+6
| | | | | | | | |
| * | | | | | | | polyfill_thread: Implement StoppableTimedWaitMorph2023-01-251-0/+36
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | StoppableTimedWait allows for a timed wait to be stopped immediately after a stop is requested. This is useful in cases where long duration thread sleeps are needed and allows for immediate joining of waiting threads after a stop is requested. Co-Authored-By: liamwhite <liamwhite@users.noreply.github.com>
* | | | | | | | | Merge pull request #9539 from Wollnashorn/opengl-fsrliamwhite2023-01-2814-172/+547
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | video_core/opengl: Added FSR upscaling filter to the OpenGL renderer
| * | | | | | | | | video_core/opengl: Add FSR upscaling filter to the OpenGL rendererWollnashorn2023-01-2614-172/+547
| | | | | | | | | |
* | | | | | | | | | Merge pull request #9666 from liamwhite/wait-for-mebunnei2023-01-286-42/+52
|\ \ \ \ \ \ \ \ \ \ | |_|_|_|_|/ / / / / |/| | | | | | | | | kernel: fix incorrect locking order in suspension
| * | | | | | | | | kernel: split SetAddressKey into user and kernel variantsLiam2023-01-245-11/+29
| | | | | | | | | |
| * | | | | | | | | kernel: fix incorrect locking order in suspensionLiam2023-01-233-31/+23
| | | | | | | | | |
* | | | | | | | | | kernel: unbreak min/max template deduction on Apple ClangLiam2023-01-261-2/+2
| | | | | | | | | |
* | | | | | | | | | Merge pull request #9683 from german77/high_power_joyconbunnei2023-01-264-0/+21
|\ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | input_common: Implement SetLowPowerMode and TriggersElapsed
| * | | | | | | | | | input_common: Implement SetLowPowerMode and TriggersElapsed for the joycon driverNarr the Reg2023-01-264-0/+21
| | | | | | | | | | |
* | | | | | | | | | | Merge pull request #9670 from merryhime/revert-af5ecb0b15d4449f58434e70eed835cf71fc5527bunnei2023-01-263-34/+11
|\ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | Revert "MemoryManager: use fastmem directly."
| * | | | | | | | | | | Revert "MemoryManager: use fastmem directly."Merry2023-01-253-34/+11
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This reverts commit af5ecb0b15d4449f58434e70eed835cf71fc5527.
* | | | | | | | | | | | Merge pull request #9652 from liamwhite/msbunnei2023-01-264-2/+16
|\ \ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | | | spirv: fix multisampled image fetch
| * | | | | | | | | | | | spirv: fix multisampled image fetchLiam2023-01-234-2/+16
| | |_|_|_|_|_|/ / / / / | |/| | | | | | | | | |
* | | | | | | | | | | | Merge pull request #9604 from liamwhite/ptbunnei2023-01-266-215/+477
|\ \ \ \ \ \ \ \ \ \ \ \ | |_|_|_|_|_|_|_|_|_|/ / |/| | | | | | | | | | | kernel: KPageTable: update
| * | | | | | | | | | | kernel: KPageTable: updateLiam2023-01-226-215/+477
| | |_|_|/ / / / / / / | |/| | | | | | | | |
* | | | | | | | | | | main: Only set AA_DisableWindowContextHelpButton below Qt6Morph2023-01-261-1/+3
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This is fortunately disabled by default on Qt6, so we just have to check whether we are compiling with Qt6 or not.
* | | | | | | | | | | Merge pull request #9675 from Morph1984/ini-concatliamwhite2023-01-251-2/+8
|\ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | default_ini: Split and concatenate the config string literal
| * | | | | | | | | | | default_ini: Split and concatenate the config string literalMorph2023-01-251-2/+8
| | |_|/ / / / / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | We are dangerously close to MSVC's 16384 character limit for string literals. Breaking this string up and concatenating will allow for more settings to be added in the future.
* | | | | | | | | | | Merge pull request #9668 from Morph1984/qt-why-is-this-not-the-defaultliamwhite2023-01-2510-17/+8
|\ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | main: Globally disable the "?" button on dialogs
| * | | | | | | | | | | main: Globally disable the "?" button on dialogsMorph2023-01-2510-17/+8
| |/ / / / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Sets the AA_DisableWindowContextHelpButton attribute to disable this useless button globally.
* | | | | | | | | | | Merge pull request #9676 from german77/revert-stick-rangeliamwhite2023-01-252-12/+9
|\ \ \ \ \ \ \ \ \ \ \ | | |_|_|/ / / / / / / | |/| | | | / / / / / | |_|_|_|_|/ / / / / |/| | | | | | | | | Revert #9617 and fix it on input_common
| * | | | | | | | | Revert 9617 and fix it on input_commonNarr the Reg2023-01-252-12/+9
| |/ / / / / / / /
* / / / / / / / / input_common: add missing header for libc++ after 340f15d1fa79Jan Beich2023-01-251-0/+1
|/ / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | src/input_common/drivers/joycon.cpp:187:26: error: no member named 'find_if' in namespace 'std::ranges' std::ranges::find_if(left_joycons, [](auto& device) { return !device->IsConnected(); }); ~~~~~~~~~~~~~^ src/input_common/drivers/joycon.cpp:193:54: error: no member named 'find_if' in namespace 'std::ranges' const auto unconnected_device = std::ranges::find_if( ~~~~~~~~~~~~~^ src/input_common/drivers/joycon.cpp:393:51: error: no member named 'find_if' in namespace 'std::ranges' const auto matching_device = std::ranges::find_if( ~~~~~~~~~~~~~^ src/input_common/drivers/joycon.cpp:402:51: error: no member named 'find_if' in namespace 'std::ranges' const auto matching_device = std::ranges::find_if( ~~~~~~~~~~~~~^
* | | | | | | | Merge pull request #9662 from abouvier/cmake-llvmbunnei2023-01-242-5/+3
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | cmake: prefer system llvm library
| * | | | | | | | cmake: prefer system llvm libraryAlexandre Bouvier2023-01-232-5/+3
| | |/ / / / / / | |/| | | | | |
* | | | | | | | Merge pull request #9492 from german77/joycon_releaseliamwhite2023-01-2458-408/+5812
|\ \ \ \ \ \ \ \ | |/ / / / / / / |/| | | | | | | Input_common: Implement custom joycon driver v2
| * | | | | | | core: hid: Make use of SCOPE_EXIT and SCOPE_GUARD where applicableNarr the Reg2023-01-201-67/+38
| | | | | | | |
| * | | | | | | input_common: Fix joycon mappingsgerman772023-01-202-57/+53
| | | | | | | |
| * | | | | | | input_common: Address byte reviewgerman772023-01-2016-243/+220
| | | | | | | |
| * | | | | | | core: hid: Only set the polling mode to the correct sideNarr the Reg2023-01-208-27/+70
| | | | | | | |
| * | | | | | | input_common: Drop Pro controller support from custom drivergerman772023-01-204-43/+4
| | | | | | | |
| * | | | | | | input_common: Fix issue where ring and irs are enabled at the same timegerman772023-01-204-15/+24
| | | | | | | |
| * | | | | | | input_common: Implement joycon ir cameraNarr the Reg2023-01-2015-23/+608
| | | | | | | |
| * | | | | | | yuzu: Add ring controller test buttongerman772023-01-2010-174/+370
| | | | | | | |
| * | | | | | | input_common: Use DriverResult on all enginesgerman772023-01-2017-104/+100
| | | | | | | |
| * | | | | | | Address review commentsgerman772023-01-2014-46/+44
| | | | | | | |
| * | | | | | | core: hid: Fix input regressionsNarr the Reg2023-01-206-41/+56
| | | | | | | |
| * | | | | | | input_common: Implement joycon nfcgerman772023-01-209-13/+544
| | | | | | | |
| * | | | | | | input_common: Add dual joycon supportNarr the Reg2023-01-201-24/+101
| | | | | | | |
| * | | | | | | input_common: Add support for joycon ring controllerNarr the Reg2023-01-209-4/+272
| | | | | | | |
| * | | | | | | input_common: Add support for joycon input reportsNarr the Reg2023-01-208-100/+798
| | | | | | | |
| * | | | | | | input_common: Use calibration from joyconNarr the Reg2023-01-205-0/+231
| | | | | | | |
| * | | | | | | input_common: Add support for joycon generic functionsNarr the Reg2023-01-205-3/+310
| | | | | | | |
| * | | | | | | input_common: Add joycon low level functionsNarr the Reg2023-01-203-0/+434
| | | | | | | |
| * | | | | | | service: hid: Set led pattern and fix color detectionNarr the Reg2023-01-201-0/+5
| | | | | | | |
| * | | | | | | core: hid: Enable pulling color data from controllersNarr the Reg2023-01-209-2/+246
| | | | | | | |
| * | | | | | | core: hid: Migrate ring from emulated devices to emulated controllerNarr the Reg2023-01-208-88/+105
| | | | | | | |
| * | | | | | | yuzu: Update controller colors and button namesNarr the Reg2023-01-202-3/+27
| | | | | | | |
| * | | | | | | input_common: Disable SDL driver with switch controllersNarr the Reg2023-01-206-6/+44
| | | | | | | |
| * | | | | | | input_common: Initial skeleton for custom joycon driverNarr the Reg2023-01-208-3/+1786
| | | | | | | |
* | | | | | | | Merge pull request #9555 from abouvier/catch2-updateliamwhite2023-01-2315-23/+14
|\ \ \ \ \ \ \ \ | |_|/ / / / / / |/| | | | | | | tests: update catch2 to 3.0.1
| * | | | | | | tests: update catch2 to 3.0.1Alexandre Bouvier2023-01-0515-23/+14
| | | | | | | |
* | | | | | | | Merge pull request #9660 from german77/koreaToTaiwanliamwhite2023-01-224-8/+21
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | yuzu: Fix language comobox crash
| * | | | | | | | yuzu: Fix language comobox crashgerman772023-01-224-8/+21
| | |_|/ / / / / | |/| | | | | |
* | | | | | | | Merge pull request #9656 from liamwhite/nsightliamwhite2023-01-221-4/+4
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | nsight_aftermath_tracker: update for latest Aftermath SDK
| * | | | | | | | nsight_aftermath_tracker: update for latest Aftermath SDKLiam2023-01-211-4/+4
| |/ / / / / / /
* | | | | | | | Merge pull request #9637 from SaiKai/repeat_shortcutsliamwhite2023-01-224-27/+30
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | allow volume up/down hotkeys to be repeated
| * | | | | | | | fix formatJonas Gutenschwager2023-01-182-4/+2
| | | | | | | | |
| * | | | | | | | allow volume up/down hotkeys to be repeatedJonas Gutenschwager2023-01-184-27/+32
| | |_|_|/ / / / | |/| | | | | |
* | | | | | | | Merge pull request #9617 from german77/off_by_oneliamwhite2023-01-221-2/+10
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | core: hid: Fix stick minimum range
| * | | | | | | | core: hid: Fix stick minimum rangegerman772023-01-141-2/+10
| | | | | | | | |
* | | | | | | | | Merge pull request #9613 from Kelebek1/demangleliamwhite2023-01-224-19/+56
|\ \ \ \ \ \ \ \ \ | |_|_|/ / / / / / |/| | | | | | | | Add stacktrace symbol demangling
| * | | | | | | | Be careful of mangled out of bounds readKelebek12023-01-142-9/+9
| | | | | | | | |
| * | | | | | | | Move demangle impl to cppKelebek12023-01-143-23/+36
| | | | | | | | |
| * | | | | | | | Add stacktrace symbol demanglingKelebek12023-01-143-15/+39
| |/ / / / / / /
* | | | | | | | Merge pull request #9611 from liamwhite/patch-1bunnei2023-01-201-3/+23
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | debugger: add host fastmem pointer fetch command
| * | | | | | | | debugger: add host fastmem pointer fetch commandLiam2023-01-131-3/+23
| |/ / / / / / /
* | | | | | | | Merge pull request #9640 from german77/why_sdlbunnei2023-01-201-19/+35
|\ \ \ \ \ \ \ \ | |_|_|_|/ / / / |/| | | | | | | input_common: reset sdl motion if data is invalid
| * | | | | | | input_common: reset sdl motion if data is invalidgerman772023-01-181-19/+35
| |/ / / / / /
* | | | | | | Merge pull request #9556 from vonchenplus/draw_textureliamwhite2023-01-1925-125/+502
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | video_core: Implement maxwell3d draw texture method
| * | | | | | | Address feedbackFeng Chen2023-01-165-14/+62
| | | | | | | |
| * | | | | | | video_core: Implement opengl/vulkan draw_textureFeng Chen2023-01-0519-138/+291
| | | | | | | |
| * | | | | | | video_core: Implement maxwell3d draw texture methodFeng Chen2023-01-057-1/+177
| | |_|/ / / / | |/| | | | |
* | | | | | | Merge pull request #9623 from liamwhite/wp-oopsbunnei2023-01-191-0/+4
|\ \ \ \ \ \ \ | |_|_|_|_|/ / |/| | | | | | memory: fix watchpoint use when fastmem is enabled
| * | | | | | memory: fix watchpoint use when fastmem is enabledLiam2023-01-151-0/+4
| | |/ / / / | |/| | | |
* | | | | | Merge pull request #9638 from Kelebek1/firmware4Narr the Reg2023-01-191-1/+1
|\ \ \ \ \ \ | | | | | | | | | | | | | | Demote maxwell3d Firmware4 call log to debug
| * | | | | | Demote maxwell3d Firmware4 call log to debugKelebek12023-01-181-1/+1
| |/ / / / /
* | | | | | Merge pull request #9619 from liamwhite/timing-spaghettibunnei2023-01-193-29/+28
|\ \ \ \ \ \ | | | | | | | | | | | | | | timing: wait for completion on unregister
| * | | | | | timing: wait for completion on unregisterLiam2023-01-143-29/+28
| |/ / / / /
* | | | | | Merge pull request #9615 from merryhime/upsample-ob1bunnei2023-01-181-59/+38
|\ \ \ \ \ \ | | | | | | | | | | | | | | audio_core: Corrective fixes to upsampler
| * | | | | | upsample: Fix coefficient formatMerry2023-01-141-26/+26
| | | | | | |
| * | | | | | audio_core: Fix off-by-one error in upsamplerMerry2023-01-141-33/+12
| |/ / / / /
* | | | | | Merge pull request #9608 from liamwhite/fpsbunnei2023-01-182-5/+5
|\ \ \ \ \ \ | |_|_|/ / / |/| | | | | nvnflinger: correct swap interval handling
| * | | | | nvnflinger: correct swap interval handlingLiam2023-01-122-5/+5
| |/ / / /
* | | | | Update settings.hMatías Locatti2023-01-131-0/+2
| | | | |
* | | | | CPPMatías Locatti2023-01-131-0/+8
| | | | |
* | | | | UI changeMatías Locatti2023-01-131-0/+10
| | | | |
* | | | | 1.5X resolution scaler optionMatías Locatti2023-01-133-5/+15
|/ / / /
* | | | Merge pull request #9605 from german77/mouse_mappingbunnei2023-01-113-1/+10
|\ \ \ \ | | | | | | | | | | yuzu: Read mouse scroll
| * | | | yuzu: Read mouse wheel inputNarr the Reg2023-01-113-1/+10
| | | | |
* | | | | Merge pull request #9596 from liamwhite/mvkMorph2023-01-111-10/+25
|\ \ \ \ \ | | | | | | | | | | | | MoltenVK: restrict number of vertex attributes/bindings to 16
| * | | | | MoltenVK: restrict number of vertex attributes/bindings to 16TellowKrinkle2023-01-101-10/+25
| | | | | |
* | | | | | Merge pull request #9582 from yuzu-emu/revert-9518-revert-9504-pg2liamwhite2023-01-1011-181/+322
|\ \ \ \ \ \ | | | | | | | | | | | | | | Revert "Revert "k_page_group: synchronize""
| * | | | | | Revert "Revert "k_page_group: synchronize""bunnei2023-01-0811-181/+322
| | | | | | |
* | | | | | | Merge pull request #9601 from liamwhite/it-never-endsliamwhite2023-01-102-2/+21
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | qt: unlock during signal emission
| * | | | | | | qt: unlock during signal emissionLiam2023-01-102-2/+21
| | |/ / / / / | |/| | | | |
* | | | | | | Merge pull request #9598 from liamwhite/indirectliamwhite2023-01-103-8/+15
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | vulkan_common: fix indirect draw with count
| * | | | | | | vulkan_common: fix indirect draw with countLiam2023-01-103-8/+15
| |/ / / / / /
* | | | | | | Merge pull request #9595 from liamwhite/per-gameliamwhite2023-01-101-2/+3
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | qt: fix configuration weirdness on turbo
| * | | | | | | qt: fix configuration weirdness on turboLiam2023-01-091-2/+3
| | | | | | | |
* | | | | | | | Merge pull request #9565 from MonsterDruide1/tas-multiplayer-lengthsliamwhite2023-01-104-7/+38
|\ \ \ \ \ \ \ \ | |_|/ / / / / / |/| | | | | | | TAS: Show all script lengths for multiplayer
| * | | | | | | TAS: Show all script lengths for multiplayerMonsterDruide12023-01-074-7/+38
| | | | | | | |
* | | | | | | | macOS: Make Yuzu show up in the Launchpad Games folder (#9594)UltraHDR2023-01-091-0/+2
| |/ / / / / / |/| | | | | | | | | | | | | | | | | | | | https://developer.apple.com/documentation/bundleresources/information_property_list/lsapplicationcategorytype This makes it show up in the Launchpad Games folder
* | | | | | | Merge pull request #9589 from liamwhite/defaultMorph2023-01-091-1/+1
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | renderer_vulkan: disable turbo by default
| * | | | | | | renderer_vulkan: disable turbo by defaultLiam2023-01-081-1/+1
| | |/ / / / / | |/| | | | |
* | | | | | | Merge pull request #9581 from liamwhite/turbo2Morph2023-01-095-0/+40
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | renderer_vulkan: pause turbo submissions on inactive queue
| * | | | | | | renderer_vulkan: pause turbo submissions on inactive queueLiam2023-01-075-0/+40
| | |_|_|_|_|/ | |/| | | | |
* | | | | | | Merge pull request #9530 from liamwhite/vk-feature-initMorph2023-01-093-1173/+664
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | vulkan_device: refactor feature testing
| * | | | | | | vulkan_device: refactor feature testingLiam2023-01-093-1173/+664
| | |_|_|/ / / | |/| | | | |
* | | | | | | Merge pull request #9569 from liamwhite/shutdown-warsMorph2023-01-091-3/+7
|\ \ \ \ \ \ \ | |/ / / / / / |/| | | | | | qt: additional fixes for reentrant shutdown
| * | | | | | qt: additional fixes for reentrant shutdownLiam2023-01-071-3/+7
| | | | | | |
* | | | | | | VideoCore: Fix OGL cache invalidation.Fernando Sahmkow2023-01-082-0/+6
| |_|/ / / / |/| | | | |
* | | | | | Merge pull request #9563 from german77/crash_not_allowedbunnei2023-01-074-19/+37
|\ \ \ \ \ \ | | | | | | | | | | | | | | input_common: Create an update engine
| * | | | | | input_common: Create an update engineNarr the Reg2023-01-064-19/+37
| | | | | | |
* | | | | | | Avoid OOB array access reading passthrough attr maskBilly Laws2023-01-071-1/+1
| |_|/ / / / |/| | | | | | | | | | | YFC 1.5 extended the size of the varying mask used to hold passthrough attrs without considering this
* | | | | | Merge pull request #9570 from liamwhite/less-clock-boostNarr the Reg2023-01-073-1/+15
|\ \ \ \ \ \ | | | | | | | | | | | | | | renderer_vulkan: disable clock boost on unvalidated devices
| * | | | | | renderer_vulkan: disable clock boost on unvalidated devicesLiam2023-01-073-1/+15
| | | | | | |
* | | | | | | vulkan_device: avoid attempt to access empty optionalLiam2023-01-071-2/+6
|/ / / / / /
* | / / / / opengl: Sanitize antialiasing configNarr the Reg2023-01-061-1/+7
| |/ / / / |/| | | |
* | | | | video_core/vulkan: Fixed loading of Vulkan driver pipeline cacheWollnashorn2023-01-061-1/+2
| | | | | | | | | | | | | | | | | | | | The header size of the Vulkan driver pipeline cache files was incorrectly in PipelineCache::LoadVulkanPipelineCache, for which the pipeline cache wasn't read correctly and got invalidated on each load.
* | | | | Merge pull request #9535 from bylaws/masterFernando S2023-01-0616-91/+195
|\ \ \ \ \ | | | | | | | | | | | | Port over several shader-compiler fixes from skyline
| * | | | | Run clang-formatBilly Laws2023-01-056-24/+35
| | | | | |
| * | | | | shader_recompiler: Fix shuffle partitioning for >64 invoc-per-subgroup GPUsBilly Laws2023-01-051-30/+28
| | | | | | | | | | | | | | | | | | | | | | | | The existing implementation only supports 64 invoc-per-subgroup GPUs, and misbehaves on adreno when invocations need to be split into 4 emulated subgroups.
| * | | | | Vulkan, OpenGL: Hook up geometry shader passthrough emulationBilly Laws2023-01-052-0/+2
| | | | | |
| * | | | | shader_recompiler: Add support for lowering geometry passthroughBilly Laws2023-01-052-40/+67
| | | | | | | | | | | | | | | | | | | | | | | | Reuses most of the existing code for generating the gl_Layer passthrough. Fixes geometry in Nier: Automata on GPUs without HW passthrough support.
| * | | | | Vulkan, OpenGL: Hook up storage buffer alignment codeBilly Laws2023-01-056-3/+21
| | | | | |
| * | | | | shader_recompiler: Align SSBO offsets to meet host requirementsBilly Laws2023-01-054-6/+11
| | | | | | | | | | | | | | | | | | | | | | | | We can take advantage of SSBO addresses being passed in a constant bufer to account for the extra alignment requirements in the shader itself.
| * | | | | shader_recompiler: SPIRV: Only enable int64 feature when supportedBilly Laws2023-01-051-1/+1
| | | | | |
| * | | | | shader_recompiler: Add comparison operators to descriptor typesBilly Laws2023-01-051-0/+12
| | | | | |
| * | | | | Vulkan: Add a workaround for input_position on Adreno driversBilly Laws2023-01-055-11/+42
| | | | | | | | | | | | | | | | | | | | | | | | Adreno drivers will crash compiling geometry shaders if the input position is not wrapped in a gl_in struct.
* | | | | | Merge pull request #9561 from liamwhite/update-dynarmicliamwhite2023-01-062-0/+8
|\ \ \ \ \ \ | | | | | | | | | | | | | | externals: update dynarmic, xbyak
| * | | | | | externals: update dynarmic, xbyakLiam2023-01-062-0/+8
| |/ / / / /
* | | | | | Merge pull request #9558 from MonsterDruide1/network-timeout-noerrorliamwhite2023-01-061-1/+5
|\ \ \ \ \ \ | | | | | | | | | | | | | | net: Silently translate ETIMEDOUT network error
| * | | | | | net: Silently translate ETIMEDOUT network errorMonsterDruide12023-01-051-1/+5
| | | | | | |
* | | | | | | Merge pull request #9552 from liamwhite/turboliamwhite2023-01-0615-2/+303
|\ \ \ \ \ \ \ | |_|_|_|/ / / |/| | | | | | vulkan: implement 'turbo mode' clock booster
| * | | | | | common: add setting for renderer clock workaroundLiam2023-01-058-1/+32
| | | | | | |
| * | | | | | vulkan: implement 'turbo mode' clock boosterLiam2023-01-058-2/+272
| | |_|_|/ / | |/| | | |
* | | | | | Merge pull request #9559 from FernandoS27/cached-writesFernando S2023-01-0615-53/+233
|\ \ \ \ \ \ | | | | | | | | | | | | | | VideoCore: Implement Cached Writes, use fastmem for reading GPU memory and eliminate old stuffs
| * | | | | | BufferBase: Don't ignore GPU pages.Fernando Sahmkow2023-01-058-23/+22
| | | | | | |
| * | | | | | Fermi2D: sync cache flushesFernando Sahmkow2023-01-052-2/+5
| | | | | | |
| * | | | | | MemoryManager: use fastmem directly.Fernando Sahmkow2023-01-053-11/+34
| | | | | | |
| * | | | | | video_core: Cache GPU internal writes.Fernando Sahmkow2023-01-0510-30/+185
| |/ / / / /
* | | | | | MacroHLE: eliminate 2 rushed macros.Fernando Sahmkow2023-01-061-42/+0
| | | | | |
* | | | | | Merge pull request #9528 from liamwhite/mvk-nulldescliamwhite2023-01-063-0/+19
|\ \ \ \ \ \ | | | | | | | | | | | | | | renderer_vulkan: implement fallback path for null buffer descriptors
| * | | | | | renderer_vulkan: implement fallback path for null descriptorsLiam2023-01-053-0/+19
| |/ / / / /
* | | | | | Merge pull request #9536 from liamwhite/debug-utilsliamwhite2023-01-063-11/+10
|\ \ \ \ \ \ | |_|_|/ / / |/| | | | | vulkan_common: unify VK_EXT_debug_utils and selection of validation layer
| * | | | | vulkan_common: unify VK_EXT_debug_utils and selection of validation layerLiam2023-01-013-11/+10
| | | | | |
* | | | | | video_core/vulkan: Vulkan driver pipelines now contain cache versionWollnashorn2023-01-052-16/+28
| | | | | | | | | | | | | | | | | | | | | | | | So that old cache can get deleted when the cache version changes and does not grow infinitely
* | | | | | video_core/vulkan: Driver pipeline cache will now be deleted with the shader cacheWollnashorn2023-01-052-1/+20
| | | | | |
* | | | | | config: Set the Vulkan driver pipeline cache option to be globalWollnashorn2023-01-052-0/+4
| | | | | |
* | | | | | video_core/vulkan: Added check if Vulkan pipeline path has been setWollnashorn2023-01-051-1/+1
| | | | | |
* | | | | | config: Better wording for VK pipeline cache option and enable by defaultWollnashorn2023-01-052-3/+3
| | | | | |
* | | | | | yuzu-cmd: Removed `use_vulkan_driver_pipeline_cache` from default_ini.hWollnashorn2023-01-051-4/+0
| | | | | | | | | | | | | | | | | | | | | | | | The addition of the use_vulkan_driver_pipeline_cache option into the default ini string literal caused the 16,384-byte limit of the MSVC compiler to be exceeded.
* | | | | | video_core/vulkan: Added `VkPipelineCache` to store Vulkan pipelinesWollnashorn2023-01-0515-67/+253
| |_|/ / / |/| | | | | | | | | | | | | | | | | | | | | | | | As an optional feature which can be enabled in the advanced graphics configuration, all pipelines that get built at the initial shader loading are stored in a VkPipelineCache object and are dumped to the disk. These vendor specific pipeline cache files are located at `/shader/GAME_ID/vulkan_pipelines.bin`. This feature was mainly added because of an issue with the AMD driver (see yuzu-emu#8507) causing invalidation of the cache files the driver builds automatically.
* | | | | Vulkan: Fix drivers that don't support dynamic_state_2 upFernando Sahmkow2023-01-052-8/+11
| |/ / / |/| | |
* | | | Merge pull request #9501 from FernandoS27/yfc-rel-2liamwhite2023-01-0579-573/+3008
|\ \ \ \ | |_|/ / |/| | | Yuzu Fried Chicken Part 1.5: MacroHLE Rework and Dynamic State
| * | | yuzu-ui: Add setting for disabling macro HLEFernando Sahmkow2023-01-046-5/+26
| | | |
| * | | Video_core: Address feedbackFernando Sahmkow2023-01-0420-170/+346
| | | |
| * | | Texture Cache: Implement async texture downloads.Fernando Sahmkow2023-01-045-35/+91
| | | |
| * | | Vulkan: Update blacklisting to latest driver versions.Fernando Sahmkow2023-01-041-5/+12
| | | |
| * | | ShaderCompiler: Inline driver specific constants.Fernando Sahmkow2023-01-035-3/+39
| | | |
| * | | Vulkan: rework stencil tracking.Fernando Sahmkow2023-01-034-36/+169
| | | |
| * | | vulkan_common: blacklist radv from extended_dynamic_state2 on drivers before 22.3.1Liam2023-01-012-2/+14
| | | |
| * | | video_core: fix buildLiam2023-01-014-3/+38
| | | |
| * | | MacroHLE: Final cleanup and fixes.Fernando Sahmkow2023-01-0114-128/+94
| | | |
| * | | Rasterizer: Setup skeleton for Host Conditional renderingFernando Sahmkow2023-01-016-10/+53
| | | |
| * | | RasterizerMemory: Add filtering for flushing/invalidation operations.Fernando Sahmkow2023-01-0114-93/+186
| | | |
| * | | Vulkan: Allow stagging buffer deferrals.Fernando Sahmkow2023-01-012-21/+56
| | | |
| * | | MacroHLE: Add OpenGL SupportFernando Sahmkow2023-01-016-39/+107
| | | |
| * | | Vulkan: Add other additional pipeline specsFernando Sahmkow2023-01-011-1/+17
| | | |
| * | | Vulkan: Implement Dynamic State 3Fernando Sahmkow2023-01-0113-105/+313
| | | |
| * | | Vulkan Implement Dynamic State 2 LogicOp and PatchVerticesFernando Sahmkow2023-01-0112-27/+75
| | | |
| * | | Vulkan: Implement Dynamic States 2Fernando Sahmkow2023-01-0113-66/+315
| | | |
| * | | DMAPusher: Improve collection of non executing methodsFernando Sahmkow2023-01-0113-2/+181
| | | |
| * | | Revert Buffer cache changes and setup additional macros.Fernando Sahmkow2023-01-017-128/+179
| | | |
| * | | MacroHLE: Reduce massive calculations on sizing estimation.Fernando Sahmkow2023-01-019-95/+238
| | | |
| * | | MacroHLE: Add HLE replacement for base vertex and base instance.Fernando Sahmkow2023-01-0122-70/+265
| | | |
| * | | MacroHLE: Add Index Buffer size estimation.Fernando Sahmkow2023-01-015-10/+74
| | | |
| * | | MacroHLE: Refactor MacroHLE system.Fernando Sahmkow2023-01-0111-121/+420
| | | |
| * | | MacroHLE: Implement DrawIndexedIndirect & DrawArraysIndirect.Fernando Sahmkow2023-01-0116-72/+252
| | | |
| * | | MacroHLE: Add MultidrawIndirect HLE Macro.Fernando Sahmkow2023-01-0113-47/+169
| | | |
* | | | Merge pull request #9518 from gidoly/revert-9504-pg2liamwhite2023-01-0411-322/+181
|\ \ \ \ | | | | | | | | | | Revert "k_page_group: synchronize"
| * | | | Revert "k_page_group: synchronize"gidoly2022-12-2911-322/+181
| | | | |
* | | | | TAS: Immediately switch stick to TAS on inputMonsterDruide12023-01-031-9/+11
| | | | | | | | | | | | | | | | | | | | Co-Authored-By: Narr the Reg <5944268+german77@users.noreply.github.com>
* | | | | cmake: move find-modules to root cmake dirAlexandre Bouvier2023-01-023-5/+0
| | | | |
* | | | | Merge pull request #9540 from MonsterDruide1/tas-sanitized-recordliamwhite2023-01-021-5/+5
|\ \ \ \ \ | | | | | | | | | | | | TAS: Record sanitized instead of raw stick inputs
| * | | | | TAS: Record sanitized instead of raw stick inputsMonsterDruide12023-01-011-5/+5
| | |/ / / | |/| | | | | | | | | | | | | Co-Authored-By: Narr the Reg <5944268+german77@users.noreply.github.com>
* | | | | service: nifm: Initialize request stategerman772023-01-021-0/+1
| | | | |
* | | | | service: nifm: Match documentation namesgerman772023-01-021-31/+56
|/ / / /
* | / / vfs: Replace cstr concat with char concatMerry2023-01-011-3/+3
| |/ / |/| |
* | | Merge pull request #9533 from merryhime/overcommitliamwhite2023-01-011-2/+17
|\ \ \ | | | | | | | | host_memory: mmap changes for virtual_base
| * | | host_memory: Use transparent huge pages where availableMerry2023-01-011-0/+15
| | | |
| * | | host_memory: Allocate virtual_base with MAP_NORESERVEMerry2023-01-011-2/+2
| | | | | | | | | | | | | | | | | | | | Specify that we do not require swap to be reserved for this address range; allow overcommitting.
* | | | Merge pull request #9514 from ColinKinloch/en_gbliamwhite2023-01-012-1/+47
|\ \ \ \ | |/ / / |/| | | settings: warn on invalid regon/language combinations
| * | | settings: comment language blocklist columnsColin Kinloch2022-12-301-7/+13
| | | |
| * | | settings: added regon/language warning bounds checkColin Kinloch2022-12-291-1/+1
| | | |
| * | | settings: warn on invalid regon/language combinationsColin Kinloch2022-12-282-1/+41
| | | |
* | | | core: hid: emulated_console: Avoid a crash if frontend does not configure touch_from_button_maps.bunnei2022-12-301-0/+5
| | | |
* | | | Merge pull request #9515 from liamwhite/cmake-refactorbunnei2022-12-304-14/+49
|\ \ \ \ | | | | | | | | | | CMake: make more features optional
| * | | | cmake: make cubeb and SDL2 optionalLiam2022-12-281-6/+13
| | | | |
| * | | | cmake: make libusb optionalLiam2022-12-282-7/+32
| | | | |
| * | | | cmake: make room server optionalLiam2022-12-281-1/+4
| |/ / /
* | / / config: Save multiplayer settings only globallyWollnashorn2022-12-301-2/+0
| |/ / |/| | | | | | | | Saved multiplayer settings like the nickname, remote address, etc. were reset everytime a game was booted up and the game-specific config files were loaded, as these values will never be set.
* | | Merge pull request #9423 from vonchenplus/vulkan_quad_stripliamwhite2022-12-298-125/+245
|\ \ \ | | | | | | | | video_core: Implement all vulkan topology
| * | | video_core: Implement other missing vulkan topologyFengChen2022-12-261-3/+16
| | | |
| * | | video_core: Implement vulkan QuadStrip topologyFengChen2022-12-268-122/+229
| | | |
* | | | Merge pull request #9504 from liamwhite/pg2bunnei2022-12-2811-181/+322
|\ \ \ \ | |_|/ / |/| | | k_page_group: synchronize
| * | | k_page_table: remove HACK_OpenPages/ClosePagesLiam2022-12-253-58/+54
| | | |
| * | | k_page_group: synchronizeLiam2022-12-2511-125/+270
| | |/ | |/|
* | | Merge pull request #9490 from ameerj/texture-cache-preallocbunnei2022-12-274-22/+44
|\ \ \ | | | | | | | | texture_cache: Use pre-allocated heap buffer for texture swizzles
| * | | texture_cache: Use Common::ScratchBuffer for swizzle buffersameerj2022-12-254-10/+12
| | | |
| * | | texture_cache: Use pre-allocated buffer for texture downloadsameerj2022-12-253-9/+14
| | | |
| * | | texture_cache: Use pre-allocated buffer for texture uploadsameerj2022-12-254-13/+28
| |/ /
* | | Merge pull request #9495 from german77/no_refreshbunnei2022-12-273-23/+11
|\ \ \ | | | | | | | | yuzu: Automatically refresh device list
| * | | yuzu: Automatically refresh device listgerman772022-12-243-23/+11
| | | |
* | | | tests: add missing headerAlexandre Bouvier2022-12-261-0/+1
| | | | | | | | | | | | <cstring> is needed for std::memcpy
* | | | TAS: Increase accuracy of Stick inputsMonsterDruide12022-12-251-0/+7
| |/ / |/| |
* | | Merge pull request #9500 from liamwhite/reentrant-shutdownliamwhite2022-12-252-5/+12
|\ \ \ | | | | | | | | qt: prevent reentrant shutdown
| * | | qt: prevent reentrant shutdownLiam2022-12-242-5/+12
| | | |
* | | | Merge pull request #9496 from liamwhite/shm3liamwhite2022-12-253-58/+62
|\ \ \ \ | | | | | | | | | | kernel: workaround static shared memory initialization
| * | | | kernel: workaround static shared memory initializationLiam2022-12-233-58/+62
| | |/ / | |/| |
* | | | Merge pull request #9487 from liamwhite/look-at-the-timeliamwhite2022-12-253-40/+65
|\ \ \ \ | | | | | | | | | | time: add LockFreeAtomicType
| * | | | time: add LockFreeAtomicTypeLiam2022-12-223-40/+65
| |/ / /
* | | | Merge pull request #9453 from ameerj/scratch-vectorFernando S2022-12-2514-56/+370
|\ \ \ \ | |_|/ / |/| | | common: Add ScratchBuffer Class
| * | | scratch_buffer: Explicitly defing resize and resize_destructive functionsameerj2022-12-207-19/+108
| | | | | | | | | | | | | | | | | | | | resize keeps previous data intact when the buffer grows resize_destructive destroys the previous data when the buffer grows
| * | | tests: Add ScratchBuffer testsameerj2022-12-203-5/+137
| | | |
| * | | dma_pusher: Rework command_headers usageameerj2022-12-202-9/+16
| | | | | | | | | | | | | | | | Uses ScratchBuffer and avoids overwriting the command_headers buffer with the prefetch_command_list
| * | | buffer_cache: Use Common::ScratchBuffer for ImmediateBuffer usageameerj2022-12-201-7/+4
| | | |
| * | | video_core: Add usages of ScratchBufferameerj2022-12-204-33/+21
| | | |
| * | | common: Add ScratchBuffer classameerj2022-12-202-0/+75
| | | | | | | | | | | | | | | | | | | | This class creates a default initialized heap allocated buffer for cases where value initializing members during allocation or resize is redundant.
| * | | common: add make_unique_for_overwriteameerj2022-12-202-0/+26
| | | |
* | | | qt: fix 'Pause' menu item (#9497)liamwhite2022-12-241-1/+1
| | | |
* | | | Disable automatically opening the console on windows yuzu-cmd builds (#9485)Chris Oboe2022-12-242-0/+16
| | | | | | | | | | | | | | | | | | | | * don't automatically open the console on windows build of yuzu-cmd * fix formatting
* | | | Merge pull request #9476 from liamwhite/async-shutdownliamwhite2022-12-244-15/+65
|\ \ \ \ | | | | | | | | | | qt: continue event loop during game close
| * | | | qt: fix uninitialized memory usageLiam2022-12-241-1/+1
| | | | |
| * | | | qt: use main window as close overlay parentLiam2022-12-222-4/+4
| | | | |
| * | | | qt: continue event loop during game closeLiam2022-12-204-14/+64
| | |/ / | |/| |
* / | | qt: exit properly on guest-initiated closeLiam2022-12-222-1/+9
|/ / /
* | | Merge pull request #9463 from liamwhite/manager-eventsliamwhite2022-12-206-173/+65
|\ \ \ | | | | | | | | EmuThread: refactor
| * | | qt: use _exit instead of exit on SIGINTLiam2022-12-171-1/+1
| | | |
| * | | EmuThread: refactorLiam2022-12-176-172/+64
| | | |
* | | | Merge pull request #9480 from jbeich/vk-238liamwhite2022-12-201-0/+12
|\ \ \ \ | |_|/ / |/| | | externals: update Vulkan-Headers to v1.3.238 to fix -Werror=switch with system package
| * | | externals: update Vulkan-Headers to v1.3.238Jan Beich2022-12-191-0/+12
| | | |
* | | | Merge pull request #9474 from liamwhite/timerMatías Locatti2022-12-1913-109/+290
|\ \ \ \ | |/ / / |/| | | kernel: add KHardwareTimer
| * | | kernel: remove TimeManagerLiam2022-12-1911-117/+33
| | | |
| * | | kernel: add KHardwareTimerLiam2022-12-186-6/+271
| | | |
* | | | Merge pull request #9471 from german77/inputliamwhite2022-12-192-206/+83
|\ \ \ \ | | | | | | | | | | input_common: Cleanup project
| * | | | input_common: Cleanup projectgerman772022-12-182-206/+83
| | | | |
* | | | | overlay_dialog: Avoid starting the input thread if non-interactiveMorph2022-12-191-1/+3
| | | | |
* | | | | overlay_dialog: Hide button dialog box when both buttons are hiddenMorph2022-12-191-0/+8
| |/ / / |/| | | | | | | | | | | This allows for the creation of a non-interactive dialog overlay to display system messages.
* | | | Merge pull request #9470 from german77/silenceIkillYouliamwhite2022-12-182-2/+2
|\ \ \ \ | | | | | | | | | | service: nfc: Silence ListDevices
| * | | | service: nfc: Silence ListDevicesgerman772022-12-182-2/+2
| |/ / /
* | | | Merge pull request #9469 from Rubo3/patch-1liamwhite2022-12-181-1/+1
|\ \ \ \ | | | | | | | | | | Use execlp instead of execl to avoid failure
| * | | | Use execlp instead of execl to avoid failureMarco Rubin2022-12-181-1/+1
| |/ / /
* | | | Merge pull request #9467 from german77/folderliamwhite2022-12-181-0/+3
|\ \ \ \ | | | | | | | | | | yuzu: Remember last selected directory
| * | | | yuzu: Remember last selected directorygerman772022-12-181-0/+3
| |/ / /
* | | | bootmanager: Use proper camera sizegerman772022-12-183-6/+13
| | | |
* | | | bootmanager: Encapsulate all QCamera codegerman772022-12-182-5/+7
| | | |
* | | | yuzu: fix device name settinggerman772022-12-181-3/+2
|/ / /
* | | Enable compiler optimizations and enforce x86-64-v2 on GCC/Clang (#9442)Matías Locatti2022-12-181-2/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * Testing LTO (#4) * Testing LTO * clang * linux * Added the rest of Blinkhawk's optimizations * Unlikely asserts * Removing LTO from Linux builds - GCC * Removing LTO from Linux builds - Clang
* | | Merge pull request #9456 from german77/virtual_gamepadbunnei2022-12-187-0/+274
|\ \ \ | |/ / |/| | input_common: Add virtual gamepad
| * | input_common: Add virtual gamepadgerman772022-12-177-0/+274
| | |
* | | Merge pull request #7450 from FernandoS27/ndc-vulkanliamwhite2022-12-178-7/+52
|\ \ \ | | | | | | | | Vulkan: Add support for VK_EXT_depth_clip_control.
| * | | Vulkan: Add support for VK_EXT_depth_clip_control.FernandoS272022-12-148-7/+52
| | | |
* | | | Merge pull request #9461 from liamwhite/wanativeMai2022-12-171-1/+5
|\ \ \ \ | | | | | | | | | | qt: avoid setting WA_DontCreateNativeAncestors on all platforms
| * | | | qt: avoid setting WA_DontCreateNativeAncestors on all platformsLiam2022-12-171-1/+5
| | |/ / | |/| |
* | | | Merge pull request #9454 from liamwhite/wayland-eglMai2022-12-172-3/+7
|\ \ \ \ | | | | | | | | | | qt: handle wayland-egl platform name
| * | | | qt: handle wayland-egl platform nameLiam2022-12-162-3/+7
| | | | |
* | | | | Merge pull request #9451 from ameerj/camera-data-arrayliamwhite2022-12-174-9/+12
|\ \ \ \ \ | | | | | | | | | | | | camera: Use pre-allocated vector for camera data
| * | | | | camera: Use pre-allocated vector for camera dataameerj2022-12-174-9/+12
| |/ / / / | | | | | | | | | | | | | | | And avoid an unnecessary copy
* | | | | Merge pull request #9452 from ameerj/hle-read-buffer-resreveliamwhite2022-12-171-8/+6
|\ \ \ \ \ | | | | | | | | | | | | hle_ipc: Refactor ReadBuffer to set buffer size upon initialization
| * | | | | hle_ipc: Refactor ReadBuffer to set buffer size upon initializationameerj2022-12-161-8/+6
| |/ / / / | | | | | | | | | | | | | | | Initializing the vector size during initialization is more efficient than a later call to resize()
* | | | | Merge pull request #9455 from Kelebek1/audio_signalliamwhite2022-12-175-7/+26
|\ \ \ \ \ | | | | | | | | | | | | [audio_core] Signal buffer event on audio in/out system stop
| * | | | | Signal buffer event on audio in/out system stop, and force remove all registered audio buffersKelebek12022-12-165-7/+26
| |/ / / /
* | | | | Merge pull request #9457 from Kelebek1/silence_tfbliamwhite2022-12-171-2/+1
|\ \ \ \ \ | |_|/ / / |/| | | | Remove unimplemented geometry transform feedback log spam
| * | | | Remove unimplemented transform feedback geometry spam, it should be implementedKelebek12022-12-161-2/+1
| |/ / /
* | | | Merge pull request #6354 from ogniK5377/device-nameliamwhite2022-12-169-2/+42
|\ \ \ \ | | | | | | | | | | Set: Allow setting device nickname
| * | | | Set: Allow setting device nicknameChloe Marcec2022-12-149-2/+42
| | |/ / | |/| |
* | | | Merge pull request #9450 from ameerj/hle-ipc-vector-reserveliamwhite2022-12-161-0/+8
|\ \ \ \ | | | | | | | | | | hle_ipc: Reserve vectors before populating
| * | | | hle_ipc: Reserve vectors before populatingameerj2022-12-161-0/+8
| | |/ / | |/| |
* | | | Merge pull request #9444 from german77/free_threadsliamwhite2022-12-163-80/+64
|\ \ \ \ | | | | | | | | | | kernel: process: Implement GetFreeThreadCount
| * | | | kernel: svc: Fix duplicated InfoType enumNarr the Reg2022-12-151-90/+47
| | | | |
| * | | | kernel: process: Implement GetFreeThreadCountNarr the Reg2022-12-153-1/+28
| | | | | | | | | | | | | | | | | | | | Used by Just Dance® 2023 Edition
* | | | | Merge pull request #8605 from devsnek/graceful-shutdownliamwhite2022-12-163-7/+14
|\ \ \ \ \ | | | | | | | | | | | | let games gracefully exit
| * | | | | emu_thread: properly force shutdown for unresponsive guest programsLiam2022-12-132-12/+5
| | | | | |
| * | | | | let games gracefully exitGus Caplan2022-12-133-3/+17
| | | | | |
* | | | | | Merge pull request #6769 from lat9nq/create-shortcut-2liamwhite2022-12-165-0/+210
|\ \ \ \ \ \ | |_|_|/ / / |/| | | | | yuzu qt, common: Add option to create game shortcuts on Linux
| * | | | | main: Address review feedbacklat9nq2022-12-141-19/+33
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Moves icon path to ~/.local/share/icons, though I'm opting to avoid using the game title for the icon and desktop entry name as that would cause filenames such as "yuzu-cadence-of-hyrule-crypt-of-the-necrodancer-featuring-the-legend-of-zelda-demo.desktop".
| * | | | | yuzu qt: Create shortcuts on Linuxlat9nq2022-12-135-0/+196
| | |_|/ / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This creates a Desktop Entry file and a PNG icon for the entry when the user right-clicks a game and selects "Create Shortcut -> Create {Application,Desktop} Shortcut". This uses the current executable's path to create the shortcut. yuzu qt: Add more error checking and OS gating for shortcuts main: Remove FreeBSD gating for shortcuts I'm not going to test FreeBSD, so I don't know if they follow Freedesktop.org or not. I just have to let someone else verify that it works there and let them enable it. main: Move shortcut function to its own function This function should really be in a common library, at least among frontends. main: Remove image manip references main: Fix difference in MinGW and native GCC versions main: Fix negation in creat shortcut Addresses review comment Co-authored-by: Jan Beich <jbeich@FreeBSD.org> main: Re-enable freedesktop shorcuts for FreeBSD
* | | | | Merge pull request #9431 from liamwhite/sixty-five-oh-twoNarr the Reg2022-12-161-1/+2
|\ \ \ \ \ | | | | | | | | | | | | vulkan_common: declare storageBuffer8BitAccess
| * | | | | vulkan_common: declare storageBuffer8BitAccessLiam2022-12-141-1/+2
| |/ / / /
* | | | | Merge pull request #9430 from liamwhite/capableMatías Locatti2022-12-161-0/+2
|\ \ \ \ \ | |_|_|/ / |/| | | | spirv_emit_context: declare GroupNonUniform capability for SubgroupLocalInvocationId
| * | | | spirv_emit_context: declare GroupNonUniform capability for SubgroupLocalInvocationIdLiam2022-12-141-0/+2
| |/ / /
* | | | Merge pull request #7410 from Nefsen402/wayland-fixesliamwhite2022-12-1515-62/+121
|\ \ \ \ | | | | | | | | | | Wayland fixes
| * | | | gl_device: Use a more robust way to use strict context modeAlexander Orzechowski2022-12-136-8/+17
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Instead of checking a environment variable which may not actually exist or is just wrong, ask QT if it's running on the wayland platform.
| * | | | OpenGL: Check for threading supportAlexander Orzechowski2022-12-131-0/+6
| | | | | | | | | | | | | | | | | | | | We need this.
| * | | | wayland: Always use exclusive fullscreenAlexander Orzechowski2022-12-132-4/+10
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Wayland does not allow clients to choose their own size and position on the screen. The concept of fullscreening an application by sizing it to the screen and removing decorations does not exist. Use exclusive fullscreen instead.
| * | | | RenderWidget: Set WA_DontCreateNativeAncestorsAlexander Orzechowski2022-12-131-0/+1
| | | | | | | | | | | | | | | | | | | | | | | | | Some windowing systems like wayland are designed to show hardware accellerated surfaces as subsurfaces and not native windows.
| * | | | emu_window_sdl2: Respect hidpiAlexander Orzechowski2022-12-131-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Use SDL_GL_GetDrawableSize instead of SDL_GetWindowSize which will return the true size our swapchain needs to be in even for hidpi displays.
| * | | | video_core/vulkan: Explicity check swapchain size when deciding to recreateAlexander Orzechowski2022-12-133-15/+28
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Vulkan for whatever reason does not return VK_ERROR_OUT_OF_DATE_KHR when the swapchain is the wrong size. Explicity make sure the size is indeed up to date to workaround this.
| * | | | renderer_opengl: refactor context acquireLiam2022-12-136-38/+62
| |/ / /
* | | | Revert "hle: service: audio: Use default service thread."bunnei2022-12-143-12/+18
| | | |
* | | | Merge pull request #6688 from yzct12345/valid-intel-maxliamwhite2022-12-145-2/+34
|\ \ \ \ | |/ / / |/| | | render_vulkan: Fix validation errors on less compatible Intel GPUs
| * | | Fix validation errors on less compatible Intel GPUyzct123452022-12-135-2/+34
| |/ /
* / / yuzu: Make unlimited frame rate non persistent between game bootsNarr the Reg2022-12-132-2/+3
|/ /
* | Merge pull request #9398 from liamwhite/failbunnei2022-12-125-21/+27
|\ \ | | | | | | general: improve handling of system startup failure
| * | general: improve handling of system startup failureLiam2022-12-065-21/+27
| | |
* | | Merge pull request #9406 from vonchenplus/topologybunnei2022-12-124-32/+36
|\ \ \ | | | | | | | | video_core: Adjust topology update logic and Adjust Clear Manage
| * | | video_core: Add vertex_array_instance_* sbubbed called warningFengChen2022-12-081-0/+5
| | | |
| * | | video_core: The draw manager manages whether Clear is required.FengChen2022-12-083-10/+9
| | | |
| * | | video_core: Adjust topology update logicFengChen2022-12-082-23/+23
| | | |
* | | | input_common: Filter SDL GUIDNarr the Reg2022-12-121-0/+2
| |_|/ |/| |
* | | Merge pull request #9420 from liamwhite/anisoMai2022-12-121-1/+2
|\ \ \ | | | | | | | | video_core: fix off by one in anisotropic filtering amount
| * | | video_core: fix off by one in anisotropic filtering amountLiam2022-12-111-1/+2
| | | |
* | | | Merge pull request #9419 from liamwhite/no-glMai2022-12-111-1/+1
|\ \ \ \ | | | | | | | | | | cmake: make OpenGL loader optional
| * | | | cmake: make OpenGL loader optionalLiam2022-12-101-1/+1
| |/ / / | | | | | | | | | | | | Co-authored-by: liushuyu <liushuyu@users.noreply.github.com>
* | | | Merge pull request #9415 from liamwhite/dcMai2022-12-114-102/+15
|\ \ \ \ | | | | | | | | | | memory: correct semantics of data cache management operations
| * | | | memory: correct semantics of data cache management operationsLiam2022-12-114-102/+15
| | | | |
* | | | | Merge pull request #9409 from liamwhite/smaa2Matías Locatti2022-12-1124-28/+13894
|\ \ \ \ \ | |_|/ / / |/| | | | video_core: Integrate SMAA
| * | | | video_core: Integrate SMAALiam2022-12-0824-28/+13894
| | |/ / | |/| | | | | | | | | | | | | | Co-authored-by: goldenx86 <goldenx86@users.noreply.github.com> Co-authored-by: BreadFish64 <breadfish64@users.noreply.github.com>
* | | | Merge pull request #9417 from liamwhite/debug-assertMai2022-12-101-2/+0
|\ \ \ \ | | | | | | | | | | memory: remove DEBUG_ASSERT pointer test
| * | | | memory: remove DEBUG_ASSERT pointer testLiam2022-12-101-2/+0
| | |/ / | |/| |
* / | | audio_core: remove explicitly defaulted and implicitly deleted constructorsLiam2022-12-102-2/+0
|/ / /
* | | Merge pull request #9412 from Saalvage/fix/trace-log-compilationliamwhite2022-12-091-1/+1
|\ \ \ | | | | | | | | Fix compilation error
| * | | Fix compilation errorSalvage2022-12-091-1/+1
| |/ /
* / / Remove the lock entirely as per PR discussionSalvage2022-12-091-3/+0
|/ / | | | | | | | | | | | | | | Correctly unlock mutex before its destruction As per https://en.cppreference.com/w/cpp/thread/mutex/~mutex destroying a locked mutex is undefined behavior and MSVC++ decides to throw in this case Swap out unique for scoped lock and readd comment
* | Merge pull request #9401 from vonchenplus/draw_managerFernando S2022-12-0812-267/+341
|\ \ | | | | | | video_core: Implement maxwell3d draw manager and split draw logic
| * | video_core: Implement maxwell3d draw manager and split draw logicFeng Chen2022-12-0812-267/+341
| | |
* | | Merge pull request #9365 from liamwhite/valMorph2022-12-072-1/+3
|\ \ \ | | | | | | | | vulkan_common: quiet some validation errors
| * | | vulkan_common: quiet some validation errorsLiam2022-12-012-1/+3
| | | |
* | | | Merge pull request #9370 from liamwhite/break-unmappedmerry2022-12-069-6/+69
|\ \ \ \ | |_|_|/ |/| | | core: add option to break on unmapped access
| * | | core: add option to break on unmapped accessLiam2022-12-029-6/+69
| |/ /
* | | Merge pull request #9393 from liamwhite/more-vulkanFernando S2022-12-062-1/+9
|\ \ \ | | | | | | | | vulkan_common: further initialization tweaks
| * | | vulkan_common: further initialization tweaksLiam2022-12-062-1/+9
| | | |
* | | | Merge pull request #9392 from lioncash/reporterliamwhite2022-12-062-25/+26
|\ \ \ \ | | | | | | | | | | reporter: Eliminate undefined behavior in SaveErrorReport
| * | | | reporter: Pass by const reference where applicableLioncash2022-12-062-19/+20
| | | | | | | | | | | | | | | | | | | | Same behavior, but without memory churn.
| * | | | reporter: Eliminate undefined behavior in SaveErrorReportLioncash2022-12-062-6/+6
| |/ / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The optionals are unconditionally dereferenced when setting the custom error text, and in a few cases this function is called using the default value of the optionals. This means we'd be dereferencing uninitialized storage. Since they're used unconditionally, we can use value_or to set a default when storage is uninitialized.
* | | | Merge pull request #9390 from lioncash/keyboardliamwhite2022-12-0622-100/+89
|\ \ \ \ | | | | | | | | | | applets: Extract callback types into aliases
| * | | | applets/controller: Use aliases for callbacksLioncash2022-12-064-6/+8
| | | | |
| * | | | applets/error: Use aliases for callbacksLioncash2022-12-064-16/+18
| | | | |
| * | | | applets/mii_edit: Use aliases for callbacksLioncash2022-12-062-3/+5
| | | | |
| * | | | applets/profile_select: Use aliases for callbacksLioncash2022-12-064-8/+8
| | | | | | | | | | | | | | | | | | | | Deduplicates callback definitions and situates it in one place.
| * | | | applets/web_browser: Use aliases for callbacksLioncash2022-12-064-32/+27
| | | | | | | | | | | | | | | | | | | | Deduplicates a lot of long callback declarations
| * | | | applets/software_keyboard: Use aliases for callbacksLioncash2022-12-064-35/+23
| |/ / / | | | | | | | | | | | | | | | | Deduplicates really long std::function declarations to make the interface nicer to read.
* | | | Merge pull request #9389 from lioncash/emumoveliamwhite2022-12-064-16/+14
|\ \ \ \ | | | | | | | | | | emulated_console/emulated_controller: std::move ParamPackage instances where applicable
| * | | | emulated_controller: Remove unused parameter in GetMappedDevices()Lioncash2022-12-063-5/+3
| | | | | | | | | | | | | | | | | | | | | | | | | This isn't used, so it can be removed to make the function a little nicer.
| * | | | emulated_controller: Use std::move() in GetMappedDevices()Lioncash2022-12-061-6/+6
| | | | | | | | | | | | | | | | | | | | Avoids churning allocations in a loop.
| * | | | emulated_console: Amend cast in SetTouch()Lioncash2022-12-061-1/+1
| | | | | | | | | | | | | | | | | | | | id is an int value, not a u32.
| * | | | emulated_console: std::move() ParamPackages and callbacks where applicableLioncash2022-12-061-4/+4
| |/ / /
* | | | Merge pull request #9386 from lioncash/initliamwhite2022-12-066-27/+25
|\ \ \ \ | | | | | | | | | | kernel: Ensure relevant class members are always initialized on construction
| * | | | kernel/k_shared_memory: Ensure device_memory is always initializedLioncash2022-12-051-1/+1
| | | | |
| * | | | kernel/k_memory_block: Ensure members are always initializedLioncash2022-12-052-22/+20
| | | | |
| * | | | kernel/physical_core: Ensure is_interrupted is always initializedLioncash2022-12-051-1/+1
| | | | |
| * | | | kernel/thread: Ensure stack_top and argument are always initializedLioncash2022-12-051-2/+2
| | | | |
| * | | | kernel/kernel: Ensure shutdown threads are always initializedLioncash2022-12-051-1/+1
| | | | |
* | | | | Merge pull request #9391 from abouvier/cmake-sdlliamwhite2022-12-064-22/+4
|\ \ \ \ \ | | | | | | | | | | | | cmake: use sdl2 imported target
| * | | | | cmake: use sdl2 imported targetAlexandre Bouvier2022-12-064-22/+4
| | |/ / / | |/| | |
* | | | | Merge pull request #9387 from abouvier/cmake-libusbliamwhite2022-12-061-3/+1
|\ \ \ \ \ | | | | | | | | | | | | cmake: prefer system libusb
| * | | | | cmake: prefer system libusbAlexandre Bouvier2022-12-061-3/+1
| | | | | |
* | | | | | configure_graphics: Make SPIRV backend string translatableLioncash2022-12-061-1/+1
|/ / / / / | | | | | | | | | | | | | | | The parenthetical needs to be translatable, like with GLASM
* | | | | Merge pull request #9369 from german77/mifareliamwhite2022-12-0611-52/+629
|\ \ \ \ \ | | | | | | | | | | | | service: nfc: Implement mifare service
| * | | | | input_common: Allow mifare filesNarr the Reg2022-12-052-16/+29
| | | | | |
| * | | | | service: nfc: Implement mifare serviceNarr the Reg2022-12-029-36/+600
| | |_|/ / | |/| | |
* | | | | Merge pull request #9360 from Kelebek1/R-E-S-P-E-C-Tliamwhite2022-12-061-29/+39
|\ \ \ \ \ | |_|/ / / |/| | | | Respect render mode override
| * | | | Respect render mode overrideKelebek12022-11-301-29/+39
| | | | |
* | | | | Merge pull request #6833 from abouvier/unbundleliamwhite2022-12-059-27/+16
|\ \ \ \ \ | |_|_|/ / |/| | | | cmake: prefer system libraries
| * | | | cmake: prefer system librariesAlexandre Bouvier2022-12-049-27/+16
| | | | |
* | | | | Vulkan: Implement Alpha coverageFernando Sahmkow2022-12-053-2/+6
| |_|_|/ |/| | |
* | | | Merge pull request #9381 from liamwhite/uninitMai2022-12-041-7/+7
|\ \ \ \ | | | | | | | | | | service_thread: fix uninitialized memory usage
| * | | | service_thread: fix uninitialized memory usageLiam2022-12-041-7/+7
| | | | |
* | | | | Merge pull request #9232 from bunnei/audio-default-threadliamwhite2022-12-043-18/+12
|\ \ \ \ \ | |/ / / / |/| | | | hle: service: audio: Use default service thread.
| * | | | hle: service: audio: Use default service thread.bunnei2022-11-123-18/+12
| | | | | | | | | | | | | | | | | | | | - This was arbitrarily added by me, and does not appear to be helpful.
* | | | | Merge pull request #9273 from ameerj/per-game-profileliamwhite2022-12-0413-27/+587
|\ \ \ \ \ | | | | | | | | | | | | Configuration: Add per-game input profiles
| * | | | | configure_input_player: Fix profile saving when using handheld controller typeameerj2022-11-291-1/+7
| | | | | |
| * | | | | config: Custom profile detection fixesameerj2022-11-296-64/+108
| | | | | | | | | | | | | | | | | | | | | | | | Also only reads/writes applicable configs for the custom profiles.
| * | | | | configure_input_per_game: Allow configuring all 8 playersameerj2022-11-293-54/+113
| | | | | |
| * | | | | Configuration: Add per-game input profilesameerj2022-11-2011-14/+465
| | | | | |
* | | | | | Merge pull request #9372 from liamwhite/vk12liamwhite2022-12-0417-165/+209
|\ \ \ \ \ \ | | | | | | | | | | | | | | vulkan_common: promote extension usages to core when possible
| * | | | | | vulkan_common: add feature test for shaderDrawParametersLiam2022-12-041-1/+13
| | | | | | |
| * | | | | | vulkan_common: clean up extension usageLiam2022-12-0412-102/+105
| | | | | | |
| * | | | | | vulkan_common: correct usage of timeline semaphore fallbacksLiam2022-12-041-2/+1
| | | | | | |
| * | | | | | vulkan_common: ensure all mandatory features are tested in feature reportLiam2022-12-041-1/+24
| | | | | | |
| * | | | | | vulkan_common: unsuffix 16-bit storage feature test structureLiam2022-12-041-2/+2
| | | | | | |
| * | | | | | vulkan_common: unsuffix timeline semaphore feature test structureLiam2022-12-041-2/+2
| | | | | | |
| * | | | | | vulkan_common: add logicOp to feature reportLiam2022-12-041-1/+2
| | | | | | |
| * | | | | | vulkan_common: promote host query reset usage to coreLiam2022-12-044-11/+12
| | | | | | |
| * | | | | | vulkan_common: promote descriptor update template usage to coreLiam2022-12-048-37/+36
| | | | | | |
| * | | | | | vulkan_common: promote timeline semaphore usage to coreLiam2022-12-043-9/+15
| | |_|/ / / | |/| | | |
* / | | | | yuzu-cmd: link SDL2 correctlyLiam2022-12-041-1/+1
|/ / / / /
* | | | | Merge pull request #9374 from liamwhite/externalsliamwhite2022-12-045-21/+23
|\ \ \ \ \ | | | | | | | | | | | | externals: update dynarmic, SDL2
| * | | | | externals: update dynarmic, SDL2Liam2022-12-045-21/+23
| | | | | |
* | | | | | Merge pull request #9344 from liamwhite/nullbunnei2022-12-0320-28/+383
|\ \ \ \ \ \ | |/ / / / / |/| | | | | video_core: add null backend
| * | | | | video_core: add null backendLiam2022-11-2920-28/+383
| | | | | |
* | | | | | Merge pull request #9300 from ameerj/pchliamwhite2022-12-0328-4/+157
|\ \ \ \ \ \ | | | | | | | | | | | | | | CMake: Use precompiled headers to improve compile times
| * | | | | | CMake: Consolidate common PCH headersameerj2022-12-0114-84/+29
| | | | | | |
| * | | | | | string_util: Fix Mingw compile errorameerj2022-12-011-2/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | Co-Authored-By: liamwhite <9658600+liamwhite@users.noreply.github.com>
| * | | | | | CMake: Disable PCH on MSVC + Buildcache configsameerj2022-11-301-4/+0
| | | | | | |
| * | | | | | CMake: Use precompiled headersameerj2022-11-3025-1/+214
| | | | | | |
| * | | | | | value.h: remove recursive includeameerj2022-11-301-1/+0
| | | | | | |
* | | | | | | Merge pull request #9289 from liamwhite/fruit-companyliamwhite2022-12-0378-37/+949
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | general: fix compile for Apple Clang
| * | | | | | | general: fix compile for Apple ClangLiam2022-11-2378-37/+949
| | | | | | | |
* | | | | | | | Merge pull request #9353 from vonchenplus/draw_indexedliamwhite2022-12-032-27/+22
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | video_core: Fine tuning the index drawing judgment logic
| * | | | | | | | video_core: Fine tuning the index drawing judgment logicFeng Chen2022-12-012-27/+22
| | |_|/ / / / / | |/| | | | | |
* | | | | | | | Merge pull request #9303 from liamwhite/new-vulkan-initMatías Locatti2022-12-0213-101/+191
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | Vulkan: update initialization
| * | | | | | | | Vulkan: update initializationLiam2022-11-2713-101/+191
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Co-authored-by: bylaws <bylaws@users.noreply.github.com>
* | | | | | | | | Merge pull request #9363 from liamwhite/gsMatías Locatti2022-12-029-6/+230
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | shader_recompiler: add gl_Layer translation GS for older hardware
| * | | | | | | | | shader_recompiler: add gl_Layer translation GS for older hardwareLiam2022-12-019-6/+230
| | |_|_|/ / / / / | |/| | | | | | |
* | | | | | | | | Merge pull request #9348 from Morph1984/when-the-network-is-downliamwhite2022-12-021-7/+34
|\ \ \ \ \ \ \ \ \ | |_|_|_|_|_|_|_|/ |/| | | | | | | | service: nifm: Update stubs for Submit/GetRequestState/GetResult
| * | | | | | | | service: nifm: Update stubs for Submit/GetRequestState/GetResultMorph2022-11-291-7/+34
| | | | | | | | |
* | | | | | | | | Merge pull request #9320 from yuzu-emu/fix-audio-suspendFernando S2022-11-303-13/+14
|\ \ \ \ \ \ \ \ \ | |_|_|_|_|_|_|_|/ |/| | | | | | | | AudioCore: Take suspend lock when stalling the running process.
| * | | | | | | | audio_core: sink_stream: Hold the suspend lock when process is stalled.bunnei2022-11-302-7/+9
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | - Prevents us from clashing with other callers trying to un/stall.
| * | | | | | | | core: Use atomic instead of a lock to protect is_paused.bunnei2022-11-261-6/+5
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | - This allows us to call IsPaused() elsewhere if we are holding the suspend lock.
* | | | | | | | | Merge pull request #9349 from lat9nq/cmake-322Morph2022-11-303-3/+15
|\ \ \ \ \ \ \ \ \ | |_|_|/ / / / / / |/| | | | | | | | CMakeLists: Bump minimum required CMake version to 3.22
| * | | | | | | | CMake: Directly link to SDL2-static when appropriatelat9nq2022-11-293-3/+15
| | |/ / / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Trying to be lazy and alias SDL2 to SDL2-static causes issues in later versions of CMake. Just use the same condition to tell which one to use.
* | | | | | | | Merge pull request #9308 from lat9nq/from-scratchliamwhite2022-11-302-22/+64
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | startup_checks: Use Windows flow for *nix
| * | | | | | | | startup_checks: Use fmt::print, fix exec error handlinglat9nq2022-11-241-21/+21
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Uses fmt::print opposed to std::fprintf for error printing. Call exit instead of returning to caller to prevent a like issue the previous commit was trying to solve. Removes unneeded comment. Co-authored-by: liamwhite <liamwhite@users.noreply.github.com> Co-authored-by: Lioncash <mathew1800@gmail.com>
| * | | | | | | | startup_checks: Use Windows flow for *nixlat9nq2022-11-242-9/+51
| | |_|/ / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Spawns a child using fork and exec as opposed to fork alone. Workaround for the macos file manager complaining about not supporting fork without exec. Control flow for *nix is now roughly the same as for Windows.
* | | | | | | | Merge pull request #9322 from german77/pump_eventsliamwhite2022-11-306-10/+35
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | input_common: Pump SDL events from main thread
| * | | | | | | | input_common: Pump sdl events from main threadgerman772022-11-276-10/+35
| | | | | | | | |
* | | | | | | | | Merge pull request #9352 from lioncash/vidcastliamwhite2022-11-3010-88/+60
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | engines: Remove unnecessary casts
| * | | | | | | | | maxwell_3d: Mark shifted value as unsignedLioncash2022-11-291-3/+3
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Otherwise this is technically creating a signed int result that gets converted. Just a consistency change. While we're in the area, we can mark Samples() as const.
| * | | | | | | | | engines: Remove unnecessary castsLioncash2022-11-2910-85/+57
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | In a few cases we have some casts that can be trivially removed.
* | | | | | | | | | host1x/syncpoint_manager: Eliminate unnecessary std::function constructionLioncash2022-11-291-4/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | We can just pass the function object through, and if it's a valid function, then it will automatically be converted.
* | | | | | | | | | host1x/syncpoint_manager: Pass DeregisterAction() handle as const-refLioncash2022-11-292-6/+6
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The handle is only compared against and not modified in any way, so we can pass it by const reference. This also allows us to mark the respective parameters for DeregisterGuestAction() and DeregisterHostAction() as const references as well.
* | | | | | | | | | Merge pull request #9340 from lioncash/nvdrvliamwhite2022-11-291-26/+18
|\ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | nvdrv: Simplify builder declarations
| * | | | | | | | | | nvdrv: Simplify builder declarationsLioncash2022-11-281-26/+18
| |/ / / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | We can just use auto here. If one of these ever happens to not be derived from nvdevice, then this will cause a compilation error. We can also move the devices into the collection to get rid of an unnecessary atomic reference count increment and decrement.
* | | | | | | | | | Merge pull request #9347 from lioncash/vcastliamwhite2022-11-291-11/+4
|\ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | video_core/surface: Eliminate casts in GetFormatType()
| * | | | | | | | | | video_core/surface: Eliminate casts in GetFormatType()Lioncash2022-11-291-11/+4
| |/ / / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | We can just compare directly and get rid of verbose casting.
* | | | | | | | | | Merge pull request #9346 from lioncash/vtableliamwhite2022-11-291-0/+1
|\ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | producer_listener: Add virtual destructor to IProducerListener
| * | | | | | | | | | producer_listener: Add virtual destructor to IProducerListenerLioncash2022-11-291-0/+1
| |/ / / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Several member variables are shared_ptr's to this base class. Even though producer listeners are still unimplemented, this ensures we always have consistent deletion behavior once this ends up being used polymorphically.
* | | | | | | | | | Merge pull request #9345 from lioncash/fenceliamwhite2022-11-296-16/+15
|\ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | consumer_base: Pass std::shared_ptr by const reference
| * | | | | | | | | | buffer_item_consumer: Pass fence by const-ref in ReleaseBuffer()Lioncash2022-11-293-4/+3
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This isn't directly modified. Also allows rvalues to be used with it.
| * | | | | | | | | | buffer_queue_consumer: std::move std::shared_ptr in Connect()Lioncash2022-11-291-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Avoids an unnecessary reference count increment and decrement
| * | | | | | | | | | consumer_base: Pass shared_ptr by const referenceLioncash2022-11-292-6/+6
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Avoids churning atomic reference count increments and decrements.
| * | | | | | | | | | consumer_base: Remove redundant virtualLioncash2022-11-291-5/+5
| |/ / / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | override already serves this purpose
* | | | | | | | | | Merge pull request #9343 from lioncash/boundsliamwhite2022-11-292-17/+31
|\ \ \ \ \ \ \ \ \ \ | |_|_|_|/ / / / / / |/| | | | | | | | | syncpoint_manager: Reduce redundant bounds checks
| * | | | | | | | | syncpoint_manager: Mark IsSyncpointAllocated() as constLioncash2022-11-282-3/+3
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This doesn't modify class state at all.
| * | | | | | | | | syncpoint_manager: Reduce number of bounds checksLioncash2022-11-281-14/+28
| |/ / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | The only time we need to check bounds is on the first access.
* | | | | | | | | Merge pull request #9339 from lioncash/cacheheaderMorph2022-11-282-4/+3
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | common/cache_management: Amend header includes
| * | | | | | | | | common/cache_management: Amend header includesLioncash2022-11-282-4/+3
| |/ / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Narrows the include in the header to <cstddef>, since that's what houses size_t's definition, meanwhile the <cstdint> include can be moved into the cpp file.
* | | | | | | | | Merge pull request #9338 from lioncash/propertiesMorph2022-11-282-2/+18
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | input_common/helpers: Mark analog property structs members as static constexpr
| * | | | | | | | | input_common/helpers: Mark analog property structs members as static constexprLioncash2022-11-282-2/+18
| |/ / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | These are const with no dependency on any other data members, so we can make these static constexpr to reduce the overall object size.
* | | | | | | | | Merge pull request #9337 from lioncash/pbrMorph2022-11-287-104/+112
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | common/input: Add helper functions for constructing input and output devices
| * | | | | | | | | core/hid/emulated_controller: Use ranges version of transformLioncash2022-11-281-19/+15
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Makes the transform calls much nicer to read.
| * | | | | | | | | common/input: Add helpers functions for creating input and output devicesLioncash2022-11-287-90/+102
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Avoids the redundancy of needing to explictly specify the common namespace and the type.
| * | | | | | | | | common/input: Pass ParamPackage by const reference in CreateDeviceLioncash2022-11-281-3/+3
| |/ / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This was previously being passed by value, which was unnecessary and created more allocations than necessary.
* / / / / / / / / yuzu/main: Merge variable declaration into ifdefLioncash2022-11-281-2/+1
|/ / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | This is only used in the non-Windows path.
* | | | | | | | Merge pull request #9325 from german77/default_by_defaultliamwhite2022-11-281-1/+5
|\ \ \ \ \ \ \ \ | |_|_|_|/ / / / |/| | | | | | | yuzu-cmd: Fix default config value
| * | | | | | | yuzu-cmd: Fix default config valuegerman772022-11-281-1/+5
| | | | | | | |
* | | | | | | | Merge pull request #8829 from Docteh/qt6_0002liamwhite2022-11-279-14/+56
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | CMake: rework for Qt6 support
| * | | | | | | | CMake: rework for Qt6 supportKyle Kienapfel2022-11-243-14/+30
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This PR rearranges things in the CMake system to make compiling with Qt6 possible 1. Camera API has changed in Qt6, so the camera feature is disabled 2. A previous fix involving QLocale is now version gated. 3. QRegExp replaced with QRegularExpression, see #5343 4. Qt6_LOCATION option added to specify a location to search for Qt6 (see examples below) 5. windeployqt is used to copy Qt6 files into the build directory on Windows Notes for Arch Linux Arch install happened to have qt6-base qt6-declarative qt6-translations installed mkdir build && cd build cmake .. -GNinja -DYUZU_USE_BUNDLED_VCPKG=ON -DYUZU_TESTS=OFF -DENABLE_QT6=YES -DYUZU_USE_BUNDLED_QT=NO Windows (MSVC) Qt wants users to download precompiled libraries via an online installer, it is worth noting that the GPL/LGPL takes precendence over any ... In the Qt Maintenance tool, under a version, such as 6.3.1 Select "MSVC 2019 64-bit" Under Additional Libraries Qt Multimedia may be of use for Camera support For the Web Applet I had to select the following: PDF Positioning WebChannel WebEngine mkdir build && cd build cmake -G "Visual Studio 16 2019" -DQt6_LOCATION=C:/Qt/6.4.0/msvc2019_64/ \ -DENABLE_COMPATIBILITY_LIST_DOWNLOAD=YES -DYUZU_USE_BUNDLED_QT=NO \ -DENABLE_QT_TRANSLATION=YES -DENABLE_QT6=YES .. Some numbers for reference (msvc2019_64) Qt5 (slimmed down) 508 MB Qt5.15.2 all in 929 MB Qt6.3.1 1.71 GB Qt6.3.2 1.73 GB Qt6.4.0-beta3 1.83 GB Qt6.4.0 1.67 GB
| * | | | | | | | qt: Add Qt version to LogRuntimesKyle Kienapfel2022-11-181-0/+1
| | | | | | | | |
| * | | | | | | | Qt6: Disable IR Sensor when compiling with Qt6Kyle Kienapfel2022-11-186-0/+25
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Gating the IR Sensor code behind a macro like so `#if (QT_VERSION < QT_VERSION_CHECK(6, 0, 0)) && YUZU_USE_QT_MULTIMEDIA` The YUZU_USE_QT_MULTIMEDIA flag is implemented in later commit Also the locale fix in src/yuzu/main.cpp is now gated against Qt6, as it causes compilation error
* | | | | | | | | Merge pull request #9317 from german77/input-crashliamwhite2022-11-273-0/+13
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | yuzu-cmd: Fix input callback crash on close
| * | | | | | | | | yuzu-cmd: Fix input callback crash on closegerman772022-11-273-0/+13
| | |_|/ / / / / / | |/| | | | | | |
* | | | | | | | | Merge pull request #9323 from german77/intructionsliamwhite2022-11-271-3/+26
|\ \ \ \ \ \ \ \ \ | |/ / / / / / / / |/| | | | | | | | yuzu-cmd: Update configuration file description
| * | | | | | | | yuzu-cmd: Update configuration file descriptiongerman772022-11-271-3/+26
| | |/ / / / / / | |/| | | | | |
* | | | | | | | Merge pull request #9276 from goldenx86/fsrSliderbunnei2022-11-278-1/+200
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | FSR Sharpening Slider
| * | | | | | | | Sharpness instead of SharpeningMatías Locatti2022-11-261-3/+3
| | | | | | | | |
| * | | | | | | | configure_graphics: Implement custom FSR Sharpening settinglat9nq2022-11-262-61/+128
| | | | | | | | |
| * | | | | | | | settings: Reset FSR sharpening global state with the otherslat9nq2022-11-261-0/+1
| | | | | | | | |
| * | | | | | | | FSR Sharpening Slider part 1 - only a global sliderMatías Locatti2022-11-248-1/+132
| | |_|/ / / / / | |/| | | | | |
* | | | | | | | crypto: use user-provided keys whenever possibleValeri2022-11-271-4/+4
| | | | | | | | | | | | | | | | | | | | | | | | Solves an issue where autogenerated title keys would take precedence over those provided by user.
* | | | | | | | OopsMatías Locatti2022-11-261-1/+1
| | | | | | | |
* | | | | | | | Replace GLSL as the default OpenGL shader backendMatías Locatti2022-11-261-1/+1
| |/ / / / / / |/| | | | | | | | | | | | | GLASM is not very compatible with the latest games, and too many people have the special superpower to break their Vulkan support.
* | | | | | | Merge pull request #9288 from vonchenplus/deferred_drawliamwhite2022-11-262-61/+63
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | video_core: Fine tune maxwell drawing trigger mechanism
| * | | | | | | video_core: Optimize maxwell drawing trigger mechanismFengChen2022-11-222-61/+63
| | |_|_|/ / / | |/| | | | |
* | | | | | | Merge pull request #9307 from Morph1984/not-used-correctlyliamwhite2022-11-261-3/+3
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | maxwell_to_vk: Fix format usage bits and add R16_SINT
| * | | | | | | maxwell_to_vk: Add R16_SINTMorph2022-11-241-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This was somehow missed when the format was added to GL
| * | | | | | | maxwell_to_vk: Fix format usage bitsMorph2022-11-241-2/+2
| | |/ / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | - VK_FORMAT_B8G8R8A8_UNORM supports the STORAGE_IMAGE_BIT - VK_FORMAT_R4G4B4A4_UNORM_PACK16 does not support the COLOR_ATTACHMENT_BIT
* | | | | | | Merge pull request #9297 from Kelebek1/sink_oobliamwhite2022-11-251-6/+8
|\ \ \ \ \ \ \ | |_|_|_|/ / / |/| | | | | | [audio_core] Fix an OoB with sample sinking
| * | | | | | Use the maximum input index for samples buffer span size, not just the input countKelebek12022-11-221-6/+8
| | | | | | |
* | | | | | | Merge pull request #9304 from liamwhite/menu-rollbunnei2022-11-251-0/+9
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | Qt: assign menuRole properties for actions
| * | | | | | | Qt: assign menuRole properties for actionsLiam2022-11-231-0/+9
| | |/ / / / / | |/| | | | |
* | | | | | | Merge pull request #9305 from lioncash/requestbunnei2022-11-2513-72/+78
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | hle_ipc: Add helper function for determining element counts
| * | | | | | | service: Make use of buffer element count helpersLioncash2022-11-2312-47/+41
| | | | | | | |
| * | | | | | | hle_ipc: Add helper functions for getting number of buffer elementsLioncash2022-11-231-0/+12
| | | | | | | |
| * | | | | | | hle_ipc: Mark relevant member functions as [[nodiscard]]Lioncash2022-11-231-25/+25
| |/ / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | Will allow the compiler to complain about cases where ignoring the return value would be a bug.
* | | | | | | Merge pull request #9194 from FernandoS27/yfc-fermi2dliamwhite2022-11-2521-31/+1832
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | YFC - Fermi2D: Rework blit engine and add a software blitter.
| * | | | | | | Fermi2D: Cleanup and address feedback.Fernando Sahmkow2022-11-243-8/+150
| | | | | | | |
| * | | | | | | GPU: Implement additional render target formats.Fernando Sahmkow2022-11-247-12/+126
| | | | | | | |
| * | | | | | | MaxwellDMA: Implement BlockLinear to BlockLinear copies.Fernando Sahmkow2022-11-242-1/+69
| | | | | | | |
| * | | | | | | Fermi2D: Implement Bilinear software filtering and address feedback.Fernando Sahmkow2022-11-247-116/+180
| | | | | | | |
| * | | | | | | Fermi2D: Rework blit engine and add a software blitter.Fernando Sahmkow2022-11-2412-18/+1431
| |/ / / / / /
* / / / / / / GPU: Fix buffer cache issue, engine upload not inlining memory in multiline and pessismistic invalidation.Fernando Sahmkow2022-11-244-15/+9
|/ / / / / /
* | | | | | Merge pull request #9299 from lioncash/castliamwhite2022-11-222-15/+18
|\ \ \ \ \ \ | | | | | | | | | | | | | | k_handle_table: Remove cast to void* in GetObjectForIpc
| * | | | | | k_handle_table: Remove cast to void* in GetObjectForIpcLioncash2022-11-222-15/+18
| |/ / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This was used to get around the KProcess class being incomplete. We can just move this to the cpp file and eliminate the cast entirely, letting the compiler do its work.
* | | | | | Merge pull request #9219 from german77/nfc_implbunnei2022-11-2212-84/+723
|\ \ \ \ \ \ | |/ / / / / |/| | | | | service: nfc: Implement NFC IUser service
| * | | | | Merge branch 'master' into nfc_implNarr the Reg2022-11-2084-190/+2159
| |\ \ \ \ \
| * | | | | | service: nfc: Implement nfc userNarr the Reg2022-11-1912-84/+723
| | | | | | |
* | | | | | | qt_amiibo_settings: Use WebClient only if ENABLE_WEB_SERVICE is enabledMorph2022-11-211-0/+4
| |_|/ / / / |/| | | | | | | | | | | | | | | | | Resolves compilation errors when ENABLE_WEB_SERVICE is disabled in CMake configuration
* | | | | | Merge pull request #9279 from liamwhite/this-would-have-never-happened-in-rustMorph2022-11-201-1/+1
|\ \ \ \ \ \ | | | | | | | | | | | | | | dmnt:cht: fix copy-paste error
| * | | | | | dmnt:cht: fix copy-paste errorLiam2022-11-201-1/+1
| | |/ / / / | |/| | | |
* | | | | | Merge pull request #9216 from vonchenplus/reimp_inline_index_bufferliamwhite2022-11-205-33/+31
|\ \ \ \ \ \ | |/ / / / / |/| | | | | video_core: Reimplement inline index buffer binding
| * | | | | video_core: Reimplement inline index buffer bindingFeng Chen2022-11-155-33/+31
| | | | | |
* | | | | | Merge pull request #9238 from german77/cabinet_appletbunnei2022-11-2020-16/+1310
|\ \ \ \ \ \ | | | | | | | | | | | | | | service: am: Implement cabinet applet
| * | | | | | general: Address review commentsgerman772022-11-1414-190/+200
| | | | | | |
| * | | | | | service: am: Fix cabinet applet resultgerman772022-11-132-10/+22
| | | | | | |
| * | | | | | yuzu: Implement cabinet applet frontendgerman772022-11-136-1/+865
| | | | | | |
| * | | | | | service: am: Implement cabinet applet backendgerman772022-11-139-7/+362
| | | | | | |
| * | | | | | input_common: Add amiibo applet functionsgerman772022-11-133-1/+19
| | | | | | |
| * | | | | | service: nfc: fix tagprotocol and implement GetApplicationAreaIdgerman772022-11-134-8/+43
| | |/ / / / | |/| | | |
* | | | | | Merge pull request #9249 from goldenx86/available-vramMorph2022-11-201-0/+4
|\ \ \ \ \ \ | | | | | | | | | | | | | | Add available Vulkan VRAM to log files
| * | | | | | Update renderer_vulkan.cppMatías Locatti2022-11-161-0/+4
| | |_|_|/ / | |/| | | |
* | | | | | Merge pull request #9254 from FernandoS27/auto-cpu-fixbunnei2022-11-191-1/+0
|\ \ \ \ \ \ | | | | | | | | | | | | | | Dynarmic: Remove inaccurate NaN from Auto CPU settings.
| * | | | | | Dynarmic: Remove inaccurate NaN from Auto CPU settings.Fernando Sahmkow2022-11-171-1/+0
| |/ / / / /
* | | | | | Merge pull request #9191 from german77/touching_soulsliamwhite2022-11-197-52/+123
|\ \ \ \ \ \ | | | | | | | | | | | | | | core: hid: Implement true multitouch support
| * | | | | | service: hid: Only overclock npad controllersgerman772022-11-192-6/+30
| | | | | | |
| * | | | | | core: hid: Implement true multitouch supportNarr the Reg2022-11-195-46/+93
| | |/ / / / | |/| | | |
* | | | | | Merge pull request #9260 from liamwhite/youre-in-big-trouble-nowFernando S2022-11-191-0/+1
|\ \ \ \ \ \ | | | | | | | | | | | | | | spirv_emit_context: add missing flat decoration
| * | | | | | spirv_emit_context: add missing flat decorationLiam2022-11-191-0/+1
| | | | | | |
* | | | | | | Merge pull request #9252 from liamwhite/radv-superioritybunnei2022-11-198-13/+27
|\ \ \ \ \ \ \ | |/ / / / / / |/| | | | | | maxwell3d: HLE multi-layer clear macro
| * | | | | | maxwell3d: full HLE for multi-layer clearsLiam2022-11-178-24/+17
| | | | | | |
| * | | | | | maxwell3d: HLE multi-layer clear macroLiam2022-11-172-1/+22
| | |/ / / / | |/| | | |
* | | | | | Merge pull request #9253 from vonchenplus/attr_layerliamwhite2022-11-195-0/+13
|\ \ \ \ \ \ | | | | | | | | | | | | | | shader: Implement miss attribute layer
| * | | | | | shader: Implement miss attribute layerFengChen2022-11-175-0/+13
| | |_|/ / / | |/| | | |
* | | | | | Merge pull request #9234 from liamwhite/data-cash-moneybunnei2022-11-187-8/+214
|\ \ \ \ \ \ | |_|_|_|/ / |/| | | | | kernel: implement data cache management operations
| * | | | | kernel: implement FlushProcessDataCacheLiam2022-11-124-8/+125
| | | | | |
| * | | | | common: add cache management functionsLiam2022-11-123-0/+89
| | | | | |
* | | | | | Merge pull request #9244 from liamwhite/lost-wakeupbunnei2022-11-184-12/+16
|\ \ \ \ \ \ | | | | | | | | | | | | | | nvnflinger: fix lost wakeup
| * | | | | | nvnflinger: fix lost wakeupLiam2022-11-154-12/+16
| | | | | | |
* | | | | | | Merge pull request #9229 from Docteh/achy_breaky_heartMorph2022-11-1823-6/+37
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | Add break for default cases
| * | | | | | | Add break for default casesKyle Kienapfel2022-11-1424-6/+38
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Visual Studio has an option to search all files in a solution, so I did a search in there for "default:" looking for any missing break statements. I've left out default statements that return something, and that throw something, even if via ThrowInvalidType. UNREACHABLE leads towards throw R_THROW macro leads towards a return
* | | | | | | | Merge pull request #9228 from HidroSaphire/patch-1liamwhite2022-11-181-0/+1
|\ \ \ \ \ \ \ \ | |_|_|_|_|/ / / |/| | | | | | | Add break statement in default case
| * | | | | | | Add break statement in default caseEnrico Mancuso2022-11-111-0/+1
| |/ / / / / / | | | | | | | | | | | | | | According to the contributing page (https://github.com/yuzu-emu/yuzu/wiki/Contributing) the default cases should have a break statement
* | | | | | | configure_profile_manager: Cleanup reference/pointer usagelat9nq2022-11-162-8/+10
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Co-authored-by: Morph <39850852+Morph1984@users.noreply.github.com> Co-authored-by: Mai M. <mathew1800@gmail.com>
* | | | | | | configure_profile_manager: Remove profile picture borderlat9nq2022-11-161-0/+6
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The border adds its own width at least on Linux which causes the icon to be offset by 1px, and cropped by 2px on the bottom and right sides.
* | | | | | | configure_profile_manager: Use a custom dialog for deletionlat9nq2022-11-162-11/+81
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | A hopefully more informative dialog that most importantly notifies the user that their saves will be deleted with the user profile. cpm: Only keep track of UI elements that we need cpm: Remove unused forward declarations cpm: Add missing include
* | | | | | | Merge pull request #9243 from german77/resultbunnei2022-11-151-1/+75
|\ \ \ \ \ \ \ | |_|/ / / / / |/| | | | | | core: Update result module
| * | | | | | core: Update result moduleNarr the Reg2022-11-151-1/+75
| | |_|_|/ / | |/| | | |
* | | | | | Merge pull request #9225 from liamwhite/debugger-instanceliamwhite2022-11-134-68/+248
|\ \ \ \ \ \ | | | | | | | | | | | | | | Debugger improvements
| * | | | | | gdbstub: add ams monitor commandsLiam2022-11-113-0/+155
| | | | | | |
| * | | | | | debugger: allow more than one connection attempt per sessionLiam2022-11-101-68/+93
| | | | | | |
* | | | | | | Ignore ARM for core countMatías Locatti2022-11-121-2/+1
| |/ / / / / |/| | | | |
* | | | | | Merge pull request #9226 from Kelebek1/regs_regressionbunnei2022-11-126-5/+32
|\ \ \ \ \ \ | | | | | | | | | | | | | | [video_core] Fix a couple regs regressions
| * | | | | | Fix regs regression with OpenGL two-sided stencil, and re-add data invalidation regKelebek12022-11-116-5/+32
| | | | | | |
* | | | | | | Merge pull request #9224 from liamwhite/services-arent-processesbunnei2022-11-122-29/+13
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | service_thread: remove explicit KProcess
| * | | | | | | service_thread: remove explicit KProcessLiam2022-11-102-29/+13
| | |/ / / / / | |/| | | | |
* | | | | | | Merge pull request #9231 from goldenx86/corecountMai2022-11-123-3/+64
|\ \ \ \ \ \ \ | |_|_|_|_|_|/ |/| | | | | | Add CPU core count to log files
| * | | | | | Add CPU core count to log filesMatías Locatti2022-11-123-3/+64
| | |_|/ / / | |/| | | |
* | | | | | Merge pull request #9204 from vonchenplus/dma_copy_1d_random_crashliamwhite2022-11-111-17/+20
|\ \ \ \ \ \ | | | | | | | | | | | | | | video_core: Fix dma copy 1D random crash
| * | | | | | video_core: Fix dma copy 1D random crashFengChen2022-11-101-17/+20
| | | | | | |
* | | | | | | Merge pull request #9133 from FearlessTobi/compat-improvementsliamwhite2022-11-115-71/+404
|\ \ \ \ \ \ \ | |_|_|_|_|/ / |/| | | | | | yuzu/compatdb: Improve compatibility submission system
| * | | | | | yuzu/main: Change to 8_GiB instead of magic numberTobias2022-11-111-1/+1
| | | | | | | | | | | | | | | | | | | | | Co-authored-by: Morph <39850852+Morph1984@users.noreply.github.com>
| * | | | | | yuzu/compatdb: Rework compatibility submission systemFearlessTobi2022-11-105-71/+404
| | | | | | | | | | | | | | | | | | | | | | | | | | | | Co-Authored-By: Narr the Reg <5944268+german77@users.noreply.github.com>
* | | | | | | Merge pull request #9167 from vonchenplus/tessliamwhite2022-11-1118-6/+63
|\ \ \ \ \ \ \ | |_|_|/ / / / |/| | | | | | video_core: Fix few issues in Tess stage
| * | | | | | video_core: Fix few issues in Tess stageFengChen2022-11-0718-6/+63
| | | | | | |
* | | | | | | Merge pull request #9223 from goldenx86/threadcountbunnei2022-11-111-0/+2
|\ \ \ \ \ \ \ | |_|_|_|_|/ / |/| | | | | | Add CPU thread count to log files
| * | | | | | Me likesMatías Locatti2022-11-101-1/+1
| | | | | | | | | | | | | | | | | | | | | Co-authored-by: Morph <39850852+Morph1984@users.noreply.github.com>
| * | | | | | Add CPU thread count to log filesMatías Locatti2022-11-101-0/+2
| | | | | | |
* | | | | | | ir/texture_pass: Use host_info instead of querying Settings::values (#9176)Morph2022-11-1112-16/+23
| | | | | | |
* | | | | | | Merge pull request #9198 from liamwhite/arm64bunnei2022-11-1111-24/+57
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | Initial ARM64 support
| * | | | | | | Initial ARM64 supportLiam2022-11-0911-24/+57
| | | | | | | |
* | | | | | | | Merge pull request #9180 from Docteh/remove_stuffMai2022-11-112-20/+33
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | UI: split up strings relating to content removal
| * | | | | | | | UI: split up strings relating to content removalKyle Kienapfel2022-11-052-20/+33
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Requested by Italian translator (Fs00 in Discord) "Remove Installed Game %1?" "Error Removing %1" I didn't press for translated strings, so have a taste direct from deepl Rimuovere il contenuto del gioco installato? Rimuovere l'aggiornamento del gioco installato? Rimuovere il DLC del gioco installato?
* | | | | | | | | Merge pull request #9217 from HidroSaphire/patch-1Mai2022-11-111-0/+1
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | Add break statement in default cases
| * | | | | | | | | Add break statement in default casesEnrico Mancuso2022-11-091-0/+1
| | |/ / / / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | According to the contributing page (https://github.com/yuzu-emu/yuzu/wiki/Contributing) the default cases should have a break statement default: // Yes, even break for the last case break;
* | | | | | | | | Merge pull request #9192 from german77/i_had_to_copy_each_one_againbunnei2022-11-101-217/+120
|\ \ \ \ \ \ \ \ \ | |_|_|_|_|_|_|/ / |/| | | | | | | | yuzu: Change QtKeyToSwitchKey switch case to array
| * | | | | | | | yuzu: Change QtKeyToSwitchKey switch case to arraygerman772022-11-071-217/+120
| | | | | | | | |
* | | | | | | | | kernel/svc_types: refreshLiam2022-11-1019-137/+563
| |_|_|/ / / / / |/| | | | | | |
* | | | | | | | Merge pull request #9182 from liamwhite/services-are-processesbunnei2022-11-105-25/+56
|\ \ \ \ \ \ \ \ | |_|/ / / / / / |/| | | | | | | kernel: assign KProcess to service threads
| * | | | | | | service_thread: register service threads to the logical owner processLiam2022-11-045-20/+39
| | | | | | | |
| * | | | | | | kernel: avoid racy behavior in global suspensionLiam2022-11-041-5/+17
| | |/ / / / / | |/| | | | |
* | | | | | | Merge pull request #9215 from liamwhite/swordfightFernando S2022-11-092-3/+9
|\ \ \ \ \ \ \ | |_|_|_|_|_|/ |/| | | | | | Ensure correctness of atomic store ordering
| * | | | | | Ensure correctness of atomic store orderingLiam2022-11-092-3/+9
| | |_|_|_|/ | |/| | | |
* / | | | | service_thread: fix deletionLiam2022-11-074-39/+33
|/ / / / /
* | | / / video_core:Fix vmm kinds size errorFengChen2022-11-061-1/+1
| |_|/ / |/| | |
* | | | Merge pull request #9163 from vonchenplus/draw_errorFernando S2022-11-061-32/+25
|\ \ \ \ | | | | | | | | | | video_core: Fix drawing trigger mechanism regression
| * | | | video_core: Fix drawing trigger mechanism regressionFengChen2022-10-311-32/+25
| | | | |
* | | | | Merge pull request #9173 from bunnei/kern-update-15liamwhite2022-11-0538-737/+2786
|\ \ \ \ \ | |_|_|/ / |/| | | | Kernel: Various updates for FW 15.0.x
| * | | | core: hle: kernel: Address review comments.Liam2022-11-052-2/+2
| | | | |
| * | | | core: hle: kernel: k_page_table: Remove unnecessary casts.bunnei2022-11-041-17/+8
| | | | |
| * | | | core: hle: kernel: k_page_table: Manually open/close pages for IPC methods.bunnei2022-11-041-0/+18
| | | | |
| * | | | core: hle: kernel: k_page_table: Implement IPC memory methods.bunnei2022-11-043-3/+910
| | | | |
| * | | | core: hle: kernel: k_memory_manager: Refresh.bunnei2022-11-044-369/+460
| | | | |
| * | | | core: hle: kernel: Integrate system KSystemResource.bunnei2022-11-047-69/+209
| | | | |
| * | | | core: hle: kernel: k_dynamic_page_manager: Refresh.bunnei2022-11-041-17/+50
| | | | |
| * | | | core: hle: kernel: Add KSystemResource.bunnei2022-11-045-1/+173
| | | | |
| * | | | core: hle: kernel: k_handle_table: Refresh.bunnei2022-11-042-54/+87
| | | | |
| * | | | core: hle: kernel: k_memory_layout: Refresh.bunnei2022-11-043-12/+23
| | | | |
| * | | | core: hle: kernel: k_memory_region_type: Refresh.bunnei2022-11-041-49/+74
| | | | |
| * | | | core: hle: kernel: slab_helpers: Add KAutoObjectWithSlabHeap.bunnei2022-11-041-0/+78
| | | | |
| * | | | core: hle: kernel: k_dynamic_resource_manager: Add KBlockInfoManager, KBlockInfoSlabHeap.bunnei2022-11-041-0/+3
| | | | |
| * | | | core: hle: kernel: k_page_bitmap: Refresh.bunnei2022-11-041-88/+155
| | | | |
| * | | | core: hle: kernel: k_memory_block: Refresh.bunnei2022-11-042-48/+66
| | | | |
| * | | | core: hle: kernel: k_page_heap: Refresh.bunnei2022-11-042-17/+108
| | | | |
| * | | | core: hle: kernel: k_page_group: Add KPageBufferSlabHeap.bunnei2022-11-041-0/+86
| | | | |
| * | | | core: hle: kernel: k_system_control: Add SecureAppletMemorySize.bunnei2022-11-041-0/+4
| | | | |
| * | | | core: hle: kernel: k_page_buffer: Add KPageBufferSlabHeap.bunnei2022-11-041-3/+11
| | | | |
| * | | | core: hle: kernel: Add KPageTableManager.bunnei2022-11-042-0/+56
| | | | |
| * | | | core: hle: kernel: Add KPageTableSlabHeap.bunnei2022-11-042-0/+94
| | | | |
| * | | | core: hle: kernel: Add KEventInfo.bunnei2022-11-044-1/+102
| | | | |
| * | | | core: hle: kernel: Add KDebug.bunnei2022-11-042-0/+21
| | | | |
| * | | | core: hle: result: Fix code for compilers.bunnei2022-11-041-6/+7
| | | | |
* | | | | Merge pull request #9189 from vonchenplus/stupidMorph2022-11-051-4/+4
|\ \ \ \ \ | | | | | | | | | | | | video_core: Fix scaling graphical regressions for multiple games
| * | | | | video_core: Fix scaling graphical regressions for multiple gamesFengChen2022-11-051-4/+4
| | | | | |
* | | | | | Merge pull request #9181 from jbeich/freebsd-qt-parityMai2022-11-043-17/+17
|\ \ \ \ \ \ | | | | | | | | | | | | | | Qt: enable recent Linux features on BSDs
| * | | | | | Qt: enable recent Linux features on more UnicesJan Beich2022-11-043-17/+17
| | |_|_|/ / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | - Prevent sleep via xdg-desktop-portal after fa7abafa5f2a - Pause on suspend after b7642cff3611 - Exit on SIGINT/SIGTERM after 9479940a1fc7 - Improve dark themes after b51db125676f
* | | | | | Merge pull request #9178 from jbeich/freebsd-includeMai2022-11-041-0/+4
|\ \ \ \ \ \ | |/ / / / / |/| | | | | network: unbreak on BSDs due to missing include
| * | | | | network: add missing header for SO_* on Unix after f80c7c4cd5c0Jan Beich2022-11-041-0/+4
| |/ / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | src/core/internal_network/socket_proxy.cpp: In member function 'virtual Network::Errno Network::ProxySocket::Initialize(Network::Domain, Network::Type, Network::Protocol)': src/core/internal_network/socket_proxy.cpp:51:20: error: 'SO_TYPE' was not declared in this scope 51 | SetSockOpt(fd, SO_TYPE, type); | ^~~~~~~ src/core/internal_network/socket_proxy.cpp: In member function 'virtual Network::Errno Network::ProxySocket::SetLinger(bool, u32)': src/core/internal_network/socket_proxy.cpp:253:27: error: 'SO_LINGER' was not declared in this scope 253 | return SetSockOpt(fd, SO_LINGER, values); | ^~~~~~~~~ src/core/internal_network/socket_proxy.cpp: In member function 'virtual Network::Errno Network::ProxySocket::SetReuseAddr(bool)': src/core/internal_network/socket_proxy.cpp:257:32: error: 'SO_REUSEADDR' was not declared in this scope 257 | return SetSockOpt<u32>(fd, SO_REUSEADDR, enable ? 1 : 0); | ^~~~~~~~~~~~ src/core/internal_network/socket_proxy.cpp: In member function 'virtual Network::Errno Network::ProxySocket::SetBroadcast(bool)': src/core/internal_network/socket_proxy.cpp:262:32: error: 'SO_BROADCAST' was not declared in this scope 262 | return SetSockOpt<u32>(fd, SO_BROADCAST, enable ? 1 : 0); | ^~~~~~~~~~~~ src/core/internal_network/socket_proxy.cpp: In member function 'virtual Network::Errno Network::ProxySocket::SetSndBuf(u32)': src/core/internal_network/socket_proxy.cpp:266:27: error: 'SO_SNDBUF' was not declared in this scope 266 | return SetSockOpt(fd, SO_SNDBUF, value); | ^~~~~~~~~ src/core/internal_network/socket_proxy.cpp: In member function 'virtual Network::Errno Network::ProxySocket::SetRcvBuf(u32)': src/core/internal_network/socket_proxy.cpp:274:27: error: 'SO_RCVBUF' was not declared in this scope 274 | return SetSockOpt(fd, SO_RCVBUF, value); | ^~~~~~~~~ src/core/internal_network/socket_proxy.cpp: In member function 'virtual Network::Errno Network::ProxySocket::SetSndTimeo(u32)': src/core/internal_network/socket_proxy.cpp:279:27: error: 'SO_SNDTIMEO' was not declared in this scope 279 | return SetSockOpt(fd, SO_SNDTIMEO, static_cast<int>(value)); | ^~~~~~~~~~~ src/core/internal_network/socket_proxy.cpp: In member function 'virtual Network::Errno Network::ProxySocket::SetRcvTimeo(u32)': src/core/internal_network/socket_proxy.cpp:284:27: error: 'SO_RCVTIMEO' was not declared in this scope 284 | return SetSockOpt(fd, SO_RCVTIMEO, static_cast<int>(value)); | ^~~~~~~~~~~
* / / / / Update shader cache version. (#9175)gidoly2022-11-041-1/+1
|/ / / /
* | | | video_core: Fix SNORM texture buffer emulating error (#9001)Feng Chen2022-11-0423-52/+224
| | | |
* | | | UI: Add options to hide extra columns (#9093)Piplup2022-11-045-1/+31
| | | | | | | | | | | | UI change that allows the user to hide the size and or file types columns
* | | | Merge pull request #8858 from vonchenplus/mipmapbunnei2022-11-0429-8/+259
|\ \ \ \ | | | | | | | | | | video_core: Generate mipmap texture by drawing
| * \ \ \ Merge branch 'master' into mipmapFeng Chen2022-09-20157-1773/+3064
| |\ \ \ \
| * | | | | video_core: Generate mipmap texture by drawingFengChen2022-09-2029-8/+259
| | | | | |
* | | | | | Merge pull request #9135 from liamwhite/service-thread-eventbunnei2022-11-0422-335/+438
|\ \ \ \ \ \ | |_|_|/ / / |/| | | | | kernel: invert session request handling flow
| * | | | | sm:: avoid excessive port recreationLiam2022-10-313-18/+24
| | | | | |
| * | | | | kernel: fix single core for service threadsLiam2022-10-311-1/+2
| | | | | |
| * | | | | kernel: fix port trackingLiam2022-10-315-49/+4
| | | | | |
| * | | | | k_server_session: add SendReplyHLELiam2022-10-313-5/+6
| | | | | |
| * | | | | service_thread: convert to map for session managementLiam2022-10-311-23/+21
| | | | | |
| * | | | | kernel: invert session request handling flowLiam2022-10-3122-279/+421
| | | | | |
* | | | | | Merge pull request #9154 from liamwhite/new-fbFernando S2022-11-042-1/+10
|\ \ \ \ \ \ | | | | | | | | | | | | | | vk_blit_screen: recreate swapchain images on guest format change
| * | | | | | vk_blit_screen: recreate swapchain images on guest format changeLiam2022-10-302-1/+10
| | | | | | |
* | | | | | | Merge pull request #9097 from liamwhite/intel-spv-compilerMorph2022-11-044-14/+19
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | video_core: don't build ASTC decoder shader unless requested
| * | | | | | | video_core: don't build ASTC decoder shader unless requestedLiam2022-10-204-14/+19
| | | | | | | |
* | | | | | | | core: hle: service: acc: Fix ListOpenContextStoredUsers/StoreOpenContext.bunnei2022-11-035-23/+42
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | - These APIs are used to capture the opened users and allow that state to be persisted across processes. - They are not intended to just return the system opened users, that is what ListOpenUsers is for. - Fixes the launch hang with Bayonetta 3.
* | | | | | | | remove unnecessary sepator in file menu (main.ui)Ludovic2022-11-021-1/+0
| | | | | | | |
* | | | | | | | Merge pull request #9143 from K0bin/scheduler-emptyliamwhite2022-11-011-3/+1
|\ \ \ \ \ \ \ \ | |_|_|/ / / / / |/| | | | | | | vk_scheduler: Remove recorded_counts
| * | | | | | | vk_scheduler: Remove recorded_countsRobin Kertels2022-10-281-3/+1
| | | | | | | |
* | | | | | | | Merge pull request #9159 from liamwhite/kborkbunnei2022-10-312-13/+27
|\ \ \ \ \ \ \ \ | |_|_|_|_|_|/ / |/| | | | | | | kernel: more complete fix for KPort reference counting
| * | | | | | | kernel: more complete fix for KPort reference countingLiam2022-10-312-13/+27
| | | | | | | |
* | | | | | | | Merge pull request #9155 from FernandoS27/goosfrababunnei2022-10-311-6/+6
|\ \ \ \ \ \ \ \ | |/ / / / / / / |/| | | | | | | Vulkan: Fix regression caused by limiting render area to width/height of render targets.
| * | | | | | | Vulkan: Fix regression caused by limiting render area to width/height of rendef targets.Fernando Sahmkow2022-10-301-6/+6
| | |_|/ / / / | |/| | | | |
* / | | | | | k_thread: fix single coreLiam2022-10-301-2/+4
|/ / / / / /
* | | | | | Merge pull request #9151 from liamwhite/dram-sizeMorph2022-10-301-1/+8
|\ \ \ \ \ \ | | | | | | | | | | | | | | kernel: reinitialize after dram layout change
| * | | | | | kernel: reinitialize after dram layout changeLiam2022-10-301-1/+8
| | | | | | |
* | | | | | | Merge pull request #9091 from Docteh/what_compat_listliamwhite2022-10-305-0/+17
|\ \ \ \ \ \ \ | |/ / / / / / |/| | | | | | UI: Add option to hide the compatibility list
| * | | | | | UI: Add option to hide the compatibility listKyle Kienapfel2022-10-195-0/+17
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Option is added directly below the option for the addons column Defaulting to hide compatibility list. Changing default works properly. Co-authored-by: Piplup <piplup55@users.noreply.github.com>
* | | | | | | Merge pull request #9149 from german77/volumbunnei2022-10-302-1/+13
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | service: am: Stub SetRecordVolumeMuted
| * | | | | | | service: am: Stub SetRecordVolumeMutedgerman772022-10-302-1/+13
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Used by bayonetta 3
* | | | | | | | k_server_session: fix crashesLiam2022-10-302-2/+1
| | | | | | | |
* | | | | | | | Merge pull request #9137 from liamwhite/hbmenubunnei2022-10-308-10/+45
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | Improved support for nx-hbmenu
| * | | | | | | | nvnflinger: release queued handles immediately on disconnectionLiam2022-10-274-6/+17
| | | | | | | | |
| * | | | | | | | vi: implement CloseDisplayLiam2022-10-274-4/+28
| | | | | | | | |
* | | | | | | | | Merge pull request #9140 from vonchenplus/darw_index_bufferx_first_errorbunnei2022-10-302-61/+70
|\ \ \ \ \ \ \ \ \ | |_|/ / / / / / / |/| | | | | | | | video_core: Fix drawing trigger mechanism regression
| * | | | | | | | video_core: Fix drawing trigger mechanism regressionFengChen2022-10-272-61/+70
| |/ / / / / / /
* | | | | | | | Merge pull request #9127 from vonchenplus/vulkan_clearbunnei2022-10-281-8/+13
|\ \ \ \ \ \ \ \ | |_|_|/ / / / / |/| | | | | | | video_core: Catch vulkan clear op not all channel need clear
| * | | | | | | video_core: Catch vulkan clear op not all channel need clearFengChen2022-10-251-8/+13
| | | | | | | |
* | | | | | | | Merge pull request #9138 from liamwhite/hbl-stacktraceliamwhite2022-10-282-2/+2
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | arm_interface: curb infinite recursion in stacktrace generation
| * | | | | | | | arm_interface: curb infinite recursion in stacktrace generationLiam2022-10-272-2/+2
| | |/ / / / / / | |/| | | | | |
* | | | | | | | Merge pull request #9115 from vonchenplus/game_name_by_languagebunnei2022-10-272-12/+37
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | file_sys: Priority display of game titles in the current language
| * | | | | | | | file_sys: Priority display of game titles in the current languageFengChen2022-10-242-12/+37
| | | | | | | | |
* | | | | | | | | Merge pull request #9126 from vonchenplus/revert-8068-shader-if-falsebunnei2022-10-273-98/+9
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | Revert "shader_recompiler/dead_code_elimination: Add DeadBranchElimination pass"
| * | | | | | | | | Revert "shader_recompiler/dead_code_elimination: Add DeadBranchElimination pass"Feng Chen2022-10-253-98/+9
| | | | | | | | | |
* | | | | | | | | | Merge pull request #9134 from lioncash/initliamwhite2022-10-276-8/+8
|\ \ \ \ \ \ \ \ \ \ | |_|_|/ / / / / / / |/| | | | | | | | | audio_in/out_system: Pass Initialize members by value where applicable
| * | | | | | | | | audio_in/out_system: Pass Initialize members by value where applicableLioncash2022-10-266-8/+8
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | applet_resource_user_id isn't actually modified and is just assigned to a member variable, so this doesn't need to be a mutable reference. Similarly, the device name itself isn't modified and is only moved. We pass by value here, since we can still perform the move, but eliminate a sneaky set of calls that can unintentionally destroy the original string. Given how nested the calls are, it's good to get rid of this potential vector for a use-after-move bug.
* | | | | | | | | | Merge pull request #9125 from liamwhite/dummy-schedulerbunnei2022-10-265-26/+76
|\ \ \ \ \ \ \ \ \ \ | |/ / / / / / / / / |/| | | | | | | | | kernel: refactor dummy thread wakeups
| * | | | | | | | | kernel: refactor dummy thread wakeupsLiam2022-10-255-26/+76
| | |/ / / / / / / | |/| | | | | | |
* | | | | | | | | concepts: Use the std::contiguous_iterator conceptMorph2022-10-263-20/+10
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This also covers std::span, which does not have a const iterator. Also renames IsSTLContainer to IsContiguousContainer to explicitly convey its semantics.
* | | | | | | | | Merge pull request #9128 from abouvier/patch-1liamwhite2022-10-251-1/+1
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | tests: fix for -Wall
| * | | | | | | | | tests: fix for -WallAlexandre Bouvier2022-10-251-1/+1
| | |_|/ / / / / / | |/| | | | | | | | | | | | | | | | Fix #9123
* | | | | | | | | Merge pull request #9113 from german77/peer_pressureliamwhite2022-10-258-12/+26
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | service: nfp: Allow amiibos without keys
| * | | | | | | | | core: hid: Add handheld to nfc devicesgerman772022-10-221-0/+1
| | | | | | | | | |
| * | | | | | | | | service: nfp: Allow amiibos without keysNarr the Reg2022-10-223-1/+18
| | | | | | | | | |
| * | | | | | | | | service: nfp: remove unnecessary includeNarr the Reg2022-10-225-11/+7
| | | | | | | | | |
* | | | | | | | | | Merge pull request #9107 from german77/gidoly_rulesliamwhite2022-10-2510-57/+93
|\ \ \ \ \ \ \ \ \ \ | |_|/ / / / / / / / |/| | | | | | | | | input_common: cache vibration tests
| * | | | | | | | | input_common: cache vibration testsgerman772022-10-2110-57/+93
| |/ / / / / / / /
* | | | | | | | | Merge pull request #9112 from vonchenplus/deferred_drawliamwhite2022-10-2510-232/+203
|\ \ \ \ \ \ \ \ \ | |_|_|_|_|_|_|_|/ |/| | | | | | | | video_core: Reimplementing the maxwell drawing trigger mechanism
| * | | | | | | | video_core: Implement maxwell inline_index methodFengChen2022-10-226-74/+130
| | | | | | | | |
| * | | | | | | | video_coare: Reimplementing the maxwell drawing trigger mechanismFengChen2022-10-2110-224/+139
| |/ / / / / / /
* | | | | | | | Merge pull request #9119 from liamwhite/shutdown-barrierliamwhite2022-10-256-7/+26
|\ \ \ \ \ \ \ \ | |_|_|/ / / / / |/| | | | | | | core: barrier service thread shutdown
| * | | | | | | core: barrier service thread shutdownLiam2022-10-236-7/+26
| | |/ / / / / | |/| | | | |
* | | | | | | Merge pull request #8873 from vonchenplus/fix_legacy_location_errorbunnei2022-10-245-19/+35
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | video_core: Fix legacy to generic location unpaired
| * | | | | | | Address feedbackFengChen2022-10-171-6/+6
| | | | | | | |
| * | | | | | | video_core: Fix legacy to generic location unpairedFengChen2022-09-205-15/+31
| | | | | | | |
* | | | | | | | Merge pull request #9122 from liamwhite/burnt-chickenFernando S2022-10-242-4/+4
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | nvdrv: fix container destruction order
| * | | | | | | | nvdrv: fix container destruction orderLiam2022-10-242-4/+4
| | |/ / / / / / | |/| | | | | |
* | | | | | | | CMakeLists: Disable -Wbraced-scalar-init on ClangMorph2022-10-221-0/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Clang erroneously emits this warning when using designated initializers.
* | | | | | | | yuzu: Resolve -Wpessimizing-moveMorph2022-10-221-1/+1
| | | | | | | |
* | | | | | | | startup_checks: Resolve -Wstringop-truncationMorph2022-10-221-1/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Copies up to sizeof(p_name) - 1 in strncpy and null terminates it at p_name[254]
* | | | | | | | startup_checks: Resolve -WformatMorph2022-10-221-7/+7
| | | | | | | |
* | | | | | | | general: Resolve -Wunused-but-set-variableMorph2022-10-221-2/+2
| | | | | | | |
* | | | | | | | general: Resolve -Wunused-lambda-capture and C5233Morph2022-10-224-29/+24
| | | | | | | |
* | | | | | | | general: Resolve -Wclass-memaccessMorph2022-10-223-3/+3
| | | | | | | |
* | | | | | | | ipc_helpers: Ignore GCC compiler warnings only on GCCMorph2022-10-221-2/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Clang and ICC for whatever reason also defines __GNUC__. Exclude them from this check.
* | | | | | | | CMakeLists: Enforce C5233 on MSVCMorph2022-10-221-0/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This is similar to Clang's -Wunused-lambda-capture
* | | | | | | | CMakeLists: Disable C4100 and C4324Morph2022-10-224-17/+3
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Disabling C4100 is similar to -Wno-unused-parameter
* | | | | | | | CMakeLists: Remove redundant warningsMorph2022-10-224-12/+0
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | These warnings are already included in /W3.
* | | | | | | | decoders: Use 2's complement instead of unary -Morph2022-10-221-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Resolves C4146 on MSVC
* | | | | | | | CMakeLists: Treat MSVC warnings as errorsMorph2022-10-224-3/+2
| | | | | | | |
* | | | | | | | general: Enforce C4800 everywhere except in video_coreMorph2022-10-2214-41/+57
| | | | | | | |
* | | | | | | | CMakeLists: Remove all redundant warningsMorph2022-10-227-45/+4
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | These are already explicitly or implicitly set in src/CMakeLists.txt
* | | | | | | | CMakeLists: Consolidate all unused warnings into -WunusedMorph2022-10-221-3/+3
| | | | | | | |
* | | | | | | | CMakeLists: Treat -Wall and -Wextra as errorsMorph2022-10-221-3/+3
|/ / / / / / /
* | | | | | | Merge pull request #9095 from FernandoS27/meat-good-vegetable-badFernando S2022-10-222-13/+9
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | Maxwell3D/Puller: Fix regressions and syncing issues.
| * | | | | | | Maxwell3D/Puller: Fix regressions and syncing issues.Fernando Sahmkow2022-10-192-13/+9
| | | | | | | |
* | | | | | | | Merge pull request #9106 from lioncash/copy-errliamwhite2022-10-211-2/+3
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | hid/npad: Fix copy size in GetSupportedNpadIdTypes
| * | | | | | | | hid/npad: Fix copy size in GetSupportedNpadIdTypesLioncash2022-10-211-2/+3
| | |_|/ / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Previously this was passing the size of the vector into memcpy rather than the size in bytes to copy, which would result in a partial read. Thankfully, this function isn't used yet, so this gets rid of a bug before it's able to do anything.
* | | | | | | | Merge pull request #9108 from Morph1984/r32-b24g8liamwhite2022-10-211-0/+2
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | format_lookup_table: Implement R32_B24G8 with D32_FLOAT_S8_UINT
| * | | | | | | | format_lookup_table: Implement R32_B24G8 with D32_FLOAT_S8_UINTMorph2022-10-211-0/+2
| |/ / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This format is similar to Z32_FLOAT_X24S8_UINT, which is implemented with D32_FLOAT_S8_UINT. Used in Persona 5 Royal
* | | | | | | | k_session_request: Add missing override specifierLioncash2022-10-211-1/+1
| | | | | | | |
* | | | | | | | k_session_request: Turn C-style array into std::arrayLioncash2022-10-211-1/+3
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Makes for stronger typing and allows tooling bounds checks provided by the standard library for debugging purposes.
* | | | | | | | k_session_request: Simplify constructor initializationLioncash2022-10-211-14/+11
|/ / / / / / /
* | | | | | | Merge pull request #9078 from liamwhite/session-requestliamwhite2022-10-2117-200/+608
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | kernel: Session request cleanup
| * | | | | | | kernel: remove most SessionRequestManager handling from KServerSessionLiam2022-10-196-138/+119
| | | | | | | |
| * | | | | | | kernel: add KSessionRequestLiam2022-10-1913-62/+489
| | |_|_|/ / / | |/| | | | |
* | | | | | | Merge pull request #9099 from Docteh/undockedliamwhite2022-10-211-1/+1
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | Controller Applet had instance of Undocked, make Handheld
| * | | | | | | Controller Applet had instance of Undocked, make HandheldKyle Kienapfel2022-10-201-1/+1
| | |_|_|/ / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Remember that time we renamed the Undocked option to Handheld in the status bar, and then later remembered the Controller Configuration? Scrolling through Transifex I noticed that we still have one instance of "Undocked" in the text.
* | | | | | | Merge pull request #9096 from Kelebek1/audio_15bunnei2022-10-205-33/+114
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | [audio_core] Update for firmware 15.0.0
| * | | | | | | Update audio_core for firmware 15.0.0Kelebek12022-10-195-33/+114
| | | | | | | |
* | | | | | | | Merge pull request #9094 from lioncash/fixedliamwhite2022-10-202-115/+80
|\ \ \ \ \ \ \ \ | |_|_|/ / / / / |/| | | | | | | common/fixed_point: Minor interface improvements
| * | | | | | | fixed_point: Mark default constructor as constexprLioncash2022-10-181-2/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Ensures that a fixed-point value is always initialized This likely also fixes several cases of uninitialized values being operated on, since we have multiple areas in the codebase where the default constructor is being used like: Common::FixedPoint<50, 14> current_sample{}; and is then followed up with an arithmetic operation like += or something else, which operates directly on FixedPoint's internal data member, which would previously be uninitialized.
| * | | | | | | fixed_point: Mark copy/move assignment operators and constructors as constexprLioncash2022-10-181-3/+6
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Given these are just moving a raw value around, these can sensibly be made constexpr to make the interface more useful.
| * | | | | | | fixed_point: Mark std::swap and move constructor as noexceptLioncash2022-10-181-2/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | These shouldn't throw and can influence how some standard algorithms will work.
| * | | | | | | fixed_point: Mark relevant member function [[nodiscard]]Lioncash2022-10-181-14/+14
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Marks member functions as discard, where ignoring the return value would be indicative of a bug or dead code.
| * | | | | | | fixed_point: Make to_uint() non-constLioncash2022-10-181-2/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This calls round_up(), which is a non-const member function, so if a fixed-point instantiation ever calls to_uint(), it'll result in a compiler error. This allows the member function to work. While we're at it, we can actually mark to_long_floor() as const, since it's not modifying any member state.
| * | | | | | | fixed_point: Use defaulted comparisonsLioncash2022-10-181-23/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Collapses all of the comparison functions down to a single line.
| * | | | | | | fixed_point: Use variable templates and concepts where applicableLioncash2022-10-182-72/+56
| |/ / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | Makes a few things a little less noisy and removes the need for SFINAE in quite a few functions.
* | | | | | | Merge pull request #9082 from Morph1984/futureliamwhite2022-10-193-13/+59
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | savedata_factory: Detect future save data paths
| * | | | | | | savedata_factory: Detect future save data pathsMorph2022-10-173-13/+59
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Enable compatibility for new account/device save paths planned on a future implementation.
* | | | | | | | Merge pull request #9083 from liamwhite/take-a-chance-on-meliamwhite2022-10-191-10/+17
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | kernel: fix slab heap ABA
| * | | | | | | | kernel: fix slab heap ABALiam2022-10-171-10/+17
| |/ / / / / / /
* | | | | | | | Merge pull request #9071 from bunnei/mp-mmliamwhite2022-10-1941-1239/+2441
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | Kernel Multiprocess (Part 1) - Persist memory & core timing
| * | | | | | | | core: hle: kernel: Migrate ProcessState to enum class.bunnei2022-10-192-17/+17
| | | | | | | | |
| * | | | | | | | core: Initialize: Add missing braces.bunnei2022-10-191-2/+4
| | | | | | | | |
| * | | | | | | | core: core_timing: Re-initialize if single/multicore state changes.bunnei2022-10-193-14/+36
| | | | | | | | |
| * | | | | | | | core: core_timing: Remove unused IsHostTiming.bunnei2022-10-191-5/+0
| | | | | | | | |
| * | | | | | | | core: hle: kernel: Use result macros for new/changed code.bunnei2022-10-199-128/+110
| | | | | | | | |
| * | | | | | | | core: Partially persist emulation state across game boots.bunnei2022-10-198-58/+65
| | | | | | | | |
| * | | | | | | | core: hle: kernel: Fix InitializePreemption order.bunnei2022-10-191-1/+1
| | | | | | | | |
| * | | | | | | | core: hle: kernel: k_process: Improve management of page table & cleanup.bunnei2022-10-197-60/+92
| | | | | | | | |
| * | | | | | | | core: hle: kernel: k_interrupt_manager: HandleInterrupt should not depend on current process.bunnei2022-10-191-12/+9
| | | | | | | | |
| * | | | | | | | core: hle: kernel: Remove junk.bunnei2022-10-191-9/+0
| | | | | | | | |
| * | | | | | | | core: hle: kernel: k_page_table: Impl. LockForUn/MapDeviceAddressSpace, cleanup.bunnei2022-10-193-545/+624
| | | | | | | | |
| * | | | | | | | video_core: renderer_vulkan: vk_query_cache: Avoid shutdown crash in QueryPool::Reserve.bunnei2022-10-191-3/+4
| | | | | | | | |
| * | | | | | | | core: hle: kernel: Integration application memory block slab manager.bunnei2022-10-193-3/+44
| | | | | | | | |
| * | | | | | | | core: hle: kernel: k_page_table: Update, and integrate with new KMemoryBlockManager/SlabManager.bunnei2022-10-192-251/+393
| | | | | | | | |
| * | | | | | | | core: hle: kernel: k_memory_block: Update.bunnei2022-10-192-119/+391
| | | | | | | | |
| * | | | | | | | core: hle: kernel: k_memory_block_manager: Update.bunnei2022-10-192-174/+380
| | | | | | | | |
| * | | | | | | | core: hle: kernel: k_thread: Implement thread termination DPC.bunnei2022-10-195-1/+99
| | | | | | | | |
| * | | | | | | | core: hle: kernel: Add KDynamicResourceManager.bunnei2022-10-192-0/+59
| | | | | | | | |
| * | | | | | | | core: hle: kernel: Add KDynamicSlabHeap.bunnei2022-10-192-0/+123
| | | | | | | | |
| * | | | | | | | core: hle: kernel: Add KDynamicPageManager.bunnei2022-10-192-0/+137
| | | | | | | | |
| * | | | | | | | core: hle: kernel: k_process: Change Status -> State.bunnei2022-10-193-37/+27
| | | | | | | | |
| * | | | | | | | core: hle: kernel: svc_types: Add SystemThreadPriorityHighest and ProcessState.bunnei2022-10-191-0/+13
| | | | | | | | |
| * | | | | | | | core: device_memory: Templatize GetPointer(..).bunnei2022-10-199-19/+21
| | | | | | | | |
| * | | | | | | | core: hle: result: Add GetInnerValue and Includes methods.bunnei2022-10-191-0/+8
| | | | | | | | |
| * | | | | | | | core: hle: kernel: svc_common: Add WaitInfinite & cleanup.bunnei2022-10-191-2/+5
| | |/ / / / / / | |/| | | | | |
* | | | | | | | Merge pull request #9084 from vonchenplus/dma_copyFernando S2022-10-197-73/+415
|\ \ \ \ \ \ \ \ | |/ / / / / / / |/| | | | | | | video_core: implement 1D copies based on VMM 'kind'
| * | | | | | | video_core: implement 1D copies based on VMM 'kind'FengChen2022-10-172-56/+73
| | | | | | | |
| * | | | | | | video_core: Implement memory manager page kindFengChen2022-10-175-17/+342
| | | | | | | |
* | | | | | | | Merge pull request #9054 from Docteh/just_lz4bunnei2022-10-181-1/+5
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | CMake: Try add_library "lz4" if "lz4::lz4" is unavailable
| * | | | | | | | CMake: Try add library "LZ4::lz4_shared" if "lz4::lz4" is unavailableKyle Kienapfel2022-10-141-1/+5
| |/ / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Right now this looks like a distro specific problem, but we'll have to see. Over on Gentoo: with lz4 1.9.3 there is a lz4::lz4 library target, with 1.9.4 it's no longer mentioned in the cmake files provided by the package. (/usr/lib64/cmake/lz4) arch and openSUSE have lz4 1.9.4 available so I checked there, they only have .pc files for pkg-config, so asking for "lz4::lz4" works as usual MSVC does require "lz4::lz4" to be asked for
* | | | | | | | Merge pull request #9087 from Morph1984/oncebunnei2022-10-182-54/+45
|\ \ \ \ \ \ \ \ | |_|_|/ / / / / |/| | | | | | | general: Add missing pragma once
| * | | | | | | fixed_point: Replace CONSTEXPR14 with constexprMorph2022-10-171-50/+42
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | As we require the latest C++ standards to compile yuzu, checking for C++14 constexpr is not needed.
| * | | | | | | general: Add missing pragma onceMorph2022-10-172-4/+3
| | |/ / / / / | |/| | | | |
* | | | | | | Merge pull request #9079 from Morph1984/unknown-unkownsMorph2022-10-175-18/+18
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | general: Fix spelling
| * | | | | | | video_core: Fix spelling of "synchronize"Morph2022-10-162-5/+5
| | | | | | | |
| * | | | | | | general: Fix spelling of "unknown"Morph2022-10-163-13/+13
| |/ / / / / /
* | | | | | | sdl2_sink: Inline variable init into if conditionlat9nq2022-10-171-2/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | Co-authored-by: Mai <mathew1800@gmail.com>
* | | | | | | sdl2_sink: Distinguish between capture and non-capture device nameslat9nq2022-10-161-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The function prototype appears to care whether we are loading capture devices or not, and SDL_GetAudioDeviceName has a parameter to use it, but for some reason it isn't. This puts `capture` where it goes.
* | | | | | | sdl2_sink: Check for null string when loading SDL audio deviceslat9nq2022-10-161-1/+4
|/ / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Attempting to place a null string into a vector of strings causes an error that closes the application. Don't.
* | | | | | fix a tiny spelling mistakeKyle Kienapfel2022-10-151-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | Kreato pointed this out over on discord.
* | | | | | Merge pull request #9061 from liamwhite/writable-eventliamwhite2022-10-1437-232/+151
|\ \ \ \ \ \ | | | | | | | | | | | | | | kernel: remove KWritableEvent
| * | | | | | kernel: remove KWritableEventLiam2022-10-1337-232/+151
| | | | | | |
* | | | | | | Merge pull request #9055 from liamwhite/hblliamwhite2022-10-1415-55/+572
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | Preliminary support for nx-hbloader
| * | | | | | | k_server_session: preliminary support for userspace server sessionsLiam2022-10-129-49/+346
| | | | | | | |
| * | | | | | | Add implementation of svcCreateSessionLiam2022-10-122-1/+103
| | | | | | | |
| * | | | | | | general: preliminary support for hblLiam2022-10-126-6/+124
| | | | | | | |
* | | | | | | | audio_core: Revert sink name to sdl2Narr the Reg2022-10-141-2/+2
| |_|/ / / / / |/| | | | | |
* | | | | | | Merge pull request #9067 from Morph1984/tess-cwliamwhite2022-10-143-6/+6
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | renderer_(opengl/vulkan): Fix tessellation clockwise parameter
| * | | | | | | renderer_(opengl/vulkan): Fix tessellation clockwise parameterMorph2022-10-133-6/+6
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This should be assigned CW only on Triangles_CW rather than not Triangles_CCW, making CCW the default winding order rather than CW.
* | | | | | | | Merge pull request #9039 from Kelebek1/auto_backendliamwhite2022-10-147-32/+95
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | Auto select the SDL audio backend when Cubeb latency is too high
| * | | | | | | | Choose the SDL audio backend when Cubeb reports too high of a latencyKelebek12022-10-097-32/+95
| | | | | | | | |
* | | | | | | | | Merge pull request #9032 from liamwhite/stub-friendsliamwhite2022-10-141-1/+12
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | IFriendService: stub CheckFriendListAvailability
| * | | | | | | | | IFriendService: stub CheckFriendListAvailabilityLiam2022-10-081-1/+12
| | | | | | | | | |
* | | | | | | | | | Merge pull request #9065 from liamwhite/result-messMai2022-10-131-4/+3
|\ \ \ \ \ \ \ \ \ \ | |_|_|/ / / / / / / |/| | | | | | | | | result: enforce reference check specialization
| * | | | | | | | | result: enforce reference check specializationLiam2022-10-131-4/+3
| | | | | | | | | |
* | | | | | | | | | settings: Update aspect_ratio rangeMorph2022-10-131-1/+1
|/ / / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | Since 16:10 was added, the maximum value is now 4.
* | | | | | | | | Merge pull request #9034 from liamwhite/result-macrosbunnei2022-10-131-6/+114
|\ \ \ \ \ \ \ \ \ | |_|_|_|/ / / / / |/| | | | | | | | kernel: add expanded result macros
| * | | | | | | | kernel: add expanded result macrosLiam2022-10-081-6/+114
| |/ / / / / / /
* | | | | | | | Merge pull request #9027 from yuzu-emu/revert-8987-another-name-for-reinforcement-steelbunnei2022-10-132-60/+27
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | Revert "vulkan: automatically use larger staging buffer sizes when possible"
| * | | | | | | | Revert "vulkan: automatically use larger staging buffer sizes when possible"liamwhite2022-10-072-60/+27
| | |/ / / / / / | |/| | | | | |
* | | | | | | | Merge pull request #9040 from liamwhite/woe-thirty-twobunnei2022-10-131-0/+4
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | core_timing: use high-precision sleeps on non-Windows targets
| * | | | | | | | core_timing: use high-precision sleeps on non-Windows targetsLiam2022-10-091-0/+4
| | |/ / / / / / | |/| | | | | |
* | | | | | | | Merge pull request #9024 from liamwhite/async-screenshotbunnei2022-10-121-1/+7
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | video_core: don't block rendering on screenshots
| * | | | | | | | video_core: don't block rendering on screenshotsLiam2022-10-071-1/+7
| | |/ / / / / / | |/| | | | | |
* | | | | | | | Merge pull request #9047 from german77/steam-aspectbunnei2022-10-123-0/+8
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | yuzu: Add 16:10 aspect ratio
| * | | | | | | | yuzu: Add 16:10 aspect ratioNarr the Reg2022-10-103-0/+8
| | | | | | | | |
* | | | | | | | | Merge pull request #9049 from liamwhite/monkeyhawkbunnei2022-10-121-1/+11
|\ \ \ \ \ \ \ \ \ | |_|_|_|/ / / / / |/| | | | | | | | syncpoint_manager: ensure handle is removable before removing
| * | | | | | | | syncpoint_manager: ensure handle is removable before removingLiam2022-10-111-1/+11
| | |_|_|/ / / / | |/| | | | | |
* / | | | | | | Fix stencil func registers, make clip control equivalent to how it was before, but surely wrong.Kelebek12022-10-108-44/+51
|/ / / / / / /
* | | | | | | Merge pull request #9043 from german77/vector_dataliamwhite2022-10-093-6/+19
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | input_common: have an unique vector in callback status
| * | | | | | | input_common: have an unique vector in callback statusgerman772022-10-093-6/+19
| | |_|/ / / / | |/| | | | |
* | | | | | | Merge pull request #8766 from Kelebek1/regsFernando S2022-10-0929-2043/+3974
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | [video_core] Update 3D registers
| * | | | | | | Update 3D regsKelebek12022-10-0729-2043/+3974
| | |_|/ / / / | |/| | | | |
* | | | | | | fsp_srv: stub GetCacheStorageSizeLiam2022-10-082-1/+14
| |/ / / / / |/| | | | |
* | | | | | Merge pull request #9016 from liamwhite/drunken-scheduleMai2022-10-081-2/+4
|\ \ \ \ \ \ | | | | | | | | | | | | | | vk_scheduler: wait for command processing to complete
| * | | | | | vk_scheduler: wait for command processing to completeLiam2022-10-041-2/+4
| | | | | | |
* | | | | | | Merge pull request #9030 from Morph1984/api-disableMai2022-10-081-3/+4
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | configure_graphics: Fix graphics API selection when a game is running
| * | | | | | | configure_graphics: Fix graphics API selection when a game is runningMorph2022-10-071-3/+4
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The graphics API setting should not be changed when a game is running.
* | | | | | | | Merge pull request #8807 from Docteh/default_fontsliamwhite2022-10-071-0/+16
|\ \ \ \ \ \ \ \ | |/ / / / / / / |/| | | | | | | Qt: work around Qt5's font choice for Chinese (in Windows)
| * | | | | | | Qt: work around Qt5's font choice for ChineseKyle Kienapfel2022-10-021-0/+16
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | On Windows there are currently two fonts used. The first, does the Menu, QTreeView and Tooltips Second is Everything else which is a default font. From inspecting QApplication::font() at runtime Windows 10 English: QFont(MS Shell Dlg 2,8.25,-1,5,50,0,0,0,0,0) Windows 11 Japanese: MS UI Gothic,9 ,-1,5,50,0,0,0,0,0 Windows 11 Traditional Chinese: PMingLiU,9 ,-1,5,50,0,0,0,0,0 Windows 11 Simplified Chinese: SimSun,9 ,-1,5,50,0,0,0,0,0 Windows 11 Korean: Gulim,9 ,-1,5,50,0,0,0,0,0 I initially investigated dynamically changing the font when the UI language is English, but this was getting quite messy Qt6 makes changes to default font in some situations, so this PR is being narrowed in scope to only effect Chinese font choices. This change only effects rendering of Latin/Cyrillic characters.
* | | | | | | | nfp_types: silence -Wtype-limitsLiam2022-10-071-1/+1
| |_|/ / / / / |/| | | | | |
* | | | | | | Merge pull request #6142 from lat9nq/prog_meta_ref_bind_addressbunnei2022-10-072-15/+51
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | program_metadata: Avoid reference binding to misaligned address
| * | | | | | | program_metadata: Unpack FileAccessHeader and FileAccessControllat9nq2022-02-132-15/+51
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Avoids a reference binding to a misaligned addresses. Unpacking one requires unpacking the other, otherwise there'll be a misaligned address on the leftover one.
* | | | | | | | Merge pull request #8944 from Tachi107/patch-2bunnei2022-10-071-1/+1
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | build(room): simplify yuzu-room installation
| * | | | | | | | build(room): simplify yuzu-room installationAndrea Pappacoda2022-09-221-1/+1
| | |_|_|_|_|_|/ | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | CMake is able to automatically install binaries in the correct location. Also see my older patch, https://github.com/yuzu-emu/yuzu/commit/af94bf4a594b6a3599fae1d78e5d283b9f602032 Cc: @FearlessTobi
* | | | | | | | vulkan_blitter: Fix pool allocation double free.Byte2022-10-063-25/+10
| | | | | | | |
* | | | | | | | maxwell_dma: remove warnings from implemented functionalityLiam2022-10-061-2/+0
| | | | | | | |
* | | | | | | | General: address feedbackFernando Sahmkow2022-10-0630-165/+167
| | | | | | | |
* | | | | | | | state_tracker: workaround channel setup for homebrewLiam2022-10-065-4/+9
| | | | | | | |
* | | | | | | | general: rework usages of UNREACHABLE macroLiam2022-10-063-27/+28
| | | | | | | |
* | | | | | | | nvdisp: End system frame after requesting to swap buffersMorph2022-10-061-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Fixes frametime reporting
* | | | | | | | address_space: Rename va_start to virt_startMorph2022-10-062-5/+5
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Avoids conflicting with the va_start macro
* | | | | | | | address_space: Address feedbackMorph2022-10-063-195/+237
| | | | | | | |
* | | | | | | | general: Format licenses as per SPDX guidelinesMorph2022-10-0638-121/+93
| | | | | | | |
* | | | | | | | NvHostChannels: improve hack for supporting multiple channels.Fernando Sahmkow2022-10-062-2/+11
| | | | | | | |
* | | | | | | | Address Feedback from bylaws.Fernando Sahmkow2022-10-063-7/+3
| | | | | | | |
* | | | | | | | Nvflinger: correct duplication.Fernando Sahmkow2022-10-064-5/+5
| | | | | | | |
* | | | | | | | Core: Fix get nvmap object random crashVonChenPlus2022-10-0612-35/+66
| | | | | | | |
* | | | | | | | General: Fix clang format.Fernando Sahmkow2022-10-067-18/+14
| | | | | | | |
* | | | | | | | Common: Fix variable shadowing.Fernando Sahmkow2022-10-061-5/+5
| | | | | | | |
* | | | | | | | Vulkan Swapchain: Overall improvements.Fernando Sahmkow2022-10-063-6/+17
| | | | | | | |
* | | | | | | | NvDec: Fix regressions.Fernando Sahmkow2022-10-066-5/+31
| | | | | | | |
* | | | | | | | Vulkan Texture Cache: Limit render area to the max width/height of the targets.Fernando Sahmkow2022-10-064-9/+29
| | | | | | | |
* | | | | | | | ImageBase: Basic fixes.Fernando Sahmkow2022-10-061-8/+5
| | | | | | | |
* | | | | | | | General: Fix compilation for GCCLiam White2022-10-0616-42/+56
| | | | | | | |
* | | | | | | | VideoCore: Implement formats needed for N64 emulation.Fernando Sahmkow2022-10-066-10/+10
| | | | | | | |
* | | | | | | | Buffer Cache: Deduce vertex array limit from memory layout when limit is the highest possible.Fernando Sahmkow2022-10-063-4/+12
| | | | | | | |
* | | | | | | | VideoCore: Add option to dump the macros.Fernando Sahmkow2022-10-061-0/+1
| | | | | | | |
* | | | | | | | NVDRV: Further improvements.Fernando Sahmkow2022-10-0616-159/+278
| | | | | | | |
* | | | | | | | Buffer Cache: Basic fixes.Fernando Sahmkow2022-10-061-15/+22
| | | | | | | |
* | | | | | | | Decoders: Improve overall speed.Fernando Sahmkow2022-10-061-4/+11
| | | | | | | |
* | | | | | | | DMA & InlineToMemory Engines Rework.bunnei2022-10-0621-242/+323
| | | | | | | |
* | | | | | | | Maxwell3D: Add small_index_2Fernando Sahmkow2022-10-061-0/+2
| | | | | | | |
* | | | | | | | Memory Manager: ensure safety of GPU to CPU address.Fernando Sahmkow2022-10-061-0/+3
| | | | | | | |
* | | | | | | | MemoryManager: Fix errors popping out.Fernando Sahmkow2022-10-063-4/+18
| | | | | | | |
* | | | | | | | Shader Decompiler: implement better tracking for Vulkan samplers.Fernando Sahmkow2022-10-061-9/+59
| | | | | | | |
* | | | | | | | Shader Decompiler: Check for shift when deriving composite samplers.Fernando Sahmkow2022-10-066-11/+46
| | | | | | | |
* | | | | | | | Shader Decompiler: Fix dangerous behavior of invalid iterator insertion.Fernando Sahmkow2022-10-061-3/+3
| | | | | | | |
* | | | | | | | MemoryManager: Finish up the initial implementation.Fernando Sahmkow2022-10-062-50/+138
| | | | | | | |
* | | | | | | | OpenGL: Fix TickWorkFernando Sahmkow2022-10-061-0/+4
| | | | | | | |
* | | | | | | | VideoCore: Refactor fencing system.Fernando Sahmkow2022-10-0620-167/+154
| | | | | | | |
* | | | | | | | MemoryManager: initial multi paging system implementation.Fernando Sahmkow2022-10-066-209/+343
| | | | | | | |
* | | | | | | | Vulkan: Fix Scissor on ClearsFernando Sahmkow2022-10-061-1/+8
| | | | | | | |
* | | | | | | | NVDRV: Further refactors and eliminate old code.Fernando Sahmkow2022-10-0618-242/+12
| | | | | | | |
* | | | | | | | NVDRV: Refactor Host1xFernando Sahmkow2022-10-0633-173/+201
| | | | | | | |
* | | | | | | | VideoCore: Refactor syncing.Fernando Sahmkow2022-10-0644-252/+648
| | | | | | | |
* | | | | | | | Texture Cache: Fix GC and GPU Modified on Joins.Fernando Sahmkow2022-10-061-3/+5
| | | | | | | |
* | | | | | | | Texture cache: Fix the remaining issues with memory mnagement and unmapping.Fernando Sahmkow2022-10-0612-16/+63
| | | | | | | |
* | | | | | | | Texture cache: Fix dangling references on multichannel.Fernando Sahmkow2022-10-063-27/+36
| | | | | | | |
* | | | | | | | Refactor VideoCore to use AS sepparate from Channel.Fernando Sahmkow2022-10-0610-152/+171
| | | | | | | |
* | | | | | | | General: Rebase fixes.Fernando Sahmkow2022-10-061-7/+6
| | | | | | | |
* | | | | | | | VideoCore: Extra Fixes.Fernando Sahmkow2022-10-063-3/+5
| | | | | | | |
* | | | | | | | NVDRV: Remake ASGPUFernando Sahmkow2022-10-068-239/+882
| | | | | | | |
* | | | | | | | NVDRV: Update copyright notices.Fernando Sahmkow2022-10-064-7/+13
| | | | | | | |
* | | | | | | | MemoryManager: Temporary Fix for NVDEC.Fernando Sahmkow2022-10-061-1/+1
| | | | | | | |
* | | | | | | | NvHostCtrl: Fix merge of nvflinger.Fernando Sahmkow2022-10-061-1/+2
| | | | | | | |
* | | | | | | | VideoCore: Update MemoryManagerFernando Sahmkow2022-10-064-167/+86
| | | | | | | |
* | | | | | | | Common: implement MultiLevelPageTable.Fernando Sahmkow2022-10-064-0/+171
| | | | | | | |
* | | | | | | | VideoCore: Fix channels with disk pipeline/shader cache.Fernando Sahmkow2022-10-0611-71/+87
| | | | | | | |
* | | | | | | | OpenGl: Implement Channels.Fernando Sahmkow2022-10-069-118/+186
| | | | | | | |
* | | | | | | | NVHOST_CTRl: Implement missing method and fix some stuffs.Fernando Sahmkow2022-10-064-6/+35
| | | | | | | |
* | | | | | | | VideoCore: implement channels on gpu caches.Fernando Sahmkow2022-10-0650-809/+1461
| | | | | | | |
* | | | | | | | NVASGPU: Fix Remap.Fernando Sahmkow2022-10-061-0/+8
| | | | | | | |
* | | | | | | | NVDRV: Fix clearing when destroying.Fernando Sahmkow2022-10-063-14/+9
| | | | | | | |
* | | | | | | | NVMAP: Fix the Free return parameters.Fernando Sahmkow2022-10-063-15/+18
| | | | | | | |
* | | | | | | | NVDRV: Fix Open/Close and make sure each device is correctly created.Fernando Sahmkow2022-10-0614-199/+291
| | | | | | | |
* | | | | | | | NVDRV: Implement new NvMapFernando Sahmkow2022-10-0618-277/+307
| | | | | | | |
* | | | | | | | NVDRV: Refactor and add new NvMap.Fernando Sahmkow2022-10-0620-45/+558
| | | | | | | |
* | | | | | | | NVDRV: Cleanup.Fernando Sahmkow2022-10-064-32/+40
| | | | | | | |
* | | | | | | | NVDRV: Implement QueryEvent.Fernando Sahmkow2022-10-0610-40/+133
| | | | | | | |
* | | | | | | | NvHost: Remake Ctrl Implementation.Fernando Sahmkow2022-10-067-170/+312
| | | | | | | |
* | | | | | | | NvHost: Try a different approach to blocking.Fernando Sahmkow2022-10-062-10/+7
| | | | | | | |
* | | | | | | | NvHost: Fix some regressions and correct signaling on timeout.Fernando Sahmkow2022-10-061-25/+19
| | | | | | | |
* | | | | | | | Texture Cache: Add ASTC 10x5 Format.Fernando Sahmkow2022-10-066-0/+23
| | | | | | | |
* | | | | | | | Merge pull request #9013 from liamwhite/spinning-a-yarnbunnei2022-10-0619-23/+23
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | common: remove "yuzu:" prefix from thread names
| * | | | | | | | common: remove "yuzu:" prefix from thread namesLiam2022-10-0419-23/+23
| | |_|_|/ / / / | |/| | | | | |
* | | | | | | | Merge pull request #9015 from german77/amiibo-rewritebunnei2022-10-056-42/+112
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | service: nfp: Fix errors to pass unit testing
| * | | | | | | | service: nfp: Fix errors to pass unit testingNarr the Reg2022-10-046-42/+112
| |/ / / / / / /
* | | | | | | | Show error from cpp-httplib when we don't have a response to read (report errors while connecting to API) (#8999)Kyle Kienapfel2022-10-051-1/+2
| | | | | | | | | | | | | | | | | | | | | | | | Co-authored-by: Kyle Kienapfel <Docteh@users.noreply.github.com>
* | | | | | | | Merge pull request #8987 from liamwhite/another-name-for-reinforcement-steelFernando S2022-10-052-27/+60
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | vulkan: automatically use larger staging buffer sizes when possible
| * | | | | | | | vulkan: automatically use larger staging buffer sizes when possibleLiam2022-09-252-27/+60
| | | | | | | | |
* | | | | | | | | Merge pull request #9011 from liamwhite/frog-emoji-momentFernando S2022-10-051-4/+21
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | shader_recompiler: add extended LDC to GLASM backend
| * | | | | | | | | shader_recompiler: add extended LDC to GLASM backendLiam2022-10-021-4/+21
| | |/ / / / / / / | |/| | | | | | |
* | | | | | | | | Merge pull request #9005 from liamwhite/micro-fitbunnei2022-10-051-11/+5
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | macro_jit_x64: cancel exit for taken branch
| * | | | | | | | | macro_jit_x64: cancel exit for taken branchLiam2022-10-011-11/+5
| | | | | | | | | |
* | | | | | | | | | Merge pull request #9010 from liamwhite/buttwisebunnei2022-10-051-37/+9
|\ \ \ \ \ \ \ \ \ \ | |_|/ / / / / / / / |/| | | | | | | | | macro_jit_x64: fix miscompilation of bit extraction operations
| * | | | | | | | | macro_jit_x64: fix miscompilation of bit extraction operationsLiam2022-10-021-37/+9
| |/ / / / / / / /
* | | | | | | | | Merge pull request #8955 from german77/amiibo-rewritebunnei2022-10-0229-1333/+2303
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | core: nfp: Rewrite implementation to remove direct access from the frontend
| * | | | | | | | | service: mii: Copy only valid name bytesgerman772022-10-021-3/+18
| | | | | | | | | |
| * | | | | | | | | service: nfp: Implement mount target and open application area errors, minor fixesNarr the Reg2022-10-025-19/+124
| | | | | | | | | |
| * | | | | | | | | nfp: Multiple fixes against HWgerman772022-10-029-62/+163
| | | | | | | | | |
| * | | | | | | | | service: nfp: address commentsgerman772022-10-029-26/+29
| | | | | | | | | |
| * | | | | | | | | service: nfp: Rewrite and implement applet callsgerman772022-10-0213-1263/+1542
| | | | | | | | | |
| * | | | | | | | | core: hid: Add nfc support to emulated controllergerman772022-10-024-3/+123
| | | | | | | | | |
| * | | | | | | | | yuzu: Use virtual amiibo driver instead of nfp servicegerman772022-10-021-25/+26
| | | | | | | | | |
| * | | | | | | | | input_common: Enable virtual amiibo drivergerman772022-10-024-0/+102
| | | | | | | | | |
| * | | | | | | | | input_common: Create virtual amiibo drivergerman772022-10-026-0/+244
| | | | | | | | | |
* | | | | | | | | | Merge pull request #8992 from Morph1984/vi-vsync-eventbunnei2022-10-026-29/+66
|\ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | service: vi: Retrieve vsync event once per display
| * | | | | | | | | | service: vi: Retrieve vsync event once per displayMorph2022-09-265-14/+42
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The display vsync event can only be retrieved once per display. Returns VI::ResultPermissionDenied if we attempt to retrieve the vsync event for the same display. Prevents games such as .hack//G.U. Last Recode from consuming all the handles in the handle table by spamming vsync event retrievals and allows it to go in game.
| * | | | | | | | | | service: vi: Move VI results into its own fileMorph2022-09-262-16/+25
| | |_|_|/ / / / / / | |/| | | | | | | |
* | | | | | | | | | Merge pull request #6598 from FernandoS27/falklands-are-britishliamwhite2022-10-021-1/+62
|\ \ \ \ \ \ \ \ \ \ | |_|_|_|_|_|/ / / / |/| | | | | | | | | MacroHLE: Add MultidrawIndirect HLE Macro.
| * | | | | | | | | MacroHLE: Add MultidrawIndirect HLE Macro.Fernando Sahmkow2022-10-021-1/+62
| | |_|/ / / / / / | |/| | | | | | |
* | | | | | | | | Merge pull request #8876 from FearlessTobi/multiplayer-part3bunnei2022-10-0130-184/+1307
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | ldn: Implement "local wireless" networked multiplayer
| * | | | | | | | | Address some review commentsFearlessTobi2022-09-207-52/+38
| | | | | | | | | |
| * | | | | | | | | dedicated_room: fix token padding ...liushuyu2022-09-111-2/+12
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | ... mebedtls' base64 routine has a strange behavioral issue where if the input is invalid, it will not report it as invalid, but rather returning a bunch of garbage data. This new round-tripping padding method should eliminate such issue.
| * | | | | | | | | fix black iconNarr the Reg2022-09-111-0/+2
| | | | | | | | | |
| * | | | | | | | | yuzu: Multiple room UI improvementsgerman772022-09-1018-59/+176
| | | | | | | | | |
| * | | | | | | | | ldn: Initial implementationFearlessTobi2022-09-0915-124/+1132
| | | | | | | | | |
* | | | | | | | | | Merge pull request #9008 from ZwipZwapZapony/controller.colors_state.rightNarr the Reg2022-10-011-1/+1
|\ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | Fix "controller.colors_state.right" being "left"
| * | | | | | | | | | Fix "controller.colors_state.right" being "left"Zwip-Zwap Zapony2022-10-011-1/+1
| | |/ / / / / / / / | |/| | | | | | | |
* | | | | | | | | | Merge pull request #8874 from vonchenplus/align_index_buffer_sizebunnei2022-10-011-1/+1
|\ \ \ \ \ \ \ \ \ \ | |/ / / / / / / / / |/| | | | | | | | | Align index buffe size when vertex_buffer_unified_memory enable
| * | | | | | | | | Align index buffe size when vertex_buffer_unified_memory enableFengChen2022-09-101-1/+1
| | |_|_|_|_|_|/ / | |/| | | | | | |
* | | | | | | | | Merge pull request #8910 from vonchenplus/astc_decode_errorbunnei2022-10-012-2/+2
|\ \ \ \ \ \ \ \ \ | |_|_|_|/ / / / / |/| | | | | | | | video_core: Modify astc texture decode error fill value
| * | | | | | | | video_core: Modify astc texture decode error fill valueFengChen2022-09-152-2/+2
| |/ / / / / / /
* | | | | | | | Merge pull request #8934 from german77/palma_releasebunnei2022-09-297-33/+842
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | service: hid: Partially implement palma controller
| * | | | | | | | service: hid: Partially implement palma controllerNarr the Reg2022-09-257-33/+842
| | |_|/ / / / / | |/| | | | | |
* | | | | | | | Merge pull request #8940 from german77/silencebunnei2022-09-284-8/+8
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | yuzu: Silence some clang warnings
| * | | | | | | | yuzu: Silence some clang warningsNarr the Reg2022-09-214-8/+8
| |/ / / / / / /
* | | | / / / / core/loader: Return nullptr if file is nullptrMerry2022-09-251-0/+4
| |_|_|/ / / / |/| | | | | |
* | | | | | | Merge pull request #8920 from abouvier/cmake-gitbunnei2022-09-251-27/+2
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | cmake: fix git detection
| * | | | | | | cmake: fix git detectionAlexandre Bouvier2022-09-181-27/+2
| | | | | | | |
* | | | | | | | Merge pull request #8941 from Kelebek1/single_core_sucksbunnei2022-09-241-2/+7
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | Do not try to pause core timing from the audio thread when using single-core
| * | | | | | | | Do not try to pause core timing from the audio thread when using single-coreKelebek12022-09-221-2/+7
| | |/ / / / / / | |/| | | | | |
* | | | | | | | Merge pull request #8945 from Tachi107/typosMorph2022-09-245-6/+6
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | chore: fix some typos
| * | | | | | | | chore: fix some typosAndrea Pappacoda2022-09-235-6/+6
| |/ / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | Fix some typos reported by Lintian
* | | | | | | | Merge pull request #8948 from german77/orderMorph2022-09-241-0/+2
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | yuzu: sort input profiles by name
| * | | | | | | | yuzu: sort input profiles by nameNarr the Reg2022-09-231-0/+2
| | | | | | | | |
* | | | | | | | | Merge pull request #8930 from lat9nq/disable-vulkan-checkMorph2022-09-247-45/+66
|\ \ \ \ \ \ \ \ \ | |/ / / / / / / / |/| | | | | | | | yuzu qt: Add option to disable startup Vulkan check
| * | | | | | | | yuzu qt: Add option to disable startup Vulkan checklat9nq2022-09-197-45/+66
| | |_|_|_|_|/ / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The startup check apparently confuses other programs when yuzu launches 2 processes and then quickly closes one of them. Though this isn't really our issues it's also not a big deal for me to add an option to work around that issue.
* | | | | | | | Merge pull request #8943 from lioncash/netifaceMorph2022-09-232-6/+17
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | sockets: Make fd member variable protected
| * | | | | | | | sockets: Make fd member variable protectedLioncash2022-09-222-6/+17
| | |/ / / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Other things shouldn't be able to directly mess around with the descriptor
* | | | | | | | Merge pull request #8939 from lioncash/renderMorph2022-09-232-2/+2
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | audio_renderer: Make GetCommandBuffer() take a u32
| * | | | | | | | audio_renderer: Make GetCommandBuffer() take a u32Lioncash2022-09-212-2/+2
| |/ / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This function is only ever called with unsigned types, and all of the other interface functions take session_id as a u32, so this makes the class a little more consistent.
* | | | | | | | audio_manager: Forward declare result typeLioncash2022-09-212-1/+3
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Moves the include into the cpp file to lessen header dependencies.
* | | | | | | | audio_manager: Remove redundant cast in ThreadFunc()Lioncash2022-09-211-3/+5
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | We can just use a local here to get rid of a second cast.
* | | | | | | | audio_manager: move std::functions in SetOutManager/SetInManagerLioncash2022-09-211-2/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Prevents unnecessary reallocations in the event the captured variables are larger than the internal std::function buffer.
* | | | | | | | audio_manager: Remove unused forward declarationsLioncash2022-09-212-10/+0
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Allows us to get rid of some unnecessary forward declarations and includes.
* | | | | | | | audio_manager: Remove unused sessions_started member variableLioncash2022-09-211-2/+0
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This isn't used, so it can be removed.
* | | | | | | | audio_manager: Remove dependence on system stateLioncash2022-09-213-10/+4
|/ / / / / / / | | | | | | | | | | | | | | | | | | | | | This isn't used by the class, so this can be removed for the time being.
* | | | | | | Merge pull request #8849 from Morph1984/parallel-astcbunnei2022-09-191-21/+35
|\ \ \ \ \ \ \ | |/ / / / / / |/| | | | | | astc: Enable parallel CPU astc decoding
| * | | | | | astc: Enable parallel CPU astc decodingMorph2022-09-161-21/+35
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Given the issues with GPU accelerated ASTC decoding with NVIDIA's latest drivers, parallelize astc decoding on the CPU. Uses half the available threads in the system for astc decoding.
* | | | | | | Merge pull request #8915 from vonchenplus/opus_multi_streambunnei2022-09-182-1/+38
|\ \ \ \ \ \ \ | |_|/ / / / / |/| | | | | | core: implement HwOpus GetWorkBufferSizeForMultiStreamEx
| * | | | | | core: implement HwOpus GetWorkBufferSizeForMultiStreamExFengChen2022-09-162-1/+38
| | |/ / / / | |/| | | |
* | | | | | Merge pull request #8827 from german77/amiibo_releasebunnei2022-09-1712-302/+1370
|\ \ \ \ \ \ | | | | | | | | | | | | | | core: nfp: Implement amiibo encryption
| * | | | | | core: nfp: Remove magic numbersgerman772022-09-073-105/+103
| | | | | | |
| * | | | | | core: nfp: Workaround for lack of multiple nfp interfacesgerman772022-09-071-1/+3
| | | | | | |
| * | | | | | core: nfp: Correct date and amiibo nameNarr the Reg2022-09-074-18/+36
| | | | | | |
| * | | | | | core: nfp: Implement Convert and RecreateApplicationArea, accuracy fixesNarr the Reg2022-09-0710-257/+356
| | | | | | |
| * | | | | | core: nfp: Implement amiibo encryptiongerman772022-09-077-276/+1227
| | | | | | |
* | | | | | | Merge pull request #8650 from Kelebek1/vsyncbunnei2022-09-174-33/+71
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | [Coretiming/NVNFlinger] Improve multi-core vsync timing, and core timing accuracy
| * | | | | | | core_timing: Sleep in discrete intervals, yield during spinMorph2022-08-021-12/+13
| | | | | | | |
| * | | | | | | Add missing looping event schedule signalKelebek12022-08-021-5/+9
| | | | | | | |
| * | | | | | | Make coretiming waiting more accurateKelebek12022-08-022-11/+31
| | | | | | | |
| * | | | | | | Rework multi-core vsyncKelebek12022-08-022-17/+30
| | | | | | | |
* | | | | | | | Merge pull request #8914 from lioncash/audio-constbunnei2022-09-1725-82/+87
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | audio_core: Mark several member functions as const
| * | | | | | | | audio_renderer: Pass command buffer by const referenceLioncash2022-09-164-4/+4
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This is just being copied and isn't modified at all.
| * | | | | | | | sink_stream: Mark GetQueueSize as constLioncash2022-09-161-1/+1
| | | | | | | | |
| * | | | | | | | node_states: Mark relevant member functions as constLioncash2022-09-161-2/+2
| | | | | | | | |
| * | | | | | | | i3dl2/reverb: Mark relevant member functions as constLioncash2022-09-162-4/+4
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | These two don't modify member state.
| * | | | | | | | behavior_info: Mark CopyErrorInfo as constLioncash2022-09-164-6/+6
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This doesn't modify member state. We can also mark the parameter of AppendError as const as well, since it isn't modified.
| * | | | | | | | audio_device: Mark GetDeviceVolume as constLioncash2022-09-162-2/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This doesn't modify instance state.
| * | | | | | | | audio_render_manager: Mark several functions as constLioncash2022-09-162-6/+6
| | | | | | | | |
| * | | | | | | | audio_in: Mark several functions as constLioncash2022-09-164-18/+18
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | These functions don't modify class state, so we can mark them as such
| * | | | | | | | audio_out: Mark several functions as constLioncash2022-09-164-16/+17
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | These don't affect class state, so we can mark them as such.
| * | | | | | | | audio_buffers: Pass by const-ref in AppendBuffersLioncash2022-09-163-13/+17
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This function doesn't modify the passed in buffer, so we can make that explicit.
| * | | | | | | | device_session: Convert for loop into ranged for in AppendBuffersLioncash2022-09-161-5/+5
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Simplifies the indexing code a little bit.
| * | | | | | | | device_session: Pass arguments by const-ref in relevant functionsLioncash2022-09-163-7/+7
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | These functions don't modify the passed in audio buffers, so we can signify that in the interface.
* | | | | | | | | Merge pull request #8906 from Docteh/fix_iconsbunnei2022-09-171-8/+13
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | UI: move icons from default into colorful theme.
| * | | | | | | | | UI: move icons from default into colorful theme.Kyle Kienapfel2022-09-161-8/+13
| |/ / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | colorful theme has been default theme for awhile. having colorful theme try and grab icons from other theme doesn't work on Linux. Also adding two additional icons, info is to hint to the user that they should hit verify after pasting in a token, sync is to show that the verification is occurring.
* | | | | | | | | Merge pull request #8869 from SachinVin/cmakeMorph2022-09-161-6/+0
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | core/CMakeLists.txt: Remove duplicate files.
| * | | | | | | | | core/CMakeLists.txt: Remove duplicate files.SachinVin2022-09-081-6/+0
| | | | | | | | | |
* | | | | | | | | | Merge pull request #8649 from lat9nq/common-position-independentMorph2022-09-161-3/+3
|\ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | common: Use PROJECT_SOURCE_DIR to find CMakeModules
| * | | | | | | | | | common: Use PROJECT_SOURCE_DIR to find CMakeModuleslat9nq2022-08-021-3/+3
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Fixes CMake configuration when yuzu is a submodule of another project.
* | | | | | | | | | | Merge pull request #8682 from lat9nq/dumpyMorph2022-09-1618-91/+386
|\ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | yuzu qt: Add option to create Windows crash dumps
| * | | | | | | | | | | mini_dump: Address review feedbacklat9nq2022-09-054-63/+71
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Uses fmt::print as opposed to std::fprintf. Adds a missing return. static's a single-use function. Initializes structs as opposed to std::memset where possible. Fixes CMake linkage. Co-authored-by: Lioncash <mathew1800@gmail.com> mini_dump: Use a namespace Co-authored-by: Lioncash <mathew1800@gmail.com>
| * | | | | | | | | | | vcpkg,cmake: Use vcpkg for dbghelplat9nq2022-09-051-1/+1
| | | | | | | | | | | |
| * | | | | | | | | | | mini_dump: Check for debugger before spawning a childlat9nq2022-09-052-63/+37
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | mini_dump: Clean up mini_dump: Fix MSVC error mini_dump: Silence MSVC warning C4700 Zero initialize deb_ev. mini_dump: Add license info
| * | | | | | | | | | | mini_dump: Cleanup and add commentslat9nq2022-09-053-43/+87
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Removes some unnecessary code. wip
| * | | | | | | | | | | yuzu: Use a debugger to generate minidumpslat9nq2022-09-0518-91/+360
| | |/ / / / / / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | yuzu: Move mini_dump out of core startup_checks: Better exception handling
* | | | | | | | | | | Merge pull request #8911 from lioncash/cexpr-stringMorph2022-09-166-27/+40
|\ \ \ \ \ \ \ \ \ \ \ | |_|_|/ / / / / / / / |/| | | | | | | | | | audio_device: Make AudioDeviceName constructor constexpr
| * | | | | | | | | | audio_device: Mark member functions as const where applicableLioncash2022-09-153-10/+10
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | These member functions don't modify any internal state.
| * | | | | | | | | | audio_device: Make AudioDeviceName constructor constexprLioncash2022-09-155-17/+30
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | These are used as read-only arrays, so we can make the data read-only and available at compile-time. Now constructing an AudioDevice no longer needs to initialize some tables
* | | | | | | | | | | Merge pull request #8878 from Kelebek1/remove_pausebunnei2022-09-1515-144/+29
|\ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | Remove pause callbacks from coretiming
| * | | | | | | | | | | Remove pause callbacks from coretimingKelebek12022-09-1315-144/+29
| | | | | | | | | | | |
* | | | | | | | | | | | Merge pull request #8901 from lioncash/docsliamwhite2022-09-1528-112/+105
|\ \ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | | | audio_core: Amend documentation comment tags
| * | | | | | | | | | | | audio_core: Amend documentation tagsLioncash2022-09-1528-112/+105
| | |/ / / / / / / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Resolves a wackload of -Wdocumentation warnings due to mismatching tags and whatnot.
* | | | | | | | | | | | Merge pull request #8909 from Docteh/taslinkyNarr the Reg2022-09-151-0/+3
|\ \ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | | | UI: Fix link to TAS help page
| * | | | | | | | | | | | UI: Fix link to TAS help pageKyle Kienapfel2022-09-151-0/+3
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Tools -> TAS -> Configure TAS Thanks to Rei on discord for the fix. Basically: openExternalLinks is a checkbox in Qt Creator
* | | | | | | | | | | | | Merge pull request #8904 from liushuyu/fix-xbyak-linkageMai2022-09-151-1/+2
|\ \ \ \ \ \ \ \ \ \ \ \ \ | |/ / / / / / / / / / / / |/| | | | | | | | | | | | common: do not link to xbyak on non-amd64 architectures
| * | | | | | | | | | | | common: do not link to xbyak on non-amd64 architecturesliushuyu2022-09-141-1/+2
| |/ / / / / / / / / / /
* | | | | | | | | | | | compressor: Simplify memset in InitializeCompressorEffectLioncash2022-09-131-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Provides equivalent behavior while being significantly smaller.
* | | | | | | | | | | | compressor: Mark params parameters as constLioncash2022-09-131-3/+3
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | These functions don't modify the parameters.
* | | | | | | | | | | | compressor: Remove unneeded casts in ApplyCompressorEffectLioncash2022-09-131-2/+1
|/ / / / / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Same behavior, but also silences a -Wcast-qual warning, since the second cast casts away const.
* | | | | | | | | | | Merge pull request #8880 from german77/slow-movingMai2022-09-131-1/+1
|\ \ \ \ \ \ \ \ \ \ \ | |_|_|_|_|_|_|/ / / / |/| | | | | | | | | | input_common: Increase mapping timer from 2.5 seconds to 4 seconds
| * | | | | | | | | | input_common: Increase mapping timer from 2.5 seconds to 4 secondsgerman772022-09-111-1/+1
| | |_|_|_|_|_|/ / / | |/| | | | | | | |
* | | | | | | | | | Remove a pragma once from a cpp fileKelebek12022-09-121-2/+0
| |/ / / / / / / / |/| | | | | | | |
* | | | | | | | | Merge pull request #8842 from Kelebek1/AudOutbunnei2022-09-1024-832/+574
|\ \ \ \ \ \ \ \ \ | |_|_|_|_|_|/ / / |/| | | | | | | | [audio_core] Rework audio output
| * | | | | | | | Don't stall with nvdecKelebek12022-09-044-2/+35
| | | | | | | | |
| * | | | | | | | Rework audio output, connecting AudioOut into coretiming to fix desync during heavy loads.Kelebek12022-09-0223-842/+551
| | |_|_|_|_|_|/ | |/| | | | | |
* | | | | | | | Merge pull request #8863 from german77/triggersbunnei2022-09-101-0/+15
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | core: hid: Fix GC triggers overwriting ZL and ZR buttons
| * | | | | | | | core: hid: Fix GC triggers overwritting ZL and ZR buttonsNarr the Reg2022-09-051-0/+15
| | | | | | | | |
* | | | | | | | | Merge pull request #8864 from german77/toggle_analogbunnei2022-09-104-7/+23
|\ \ \ \ \ \ \ \ \ | |_|_|/ / / / / / |/| | | | | | | | input_common: Add support for analog toggle
| * | | | | | | | yuzu: input: fix invert symbol on axis and order options alphabeticallyNarr the Reg2022-09-061-13/+14
| | | | | | | | |
| * | | | | | | | input_common: Add support for analog toggleNarr the Reg2022-09-064-0/+15
| |/ / / / / / /
* | | | | | | | Merge pull request #8819 from liamwhite/cash-moneylat9nq2022-09-099-1/+32
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | video_core: add option for pessimistic flushing
| * | | | | | | | video_core: add option for pessimistic flushingLiam2022-08-259-1/+32
| | | | | | | | |
* | | | | | | | | CMake: explicitly link mbedcrypto for yuzu-roomKyle Kienapfel2022-09-081-1/+1
| |_|_|_|_|_|/ / |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Doesn't appear to effect anything regular, but in both Linux and Windows builds it looks like our project has all the libraries available for linking. If this feature is turned off, there is only one thing that quit working, when linking yuzu-room it couldn't find a function called mbedtls_base64_decode mbedtls is split into three libraries for some reason: mbedtls mbedx509 mbedcrypto mbedtls_base64_decode is in mbedcrypto
* | | | | | | | Merge pull request #8837 from Morph1984/invalidatebunnei2022-09-064-12/+9
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | (shader/pipeline)_cache: Raise shader/pipeline cache version
| * | | | | | | | style: General style changes to match with the rest of the codebaseMorph2022-08-312-10/+7
| | | | | | | | |
| * | | | | | | | (shader/pipeline)_cache: Raise shader/pipeline cache versionMorph2022-08-312-2/+2
| | |_|/ / / / / | |/| | | | | | | | | | | | | | | | | | | | | | Since the following commit: https://github.com/yuzu-emu/yuzu/commit/a83a5d2e4c8932df864dd4cea2b04d87a12c8760 , many games will refuse to boot unless the shader/pipeline cache has been invalidated.
* | | | | | | | Merge pull request #8847 from german77/stopbunnei2022-09-051-4/+7
|\ \ \ \ \ \ \ \ | |_|_|_|/ / / / |/| | | | | | | input_common: sdl: Always check for motion on reconnect
| * | | | | | | input_common: sdl: Always check for motion on reconnectNarr the Reg2022-09-041-4/+7
| | |_|/ / / / | |/| | | | |
* | | | | | | Merge pull request #8855 from german77/plsliamwhite2022-09-046-26/+27
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | core: ns: Implement pl:s service
| * | | | | | | core: ns: Implement pl:s serviceNarr the Reg2022-09-036-26/+27
| |/ / / / / /
* | | | | | | Qt: Make General->Debug scrollableKyle Kienapfel2022-09-033-4/+9
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Configuration -> General -> Debug is getting a bit crowded. yzct12345 submit this originally, so I'm tagging them as a co-author. The original #6714 also modifies the Controls -> Player N sections, but it looks like more work is needed to make the current area scrollable. Co-authored-by: yzct12345 <87620833+yzct12345@users.noreply.github.com>
* | | | | | | Merge pull request #8822 from FearlessTobi/multiplayer-fixesbunnei2022-09-0228-49/+182
|\ \ \ \ \ \ \ | |/ / / / / / |/| | | | | | network: Fixes and improvements to the room feature
| * | | | | | Address review commentsFearlessTobi2022-09-0211-27/+26
| | | | | | |
| * | | | | | core/ldn_types: Minor corrections and additionsFearlessTobi2022-08-271-1/+16
| | | | | | |
| * | | | | | yuzu/chat_room: Make font size biggerFearlessTobi2022-08-271-0/+4
| | | | | | |
| * | | | | | dedicated_room: Correctly handle token decodingFearlessTobi2022-08-271-0/+12
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Correctly handle token decoding when '=' has been trimmed by the backend server. Co-Authored-By: liushuyu <liushuyu011@gmail.com>
| * | | | | | yuzu/multiplayer: Warn when game is running or no network interface is selectedFearlessTobi2022-08-2711-19/+81
| | | | | | |
| * | | | | | core/socket_proxy: Correct broadcast behaviorFearlessTobi2022-08-271-1/+7
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Broadcasts should only be sent when the broadcast IP is used. They should also only be received when SO_BROADCAST is enabled.
| * | | | | | yuzu: Display current game version in multiplayer roomFearlessTobi2022-08-276-11/+38
| | | | | | | | | | | | | | | | | | | | | | | | | | | | Makes it easier for users to recognize connection errors caused by different game versions.
| * | | | | | network: Use lower timeout for enet_host_serviceFearlessTobi2022-08-272-2/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | This allows us to have a 10x higher throughput of packets by using a much shorter waiting time.
| * | | | | | core/bsd: Correctly unbind methods in destructorFearlessTobi2022-08-271-1/+5
| | | | | | | | | | | | | | | | | | | | | | | | | | | | Prevents yuzu from crashing when the BSD service is created a second time.
| * | | | | | core/acc: Make CheckAvailability use LOG_DEBUGFearlessTobi2022-08-271-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | Previously it was spamming the logs in certain multiplayer games like Puyo Puyo Tetris.
| * | | | | | yuzu_room: Remove dependency on coreFearlessTobi2022-08-2711-9/+13
| | | | | | |
* | | | | | | Merge pull request #8843 from Kelebek1/SILENCE_WENCHMai2022-09-021-1/+1
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | Silence a million MSVC warnings
| * | | | | | | Silence std::aligned_storage warnings as it's deprecated in C++23,Kelebek12022-09-011-1/+1
| | |/ / / / / | |/| | | | | | | | | | | | | | | | | | | replace it with alignas() and a C array
* / | | | | | Demote services from warning/info to debug to reduce log spam:Kelebek12022-09-015-16/+16
|/ / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | GetCurrentFocusState SetClockSpeed EnableSixAxisSensorUnalteredPassthrough IsSixAxisSensorUnalteredPassthroughEnabled Get, GetOld SetAndWait, SetAndWaitOld IocParam IocFree
* | | | | | Merge pull request #8752 from vonchenplus/rectangle_textureFernando S2022-08-3114-15/+62
|\ \ \ \ \ \ | | | | | | | | | | | | | | video_code: support rectangle texture
| * | | | | | video_code: support rectangle textureFengChen2022-08-2514-15/+62
| | | | | | |
* | | | | | | Merge pull request #8809 from german77/finally_is_fixedbunnei2022-08-281-1/+8
|\ \ \ \ \ \ \ | |_|/ / / / / |/| | | | | | video_core: vulkan: rasterizer: Workaround on viewport swizzle on AMD
| * | | | | | video_core: vulkan: rasterizer: Workaround on viewport swizzle on AMDNarr the Reg2022-08-241-1/+8
| | | | | | |
* | | | | | | Merge pull request #8566 from german77/galaxybunnei2022-08-272-1/+35
|\ \ \ \ \ \ \ | |_|_|/ / / / |/| | | | | | core: hid: Add fallback for dualjoycon and pro controllers
| * | | | | | core: hid: Add fallback for dualjoycon and pro controllersgerman772022-07-112-1/+35
| | | | | | |
* | | | | | | Merge pull request #8812 from Kelebek1/autobunnei2022-08-241-6/+21
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | [Audio] Implement AudRenU:RequestUpdateAuto
| * | | | | | | Implement AudRenU:RequestUpdateAuto, and use C descriptors when B reports as empty.Kelebek12022-08-241-6/+21
| | | | | | | |
* | | | | | | | Merge pull request #8804 from vonchenplus/speed_up_idirectory_servicesbunnei2022-08-231-1/+2
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | core:filesystem: speed up IDirectory service
| * | | | | | | | core:filesystem: speed up IDirectory servicevonchenplus2022-08-231-1/+2
| | |_|/ / / / / | |/| | | | | |
* | | | | | | | yuzu: Force camera output to be saved on a buffer (#8805)Narr the Reg2022-08-232-2/+38
| | | | | | | |
* | | | | | | | hid: core: Add missing function table namesgerman772022-08-221-0/+6
|/ / / / / / /
* | | | | | | Merge pull request #8799 from liamwhite/where-did-the-padding-goliamwhite2022-08-212-3/+3
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | core/file_sys: fix alignment of BuildId
| * | | | | | | core/file_sys: fix alignment of BuildIdLiam2022-08-212-3/+3
| | | | | | | |
* | | | | | | | Merge pull request #8660 from Tachi107/findmodules-pkg-configliamwhite2022-08-211-1/+1
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | build: simplify find modules
| * | | | | | | | build(externals): rename Findopus to FindOpusAndrea Pappacoda2022-08-011-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This better matches upstream's FindOpus.cmake file, and it will make using upstream's FindOpus.cmake file easier.
* | | | | | | | | Merge pull request #8784 from Docteh/nosnekliamwhite2022-08-2117-119/+116
|\ \ \ \ \ \ \ \ \ | |_|/ / / / / / / |/| | | | | | | | code: dodge PAGE_SIZE #define
| * | | | | | | | code: dodge PAGE_SIZE #defineKyle Kienapfel2022-08-2017-119/+116
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Some header files, specifically for OSX and Musl libc define PAGE_SIZE to be a number This is great except in yuzu we're using PAGE_SIZE as a variable Specific example `static constexpr u64 PAGE_SIZE = u64(1) << PAGE_BITS;` PAGE_SIZE PAGE_BITS PAGE_MASK are all similar variables. Simply deleted the underscores, and then added YUZU_ prefix Might be worth noting that there are multiple uses in different classes/namespaces This list may not be exhaustive Core::Memory 12 bits (4096) QueryCacheBase 12 bits ShaderCache 14 bits (16384) TextureCache 20 bits (1048576, or 1MB) Fixes #8779
* | | | | | | | | Merge pull request #8790 from liamwhite/too-many-ways-to-name-a-byte-stringbunnei2022-08-212-11/+7
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | core/file_sys: fix BuildId padding in patch loading
| * | | | | | | | | core/file_sys: fix BuildId paddingLiam2022-08-192-11/+7
| | |_|/ / / / / / | |/| | | | | | |
* | | | | | | | | Merge pull request #8783 from german77/looongliamwhite2022-08-211-1/+1
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | yuzu: Allow longer controller profile names
| * | | | | | | | | yuzu: Allow longer controller profile namesNarr the Reg2022-08-191-1/+1
| | | | | | | | | |
* | | | | | | | | | Merge pull request #8797 from Docteh/filteringliamwhite2022-08-213-7/+37
|\ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | Qt: Retranslate GameList header and Filter line
| * | | | | | | | | | Qt: Retranslate GameList header and Filter lineKyle Kienapfel2022-08-203-7/+37
| | |_|/ / / / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Didn't notice this until I was trying to change the default font to Comic Sans MS when language is set to English in yuzu.
* | | | | | | | | | Merge pull request #8795 from vonchenplus/support_framebuffer_crop_rect_top_not_zeroliamwhite2022-08-212-12/+25
|\ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | video_core: support framebuffer crop rect top not zero
| * | | | | | | | | | video_core: support framebuffer crop rect top not zerovonchenplus2022-08-202-12/+25
| | | | | | | | | | |
* | | | | | | | | | | core: implement clkrst servicevonchenplus2022-08-202-0/+184
|/ / / / / / / / / /
* | | / / / / / / / video_core: implement R16G16B16X16 texture formatLiam2022-08-191-1/+1
| |_|/ / / / / / / |/| | | | | | | |
* | | | | | | | | common: remove unneeded x86-specific headerliushuyu2022-08-161-1/+0
|/ / / / / / / /
* | | | | | | | core/socket_proxy: Final nitsFearlessTobi2022-08-151-8/+7
| | | | | | | |
* | | | | | | | core: network: Address review commentsgerman772022-08-155-32/+31
| | | | | | | |
* | | | | | | | yuzu: Fix crash on shutdownFearlessTobi2022-08-152-6/+4
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Previously, accessing the room_network when it was already freed would crash the emulator on shutdown. Co-Authored-By: Narr the Reg <5944268+german77@users.noreply.github.com>
* | | | | | | | internal_network: Fix mingw compilationFearlessTobi2022-08-151-4/+5
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Apparently, "interface" is a reserved keyword on this compiler.
* | | | | | | | core, yuzu: Address first part of review commentsFearlessTobi2022-08-159-71/+70
| | | | | | | |
* | | | | | | | core/socket_proxy: Fix compilationFearlessTobi2022-08-151-1/+1
| | | | | | | |
* | | | | | | | Make copyright headers SPDX-compliantFearlessTobi2022-08-156-12/+14
| | | | | | | |
* | | | | | | | core, network: Add ability to proxy socket packetsFearlessTobi2022-08-1528-526/+1028
| | | | | | | |
* | | | | | | | web_service: Correct jwt issuer stringFearlessTobi2022-08-151-1/+3
| | | | | | | |
* | | | | | | | dedicated_room: Initial implementationFearlessTobi2022-08-154-0/+418
| | | | | | | |
* | | | | | | | Merge pull request #8739 from merryhime/swizzle_tablebunnei2022-08-142-15/+48
|\ \ \ \ \ \ \ \ | |/ / / / / / / |/| | | | | | | video_core/textures/decoders: Avoid SWIZZLE_TABLE
| * | | | | | | video_core/textures/decoders: Avoid SWIZZLE_TABLEMerry2022-08-092-15/+48
| | |_|/ / / / | |/| | | | |
* | | | | | | Merge pull request #8756 from Kelebek1/volbunnei2022-08-136-11/+12
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | Allow audio volume up to 200%
| * | | | | | | Do some log memes to help perceived volumeKelebek12022-08-122-2/+5
| | | | | | | |
| * | | | | | | Allow audio volume up to 200%Kelebek12022-08-124-9/+7
| | | | | | | |
* | | | | | | | Merge pull request #8755 from Morph1984/delimit-ipsbunnei2022-08-121-1/+2
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | ips_layer: Delimit parsed hex value string
| * | | | | | | | ips_layer: Delimit parsed hex value stringMorph2022-08-121-1/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Delimits the hex value string on spaces, slashes, carriage returns or newlines, allowing for comments to be added in-line.
* | | | | | | | | Merge pull request #8741 from Docteh/abootMai2022-08-122-2/+3
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | Qt: tweak ui files
| * | | | | | | | | Qt: tweak ui filesKyle K2022-08-092-2/+3
| | |_|/ / / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | make about dialog a bit taller for full message on more systems for direct_connect.ui hedging bets here, there is a text field for port number that possibly shouldn't be translated, marking as such, but also adding a translation note for the event that it makes sense to translate the placeholder text to something other than the default multiplayer direct connect port.
* | | | | | | | | Merge pull request #8745 from merryhime/null-fastmem-arenaliamwhite2022-08-122-7/+11
|\ \ \ \ \ \ \ \ \ | |_|_|/ / / / / / |/| | | | | | | | arm_dynarmic: Fix nullptr fastmem arenas
| * | | | | | | | arm_dynarmic: Fix nullptr fastmem arenasMerry2022-08-092-7/+11
| |/ / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | Unable to enable fastmem of exclusive access without a valid fastmem arena.
* | | | | | | | Merge pull request #8647 from Docteh/default_darkliamwhite2022-08-124-14/+77
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | Linux: handle dark system themes nicely
| * | | | | | | | review pass on CheckDarkMode functionKyle Kienapfel2022-08-122-4/+4
| | | | | | | | |
| * | | | | | | | Linux: handle dark system themes nicelyKyle K2022-08-054-14/+77
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | yuzu's default theme doesn't specify everything, which is fine for windows, but in linux anything unspecified is set to the users theme. Symptoms of this are that a linux user with a dark theme won't think to change the theme to a dark theme when first using yuzu Idea here is to try and support arbitrary themes on linux. preliminary work on a "default_dark" theme, used only as overlay for any themes that are measured to be dark mode. Other work done: FreeDesktop standard icon names: plus -> list-add delete refresh, we use view-refresh remove duplicated icons for qdarkstyle_midnight_blue referencing icon aliases in the qrc files is the way to go Note: Dynamic style changing doesn't appear to work with AppImage
* | | | | | | | | Merge pull request #8731 from FearlessTobi/better-ldnliamwhite2022-08-126-57/+711
|\ \ \ \ \ \ \ \ \ | |_|_|/ / / / / / |/| | | | | | | | ldn: Add better stubs and more data types
| * | | | | | | | core: ldn: Address review comments part 2german772022-08-122-334/+297
| | | | | | | | |
| * | | | | | | | core: ldn: Address review commentsNarr the Reg2022-08-084-56/+46
| | | | | | | | |
| * | | | | | | | ldn: Add better stubs and more data typesFearlessTobi2022-08-076-72/+773
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Co-Authored-By: Narr the Reg <5944268+german77@users.noreply.github.com> Co-Authored-By: Morph <39850852+Morph1984@users.noreply.github.com>
* | | | | | | | | Merge pull request #8735 from djrobx/add_vsyncliamwhite2022-08-102-3/+4
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | Make vsync setting work for Vulkan
| * | | | | | | | | Make vsync setting work for VulkanDJRobX2022-08-082-3/+4
| | | | | | | | | |
* | | | | | | | | | Merge pull request #8722 from german77/ds4_goes_brrrbunnei2022-08-101-0/+4
|\ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | hid: core: Delay the stop vibration command when testing
| * | | | | | | | | | hid: core: Delay the stop vibration command when testingNarr the Reg2022-08-061-0/+4
| | | | | | | | | | |
* | | | | | | | | | | Merge pull request #8724 from german77/no_alphabunnei2022-08-104-25/+97
|\ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | hid: core: Properly emulate controller color and battery level
| * | | | | | | | | | | hid: core: Properly emulate controller color and battery levelNarr the Reg2022-08-084-25/+97
| |/ / / / / / / / / /
* | | | | | | | | | | Merge pull request #8729 from merryhime/cp15-barriersbunnei2022-08-102-4/+29
|\ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | arm_dynarmic_cp15: Implement CP15DMB/CP15DSB/CP15ISB
| * | | | | | | | | | | arm_dynarmic_cp15: Implement CP15DMB/CP15DSB/CP15ISBMerry2022-08-072-4/+29
| | |_|/ / / / / / / / | |/| | | | | | | | |
* | | | | | | | | | | Merge pull request #8499 from Docteh/pluralsbunnei2022-08-103-6/+14
|\ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | Translate english plurals
| * | | | | | | | | | | Translate english pluralsKyle Kienapfel2022-07-303-6/+14
| | |_|_|_|_|/ / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Turns out that for Qt to properly handle plurals in English a translation needs to be provided, otherwise the user is left with messages such as "Building: 2 shader(s)" Plurals for other all other languages are handled on transifex. I wrote the README.md to just refer to it as a translation collaboration site just in case we ever switch. These translations being out of date won't pose any technical problems so I believe it is fine to handle them manually on a "best effort" basis. The files are generated into the source directory so that the relative filenames are correct. The generated file is added to .gitignore
* | | | | | | | | | | Merge pull request #8715 from Docteh/suzhoubunnei2022-08-091-0/+9
|\ \ \ \ \ \ \ \ \ \ \ | |_|_|_|_|_|/ / / / / |/| | | | | | | | | | Qt5 work around for suzhou numerals
| * | | | | | | | | | Qt5 work around for suzhou numeralsKyle Kienapfel2022-08-041-0/+9
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | When windows is told to display Standard digits as suzhou, it is showing incorrect information in yuzu, file sizes and the CPU speed limiter are effected by this. See #8698 for some screenshots. Setting number format to Chinese (Simplified, Hong Kong SAR) is one way to see this issue in action. Fixes #8698
* | | | | | | | | | | core/arm: fix build errorLiam2022-08-082-2/+10
| |_|_|_|/ / / / / / |/| | | | | | | | |
* | | | | | | | | | Merge pull request #8637 from liamwhite/bad-interruptsbunnei2022-08-0813-152/+64
|\ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | kernel: unlayer CPU interrupt handling
| * | | | | | | | | | kernel: unlayer CPU interrupt handlingLiam2022-07-2513-152/+64
| | | | | | | | | | |
* | | | | | | | | | | Merge pull request #8240 from liamwhite/count-cyclesMorph2022-08-082-8/+22
|\ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | core/arm: re-enable cycle counting
| * | | | | | | | | | | core/arm: increase minimum_run_cyclesLiam2022-06-222-2/+2
| | | | | | | | | | | |
| * | | | | | | | | | | core/arm: re-enable cycle countingmerry2022-06-222-6/+20
| | | | | | | | | | | |
* | | | | | | | | | | | yuzu: Fix fmt 9.0.0 issueslat9nq2022-08-072-3/+4
| |_|_|_|/ / / / / / / |/| | | | | | | | | |
* | | | | | | | | | | Merge pull request #8658 from liamwhite/plgpbunnei2022-08-071-9/+7
|\ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | video_core: differentiate between tiled and untiled framebuffer sizes for unaccelerated blits
| * | | | | | | | | | | video_core: differentiate between tiled and untiled framebuffer sizes for unaccelerated copiesLiam2022-07-281-9/+7
| | |_|_|_|_|_|_|/ / / | |/| | | | | | | | |
* | | | | | | | | | | Merge pull request #8700 from liamwhite/xc3-vk-crashbunnei2022-08-061-0/+12
|\ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | vk_texture_cache: return VK_NULL_HANDLE for views of null images
| * | | | | | | | | | | vk_texture_cache: return VK_NULL_HANDLE for views of null imagesLiam2022-08-021-0/+12
| | |_|_|_|_|_|_|_|/ / | |/| | | | | | | | |
* | | | | | | | | | | Merge pull request #8667 from Kelebek1/xc3liamwhite2022-08-061-2/+3
|\ \ \ \ \ \ \ \ \ \ \ | |_|_|_|_|_|_|/ / / / |/| | | | | | | | | | [SPIRV] Add missed shader defines
| * | | | | | | | | | Add missed shader defines. Fixes Xenoblade Chronicles 3 booting with Vulkan.Kelebek12022-07-291-2/+3
| | | | | | | | | | |
* | | | | | | | | | | Controller bugfixes in profile select (#8716)Steve2022-08-053-5/+10
| |_|_|_|_|_|_|/ / / |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * Controller bugfixes in profile select, closes #8265 2 fixes for using a controller in profile select dialog. Pressing 'B' cancels the launch of the game Using controller to select a profile now correctly sets the index to use for the launch * Added brackets to if statements as requested.
* | | | | | | | | | renderer_vulkan: add format fallbacks for R16G16B16_SFLOAT, R16G16B16_SSCALED, R8G8B8_SSCALEDLiam2022-08-035-273/+337
| |/ / / / / / / / |/| | | | | | | |
* | | | | | | | | core/loader: remove ELF loaderLiam2022-08-015-313/+0
| |_|_|_|/ / / / |/| | | | | | |
* | | | | | | | Merge pull request #8678 from liamwhite/stop-waitingbunnei2022-07-312-2/+2
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | video_core: stop waiting for shader compilation on user cancel
| * | | | | | | | video_core: stop waiting for shader compilation on user cancelLiam2022-07-302-2/+2
| | |_|_|_|/ / / | |/| | | | | |
* | | | | | | | Merge pull request #8622 from liamwhite/progressbunnei2022-07-311-0/+4
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | qt: reset progress bar after shader compilation
| * | | | | | | | qt: reset progress bar after shader compilationLiam2022-07-241-0/+4
| | | | | | | | |
* | | | | | | | | Properly write out the command buffer when serving close requestNikita Strygin2022-07-311-2/+5
| | | | | | | | |
* | | | | | | | | Merge pull request #8684 from liamwhite/delete-shaderMorph2022-07-311-0/+1
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | renderer_opengl: delete shader source after linking
| * | | | | | | | | renderer_opengl: delete shader source after linkingLiam2022-07-301-0/+1
| | |/ / / / / / / | |/| | | | | | |
* | | | | | | | | Merge pull request #8664 from liamwhite/monkey-compiler-v12-1Morph2022-07-301-1/+1
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | common: move forwarded value into SPSCQueue
| * | | | | | | | | common: move forwarded value into SPSCQueueLiam2022-07-291-1/+1
| | |_|/ / / / / / | |/| | | | | | |
* | | | | | | | | audio_core: fix -Wuninitialized when compiling with ASanLiam2022-07-301-4/+4
| |/ / / / / / / |/| | | | | | |
* | | | | | | | Merge pull request #8656 from german77/audio-stepbunnei2022-07-291-2/+16
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | yuzu: Add incremental steps to volume hotkeys
| * | | | | | | | yuzu: Add incremental steps to volume hotkeysNarr the Reg2022-07-271-2/+16
| | |/ / / / / / | |/| | | | | |
* | | | | | | | Merge pull request #8657 from Kelebek1/depopliamwhite2022-07-282-2/+2
|\ \ \ \ \ \ \ \ | |_|/ / / / / / |/| | | | | | | [Audio] Avoid an out-of-bounds span write in depop prepare
| * | | | | | | Avoid depop out of boundsKelebek12022-07-282-2/+2
| | | | | | | |
* | | | | | | | Revert Coretiming PRs 8531 and 7454 (#8591)Maide2022-07-285-118/+69
| | | | | | | |
* | | | | | | | implement pause on system suspend (#8585)snek2022-07-282-1/+43
|/ / / / / / /
* | | | | | | Merge pull request #8542 from Morph1984/gpu-use-old-qliamwhite2022-07-272-4/+3
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | gpu_thread: Use the previous MPSCQueue implementation
| * | | | | | | gpu_thread: Use the previous MPSCQueue implementationMorph2022-07-062-4/+3
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The bounded MPSCQueue implementation causes crashes in Fire Emblem Three Houses, use the previous implementation for now.
* | | | | | | | Merge pull request #8636 from german77/irs_cluster_releaseliamwhite2022-07-276-7/+323
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | service: irs: Implement clustering processor
| * | | | | | | | Address commentsNarr the Reg2022-07-252-17/+18
| | | | | | | | |
| * | | | | | | | fix compiler errorsgerman772022-07-242-12/+14
| | | | | | | | |
| * | | | | | | | service: irs: Implement clustering processorgerman772022-07-246-7/+320
| | |/ / / / / / | |/| | | | | |
* | | | | | | | Merge pull request #8633 from Morph1984/optional-keysliamwhite2022-07-275-4/+81
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | applet/swkbd: Implement optional symbol keys
| * | | | | | | | qt_software_keyboard: Fix infinite loop when moving between buttonsMorph2022-07-241-0/+14
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | There was a bug where, when using the numeric keyboard, moving between buttons resulted in an infinite loop, resulting in a stuck state. This was due to prev_button being the only one enabled in that row or column, causing the condition in the while loop to always be true. To fix this, detect whether we have returned to that initial row/column and break out of the loop.
| * | | | | | | | applet/swkbd: Implement optional symbol keysMorph2022-07-245-4/+67
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | These are only used in the numeric keyboard, and correspond to the keys to the left and right of the "0" key on the numeric keyboard.
* | | | | | | | | Merge pull request #8592 from devsnek/sig-handlerssnek2022-07-272-0/+71
| | | | | | | | | | | | | | | | | | | | | | | | | | | exit gracefully on sigint/sigterm
* | | | | | | | | chore: make yuzu REUSE compliantAndrea Pappacoda2022-07-27180-487/+390
| |_|_|/ / / / / |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | [REUSE] is a specification that aims at making file copyright information consistent, so that it can be both human and machine readable. It basically requires that all files have a header containing copyright and licensing information. When this isn't possible, like when dealing with binary assets, generated files or embedded third-party dependencies, it is permitted to insert copyright information in the `.reuse/dep5` file. Oh, and it also requires that all the licenses used in the project are present in the `LICENSES` folder, that's why the diff is so huge. This can be done automatically with `reuse download --all`. The `reuse` tool also contains a handy subcommand that analyzes the project and tells whether or not the project is (still) compliant, `reuse lint`. Following REUSE has a few advantages over the current approach: - Copyright information is easy to access for users / downstream - Files like `dist/license.md` do not need to exist anymore, as `.reuse/dep5` is used instead - `reuse lint` makes it easy to ensure that copyright information of files like binary assets / images is always accurate and up to date To add copyright information of files that didn't have it I looked up who committed what and when, for each file. As yuzu contributors do not have to sign a CLA or similar I couldn't assume that copyright ownership was of the "yuzu Emulator Project", so I used the name and/or email of the commit author instead. [REUSE]: https://reuse.software Follow-up to 01cf05bc75b1e47beb08937439f3ed9339e7b254
* | | | | | | | network: Address review commentsFearlessTobi2022-07-255-199/+203
| | | | | | | |
* | | | | | | | network, yuzu: Make copyright headers SPDX-compliantFearlessTobi2022-07-2537-111/+74
| | | | | | | |
* | | | | | | | network, yuzu: Improve variable naming and style consistencyFearlessTobi2022-07-2514-47/+53
| | | | | | | |
* | | | | | | | yuzu_cmd: Fix compilationFearlessTobi2022-07-252-13/+1
| | | | | | | |
* | | | | | | | network: Move global state into a seperate classFearlessTobi2022-07-2521-96/+150
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Co-Authored-By: Narr the Reg <5944268+german77@users.noreply.github.com>
* | | | | | | | common: multiplayer: Use GameInfo typegerman772022-07-2511-62/+60
| | | | | | | |
* | | | | | | | Address second part of review commentsFearlessTobi2022-07-259-103/+92
| | | | | | | |
* | | | | | | | Address first part of review commentsFearlessTobi2022-07-2514-133/+231
| | | | | | | |
* | | | | | | | Fix compilation on linux gccFearlessTobi2022-07-256-31/+32
| | | | | | | |
* | | | | | | | web_service: Fix -Wmissing-field-initializersFearlessTobi2022-07-251-1/+1
| | | | | | | |
* | | | | | | | core: Fix -Wunused-variableFearlessTobi2022-07-251-1/+3
| | | | | | | |
* | | | | | | | common, core: fix -Wmissing-field-initializersFearlessTobi2022-07-252-5/+5
| | | | | | | |
* | | | | | | | yuzu: Hide multiplayer button and room statusFearlessTobi2022-07-252-16/+3
| | | | | | | |
* | | | | | | | yuzu: Add ui files for multiplayer roomsFearlessTobi2022-07-2567-49/+4499
| | | | | | | |
* | | | | | | | network: Add initial files and enet dependencyFearlessTobi2022-07-2512-0/+2890
| | | | | | | |
* | | | | | | | Merge pull request #8564 from lat9nq/dinner-forkbunnei2022-07-2512-124/+181
|\ \ \ \ \ \ \ \ | |_|_|_|_|/ / / |/| | | | | | | yuzu: Streamline broken Vulkan handling
| * | | | | | | startup_checks: Use WaitForSingleObject and more cleanuplat9nq2022-07-121-6/+9
| | | | | | | |
| * | | | | | | startup_checks: Use GetEnvironmentVariableAlat9nq2022-07-111-4/+3
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Solves MSVC compile error. Also drops need string use for comparison.
| * | | | | | | startup_checks: Clean uplat9nq2022-07-101-9/+6
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Adds some comments, removes unused includes, and removes last bits of logging since this is before the logging backend starts up.
| * | | | | | | startup_checks: Implement unix side codelat9nq2022-07-102-17/+48
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Wow fork() is nice, isn't it?
| * | | | | | | yuzu: Simplify broken Vulkan handlinglat9nq2022-07-109-115/+65
| | | | | | | |
| * | | | | | | yuzu: Check Vulkan on startup with a childlat9nq2022-07-103-1/+78
| | | | | | | |
| * | | | | | | yuzu: Rename check_vulkan to startup_checkslat9nq2022-07-104-3/+3
| | |_|_|_|/ / | |/| | | | |
* | | | | | | Merge pull request #8549 from liamwhite/kscheduler-scMorph2022-07-2513-602/+605
|\ \ \ \ \ \ \ | |_|_|/ / / / |/| | | | | | kernel: use KScheduler from Mesosphere
| * | | | | | kernel: Ensure all uses of disable_count are balancedLiam2022-07-153-10/+21
| | | | | | |
| * | | | | | kernel: be more careful about initialization path for HLE threadsLiam2022-07-152-1/+8
| | | | | | |
| * | | | | | kernel: fix single-core preemption pointsLiam2022-07-156-40/+28
| | | | | | |
| * | | | | | kernel: fix issues with single core modeLiam2022-07-159-189/+225
| | | | | | |
| * | | | | | kernel: use KScheduler from mesosphereLiam2022-07-1512-602/+563
| | | | | | |
* | | | | | | yuzu: Add webcam support and rebase to latest masterNarr the Reg2022-07-248-16/+43
| | | | | | |
* | | | | | | service: irs: Move to IRS namespace and minor fixesgerman772022-07-2419-76/+70
| | | | | | |
* | | | | | | service: irs: Split processors and implement ImageTransferProcessorgerman772022-07-2418-291/+1091
| | | | | | |
* | | | | | | core: hid: Add cammera supportgerman772022-07-246-3/+423
| | | | | | |
* | | | | | | yuzu: Hook qt camera to camera drivergerman772022-07-2413-1/+481
| | | | | | |
* | | | | | | input_common: Add camera drivergerman772022-07-2411-5/+298
| |_|/ / / / |/| | | | |
* | | | | | Merge pull request #8545 from Kelebek1/Audioliamwhite2022-07-23269-8436/+33703
|\ \ \ \ \ \ | | | | | | | | | | | | | | Project Andio
| * | | | | | Project AndioKelebek12022-07-22269-8436/+33703
| | | | | | |
* | | | | | | Merge pull request #8611 from liamwhite/fix-flatpak-crashbunnei2022-07-231-5/+8
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | video_core: use correct byte size for framebuffer
| * | | | | | | video_core: use correct byte size for framebufferLiam2022-07-191-5/+8
| | | | | | | |
* | | | | | | | ci,CMake: Drop Conan support for vcpkglat9nq2022-07-231-2/+3
| |/ / / / / / |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Between packages breaking, Conan always being a moving target for minimum required CMake support, and now their moves to Conan 2.0 causing existing packages to break, I suppose this was a long time coming. vcpkg isn't without its drawbacks, but at the moment it seems easier on the project to use for external packages. Mostly removes the logic for Conan from the root CMakeLists file, leaving basic find_package()'s in its place. Sets only the find_package()'s that require CONFIG mode as necessary. clang and linux CI now use the vcpkg toolchain file configured in the Docker container when possible. mingw CI turns off YUZU_TESTS because there's no way on the container to run Windows executables on a Linux host anyway, and it's not easy to get Catch2 there.
* | | | | | | Merge pull request #8598 from Link4565/recv-dontwaitbunnei2022-07-221-1/+19
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | Enable the use of MSG_DONTWAIT flag on RecvImpl
| * | | | | | | Enable the use of MSG_DONTWAIT flag on RecvImplLink45652022-07-161-1/+19
| | | | | | | |
* | | | | | | | Update configure_input.uiMatías Locatti2022-07-191-1/+1
| | | | | | | |
* | | | | | | | implement resume messageGus Caplan2022-07-184-0/+23
| |/ / / / / / |/| | | | | |
* | | | | | | Merge pull request #8569 from merryhime/watchpointsmerry2022-07-174-8/+3
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | dynarmic: Abort watchpoints ASAP
| * | | | | | | dynarmic: Abort watchpoints ASAPMerry2022-07-154-8/+3
| | |/ / / / / | |/| | | | |
* | | | | | | Merge pull request #8508 from yuzu-emu/mc-speed-limitbunnei2022-07-1710-130/+20
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | hle: service: nvflinger: Factor speed limit into frame time calculation.
| * | | | | | | hle: service: nvflinger: Fix implicit conversion.bunnei2022-07-171-1/+4
| | | | | | | |
| * | | | | | | yuzu: settings: Remove framerate cap and merge unlocked framerate setting.bunnei2022-07-1710-135/+15
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | - These were all somewhat redundant.
| * | | | | | | hle: service: nvflinger: Factor speed limit into frame time calculation.bunnei2022-07-171-1/+8
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | - This allows the %-based "Limit Speed Percent" setting to work with MC emulation. - This is already supported for SC emulation.
* | | | | | | | Merge pull request #8544 from german77/14dot0bunnei2022-07-178-29/+45
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | service: Update some services to 14.0.0+
| * | | | | | | | service: fatal: Add function tablegerman772022-07-141-1/+7
| | | | | | | | |
| * | | | | | | | service: btdrv,bcat,btm: Update service tables to 14.0.0german772022-07-143-4/+13
| | | | | | | | |
| * | | | | | | | service am: Update service tables to 14.0.0german772022-07-141-0/+3
| | | | | | | | |
| * | | | | | | | service: ac: Replace intances of ProfileData with UserDatagerman772022-07-143-24/+22
| | | | | | | | |
* | | | | | | | | Merge pull request #8543 from BreadFish64/use_tsc_from_capsbunnei2022-07-173-1/+22
|\ \ \ \ \ \ \ \ \ | |_|/ / / / / / / |/| | | | | | | | common/x64: Use TSC clock rate from CPUID when available
| * | | | | | | | guard against div-by-zeroMarshall Mohror2022-07-061-2/+5
| | | | | | | | |
| * | | | | | | | common/x64: Use TSC clock rate from CPUID when availableMarshall Mohror2022-07-063-1/+19
| | |_|_|_|/ / / | |/| | | | | | | | | | | | | | | | | | | | | | The current method used to estimate the TSC is fairly accurate - within a few kHz - but the exact value can be extracted from CPUID if available.
* | | | | | | | Merge pull request #8593 from merryhime/ranged-setting-Tbunnei2022-07-176-58/+59
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | common/setting: Make ranged a property of the type
| * | | | | | | | common/setting: Make ranged a property of the typemerry2022-07-156-58/+59
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | - Avoids new GCC 12 warnings when Type is of form std::optional<T> - Makes more sense this way, because ranged is not a property which would change over time
* | | | | | | | | Merge pull request #8594 from liamwhite/skip-wpbunnei2022-07-162-6/+6
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | core/arm: skip watchpoint checks when reading instructions
| * | | | | | | | | core/arm: skip watchpoint checks when reading instructionsLiam2022-07-162-6/+6
| |/ / / / / / / /
* | | | | | | | | Merge pull request #8511 from german77/hbmenubunnei2022-07-1611-85/+224
|\ \ \ \ \ \ \ \ \ | |_|_|_|_|/ / / / |/| | | | | | | | service: ptm: Add TS, nifm: Stub GetInternetConnectionStatus
| * | | | | | | | service: nifm: Stub GetInternetConnectionStatusgerman772022-06-291-1/+41
| | | | | | | | |
| * | | | | | | | service: ptm: Rewrite PSM and add TSgerman772022-06-2910-84/+183
| | | | | | | | |
* | | | | | | | | Merge pull request #8560 from liamwhite/bitfield-may-aliasbunnei2022-07-161-0/+9
|\ \ \ \ \ \ \ \ \ | |_|/ / / / / / / |/| | | | | | | | common: fix bitfield aliasing on GCC/Clang
| * | | | | | | | common: fix bitfield aliasing on GCC/ClangLiam2022-07-101-0/+9
| | | | | | | | |
* | | | | | | | | Merge pull request #8587 from merryhime/padding-unusedMorph2022-07-151-4/+6
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | common_funcs: Mark padding as [[maybe_unused]]
| * | | | | | | | | common_funcs: Mark padding as [[maybe_unused]]Merry2022-07-151-4/+6
| | |_|_|_|/ / / / | |/| | | | | | |
* | | | | | | | | Merge pull request #8588 from merryhime/IBinder-vdestructMorph2022-07-151-0/+1
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | nvflinger: Polymorphic destructor requried for abstract class IBinder
| * | | | | | | | | nvflinger: Polymorphic destructor requried for abstract class IBinderMerry2022-07-151-0/+1
| |/ / / / / / / /
* / / / / / / / / KCodeMemory: Mark virtual methods as overrideMerry2022-07-151-3/+3
|/ / / / / / / /
* | | | | | | | Merge pull request #8536 from Morph1984/fix-webapplet-inputliamwhite2022-07-151-2/+6
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | qt_web_browser: Fix button inputs with QtWebEngine
| * | | | | | | | qt_web_browser: Fix button inputs with QtWebEngineMorph2022-07-061-2/+6
| | |_|/ / / / / | |/| | | | | | | | | | | | | | | | | | | | | | Button inputs were broken as button was assumed to be the bit position of NpadButton prior to the input rewrite. Since this was changed to use NpadButton directly, we should count the number of trailing zeros to determine the bit position.
* | | | | | | | Merge pull request #8510 from german77/vibrationliamwhite2022-07-153-3/+12
|\ \ \ \ \ \ \ \ | |_|_|_|/ / / / |/| | | | | | | input_common: sdl: lower vibration frequency and use it's own unique thread
| * | | | | | | input_common: sdl: lower vibration frequency and use it's own unique threadgerman772022-06-293-3/+12
| | |_|/ / / / | |/| | | | |
* | | | | | | Merge pull request #8559 from liamwhite/waiter-listbunnei2022-07-111-3/+9
|\ \ \ \ \ \ \ | |_|_|_|/ / / |/| | | | | | kernel: fix usage of waiter_list in Finalize
| * | | | | | kernel: fix usage of waiter_list in FinalizeLiam2022-07-101-3/+9
| | |_|/ / / | |/| | | |
* | | | | | Merge pull request #8528 from Morph1984/astc10x6Fernando S2022-07-107-1/+16
|\ \ \ \ \ \ | | | | | | | | | | | | | | renderer_(gl/vk): Implement ASTC_10x6_UNORM
| * | | | | | renderer_(gl/vk): Implement ASTC_10x6_UNORMMorph2022-07-067-1/+16
| | |_|/ / / | |/| | | | | | | | | | | | | | | | - Used by Monster Hunter Rise Update 10.0.2
* | | | | | PRKelebek12022-07-105-11/+9
| | | | | |
* | | | | | Rework CoreTimingKelebek12022-07-1013-82/+154
| | | | | |
* | | | | | Merge pull request #8531 from FernandoS27/core-timing-fix-regliamwhite2022-07-102-12/+2
|\ \ \ \ \ \ | |_|/ / / / |/| | | | | Core timing: use only one thread.
| * | | | | Core timing: use only one thread.Fernando Sahmkow2022-07-022-12/+2
| | | | | |
* | | | | | Merge pull request #8501 from liamwhite/backtrace-againMai2022-07-085-15/+51
|\ \ \ \ \ \ | | | | | | | | | | | | | | core/arm: better support for backtrace generation
| * | | | | | core/arm: better support for backtrace generationLiam2022-06-255-15/+51
| | | | | | |
* | | | | | | Merge pull request #8502 from liamwhite/end-waitliamwhite2022-07-072-4/+5
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | kernel: clean up waiting implementation
| * | | | | | | kernel: clean up waiting implementationLiam2022-06-252-4/+5
| |/ / / / / /
* | | | | | | Merge pull request #8492 from german77/no_more_errorsFernando S2022-07-075-40/+76
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | service: hid: Correct some mistakes and add more validations
| * | | | | | | service: hid: Correct some mistakes and add more validationsNarr the Reg2022-06-295-40/+76
| | |_|_|/ / / | |/| | | | |
* | | | | | | Merge pull request #8522 from lat9nq/consolidate-settingsMorph2022-07-078-320/+232
|\ \ \ \ \ \ \ | |_|_|_|/ / / |/| | | | | | settings: Consolidate RangedSetting's with regular ones
| * | | | | | settings: Consolidate RangedSetting's with regular oneslat9nq2022-06-308-320/+232
| |/ / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The latest git version of GCC has issues with my diamond inheritance shenanigans. Since that's now two compilers that don't like it I thought it'd be best to just axe all of it and just have the two templates like before. This rolls the features of BasicRangedSetting into BasicSetting, and likewise RangedSetting into Setting. It also renames them from BasicSetting and Setting to Setting and SwitchableSetting respectively. Now longer name corresponds to more complex thing.
* | | | | | Merge pull request #8486 from liushuyu/github-actions-verifyMorph2022-07-061-1/+7
|\ \ \ \ \ \ | | | | | | | | | | | | | | CI: Use GitHub Actions to validate pull requests
| * | | | | | CI: fix cachingliushuyu2022-07-051-1/+7
| | | | | | |
* | | | | | | Merge pull request #8532 from liamwhite/fiber-supplementsliamwhite2022-07-069-170/+79
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | common/fiber: make fibers easier to use
| * | | | | | | common/fiber: make fibers easier to useLiam2022-07-029-170/+79
| | | | | | | |
* | | | | | | | Merge pull request #8477 from Docteh/less_globalMorph2022-07-051-3/+3
|\ \ \ \ \ \ \ \ | |_|/ / / / / / |/| | | | | | | tweak API usage in qt_web_browser.cpp
| * | | | | | | tweak API usage in qt_web_browser.cppKyle Kienapfel2022-06-221-3/+3
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | In testing future versions of Qt I forgot to compile with `YUZU_USE_QT_WEB_ENGINE`, so with that flag enabled there are two issues that cropped up. 1. yuzu currently uses setRequestInterceptor, added in Qt 5.6, deprecated in 5.13 with this explaination at https://doc.qt.io/qt-5/qwebengineprofile-obsolete.html Interceptors installed with this method will call QWebEngineUrlRequestInterceptor::interceptRequest on the I/O thread. Therefore the user has to provide thread-safe interaction with the other user classes. For a duration of this call ui thread is blocked. Use setUrlRequestInterceptor instead. 2. QWebEngineSettings::globalSettings() pointer no longer exists in later versions of Qt From what I can tell, QtNXWebEngineView doesn't need to set these globally, when we make changes to settings(), QtWebEngineView::page() creates the page object if it doesn't exist yet. I don't see the page object being destroyed or otherwise replaced, except via destroying the QtNXWebEngineView object. The globalSettings() make sense if Pages or Views objects are being created outside of yuzu's control. To test this I've compared what BrowseNX and Odyssey's Action guide do in mainline 1049 and this PR. For now we're going to go up the chain to QWebEngineProfile::defaultProfile()->settings()
* | | | | | | | Merge pull request #8521 from lat9nq/gdbstub-in-boundsMorph2022-07-051-2/+6
|\ \ \ \ \ \ \ \ | |_|_|_|_|/ / / |/| | | | | | | gdbstub_arch: Directly access SP register
| * | | | | | | gdbstub_arch: Directly access SP registerlat9nq2022-06-301-2/+6
| | |_|/ / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Currently to access the SP register, RegRead and RegWrite rely on a out-of-bounds array access to reach the next element in a struct. As of writing only git versions of GCC catch this error. Specify the SP register when we want to access it in these functions.
* | | | | | | Merge pull request #8523 from liamwhite/sc-oopsieFernando S2022-07-012-1/+8
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | cpu_manager: properly check idle on return from preemption
| * | | | | | | cpu_manager: properly check idle on return from preemptionLiam2022-06-302-1/+8
| | |_|/ / / / | |/| | | | |
* | | | | | | Merge pull request #8490 from liamwhite/read-code-stopMorph2022-07-014-24/+64
|\ \ \ \ \ \ \ | |/ / / / / / |/| | | | | | dynarmic: Stop ReadCode callbacks to unmapped addresses
| * | | | | | dynarmic: Stop ReadCode callbacks to unmapped addressesLiam2022-06-224-24/+64
| | |_|_|/ / | |/| | | |
* | | | | | Merge pull request #7454 from FernandoS27/new-core-timingFernando S2022-06-308-73/+133
|\ \ \ \ \ \ | | | | | | | | | | | | | | Core: Remake Core Timing
| * | | | | | Adress Feedback.Fernando Sahmkow2022-06-303-19/+29
| | | | | | |
| * | | | | | Native clock: Use atomic ops as before.Fernando Sahmkow2022-06-282-24/+29
| | | | | | |
| * | | | | | Native Clock: remove inaccuracy mask.Fernando Sahmkow2022-06-282-6/+1
| | | | | | |
| * | | | | | Address feedback.Fernando Sahmkow2022-06-281-13/+13
| | | | | | |
| * | | | | | Core: Protect each event from race conditions within it.Fernando Sahmkow2022-06-282-0/+2
| | | | | | |
| * | | | | | Core: Fix tests.Fernando Sahmkow2022-06-283-2/+5
| | | | | | |
| * | | | | | Core: add missing include.Fernando Sahmkow2022-06-281-0/+1
| | | | | | |
| * | | | | | Core/Common: Corrections to core timing and add critical priority.Fernando Sahmkow2022-06-283-5/+11
| | | | | | |
| * | | | | | Core: Reimplement Core Timing.Fernando Sahmkow2022-06-283-55/+93
| | | | | | |
| * | | | | | Common: improve native clock.Fernando Sahmkow2022-06-283-29/+29
| | | | | | |
* | | | | | | Revert "vulkan_device: Block AMDVLK's VK_KHR_push_descriptor"lat9nq2022-06-291-11/+0
| |_|/ / / / |/| | | | |
* | | | | | Merge pull request #8512 from german77/nnResultMorph2022-06-29177-1450/+1404
|\ \ \ \ \ \ | |/ / / / / |/| | | | | Replace multiple names with a better name
| * | | | | video_core: Replace VKUpdateDescriptorQueue with UpdateDescriptorQueuegerman772022-06-2714-33/+33
| | | | | |
| * | | | | video_core: Replace VKSwapchain with Swapchaingerman772022-06-275-25/+23
| | | | | |
| * | | | | video_core: Replace VKQueryCache with QueryCachegerman772022-06-276-28/+27
| | | | | |
| * | | | | video_core: Replace VKScheduler with Schedulergerman772022-06-2735-111/+110
| | | | | |
| * | | | | video_core: Replace VKBlitScreen with BlitScreengerman772022-06-273-51/+51
| | | | | |
| * | | | | video_core: Replace VKFenceManager with FenceManagergerman772022-06-273-15/+14
| | | | | |
| * | | | | core: kernel: Replace instances of KPageLinkedList with KPageGroupgerman772022-06-2711-64/+63
| | | | | |
| * | | | | core: Replace all instances of ResultCode with Resultgerman772022-06-27140-1176/+1136
| | | | | |
* | | | | | Merge pull request #8504 from comex/mesosphere-current-processbunnei2022-06-271-0/+24
|\ \ \ \ \ \ | |/ / / / / |/| | | | | Support `InfoType_MesosphereCurrentProcess`
| * | | | | Re-add missing `case` and braces, and trim whitespacecomex2022-06-261-1/+3
| | | | | |
| * | | | | Update src/core/hle/kernel/svc.cppcomex2022-06-261-6/+14
| | | | | | | | | | | | | | | | | | Co-authored-by: liamwhite <liamwhite@users.noreply.github.com>
| * | | | | Support InfoType_MesosphereCurrentProcesscomex2022-06-261-0/+14
| | | | | |
* | | | | | Merge pull request #8475 from liamwhite/x18bunnei2022-06-2613-52/+69
|\ \ \ \ \ \ | |/ / / / / |/| | | | | kernel: make current thread pointer thread local
| * | | | | kernel: make current thread pointer thread localLiam2022-06-2313-52/+69
| | |_|/ / | |/| | |
* / | | | gdbstub: fix register pokesLiam2022-06-251-0/+1
|/ / / /
* | | | Merge pull request #8491 from Morph1984/extra-assertbunnei2022-06-221-1/+0
|\ \ \ \ | | | | | | | | | | KPageTable: Remove extraneous assert
| * | | | KPageTable: Remove extraneous assertMorph2022-06-221-1/+0
| |/ / / | | | | | | | | | | | | Since start is always 0 and VAddr is unsigned, we can safely remove this assert.
* | | | Merge pull request #8483 from liamwhite/fire-emblem-three-semaphoresbunnei2022-06-223-0/+22
|\ \ \ \ | |/ / / |/| | | kernel: wait for threads to stop on pause
| * | | kernel: wait for threads to stop on pauseLiam2022-06-183-0/+22
| | | |
* | | | Merge pull request #8432 from liamwhite/watchpointbunnei2022-06-2218-54/+510
|\ \ \ \ | | | | | | | | | | core/debugger: memory breakpoint support
| * | | | core/debugger: memory breakpoint supportLiam2022-06-1618-54/+510
| | | | |
* | | | | Merge pull request #8468 from liamwhite/dispatch-trackingbunnei2022-06-224-14/+7
|\ \ \ \ \ | | | | | | | | | | | | kernel: fix some uses of disable_count
| * | | | | kernel: fix some uses of disable_countLiam2022-06-164-14/+7
| |/ / / /
* | / / / service: am: Stub PerformSystemButtonPressingIfInFocusNarr the Reg2022-06-202-1/+24
| |/ / / |/| | | | | | | | | | | Used by Ring Fit Adventure
* | | | core: fix initialization in single core, sync GPU modeLiam2022-06-174-0/+13
| | | |
* | | | Merge pull request #8472 from german77/taceMorph2022-06-161-3/+3
|\ \ \ \ | | | | | | | | | | common: param_package: Demote DEBUG to TRACE for getters
| * | | | common: param_package: Demote DEBUG to TRACE for gettersNarr the Reg2022-06-161-3/+3
| | | | |
* | | | | Make yuzu-cmd respect log_filter settingNikita Strygin2022-06-161-0/+6
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Because logging infrastructure initializes before the loading of the config, it reads the default setting for log_filter and ignores the one set in config. To change log_filter after logging initialization some additional calls need to be made.
* | | | | Implement ExitProcess svcNikita Strygin2022-06-161-1/+2
| |/ / / |/| | | | | | | | | | | | | | | | | | | | | | | Currently this just stops all the emulation This works under assumption that only application will try to use ExitProcess, with services not touching it If application exits - it quite makes sense to end the emulation
* | | | Merge pull request #8457 from liamwhite/kprocess-suspendFernando S2022-06-1612-212/+199
|\ \ \ \ | | | | | | | | | | kernel: implement KProcess suspension
| * | | | kernel: implement KProcess suspensionLiam2022-06-1412-212/+199
| |/ / /
* | | | Merge pull request #8460 from Morph1984/bounded-qliamwhite2022-06-162-87/+74
|\ \ \ \ | | | | | | | | | | bounded_threadsafe_queue: Use constexpr capacity and mask
| * | | | bounded_threadsafe_queue: Use constexpr capacity and maskMorph2022-06-152-87/+74
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | While this is the primary change, we also: - Remove the mpsc namespace and rename Queue to MPSCQueue - Make Slot a private struct within MPSCQueue - Remove the AlignedAllocator template argument, as we use std::allocator - Replace instances of mask + 1 with capacity, and mask + 2 with capacity + 1
* | | | | Merge pull request #8317 from german77/notifabunnei2022-06-152-8/+172
|\ \ \ \ \ | | | | | | | | | | | | service: notifa: Implement most part of this service
| * | | | | service: notifa: Implement most part of this servicegerman772022-05-092-8/+172
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Implements partially RegisterAlarmSetting, UpdateAlarmSetting, LoadApplicationParameter, DeleteAlarmSetting. Needed for Fitness `Boxing 2: Rhythm & Exercise` and `Ring Fit Adventure`.
* | | | | | Merge pull request #8464 from liamwhite/break-debugMai2022-06-151-0/+7
|\ \ \ \ \ \ | | | | | | | | | | | | | | kernel: notify debugger on break SVC
| * | | | | | kernel: notify debugger on break SVCLiam2022-06-151-0/+7
| | |_|/ / / | |/| | | |
* | | | | | vk_compute_pass: Explicitly cast to VkAccessFlagsMorph2022-06-151-25/+26
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | According to the standard, a narrowing conversion is an implicit conversion from an integer or unscoped enumeration type to an integer type that cannot represent all the values of the original type, except when the value is a literal or constant expression. MSVC, unlike GCC or Clang, determines this to be a narrowing conversion despite the enumeration exclusively containing values that fit within the range of a 32 bit integer, emitting a warning since designated initializers prohibit narrowing conversions. To solve this, explicitly cast to the type we are initializing.
* | | | | | Merge pull request #8383 from Morph1984/shadow-of-the-pastMai2022-06-1535-153/+139
|\ \ \ \ \ \ | | | | | | | | | | | | | | yuzu: Make variable shadowing a compile-time error
| * | | | | | main: Eliminate variable shadowingMorph2022-06-141-3/+2
| | | | | | |
| * | | | | | wait_tree: Eliminate variable shadowingMorph2022-06-142-12/+12
| | | | | | |
| * | | | | | configure_ringcon: Eliminate variable shadowingMorph2022-06-141-4/+4
| | | | | | |
| * | | | | | configure_touch_from_button: Eliminate variable shadowingMorph2022-06-142-3/+3
| | | | | | |
| * | | | | | configure_per_game: Eliminate variable shadowingMorph2022-06-142-4/+4
| | | | | | |
| * | | | | | configure_input_player: Eliminate variable shadowingMorph2022-06-141-39/+39
| | | | | | |
| * | | | | | configure_dialog: Eliminate variable shadowingMorph2022-06-142-5/+4
| | | | | | |
| * | | | | | bootmanager: Eliminate variable shadowingMorph2022-06-141-1/+1
| | | | | | |
| * | | | | | game_list: Eliminate variable shadowingMorph2022-06-145-19/+19
| | | | | | |
| * | | | | | yuzu_cmd: Eliminate variable shadowingMorph2022-06-145-7/+7
| | | | | | |
| * | | | | | audio_core: Remove -Werror=unused-parameterMorph2022-06-141-1/+0
| | | | | | | | | | | | | | | | | | | | | | | | | | | | Removing this as we don't enforce unused parameter warnings elsewhere in the project, and explicitly specify -Wno-unused-parameter in the main CMakeLists.
| * | | | | | CMakeLists: Make variable shadowing a compile-time errorMorph2022-06-146-16/+5
| | | | | | | | | | | | | | | | | | | | | | | | | | | | Now that the entire project is free of variable shadowing, we can enforce this as a compile time error to prevent any further introduction of this logic bug.
| * | | | | | common: Eliminate variable shadowingMorph2022-06-141-2/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | GCC/Clang treats variables within lambdas as potentially shadowing those outside the lambda, despite them not being captured inside the lambda's capture list.
| * | | | | | yuzu: Eliminate variable shadowingMorph2022-06-1410-25/+25
| | | | | | |
| * | | | | | web_service: Eliminate variable shadowingMorph2022-06-142-12/+12
| | | | | | |
* | | | | | | core: centralize profile scope for DynarmicLiam2022-06-153-7/+2
| |/ / / / / |/| | | | |
* | | | | | Merge pull request #8461 from Morph1984/msvc-narrow-convMorph2022-06-141-1/+1
|\ \ \ \ \ \ | | | | | | | | | | | | | | vk_compute_pass: Use VK_ACCESS_NONE
| * | | | | | vk_compute_pass: Use VK_ACCESS_NONEMorph2022-06-141-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This enumeration was introduced in Vulkan 1.3, prefer using this instead of defaulting the enum. Also resolves a narrowing conversion warning on MSVC.
* | | | | | | Merge pull request #8434 from german77/uuidMorph2022-06-142-33/+38
|\ \ \ \ \ \ \ | |/ / / / / / |/| | | | | | input_common: Replace usage of string guid to common uuid
| * | | | | | input_common: Replace usage of string guid to common uuidNarr the Reg2022-06-072-33/+38
| | | | | | |
* | | | | | | Merge pull request #8439 from liamwhite/monkey-compilerMai2022-06-1479-213/+216
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | general: fix compilation on GCC 12
| * | | | | | | kernel: fix passthrough of local captures in lambdaLiam2022-06-141-1/+3
| | | | | | | |
| * | | | | | | common/assert: rework ASSERT handling to avoid std::function usageLiam2022-06-142-35/+20
| | | | | | | |
| * | | | | | | general: fix compilation on MinGW GCC 12Liam2022-06-142-6/+5
| | | | | | | |
| * | | | | | | common/assert: add unlikelyLiam2022-06-141-1/+1
| | | | | | | |
| * | | | | | | general: fix compilation on GCC 12Liam2022-06-142-2/+2
| | | | | | | |
| * | | | | | | kernel: ensure class token lambda exit is unreachableLiam2022-06-141-0/+1
| | | | | | | |
| * | | | | | | kernel: fix inconsistency in AutoObjectTraits macro definitionsLiam2022-06-141-4/+7
| | | | | | | |
| * | | | | | | common: Don't test ASSERT conditions inlineLiam2022-06-142-32/+36
| | | | | | | |
| * | | | | | | common: Change semantics of UNREACHABLE to unconditionally crashLiam2022-06-1472-173/+182
| | |_|_|/ / / | |/| | | | |
* / | | | | | vk_compute_pass: Silence Wextra warningMorph2022-06-141-1/+1
|/ / / / / / | | | | | | | | | | | | | | | | | | Silences a warning about using enumerated and non-enumerated types in a conditional expression.
* | | | | | Merge pull request #8458 from lat9nq/no-constexpr-flow-blockliamwhite2022-06-141-6/+0
|\ \ \ \ \ \ | | | | | | | | | | | | | | structured_control_flow: Remove constexpr Flow::Block
| * | | | | | structured_control_flow: Remove constexpr Flow::Blocklat9nq2022-06-141-6/+0
| | |/ / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | This seems to be unsupported in newer libstdc++ versions due to Flow::Block's base class being a non-literal type. It's not clear to me why this was permitted in earlier versions.
* | | | | | Merge pull request #8388 from liamwhite/simpler-pausebunnei2022-06-143-95/+36
|\ \ \ \ \ \ | |/ / / / / |/| | | | | CpuManager: simplify pausing
| * | | | | CpuManager: simplify pausingLiam2022-06-093-95/+36
| | | | | |
* | | | | | Merge pull request #8446 from liamwhite/cmd-gdbMorph2022-06-1312-8/+96
|\ \ \ \ \ \ | | | | | | | | | | | | | | core/debugger: support operation in yuzu-cmd
| * | | | | | yuzu-cmd: ignore bogus timeous from SDLLiam2022-06-101-1/+9
| | | | | | |
| * | | | | | core/debugger: fix a number of shutdown deadlocksLiam2022-06-109-7/+72
| | | | | | |
| * | | | | | core/debugger: support operation in yuzu-cmdLiam2022-06-103-0/+15
| |/ / / / /
* | | | | | Merge pull request #8454 from liamwhite/inaddr-anyMorph2022-06-131-1/+1
|\ \ \ \ \ \ | | | | | | | | | | | | | | core/debugger: allow remote connections
| * | | | | | core/debugger: allow remote connectionsLiam2022-06-121-1/+1
| | |_|_|/ / | |/| | | |
* | | | | | Merge pull request #8443 from liamwhite/code-membunnei2022-06-133-26/+118
|\ \ \ \ \ \ | |/ / / / / |/| | | | | kernel: fix KCodeMemory initialization
| * | | | | kernel: fix KCodeMemory initializationLiam2022-06-093-26/+118
| |/ / / /
* | | | | gdbstub_arch: Add missing virtual destructorLioncash2022-06-121-0/+1
| | | | | | | | | | | | | | | | | | | | | | | | | The class is used polymorphically, so it's undefined behavior to delete instances of GDBStubA64 and GDBStubA32 from the base class pointer.
* | | | | Merge pull request #8353 from Docteh/msvc_report_runtimeMai M2022-06-112-0/+30
|\ \ \ \ \ | | | | | | | | | | | | log the MSVC runtime version when running on MSVC build
| * | | | | log the MSVC runtime version when running on MSVC buildKyle Kienapfel2022-06-112-0/+30
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This might be useful information, not 100% sure. [ 0.958068] Frontend <Info> yuzu\main.cpp:GMainWindow:275: yuzu Version: yuzu Development Build | master-0b9ef3c0b-dirty [ 0.958095] Frontend <Info> yuzu\main.cpp:LogRuntimes:220: MSVC Compiler: 1931 Runtime: 14.32.31326.0
* | | | | | Merge pull request #8427 from Docteh/deprecate_qdesktopMai M2022-06-111-3/+15
|\ \ \ \ \ \ | | | | | | | | | | | | | | deprecate usage of QDesktopWidget for going fullscreen
| * | | | | | deprecate usage of QDesktopWidget for going fullscreenKyle Kienapfel2022-06-061-3/+15
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Idea works as follows, while going fullscreen we compare the current window geometry with available screens and ask for an intersection rectangle, we go fullscreen where most of the window is located GuessCurrentScreen could also potentially be used to see which screen the window is on for dynamic DPI handling
* | | | | | | Merge pull request #8449 from Docteh/translate_placeholderMai M2022-06-112-1/+16
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | retranslate the game list placeholder
| * | | | | | | UI: retranslate the game list placeholderKyle Kienapfel2022-06-112-1/+16
| |/ / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This is the "Double-click to add a new folder to the game list" message that shows up when users first launch yuzu and is most likely never seen again. Previously this message was not re-translated.
* | | | | | | Merge pull request #8413 from behunin/bounded-queuebunnei2022-06-113-4/+185
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | gpu_thread: Move to bounded queue
| * | | | | | | gpu_thread: Move to bounded queueLevi Behunin2022-06-033-4/+185
| | | | | | | |
* | | | | | | | Merge pull request #8393 from lat9nq/default-vulkanbunnei2022-06-1112-48/+184
|\ \ \ \ \ \ \ \ | |_|_|/ / / / / |/| | | | | | | general: Set renderer_backend's default to Vulkan
| * | | | | | | configure_graphics: Remove unused includelat9nq2022-06-041-1/+0
| | | | | | | |
| * | | | | | | main: Insert warning text on broken Vulkanlat9nq2022-05-301-1/+6
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Co-authored-by: Schplee <24275329+Schplee@users.noreply.github.com>
| * | | | | | | main: Save config on broken Vulkan detectlat9nq2022-05-301-0/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Prevents possible issues if someone were to open yuzu repeatedly over and over again.
| * | | | | | | yuzu-qt: Make has_broken_vulkan only for crasheslat9nq2022-05-305-11/+17
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Being able to catch and handle a Vulkan exception is not what this is for.
| * | | | | | | vulkan_library: Add debug logginglat9nq2022-05-301-0/+4
| | | | | | | |
| * | | | | | | yuzu-qt: Attempt to workaround broken Vulkan installationslat9nq2022-05-309-46/+166
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This does a few things in order to make the default setting Vulkan workable. - When yuzu boots, it just opens the Vulkan library. - If it works, all good and we continue with Vulkan as the default. - If something breaks, a new file in the config directory will be left behind (this is deleted normally). - If Vulkan is not working, has_broken_vulkan is set to true. - The first time this happens, a warning is displayed to notify the user. - This forces use of OpenGL, and Vulkan cannot be selected. - The Shader Backend selector is made accessible for use in custom configurations. - To disable has_broken_vulkan, the user needs to press a button in Graphics Configuration to manually run the Vulkan device enumeration.
| * | | | | | | default_ini: Reflect new renderer backend default settinglat9nq2022-05-301-1/+1
| | | | | | | |
| * | | | | | | settings: Set Vulkan to the default renderer backendlat9nq2022-05-301-1/+1
| | | | | | | |
* | | | | | | | Merge pull request #8405 from Docteh/dock_undockMai M2022-06-112-5/+11
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | ui: Status bars dock button becomes DOCKED/HANDHELD button
| * | | | | | | | ui: Status bars dock button becomes dock/undock buttonKyle Kienapfel2022-06-022-5/+11
| | |_|/ / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | For people not used to the Yuzu UI it's not always clear if the emulated console is docked or not. The other items update their text when clicked, this PR brings the DOCK button in line with this. DOCK -> DOCKED or HANDHELD
* | | | | | | | Merge pull request #8333 from Docteh/translate_hotkeysMai M2022-06-112-26/+40
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | UI: Translate hotkey labels in configuration
| * | | | | | | | UI: Translate hotkey labels in configurationKyle K2022-05-192-26/+40
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Another request from GillianMC. The translated strings have been placed in a separate "Hotkeys" context as an alternative to having to add the tr function to the Config class, or adding them to ConfigureHotkeys context which is quite long. The English strings get attached to the items in the Action column as "data", and are used for RetranslateUI and saving the hotkey configuration.
* | | | | | | | | Merge pull request #8318 from Docteh/cmake-qt56-entryMai M2022-06-1110-35/+25
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | Update some files with Qt 5.15.2 best practices in mind
| * | | | | | | | | motion touch ui: move remaining connection out of .ui fileKyle K2022-05-302-18/+3
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Two reasons for this: 1. Out of 7 connections, 6 are in ConfigureMotionTouch::ConnectEvents, this is the outlier. 2. Qt6 doesn't moc the connection properly
| * | | | | | | | | Update some files with Qt 5.15.2 best practices in mindKyle K2022-05-298-17/+22
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | There was some discussion about updating to Qt6 and I figured I would work on some smaller parts. For Windows platform the WinMain function has moved from the Qt5::WinMain to a new one called Qt6::EntryPointPrivate Also Qt5 supports versionless CMake targets https://www.qt.io/blog/versionless-cmake-targets-qt-5.15 These other changes in this commit are to support Qt6, but in ways that don't mess with Qt5. src/yuzu/bootmanager.cpp: Qt6 complains about not being able to know to use QPoint or QPointF, picking QPoint src/yuzu/bootmanager.h: Qt6 prefers that QStringList.h be included rather than an empty class definition src/yuzu/configuration/configure_system.cpp: toULongLong intends to return unsigned 64 bit integer, but Settings::values.rng_seed is only 32 bits wide src/yuzu/game_list.cpp: Qt6 returns a different datatype for QStringList.length than Qt5, it used to be int, but in Qt6 its now qsizetype src/yuzu/loading_screen.cpp: Qt5's for QStyleOption.init say to switch to initFrom. The QStyleOption.init doesn't exist in Qt6 src/yuzu/main.cpp: Another QPointer and QStringList.size, lets standardize on size()
* | | | | | | | | | service: hid: Fix gesture regressionNarr the Reg2022-06-102-4/+3
| |_|_|_|_|/ / / / |/| | | | | | | |
* | | | | | | | | Merge pull request #8428 from bunnei/nvflinger-fix-timingbunnei2022-06-083-31/+3
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | Follow-up fixes for NVFlinger rewrite (Part 3)
| * | | | | | | | | hle: service: nvflinger: buffer_queue_consumer: Always free released buffers.bunnei2022-06-063-31/+3
| | | | | | | | | |
* | | | | | | | | | core/debugger: fix asio write usageLiam2022-06-071-2/+2
| | | | | | | | | |
* | | | | | | | | | core/debugger: fix crash due to incorrect lambda captureLiam2022-06-071-8/+9
| | | | | | | | | |
* | | | | | | | | | Merge pull request #8367 from Docteh/say_win11bunnei2022-06-061-1/+26
|\ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | Logging: Report Post Windows 10 2004 versions, like Windows 11
| * | | | | | | | | | Logging: Report Post Windows 10 2004 versions, like Windows 11Kyle K2022-05-291-1/+26
| | |_|_|/ / / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Qt5 and Qt6 don't really do a good job of reporting Windows versions past the 2004 version. Current: Windows 10 Version 2009 This Patch: Windows 10 Version 21H1 (Build 19043.1706) Also: Windows 11 Version 21H2 (Build 22000.675) Fixes: #8362
* | | | | | | | | | Merge pull request #8426 from liamwhite/elfbunnei2022-06-065-263/+371
|\ \ \ \ \ \ \ \ \ \ | |_|/ / / / / / / / |/| | | | | | | | | common: consolidate ELF structure definitions
| * | | | | | | | | common: consolidate ELF structure definitionsLiam2022-06-055-263/+371
| | | | | | | | | |
* | | | | | | | | | Merge pull request #8419 from liamwhite/library-listMai M2022-06-061-22/+28
|\ \ \ \ \ \ \ \ \ \ | |_|_|_|_|_|_|/ / / |/| | | | | | | | | gdbstub: add missing library list query
| * | | | | | | | | gdbstub: add missing library list commandLiam2022-06-041-22/+28
| |/ / / / / / / /
* | | | | | | | | Merge pull request #8395 from german77/ir_stubbunnei2022-06-042-21/+460
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | service: hid: Improve stub of IRS
| * | | | | | | | | service: hid: Improve stub of IRSNarr the Reg2022-05-312-21/+460
| | | | | | | | | |
* | | | | | | | | | Maxwell3D: Fix 3D semaphore counter type 0 handlingBilly Laws2022-06-022-3/+3
| |/ / / / / / / / |/| | | | | | | | | | | | | | | | | | | | | | | | | | Counter type 0 actually releases the semaphore payload rather than a constant zero as was previously thought. This is required by Skyrim.
* | | | | | | | | Merge pull request #8410 from liamwhite/thread-namesMai M2022-06-024-14/+172
|\ \ \ \ \ \ \ \ \ | |_|_|_|_|_|/ / / |/| | | | | | | | gdbstub: Support reading guest thread names
| * | | | | | | | core/debugger: Support reading guest thread namesLiam2022-06-024-14/+172
| | | | | | | | |
* | | | | | | | | Merge pull request #8409 from liamwhite/tdesc-fixMai M2022-06-022-10/+87
|\ \ \ \ \ \ \ \ \ | |/ / / / / / / / |/| | | | | | | | gdbstub: fix target descriptions
| * | | | | | | | gdbstub: fix target descriptionsLiam2022-06-022-10/+87
| | | | | | | | |
* | | | | | | | | Merge pull request #8402 from liamwhite/better-stepMorph2022-06-0215-122/+247
|\ \ \ \ \ \ \ \ \ | |/ / / / / / / / |/| | | | | | | | core/debugger: Improved stepping mechanism and misc fixes
| * | | | | | | | core/debugger: Improved stepping mechanism and misc fixesLiam2022-06-0115-122/+247
| | | | | | | | |
* | | | | | | | | Merge pull request #8400 from Docteh/fullscreen_glitchbunnei2022-06-011-0/+4
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | fix UI opening fullscreen after certain crashes
| * | | | | | | | | fix UI opening fullscreen after certain crashesKyle Kienapfel2022-06-011-0/+4
| | |_|/ / / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Sometimes when yuzu crashes, it restarts with the games list in fullscreen, which would be fine, except there isn't an easy way to exit this. It also doesn't occur often enough for qt-config.ini files to be in good supply. UILayout\geometry value in qt-config.ini is the culprit, at least for the one provided. Proposed fix is to simply check isFullScreen when yuzu is starting up, and take it out of full screen immediately
* | | | | | | | | Merge pull request #8404 from Morph1984/virtualliamwhite2022-06-013-2/+6
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | core/debugger: Define defaulted virtual destructors
| * | | | | | | | | core/debugger: Define defaulted virtual destructorsMorph2022-06-013-2/+6
| | |/ / / / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | Resolves an MSVC warning where a virtual destructor is not defined in the base class with virtual functions.
* / | | | | | | | gdbstub: Explicitly cast return type to u8Morph2022-06-011-2/+2
|/ / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | Otherwise, the addition promotes the returned value to an int instead of keeping it as a u8.
* | / / / / / / core/debugger: Implement new GDB stub debuggerLiam2022-06-0127-42/+1500
| |/ / / / / / |/| | | | | |
* | | | | | | Merge pull request #8368 from german77/seventimesbunnei2022-05-306-368/+643
|\ \ \ \ \ \ \ | |_|_|_|/ / / |/| | | | | | Service: hid: Several improvements and implementations
| * | | | | | service: hid: Implement ResetIsSixAxisSensorDeviceNewlyAssignedgerman772022-05-275-6/+125
| | | | | | | | | | | | | | | | | | | | | | | | | | | | Needed by Nintendo Switch Sports
| * | | | | | service: hid: Implement LoadSixAxisSensorCalibrationParameter and GetSixAxisSensorIcInformationgerman772022-05-275-3/+136
| | | | | | | | | | | | | | | | | | | | | | | | | | | | Needed by Nintendo Switch Sports
| * | | | | | service: hid: Implement EnableSixAxisSensorUnalteredPassthrough and IsSixAxisSensorUnalteredPassthroughEnabledgerman772022-05-274-2/+88
| | | | | | | | | | | | | | | | | | | | | | | | | | | | Needed by Nintendo Switch Sports
| * | | | | | service: hid: Add error handling to sixaxis functionsgerman772022-05-273-31/+55
| | | | | | |
| * | | | | | service: hid: Refractor sixaxis functionsgerman772022-05-272-185/+88
| | | | | | |
| * | | | | | service: hid: Implement MergeSingleJoyAsDualJoy according to REgerman772022-05-274-65/+57
| | | | | | |
| * | | | | | service: hid: Add error handling to setNpadAssignment and variantsgerman772022-05-273-23/+27
| | | | | | |
| * | | | | | service: hid: Quick RE fixes and commentsgerman772022-05-274-54/+68
| | | | | | |
* | | | | | | Merge pull request #8332 from Morph1984/reduce_exec_sizebunnei2022-05-294-19/+18
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | general: Use smaller array types where applicable
| * | | | | | | time_zone_manager: Use s8 for month length tablesMorph2022-05-131-4/+3
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Using this smaller type saves 512 bytes in the compiled executable.
| * | | | | | | video_core/surface: Use u8 for PixelFormat block tablesMorph2022-05-131-3/+3
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Using this smaller type saves 33280 bytes in the compiled executable.
| * | | | | | | codecs/vp9: Use u8 for norm and map lutsMorph2022-05-131-4/+4
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Using this smaller type saves 1536 bytes in the compiled executable.
| * | | | | | | command_generator: Use u8 for tap index lutMorph2022-05-131-8/+8
| | |_|/ / / / | |/| | | | | | | | | | | | | | | | | | | Using this smaller type saves 1024 bytes in the compiled executable.
* | | | | | | Merge pull request #8339 from Docteh/about_iconbunnei2022-05-292-3/+19
|\ \ \ \ \ \ \ | |_|_|/ / / / |/| | | | | | about dialog: Fix yuzu icon
| * | | | | | about dialog: Fix the logo in a multiplatform wayKyle K2022-05-162-3/+19
| |/ / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The Icon was renamed in #8283 for Linux builds, and the fix proposed in #8312 would in turn break the icon for Windows users. I've decided to fix the aboutdialog.ui file via qtcreator. I'm not sure its important to have the yuzu icon inside the About dialog grabbed from the local Qt theme, but I've reword how the code works for that, and we can just delete those lines. I've also thrown the yuzu.png through pngcrush to remove this warning libpng warning: iCCP: known incorrect sRGB profile Credit to abouvier for bringing bug up.
* | | | | | Merge pull request #8385 from lat9nq/just-subsys-winMai M2022-05-281-1/+1
|\ \ \ \ \ \ | | | | | | | | | | | | | | yuzu-qt: Call -Wl,--subsystem,windows directly
| * | | | | | yuzu-qt: Call -Wl,--subsystem,windows directlylat9nq2022-05-281-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | -mwindows doesn't work with Clang. tpoechtrager/wclang resolves this by just using MinGW-GCC to link the executable, however this prevents us from using LLVM-exclusive tools when building yuzu. Solution is to send the linker argument we need from -mwindows directly to the linker. From https://gcc-help.gcc.gnu.narkive.com/FogklN5J/gcc-wl-subsystem-windows-mwindows-options
* | | | | | | Merge pull request #8374 from german77/asnycvibrationsbunnei2022-05-284-7/+63
|\ \ \ \ \ \ \ | |/ / / / / / |/| | | | | | input_common: Make vibration request async
| * | | | | | input_common: Make vibration request asyncNarr the Reg2022-05-234-7/+63
| | |/ / / / | |/| | | |
* | | | | | Merge pull request #8372 from german77/touchbunnei2022-05-278-92/+140
|\ \ \ \ \ \ | | | | | | | | | | | | | | input_common: touch: Rewrite touch driver to support multiple touch points
| * | | | | | input_common: touch: Rewrite touch driver to support multiple touch pointsgerman772022-05-238-92/+140
| |/ / / / /
* | | | | | path_util: Resolve `-Wpointer-bool-conversion` warninglat9nq2022-05-271-3/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Clang (rightfully) warns that we are checking for the existence of pointer to something just allocated on the stack, which is always true. Instead, check whether GetModuleFileNameW failed. Co-authored-by: Mai M <mathew1800@gmail.com>
* | | | | | Merge pull request #8379 from lat9nq/amd-push-desc-workaroundbunnei2022-05-251-0/+11
|\ \ \ \ \ \ | | | | | | | | | | | | | | vulkan_device: Block AMDVLK's VK_KHR_push_descriptor
| * | | | | | vulkan_device: Block AMDVLK's VK_KHR_push_descriptorlat9nq2022-05-251-0/+11
| |/ / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Recent AMD Vulkan drivers (22.5.2 or 2.0.226 for specifically Vulkan) have a broken VK_KHR_push_descriptor implementation that causes a crash in yuzu. Disable it for the time being.
* | | | | | Merge pull request #8369 from lat9nq/amd-wmel-workaroundbunnei2022-05-251-1/+6
|\ \ \ \ \ \ | | | | | | | | | | | | | | vulkan_device: Workaround extension bug
| * | | | | | vulkan_device: Workaround extension buglat9nq2022-05-251-1/+6
| | |_|/ / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | A bug occurs in yuzu when VK_KHR_workgroup_memory_explicit_layout is available but 16-bit integers are not supported in the host driver. Disable usage of the extension when this case arises.
* | | | | | Merge pull request #8311 from asLody/fix-stencil-facesbunnei2022-05-251-2/+2
|\ \ \ \ \ \ | |_|/ / / / |/| | | | | vk_rasterizer: fix stencil test when two faces are disabled
| * | | | | vk_rasterizer: fix stencil test when two faces are disabledLody2022-05-061-2/+2
| | |_|/ / | |/| | |
* | | | | Merge pull request #8342 from lat9nq/clang-latest-stdc++liamwhite2022-05-214-16/+25
|\ \ \ \ \ | |_|/ / / |/| | | | general: Use Common::U16StringFromBuffer in place of QString::toStdU16String
| * | | | qt_software_keyboard: Address review feedbacklat9nq2022-05-161-14/+14
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Use auto and a more descriptive variable name. Secondly, fix some C++ misconceptions or constructing too many objects. Co-authored-by: Morph <39850852+Morph1984@users.noreply.github.com> Co-authored-by: Lioncash <mathew1800@gmail.com>
| * | | | main: Use Common::U16StringFromBufferlat9nq2022-05-161-2/+4
| | | | | | | | | | | | | | | | | | | | See ffd3afcf2
| * | | | qt_software_keyboard: Use Common::U16StringFromBufferlat9nq2022-05-161-14/+15
| | | | | | | | | | | | | | | | | | | | See ffd3afcf2
| * | | | string_util: Add U16StringFromBufferlat9nq2022-05-162-0/+6
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Qt's QString::toStdU16String doesn't work when compiling against the latest libstdc++, at least when using Clang. This function effectively does the same thing as the aforementioned one.
* | | | | video_core: Support new VkResultAlexandre Bouvier2022-05-171-0/+2
|/ / / /
* | / / general: Avoid ambiguous format_to compilation errorsLioncash2022-05-143-3/+3
| |/ / |/| | | | | | | | | | | | | | | | | Ensures that we're using the fmt version of format_to. These are also the only three outliers. All of the other formatters we have are properly qualified.
* | | Merge pull request #8308 from german77/disablesixMorph2022-05-112-52/+47
|\ \ \ | | | | | | | | service: hid: Disable correctly motion input
| * | | service: hid: Fix motion refresh rateNarr the Reg2022-05-062-2/+6
| | | |
| * | | service: hid: Disable correctly motion inputgerman772022-05-061-50/+41
| |/ /
* | | Merge pull request #8314 from liamwhite/gl-flip-2Morph2022-05-111-4/+3
|\ \ \ | | | | | | | | OpenGL: interpret face flips according to GL NDC
| * | | OpenGL: implement face flips according to NDCLiam2022-05-071-4/+3
| |/ /
* | | Merge pull request #8313 from liamwhite/dma-bppMorph2022-05-111-3/+6
|\ \ \ | | | | | | | | maxwell_dma: fix bytes_per_pixel
| * | | maxwell_dma: use fallback if remapping is enabledLiam2022-05-111-3/+6
| | | |
| * | | maxwell_dma: fix bytes per pixelLiam2022-05-071-3/+3
| |/ /
* | | video_core/macro: clear code on upload address assignmentLiam2022-05-103-0/+10
| | |
* | | VideoCore: Add option to dump the macros.Fernando Sahmkow2022-05-094-0/+44
| | | | | | | | | | | | Co-Authored-By: liamwhite <liamwhite@users.noreply.github.com>
* | | video_core/macro_jit_x64: warn on invalid parameter accessLiam2022-05-081-3/+21
|/ /
* | hle/result: Update std::expected replacement messageMorph2022-05-031-1/+1
| | | | | | | | std::expected is included in C++23
* | hle/result: Add ResultRange overload in ResultValMorph2022-05-031-1/+3
| | | | | | | | Also marks the implicit conversion operator as constexpr instead of consteval as the constructor is not constant evaluated.
* | Merge pull request #8272 from german77/stick_rangebunnei2022-05-034-9/+30
|\ \ | | | | | | yuzu: config: Improve analog stick mapping
| * | yuzu: Config allow to delete single axis directions when buttons are mapped to a stickNarr the Reg2022-04-272-3/+24
| | |
| * | yuzu: config: Set default range to 95%Narr the Reg2022-04-273-6/+6
| | |
* | | hle/result: Implement ResultRangeMorph2022-05-031-0/+42
| | | | | | | | | | | | | | | | | | A ResultRange defines an inclusive range of error descriptions within an error module. This can be used to check whether the description of a given ResultCode falls within the range. The conversion function returns a ResultCode with its description set to description_start.
* | | ui: retranslate the network tabKyle K2022-05-022-2/+11
| | | | | | | | | | | | | | | Looks like it was just missed when it was added, as currently the Network Tab only has one item RetranslateUI is used more commonly throughout the project
* | | ui: let system locale control format of Custom RTCKyle K2022-05-011-3/+0
| | | | | | | | | | | | | | | | | | | | | | | | | | | The Custom RTC widget is under the influence of the computers System Locale. The format strings are not necessarily related. As a small example, setting the Windows Language to Dansk, and then trying to use yuzu in English the requested AM/PM indicator is simply not shown The display format for the Custom RTC field needs to be removed from src/yuzu/configuration/configure_system.ui modifying the display format needs to be moved to src/yuzu/configuration/configure_system.cpp
* | | Merge pull request #8274 from german77/firmwareMorph2022-04-292-1/+21
|\ \ \ | | | | | | | | service: hid: Stub IsFirmwareUpdateNeededForNotification
| * | | service: hid: Stub IsFirmwareUpdateNeededForNotificationgerman772022-04-272-1/+21
| |/ / | | | | | | | | | Used in Fitness Boxing 2: Rhythm & Exercise (0100073011382000)
* | | Merge pull request #8280 from Tachi107/spdx-fixupMai M2022-04-2933-357/+90
|\ \ \ | | | | | | | | chore: add missing SPDX tags
| * | | chore: add missing SPDX tagsAndrea Pappacoda2022-04-2833-357/+90
| | | | | | | | | | | | | | | | Follow-up to 99ceb03a1cfcf35968cab589ea188a8c406cda52
* | | | Merge pull request #8282 from liamwhite/gcc-12Mai M2022-04-293-4/+4
|\ \ \ \ | |/ / / |/| | | GCC 12 fixes
| * | | GCC 12 fixesLiam2022-04-283-4/+4
| | | |
* | | | Merge pull request #8267 from Morph1984/swapbuffersbunnei2022-04-281-0/+5
|\ \ \ \ | | | | | | | | | | renderer_vulkan: Update screen info if the framebuffer size has changed
| * | | | renderer_vulkan: Update screen info if the framebuffer size has changedMorph2022-04-261-0/+5
| | |/ / | |/| |
* | | | Merge pull request #8236 from Docteh/sort_translationsMai M2022-04-281-6/+67
|\ \ \ \ | | | | | | | | | | Changes to language order in General -> UI -> Interface Language
| * | | | Changes to language order in General -> UI -> Interface LanguageKyle K2022-04-271-6/+67
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Language List is from Dolphin, specifically https://github.com/dolphin-emu/dolphin/blob/master/Source/Core/DolphinQt/Settings/InterfacePane.cpp#L30 Any languages that are compiled in, but not in the list will be at the end.
* | | | | Merge pull request #8229 from german77/reinterpret2bunnei2022-04-2722-386/+429
|\ \ \ \ \ | |_|/ / / |/| | | | service: hid: Access shared memory directly
| * | | | service: hid: Ensure all structs are initializedNarr the Reg2022-04-2416-104/+105
| | | | |
| * | | | service: hid: Access shared memory directlyNarr the Reg2022-04-2321-305/+347
| |/ / /
* | | | Merge pull request #8261 from liamwhite/jit-cleanupMai M2022-04-253-132/+225
|\ \ \ \ | |_|/ / |/| | | service: jit: document and clean up
| * | | service: jit: document and clean upLiam2022-04-253-132/+225
| |/ /
* | | Merge pull request #8260 from Morph1984/c4146Mai M2022-04-251-1/+1
|\ \ \ | | | | | | | | kernel: svc: Replace -1ULL with 0xFFFFFFFFFFFFFFFF
| * | | kernel: svc: Replace -1ULL with 0xFFFFFFFFFFFFFFFFMorph2022-04-241-1/+1
| |/ / | | | | | | | | | Resolves the C4146 compiler warning on MSVC.
* / / Remove unused PrepareReschedule functionMerry2022-04-247-20/+0
|/ /
* | Merge pull request #8249 from german77/queuedMorph2022-04-231-3/+5
|\ \ | | | | | | hotkeys: Trigger actions on a separate thread
| * | hotkeys: Trigger actions on a separate threadNarr the Reg2022-04-231-3/+5
| | |
* | | general: Convert source file copyright comments over to SPDXMorph2022-04-231366-4208/+2745
| | | | | | | | | | | | | | | This formats all copyright comments according to SPDX formatting guidelines. Additionally, this resolves the remaining GPLv2 only licensed files by relicensing them to GPLv2.0-or-later.
* | | Merge pull request #7976 from BytesGalore/masterbunnei2022-04-231-1/+2
|\ \ \ | | | | | | | | loader: log the type of mismatching file-extension
| * \ \ Merge branch 'yuzu-emu:master' into masterBytesGalore2022-03-061-2/+2
| |\ \ \
| * | | | loader: log the type of mismatching file-extensionBytesGalore2022-03-031-1/+2
| | | | |
* | | | | Merge pull request #7978 from german77/sidewaybunnei2022-04-2210-0/+127
|\ \ \ \ \ | |_|_|/ / |/| | | | input_common: Map sticks correctly when mapped sideways
| * | | | input_common: Map sticks correctly when mapped sidewaysNarr the Reg2022-03-2210-0/+127
| | | | |
* | | | | Merge pull request #8222 from german77/sixaxis_testbunnei2022-04-226-99/+363
|\ \ \ \ \ | | | | | | | | | | | | service: hid: Improve accuracy of sixaxis functions
| * | | | | service: hid: Improve accuracy of sixaxis functionsNarr the Reg2022-04-186-99/+363
| | | | | |
* | | | | | Merge pull request #8192 from german77/screenshotMai M2022-04-213-0/+13
|\ \ \ \ \ \ | | | | | | | | | | | | | | bootmanager: Don't create another screenshot request if previous one is not done yet
| * | | | | | bootmanager: Don't create another screenshot request if previous one is not done yetgerman772022-04-183-0/+13
| |/ / / / /
* | | | | | Merge pull request #8232 from liamwhite/backtraceMai M2022-04-216-90/+98
|\ \ \ \ \ \ | | | | | | | | | | | | | | core/arm: separate backtrace collection
| * | | | | | core/arm: separate backtrace collectionLiam2022-04-216-90/+98
| | | | | | |
* | | | | | | Merge pull request #8231 from german77/warningMai M2022-04-211-0/+9
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | input_common: Ignore boost uninitialized local variable
| * | | | | | | input_common: Ignore boost uninitialized local variableNarr the Reg2022-04-211-0/+9
| | | | | | | |
* | | | | | | | Merge pull request #8224 from Docteh/hihi1bunnei2022-04-201-1/+19
|\ \ \ \ \ \ \ \ | |/ / / / / / / |/| | | | | | | ui: translate hat directions
| * | | | | | | ui: translate hat directionsKyle K2022-04-191-1/+19
| | |/ / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | QObject ends up being its own translation context. But this works in our favor. GetButtonName and GetDirectionName will share one translation the directions such as "Left" "Right" and the ConfigureInputPlayer context will contain translations that show up in the form, in places that aren't those buttons.
* | | | | | | Prevent the mouse cursor from leaving the window when mouse panning is enabledPurple2022-04-192-2/+41
| |/ / / / / |/| | | | |
* | | | | | yuzu: mention GPLv3.0+ in about dialogAndrea Pappacoda2022-04-181-1/+1
|/ / / / / | | | | | | | | | | | | | | | | | | | | | | | | | Follow-up to 284934ebfdf5e530c960cf69969172ff76f40bea Fixes #8218
* | | | | Merge pull request #8204 from Docteh/translate_gameslistMai M2022-04-173-3/+6
|\ \ \ \ \ | | | | | | | | | | | | ui: Fix Game Compatibility list translations
| * | | | | ui: Fix Game Compatibility list translationsKyle K2022-04-173-3/+6
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Reported by GillianMC on Discord. Looks to be a small quirk in the QT API. setText(QObject::tr(status.text)); bringing up QObject breaks the link with the GameListItemCompat
* | | | | | Merge pull request #6558 from german77/ringcon2Fernando S2022-04-1629-28/+2608
|\ \ \ \ \ \ | | | | | | | | | | | | | | hidbus: Implement hidbus and ringcon
| * | | | | | yuzu: Call ignore event after ensuring it's initializedNarr the Reg2022-04-162-2/+2
| | | | | | |
| * | | | | | yuzu: Add custom ringcon configurationgerman772022-04-1619-65/+992
| | | | | | |
| * | | | | | hidbus: Implement hidbus and ringcongerman772022-04-1614-26/+1679
| | | | | | |
* | | | | | | Merge pull request #8188 from merryhime/jit-race-page-table-changedbunnei2022-04-164-57/+84
|\ \ \ \ \ \ \ | |/ / / / / / |/| | | | | | dynarmic: Fix race when switching page tables
| * | | | | | dynarmic: Fix race when switching page tablesmerry2022-04-104-57/+84
| | | | | | |
* | | | | | | Merge pull request #8205 from liamwhite/n64-miscFernando S2022-04-1611-9/+127
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | Fixes for Mario 64
| * | | | | | | video_core: implement formats for N64 emulationFernando Sahmkow2022-04-148-7/+102
| | | | | | | |
| * | | | | | | buffer_cache: cap vertex buffer sizesLiam2022-04-141-1/+14
| | | | | | | |
| * | | | | | | maxwell3d: add small_index_2 registerLiam2022-04-142-1/+11
| | | | | | | |
* | | | | | | | Merge pull request #8172 from bunnei/kernel-mutexFernando S2022-04-1612-89/+46
|\ \ \ \ \ \ \ \ | |/ / / / / / / |/| | | | | | | hle: kernel: Use std::mutex instead of spin locks for most kernel locking.
| * | | | | | | core: hle: kernel: k_thread: Rework dummy thread waiting.bunnei2022-04-122-28/+21
| | | | | | | |
| * | | | | | | core: hle: service: Allocate a service thread.bunnei2022-04-121-1/+2
| | | | | | | |
| * | | | | | | hle: kernel: k_spin_lock: Remove unused ThreadPause.bunnei2022-04-121-28/+0
| | | | | | | |
| * | | | | | | hle: kernel: Use std::mutex instead of spin locks for most kernel locking.bunnei2022-04-1210-32/+23
| | | | | | | |
* | | | | | | | Merge pull request #8190 from Docteh/palswapbunnei2022-04-143-0/+18
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | ui: Set Link Color when setting theme
| * | | | | | | | ui: Touching QPalette::Text broke dark -> light UI. don't doKyle K2022-04-121-2/+0
| | | | | | | | |
| * | | | | | | | ui: Set Link Color when setting themeKyle K2022-04-113-0/+20
| | |/ / / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Long story short, QT doesn't allow the link colors to be set via their stylesheets. There are two ways to work with this, specify the color manually for every link (See the About dialog) The other way is to change the default palette. IsDarkTheme is copy/pasted from src/yuzu/debugger/wait_tree.cpp
* | | | | | | | Merge pull request #8027 from lat9nq/cmd-fullscreen-sizebunnei2022-04-141-6/+7
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | emu_window_sdl2: Set window size to display dimensions for exclusive fullscreen
| * | | | | | | | emu_window_sdl2: Set window size to display dimensions for exclusive fullscreenlat9nq2022-03-151-6/+7
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Since SDL2 does not automatically resize the canvas when entering fullscreen mode, resize the window to desktop display dimensions.
* | | | | | | | | Merge pull request #8202 from merryhime/fix-single-coreFernando S2022-04-132-2/+2
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | dynarmic: Fix single core mode
| * | | | | | | | | dynarmic: Fix single core modemerry2022-04-132-2/+2
| | |_|_|/ / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | Regression introduced in a5d040df3d. Closes #8201.
* / | | | | | | | service: jit: Implement the JIT serviceLiam2022-04-135-9/+784
|/ / / / / / / /
* | | | | | | | Merge pull request #8165 from bunnei/ensure-session-port-cleanupbunnei2022-04-128-25/+53
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | Kernel: Track open references to KServerPort and KServerSession.
| * | | | | | | | hle: kernel: Unify and integrate reference tracking for KServerPort/KServerSession.bunnei2022-04-086-13/+46
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | - These are not managed elsewhere, and need to be tracked and closed on emulation shutdown.
| * | | | | | | | hle: kernel: k_server_port: Release ref-counted host emulation members on Destroy.bunnei2022-04-081-0/+3
| | | | | | | | |
| * | | | | | | | hle: kernel: k_auto_object: Move unregister with kernel to after Destroy.bunnei2022-04-081-3/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | - Destructor is no longer invoked, so our object counting was off.
| * | | | | | | | hle: service: sm: Remove manual tracking of KServerPorts.bunnei2022-04-082-8/+1
| | | | | | | | |
| * | | | | | | | hle: kernel: hle_ipc: HasSessionRequestHandler: Check if domain handler is expired rather than locking.bunnei2022-04-081-1/+1
| | | | | | | | |
* | | | | | | | | Merge pull request #8178 from tech-ticks/skyline-icache-fixbunnei2022-04-124-15/+34
|\ \ \ \ \ \ \ \ \ | |_|_|_|/ / / / / |/| | | | | | | | hle: kernel: Invalidate entire icache in UnmapProcessMemory and UnmapCodeMemory (fixes #8174)
| * | | | | | | | hle: kernel: Invalidate entire icache in UnmapProcessMemory and UnmapCodeMemory (fixes #8174)tech-ticks2022-04-094-15/+34
| | | | | | | | |
* | | | | | | | | Merge pull request #8157 from lat9nq/kernel-racesbunnei2022-04-127-13/+15
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | kernel: Fix some data races
| * | | | | | | | | k_system_control: Fix data racelat9nq2022-04-061-3/+3
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | `return distribution(gen)` is a data race between a read and a write in two threads, reported by TSan. Remove static random number generators so they aren't using the same generator.
| * | | | | | | | | k_auto_object: Fix data racelat9nq2022-04-041-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Change the memory order to acqure-release when we decrement the reference count. Prevents a race with line 89 reported by TSan.
| * | | | | | | | | k_thread: Fix data racelat9nq2022-04-042-3/+4
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | TSan reports a data race between writing at cpp:1162 and reading at h:262. Make the thread_state atomic to prevent this.
| * | | | | | | | | k_process: Fix data racelat9nq2022-04-041-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | TSan reported a race between thread 36 and thread 34, a read at :225 and a write at :225 respectively. Make total_proces_running_time_ticks atomic to avoid this race.
| * | | | | | | | | kernel: Fix current_process racelat9nq2022-04-041-4/+4
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | TSan reported a race at :258 and :803, so make current_process an atomic pointer.
| * | | | | | | | | k_scheduler_lock: Fix data racelat9nq2022-04-041-1/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | TSan reports a race between the main thread and T37 during IsLockedByCurrentThread and when it's set at the end of Lock(), respectively. Set owner_thread to an atomic pointer to fix it. Co-authored-by: bunnei <bunneidev@gmail.com>
* | | | | | | | | | service: sfdnsres: add missing includes for some BSDs after 82d46a974ad4Jan Beich2022-04-121-0/+4
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | src/core/hle/service/sockets/sfdnsres.cpp: In function 'Service::Sockets::NetDbError Service::Sockets::AddrInfoErrorToNetDbError(s32)': src/core/hle/service/sockets/sfdnsres.cpp:66:10: error: 'EAI_NODATA' was not declared in this scope; did you mean 'EAI_NONAME'? 66 | case EAI_NODATA: | ^~~~~~~~~~ | EAI_NONAME src/core/hle/service/sockets/sfdnsres.cpp: In function 'std::vector<unsigned char> Service::Sockets::SerializeAddrInfo(const addrinfo*, s32, std::string_view)': src/core/hle/service/sockets/sfdnsres.cpp:127:53: error: 'sockaddr_in' does not name a type; did you mean 'SockAddrIn'? 127 | const auto addr = *reinterpret_cast<sockaddr_in*>(current->ai_addr); | ^~~~~~~~~~~ | SockAddrIn src/core/hle/service/sockets/sfdnsres.cpp:127:64: error: expected '>' before '*' token 127 | const auto addr = *reinterpret_cast<sockaddr_in*>(current->ai_addr); | ^ src/core/hle/service/sockets/sfdnsres.cpp:127:64: error: expected '(' before '*' token 127 | const auto addr = *reinterpret_cast<sockaddr_in*>(current->ai_addr); | ^ | ( src/core/hle/service/sockets/sfdnsres.cpp:127:65: error: expected primary-expression before '>' token 127 | const auto addr = *reinterpret_cast<sockaddr_in*>(current->ai_addr); | ^ src/core/hle/service/sockets/sfdnsres.cpp:127:84: error: expected ')' before ';' token 127 | const auto addr = *reinterpret_cast<sockaddr_in*>(current->ai_addr); | ^ | ) src/core/hle/service/sockets/sfdnsres.cpp:148:53: error: 'sockaddr_in6' does not name a type; did you mean 'SockAddrIn6'? 148 | const auto addr = *reinterpret_cast<sockaddr_in6*>(current->ai_addr); | ^~~~~~~~~~~~ | SockAddrIn6 src/core/hle/service/sockets/sfdnsres.cpp:148:65: error: expected '>' before '*' token 148 | const auto addr = *reinterpret_cast<sockaddr_in6*>(current->ai_addr); | ^ src/core/hle/service/sockets/sfdnsres.cpp:148:65: error: expected '(' before '*' token 148 | const auto addr = *reinterpret_cast<sockaddr_in6*>(current->ai_addr); | ^ | ( src/core/hle/service/sockets/sfdnsres.cpp:148:66: error: expected primary-expression before '>' token 148 | const auto addr = *reinterpret_cast<sockaddr_in6*>(current->ai_addr); | ^ src/core/hle/service/sockets/sfdnsres.cpp:148:85: error: expected ')' before ';' token 148 | const auto addr = *reinterpret_cast<sockaddr_in6*>(current->ai_addr); | ^ | )
* | | | | | | | | | Merge pull request #8180 from liamwhite/symbolsFernando S2022-04-114-129/+231
|\ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | core: extract symbol reading
| * | | | | | | | | | core: extract symbol readingLiam2022-04-094-129/+231
| | | | | | | | | | |
* | | | | | | | | | | Merge pull request #8171 from tech-ticks/skyline-improvementsFernando S2022-04-107-30/+245
|\ \ \ \ \ \ \ \ \ \ \ | |_|_|_|_|_|/ / / / / |/| | | | | | | | | | Improvements for game modding with Skyline, DNS resolution
| * | | | | | | | | | service: sfdnsres: Implement DNS address resolutiontech-ticks2022-04-082-5/+197
| | | | | | | | | | |
| * | | | | | | | | | service: bsd: Add keepalive socket optiontech-ticks2022-04-074-0/+10
| | | | | | | | | | |
| * | | | | | | | | | patch_manager: Apply layered exefs patches from 'atmosphere' SD directorytech-ticks2022-04-071-25/+38
| | |_|/ / / / / / / | |/| | | | | | | |
* | | | | | | | | | Merge pull request #8149 from liamwhite/front-facebunnei2022-04-091-1/+8
|\ \ \ \ \ \ \ \ \ \ | |_|/ / / / / / / / |/| | | | | | | | | OpenGL: flip front faces if Z scale is inverted
| * | | | | | | | | OpenGL: propagate face flip conditionLiam2022-04-041-4/+10
| | | | | | | | | |
| * | | | | | | | | OpenGL: flip front faces if Z scale is invertedLiam2022-04-041-2/+3
| | |/ / / / / / / | |/| | | | | | |
* | | | | | | | | Merge pull request #8138 from german77/data-no-racebunnei2022-04-086-176/+256
|\ \ \ \ \ \ \ \ \ | |_|_|/ / / / / / |/| | | | | | | | core: hid: Reduce the amount of data races
| * | | | | | | | core: hid: Fix double lock on softlock and forced updatesNarr the Reg2022-04-081-2/+12
| | | | | | | | |
| * | | | | | | | core: hid: Replace lock_guard with scoped_lockNarr the Reg2022-04-073-44/+44
| | | | | | | | |
| * | | | | | | | core: hid: Reduce the amount of dataracesgerman772022-04-076-176/+246
| | | | | | | | |
* | | | | | | | | Merge pull request #8169 from merryhime/scoped_lockbunnei2022-04-0829-105/+105
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | Replace lock_guard with scoped_lock
| * | | | | | | | | core/hle: Standardize scoped_lock initializersMerry2022-04-075-23/+23
| | | | | | | | | |
| * | | | | | | | | yuzu/util: Replace lock_guard with scoped_lockMerry2022-04-071-1/+1
| | | | | | | | | |
| * | | | | | | | | web_service: Replace lock_guard with scoped_lockMerry2022-04-071-2/+2
| | | | | | | | | |
| * | | | | | | | | video_core: Replace lock_guard with scoped_lockMerry2022-04-0711-18/+18
| | | | | | | | | |
| * | | | | | | | | input_common: Replace lock_guard with scoped_lockMerry2022-04-072-29/+29
| | | | | | | | | |
| * | | | | | | | | core: Replace lock_guard with scoped_lockMerry2022-04-072-14/+14
| | | | | | | | | |
| * | | | | | | | | core/hle: Replace lock_guard with scoped_lockMerry2022-04-074-13/+13
| | | | | | | | | |
| * | | | | | | | | common: Replace lock_guard with scoped_lockMerry2022-04-073-5/+5
| | | | | | | | | |
* | | | | | | | | | CMakeLists: Enforce C4505 and C5245Morph2022-04-081-0/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | These are similar to Wunused-function on gcc/clang
* | | | | | | | | | Merge pull request #8167 from Tachi107/patch-1merry2022-04-071-2/+0
|\ \ \ \ \ \ \ \ \ \ | |/ / / / / / / / / |/| | | | | | | | | fix: remove #pragma once in .cpp file
| * | | | | | | | | fix: remove #pragma once in .cpp fileAndrea Pappacoda2022-04-071-2/+0
| |/ / / / / / / /
* | | | | | | | | Merge pull request #8161 from liamwhite/gl-s8d24Fernando S2022-04-076-4/+58
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | OpenGL: fix S8D24 to ABGR8 conversions
| * | | | | | | | | OpenGL: fix S8D24 to ABGR8 conversionsLiam2022-04-076-4/+58
| | | | | | | | | |
* | | | | | | | | | Merge pull request #8152 from liamwhite/gl-cropFernando S2022-04-073-1/+10
|\ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | OpenGL: fix cropping
| * | | | | | | | | | OpenGL: fix croppingLiam2022-04-043-1/+10
| | |_|/ / / / / / / | |/| | | | | | | |
* | | | | | | | | | Merge pull request #8150 from liamwhite/vk-cropFernando S2022-04-071-2/+3
|\ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | Vulkan: crop to screen dimensions if crop not explicitly requested
| * | | | | | | | | | Vulkan: crop to screen dimensions if crop not explicitly requestedLiam2022-04-041-2/+3
| |/ / / / / / / / /
* | | | | | | | | | Merge pull request #8148 from merryhime/interruptsFernando S2022-04-076-45/+42
|\ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | dynarmic: Better interrupts
| * | | | | | | | | | arm_dynarmic: Use HaltReason for svc calls and reschedulesmerry2022-04-034-27/+19
| | | | | | | | | | |
| * | | | | | | | | | dynarmic: Better interruptsmerry2022-04-036-22/+27
| | | | | | | | | | |
* | | | | | | | | | | Merge pull request #8143 from merryhime/rdtscFernando S2022-04-071-14/+35
|\ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | native_clock: Use lfence with rdtsc
| * | | | | | | | | | | native_clock: Internal linkage for FencedRDTSCMerry2022-04-031-2/+4
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | __forceinline required on MSVC for function to be inlined
| * | | | | | | | | | | native_clock: Use lfence with rdtscmerry2022-04-031-14/+33
| | |/ / / / / / / / / | |/| | | | | | | | |
* | | | | | | | | | | Merge pull request #8133 from liamwhite/gl-spv-cbufFernando S2022-04-076-25/+51
|\ \ \ \ \ \ \ \ \ \ \ | |_|_|_|/ / / / / / / |/| | | | | | | | | | shader_recompiler: support const buffer indirect addressing on OpenGL
| * | | | | | | | | | shader_recompiler: Decrease indirect cbuf limit to match hardwareLiam2022-04-041-1/+1
| | | | | | | | | | |
| * | | | | | | | | | shader_compiler: support const buffer indirect addressing in GLSLLiam2022-04-014-9/+38
| | | | | | | | | | |
| * | | | | | | | | | shader_recompiler: support const buffer indirect addressing on OpenGL SPIR-VLiam2022-04-013-17/+14
| | | | | | | | | | |
* | | | | | | | | | | Merge pull request #8164 from liamwhite/jit-stubbunnei2022-04-078-1/+88
|\ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | service: jit: stub JIT service
| * | | | | | | | | | | service: jit: stub JIT serviceLiam2022-04-078-1/+88
| | |_|_|_|/ / / / / / | |/| | | | | | | | |
* | | | | | | | | | | Merge pull request #8122 from bunnei/improve-thread-usagebunnei2022-04-0613-27/+74
|\ \ \ \ \ \ \ \ \ \ \ | |/ / / / / / / / / / |/| | | | | | | | | | Improve usage of service host threads
| * | | | | | | | | | hle: service: nvdrv: Create a service thread where appropriate.Morph2022-04-021-1/+1
| | | | | | | | | | |
| * | | | | | | | | | hle: service: vi: Create a service thread where appropriate.bunnei2022-04-021-1/+2
| | | | | | | | | | |
| * | | | | | | | | | hle: service: bsd: Create a service thread where appropriate.bunnei2022-04-021-1/+2
| | | | | | | | | | |
| * | | | | | | | | | hle: service: filesystem: Create a service thread where appropriate.bunnei2022-04-021-5/+8
| | | | | | | | | | |
| * | | | | | | | | | hle: service: audio: Create a service thread where appropriate.bunnei2022-04-022-4/+6
| | | | | | | | | | |
| * | | | | | | | | | hle: service: Add option for service interfaces to create or use the default thread.bunnei2022-04-025-11/+29
| | | | | | | | | | |
| * | | | | | | | | | hle: kernel: Create a default thread for services that do not need their own host thread.bunnei2022-04-022-4/+26
| | |_|/ / / / / / / | |/| | | | | | | |
* | | | | | | | | | service: hid: Partially revert #8123german772022-04-061-0/+4
| | | | | | | | | |
* | | | | | | | | | Merge pull request #8137 from bunnei/improve-nvflinger-2bunnei2022-04-069-91/+99
|\ \ \ \ \ \ \ \ \ \ | |_|_|_|/ / / / / / |/| | | | | | | | | Follow-up fixes for NVFlinger rewrite (Part 2)
| * | | | | | | | | hle: service: nvflinger: buffer_queue_producer: Cleanup & fixes.bunnei2022-04-022-61/+42
| | | | | | | | | |
| * | | | | | | | | hle: service: nvflinger: consumer_base: Cleanup & fixes.bunnei2022-04-022-15/+17
| | | | | | | | | |
| * | | | | | | | | hle: service: nvflinger: buffer_queue_producer: Cleanup & add GetReleasedBuffers.bunnei2022-04-022-10/+38
| | | | | | | | | |
| * | | | | | | | | hle: service: nvflinger: buffer_queue_core: Cleanup & fixes.bunnei2022-04-022-3/+0
| | | | | | | | | |
| * | | | | | | | | hle: service: nvflinger: Use correct logger namespace.bunnei2022-04-021-2/+2
| |/ / / / / / / /
* | | | | | | | | Merge pull request #8100 from Morph1984/registered-crashbunnei2022-04-061-2/+4
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | registered_cache: Prevent nullptr dereference when accumulating files
| * | | | | | | | | registered_cache: Prevent nullptr dereference when accumulating filesMorph2022-03-271-2/+4
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | For whatever reason, nca_file/dir can be nullptr in the list of files/dirs. I have not determined the cause of this yet, so add a nullptr check for these prior to dereferencing them.
* | | | | | | | | | Merge pull request #8159 from merryhime/pstMai M2022-04-052-0/+4
|\ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | dynarmic: Print stack trace on unrecognised instruction or other exception
| * | | | | | | | | | dynarmic: Print stack trace on unrecognised instruction or other exceptionmerry2022-04-052-0/+4
| | | | | | | | | | |
* | | | | | | | | | | build: remove -fconceptsAndrea Pappacoda2022-04-051-6/+0
|/ / / / / / / / / / | | | | | | | | | | | | | | | | | | | | It was needed on GCC versions not supporting `-std=c++20`, but GCC 10 and newer (required to compile yuzu) don't need it anymore
* | | | | | | | | | Revert "texture_cache/util: Remove unneeded ReadBlockUnsafe"bunnei2022-04-051-0/+1
| | | | | | | | | |
* | | | | | | | | | texture_cache/util: Remove unneeded ReadBlockUnsafeameerj2022-04-041-1/+0
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This call was reading GPU memory into the dst buffer, which is then overwritten by the SwizzleTexture call.
* | | | | | | | | | Merge pull request #8089 from merryhime/paranoiabunnei2022-04-044-45/+63
|\ \ \ \ \ \ \ \ \ \ | |_|_|_|/ / / / / / |/| | | | | | | | | configuration: Add Paranoid CPU accuracy level
| * | | | | | | | | configure_cpu: More descriptive text for Paranoid optionmerry2022-03-261-1/+1
| | | | | | | | | |
| * | | | | | | | | configuration: Add Paranoid CPU accuracy levelmerry2022-03-264-45/+63
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Disables most optimizations for the paranoid.
* | | | | | | | | | Merge pull request #8105 from merryhime/atomicload128bunnei2022-04-032-4/+96
|\ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | native_clock: Use AtomicLoad128
| * | | | | | | | | | native_clock: Use writeback from CAS to avoid double-loadingmerry2022-04-021-4/+6
| | | | | | | | | | |
| * | | | | | | | | | atomic_ops: Implement AtomicCompareAndSwap with writebackmerry2022-04-021-0/+73
| | | | | | | | | | |
| * | | | | | | | | | native_clock: Use AtomicLoad128Merry2022-04-021-2/+2
| | | | | | | | | | |
| * | | | | | | | | | atomic_ops: Implement AtomicLoad128Merry2022-04-021-0/+17
| | | | | | | | | | |
* | | | | | | | | | | Merge pull request #8135 from Morph1984/websession-hackbunnei2022-04-031-0/+8
|\ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | applets/web: Keep foreground (websession) web applet open
| * | | | | | | | | | | applets/web: Keep foreground (websession) web applet openMorph2022-04-021-0/+8
| | |_|_|/ / / / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This is a hack to keep the foreground (websession) web applet open in games using these such as Super Mario 3D All-Stars.
* | | | | | | | | | | Merge pull request #8123 from german77/bombslingerbunnei2022-04-033-66/+69
|\ \ \ \ \ \ \ \ \ \ \ | |_|/ / / / / / / / / |/| | | | | | | | | | service: hid: Remove inaccurate behavior on initialization
| * | | | | | | | | | service: npad: Default initialize shared memorygerman772022-04-031-48/+48
| | | | | | | | | | |
| * | | | | | | | | | service: hid: Remove inaccurate behavior on initializationgerman772022-03-313-18/+21
| | | | | | | | | | |
* | | | | | | | | | | Merge pull request #8134 from Tachi107/remove-time-stretchermerry2022-04-026-137/+3
|\ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | audio_core: remove time stretcher
| * | | | | | | | | | | audio_core: remove time stretcherAndrea Pappacoda2022-04-016-137/+3
| | |/ / / / / / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Also drop the SoundTouch dependency
* | | | | | | | | | | Merge pull request #8141 from merryhime/configure-hotkeys-columnsMorph2022-04-021-3/+4
|\ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | configure_hotkeys: Make first column stretch and not last column
| * | | | | | | | | | | configure_hotkeys: Make first column stretch and not last columnmerry2022-04-021-3/+4
| |/ / / / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Also configure minimum width of columns to be 150px.
* | | | | | | | | | | Merge pull request #8140 from merryhime/per-game-addon-columnsMorph2022-04-021-1/+5
|\ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | configure_per_game_addons: Stretch first column and not last
| * | | | | | | | | | | configure_per_game_addons: Set tree view minimum section size to 150pxmerry2022-04-021-0/+1
| | | | | | | | | | | |
| * | | | | | | | | | | configure_per_game_addons: Stretch first column and not lastmerry2022-04-021-1/+4
| |/ / / / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This provides more sensible column widths.
* / / / / / / / / / / fix: typosAndrea Pappacoda2022-04-025-10/+10
|/ / / / / / / / / /
* | | | | | | | | | Merge pull request #8128 from FernandoS27/gc-fixesFernando S2022-04-012-3/+1
|\ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | GPU Garbage Collection: Fix regressions.
| * | | | | | | | | | GPU Garbage Collection: Fix regressions.Fernando Sahmkow2022-04-012-3/+1
| | | | | | | | | | |
* | | | | | | | | | | Merge pull request #8079 from lat9nq/applet-typoMai M2022-04-011-2/+2
|\ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | configure_debug: Fix typo
| * | | | | | | | | | | configure_debug: Fix typolat9nq2022-03-241-2/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | I thought I removed the double-asterisks in db637b5a4c02772eb827ed01a6ecb430e4b65daa but I am apparently mistaken. This corrects that. While we're at it, capitalize `All` in the previous setting.
* | | | | | | | | | | | Merge pull request #8097 from Tachi107/build-cleanup-installMai M2022-04-012-2/+2
|\ \ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | | | build: cleanup installation of yuzu and yuzu-cmd
| * | | | | | | | | | | | build: cleanup installation of yuzu and yuzu-cmdAndrea Pappacoda2022-03-272-2/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Explicitly specifying an install destination is not needed anymore since CMake 3.14. By removing the hardcoded ${CMAKE_INSTALL_PREFIX}/bin it is also now possible to override the install destination via the command line. For example, you can now install yuzu to /usr/games with -DCMAKE_INSTALL_BINDIR=games
* | | | | | | | | | | | | Merge pull request #8066 from ameerj/gpu-decode-fixesFernando S2022-04-011-14/+21
|\ \ \ \ \ \ \ \ \ \ \ \ \ | |_|_|/ / / / / / / / / / |/| | | | | | | | | | | | codec: Fix GPU decoder detection on Windows and a memory leak
| * | | | | | | | | | | | codec: Plug GPU decoder memory leakameerj2022-03-221-0/+2
| | | | | | | | | | | | |
| * | | | | | | | | | | | codec: Disable HW_FRAMES method check on Windowsameerj2022-03-221-14/+19
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | It was reported that this method causes crashes on certain Linux decoding backends, hence the check to avoid it. This subsequently caused Windows GPU decoders to never be selected and always fall back to CPU decoding, disable the check on Windows for now.
* | | | | | | | | | | | | Merge pull request #8116 from ameerj/nvhost_ctrl_bad_paramFernando S2022-04-011-1/+1
|\ \ \ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | | | | | nvhost_ctrl: Only mark EventState::Busy as BadParameter
| * | | | | | | | | | | | | nvhost_ctrl: Only mark EventState::Busy as BadParameterameerj2022-03-291-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Fixes an svc break in Kirby and the Forgotten Land with async GPU enabled.
* | | | | | | | | | | | | | Merge pull request #8076 from ameerj/nv-vk-msaa-scalebunnei2022-03-313-7/+8
|\ \ \ \ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Vulkan: Use 3D helpers for MSAA scaling on NV drivers 510+
| * | | | | | | | | | | | | | Vulkan: Use 3D helpers for MSAA scaling on NV drivers 510+ameerj2022-03-243-7/+8
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Nvidia Vulkan drivers 510+ crash when blitting MSAA images. Fall-back to 3D scale helpers for MSAA image scaling.
* | | | | | | | | | | | | | | Merge pull request #8120 from german77/signalbunnei2022-03-311-0/+4
|\ \ \ \ \ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | service: hid: Signal event on AcquireNpadStyleSetUpdateEventHandle
| * | | | | | | | | | | | | | | service: hid: Signal event on AcquireNpadStyleSetUpdateEventHandleNarr the Reg2022-03-311-0/+4
| | | | | | | | | | | | | | | |
* | | | | | | | | | | | | | | | Merge pull request #8090 from bunnei/fix-skylinebunnei2022-03-315-54/+241
|\ \ \ \ \ \ \ \ \ \ \ \ \ \ \ \ | |_|_|_|_|_|_|_|_|_|/ / / / / / |/| | | | | | | | | | | | | | | Kernel Memory Updates (Part 7): Various fixes to code memory (Skyline support)
| * | | | | | | | | | | | | | | hle: kernel: k_page_table: Fix implementations of LockForCodeMemory & UnlockForCodeMemory.bunnei2022-03-261-48/+12
| | | | | | | | | | | | | | | |
| * | | | | | | | | | | | | | | hle: kernel: k_page_table: Implement LockMemoryAndOpen & UnlockMemory.bunnei2022-03-262-0/+124
| | | | | | | | | | | | | | | |
| * | | | | | | | | | | | | | | hle: kernel: svc: MapProcessMemory: Fix usage of KPageLinkedList to use physical address space.bunnei2022-03-261-2/+5
| | | | | | | | | | | | | | | |
| * | | | | | | | | | | | | | | hle: kernel: svc: CreateCodeMemory: Remove log of 'out' host pointer.bunnei2022-03-261-2/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | - This does not seem terribly useful and is inconsistent with other usage.
| * | | | | | | | | | | | | | | hle: kernel: k_code_memory: Fix usage of KPageLinkedList to use physical address space.bunnei2022-03-261-1/+2
| | | | | | | | | | | | | | | |
| * | | | | | | | | | | | | | | hle: kernel: k_page_table: Implement MakeAndOpenPageGroup & MakePageGroup.bunnei2022-03-262-0/+83
| | | | | | | | | | | | | | | |
| * | | | | | | | | | | | | | | hle: kernel: k_page_table: Add IsHeapPhysicalAddress method.bunnei2022-03-261-0/+8
| | | | | | | | | | | | | | | |
| * | | | | | | | | | | | | | | hle: kernel: k_page_linked_list: Add Empty method.bunnei2022-03-261-0/+4
| | | | | | | | | | | | | | | |
| * | | | | | | | | | | | | | | hle: kernel: svc: UnmapProcessCodeMemory: Fix inverted alignment check.bunnei2022-03-261-1/+1
| | |_|_|_|_|_|_|/ / / / / / / | |/| | | | | | | | | | | | |
* | | | | | | | | | | | | | | Merge pull request #8107 from german77/fullscreenbunnei2022-03-301-3/+10
|\ \ \ \ \ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | yuzu: Only override fullscreen setting if gamepath or argument is provided
| * | | | | | | | | | | | | | | yuzu: Only override fullscreen setting if gamepath or argument is providedgerman772022-03-291-3/+10
| | |_|_|_|_|_|_|_|/ / / / / / | |/| | | | | | | | | | | | |
* | | | | | | | | | | | | | | Merge pull request #8109 from lat9nq/god-whyMorph2022-03-291-0/+1
|\ \ \ \ \ \ \ \ \ \ \ \ \ \ \ | |_|_|_|_|_|_|_|_|/ / / / / / |/| | | | | | | | | | | | | | yuzu_cmd: Start the logging backend
| * | | | | | | | | | | | | | yuzu_cmd: Start the logging backendlat9nq2022-03-291-0/+1
| | |_|_|_|/ / / / / / / / / | |/| | | | | | | | | | | |
* / | | | | | | | | | | | | gl_rasterizer: Avoid scenario locking already owned mutexameerj2022-03-291-3/+3
|/ / / / / / / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | gpu.TickWork() may lock the texture_cache and buffer_cache mutexes, which are owned by the thread prior to invoking TickWork(). Defer invoking gpu.TickWork() until the scope ends, where the owned mutexes are released.
* | | | | | | | | | | | | Merge pull request #8098 from merryhime/ic-ivaubunnei2022-03-291-2/+4
|\ \ \ \ \ \ \ \ \ \ \ \ \ | |/ / / / / / / / / / / / |/| | | | | | | | | | | | dynarmic: Invalidate CPU cache on all cores
| * | | | | | | | | | | | arm_dynarmic_64: Invalidate on all coresmerry2022-03-271-2/+4
| | |_|_|_|/ / / / / / / | |/| | | | | | | | | |
* | | | | | | | | | | | Merge pull request #8095 from bylaws/masterMai M2022-03-273-0/+4
|\ \ \ \ \ \ \ \ \ \ \ \ | |/ / / / / / / / / / / |/| | | | | | | | | | | shader_recompiler: Include <bit> header when std::count{r,l}_zero is used
| * | | | | | | | | | | Include <bit> header when std::count{r,l}_zero is usedBilly Laws2022-03-223-0/+4
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Needed for compilation with older libc++ releases
* | | | | | | | | | | | Merge pull request #8088 from bunnei/fixup-nvflingerFernando S2022-03-279-547/+136
|\ \ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | | | Follow-up fixes for NVFlinger rewrite
| * | | | | | | | | | | | hle: service: nvflinger: buffer_queue: Remove AutoLock and fix free buffer tracking.bunnei2022-03-265-181/+130
| | | | | | | | | | | | |
| * | | | | | | | | | | | hle: service: nvflinger: buffer_queue_consumer: Use scoped_lock instead of unique_lock.bunnei2022-03-261-2/+2
| | | | | | | | | | | | |
| * | | | | | | | | | | | hle: service: nvflinger: consumer_base: Use scoped_lock instead of unique_lock.bunnei2022-03-261-4/+4
| | | | | | | | | | | | |
| * | | | | | | | | | | | hle: service: nvflinger: Remove unused BufferQueue.bunnei2022-03-262-360/+0
| | | | | | | | | | | | |
* | | | | | | | | | | | | Revert "Memory GPU <-> CPU: reduce infighting in the texture cache by adding CPU Cached memory."bunnei2022-03-266-65/+4
| |_|/ / / / / / / / / / |/| | | | | | | | | | |
* | | | | | | | | | | | Merge pull request #8041 from Morph1984/inline-swkbdbunnei2022-03-263-166/+415
|\ \ \ \ \ \ \ \ \ \ \ \ | |/ / / / / / / / / / / |/| | | | | | | | | | | applets/swkbd: Add support for an updated inline software keyboard
| * | | | | | | | | | | applets/swkbd: Split software keyboard initializationMorph2022-03-222-160/+349
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Since the CalcArg struct has been updated with a new size and fields, we have to split the initialization of the keyboard into multiple functions. This also adds support for parsing the new CalcArg struct used by updated versions of Monster Hunter Rise.
| * | | | | | | | | | | applets/swkbd: Add new inline software keyboard typesMorph2022-03-221-6/+66
| |/ / / / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | These were added in newer firmware versions.
* | | | | | | | | | | Memory: Don't protect reads on Normal accuracy.Fernando Sahmkow2022-03-251-1/+1
| | | | | | | | | | |
* | | | | | | | | | | Texture Cache: Add Cached CPU system.Fernando Sahmkow2022-03-255-3/+64
| | | | | | | | | | |
* | | | | | | | | | | Merge pull request #7720 from FernandoS27/yfc-gcbunnei2022-03-2520-43/+259
|\ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | First Nugget: Reworked Garbage Collection to be smarter [originally from Project YFC]
| * | | | | | | | | | | GC: Address Feedback.Fernando Sahmkow2022-03-257-29/+37
| | | | | | | | | | | |
| * | | | | | | | | | | Garbage Collection: Final tuning.Fernando Sahmkow2022-03-256-24/+36
| | | | | | | | | | | |
| * | | | | | | | | | | Buffer Cache: Tune to the levels of the new GC.Fernando Sahmkow2022-03-256-6/+78
| | | | | | | | | | | |
| * | | | | | | | | | | Garbage Collection: Redesign the algorithm to do a better use of memory.Fernando Sahmkow2022-03-2513-32/+156
| | |_|_|_|/ / / / / / | |/| | | | | | | | |
* | | | | | | | | | | Merge pull request #8050 from bunnei/nvflinger-rewriteFernando S2022-03-2560-796/+2984
|\ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | Rewrite of the NVFlinger implementation
| * | | | | | | | | | | hle: nvflinger: ConsumerBase: Mark ctor as explicit.bunnei2022-03-251-1/+1
| | | | | | | | | | | |
| * | | | | | | | | | | hle: vi: NativeWindow: Fix trivially copyable issues.bunnei2022-03-251-4/+4
| | | | | | | | | | | |
| * | | | | | | | | | | hle: nvdrv: nvdata: buffer_queue_producer: Minor cleanup.bunnei2022-03-251-11/+11
| | | | | | | | | | | |
| * | | | | | | | | | | hle: nvdrv: nvdata: Cleanup NvFence static assert.bunnei2022-03-251-1/+1
| | | | | | | | | | | |
| * | | | | | | | | | | hle: nvflinger: Remove unused unordered_map include.bunnei2022-03-251-1/+0
| | | | | | | | | | | |
| * | | | | | | | | | | hle: nvflinger: buffer_queue_consumer: AcquireBuffer: Fix typo.bunnei2022-03-251-1/+1
| | | | | | | | | | | |
| * | | | | | | | | | | hle: nvflinger: Merge Rect with Common::Rectangle.bunnei2022-03-256-90/+54
| | | | | | | | | | | |
| * | | | | | | | | | | hle: nvflinger: buffer_queue_core: Declare default dtor.bunnei2022-03-252-0/+3
| | | | | | | | | | | |
| * | | | | | | | | | | hle: nvflinger: buffer_queue_producer: DequeueBuffer: Remove unnecessary lock.bunnei2022-03-251-3/+1
| | | | | | | | | | | |
| * | | | | | | | | | | hle: nvflinger: consumer_base: StillTracking: Should be const.bunnei2022-03-252-2/+3
| | | | | | | | | | | |
| * | | | | | | | | | | hle: nvflinger: graphic_buffer_producer: Remove unnecessary pragma pack.bunnei2022-03-251-2/+0
| | | | | | | | | | | |
| * | | | | | | | | | | hle: nvflinger: parcel: Reserve token size.bunnei2022-03-251-1/+2
| | | | | | | | | | | |
| * | | | | | | | | | | hle: nvflinger: buffer_queue_core: StillTracking: Take const reference.bunnei2022-03-254-7/+7
| | | | | | | | | | | |
| * | | | | | | | | | | hle: nvflinger: buffer_queue_core: Cleanup locking.bunnei2022-03-251-2/+2
| | | | | | | | | | | |
| * | | | | | | | | | | hle: nvflinger: Use std::chrono for present_ns.bunnei2022-03-257-25/+30
| | | | | | | | | | | |
| * | | | | | | | | | | hle: nvflinger: Migrate android namespace -> Service::android.bunnei2022-03-2535-79/+76
| | | | | | | | | | | |
| * | | | | | | | | | | hle: nvflinger: BufferQueueProducer: Handle SetPreallocatedBuffer with empty buffer.bunnei2022-03-251-7/+10
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | - Used by Naruto Ultimate Ninja Storm.
| * | | | | | | | | | | hle: vi: Integrate new NVFlinger and HosBinderDriverServer service.bunnei2022-03-2517-723/+286
| | | | | | | | | | | |
| * | | | | | | | | | | hle: nvflinger: Add implementation for HosBinderDriverServer service.bunnei2022-03-253-0/+75
| | | | | | | | | | | |
| * | | | | | | | | | | hle: nvflinger: Add implementation for BufferQueueProducer class.bunnei2022-03-253-2/+1021
| | | | | | | | | | | |
| * | | | | | | | | | | hle: nvflinger: Add implementation for BufferQueueCore class.bunnei2022-03-253-0/+235
| | | | | | | | | | | |
| * | | | | | | | | | | hle: nvflinger: Add implementation for BufferQueueConsumer class.bunnei2022-03-253-0/+263
| | | | | | | | | | | |
| * | | | | | | | | | | hle: nvflinger: Add implementation for QueueBufferInput and QueueBufferOutput structs.bunnei2022-03-253-0/+100
| | | | | | | | | | | |
| * | | | | | | | | | | hle: nvflinger: Add implementation for BufferItemConsumer class.bunnei2022-03-253-0/+87
| | | | | | | | | | | |
| * | | | | | | | | | | hle: nvflinger: Add implementation for ConsumerBase class.bunnei2022-03-253-0/+190
| | | | | | | | | | | |
| * | | | | | | | | | | hle: nvflinger: Add implementation for BufferSlot class.bunnei2022-03-252-0/+40
| | | | | | | | | | | |
| * | | | | | | | | | | hle: nvflinger: Add implementation for BufferItem class.bunnei2022-03-252-0/+47
| | | | | | | | | | | |
| * | | | | | | | | | | hle: nvflinger: Move implementation for Parcel to its own header.bunnei2022-03-252-0/+172
| | | | | | | | | | | |
| * | | | | | | | | | | hle: nvflinger: Add android buffer queue definitions to its own header.bunnei2022-03-252-0/+22
| | | | | | | | | | | |
| * | | | | | | | | | | hle: nvflinger: Add IBinder interface.bunnei2022-03-252-0/+43
| | | | | | | | | | | |
| * | | | | | | | | | | hle: nvflinger: Add IConsumerListener interface.bunnei2022-03-252-0/+27
| | | | | | | | | | | |
| * | | | | | | | | | | hle: nvflinger: Add ProducerListener interface.bunnei2022-03-252-0/+17
| | | | | | | | | | | |
| * | | | | | | | | | | hle: nvflinger: Add android window enumerations to its own header.bunnei2022-03-252-0/+54
| | | | | | | | | | | |
| * | | | | | | | | | | hle: nvflinger: Add android Status flags to its own header.bunnei2022-03-251-0/+28
| | | | | | | | | | | |
| * | | | | | | | | | | hle: nvflinger: Move BufferTransformFlags to its own header.bunnei2022-03-254-18/+29
| | | | | | | | | | | |
| * | | | | | | | | | | hle: nvdrv: Rename Fence to NvFence to avoid naming conflicts.bunnei2022-03-254-17/+13
| | | | | | | | | | | |
| * | | | | | | | | | | hle: nvflinger: Move PixelFormat to its own header.bunnei2022-03-2511-33/+50
| | | | | | | | | | | |
| * | | | | | | | | | | hle: nvflinger: Add implementation for GraphicBuffer class.bunnei2022-03-252-0/+101
| | | | | | | | | | | |
| * | | | | | | | | | | hle: nvflinger: Add implementation for Fence class.bunnei2022-03-252-0/+34
| | | | | | | | | | | |
| * | | | | | | | | | | hle: nvflinger: Add implementation for Rect class.bunnei2022-03-252-0/+76
| | | | | | | | | | | |
| * | | | | | | | | | | common: logging: Add a logger for NVFlinger.bunnei2022-03-252-0/+2
| |/ / / / / / / / / /
* | | | | | | | | | | Merge pull request #8068 from ameerj/shader-if-falseFernando S2022-03-253-9/+98
|\ \ \ \ \ \ \ \ \ \ \ | |/ / / / / / / / / / |/| | | | | | | | | | shader_recompiler/dead_code_elimination: Add DeadBranchElimination pass
| * | | | | | | | | | dead_code_elimination_pass: Remove unreachable Phi argumentsameerj2022-03-233-0/+36
| | | | | | | | | | |
| * | | | | | | | | | shader_recompiler/dead_code_elimination: Add DeadBranchElimination passameerj2022-03-221-9/+62
| | |/ / / / / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | This adds a pass to eliminate if(false) branches within the shader code
* | | | | | | | | | Merge pull request #8074 from liamwhite/cached-wordsFernando S2022-03-241-1/+2
|\ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | buffer_cache: reset cached write bits after flushing invalidations
| * | | | | | | | | | buffer_cache: reset cached write bits after flushing invalidationsLiam2022-03-241-1/+2
| | |_|/ / / / / / / | |/| | | | | | | |
* | | | | | | | | | Merge pull request #8035 from lat9nq/disable-web-appletbunnei2022-03-246-50/+65
|\ \ \ \ \ \ \ \ \ \ | |/ / / / / / / / / |/| | | | | | | | | yuzu qt: Disable the web applet by default
| * | | | | | | | | yuzu qt: Save disable_web_applet settinglat9nq2022-03-184-3/+6
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The web applet causes multiple issues with the rest of the application. Disable it by default and add a debug option to re-enable it until a proper solution can be found.
| * | | | | | | | | main: Update Disable Web Applet warninglat9nq2022-03-171-3/+2
| | | | | | | | | |
| * | | | | | | | | configure_debug: Add option to set disable_web_appletlat9nq2022-03-172-42/+57
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Allow the user to configure the web applet usage ahead of booting the application.
| * | | | | | | | | yuzu: Move disable_web_applet to UISettingslat9nq2022-03-173-5/+3
| | | | | | | | | |
* | | | | | | | | | Add include to fix compilingShoegzer2022-03-231-0/+1
| | | | | | | | | |
* | | | | | | | | | Merge pull request #8031 from Morph1984/cleanup-mii-pleasebunnei2022-03-2319-574/+644
|\ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | applets: Cleanup MiiEdit applet implementation
| * | | | | | | | | | applets/mii: Remove unused includeMorph2022-03-221-1/+0
| | | | | | | | | | |
| * | | | | | | | | | applets/mii: Remove frontend parametersMorph2022-03-222-17/+4
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | These are unused for now as we do not support a frontend implementation.
| * | | | | | | | | | applets/mii: Cleanup MiiEdit applet implementationMorph2022-03-222-44/+85
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This also enables proper support for MiiEdit applets which are used in games with firmware versions prior to 10.2.0 by handling the 2 different versions of applet inputs and outputs.
| * | | | | | | | | | applets/mii: Cleanup MiiEdit applet typesMorph2022-03-221-23/+44
| | | | | | | | | | |
| * | | | | | | | | | applets/mii: Move MiiEdit applet types into its own fileMorph2022-03-224-54/+70
| | | | | | | | | | |
| * | | | | | | | | | service: Move mii enums and structs into its own fileMorph2022-03-227-308/+312
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Moves these into types.h, since other files also make use of these types.
| * | | | | | | | | | applets: Rename Mii to MiiEditMorph2022-03-228-47/+49
| | |_|/ / / / / / / | |/| | | | | | | |
* / | | | | | | | | Revert "dynarmic: Reduce size of code caches"bunnei2022-03-232-4/+4
|/ / / / / / / / /
* | / / / / / / / qt_web_browser: Add missing includesameerj2022-03-221-0/+3
| |/ / / / / / / |/| | | | | | |
* | | | | | | | Merge pull request #8038 from liamwhite/exit-register-detectionAmeer J2022-03-222-0/+9
|\ \ \ \ \ \ \ \ | |_|_|_|/ / / / |/| | | | | | | shader_recompiler/EXIT: increment output register on failed enable test
| * | | | | | | Address review commentsLiam2022-03-181-1/+1
| | | | | | | |
| * | | | | | | shader_recompiler/EXIT: skip render targets with no outputsLiam2022-03-182-0/+8
| | | | | | | |
| * | | | | | | shader_recompiler/EXIT: increment output register on failed enable testLiam2022-03-181-0/+1
| | | | | | | |
* | | | | | | | Merge pull request #8048 from ameerj/include-purgebunnei2022-03-22271-452/+44
|\ \ \ \ \ \ \ \ | |_|_|/ / / / / |/| | | | | | | general: Reduce unused includes across the project
| * | | | | | | general: Fix clang/gcc build errorsameerj2022-03-2012-4/+17
| | | | | | | |
| * | | | | | | yuzu_cmd: Reduce unused includesameerj2022-03-205-9/+0
| | | | | | | |
| * | | | | | | yuzu: Reduce unused includesameerj2022-03-2045-104/+5
| | | | | | | |
| * | | | | | | web_service: Reduce unused includesameerj2022-03-201-1/+0
| | | | | | | |
| * | | | | | | input_common: Reduce unused includesameerj2022-03-204-4/+0
| | | | | | | |
| * | | | | | | shader_recompiler: Reduce unused includesameerj2022-03-2069-106/+7
| | | | | | | |
| * | | | | | | common: Reduce unused includesameerj2022-03-1930-32/+8
| | | | | | | |
| * | | | | | | video_core: Reduce unused includesameerj2022-03-1975-139/+12
| | | | | | | |
| * | | | | | | common: Reduce unused includesameerj2022-03-198-12/+0
| | | | | | | |
| * | | | | | | core: Reduce unused includesameerj2022-03-1938-54/+8
| | | | | | | |
* | | | | | | | Merge pull request #7812 from FernandoS27/made-straight-from-the-nutbunnei2022-03-201-6/+14
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | BufferCache: Find direction of the stream buffer increase.
| * | | | | | | | BufferCache: Find direction of the stream buffer increase.Fernando Sahmkow2022-03-201-6/+14
| | | | | | | | |
* | | | | | | | | Merge pull request #8036 from ameerj/starbit-nvFernando S2022-03-201-5/+0
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | vk_texture_cache: Do not reinterpret DepthStencil source images
| * | | | | | | | | vk_texture_cache: Do not reinterpret DepthStencil source imagesameerj2022-03-181-5/+0
| | |_|/ / / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Fixes star pointer interactions in Super Mario Galaxy on some drivers, notably Nvidia. Co-Authored-By: Fernando S. <1731197+fernandos27@users.noreply.github.com>
* | | | | | | | | Merge pull request #7840 from lioncash/bitorbunnei2022-03-201-15/+3
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | texture_cache: Amend unintended bitwise OR in SynchronizeAliases
| * | | | | | | | | texture_cache: Ensure has_blacklisted is always initializedLioncash2022-02-021-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Resolves a -Wmaybe_uninitialized warning
| * | | | | | | | | texture_cache: Remove dead code within SynchronizeAliasesLioncash2022-02-021-13/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Since these were being copied by value, none of the changes applied in the loop would be reflected. However, from the looks of it, this would already be applied within CopyImage() anyways, so this can be removed.
| * | | | | | | | | texture_cache: Amend unintended bitwise OR in SynchronizeAliasesLioncash2022-02-021-1/+1
| | | | | | | | | |
* | | | | | | | | | Merge pull request #8040 from Morph1984/handle-tablebunnei2022-03-202-30/+12
|\ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | KHandleTable: Optimize table entry layout
| * | | | | | | | | | KHandleTable: Optimize table entry layoutMorph2022-03-182-30/+12
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Since the handle type is not being used, we can reduce the amount of space each entry takes up by 4 bytes.
* | | | | | | | | | | Merge pull request #8025 from lat9nq/cmd-specify-configbunnei2022-03-193-10/+27
|\ \ \ \ \ \ \ \ \ \ \ | |_|_|_|_|/ / / / / / |/| | | | | | | | | | yuzu_cmd: Allow user to specify config file location
| * | | | | | | | | | yuzu_cmd: Allow user to specify config file locationlat9nq2022-03-153-10/+27
| | |_|_|_|_|/ / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Adds an option `-c` or `--config` with one required argument that allows the user to specify to where the config file is located. Useful for scripts that run specific games with different preferences for settings.
* | | | | | | | | | Merge pull request #8028 from v1993/patch-9bunnei2022-03-191-2/+2
|\ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | bsd: Allow inexact match for address length in AcceptImpl
| * | | | | | | | | | bsd: Allow inexact match for address length in AcceptImplValeri2022-03-151-2/+2
| |/ / / / / / / / / | | | | | | | | | | | | | | | | | | | | Minecraft passes in zero for length, but this should account for all possible cases
* | | | / / / / / / general: Reduce core.h includesameerj2022-03-188-12/+23
| |_|_|/ / / / / / |/| | | | | | | |
* | | | | | | | | Merge pull request #8024 from liamwhite/const-indexingFernando S2022-03-186-65/+163
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | Add shader support for const buffer indirect addressing
| * | | | | | | | | Address review commentsLiam2022-03-174-52/+36
| | | | | | | | | |
| * | | | | | | | | shader_recompiler: Use functions for indirect const buffer accessesLiam2022-03-175-39/+94
| | | | | | | | | |
| * | | | | | | | | Address review commentsLiam2022-03-171-16/+15
| | | | | | | | | |
| * | | | | | | | | shader_recompiler: Implement LDC.IS address modeLiam2022-03-161-2/+12
| | | | | | | | | |
| * | | | | | | | | shader: add support for const buffer indirect addressingLiam2022-03-152-18/+68
| |/ / / / / / / /
* | | | | | | | | Merge pull request #8030 from liamwhite/s8d24-conversionFernando S2022-03-185-2/+41
|\ \ \ \ \ \ \ \ \ | |_|_|_|_|/ / / / |/| | | | | | | | Vulkan: convert S8D24 <-> ABGR8
| * | | | | | | | Address review commentsLiam2022-03-162-2/+2
| | | | | | | | |
| * | | | | | | | Vulkan: convert S8D24 <-> ABGR8Liam2022-03-165-2/+41
| |/ / / / / / /
* | | | | | | | Merge pull request #7964 from german77/miiiibunnei2022-03-178-5/+272
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | applet: mii: Simple implementation of mii applet
| * | | | | | | | applet: mii: Simple implementation of mii appletgerman772022-03-018-5/+272
| | | | | | | | |
* | | | | | | | | Merge pull request #8013 from bunnei/kernel-slab-rework-v2Fernando S2022-03-1632-849/+1271
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | Kernel Memory Updates (Part 6): Use guest memory for slab heaps & update TLS.
| * | | | | | | | | core: hle: kernel: init_slab_setup: Move CalculateSlabHeapGapSize to global namespace.bunnei2022-03-151-6/+6
| | | | | | | | | |
| * | | | | | | | | core: hle: kernel: Allocate dummy threads on host thread storage.bunnei2022-03-152-8/+6
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | - Fixes a crash where on subsequent boots, long-lived host threads would have their dummy threads freed.
| * | | | | | | | | core: hle: kernel: Downgrade dangling objects warning to debug.bunnei2022-03-151-2/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | - It is not impossible to leak kernel objects, so this is not really any issue anymore (albeit, still interesting).
| * | | | | | | | | core: hle: kernel: Make object list container global and ensure it is reset on each emulation session.bunnei2022-03-151-7/+9
| | | | | | | | | |
| * | | | | | | | | core: hle: kernel: Remove server session tracking.bunnei2022-03-154-37/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | - These are now allocated/managed by emulated memory, so we do not need to track and free them on shutdown.
| * | | | | | | | | core: hle: kernel: k_process: Remove handle table finalize, reset page table.bunnei2022-03-151-3/+3
| | | | | | | | | |
| * | | | | | | | | core: hle: kernel: k_process: Implement thread local storage accurately.bunnei2022-03-153-111/+99
| | | | | | | | | |
| * | | | | | | | | core: hle: kernel: k_page_table: Add implementations of MapPages, UnmapPages, and FindFreeArea for TLS.bunnei2022-03-152-2/+141
| | | | | | | | | |
| * | | | | | | | | core: hle: kernel: k_slab_heap: Refresh to use guest allocations.bunnei2022-03-152-125/+107
| | | | | | | | | |
| * | | | | | | | | core: hle: kernel: Update init_slab_heap, use device memory, and add KThreadLocalPage and KPageBuffer.bunnei2022-03-154-55/+92
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | - Refreshes our slab initialization code to latest known behavior. - Moves all guest kernel slabs into emulated device memory. - Adds KThreadLocalPage and KPageBuffer, which we will use for accurate TLS management.
| * | | | | | | | | core: hle: kernel: k_page_buffer: Add KThreadLocalPage primitive.bunnei2022-03-153-0/+179
| | | | | | | | | |
| * | | | | | | | | core: hle: kernel: k_page_buffer: Add KPageBuffer primitive.bunnei2022-03-152-0/+35
| | | | | | | | | |
| * | | | | | | | | core: hle: kernel: k_thread: Ensure host Fiber is freed.bunnei2022-03-151-0/+3
| | | | | | | | | |
| * | | | | | | | | core: hle: kernel: k_server_session: Ensure SessionRequestManager is freed.bunnei2022-03-151-0/+3
| | | | | | | | | |
| * | | | | | | | | core: hle: service: kernel_helpers: Use system resource limit.bunnei2022-03-151-10/+1
| | | | | | | | | |
| * | | | | | | | | core: hle: service: sm: Fix KPort reference count.bunnei2022-03-151-0/+2
| | | | | | | | | |
| * | | | | | | | | core: hle: kernel: k_thread: Update to reflect tree changes.bunnei2022-03-151-3/+3
| | | | | | | | | |
| * | | | | | | | | core: hle: kernel: Use weak_ptr where possible for SessionRequestHandler and SessionRequestManager.bunnei2022-03-157-14/+25
| | | | | | | | | |
| * | | | | | | | | core: hle: kernel: k_memory_layout: Update kernel slab memory sizes.bunnei2022-03-151-3/+3
| | | | | | | | | |
| * | | | | | | | | core: hle: kernel: svc_types: Add ThreadLocalRegionSize.bunnei2022-03-151-0/+2
| | | | | | | | | |
| * | | | | | | | | core: hle: kernel: k_condition_variable: Update to reflect tree changes.bunnei2022-03-151-1/+1
| | | | | | | | | |
| * | | | | | | | | core: hle: kernel: k_address_arbiter: Update to reflect tree changes.bunnei2022-03-151-3/+3
| | | | | | | | | |
| * | | | | | | | | common: tree: Various updates.bunnei2022-03-151-284/+341
| | | | | | | | | |
| * | | | | | | | | common: intrusive_red_black_tree: Various updates.bunnei2022-03-151-181/+210
| | |/ / / / / / / | |/| | | | | | |
* | | | | | | | | Merge pull request #8023 from ameerj/kirby-pop-inFernando S2022-03-162-70/+12
|\ \ \ \ \ \ \ \ \ | |_|_|/ / / / / / |/| | | | | | | | maxwell_3d: Implement a safer CB data upload
| * | | | | | | | maxwell_3d: Implement a safer CB data uploadameerj2022-03-152-70/+12
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This makes constant buffer uploads safer and more accurate by updating the GPU memory as soon as the CB Data method is invoked. The previous implementation was deferring the updates until a different maxwell 3d method was detected, then writing all CB data at once.
* | | | | | | | | default_ini: List use_extended_memory_layout in default config filelat9nq2022-03-151-1/+5
| |/ / / / / / / |/| | | | | | |
* | | | | | | | Merge pull request #8008 from ameerj/rescale-offsets-arrayFernando S2022-03-151-2/+27
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | rescaling_pass: Fix rescaling Color2DArray ImageFetch offsets
| * | | | | | | | rescaling_pass: Fix rescaling Color2DArray ImageFetch offsetsameerj2022-03-121-2/+27
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | ImageFetch offsets for 2D array coordinates have a different composite size than the coordinates. The rescaling pass was not taking this into account. Fixes broken shaders when scaling is enabled in Astral Chain, and likely other titles.
* | | | | | | | | Merge pull request #8000 from liamwhite/hagiFernando S2022-03-153-3/+77
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | Initial support for Wii Hagi emulator
| * | | | | | | | | Maxwell3D: Link to override constant definition in nouveaubyte[]2022-03-141-0/+2
| | | | | | | | | |
| * | | | | | | | | Maxwell3D: restore original topology when topology overrides are disabledbyte[]2022-03-141-0/+2
| | | | | | | | | |
| * | | | | | | | | Maxwell3D: Use override constants from nouveauLiam2022-03-142-2/+37
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This fixes some incorrect rendering in Sunshine
| * | | | | | | | | Maxwell3D: Restrict topology override effect to after the register is setLiam2022-03-122-1/+5
| | | | | | | | | |
| * | | | | | | | | Maxwell3D: mark index buffers as dirty after updating countsLiam2022-03-111-0/+2
| | | | | | | | | |
| * | | | | | | | | TextureCacheRuntime: allow converting D24S8 to ABGR8Liam2022-03-111-1/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | I can't see how this would be useful, but Galaxy uses it.
| * | | | | | | | | Maxwell3D: read small-index draw and primitive topology override registersLiam2022-03-112-2/+30
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This allows Galaxy and Sunshine to render for the first time.
* | | | | | | | | | Merge pull request #8015 from FernandoS27/fix-global-membunnei2022-03-152-3/+4
|\ \ \ \ \ \ \ \ \ \ | |_|_|/ / / / / / / |/| | | | | | | | | Shader decompiler: Fix storage tracking in deko3d.
| * | | | | | | | | Shader decompiler: do constant propgation before texture pass.Fernando Sahmkow2022-03-131-2/+2
| | | | | | | | | |
| * | | | | | | | | Shader decompiler: Fix storage tracking in deko3d.Fernando Sahmkow2022-03-131-1/+2
| | | | | | | | | |
* | | | | | | | | | Merge pull request #8016 from merryhime/kill-mem-useFernando S2022-03-142-4/+4
|\ \ \ \ \ \ \ \ \ \ | |/ / / / / / / / / |/| | | | | | | | | dynarmic: Reduce size of code caches
| * | | | | | | | | dynarmic: Reduce size of code cachesMerry2022-03-132-4/+4
| | |/ / / / / / / | |/| | | | | | |
* | | | | | | | | Merge pull request #8007 from ameerj/vs-2022-errorsbunnei2022-03-132-2/+3
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | emit_spirv, vk_compute_pass: Resolve VS2022 compiler errors
| * | | | | | | | | emit_spirv, vk_compute_pass: Resolve VS2022 compiler errorsameerj2022-03-122-2/+3
| |/ / / / / / / /
* / / / / / / / / config: Write dynarmic exclusive memory configsameerj2022-03-121-0/+2
|/ / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | Ensures the configs are written and saved between boots
* | | | | | | | cpu_detect: Add additional x86 flags and telemetryWunkolo2022-03-114-29/+86
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Adds detection of additional CPU flags to cpu_detect and additions to telemetry output. This is not exhaustive but guided by features that [dynarmic utilizes](https://github.com/merryhime/dynarmic/blob/bcfe377aaa5138af740e90af5be7a7dff7b62a52/src/dynarmic/backend/x64/host_feature.h#L12-L33) as well as features that are currently utilized but not reported to telemetry(invariant_tsc). This is intended to guide future optimizations. AVX512 in particular is broken up into its individual subsets and some other processor features such as [sha](https://en.wikipedia.org/wiki/Intel_SHA_extensions) and [gfni](https://en.wikipedia.org/wiki/AVX-512#GFNI) are added to have some forward-facing data-points. What used to be a single `CPU_Extension_x64_AVX512` telemetry field is also broken up into individual `CPU_Extension_x64_AVX512{F,VL,CD,...}` fields.
* | | | | | | | common/telemetry: Update `AddField` name type to `string_view`Wunkolo2022-03-111-3/+4
|/ / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | Non-owning `string_view` is flexable and avoids some of the many redundant copies made over `std::string`
* | | | | | | backend: Ensure backend_thread is destructed before message_queueMerry2022-03-101-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | Ensures that stop_token signals that stop has been requested before destruction of conditional_variable
* | | | | | | cpu_detect: Revert `__cpuid{ex}` array-type argumentWunkolo2022-03-101-6/+6
| | | | | | | | | | | | | | | | | | | | | | | | | | | | Restores compatibility with MSVC's `__cpuid` intrinsic.
* | | | | | | cpu_detect: Add missing `lzcnt` detectionWunkolo2022-03-091-0/+1
| | | | | | |
* | | | | | | cpu_detect: Refactor cpu/manufacturer identificationWunkolo2022-03-092-24/+38
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Set the zero-enum value to Unknown Move the Manufacterer enum into the CPUCaps structure namespace Add "ParseManufacturer" utility-function Fix cpu/brand string buffer sizes(!)
* | | | | | | cpu_detect: Update array-types to `span` and `array`Wunkolo2022-03-091-11/+13
| | | | | | | | | | | | | | | | | | | | | | | | | | | | Update some uses of `int` into some more explicitly sized types as well
* | | | | | | cpu_detect: Utilize `Bit<N>` utility functionWunkolo2022-03-091-32/+20
| | | | | | |
* | | | | | | cpu_detect: Compact capability fieldsWunkolo2022-03-091-20/+21
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | As this structure gets more explicit, bools can be bitfields and small enums can use smaller types for their span of values.
* | | | | | | bit_util: Add `bit` utility functionWunkolo2022-03-091-0/+7
| | | | | | | | | | | | | | | | | | | | | | | | | | | | Extracts a singular bit, as a bool, from the specified compile-time index.
* | | | | | | hle: service: ldr: Use deterministic addresses when mapping NROs.bunnei2022-03-092-24/+62
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | - Instead of randomization, choose in-order addresses for where to map NROs into memory. - This results in predictable behavior when debugging and consistent behavior when reproducing issues.
* | | | | | | Merge pull request #7986 from lat9nq/vk-callbackbunnei2022-03-083-2/+14
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | core, video_core: Fix two crashes when failing to create the emulated GPU instance
| * | | | | | | video_core: Cancel Scoped's exit call on GPU failurelat9nq2022-03-081-0/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | When CreateRenderer fails, the GraphicsContext that was std::move'd into it is destroyed before the Scoped that was created to manage its currency. In that case, the GraphicsContext::Scoped will still call its destructor at the ending of the function. And because the context is destroyed, the Scoped will cause a crash as it attempts to call a destroyed object's DoneCurrent function. Since we know when the call would be invalid, call the Scoped's Cancel method. This prevents it from calling a method on a destroyed object.
| * | | | | | | emu_window: Create a way to Cancel the exit of a Scopedlat9nq2022-03-081-1/+10
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | If a GraphicsContext is destroyed before its Scoped is destroyed, this causes a crash as the Scoped tries to call a method in the destroyed context on exit. Add a way to Cancel the call when we know that calling the GraphicsContext will not work.
| * | | | | | | core: Don't shutdown a null GPUlat9nq2022-03-071-1/+3
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | When CreateGPU fails, yuzu would try and shutdown the GPU instance regardless of whether any instance was actually created. Check for nullptr before calling its methods to prevent a crash.
* | | | | | | | shader_recompiler/LOP3: Use brute force python results within switch/case.Markus Wick2022-03-082-52/+620
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Thanks to @asLody for optimizing this function. This raised the focus that this function should be optimized more. The current table assumes that the host GPU is able to invert for free, so only AND,OR,XOR are accumulated in the performance metrik. Performance results: Instructions 0: 8 1: 30 2: 114 3: 80 4: 24 Latency 0: 8 1: 30 2: 194 3: 24
* | | | | | | | hle: kernel: KPageTable: Improve implementations of MapCodeMemory and UnmapCodeMemory.bunnei2022-03-082-47/+116
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | - This makes these functions more accurate to the real HOS implementations. - Fixes memory access issues in Super Smash Bros. Ultimate that occur when un/mapping NROs.
* | | | | | | | Merge pull request #7930 from asLody/dma-semaphoreFernando S2022-03-072-1/+21
|\ \ \ \ \ \ \ \ | |/ / / / / / / |/| | | | | | | MaxwellDMA: Implement semaphore operations
| * | | | | | | MaxwellDMA: Implement semaphore operationsLody2022-03-072-1/+21
| | | | | | | |
* | | | | | | | gl_graphics_pipeline: Improve shader builder synchronization using fences (#7969)Ameer J2022-03-062-21/+32
| |_|_|_|_|/ / |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * gl_graphics_pipeline: Improve shader builder synchronization Make use of GLsync objects to ensure better synchronization between shader builder threads and the main context * gl_graphics_pipeline: Make built_fence access threadsafe * gl_graphics_pipeline: Use GLsync objects only when building in parallel * gl_graphics_pipeline: Replace GetSync calls with non-blocking waits The spec states that a ClientWait on a Fence object ensures the changes propagate to the calling context
* | | | | | | Merge pull request #7973 from Morph1984/debug-crashFernando S2022-03-061-2/+2
|\ \ \ \ \ \ \ | |_|_|_|_|/ / |/| | | | | | host_memory: Fix fastmem crashes in debug builds
| * | | | | | host_memory: Fix fastmem crashes in debug buildsMorph2022-03-031-2/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | It is possible for virtual_offset to not be 0 when the iterator is at the beginning, and thus, std::prev(it) may be evaluated, leading to a crash in debug mode. Co-Authored-By: Fernando S. <1731197+FernandoS27@users.noreply.github.com>
* | | | | | | Merge pull request #7935 from Wunkolo/logging-join-fixbunnei2022-03-031-13/+5
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | logging: Convert `backend_thread` into an `std::jthread`
| * | | | | | | logging: Convert `backend_thread` into an `std::jthread`Wunkolo2022-02-281-13/+5
| | |_|/ / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Was getting an unhandled `invalid_argument` [exception](https://en.cppreference.com/w/cpp/thread/thread/join) during shutdown on my linux machine. This removes the need for a `StopBackendThread` function entirely since `jthread` [automatically handles both checking if the thread is joinable and stopping the token before attempting to join](https://en.cppreference.com/w/cpp/thread/jthread/~jthread) in the case that `StartBackendThread` was never called.
* | | | | | | Merge pull request #7956 from bunnei/improve-mem-managerbunnei2022-03-0315-376/+848
|\ \ \ \ \ \ \ | |_|/ / / / / |/| | | | | | Kernel Memory Updates (Part 4): Revamp KMemoryManager & other fixes
| * | | | | | hle: kernel: Re-create memory layout at initialization.bunnei2022-02-281-41/+43
| | | | | | | | | | | | | | | | | | | | | | | | | | | | - As this can only be derived once.
| * | | | | | hle: kernel: Remove unused pool locals.bunnei2022-02-281-2/+0
| | | | | | |
| * | | | | | hle: kernel: k_memory_manager: Rework for latest kernel behavior.bunnei2022-02-286-173/+548
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | - Updates the KMemoryManager implementation against latest documentation. - Reworks KMemoryLayout to be accessed throughout the kernel. - Fixes an issue with pool sizes being incorrectly reported.
| * | | | | | hle: kernel: k_page_heap: GetPhysicalAddr can be const.bunnei2022-02-271-2/+1
| | | | | | |
| * | | | | | hle: kernel: k_page_heap: Remove superfluous consexpr.bunnei2022-02-272-4/+4
| | | | | | |
| * | | | | | hle: kernel: k_page_heap: Various updates and improvements.bunnei2022-02-272-155/+192
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | - KPageHeap tracks physical addresses, not virtual addresses. - Various updates and improvements to match latest documentation for this type.
| * | | | | | hle: kernel: Add initial_process.h header.bunnei2022-02-272-0/+24
| | | | | | |
| * | | | | | hle: kernel: board: nx: Add k_memory_layout.h header.bunnei2022-02-272-0/+14
| | | | | | |
| * | | | | | hle: kernel: k_system_control: Add GetRealMemorySize and update GetKernelPhysicalBaseAddress.bunnei2022-02-272-1/+12
| | | | | | |
| * | | | | | hle: kernel: k_memory_layout: Add GetPhysicalLinearRegion.bunnei2022-02-271-0/+4
| | | | | | |
| * | | | | | hle: kernel: k_memory_region_types: Update for new regions.bunnei2022-02-271-1/+9
| |/ / / / /
* | | | | | Merge pull request #7959 from merryhime/cmpxchgFernando S2022-03-0116-7/+113
|\ \ \ \ \ \ | | | | | | | | | | | | | | dynarmic: Inline exclusive memory accesses
| * | | | | | dynarmic: Inline exclusive memory accessesmerry2022-02-2716-7/+113
| |/ / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Inlines implementation of exclusive instructions into JITted code, improving performance of applications relying heavily on these instructions. We also fastmem these instructions for additional speed, with support for appropriate recompilation on fastmem failure. An unsafe optimization to disable the intercore global_monitor is also provided, should one wish to rely solely on cmpxchg semantics for safety. See also: merryhime/dynarmic#664
* / / / / / gl_fence_manager: Minor optimization to signal queryingameerj2022-02-271-2/+1
|/ / / / / | | | | | | | | | | | | | | | | | | | | | | | | | Per the spec, bufSize is the number of integers that will be written, in this case, 1. Also, the length argument is optional if the information of the number of elements written is not needed.
* | | | | Merge pull request #7932 from bunnei/extended-mem-layoutbunnei2022-02-2621-55/+91
|\ \ \ \ \ | | | | | | | | | | | | Add extended memory layout (6GB) support and improve KResourceLimit management
| * | | | | hle: kernel: KSystemControl: Use 6GB memory layout when "use_extended_memory_layout" setting is enabled.bunnei2022-02-211-20/+4
| | | | | | | | | | | | | | | | | | | | | | | | - This uses a larger 6GB DRAM memory layout, which is useful for some mods that require more memory.
| * | | | | core: device_memory: Use memory size reported by KSystemControl.bunnei2022-02-213-7/+5
| | | | | | | | | | | | | | | | | | | | | | | | - That way, we can consolidate the memory layout to one place.
| * | | | | settings: Add a new "use_extended_memory_layout" setting.bunnei2022-02-217-0/+22
| | | | | | | | | | | | | | | | | | | | | | | | - This will be used to enable emulation of a larger memory arrangement.
| * | | | | core: hle: kernel: Remove resource limit hack for PhysicalMemory.bunnei2022-02-211-7/+0
| | | | | | | | | | | | | | | | | | | | | | | | - With prior changes, we now report the correct amount of physical memory available to the emulated process.
| * | | | | core: hle: kernel: KProcess: Pass in KResourceLimit on process creation.bunnei2022-02-214-9/+30
| | | | | | | | | | | | | | | | | | | | | | | | - This allows us to have a resource limit per process, rather than use the global system resource limit.
| * | | | | core: hle: kernel: KEvent: Pass in owner KProcess on event creation.bunnei2022-02-214-12/+8
| | | | | | | | | | | | | | | | | | | | | | | | - This is necessary to ensure resource limits are freed from the right process.
| * | | | | core: hle: kernel: KResourceLimit: Add a helper function for creating a KResourceLimit for a process.bunnei2022-02-212-0/+22
| | | | | |
* | | | | | Merge pull request #7953 from ameerj/radv-rdna2-crashbunnei2022-02-261-4/+21
|\ \ \ \ \ \ | | | | | | | | | | | | | | vulkan_device: Blacklist RADV on RDNA2 from VK_EXT_vertex_input_dynamic_state
| * | | | | | vulkan_device: Blacklist RADV on RDNA2 from VK_EXT_vertex_input_dynamic_stateAmeer J2022-02-261-4/+21
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | RDNA2 devices running under the RADV driver were crashing when VK_EXT_vertex_input_dynamic_state was enabled. Blacklisting these devices until a proper fix is established.
* | | | | | | Merge pull request #7948 from Morph1984/11-11-10-floatMai M2022-02-262-0/+4
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | maxwell_to_(gl/vk): Add 11_11_10 float vertex format
| * | | | | | | maxwell_to_(gl/vk): Add 11_11_10 float vertex formatMorph2022-02-252-0/+4
| |/ / / / / / | | | | | | | | | | | | | | | | | | | | | - Used by パワプロクンポケットR
* | | | | | | Merge pull request #7939 from asLody/fb-format-gbra8bunnei2022-02-251-0/+2
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | vk_blit_screen: Add missing framebuffer format
| * | | | | | | vk_blit_screen: Add missing format bgra8Lody2022-02-241-0/+2
| |/ / / / / /
* | | | | | | Merge pull request #7927 from german77/amiibobunnei2022-02-251-0/+10
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | yuzu: Disconnect amiibos on drag and drop
| * | | | | | | yuzu: Remove amiibos on drag and dropgerman772022-02-201-0/+10
| | |_|/ / / / | |/| | | | |
* | | | | | | Merge pull request #7859 from german77/battery_againbunnei2022-02-246-34/+27
|\ \ \ \ \ \ \ | |_|/ / / / / |/| | | | | | input_common: Remove battery duplicated struct and update every button press
| * | | | | | input_common: Remove battery duplicated struct and update every button pressgerman772022-02-076-34/+27
| | | | | | |
* | | | | | | service: am: Update enum names to match documentationNarr the Reg2022-02-224-16/+51
| | | | | | |
* | | | | | | Merge pull request #7913 from voidanix/anv-fixbunnei2022-02-213-2/+21
|\ \ \ \ \ \ \ | |_|_|/ / / / |/| | | | | | vulkan_device: fix missing format in ANV
| * | | | | | vulkan_device: fix missing format in ANVvoidanix2022-02-213-2/+21
| | |/ / / / | |/| | | | | | | | | | | | | | | | | | | | | | Currently Mesa's ANV driver does not support VK_FORMAT_B5G6R5_UNORM_PACK16, implement an alternative for it.
* | | | | | Merge pull request #7919 from bunnei/phys-mem-updatesbunnei2022-02-213-131/+506
|\ \ \ \ \ \ | | | | | | | | | | | | | | core: hle: kernel: KPageTable: Improve Un/MapPhysicalMemory.
| * | | | | | fixup! core: hle: kernel: KPageTable: Improve Un/MapPhysicalMemory.bunnei2022-02-193-38/+18
| | | | | | |
| * | | | | | core: hle: kernel: KPageTable: Improve Un/MapPhysicalMemory.bunnei2022-02-193-113/+508
| | | | | | | | | | | | | | | | | | | | | | | | | | | | - Improves the implementations of MapPhysicalMemory and UnmapPhysicalMemory to more closely reflect latest HOS.
* | | | | | | Merge pull request #7920 from bunnei/fix-unmap-pagesbunnei2022-02-211-3/+2
|\ \ \ \ \ \ \ | |_|/ / / / / |/| | | | | | core: hle: kernel: KPageTable: Fix UnmapPages.
| * | | | | | core: hle: kernel: KPageTable: Fix UnmapPages.bunnei2022-02-191-3/+2
| |/ / / / / | | | | | | | | | | | | | | | | | | - Fixes a logic bug in KPageTable::UnmapPages.
* | | | | | Merge pull request #7867 from german77/amiibobunnei2022-02-197-254/+949
|\ \ \ \ \ \ | |/ / / / / |/| | | | | nfp: Improve amiibo support
| * | | | | nfp: Allow files without password datagerman772022-02-132-9/+24
| | | | | |
| * | | | | nfp: Separate nfc tag from amiibo dataNarr the Reg2022-02-103-44/+76
| | | | | |
| * | | | | nfp: Address compiler issuesgerman772022-02-092-27/+27
| | | | | |
| * | | | | nfp: Validate amiibo filesNarr the Reg2022-02-082-41/+145
| | | | | |
| * | | | | yuzu: Allow to open and remove the amiibogerman772022-02-083-5/+24
| | | | | |
| * | | | | nfp: Improve implementationgerman772022-02-084-189/+672
| | | | | |
| * | | | | nfp: Move IUser class to header and add missing enum and structsgerman772022-02-072-257/+299
| | | | | |
| * | | | | nfp: Sort functions by command numbergerman772022-02-071-79/+79
| |/ / / /
* | | | | Merge pull request #7900 from german77/enterbunnei2022-02-182-0/+6
|\ \ \ \ \ | | | | | | | | | | | | yuzu: config: Fix mapping issues with the enter key
| * | | | | yuzu: config: Fix mapping issues with the enter keyNarr the Reg2022-02-152-0/+6
| | | | | |
* | | | | | common: Add NullVisitor default constructorWunkolo2022-02-171-0/+3
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Addresses https://github.com/yuzu-emu/yuzu/issues/7881 to fix linux builds. `YUZU_NON_COPYABLE` deletes the `T(const T&)` constructor which will cause the implicitly defined default ctor/dtor to no-longer generate.
* | | | | | Merge pull request #7866 from xerpi/svc-OutputDebugString32-CreateCodeMemory32-ControlCodeMemory32Mai M2022-02-172-4/+40
|\ \ \ \ \ \ | | | | | | | | | | | | | | kernel: svc: Add OutputDebugString32, CreateCodeMemory32, ControlCodeMemory32
| * | | | | | kernel: svc: Add OutputDebugString32, CreateCodeMemory32, ControlCodeMemory32Sergi Granell2022-02-152-4/+40
| |/ / / / / | | | | | | | | | | | | | | | | | | | | | | | | Very straightforward, they are just wrappers to the 64-bit version of the SVC.
* | | | | | Merge pull request #7878 from german77/mnppbunnei2022-02-176-0/+71
|\ \ \ \ \ \ | | | | | | | | | | | | | | service/mnpp: Stub mnpp_app
| * | | | | | service/mnpp: Stub mnpp_appNarr the Reg2022-02-116-0/+71
| | |/ / / / | |/| | | | | | | | | | | | | | | | Used in Super Nintendo Entertainment System™ - Nintendo Switch Online
* | | | | | Merge pull request #7899 from Kelebek1/testMorph2022-02-161-9/+9
|\ \ \ \ \ \ | | | | | | | | | | | | | | file_sys: Dump patched exefs rather than base
| * | | | | | Dump patched exefs rather than baseKelebek12022-02-151-9/+9
| | | | | | |
* | | | | | | Merge pull request #7877 from lat9nq/upd_revbunnei2022-02-151-1/+3
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | audio_core: Update current process revision
| * | | | | | | audio_core: Update current process revisionlat9nq2022-02-111-1/+3
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Update CURRENT_PROCESS_REVISION from REV9 to REVA. Used by Nintendo Entertainment System - Nintendo Switch Online 6.0.0 and Super Nintendo Entertainment System - Nintendo Switch Online 3.0.0.
* | | | | | | | Merge pull request #7891 from Morph1984/buffer_to_string_viewbunnei2022-02-152-0/+26
|\ \ \ \ \ \ \ \ | |_|_|_|/ / / / |/| | | | | | | common: fs_util: Add buffer to string view utility functions
| * | | | | | | common: fs_util: Add buffer to string view utility functionsMorph2022-02-142-0/+26
| | |_|_|_|_|/ | |/| | | | | | | | | | | | | | | | | | | These functions allow to construct a string view from an input buffer, avoiding the copy done by the non string view counterparts. However, callers must be cognizant of the viewed buffer's lifetime to avoid a use-after-free.
* | | | | | | Merge pull request #7871 from german77/svc2bunnei2022-02-151-77/+77
|\ \ \ \ \ \ \ | |_|_|/ / / / |/| | | | | | svc: Set unique names for function tables
| * | | | | | svc: Set unique names for function tablesNarr the Reg2022-02-091-77/+77
| | |_|/ / / | |/| | | |
* | | | | | debugger: console: Set console output codepage to UTF-8Morph2022-02-141-0/+1
| |/ / / / |/| | | | | | | | | | | | | | This allows the console to display multi-byte encoded characters.
* | | | | hid: Stub IsUsbFullKeyControllerEnabledlat9nq2022-02-122-1/+12
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Used by Splatoon 2, when opening the inventory from a LAN battle lobby. Reference: https://switchbrew.org/wiki/HID_services
* | | | | Merge pull request #7852 from Morph1984/new-uuidbunnei2022-02-1131-193/+370
|\ \ \ \ \ | |_|/ / / |/| | | | common: Revise and fix the UUID implementation
| * | | | common: uuid: Use sizeof(u64) instead of 8 in Hash()Morph2022-02-101-5/+5
| | | | |
| * | | | common: uuid: Return an invalid UUID if conversion from string failsMorph2022-02-051-14/+39
| | | | | | | | | | | | | | | | | | | | | | | | | The string constructor of UUID states: Should the input string not meet the above requirements, an assert will be triggered and an invalid UUID is set instead.
| * | | | general: Rename NewUUID to UUID, and remove the previous UUID implMorph2022-02-0541-598/+415
| | | | | | | | | | | | | | | | | | | | This completes the removal of the old UUID implementation.
| * | | | profile: Migrate to the new UUID implementationMorph2022-02-0514-127/+131
| | | | |
| * | | | common: uuid: Add AsU128()Morph2022-02-052-0/+9
| | | | | | | | | | | | | | | | | | | | This copies the internal bytes of the UUID into a u128 for backwards compatibility. This should not be used.
| * | | | hle: ipc_helpers: Ignore -Wclass-memaccessMorph2022-02-051-0/+8
| | | | | | | | | | | | | | | | | | | | This warning is triggered by GCC when copying into non-trivially default constructible types, as it uses the more restrictive std::is_trivial (which includes std::is_trivially_default_constructible) to determine whether memcpy is safe instead of std::is_trivially_copyable.
| * | | | service: Migrate to the new UUID implementationMorph2022-02-059-45/+36
| | | | |
| * | | | input/hid: Migrate to the new UUID implementationMorph2022-02-0516-56/+57
| | | | |
| * | | | common: Implement NewUUIDMorph2022-02-053-0/+322
| | | | | | | | | | | | | | | | | | | | | | | | | This is a fixed and revised implementation of UUID that uses an array of bytes as its internal representation of a UUID instead of a u128 (which was an array of 2 u64s). In addition to this, the generation of RFC 4122 Version 4 compliant UUIDs is also implemented.
* | | | | Merge pull request #7861 from german77/user_featuresbunnei2022-02-107-62/+95
|\ \ \ \ \ | | | | | | | | | | | | yuzu: New hotkeys and mute audio on background
| * | | | | yuzu: Mute audio when in backgroundgerman772022-02-076-4/+27
| | | | | |
| * | | | | yuzu: Add docked, GPU accuracy and adapting filter hotkeysgerman772022-02-074-58/+68
| | |/ / / | |/| | |
* | | | | Merge pull request #7860 from german77/no-more-driftbunnei2022-02-103-4/+30
|\ \ \ \ \ | | | | | | | | | | | | yuzu: Add auto center on right click
| * | | | | yuzu: Add auto center on right clickgerman772022-02-073-4/+30
| |/ / / /
* | | | | hle: kernel: KCodeMemory: Remove unused QueryMemory.bunnei2022-02-091-1/+0
| | | | |
* | | | | hle: kernel: KCodeMemory: Correct m_page_group number of pages.bunnei2022-02-091-2/+3
|/ / / / | | | | | | | | Credits to @xerpi for finding this issue and pointing it out on #7519.
* | | | Merge pull request #7847 from tech-ticks/masterMorph2022-02-062-1/+46
|\ \ \ \ | | | | | | | | | | service: pm: Implement AtmosphereGetProcessInfo
| * | | | service: pm: Implement AtmosphereGetProcessInfotech-ticks2022-02-042-1/+46
| | | | |
* | | | | Merge pull request #7851 from lat9nq/cmd-add-motionMorph2022-02-061-8/+28
|\ \ \ \ \ | | | | | | | | | | | | yuzu-cmd: config: Support motion inputs
| * | | | | config: Support motion inputslat9nq2022-02-051-8/+28
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Motion inputs were not being read in by the config when yuzu-cmd boots up. This adds support for those. While we're at it, make a reference to the current player controls to improve readability. Also updates the if statements in the Analog and Button loops with curly braces to keep the style consistent.
* | | | | | Merge pull request #7849 from Morph1984/qt-frameless-windowbunnei2022-02-051-0/+2
|\ \ \ \ \ \ | |_|_|/ / / |/| | | | | main: Always remove the frameless window flag when restoring UI state
| * | | | | main: Always remove the frameless window flag when restoring UI stateMorph2022-02-041-0/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | For unknown reasons, this flag may persist after the application has been closed. Removing this flag when restoring the UI state ensures that a frameless window will not be shown on startup.
* | | | | | Merge pull request #7842 from german77/vibration_testbunnei2022-02-055-8/+95
|\ \ \ \ \ \ | | | | | | | | | | | | | | yuzu: config: Vibrate the controller while configuring vibration strength
| * | | | | | yuzu: config: Vibrate the controller while configuring vibration strengthNarr the Reg2022-02-025-8/+95
| | | | | | |
* | | | | | | Merge pull request #7839 from german77/batterybunnei2022-02-054-39/+59
|\ \ \ \ \ \ \ | |_|_|/ / / / |/| | | | | | yuzu: ui: Improve battery symbols
| * | | | | | yuzu: ui: Improve battery symbolsNarr the Reg2022-02-024-39/+59
| |/ / / / /
* | | / / / input_common: Remove unused core includeMorph2022-02-041-1/+0
| |_|/ / / |/| | | |
* | | | | Merge pull request #7811 from german77/analog-modbunnei2022-02-031-4/+26
|\ \ \ \ \ | | | | | | | | | | | | input_common: Use attributes for analog range modifiers
| * | | | | input_common: Use attributes for analog range modifiersgerman772022-01-311-4/+26
| | |_|_|/ | |/| | |
* | | | | Merge pull request #7814 from FernandoS27/another-bug-in-my-schedulebunnei2022-02-032-4/+6
|\ \ \ \ \ | | | | | | | | | | | | Vulkan: Fix Scheduler Chunks when their FuncType is 0.
| * | | | | Vulkan: Fix Scheduler Chunks when their FuncType is 0.Fernando Sahmkow2022-01-312-4/+6
| |/ / / /
* | | | | Merge pull request #7835 from bunnei/page-table-lockbunnei2022-02-032-34/+46
|\ \ \ \ \ | |_|_|/ / |/| | | | hle: kernel: KPageTable: Migrate locks to KScopedLightLock.
| * | | | hle: kernel: KPageTable: Migrate locks to KScopedLightLock.bunnei2022-02-022-34/+46
| | | | | | | | | | | | | | | | | | | | - More accurately reflects real kernel behavior by using guest locks.
* | | | | Merge pull request #7838 from lioncash/noncopyMorph2022-02-0220-150/+228
|\ \ \ \ \ | | | | | | | | | | | | common_types: Remove NonCopyable struct
| * | | | | common_types: Remove NonCopyable structLioncash2022-02-021-10/+0
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Now that we're moved over to the YUZU_ defines, we can get rid of this struct.
| * | | | | general: Replace NonCopyable struct with equivalentsLioncash2022-02-0212-129/+219
| | | | | |
| * | | | | general: Move deleted copy/move constructor/assignment operators to public interfaceLioncash2022-02-027-11/+9
| | |_|_|/ | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This allows for better compiler errors, where the compiler will state a copy or move couldn't occur due to the relevant function being deleted. Previously a compiler would warn about the relevant function not being accessible (which, while true, isn't as informative as it could be).
* | | | | Merge pull request #7834 from german77/repeatbunnei2022-02-021-0/+1
|\ \ \ \ \ | | | | | | | | | | | | yuzu: Disable auto repeat on hotkeys again
| * | | | | yuzu: Disable auto repeat on hotkeys againNarr the Reg2022-02-021-0/+1
| | |_|/ / | |/| | |
* | | | | Merge pull request #7806 from ameerj/atomic64-fallbacksbunnei2022-02-0211-3/+582
|\ \ \ \ \ | |_|/ / / |/| | | | shaders: Implement U32x2 atomic fallbacks when device does not support int64
| * | | | emit_glsl_atomic: Implement 32x2 fallback atomic opsameerj2022-01-301-9/+55
| | | | |
| * | | | lower_int64_to_int32: Add 64-bit atomic fallbacksameerj2022-01-303-11/+76
| | | | |
| * | | | shaders: Add U64->U32x2 Atomic fallback functionsameerj2022-01-309-1/+469
| |/ / /
* | | | Merge pull request #7807 from german77/moar-buttonsbunnei2022-02-024-3/+22
|\ \ \ \ | |_|_|/ |/| | | input_common: Add home and hard touch press buttons to UDP controllers
| * | | input_common: Add home and hard touch press buttons to UDP controllersgerman772022-01-304-3/+22
| |/ /
* | | Merge pull request #7833 from lioncash/file-sysMorph2022-02-023-8/+18
|\ \ \ | | | | | | | | configure_filesystem: Add missing changeEvent() override
| * | | configure_filesystem: Add missing changeEvent() overrideLioncash2022-02-022-0/+10
| | | | | | | | | | | | | | | | | | | | This allows the dialog to be retranslated during runtime if the language is changed.
| * | | configure_filesystem: Normalize member function casingLioncash2022-02-023-8/+8
| | |/ | |/| | | | | | | All other dialog types we have use CamelCase naming.
* | | Merge pull request #7792 from german77/translatebunnei2022-02-021-16/+16
|\ \ \ | |/ / |/| | hotkeys: Don't translate hotkey buttons
| * | hotkeys: Don't translate hotkey buttonsgerman772022-01-281-16/+16
| | |
* | | Merge pull request #7809 from Morph1984/clock-constantsbunnei2022-02-023-11/+19
|\ \ \ | | | | | | | | common: wall_clock: Utilize constants for ms, us, and ns ratios
| * | | common: wall_clock: Check precision against the emulated CPU and CNTFRQMorph2022-01-302-8/+12
| | | | | | | | | | | | | | | | In addition to requiring nanosecond precision, using the native clock requires that the hardware TSC has a precision greater than the emulated CPU and its clock counter.
| * | | common: wall_clock: Utilize constants for ms, us, and ns ratiosMorph2022-01-303-5/+9
| | |/ | |/|
* | | Merge pull request #7831 from lioncash/motionMorph2022-02-011-18/+20
|\ \ \ | | | | | | | | configure_motion_touch: Use functor versions of invokeMethod
| * | | configure_motion_touch: Use functor versions of invokeMethodLioncash2022-02-011-18/+20
| | | | | | | | | | | | | | | | | | | | Same behavior, but ensures that the functions we're calling exist, since they can be checked at compile-time.
* | | | configure_input_player: Eliminate variable shadowingLioncash2022-02-011-4/+5
| | | |
* | | | configure_input_player: std::move input setters in HandleClickLioncash2022-02-011-1/+1
| | | |
* | | | configure_input_player: Avoid unnecessary ParamPackage copiesLioncash2022-02-011-6/+6
|/ / / | | | | | | | | | Avoids churning allocations.
* | | yuzu/game_list: Use non-deprecated version of QString's split() functionLioncash2022-02-011-1/+1
| | | | | | | | | | | | The previous overload of split() was deprecated in 5.14.
* | | Merge pull request #7825 from lioncash/nodisc2Morph2022-02-011-3/+2
|\ \ \ | | | | | | | | common/file: Remove [[nodiscard]] from Open()
| * | | common/file: Remove [[nodiscard]] from Open()Lioncash2022-02-011-3/+2
| |/ / | | | | | | | | | | | | Since this has a void return value, there's nothing that can actually be used.
* | | Merge pull request #7824 from lioncash/scacheMorph2022-02-012-4/+3
|\ \ \ | | | | | | | | video_core/shader_cache: Take std::span in RemoveShadersFromStorage()
| * | | video_core/shader_cache: Remove unused algorithm includeLioncash2022-02-011-1/+0
| | | |
| * | | video_core/shader_cache: Take std::span in RemoveShadersFromStorage()Lioncash2022-02-012-3/+3
| |/ / | | | | | | | | | | | | Same behavior, but without the need to move into the function to avoid an allocation.
* | | Merge pull request #7821 from german77/espada_agudabunnei2022-02-011-1/+1
|\ \ \ | | | | | | | | svc: Add 32 bit SynchronizePreemptionState
| * | | svc: Add 32 bit SynchronizePreemptionStateNarr the Reg2022-02-011-1/+1
| |/ / | | | | | | | | | Used by Espgaluda II
* | | Rasterizer: Refactor inlineToMemory.Fernando Sahmkow2022-02-019-15/+16
| | |
* | | GPU: Improve syncing.Fernando Sahmkow2022-01-291-3/+10
| | |
* | | Rasterizer: Implement Inline2Memory Acceleration.Fernando Sahmkow2022-01-2914-6/+122
| | |
* | | Inline2Memory: Flush before writting buffer.Fernando Sahmkow2022-01-292-2/+3
|/ /
* | Merge pull request #7791 from german77/wall_clockMorph2022-01-291-1/+3
|\ \ | | | | | | wall_clock: Use standard wall clock if rtsc frequency is too low
| * | wall_clock: use standard wall clock if rtsc frequency is too lowgerman772022-01-281-1/+3
| |/
* | spirv_atomic: Define U32x2 storage buffers for 64-bit storage atomicsameerj2022-01-292-3/+3
| | | | | | | | | | | | Some drivers do not support 64-bit atomics, and fallback to atomically modifying U32x2 vectors. This change ensures that U32x2 storage vectors are defined in the spir-v shader when 64-bit atomics are used. Fixes a hang on some devices, notably Intel GPUs, when booting Pokemon Legends Arceus
* | Merge pull request #7784 from german77/ds5Morph2022-01-291-2/+3
|\ \ | | | | | | input_common: Add DS5 to HD rumble list
| * | input_common: Add DS5 to HD rumble listNarr the Reg2022-01-271-2/+3
| | |
* | | Merge pull request #7787 from bunnei/scheduler-deadlock-fixMorph2022-01-292-23/+24
|\ \ \ | | | | | | | | hle: kernel: KScheduler: Fix deadlock with core waiting for a thread lock that has migrated.
| * | | hle: kernel: KScheduler: Fix deadlock with core waiting for a thread lock that has migrated.bunnei2022-01-272-23/+24
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | - Previously, it was possible for a thread migration to occur from core A to core B. - Next, core B waits on a guest lock that must be released by a thread queued for core A. - Meanwhile, core A is still waiting on the core B's current thread lock - resulting in a deadlock. - Fix this by try-locking the thread lock. - Fixes softlocks in FF8 and Pokemon Legends Arceus.
* | | | Merge pull request #7788 from ameerj/stream-buffer-beginMorph2022-01-291-0/+2
|\ \ \ \ | | | | | | | | | | buffer_cache: Reduce stream buffer allocations when expanding from the left
| * | | | buffer_cache: Reduce stream buffer allocations when expanding from the leftameerj2022-01-271-0/+2
| |/ / / | | | | | | | | | | | | | | | | The existing stream buffer optimization accounts for size increases at the end of the allocated buffer. This adds the same optimization, increasing the size from the beginning of the buffer as well to reduce buffer allocations when expanding the same buffer from the left.
* | | | Merge pull request #7786 from ameerj/vmnmx-selMorph2022-01-291-12/+6
|\ \ \ \ | | | | | | | | | | video_minimum_maximum: Implement src operand selectors
| * | | | video_minimum_maximum: Implement src operand selectorsameerj2022-01-271-12/+6
| |/ / / | | | | | | | | | | | | Used by Pokemon Legends: Arceus
* | | | emit_spirv: Add Xfb execution mode when transform feedback is usedameerj2022-01-281-3/+9
| | | | | | | | | | | | | | | | Fixes Transform Feedback on Vulkan AMD drivers.
* | | | Merge pull request #7770 from german77/motion-thresholdbunnei2022-01-284-6/+24
|\ \ \ \ | |/ / / |/| | | input_common: Add option to configure gyro threshold
| * | | input_common: Add option to configure gyro thresholdgerman772022-01-244-6/+24
| | |/ | |/|
* | | Merge pull request #7783 from lioncash/abi-cexprMorph2022-01-272-9/+9
|\ \ \ | | | | | | | | common/xbyak_api: Make BuildRegSet() constexpr
| * | | common/xbyak_api: Make BuildRegSet() constexprLioncash2022-01-262-9/+9
| | | | | | | | | | | | | | | | | | | | This allows us to eliminate any static constructors that would have been emitted due to the function not being constexpr.
* | | | Merge pull request #7762 from bunnei/un-map-improvebunnei2022-01-273-111/+108
|\ \ \ \ | |/ / / |/| | | Kernel Memory Updates (Part 4): Improve Un/MapPages, and more.
| * | | core: hle: kernel: KPageTable: Various improvements to MapPages and UnmapPages.bunnei2022-01-231-22/+25
| | | |
| * | | core: hle: kernel: KPageTable: MapProcessCode: Various cleanup.bunnei2022-01-231-11/+12
| | | |
| * | | core: hle: kernel: KPageTable: ReserveTransferMemory: Various cleanup.bunnei2022-01-231-6/+6
| | | |
| * | | core: hle: kernel: KPageTable: ResetTransferMemory: Various cleanup.bunnei2022-01-231-6/+5
| | | |
| * | | core: hle: kernel: KPageTable: SetMemoryAttribute: Various cleanup.bunnei2022-01-231-2/+3
| | | |
| * | | core: hle: kernel: KPageTable: Assert valid address on GetPhysicalAddr.bunnei2022-01-221-1/+3
| | | |
| * | | core: hle: kernel: KPageTable: Operate: Assert lock ownership.bunnei2022-01-221-2/+2
| | | |
| * | | core: hle: kernel: KPageTable: SetHeapSize: Cleanup & take physical memory lock.bunnei2022-01-221-4/+7
| | | |
| * | | core: hle: kernel: Refactor Un/MapPhysicalMemory to remove unnecessary methods.bunnei2022-01-222-50/+39
| | | |
| * | | core: hle: kernel: Rename Un/Map to Un/MapMeory.bunnei2022-01-223-7/+6
| | | |
* | | | Merge pull request #7780 from lioncash/macrobunnei2022-01-269-213/+204
|\ \ \ \ | |_|_|/ |/| | | video_core/macro: Move impl classes into their cpp files
| * | | video_core/macro: Add missing <cstring> headerLioncash2022-01-251-2/+3
| | | | | | | | | | | | | | | | Necessary since memcpy is used.
| * | | video_core/macro_interpreter: Move impl class to the cpp fileLioncash2022-01-252-84/+86
| | | | | | | | | | | | | | | | | | | | Keeps the implementation hidden from the intended API and lessens the header dependencies on the interpreter's header.
| * | | video_core/macro_hle: Return unique_ptr directly from GetHLEProgram()Lioncash2022-01-253-7/+7
| | | | | | | | | | | | | | | | Same behavior, but less code and header dependencies.
| * | | video_core/macro: Remove unused parameter from Execute()Lioncash2022-01-253-4/+3
| | | | | | | | | | | | | | | | Simplifies the function interface.
| * | | video_core/macro_jit_x64: Remove unused impl class memberLioncash2022-01-251-1/+0
| | | | | | | | | | | | | | | | Reduces the size of the impl class a tiny bit.
| * | | video_core/macro_jit_x64: Decouple PersistentCallerSavedRegs() from implLioncash2022-01-251-5/+4
| | | | | | | | | | | | | | | | This doesn't depend on class state and can just be a regular function.
| * | | video_core/macro_jit_x64: Move impl class into cpp fileLioncash2022-01-252-87/+86
| | | | | | | | | | | | | | | | | | | | | | | | | | | | Keeps the implementation internalized and also reduces API-facing header dependencies. Notably, this fully internalizes all of the xbyak externals.
| * | | video_core/macro_hle: Move impl class into cpp fileLioncash2022-01-252-27/+19
| | |/ | |/| | | | | | | | | | | | | | | | | | | Given it's intended to be an internal implementation class, we can move it into the cpp file to ensure that. This also lets us move some header dependencies into the cpp file as well.
* | | Merge pull request #7769 from german77/no-controlbunnei2022-01-266-3/+28
|\ \ \ | | | | | | | | yuzu: Add setting to disable controller navigation
| * | | yuzu: Add setting to disable controller navigationgerman772022-01-246-3/+28
| |/ /
* | | Merge pull request #7768 from Moonlacer/fsr-1.0.2bunnei2022-01-261-1/+1
|\ \ \ | | | | | | | | Update AMD FidelityFX Super Resolution™ to 1.0.2
| * | | Update FSR to 1.0.2Moonlacer2022-01-231-1/+1
| |/ / | | | | | | | | | Updates yuzu's FSR implementation to 1.0.2
* | | Merge pull request #7777 from lioncash/nodiscMorph2022-01-251-2/+1
|\ \ \ | | | | | | | | shader_recompiler: Remove unnecessary [[nodiscard]] specifier
| * | | shader_recompiler: Remove unnecessary [[nodiscard]]Lioncash2022-01-251-2/+1
| |/ / | | | | | | | | | | | | Since ConvertLegacyToGeneric has a void return value, there's nothing that is actually returned by the function.
* | | Merge pull request #7779 from lioncash/gpu-ifaceMorph2022-01-251-16/+0
|\ \ \ | | | | | | | | gpu: Remove obsoleted CDmaPusher() accessors
| * | | gpu: Tidy up forward declarationsLioncash2022-01-251-10/+0
| | | | | | | | | | | | | | | | | | | | Over time a few forward declarations became unnecessary, so we can remove these to tidy up the header a little bit.
| * | | gpu: Remove obsoleted CDMAPusher() accessorsLioncash2022-01-251-6/+0
| |/ / | | | | | | | | | | | | These were obsoleted in 2c47f8aa1886522898b5b3a73185b5662be3e9f3 but were accidentally overlooked.
* | | Merge pull request #7778 from lioncash/commaMorph2022-01-251-1/+1
|\ \ \ | | | | | | | | vk_fsr: Replace comma operator with semicolon
| * | | vk_fsr: Replace comma operator with semicolonLioncash2022-01-251-1/+1
| |/ / | | | | | | | | | | | | | | | Generally, we should be ending statements with a semicolon not a comma Resolves a clang diagnostic.
* | | Merge pull request #7774 from lioncash/mappingMorph2022-01-255-13/+18
|\ \ \ | | | | | | | | input_common/main: Pass MappingData by const reference in callbacks
| * | | input_common/input_engine: Ensure PadIdentifier UUIDs have a valid initial stateLioncash2022-01-241-1/+1
| | | | | | | | | | | | | | | | | | | | The default constructor of a UUID instance doesn't initialize the underlying array.
| * | | input_common/input_mapping: Simplify UUID validity checksLioncash2022-01-241-3/+3
| | | | | | | | | | | | | | | | | | | | Makes the checks a little more intuitive to read and doesn't construct an extra UUID instance
| * | | input_common/input_mapping: Add missing includesLioncash2022-01-242-1/+6
| | | | | | | | | | | | | | | | Ensures that the class always sees the types it needs.
| * | | input_common/input_mapping: Remove const from return valueLioncash2022-01-244-4/+4
| | | | | | | | | | | | | | | | | | | | Top-level const on a return by value can inhibit move semantics, and is unnecessary.
| * | | input_common/input_mapping: Default constructorLioncash2022-01-241-1/+1
| | | |
| * | | input_common/main: Pass MappingData by const reference in callbacksLioncash2022-01-242-3/+3
| |/ / | | | | | | | | | Avoids creating unnecessary 168 byte copies per callback invocation.
* | | Merge pull request #7773 from lioncash/udp-deprecatedMorph2022-01-252-6/+6
|\ \ \ | | | | | | | | input_common/udp_client: Replace deprecated from_string()/to_ulong() functions
| * | | input_common/udp_client: Replace deprecated from_string()/to_ulong() functionsLioncash2022-01-241-2/+2
| | | | | | | | | | | | | | | | These are deprecated and make_address variants and to_uint() should be used instead.
| * | | input_common/udp_client: Prevent unnecessary string copiesLioncash2022-01-242-4/+4
| |/ / | | | | | | | | | | | | We can also remove some redundant const on the return values, since these don't do anything
* | | Merge pull request #7771 from lioncash/assertMorph2022-01-251-2/+0
|\ \ \ | | | | | | | | kernel/k_affinity_mask: Remove duplicated assert
| * | | kernel/k_affinity_mask: Remove duplicated assertLioncash2022-01-241-2/+0
| |/ / | | | | | | | | | This is already checked inside GetCoreBit()
* | | Merge pull request #7765 from bunnei/update-thread-countbunnei2022-01-253-24/+21
|\ \ \ | | | | | | | | hle: kernel: KThread: Improve Increment/Decrement RunningThreadCount.
| * | | hle: kernel: KThread: Improve Increment/Decrement RunningThreadCount.bunnei2022-01-233-24/+21
| |/ / | | | | | | | | | - Previously implementation was incorrect, and would occasionally underflow.
* | | Merge pull request #7760 from german77/inverted_keyboardbunnei2022-01-251-25/+34
|\ \ \ | |/ / |/| | yuzu: Add modifiers for keyboard
| * | yuzu: Add modifiers for keyboardNarr the Reg2022-01-221-25/+34
| | |
* | | Merge pull request #7716 from german77/volumebunnei2022-01-224-28/+18
|\ \ \ | |_|/ |/| | yuzu: Add volume hotkeys
| * | audio/stream: Adjust volume scale factorgerman772022-01-161-2/+2
| | |
| * | yuzu: Add volume up/down hotkeysgerman772022-01-163-4/+16
| | |
| * | yuzu: Remove speed limit hotkeysgerman772022-01-153-24/+2
| | |
* | | Merge pull request #7735 from german77/udp_batterybunnei2022-01-222-0/+25
|\ \ \ | | | | | | | | input_common: Report battery for UDP controllers
| * | | input_common: Report battery for UDP controllersNarr the Reg2022-01-172-0/+25
| |/ /
* | | Merge pull request #7737 from bunnei/fix-dummy-thread-leakbunnei2022-01-229-40/+120
|\ \ \ | |_|/ |/| | Various fixes to HLE service thread management
| * | hle: kernel: KThread: Ensure host (dummy) threads block on locking.bunnei2022-01-224-0/+89
| | | | | | | | | | | | | | | - But do not enter the priority queue, as otherwise they will be scheduled. - Allows dummy threads to use guest synchronization primitives.
| * | hle: kernel: Remove redundant tracking of dummy threads.bunnei2022-01-211-9/+3
| | | | | | | | | | | | - These are already tracked by kernel's registered_objects member.
| * | hle: kernel: KThread: DummyThread can be waited, ensure wait_queue is not nullptr.bunnei2022-01-211-6/+6
| | |
| * | hle: kernel: KThread: Decrease DummyThread priority to ensure it is never scheduled.bunnei2022-01-213-2/+5
| | |
| * | hle: kernel: service_thread: Ensure dummy thread is closed & destroyed on thread exit.bunnei2022-01-211-0/+5
| | |
| * | hle: kernel: KServerSession: Remove hack for CompleteSyncRequest.bunnei2022-01-211-11/+0
| | | | | | | | | | | | - This does not appear to be necessary anymore.
| * | hle: kernel: KServerSession: Simplify CompleteSyncRequest EndWait.bunnei2022-01-212-12/+2
| | | | | | | | | | | | | | | - Considering is_thread_waiting is never set, so we can remove IsThreadWaiting. - KThread::EndWait will take the scheduler lock, so we can remove the redundant lock.
| * | hle: kernel: KThread: Ensure dummy threads never call EndWait.bunnei2022-01-211-0/+5
| | | | | | | | | | | | - These are only used by host threads for locking and will never have a wait_queue.
| * | hle: kernel: KScheduler: Ensure dummy threads are never scheduled.bunnei2022-01-211-0/+5
| | | | | | | | | | | | - These are only used by host threads for locking.
| * | hle: kernel: KThread: Rename thread_type_for_debugging -> thread_type.bunnei2022-01-213-6/+6
| | | | | | | | | | | | - This will be used to ensure that we do not schedule dummy threads.
* | | Merge pull request #7752 from Morph1984/SetCpuOverclockEnabledbunnei2022-01-221-1/+13
|\ \ \ | | | | | | | | service: apm: Stub ISession SetCpuOverclockEnabled
| * | | service: apm: Stub ISession SetCpuOverclockEnabledMorph2022-01-211-1/+13
| | | | | | | | | | | | | | | | | | | | | | | | Since we don't currently support CPU overclocking within the emulated system, this can be stubbed for now, like APM IsCpuOverclockEnabled. - Used by Gravity Rider Zero
* | | | service/wlan: Update function tablesLioncash2022-01-211-1/+1
| | | |
* | | | service/usb: Update function tablesLioncash2022-01-211-27/+15
| | | |
* | | | service/set: Update function tablesLioncash2022-01-211-0/+2
| | | |
* | | | service/ns: Update function tablesLioncash2022-01-211-0/+6
| | | |
* | | | service/nim: Update unknown function table entriesLioncash2022-01-211-0/+6
| | | |
* | | | service/friend: Update unknown function table entriesLioncash2022-01-211-6/+6
| | | |
* | | | service/filsystem: Update fsp-srv function tableLioncash2022-01-211-0/+3
| | | |
* | | | service/btm: Update function tablesLioncash2022-01-211-0/+30
| | | |
* | | | service/audio: Update audctl unknown function namesLioncash2022-01-211-8/+8
| | | |
* | | | service/am: Update omm function tablesLioncash2022-01-211-0/+1
| | | |
* | | | service/acc: Update unknown function namesLioncash2022-01-212-4/+4
| | | | | | | | | | | | | | | | Switchbrew has the function names now.
* | | | Merge pull request #7755 from v1993/someone-in-here-lacks-system-wide-themingbunnei2022-01-212-6/+11
|\ \ \ \ | | | | | | | | | | Use Default Colorful theme by default outside of Windows
| * | | | Use Default Colorful theme by default outside of Windowsv19932022-01-212-6/+11
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | On OSes with system-wide theming this allows yuzu to follow system style, regardless of its exact coloration, working well with both light and dark system themes. Dark /Colorful, on the other hand, forces dark theme regardless of user preferences set in system settings, making for a poor default. Use Colorful variation to keep in line with icon style of patron-voted Dark Colorful.
* | | | | Merge pull request #7731 from v1993/xfb-varying-check-fixbunnei2022-01-212-6/+8
|\ \ \ \ \ | |/ / / / |/| | | | shader_recompiler: fix potential OOB access
| * | | | shader_recompiler: fix potential OOB accessv19932022-01-172-6/+8
| | | | | | | | | | | | | | | | | | | | Found by static analysis with PVS-Studio. Original check wasn't actually checking for OOB and would segfault in case of it.
* | | | | Merge pull request #7695 from Morph1984/is-pow2bunnei2022-01-211-0/+6
|\ \ \ \ \ | |_|_|/ / |/| | | | common: bit_util: Add IsPow2 helper function
| * | | | common: bit_util: Add IsPow2 helper functionMorph2022-01-111-0/+6
| | | | | | | | | | | | | | | | | | | | Makes use of std::has_single_bit() to check whether the value is a power of 2.
* | | | | Merge pull request #7710 from german77/just-shake-itbunnei2022-01-211-1/+1
|\ \ \ \ \ | | | | | | | | | | | | core/hid: Increment shake force
| * | | | | core/hid: Increment shake forceNarr the Reg2022-01-141-1/+1
| | | | | | | | | | | | | | | | | | With the current settings 2p mode in pokemon let's go wasn't showing up. By making the shake more violent we can make it appear without any effort using the keyboard
* | | | | | video_core: constify AVCodec for ffmpeg >= 5.0Jan Beich2022-01-201-1/+1
| |_|_|/ / |/| | | | | | | | | | | | | | | | | | | | | | | | src/video_core/command_classes/codecs/codec.cpp:177:16: error: assigning to 'AVCodec *' from 'const AVCodec *' discards qualifiers av_codec = avcodec_find_decoder(codec); ^~~~~~~~~~~~~~~~~~~~~~~~~~~
* | | | | Merge pull request #7726 from german77/clampMorph2022-01-191-1/+2
|\ \ \ \ \ | | | | | | | | | | | | service/hid: Initialize applet_resource on SetNpadAnalogStickUseCenterClamp
| * | | | | service/hid: Initialize applet_resource on SetNpadAnalogStickUseCenterClampgerman772022-01-191-1/+2
| | | | | |
* | | | | | vulkan_device: Fix sType for VkPhysicalDeviceShaderAtomicInt64FeaturesGeorg Lehmann2022-01-191-1/+1
| | | | | |
* | | | | | Merge pull request #7701 from bunnei/clear-mem-pagesbunnei2022-01-195-16/+34
|\ \ \ \ \ \ | | | | | | | | | | | | | | Kernel Memory Updates (Part 3): Clear KMemoryManager pages & other fixes
| * | | | | | hle: kernel: k_memory_manager: Clear pages on allocation & free.bunnei2022-01-155-16/+34
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | - Heap pages should be zero'd. - Also explicitly passed along heap allocation option.
* | | | | | | Merge pull request #7715 from gidoly/patch-4bunnei2022-01-191-2/+2
|\ \ \ \ \ \ \ | |_|/ / / / / |/| | | | | | Xbox controller default name nit pick
| * | | | | | Xbox controller default name nit pickgidoly2022-01-151-2/+2
| | |_|_|_|/ | |/| | | | | | | | | | Discord User moon lacer pointed us that official name is 'Xbox' not 'XBox'
* | | | | | Merge pull request #7725 from german77/mouse_in_motionbunnei2022-01-195-1/+64
|\ \ \ \ \ \ | | | | | | | | | | | | | | input_common: Reintroduce motion from mouse and use button names
| * | | | | | input_common: Reintroduce motion from mouse and use button namesgerman772022-01-175-1/+64
| |/ / / / /
* | | | | | Merge pull request #7712 from bunnei/fix-thread-exitbunnei2022-01-1811-39/+181
|\ \ \ \ \ \ | | | | | | | | | | | | | | Accurately implement thread exit
| * | | | | | core: hle: kernel: KThread: Integrate with KWorkerTask and implement DoWorkerTaskImpl.bunnei2022-01-152-2/+28
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | - This is used to terminate a thread asynchronously after it has been exited. - This fixes a crash that can occur in Pokemon Sword/Shield because a thread is incorrectly closed on svcExitThread, then, the thread is destroyed on svcCloseHandle while it is still scheduled. - Instead, we now wait for the thread to no longer be scheduled on all cores before destroying it from KWorkerTaskManager, which is accurate to HOS behavior.
| * | | | | | core: hle: kernel: KProcess: Integrate with KWorkerTask and add unimplemented DoWorkerTaskImpl.bunnei2022-01-152-3/+9
| | | | | | |
| * | | | | | core: hle: kernel: KThread: Replace Suspend with UpdateState & various updates.bunnei2022-01-152-33/+26
| | | | | | | | | | | | | | | | | | | | | | | | | | | | - This makes our implementations of these more closely match HOS.
| * | | | | | core: hle: kernel: Instantiate a kernel instance of KWorkerTaskManager.bunnei2022-01-152-0/+18
| | | | | | |
| * | | | | | core: hle: kernel: Add KWorkerTask and KWorkerTaskManager.bunnei2022-01-154-0/+96
| | | | | | | | | | | | | | | | | | | | | | | | | | | | - These primitives are used to dispatch asynchronous kernel tasks from KThread and KProcess.
| * | | | | | common: fiber: YieldTo: Avoid hard crash on nullptr previous_fiber.bunnei2022-01-151-1/+4
| | | | | | | | | | | | | | | | | | | | | | | | | | | | - When the emulator crashes to desktop below, we don't even get this captured in a log, making such issues harder to debug.
* | | | | | | Merge pull request #7724 from ameerj/astc_new_nvbunnei2022-01-181-34/+46
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | astc_decoder: Combine FastReplicate functions to work around new NV driver bug
| * | | | | | | astc_decoder: Combine FastReplicate functions to work around new NV driver bugameerj2022-01-161-34/+46
| | |/ / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The new Nvidia drivers have a bug where the FastReplicateTo6 function produces a lookup into the REPLICATE_TO_8 table rather than the REPLICATE_TO_6 table. This seems to be an optimization gone wrong. Combining the logic of the FastReplicate functions seems to address the bug.
* | | | | | | Merge pull request #7732 from v1993/patch-7bunnei2022-01-181-2/+0
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | kernel: remove no-op code
| * | | | | | | hle: remove no-op codeValeri2022-01-171-2/+0
| | |_|_|_|_|/ | |/| | | | | | | | | | | | Found by static analysis with PVS-Studio. Nobody seems to really know what was it doing there.
* | | | | | | Merge pull request #7730 from v1993/patch-6Mai M2022-01-171-1/+1
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | input_common: nitpick about SetHatButton usage
| * | | | | | | input_common: nitpick about SetHatButton usageValeri2022-01-171-1/+1
| | |/ / / / / | |/| | | | |
* | | | | | | Merge pull request #7729 from v1993/patch-5Mai M2022-01-171-1/+1
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | input_common: fix copy-paste error
| * | | | | | | input_common: fix copy-paste errorValeri2022-01-171-1/+1
| |/ / / / / / | | | | | | | | | | | | | | Found by static analysis with PVS-Studio.
* | | | | | | Merge pull request #7728 from v1993/patch-4Mai M2022-01-171-1/+1
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | hid: fix std::transform call
| * | | | | | | hid: fix std::transform callValeri2022-01-171-1/+1
| |/ / / / / / | | | | | | | | | | | | | | Found by static analysis with PVS-Studio.
* | | | | | | Merge pull request #7727 from v1993/patch-3Mai M2022-01-171-1/+1
|\ \ \ \ \ \ \ | |_|/ / / / / |/| | | | | | hid: Correct assignment source for rotations
| * | | | | | Correct assignment source for rotationsValeri2022-01-171-1/+1
| |/ / / / / | | | | | | | | | | | | Found by static analysis with PVS-Studio
* | | | | | uisettings: Add enumeration type for themesMorph2022-01-172-3/+17
| | | | | | | | | | | | | | | | | | | | | | | | Eliminates the usage of a magic number to indicate the default index of the themes array,
* | | | | | config: Change default theme to Dark Colorfulgidoly2022-01-171-2/+2
|/ / / / /
* | | | | Merge pull request #7713 from gidoly/patch-3bunnei2022-01-151-0/+6
|\ \ \ \ \ | | | | | | | | | | | | Change default name for playstation controllers
| * | | | | Change default name for ps controllersgidoly2022-01-151-0/+6
| | |/ / / | |/| | | | | | | | | | | | | Minor nitpick Code is from narr
* | | | | Merge pull request #7711 from bunnei/fix-service-thread-race-v2bunnei2022-01-151-12/+11
|\ \ \ \ \ | |/ / / / |/| | | | hle: kernel: Fix service_threads access to be thread safe V2.
| * | | | hle: kernel: Fix service_threads access to be thread safe V2.bunnei2022-01-151-12/+11
| |/ / / | | | | | | | | | | | | | | | | | | | | - PR #7699 attempted to fix CreateServiceThread and ReleaseServiceThread to be thread safe, but inadvertently introduced a possible dead-lock. - With this PR, we use a worker thread to manage the service thread list, allowing it only to be accessed by a single thread, and guaranteeing threads will not destroy themselves. - Fixes a rare crash in Pokemon Sword/Shield, I've now run this game for ~12 hours non-stop and am quite confident this is a good solution for this issue.
* | | | Merge pull request #7707 from german77/slow-updatebunnei2022-01-151-1/+2
|\ \ \ \ | |/ / / |/| | | service/hid: Decrease motion update rate
| * | | service/hid: Decrease motion update rateNarr the Reg2022-01-131-1/+2
| |/ / | | | | | | Motion stops working in Mario Tennis in swing mode if the update rate is too fast even when HW it updates at the same speed. 10ms it's the minimum period that the game needs to start working again.
* | | Merge pull request #7699 from bunnei/fix-service-thread-raceMai M2022-01-141-7/+27
|\ \ \ | | | | | | | | hle: kernel: Fix service_threads access to be thread safe.
| * | | hle: kernel: Fix service_threads access to be thread safe.bunnei2022-01-141-7/+27
| | | | | | | | | | | | | | | | | | | | - CreateServiceThread and ReleaseServiceThread can be accessed by different threads, uses a lock to make this thread safe. - Fixes a rare crash in Pokemon Sword/Shield that can occur when a new service thread is being created while an old one is being destroyed.
* | | | Merge pull request #7698 from bunnei/mem-code-memory-updatesMai M2022-01-146-81/+107
|\ \ \ \ | |/ / / |/| | | Kernel Memory Updates (Part 2): SetProcessMemoryPermission, update permissions, and other minor changes.
| * | | hle: kernel: k_page_table: Update SetProcessMemoryPermission.bunnei2022-01-126-45/+68
| | | |
| * | | hle: service: ldr: UnmapCodeMemory BSS only when set.bunnei2022-01-121-3/+7
| | | |
| * | | hle: kernel: k_page_table: ReadAndWrite -> UserReadWrite.bunnei2022-01-123-18/+18
| | | |
| * | | hle: kernel: k_page_table: Rename *ProcessCodeMemory -> *CodeMemory.bunnei2022-01-124-20/+19
| | | |
* | | | Merge pull request #7690 from Morph1984/increase-file-limit-winbunnei2022-01-141-2/+2
|\ \ \ \ | | | | | | | | | | yuzu: main: Increase the open file limit on Windows to 8192
| * | | | yuzu: main: Increase the open file limit on Windows to 8192Morph2022-01-101-2/+2
| | |_|/ | |/| | | | | | | | | | This is a temporary solution for now to accommodate for mods containing more than 4096 files.
* | | | Merge pull request #7700 from german77/no-gyrobunnei2022-01-141-1/+1
|\ \ \ \ | |_|_|/ |/| | | core/hid: Reduce gyro threshold even more
| * | | core/hid: Reduce gyro threshold even moreNarr the Reg2022-01-121-1/+1
| | | |
* | | | Merge pull request #7697 from abouvier/opt-testsbunnei2022-01-122-2/+5
|\ \ \ \ | |_|_|/ |/| | | cmake: make tests optional
| * | | cmake: make tests optionalAlexandre Bouvier2022-01-122-2/+5
| | | |
* | | | Merge pull request #7684 from bunnei/set-mem-perm-attrbunnei2022-01-125-160/+211
|\ \ \ \ | |/ / / |/| | | Kernel Memory Updates (Part 1): SetMemoryAttribute, and other minor changes.
| * | | core: hle: kernel: svc: Updates to SetMemoryAttribute and SetMemoryPermission.bunnei2022-01-083-45/+46
| | | |
| * | | core: hle: kernel: k_page_table: Update CheckMemoryState.bunnei2022-01-084-116/+166
| | | |
* | | | Merge pull request #7633 from german77/hotkeysbunnei2022-01-1115-80/+626
|\ \ \ \ | |_|_|/ |/| | | yuzu: Add controller hotkeys
| * | | yuzu: Add controller hotkeysgerman772022-01-0714-79/+580
| | | |
| * | | core/hid: Add home and screenshot button supportgerman772022-01-073-1/+46
| | | |
* | | | Merge pull request #7683 from liushuyu/fmt-8.1Morph2022-01-104-2/+27
|\ \ \ \ | | | | | | | | | | logging: adapt to changes in fmt 8.1
| * | | | logging/log.h: move enum class formatter to a separate file ...liushuyu2022-01-106-22/+32
| | | | | | | | | | | | | | | | | | | | ... to common/logging/formatter.h
| * | | | logging/log: use `underlying_type` instead of hardcoding typesliushuyu2022-01-091-2/+4
| | | | |
| * | | | logging: adapt to changes in fmt 8.1liushuyu2022-01-083-7/+20
| | |/ / | |/| |
* | | | Merge pull request #7687 from german77/tas_handleMorph2022-01-101-7/+24
|\ \ \ \ | |_|_|/ |/| | | input_common: Handle errors on TAS scripts
| * | | input_common: Handle errors on TAS scriptsgerman772022-01-081-7/+24
| | | |
* | | | Merge pull request #7682 from german77/udp_fixbunnei2022-01-083-17/+30
|\ \ \ \ | |_|/ / |/| | | input_common: Fix UDP controller mappings
| * | | yuzu: Use pad parameter to choose the correct controllergerman772022-01-072-9/+14
| | | |
| * | | input_common: Fix udp motion not automapping to both sidesgerman772022-01-071-8/+16
| |/ /
* | | Merge pull request #7680 from german77/accel_mappingbunnei2022-01-082-2/+11
|\ \ \ | |/ / |/| | input_common: Allow to only have acceleration motion data
| * | core/hid: Set minimum gyro thresholdgerman772022-01-071-0/+1
| | |
| * | input_common: Use accelerometer data for mappinggerman772022-01-071-2/+10
| |/
* | Merge pull request #7658 from ameerj/sparse-fixesFernando S2022-01-063-61/+44
|\ \ | | | | | | video_core/memory_manager: Fixes for sparse memory management
| * | video_core/memory_manager: Fixes for sparse memory managementameerj2021-12-312-14/+12
| | |
| * | video_core/memory_manager: Deduplicate Read/WriteBlockameerj2021-12-312-47/+32
| | |
* | | Merge pull request #7674 from lat9nq/fix-custom-highlightbunnei2022-01-061-15/+9
|\ \ \ | |_|/ |/| | configure_per_game: Initialize tabs after loading custom configuration
| * | configure_per_game: Initialize tabs after loading custom configurationlat9nq2022-01-051-15/+9
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Changes tab initialization to happen after the configuration is loaded, which means that it no longer happens as member initializers in the ConfigurePerGame constructor. Removes the cluster of ??_tab->SetConfiguration's that I added earlier to get around this issue initially. Fixes a regression in #6774
* | | Merge pull request #7673 from german77/no_returnMai M2022-01-052-2/+1
|\ \ \ | |/ / |/| | glsl: Remove unreachable return
| * | video_core: Remove unnecesary maybe_unused flagNarr the Reg2022-01-051-1/+1
| | |
| * | glsl: Remove unreachable returnNarr the Reg2022-01-051-1/+0
| | |
* | | Merge pull request #7636 from vonchenplus/buffer_queue_querybunnei2022-01-044-4/+9
|\ \ \ | | | | | | | | core:hle:service:nvflinger Implement few type in bufferqueue query method
| * | | Remove invalid assertion statementFeng Chen2021-12-281-3/+0
| | | |
| * | | Remove invalid header includeFeng Chen2021-12-281-1/+0
| | | |
| * | | Implement few type in bufferqueue query methodFeng Chen2021-12-282-0/+9
| | | |
* | | | Merge pull request #7670 from ameerj/vsync-blockFernando S2022-01-044-10/+30
|\ \ \ \ | |_|/ / |/| | | gpu: Add shut down method to synchronize threads before destruction
| * | | gpu: Add shut down method to synchronize threads before destructionameerj2022-01-043-0/+15
| | | |
| * | | Revert "Merge pull request #7668 from ameerj/fence-stop-token"ameerj2022-01-043-10/+15
| | | | | | | | | | | | | | | | | | | | This reverts commit e7733544779f2706d108682dd027d44e7fa5ff4b, reversing changes made to abbbdc2bc027ed7af236625ae8427a46df63f7e7.
* | | | Merge pull request #7251 from FernandoS27/shader-dumpbunnei2022-01-048-1/+98
|\ \ \ \ | |/ / / |/| | | ShaderDecompiler: Add a debug option to dump the game's shaders.
| * | | ShaderDecompiler: Add a debug option to dump the game's shaders.Fernando Sahmkow2022-01-048-1/+98
| | | |
* | | | Merge pull request #7668 from ameerj/fence-stop-tokenbunnei2022-01-043-15/+10
|\ \ \ \ | | | | | | | | | | gpu: Use std::stop_token in WaitFence for VSync thread
| * | | | gpu: Use std::stop_token in WaitFence for VSync threadameerj2022-01-033-15/+10
| |/ / / | | | | | | | | | | | | Fixes a hang that may occur when stopping emulation and the VSync thread is blocked on the syncpoint condition variable.
* | | | Merge pull request #7664 from german77/fallbackbunnei2022-01-042-4/+36
|\ \ \ \ | | | | | | | | | | core/hid: Add fallback to fullkey controllers
| * | | | core/hid: Add fallback to fullkey controllersgerman772022-01-022-4/+36
| | |_|/ | |/| |
* | | | Merge pull request #7662 from german77/uistatusbunnei2022-01-031-2/+2
|\ \ \ \ | | | | | | | | | | yuzu: Fix UI elements not updating correctly
| * | | | yuzu: Fix UI elements not updating correctlygerman772022-01-021-2/+2
| |/ / /
* | | | Merge pull request #7663 from german77/appletbunnei2022-01-032-53/+68
|\ \ \ \ | |_|/ / |/| | | controller_applet: Only populate supported controllers
| * | | controller_applet: Only populate supported controllersgerman772022-01-022-53/+68
| |/ /
* | | Merge pull request #7648 from bunnei/thread-pinningFernando S2022-01-0310-14/+140
|\ \ \ | | | | | | | | core: hle: kernel: Implement thread pinning.
| * | | core: hle: kernel: Implement thread pinning.bunnei2021-12-3110-14/+140
| | | | | | | | | | | | | | | | | | | | - We largely had the mechanics in place for thread pinning, this change hooks these up. - Validated with tests https://github.com/Atmosphere-NX/Atmosphere/blob/master/tests/TestSvc/source/test_thread_pinning.cpp.
* | | | Merge pull request #7624 from ameerj/intel-msaa-scaleFernando S2022-01-034-20/+35
|\ \ \ \ | | | | | | | | | | vk_texture_cache: Use 3D scale helpers for MSAA texture scaling on Intel Windows drivers
| * | | | vk_texture_cache: Use 3D scale helpers for MSAA texture scaling on Intel Windows driversameerj2021-12-244-20/+35
| | | | | | | | | | | | | | | | | | | | Fixes a crash when scaling MSAA textures in titles such as Sonic Colors Ultimate.
* | | | | Merge pull request #7629 from ameerj/nv-driver-fixesFernando S2022-01-0318-30/+140
|\ \ \ \ \ | | | | | | | | | | | | shaders: Add fixes for NVIDIA drivers 495+
| * | | | | glsl: Add boolean reference workaroundameerj2021-12-306-2/+15
| | | | | |
| * | | | | glsl_context_get_set: Add alternative cbuf type for broken driversameerj2021-12-306-24/+35
| | | | | | | | | | | | | | | | | | | | | | | | some drivers have a bug bitwise converting floating point cbuf values to uint variables. This adds a workaround for these drivers to make all cbufs uint and convert to floating point as needed.
| * | | | | emit_glsl_integer: Use negation work aroundameerj2021-12-301-2/+2
| | | | | |
| * | | | | shader: Add integer attribute get optimization passameerj2021-12-309-0/+86
| | | | | | | | | | | | | | | | | | | | | | | | Works around an nvidia driver bug, where casting the integer attributes to float and back to an integer always returned 0.
| * | | | | emit_glsl_floating_point: Fix FPNeg on newer Nvidia driversameerj2021-12-251-2/+2
| | | | | |
* | | | | | texture_cache/util: Fix s32 overflow when resolving overlapsameerj2022-01-011-5/+5
| |_|_|/ / |/| | | |
* | | | | Merge pull request #7647 from german77/toadbunnei2021-12-315-17/+23
|\ \ \ \ \ | |_|_|/ / |/| | | | core/hid: Fix controller type validation
| * | | | core/hid: Fix controller type validationgerman772021-12-305-17/+23
| | | | |
* | | | | Merge pull request #7635 from bunnei/set-heap-sizebunnei2021-12-306-83/+141
|\ \ \ \ \ | | | | | | | | | | | | core: hle: kernel: Updated implementation of svcSetHeapSize.
| * | | | | core: hle: kernel: Updated implementation of svcSetHeapSize.bunnei2021-12-286-83/+141
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | - Updates our svcSetHeapSize with latest HOS, furthermore allowing heap size to properly be extended/shrunk. - Validated with tests https://github.com/Atmosphere-NX/Atmosphere/blob/master/tests/TestSvc/source/test_set_heap_size.cpp.
* | | | | | Merge pull request #7618 from goldenx86/patch-4bunnei2021-12-291-0/+9
|\ \ \ \ \ \ | |_|_|_|_|/ |/| | | | | Increase boost requirement to 1.78.0
| * | | | | Empty spacesMatías Locatti2021-12-281-1/+1
| | | | | |
| * | | | | Changes to avoid warnings in SSE4.2 optimized SPIR-VMatías Locatti2021-12-281-0/+9
| | | | | |
* | | | | | Merge pull request #7622 from ameerj/vk-rescale-invalid-ptrbunnei2021-12-285-8/+21
|\ \ \ \ \ \ | |_|/ / / / |/| | | | | vk_texture_cache: Fix invalidated pointer access
| * | | | | vk_texture_cache: Fix invalidated pointer accessameerj2021-12-245-8/+21
| | |_|_|/ | |/| | | | | | | | | | | | | | | | | | The vulkan ImageView held a reference to its source image for rescale status checking. This pointer is sometimes invalidated when the texture cache slot_images container is resized. To avoid an invalid pointer dereference, the ImageView now holds a reference to the container itself.
* | | | | Merge pull request #7621 from bunnei/set-mem-permbunnei2021-12-284-1/+67
|\ \ \ \ \ | | | | | | | | | | | | core: hle: kernel: Implement SetMemoryPermission.
| * | | | | core: hle: kernel: Implement SetMemoryPermission.bunnei2021-12-234-1/+67
| | |/ / / | |/| | | | | | | | | | | | | - Not seen in any games yet, but validated with kernel tests.
* | | | | Merge pull request #7630 from ameerj/glasm-get-intbunnei2021-12-281-4/+4
|\ \ \ \ \ | |_|_|/ / |/| | | | emit_glasm_context_get_set: Fix GetAttribute return value type.
| * | | | emit_glasm_context_get_set: Fix GetAttribute return value type.ameerj2021-12-251-4/+4
| | |_|/ | |/| | | | | | | | | | GetAttribute expects an F32 result type at the IR level, this fixes the return value of attributes which were not returning an F32
* | | | Merge pull request #7620 from bunnei/kernel-thread-x18bunnei2021-12-251-0/+2
|\ \ \ \ | |/ / / |/| | | core: hle: kernel: KThread: X18 should be a cryptographically random number.
| * | | core: hle: kernel: KThread: X18 should be a cryptographically random number.bunnei2021-12-231-0/+2
| |/ / | | | | | | | | | | | | - This was added with firmware 11.0.0 (https://switchbrew.org/wiki/11.0.0). - X18 is OR'd by kernel with 1, to make sure it is odd.
* | / blit_image: Remove unused functionameerj2021-12-242-50/+0
| |/ |/|
* | Merge pull request #7614 from liushuyu/fix-linux-inhibitbunnei2021-12-233-0/+64
|\ \ | |/ |/| main: Fix wake lock (prevent sleep) in Flatpak
| * main: reword inhibit reasonliushuyu2021-12-221-2/+3
| |
| * main: fix wake lock in Flatpak ...liushuyu2021-12-223-0/+63
| | | | | | | | ... by using the XDP system
* | Merge pull request #7616 from bunnei/fix-get-idle-ticksFernando S2021-12-221-14/+9
|\ \ | | | | | | hle: kernel: svc: GetInfo: Fix error checking with IdleTickCount.
| * | hle: kernel: svc: GetInfo: Fix error checking with IdleTickCount.bunnei2021-12-221-14/+9
| | | | | | | | | | | | | | | - Enforce tha the supplied handle is invalid, not valid. - This gets Witcher 3 booting.
* | | Merge pull request #7375 from vonchenplus/convert_legacyFernando S2021-12-2212-293/+109
|\ \ \ | |_|/ |/| | Convert all legacy attributes to generic attributes
| * | Address format clangvonchenplus2021-12-183-38/+38
| | |
| * | Remove spirv handle legacy related codevonchenplus2021-12-184-190/+1
| | |
| * | Remove glsl handle legacy related codevonchenplus2021-12-183-103/+1
| | |
| * | Merge branch 'yuzu-emu:master' into convert_legacyFeng Chen2021-12-18334-12898/+18256
| |\ \
| * | | Implement convert legacy to genericFeng Chen2021-11-196-1/+108
| | | |
* | | | Merge pull request #7599 from FernandoS27/primrestart-vulkanbunnei2021-12-223-5/+50
|\ \ \ \ | | | | | | | | | | Vulkan: Fix Primitive Restart and implement Logical Operations
| * | | | Vulkan: Fix the checks for primitive restart extension.Fernando Sahmkow2021-12-183-21/+28
| | | | |
| * | | | Vulkan: implement Logical Operations.Fernando Sahmkow2021-12-182-3/+3
| | | | |
| * | | | Vulkan: Implement VK_EXT_primitive_topology_list_restartFernando Sahmkow2021-12-183-2/+40
| | | | |
* | | | | Merge pull request #7602 from jbeich/freebsd-vaapibunnei2021-12-221-1/+1
|\ \ \ \ \ | |_|_|_|/ |/| | | | build: enable VA-API on FreeBSD
| * | | | video_core/codecs: re-enable VAAPI/VDPAU on BSDs after 72aa418b0b41Jan Beich2021-12-181-1/+1
| | | | |
* | | | | Merge pull request #7604 from ameerj/fullscreen-render-windowbunnei2021-12-221-25/+16
|\ \ \ \ \ | | | | | | | | | | | | main: Make separate render window fullscreen toggle on the monitor it resides in
| * | | | | main: Refactor to reduce code duplication in ShowFullscreen()ameerj2021-12-191-25/+16
| | | | | |
| * | | | | main: Make render window borderless fullscreen toggle on the monitor it resides inameerj2021-12-191-1/+1
| |/ / / / | | | | | | | | | | | | | | | | | | | | | | | | | Toggling borderless fullscreen on the separate render window made it fullscreen on the monitor which the main yuzu window resided in. This change allows the render window to go fullscreen on the monitor it resides in, independent of the main window location.
* | | | | Merge pull request #7608 from Tatsh/scm-ver-overridebunnei2021-12-221-0/+5
|\ \ \ \ \ | | | | | | | | | | | | Allow overriding SCM version info
| * | | | | Allow overriding SCM version infoAndrew Udvare2021-12-211-0/+5
| | |/ / / | |/| | | | | | | | | | | | | | | | | | | | | | | If the build is from a non-repository, these functions will return empty. This patch allows using defines to CMake to set version info such as -DGIT_BRANCH=master.
* | | | | Merge pull request #7481 from german77/gyro-biasbunnei2021-12-216-20/+32
|\ \ \ \ \ | | | | | | | | | | | | service/hid: Improve console motion accuracy
| * | | | | service/hid: Improve console motion accuracyNarr the Reg2021-12-136-20/+32
| | | | | |
* | | | | | Merge pull request #7597 from bunnei/remove-global-lockbunnei2021-12-2011-67/+1
|\ \ \ \ \ \ | | | | | | | | | | | | | | core: hle: Remove global HLE lock.
| * | | | | | core: hle: Remove global HLE lock.bunnei2021-12-1811-67/+1
| | |/ / / / | |/| | | | | | | | | | | | | | | | | | | | | | - This was added early on as a hack to protect against some concurrency issues. - It's not clear that this serves any purpose anymore, and if it does, individual components should be fixed rather than using a global recursive mutex.
* | | | | | kernel: Manually destroy the current process during shut downameerj2021-12-191-1/+4
| |_|/ / / |/| | | | | | | | | | | | | | Avoids a memory leak.
* | | | | Merge pull request #7593 from german77/brrr_testMorph2021-12-185-23/+19
|\ \ \ \ \ | | | | | | | | | | | | core/hid: Cancel any vibration after the test
| * | | | | core/hid: Cancel any vibration after the testNarr the Reg2021-12-165-23/+19
| | | | | |
* | | | | | Merge pull request #7600 from bunnei/fix-kip-loadingMorph2021-12-181-1/+7
|\ \ \ \ \ \ | | | | | | | | | | | | | | core: loader: kip: Minimal changes to fix KIP loading.
| * | | | | | core: loader: kip: Minimal changes to fix KIP loading.bunnei2021-12-181-1/+7
| | | | | | | | | | | | | | | | | | | | | | | | | | | | - Allows us to boot KIP (kernal apps), useful for testing the kernel.
* | | | | | | Merge pull request #7587 from liushuyu/fix-linux-decodingbunnei2021-12-181-0/+6
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | [Patch v2] externals/ffmpeg: refactor ffmpeg searching and handling in cmake
| * | | | | | | video_core/codecs: (re-spin) refactor ffmpeg searching and handlingliushuyu2021-12-161-0/+6
| | |/ / / / / | |/| | | | |
* | | | | | | Merge pull request #7302 from VPeruS/check-deadlockbunnei2021-12-184-44/+190
|\ \ \ \ \ \ \ | |_|/ / / / / |/| | | | | | [input_common] Fixed thread hang
| * | | | | | [input_common] Move variable declaration closer to usagevperus2021-12-171-2/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | MSVC supplied with VS2022 generates "warning C4189: 'CALIBRATION_THRESHOLD': local variable is initialized but not referenced" which is treated as an error. Circumvent it by moving constexpr variable directly into body of lambda function.
| * | | | | | Revert of b01aa72vperus2021-11-291-35/+39
| | | | | | | | | | | | | | | | | | | | | | | | | | | | Caused worker_thread to be stuck in Stage1Completed state until job's destruction.
| * | | | | | [input_common] Add completion test for CalibrationConfigurationJobvperus2021-11-293-9/+151
| | | | | | |
* | | | | | | Merge pull request #7399 from ameerj/art-refactorFernando S2021-12-188-152/+147
|\ \ \ \ \ \ \ | |_|_|_|_|_|/ |/| | | | | | video_core: Refactoring post A.R.T. merge
| * | | | | | vk_texture_cache: Add ABGR src format check for D24S8 conversionsameerj2021-12-051-1/+5
| | | | | | |
| * | | | | | renderer_opengl: Minor refactoring of filter selectionameerj2021-12-051-30/+20
| | | | | | |
| * | | | | | texture_cache: Fix image convert dimensions assertionameerj2021-12-051-1/+12
| | | | | | |
| * | | | | | blit_image: Refactor upscale factors usageameerj2021-12-056-62/+53
| | | | | | | | | | | | | | | | | | | | | | | | | | | | The image view itself can be queried to see if it is being rescaled or not, removing the need to pass the upscale/down shift factors from the texture cache.
| * | | | | | vk_texture_cache: Add a function to ImageView to check if src image is rescaledameerj2021-12-052-4/+22
| | | | | | |
| * | | | | | blit_image: Refactor ConvertPipeline functionsameerj2021-12-052-29/+15
| | | | | | |
| * | | | | | blit_image: Refactor ConvertPipelineEx functionsameerj2021-12-052-33/+18
| | | | | | | | | | | | | | | | | | | | | | | | | | | | reduces much of the duplication between the color/depth variants
| * | | | | | vk_blit_screen: Minor refactor of filter pipeline selectionameerj2021-12-051-21/+16
| | | | | | |
| * | | | | | Revert "Merge pull request #7395 from Morph1984/resolve-comments"ameerj2021-12-053-16/+31
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This reverts commit d20f91da11fe7c5d5f1bd4f63cc3b4d221be67a4, reversing changes made to 5082712b4e44ebfe48bd587ea2fa38767b7339cb.
* | | | | | | Merge pull request #7570 from ameerj/favorites-expandedbunnei2021-12-183-7/+17
|\ \ \ \ \ \ \ | |_|_|_|/ / / |/| | | | | | game_list: Add persistent setting for the favorites row expanded state
| * | | | | | game_list: Add persistent setting for the favorites row expanded stateameerj2021-12-123-7/+17
| | | | | | | | | | | | | | | | | | | | | | | | | | | | Previously, the favorites row was always expanded on launch. This change introduces a persistent setting that allows the favorites row's expanded state to be remembered between launches.
* | | | | | | Merge pull request #7532 from goldenx86/patch-3bunnei2021-12-161-8/+5
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | Update video core popup
| * | | | | | | Suggestions from CrusadingNinjaMatías Locatti2021-12-161-2/+2
| | | | | | | |
| * | | | | | | Changed linkMatías Locatti2021-12-161-1/+1
| | | | | | | |
| * | | | | | | main: Update video core popupMatías Locatti2021-12-071-8/+5
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Old version had formatting issues, and I want to provide an answer to the most common reason this pops up in the first place, outdated drivers.
* | | | | | | | Merge pull request #7551 from vonchenplus/fix_blit_image_view_mismatchingbunnei2021-12-161-1/+6
|\ \ \ \ \ \ \ \ | |_|_|_|_|/ / / |/| | | | | | | Fix blit image/view not compatible
| * | | | | | | Fix blit image/view not compatibleFeng Chen2021-12-101-1/+6
| | |/ / / / / | |/| | | | |
* | | | | | | Merge pull request #7588 from Wunkolo/gibibibi-bytesbunnei2021-12-151-4/+6
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | yuzu/main: Fix host memory byte units. GB to GiB
| * | | | | | | yuzu/main: Fix host memory byte units. GB to GiBWunkolo2021-12-151-4/+6
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | I have `134850146304` bytes of ram and Yuzu was saying that I had `125.59 GB` of ram. But `125.59` is actually the amount of gi**bi**bytes I have. In gi**ga**bytes I would have `134.9`. Additionally, I changed the `1024 / 1024 / 1024` here into the `_GiB` user-literals that I added a while ago(#6519). https://www.wolframalpha.com/input/?i=134850146304+bytes
* | | | | | | | Revert "video_core/codecs: refactor ffmpeg searching and handling in cmake"bunnei2021-12-151-6/+0
|/ / / / / / /
* | | | | | | Merge pull request #7565 from liushuyu/fix-linux-decodingbunnei2021-12-151-0/+6
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | video_core/codecs: refactor ffmpeg searching and handling in cmake
| * | | | | | | CI: fix CI on Linuxliushuyu2021-12-141-3/+0
| | | | | | | |
| * | | | | | | video_core/codecs: skip decoders that use hw frames ...liushuyu2021-12-141-0/+9
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | ... this would resolve some edge-cases where multiple devices are present and ffmpeg is unable to auto-supply the hw surfaces
* | | | | | | | Merge pull request #7558 from Morph1984/unused-cpu-family-modelMai M2021-12-151-12/+0
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | common/cpu_detect: Remove CPU family and model
| * | | | | | | | common/cpu_detect: Remove CPU family and modelMorph2021-12-141-12/+0
| | |/ / / / / / | |/| | | | | | | | | | | | | | | | | | | | | | We currently do not make use of these fields, remove them for now.
* | | | | | | | Merge pull request #7549 from Morph1984/astc-8x5Mai M2021-12-151-2/+2
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | maxwell_to_vk: Add ASTC_2D_8X5_UNORM
| * | | | | | | | maxwell_to_vk: Add ASTC_2D_5X4_UNORMMorph2021-12-111-1/+1
| | | | | | | | |
| * | | | | | | | maxwell_to_vk: Add ASTC_2D_8X5_UNORMMorph2021-12-091-1/+1
| |/ / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | - Used by Lego City Undercover
* | | | | | | | Merge pull request #7579 from Morph1984/swkbd-oob-array-accessMai M2021-12-151-4/+19
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | qt_software_keyboard: Fix out of bounds array access
| * | | | | | | | qt_software_keyboard: Fix out of bounds array accessMorph2021-12-141-4/+19
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | We were unconditionally accessing the keyboard_buttons array, even if the bottom_osk_index was for the numberpad, leading to an out of bounds array access. Fix this by accessing the proper array for the current button when the index is for the numberpad.
* | | | | | | | | core/hid: Fix faulty analog triggersNarr the Reg2021-12-151-2/+2
| | | | | | | | |
* | | | | | | | | Merge pull request #7581 from lioncash/input-ifaceNarr the Reg2021-12-1510-155/+192
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | common/input: Avoid numerous large copies of CallbackStatus
| * | | | | | | | | common/input: Avoid numerous large copies of CallbackStatusLioncash2021-12-149-129/+171
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | CallbackStatus instances aren't the cheapest things to copy around (relative to everything else), given that they're currently 520 bytes in size and are currently copied numerous times when callbacks are invoked. Instead, we can pass the status by const reference to avoid all the copying.
| * | | | | | | | | common/input: Remove unnecessary returnsLioncash2021-12-141-6/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Given these return void, these can be omitted.
| * | | | | | | | | input_poller: Add missing override specifiersLioncash2021-12-141-20/+19
| | | | | | | | | |
* | | | | | | | | | Merge pull request #7577 from v1993/patch-2Narr the Reg2021-12-141-3/+4
|\ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | input/SDL: Update SDL hints
| * | | | | | | | | | input/SDL: Update SDL hintsValeri2021-12-141-3/+4
| | |/ / / / / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | SDL_HINT_JOYSTICK_HIDAPI_SWITCH_HOME_LED is no longer needed thanks to new default in SDL 2.0.18. SDL_HINT_JOYSTICK_HIDAPI_XBOX is reported to cause conflicts with native driver Xbox driver on Linux, and Xbox controllers don't benefit from hidapi anyways.
* | | | | | | | | | input_mapping: Amend specification of parametersLioncash2021-12-141-14/+14
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | param tags are supposed to specify the parameter name without any quoting. Silences several -Wdocumentation warnings.
* | | | | | | | | | input_poller: Remove several unnecessary @param tagsLioncash2021-12-141-106/+106
| |/ / / / / / / / |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Silences quite a bit of -Wdocumentation warnings, given the @param tag is only intended to be used to identify function parameters, not what it contains.
* | | | | | | | | Merge pull request #7575 from lioncash/inputbunnei2021-12-1418-114/+109
|\ \ \ \ \ \ \ \ \ | |_|_|/ / / / / / |/| | | | | | | | input_engine: Minor object churn cleanup
| * | | | | | | | input_engine: Fix typo in TriggerOnAxisChange() parameter nameLioncash2021-12-131-1/+1
| | | | | | | | |
| * | | | | | | | input_engine: Simplify PreSet* family of functionsLioncash2021-12-132-24/+14
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | We can make use of try_emplace() to insert values only if they don't already exist.
| * | | | | | | | input_engine: Avoid redundant map lookupsLioncash2021-12-131-16/+24
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | We can use iterators to avoid looking up into maps twice in the getter functions. At the same time we can also avoid copying the ControllerData structs, since they're 264 bytes in size.
| * | | | | | | | input_engine: Remove left-over namespace qualifiersLioncash2021-12-131-3/+3
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | These types are part of the InputCommon namespace.
| * | | | | | | | input_engine: Iterate by reference rather than by value where applicableLioncash2021-12-131-10/+10
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Avoids creating copies of several object instances (some of which being over 100 bytes in size).
| * | | | | | | | input_engine: Take BasicMotion by const reference with SetMotion() and TriggerOnMotionChange()Lioncash2021-12-133-6/+7
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Copies the BasicMotion instance once instead of twice.
| * | | | | | | | input_engine: std::move InputIdentifier in SetCallback()Lioncash2021-12-131-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Allows avoiding std::function allocations.
| * | | | | | | | input_engine: Pass LedStatus by const referenceLioncash2021-12-133-3/+3
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Avoids copies where reasonably applicable
| * | | | | | | | input_engine: Pass VibrationStatus by const reference in SetRumble()Lioncash2021-12-137-12/+12
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Avoids creating copies of the struct where not necessary.
| * | | | | | | | input_engine: std::move engine name where applicableLioncash2021-12-1315-29/+29
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | We can allow the name to be moved into, allowing allocations to be avoided.
| * | | | | | | | input_engine: Remove callback clearing in constructorLioncash2021-12-131-3/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The callback map is a member variable, so this will always be empty on initial construction.
| * | | | | | | | input_engine: Remove unnecessary semi-colonsLioncash2021-12-131-6/+6
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Silences -Wextra-semi warnings
| * | | | | | | | input_engine: Remove unnecessary returnLioncash2021-12-131-3/+1
| |/ / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | This is a void function, so it doesn't need this.
* | | | | | | | tas_input: Avoid minor copies in Read/WriteCommandButtons()Lioncash2021-12-131-2/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | We don't need to copy the whole pair
* | | | | | | | tas_input: Remove unnecessary semicolonLioncash2021-12-131-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Resolves a -Wextra-semi warning
* | | | | | | | tas_input: Execute clear() even if emptyLioncash2021-12-131-3/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | clear() when empty is simply a no-op, so we can get rid of the check here and let the stdlib do it for us.
* | | | | | | | tas_input: Remove unnecessary includesLioncash2021-12-131-2/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Gets rid of indirect includes and includes only what the interface needs.
* | | | | | | | tas_input: std::move strings into vectorLioncash2021-12-131-21/+24
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | While we're in the same area, we can also avoid performing std::stoi in a loop when it only needs to be performed once.
* | | | | | | | tas_input: Use istringstream over stringstreamLioncash2021-12-131-2/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This is only using the input facilities, so we don't need to use the fully-fleged stringstream.
* | | | | | | | tas_input: Use u8string_view instead of u8stringLioncash2021-12-132-6/+7
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Same behavior, but without the potential for extra allocations.
* | | | | | | | tas_input: Remove unused std::smatch variableLioncash2021-12-131-2/+0
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This also means we can get rid of the dependency on <regex>
* | | | | | | | tas_input: Amend -Wdocumentation warningsLioncash2021-12-132-28/+30
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Parameters shouldn't have the colon by their name.
* | | | | | | | tas_input: Make TasAxes enum an enum classLioncash2021-12-132-5/+14
|/ / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | Prevents these values from potentially clashing with anything in other headers.
* | | | | | | Remove erroneous #pragma onceValeri2021-12-131-2/+0
| | | | | | |
* | | | | | | Merge pull request #7462 from bunnei/kernel-improve-schedulingbunnei2021-12-1332-634/+895
|\ \ \ \ \ \ \ | |/ / / / / / |/| | | | | | Kernel: Improve threading & scheduling V3
| * | | | | | hle: kernel k_scheduler: EnableScheduling: Remove redundant GetCurrentThreadPointer calls.bunnei2021-12-071-3/+5
| | | | | | |
| * | | | | | hle: kernel k_process: Remove unnecessary .at usage with thread pinning methods.bunnei2021-12-071-3/+3
| | | | | | |
| * | | | | | hle: kernel: Remove unnecessary virtual specifier on NotifyAvailable.bunnei2021-12-071-2/+2
| | | | | | |
| * | | | | | hle: kernel: Remove unnecessary virtual specifier on EndWait.bunnei2021-12-071-1/+1
| | | | | | |
| * | | | | | hle: kernel: k_light_condition_variable: Revert unnecessary license comment changes.bunnei2021-12-071-1/+1
| | | | | | |
| * | | | | | hle: kernel: k_condition_variable: Revert unnecessary style changes.bunnei2021-12-071-2/+2
| | | | | | |
| * | | | | | hle: kernel: Remove unnecessary virtual specifier on CancelWait.bunnei2021-12-076-14/+14
| | | | | | |
| * | | | | | hle: kernel: service_thread: Force stop threads on destruction.bunnei2021-12-071-1/+7
| | | | | | |
| * | | | | | hle: kernel: k_light_lock: Implement CancelWait.bunnei2021-12-071-5/+10
| | | | | | | | | | | | | | | | | | | | | | | | | | | | - Fixes a crash in Megadimension Neptunia VII.
| * | | | | | hle: kernel: service_thread: Use std::jthread.bunnei2021-12-071-18/+19
| | | | | | | | | | | | | | | | | | | | | | | | | | | | - Fixes a potential deadlock on service thread shutdown.
| * | | | | | hle: kernel: k_thread: Skip reschedule on DisableDispatch with SC.bunnei2021-12-071-0/+5
| | | | | | |
| * | | | | | hle: kernel: k_thread: Rename sleeping_queue -> wait_queue.bunnei2021-12-072-17/+13
| | | | | | |
| * | | | | | hle: kernel: svc: Fix deadlock that can occur with single core.bunnei2021-12-071-10/+8
| | | | | | |
| * | | | | | hle: kernel: k_thread: Treat dummy threads as a special type.bunnei2021-12-072-1/+4
| | | | | | |
| * | | | | | hle: kernel: fix timing on thread preemptionFernandoS272021-12-071-4/+2
| | | | | | |
| * | | | | | hle: kernel: fix scheduling ops from HLE host thread.FernandoS272021-12-071-3/+3
| | | | | | |
| * | | | | | hle: kernel: Add a flag for indicating that the kernel is currently shutting down.bunnei2021-12-076-0/+49
| | | | | | |
| * | | | | | hle: kernel: KSynchronizationObject: Fix variable shadowing.bunnei2021-12-071-8/+8
| | | | | | |
| * | | | | | hle: kernel: Cleanup to match coding style.bunnei2021-12-076-26/+21
| | | | | | |
| * | | | | | hle: kernel: KProcess: Improvements for thread pinning.bunnei2021-12-072-8/+26
| | | | | | |
| * | | | | | hle: kernel: KThreadQueue: Remove deprecated code.bunnei2021-12-071-63/+0
| | | | | | |
| * | | | | | hle: kernel: KConditionVariable: Various updates & simplifications.bunnei2021-12-072-121/+65
| | | | | | |
| * | | | | | hle: kernel: KThread: Migrate to updated KThreadQueue (part 2).bunnei2021-12-071-29/+19
| | | | | | |
| * | | | | | hle: kernel: KThread: Migrate to updated KThreadQueue (part 1).bunnei2021-12-073-60/+71
| | | | | | |
| * | | | | | hle: kernel: KConditionVariable: Migrate to updated KThreadQueue.bunnei2021-12-071-12/+55
| | | | | | |
| * | | | | | hle: kernel: KServerSession: Migrate to updated KThreadQueue.bunnei2021-12-072-5/+11
| | | | | | |
| * | | | | | hle: kernel: KLightConditionVariable: Migrate to updated KThreadQueue.bunnei2021-12-073-54/+87
| | | | | | |
| * | | | | | hle: kernel: KLightLock: Migrate to updated KThreadQueue.bunnei2021-12-072-35/+36
| | | | | | |
| * | | | | | hle: kernel: KAddressArbiter: Migrate to updated KThreadQueue.bunnei2021-12-071-43/+39
| | | | | | |
| * | | | | | hle: kernel: KThread: Remove tracking of sync object from threads.bunnei2021-12-076-41/+21
| | | | | | |
| * | | | | | hle: kernel: Update KThreadQueue and migrate KSynchronizationObject.bunnei2021-12-078-75/+251
| | | | | | |
| * | | | | | core: hle: kernel: Disable dispatch count tracking on single core.bunnei2021-12-073-5/+14
| | | | | | | | | | | | | | | | | | | | | | | | | | | | - This would have limited value, and would be a mess to handle properly.
| * | | | | | core: hle: kernel: k_thread: Mark KScopedDisableDispatch as nodiscard.bunnei2021-12-071-1/+1
| | | | | | |
| * | | | | | core: cpu_manager: Use invalid core_id on init and simplify shutdown.bunnei2021-12-071-7/+3
| | | | | | |
| * | | | | | core: hle: kernel: k_auto_object: Add GetName method.bunnei2021-12-071-0/+4
| | | | | | | | | | | | | | | | | | | | | | | | | | | | - Useful purely for debugging.
| * | | | | | core: hle: kernel: DisableDispatch on suspend threads.bunnei2021-12-071-0/+3
| | | | | | |
| * | | | | | core: hle: kernel: k_scheduler: Improve DisableScheduling and EnableScheduling.bunnei2021-12-071-14/+9
| | | | | | |
| * | | | | | core: cpu_manager: Use KScopedDisableDispatch.bunnei2021-12-071-7/+8
| | | | | | |
| * | | | | | core: hle: kernel: Use CurrentPhysicalCoreIndex as appropriate.bunnei2021-12-071-6/+2
| | | | | | |
| * | | | | | core: hle: kernel: k_scheduler: Remove unnecessary MakeCurrentProcess.bunnei2021-12-071-5/+0
| | | | | | |
| * | | | | | core: hle: kernel: k_scheduler: Improve ScheduleImpl.bunnei2021-12-071-6/+7
| | | | | | |
| * | | | | | core: hle: kernel: k_scheduler: Improve Unload.bunnei2021-12-071-17/+29
| | | | | | |
| * | | | | | core: hle: kernel: k_process: DisableDispatch on main thread.bunnei2021-12-071-0/+1
| | | | | | |
| * | | | | | core: hle: kernel: k_handle_table: Use KScopedDisableDispatch as necessary.bunnei2021-12-072-0/+8
| | | | | | |
| * | | | | | core: hle: kernel: k_thread: Add KScopedDisableDispatch.bunnei2021-12-072-1/+47
| | | | | | |
| * | | | | | core: hle: kernel: Ensure idle threads are closed before destroying scheduler.bunnei2021-12-073-24/+22
| | | | | | |
| * | | | | | core: hle: kernel: Reflect non-emulated threads as core 3.bunnei2021-12-077-14/+17
| |/ / / / /
* | | | | | Merge pull request #7495 from FernandoS27/text-blit-fix-againMorph2021-12-091-3/+6
|\ \ \ \ \ \ | | | | | | | | | | | | | | Texture Cache: Fix mismatching image/views on blits
| * | | | | | Texture Cache: Fix crashes on NVIDIA.Fernando Sahmkow2021-12-041-3/+6
| | | | | | |
* | | | | | | Merge pull request #7519 from itsmeft24/masterbunnei2021-12-0912-6/+611
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | kernel: svc: Implement ProcessMemory and CodeMemory SVCs
| * | | | | | | Update k_code_memory.hitsmeft242021-12-071-6/+6
| | | | | | | |
| * | | | | | | make KCodeMemory::GetSourceAddress constitsmeft242021-12-071-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | Co-authored-by: Mai M. <mathew1800@gmail.com>
| * | | | | | | fix formattingitsmeft242021-12-061-1/+6
| | | | | | | |
| * | | | | | | move private members below public membersitsmeft242021-12-061-10/+11
| | | | | | | |
| * | | | | | | fix formattingitsmeft242021-12-061-4/+1
| | | | | | | |
| * | | | | | | fix formattingitsmeft242021-12-061-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | Co-authored-by: Mai M. <mathew1800@gmail.com>
| * | | | | | | fix formattingitsmeft242021-12-062-2/+2
| | | | | | | |
| * | | | | | | Remove unnecessary includesitsmeft242021-12-062-50/+13
| | | | | | | |
| * | | | | | | Add copyright noticeitsmeft242021-12-052-0/+8
| | | | | | | |
| * | | | | | | Add KCodeMemory to CMakeLists.txtitsmeft242021-12-051-0/+2
| | | | | | | |
| * | | | | | | kernel: svc: Implement Map/UnmapProcessMemory and Create/ControlCodeMemoryitsmeft242021-12-0511-7/+636
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Used by Skyline modding framework
* | | | | | | | profiler: Use QWheelEvent position().toPoint()Morph2021-12-081-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | QWheelEvent::pos() is deprecated. Make use of position().toPoint() instead.
* | | | | | | | renderer_vulkan: Add R16G16_UINTMorph2021-12-082-1/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | - Used by Immortals Fenyx Rising
* | | | | | | | Merge pull request #7525 from german77/notifabunnei2021-12-086-0/+77
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | service/notif: Add notif:a and stub ListAlarmSettings, Initialize
| * | | | | | | | service/notif: Add notif:a and stub ListAlarmSettings,Initializegerman772021-12-066-0/+77
| | |_|_|/ / / / | |/| | | | | | | | | | | | | | | | | | | | | | Used by ring fit adventure 1.2.0
* | | | | | | | Merge pull request #7521 from german77/dual_single_joyconsbunnei2021-12-085-38/+174
|\ \ \ \ \ \ \ \ | |_|_|_|_|_|/ / |/| | | | | | | service/hid: Implement SetNpadJoyAssignmentMode
| * | | | | | | service/hid: Implement SetNpadJoyAssignmentModegerman772021-12-055-38/+174
| |/ / / / / /
* | | | | | | Merge pull request #7488 from vonchenplus/support_multiple_videos_playingbunnei2021-12-088-40/+45
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | Support multiple videos playing
| * | | | | | | Address feedbackFeng Chen2021-12-045-17/+27
| | | | | | | |
| * | | | | | | Support multiple videos playingFeng Chen2021-12-026-41/+36
| | | | | | | |
* | | | | | | | Merge pull request #7506 from heinermann/focus_crashMai M2021-12-081-8/+9
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | Fixed #7502
| * | | | | | | | Fixed #7502Adam Heinermann2021-12-051-8/+9
| | |_|_|/ / / / | |/| | | | | |
* | | | | | | | Merge pull request #7522 from ameerj/shader-recompiler-filenamesMai M2021-12-0865-214/+282
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | shader_recompiler/backend: Minor organization and refactoring to reduce compile time overhead
| * | | | | | | | emit_spirv: Reduce emit_spirv.h include overheadameerj2021-12-0620-3/+20
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | emit_spirv.h is included in video_core, which was propagating further includes that video_core did not depend on.
| * | | | | | | | glasm: Move implemented instructions from not_implemented.cppameerj2021-12-067-169/+220
| | | | | | | | |
| * | | | | | | | shader_recompiler: Adjust emit_context includesameerj2021-12-0637-37/+37
| | | | | | | | |
| * | | | | | | | shader_recompiler: Rename backend emit_context filesameerj2021-12-057-6/+6
| | |_|/ / / / / | |/| | | | | |
* | | | | | | | CMakeLists: Specify /Zm200 when compiling in MSVCMorph2021-12-071-0/+2
| |_|_|_|/ / / |/| | | | | | | | | | | | | | | | | | | | This increases the memory heap size for constructing precompiled headers to 2x the default.
* | | | | | | Merge pull request #7524 from german77/hid_stubbunnei2021-12-062-2/+35
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | service/hid: Stub SetNpadCaptureButtonAssignment and ClearNpadCaptureButtonAssignment
| * | | | | | | service/hid: Stub SetNpadCaptureButtonAssignment and ClearNpadCaptureButtonAssignmentgerman772021-12-062-2/+35
| |/ / / / / / | | | | | | | | | | | | | | | | | | | | | Used by ring fit adventure 1.2.0
* | | | | | | loader: Support loading subsdk{8,9}jam1garner2021-12-061-2/+3
| | | | | | |
* | | | | | | general: Add missing copyright noticesameerj2021-12-055-0/+20
|/ / / / / /
* | | / / / core/hid: Add missing controller typegerman772021-12-051-0/+2
| |_|/ / / |/| | | |
* | | | | Merge pull request #7494 from Morph1984/no-time-to-waitFernando S2021-12-051-18/+18
|\ \ \ \ \ | | | | | | | | | | | | native_clock: Wait for less time in EstimateRDTSCFrequency
| * | | | | native_clock: Wait for less time in EstimateRDTSCFrequencyMorph2021-12-041-18/+18
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | In my testing, waiting for 200ms provided the same level of precision as the previous implementation when estimating the RDTSC frequency. This significantly improves the yuzu executable launch times since we reduced the wait time from 3 seconds to 200 milliseconds.
* | | | | | core/hid: Ensure only valid npad are connectedgerman772021-12-058-88/+147
| |/ / / / |/| | | |
* | | | | Merge pull request #7467 from liushuyu/fix-linux-decodingbunnei2021-12-042-66/+50
|\ \ \ \ \ | |/ / / / |/| | | | video_core/codecs: more robust ffmpeg hwdecoder selection logic
| * | | | video_core/cmake: link against libva explicitly ...liushuyu2021-12-031-0/+1
| | | | | | | | | | | | | | | | | | | | ... to fix build on Flatpak (and self-builds)
| * | | | video_core/codecs: more fixes for VAAPI detection ...liushuyu2021-12-031-63/+25
| | | | | | | | | | | | | | | | | | | | | | | | | * skip impersonated VAAPI implementaions ("imposter detection") * place VAAPI priority below CUDA/NVDEC/CUVID
| * | | | video_core/codec: address commentsliushuyu2021-12-031-8/+12
| | | | |
| * | | | video_core/codecs: more robust ffmpeg hwdecoder selection logicliushuyu2021-12-031-10/+27
| | | | |
* | | | | Merge pull request #7489 from Morph1984/steady-clockbunnei2021-12-047-13/+13
|\ \ \ \ \ | |/ / / / |/| | | | general: Replace high_resolution_clock with steady_clock
| * | | | general: Replace high_resolution_clock with steady_clockMorph2021-12-027-13/+13
| |/ / / | | | | | | | | | | | | On some OSes, high_resolution_clock is an alias to system_clock and is not monotonic in nature. Replace this with steady_clock.
* | | | Merge pull request #7490 from Morph1984/stub-album-save-screenshotbunnei2021-12-033-2/+15
|\ \ \ \ | | | | | | | | | | service: am: ISelfController: Stub SaveCurrentScreenshot
| * | | | service: am: ISelfController: Stub SaveCurrentScreenshotMorph2021-12-033-2/+15
| |/ / / | | | | | | | | | | | | - Used by Disney Magical World 2: Enchanted Edition
* | | | Merge pull request #7452 from german77/controller_navigationMorph2021-12-039-8/+285
|\ \ \ \ | |/ / / |/| | | yuzu: Implement basic controller UI navigation
| * | | yuzu: Implement basic controller navigationgerman772021-12-029-8/+285
| | | |
* | | | service: friend: Implement GetCompletionEventMorph2021-11-301-2/+21
|/ / / | | | | | | | | | - Used by Super Bomberman R Online
* | | Merge pull request #7472 from Morph1984/post-kraken-cleanupNarr the Reg2021-11-3014-112/+149
|\ \ \ | | | | | | | | core: hid: Post kraken cleanup
| * | | input_interpreter: Make use of NpadButton instead of a u64Morph2021-11-302-9/+9
| | | | | | | | | | | | | | | | Allows us to be more explicit with the representation of button states and use the provided bit manipulation operators
| * | | npad: Return NpadButton in GetAndResetPressStateMorph2021-11-303-7/+6
| | | | | | | | | | | | | | | | We were previously truncating this to a u32 as there were no known buttons that used the full 64 bits of this type. Fix this now that we know they are used.
| * | | core: hid: hid_types: Add "All" to NpadButtonMorph2021-11-301-0/+2
| | | | | | | | | | | | | | | | This represents a bitmask for all pressed buttons
| * | | qt_controller: Make use of (Enable/Disable)AllControllerConfigurationMorph2021-11-301-8/+5
| | | | | | | | | | | | | | | | This also moves the use of DisableConfiguration to the destructor.
| * | | core: hid: hid_core: Add (Enable/DIsable)AllControllerConfigurationMorph2021-11-292-0/+32
| | | |
| * | | general: Fix handheld typoMorph2021-11-292-17/+17
| | | |
| * | | core: hid: Mark constructors as explicitMorph2021-11-292-2/+2
| | | |
| * | | core: hid: Cleanup and amend documentationMorph2021-11-294-69/+76
| | | |
* | | | input_common: Fix error with thread nameNarr the Reg2021-11-301-2/+1
| | | |
* | | | Merge pull request #7466 from vonchenplus/add_miss_pixel_format_mappingbunnei2021-11-301-0/+2
|\ \ \ \ | |/ / / |/| | | Add missing pixel format mapping
| * | | Add missing pixel format mappingFeng Chen2021-11-291-0/+2
| |/ /
* / / qt_controller: Fix input when the controller applet is ignoredgerman772021-11-291-0/+3
|/ /
* | Merge pull request #7396 from FernandoS27/blit-this-mfFernando S2021-11-2814-223/+168
|\ \ | | | | | | TextureCache: Eliminate format deduction as full depth conversion has been supported.
| * | Texture Cache: Secure insertions against deletions.Fernando Sahmkow2021-11-281-3/+13
| | |
| * | Texture Cache: Redesigning the blitting system (again).Fernando Sahmkow2021-11-273-23/+64
| | |
| * | Texture Cache: Further fix regressions.Fernando Sahmkow2021-11-261-11/+15
| | |
| * | Texture Cache: Fix issue with blitting 3D textures.Fernando Sahmkow2021-11-221-2/+4
| | |
| * | Texture Cache: Correct conversion shaders.Fernando Sahmkow2021-11-222-2/+2
| | |
| * | Texture Cache: Always copy on NVIDIA.Fernando Sahmkow2021-11-221-0/+5
| | |
| * | TextureCache: Simplify blitting of D24S8 formats and fix bugs.Fernando Sahmkow2021-11-2210-195/+73
| | |
| * | VulkanTexturECache: Use reinterpret on D32_S8 formats.Fernando Sahmkow2021-11-211-2/+7
| | |
| * | HostShaders: Fix D24S8 convertion shaders.Fernando Sahmkow2021-11-216-23/+47
| | |
| * | TextureCache: Eliminate format deduction as full depth conversion has been supported.Fernando Sahmkow2021-11-212-29/+5
| | |
* | | Merge pull request #7438 from german77/homebrew2bunnei2021-11-286-2/+146
|\ \ \ | | | | | | | | Core: Stub services and functions needed for checkpoint
| * | | core/ns: Implement GetReadOnlyApplicationControlDataInterfaceNarr the Reg2021-11-282-1/+26
| | | | | | | | | | | | | | | | Used in checkpoint homebrew
| * | | core/pdm: Stub QueryPlayStatisticsByApplicationIdAndUserAccountIdNarr the Reg2021-11-284-0/+107
| | | | | | | | | | | | | | | | Used in checkpoint homebrew
| * | | core/hid: Stub GetUniquePadsFromNpadNarr the Reg2021-11-271-1/+13
| | | | | | | | | | | | | | | | Used in checkpoint homebrew
* | | | settings: Add debug setting to enable all controllersgerman772021-11-288-0/+75
|/ / /
* | | Merge pull request #7255 from german77/krakenFernando S2021-11-27146-11257/+13922
|\ \ \ | | | | | | | | Project Kraken: Input rewrite
| * | | config: Remove vibration configurationgerman772021-11-277-104/+3
| | | |
| * | | applet/controller: Enable configuring mode while the applet is opengerman772021-11-271-7/+12
| | | |
| * | | input_common: Fully implement UDP controllersNarr the Reg2021-11-2612-40/+397
| | | |
| * | | service/hid: Finish converting LIFO objects and address some nitsNarr the Reg2021-11-2514-95/+50
| | | |
| * | | yuzu: Fix TAS from rebasegerman772021-11-253-9/+11
| | | |
| * | | input_common: Move button names to the frontendgerman772021-11-2512-52/+160
| | | |
| * | | input_common: Fix SDL controller with inverted axisgerman772021-11-252-24/+8
| | | |
| * | | bootmanager: Use cross-platform keyboard inputgerman772021-11-253-39/+58
| | | |
| * | | kraken: Address comments from reviewgerman772021-11-2517-66/+54
| | | | | | | | | | | | | | | | Fix compiler bug
| * | | core/hid: Improve accuary of mouse implementationgerman772021-11-2514-48/+79
| | | |
| * | | core/hid: Fully implement native mousegerman772021-11-2521-1039/+323
| | | |
| * | | input_common: Allow keyboard to be backwards compatiblegerman772021-11-2510-48/+115
| | | |
| * | | core/hid: Improve accuracy of the keyboard implementationgerman772021-11-2513-313/+682
| | | |
| * | | core/hid: Fix keyboard alignmentgerman772021-11-252-12/+14
| | | |
| * | | core/hid: Remove usage of native types, fix a couple of errors with motiongerman772021-11-2511-428/+632
| | | |
| * | | settings: Remove includes of core.hgerman772021-11-2510-57/+55
| | | |
| * | | service/hid: Remove includes of core.h and settings.hgerman772021-11-2529-67/+67
| | | |
| * | | UI nitsLevi Behunin2021-11-251-9/+6
| | | | | | | | | | | | | | | | | | | | Set top margin to 6 on Right Stick, LeftStick, Face Buttons, D-Pad. Change property on Input Device QComboBox from minimumSize to minimumContentsLength.
| * | | service/hid: Add support for new controllersgerman772021-11-252-2/+31
| | | |
| * | | settings: Fix controller preview not displaying the correct controllergerman772021-11-253-4/+7
| | | |
| * | | core/hid: Rename NpadType to NpadStyleIndexgerman772021-11-2515-215/+228
| | | |
| * | | config: Cleanup and documentationgerman772021-11-258-99/+46
| | | |
| * | | input_common: Fix motion from 3 axisgerman772021-11-251-0/+2
| | | |
| * | | core/hid: Prevent Emulated controller from flapping with multiple inputs devicesgerman772021-11-255-36/+77
| | | |
| * | | core/hid: Fully emulate motion from buttongerman772021-11-257-37/+97
| | | |
| * | | second commit lion reviewgerman772021-11-2528-42/+73
| | | |
| * | | settings: Fix Debug controller type optionsgerman772021-11-2513-95/+77
| | | |
| * | | kraken: Address comments from reviewgerman772021-11-2531-466/+534
| | | | | | | | | | | | | | | | start lion review
| * | | input_common: Revert deleted TAS functionsgerman772021-11-257-48/+122
| | | |
| * | | core/hid: Explain better what a temporary value doesgerman772021-11-252-24/+28
| | | |
| * | | input_common: Fix GC adapter initializationgerman772021-11-251-12/+12
| | | | | | | | | | | | | | | | Fix GC controller
| * | | core/hid: Update structs to 13.1.0german772021-11-2512-50/+107
| | | |
| * | | core/hid: Add TAS inputgerman772021-11-256-13/+82
| | | |
| * | | input_common: Fix UDP uuidgerman772021-11-253-2/+16
| | | |
| * | | input_common: Add multiple vibration curvesgerman772021-11-252-15/+28
| | | |
| * | | core/hid: Rework battery mappingsgerman772021-11-259-46/+109
| | | |
| * | | input_common: Add manual update options to input devicesgerman772021-11-255-0/+56
| | | |
| * | | service/hid: Fix memory allocated incorrectlygerman772021-11-255-7/+7
| | | |
| * | | settings: Fix mouse and keyboard mappingsgerman772021-11-2510-105/+102
| | | |
| * | | web_applet: Replace HIDButton with NpadButtongerman772021-11-253-36/+44
| | | |
| * | | Morph review first wavegerman772021-11-2523-136/+117
| | | |
| * | | service/hid: Match shared memory closer to HWgerman772021-11-252-26/+75
| | | |
| * | | yuzu: Fix loading input profilesgerman772021-11-252-0/+9
| | | |
| * | | kraken: Address comments from reviewgerman772021-11-2515-56/+56
| | | | | | | | | | | | | | | | review fixes
| * | | service/hid: Use ring buffer for gesturesgerman772021-11-252-79/+52
| | | |
| * | | service/hid: Fix gesture inputgerman772021-11-258-91/+159
| | | |
| * | | configuration: Migrate controller settings to emulated controllergerman772021-11-2512-127/+141
| | | |
| * | | core/hid: Fix rumble too strong at 1%german772021-11-253-13/+48
| | | |
| * | | core/hid: Only signal when neededgerman772021-11-2511-153/+240
| | | |
| * | | hid: Fix controller connection/disconnectiongerman772021-11-2510-65/+226
| | | |
| * | | core/hid: Documment some filesgerman772021-11-254-52/+265
| | | |
| * | | kraken: Fix errors from rebase and format filesgerman772021-11-2520-53/+83
| | | |
| * | | core/hid: Add output devicesgerman772021-11-2520-144/+312
| | | |
| * | | core: Update input interpretergerman772021-11-254-54/+18
| | | |
| * | | yuzu: Update overlay appletgerman772021-11-252-16/+21
| | | |
| * | | core/frontend: Update appletsgerman772021-11-252-10/+15
| | | |
| * | | core: Remove frontend/inputgerman772021-11-251-217/+0
| | | |
| * | | service/hid: Rewrite npad to use ring lifo and the emulated controllergerman772021-11-252-890/+605
| | | |
| * | | service/hid: Update console sixaxis to the emulated consolegerman772021-11-252-28/+26
| | | |
| * | | service/hid: Update mouse and keyboard to use ring lifo and the emulated devicegerman772021-11-254-158/+71
| | | |
| * | | service/hid: Update touch and gestures to use ring lifo and the emulated consolegerman772021-11-254-370/+191
| | | |
| * | | service/hid: Update debug pad, xpad, stubbed and controller base to use ring lifo and the emulated controllergerman772021-11-257-166/+80
| | | |
| * | | service/hid: Use remove duplicated code, update namesgerman772021-11-252-64/+30
| | | |
| * | | service/hid: Create ring LIFOgerman772021-11-252-1/+55
| | | |
| * | | Qt_applets: Use new inputgerman772021-11-255-49/+68
| | | |
| * | | settings: Cleanup settingsgerman772021-11-256-9/+16
| | | |
| * | | debugger/controller: Remove TASgerman772021-11-252-46/+5
| | | |
| * | | core/emu_window: Remove touch inputgerman772021-11-252-113/+15
| | | |
| * | | yuzu: Update frontendgerman772021-11-2513-1010/+822
| | | |
| * | | core: Register HIDgerman772021-11-253-4/+25
| | | |
| * | | core/hid: Add emulated controllersgerman772021-11-259-0/+2025
| | | |
| * | | yuzu_cmd: Use new inputgerman772021-11-253-45/+39
| | | |
| * | | yuzu: Use new input on main and bootmanagergerman772021-11-253-68/+59
| | | |
| * | | input_common: Rewrite main and add the new driversgerman772021-11-252-49/+330
| | | |
| * | | input_common: Remove obsolete filesgerman772021-11-255-444/+0
| | | |
| * | | input_common: Rewrite SDLgerman772021-11-256-1757/+950
| | | |
| * | | input_common: Rewrite udp clientgerman772021-11-255-441/+54
| | | |
| * | | input_common: Rewrite tas inputgerman772021-11-255-840/+2
| | | |
| * | | input_common: Rewrite gc_adaptergerman772021-11-258-827/+848
| | | |
| * | | input_common: Rewrite touchgerman772021-11-253-0/+99
| | | |
| * | | input_common: Rewrite mousegerman772021-11-257-751/+217
| | | |