summaryrefslogtreecommitdiffstats
Commit message (Collapse)AuthorAgeFilesLines
* Merge pull request #8772 from liushuyu/remove-common-intrinbunnei2022-08-181-1/+0
|\ | | | | common: remove unneeded x86-specific header
| * common: remove unneeded x86-specific headerliushuyu2022-08-161-1/+0
|/
* Merge pull request #8685 from FearlessTobi/multiplayer-part2bunnei2022-08-1637-539/+1459
|\ | | | | core, network: Add ability to proxy socket packets
| * core/socket_proxy: Final nitsFearlessTobi2022-08-151-8/+7
| |
| * core: network: Address review commentsgerman772022-08-155-32/+31
| |
| * yuzu: Fix crash on shutdownFearlessTobi2022-08-152-6/+4
| | | | | | | | | | | | Previously, accessing the room_network when it was already freed would crash the emulator on shutdown. Co-Authored-By: Narr the Reg <5944268+german77@users.noreply.github.com>
| * internal_network: Fix mingw compilationFearlessTobi2022-08-151-4/+5
| | | | | | | | Apparently, "interface" is a reserved keyword on this compiler.
| * core, yuzu: Address first part of review commentsFearlessTobi2022-08-159-71/+70
| |
| * core/socket_proxy: Fix compilationFearlessTobi2022-08-151-1/+1
| |
| * Make copyright headers SPDX-compliantFearlessTobi2022-08-156-12/+14
| |
| * core, network: Add ability to proxy socket packetsFearlessTobi2022-08-1528-526/+1028
| |
| * web_service: Correct jwt issuer stringFearlessTobi2022-08-151-1/+3
| |
| * dedicated_room: Initial implementationFearlessTobi2022-08-154-0/+418
|/
* Merge pull request #8104 from Docteh/them_iconsliamwhite2022-08-1538-103/+402
|\ | | | | Moving Icons away from CC BY-ND 3.0 licensed Icons to help with FOSS Packaging
| * Moving Icons away from CC BY-ND 3.0 for FOSS packaging purposesKyle Kienapfel2022-08-1438-103/+402
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | I've seen some comments stating that sharing pre-compiled packages of yuzu is problematic for linux distributions due to some contents having license of CC BY-ND 3.0 Better licensed sources of icons have been found for most cases, see the changes to the .reuse/dep5 file for details. Placeholders for connected/disconnected icons At the time of writing I consider these icons to be placeholders, hence three copies. colorful is grey, default is black, qdarkstyle is white connected is gnome/16x16/network-idle.png with no changes connected_notification is gnome/16x16/network-error.png with changes disconnected is gnome/16x16/network-offline.png with changes Looking at licenses: GNOME icon theme is distributed under the terms of either GNU LGPL v.3 or Creative Commons BY-SA 3.0 license. Debian appears to explicitly state they're licensing under Creative Commons Attribution-Share Alike 3.0 From a tarball at the following link suggests we can just attribute GNOME Project https://download.gnome.org/sources/gnome-icon-theme/ When attributing the artwork, using "GNOME Project" is enough. Please link to http://www.gnome.org where available. CC-BY-SA-3.0.txt from https://creativecommons.org/licenses/by-sa/3.0/legalcode.txt
* | Merge pull request #8739 from merryhime/swizzle_tablebunnei2022-08-142-15/+48
|\ \ | |/ |/| video_core/textures/decoders: Avoid SWIZZLE_TABLE
| * video_core/textures/decoders: Avoid SWIZZLE_TABLEMerry2022-08-092-15/+48
| |
* | Merge pull request #8756 from Kelebek1/volbunnei2022-08-136-11/+12
|\ \ | | | | | | Allow audio volume up to 200%
| * | Do some log memes to help perceived volumeKelebek12022-08-122-2/+5
| | |
| * | Allow audio volume up to 200%Kelebek12022-08-124-9/+7
| | |
* | | Merge pull request #8755 from Morph1984/delimit-ipsbunnei2022-08-121-1/+2
|\ \ \ | | | | | | | | ips_layer: Delimit parsed hex value string
| * | | ips_layer: Delimit parsed hex value stringMorph2022-08-121-1/+2
| | | | | | | | | | | | | | | | Delimits the hex value string on spaces, slashes, carriage returns or newlines, allowing for comments to be added in-line.
* | | | Merge pull request #8741 from Docteh/abootMai2022-08-122-2/+3
|\ \ \ \ | | | | | | | | | | Qt: tweak ui files
| * | | | Qt: tweak ui filesKyle K2022-08-092-2/+3
| | |_|/ | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | make about dialog a bit taller for full message on more systems for direct_connect.ui hedging bets here, there is a text field for port number that possibly shouldn't be translated, marking as such, but also adding a translation note for the event that it makes sense to translate the placeholder text to something other than the default multiplayer direct connect port.
* | | | Merge pull request #8745 from merryhime/null-fastmem-arenaliamwhite2022-08-122-7/+11
|\ \ \ \ | |_|_|/ |/| | | arm_dynarmic: Fix nullptr fastmem arenas
| * | | arm_dynarmic: Fix nullptr fastmem arenasMerry2022-08-092-7/+11
| |/ / | | | | | | | | | Unable to enable fastmem of exclusive access without a valid fastmem arena.
* | | Merge pull request #8647 from Docteh/default_darkliamwhite2022-08-1232-35/+817
|\ \ \ | | | | | | | | Linux: handle dark system themes nicely
| * | | review pass on CheckDarkMode functionKyle Kienapfel2022-08-122-4/+4
| | | |
| * | | assign colors to default_dark themeKyle K2022-08-051-7/+5
| | | | | | | | | | | | | | | | separate commit might be useful later on
| * | | Linux: handle dark system themes nicelyKyle K2022-08-0532-35/+819
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | yuzu's default theme doesn't specify everything, which is fine for windows, but in linux anything unspecified is set to the users theme. Symptoms of this are that a linux user with a dark theme won't think to change the theme to a dark theme when first using yuzu Idea here is to try and support arbitrary themes on linux. preliminary work on a "default_dark" theme, used only as overlay for any themes that are measured to be dark mode. Other work done: FreeDesktop standard icon names: plus -> list-add delete refresh, we use view-refresh remove duplicated icons for qdarkstyle_midnight_blue referencing icon aliases in the qrc files is the way to go Note: Dynamic style changing doesn't appear to work with AppImage
* | | | Merge pull request #8731 from FearlessTobi/better-ldnliamwhite2022-08-126-57/+711
|\ \ \ \ | |_|_|/ |/| | | ldn: Add better stubs and more data types
| * | | core: ldn: Address review comments part 2german772022-08-122-334/+297
| | | |
| * | | core: ldn: Address review commentsNarr the Reg2022-08-084-56/+46
| | | |
| * | | ldn: Add better stubs and more data typesFearlessTobi2022-08-076-72/+773
| | | | | | | | | | | | | | | | | | | | Co-Authored-By: Narr the Reg <5944268+german77@users.noreply.github.com> Co-Authored-By: Morph <39850852+Morph1984@users.noreply.github.com>
* | | | Merge pull request #8686 from lat9nq/graft-sourceMorph2022-08-112-8/+6
|\ \ \ \ | | | | | | | | | | ci: Graft source when archiving
| * | | | post-upload: Upload Linux source to artifacts dirlat9nq2022-08-091-0/+1
| | | | | | | | | | | | | | | | | | | | | | | | | The source from the Linux build is desireable as it has permissions and line endings set correctly.
| * | | | ci: Graft source when archivinglat9nq2022-08-092-8/+5
| | |_|/ | |/| | | | | | | | | | | | | | | | | | | | | | Instead of including yuzu and all the sources it uses directly, include only what specifically belongs to yuzu. Submodules can be downloaded separately later using git since a shallow clone includes minimally all the repository information needed for it.
* | | | Merge pull request #8735 from djrobx/add_vsyncliamwhite2022-08-102-3/+4
|\ \ \ \ | | | | | | | | | | Make vsync setting work for Vulkan
| * | | | Make vsync setting work for VulkanDJRobX2022-08-082-3/+4
| | | | |
* | | | | Merge pull request #8722 from german77/ds4_goes_brrrbunnei2022-08-101-0/+4
|\ \ \ \ \ | | | | | | | | | | | | hid: core: Delay the stop vibration command when testing
| * | | | | hid: core: Delay the stop vibration command when testingNarr the Reg2022-08-061-0/+4
| | | | | |
* | | | | | Merge pull request #8724 from german77/no_alphabunnei2022-08-104-25/+97
|\ \ \ \ \ \ | | | | | | | | | | | | | | hid: core: Properly emulate controller color and battery level
| * | | | | | hid: core: Properly emulate controller color and battery levelNarr the Reg2022-08-084-25/+97
| |/ / / / /
* | | | | | Merge pull request #8729 from merryhime/cp15-barriersbunnei2022-08-102-4/+29
|\ \ \ \ \ \ | | | | | | | | | | | | | | arm_dynarmic_cp15: Implement CP15DMB/CP15DSB/CP15ISB
| * | | | | | arm_dynarmic_cp15: Implement CP15DMB/CP15DSB/CP15ISBMerry2022-08-072-4/+29
| | |_|_|/ / | |/| | | |
* | | | | | Merge pull request #8499 from Docteh/pluralsbunnei2022-08-107-8/+103
|\ \ \ \ \ \ | | | | | | | | | | | | | | Translate english plurals
| * | | | | | Translate english pluralsKyle Kienapfel2022-07-307-8/+103
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Turns out that for Qt to properly handle plurals in English a translation needs to be provided, otherwise the user is left with messages such as "Building: 2 shader(s)" Plurals for other all other languages are handled on transifex. I wrote the README.md to just refer to it as a translation collaboration site just in case we ever switch. These translations being out of date won't pose any technical problems so I believe it is fine to handle them manually on a "best effort" basis. The files are generated into the source directory so that the relative filenames are correct. The generated file is added to .gitignore
* | | | | | | Merge pull request #8715 from Docteh/suzhoubunnei2022-08-091-0/+9
|\ \ \ \ \ \ \ | |_|_|_|_|/ / |/| | | | | | Qt5 work around for suzhou numerals
| * | | | | | Qt5 work around for suzhou numeralsKyle Kienapfel2022-08-041-0/+9
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | When windows is told to display Standard digits as suzhou, it is showing incorrect information in yuzu, file sizes and the CPU speed limiter are effected by this. See #8698 for some screenshots. Setting number format to Chinese (Simplified, Hong Kong SAR) is one way to see this issue in action. Fixes #8698
* | | | | | | Merge pull request #8734 from liamwhite/bors-is-my-best-friendbunnei2022-08-082-2/+10
|\ \ \ \ \ \ \ | |_|_|_|_|/ / |/| | | | | | core/arm: fix build error
| * | | | | | core/arm: fix build errorLiam2022-08-082-2/+10
|/ / / / / /
* | | | | | Merge pull request #8637 from liamwhite/bad-interruptsbunnei2022-08-0813-152/+64
|\ \ \ \ \ \ | | | | | | | | | | | | | | kernel: unlayer CPU interrupt handling
| * | | | | | kernel: unlayer CPU interrupt handlingLiam2022-07-2513-152/+64
| | | | | | |
* | | | | | | Merge pull request #8240 from liamwhite/count-cyclesMorph2022-08-082-8/+22
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | core/arm: re-enable cycle counting
| * | | | | | | core/arm: increase minimum_run_cyclesLiam2022-06-222-2/+2
| | | | | | | |
| * | | | | | | core/arm: re-enable cycle countingmerry2022-06-222-6/+20
| | | | | | | |
* | | | | | | | Merge pull request #8730 from lat9nq/fmt-9.0.0liamwhite2022-08-084-4/+9
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | vcpkg,yuzu: Update to fmt 9.0.0
| * | | | | | | | yuzu: Fix fmt 9.0.0 issueslat9nq2022-08-072-3/+4
| | | | | | | | |
| * | | | | | | | vcpkg: Update and update fmt to 9.0.0lat9nq2022-08-072-1/+5
| | |_|_|_|/ / / | |/| | | | | |
* | | | | | | | Merge pull request #8675 from merryhime/track-dynarmic-202207liamwhite2022-08-081-0/+0
|\ \ \ \ \ \ \ \ | |/ / / / / / / |/| | | | | | | externals: Update dynarmic to 6.2.3
| * | | | | | | externals: Update dynarmic to 6.2.3Merry2022-07-301-0/+0
| | | | | | | |
* | | | | | | | Merge pull request #8658 from liamwhite/plgpbunnei2022-08-071-9/+7
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | video_core: differentiate between tiled and untiled framebuffer sizes for unaccelerated blits
| * | | | | | | | video_core: differentiate between tiled and untiled framebuffer sizes for unaccelerated copiesLiam2022-07-281-9/+7
| | | | | | | | |
* | | | | | | | | Merge pull request #8700 from liamwhite/xc3-vk-crashbunnei2022-08-061-0/+12
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | vk_texture_cache: return VK_NULL_HANDLE for views of null images
| * | | | | | | | | vk_texture_cache: return VK_NULL_HANDLE for views of null imagesLiam2022-08-021-0/+12
| | | | | | | | | |
* | | | | | | | | | Merge pull request #8667 from Kelebek1/xc3liamwhite2022-08-061-2/+3
|\ \ \ \ \ \ \ \ \ \ | |_|_|_|_|_|_|_|/ / |/| | | | | | | | | [SPIRV] Add missed shader defines
| * | | | | | | | | Add missed shader defines. Fixes Xenoblade Chronicles 3 booting with Vulkan.Kelebek12022-07-291-2/+3
| | | | | | | | | |
* | | | | | | | | | Controller bugfixes in profile select (#8716)Steve2022-08-053-5/+10
| |_|_|_|_|_|_|_|/ |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * Controller bugfixes in profile select, closes #8265 2 fixes for using a controller in profile select dialog. Pressing 'B' cancels the launch of the game Using controller to select a profile now correctly sets the index to use for the launch * Added brackets to if statements as requested.
* | | | | | | | | Merge pull request #8702 from liamwhite/format-swapbunnei2022-08-045-273/+337
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | renderer_vulkan: add format fallbacks for R16G16B16_SFLOAT, R16G16B16_SSCALED, R8G8B8_SSCALED
| * | | | | | | | | renderer_vulkan: add format fallbacks for R16G16B16_SFLOAT, R16G16B16_SSCALED, R8G8B8_SSCALEDLiam2022-08-035-273/+337
|/ / / / / / / / /
* | | | | | | | | Merge pull request #8681 from Docteh/testMorph2022-08-022-1/+2
|\ \ \ \ \ \ \ \ \ | |_|/ / / / / / / |/| | | | | | | | tidy up github actions
| * | | | | | | | tidy up github actionsKyle K2022-07-302-1/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | ci.yml: REUSE task should only run on yuzu-emu/yuzu repository verify.yml: #8659 is a better fix to the discord-rpc dirty flag
* | | | | | | | | Merge pull request #8701 from liamwhite/elfMorph2022-08-025-313/+0
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | core/loader: remove ELF loader
| * | | | | | | | | core/loader: remove ELF loaderLiam2022-08-015-313/+0
| | |_|_|_|_|_|/ / | |/| | | | | | |
* | | | | | | | | Merge pull request #8697 from zhaobot/tx-update-20220801034544Mai2022-08-0223-15528/+31044
|\ \ \ \ \ \ \ \ \ | |/ / / / / / / / |/| | | | | | | | Update translations (2022-08-01)
| * | | | | | | | Update translations (2022-08-01)The yuzu Community2022-08-0123-15528/+31044
|/ / / / / / / /
* | | | | | | | Merge pull request #8678 from liamwhite/stop-waitingbunnei2022-07-312-2/+2
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | video_core: stop waiting for shader compilation on user cancel
| * | | | | | | | video_core: stop waiting for shader compilation on user cancelLiam2022-07-302-2/+2
| | |_|_|/ / / / | |/| | | | | |
* | | | | | | | Merge pull request #8622 from liamwhite/progressbunnei2022-07-311-0/+4
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | qt: reset progress bar after shader compilation
| * | | | | | | | qt: reset progress bar after shader compilationLiam2022-07-241-0/+4
| | | | | | | | |
* | | | | | | | | Merge pull request #8692 from DCNick3/write-command-output-on-closebunnei2022-07-311-2/+5
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | Properly write out the command buffer when serving close request
| * | | | | | | | | Properly write out the command buffer when serving close requestNikita Strygin2022-07-311-2/+5
|/ / / / / / / / /
* | | | | | | | | Merge pull request #8684 from liamwhite/delete-shaderMorph2022-07-311-0/+1
|\ \ \ \ \ \ \ \ \ | |_|_|/ / / / / / |/| | | | | | | | renderer_opengl: delete shader source after linking
| * | | | | | | | renderer_opengl: delete shader source after linkingLiam2022-07-301-0/+1
| | |_|_|_|_|_|/ | |/| | | | | |
* | | | | | | | Merge pull request #8640 from lat9nq/vcpkg-extraMorph2022-07-304-12/+28
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | cmake,ci: vcpkg leftovers
| * | | | | | | | cmake,ci: vcpkg for MSVC default, fix lz4 include, catch2, cleanuplat9nq2022-07-284-12/+28
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | vcpkg: Add Catch2 2.13.9 Catch2 >= 3.0 is not compatible with earlier versions, and for now we must override the desired version in our vcpkg manifest. We can do this programmatically by using VCPKG_MANIFEST_FEATURES. CMakeLists: Search for lz4 CONFIG mode first vcpkg's lz4 CONFIG cmake script works in Release mode but not in Debug mode, failing to copy the correct DLLs at compile time. We still need to search for the regular mode for system-installed versions. CMakeLists: Clean up boost exports Remove some Conan-specific workarounds. CMakeLists: Use vcpkg for MSVC by default Not enabling it generally since it's much easier to have system dependencies installed for Linux and MinGW.
* | | | | | | | | Merge pull request #8664 from liamwhite/monkey-compiler-v12-1Morph2022-07-301-1/+1
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | common: move forwarded value into SPSCQueue
| * | | | | | | | | common: move forwarded value into SPSCQueueLiam2022-07-291-1/+1
| | |_|_|_|/ / / / | |/| | | | | | |
* | | | | | | | | Merge pull request #8677 from liamwhite/asan-wuninitializedMorph2022-07-301-4/+4
|\ \ \ \ \ \ \ \ \ | |_|_|_|_|/ / / / |/| | | | | | | | audio_core: fix -Wuninitialized when compiling with ASan
| * | | | | | | | audio_core: fix -Wuninitialized when compiling with ASanLiam2022-07-301-4/+4
|/ / / / / / / /
* | | | | | | | Merge pull request #8665 from liamwhite/github-is-dumbNarr the Reg2022-07-291-0/+8
|\ \ \ \ \ \ \ \ | |_|_|/ / / / / |/| | | | | | | ci: use dep5 for GitHub issue template files
| * | | | | | | ci: use dep5 for GitHub issue template filesLiam2022-07-291-0/+8
| | |/ / / / / | |/| | | | |
* | | | | | | Update bug-report-feature-request.mdbunnei2022-07-291-6/+0
| | | | | | |
* | | | | | | Update config.ymlbunnei2022-07-291-3/+0
| | | | | | |
* | | | | | | Merge pull request #8656 from german77/audio-stepbunnei2022-07-291-2/+16
|\ \ \ \ \ \ \ | |/ / / / / / |/| | | | | | yuzu: Add incremental steps to volume hotkeys
| * | | | | | yuzu: Add incremental steps to volume hotkeysNarr the Reg2022-07-271-2/+16
| | |/ / / / | |/| | | |
* | | | | | Merge pull request #8349 from yuzu-emu/revert-8256-ci-vs-2022bunnei2022-07-283-3/+3
|\ \ \ \ \ \ | | | | | | | | | | | | | | Revert "ci: Enable building with Visual Studio 2022"
| * | | | | | Revert "ci: Enable building with Visual Studio 2022"bunnei2022-07-233-3/+3
| | | | | | |
* | | | | | | Merge pull request #8659 from lat9nq/drpc-yuzuliamwhite2022-07-282-1/+1
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | externals: Use yuzu-emu/discord-rpc to provide Discord integration
| * | | | | | | externals: Use yuzu-emu/discord-rpc to provide Discord integrationlat9nq2022-07-282-1/+1
|/ / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | Our fork includes a commit to disable clang-format, preventing the dirty flag from being set when building yuzu on CI.
* | | | | | | Merge pull request #8657 from Kelebek1/depopliamwhite2022-07-282-2/+2
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | [Audio] Avoid an out-of-bounds span write in depop prepare
| * | | | | | | Avoid depop out of boundsKelebek12022-07-282-2/+2
| | | | | | | |
* | | | | | | | Merge pull request #8642 from lat9nq/appimg-more-controlliamwhite2022-07-281-0/+3
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | ci/linux: Exclude libwayland-client from AppImage
| * | | | | | | | ci/linux: Delete libwayland-client from AppDirlat9nq2022-07-261-0/+3
| | |_|_|_|/ / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This library causes issues in Vulkan driver detection. libQt5MultimediaGstTools's dependencies seem to be the issue.
* | | | | | | | Merge pull request #8641 from Docteh/vcpkg_dllliamwhite2022-07-281-3/+4
|\ \ \ \ \ \ \ \ | |_|_|_|_|/ / / |/| | | | | | | build: Ship vcpkg dlls with MSVC pr-verify builds
| * | | | | | | build: Ship vcpkg dlls with MSVC pr-verify buildsKyle Kienapfel2022-07-271-3/+4
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | With our recent switchover from conan to vcpkg, we're shipping a few more dll files, these need to be in the full zip. cp .\build\bin\*.dll .\artifacts\ also tacking on the fix where we're shipping scm_rev.cpp accidentally
* | | | | | | | Revert Coretiming PRs 8531 and 7454 (#8591)Maide2022-07-285-118/+69
| | | | | | | |
* | | | | | | | implement pause on system suspend (#8585)snek2022-07-282-1/+43
| |_|/ / / / / |/| | | | | |
* | | | | | | Merge pull request #8542 from Morph1984/gpu-use-old-qliamwhite2022-07-272-4/+3
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | gpu_thread: Use the previous MPSCQueue implementation
| * | | | | | | gpu_thread: Use the previous MPSCQueue implementationMorph2022-07-062-4/+3
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The bounded MPSCQueue implementation causes crashes in Fire Emblem Three Houses, use the previous implementation for now.
* | | | | | | | Merge pull request #8636 from german77/irs_cluster_releaseliamwhite2022-07-276-7/+323
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | service: irs: Implement clustering processor
| * | | | | | | | Address commentsNarr the Reg2022-07-252-17/+18
| | | | | | | | |
| * | | | | | | | fix compiler errorsgerman772022-07-242-12/+14
| | | | | | | | |
| * | | | | | | | service: irs: Implement clustering processorgerman772022-07-246-7/+320
| | |_|_|_|/ / / | |/| | | | | |
* | | | | | | | Merge pull request #8633 from Morph1984/optional-keysliamwhite2022-07-275-4/+81
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | applet/swkbd: Implement optional symbol keys
| * | | | | | | | qt_software_keyboard: Fix infinite loop when moving between buttonsMorph2022-07-241-0/+14
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | There was a bug where, when using the numeric keyboard, moving between buttons resulted in an infinite loop, resulting in a stuck state. This was due to prev_button being the only one enabled in that row or column, causing the condition in the while loop to always be true. To fix this, detect whether we have returned to that initial row/column and break out of the loop.
| * | | | | | | | applet/swkbd: Implement optional symbol keysMorph2022-07-245-4/+67
| | |_|/ / / / / | |/| | | | | | | | | | | | | | | | | | | | | | These are only used in the numeric keyboard, and correspond to the keys to the left and right of the "0" key on the numeric keyboard.
* | | | | | | | Merge pull request #8592 from devsnek/sig-handlerssnek2022-07-272-0/+71
| | | | | | | | | | | | | | | | | | | | | | | | exit gracefully on sigint/sigterm
* | | | | | | | Merge pull request #8338 from Tachi107/spdx-fixesliamwhite2022-07-27294-546/+1982
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | chore: make yuzu REUSE compliant
| * | | | | | | | ci: add reuse jobAndrea Pappacoda2022-07-271-0/+6
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | As mentioned in the previous commit, `reuse lint` can be used to ensure that copyright information is always present and up to date. This adds a GitHub Action that does just that, using the official fsfe/reuse-action
| * | | | | | | | chore: make yuzu REUSE compliantAndrea Pappacoda2022-07-27294-546/+1976
|/ / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | [REUSE] is a specification that aims at making file copyright information consistent, so that it can be both human and machine readable. It basically requires that all files have a header containing copyright and licensing information. When this isn't possible, like when dealing with binary assets, generated files or embedded third-party dependencies, it is permitted to insert copyright information in the `.reuse/dep5` file. Oh, and it also requires that all the licenses used in the project are present in the `LICENSES` folder, that's why the diff is so huge. This can be done automatically with `reuse download --all`. The `reuse` tool also contains a handy subcommand that analyzes the project and tells whether or not the project is (still) compliant, `reuse lint`. Following REUSE has a few advantages over the current approach: - Copyright information is easy to access for users / downstream - Files like `dist/license.md` do not need to exist anymore, as `.reuse/dep5` is used instead - `reuse lint` makes it easy to ensure that copyright information of files like binary assets / images is always accurate and up to date To add copyright information of files that didn't have it I looked up who committed what and when, for each file. As yuzu contributors do not have to sign a CLA or similar I couldn't assume that copyright ownership was of the "yuzu Emulator Project", so I used the name and/or email of the commit author instead. [REUSE]: https://reuse.software Follow-up to 01cf05bc75b1e47beb08937439f3ed9339e7b254
* | | | | | | | Merge pull request #8652 from lat9nq/ffmpeg-ghliamwhite2022-07-272-1/+1
|\ \ \ \ \ \ \ \ | |_|_|_|/ / / / |/| | | | | | | externals: Use GitHub for FFmpeg
| * | | | | | | externals: Use GitHub for FFmpeglat9nq2022-07-272-1/+1
|/ / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | FFmpeg's own git repo seems to be down, so switch to GitHub like we use for most externals.
* | | | | | | Merge pull request #8541 from FearlessTobi/multiplayer-part1liamwhite2022-07-2699-32/+7501
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | yuzu, network: Add room service and UI configuration
| * | | | | | | network: Address review commentsFearlessTobi2022-07-255-199/+203
| | | | | | | |
| * | | | | | | network, yuzu: Make copyright headers SPDX-compliantFearlessTobi2022-07-2537-111/+74
| | | | | | | |
| * | | | | | | network, yuzu: Improve variable naming and style consistencyFearlessTobi2022-07-2514-47/+53
| | | | | | | |
| * | | | | | | yuzu_cmd: Fix compilationFearlessTobi2022-07-252-13/+1
| | | | | | | |
| * | | | | | | network: Move global state into a seperate classFearlessTobi2022-07-2521-96/+150
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Co-Authored-By: Narr the Reg <5944268+german77@users.noreply.github.com>
| * | | | | | | common: multiplayer: Use GameInfo typegerman772022-07-2511-62/+60
| | | | | | | |
| * | | | | | | Address second part of review commentsFearlessTobi2022-07-259-103/+92
| | | | | | | |
| * | | | | | | Address first part of review commentsFearlessTobi2022-07-2516-133/+239
| | | | | | | |
| * | | | | | | Fix compilation on linux gccFearlessTobi2022-07-256-31/+32
| | | | | | | |
| * | | | | | | web_service: Fix -Wmissing-field-initializersFearlessTobi2022-07-251-1/+1
| | | | | | | |
| * | | | | | | core: Fix -Wunused-variableFearlessTobi2022-07-251-1/+3
| | | | | | | |
| * | | | | | | common, core: fix -Wmissing-field-initializersFearlessTobi2022-07-252-5/+5
| | | | | | | |
| * | | | | | | yuzu: Hide multiplayer button and room statusFearlessTobi2022-07-252-16/+3
| | | | | | | |
| * | | | | | | yuzu: Add ui files for multiplayer roomsFearlessTobi2022-07-2584-49/+4523
| | | | | | | |
| * | | | | | | network: Add initial files and enet dependencyFearlessTobi2022-07-2515-0/+2897
|/ / / / / / /
* | | | | | | Merge pull request #8564 from lat9nq/dinner-forkbunnei2022-07-2512-124/+181
|\ \ \ \ \ \ \ | |_|_|_|_|_|/ |/| | | | | | yuzu: Streamline broken Vulkan handling
| * | | | | | startup_checks: Use WaitForSingleObject and more cleanuplat9nq2022-07-121-6/+9
| | | | | | |
| * | | | | | startup_checks: Use GetEnvironmentVariableAlat9nq2022-07-111-4/+3
| | | | | | | | | | | | | | | | | | | | | | | | | | | | Solves MSVC compile error. Also drops need string use for comparison.
| * | | | | | startup_checks: Clean uplat9nq2022-07-101-9/+6
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Adds some comments, removes unused includes, and removes last bits of logging since this is before the logging backend starts up.
| * | | | | | startup_checks: Implement unix side codelat9nq2022-07-102-17/+48
| | | | | | | | | | | | | | | | | | | | | | | | | | | | Wow fork() is nice, isn't it?
| * | | | | | yuzu: Simplify broken Vulkan handlinglat9nq2022-07-109-115/+65
| | | | | | |
| * | | | | | yuzu: Check Vulkan on startup with a childlat9nq2022-07-103-1/+78
| | | | | | |
| * | | | | | yuzu: Rename check_vulkan to startup_checkslat9nq2022-07-104-3/+3
| | | | | | |
* | | | | | | Merge pull request #8549 from liamwhite/kscheduler-scMorph2022-07-2513-602/+605
|\ \ \ \ \ \ \ | |_|_|/ / / / |/| | | | | | kernel: use KScheduler from Mesosphere
| * | | | | | kernel: Ensure all uses of disable_count are balancedLiam2022-07-153-10/+21
| | | | | | |
| * | | | | | kernel: be more careful about initialization path for HLE threadsLiam2022-07-152-1/+8
| | | | | | |
| * | | | | | kernel: fix single-core preemption pointsLiam2022-07-156-40/+28
| | | | | | |
| * | | | | | kernel: fix issues with single core modeLiam2022-07-159-189/+225
| | | | | | |
| * | | | | | kernel: use KScheduler from mesosphereLiam2022-07-1512-602/+563
| | | | | | |
* | | | | | | Merge pull request #8484 from german77/irs_releaseliamwhite2022-07-2450-320/+2342
|\ \ \ \ \ \ \ | |_|_|/ / / / |/| | | | | | service: irs: Add camera support, split processors and implement ImageTransferProcessor
| * | | | | | yuzu: Add webcam support and rebase to latest masterNarr the Reg2022-07-248-16/+43
| | | | | | |
| * | | | | | service: irs: Move to IRS namespace and minor fixesgerman772022-07-2420-76/+71
| | | | | | |
| * | | | | | service: irs: Split processors and implement ImageTransferProcessorgerman772022-07-2418-291/+1091
| | | | | | |
| * | | | | | core: hid: Add cammera supportgerman772022-07-246-3/+423
| | | | | | |
| * | | | | | yuzu: Hook qt camera to camera drivergerman772022-07-2415-4/+491
| | | | | | |
| * | | | | | input_common: Add camera drivergerman772022-07-2411-5/+298
|/ / / / / /
* | | | | | Merge pull request #8545 from Kelebek1/Audioliamwhite2022-07-23270-8437/+33704
|\ \ \ \ \ \ | | | | | | | | | | | | | | Project Andio
| * | | | | | Project AndioKelebek12022-07-22270-8437/+33704
| | | | | | |
* | | | | | | Merge pull request #8629 from Docteh/test_transifexliamwhite2022-07-231-1/+4
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | ci,transifex: enable vcpkg on transifex step
| * | | | | | | ci,transifex: enable vcpkg on transifex stepKyle Kienapfel2022-07-231-1/+4
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The slim docker container that runs transifex needs a few packages added in, curl zip unzip I've tested everything except actually pushing to transifex, but it's not November 2022 yet so we're fine for now. Or we're actually using the newer client and all is well.
* | | | | | | | Merge pull request #8625 from Docteh/ado_titlebarliamwhite2022-07-231-1/+6
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | ci: pass environment variables to linux docker (AppImage)
| * | | | | | | | ci: pass environment variables to linux docker (AppImage)Kyle K2022-07-231-1/+6
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Variables in question: AZURECIREPO TITLEBARFORMATIDLE TITLEBARFORMATRUNNING DISPLAYVERSION CMakeModules/GenerateSCMRev.cmake has some logic that looks at BUILD_REPOSITORY variable inside CMake src/common/CMakeLists.txt has some logic that takes some items from environment variables and sets variables inside CMake This is the whole section at the moment. if (DEFINED ENV{AZURECIREPO}) set(BUILD_REPOSITORY $ENV{AZURECIREPO}) endif() if (DEFINED ENV{TITLEBARFORMATIDLE}) set(TITLE_BAR_FORMAT_IDLE $ENV{TITLEBARFORMATIDLE}) endif () if (DEFINED ENV{TITLEBARFORMATRUNNING}) set(TITLE_BAR_FORMAT_RUNNING $ENV{TITLEBARFORMATRUNNING}) endif () if (DEFINED ENV{DISPLAYVERSION}) set(DISPLAY_VERSION $ENV{DISPLAYVERSION}) endif ()
* | | | | | | | | Merge pull request #8596 from Docteh/fix_ghaliamwhite2022-07-232-1/+55
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | package MSVC CI Builds differently, and include yuzu.exe
| * | | | | | | | | package MSVC CI Builds differently, and include yuzu.exeKyle Kienapfel2022-07-232-1/+55
| | |/ / / / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This is related to 8486 Ninja places the exe files into .\build\bin while MSBuild may place them into .\build\bin\Release upload.ps1 was originally written for use with Azure Dev Ops to cough up about 5 files and the script appears to be used for both CI and mainline builds GHA (GitHub Actions) makes available a single zip of the items uploaded by each Upload action (artifacts directory), so we want to work with that. I'm doing changes to upload.ps1 to accomplish this. The changes to the verify.yml are as follows -DGIT_BRANCH=pr-verify changes the header in yuzu, instead of saying HEAD-<hash>-dirty it'll say pr-verify-<hash> -DCLANG_FORMAT_SUFFIX=discordplzdontclang tricks the CMake stuff for discord-rpc to NOT run clang-format, as this was marking CI builds as dirty I'm also making it upload just the exe by itself, as the msvc builds are quite chunky. but maybe this is unnecessary. Currently the MSVC artifact option is a 274MB zip that contains 3 copies of the DLLs, and 4 copies of the source tarball, and zero copies of yuzu.exe This PR should have msvc artifacts of about 190MB that downloads as 81 MB zip
* | | | | | | | | Merge pull request #8627 from lat9nq/submodule-cleanliamwhite2022-07-231-0/+3
|\ \ \ \ \ \ \ \ \ | |/ / / / / / / / |/| | | | | | | | ci/windows: Cleanup unused data in submodules before packaging
| * | | | | | | | ci/windows: Cleanup unused data before packaginglat9nq2022-07-231-0/+3
|/ / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | vcpkg data takes up a lot of space, and currently the scripts will package all that data with the source archive which is unnecessary.
* | | | | | | | Merge pull request #8584 from Morph1984/qt5-cleanupbunnei2022-07-232-10/+6
|\ \ \ \ \ \ \ \ | |/ / / / / / / |/| | | | | | | CMakeLists: Require QtConcurrent, and remove unused dlls
| * | | | | | | CopyYuzuQt5Deps: Remove unused dllsMorph2022-07-151-7/+3
| | | | | | | |
| * | | | | | | CMakeLists: Mark WebEngine(Core/Widgets) as requiredMorph2022-07-151-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Mark these components as required when we are building with QtWebEngine enabled.
| * | | | | | | CMakeLists: Add QtConcurrent to required componentsMorph2022-07-151-2/+2
| | |/ / / / / | |/| | | | | | | | | | | | | | | | | | | We use QtConcurrent in various places in our Qt frontend, add it to the required components.
* | | | | | | Merge pull request #8611 from liamwhite/fix-flatpak-crashbunnei2022-07-231-5/+8
|\ \ \ \ \ \ \ | |_|_|_|_|/ / |/| | | | | | video_core: use correct byte size for framebuffer
| * | | | | | video_core: use correct byte size for framebufferLiam2022-07-191-5/+8
| | | | | | |
* | | | | | | Merge pull request #8624 from lat9nq/vcpkgbunnei2022-07-239-156/+79
|\ \ \ \ \ \ \ | |_|_|/ / / / |/| | | | | | ci,CMake: Drop Conan support for vcpkg
| * | | | | | gitmodules: Remove 'externals' from names of submoduleslat9nq2022-07-231-3/+3
| | | | | | |
| * | | | | | ci,CMake: Integrate vcpkg into CMakeListslat9nq2022-07-238-7/+44
| | | | | | | | | | | | | | | | | | | | | | | | | | | | Uses manifest mode if the bundled vcpkg is used.
| * | | | | | ci,CMake: Drop Conan support for vcpkglat9nq2022-07-235-149/+35
|/ / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Between packages breaking, Conan always being a moving target for minimum required CMake support, and now their moves to Conan 2.0 causing existing packages to break, I suppose this was a long time coming. vcpkg isn't without its drawbacks, but at the moment it seems easier on the project to use for external packages. Mostly removes the logic for Conan from the root CMakeLists file, leaving basic find_package()'s in its place. Sets only the find_package()'s that require CONFIG mode as necessary. clang and linux CI now use the vcpkg toolchain file configured in the Docker container when possible. mingw CI turns off YUZU_TESTS because there's no way on the container to run Windows executables on a Linux host anyway, and it's not easy to get Catch2 there.
* | | | | | Merge pull request #8598 from Link4565/recv-dontwaitbunnei2022-07-221-1/+19
|\ \ \ \ \ \ | | | | | | | | | | | | | | Enable the use of MSG_DONTWAIT flag on RecvImpl
| * | | | | | Enable the use of MSG_DONTWAIT flag on RecvImplLink45652022-07-161-1/+19
| | | | | | |
* | | | | | | Merge pull request #8607 from lat9nq/sdl-2.0.20Narr the Reg2022-07-211-0/+0
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | externals: Revert SDL2 to release-2.0.20
| * | | | | | | externals: Revert SDL2 to release-2.0.20lat9nq2022-07-191-0/+0
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | prerelease-2.23.1 appears to have issues on the SteamDeck with external controllers. Revert to 2.0.20 for now (and as opposed to using prerelease-2.0.19 like before.)
* | | | | | | | Merge pull request #8610 from yuzu-emu/HandheldNarr the Reg2022-07-201-1/+1
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | Rename Undocked to Handheld in input settings
| * | | | | | | | Update configure_input.uiMatías Locatti2022-07-191-1/+1
|/ / / / / / / /
* | | | | | | | Merge pull request #8604 from merryhime/A64CallbackConfigPassbunnei2022-07-191-0/+0
|\ \ \ \ \ \ \ \ | |/ / / / / / / |/| | | | | | | externals: Update dynarmic to 6.2.1
| * | | | | | | externals: Update dynarmic to 6.2.1Merry2022-07-171-0/+0
| | |/ / / / / | |/| | | | | | | | | | | | | | | | | | | Fix issue with A64CallbackConfigPass
* | | | | | | Merge pull request #8581 from devsnek/send-resumebunnei2022-07-184-0/+23
|\ \ \ \ \ \ \ | |/ / / / / / |/| | | | | | implement resume message
| * | | | | | implement resume messageGus Caplan2022-07-184-0/+23
|/ / / / / /
* | | | | | Merge pull request #8569 from merryhime/watchpointsmerry2022-07-175-8/+3
|\ \ \ \ \ \ | | | | | | | | | | | | | | dynarmic: Abort watchpoints ASAP
| * | | | | | dynarmic: Abort watchpoints ASAPMerry2022-07-155-8/+3
| | |/ / / / | |/| | | |
* | | | | | Merge pull request #8508 from yuzu-emu/mc-speed-limitbunnei2022-07-1710-130/+20
|\ \ \ \ \ \ | | | | | | | | | | | | | | hle: service: nvflinger: Factor speed limit into frame time calculation.
| * | | | | | hle: service: nvflinger: Fix implicit conversion.bunnei2022-07-171-1/+4
| | | | | | |
| * | | | | | yuzu: settings: Remove framerate cap and merge unlocked framerate setting.bunnei2022-07-1710-135/+15
| | | | | | | | | | | | | | | | | | | | | | | | | | | | - These were all somewhat redundant.
| * | | | | | hle: service: nvflinger: Factor speed limit into frame time calculation.bunnei2022-07-171-1/+8
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | - This allows the %-based "Limit Speed Percent" setting to work with MC emulation. - This is already supported for SC emulation.
* | | | | | | Merge pull request #8544 from german77/14dot0bunnei2022-07-178-29/+45
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | service: Update some services to 14.0.0+
| * | | | | | | service: fatal: Add function tablegerman772022-07-141-1/+7
| | | | | | | |
| * | | | | | | service: btdrv,bcat,btm: Update service tables to 14.0.0german772022-07-143-4/+13
| | | | | | | |
| * | | | | | | service am: Update service tables to 14.0.0german772022-07-141-0/+3
| | | | | | | |
| * | | | | | | service: ac: Replace intances of ProfileData with UserDatagerman772022-07-143-24/+22
| | | | | | | |
* | | | | | | | Merge pull request #8525 from lat9nq/update-sdlbunnei2022-07-171-0/+0
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | externals/SDL: Update to prerelease-2.23.1
| * | | | | | | | externals/SDL: Update to prerelease-2.23.1lat9nq2022-07-011-0/+0
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This includes a fix needed for building with MSYS2/MinGW.
* | | | | | | | | Merge pull request #8543 from BreadFish64/use_tsc_from_capsbunnei2022-07-173-1/+22
|\ \ \ \ \ \ \ \ \ | |_|_|/ / / / / / |/| | | | | | | | common/x64: Use TSC clock rate from CPUID when available
| * | | | | | | | guard against div-by-zeroMarshall Mohror2022-07-061-2/+5
| | | | | | | | |
| * | | | | | | | common/x64: Use TSC clock rate from CPUID when availableMarshall Mohror2022-07-063-1/+19
| | |_|_|_|_|/ / | |/| | | | | | | | | | | | | | | | | | | | | | The current method used to estimate the TSC is fairly accurate - within a few kHz - but the exact value can be extracted from CPUID if available.
* | | | | | | | Merge pull request #8593 from merryhime/ranged-setting-Tbunnei2022-07-176-58/+59
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | common/setting: Make ranged a property of the type
| * | | | | | | | common/setting: Make ranged a property of the typemerry2022-07-156-58/+59
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | - Avoids new GCC 12 warnings when Type is of form std::optional<T> - Makes more sense this way, because ranged is not a property which would change over time
* | | | | | | | | Merge pull request #8594 from liamwhite/skip-wpbunnei2022-07-162-6/+6
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | core/arm: skip watchpoint checks when reading instructions
| * | | | | | | | | core/arm: skip watchpoint checks when reading instructionsLiam2022-07-162-6/+6
| |/ / / / / / / /
* | | | | | | | | Merge pull request #8511 from german77/hbmenubunnei2022-07-1611-85/+224
|\ \ \ \ \ \ \ \ \ | |_|_|_|_|_|/ / / |/| | | | | | | | service: ptm: Add TS, nifm: Stub GetInternetConnectionStatus
| * | | | | | | | service: nifm: Stub GetInternetConnectionStatusgerman772022-06-291-1/+41
| | | | | | | | |
| * | | | | | | | service: ptm: Rewrite PSM and add TSgerman772022-06-2910-84/+183
| | | | | | | | |
* | | | | | | | | Merge pull request #8560 from liamwhite/bitfield-may-aliasbunnei2022-07-161-0/+9
|\ \ \ \ \ \ \ \ \ | |_|/ / / / / / / |/| | | | | | | | common: fix bitfield aliasing on GCC/Clang
| * | | | | | | | common: fix bitfield aliasing on GCC/ClangLiam2022-07-101-0/+9
| | | | | | | | |
* | | | | | | | | Merge pull request #8587 from merryhime/padding-unusedMorph2022-07-151-4/+6
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | common_funcs: Mark padding as [[maybe_unused]]
| * | | | | | | | | common_funcs: Mark padding as [[maybe_unused]]Merry2022-07-151-4/+6
| | |_|_|_|_|/ / / | |/| | | | | | |
* | | | | | | | | Merge pull request #8588 from merryhime/IBinder-vdestructMorph2022-07-151-0/+1
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | nvflinger: Polymorphic destructor requried for abstract class IBinder
| * | | | | | | | | nvflinger: Polymorphic destructor requried for abstract class IBinderMerry2022-07-151-0/+1
| |/ / / / / / / /
* | | | | | | | | Merge pull request #8586 from merryhime/KCodeMemory-overrideMorph2022-07-151-3/+3
|\ \ \ \ \ \ \ \ \ | |/ / / / / / / / |/| | | | | | | | KCodeMemory: Mark virtual methods as override
| * | | | | | | | KCodeMemory: Mark virtual methods as overrideMerry2022-07-151-3/+3
|/ / / / / / / /
* | | | | | | | Merge pull request #8540 from lat9nq/copy-nv-ffmpegliamwhite2022-07-151-1/+1
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | ci/windows: Copy what of FFmpeg not already present
| * | | | | | | | ci/windows: Copy what of FFmpeg not already presentlat9nq2022-07-061-1/+1
| | |_|/ / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Prevents overwriting libwinpthreads.dll when one should already be present from the first DLL search.
* | | | | | | | Merge pull request #8539 from Morph1984/gha-update-actionsliamwhite2022-07-152-6/+6
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | ci: Update various actions from v2 to v3
| * | | | | | | | ci: Update various actions from v2 to v3Morph2022-07-062-6/+6
| |/ / / / / / /
* | | | | | | | Merge pull request #8571 from merryhime/update-dynarmicliamwhite2022-07-151-0/+0
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | externals: Update dynarmic to 6.1.1
| * | | | | | | | externals: Update dynarmic to 6.1.1Merry2022-07-121-0/+0
| | |_|_|_|/ / / | |/| | | | | | | | | | | | | | | | | | | | | | Fixes for fast dispatcher
* | | | | | | | Merge pull request #8536 from Morph1984/fix-webapplet-inputliamwhite2022-07-151-2/+6
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | qt_web_browser: Fix button inputs with QtWebEngine
| * | | | | | | | qt_web_browser: Fix button inputs with QtWebEngineMorph2022-07-061-2/+6
| | |/ / / / / / | |/| | | | | | | | | | | | | | | | | | | | | | Button inputs were broken as button was assumed to be the bit position of NpadButton prior to the input rewrite. Since this was changed to use NpadButton directly, we should count the number of trailing zeros to determine the bit position.
* | | | | | | | Merge pull request #8510 from german77/vibrationliamwhite2022-07-153-3/+12
|\ \ \ \ \ \ \ \ | |_|/ / / / / / |/| | | | | | | input_common: sdl: lower vibration frequency and use it's own unique thread
| * | | | | | | input_common: sdl: lower vibration frequency and use it's own unique threadgerman772022-06-293-3/+12
| | |_|/ / / / | |/| | | | |
* | | | | | | Merge pull request #8559 from liamwhite/waiter-listbunnei2022-07-111-3/+9
|\ \ \ \ \ \ \ | |_|_|_|_|/ / |/| | | | | | kernel: fix usage of waiter_list in Finalize
| * | | | | | kernel: fix usage of waiter_list in FinalizeLiam2022-07-101-3/+9
| | |_|/ / / | |/| | | |
* | | | | | Merge pull request #8528 from Morph1984/astc10x6Fernando S2022-07-107-1/+16
|\ \ \ \ \ \ | | | | | | | | | | | | | | renderer_(gl/vk): Implement ASTC_10x6_UNORM
| * | | | | | renderer_(gl/vk): Implement ASTC_10x6_UNORMMorph2022-07-067-1/+16
| | |_|/ / / | |/| | | | | | | | | | | | | | | | - Used by Monster Hunter Rise Update 10.0.2
* | | | | | Merge pull request #8561 from Kelebek1/Audio-CoreTimingFernando S2022-07-1013-82/+152
|\ \ \ \ \ \ | | | | | | | | | | | | | | Rework CoreTiming events
| * | | | | | PRKelebek12022-07-105-11/+9
| | | | | | |
| * | | | | | Rework CoreTimingKelebek12022-07-1013-82/+154
|/ / / / / /
* | | | | | Merge pull request #8531 from FernandoS27/core-timing-fix-regliamwhite2022-07-102-12/+2
|\ \ \ \ \ \ | |_|/ / / / |/| | | | | Core timing: use only one thread.
| * | | | | Core timing: use only one thread.Fernando Sahmkow2022-07-022-12/+2
| | | | | |
* | | | | | Merge pull request #8501 from liamwhite/backtrace-againMai2022-07-085-15/+51
|\ \ \ \ \ \ | | | | | | | | | | | | | | core/arm: better support for backtrace generation
| * | | | | | core/arm: better support for backtrace generationLiam2022-06-255-15/+51
| | | | | | |
* | | | | | | Merge pull request #8502 from liamwhite/end-waitliamwhite2022-07-072-4/+5
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | kernel: clean up waiting implementation
| * | | | | | | kernel: clean up waiting implementationLiam2022-06-252-4/+5
| |/ / / / / /
* | | | | | | Merge pull request #8492 from german77/no_more_errorsFernando S2022-07-075-40/+76
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | service: hid: Correct some mistakes and add more validations
| * | | | | | | service: hid: Correct some mistakes and add more validationsNarr the Reg2022-06-295-40/+76
| | |_|_|/ / / | |/| | | | |
* | | | | | | Merge pull request #8522 from lat9nq/consolidate-settingsMorph2022-07-078-320/+232
|\ \ \ \ \ \ \ | |_|_|_|/ / / |/| | | | | | settings: Consolidate RangedSetting's with regular ones
| * | | | | | settings: Consolidate RangedSetting's with regular oneslat9nq2022-06-308-320/+232
| |/ / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The latest git version of GCC has issues with my diamond inheritance shenanigans. Since that's now two compilers that don't like it I thought it'd be best to just axe all of it and just have the two templates like before. This rolls the features of BasicRangedSetting into BasicSetting, and likewise RangedSetting into Setting. It also renames them from BasicSetting and Setting to Setting and SwitchableSetting respectively. Now longer name corresponds to more complex thing.
* | | | | | Merge pull request #8486 from liushuyu/github-actions-verifyMorph2022-07-0616-24/+174
|\ \ \ \ \ \ | | | | | | | | | | | | | | CI: Use GitHub Actions to validate pull requests
| * | | | | | CI: unbreak ADO after GHA changesliushuyu2022-07-055-6/+6
| | | | | | |
| * | | | | | CI: lint scriptsliushuyu2022-07-052-3/+2
| | | | | | |
| * | | | | | CI: workaround appimage generation if FUSE is not availableliushuyu2022-07-051-0/+5
| | | | | | |
| * | | | | | CI: upload artifacts for pull request verificationliushuyu2022-07-055-2/+22
| | | | | | |
| * | | | | | CI: fix cachingliushuyu2022-07-056-6/+78
| | | | | | |
| * | | | | | CI: use Ninja to build stuff fasterliushuyu2022-07-053-8/+9
| | | | | | |
| * | | | | | CI: Use GitHub Actions to check pull requestsliushuyu2022-07-054-10/+63
| | | | | | |
* | | | | | | Merge pull request #8532 from liamwhite/fiber-supplementsliamwhite2022-07-069-170/+79
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | common/fiber: make fibers easier to use
| * | | | | | | common/fiber: make fibers easier to useLiam2022-07-029-170/+79
| | |_|_|_|/ / | |/| | | | |
* | | | | | | Merge pull request #8477 from Docteh/less_globalMorph2022-07-051-3/+3
|\ \ \ \ \ \ \ | |_|/ / / / / |/| | | | | | tweak API usage in qt_web_browser.cpp
| * | | | | | tweak API usage in qt_web_browser.cppKyle Kienapfel2022-06-221-3/+3
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | In testing future versions of Qt I forgot to compile with `YUZU_USE_QT_WEB_ENGINE`, so with that flag enabled there are two issues that cropped up. 1. yuzu currently uses setRequestInterceptor, added in Qt 5.6, deprecated in 5.13 with this explaination at https://doc.qt.io/qt-5/qwebengineprofile-obsolete.html Interceptors installed with this method will call QWebEngineUrlRequestInterceptor::interceptRequest on the I/O thread. Therefore the user has to provide thread-safe interaction with the other user classes. For a duration of this call ui thread is blocked. Use setUrlRequestInterceptor instead. 2. QWebEngineSettings::globalSettings() pointer no longer exists in later versions of Qt From what I can tell, QtNXWebEngineView doesn't need to set these globally, when we make changes to settings(), QtWebEngineView::page() creates the page object if it doesn't exist yet. I don't see the page object being destroyed or otherwise replaced, except via destroying the QtNXWebEngineView object. The globalSettings() make sense if Pages or Views objects are being created outside of yuzu's control. To test this I've compared what BrowseNX and Odyssey's Action guide do in mainline 1049 and this PR. For now we're going to go up the chain to QWebEngineProfile::defaultProfile()->settings()
* | | | | | | Merge pull request #8521 from lat9nq/gdbstub-in-boundsMorph2022-07-051-2/+6
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | gdbstub_arch: Directly access SP register
| * | | | | | | gdbstub_arch: Directly access SP registerlat9nq2022-06-301-2/+6
| | |_|/ / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Currently to access the SP register, RegRead and RegWrite rely on a out-of-bounds array access to reach the next element in a struct. As of writing only git versions of GCC catch this error. Specify the SP register when we want to access it in these functions.
* | | | | | | Merge pull request #8527 from zhaobot/tx-update-20220701033842Morph2022-07-0323-8002/+12013
|\ \ \ \ \ \ \ | |_|_|_|_|/ / |/| | | | | | Update translations (2022-07-01)
| * | | | | | Update translations (2022-07-01)The yuzu Community2022-07-0123-8002/+12013
| | |_|/ / / | |/| | | |
* | | | | | Merge pull request #8523 from liamwhite/sc-oopsieFernando S2022-07-012-1/+8
|\ \ \ \ \ \ | | | | | | | | | | | | | | cpu_manager: properly check idle on return from preemption
| * | | | | | cpu_manager: properly check idle on return from preemptionLiam2022-06-302-1/+8
| |/ / / / /
* | | | | | Merge pull request #8490 from liamwhite/read-code-stopMorph2022-07-015-24/+64
|\ \ \ \ \ \ | |/ / / / / |/| | | | | dynarmic: Stop ReadCode callbacks to unmapped addresses
| * | | | | dynarmic: Stop ReadCode callbacks to unmapped addressesLiam2022-06-225-24/+64
| | |_|_|/ | |/| | |
* | | | | Merge pull request #7454 from FernandoS27/new-core-timingFernando S2022-06-308-73/+133
|\ \ \ \ \ | | | | | | | | | | | | Core: Remake Core Timing
| * | | | | Adress Feedback.Fernando Sahmkow2022-06-303-19/+29
| | | | | |
| * | | | | Native clock: Use atomic ops as before.Fernando Sahmkow2022-06-282-24/+29
| | | | | |
| * | | | | Native Clock: remove inaccuracy mask.Fernando Sahmkow2022-06-282-6/+1
| | | | | |
| * | | | | Address feedback.Fernando Sahmkow2022-06-281-13/+13
| | | | | |
| * | | | | Core: Protect each event from race conditions within it.Fernando Sahmkow2022-06-282-0/+2
| | | | | |
| * | | | | Core: Fix tests.Fernando Sahmkow2022-06-283-2/+5
| | | | | |
| * | | | | Core: add missing include.Fernando Sahmkow2022-06-281-0/+1
| | | | | |
| * | | | | Core/Common: Corrections to core timing and add critical priority.Fernando Sahmkow2022-06-283-5/+11
| | | | | |
| * | | | | Core: Reimplement Core Timing.Fernando Sahmkow2022-06-283-55/+93
| | | | | |
| * | | | | Common: improve native clock.Fernando Sahmkow2022-06-283-29/+29
| | | | | |
* | | | | | Merge pull request #8518 from yuzu-emu/revert-8379-amd-push-desc-workaroundFernando S2022-06-301-11/+0
|\ \ \ \ \ \ | |_|_|/ / / |/| | | | | Revert "vulkan_device: Block AMDVLK's VK_KHR_push_descriptor"
| * | | | | Revert "vulkan_device: Block AMDVLK's VK_KHR_push_descriptor"lat9nq2022-06-291-11/+0
|/ / / / /
* | | | | Merge pull request #8512 from german77/nnResultMorph2022-06-29177-1450/+1404
|\ \ \ \ \ | |/ / / / |/| | | | Replace multiple names with a better name
| * | | | video_core: Replace VKUpdateDescriptorQueue with UpdateDescriptorQueuegerman772022-06-2714-33/+33
| | | | |
| * | | | video_core: Replace VKSwapchain with Swapchaingerman772022-06-275-25/+23
| | | | |
| * | | | video_core: Replace VKQueryCache with QueryCachegerman772022-06-276-28/+27
| | | | |
| * | | | video_core: Replace VKScheduler with Schedulergerman772022-06-2735-111/+110
| | | | |
| * | | | video_core: Replace VKBlitScreen with BlitScreengerman772022-06-273-51/+51
| | | | |
| * | | | video_core: Replace VKFenceManager with FenceManagergerman772022-06-273-15/+14
| | | | |
| * | | | core: kernel: Replace instances of KPageLinkedList with KPageGroupgerman772022-06-2711-64/+63
| | | | |
| * | | | core: Replace all instances of ResultCode with Resultgerman772022-06-27140-1176/+1136
| | | | |
* | | | | Merge pull request #8504 from comex/mesosphere-current-processbunnei2022-06-271-0/+24
|\ \ \ \ \ | |/ / / / |/| | | | Support `InfoType_MesosphereCurrentProcess`
| * | | | Re-add missing `case` and braces, and trim whitespacecomex2022-06-261-1/+3
| | | | |
| * | | | Update src/core/hle/kernel/svc.cppcomex2022-06-261-6/+14
| | | | | | | | | | | | | | | Co-authored-by: liamwhite <liamwhite@users.noreply.github.com>
| * | | | Support InfoType_MesosphereCurrentProcesscomex2022-06-261-0/+14
| | | | |
* | | | | Merge pull request #8475 from liamwhite/x18bunnei2022-06-2613-52/+69
|\ \ \ \ \ | |/ / / / |/| | | | kernel: make current thread pointer thread local
| * | | | kernel: make current thread pointer thread localLiam2022-06-2313-52/+69
| | |_|/ | |/| |
* | | | Merge pull request #8500 from liamwhite/pokebunnei2022-06-251-0/+1
|\ \ \ \ | |/ / / |/| | | gdbstub: fix register pokes
| * | | gdbstub: fix register pokesLiam2022-06-251-0/+1
|/ / /
* | | Merge pull request #8491 from Morph1984/extra-assertbunnei2022-06-221-1/+0
|\ \ \ | | | | | | | | KPageTable: Remove extraneous assert
| * | | KPageTable: Remove extraneous assertMorph2022-06-221-1/+0
| | | | | | | | | | | | | | | | Since start is always 0 and VAddr is unsigned, we can safely remove this assert.
* | | | Merge pull request #8483 from liamwhite/fire-emblem-three-semaphoresbunnei2022-06-223-0/+22
|\ \ \ \ | |/ / / |/| | | kernel: wait for threads to stop on pause
| * | | kernel: wait for threads to stop on pauseLiam2022-06-183-0/+22
| | | |
* | | | Merge pull request #8455 from lat9nq/mingw-clangMorph2022-06-222-2/+72
|\ \ \ \ | |_|/ / |/| | | ci/windows: Use Clang for MinGW builds
| * | | ci/windows: Build using Clanglat9nq2022-06-171-3/+11
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Uses the MinGWClangCross toolchain script to build yuzu. Disables our bundled SDL2 to use the system ones that have been modified to not use `-mwindows`. Also set's `-e` to stop the script on an error (as opposed to packaging nothing). Uses LLVM's linker for linking yuzu. Adds -femulated-tls due to a libstdc++ incompatibility between GCC and Clang in vulkan_common.
| * | | CMakeModules: Add MinGWClangCrosslat9nq2022-06-171-0/+55
| | | | | | | | | | | | | | | | | | | | Facilitates what programs we need for cross-compiling to Windows from Linux using LLVM's compilers. Based on MinGWCross
| * | | ci/windows: Split up cmake commandlat9nq2022-06-171-1/+8
| | | | | | | | | | | | | | | | Improves readability.
* | | | Merge pull request #8432 from liamwhite/watchpointbunnei2022-06-2219-54/+510
|\ \ \ \ | | | | | | | | | | core/debugger: memory breakpoint support
| * | | | core/debugger: memory breakpoint supportLiam2022-06-1619-54/+510
| | | | |
* | | | | Merge pull request #8468 from liamwhite/dispatch-trackingbunnei2022-06-224-14/+7
|\ \ \ \ \ | | | | | | | | | | | | kernel: fix some uses of disable_count
| * | | | | kernel: fix some uses of disable_countLiam2022-06-164-14/+7
| |/ / / /
* | | | | Merge pull request #8487 from german77/system-buttonliamwhite2022-06-202-1/+24
|\ \ \ \ \ | |_|_|/ / |/| | | | service: am: Stub PerformSystemButtonPressingIfInFocus
| * | | | service: am: Stub PerformSystemButtonPressingIfInFocusNarr the Reg2022-06-202-1/+24
|/ / / / | | | | | | | | | | | | Used by Ring Fit Adventure
* | | | Merge pull request #8476 from liamwhite/gpu-wasnt-readyMorph2022-06-174-0/+13
|\ \ \ \ | |_|/ / |/| | | core: fix initialization in single core, sync GPU mode
| * | | core: fix initialization in single core, sync GPU modeLiam2022-06-174-0/+13
|/ / /
* | | Merge pull request #8472 from german77/taceMorph2022-06-161-3/+3
|\ \ \ | | | | | | | | common: param_package: Demote DEBUG to TRACE for getters
| * | | common: param_package: Demote DEBUG to TRACE for gettersNarr the Reg2022-06-161-3/+3
| | | |
* | | | Merge pull request #8474 from DCNick3/yuzu-cmd-respect-log-filterMorph2022-06-161-0/+6
|\ \ \ \ | | | | | | | | | | Make yuzu-cmd respect log_filter setting
| * | | | Make yuzu-cmd respect log_filter settingNikita Strygin2022-06-161-0/+6
|/ / / / | | | | | | | | | | | | | | | | | | | | | | | | Because logging infrastructure initializes before the loading of the config, it reads the default setting for log_filter and ignores the one set in config. To change log_filter after logging initialization some additional calls need to be made.
* | | | Merge pull request #8473 from DCNick3/implement-exit-processliamwhite2022-06-161-1/+2
|\ \ \ \ | |_|/ / |/| | | Implement ExitProcess svc
| * | | Implement ExitProcess svcNikita Strygin2022-06-161-1/+2
|/ / / | | | | | | | | | | | | | | | | | | Currently this just stops all the emulation This works under assumption that only application will try to use ExitProcess, with services not touching it If application exits - it quite makes sense to end the emulation
* | | Merge pull request #8457 from liamwhite/kprocess-suspendFernando S2022-06-1612-212/+199
|\ \ \ | | | | | | | | kernel: implement KProcess suspension
| * | | kernel: implement KProcess suspensionLiam2022-06-1412-212/+199
| |/ /
* | | Merge pull request #8460 from Morph1984/bounded-qliamwhite2022-06-162-87/+74
|\ \ \ | | | | | | | | bounded_threadsafe_queue: Use constexpr capacity and mask
| * | | bounded_threadsafe_queue: Use constexpr capacity and maskMorph2022-06-152-87/+74
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | While this is the primary change, we also: - Remove the mpsc namespace and rename Queue to MPSCQueue - Make Slot a private struct within MPSCQueue - Remove the AlignedAllocator template argument, as we use std::allocator - Replace instances of mask + 1 with capacity, and mask + 2 with capacity + 1
* | | | Merge pull request #8317 from german77/notifabunnei2022-06-152-8/+172
|\ \ \ \ | | | | | | | | | | service: notifa: Implement most part of this service
| * | | | service: notifa: Implement most part of this servicegerman772022-05-092-8/+172
| | | | | | | | | | | | | | | | | | | | | | | | | Implements partially RegisterAlarmSetting, UpdateAlarmSetting, LoadApplicationParameter, DeleteAlarmSetting. Needed for Fitness `Boxing 2: Rhythm & Exercise` and `Ring Fit Adventure`.
* | | | | Merge pull request #8464 from liamwhite/break-debugMai2022-06-151-0/+7
|\ \ \ \ \ | | | | | | | | | | | | kernel: notify debugger on break SVC
| * | | | | kernel: notify debugger on break SVCLiam2022-06-151-0/+7
| | |_|/ / | |/| | |
* | | | | Merge pull request #8465 from Morph1984/why-msvcMai2022-06-151-25/+26
|\ \ \ \ \ | | | | | | | | | | | | vk_compute_pass: Explicitly cast to VkAccessFlags
| * | | | | vk_compute_pass: Explicitly cast to VkAccessFlagsMorph2022-06-151-25/+26
|/ / / / / | | | | | | | | | | | | | | | | | | | | | | | | | According to the standard, a narrowing conversion is an implicit conversion from an integer or unscoped enumeration type to an integer type that cannot represent all the values of the original type, except when the value is a literal or constant expression. MSVC, unlike GCC or Clang, determines this to be a narrowing conversion despite the enumeration exclusively containing values that fit within the range of a 32 bit integer, emitting a warning since designated initializers prohibit narrowing conversions. To solve this, explicitly cast to the type we are initializing.
* | | | | Merge pull request #8383 from Morph1984/shadow-of-the-pastMai2022-06-1538-192/+177
|\ \ \ \ \ | | | | | | | | | | | | yuzu: Make variable shadowing a compile-time error
| * | | | | externals: Update cpp-httplib to latestMorph2022-06-141-0/+0
| | | | | |
| * | | | | main: Eliminate variable shadowingMorph2022-06-141-3/+2
| | | | | |
| * | | | | wait_tree: Eliminate variable shadowingMorph2022-06-142-12/+12
| | | | | |
| * | | | | configure_ringcon: Eliminate variable shadowingMorph2022-06-141-4/+4
| | | | | |
| * | | | | configure_touch_from_button: Eliminate variable shadowingMorph2022-06-142-3/+3
| | | | | |
| * | | | | configure_per_game: Eliminate variable shadowingMorph2022-06-142-4/+4
| | | | | |
| * | | | | configure_input_player: Eliminate variable shadowingMorph2022-06-141-39/+39
| | | | | |
| * | | | | configure_dialog: Eliminate variable shadowingMorph2022-06-142-5/+4
| | | | | |
| * | | | | bootmanager: Eliminate variable shadowingMorph2022-06-141-1/+1
| | | | | |
| * | | | | game_list: Eliminate variable shadowingMorph2022-06-145-19/+19
| | | | | |
| * | | | | externals: microprofileui: Eliminate variable shadowingMorph2022-06-141-38/+37
| | | | | |
| * | | | | yuzu_cmd: Eliminate variable shadowingMorph2022-06-145-7/+7
| | | | | |
| * | | | | audio_core: Remove -Werror=unused-parameterMorph2022-06-141-1/+0
| | | | | | | | | | | | | | | | | | | | | | | | Removing this as we don't enforce unused parameter warnings elsewhere in the project, and explicitly specify -Wno-unused-parameter in the main CMakeLists.
| * | | | | CMakeLists: Make variable shadowing a compile-time errorMorph2022-06-146-16/+5
| | | | | | | | | | | | | | | | | | | | | | | | Now that the entire project is free of variable shadowing, we can enforce this as a compile time error to prevent any further introduction of this logic bug.
| * | | | | externals: microprofile: Eliminate variable shadowingMorph2022-06-141-1/+1
| | | | | |
| * | | | | common: Eliminate variable shadowingMorph2022-06-141-2/+2
| | | | | | | | | | | | | | | | | | | | | | | | GCC/Clang treats variables within lambdas as potentially shadowing those outside the lambda, despite them not being captured inside the lambda's capture list.
| * | | | | yuzu: Eliminate variable shadowingMorph2022-06-1410-25/+25
| | | | | |
| * | | | | web_service: Eliminate variable shadowingMorph2022-06-142-12/+12
| | | | | |
* | | | | | Merge pull request #8462 from liamwhite/dynarmic-profileMai2022-06-153-7/+2
|\ \ \ \ \ \ | |_|/ / / / |/| | | | | core: centralize profile scope for Dynarmic
| * | | | | core: centralize profile scope for DynarmicLiam2022-06-153-7/+2
|/ / / / /
* | | | | Merge pull request #8461 from Morph1984/msvc-narrow-convMorph2022-06-141-1/+1
|\ \ \ \ \ | | | | | | | | | | | | vk_compute_pass: Use VK_ACCESS_NONE
| * | | | | vk_compute_pass: Use VK_ACCESS_NONEMorph2022-06-141-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This enumeration was introduced in Vulkan 1.3, prefer using this instead of defaulting the enum. Also resolves a narrowing conversion warning on MSVC.
* | | | | | Merge pull request #8434 from german77/uuidMorph2022-06-142-33/+38
|\ \ \ \ \ \ | |/ / / / / |/| | | | | input_common: Replace usage of string guid to common uuid
| * | | | | input_common: Replace usage of string guid to common uuidNarr the Reg2022-06-072-33/+38
| | | | | |
* | | | | | Merge pull request #8439 from liamwhite/monkey-compilerMai2022-06-1480-213/+221
|\ \ \ \ \ \ | | | | | | | | | | | | | | general: fix compilation on GCC 12
| * | | | | | kernel: fix passthrough of local captures in lambdaLiam2022-06-141-1/+3
| | | | | | |
| * | | | | | common/assert: rework ASSERT handling to avoid std::function usageLiam2022-06-142-35/+20
| | | | | | |
| * | | | | | general: fix compilation on MinGW GCC 12Liam2022-06-143-6/+10
| | | | | | |
| * | | | | | common/assert: add unlikelyLiam2022-06-141-1/+1
| | | | | | |
| * | | | | | general: fix compilation on GCC 12Liam2022-06-142-2/+2
| | | | | | |
| * | | | | | kernel: ensure class token lambda exit is unreachableLiam2022-06-141-0/+1
| | | | | | |
| * | | | | | kernel: fix inconsistency in AutoObjectTraits macro definitionsLiam2022-06-141-4/+7
| | | | | | |
| * | | | | | common: Don't test ASSERT conditions inlineLiam2022-06-142-32/+36
| | | | | | |
| * | | | | | common: Change semantics of UNREACHABLE to unconditionally crashLiam2022-06-1472-173/+182
| | |_|_|/ / | |/| | | |
* | | | | | Merge pull request #8459 from Morph1984/wextra-gccMai2022-06-141-1/+1
|\ \ \ \ \ \ | |/ / / / / |/| | | | | vk_compute_pass: Silence Wextra warning
| * | | | | vk_compute_pass: Silence Wextra warningMorph2022-06-141-1/+1
|/ / / / / | | | | | | | | | | | | | | | Silences a warning about using enumerated and non-enumerated types in a conditional expression.
* | | | | Merge pull request #8458 from lat9nq/no-constexpr-flow-blockliamwhite2022-06-141-6/+0
|\ \ \ \ \ | | | | | | | | | | | | structured_control_flow: Remove constexpr Flow::Block
| * | | | | structured_control_flow: Remove constexpr Flow::Blocklat9nq2022-06-141-6/+0
| | |/ / / | |/| | | | | | | | | | | | | | | | | | | | | | | This seems to be unsupported in newer libstdc++ versions due to Flow::Block's base class being a non-literal type. It's not clear to me why this was permitted in earlier versions.
* | | | | Merge pull request #8388 from liamwhite/simpler-pausebunnei2022-06-143-95/+36
|\ \ \ \ \ | |/ / / / |/| | | | CpuManager: simplify pausing
| * | | | CpuManager: simplify pausingLiam2022-06-093-95/+36
| | | | |
* | | | | Merge pull request #8446 from liamwhite/cmd-gdbMorph2022-06-1312-8/+96
|\ \ \ \ \ | | | | | | | | | | | | core/debugger: support operation in yuzu-cmd
| * | | | | yuzu-cmd: ignore bogus timeous from SDLLiam2022-06-101-1/+9
| | | | | |
| * | | | | core/debugger: fix a number of shutdown deadlocksLiam2022-06-109-7/+72
| | | | | |
| * | | | | core/debugger: support operation in yuzu-cmdLiam2022-06-103-0/+15
| |/ / / /
* | | | | Merge pull request #8454 from liamwhite/inaddr-anyMorph2022-06-131-1/+1
|\ \ \ \ \ | | | | | | | | | | | | core/debugger: allow remote connections
| * | | | | core/debugger: allow remote connectionsLiam2022-06-121-1/+1
| | |_|_|/ | |/| | |
* | | | | Merge pull request #8443 from liamwhite/code-membunnei2022-06-133-26/+118
|\ \ \ \ \ | |/ / / / |/| | | | kernel: fix KCodeMemory initialization
| * | | | kernel: fix KCodeMemory initializationLiam2022-06-093-26/+118
| |/ / /
* | | | Merge pull request #8450 from lioncash/undefliamwhite2022-06-121-0/+1
|\ \ \ \ | | | | | | | | | | gdbstub_arch: Add missing virtual destructor
| * | | | gdbstub_arch: Add missing virtual destructorLioncash2022-06-121-0/+1
|/ / / / | | | | | | | | | | | | | | | | The class is used polymorphically, so it's undefined behavior to delete instances of GDBStubA64 and GDBStubA32 from the base class pointer.
* | | | Merge pull request #8353 from Docteh/msvc_report_runtimeMai M2022-06-112-0/+30
|\ \ \ \ | | | | | | | | | | log the MSVC runtime version when running on MSVC build
| * | | | log the MSVC runtime version when running on MSVC buildKyle Kienapfel2022-06-112-0/+30
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This might be useful information, not 100% sure. [ 0.958068] Frontend <Info> yuzu\main.cpp:GMainWindow:275: yuzu Version: yuzu Development Build | master-0b9ef3c0b-dirty [ 0.958095] Frontend <Info> yuzu\main.cpp:LogRuntimes:220: MSVC Compiler: 1931 Runtime: 14.32.31326.0
* | | | | Merge pull request #8427 from Docteh/deprecate_qdesktopMai M2022-06-111-3/+15
|\ \ \ \ \ | | | | | | | | | | | | deprecate usage of QDesktopWidget for going fullscreen
| * | | | | deprecate usage of QDesktopWidget for going fullscreenKyle Kienapfel2022-06-061-3/+15
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Idea works as follows, while going fullscreen we compare the current window geometry with available screens and ask for an intersection rectangle, we go fullscreen where most of the window is located GuessCurrentScreen could also potentially be used to see which screen the window is on for dynamic DPI handling
* | | | | | Merge pull request #8449 from Docteh/translate_placeholderMai M2022-06-112-1/+16
|\ \ \ \ \ \ | | | | | | | | | | | | | | retranslate the game list placeholder
| * | | | | | UI: retranslate the game list placeholderKyle Kienapfel2022-06-112-1/+16
| |/ / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This is the "Double-click to add a new folder to the game list" message that shows up when users first launch yuzu and is most likely never seen again. Previously this message was not re-translated.
* | | | | | Merge pull request #8413 from behunin/bounded-queuebunnei2022-06-113-4/+185
|\ \ \ \ \ \ | | | | | | | | | | | | | | gpu_thread: Move to bounded queue
| * | | | | | gpu_thread: Move to bounded queueLevi Behunin2022-06-033-4/+185
| | | | | | |
* | | | | | | Merge pull request #8393 from lat9nq/default-vulkanbunnei2022-06-1112-48/+184
|\ \ \ \ \ \ \ | |_|_|/ / / / |/| | | | | | general: Set renderer_backend's default to Vulkan
| * | | | | | configure_graphics: Remove unused includelat9nq2022-06-041-1/+0
| | | | | | |
| * | | | | | main: Insert warning text on broken Vulkanlat9nq2022-05-301-1/+6
| | | | | | | | | | | | | | | | | | | | | | | | | | | | Co-authored-by: Schplee <24275329+Schplee@users.noreply.github.com>
| * | | | | | main: Save config on broken Vulkan detectlat9nq2022-05-301-0/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Prevents possible issues if someone were to open yuzu repeatedly over and over again.
| * | | | | | yuzu-qt: Make has_broken_vulkan only for crasheslat9nq2022-05-305-11/+17
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Being able to catch and handle a Vulkan exception is not what this is for.
| * | | | | | vulkan_library: Add debug logginglat9nq2022-05-301-0/+4
| | | | | | |
| * | | | | | yuzu-qt: Attempt to workaround broken Vulkan installationslat9nq2022-05-309-46/+166
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This does a few things in order to make the default setting Vulkan workable. - When yuzu boots, it just opens the Vulkan library. - If it works, all good and we continue with Vulkan as the default. - If something breaks, a new file in the config directory will be left behind (this is deleted normally). - If Vulkan is not working, has_broken_vulkan is set to true. - The first time this happens, a warning is displayed to notify the user. - This forces use of OpenGL, and Vulkan cannot be selected. - The Shader Backend selector is made accessible for use in custom configurations. - To disable has_broken_vulkan, the user needs to press a button in Graphics Configuration to manually run the Vulkan device enumeration.
| * | | | | | default_ini: Reflect new renderer backend default settinglat9nq2022-05-301-1/+1
| | | | | | |
| * | | | | | settings: Set Vulkan to the default renderer backendlat9nq2022-05-301-1/+1
| | | | | | |
* | | | | | | Merge pull request #8405 from Docteh/dock_undockMai M2022-06-115-5/+50
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | ui: Status bars dock button becomes DOCKED/HANDHELD button
| * | | | | | | ui: Status bars dock button becomes dock/undock buttonKyle Kienapfel2022-06-025-5/+50
| | |_|/ / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | For people not used to the Yuzu UI it's not always clear if the emulated console is docked or not. The other items update their text when clicked, this PR brings the DOCK button in line with this. DOCK -> DOCKED or HANDHELD
* | | | | | | Merge pull request #8333 from Docteh/translate_hotkeysMai M2022-06-112-26/+40
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | UI: Translate hotkey labels in configuration
| * | | | | | | UI: Translate hotkey labels in configurationKyle K2022-05-192-26/+40
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Another request from GillianMC. The translated strings have been placed in a separate "Hotkeys" context as an alternative to having to add the tr function to the Config class, or adding them to ConfigureHotkeys context which is quite long. The English strings get attached to the items in the Action column as "data", and are used for RetranslateUI and saving the hotkey configuration.
* | | | | | | | Merge pull request #8318 from Docteh/cmake-qt56-entryMai M2022-06-1110-35/+25
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | Update some files with Qt 5.15.2 best practices in mind
| * | | | | | | | motion touch ui: move remaining connection out of .ui fileKyle K2022-05-302-18/+3
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Two reasons for this: 1. Out of 7 connections, 6 are in ConfigureMotionTouch::ConnectEvents, this is the outlier. 2. Qt6 doesn't moc the connection properly
| * | | | | | | | Update some files with Qt 5.15.2 best practices in mindKyle K2022-05-298-17/+22
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | There was some discussion about updating to Qt6 and I figured I would work on some smaller parts. For Windows platform the WinMain function has moved from the Qt5::WinMain to a new one called Qt6::EntryPointPrivate Also Qt5 supports versionless CMake targets https://www.qt.io/blog/versionless-cmake-targets-qt-5.15 These other changes in this commit are to support Qt6, but in ways that don't mess with Qt5. src/yuzu/bootmanager.cpp: Qt6 complains about not being able to know to use QPoint or QPointF, picking QPoint src/yuzu/bootmanager.h: Qt6 prefers that QStringList.h be included rather than an empty class definition src/yuzu/configuration/configure_system.cpp: toULongLong intends to return unsigned 64 bit integer, but Settings::values.rng_seed is only 32 bits wide src/yuzu/game_list.cpp: Qt6 returns a different datatype for QStringList.length than Qt5, it used to be int, but in Qt6 its now qsizetype src/yuzu/loading_screen.cpp: Qt5's for QStyleOption.init say to switch to initFrom. The QStyleOption.init doesn't exist in Qt6 src/yuzu/main.cpp: Another QPointer and QStringList.size, lets standardize on size()
* | | | | | | | | Merge pull request #8448 from german77/gesturetypoMai M2022-06-102-4/+3
|\ \ \ \ \ \ \ \ \ | |_|_|_|_|_|/ / / |/| | | | | | | | service: hid: Fix gesture regression
| * | | | | | | | service: hid: Fix gesture regressionNarr the Reg2022-06-102-4/+3
|/ / / / / / / /
* | | | | | | | Merge pull request #8428 from bunnei/nvflinger-fix-timingbunnei2022-06-083-31/+3
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | Follow-up fixes for NVFlinger rewrite (Part 3)
| * | | | | | | | hle: service: nvflinger: buffer_queue_consumer: Always free released buffers.bunnei2022-06-063-31/+3
| | | | | | | | |
* | | | | | | | | Merge pull request #8436 from liamwhite/asio-usagebunnei2022-06-071-2/+2
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | core/debugger: fix asio write usage
| * | | | | | | | | core/debugger: fix asio write usageLiam2022-06-071-2/+2
| | | | | | | | | |
* | | | | | | | | | Merge pull request #8435 from liamwhite/lambda-captureMai M2022-06-071-8/+9
|\| | | | | | | | | | | | | | | | | | | | | | | | | | | | | core/debugger: fix crash due to incorrect lambda capture
| * | | | | | | | | core/debugger: fix crash due to incorrect lambda captureLiam2022-06-071-8/+9
|/ / / / / / / / /
* | | | | | | | | Merge pull request #8367 from Docteh/say_win11bunnei2022-06-061-1/+26
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | Logging: Report Post Windows 10 2004 versions, like Windows 11
| * | | | | | | | | Logging: Report Post Windows 10 2004 versions, like Windows 11Kyle K2022-05-291-1/+26
| | |_|_|/ / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Qt5 and Qt6 don't really do a good job of reporting Windows versions past the 2004 version. Current: Windows 10 Version 2009 This Patch: Windows 10 Version 21H1 (Build 19043.1706) Also: Windows 11 Version 21H2 (Build 22000.675) Fixes: #8362
* | | | | | | | | Merge pull request #8426 from liamwhite/elfbunnei2022-06-065-263/+371
|\ \ \ \ \ \ \ \ \ | |_|/ / / / / / / |/| | | | | | | | common: consolidate ELF structure definitions
| * | | | | | | | common: consolidate ELF structure definitionsLiam2022-06-055-263/+371
| | | | | | | | |
* | | | | | | | | Merge pull request #8419 from liamwhite/library-listMai M2022-06-061-22/+28
|\ \ \ \ \ \ \ \ \ | |_|_|_|_|_|_|/ / |/| | | | | | | | gdbstub: add missing library list query
| * | | | | | | | gdbstub: add missing library list commandLiam2022-06-041-22/+28
| |/ / / / / / /
* | | | | | | | Merge pull request #8395 from german77/ir_stubbunnei2022-06-042-21/+460
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | service: hid: Improve stub of IRS
| * | | | | | | | service: hid: Improve stub of IRSNarr the Reg2022-05-312-21/+460
| | | | | | | | |
* | | | | | | | | Merge pull request #8414 from bylaws/masterFernando S2022-06-032-3/+3
|\ \ \ \ \ \ \ \ \ | |_|/ / / / / / / |/| | | | | | | | Maxwell3D: Fix 3D semaphore counter type 0 handling
| * | | | | | | | Maxwell3D: Fix 3D semaphore counter type 0 handlingBilly Laws2022-06-022-3/+3
|/ / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | Counter type 0 actually releases the semaphore payload rather than a constant zero as was previously thought. This is required by Skyrim.
* | | | | | | | Merge pull request #8410 from liamwhite/thread-namesMai M2022-06-024-14/+172
|\ \ \ \ \ \ \ \ | |_|_|_|_|_|/ / |/| | | | | | | gdbstub: Support reading guest thread names
| * | | | | | | core/debugger: Support reading guest thread namesLiam2022-06-024-14/+172
| | | | | | | |
* | | | | | | | Merge pull request #8409 from liamwhite/tdesc-fixMai M2022-06-022-10/+87
|\ \ \ \ \ \ \ \ | |/ / / / / / / |/| | | | | | | gdbstub: fix target descriptions
| * | | | | | | gdbstub: fix target descriptionsLiam2022-06-022-10/+87
| | | | | | | |
* | | | | | | | Merge pull request #8402 from liamwhite/better-stepMorph2022-06-0216-122/+252
|\ \ \ \ \ \ \ \ | |/ / / / / / / |/| | | | | | | core/debugger: Improved stepping mechanism and misc fixes
| * | | | | | | core/debugger: Improved stepping mechanism and misc fixesLiam2022-06-0116-122/+252
| | | | | | | |
* | | | | | | | Merge pull request #8400 from Docteh/fullscreen_glitchbunnei2022-06-011-0/+4
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | fix UI opening fullscreen after certain crashes
| * | | | | | | | fix UI opening fullscreen after certain crashesKyle Kienapfel2022-06-011-0/+4
| | |_|/ / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Sometimes when yuzu crashes, it restarts with the games list in fullscreen, which would be fine, except there isn't an easy way to exit this. It also doesn't occur often enough for qt-config.ini files to be in good supply. UILayout\geometry value in qt-config.ini is the culprit, at least for the one provided. Proposed fix is to simply check isFullScreen when yuzu is starting up, and take it out of full screen immediately
* | | | | | | | Merge pull request #8404 from Morph1984/virtualliamwhite2022-06-013-2/+6
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | core/debugger: Define defaulted virtual destructors
| * | | | | | | | core/debugger: Define defaulted virtual destructorsMorph2022-06-013-2/+6
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Resolves an MSVC warning where a virtual destructor is not defined in the base class with virtual functions.
* | | | | | | | | Merge pull request #8403 from Morph1984/castliamwhite2022-06-011-2/+2
|\ \ \ \ \ \ \ \ \ | |/ / / / / / / / |/| | | | | | | | gdbstub: Explicitly cast return type to u8
| * | | | | | | | gdbstub: Explicitly cast return type to u8Morph2022-06-011-2/+2
|/ / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | Otherwise, the addition promotes the returned value to an int instead of keeping it as a u8.
* | | | | | | | Merge pull request #8394 from liamwhite/debuggerMai M2022-06-0127-42/+1500
|\ \ \ \ \ \ \ \ | | |/ / / / / / | |/| | | | | | core/debugger: Implement new GDB stub debugger
| * | | | | | | core/debugger: Implement new GDB stub debuggerLiam2022-06-0127-42/+1500
| | |/ / / / / | |/| | | | |
* | | | | | | Merge pull request #8401 from zhaobot/tx-update-20220601034505Mai M2022-06-0123-4841/+4738
|\ \ \ \ \ \ \ | |/ / / / / / |/| | | | | | Update translations (2022-06-01)
| * | | | | | Update translations (2022-06-01)The yuzu Community2022-06-0123-4841/+4738
|/ / / / / /
* | | | | | Merge pull request #8368 from german77/seventimesbunnei2022-05-306-368/+643
|\ \ \ \ \ \ | | | | | | | | | | | | | | Service: hid: Several improvements and implementations
| * | | | | | service: hid: Implement ResetIsSixAxisSensorDeviceNewlyAssignedgerman772022-05-275-6/+125
| | | | | | | | | | | | | | | | | | | | | | | | | | | | Needed by Nintendo Switch Sports
| * | | | | | service: hid: Implement LoadSixAxisSensorCalibrationParameter and GetSixAxisSensorIcInformationgerman772022-05-275-3/+136
| | | | | | | | | | | | | | | | | | | | | | | | | | | | Needed by Nintendo Switch Sports
| * | | | | | service: hid: Implement EnableSixAxisSensorUnalteredPassthrough and IsSixAxisSensorUnalteredPassthroughEnabledgerman772022-05-274-2/+88
| | | | | | | | | | | | | | | | | | | | | | | | | | | | Needed by Nintendo Switch Sports
| * | | | | | service: hid: Add error handling to sixaxis functionsgerman772022-05-273-31/+55
| | | | | | |
| * | | | | | service: hid: Refractor sixaxis functionsgerman772022-05-272-185/+88
| | | | | | |
| * | | | | | service: hid: Implement MergeSingleJoyAsDualJoy according to REgerman772022-05-274-65/+57
| | | | | | |
| * | | | | | service: hid: Add error handling to setNpadAssignment and variantsgerman772022-05-273-23/+27
| | | | | | |
| * | | | | | service: hid: Quick RE fixes and commentsgerman772022-05-274-54/+68
| | | | | | |
* | | | | | | Merge pull request #8392 from Morph1984/boostedMai M2022-05-301-2/+2
|\ \ \ \ \ \ \ | |_|_|_|_|/ / |/| | | | | | CMakeLists: Update boost to 1.79.0
| * | | | | | CMakeLists: Update boost to 1.79.0Morph2022-05-301-2/+2
|/ / / / / / | | | | | | | | | | | | | | | | | | This version of boost brings in a number of bug fixes, especially to the asio library. Details can be seen here: https://www.boost.org/users/history/version_1_79_0.html
* | | | | | Merge pull request #8348 from JakobDev/metainfocontrolbunnei2022-05-291-0/+5
|\ \ \ \ \ \ | | | | | | | | | | | | | | Add control to metainfo
| * | | | | | Add control to MetainfoJakobDev2022-05-171-0/+5
| | | | | | |
* | | | | | | Merge pull request #8332 from Morph1984/reduce_exec_sizebunnei2022-05-294-19/+18
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | general: Use smaller array types where applicable
| * | | | | | | time_zone_manager: Use s8 for month length tablesMorph2022-05-131-4/+3
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Using this smaller type saves 512 bytes in the compiled executable.
| * | | | | | | video_core/surface: Use u8 for PixelFormat block tablesMorph2022-05-131-3/+3
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Using this smaller type saves 33280 bytes in the compiled executable.
| * | | | | | | codecs/vp9: Use u8 for norm and map lutsMorph2022-05-131-4/+4
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Using this smaller type saves 1536 bytes in the compiled executable.
| * | | | | | | command_generator: Use u8 for tap index lutMorph2022-05-131-8/+8
| | |_|_|/ / / | |/| | | | | | | | | | | | | | | | | | | Using this smaller type saves 1024 bytes in the compiled executable.
* | | | | | | Merge pull request #8339 from Docteh/about_iconbunnei2022-05-293-3/+19
|\ \ \ \ \ \ \ | |_|_|_|/ / / |/| | | | | | about dialog: Fix yuzu icon
| * | | | | | about dialog: Fix the logo in a multiplatform wayKyle K2022-05-163-3/+19
| |/ / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The Icon was renamed in #8283 for Linux builds, and the fix proposed in #8312 would in turn break the icon for Windows users. I've decided to fix the aboutdialog.ui file via qtcreator. I'm not sure its important to have the yuzu icon inside the About dialog grabbed from the local Qt theme, but I've reword how the code works for that, and we can just delete those lines. I've also thrown the yuzu.png through pngcrush to remove this warning libpng warning: iCCP: known incorrect sRGB profile Credit to abouvier for bringing bug up.
* | | | | | Merge pull request #8385 from lat9nq/just-subsys-winMai M2022-05-281-1/+1
|\ \ \ \ \ \ | | | | | | | | | | | | | | yuzu-qt: Call -Wl,--subsystem,windows directly
| * | | | | | yuzu-qt: Call -Wl,--subsystem,windows directlylat9nq2022-05-281-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | -mwindows doesn't work with Clang. tpoechtrager/wclang resolves this by just using MinGW-GCC to link the executable, however this prevents us from using LLVM-exclusive tools when building yuzu. Solution is to send the linker argument we need from -mwindows directly to the linker. From https://gcc-help.gcc.gnu.narkive.com/FogklN5J/gcc-wl-subsystem-windows-mwindows-options
* | | | | | | Merge pull request #8374 from german77/asnycvibrationsbunnei2022-05-284-7/+63
|\ \ \ \ \ \ \ | |/ / / / / / |/| | | | | | input_common: Make vibration request async
| * | | | | | input_common: Make vibration request asyncNarr the Reg2022-05-234-7/+63
| | |_|/ / / | |/| | | |
* | | | | | Merge pull request #8372 from german77/touchbunnei2022-05-278-92/+140
|\ \ \ \ \ \ | | | | | | | | | | | | | | input_common: touch: Rewrite touch driver to support multiple touch points
| * | | | | | input_common: touch: Rewrite touch driver to support multiple touch pointsgerman772022-05-238-92/+140
| |/ / / / /
* | | | | | Merge pull request #8381 from lat9nq/path-util-pointer-boolMai M2022-05-271-3/+1
|\ \ \ \ \ \ | | | | | | | | | | | | | | path_util: Resolve `-Wpointer-bool-conversion` warning
| * | | | | | path_util: Resolve `-Wpointer-bool-conversion` warninglat9nq2022-05-271-3/+1
|/ / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Clang (rightfully) warns that we are checking for the existence of pointer to something just allocated on the stack, which is always true. Instead, check whether GetModuleFileNameW failed. Co-authored-by: Mai M <mathew1800@gmail.com>
* | | | | | Merge pull request #8379 from lat9nq/amd-push-desc-workaroundbunnei2022-05-251-0/+11
|\ \ \ \ \ \ | | | | | | | | | | | | | | vulkan_device: Block AMDVLK's VK_KHR_push_descriptor
| * | | | | | vulkan_device: Block AMDVLK's VK_KHR_push_descriptorlat9nq2022-05-251-0/+11
| |/ / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Recent AMD Vulkan drivers (22.5.2 or 2.0.226 for specifically Vulkan) have a broken VK_KHR_push_descriptor implementation that causes a crash in yuzu. Disable it for the time being.
* | | | | | Merge pull request #8369 from lat9nq/amd-wmel-workaroundbunnei2022-05-251-1/+6
|\ \ \ \ \ \ | | | | | | | | | | | | | | vulkan_device: Workaround extension bug
| * | | | | | vulkan_device: Workaround extension buglat9nq2022-05-251-1/+6
| | |_|_|/ / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | A bug occurs in yuzu when VK_KHR_workgroup_memory_explicit_layout is available but 16-bit integers are not supported in the host driver. Disable usage of the extension when this case arises.
* | | | | | Merge pull request #8311 from asLody/fix-stencil-facesbunnei2022-05-251-2/+2
|\ \ \ \ \ \ | |_|/ / / / |/| | | | | vk_rasterizer: fix stencil test when two faces are disabled
| * | | | | vk_rasterizer: fix stencil test when two faces are disabledLody2022-05-061-2/+2
| | |_|_|/ | |/| | |
* | | | | Merge pull request #8342 from lat9nq/clang-latest-stdc++liamwhite2022-05-214-16/+25
|\ \ \ \ \ | |_|/ / / |/| | | | general: Use Common::U16StringFromBuffer in place of QString::toStdU16String
| * | | | qt_software_keyboard: Address review feedbacklat9nq2022-05-161-14/+14
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Use auto and a more descriptive variable name. Secondly, fix some C++ misconceptions or constructing too many objects. Co-authored-by: Morph <39850852+Morph1984@users.noreply.github.com> Co-authored-by: Lioncash <mathew1800@gmail.com>
| * | | | main: Use Common::U16StringFromBufferlat9nq2022-05-161-2/+4
| | | | | | | | | | | | | | | | | | | | See ffd3afcf2
| * | | | qt_software_keyboard: Use Common::U16StringFromBufferlat9nq2022-05-161-14/+15
| | | | | | | | | | | | | | | | | | | | See ffd3afcf2
| * | | | string_util: Add U16StringFromBufferlat9nq2022-05-162-0/+6
| | |_|/ | |/| | | | | | | | | | | | | | | | | | Qt's QString::toStdU16String doesn't work when compiling against the latest libstdc++, at least when using Clang. This function effectively does the same thing as the aforementioned one.
* | | | Merge pull request #8351 from abouvier/patch-2Mai M2022-05-172-0/+2
|\ \ \ \ | |/ / / |/| | | video_core: Support new VkResult
| * | | video_core: Support new VkResultAlexandre Bouvier2022-05-172-0/+2
|/ / /
* | | Merge pull request #8336 from abouvier/unspirvMai M2022-05-151-0/+0
|\ \ \ | | | | | | | | sirit: Allow using system spirv-headers
| * | | sirit: Allow using system spirv-headersAlexandre Bouvier2022-05-141-0/+0
| | |/ | |/|
* | | Merge pull request #8337 from lioncash/fmtMai M2022-05-153-3/+3
|\ \ \ | |/ / |/| | general: Avoid ambiguous format_to compilation errors
| * | general: Avoid ambiguous format_to compilation errorsLioncash2022-05-143-3/+3
|/ / | | | | | | | | | | | | Ensures that we're using the fmt version of format_to. These are also the only three outliers. All of the other formatters we have are properly qualified.
* | Merge pull request #8308 from german77/disablesixMorph2022-05-112-52/+47
|\ \ | | | | | | service: hid: Disable correctly motion input
| * | service: hid: Fix motion refresh rateNarr the Reg2022-05-062-2/+6
| | |
| * | service: hid: Disable correctly motion inputgerman772022-05-061-50/+41
| |/
* | Merge pull request #8314 from liamwhite/gl-flip-2Morph2022-05-111-4/+3
|\ \ | | | | | | OpenGL: interpret face flips according to GL NDC
| * | OpenGL: implement face flips according to NDCLiam2022-05-071-4/+3
| |/
* | Merge pull request #8313 from liamwhite/dma-bppMorph2022-05-111-3/+6
|\ \ | | | | | | maxwell_dma: fix bytes_per_pixel
| * | maxwell_dma: use fallback if remapping is enabledLiam2022-05-111-3/+6
| | |
| * | maxwell_dma: fix bytes per pixelLiam2022-05-071-3/+3
| |/
* | Merge pull request #8328 from liamwhite/macro-clearMorph2022-05-113-0/+10
|\ \ | | | | | | video_core/macro: clear code on upload address assignment
| * | video_core/macro: clear code on upload address assignmentLiam2022-05-103-0/+10
| | |
* | | Merge pull request #8325 from zhaobot/tx-update-20220509164742Mai M2022-05-1023-12781/+15829
|\ \ \ | |/ / |/| | Update translations (2022-05-09)
| * | Update translations (2022-05-09)The yuzu Community2022-05-0923-12781/+15829
|/ /
* | Merge pull request #8320 from liamwhite/macro-dumpMai M2022-05-094-0/+44
|\ \ | | | | | | video_core/macro: Add option to dump macros
| * | VideoCore: Add option to dump the macros.Fernando Sahmkow2022-05-094-0/+44
|/ / | | | | | | Co-Authored-By: liamwhite <liamwhite@users.noreply.github.com>
* | Merge pull request #8319 from liamwhite/macro-warnMai M2022-05-081-3/+21
|\ \ | |/ |/| video_core/macro_jit_x64: warn on invalid parameter access
| * video_core/macro_jit_x64: warn on invalid parameter accessLiam2022-05-081-3/+21
|/
* Merge pull request #8300 from Morph1984/resultval-rangeMai M2022-05-041-2/+4
|\ | | | | hle/result: Add ResultRange overload in ResultVal
| * hle/result: Update std::expected replacement messageMorph2022-05-031-1/+1
| | | | | | | | std::expected is included in C++23
| * hle/result: Add ResultRange overload in ResultValMorph2022-05-031-1/+3
|/ | | | Also marks the implicit conversion operator as constexpr instead of consteval as the constructor is not constant evaluated.
* Merge pull request #8272 from german77/stick_rangebunnei2022-05-034-9/+30
|\ | | | | yuzu: config: Improve analog stick mapping
| * yuzu: Config allow to delete single axis directions when buttons are mapped to a stickNarr the Reg2022-04-272-3/+24
| |
| * yuzu: config: Set default range to 95%Narr the Reg2022-04-273-6/+6
| |
* | Merge pull request #8296 from Morph1984/result-rangeMai M2022-05-031-0/+42
|\ \ | | | | | | hle/result: Implement ResultRange
| * | hle/result: Implement ResultRangeMorph2022-05-031-0/+42
| | | | | | | | | | | | | | | | | | A ResultRange defines an inclusive range of error descriptions within an error module. This can be used to check whether the description of a given ResultCode falls within the range. The conversion function returns a ResultCode with its description set to description_start.
* | | Merge pull request #8297 from yuzu-emu/revert-8295-patch-1Morph2022-05-021-4/+0
|\ \ \ | | | | | | | | Revert "gc_adapter: fix libusb import on GCC11.2"
| * | | Revert "gc_adapter: fix libusb import on GCC11.2"Morph2022-05-021-4/+0
|/ / / | | | | | | | | | This reverts commit f72f4377f4cbbe45e5a43bb67c7245737ffa135f.
* / / gc_adapter: fix libusb import on GCC11.2Levi Behunin2022-05-021-0/+4
|/ / | | | | | | Just to silence an intermittent error. GCC11.2 complains cannot find 'libusb.h' during a fresh build.
* | Merge pull request #8293 from Docteh/translate_networkMai M2022-05-022-2/+11
|\ \ | | | | | | ui: retranslate the network tab
| * | ui: retranslate the network tabKyle K2022-05-022-2/+11
|/ / | | | | | | | | Looks like it was just missed when it was added, as currently the Network Tab only has one item RetranslateUI is used more commonly throughout the project
* | Merge pull request #8283 from Tachi107/appstreamMai M2022-05-014-16/+71
|\ \ | | | | | | dist: add AppStream metadata
| * | dist: add AppStream metadataAndrea Pappacoda2022-04-294-16/+71
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The AppStream file is mostly copied from the one already used by the Flatpak yuzu build: https://github.com/flathub/org.yuzu_emu.yuzu/blob/62fc225acfa0178ddf61be68ad9be60841077263/org.yuzu_emu.yuzu.metainfo.xml As it already defines the application id as org.yuzu_emu.yuzu I renamed the yuzu.desktop and yuzu.xml files so that they match. I've also made some minor tweaks to it, like fixing the capitalization of "yuzu", adding a few keys and sorting them as presented in the documentation. Lastly, I added PrefersNonDefaultGPU=true to the .desktop file so that yuzu is launched with the dedicated graphics card on Linux.
* | | Merge pull request #8291 from Docteh/ampm_fixMai M2022-05-011-3/+0
|\ \ \ | | | | | | | | ui: let system locale control format of Custom RTC
| * | | ui: let system locale control format of Custom RTCKyle K2022-05-011-3/+0
|/ / / | | | | | | | | | | | | | | | | | | | | | | | | The Custom RTC widget is under the influence of the computers System Locale. The format strings are not necessarily related. As a small example, setting the Windows Language to Dansk, and then trying to use yuzu in English the requested AM/PM indicator is simply not shown The display format for the Custom RTC field needs to be removed from src/yuzu/configuration/configure_system.ui modifying the display format needs to be moved to src/yuzu/configuration/configure_system.cpp
* | | Merge pull request #8274 from german77/firmwareMorph2022-04-292-1/+21
|\ \ \ | |/ / |/| | service: hid: Stub IsFirmwareUpdateNeededForNotification
| * | service: hid: Stub IsFirmwareUpdateNeededForNotificationgerman772022-04-272-1/+21
| |/ | | | | | | Used in Fitness Boxing 2: Rhythm & Exercise (0100073011382000)
* | Merge pull request #8280 from Tachi107/spdx-fixupMai M2022-04-2933-357/+90
|\ \ | | | | | | chore: add missing SPDX tags
| * | chore: add missing SPDX tagsAndrea Pappacoda2022-04-2833-357/+90
| | | | | | | | | | | | Follow-up to 99ceb03a1cfcf35968cab589ea188a8c406cda52
* | | Merge pull request #8282 from liamwhite/gcc-12Mai M2022-04-294-4/+4
|\ \ \ | |/ / |/| | GCC 12 fixes
| * | GCC 12 fixesLiam2022-04-284-4/+4
| | |
* | | Merge pull request #8267 from Morph1984/swapbuffersbunnei2022-04-281-0/+5
|\ \ \ | | | | | | | | renderer_vulkan: Update screen info if the framebuffer size has changed
| * | | renderer_vulkan: Update screen info if the framebuffer size has changedMorph2022-04-261-0/+5
| | |/ | |/|
* | | Merge pull request #8236 from Docteh/sort_translationsMai M2022-04-281-6/+67
|\ \ \ | | | | | | | | Changes to language order in General -> UI -> Interface Language
| * | | Changes to language order in General -> UI -> Interface LanguageKyle K2022-04-271-6/+67
| | | | | | | | | | | | | | | | | | | | | | | | Language List is from Dolphin, specifically https://github.com/dolphin-emu/dolphin/blob/master/Source/Core/DolphinQt/Settings/InterfacePane.cpp#L30 Any languages that are compiled in, but not in the list will be at the end.
* | | | Merge pull request #8229 from german77/reinterpret2bunnei2022-04-2722-386/+429
|\ \ \ \ | |_|/ / |/| | | service: hid: Access shared memory directly
| * | | service: hid: Ensure all structs are initializedNarr the Reg2022-04-2416-104/+105
| | | |
| * | | service: hid: Access shared memory directlyNarr the Reg2022-04-2321-305/+347
| |/ /
* | | Merge pull request #8262 from Morph1984/conanbunnei2022-04-261-4/+2
|\ \ \ | | | | | | | | CMakeLists: Update Conan requirement to 1.45.0
| * | | CMakeLists: Download conan.cmake 0.18.1Morph2022-04-251-3/+1
| | | |
| * | | CMakeLists: Update Conan requirement to 1.45.0Morph2022-04-251-1/+1
| | | |
* | | | Merge pull request #8256 from Morph1984/ci-vs-2022bunnei2022-04-253-3/+3
|\ \ \ \ | |/ / / |/| | | ci: Enable building with Visual Studio 2022
| * | | ci: Update build generator to VS 2022Morph2022-04-251-1/+1
| | | |
| * | | ci: Update vmImage to windows-2022Morph2022-04-252-2/+2
|/ / / | | | | | | | | | The windows-2022 image contains Visual Studio 2022.
* | | Merge pull request #8255 from Morph1984/libresslMai M2022-04-251-0/+0
|\ \ \ | | | | | | | | externals: Update libressl to 3.5.2
| * | | externals: Update libressl to 3.5.2Morph2022-04-241-0/+0
| |/ / | | | | | | | | | This resolves compiler errors in Visual Studio 2022.
* | | Merge pull request #8261 from liamwhite/jit-cleanupMai M2022-04-253-132/+225
|\ \ \ | |_|/ |/| | service: jit: document and clean up
| * | service: jit: document and clean upLiam2022-04-253-132/+225
| |/
* | Merge pull request #8260 from Morph1984/c4146Mai M2022-04-251-1/+1
|\ \ | | | | | | kernel: svc: Replace -1ULL with 0xFFFFFFFFFFFFFFFF
| * | kernel: svc: Replace -1ULL with 0xFFFFFFFFFFFFFFFFMorph2022-04-241-1/+1
| |/ | | | | | | Resolves the C4146 compiler warning on MSVC.
* | Merge pull request #8257 from merryhime/rm-PrepareRescheduleMai M2022-04-247-20/+0
|\ \ | |/ |/| Remove unused PrepareReschedule function
| * Remove unused PrepareReschedule functionMerry2022-04-247-20/+0
|/
* Merge pull request #8249 from german77/queuedMorph2022-04-231-3/+5
|\ | | | | hotkeys: Trigger actions on a separate thread
| * hotkeys: Trigger actions on a separate threadNarr the Reg2022-04-231-3/+5
| |
* | Merge pull request #8243 from lat9nq/boost-just-errorMorph2022-04-231-19/+1
|\ \ | | | | | | CMakeLists: Revert ad55faaa3
| * | CMakeLists: Revert ad55faaa3lat9nq2022-04-231-19/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The premise behind ad55faaa3 was due to an issue between Conan's libiconv package and compiling SDL2 from our externals. Since none of our Conan externals require libiconv any longer, though, we can remove downloading our own Boost package and just rely on Conan again. Additionally, removing CONFIG from the find_package(boost) call fixes issues with finding Boost on Fedora and MSYS2, which was the main motivation for this. Also, remove QUIET since if something goes wrong finding Boost, this makes it harder to tell what went wrong.
* | | Merge pull request #8245 from Morph1984/spdxFernando S2022-04-231366-4208/+2745
|\ \ \ | | | | | | | | general: Convert source file copyright comments over to SPDX
| * | | general: Convert source file copyright comments over to SPDXMorph2022-04-231366-4208/+2745
|/ / / | | | | | | | | | | | | This formats all copyright comments according to SPDX formatting guidelines. Additionally, this resolves the remaining GPLv2 only licensed files by relicensing them to GPLv2.0-or-later.
* | | Merge pull request #7976 from BytesGalore/masterbunnei2022-04-231-1/+2
|\ \ \ | | | | | | | | loader: log the type of mismatching file-extension
| * \ \ Merge branch 'yuzu-emu:master' into masterBytesGalore2022-03-061-2/+2
| |\ \ \
| * | | | loader: log the type of mismatching file-extensionBytesGalore2022-03-031-1/+2
| | | | |
* | | | | Merge pull request #7978 from german77/sidewaybunnei2022-04-2210-0/+127
|\ \ \ \ \ | |_|_|_|/ |/| | | | input_common: Map sticks correctly when mapped sideways
| * | | | input_common: Map sticks correctly when mapped sidewaysNarr the Reg2022-03-2210-0/+127
| | | | |
* | | | | Merge pull request #8222 from german77/sixaxis_testbunnei2022-04-226-99/+363
|\ \ \ \ \ | | | | | | | | | | | | service: hid: Improve accuracy of sixaxis functions
| * | | | | service: hid: Improve accuracy of sixaxis functionsNarr the Reg2022-04-186-99/+363
| | | | | |
* | | | | | Merge pull request #8192 from german77/screenshotMai M2022-04-213-0/+13
|\ \ \ \ \ \ | | | | | | | | | | | | | | bootmanager: Don't create another screenshot request if previous one is not done yet
| * | | | | | bootmanager: Don't create another screenshot request if previous one is not done yetgerman772022-04-183-0/+13
| |/ / / / /
* | | | | | Merge pull request #8232 from liamwhite/backtraceMai M2022-04-216-90/+98
|\ \ \ \ \ \ | | | | | | | | | | | | | | core/arm: separate backtrace collection
| * | | | | | core/arm: separate backtrace collectionLiam2022-04-216-90/+98
| | | | | | |
* | | | | | | Merge pull request #8231 from german77/warningMai M2022-04-211-0/+9
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | input_common: Ignore boost uninitialized local variable
| * | | | | | | input_common: Ignore boost uninitialized local variableNarr the Reg2022-04-211-0/+9
| | | | | | | |
* | | | | | | | Merge pull request #8224 from Docteh/hihi1bunnei2022-04-201-1/+19
|\ \ \ \ \ \ \ \ | |/ / / / / / / |/| | | | | | | ui: translate hat directions
| * | | | | | | ui: translate hat directionsKyle K2022-04-191-1/+19
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | QObject ends up being its own translation context. But this works in our favor. GetButtonName and GetDirectionName will share one translation the directions such as "Left" "Right" and the ConfigureInputPlayer context will contain translations that show up in the form, in places that aren't those buttons.
* | | | | | | | Merge pull request #8228 from liamwhite/bump-dynarmicMai M2022-04-201-0/+0
|\ \ \ \ \ \ \ \ | | |/ / / / / / | |/| | | | | | dynarmic: Always use mmap for allocation on Linux
| * | | | | | | Update dynarmicLiam2022-04-191-0/+0
| | | | | | | |
* | | | | | | | Prevent the mouse cursor from leaving the window when mouse panning is enabledPurple2022-04-192-2/+41
|/ / / / / / /
* | | | | | | Merge pull request #8225 from Tachi107/aboutdialog-gplv3Fernando S2022-04-1825-48/+48
|\ \ \ \ \ \ \ | |/ / / / / / |/| | | | | | yuzu: mention GPLv3.0 in about dialog
| * | | | | | yuzu: mention GPLv3.0+ in about dialogAndrea Pappacoda2022-04-1825-48/+48
|/ / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Follow-up to 284934ebfdf5e530c960cf69969172ff76f40bea Fixes #8218
* | | | | | Merge pull request #8223 from Tachi107/patch-3Mai M2022-04-181-1/+1
|\ \ \ \ \ \ | |/ / / / / |/| | | | | Clarify the Skyline Emulator license exception
| * | | | | Clarify the Skyline Emulator license exceptionAndrea Pappacoda2022-04-181-1/+1
|/ / / / / | | | | | | | | | | | | | | | | | | | | `GPL-3.0-or-later OR MPL-2.0` is an SPDX expression: https://spdx.github.io/spdx-spec/SPDX-license-expressions/ Fixes #8219
* | | | | Merge pull request #8204 from Docteh/translate_gameslistMai M2022-04-173-3/+6
|\ \ \ \ \ | | | | | | | | | | | | ui: Fix Game Compatibility list translations
| * | | | | ui: Fix Game Compatibility list translationsKyle K2022-04-173-3/+6
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Reported by GillianMC on Discord. Looks to be a small quirk in the QT API. setText(QObject::tr(status.text)); bringing up QObject breaks the link with the GameListItemCompat
* | | | | | Merge pull request #6558 from german77/ringcon2Fernando S2022-04-1629-28/+2608
|\ \ \ \ \ \ | | | | | | | | | | | | | | hidbus: Implement hidbus and ringcon
| * | | | | | yuzu: Call ignore event after ensuring it's initializedNarr the Reg2022-04-162-2/+2
| | | | | | |
| * | | | | | yuzu: Add custom ringcon configurationgerman772022-04-1619-65/+992
| | | | | | |
| * | | | | | hidbus: Implement hidbus and ringcongerman772022-04-1614-26/+1679
| | | | | | |
* | | | | | | Merge pull request #8188 from merryhime/jit-race-page-table-changedbunnei2022-04-164-57/+84
|\ \ \ \ \ \ \ | |/ / / / / / |/| | | | | | dynarmic: Fix race when switching page tables
| * | | | | | dynarmic: Fix race when switching page tablesmerry2022-04-104-57/+84
| | | | | | |
* | | | | | | Merge pull request #8205 from liamwhite/n64-miscFernando S2022-04-1611-9/+127
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | Fixes for Mario 64
| * | | | | | | video_core: implement formats for N64 emulationFernando Sahmkow2022-04-148-7/+102
| | | | | | | |
| * | | | | | | buffer_cache: cap vertex buffer sizesLiam2022-04-141-1/+14
| | | | | | | |
| * | | | | | | maxwell3d: add small_index_2 registerLiam2022-04-142-1/+11
| | | | | | | |
* | | | | | | | Merge pull request #8172 from bunnei/kernel-mutexFernando S2022-04-1612-89/+46
|\ \ \ \ \ \ \ \ | |/ / / / / / / |/| | | | | | | hle: kernel: Use std::mutex instead of spin locks for most kernel locking.
| * | | | | | | core: hle: kernel: k_thread: Rework dummy thread waiting.bunnei2022-04-122-28/+21
| | | | | | | |
| * | | | | | | core: hle: service: Allocate a service thread.bunnei2022-04-121-1/+2
| | | | | | | |
| * | | | | | | hle: kernel: k_spin_lock: Remove unused ThreadPause.bunnei2022-04-121-28/+0
| | | | | | | |
| * | | | | | | hle: kernel: Use std::mutex instead of spin locks for most kernel locking.bunnei2022-04-1210-32/+23
| | | | | | | |
* | | | | | | | Merge pull request #8190 from Docteh/palswapbunnei2022-04-143-0/+18
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | ui: Set Link Color when setting theme
| * | | | | | | | ui: Touching QPalette::Text broke dark -> light UI. don't doKyle K2022-04-121-2/+0
| | | | | | | | |
| * | | | | | | | ui: Set Link Color when setting themeKyle K2022-04-113-0/+20
| | |/ / / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Long story short, QT doesn't allow the link colors to be set via their stylesheets. There are two ways to work with this, specify the color manually for every link (See the About dialog) The other way is to change the default palette. IsDarkTheme is copy/pasted from src/yuzu/debugger/wait_tree.cpp
* | | | | | | | Merge pull request #8027 from lat9nq/cmd-fullscreen-sizebunnei2022-04-141-6/+7
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | emu_window_sdl2: Set window size to display dimensions for exclusive fullscreen
| * | | | | | | | emu_window_sdl2: Set window size to display dimensions for exclusive fullscreenlat9nq2022-03-151-6/+7
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Since SDL2 does not automatically resize the canvas when entering fullscreen mode, resize the window to desktop display dimensions.
* | | | | | | | | Merge pull request #8202 from merryhime/fix-single-coreFernando S2022-04-132-2/+2
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | dynarmic: Fix single core mode
| * | | | | | | | | dynarmic: Fix single core modemerry2022-04-132-2/+2
| | |_|_|/ / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | Regression introduced in a5d040df3d. Closes #8201.
* | | | | | | | | Merge pull request #8199 from liamwhite/jit-serviceFernando S2022-04-135-9/+784
|\ \ \ \ \ \ \ \ \ | |/ / / / / / / / |/| | | | | | | | service: jit: Implement the JIT service
| * | | | | | | | service: jit: Implement the JIT serviceLiam2022-04-135-9/+784
|/ / / / / / / /
* | | | | | | | Merge pull request #8165 from bunnei/ensure-session-port-cleanupbunnei2022-04-128-25/+53
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | Kernel: Track open references to KServerPort and KServerSession.
| * | | | | | | | hle: kernel: Unify and integrate reference tracking for KServerPort/KServerSession.bunnei2022-04-086-13/+46
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | - These are not managed elsewhere, and need to be tracked and closed on emulation shutdown.
| * | | | | | | | hle: kernel: k_server_port: Release ref-counted host emulation members on Destroy.bunnei2022-04-081-0/+3
| | | | | | | | |
| * | | | | | | | hle: kernel: k_auto_object: Move unregister with kernel to after Destroy.bunnei2022-04-081-3/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | - Destructor is no longer invoked, so our object counting was off.
| * | | | | | | | hle: service: sm: Remove manual tracking of KServerPorts.bunnei2022-04-082-8/+1
| | | | | | | | |
| * | | | | | | | hle: kernel: hle_ipc: HasSessionRequestHandler: Check if domain handler is expired rather than locking.bunnei2022-04-081-1/+1
| | | | | | | | |
* | | | | | | | | Merge pull request #8178 from tech-ticks/skyline-icache-fixbunnei2022-04-124-15/+34
|\ \ \ \ \ \ \ \ \ | |_|_|_|/ / / / / |/| | | | | | | | hle: kernel: Invalidate entire icache in UnmapProcessMemory and UnmapCodeMemory (fixes #8174)
| * | | | | | | | hle: kernel: Invalidate entire icache in UnmapProcessMemory and UnmapCodeMemory (fixes #8174)tech-ticks2022-04-094-15/+34
| | | | | | | | |
* | | | | | | | | Merge pull request #8157 from lat9nq/kernel-racesbunnei2022-04-127-13/+15
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | kernel: Fix some data races
| * | | | | | | | | k_system_control: Fix data racelat9nq2022-04-061-3/+3
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | `return distribution(gen)` is a data race between a read and a write in two threads, reported by TSan. Remove static random number generators so they aren't using the same generator.
| * | | | | | | | | k_auto_object: Fix data racelat9nq2022-04-041-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Change the memory order to acqure-release when we decrement the reference count. Prevents a race with line 89 reported by TSan.
| * | | | | | | | | k_thread: Fix data racelat9nq2022-04-042-3/+4
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | TSan reports a data race between writing at cpp:1162 and reading at h:262. Make the thread_state atomic to prevent this.
| * | | | | | | | | k_process: Fix data racelat9nq2022-04-041-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | TSan reported a race between thread 36 and thread 34, a read at :225 and a write at :225 respectively. Make total_proces_running_time_ticks atomic to avoid this race.
| * | | | | | | | | kernel: Fix current_process racelat9nq2022-04-041-4/+4
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | TSan reported a race at :258 and :803, so make current_process an atomic pointer.
| * | | | | | | | | k_scheduler_lock: Fix data racelat9nq2022-04-041-1/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | TSan reports a race between the main thread and T37 during IsLockedByCurrentThread and when it's set at the end of Lock(), respectively. Set owner_thread to an atomic pointer to fix it. Co-authored-by: bunnei <bunneidev@gmail.com>
* | | | | | | | | | Merge pull request #8196 from jbeich/freebsdbunnei2022-04-121-0/+4
|\ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | service: sfdnsres: unbreak build on FreeBSD
| * | | | | | | | | | service: sfdnsres: add missing includes for some BSDs after 82d46a974ad4Jan Beich2022-04-121-0/+4
|/ / / / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | src/core/hle/service/sockets/sfdnsres.cpp: In function 'Service::Sockets::NetDbError Service::Sockets::AddrInfoErrorToNetDbError(s32)': src/core/hle/service/sockets/sfdnsres.cpp:66:10: error: 'EAI_NODATA' was not declared in this scope; did you mean 'EAI_NONAME'? 66 | case EAI_NODATA: | ^~~~~~~~~~ | EAI_NONAME src/core/hle/service/sockets/sfdnsres.cpp: In function 'std::vector<unsigned char> Service::Sockets::SerializeAddrInfo(const addrinfo*, s32, std::string_view)': src/core/hle/service/sockets/sfdnsres.cpp:127:53: error: 'sockaddr_in' does not name a type; did you mean 'SockAddrIn'? 127 | const auto addr = *reinterpret_cast<sockaddr_in*>(current->ai_addr); | ^~~~~~~~~~~ | SockAddrIn src/core/hle/service/sockets/sfdnsres.cpp:127:64: error: expected '>' before '*' token 127 | const auto addr = *reinterpret_cast<sockaddr_in*>(current->ai_addr); | ^ src/core/hle/service/sockets/sfdnsres.cpp:127:64: error: expected '(' before '*' token 127 | const auto addr = *reinterpret_cast<sockaddr_in*>(current->ai_addr); | ^ | ( src/core/hle/service/sockets/sfdnsres.cpp:127:65: error: expected primary-expression before '>' token 127 | const auto addr = *reinterpret_cast<sockaddr_in*>(current->ai_addr); | ^ src/core/hle/service/sockets/sfdnsres.cpp:127:84: error: expected ')' before ';' token 127 | const auto addr = *reinterpret_cast<sockaddr_in*>(current->ai_addr); | ^ | ) src/core/hle/service/sockets/sfdnsres.cpp:148:53: error: 'sockaddr_in6' does not name a type; did you mean 'SockAddrIn6'? 148 | const auto addr = *reinterpret_cast<sockaddr_in6*>(current->ai_addr); | ^~~~~~~~~~~~ | SockAddrIn6 src/core/hle/service/sockets/sfdnsres.cpp:148:65: error: expected '>' before '*' token 148 | const auto addr = *reinterpret_cast<sockaddr_in6*>(current->ai_addr); | ^ src/core/hle/service/sockets/sfdnsres.cpp:148:65: error: expected '(' before '*' token 148 | const auto addr = *reinterpret_cast<sockaddr_in6*>(current->ai_addr); | ^ | ( src/core/hle/service/sockets/sfdnsres.cpp:148:66: error: expected primary-expression before '>' token 148 | const auto addr = *reinterpret_cast<sockaddr_in6*>(current->ai_addr); | ^ src/core/hle/service/sockets/sfdnsres.cpp:148:85: error: expected ')' before ';' token 148 | const auto addr = *reinterpret_cast<sockaddr_in6*>(current->ai_addr); | ^ | )
* | | | | | | | | | Merge pull request #8180 from liamwhite/symbolsFernando S2022-04-114-129/+231
|\ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | core: extract symbol reading
| * | | | | | | | | | core: extract symbol readingLiam2022-04-094-129/+231
| | | | | | | | | | |
* | | | | | | | | | | Merge pull request #8171 from tech-ticks/skyline-improvementsFernando S2022-04-107-30/+245
|\ \ \ \ \ \ \ \ \ \ \ | |_|_|_|_|_|/ / / / / |/| | | | | | | | | | Improvements for game modding with Skyline, DNS resolution
| * | | | | | | | | | service: sfdnsres: Implement DNS address resolutiontech-ticks2022-04-082-5/+197
| | | | | | | | | | |
| * | | | | | | | | | service: bsd: Add keepalive socket optiontech-ticks2022-04-074-0/+10
| | | | | | | | | | |
| * | | | | | | | | | patch_manager: Apply layered exefs patches from 'atmosphere' SD directorytech-ticks2022-04-071-25/+38
| | |_|/ / / / / / / | |/| | | | | | | |
* | | | | | | | | | Merge pull request #8149 from liamwhite/front-facebunnei2022-04-091-1/+8
|\ \ \ \ \ \ \ \ \ \ | |_|/ / / / / / / / |/| | | | | | | | | OpenGL: flip front faces if Z scale is inverted
| * | | | | | | | | OpenGL: propagate face flip conditionLiam2022-04-041-4/+10
| | | | | | | | | |
| * | | | | | | | | OpenGL: flip front faces if Z scale is invertedLiam2022-04-041-2/+3
| | |/ / / / / / / | |/| | | | | | |
* | | | | | | | | Merge pull request #8138 from german77/data-no-racebunnei2022-04-086-176/+256
|\ \ \ \ \ \ \ \ \ | |_|_|/ / / / / / |/| | | | | | | | core: hid: Reduce the amount of data races
| * | | | | | | | core: hid: Fix double lock on softlock and forced updatesNarr the Reg2022-04-081-2/+12
| | | | | | | | |
| * | | | | | | | core: hid: Replace lock_guard with scoped_lockNarr the Reg2022-04-073-44/+44
| | | | | | | | |
| * | | | | | | | core: hid: Reduce the amount of dataracesgerman772022-04-076-176/+246
| | | | | | | | |
* | | | | | | | | Merge pull request #8169 from merryhime/scoped_lockbunnei2022-04-0829-105/+105
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | Replace lock_guard with scoped_lock
| * | | | | | | | | core/hle: Standardize scoped_lock initializersMerry2022-04-075-23/+23
| | | | | | | | | |
| * | | | | | | | | yuzu/util: Replace lock_guard with scoped_lockMerry2022-04-071-1/+1
| | | | | | | | | |
| * | | | | | | | | web_service: Replace lock_guard with scoped_lockMerry2022-04-071-2/+2
| | | | | | | | | |
| * | | | | | | | | video_core: Replace lock_guard with scoped_lockMerry2022-04-0711-18/+18
| | | | | | | | | |
| * | | | | | | | | input_common: Replace lock_guard with scoped_lockMerry2022-04-072-29/+29
| | | | | | | | | |
| * | | | | | | | | core: Replace lock_guard with scoped_lockMerry2022-04-072-14/+14
| | | | | | | | | |
| * | | | | | | | | core/hle: Replace lock_guard with scoped_lockMerry2022-04-074-13/+13
| | | | | | | | | |
| * | | | | | | | | common: Replace lock_guard with scoped_lockMerry2022-04-073-5/+5
| | | | | | | | | |
* | | | | | | | | | Merge pull request #8173 from Morph1984/msvc-warn-unused-fnMai M2022-04-081-0/+2
|\ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | CMakeLists: Enforce C4505 and C5245
| * | | | | | | | | | CMakeLists: Enforce C4505 and C5245Morph2022-04-081-0/+2
|/ / / / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | These are similar to Wunused-function on gcc/clang
* | | | | | | | | | Merge pull request #8167 from Tachi107/patch-1merry2022-04-071-2/+0
|\ \ \ \ \ \ \ \ \ \ | |/ / / / / / / / / |/| | | | | | | | | fix: remove #pragma once in .cpp file
| * | | | | | | | | fix: remove #pragma once in .cpp fileAndrea Pappacoda2022-04-071-2/+0
| |/ / / / / / / /
* | | | | | | | | Merge pull request #8161 from liamwhite/gl-s8d24Fernando S2022-04-076-4/+58
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | OpenGL: fix S8D24 to ABGR8 conversions
| * | | | | | | | | OpenGL: fix S8D24 to ABGR8 conversionsLiam2022-04-076-4/+58
| | | | | | | | | |
* | | | | | | | | | Merge pull request #8152 from liamwhite/gl-cropFernando S2022-04-073-1/+10
|\ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | OpenGL: fix cropping
| * | | | | | | | | | OpenGL: fix croppingLiam2022-04-043-1/+10
| | |_|/ / / / / / / | |/| | | | | | | |
* | | | | | | | | | Merge pull request #8150 from liamwhite/vk-cropFernando S2022-04-071-2/+3
|\ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | Vulkan: crop to screen dimensions if crop not explicitly requested
| * | | | | | | | | | Vulkan: crop to screen dimensions if crop not explicitly requestedLiam2022-04-041-2/+3
| |/ / / / / / / / /
* | | | | | | | | | Merge pull request #8148 from merryhime/interruptsFernando S2022-04-077-45/+42
|\ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | dynarmic: Better interrupts
| * | | | | | | | | | arm_dynarmic: Use HaltReason for svc calls and reschedulesmerry2022-04-034-27/+19
| | | | | | | | | | |
| * | | | | | | | | | dynarmic: Better interruptsmerry2022-04-037-22/+27
| | | | | | | | | | |
| * | | | | | | | | | externals: Update dynarmic to 8bcd46b7merry2022-04-021-0/+0
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * Ensure 128-bit ordered load/stores are atomic * Always order exclusive load/stores
| * | | | | | | | | | externals: Update dynarmic to 9cadab8fa91a63564774ae7dbe74e7c18715f586merry2022-04-021-0/+0
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Enforce memory ordering for acquire/release instructions.
* | | | | | | | | | | Merge pull request #8143 from merryhime/rdtscFernando S2022-04-071-14/+35
|\ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | native_clock: Use lfence with rdtsc
| * | | | | | | | | | | native_clock: Internal linkage for FencedRDTSCMerry2022-04-031-2/+4
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | __forceinline required on MSVC for function to be inlined
| * | | | | | | | | | | native_clock: Use lfence with rdtscmerry2022-04-031-14/+33
| | |/ / / / / / / / / | |/| | | | | | | | |
* | | | | | | | | | | Merge pull request #8133 from liamwhite/gl-spv-cbufFernando S2022-04-076-25/+51
|\ \ \ \ \ \ \ \ \ \ \ | |_|_|_|/ / / / / / / |/| | | | | | | | | | shader_recompiler: support const buffer indirect addressing on OpenGL
| * | | | | | | | | | shader_recompiler: Decrease indirect cbuf limit to match hardwareLiam2022-04-041-1/+1
| | | | | | | | | | |
| * | | | | | | | | | shader_compiler: support const buffer indirect addressing in GLSLLiam2022-04-014-9/+38
| | | | | | | | | | |
| * | | | | | | | | | shader_recompiler: support const buffer indirect addressing on OpenGL SPIR-VLiam2022-04-013-17/+14
| | | | | | | | | | |
* | | | | | | | | | | Merge pull request #8164 from liamwhite/jit-stubbunnei2022-04-078-1/+88
|\ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | service: jit: stub JIT service
| * | | | | | | | | | | service: jit: stub JIT serviceLiam2022-04-078-1/+88
| | |_|_|_|/ / / / / / | |/| | | | | | | | |
* | | | | | | | | | | Merge pull request #8122 from bunnei/improve-thread-usagebunnei2022-04-0613-27/+74
|\ \ \ \ \ \ \ \ \ \ \ | |/ / / / / / / / / / |/| | | | | | | | | | Improve usage of service host threads
| * | | | | | | | | | hle: service: nvdrv: Create a service thread where appropriate.Morph2022-04-021-1/+1
| | | | | | | | | | |
| * | | | | | | | | | hle: service: vi: Create a service thread where appropriate.bunnei2022-04-021-1/+2
| | | | | | | | | | |
| * | | | | | | | | | hle: service: bsd: Create a service thread where appropriate.bunnei2022-04-021-1/+2
| | | | | | | | | | |
| * | | | | | | | | | hle: service: filesystem: Create a service thread where appropriate.bunnei2022-04-021-5/+8
| | | | | | | | | | |
| * | | | | | | | | | hle: service: audio: Create a service thread where appropriate.bunnei2022-04-022-4/+6
| | | | | | | | | | |
| * | | | | | | | | | hle: service: Add option for service interfaces to create or use the default thread.bunnei2022-04-025-11/+29
| | | | | | | | | | |
| * | | | | | | | | | hle: kernel: Create a default thread for services that do not need their own host thread.bunnei2022-04-022-4/+26
| | |_|/ / / / / / / | |/| | | | | | | |
* | | | | | | | | | Merge pull request #8162 from german77/bombslingerbunnei2022-04-061-0/+4
|\ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | service: hid: Partially revert #8123
| * | | | | | | | | | service: hid: Partially revert #8123german772022-04-061-0/+4
|/ / / / / / / / / /
* | | | | | | | | | Merge pull request #8137 from bunnei/improve-nvflinger-2bunnei2022-04-069-91/+99
|\ \ \ \ \ \ \ \ \ \ | |_|_|_|/ / / / / / |/| | | | | | | | | Follow-up fixes for NVFlinger rewrite (Part 2)
| * | | | | | | | | hle: service: nvflinger: buffer_queue_producer: Cleanup & fixes.bunnei2022-04-022-61/+42
| | | | | | | | | |
| * | | | | | | | | hle: service: nvflinger: consumer_base: Cleanup & fixes.bunnei2022-04-022-15/+17
| | | | | | | | | |
| * | | | | | | | | hle: service: nvflinger: buffer_queue_producer: Cleanup & add GetReleasedBuffers.bunnei2022-04-022-10/+38
| | | | | | | | | |
| * | | | | | | | | hle: service: nvflinger: buffer_queue_core: Cleanup & fixes.bunnei2022-04-022-3/+0
| | | | | | | | | |
| * | | | | | | | | hle: service: nvflinger: Use correct logger namespace.bunnei2022-04-021-2/+2
| |/ / / / / / / /
* | | | | | | | | Merge pull request #8100 from Morph1984/registered-crashbunnei2022-04-061-2/+4
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | registered_cache: Prevent nullptr dereference when accumulating files
| * | | | | | | | | registered_cache: Prevent nullptr dereference when accumulating filesMorph2022-03-271-2/+4
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | For whatever reason, nca_file/dir can be nullptr in the list of files/dirs. I have not determined the cause of this yet, so add a nullptr check for these prior to dereferencing them.
* | | | | | | | | | Merge pull request #8159 from merryhime/pstMai M2022-04-052-0/+4
|\ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | dynarmic: Print stack trace on unrecognised instruction or other exception
| * | | | | | | | | | dynarmic: Print stack trace on unrecognised instruction or other exceptionmerry2022-04-052-0/+4
| | | | | | | | | | |
* | | | | | | | | | | Merge pull request #8158 from Tachi107/patch-1Mai M2022-04-051-6/+0
|\ \ \ \ \ \ \ \ \ \ \ | |/ / / / / / / / / / |/| | | | | | | | | | build: remove -fconcepts
| * | | | | | | | | | build: remove -fconceptsAndrea Pappacoda2022-04-051-6/+0
|/ / / / / / / / / / | | | | | | | | | | | | | | | | | | | | It was needed on GCC versions not supporting `-std=c++20`, but GCC 10 and newer (required to compile yuzu) don't need it anymore
* | | | | | | | | | Merge pull request #8156 from yuzu-emu/revert-8154-unneeded-read-blockbunnei2022-04-051-0/+1
|\ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | Revert "texture_cache/util: Remove unneeded ReadBlockUnsafe"
| * | | | | | | | | | Revert "texture_cache/util: Remove unneeded ReadBlockUnsafe"bunnei2022-04-051-0/+1
|/ / / / / / / / / /
* | | | | | | | | | Merge pull request #8154 from ameerj/unneeded-read-blockbunnei2022-04-041-1/+0
|\ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | texture_cache/util: Remove unneeded ReadBlockUnsafe
| * | | | | | | | | | texture_cache/util: Remove unneeded ReadBlockUnsafeameerj2022-04-041-1/+0
|/ / / / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This call was reading GPU memory into the dst buffer, which is then overwritten by the SwizzleTexture call.
* | | | | | | | | | Merge pull request #8089 from merryhime/paranoiabunnei2022-04-044-45/+63
|\ \ \ \ \ \ \ \ \ \ | |_|_|_|/ / / / / / |/| | | | | | | | | configuration: Add Paranoid CPU accuracy level
| * | | | | | | | | configure_cpu: More descriptive text for Paranoid optionmerry2022-03-261-1/+1
| | | | | | | | | |
| * | | | | | | | | configuration: Add Paranoid CPU accuracy levelmerry2022-03-264-45/+63
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Disables most optimizations for the paranoid.
* | | | | | | | | | Merge pull request #8105 from merryhime/atomicload128bunnei2022-04-032-4/+96
|\ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | native_clock: Use AtomicLoad128
| * | | | | | | | | | native_clock: Use writeback from CAS to avoid double-loadingmerry2022-04-021-4/+6
| | | | | | | | | | |
| * | | | | | | | | | atomic_ops: Implement AtomicCompareAndSwap with writebackmerry2022-04-021-0/+73
| | | | | | | | | | |
| * | | | | | | | | | native_clock: Use AtomicLoad128Merry2022-04-021-2/+2
| | | | | | | | | | |
| * | | | | | | | | | atomic_ops: Implement AtomicLoad128Merry2022-04-021-0/+17
| | | | | | | | | | |
* | | | | | | | | | | Merge pull request #8135 from Morph1984/websession-hackbunnei2022-04-031-0/+8
|\ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | applets/web: Keep foreground (websession) web applet open
| * | | | | | | | | | | applets/web: Keep foreground (websession) web applet openMorph2022-04-021-0/+8
| | |_|_|/ / / / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This is a hack to keep the foreground (websession) web applet open in games using these such as Super Mario 3D All-Stars.
* | | | | | | | | | | Merge pull request #8123 from german77/bombslingerbunnei2022-04-033-66/+69
|\ \ \ \ \ \ \ \ \ \ \ | |_|/ / / / / / / / / |/| | | | | | | | | | service: hid: Remove inaccurate behavior on initialization
| * | | | | | | | | | service: npad: Default initialize shared memorygerman772022-04-031-48/+48
| | | | | | | | | | |
| * | | | | | | | | | service: hid: Remove inaccurate behavior on initializationgerman772022-03-313-18/+21
| | | | | | | | | | |
* | | | | | | | | | | Merge pull request #8134 from Tachi107/remove-time-stretchermerry2022-04-029-143/+3
|\ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | audio_core: remove time stretcher
| * | | | | | | | | | | audio_core: remove time stretcherAndrea Pappacoda2022-04-019-143/+3
| | |/ / / / / / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Also drop the SoundTouch dependency
* | | | | | | | | | | Merge pull request #8141 from merryhime/configure-hotkeys-columnsMorph2022-04-021-3/+4
|\ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | configure_hotkeys: Make first column stretch and not last column
| * | | | | | | | | | | configure_hotkeys: Make first column stretch and not last columnmerry2022-04-021-3/+4
| |/ / / / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Also configure minimum width of columns to be 150px.
* | | | | | | | | | | Merge pull request #8140 from merryhime/per-game-addon-columnsMorph2022-04-021-1/+5
|\ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | configure_per_game_addons: Stretch first column and not last
| * | | | | | | | | | | configure_per_game_addons: Set tree view minimum section size to 150pxmerry2022-04-021-0/+1
| | | | | | | | | | | |
| * | | | | | | | | | | configure_per_game_addons: Stretch first column and not lastmerry2022-04-021-1/+4
| |/ / / / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This provides more sensible column widths.
* | | | | | | | | | | Merge pull request #8142 from Tachi107/typosMorph2022-04-025-10/+10
|\ \ \ \ \ \ \ \ \ \ \ | |/ / / / / / / / / / |/| | | | | | | | | | fix: typos
| * | | | | | | | | | fix: typosAndrea Pappacoda2022-04-025-10/+10
|/ / / / / / / / / /
* | | | | | | | | | Merge pull request #8128 from FernandoS27/gc-fixesFernando S2022-04-012-3/+1
|\ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | GPU Garbage Collection: Fix regressions.
| * | | | | | | | | | GPU Garbage Collection: Fix regressions.Fernando Sahmkow2022-04-012-3/+1
| | | | | | | | | | |
* | | | | | | | | | | Merge pull request #8079 from lat9nq/applet-typoMai M2022-04-011-2/+2
|\ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | configure_debug: Fix typo
| * | | | | | | | | | | configure_debug: Fix typolat9nq2022-03-241-2/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | I thought I removed the double-asterisks in db637b5a4c02772eb827ed01a6ecb430e4b65daa but I am apparently mistaken. This corrects that. While we're at it, capitalize `All` in the previous setting.
* | | | | | | | | | | | Merge pull request #8097 from Tachi107/build-cleanup-installMai M2022-04-012-2/+2
|\ \ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | | | build: cleanup installation of yuzu and yuzu-cmd
| * | | | | | | | | | | | build: cleanup installation of yuzu and yuzu-cmdAndrea Pappacoda2022-03-272-2/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Explicitly specifying an install destination is not needed anymore since CMake 3.14. By removing the hardcoded ${CMAKE_INSTALL_PREFIX}/bin it is also now possible to override the install destination via the command line. For example, you can now install yuzu to /usr/games with -DCMAKE_INSTALL_BINDIR=games
* | | | | | | | | | | | | Merge pull request #8130 from zhaobot/tx-update-20220401030746Mai M2022-04-0124-12453/+19860
|\ \ \ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | | | | | Update translations (2022-04-01)
| * | | | | | | | | | | | | Update translations (2022-04-01)The yuzu Community2022-04-0124-12453/+19860
|/ / / / / / / / / / / / /
* | | | | | | | | | | | | Merge pull request #8066 from ameerj/gpu-decode-fixesFernando S2022-04-011-14/+21
|\ \ \ \ \ \ \ \ \ \ \ \ \ | |_|_|/ / / / / / / / / / |/| | | | | | | | | | | | codec: Fix GPU decoder detection on Windows and a memory leak
| * | | | | | | | | | | | codec: Plug GPU decoder memory leakameerj2022-03-221-0/+2
| | | | | | | | | | | | |
| * | | | | | | | | | | | codec: Disable HW_FRAMES method check on Windowsameerj2022-03-221-14/+19
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | It was reported that this method causes crashes on certain Linux decoding backends, hence the check to avoid it. This subsequently caused Windows GPU decoders to never be selected and always fall back to CPU decoding, disable the check on Windows for now.
* | | | | | | | | | | | | Merge pull request #8116 from ameerj/nvhost_ctrl_bad_paramFernando S2022-04-011-1/+1
|\ \ \ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | | | | | nvhost_ctrl: Only mark EventState::Busy as BadParameter
| * | | | | | | | | | | | | nvhost_ctrl: Only mark EventState::Busy as BadParameterameerj2022-03-291-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Fixes an svc break in Kirby and the Forgotten Land with async GPU enabled.
* | | | | | | | | | | | | | Merge pull request #8076 from ameerj/nv-vk-msaa-scalebunnei2022-03-313-7/+8
|\ \ \ \ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Vulkan: Use 3D helpers for MSAA scaling on NV drivers 510+
| * | | | | | | | | | | | | | Vulkan: Use 3D helpers for MSAA scaling on NV drivers 510+ameerj2022-03-243-7/+8
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Nvidia Vulkan drivers 510+ crash when blitting MSAA images. Fall-back to 3D scale helpers for MSAA image scaling.
* | | | | | | | | | | | | | | Merge pull request #8120 from german77/signalbunnei2022-03-311-0/+4
|\ \ \ \ \ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | service: hid: Signal event on AcquireNpadStyleSetUpdateEventHandle
| * | | | | | | | | | | | | | | service: hid: Signal event on AcquireNpadStyleSetUpdateEventHandleNarr the Reg2022-03-311-0/+4
| | | | | | | | | | | | | | | |
* | | | | | | | | | | | | | | | Merge pull request #8090 from bunnei/fix-skylinebunnei2022-03-315-54/+241
|\ \ \ \ \ \ \ \ \ \ \ \ \ \ \ \ | |_|_|_|_|_|_|_|_|_|/ / / / / / |/| | | | | | | | | | | | | | | Kernel Memory Updates (Part 7): Various fixes to code memory (Skyline support)
| * | | | | | | | | | | | | | | hle: kernel: k_page_table: Fix implementations of LockForCodeMemory & UnlockForCodeMemory.bunnei2022-03-261-48/+12
| | | | | | | | | | | | | | | |
| * | | | | | | | | | | | | | | hle: kernel: k_page_table: Implement LockMemoryAndOpen & UnlockMemory.bunnei2022-03-262-0/+124
| | | | | | | | | | | | | | | |
| * | | | | | | | | | | | | | | hle: kernel: svc: MapProcessMemory: Fix usage of KPageLinkedList to use physical address space.bunnei2022-03-261-2/+5
| | | | | | | | | | | | | | | |
| * | | | | | | | | | | | | | | hle: kernel: svc: CreateCodeMemory: Remove log of 'out' host pointer.bunnei2022-03-261-2/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | - This does not seem terribly useful and is inconsistent with other usage.
| * | | | | | | | | | | | | | | hle: kernel: k_code_memory: Fix usage of KPageLinkedList to use physical address space.bunnei2022-03-261-1/+2
| | | | | | | | | | | | | | | |
| * | | | | | | | | | | | | | | hle: kernel: k_page_table: Implement MakeAndOpenPageGroup & MakePageGroup.bunnei2022-03-262-0/+83
| | | | | | | | | | | | | | | |
| * | | | | | | | | | | | | | | hle: kernel: k_page_table: Add IsHeapPhysicalAddress method.bunnei2022-03-261-0/+8
| | | | | | | | | | | | | | | |
| * | | | | | | | | | | | | | | hle: kernel: k_page_linked_list: Add Empty method.bunnei2022-03-261-0/+4
| | | | | | | | | | | | | | | |
| * | | | | | | | | | | | | | | hle: kernel: svc: UnmapProcessCodeMemory: Fix inverted alignment check.bunnei2022-03-261-1/+1
| | |_|_|_|_|_|_|/ / / / / / / | |/| | | | | | | | | | | | |
* | | | | | | | | | | | | | | Merge pull request #8107 from german77/fullscreenbunnei2022-03-301-3/+10
|\ \ \ \ \ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | yuzu: Only override fullscreen setting if gamepath or argument is provided
| * | | | | | | | | | | | | | | yuzu: Only override fullscreen setting if gamepath or argument is providedgerman772022-03-291-3/+10
| | |_|_|_|_|_|_|_|/ / / / / / | |/| | | | | | | | | | | | |
* | | | | | | | | | | | | | | Merge pull request #8109 from lat9nq/god-whyMorph2022-03-291-0/+1
|\ \ \ \ \ \ \ \ \ \ \ \ \ \ \ | |_|_|_|_|_|_|_|_|/ / / / / / |/| | | | | | | | | | | | | | yuzu_cmd: Start the logging backend
| * | | | | | | | | | | | | | yuzu_cmd: Start the logging backendlat9nq2022-03-291-0/+1
| | |_|_|_|/ / / / / / / / / | |/| | | | | | | | | | | |
* | | | | | | | | | | | | | Merge pull request #8106 from ameerj/gl-extreme-crashbunnei2022-03-291-3/+3
|\ \ \ \ \ \ \ \ \ \ \ \ \ \ | |/ / / / / / / / / / / / / |/| | | | | | | | | | | | | gl_rasterizer: Avoid scenario locking already owned mutex
| * | | | | | | | | | | | | gl_rasterizer: Avoid scenario locking already owned mutexameerj2022-03-291-3/+3
|/ / / / / / / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | gpu.TickWork() may lock the texture_cache and buffer_cache mutexes, which are owned by the thread prior to invoking TickWork(). Defer invoking gpu.TickWork() until the scope ends, where the owned mutexes are released.
* | | | | | | | | | | | | Merge pull request #8098 from merryhime/ic-ivaubunnei2022-03-292-2/+4
|\ \ \ \ \ \ \ \ \ \ \ \ \ | |/ / / / / / / / / / / / |/| | | | | | | | | | | | dynarmic: Invalidate CPU cache on all cores
| * | | | | | | | | | | | arm_dynarmic_64: Invalidate on all coresmerry2022-03-271-2/+4
| | | | | | | | | | | | |
| * | | | | | | | | | | | externals: Update dynarmicmerry2022-03-271-0/+0
| | |_|_|_|/ / / / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | IC instructions now check for a need to halt execution
* | | | | | | | | | | | Merge pull request #8095 from bylaws/masterMai M2022-03-273-0/+4
|\ \ \ \ \ \ \ \ \ \ \ \ | |/ / / / / / / / / / / |/| | | | | | | | | | | shader_recompiler: Include <bit> header when std::count{r,l}_zero is used
| * | | | | | | | | | | Include <bit> header when std::count{r,l}_zero is usedBilly Laws2022-03-223-0/+4
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Needed for compilation with older libc++ releases
* | | | | | | | | | | | Merge pull request #8088 from bunnei/fixup-nvflingerFernando S2022-03-279-547/+136
|\ \ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | | | Follow-up fixes for NVFlinger rewrite
| * | | | | | | | | | | | hle: service: nvflinger: buffer_queue: Remove AutoLock and fix free buffer tracking.bunnei2022-03-265-181/+130
| | | | | | | | | | | | |
| * | | | | | | | | | | | hle: service: nvflinger: buffer_queue_consumer: Use scoped_lock instead of unique_lock.bunnei2022-03-261-2/+2
| | | | | | | | | | | | |
| * | | | | | | | | | | | hle: service: nvflinger: consumer_base: Use scoped_lock instead of unique_lock.bunnei2022-03-261-4/+4
| | | | | | | | | | | | |
| * | | | | | | | | | | | hle: service: nvflinger: Remove unused BufferQueue.bunnei2022-03-262-360/+0
| | | | | | | | | | | | |
* | | | | | | | | | | | | Merge pull request #8092 from yuzu-emu/revert-8080-yo-momma-so-fat-thatbunnei2022-03-266-65/+4
|\ \ \ \ \ \ \ \ \ \ \ \ \ | |_|_|/ / / / / / / / / / |/| | | | | | | | | | | | Revert "Memory GPU <-> CPU: reduce infighting in the texture cache by adding CPU Cached memory."
| * | | | | | | | | | | | Revert "Memory GPU <-> CPU: reduce infighting in the texture cache by adding CPU Cached memory."bunnei2022-03-266-65/+4
|/ / / / / / / / / / / /
* | | | | | | | | | | | Merge pull request #8041 from Morph1984/inline-swkbdbunnei2022-03-263-166/+415
|\ \ \ \ \ \ \ \ \ \ \ \ | |/ / / / / / / / / / / |/| | | | | | | | | | | applets/swkbd: Add support for an updated inline software keyboard
| * | | | | | | | | | | applets/swkbd: Split software keyboard initializationMorph2022-03-222-160/+349
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Since the CalcArg struct has been updated with a new size and fields, we have to split the initialization of the keyboard into multiple functions. This also adds support for parsing the new CalcArg struct used by updated versions of Monster Hunter Rise.
| * | | | | | | | | | | applets/swkbd: Add new inline software keyboard typesMorph2022-03-221-6/+66
| |/ / / / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | These were added in newer firmware versions.
* | | | | | | | | | | Merge pull request #8080 from FernandoS27/yo-momma-so-fat-thatMorph2022-03-256-4/+65
|\ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | Memory GPU <-> CPU: reduce infighting in the texture cache by adding CPU Cached memory.
| * | | | | | | | | | | Memory: Don't protect reads on Normal accuracy.Fernando Sahmkow2022-03-251-1/+1
| | | | | | | | | | | |
| * | | | | | | | | | | Texture Cache: Add Cached CPU system.Fernando Sahmkow2022-03-255-3/+64
|/ / / / / / / / / / /
* | | | | | | | | | | Merge pull request #7720 from FernandoS27/yfc-gcbunnei2022-03-2520-43/+259
|\ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | First Nugget: Reworked Garbage Collection to be smarter [originally from Project YFC]
| * | | | | | | | | | | GC: Address Feedback.Fernando Sahmkow2022-03-257-29/+37
| | | | | | | | | | | |
| * | | | | | | | | | | Garbage Collection: Final tuning.Fernando Sahmkow2022-03-256-24/+36
| | | | | | | | | | | |
| * | | | | | | | | | | Buffer Cache: Tune to the levels of the new GC.Fernando Sahmkow2022-03-256-6/+78
| | | | | | | | | | | |
| * | | | | | | | | | | Garbage Collection: Redesign the algorithm to do a better use of memory.Fernando Sahmkow2022-03-2513-32/+156
| | |_|_|_|/ / / / / / | |/| | | | | | | | |
* | | | | | | | | | | Merge pull request #8050 from bunnei/nvflinger-rewriteFernando S2022-03-2562-1112/+3609
|\ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | Rewrite of the NVFlinger implementation
| * | | | | | | | | | | Update project license to GPL v3.bunnei2022-03-252-316/+625
| | | | | | | | | | | |
| * | | | | | | | | | | hle: nvflinger: ConsumerBase: Mark ctor as explicit.bunnei2022-03-251-1/+1
| | | | | | | | | | | |
| * | | | | | | | | | | hle: vi: NativeWindow: Fix trivially copyable issues.bunnei2022-03-251-4/+4
| | | | | | | | | | | |
| * | | | | | | | | | | hle: nvdrv: nvdata: buffer_queue_producer: Minor cleanup.bunnei2022-03-251-11/+11
| | | | | | | | | | | |
| * | | | | | | | | | | hle: nvdrv: nvdata: Cleanup NvFence static assert.bunnei2022-03-251-1/+1
| | | | | | | | | | | |
| * | | | | | | | | | | hle: nvflinger: Remove unused unordered_map include.bunnei2022-03-251-1/+0
| | | | | | | | | | | |
| * | | | | | | | | | | hle: nvflinger: buffer_queue_consumer: AcquireBuffer: Fix typo.bunnei2022-03-251-1/+1
| | | | | | | | | | | |
| * | | | | | | | | | | hle: nvflinger: Merge Rect with Common::Rectangle.bunnei2022-03-256-90/+54
| | | | | | | | | | | |
| * | | | | | | | | | | hle: nvflinger: buffer_queue_core: Declare default dtor.bunnei2022-03-252-0/+3
| | | | | | | | | | | |
| * | | | | | | | | | | hle: nvflinger: buffer_queue_producer: DequeueBuffer: Remove unnecessary lock.bunnei2022-03-251-3/+1
| | | | | | | | | | | |
| * | | | | | | | | | | hle: nvflinger: consumer_base: StillTracking: Should be const.bunnei2022-03-252-2/+3
| | | | | | | | | | | |
| * | | | | | | | | | | hle: nvflinger: graphic_buffer_producer: Remove unnecessary pragma pack.bunnei2022-03-251-2/+0
| | | | | | | | | | | |
| * | | | | | | | | | | hle: nvflinger: parcel: Reserve token size.bunnei2022-03-251-1/+2
| | | | | | | | | | | |
| * | | | | | | | | | | hle: nvflinger: buffer_queue_core: StillTracking: Take const reference.bunnei2022-03-254-7/+7
| | | | | | | | | | | |
| * | | | | | | | | | | hle: nvflinger: buffer_queue_core: Cleanup locking.bunnei2022-03-251-2/+2
| | | | | | | | | | | |
| * | | | | | | | | | | hle: nvflinger: Use std::chrono for present_ns.bunnei2022-03-257-25/+30
| | | | | | | | | | | |
| * | | | | | | | | | | hle: nvflinger: Migrate android namespace -> Service::android.bunnei2022-03-2535-79/+76
| | | | | | | | | | | |
| * | | | | | | | | | | hle: nvflinger: BufferQueueProducer: Handle SetPreallocatedBuffer with empty buffer.bunnei2022-03-251-7/+10
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | - Used by Naruto Ultimate Ninja Storm.
| * | | | | | | | | | | hle: vi: Integrate new NVFlinger and HosBinderDriverServer service.bunnei2022-03-2517-723/+286
| | | | | | | | | | | |
| * | | | | | | | | | | hle: nvflinger: Add implementation for HosBinderDriverServer service.bunnei2022-03-253-0/+75
| | | | | | | | | | | |
| * | | | | | | | | | | hle: nvflinger: Add implementation for BufferQueueProducer class.bunnei2022-03-253-2/+1021
| | | | | | | | | | | |
| * | | | | | | | | | | hle: nvflinger: Add implementation for BufferQueueCore class.bunnei2022-03-253-0/+235
| | | | | | | | | | | |
| * | | | | | | | | | | hle: nvflinger: Add implementation for BufferQueueConsumer class.bunnei2022-03-253-0/+263
| | | | | | | | | | | |
| * | | | | | | | | | | hle: nvflinger: Add implementation for QueueBufferInput and QueueBufferOutput structs.bunnei2022-03-253-0/+100
| | | | | | | | | | | |
| * | | | | | | | | | | hle: nvflinger: Add implementation for BufferItemConsumer class.bunnei2022-03-253-0/+87
| | | | | | | | | | | |
| * | | | | | | | | | | hle: nvflinger: Add implementation for ConsumerBase class.bunnei2022-03-253-0/+190
| | | | | | | | | | | |
| * | | | | | | | | | | hle: nvflinger: Add implementation for BufferSlot class.bunnei2022-03-252-0/+40
| | | | | | | | | | | |
| * | | | | | | | | | | hle: nvflinger: Add implementation for BufferItem class.bunnei2022-03-252-0/+47
| | | | | | | | | | | |
| * | | | | | | | | | | hle: nvflinger: Move implementation for Parcel to its own header.bunnei2022-03-252-0/+172
| | | | | | | | | | | |
| * | | | | | | | | | | hle: nvflinger: Add android buffer queue definitions to its own header.bunnei2022-03-252-0/+22
| | | | | | | | | | | |
| * | | | | | | | | | | hle: nvflinger: Add IBinder interface.bunnei2022-03-252-0/+43
| | | | | | | | | | | |
| * | | | | | | | | | | hle: nvflinger: Add IConsumerListener interface.bunnei2022-03-252-0/+27
| | | | | | | | | | | |
| * | | | | | | | | | | hle: nvflinger: Add ProducerListener interface.bunnei2022-03-252-0/+17
| | | | | | | | | | | |
| * | | | | | | | | | | hle: nvflinger: Add android window enumerations to its own header.bunnei2022-03-252-0/+54
| | | | | | | | | | | |
| * | | | | | | | | | | hle: nvflinger: Add android Status flags to its own header.bunnei2022-03-251-0/+28
| | | | | | | | | | | |
| * | | | | | | | | | | hle: nvflinger: Move BufferTransformFlags to its own header.bunnei2022-03-254-18/+29
| | | | | | | | | | | |
| * | | | | | | | | | | hle: nvdrv: Rename Fence to NvFence to avoid naming conflicts.bunnei2022-03-254-17/+13
| | | | | | | | | | | |
| * | | | | | | | | | | hle: nvflinger: Move PixelFormat to its own header.bunnei2022-03-2511-33/+50
| | | | | | | | | | | |
| * | | | | | | | | | | hle: nvflinger: Add implementation for GraphicBuffer class.bunnei2022-03-252-0/+101
| | | | | | | | | | | |
| * | | | | | | | | | | hle: nvflinger: Add implementation for Fence class.bunnei2022-03-252-0/+34
| | | | | | | | | | | |
| * | | | | | | | | | | hle: nvflinger: Add implementation for Rect class.bunnei2022-03-252-0/+76
| | | | | | | | | | | |
| * | | | | | | | | | | common: logging: Add a logger for NVFlinger.bunnei2022-03-252-0/+2
| |/ / / / / / / / / /
* | | | | | | | | | | Merge pull request #8068 from ameerj/shader-if-falseFernando S2022-03-253-9/+98
|\ \ \ \ \ \ \ \ \ \ \ | |/ / / / / / / / / / |/| | | | | | | | | | shader_recompiler/dead_code_elimination: Add DeadBranchElimination pass
| * | | | | | | | | | dead_code_elimination_pass: Remove unreachable Phi argumentsameerj2022-03-233-0/+36
| | | | | | | | | | |
| * | | | | | | | | | shader_recompiler/dead_code_elimination: Add DeadBranchElimination passameerj2022-03-221-9/+62
| | |/ / / / / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | This adds a pass to eliminate if(false) branches within the shader code
* | | | | | | | | | Merge pull request #8074 from liamwhite/cached-wordsFernando S2022-03-241-1/+2
|\ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | buffer_cache: reset cached write bits after flushing invalidations
| * | | | | | | | | | buffer_cache: reset cached write bits after flushing invalidationsLiam2022-03-241-1/+2
| | |_|/ / / / / / / | |/| | | | | | | |
* | | | | | | | | | Merge pull request #8035 from lat9nq/disable-web-appletbunnei2022-03-246-50/+65
|\ \ \ \ \ \ \ \ \ \ | |/ / / / / / / / / |/| | | | | | | | | yuzu qt: Disable the web applet by default
| * | | | | | | | | yuzu qt: Save disable_web_applet settinglat9nq2022-03-184-3/+6
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The web applet causes multiple issues with the rest of the application. Disable it by default and add a debug option to re-enable it until a proper solution can be found.
| * | | | | | | | | main: Update Disable Web Applet warninglat9nq2022-03-171-3/+2
| | | | | | | | | |
| * | | | | | | | | configure_debug: Add option to set disable_web_appletlat9nq2022-03-172-42/+57
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Allow the user to configure the web applet usage ahead of booting the application.
| * | | | | | | | | yuzu: Move disable_web_applet to UISettingslat9nq2022-03-173-5/+3
| | | | | | | | | |
* | | | | | | | | | Merge pull request #8073 from Shoegzer/compile_fixesAmeer J2022-03-231-0/+1
|\ \ \ \ \ \ \ \ \ \ | |_|_|_|_|_|_|_|_|/ |/| | | | | | | | | Add include to fix compiling
| * | | | | | | | | Add include to fix compilingShoegzer2022-03-231-0/+1
|/ / / / / / / / /
* | | | | | | | | Merge pull request #8031 from Morph1984/cleanup-mii-pleasebunnei2022-03-2319-574/+644
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | applets: Cleanup MiiEdit applet implementation
| * | | | | | | | | applets/mii: Remove unused includeMorph2022-03-221-1/+0
| | | | | | | | | |
| * | | | | | | | | applets/mii: Remove frontend parametersMorph2022-03-222-17/+4
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | These are unused for now as we do not support a frontend implementation.
| * | | | | | | | | applets/mii: Cleanup MiiEdit applet implementationMorph2022-03-222-44/+85
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This also enables proper support for MiiEdit applets which are used in games with firmware versions prior to 10.2.0 by handling the 2 different versions of applet inputs and outputs.
| * | | | | | | | | applets/mii: Cleanup MiiEdit applet typesMorph2022-03-221-23/+44
| | | | | | | | | |
| * | | | | | | | | applets/mii: Move MiiEdit applet types into its own fileMorph2022-03-224-54/+70
| | | | | | | | | |
| * | | | | | | | | service: Move mii enums and structs into its own fileMorph2022-03-227-308/+312
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Moves these into types.h, since other files also make use of these types.
| * | | | | | | | | applets: Rename Mii to MiiEditMorph2022-03-228-47/+49
| | |_|/ / / / / / | |/| | | | | | |
* | | | | | | | | Merge pull request #8070 from yuzu-emu/revert-8016-kill-mem-usebunnei2022-03-232-4/+4
|\ \ \ \ \ \ \ \ \ | |/ / / / / / / / |/| | | | | | | | Revert "dynarmic: Reduce size of code caches"
| * | | | | | | | Revert "dynarmic: Reduce size of code caches"bunnei2022-03-232-4/+4
|/ / / / / / / /
* | | | | | | | Merge pull request #8067 from ameerj/qt-browser-includeNarr the Reg2022-03-221-0/+3
|\ \ \ \ \ \ \ \ | |_|/ / / / / / |/| | | | | | | qt_web_browser: Add missing includes
| * | | | | | | qt_web_browser: Add missing includesameerj2022-03-221-0/+3
|/ / / / / / /
* | | | | | | Merge pull request #8038 from liamwhite/exit-register-detectionAmeer J2022-03-222-0/+9
|\ \ \ \ \ \ \ | |_|_|_|/ / / |/| | | | | | shader_recompiler/EXIT: increment output register on failed enable test
| * | | | | | Address review commentsLiam2022-03-181-1/+1
| | | | | | |
| * | | | | | shader_recompiler/EXIT: skip render targets with no outputsLiam2022-03-182-0/+8
| | | | | | |
| * | | | | | shader_recompiler/EXIT: increment output register on failed enable testLiam2022-03-181-0/+1
| | | | | | |
* | | | | | | Merge pull request #8048 from ameerj/include-purgebunnei2022-03-22271-452/+44
|\ \ \ \ \ \ \ | |_|_|/ / / / |/| | | | | | general: Reduce unused includes across the project
| * | | | | | general: Fix clang/gcc build errorsameerj2022-03-2012-4/+17
| | | | | | |
| * | | | | | yuzu_cmd: Reduce unused includesameerj2022-03-205-9/+0
| | | | | | |
| * | | | | | yuzu: Reduce unused includesameerj2022-03-2045-104/+5
| | | | | | |
| * | | | | | web_service: Reduce unused includesameerj2022-03-201-1/+0
| | | | | | |
| * | | | | | input_common: Reduce unused includesameerj2022-03-204-4/+0
| | | | | | |
| * | | | | | shader_recompiler: Reduce unused includesameerj2022-03-2069-106/+7
| | | | | | |
| * | | | | | common: Reduce unused includesameerj2022-03-1930-32/+8
| | | | | | |
| * | | | | | video_core: Reduce unused includesameerj2022-03-1975-139/+12
| | | | | | |
| * | | | | | common: Reduce unused includesameerj2022-03-198-12/+0
| | | | | | |
| * | | | | | core: Reduce unused includesameerj2022-03-1938-54/+8
| | | | | | |
* | | | | | | Merge pull request #7812 from FernandoS27/made-straight-from-the-nutbunnei2022-03-201-6/+14
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | BufferCache: Find direction of the stream buffer increase.
| * | | | | | | BufferCache: Find direction of the stream buffer increase.Fernando Sahmkow2022-03-201-6/+14
| | | | | | | |
* | | | | | | | Merge pull request #8054 from merryhime/dynarmicMai M2022-03-201-0/+0
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | dynarmic: Accelerate SHA256 and implement for A32 frontend
| * | | | | | | | dynarmic: Accelerate SHA256 and implement for A32 frontendMerry2022-03-201-0/+0
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * Implements hardware acceleration for SHA256 instructions. * Adds SHA256 instructions introduced in ARMv8 to A32 frontend. * Implements polyfill for processors that do not support hardware accelerated SHA instructions.
* | | | | | | | | Merge pull request #8036 from ameerj/starbit-nvFernando S2022-03-201-5/+0
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | vk_texture_cache: Do not reinterpret DepthStencil source images
| * | | | | | | | | vk_texture_cache: Do not reinterpret DepthStencil source imagesameerj2022-03-181-5/+0
| | |_|_|/ / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Fixes star pointer interactions in Super Mario Galaxy on some drivers, notably Nvidia. Co-Authored-By: Fernando S. <1731197+fernandos27@users.noreply.github.com>
* | | | | | | | | Merge pull request #7840 from lioncash/bitorbunnei2022-03-201-15/+3
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | texture_cache: Amend unintended bitwise OR in SynchronizeAliases
| * | | | | | | | | texture_cache: Ensure has_blacklisted is always initializedLioncash2022-02-021-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Resolves a -Wmaybe_uninitialized warning
| * | | | | | | | | texture_cache: Remove dead code within SynchronizeAliasesLioncash2022-02-021-13/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Since these were being copied by value, none of the changes applied in the loop would be reflected. However, from the looks of it, this would already be applied within CopyImage() anyways, so this can be removed.
| * | | | | | | | | texture_cache: Amend unintended bitwise OR in SynchronizeAliasesLioncash2022-02-021-1/+1
| | | | | | | | | |
* | | | | | | | | | Merge pull request #8040 from Morph1984/handle-tablebunnei2022-03-202-30/+12
|\ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | KHandleTable: Optimize table entry layout
| * | | | | | | | | | KHandleTable: Optimize table entry layoutMorph2022-03-182-30/+12
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Since the handle type is not being used, we can reduce the amount of space each entry takes up by 4 bytes.
* | | | | | | | | | | Merge pull request #8047 from ameerj/msvc-test-disablebunnei2022-03-201-1/+1
|\ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | .ci/build-msvc: Disable YUZU_TESTS cmake variable
| * | | | | | | | | | | build-msvc: Disable testsameerj2022-03-191-1/+1
| | |_|_|_|_|/ / / / / | |/| | | | | | | | |
* | | | | | | | | | | Merge pull request #8025 from lat9nq/cmd-specify-configbunnei2022-03-193-10/+27
|\ \ \ \ \ \ \ \ \ \ \ | |/ / / / / / / / / / |/| | | | | | | | | | yuzu_cmd: Allow user to specify config file location
| * | | | | | | | | | yuzu_cmd: Allow user to specify config file locationlat9nq2022-03-153-10/+27
| | |_|_|_|_|_|/ / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Adds an option `-c` or `--config` with one required argument that allows the user to specify to where the config file is located. Useful for scripts that run specific games with different preferences for settings.
* | | | | | | | | | Merge pull request #8028 from v1993/patch-9bunnei2022-03-191-2/+2
|\ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | bsd: Allow inexact match for address length in AcceptImpl
| * | | | | | | | | | bsd: Allow inexact match for address length in AcceptImplValeri2022-03-151-2/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Minecraft passes in zero for length, but this should account for all possible cases
* | | | | | | | | | | Merge pull request #8039 from ameerj/core-includeMorph2022-03-188-12/+23
|\ \ \ \ \ \ \ \ \ \ \ | |_|_|_|_|/ / / / / / |/| | | | | | | | | | general: Reduce core.h includes
| * | | | | | | | | | general: Reduce core.h includesameerj2022-03-188-12/+23
|/ / / / / / / / / /
* | | | | | | | | | Merge pull request #8024 from liamwhite/const-indexingFernando S2022-03-186-65/+163
|\ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | Add shader support for const buffer indirect addressing
| * | | | | | | | | | Address review commentsLiam2022-03-174-52/+36
| | | | | | | | | | |
| * | | | | | | | | | shader_recompiler: Use functions for indirect const buffer accessesLiam2022-03-175-39/+94
| | | | | | | | | | |
| * | | | | | | | | | Address review commentsLiam2022-03-171-16/+15
| | | | | | | | | | |
| * | | | | | | | | | shader_recompiler: Implement LDC.IS address modeLiam2022-03-161-2/+12
| | | | | | | | | | |
| * | | | | | | | | | shader: add support for const buffer indirect addressingLiam2022-03-152-18/+68
| | |/ / / / / / / / | |/| | | | | | | |
* | | | | | | | | | Merge pull request #8030 from liamwhite/s8d24-conversionFernando S2022-03-185-2/+41
|\ \ \ \ \ \ \ \ \ \ | |_|_|_|_|_|_|/ / / |/| | | | | | | | | Vulkan: convert S8D24 <-> ABGR8
| * | | | | | | | | Address review commentsLiam2022-03-162-2/+2
| | | | | | | | | |
| * | | | | | | | | Vulkan: convert S8D24 <-> ABGR8Liam2022-03-165-2/+41
| | |/ / / / / / / | |/| | | | | | |
* | | | | | | | | Merge pull request #7964 from german77/miiiibunnei2022-03-178-5/+272
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | applet: mii: Simple implementation of mii applet
| * | | | | | | | | applet: mii: Simple implementation of mii appletgerman772022-03-018-5/+272
| | | | | | | | | |
* | | | | | | | | | Merge pull request #8013 from bunnei/kernel-slab-rework-v2Fernando S2022-03-1632-849/+1271
|\ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | Kernel Memory Updates (Part 6): Use guest memory for slab heaps & update TLS.
| * | | | | | | | | | core: hle: kernel: init_slab_setup: Move CalculateSlabHeapGapSize to global namespace.bunnei2022-03-151-6/+6
| | | | | | | | | | |
| * | | | | | | | | | core: hle: kernel: Allocate dummy threads on host thread storage.bunnei2022-03-152-8/+6
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | - Fixes a crash where on subsequent boots, long-lived host threads would have their dummy threads freed.
| * | | | | | | | | | core: hle: kernel: Downgrade dangling objects warning to debug.bunnei2022-03-151-2/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | - It is not impossible to leak kernel objects, so this is not really any issue anymore (albeit, still interesting).
| * | | | | | | | | | core: hle: kernel: Make object list container global and ensure it is reset on each emulation session.bunnei2022-03-151-7/+9
| | | | | | | | | | |
| * | | | | | | | | | core: hle: kernel: Remove server session tracking.bunnei2022-03-154-37/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | - These are now allocated/managed by emulated memory, so we do not need to track and free them on shutdown.
| * | | | | | | | | | core: hle: kernel: k_process: Remove handle table finalize, reset page table.bunnei2022-03-151-3/+3
| | | | | | | | | | |
| * | | | | | | | | | core: hle: kernel: k_process: Implement thread local storage accurately.bunnei2022-03-153-111/+99
| | | | | | | | | | |
| * | | | | | | | | | core: hle: kernel: k_page_table: Add implementations of MapPages, UnmapPages, and FindFreeArea for TLS.bunnei2022-03-152-2/+141
| | | | | | | | | | |
| * | | | | | | | | | core: hle: kernel: k_slab_heap: Refresh to use guest allocations.bunnei2022-03-152-125/+107
| | | | | | | | | | |
| * | | | | | | | | | core: hle: kernel: Update init_slab_heap, use device memory, and add KThreadLocalPage and KPageBuffer.bunnei2022-03-154-55/+92
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | - Refreshes our slab initialization code to latest known behavior. - Moves all guest kernel slabs into emulated device memory. - Adds KThreadLocalPage and KPageBuffer, which we will use for accurate TLS management.
| * | | | | | | | | | core: hle: kernel: k_page_buffer: Add KThreadLocalPage primitive.bunnei2022-03-153-0/+179
| | | | | | | | | | |
| * | | | | | | | | | core: hle: kernel: k_page_buffer: Add KPageBuffer primitive.bunnei2022-03-152-0/+35
| | | | | | | | | | |
| * | | | | | | | | | core: hle: kernel: k_thread: Ensure host Fiber is freed.bunnei2022-03-151-0/+3
| | | | | | | | | | |
| * | | | | | | | | | core: hle: kernel: k_server_session: Ensure SessionRequestManager is freed.bunnei2022-03-151-0/+3
| | | | | | | | | | |
| * | | | | | | | | | core: hle: service: kernel_helpers: Use system resource limit.bunnei2022-03-151-10/+1
| | | | | | | | | | |
| * | | | | | | | | | core: hle: service: sm: Fix KPort reference count.bunnei2022-03-151-0/+2
| | | | | | | | | | |
| * | | | | | | | | | core: hle: kernel: k_thread: Update to reflect tree changes.bunnei2022-03-151-3/+3
| | | | | | | | | | |
| * | | | | | | | | | core: hle: kernel: Use weak_ptr where possible for SessionRequestHandler and SessionRequestManager.bunnei2022-03-157-14/+25
| | | | | | | | | | |
| * | | | | | | | | | core: hle: kernel: k_memory_layout: Update kernel slab memory sizes.bunnei2022-03-151-3/+3
| | | | | | | | | | |
| * | | | | | | | | | core: hle: kernel: svc_types: Add ThreadLocalRegionSize.bunnei2022-03-151-0/+2
| | | | | | | | | | |
| * | | | | | | | | | core: hle: kernel: k_condition_variable: Update to reflect tree changes.bunnei2022-03-151-1/+1
| | | | | | | | | | |
| * | | | | | | | | | core: hle: kernel: k_address_arbiter: Update to reflect tree changes.bunnei2022-03-151-3/+3
| | | | | | | | | | |
| * | | | | | | | | | common: tree: Various updates.bunnei2022-03-151-284/+341
| | | | | | | | | | |
| * | | | | | | | | | common: intrusive_red_black_tree: Various updates.bunnei2022-03-151-181/+210
| | |_|/ / / / / / / | |/| | | | | | | |
* | | | | | | | | | Merge pull request #8023 from ameerj/kirby-pop-inFernando S2022-03-162-70/+12
|\ \ \ \ \ \ \ \ \ \ | |_|_|_|/ / / / / / |/| | | | | | | | | maxwell_3d: Implement a safer CB data upload
| * | | | | | | | | maxwell_3d: Implement a safer CB data uploadameerj2022-03-152-70/+12
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This makes constant buffer uploads safer and more accurate by updating the GPU memory as soon as the CB Data method is invoked. The previous implementation was deferring the updates until a different maxwell 3d method was detected, then writing all CB data at once.
* | | | | | | | | | Merge pull request #8026 from lat9nq/ext-mem-inibunnei2022-03-161-1/+5
|\ \ \ \ \ \ \ \ \ \ | |_|_|_|/ / / / / / |/| | | | | | | | | default_ini: List use_extended_memory_layout in default config file
| * | | | | | | | | default_ini: List use_extended_memory_layout in default config filelat9nq2022-03-151-1/+5
| | |/ / / / / / / | |/| | | | | | |
* | | | | | | | | Merge pull request #8006 from BytesGalore/fix_cmake_missing_qt5_dbusbunnei2022-03-151-1/+5
|\ \ \ \ \ \ \ \ \ | |/ / / / / / / / |/| | | | | | | | build(cmake): fix missing Qt5::DBus link target for bundled linux package
| * | | | | | | | build(cmake): fix missing Qt5::DBus link target for bundled linux packageBytesGalore2022-03-121-1/+5
| | |_|_|/ / / / | |/| | | | | |
* | | | | | | | Merge pull request #8008 from ameerj/rescale-offsets-arrayFernando S2022-03-151-2/+27
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | rescaling_pass: Fix rescaling Color2DArray ImageFetch offsets
| * | | | | | | | rescaling_pass: Fix rescaling Color2DArray ImageFetch offsetsameerj2022-03-121-2/+27
| |/ / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | ImageFetch offsets for 2D array coordinates have a different composite size than the coordinates. The rescaling pass was not taking this into account. Fixes broken shaders when scaling is enabled in Astral Chain, and likely other titles.
* | | | | | | | Merge pull request #8000 from liamwhite/hagiFernando S2022-03-153-3/+77
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | Initial support for Wii Hagi emulator
| * | | | | | | | Maxwell3D: Link to override constant definition in nouveaubyte[]2022-03-141-0/+2
| | | | | | | | |
| * | | | | | | | Maxwell3D: restore original topology when topology overrides are disabledbyte[]2022-03-141-0/+2
| | | | | | | | |
| * | | | | | | | Maxwell3D: Use override constants from nouveauLiam2022-03-142-2/+37
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This fixes some incorrect rendering in Sunshine
| * | | | | | | | Maxwell3D: Restrict topology override effect to after the register is setLiam2022-03-122-1/+5
| | | | | | | | |
| * | | | | | | | Maxwell3D: mark index buffers as dirty after updating countsLiam2022-03-111-0/+2
| | | | | | | | |
| * | | | | | | | TextureCacheRuntime: allow converting D24S8 to ABGR8Liam2022-03-111-1/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | I can't see how this would be useful, but Galaxy uses it.
| * | | | | | | | Maxwell3D: read small-index draw and primitive topology override registersLiam2022-03-112-2/+30
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This allows Galaxy and Sunshine to render for the first time.
* | | | | | | | | Merge pull request #8015 from FernandoS27/fix-global-membunnei2022-03-152-3/+4
|\ \ \ \ \ \ \ \ \ | |_|_|/ / / / / / |/| | | | | | | | Shader decompiler: Fix storage tracking in deko3d.
| * | | | | | | | Shader decompiler: do constant propgation before texture pass.Fernando Sahmkow2022-03-131-2/+2
| | | | | | | | |
| * | | | | | | | Shader decompiler: Fix storage tracking in deko3d.Fernando Sahmkow2022-03-131-1/+2
| | | | | | | | |
* | | | | | | | | Merge pull request #8016 from merryhime/kill-mem-useFernando S2022-03-142-4/+4
|\ \ \ \ \ \ \ \ \ | |/ / / / / / / / |/| | | | | | | | dynarmic: Reduce size of code caches
| * | | | | | | | dynarmic: Reduce size of code cachesMerry2022-03-132-4/+4
| | |/ / / / / / | |/| | | | | |
* | | | | | | | Merge pull request #8007 from ameerj/vs-2022-errorsbunnei2022-03-132-2/+3
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | emit_spirv, vk_compute_pass: Resolve VS2022 compiler errors
| * | | | | | | | emit_spirv, vk_compute_pass: Resolve VS2022 compiler errorsameerj2022-03-122-2/+3
| |/ / / / / / /
* | | | | | | | Merge pull request #8009 from ameerj/dynarmic-exclusives-configmerry2022-03-131-0/+2
|\ \ \ \ \ \ \ \ | |/ / / / / / / |/| | | | | | | config: Write dynarmic exclusive memory configs
| * | | | | | | config: Write dynarmic exclusive memory configsameerj2022-03-121-0/+2
|/ / / / / / / | | | | | | | | | | | | | | | | | | | | | Ensures the configs are written and saved between boots
* | | | | | | Merge pull request #7997 from Wunkolo/cpu_detect_morebunnei2022-03-125-32/+90
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | cpu_detect: Add additional x86 flags and telemetry
| * | | | | | | cpu_detect: Add additional x86 flags and telemetryWunkolo2022-03-114-29/+86
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Adds detection of additional CPU flags to cpu_detect and additions to telemetry output. This is not exhaustive but guided by features that [dynarmic utilizes](https://github.com/merryhime/dynarmic/blob/bcfe377aaa5138af740e90af5be7a7dff7b62a52/src/dynarmic/backend/x64/host_feature.h#L12-L33) as well as features that are currently utilized but not reported to telemetry(invariant_tsc). This is intended to guide future optimizations. AVX512 in particular is broken up into its individual subsets and some other processor features such as [sha](https://en.wikipedia.org/wiki/Intel_SHA_extensions) and [gfni](https://en.wikipedia.org/wiki/AVX-512#GFNI) are added to have some forward-facing data-points. What used to be a single `CPU_Extension_x64_AVX512` telemetry field is also broken up into individual `CPU_Extension_x64_AVX512{F,VL,CD,...}` fields.
| * | | | | | | common/telemetry: Update `AddField` name type to `string_view`Wunkolo2022-03-111-3/+4
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Non-owning `string_view` is flexable and avoids some of the many redundant copies made over `std::string`
* | | | | | | | Merge pull request #8003 from yuzu-emu/revert-7982-fix_cmake_missing_qt5_dbusbunnei2022-03-121-1/+1
|\ \ \ \ \ \ \ \ | |/ / / / / / / |/| | | | | | | Revert "build(cmake): fix missing Qt5::DBus target on linux"
| * | | | | | | Revert "build(cmake): fix missing Qt5::DBus target on linux"bunnei2022-03-121-1/+1
|/ / / / / / /
* | | | | | | Merge pull request #7982 from BytesGalore/fix_cmake_missing_qt5_dbusbunnei2022-03-111-1/+1
|\ \ \ \ \ \ \ | |/ / / / / / |/| | | | | | build(cmake): fix missing Qt5::DBus target on linux
| * | | | | | build(cmake): fix missing Qt5::DBus link targetBytesGalore2022-03-061-1/+1
| | |_|_|_|/ | |/| | | |
* | | | | | Merge pull request #7999 from merryhime/fix-7992Mai M2022-03-101-1/+1
|\ \ \ \ \ \ | | | | | | | | | | | | | | backend: Ensure backend_thread is destructed before message_queue
| * | | | | | backend: Ensure backend_thread is destructed before message_queueMerry2022-03-101-1/+1
|/ / / / / / | | | | | | | | | | | | | | | | | | Ensures that stop_token signals that stop has been requested before destruction of conditional_variable
* | | | | | Merge pull request #7998 from Wunkolo/cpuid_arrayMorph2022-03-101-6/+6
|\ \ \ \ \ \ | | | | | | | | | | | | | | cpu_detect: Revert `__cpuid{ex}` array-type argument
| * | | | | | cpu_detect: Revert `__cpuid{ex}` array-type argumentWunkolo2022-03-101-6/+6
|/ / / / / / | | | | | | | | | | | | | | | | | | Restores compatibility with MSVC's `__cpuid` intrinsic.
* | | | | | Merge pull request #7936 from Wunkolo/cpu_detectbunnei2022-03-103-85/+98
|\ \ \ \ \ \ | | | | | | | | | | | | | | cpu_detect: Refactor detection of processor features
| * | | | | | cpu_detect: Add missing `lzcnt` detectionWunkolo2022-03-091-0/+1
| | | | | | |
| * | | | | | cpu_detect: Refactor cpu/manufacturer identificationWunkolo2022-03-092-24/+38
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Set the zero-enum value to Unknown Move the Manufacterer enum into the CPUCaps structure namespace Add "ParseManufacturer" utility-function Fix cpu/brand string buffer sizes(!)
| * | | | | | cpu_detect: Update array-types to `span` and `array`Wunkolo2022-03-091-11/+13
| | | | | | | | | | | | | | | | | | | | | | | | | | | | Update some uses of `int` into some more explicitly sized types as well
| * | | | | | cpu_detect: Utilize `Bit<N>` utility functionWunkolo2022-03-091-32/+20
| | | | | | |
| * | | | | | cpu_detect: Compact capability fieldsWunkolo2022-03-091-20/+21
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | As this structure gets more explicit, bools can be bitfields and small enums can use smaller types for their span of values.
| * | | | | | bit_util: Add `bit` utility functionWunkolo2022-03-091-0/+7
|/ / / / / / | | | | | | | | | | | | | | | | | | Extracts a singular bit, as a bool, from the specified compile-time index.
* | | | | | Merge pull request #7975 from bunnei/ldr-fixbunnei2022-03-092-24/+62
|\ \ \ \ \ \ | | | | | | | | | | | | | | hle: service: ldr: Use deterministic addresses when mapping NROs.
| * | | | | | hle: service: ldr: Use deterministic addresses when mapping NROs.bunnei2022-03-092-24/+62
|/ / / / / / | | | | | | | | | | | | | | | | | | | | | | | | - Instead of randomization, choose in-order addresses for where to map NROs into memory. - This results in predictable behavior when debugging and consistent behavior when reproducing issues.
* | | | | | Merge pull request #7986 from lat9nq/vk-callbackbunnei2022-03-083-2/+14
|\ \ \ \ \ \ | | | | | | | | | | | | | | core, video_core: Fix two crashes when failing to create the emulated GPU instance
| * | | | | | video_core: Cancel Scoped's exit call on GPU failurelat9nq2022-03-081-0/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | When CreateRenderer fails, the GraphicsContext that was std::move'd into it is destroyed before the Scoped that was created to manage its currency. In that case, the GraphicsContext::Scoped will still call its destructor at the ending of the function. And because the context is destroyed, the Scoped will cause a crash as it attempts to call a destroyed object's DoneCurrent function. Since we know when the call would be invalid, call the Scoped's Cancel method. This prevents it from calling a method on a destroyed object.
| * | | | | | emu_window: Create a way to Cancel the exit of a Scopedlat9nq2022-03-081-1/+10
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | If a GraphicsContext is destroyed before its Scoped is destroyed, this causes a crash as the Scoped tries to call a method in the destroyed context on exit. Add a way to Cancel the call when we know that calling the GraphicsContext will not work.
| * | | | | | core: Don't shutdown a null GPUlat9nq2022-03-071-1/+3
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | When CreateGPU fails, yuzu would try and shutdown the GPU instance regardless of whether any instance was actually created. Check for nullptr before calling its methods to prevent a crash.
* | | | | | | Merge pull request #7989 from degasus/maxwell_LUT3Fernando S2022-03-082-52/+620
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | shader_recompiler/LOP3: Use brute force python results within switch/case.
| * | | | | | | shader_recompiler/LOP3: Use brute force python results within switch/case.Markus Wick2022-03-082-52/+620
|/ / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Thanks to @asLody for optimizing this function. This raised the focus that this function should be optimized more. The current table assumes that the host GPU is able to invert for free, so only AND,OR,XOR are accumulated in the performance metrik. Performance results: Instructions 0: 8 1: 30 2: 114 3: 80 4: 24 Latency 0: 8 1: 30 2: 194 3: 24
* | | | | | | Merge pull request #7974 from bunnei/improve-code-membunnei2022-03-082-47/+116
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | Kernel Memory Updates (Part 5): Revamp MapCodeMemory and UnmapCodeMemory.
| * | | | | | | hle: kernel: KPageTable: Improve implementations of MapCodeMemory and UnmapCodeMemory.bunnei2022-03-082-47/+116
|/ / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | - This makes these functions more accurate to the real HOS implementations. - Fixes memory access issues in Super Smash Bros. Ultimate that occur when un/mapping NROs.
* | | | | | | Merge pull request #7930 from asLody/dma-semaphoreFernando S2022-03-072-1/+21
|\ \ \ \ \ \ \ | |/ / / / / / |/| | | | | | MaxwellDMA: Implement semaphore operations
| * | | | | | MaxwellDMA: Implement semaphore operationsLody2022-03-072-1/+21
| | | | | | |
* | | | | | | gl_graphics_pipeline: Improve shader builder synchronization using fences (#7969)Ameer J2022-03-062-21/+32
| |/ / / / / |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * gl_graphics_pipeline: Improve shader builder synchronization Make use of GLsync objects to ensure better synchronization between shader builder threads and the main context * gl_graphics_pipeline: Make built_fence access threadsafe * gl_graphics_pipeline: Use GLsync objects only when building in parallel * gl_graphics_pipeline: Replace GetSync calls with non-blocking waits The spec states that a ClientWait on a Fence object ensures the changes propagate to the calling context
* | | | | | Merge pull request #7973 from Morph1984/debug-crashFernando S2022-03-061-2/+2
|\ \ \ \ \ \ | |_|_|_|_|/ |/| | | | | host_memory: Fix fastmem crashes in debug builds
| * | | | | host_memory: Fix fastmem crashes in debug buildsMorph2022-03-031-2/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | It is possible for virtual_offset to not be 0 when the iterator is at the beginning, and thus, std::prev(it) may be evaluated, leading to a crash in debug mode. Co-Authored-By: Fernando S. <1731197+FernandoS27@users.noreply.github.com>
* | | | | | Merge pull request #7935 from Wunkolo/logging-join-fixbunnei2022-03-031-13/+5
|\ \ \ \ \ \ | | | | | | | | | | | | | | logging: Convert `backend_thread` into an `std::jthread`
| * | | | | | logging: Convert `backend_thread` into an `std::jthread`Wunkolo2022-02-281-13/+5
| | |_|/ / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | Was getting an unhandled `invalid_argument` [exception](https://en.cppreference.com/w/cpp/thread/thread/join) during shutdown on my linux machine. This removes the need for a `StopBackendThread` function entirely since `jthread` [automatically handles both checking if the thread is joinable and stopping the token before attempting to join](https://en.cppreference.com/w/cpp/thread/jthread/~jthread) in the case that `StartBackendThread` was never called.
* | | | | | Merge pull request #7956 from bunnei/improve-mem-managerbunnei2022-03-0315-376/+848
|\ \ \ \ \ \ | |_|/ / / / |/| | | | | Kernel Memory Updates (Part 4): Revamp KMemoryManager & other fixes
| * | | | | hle: kernel: Re-create memory layout at initialization.bunnei2022-02-281-41/+43
| | | | | | | | | | | | | | | | | | | | | | | | - As this can only be derived once.
| * | | | | hle: kernel: Remove unused pool locals.bunnei2022-02-281-2/+0
| | | | | |
| * | | | | hle: kernel: k_memory_manager: Rework for latest kernel behavior.bunnei2022-02-286-173/+548
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | - Updates the KMemoryManager implementation against latest documentation. - Reworks KMemoryLayout to be accessed throughout the kernel. - Fixes an issue with pool sizes being incorrectly reported.
| * | | | | hle: kernel: k_page_heap: GetPhysicalAddr can be const.bunnei2022-02-271-2/+1
| | | | | |
| * | | | | hle: kernel: k_page_heap: Remove superfluous consexpr.bunnei2022-02-272-4/+4
| | | | | |
| * | | | | hle: kernel: k_page_heap: Various updates and improvements.bunnei2022-02-272-155/+192
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | - KPageHeap tracks physical addresses, not virtual addresses. - Various updates and improvements to match latest documentation for this type.
| * | | | | hle: kernel: Add initial_process.h header.bunnei2022-02-272-0/+24
| | | | | |
| * | | | | hle: kernel: board: nx: Add k_memory_layout.h header.bunnei2022-02-272-0/+14
| | | | | |
| * | | | | hle: kernel: k_system_control: Add GetRealMemorySize and update GetKernelPhysicalBaseAddress.bunnei2022-02-272-1/+12
| | | | | |
| * | | | | hle: kernel: k_memory_layout: Add GetPhysicalLinearRegion.bunnei2022-02-271-0/+4
| | | | | |
| * | | | | hle: kernel: k_memory_region_types: Update for new regions.bunnei2022-02-271-1/+9
| |/ / / /
* | | | | Merge pull request #7959 from merryhime/cmpxchgFernando S2022-03-0117-7/+113
|\ \ \ \ \ | | | | | | | | | | | | dynarmic: Inline exclusive memory accesses
| * | | | | dynarmic: Update to latest mastermerry2022-02-281-0/+0
| | | | | |
| * | | | | dynarmic: Inline exclusive memory accessesmerry2022-02-2717-7/+113
| |/ / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Inlines implementation of exclusive instructions into JITted code, improving performance of applications relying heavily on these instructions. We also fastmem these instructions for additional speed, with support for appropriate recompilation on fastmem failure. An unsafe optimization to disable the intercore global_monitor is also provided, should one wish to rely solely on cmpxchg semantics for safety. See also: merryhime/dynarmic#664
* | | | | Merge pull request #7967 from zhaobot/tx-update-20220301023432Mai M2022-03-0123-9968/+15533
|\ \ \ \ \ | | | | | | | | | | | | Update translations (2022-03-01)
| * | | | | Update translations (2022-03-01)The yuzu Community2022-03-0123-9968/+15533
|/ / / / /
* | | | | Merge pull request #7963 from ameerj/gl_fence_nitMai M2022-03-011-2/+1
|\ \ \ \ \ | | | | | | | | | | | | gl_fence_manager: Minor optimization to signal querying
| * | | | | gl_fence_manager: Minor optimization to signal queryingameerj2022-02-271-2/+1
| |/ / / / | | | | | | | | | | | | | | | | | | | | | | | | | Per the spec, bufSize is the number of integers that will be written, in this case, 1. Also, the length argument is optional if the information of the number of elements written is not needed.
* | | | | Merge pull request #7966 from merryhime/cmake-ffmpeg-endifMai M2022-03-011-1/+1
|\ \ \ \ \ | |/ / / / |/| | | | ffmpeg: Fix mis-maching argument warning for endif
| * | | | ffmpeg: Fix mis-maching argument warning for endifMerry2022-02-281-1/+1
|/ / / /
* | | | Merge pull request #7955 from bunnei/update-dynarmicbunnei2022-02-261-0/+0
|\ \ \ \ | | | | | | | | | | externals: Dynarmic: Update to latest rev.
| * | | | externals: Dynarmic: Update to latest rev.bunnei2022-02-261-0/+0
|/ / / / | | | | | | | | | | | | - Fixes inaccurate size reporting in SpaceRemaining, which caused crashes in yuzu with SSBU.
* | | | Merge pull request #7932 from bunnei/extended-mem-layoutbunnei2022-02-2621-55/+91
|\ \ \ \ | | | | | | | | | | Add extended memory layout (6GB) support and improve KResourceLimit management
| * | | | hle: kernel: KSystemControl: Use 6GB memory layout when "use_extended_memory_layout" setting is enabled.bunnei2022-02-211-20/+4
| | | | | | | | | | | | | | | | | | | | - This uses a larger 6GB DRAM memory layout, which is useful for some mods that require more memory.
| * | | | core: device_memory: Use memory size reported by KSystemControl.bunnei2022-02-213-7/+5
| | | | | | | | | | | | | | | | | | | | - That way, we can consolidate the memory layout to one place.
| * | | | settings: Add a new "use_extended_memory_layout" setting.bunnei2022-02-217-0/+22
| | | | | | | | | | | | | | | | | | | | - This will be used to enable emulation of a larger memory arrangement.
| * | | | core: hle: kernel: Remove resource limit hack for PhysicalMemory.bunnei2022-02-211-7/+0
| | | | | | | | | | | | | | | | | | | | - With prior changes, we now report the correct amount of physical memory available to the emulated process.
| * | | | core: hle: kernel: KProcess: Pass in KResourceLimit on process creation.bunnei2022-02-214-9/+30
| | | | | | | | | | | | | | | | | | | | - This allows us to have a resource limit per process, rather than use the global system resource limit.
| * | | | core: hle: kernel: KEvent: Pass in owner KProcess on event creation.bunnei2022-02-214-12/+8
| | | | | | | | | | | | | | | | | | | | - This is necessary to ensure resource limits are freed from the right process.
| * | | | core: hle: kernel: KResourceLimit: Add a helper function for creating a KResourceLimit for a process.bunnei2022-02-212-0/+22
| | | | |
* | | | | Merge pull request #7953 from ameerj/radv-rdna2-crashbunnei2022-02-261-4/+21
|\ \ \ \ \ | | | | | | | | | | | | vulkan_device: Blacklist RADV on RDNA2 from VK_EXT_vertex_input_dynamic_state
| * | | | | vulkan_device: Blacklist RADV on RDNA2 from VK_EXT_vertex_input_dynamic_stateAmeer J2022-02-261-4/+21
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | RDNA2 devices running under the RADV driver were crashing when VK_EXT_vertex_input_dynamic_state was enabled. Blacklisting these devices until a proper fix is established.
* | | | | | Merge pull request #7948 from Morph1984/11-11-10-floatMai M2022-02-262-0/+4
|\ \ \ \ \ \ | | | | | | | | | | | | | | maxwell_to_(gl/vk): Add 11_11_10 float vertex format
| * | | | | | maxwell_to_(gl/vk): Add 11_11_10 float vertex formatMorph2022-02-252-0/+4
| |/ / / / / | | | | | | | | | | | | | | | | | | - Used by パワプロクンポケットR
* | | | | | Merge pull request #7939 from asLody/fb-format-gbra8bunnei2022-02-251-0/+2
|\ \ \ \ \ \ | | | | | | | | | | | | | | vk_blit_screen: Add missing framebuffer format
| * | | | | | vk_blit_screen: Add missing format bgra8Lody2022-02-241-0/+2
| |/ / / / /
* | | | | | Merge pull request #7927 from german77/amiibobunnei2022-02-251-0/+10
|\ \ \ \ \ \ | | | | | | | | | | | | | | yuzu: Disconnect amiibos on drag and drop
| * | | | | | yuzu: Remove amiibos on drag and dropgerman772022-02-201-0/+10
| | |_|/ / / | |/| | | |
* | | | | | Merge pull request #7859 from german77/battery_againbunnei2022-02-246-34/+27
|\ \ \ \ \ \ | |_|/ / / / |/| | | | | input_common: Remove battery duplicated struct and update every button press
| * | | | | input_common: Remove battery duplicated struct and update every button pressgerman772022-02-076-34/+27
| | | | | |
* | | | | | Merge pull request #7933 from german77/am_updateMai M2022-02-224-16/+51
|\ \ \ \ \ \ | | | | | | | | | | | | | | service: am: Update enum names to match documentation
| * | | | | | service: am: Update enum names to match documentationNarr the Reg2022-02-224-16/+51
|/ / / / / /
* | | | | | Merge pull request #7913 from voidanix/anv-fixbunnei2022-02-213-2/+21
|\ \ \ \ \ \ | |_|_|/ / / |/| | | | | vulkan_device: fix missing format in ANV
| * | | | | vulkan_device: fix missing format in ANVvoidanix2022-02-213-2/+21
| | |/ / / | |/| | | | | | | | | | | | | | | | | | Currently Mesa's ANV driver does not support VK_FORMAT_B5G6R5_UNORM_PACK16, implement an alternative for it.
* | | | | Merge pull request #7919 from bunnei/phys-mem-updatesbunnei2022-02-213-131/+506
|\ \ \ \ \ | | | | | | | | | | | | core: hle: kernel: KPageTable: Improve Un/MapPhysicalMemory.
| * | | | | fixup! core: hle: kernel: KPageTable: Improve Un/MapPhysicalMemory.bunnei2022-02-193-38/+18
| | | | | |
| * | | | | core: hle: kernel: KPageTable: Improve Un/MapPhysicalMemory.bunnei2022-02-193-113/+508
| | | | | | | | | | | | | | | | | | | | | | | | - Improves the implementations of MapPhysicalMemory and UnmapPhysicalMemory to more closely reflect latest HOS.
* | | | | | Merge pull request #7920 from bunnei/fix-unmap-pagesbunnei2022-02-211-3/+2
|\ \ \ \ \ \ | |_|/ / / / |/| | | | | core: hle: kernel: KPageTable: Fix UnmapPages.
| * | | | | core: hle: kernel: KPageTable: Fix UnmapPages.bunnei2022-02-191-3/+2
| |/ / / / | | | | | | | | | | | | | | | - Fixes a logic bug in KPageTable::UnmapPages.
* | | | | Merge pull request #7867 from german77/amiibobunnei2022-02-197-254/+949
|\ \ \ \ \ | |/ / / / |/| | | | nfp: Improve amiibo support
| * | | | nfp: Allow files without password datagerman772022-02-132-9/+24
| | | | |
| * | | | nfp: Separate nfc tag from amiibo dataNarr the Reg2022-02-103-44/+76
| | | | |
| * | | | nfp: Address compiler issuesgerman772022-02-092-27/+27
| | | | |
| * | | | nfp: Validate amiibo filesNarr the Reg2022-02-082-41/+145
| | | | |
| * | | | yuzu: Allow to open and remove the amiibogerman772022-02-083-5/+24
| | | | |
| * | | | nfp: Improve implementationgerman772022-02-084-189/+672
| | | | |
| * | | | nfp: Move IUser class to header and add missing enum and structsgerman772022-02-072-257/+299
| | | | |
| * | | | nfp: Sort functions by command numbergerman772022-02-071-79/+79
| |/ / /
* | | | Merge pull request #7900 from german77/enterbunnei2022-02-182-0/+6
|\ \ \ \ | | | | | | | | | | yuzu: config: Fix mapping issues with the enter key
| * | | | yuzu: config: Fix mapping issues with the enter keyNarr the Reg2022-02-152-0/+6
| | | | |
* | | | | Merge pull request #7909 from Wunkolo/null-visit-ctorMai M2022-02-181-0/+3
|\ \ \ \ \ | | | | | | | | | | | | common: Add NullVisitor default constructor
| * | | | | common: Add NullVisitor default constructorWunkolo2022-02-171-0/+3
|/ / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Addresses https://github.com/yuzu-emu/yuzu/issues/7881 to fix linux builds. `YUZU_NON_COPYABLE` deletes the `T(const T&)` constructor which will cause the implicitly defined default ctor/dtor to no-longer generate.
* | | | | Merge pull request #7866 from xerpi/svc-OutputDebugString32-CreateCodeMemory32-ControlCodeMemory32Mai M2022-02-172-4/+40
|\ \ \ \ \ | | | | | | | | | | | | kernel: svc: Add OutputDebugString32, CreateCodeMemory32, ControlCodeMemory32
| * | | | | kernel: svc: Add OutputDebugString32, CreateCodeMemory32, ControlCodeMemory32Sergi Granell2022-02-152-4/+40
| |/ / / / | | | | | | | | | | | | | | | | | | | | Very straightforward, they are just wrappers to the 64-bit version of the SVC.
* | | | | Merge pull request #7878 from german77/mnppbunnei2022-02-176-0/+71
|\ \ \ \ \ | | | | | | | | | | | | service/mnpp: Stub mnpp_app
| * | | | | service/mnpp: Stub mnpp_appNarr the Reg2022-02-116-0/+71
| | |/ / / | |/| | | | | | | | | | | | | Used in Super Nintendo Entertainment System™ - Nintendo Switch Online
* | | | | Merge pull request #7899 from Kelebek1/testMorph2022-02-161-9/+9
|\ \ \ \ \ | | | | | | | | | | | | file_sys: Dump patched exefs rather than base
| * | | | | Dump patched exefs rather than baseKelebek12022-02-151-9/+9
| | | | | |
* | | | | | Merge pull request #7877 from lat9nq/upd_revbunnei2022-02-151-1/+3
|\ \ \ \ \ \ | | | | | | | | | | | | | | audio_core: Update current process revision
| * | | | | | audio_core: Update current process revisionlat9nq2022-02-111-1/+3
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Update CURRENT_PROCESS_REVISION from REV9 to REVA. Used by Nintendo Entertainment System - Nintendo Switch Online 6.0.0 and Super Nintendo Entertainment System - Nintendo Switch Online 3.0.0.
* | | | | | | Merge pull request #7891 from Morph1984/buffer_to_string_viewbunnei2022-02-152-0/+26
|\ \ \ \ \ \ \ | |_|_|_|/ / / |/| | | | | | common: fs_util: Add buffer to string view utility functions
| * | | | | | common: fs_util: Add buffer to string view utility functionsMorph2022-02-142-0/+26
| | | | | | | | | | | | | | | | | | | | | | | | | | | | These functions allow to construct a string view from an input buffer, avoiding the copy done by the non string view counterparts. However, callers must be cognizant of the viewed buffer's lifetime to avoid a use-after-free.
* | | | | | | Merge pull request #7871 from german77/svc2bunnei2022-02-151-77/+77
|\ \ \ \ \ \ \ | |_|_|/ / / / |/| | | | | | svc: Set unique names for function tables
| * | | | | | svc: Set unique names for function tablesNarr the Reg2022-02-091-77/+77
| | |_|/ / / | |/| | | |
* | | | | | Merge pull request #7890 from Morph1984/utf8-consoleMai M2022-02-141-0/+1
|\ \ \ \ \ \ | |_|/ / / / |/| | | | | debugger: console: Set console output codepage to UTF-8
| * | | | | debugger: console: Set console output codepage to UTF-8Morph2022-02-141-0/+1
|/ / / / / | | | | | | | | | | | | | | | This allows the console to display multi-byte encoded characters.
* | | | | Merge pull request #7887 from lat9nq/stub-is-usb-full-keyNarr the Reg2022-02-132-1/+12
|\ \ \ \ \ | | | | | | | | | | | | hid: Stub IsUsbFullKeyControllerEnabled
| * | | | | hid: Stub IsUsbFullKeyControllerEnabledlat9nq2022-02-122-1/+12
|/ / / / / | | | | | | | | | | | | | | | | | | | | | | | | | Used by Splatoon 2, when opening the inventory from a LAN battle lobby. Reference: https://switchbrew.org/wiki/HID_services
* | | | | Merge pull request #7852 from Morph1984/new-uuidbunnei2022-02-1131-193/+370
|\ \ \ \ \ | |_|/ / / |/| | | | common: Revise and fix the UUID implementation
| * | | | common: uuid: Use sizeof(u64) instead of 8 in Hash()Morph2022-02-101-5/+5
| | | | |
| * | | | common: uuid: Return an invalid UUID if conversion from string failsMorph2022-02-051-14/+39
| | | | | | | | | | | | | | | | | | | | | | | | | The string constructor of UUID states: Should the input string not meet the above requirements, an assert will be triggered and an invalid UUID is set instead.
| * | | | general: Rename NewUUID to UUID, and remove the previous UUID implMorph2022-02-0541-598/+415
| | | | | | | | | | | | | | | | | | | | This completes the removal of the old UUID implementation.
| * | | | profile: Migrate to the new UUID implementationMorph2022-02-0514-127/+131
| | | | |
| * | | | common: uuid: Add AsU128()Morph2022-02-052-0/+9
| | | | | | | | | | | | | | | | | | | | This copies the internal bytes of the UUID into a u128 for backwards compatibility. This should not be used.
| * | | | hle: ipc_helpers: Ignore -Wclass-memaccessMorph2022-02-051-0/+8
| | | | | | | | | | | | | | | | | | | | This warning is triggered by GCC when copying into non-trivially default constructible types, as it uses the more restrictive std::is_trivial (which includes std::is_trivially_default_constructible) to determine whether memcpy is safe instead of std::is_trivially_copyable.
| * | | | service: Migrate to the new UUID implementationMorph2022-02-059-45/+36
| | | | |
| * | | | input/hid: Migrate to the new UUID implementationMorph2022-02-0516-56/+57
| | | | |
| * | | | common: Implement NewUUIDMorph2022-02-053-0/+322
| | | | | | | | | | | | | | | | | | | | | | | | | This is a fixed and revised implementation of UUID that uses an array of bytes as its internal representation of a UUID instead of a u128 (which was an array of 2 u64s). In addition to this, the generation of RFC 4122 Version 4 compliant UUIDs is also implemented.
* | | | | Merge pull request #7861 from german77/user_featuresbunnei2022-02-107-62/+95
|\ \ \ \ \ | | | | | | | | | | | | yuzu: New hotkeys and mute audio on background
| * | | | | yuzu: Mute audio when in backgroundgerman772022-02-076-4/+27
| | | | | |
| * | | | | yuzu: Add docked, GPU accuracy and adapting filter hotkeysgerman772022-02-074-58/+68
| | |/ / / | |/| | |
* | | | | Merge pull request #7860 from german77/no-more-driftbunnei2022-02-103-4/+30
|\ \ \ \ \ | | | | | | | | | | | | yuzu: Add auto center on right click
| * | | | | yuzu: Add auto center on right clickgerman772022-02-073-4/+30
| |/ / / /
* | | | | Merge pull request #7870 from yuzu-emu/fix-codememory-sizebunnei2022-02-091-3/+3
|\ \ \ \ \ | |/ / / / |/| | | | hle: kernel: KCodeMemory: Correct m_page_group number of pages.
| * | | | hle: kernel: KCodeMemory: Remove unused QueryMemory.bunnei2022-02-091-1/+0
| | | | |
| * | | | hle: kernel: KCodeMemory: Correct m_page_group number of pages.bunnei2022-02-091-2/+3
|/ / / / | | | | | | | | Credits to @xerpi for finding this issue and pointing it out on #7519.
* | | | Merge pull request #7847 from tech-ticks/masterMorph2022-02-062-1/+46
|\ \ \ \ | | | | | | | | | | service: pm: Implement AtmosphereGetProcessInfo
| * | | | service: pm: Implement AtmosphereGetProcessInfotech-ticks2022-02-042-1/+46
| | | | |
* | | | | Merge pull request #7851 from lat9nq/cmd-add-motionMorph2022-02-061-8/+28
|\ \ \ \ \ | | | | | | | | | | | | yuzu-cmd: config: Support motion inputs
| * | | | | config: Support motion inputslat9nq2022-02-051-8/+28
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Motion inputs were not being read in by the config when yuzu-cmd boots up. This adds support for those. While we're at it, make a reference to the current player controls to improve readability. Also updates the if statements in the Analog and Button loops with curly braces to keep the style consistent.
* | | | | | Merge pull request #7849 from Morph1984/qt-frameless-windowbunnei2022-02-051-0/+2
|\ \ \ \ \ \ | |_|_|/ / / |/| | | | | main: Always remove the frameless window flag when restoring UI state
| * | | | | main: Always remove the frameless window flag when restoring UI stateMorph2022-02-041-0/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | For unknown reasons, this flag may persist after the application has been closed. Removing this flag when restoring the UI state ensures that a frameless window will not be shown on startup.
* | | | | | Merge pull request #7842 from german77/vibration_testbunnei2022-02-055-8/+95
|\ \ \ \ \ \ | | | | | | | | | | | | | | yuzu: config: Vibrate the controller while configuring vibration strength
| * | | | | | yuzu: config: Vibrate the controller while configuring vibration strengthNarr the Reg2022-02-025-8/+95
| | | | | | |
* | | | | | | Merge pull request #7839 from german77/batterybunnei2022-02-054-39/+59
|\ \ \ \ \ \ \ | |_|_|/ / / / |/| | | | | | yuzu: ui: Improve battery symbols
| * | | | | | yuzu: ui: Improve battery symbolsNarr the Reg2022-02-024-39/+59
| |/ / / / /
* | | | | | Merge pull request #7848 from Morph1984/unused-core-includeMai M2022-02-041-1/+0
|\ \ \ \ \ \ | |_|_|/ / / |/| | | | | input_common: Remove unused core include
| * | | | | input_common: Remove unused core includeMorph2022-02-041-1/+0
|/ / / / /
* | | | | Merge pull request #7811 from german77/analog-modbunnei2022-02-031-4/+26
|\ \ \ \ \ | | | | | | | | | | | | input_common: Use attributes for analog range modifiers
| * | | | | input_common: Use attributes for analog range modifiersgerman772022-01-311-4/+26
| | |_|_|/ | |/| | |
* | | | | Merge pull request #7814 from FernandoS27/another-bug-in-my-schedulebunnei2022-02-032-4/+6
|\ \ \ \ \ | | | | | | | | | | | | Vulkan: Fix Scheduler Chunks when their FuncType is 0.
| * | | | | Vulkan: Fix Scheduler Chunks when their FuncType is 0.Fernando Sahmkow2022-01-312-4/+6
| |/ / / /
* | | | | Merge pull request #7835 from bunnei/page-table-lockbunnei2022-02-032-34/+46
|\ \ \ \ \ | |_|_|/ / |/| | | | hle: kernel: KPageTable: Migrate locks to KScopedLightLock.
| * | | | hle: kernel: KPageTable: Migrate locks to KScopedLightLock.bunnei2022-02-022-34/+46
| | | | | | | | | | | | | | | | | | | | - More accurately reflects real kernel behavior by using guest locks.
* | | | | Merge pull request #7838 from lioncash/noncopyMorph2022-02-0220-150/+228
|\ \ \ \ \ | | | | | | | | | | | | common_types: Remove NonCopyable struct
| * | | | | common_types: Remove NonCopyable structLioncash2022-02-021-10/+0
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Now that we're moved over to the YUZU_ defines, we can get rid of this struct.
| * | | | | general: Replace NonCopyable struct with equivalentsLioncash2022-02-0212-129/+219
| | | | | |
| * | | | | general: Move deleted copy/move constructor/assignment operators to public interfaceLioncash2022-02-027-11/+9
| | |_|_|/ | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This allows for better compiler errors, where the compiler will state a copy or move couldn't occur due to the relevant function being deleted. Previously a compiler would warn about the relevant function not being accessible (which, while true, isn't as informative as it could be).
* | | | | Merge pull request #7834 from german77/repeatbunnei2022-02-021-0/+1
|\ \ \ \ \ | | | | | | | | | | | | yuzu: Disable auto repeat on hotkeys again
| * | | | | yuzu: Disable auto repeat on hotkeys againNarr the Reg2022-02-021-0/+1
| | |_|/ / | |/| | |
* | | | | Merge pull request #7806 from ameerj/atomic64-fallbacksbunnei2022-02-0211-3/+582
|\ \ \ \ \ | |_|/ / / |/| | | | shaders: Implement U32x2 atomic fallbacks when device does not support int64
| * | | | emit_glsl_atomic: Implement 32x2 fallback atomic opsameerj2022-01-301-9/+55
| | | | |
| * | | | lower_int64_to_int32: Add 64-bit atomic fallbacksameerj2022-01-303-11/+76
| | | | |
| * | | | shaders: Add U64->U32x2 Atomic fallback functionsameerj2022-01-309-1/+469
| |/ / /
* | | | Merge pull request #7807 from german77/moar-buttonsbunnei2022-02-024-3/+22
|\ \ \ \ | |_|_|/ |/| | | input_common: Add home and hard touch press buttons to UDP controllers
| * | | input_common: Add home and hard touch press buttons to UDP controllersgerman772022-01-304-3/+22
| |/ /
* | | Merge pull request #7833 from lioncash/file-sysMorph2022-02-023-8/+18
|\ \ \ | | | | | | | | configure_filesystem: Add missing changeEvent() override
| * | | configure_filesystem: Add missing changeEvent() overrideLioncash2022-02-022-0/+10
| | | | | | | | | | | | | | | | | | | | This allows the dialog to be retranslated during runtime if the language is changed.
| * | | configure_filesystem: Normalize member function casingLioncash2022-02-023-8/+8
| | |/ | |/| | | | | | | All other dialog types we have use CamelCase naming.
* | | Merge pull request #7792 from german77/translatebunnei2022-02-021-16/+16
|\ \ \ | |/ / |/| | hotkeys: Don't translate hotkey buttons
| * | hotkeys: Don't translate hotkey buttonsgerman772022-01-281-16/+16
| | |
* | | Merge pull request #7809 from Morph1984/clock-constantsbunnei2022-02-023-11/+19
|\ \ \ | | | | | | | | common: wall_clock: Utilize constants for ms, us, and ns ratios
| * | | common: wall_clock: Check precision against the emulated CPU and CNTFRQMorph2022-01-302-8/+12
| | | | | | | | | | | | | | | | In addition to requiring nanosecond precision, using the native clock requires that the hardware TSC has a precision greater than the emulated CPU and its clock counter.
| * | | common: wall_clock: Utilize constants for ms, us, and ns ratiosMorph2022-01-303-5/+9
| | |/ | |/|
* | | Merge pull request #7831 from lioncash/motionMorph2022-02-011-18/+20
|\ \ \ | | | | | | | | configure_motion_touch: Use functor versions of invokeMethod
| * | | configure_motion_touch: Use functor versions of invokeMethodLioncash2022-02-011-18/+20
| | | | | | | | | | | | | | | | | | | | Same behavior, but ensures that the functions we're calling exist, since they can be checked at compile-time.
* | | | Merge pull request #7830 from lioncash/player-copyMorph2022-02-011-11/+12
|\ \ \ \ | |/ / / |/| | | configure_input_player: Avoid unnecessary ParamPackage copies
| * | | configure_input_player: Eliminate variable shadowingLioncash2022-02-011-4/+5
| | | |
| * | | configure_input_player: std::move input setters in HandleClickLioncash2022-02-011-1/+1
| | | |
| * | | configure_input_player: Avoid unnecessary ParamPackage copiesLioncash2022-02-011-6/+6
|/ / / | | | | | | | | | Avoids churning allocations.
* | | Merge pull request #7828 from lioncash/depMorph2022-02-011-1/+1
|\ \ \ | | | | | | | | yuzu/game_list: Use non-deprecated version of QString's split() function
| * | | yuzu/game_list: Use non-deprecated version of QString's split() functionLioncash2022-02-011-1/+1
| | | | | | | | | | | | | | | | The previous overload of split() was deprecated in 5.14.
* | | | Merge pull request #7827 from FernandoS27/dynamite-costume-with-the-wick-outsideMai M2022-02-011-0/+0
|\ \ \ \ | |/ / / |/| | | Update dynarmic.
| * | | Update dynarmic.Fernando Sahmkow2022-02-011-0/+0
| |/ /
* | | Merge pull request #7825 from lioncash/nodisc2Morph2022-02-011-3/+2
|\ \ \ | | | | | | | | common/file: Remove [[nodiscard]] from Open()
| * | | common/file: Remove [[nodiscard]] from Open()Lioncash2022-02-011-3/+2
| |/ / | | | | | | | | | | | | Since this has a void return value, there's nothing that can actually be used.
* | | Merge pull request #7824 from lioncash/scacheMorph2022-02-012-4/+3
|\ \ \ | | | | | | | | video_core/shader_cache: Take std::span in RemoveShadersFromStorage()
| * | | video_core/shader_cache: Remove unused algorithm includeLioncash2022-02-011-1/+0
| | | |
| * | | video_core/shader_cache: Take std::span in RemoveShadersFromStorage()Lioncash2022-02-012-3/+3
| |/ / | | | | | | | | | | | | Same behavior, but without the need to move into the function to avoid an allocation.
* | | Merge pull request #7822 from zhaobot/tx-update-20220201021425Mai M2022-02-0122-7155/+22525
|\ \ \ | | | | | | | | Update translations (2022-02-01)
| * | | Update translations (2022-02-01)The yuzu Community2022-02-0122-7155/+22525
|/ / /
* | | Merge pull request #7821 from german77/espada_agudabunnei2022-02-011-1/+1
|\ \ \ | | | | | | | | svc: Add 32 bit SynchronizePreemptionState
| * | | svc: Add 32 bit SynchronizePreemptionStateNarr the Reg2022-02-011-1/+1
| |/ / | | | | | | | | | Used by Espgaluda II
* | | Merge pull request #7805 from FernandoS27/rodrigo-failed-mebunnei2022-02-0115-8/+133
|\ \ \ | |/ / |/| | Inline2Memory: Flush before writing buffer.
| * | Rasterizer: Refactor inlineToMemory.Fernando Sahmkow2022-02-019-15/+16
| | |
| * | GPU: Improve syncing.Fernando Sahmkow2022-01-291-3/+10
| | |
| * | Rasterizer: Implement Inline2Memory Acceleration.Fernando Sahmkow2022-01-2914-6/+122
| | |
| * | Inline2Memory: Flush before writting buffer.Fernando Sahmkow2022-01-292-2/+3
|/ /
* | Merge pull request #7791 from german77/wall_clockMorph2022-01-291-1/+3
|\ \ | | | | | | wall_clock: Use standard wall clock if rtsc frequency is too low
| * | wall_clock: use standard wall clock if rtsc frequency is too lowgerman772022-01-281-1/+3
| |/
* | Merge pull request #7800 from ameerj/spirv-int64-storageMorph2022-01-292-3/+3
|\ \ | | | | | | spirv_atomic: Define U32x2 storage buffers for 64-bit storage atomics
| * | spirv_atomic: Define U32x2 storage buffers for 64-bit storage atomicsameerj2022-01-292-3/+3
|/ / | | | | | | | | | | Some drivers do not support 64-bit atomics, and fallback to atomically modifying U32x2 vectors. This change ensures that U32x2 storage vectors are defined in the spir-v shader when 64-bit atomics are used. Fixes a hang on some devices, notably Intel GPUs, when booting Pokemon Legends Arceus
* | Merge pull request #7784 from german77/ds5Morph2022-01-291-2/+3
|\ \ | | | | | | input_common: Add DS5 to HD rumble list
| * | input_common: Add DS5 to HD rumble listNarr the Reg2022-01-271-2/+3
| | |
* | | Merge pull request #7787 from bunnei/scheduler-deadlock-fixMorph2022-01-292-23/+24
|\ \ \ | | | | | | | | hle: kernel: KScheduler: Fix deadlock with core waiting for a thread lock that has migrated.
| * | | hle: kernel: KScheduler: Fix deadlock with core waiting for a thread lock that has migrated.bunnei2022-01-272-23/+24
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | - Previously, it was possible for a thread migration to occur from core A to core B. - Next, core B waits on a guest lock that must be released by a thread queued for core A. - Meanwhile, core A is still waiting on the core B's current thread lock - resulting in a deadlock. - Fix this by try-locking the thread lock. - Fixes softlocks in FF8 and Pokemon Legends Arceus.
* | | | Merge pull request #7788 from ameerj/stream-buffer-beginMorph2022-01-291-0/+2
|\ \ \ \ | | | | | | | | | | buffer_cache: Reduce stream buffer allocations when expanding from the left
| * | | | buffer_cache: Reduce stream buffer allocations when expanding from the leftameerj2022-01-271-0/+2
| |/ / / | | | | | | | | | | | | | | | | The existing stream buffer optimization accounts for size increases at the end of the allocated buffer. This adds the same optimization, increasing the size from the beginning of the buffer as well to reduce buffer allocations when expanding the same buffer from the left.
* | | | Merge pull request #7786 from ameerj/vmnmx-selMorph2022-01-291-12/+6
|\ \ \ \ | | | | | | | | | | video_minimum_maximum: Implement src operand selectors
| * | | | video_minimum_maximum: Implement src operand selectorsameerj2022-01-271-12/+6
| |/ / / | | | | | | | | | | | | Used by Pokemon Legends: Arceus
* | | | Merge pull request #7799 from ameerj/amd-xfbMorph2022-01-281-3/+9
|\ \ \ \ | | | | | | | | | | emit_spirv: Add Xfb execution mode when transform feedback is used
| * | | | emit_spirv: Add Xfb execution mode when transform feedback is usedameerj2022-01-281-3/+9
|/ / / / | | | | | | | | | | | | Fixes Transform Feedback on Vulkan AMD drivers.
* | | | Merge pull request #7770 from german77/motion-thresholdbunnei2022-01-284-6/+24
|\ \ \ \ | |/ / / |/| | | input_common: Add option to configure gyro threshold
| * | | input_common: Add option to configure gyro thresholdgerman772022-01-244-6/+24
| | |/ | |/|
* | | Merge pull request #7783 from lioncash/abi-cexprMorph2022-01-272-9/+9
|\ \ \ | | | | | | | | common/xbyak_api: Make BuildRegSet() constexpr
| * | | common/xbyak_api: Make BuildRegSet() constexprLioncash2022-01-262-9/+9
| | | | | | | | | | | | | | | | | | | | This allows us to eliminate any static constructors that would have been emitted due to the function not being constexpr.
* | | | Merge pull request #7762 from bunnei/un-map-improvebunnei2022-01-273-111/+108
|\ \ \ \ | |/ / / |/| | | Kernel Memory Updates (Part 4): Improve Un/MapPages, and more.
| * | | core: hle: kernel: KPageTable: Various improvements to MapPages and UnmapPages.bunnei2022-01-231-22/+25
| | | |
| * | | core: hle: kernel: KPageTable: MapProcessCode: Various cleanup.bunnei2022-01-231-11/+12
| | | |
| * | | core: hle: kernel: KPageTable: ReserveTransferMemory: Various cleanup.bunnei2022-01-231-6/+6
| | | |
| * | | core: hle: kernel: KPageTable: ResetTransferMemory: Various cleanup.bunnei2022-01-231-6/+5
| | | |
| * | | core: hle: kernel: KPageTable: SetMemoryAttribute: Various cleanup.bunnei2022-01-231-2/+3
| | | |
| * | | core: hle: kernel: KPageTable: Assert valid address on GetPhysicalAddr.bunnei2022-01-221-1/+3
| | | |
| * | | core: hle: kernel: KPageTable: Operate: Assert lock ownership.bunnei2022-01-221-2/+2
| | | |
| * | | core: hle: kernel: KPageTable: SetHeapSize: Cleanup & take physical memory lock.bunnei2022-01-221-4/+7
| | | |
| * | | core: hle: kernel: Refactor Un/MapPhysicalMemory to remove unnecessary methods.bunnei2022-01-222-50/+39
| | | |
| * | | core: hle: kernel: Rename Un/Map to Un/MapMeory.bunnei2022-01-223-7/+6
| | | |
* | | | Merge pull request #7780 from lioncash/macrobunnei2022-01-269-213/+204
|\ \ \ \ | |_|_|/ |/| | | video_core/macro: Move impl classes into their cpp files
| * | | video_core/macro: Add missing <cstring> headerLioncash2022-01-251-2/+3
| | | | | | | | | | | | | | | | Necessary since memcpy is used.
| * | | video_core/macro_interpreter: Move impl class to the cpp fileLioncash2022-01-252-84/+86
| | | | | | | | | | | | | | | | | | | | Keeps the implementation hidden from the intended API and lessens the header dependencies on the interpreter's header.
| * | | video_core/macro_hle: Return unique_ptr directly from GetHLEProgram()Lioncash2022-01-253-7/+7
| | | | | | | | | | | | | | | | Same behavior, but less code and header dependencies.
| * | | video_core/macro: Remove unused parameter from Execute()Lioncash2022-01-253-4/+3
| | | | | | | | | | | | | | | | Simplifies the function interface.
| * | | video_core/macro_jit_x64: Remove unused impl class memberLioncash2022-01-251-1/+0
| | | | | | | | | | | | | | | | Reduces the size of the impl class a tiny bit.
| * | | video_core/macro_jit_x64: Decouple PersistentCallerSavedRegs() from implLioncash2022-01-251-5/+4
| | | | | | | | | | | | | | | | This doesn't depend on class state and can just be a regular function.
| * | | video_core/macro_jit_x64: Move impl class into cpp fileLioncash2022-01-252-87/+86
| | | | | | | | | | | | | | | | | | | | | | | | | | | | Keeps the implementation internalized and also reduces API-facing header dependencies. Notably, this fully internalizes all of the xbyak externals.
| * | | video_core/macro_hle: Move impl class into cpp fileLioncash2022-01-252-27/+19
| | |/ | |/| | | | | | | | | | | | | | | | | | | Given it's intended to be an internal implementation class, we can move it into the cpp file to ensure that. This also lets us move some header dependencies into the cpp file as well.
* | | Merge pull request #7769 from german77/no-controlbunnei2022-01-266-3/+28
|\ \ \ | | | | | | | | yuzu: Add setting to disable controller navigation
| * | | yuzu: Add setting to disable controller navigationgerman772022-01-246-3/+28
| |/ /
* | | Merge pull request #7768 from Moonlacer/fsr-1.0.2bunnei2022-01-262-19/+19
|\ \ \ | | | | | | | | Update AMD FidelityFX Super Resolution™ to 1.0.2
| * | | Update FSR to 1.0.2Moonlacer2022-01-232-19/+19
| |/ / | | | | | | | | | Updates yuzu's FSR implementation to 1.0.2
* | | Merge pull request #7777 from lioncash/nodiscMorph2022-01-251-2/+1
|\ \ \ | | | | | | | | shader_recompiler: Remove unnecessary [[nodiscard]] specifier
| * | | shader_recompiler: Remove unnecessary [[nodiscard]]Lioncash2022-01-251-2/+1
| |/ / | | | | | | | | | | | | Since ConvertLegacyToGeneric has a void return value, there's nothing that is actually returned by the function.
* | | Merge pull request #7779 from lioncash/gpu-ifaceMorph2022-01-251-16/+0
|\ \ \ | | | | | | | | gpu: Remove obsoleted CDmaPusher() accessors
| * | | gpu: Tidy up forward declarationsLioncash2022-01-251-10/+0
| | | | | | | | | | | | | | | | | | | | Over time a few forward declarations became unnecessary, so we can remove these to tidy up the header a little bit.
| * | | gpu: Remove obsoleted CDMAPusher() accessorsLioncash2022-01-251-6/+0
| |/ / | | | | | | | | | | | | These were obsoleted in 2c47f8aa1886522898b5b3a73185b5662be3e9f3 but were accidentally overlooked.
* | | Merge pull request #7778 from lioncash/commaMorph2022-01-251-1/+1
|\ \ \ | | | | | | | | vk_fsr: Replace comma operator with semicolon
| * | | vk_fsr: Replace comma operator with semicolonLioncash2022-01-251-1/+1
| |/ / | | | | | | | | | | | | | | | Generally, we should be ending statements with a semicolon not a comma Resolves a clang diagnostic.
* | | Merge pull request #7774 from lioncash/mappingMorph2022-01-255-13/+18
|\ \ \ | | | | | | | | input_common/main: Pass MappingData by const reference in callbacks
| * | | input_common/input_engine: Ensure PadIdentifier UUIDs have a valid initial stateLioncash2022-01-241-1/+1
| | | | | | | | | | | | | | | | | | | | The default constructor of a UUID instance doesn't initialize the underlying array.
| * | | input_common/input_mapping: Simplify UUID validity checksLioncash2022-01-241-3/+3
| | | | | | | | | | | | | | | | | | | | Makes the checks a little more intuitive to read and doesn't construct an extra UUID instance
| * | | input_common/input_mapping: Add missing includesLioncash2022-01-242-1/+6
| | | | | | | | | | | | | | | | Ensures that the class always sees the types it needs.
| * | | input_common/input_mapping: Remove const from return valueLioncash2022-01-244-4/+4
| | | | | | | | | | | | | | | | | | | | Top-level const on a return by value can inhibit move semantics, and is unnecessary.
| * | | input_common/input_mapping: Default constructorLioncash2022-01-241-1/+1
| | | |
| * | | input_common/main: Pass MappingData by const reference in callbacksLioncash2022-01-242-3/+3
| |/ / | | | | | | | | | Avoids creating unnecessary 168 byte copies per callback invocation.
* | | Merge pull request #7773 from lioncash/udp-deprecatedMorph2022-01-252-6/+6
|\ \ \ | | | | | | | | input_common/udp_client: Replace deprecated from_string()/to_ulong() functions
| * | | input_common/udp_client: Replace deprecated from_string()/to_ulong() functionsLioncash2022-01-241-2/+2
| | | | | | | | | | | | | | | | These are deprecated and make_address variants and to_uint() should be used instead.
| * | | input_common/udp_client: Prevent unnecessary string copiesLioncash2022-01-242-4/+4
| |/ / | | | | | | | | | | | | We can also remove some redundant const on the return values, since these don't do anything
* | | Merge pull request #7771 from lioncash/assertMorph2022-01-251-2/+0
|\ \ \ | | | | | | | | kernel/k_affinity_mask: Remove duplicated assert
| * | | kernel/k_affinity_mask: Remove duplicated assertLioncash2022-01-241-2/+0
| |/ / | | | | | | | | | This is already checked inside GetCoreBit()
* | | Merge pull request #7765 from bunnei/update-thread-countbunnei2022-01-253-24/+21
|\ \ \ | | | | | | | | hle: kernel: KThread: Improve Increment/Decrement RunningThreadCount.
| * | | hle: kernel: KThread: Improve Increment/Decrement RunningThreadCount.bunnei2022-01-233-24/+21
| | | | | | | | | | | | | | | | - Previously implementation was incorrect, and would occasionally underflow.
* | | | Merge pull request #7760 from german77/inverted_keyboardbunnei2022-01-251-25/+34
|\ \ \ \ | |_|/ / |/| | | yuzu: Add modifiers for keyboard
| * | | yuzu: Add modifiers for keyboardNarr the Reg2022-01-221-25/+34
| | | |
* | | | Merge pull request #7761 from v1993/patch-8bunnei2022-01-231-3/+8
|\ \ \ \ | |_|/ / |/| | | Improve FFmpeg cmake file
| * | | Improve FFmpeg cmake fileValeri2022-01-221-3/+8
| | |/ | |/| | | | | | | * Fix compilation if CUDA_INCLUDE_DIRS is empty/contains multiple paths * Pass CMAKE_{C,CXX}_COMPILER_LAUNCHER to ffmpeg compiler
* | | Merge pull request #7716 from german77/volumebunnei2022-01-224-28/+18
|\ \ \ | |/ / |/| | yuzu: Add volume hotkeys
| * | audio/stream: Adjust volume scale factorgerman772022-01-161-2/+2
| | |
| * | yuzu: Add volume up/down hotkeysgerman772022-01-163-4/+16
| | |
| * | yuzu: Remove speed limit hotkeysgerman772022-01-153-24/+2
| | |
* | | Merge pull request #7735 from german77/udp_batterybunnei2022-01-222-0/+25
|\ \ \ | | | | | | | | input_common: Report battery for UDP controllers
| * | | input_common: Report battery for UDP controllersNarr the Reg2022-01-172-0/+25
| |/ /
* | | Merge pull request #7737 from bunnei/fix-dummy-thread-leakbunnei2022-01-229-40/+120
|\ \ \ | |_|/ |/| | Various fixes to HLE service thread management
| * | hle: kernel: KThread: Ensure host (dummy) threads block on locking.bunnei2022-01-224-0/+89
| | | | | | | | | | | | | | | - But do not enter the priority queue, as otherwise they will be scheduled. - Allows dummy threads to use guest synchronization primitives.
| * | hle: kernel: Remove redundant tracking of dummy threads.bunnei2022-01-211-9/+3
| | | | | | | | | | | | - These are already tracked by kernel's registered_objects member.
| * | hle: kernel: KThread: DummyThread can be waited, ensure wait_queue is not nullptr.bunnei2022-01-211-6/+6
| | |
| * | hle: kernel: KThread: Decrease DummyThread priority to ensure it is never scheduled.bunnei2022-01-213-2/+5
| | |
| * | hle: kernel: service_thread: Ensure dummy thread is closed & destroyed on thread exit.bunnei2022-01-211-0/+5
| | |
| * | hle: kernel: KServerSession: Remove hack for CompleteSyncRequest.bunnei2022-01-211-11/+0
| | | | | | | | | | | | - This does not appear to be necessary anymore.
| * | hle: kernel: KServerSession: Simplify CompleteSyncRequest EndWait.bunnei2022-01-212-12/+2
| | | | | | | | | | | | | | | - Considering is_thread_waiting is never set, so we can remove IsThreadWaiting. - KThread::EndWait will take the scheduler lock, so we can remove the redundant lock.
| * | hle: kernel: KThread: Ensure dummy threads never call EndWait.bunnei2022-01-211-0/+5
| | | | | | | | | | | | - These are only used by host threads for locking and will never have a wait_queue.
| * | hle: kernel: KScheduler: Ensure dummy threads are never scheduled.bunnei2022-01-211-0/+5
| | | | | | | | | | | | - These are only used by host threads for locking.
| * | hle: kernel: KThread: Rename thread_type_for_debugging -> thread_type.bunnei2022-01-213-6/+6
| | | | | | | | | | | | - This will be used to ensure that we do not schedule dummy threads.
* | | Merge pull request #7752 from Morph1984/SetCpuOverclockEnabledbunnei2022-01-221-1/+13
|\ \ \ | | | | | | | | service: apm: Stub ISession SetCpuOverclockEnabled
| * | | service: apm: Stub ISession SetCpuOverclockEnabledMorph2022-01-211-1/+13
| | | | | | | | | | | | | | | | | | | | | | | | Since we don't currently support CPU overclocking within the emulated system, this can be stubbed for now, like APM IsCpuOverclockEnabled. - Used by Gravity Rider Zero
* | | | Merge pull request #7756 from lioncash/servicebunnei2022-01-2112-46/+82
|\ \ \ \ | | | | | | | | | | service: Update function tables
| * | | | service/wlan: Update function tablesLioncash2022-01-211-1/+1
| | | | |
| * | | | service/usb: Update function tablesLioncash2022-01-211-27/+15
| | | | |
| * | | | service/set: Update function tablesLioncash2022-01-211-0/+2
| | | | |
| * | | | service/ns: Update function tablesLioncash2022-01-211-0/+6
| | | | |
| * | | | service/nim: Update unknown function table entriesLioncash2022-01-211-0/+6
| | | | |
| * | | | service/friend: Update unknown function table entriesLioncash2022-01-211-6/+6
| | | | |
| * | | | service/filsystem: Update fsp-srv function tableLioncash2022-01-211-0/+3
| | | | |
| * | | | service/btm: Update function tablesLioncash2022-01-211-0/+30
| | | | |
| * | | | service/audio: Update audctl unknown function namesLioncash2022-01-211-8/+8
| | | | |
| * | | | service/am: Update omm function tablesLioncash2022-01-211-0/+1
| | | | |
| * | | | service/acc: Update unknown function namesLioncash2022-01-212-4/+4
|/ / / / | | | | | | | | | | | | Switchbrew has the function names now.
* | | | Merge pull request #7755 from v1993/someone-in-here-lacks-system-wide-themingbunnei2022-01-212-6/+11
|\ \ \ \ | | | | | | | | | | Use Default Colorful theme by default outside of Windows
| * | | | Use Default Colorful theme by default outside of Windowsv19932022-01-212-6/+11
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | On OSes with system-wide theming this allows yuzu to follow system style, regardless of its exact coloration, working well with both light and dark system themes. Dark /Colorful, on the other hand, forces dark theme regardless of user preferences set in system settings, making for a poor default. Use Colorful variation to keep in line with icon style of patron-voted Dark Colorful.
* | | | | Merge pull request #7731 from v1993/xfb-varying-check-fixbunnei2022-01-212-6/+8
|\ \ \ \ \ | |/ / / / |/| | | | shader_recompiler: fix potential OOB access
| * | | | shader_recompiler: fix potential OOB accessv19932022-01-172-6/+8
| | | | | | | | | | | | | | | | | | | | Found by static analysis with PVS-Studio. Original check wasn't actually checking for OOB and would segfault in case of it.
* | | | | Merge pull request #7695 from Morph1984/is-pow2bunnei2022-01-211-0/+6
|\ \ \ \ \ | |_|_|/ / |/| | | | common: bit_util: Add IsPow2 helper function
| * | | | common: bit_util: Add IsPow2 helper functionMorph2022-01-111-0/+6
| | | | | | | | | | | | | | | | | | | | Makes use of std::has_single_bit() to check whether the value is a power of 2.
* | | | | Merge pull request #7710 from german77/just-shake-itbunnei2022-01-211-1/+1
|\ \ \ \ \ | | | | | | | | | | | | core/hid: Increment shake force
| * | | | | core/hid: Increment shake forceNarr the Reg2022-01-141-1/+1
| | | | | | | | | | | | | | | | | | With the current settings 2p mode in pokemon let's go wasn't showing up. By making the shake more violent we can make it appear without any effort using the keyboard
* | | | | | Merge pull request #7749 from jbeich/ffmpeg5Mai M2022-01-201-1/+1
|\ \ \ \ \ \ | |_|_|_|/ / |/| | | | | video_core: unbreak build with FFmpeg 5.0
| * | | | | video_core: constify AVCodec for ffmpeg >= 5.0Jan Beich2022-01-201-1/+1
|/ / / / / | | | | | | | | | | | | | | | | | | | | | | | | | src/video_core/command_classes/codecs/codec.cpp:177:16: error: assigning to 'AVCodec *' from 'const AVCodec *' discards qualifiers av_codec = avcodec_find_decoder(codec); ^~~~~~~~~~~~~~~~~~~~~~~~~~~
* | | | | Merge pull request #7726 from german77/clampMorph2022-01-191-1/+2
|\ \ \ \ \ | | | | | | | | | | | | service/hid: Initialize applet_resource on SetNpadAnalogStickUseCenterClamp
| * | | | | service/hid: Initialize applet_resource on SetNpadAnalogStickUseCenterClampgerman772022-01-191-1/+2
| | | | | |
* | | | | | Merge pull request #7747 from DadSchoorse/fix-anv-64bit-atomic-stypeFernando S2022-01-191-1/+1
|\ \ \ \ \ \ | | | | | | | | | | | | | | vulkan_device: Fix sType for VkPhysicalDeviceShaderAtomicInt64Features
| * | | | | | vulkan_device: Fix sType for VkPhysicalDeviceShaderAtomicInt64FeaturesGeorg Lehmann2022-01-191-1/+1
|/ / / / / /
* | | | | | Merge pull request #7701 from bunnei/clear-mem-pagesbunnei2022-01-195-16/+34
|\ \ \ \ \ \ | | | | | | | | | | | | | | Kernel Memory Updates (Part 3): Clear KMemoryManager pages & other fixes
| * | | | | | hle: kernel: k_memory_manager: Clear pages on allocation & free.bunnei2022-01-155-16/+34
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | - Heap pages should be zero'd. - Also explicitly passed along heap allocation option.
* | | | | | | Merge pull request #7715 from gidoly/patch-4bunnei2022-01-191-2/+2
|\ \ \ \ \ \ \ | |_|/ / / / / |/| | | | | | Xbox controller default name nit pick
| * | | | | | Xbox controller default name nit pickgidoly2022-01-151-2/+2
| | |_|_|_|/ | |/| | | | | | | | | | Discord User moon lacer pointed us that official name is 'Xbox' not 'XBox'
* | | | | | Merge pull request #7725 from german77/mouse_in_motionbunnei2022-01-195-1/+64
|\ \ \ \ \ \ | | | | | | | | | | | | | | input_common: Reintroduce motion from mouse and use button names
| * | | | | | input_common: Reintroduce motion from mouse and use button namesgerman772022-01-175-1/+64
| |/ / / / /
* | | | | | Merge pull request #7712 from bunnei/fix-thread-exitbunnei2022-01-1811-39/+181
|\ \ \ \ \ \ | | | | | | | | | | | | | | Accurately implement thread exit
| * | | | | | core: hle: kernel: KThread: Integrate with KWorkerTask and implement DoWorkerTaskImpl.bunnei2022-01-152-2/+28
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | - This is used to terminate a thread asynchronously after it has been exited. - This fixes a crash that can occur in Pokemon Sword/Shield because a thread is incorrectly closed on svcExitThread, then, the thread is destroyed on svcCloseHandle while it is still scheduled. - Instead, we now wait for the thread to no longer be scheduled on all cores before destroying it from KWorkerTaskManager, which is accurate to HOS behavior.
| * | | | | | core: hle: kernel: KProcess: Integrate with KWorkerTask and add unimplemented DoWorkerTaskImpl.bunnei2022-01-152-3/+9
| | | | | | |
| * | | | | | core: hle: kernel: KThread: Replace Suspend with UpdateState & various updates.bunnei2022-01-152-33/+26
| | | | | | | | | | | | | | | | | | | | | | | | | | | | - This makes our implementations of these more closely match HOS.
| * | | | | | core: hle: kernel: Instantiate a kernel instance of KWorkerTaskManager.bunnei2022-01-152-0/+18
| | | | | | |
| * | | | | | core: hle: kernel: Add KWorkerTask and KWorkerTaskManager.bunnei2022-01-154-0/+96
| | | | | | | | | | | | | | | | | | | | | | | | | | | | - These primitives are used to dispatch asynchronous kernel tasks from KThread and KProcess.
| * | | | | | common: fiber: YieldTo: Avoid hard crash on nullptr previous_fiber.bunnei2022-01-151-1/+4
| | | | | | | | | | | | | | | | | | | | | | | | | | | | - When the emulator crashes to desktop below, we don't even get this captured in a log, making such issues harder to debug.
* | | | | | | Merge pull request #7724 from ameerj/astc_new_nvbunnei2022-01-181-34/+46
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | astc_decoder: Combine FastReplicate functions to work around new NV driver bug
| * | | | | | | astc_decoder: Combine FastReplicate functions to work around new NV driver bugameerj2022-01-161-34/+46
| | |/ / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The new Nvidia drivers have a bug where the FastReplicateTo6 function produces a lookup into the REPLICATE_TO_8 table rather than the REPLICATE_TO_6 table. This seems to be an optimization gone wrong. Combining the logic of the FastReplicate functions seems to address the bug.
* | | | | | | Merge pull request #7732 from v1993/patch-7bunnei2022-01-181-2/+0
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | kernel: remove no-op code
| * | | | | | | hle: remove no-op codeValeri2022-01-171-2/+0
| | |_|_|_|_|/ | |/| | | | | | | | | | | | Found by static analysis with PVS-Studio. Nobody seems to really know what was it doing there.
* | | | | | | Merge pull request #7730 from v1993/patch-6Mai M2022-01-171-1/+1
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | input_common: nitpick about SetHatButton usage
| * | | | | | | input_common: nitpick about SetHatButton usageValeri2022-01-171-1/+1
| | |/ / / / / | |/| | | | |
* | | | | | | Merge pull request #7729 from v1993/patch-5Mai M2022-01-171-1/+1
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | input_common: fix copy-paste error
| * | | | | | | input_common: fix copy-paste errorValeri2022-01-171-1/+1
| |/ / / / / / | | | | | | | | | | | | | | Found by static analysis with PVS-Studio.
* | | | | | | Merge pull request #7728 from v1993/patch-4Mai M2022-01-171-1/+1
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | hid: fix std::transform call
| * | | | | | | hid: fix std::transform callValeri2022-01-171-1/+1
| |/ / / / / / | | | | | | | | | | | | | | Found by static analysis with PVS-Studio.
* | | | | | | Merge pull request #7727 from v1993/patch-3Mai M2022-01-171-1/+1
|\ \ \ \ \ \ \ | |_|/ / / / / |/| | | | | | hid: Correct assignment source for rotations
| * | | | | | Correct assignment source for rotationsValeri2022-01-171-1/+1
| |/ / / / / | | | | | | | | | | | | Found by static analysis with PVS-Studio
* | | | | | Merge pull request #7719 from gidoly/patch-6bunnei2022-01-172-3/+17
|\ \ \ \ \ \ | |/ / / / / |/| | | | | Change default theme to Dark colorful
| * | | | | uisettings: Add enumeration type for themesMorph2022-01-172-3/+17
| | | | | | | | | | | | | | | | | | | | | | | | Eliminates the usage of a magic number to indicate the default index of the themes array,
| * | | | | config: Change default theme to Dark Colorfulgidoly2022-01-171-2/+2
|/ / / / /
* | | | | Merge pull request #7713 from gidoly/patch-3bunnei2022-01-151-0/+6
|\ \ \ \ \ | | | | | | | | | | | | Change default name for playstation controllers
| * | | | | Change default name for ps controllersgidoly2022-01-151-0/+6
| | |/ / / | |/| | | | | | | | | | | | | Minor nitpick Code is from narr
* | | | | Merge pull request #7711 from bunnei/fix-service-thread-race-v2bunnei2022-01-151-12/+11
|\ \ \ \ \ | |/ / / / |/| | | | hle: kernel: Fix service_threads access to be thread safe V2.
| * | | | hle: kernel: Fix service_threads access to be thread safe V2.bunnei2022-01-151-12/+11
| |/ / / | | | | | | | | | | | | | | | | | | | | - PR #7699 attempted to fix CreateServiceThread and ReleaseServiceThread to be thread safe, but inadvertently introduced a possible dead-lock. - With this PR, we use a worker thread to manage the service thread list, allowing it only to be accessed by a single thread, and guaranteeing threads will not destroy themselves. - Fixes a rare crash in Pokemon Sword/Shield, I've now run this game for ~12 hours non-stop and am quite confident this is a good solution for this issue.
* | | | Merge pull request #7707 from german77/slow-updatebunnei2022-01-151-1/+2
|\ \ \ \ | |/ / / |/| | | service/hid: Decrease motion update rate
| * | | service/hid: Decrease motion update rateNarr the Reg2022-01-131-1/+2
| |/ / | | | | | | Motion stops working in Mario Tennis in swing mode if the update rate is too fast even when HW it updates at the same speed. 10ms it's the minimum period that the game needs to start working again.
* | | Merge pull request #7699 from bunnei/fix-service-thread-raceMai M2022-01-141-7/+27
|\ \ \ | | | | | | | | hle: kernel: Fix service_threads access to be thread safe.
| * | | hle: kernel: Fix service_threads access to be thread safe.bunnei2022-01-141-7/+27
| | | | | | | | | | | | | | | | | | | | - CreateServiceThread and ReleaseServiceThread can be accessed by different threads, uses a lock to make this thread safe. - Fixes a rare crash in Pokemon Sword/Shield that can occur when a new service thread is being created while an old one is being destroyed.
* | | | Merge pull request #7698 from bunnei/mem-code-memory-updatesMai M2022-01-146-81/+107
|\ \ \ \ | |/ / / |/| | | Kernel Memory Updates (Part 2): SetProcessMemoryPermission, update permissions, and other minor changes.
| * | | hle: kernel: k_page_table: Update SetProcessMemoryPermission.bunnei2022-01-126-45/+68
| | | |
| * | | hle: service: ldr: UnmapCodeMemory BSS only when set.bunnei2022-01-121-3/+7
| | | |
| * | | hle: kernel: k_page_table: ReadAndWrite -> UserReadWrite.bunnei2022-01-123-18/+18
| | | |
| * | | hle: kernel: k_page_table: Rename *ProcessCodeMemory -> *CodeMemory.bunnei2022-01-124-20/+19
| | | |
* | | | Merge pull request #7690 from Morph1984/increase-file-limit-winbunnei2022-01-141-2/+2
|\ \ \ \ | | | | | | | | | | yuzu: main: Increase the open file limit on Windows to 8192
| * | | | yuzu: main: Increase the open file limit on Windows to 8192Morph2022-01-101-2/+2
| | |_|/ | |/| | | | | | | | | | This is a temporary solution for now to accommodate for mods containing more than 4096 files.
* | | | Merge pull request #7700 from german77/no-gyrobunnei2022-01-141-1/+1
|\ \ \ \ | |_|_|/ |/| | | core/hid: Reduce gyro threshold even more
| * | | core/hid: Reduce gyro threshold even moreNarr the Reg2022-01-121-1/+1
| | | |
* | | | Merge pull request #7697 from abouvier/opt-testsbunnei2022-01-124-7/+12
|\ \ \ \ | |_|_|/ |/| | | cmake: make tests optional
| * | | cmake: make tests optionalAlexandre Bouvier2022-01-124-7/+12
| | | |
* | | | Merge pull request #7684 from bunnei/set-mem-perm-attrbunnei2022-01-125-160/+211
|\ \ \ \ | |/ / / |/| | | Kernel Memory Updates (Part 1): SetMemoryAttribute, and other minor changes.
| * | | core: hle: kernel: svc: Updates to SetMemoryAttribute and SetMemoryPermission.bunnei2022-01-083-45/+46
| | | |
| * | | core: hle: kernel: k_page_table: Update CheckMemoryState.bunnei2022-01-084-116/+166
| | | |
* | | | Merge pull request #7633 from german77/hotkeysbunnei2022-01-1115-80/+626
|\ \ \ \ | |_|_|/ |/| | | yuzu: Add controller hotkeys
| * | | yuzu: Add controller hotkeysgerman772022-01-0714-79/+580
| | | |
| * | | core/hid: Add home and screenshot button supportgerman772022-01-073-1/+46
| | | |
* | | | Merge pull request #7683 from liushuyu/fmt-8.1Morph2022-01-105-3/+28
|\ \ \ \ | | | | | | | | | | logging: adapt to changes in fmt 8.1
| * | | | logging/log.h: move enum class formatter to a separate file ...liushuyu2022-01-106-22/+32
| | | | | | | | | | | | | | | | | | | | ... to common/logging/formatter.h
| * | | | cmake: upgrade Conan package fmt to 8.1.1 ...liushuyu2022-01-091-1/+1
| | | | | | | | | | | | | | | | | | | | ... requirements for fmt stays at ^8.0.1
| * | | | logging/log: use `underlying_type` instead of hardcoding typesliushuyu2022-01-091-2/+4
| | | | |
| * | | | logging: adapt to changes in fmt 8.1liushuyu2022-01-083-7/+20
| | |/ / | |/| |
* | | | Merge pull request #7687 from german77/tas_handleMorph2022-01-101-7/+24
|\ \ \ \ | |_|_|/ |/| | | input_common: Handle errors on TAS scripts
| * | | input_common: Handle errors on TAS scriptsgerman772022-01-081-7/+24
| | | |
* | | | Merge pull request #7682 from german77/udp_fixbunnei2022-01-083-17/+30
|\ \ \ \ | |_|/ / |/| | | input_common: Fix UDP controller mappings
| * | | yuzu: Use pad parameter to choose the correct controllergerman772022-01-072-9/+14
| | | |
| * | | input_common: Fix udp motion not automapping to both sidesgerman772022-01-071-8/+16
| |/ /
* | | Merge pull request #7680 from german77/accel_mappingbunnei2022-01-082-2/+11
|\ \ \ | |/ / |/| | input_common: Allow to only have acceleration motion data
| * | core/hid: Set minimum gyro thresholdgerman772022-01-071-0/+1
| | |
| * | input_common: Use accelerometer data for mappinggerman772022-01-071-2/+10
| |/
* | Merge pull request #7658 from ameerj/sparse-fixesFernando S2022-01-063-61/+44
|\ \ | | | | | | video_core/memory_manager: Fixes for sparse memory management
| * | video_core/memory_manager: Fixes for sparse memory managementameerj2021-12-312-14/+12
| | |
| * | video_core/memory_manager: Deduplicate Read/WriteBlockameerj2021-12-312-47/+32
| | |
* | | Merge pull request #7679 from liushuyu/update-dynarmicMai M2022-01-061-0/+0
|\ \ \ | | | | | | | | externals/dynarmic: update to the latest revision
| * | | externals/dynarmic: update to latest revision ...liushuyu2022-01-061-0/+0
|/ / / | | | | | | | | | ... to resolve compilation errors with fmt 8.1
* | | Merge pull request #7674 from lat9nq/fix-custom-highlightbunnei2022-01-061-15/+9
|\ \ \ | |_|/ |/| | configure_per_game: Initialize tabs after loading custom configuration
| * | configure_per_game: Initialize tabs after loading custom configurationlat9nq2022-01-051-15/+9
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Changes tab initialization to happen after the configuration is loaded, which means that it no longer happens as member initializers in the ConfigurePerGame constructor. Removes the cluster of ??_tab->SetConfiguration's that I added earlier to get around this issue initially. Fixes a regression in #6774
* | | Merge pull request #7673 from german77/no_returnMai M2022-01-052-2/+1
|\ \ \ | | | | | | | | glsl: Remove unreachable return
| * | | video_core: Remove unnecesary maybe_unused flagNarr the Reg2022-01-051-1/+1
| | | |
| * | | glsl: Remove unreachable returnNarr the Reg2022-01-051-1/+0
| | | |
* | | | Merge pull request #7675 from zhaobot/tx-update-20220105075447Mai M2022-01-0520-7053/+7920
|\ \ \ \ | |_|/ / |/| | | Update translations (2022-01-05)
| * | | Update translations (2022-01-05)The yuzu Community2022-01-0520-7053/+7920
|/ / /
* | | Merge pull request #7610 from Tatsh/more-system-libsbunnei2022-01-052-3/+5
|\ \ \ | | | | | | | | Add support for linking against system Opus
| * | | Add support for linking against system opusAndrew Udvare2021-12-212-3/+5
| | | |
* | | | Merge pull request #7636 from vonchenplus/buffer_queue_querybunnei2022-01-044-4/+9
|\ \ \ \ | | | | | | | | | | core:hle:service:nvflinger Implement few type in bufferqueue query method
| * | | | Remove invalid assertion statementFeng Chen2021-12-281-3/+0
| | | | |
| * | | | Remove invalid header includeFeng Chen2021-12-281-1/+0
| | | | |
| * | | | Implement few type in bufferqueue query methodFeng Chen2021-12-282-0/+9
| | | | |
* | | | | Merge pull request #7670 from ameerj/vsync-blockFernando S2022-01-044-10/+30
|\ \ \ \ \ | |_|_|/ / |/| | | | gpu: Add shut down method to synchronize threads before destruction
| * | | | gpu: Add shut down method to synchronize threads before destructionameerj2022-01-043-0/+15
| | | | |
| * | | | Revert "Merge pull request #7668 from ameerj/fence-stop-token"ameerj2022-01-043-10/+15
| | | | | | | | | | | | | | | | | | | | | | | | | This reverts commit e7733544779f2706d108682dd027d44e7fa5ff4b, reversing changes made to abbbdc2bc027ed7af236625ae8427a46df63f7e7.
* | | | | Merge pull request #7251 from FernandoS27/shader-dumpbunnei2022-01-048-1/+98
|\ \ \ \ \ | |/ / / / |/| | | | ShaderDecompiler: Add a debug option to dump the game's shaders.
| * | | | ShaderDecompiler: Add a debug option to dump the game's shaders.Fernando Sahmkow2022-01-048-1/+98
| | | | |
* | | | | Merge pull request #7668 from ameerj/fence-stop-tokenbunnei2022-01-043-15/+10
|\ \ \ \ \ | | | | | | | | | | | | gpu: Use std::stop_token in WaitFence for VSync thread
| * | | | | gpu: Use std::stop_token in WaitFence for VSync threadameerj2022-01-033-15/+10
| |/ / / / | | | | | | | | | | | | | | | Fixes a hang that may occur when stopping emulation and the VSync thread is blocked on the syncpoint condition variable.
* | | | | Merge pull request #7664 from german77/fallbackbunnei2022-01-042-4/+36
|\ \ \ \ \ | | | | | | | | | | | | core/hid: Add fallback to fullkey controllers
| * | | | | core/hid: Add fallback to fullkey controllersgerman772022-01-022-4/+36
| | | | | |
* | | | | | Merge pull request #7662 from german77/uistatusbunnei2022-01-031-2/+2
|\ \ \ \ \ \ | | | | | | | | | | | | | | yuzu: Fix UI elements not updating correctly
| * | | | | | yuzu: Fix UI elements not updating correctlygerman772022-01-021-2/+2
| |/ / / / /
* | | | | | Merge pull request #7663 from german77/appletbunnei2022-01-032-53/+68
|\ \ \ \ \ \ | |_|/ / / / |/| | | | | controller_applet: Only populate supported controllers
| * | | | | controller_applet: Only populate supported controllersgerman772022-01-022-53/+68
| |/ / / /
* | | | | Merge pull request #7648 from bunnei/thread-pinningFernando S2022-01-0310-14/+140
|\ \ \ \ \ | | | | | | | | | | | | core: hle: kernel: Implement thread pinning.
| * | | | | core: hle: kernel: Implement thread pinning.bunnei2021-12-3110-14/+140
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | - We largely had the mechanics in place for thread pinning, this change hooks these up. - Validated with tests https://github.com/Atmosphere-NX/Atmosphere/blob/master/tests/TestSvc/source/test_thread_pinning.cpp.
* | | | | | Merge pull request #7624 from ameerj/intel-msaa-scaleFernando S2022-01-034-20/+35
|\ \ \ \ \ \ | | | | | | | | | | | | | | vk_texture_cache: Use 3D scale helpers for MSAA texture scaling on Intel Windows drivers
| * | | | | | vk_texture_cache: Use 3D scale helpers for MSAA texture scaling on Intel Windows driversameerj2021-12-244-20/+35
| | | | | | | | | | | | | | | | | | | | | | | | | | | | Fixes a crash when scaling MSAA textures in titles such as Sonic Colors Ultimate.
* | | | | | | Merge pull request #7629 from ameerj/nv-driver-fixesFernando S2022-01-0318-30/+140
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | shaders: Add fixes for NVIDIA drivers 495+
| * | | | | | | glsl: Add boolean reference workaroundameerj2021-12-306-2/+15
| | | | | | | |
| * | | | | | | glsl_context_get_set: Add alternative cbuf type for broken driversameerj2021-12-306-24/+35
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | some drivers have a bug bitwise converting floating point cbuf values to uint variables. This adds a workaround for these drivers to make all cbufs uint and convert to floating point as needed.
| * | | | | | | emit_glsl_integer: Use negation work aroundameerj2021-12-301-2/+2
| | | | | | | |
| * | | | | | | shader: Add integer attribute get optimization passameerj2021-12-309-0/+86
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Works around an nvidia driver bug, where casting the integer attributes to float and back to an integer always returned 0.
| * | | | | | | emit_glsl_floating_point: Fix FPNeg on newer Nvidia driversameerj2021-12-251-2/+2
| | | | | | | |
* | | | | | | | Merge pull request #7659 from ameerj/overlap-overflowFernando S2022-01-011-5/+5
|\ \ \ \ \ \ \ \ | |_|_|_|/ / / / |/| | | | | | | texture_cache/util: Fix s32 overflow when resolving overlaps
| * | | | | | | texture_cache/util: Fix s32 overflow when resolving overlapsameerj2022-01-011-5/+5
| | |_|_|_|_|/ | |/| | | | |
* | | | | | | Merge pull request #7654 from Morph1984/dynarmicMai M2021-12-311-0/+0
|\ \ \ \ \ \ \ | |/ / / / / / |/| | | | | | externals: Update dynarmic to 28714ee7
| * | | | | | externals: Update dynarmic to 28714ee7Morph2021-12-311-0/+0
| | | | | | | | | | | | | | | | | | | | | | | | | | | | Reduces compilation times on MSVC.
* | | | | | | Merge pull request #7647 from german77/toadbunnei2021-12-315-17/+23
|\ \ \ \ \ \ \ | |_|_|_|/ / / |/| | | | | | core/hid: Fix controller type validation
| * | | | | | core/hid: Fix controller type validationgerman772021-12-305-17/+23
| | | | | | |
* | | | | | | Merge pull request #7635 from bunnei/set-heap-sizebunnei2021-12-306-83/+141
|\ \ \ \ \ \ \ | |_|/ / / / / |/| | | | | | core: hle: kernel: Updated implementation of svcSetHeapSize.
| * | | | | | core: hle: kernel: Updated implementation of svcSetHeapSize.bunnei2021-12-286-83/+141
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | - Updates our svcSetHeapSize with latest HOS, furthermore allowing heap size to properly be extended/shrunk. - Validated with tests https://github.com/Atmosphere-NX/Atmosphere/blob/master/tests/TestSvc/source/test_set_heap_size.cpp.
* | | | | | | Merge pull request #7618 from goldenx86/patch-4bunnei2021-12-292-1/+10
|\ \ \ \ \ \ \ | |_|_|_|_|/ / |/| | | | | | Increase boost requirement to 1.78.0
| * | | | | | Empty spacesMatías Locatti2021-12-281-1/+1
| | | | | | |
| * | | | | | Changes to avoid warnings in SSE4.2 optimized SPIR-VMatías Locatti2021-12-281-0/+9
| | | | | | |
| * | | | | | Increase boost requirement to 1.78.0Matías Locatti2021-12-221-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | Liu's finding, this allows to build yuzu on VS 2022. Ignore at will.
* | | | | | | Merge pull request #7622 from ameerj/vk-rescale-invalid-ptrbunnei2021-12-285-8/+21
|\ \ \ \ \ \ \ | |_|/ / / / / |/| | | | | | vk_texture_cache: Fix invalidated pointer access
| * | | | | | vk_texture_cache: Fix invalidated pointer accessameerj2021-12-245-8/+21
| | |_|_|/ / | |/| | | | | | | | | | | | | | | | | | | | | | The vulkan ImageView held a reference to its source image for rescale status checking. This pointer is sometimes invalidated when the texture cache slot_images container is resized. To avoid an invalid pointer dereference, the ImageView now holds a reference to the container itself.
* | | | | | Merge pull request #7621 from bunnei/set-mem-permbunnei2021-12-284-1/+67
|\ \ \ \ \ \ | | | | | | | | | | | | | | core: hle: kernel: Implement SetMemoryPermission.
| * | | | | | core: hle: kernel: Implement SetMemoryPermission.bunnei2021-12-234-1/+67
| | |/ / / / | |/| | | | | | | | | | | | | | | | - Not seen in any games yet, but validated with kernel tests.
* | | | | | Merge pull request #7630 from ameerj/glasm-get-intbunnei2021-12-281-4/+4
|\ \ \ \ \ \ | |_|_|/ / / |/| | | | | emit_glasm_context_get_set: Fix GetAttribute return value type.
| * | | | | emit_glasm_context_get_set: Fix GetAttribute return value type.ameerj2021-12-251-4/+4
| | |_|/ / | |/| | | | | | | | | | | | | GetAttribute expects an F32 result type at the IR level, this fixes the return value of attributes which were not returning an F32
* | | | | Merge pull request #7620 from bunnei/kernel-thread-x18bunnei2021-12-251-0/+2
|\ \ \ \ \ | |/ / / / |/| | | | core: hle: kernel: KThread: X18 should be a cryptographically random number.
| * | | | core: hle: kernel: KThread: X18 should be a cryptographically random number.bunnei2021-12-231-0/+2
| |/ / / | | | | | | | | | | | | | | | | - This was added with firmware 11.0.0 (https://switchbrew.org/wiki/11.0.0). - X18 is OR'd by kernel with 1, to make sure it is odd.
* | | | Merge pull request #7623 from ameerj/unused-funcbunnei2021-12-242-50/+0
|\ \ \ \ | |_|/ / |/| | | blit_image: Remove unused function
| * | | blit_image: Remove unused functionameerj2021-12-242-50/+0
|/ / /
* | | Merge pull request #7614 from liushuyu/fix-linux-inhibitbunnei2021-12-234-1/+65
|\ \ \ | |/ / |/| | main: Fix wake lock (prevent sleep) in Flatpak
| * | main: reword inhibit reasonliushuyu2021-12-221-2/+3
| | |
| * | main: fix wake lock in Flatpak ...liushuyu2021-12-224-1/+64
| | | | | | | | | | | | ... by using the XDP system
* | | Merge pull request #7616 from bunnei/fix-get-idle-ticksFernando S2021-12-221-14/+9
|\ \ \ | | | | | | | | hle: kernel: svc: GetInfo: Fix error checking with IdleTickCount.
| * | | hle: kernel: svc: GetInfo: Fix error checking with IdleTickCount.bunnei2021-12-221-14/+9
| | | | | | | | | | | | | | | | | | | | - Enforce tha the supplied handle is invalid, not valid. - This gets Witcher 3 booting.
* | | | Merge pull request #7375 from vonchenplus/convert_legacyFernando S2021-12-2212-293/+109
|\ \ \ \ | |_|/ / |/| | | Convert all legacy attributes to generic attributes
| * | | Address format clangvonchenplus2021-12-183-38/+38
| | | |
| * | | Remove spirv handle legacy related codevonchenplus2021-12-184-190/+1
| | | |
| * | | Remove glsl handle legacy related codevonchenplus2021-12-183-103/+1
| | | |
| * | | Merge branch 'yuzu-emu:master' into convert_legacyFeng Chen2021-12-18360-26589/+42433
| |\ \ \
| * | | | Implement convert legacy to genericFeng Chen2021-11-196-1/+108
| | | | |
* | | | | Merge pull request #7599 from FernandoS27/primrestart-vulkanbunnei2021-12-224-5/+50
|\ \ \ \ \ | | | | | | | | | | | | Vulkan: Fix Primitive Restart and implement Logical Operations
| * | | | | Vulkan: Fix the checks for primitive restart extension.Fernando Sahmkow2021-12-183-21/+28
| | | | | |
| * | | | | Vulkan: implement Logical Operations.Fernando Sahmkow2021-12-182-3/+3
| | | | | |
| * | | | | Vulkan: Implement VK_EXT_primitive_topology_list_restartFernando Sahmkow2021-12-184-2/+40
| | |_|_|/ | |/| | |
* | | | | Merge pull request #7602 from jbeich/freebsd-vaapibunnei2021-12-222-2/+2
|\ \ \ \ \ | |_|_|_|/ |/| | | | build: enable VA-API on FreeBSD
| * | | | video_core/codecs: re-enable VAAPI/VDPAU on BSDs after 72aa418b0b41Jan Beich2021-12-181-1/+1
| | | | |
| * | | | cmake: enable VA-API on more Unix-like after 0be4e402e213Jan Beich2021-12-181-1/+1
| | | | |
* | | | | Merge pull request #7604 from ameerj/fullscreen-render-windowbunnei2021-12-221-25/+16
|\ \ \ \ \ | | | | | | | | | | | | main: Make separate render window fullscreen toggle on the monitor it resides in
| * | | | | main: Refactor to reduce code duplication in ShowFullscreen()ameerj2021-12-191-25/+16
| | | | | |
| * | | | | main: Make render window borderless fullscreen toggle on the monitor it resides inameerj2021-12-191-1/+1
| |/ / / / | | | | | | | | | | | | | | | | | | | | | | | | | Toggling borderless fullscreen on the separate render window made it fullscreen on the monitor which the main yuzu window resided in. This change allows the render window to go fullscreen on the monitor it resides in, independent of the main window location.
* | | | | Merge pull request #7608 from Tatsh/scm-ver-overridebunnei2021-12-222-3/+14
|\ \ \ \ \ | | | | | | | | | | | | Allow overriding SCM version info
| * | | | | Allow overriding SCM version infoAndrew Udvare2021-12-212-3/+14
| | |/ / / | |/| | | | | | | | | | | | | | | | | | | | | | | If the build is from a non-repository, these functions will return empty. This patch allows using defines to CMake to set version info such as -DGIT_BRANCH=master.
* | | | | Merge pull request #7481 from german77/gyro-biasbunnei2021-12-216-20/+32
|\ \ \ \ \ | | | | | | | | | | | | service/hid: Improve console motion accuracy
| * | | | | service/hid: Improve console motion accuracyNarr the Reg2021-12-136-20/+32
| | | | | |
* | | | | | Merge pull request #7609 from Tatsh/file-assocbunnei2021-12-212-1/+16
|\ \ \ \ \ \ | | | | | | | | | | | | | | dist/XDG: add more file associations
| * | | | | | dist/XDG: add more file associationsAndrew Udvare2021-12-212-1/+16
| | |/ / / / | |/| | | |
* | | | | | Merge pull request #7597 from bunnei/remove-global-lockbunnei2021-12-2011-67/+1
|\ \ \ \ \ \ | | | | | | | | | | | | | | core: hle: Remove global HLE lock.
| * | | | | | core: hle: Remove global HLE lock.bunnei2021-12-1811-67/+1
| |/ / / / / | | | | | | | | | | | | | | | | | | | | | | | | - This was added early on as a hack to protect against some concurrency issues. - It's not clear that this serves any purpose anymore, and if it does, individual components should be fixed rather than using a global recursive mutex.
* | | | | | Merge pull request #7603 from ameerj/here-we-go-againbunnei2021-12-191-1/+4
|\ \ \ \ \ \ | |_|_|/ / / |/| | | | | kernel: Manually destroy the current process during shut down
| * | | | | kernel: Manually destroy the current process during shut downameerj2021-12-191-1/+4
|/ / / / / | | | | | | | | | | | | | | | Avoids a memory leak.
* | | | | Merge pull request #7593 from german77/brrr_testMorph2021-12-185-23/+19
|\ \ \ \ \ | | | | | | | | | | | | core/hid: Cancel any vibration after the test
| * | | | | core/hid: Cancel any vibration after the testNarr the Reg2021-12-165-23/+19
| | | | | |
* | | | | | Merge pull request #7600 from bunnei/fix-kip-loadingMorph2021-12-181-1/+7
|\ \ \ \ \ \ | | | | | | | | | | | | | | core: loader: kip: Minimal changes to fix KIP loading.
| * | | | | | core: loader: kip: Minimal changes to fix KIP loading.bunnei2021-12-181-1/+7
| | | | | | | | | | | | | | | | | | | | | | | | | | | | - Allows us to boot KIP (kernal apps), useful for testing the kernel.
* | | | | | | Merge pull request #7587 from liushuyu/fix-linux-decodingbunnei2021-12-188-222/+236
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | [Patch v2] externals/ffmpeg: refactor ffmpeg searching and handling in cmake
| * | | | | | | externals/ffmpeg: set the cmake variable twice ...liushuyu2021-12-162-5/+13
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | ... to avoid leaving variable undefined in the current scope
| * | | | | | | externals: fix a regression when using MSVCliushuyu2021-12-162-1/+2
| | | | | | | |
| * | | | | | | video_core/codecs: (re-spin) refactor ffmpeg searching and handlingliushuyu2021-12-168-222/+227
| | |/ / / / / | |/| | | | |
* | | | | | | Merge pull request #7596 from Tatsh/externals-sdl-config-joycon-fixbunnei2021-12-182-3/+4
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | externals/CMakeLists: fix detection/init of Switch controllers in SDL 2.0.18
| * | | | | | | externals/SDL: update SDL to version with Wayland build fixAndrew Udvare2021-12-172-4/+4
| | | | | | | |
| * | | | | | | externals/CMakeLists: fix detection/init of Switch controllers in SDL 2.0.18Andrew Udvare2021-12-171-3/+4
| | |_|/ / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Enable SDL_THREADS and SDL_ATOMIC Also set SDL_WAYLAND=OFF due to build issue Closes #7572
* | | | | | | Merge pull request #7302 from VPeruS/check-deadlockbunnei2021-12-184-44/+190
|\ \ \ \ \ \ \ | |_|_|/ / / / |/| | | | | | [input_common] Fixed thread hang
| * | | | | | [input_common] Move variable declaration closer to usagevperus2021-12-171-2/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | MSVC supplied with VS2022 generates "warning C4189: 'CALIBRATION_THRESHOLD': local variable is initialized but not referenced" which is treated as an error. Circumvent it by moving constexpr variable directly into body of lambda function.
| * | | | | | Revert of b01aa72vperus2021-11-291-35/+39
| | | | | | | | | | | | | | | | | | | | | | | | | | | | Caused worker_thread to be stuck in Stage1Completed state until job's destruction.
| * | | | | | [input_common] Add completion test for CalibrationConfigurationJobvperus2021-11-293-9/+151
| | | | | | |
* | | | | | | Merge pull request #7399 from ameerj/art-refactorFernando S2021-12-188-152/+147
|\ \ \ \ \ \ \ | |_|_|_|_|_|/ |/| | | | | | video_core: Refactoring post A.R.T. merge
| * | | | | | vk_texture_cache: Add ABGR src format check for D24S8 conversionsameerj2021-12-051-1/+5
| | | | | | |
| * | | | | | renderer_opengl: Minor refactoring of filter selectionameerj2021-12-051-30/+20
| | | | | | |
| * | | | | | texture_cache: Fix image convert dimensions assertionameerj2021-12-051-1/+12
| | | | | | |
| * | | | | | blit_image: Refactor upscale factors usageameerj2021-12-056-62/+53
| | | | | | | | | | | | | | | | | | | | | | | | | | | | The image view itself can be queried to see if it is being rescaled or not, removing the need to pass the upscale/down shift factors from the texture cache.
| * | | | | | vk_texture_cache: Add a function to ImageView to check if src image is rescaledameerj2021-12-052-4/+22
| | | | | | |
| * | | | | | blit_image: Refactor ConvertPipeline functionsameerj2021-12-052-29/+15
| | | | | | |
| * | | | | | blit_image: Refactor ConvertPipelineEx functionsameerj2021-12-052-33/+18
| | | | | | | | | | | | | | | | | | | | | | | | | | | | reduces much of the duplication between the color/depth variants
| * | | | | | vk_blit_screen: Minor refactor of filter pipeline selectionameerj2021-12-051-21/+16
| | | | | | |
| * | | | | | Revert "Merge pull request #7395 from Morph1984/resolve-comments"ameerj2021-12-053-16/+31
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This reverts commit d20f91da11fe7c5d5f1bd4f63cc3b4d221be67a4, reversing changes made to 5082712b4e44ebfe48bd587ea2fa38767b7339cb.
* | | | | | | Merge pull request #7570 from ameerj/favorites-expandedbunnei2021-12-183-7/+17
|\ \ \ \ \ \ \ | |_|_|/ / / / |/| | | | | | game_list: Add persistent setting for the favorites row expanded state
| * | | | | | game_list: Add persistent setting for the favorites row expanded stateameerj2021-12-123-7/+17
| | | | | | | | | | | | | | | | | | | | | | | | | | | | Previously, the favorites row was always expanded on launch. This change introduces a persistent setting that allows the favorites row's expanded state to be remembered between launches.
* | | | | | | Merge pull request #7532 from goldenx86/patch-3bunnei2021-12-161-8/+5
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | Update video core popup
| * | | | | | | Suggestions from CrusadingNinjaMatías Locatti2021-12-161-2/+2
| | | | | | | |
| * | | | | | | Changed linkMatías Locatti2021-12-161-1/+1
| | | | | | | |
| * | | | | | | main: Update video core popupMatías Locatti2021-12-071-8/+5
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Old version had formatting issues, and I want to provide an answer to the most common reason this pops up in the first place, outdated drivers.
* | | | | | | | Merge pull request #7551 from vonchenplus/fix_blit_image_view_mismatchingbunnei2021-12-161-1/+6
|\ \ \ \ \ \ \ \ | |_|_|_|_|/ / / |/| | | | | | | Fix blit image/view not compatible
| * | | | | | | Fix blit image/view not compatibleFeng Chen2021-12-101-1/+6
| | |/ / / / / | |/| | | | |
* | | | | | | Merge pull request #7588 from Wunkolo/gibibibi-bytesbunnei2021-12-151-4/+6
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | yuzu/main: Fix host memory byte units. GB to GiB
| * | | | | | | yuzu/main: Fix host memory byte units. GB to GiBWunkolo2021-12-151-4/+6
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | I have `134850146304` bytes of ram and Yuzu was saying that I had `125.59 GB` of ram. But `125.59` is actually the amount of gi**bi**bytes I have. In gi**ga**bytes I would have `134.9`. Additionally, I changed the `1024 / 1024 / 1024` here into the `_GiB` user-literals that I added a while ago(#6519). https://www.wolframalpha.com/input/?i=134850146304+bytes
* | | | | | | | Merge pull request #7589 from yuzu-emu/revert-7565-fix-linux-decodingbunnei2021-12-158-227/+222
|\ \ \ \ \ \ \ \ | |/ / / / / / / |/| | | | | | | Revert "video_core/codecs: refactor ffmpeg searching and handling in cmake"
| * | | | | | | Revert "video_core/codecs: refactor ffmpeg searching and handling in cmake"bunnei2021-12-158-227/+222
|/ / / / / / /
* | | | | | | Merge pull request #7565 from liushuyu/fix-linux-decodingbunnei2021-12-158-222/+227
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | video_core/codecs: refactor ffmpeg searching and handling in cmake
| * | | | | | | CI: fix CI on Linuxliushuyu2021-12-143-7/+3
| | | | | | | |
| * | | | | | | video_core/codecs: skip decoders that use hw frames ...liushuyu2021-12-141-0/+9
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | ... this would resolve some edge-cases where multiple devices are present and ffmpeg is unable to auto-supply the hw surfaces
| * | | | | | | CI: fix MinGW installation stepliushuyu2021-12-141-1/+1
| | | | | | | |
| * | | | | | | ffmpeg: move the whole tree into externals/ffmpeg/ffmpeg ...liushuyu2021-12-146-216/+217
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * this resolves the todo items in the CMakeLists.txt * a version requirement check for ffmpeg is added to catch issues early * for future-proof reasons, nasm/yasm is now only required when build on x86/AMD64 systems
| * | | | | | | cmake: refactor ffmpeg searching and handling logic on Linuxliushuyu2021-12-141-16/+15
| | | | | | | |
* | | | | | | | Merge pull request #7558 from Morph1984/unused-cpu-family-modelMai M2021-12-151-12/+0
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | common/cpu_detect: Remove CPU family and model
| * | | | | | | | common/cpu_detect: Remove CPU family and modelMorph2021-12-141-12/+0
| | |/ / / / / / | |/| | | | | | | | | | | | | | | | | | | | | | We currently do not make use of these fields, remove them for now.
* | | | | | | | Merge pull request #7549 from Morph1984/astc-8x5Mai M2021-12-151-2/+2
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | maxwell_to_vk: Add ASTC_2D_8X5_UNORM
| * | | | | | | | maxwell_to_vk: Add ASTC_2D_5X4_UNORMMorph2021-12-111-1/+1
| | | | | | | | |
| * | | | | | | | maxwell_to_vk: Add ASTC_2D_8X5_UNORMMorph2021-12-091-1/+1
| |/ / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | - Used by Lego City Undercover
* | | | | | | | Merge pull request #7579 from Morph1984/swkbd-oob-array-accessMai M2021-12-151-4/+19
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | qt_software_keyboard: Fix out of bounds array access
| * | | | | | | | qt_software_keyboard: Fix out of bounds array accessMorph2021-12-141-4/+19
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | We were unconditionally accessing the keyboard_buttons array, even if the bottom_osk_index was for the numberpad, leading to an out of bounds array access. Fix this by accessing the proper array for the current button when the index is for the numberpad.
* | | | | | | | | Merge pull request #7583 from german77/triggeredGhost2021-12-151-2/+2
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | core/hid: Fix faulty analog triggers
| * | | | | | | | | core/hid: Fix faulty analog triggersNarr the Reg2021-12-151-2/+2
|/ / / / / / / / /
* | | | | | | | | Merge pull request #7581 from lioncash/input-ifaceNarr the Reg2021-12-1510-155/+192
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | common/input: Avoid numerous large copies of CallbackStatus
| * | | | | | | | | common/input: Avoid numerous large copies of CallbackStatusLioncash2021-12-149-129/+171
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | CallbackStatus instances aren't the cheapest things to copy around (relative to everything else), given that they're currently 520 bytes in size and are currently copied numerous times when callbacks are invoked. Instead, we can pass the status by const reference to avoid all the copying.
| * | | | | | | | | common/input: Remove unnecessary returnsLioncash2021-12-141-6/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Given these return void, these can be omitted.
| * | | | | | | | | input_poller: Add missing override specifiersLioncash2021-12-141-20/+19
| | | | | | | | | |
* | | | | | | | | | Merge pull request #7577 from v1993/patch-2Narr the Reg2021-12-141-3/+4
|\ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | input/SDL: Update SDL hints
| * | | | | | | | | | input/SDL: Update SDL hintsValeri2021-12-141-3/+4
| | |/ / / / / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | SDL_HINT_JOYSTICK_HIDAPI_SWITCH_HOME_LED is no longer needed thanks to new default in SDL 2.0.18. SDL_HINT_JOYSTICK_HIDAPI_XBOX is reported to cause conflicts with native driver Xbox driver on Linux, and Xbox controllers don't benefit from hidapi anyways.
* | | | | | | | | | Merge pull request #7580 from lioncash/input-docbunnei2021-12-142-120/+120
|\ \ \ \ \ \ \ \ \ \ | |_|/ / / / / / / / |/| | | | | | | | | input_poller/input_mapping: Silence several -Wdocumentation warnings
| * | | | | | | | | input_mapping: Amend specification of parametersLioncash2021-12-141-14/+14
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | param tags are supposed to specify the parameter name without any quoting. Silences several -Wdocumentation warnings.
| * | | | | | | | | input_poller: Remove several unnecessary @param tagsLioncash2021-12-141-106/+106
|/ / / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Silences quite a bit of -Wdocumentation warnings, given the @param tag is only intended to be used to identify function parameters, not what it contains.
* | | | | | | | | Merge pull request #7575 from lioncash/inputbunnei2021-12-1418-114/+109
|\ \ \ \ \ \ \ \ \ | |_|_|/ / / / / / |/| | | | | | | | input_engine: Minor object churn cleanup
| * | | | | | | | input_engine: Fix typo in TriggerOnAxisChange() parameter nameLioncash2021-12-131-1/+1
| | | | | | | | |
| * | | | | | | | input_engine: Simplify PreSet* family of functionsLioncash2021-12-132-24/+14
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | We can make use of try_emplace() to insert values only if they don't already exist.
| * | | | | | | | input_engine: Avoid redundant map lookupsLioncash2021-12-131-16/+24
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | We can use iterators to avoid looking up into maps twice in the getter functions. At the same time we can also avoid copying the ControllerData structs, since they're 264 bytes in size.
| * | | | | | | | input_engine: Remove left-over namespace qualifiersLioncash2021-12-131-3/+3
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | These types are part of the InputCommon namespace.
| * | | | | | | | input_engine: Iterate by reference rather than by value where applicableLioncash2021-12-131-10/+10
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Avoids creating copies of several object instances (some of which being over 100 bytes in size).
| * | | | | | | | input_engine: Take BasicMotion by const reference with SetMotion() and TriggerOnMotionChange()Lioncash2021-12-133-6/+7
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Copies the BasicMotion instance once instead of twice.
| * | | | | | | | input_engine: std::move InputIdentifier in SetCallback()Lioncash2021-12-131-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Allows avoiding std::function allocations.
| * | | | | | | | input_engine: Pass LedStatus by const referenceLioncash2021-12-133-3/+3
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Avoids copies where reasonably applicable
| * | | | | | | | input_engine: Pass VibrationStatus by const reference in SetRumble()Lioncash2021-12-137-12/+12
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Avoids creating copies of the struct where not necessary.
| * | | | | | | | input_engine: std::move engine name where applicableLioncash2021-12-1315-29/+29
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | We can allow the name to be moved into, allowing allocations to be avoided.
| * | | | | | | | input_engine: Remove callback clearing in constructorLioncash2021-12-131-3/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The callback map is a member variable, so this will always be empty on initial construction.
| * | | | | | | | input_engine: Remove unnecessary semi-colonsLioncash2021-12-131-6/+6
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Silences -Wextra-semi warnings
| * | | | | | | | input_engine: Remove unnecessary returnLioncash2021-12-131-3/+1
| |/ / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | This is a void function, so it doesn't need this.
* | | | | | | | Merge pull request #7576 from lioncash/tasenumbunnei2021-12-132-70/+82
|\ \ \ \ \ \ \ \ | |/ / / / / / / |/| | | | | | | tas_input: Minor cleanup
| * | | | | | | tas_input: Avoid minor copies in Read/WriteCommandButtons()Lioncash2021-12-131-2/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | We don't need to copy the whole pair
| * | | | | | | tas_input: Remove unnecessary semicolonLioncash2021-12-131-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Resolves a -Wextra-semi warning
| * | | | | | | tas_input: Execute clear() even if emptyLioncash2021-12-131-3/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | clear() when empty is simply a no-op, so we can get rid of the check here and let the stdlib do it for us.
| * | | | | | | tas_input: Remove unnecessary includesLioncash2021-12-131-2/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Gets rid of indirect includes and includes only what the interface needs.
| * | | | | | | tas_input: std::move strings into vectorLioncash2021-12-131-21/+24
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | While we're in the same area, we can also avoid performing std::stoi in a loop when it only needs to be performed once.
| * | | | | | | tas_input: Use istringstream over stringstreamLioncash2021-12-131-2/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This is only using the input facilities, so we don't need to use the fully-fleged stringstream.
| * | | | | | | tas_input: Use u8string_view instead of u8stringLioncash2021-12-132-6/+7
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Same behavior, but without the potential for extra allocations.
| * | | | | | | tas_input: Remove unused std::smatch variableLioncash2021-12-131-2/+0
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This also means we can get rid of the dependency on <regex>
| * | | | | | | tas_input: Amend -Wdocumentation warningsLioncash2021-12-132-28/+30
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Parameters shouldn't have the colon by their name.
| * | | | | | | tas_input: Make TasAxes enum an enum classLioncash2021-12-132-5/+14
|/ / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | Prevents these values from potentially clashing with anything in other headers.
* | | | | | | Merge pull request #7574 from v1993/patch-1Mai M2021-12-131-2/+0
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | Remove erroneous #pragma once
| * | | | | | | Remove erroneous #pragma onceValeri2021-12-131-2/+0
|/ / / / / / /
* | | | | | | Merge pull request #7554 from Tachi107/build-remove-unicornMai M2021-12-132-22/+0
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | build: remove remaining bits of Unicorn
| * | | | | | | build: remove remaining bits of UnicornAndrea Pappacoda2021-12-102-22/+0
| |/ / / / / / | | | | | | | | | | | | | | | | | | | | | Unicorn has been removed in fc6db97a09e2de5eff10131ddcab9cf8fb2f736c
* | | | | | | Merge pull request #7527 from Tachi107/cubeb-result_ofbunnei2021-12-132-1/+1
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | build: update cubeb and remove the result_of comment
| * | | | | | | build: update cubeb and remove the result_of commentAndrea Pappacoda2021-12-062-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Cubeb doesn't use result_of anymore, it has been dropped in commit mozilla/cubeb@75d9d125ee655ef80f3bfcd97ae5a805931042b8
* | | | | | | | Merge pull request #7462 from bunnei/kernel-improve-schedulingbunnei2021-12-1332-634/+895
|\ \ \ \ \ \ \ \ | |_|/ / / / / / |/| | | | | | | Kernel: Improve threading & scheduling V3
| * | | | | | | hle: kernel k_scheduler: EnableScheduling: Remove redundant GetCurrentThreadPointer calls.bunnei2021-12-071-3/+5
| | | | | | | |
| * | | | | | | hle: kernel k_process: Remove unnecessary .at usage with thread pinning methods.bunnei2021-12-071-3/+3
| | | | | | | |
| * | | | | | | hle: kernel: Remove unnecessary virtual specifier on NotifyAvailable.bunnei2021-12-071-2/+2
| | | | | | | |
| * | | | | | | hle: kernel: Remove unnecessary virtual specifier on EndWait.bunnei2021-12-071-1/+1
| | | | | | | |
| * | | | | | | hle: kernel: k_light_condition_variable: Revert unnecessary license comment changes.bunnei2021-12-071-1/+1
| | | | | | | |
| * | | | | | | hle: kernel: k_condition_variable: Revert unnecessary style changes.bunnei2021-12-071-2/+2
| | | | | | | |
| * | | | | | | hle: kernel: Remove unnecessary virtual specifier on CancelWait.bunnei2021-12-076-14/+14
| | | | | | | |
| * | | | | | | hle: kernel: service_thread: Force stop threads on destruction.bunnei2021-12-071-1/+7
| | | | | | | |
| * | | | | | | hle: kernel: k_light_lock: Implement CancelWait.bunnei2021-12-071-5/+10
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | - Fixes a crash in Megadimension Neptunia VII.
| * | | | | | | hle: kernel: service_thread: Use std::jthread.bunnei2021-12-071-18/+19
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | - Fixes a potential deadlock on service thread shutdown.
| * | | | | | | hle: kernel: k_thread: Skip reschedule on DisableDispatch with SC.bunnei2021-12-071-0/+5
| | | | | | | |
| * | | | | | | hle: kernel: k_thread: Rename sleeping_queue -> wait_queue.bunnei2021-12-072-17/+13
| | | | | | | |
| * | | | | | | hle: kernel: svc: Fix deadlock that can occur with single core.bunnei2021-12-071-10/+8
| | | | | | | |
| * | | | | | | hle: kernel: k_thread: Treat dummy threads as a special type.bunnei2021-12-072-1/+4
| | | | | | | |
| * | | | | | | hle: kernel: fix timing on thread preemptionFernandoS272021-12-071-4/+2
| | | | | | | |
| * | | | | | | hle: kernel: fix scheduling ops from HLE host thread.FernandoS272021-12-071-3/+3
| | | | | | | |
| * | | | | | | hle: kernel: Add a flag for indicating that the kernel is currently shutting down.bunnei2021-12-076-0/+49
| | | | | | | |
| * | | | | | | hle: kernel: KSynchronizationObject: Fix variable shadowing.bunnei2021-12-071-8/+8
| | | | | | | |
| * | | | | | | hle: kernel: Cleanup to match coding style.bunnei2021-12-076-26/+21
| | | | | | | |
| * | | | | | | hle: kernel: KProcess: Improvements for thread pinning.bunnei2021-12-072-8/+26
| | | | | | | |
| * | | | | | | hle: kernel: KThreadQueue: Remove deprecated code.bunnei2021-12-071-63/+0
| | | | | | | |
| * | | | | | | hle: kernel: KConditionVariable: Various updates & simplifications.bunnei2021-12-072-121/+65
| | | | | | | |
| * | | | | | | hle: kernel: KThread: Migrate to updated KThreadQueue (part 2).bunnei2021-12-071-29/+19
| | | | | | | |
| * | | | | | | hle: kernel: KThread: Migrate to updated KThreadQueue (part 1).bunnei2021-12-073-60/+71
| | | | | | | |
| * | | | | | | hle: kernel: KConditionVariable: Migrate to updated KThreadQueue.bunnei2021-12-071-12/+55
| | | | | | | |
| * | | | | | | hle: kernel: KServerSession: Migrate to updated KThreadQueue.bunnei2021-12-072-5/+11
| | | | | | | |
| * | | | | | | hle: kernel: KLightConditionVariable: Migrate to updated KThreadQueue.bunnei2021-12-073-54/+87
| | | | | | | |
| * | | | | | | hle: kernel: KLightLock: Migrate to updated KThreadQueue.bunnei2021-12-072-35/+36
| | | | | | | |
| * | | | | | | hle: kernel: KAddressArbiter: Migrate to updated KThreadQueue.bunnei2021-12-071-43/+39
| | | | | | | |
| * | | | | | | hle: kernel: KThread: Remove tracking of sync object from threads.bunnei2021-12-076-41/+21
| | | | | | | |
| * | | | | | | hle: kernel: Update KThreadQueue and migrate KSynchronizationObject.bunnei2021-12-078-75/+251
| | | | | | | |
| * | | | | | | core: hle: kernel: Disable dispatch count tracking on single core.bunnei2021-12-073-5/+14
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | - This would have limited value, and would be a mess to handle properly.
| * | | | | | | core: hle: kernel: k_thread: Mark KScopedDisableDispatch as nodiscard.bunnei2021-12-071-1/+1
| | | | | | | |
| * | | | | | | core: cpu_manager: Use invalid core_id on init and simplify shutdown.bunnei2021-12-071-7/+3
| | | | | | | |
| * | | | | | | core: hle: kernel: k_auto_object: Add GetName method.bunnei2021-12-071-0/+4
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | - Useful purely for debugging.
| * | | | | | | core: hle: kernel: DisableDispatch on suspend threads.bunnei2021-12-071-0/+3
| | | | | | | |
| * | | | | | | core: hle: kernel: k_scheduler: Improve DisableScheduling and EnableScheduling.bunnei2021-12-071-14/+9
| | | | | | | |
| * | | | | | | core: cpu_manager: Use KScopedDisableDispatch.bunnei2021-12-071-7/+8
| | | | | | | |
| * | | | | | | core: hle: kernel: Use CurrentPhysicalCoreIndex as appropriate.bunnei2021-12-071-6/+2
| | | | | | | |
| * | | | | | | core: hle: kernel: k_scheduler: Remove unnecessary MakeCurrentProcess.bunnei2021-12-071-5/+0
| | | | | | | |
| * | | | | | | core: hle: kernel: k_scheduler: Improve ScheduleImpl.bunnei2021-12-071-6/+7
| | | | | | | |
| * | | | | | | core: hle: kernel: k_scheduler: Improve Unload.bunnei2021-12-071-17/+29
| | | | | | | |
| * | | | | | | core: hle: kernel: k_process: DisableDispatch on main thread.bunnei2021-12-071-0/+1
| | | | | | | |
| * | | | | | | core: hle: kernel: k_handle_table: Use KScopedDisableDispatch as necessary.bunnei2021-12-072-0/+8
| | | | | | | |
| * | | | | | | core: hle: kernel: k_thread: Add KScopedDisableDispatch.bunnei2021-12-072-1/+47
| | | | | | | |
| * | | | | | | core: hle: kernel: Ensure idle threads are closed before destroying scheduler.bunnei2021-12-073-24/+22
| | | | | | | |
| * | | | | | | core: hle: kernel: Reflect non-emulated threads as core 3.bunnei2021-12-077-14/+17
| | |/ / / / / | |/| | | | |
* | | | | | | Merge pull request #7495 from FernandoS27/text-blit-fix-againMorph2021-12-091-3/+6
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | Texture Cache: Fix mismatching image/views on blits
| * | | | | | | Texture Cache: Fix crashes on NVIDIA.Fernando Sahmkow2021-12-041-3/+6
| | | | | | | |
* | | | | | | | Merge pull request #7519 from itsmeft24/masterbunnei2021-12-0912-6/+611
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | kernel: svc: Implement ProcessMemory and CodeMemory SVCs
| * | | | | | | | Update k_code_memory.hitsmeft242021-12-071-6/+6
| | | | | | | | |
| * | | | | | | | make KCodeMemory::GetSourceAddress constitsmeft242021-12-071-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | Co-authored-by: Mai M. <mathew1800@gmail.com>
| * | | | | | | | fix formattingitsmeft242021-12-061-1/+6
| | | | | | | | |
| * | | | | | | | move private members below public membersitsmeft242021-12-061-10/+11
| | | | | | | | |
| * | | | | | | | fix formattingitsmeft242021-12-061-4/+1
| | | | | | | | |
| * | | | | | | | fix formattingitsmeft242021-12-061-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | Co-authored-by: Mai M. <mathew1800@gmail.com>
| * | | | | | | | fix formattingitsmeft242021-12-062-2/+2
| | | | | | | | |
| * | | | | | | | Remove unnecessary includesitsmeft242021-12-062-50/+13
| | | | | | | | |
| * | | | | | | | Add copyright noticeitsmeft242021-12-052-0/+8
| | | | | | | | |
| * | | | | | | | Add KCodeMemory to CMakeLists.txtitsmeft242021-12-051-0/+2
| | | | | | | | |
| * | | | | | | | kernel: svc: Implement Map/UnmapProcessMemory and Create/ControlCodeMemoryitsmeft242021-12-0511-7/+636
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Used by Skyline modding framework
* | | | | | | | | Merge pull request #7545 from Morph1984/qt-deprecated-warnbunnei2021-12-091-1/+1
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | profiler: Use QWheelEvent position().toPoint()
| * | | | | | | | | profiler: Use QWheelEvent position().toPoint()Morph2021-12-081-1/+1
|/ / / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | QWheelEvent::pos() is deprecated. Make use of position().toPoint() instead.
* | | | | | | | | Merge pull request #7544 from Morph1984/r16g16bunnei2021-12-082-1/+2
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | renderer_vulkan: Add R16G16_UINT
| * | | | | | | | | renderer_vulkan: Add R16G16_UINTMorph2021-12-082-1/+2
|/ / / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | - Used by Immortals Fenyx Rising
* | | | | | | | | Merge pull request #7525 from german77/notifabunnei2021-12-086-0/+77
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | service/notif: Add notif:a and stub ListAlarmSettings, Initialize
| * | | | | | | | | service/notif: Add notif:a and stub ListAlarmSettings,Initializegerman772021-12-066-0/+77
| | |_|_|_|/ / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | Used by ring fit adventure 1.2.0
* | | | | | | | | Merge pull request #7521 from german77/dual_single_joyconsbunnei2021-12-085-38/+174
|\ \ \ \ \ \ \ \ \ | |_|_|_|_|_|_|/ / |/| | | | | | | | service/hid: Implement SetNpadJoyAssignmentMode
| * | | | | | | | service/hid: Implement SetNpadJoyAssignmentModegerman772021-12-055-38/+174
| |/ / / / / / /
* | | | | | | | Merge pull request #7488 from vonchenplus/support_multiple_videos_playingbunnei2021-12-088-40/+45
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | Support multiple videos playing
| * | | | | | | | Address feedbackFeng Chen2021-12-045-17/+27
| | | | | | | | |
| * | | | | | | | Support multiple videos playingFeng Chen2021-12-026-41/+36
| | | | | | | | |
* | | | | | | | | Merge pull request #7506 from heinermann/focus_crashMai M2021-12-081-8/+9
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | Fixed #7502
| * | | | | | | | | Fixed #7502Adam Heinermann2021-12-051-8/+9
| | |_|_|/ / / / / | |/| | | | | | |
* | | | | | | | | Merge pull request #7522 from ameerj/shader-recompiler-filenamesMai M2021-12-0865-214/+282
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | shader_recompiler/backend: Minor organization and refactoring to reduce compile time overhead
| * | | | | | | | | emit_spirv: Reduce emit_spirv.h include overheadameerj2021-12-0620-3/+20
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | emit_spirv.h is included in video_core, which was propagating further includes that video_core did not depend on.
| * | | | | | | | | glasm: Move implemented instructions from not_implemented.cppameerj2021-12-067-169/+220
| | | | | | | | | |
| * | | | | | | | | shader_recompiler: Adjust emit_context includesameerj2021-12-0637-37/+37
| | | | | | | | | |
| * | | | | | | | | shader_recompiler: Rename backend emit_context filesameerj2021-12-057-6/+6
| | |_|/ / / / / / | |/| | | | | | |
* | | | | | | | | Merge pull request #7526 from Void48/patch-1Mai M2021-12-081-1/+1
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | (README) changed the color of Discord badge to use the new color
| * | | | | | | | | Update README.mdVoid482021-12-061-1/+1
| | |_|_|_|_|/ / / | |/| | | | | | |
* | | | | | | | | Merge pull request #7531 from Morph1984/zm-msvcbunnei2021-12-071-0/+2
|\ \ \ \ \ \ \ \ \ | |_|_|_|_|_|/ / / |/| | | | | | | | CMakeLists: Specify /Zm200 when compiling in MSVC
| * | | | | | | | CMakeLists: Specify /Zm200 when compiling in MSVCMorph2021-12-071-0/+2
|/ / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | This increases the memory heap size for constructing precompiled headers to 2x the default.
* | | | | | | | Merge pull request #7529 from german77/sdl2.0.18bunnei2021-12-072-2/+2
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | input_common: Update SDL to 2.0.18
| * | | | | | | | input_common: Update SDL to 2.0.18Narr the Reg2021-12-062-2/+2
| | |/ / / / / / | |/| | | | | |
* | | | | | | | Merge pull request #7524 from german77/hid_stubbunnei2021-12-062-2/+35
|\ \ \ \ \ \ \ \ | |_|/ / / / / / |/| | | | | | | service/hid: Stub SetNpadCaptureButtonAssignment and ClearNpadCaptureButtonAssignment
| * | | | | | | service/hid: Stub SetNpadCaptureButtonAssignment and ClearNpadCaptureButtonAssignmentgerman772021-12-062-2/+35
| |/ / / / / / | | | | | | | | | | | | | | | | | | | | | Used by ring fit adventure 1.2.0
* | | | | | | Merge pull request #7523 from jam1garner/support-all-subsdksMorph2021-12-061-2/+3
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | Add support for subsdk8 and subsdk9
| * | | | | | | loader: Support loading subsdk{8,9}jam1garner2021-12-061-2/+3
|/ / / / / / /
* | | | | | | Merge pull request #7520 from ameerj/missing-copyrightMorph2021-12-065-0/+20
|\ \ \ \ \ \ \ | |/ / / / / / |/| | | | | | general: Add missing copyright notices
| * | | | | | general: Add missing copyright noticesameerj2021-12-055-0/+20
|/ / / / / /
* | | | | | Merge pull request #7518 from german77/is_npad_validMorph2021-12-051-0/+2
|\ \ \ \ \ \ | |_|_|/ / / |/| | | | | core/hid: Add missing controller type
| * | | | | core/hid: Add missing controller typegerman772021-12-051-0/+2
|/ / / / /
* | | | | Merge pull request #7494 from Morph1984/no-time-to-waitFernando S2021-12-051-18/+18
|\ \ \ \ \ | | | | | | | | | | | | native_clock: Wait for less time in EstimateRDTSCFrequency
| * | | | | native_clock: Wait for less time in EstimateRDTSCFrequencyMorph2021-12-041-18/+18
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | In my testing, waiting for 200ms provided the same level of precision as the previous implementation when estimating the RDTSC frequency. This significantly improves the yuzu executable launch times since we reduced the wait time from 3 seconds to 200 milliseconds.
* | | | | | Merge pull request #7503 from german77/is_npad_validbunnei2021-12-058-88/+147
|\ \ \ \ \ \ | |_|/ / / / |/| | | | | core/hid: Ensure only valid npad are connected
| * | | | | core/hid: Ensure only valid npad are connectedgerman772021-12-058-88/+147
|/ / / / /
* | | | | Merge pull request #7467 from liushuyu/fix-linux-decodingbunnei2021-12-042-66/+50
|\ \ \ \ \ | |/ / / / |/| | | | video_core/codecs: more robust ffmpeg hwdecoder selection logic
| * | | | video_core/cmake: link against libva explicitly ...liushuyu2021-12-031-0/+1
| | | | | | | | | | | | | | | | | | | | ... to fix build on Flatpak (and self-builds)
| * | | | video_core/codecs: more fixes for VAAPI detection ...liushuyu2021-12-031-63/+25
| | | | | | | | | | | | | | | | | | | | | | | | | * skip impersonated VAAPI implementaions ("imposter detection") * place VAAPI priority below CUDA/NVDEC/CUVID
| * | | | video_core/codec: address commentsliushuyu2021-12-031-8/+12
| | | | |
| * | | | video_core/codecs: more robust ffmpeg hwdecoder selection logicliushuyu2021-12-031-10/+27
| | | | |
* | | | | Merge pull request #7489 from Morph1984/steady-clockbunnei2021-12-047-13/+13
|\ \ \ \ \ | |/ / / / |/| | | | general: Replace high_resolution_clock with steady_clock
| * | | | general: Replace high_resolution_clock with steady_clockMorph2021-12-027-13/+13
| |/ / / | | | | | | | | | | | | On some OSes, high_resolution_clock is an alias to system_clock and is not monotonic in nature. Replace this with steady_clock.
* | | | Merge pull request #7490 from Morph1984/stub-album-save-screenshotbunnei2021-12-033-2/+15
|\ \ \ \ | | | | | | | | | | service: am: ISelfController: Stub SaveCurrentScreenshot
| * | | | service: am: ISelfController: Stub SaveCurrentScreenshotMorph2021-12-033-2/+15
| |/ / / | | | | | | | | | | | | - Used by Disney Magical World 2: Enchanted Edition
* | | | Merge pull request #7452 from german77/controller_navigationMorph2021-12-039-8/+285
|\ \ \ \ | |/ / / |/| | | yuzu: Implement basic controller UI navigation
| * | | yuzu: Implement basic controller navigationgerman772021-12-029-8/+285
| | | |
* | | | Merge pull request #7483 from zhaobot/tx-update-20211201022129Mai M2021-12-0120-13663/+24171
|\ \ \ \ | | | | | | | | | | Update translations (2021-12-01)
| * | | | Update translations (2021-12-01)The yuzu Community2021-12-0120-13663/+24171
|/ / / /
* | | | Merge pull request #7482 from Morph1984/friendbunnei2021-11-301-2/+21
|\ \ \ \ | |/ / / |/| | | service: friend: Implement GetCompletionEvent
| * | | service: friend: Implement GetCompletionEventMorph2021-11-301-2/+21
|/ / / | | | | | | | | | - Used by Super Bomberman R Online
* | | Merge pull request #7472 from Morph1984/post-kraken-cleanupNarr the Reg2021-11-3014-112/+149
|\ \ \ | | | | | | | | core: hid: Post kraken cleanup
| * | | input_interpreter: Make use of NpadButton instead of a u64Morph2021-11-302-9/+9
| | | | | | | | | | | | | | | | Allows us to be more explicit with the representation of button states and use the provided bit manipulation operators
| * | | npad: Return NpadButton in GetAndResetPressStateMorph2021-11-303-7/+6
| | | | | | | | | | | | | | | | We were previously truncating this to a u32 as there were no known buttons that used the full 64 bits of this type. Fix this now that we know they are used.
| * | | core: hid: hid_types: Add "All" to NpadButtonMorph2021-11-301-0/+2
| | | | | | | | | | | | | | | | This represents a bitmask for all pressed buttons
| * | | qt_controller: Make use of (Enable/Disable)AllControllerConfigurationMorph2021-11-301-8/+5
| | | | | | | | | | | | | | | | This also moves the use of DisableConfiguration to the destructor.
| * | | core: hid: hid_core: Add (Enable/DIsable)AllControllerConfigurationMorph2021-11-292-0/+32
| | | |
| * | | general: Fix handheld typoMorph2021-11-292-17/+17
| | | |
| * | | core: hid: Mark constructors as explicitMorph2021-11-292-2/+2
| | | |
| * | | core: hid: Cleanup and amend documentationMorph2021-11-294-69/+76
| | | |
* | | | input_common: Fix error with thread nameNarr the Reg2021-11-301-2/+1
| | | |
* | | | Merge pull request #7466 from vonchenplus/add_miss_pixel_format_mappingbunnei2021-11-301-0/+2
|\ \ \ \ | |/ / / |/| | | Add missing pixel format mapping
| * | | Add missing pixel format mappingFeng Chen2021-11-291-0/+2
| |/ /
* | | Merge pull request #7465 from german77/no_inputMorph2021-11-291-0/+3
|\ \ \ | |/ / |/| | qt_controller: Fix input when the controller applet is ignored
| * | qt_controller: Fix input when the controller applet is ignoredgerman772021-11-291-0/+3
|/ /
* | Merge pull request #7396 from FernandoS27/blit-this-mfFernando S2021-11-2814-223/+168
|\ \ | | | | | | TextureCache: Eliminate format deduction as full depth conversion has been supported.
| * | Texture Cache: Secure insertions against deletions.Fernando Sahmkow2021-11-281-3/+13
| | |
| * | Texture Cache: Redesigning the blitting system (again).Fernando Sahmkow2021-11-273-23/+64
| | |
| * | Texture Cache: Further fix regressions.Fernando Sahmkow2021-11-261-11/+15
| | |
| * | Texture Cache: Fix issue with blitting 3D textures.Fernando Sahmkow2021-11-221-2/+4
| | |
| * | Texture Cache: Correct conversion shaders.Fernando Sahmkow2021-11-222-2/+2
| | |
| * | Texture Cache: Always copy on NVIDIA.Fernando Sahmkow2021-11-221-0/+5
| | |
| * | TextureCache: Simplify blitting of D24S8 formats and fix bugs.Fernando Sahmkow2021-11-2210-195/+73
| | |
| * | VulkanTexturECache: Use reinterpret on D32_S8 formats.Fernando Sahmkow2021-11-211-2/+7
| | |
| * | HostShaders: Fix D24S8 convertion shaders.Fernando Sahmkow2021-11-216-23/+47
| | |
| * | TextureCache: Eliminate format deduction as full depth conversion has been supported.Fernando Sahmkow2021-11-212-29/+5
| | |
* | | Merge pull request #7438 from german77/homebrew2bunnei2021-11-286-2/+146
|\ \ \ | | | | | | | | Core: Stub services and functions needed for checkpoint
| * | | core/ns: Implement GetReadOnlyApplicationControlDataInterfaceNarr the Reg2021-11-282-1/+26
| | | | | | | | | | | | | | | | Used in checkpoint homebrew
| * | | core/pdm: Stub QueryPlayStatisticsByApplicationIdAndUserAccountIdNarr the Reg2021-11-284-0/+107
| | | | | | | | | | | | | | | | Used in checkpoint homebrew
| * | | core/hid: Stub GetUniquePadsFromNpadNarr the Reg2021-11-271-1/+13
| | | | | | | | | | | | | | | | Used in checkpoint homebrew
* | | | Merge pull request #7451 from german77/debug_controllerbunnei2021-11-288-0/+75
|\ \ \ \ | |/ / / |/| | | settings: Add debug setting to enable all controllers
| * | | settings: Add debug setting to enable all controllersgerman772021-11-288-0/+75
|/ / /
* | | Merge pull request #7255 from german77/krakenFernando S2021-11-27146-11257/+13922
|\ \ \ | | | | | | | | Project Kraken: Input rewrite
| * | | config: Remove vibration configurationgerman772021-11-277-104/+3
| | | |
| * | | applet/controller: Enable configuring mode while the applet is opengerman772021-11-271-7/+12
| | | |
| * | | input_common: Fully implement UDP controllersNarr the Reg2021-11-2612-40/+397
| | | |
| * | | service/hid: Finish converting LIFO objects and address some nitsNarr the Reg2021-11-2514-95/+50
| | | |
| * | | yuzu: Fix TAS from rebasegerman772021-11-253-9/+11
| | | |
| * | | input_common: Move button names to the frontendgerman772021-11-2512-52/+160
| | | |
| * | | input_common: Fix SDL controller with inverted axisgerman772021-11-252-24/+8
| | | |
| * | | bootmanager: Use cross-platform keyboard inputgerman772021-11-253-39/+58
| | | |
| * | | kraken: Address comments from reviewgerman772021-11-2517-66/+54
| | | | | | | | | | | | | | | | Fix compiler bug
| * | | core/hid: Improve accuary of mouse implementationgerman772021-11-2514-48/+79
| | | |
| * | | core/hid: Fully implement native mousegerman772021-11-2521-1039/+323
| | | |
| * | | input_common: Allow keyboard to be backwards compatiblegerman772021-11-2510-48/+115
| | | |
| * | | core/hid: Improve accuracy of the keyboard implementationgerman772021-11-2513-313/+682
| | | |
| * | | core/hid: Fix keyboard alignmentgerman772021-11-252-12/+14
| | | |
| * | | core/hid: Remove usage of native types, fix a couple of errors with motiongerman772021-11-2511-428/+632
| | | |
| * | | settings: Remove includes of core.hgerman772021-11-2510-57/+55
| | | |
| * | | service/hid: Remove includes of core.h and settings.hgerman772021-11-2529-67/+67
| | | |
| * | | UI nitsLevi Behunin2021-11-251-9/+6
| | | | | | | | | | | | | | | | | | | | Set top margin to 6 on Right Stick, LeftStick, Face Buttons, D-Pad. Change property on Input Device QComboBox from minimumSize to minimumContentsLength.
| * | | service/hid: Add support for new controllersgerman772021-11-252-2/+31
| | | |
| * | | settings: Fix controller preview not displaying the correct controllergerman772021-11-253-4/+7
| | | |
| * | | core/hid: Rename NpadType to NpadStyleIndexgerman772021-11-2515-215/+228
| | | |
| * | | config: Cleanup and documentationgerman772021-11-258-99/+46
| | | |
| * | | input_common: Fix motion from 3 axisgerman772021-11-251-0/+2
| | | |
| * | | core/hid: Prevent Emulated controller from flapping with multiple inputs devicesgerman772021-11-255-36/+77
| | | |
| * | | core/hid: Fully emulate motion from buttongerman772021-11-257-37/+97
| | | |
| * | | second commit lion reviewgerman772021-11-2528-42/+73
| | | |
| * | | settings: Fix Debug controller type optionsgerman772021-11-2513-95/+77
| | | |
| * | | kraken: Address comments from reviewgerman772021-11-2531-466/+534
| | | | | | | | | | | | | | | | start lion review
| * | | input_common: Revert deleted TAS functionsgerman772021-11-257-48/+122
| | | |
| * | | core/hid: Explain better what a temporary value doesgerman772021-11-252-24/+28
| | | |
| * | | input_common: Fix GC adapter initializationgerman772021-11-251-12/+12
| | | | | | | | | | | | | | | | Fix GC controller
| * | | core/hid: Update structs to 13.1.0german772021-11-2512-50/+107
| | | |
| * | | core/hid: Add TAS inputgerman772021-11-256-13/+82
| | | |
| * | | input_common: Fix UDP uuidgerman772021-11-253-2/+16
| | | |
| * | | input_common: Add multiple vibration curvesgerman772021-11-252-15/+28
| | | |
| * | | core/hid: Rework battery mappingsgerman772021-11-259-46/+109
| | | |
| * | | input_common: Add manual update options to input devicesgerman772021-11-255-0/+56
| | | |
| * | | service/hid: Fix memory allocated incorrectlygerman772021-11-255-7/+7
| | | |
| * | | settings: Fix mouse and keyboard mappingsgerman772021-11-2510-105/+102
| | | |
| * | | web_applet: Replace HIDButton with NpadButtongerman772021-11-253-36/+44
| | | |
| * | | Morph review first wavegerman772021-11-2523-136/+117
| | | |
| * | | service/hid: Match shared memory closer to HWgerman772021-11-252-26/+75
| | | |
| * | | yuzu: Fix loading input profilesgerman772021-11-252-0/+9
| | | |
| * | | kraken: Address comments from reviewgerman772021-11-2515-56/+56
| | | | | | | | | | | | | | | | review fixes
| * | | service/hid: Use ring buffer for gesturesgerman772021-11-252-79/+52
| | | |
| * | | service/hid: Fix gesture inputgerman772021-11-258-91/+159
| | | |
| * | | configuration: Migrate controller settings to emulated controllergerman772021-11-2512-127/+141
| | | |
| * | | core/hid: Fix rumble too strong at 1%german772021-11-253-13/+48
| | | |
| * | | core/hid: Only signal when neededgerman772021-11-2511-153/+240
| | | |
| * | | hid: Fix controller connection/disconnectiongerman772021-11-2510-65/+226
| | | |
| * | | core/hid: Documment some filesgerman772021-11-254-52/+265
| | | |
| * | | kraken: Fix errors from rebase and format filesgerman772021-11-2520-53/+83
| | | |
| * | | core/hid: Add output devicesgerman772021-11-2520-144/+312
| | | |
| * | | core: Update input interpretergerman772021-11-254-54/+18
| | | |
| * | | yuzu: Update overlay appletgerman772021-11-252-16/+21
| | | |
| * | | core/frontend: Update appletsgerman772021-11-252-10/+15
| | | |
| * | | core: Remove frontend/inputgerman772021-11-251-217/+0
| | | |
| * | | service/hid: Rewrite npad to use ring lifo and the emulated controllergerman772021-11-252-890/+605
| | | |
| * | | service/hid: Update console sixaxis to the emulated consolegerman772021-11-252-28/+26
| | | |
| * | | service/hid: Update mouse and keyboard to use ring lifo and the emulated devicegerman772021-11-254-158/+71
| | | |
| * | | service/hid: Update touch and gestures to use ring lifo and the emulated consolegerman772021-11-254-370/+191
| | | |
| * | | service/hid: Update debug pad, xpad, stubbed and controller base to use ring lifo and the emulated controllergerman772021-11-257-166/+80
| | | |
| * | | service/hid: Use remove duplicated code, update namesgerman772021-11-252-64/+30
| | | |
| * | | service/hid: Create ring LIFOgerman772021-11-252-1/+55
| | | |
| * | | Qt_applets: Use new inputgerman772021-11-255-49/+68
| | | |
| * | | settings: Cleanup settingsgerman772021-11-256-9/+16
| | | |
| * | | debugger/controller: Remove TASgerman772021-11-252-46/+5
| | | |
| * | | core/emu_window: Remove touch inputgerman772021-11-252-113/+15
| | | |
| * | | yuzu: Update frontendgerman772021-11-2513-1010/+822
| | | |
| * | | core: Register HIDgerman772021-11-253-4/+25
| | | |
| * | | core/hid: Add emulated controllersgerman772021-11-259-0/+2025
| | | |
| * | | yuzu_cmd: Use new inputgerman772021-11-253-45/+39
| | | |
| * | | yuzu: Use new input on main and bootmanagergerman772021-11-253-68/+59
| | | |
| * | | input_common: Rewrite main and add the new driversgerman772021-11-252-49/+330
| | | |
| * | | input_common: Remove obsolete filesgerman772021-11-255-444/+0
| | | |
| * | | input_common: Rewrite SDLgerman772021-11-256-1757/+950
| | | |
| * | | input_common: Rewrite udp clientgerman772021-11-255-441/+54
| | | |
| * | | input_common: Rewrite tas inputgerman772021-11-255-840/+2
| | | |
| * | | input_common: Rewrite gc_adaptergerman772021-11-258-827/+848
| | | |
| * | | input_common: Rewrite touchgerman772021-11-253-0/+99
| | | |
| * | | input_common: Rewrite mousegerman772021-11-257-751/+217
| | | |
| * | | input_common: Rewrite keyboardgerman772021-11-2511-614/+95
| | | |
| * | | input_common: Move touch and analog from button. Move udp protocolgerman772021-11-2510-132/+172
| | | |
| * | | input_common: Create input poller and mappinggerman772021-11-256-0/+1305
| | | |
| * | | input_common: Create input_enginegerman772021-11-252-0/+585
| | | |
| * | | core/hid: Move motion_input, create input converter and hid_typesgerman772021-11-256-0/+1164
| | | |
| * | | core/hid: Move input_interpreter to hidgerman772021-11-254-4/+4
| | | |
| * | | common: Rewrite and move core/frontend/input.h to commongerman772021-11-252-0/+243
| | | |
* | | | Merge pull request #7431 from liushuyu/fix-linux-decodingbunnei2021-11-271-2/+41
|\ \ \ \ | | | | | | | | | | video_core/codecs: fix multiple decoding issues on Linux
| * | | | video_core/codec: address commentsliushuyu2021-11-251-17/+11
| | | | |
| * | | | video_core/codecs: fix multiple decoding issues on Linux ...liushuyu2021-11-251-2/+47
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * when someone installed Intel video drivers on an AMD system, the decoder will select the Intel VA-API decoding driver and yuzu will crash due to incorrect driver selection; the fix will check if the currently about-to-use driver is loaded in the kernel * when using NVIDIA driver on Linux with a ffmpeg that does not have CUDA capability enabled, the decoder will crash; the fix simply making the decoder prefers the VDPAU driver over CUDA on Linux
* | | | | Merge pull request #7440 from lioncash/fmtbunnei2021-11-261-1/+1
|\ \ \ \ \ | | | | | | | | | | | | CMakeLists: Update fmt to 8.0.1
| * | | | | CMakeLists: Update fmt to 8.0.1Lioncash2021-11-261-1/+1
|/ / / / / | | | | | | | | | | | | | | | Ensures that we're using the latest version of fmt.
* | | | | Merge pull request #7330 from MightyCreak/simplify-theme-selectionbunnei2021-11-252-25/+27
|\ \ \ \ \ | |_|/ / / |/| | | | Replace "Light" theme by "Default"
| * | | | Replace "Light" theme by "Default"Romain Failliot2021-11-142-25/+27
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This reflects the current behavior: Light = System default. If your system is set to dark theme, then Light = Dark, which is a bit confusing for the end user. In this PR, I propose to change "Light" with "Default". This way, the user has "Default" and "Default Colorful", which will apply the system theme. Now that the Flatpak respects the system theme, I think this makes much more sense. I also simplified the theme update. Before the code was branching between the default theme and the others, but I think we can have something simpler by forcing the default theme if no theme is defined in the settings, or if the selected theme doesn't exist. And if there's an error, tell the theme name in the error message.
* | | | | Refactor menu states and shortcuts in GMainWindow. (#7419)Adam Heinermann2021-11-253-237/+175
| |/ / / |/| | | | | | | | | | | | | | | | | | | | | | | | | | | Refactor menu states and shortcuts in GMainWindow. - Removed "Start", since it was always disabled unless it was "Continue" which has now been moved to "Pause". - Allow hotkeys to be used while in fullscreen. - Removed the load amiibo hotkey.
* | | | Merge pull request #7404 from Kewlan/per-game-framerate-capbunnei2021-11-245-27/+99
|\ \ \ \ | | | | | | | | | | configure_general: Allow framerate cap to be used in custom game configs
| * | | | configure_general: Allow framerate cap to be used in custom game configsKewlan2021-11-215-27/+99
| | | | |
* | | | | Merge pull request #7394 from Morph1984/svc-SetMemoryPermissionbunnei2021-11-225-12/+64
|\ \ \ \ \ | | | | | | | | | | | | kernel: svc: Implement SetProcessMemoryPermission
| * | | | | kernel: svc: Move all IsValid functions to an anonymous namespaceMorph2021-11-211-3/+15
| | | | | |
| * | | | | kernel: svc: Implement SetProcessMemoryPermissionMorph2021-11-211-1/+41
| | | | | | | | | | | | | | | | | | | | | | | | - Used by Skyline modding framework
| * | | | | kernel: KPageTable: Rename SetCodeMemoryPermission to SetProcessMemoryPermissionMorph2021-11-214-8/+8
| | |_|/ / | |/| | |
* | | | | Merge pull request #7406 from heinermann/tas_menuMai M2021-11-225-57/+152
|\ \ \ \ \ | | | | | | | | | | | | Added TAS controls to the menu under Tools
| * | | | | const fixesAdam Heinermann2021-11-222-3/+3
| | | | | |
| * | | | | Apply clang formatAdam Heinermann2021-11-221-1/+0
| | | | | |
| * | | | | Added TAS controls to the menu under ToolsAdam Heinermann2021-11-225-57/+153
| | |/ / / | |/| | |
* | | | | Merge pull request #7407 from jam1garner/ic-ivau-instructionMai M2021-11-221-0/+20
|\ \ \ \ \ | |/ / / / |/| | | | Add InstructionCacheOperationRaised handler for 'ic ivau' instruction
| * | | | arm: dynarmic: Cleanup icache op handlingjam1garner2021-11-221-10/+9
| | | | |
| * | | | arm: dynarmic: Implement icache op handling for 'ic iallu' instructionjam1garner2021-11-221-0/+3
| | | | |
| * | | | arm: dynarmic: Implement icache op handling for 'ic ivau' instructionjam1garner2021-11-221-0/+18
|/ / / /
* | | | Merge pull request #7395 from Morph1984/resolve-commentsbunnei2021-11-213-31/+16
|\ \ \ \ | | | | | | | | | | general: Resolve comments in PR #7368
| * | | | vk_texture_cache: Mark VkBufferUsageFlags as static constexprMorph2021-11-211-3/+3
| | | | |
| * | | | vk_blit_image: Consolidate CreatePipelineTargetEx functionsMorph2021-11-212-28/+13
| |/ / /
* | | | Merge pull request #7389 from ameerj/screenshot-1xbunnei2021-11-215-20/+8
|\ \ \ \ | | | | | | | | | | Fix screenshot dimensions when at 1x scale
| * | | | Fix screenshot dimensions when at 1x scaleameerj2021-11-205-20/+8
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This was regressed by ART. Prior to ART, the screenshots were saved at the title's framebuffer resolution. A misunderstanding of the existing logic led to screenshot dimensions becoming dependent on the host render window size. This changes the behavior to match how it was prior to ART at 1x, with screenshots now always being the title's framebuffer dimensions scaled by the resolution scaling factor.
* | | | | Merge pull request #7359 from heinermann/kthread_crashbunnei2021-11-211-8/+14
|\ \ \ \ \ | | | | | | | | | | | | Fix crash on exit due to static scoped dummy threads
| * | | | | Fix crash on exit due to static scoped dummy threadsAdam Heinermann2021-11-181-8/+14
| | | | | |
* | | | | | Merge pull request #7393 from Morph1984/pm-ams-get-pidbunnei2021-11-211-9/+38
|\ \ \ \ \ \ | |_|_|/ / / |/| | | | | service: pm: Implement AtmosphereGetProcessId
| * | | | | service: pm: Implement AtmosphereGetProcessIdMorph2021-11-211-0/+24
| | | | | | | | | | | | | | | | | | | | | | | | - Used by Skyline modding framework
| * | | | | service: pm: Add all relevant result codesMorph2021-11-211-3/+8
| | | | | |
| * | | | | service: pm: Rename title id to program idMorph2021-11-211-6/+6
| | |/ / / | |/| | |
* | | | | Merge pull request #7368 from FernandoS27/vulkan-convbunnei2021-11-2118-23/+595
|\ \ \ \ \ | |/ / / / |/| | | | Fix ART Blit detection regression and add D24S8 <-> RGBA8 conv to Vulkan
| * | | | TextureCache: Refactor and fix linux compiling.Fernando Sahmkow2021-11-203-9/+11
| | | | |
| * | | | TextureCache: Assure full conversions on depth/stencil write shaders.Fernando Sahmkow2021-11-203-6/+6
| | | | |
| * | | | TextureCache: Implement buffer copies on Vulkan.Fernando Sahmkow2021-11-206-9/+193
| | | | |
| * | | | TextureCache: Add R16G16 to D24S8 converter.Fernando Sahmkow2021-11-205-0/+38
| | | | |
| * | | | TextureCache: Add B10G11R11 to D24S8 converter.Fernando Sahmkow2021-11-195-13/+84
| | | | |
| * | | | TextureCache: Further fixes on resolve algorithm.Fernando Sahmkow2021-11-192-16/+17
| | | | |
| * | | | TextureCache: Implement additional D24S8 convertions.Fernando Sahmkow2021-11-196-0/+86
| | | | |
| * | | | TextureCache: force same image format when resolving an image.Fernando Sahmkow2021-11-192-2/+9
| | | | |
| * | | | TextureCache: Fix regression caused by ART and improve blit detection algorithm to be smarter.Fernando Sahmkow2021-11-192-10/+27
| | | | |
| * | | | Vulkan: implement D24S8 <-> RGBA8 convertions.Fernando Sahmkow2021-11-196-0/+166
| | |_|/ | |/| |
* | | | Merge pull request #7294 from vonchenplus/fix_image_update_error_when_width_too_smallbunnei2021-11-202-10/+18
|\ \ \ \ | | | | | | | | | | Fix image update/download error when width too small
| * | | | Fix image update/download error when width too smallFeng Chen2021-11-172-10/+18
| | |/ / | |/| |
* | | | Merge pull request #7369 from Morph1984/amd-fsr-statusbarbunnei2021-11-192-6/+6
|\ \ \ \ | | | | | | | | | | main: Shorten AMD FSR status bar text
| * | | | main: Fix default AA nameMorph2021-11-191-4/+4
| | | | | | | | | | | | | | | | | | | | By default, no AA is applied, not FXAA
| * | | | configure_graphics_ui: AMD's -> AMDMorph2021-11-191-1/+1
| | | | | | | | | | | | | | | | | | | | AMD officially markets FSR as AMD FidelityFX™️ Super Resolution
| * | | | main: Shorten AMD FSR status bar textMorph2021-11-191-1/+1
| | |/ / | |/| | | | | | | | | | AMD'S FIDELITYFX SR -> FSR
* | | | Merge pull request #7273 from fpdotmonkey/submodule-checkout-command-on-new-linebunnei2021-11-191-1/+1
|\ \ \ \ | | | | | | | | | | Move the cmake submodule checkout command to a new line
| * | | | Move the cmake submodule checkout command to a new lineFletcher Porter2021-11-021-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Presently, if you forget to initialize the git submodules before running cmake, there'll be a helpful message that reminds you to do so. However, on narrow terminals (e.g. 80 wide) there's a word wrap that includes a new line in the middle of the git command, precluding easy copy-paste. This moves the entire git command to its own line to avoid such tragedies. Before: ``` CMake Error at CMakeLists.txt:59 (message): Git submodule externals/inih/inih not found. Please run: git submodule update --init --recursive ``` After: ``` CMake Error at CMakeLists.txt:59 (message): Git submodule externals/inih/inih not found. Please run: git submodule update --init --recursive ```
* | | | | Merge pull request #7342 from goldenx86/patch-3bunnei2021-11-191-2/+2
|\ \ \ \ \ | | | | | | | | | | | | Replace keys error pop up
| * | | | | Replace keys error pop upMatías Locatti2021-11-161-2/+2
| | | | | | | | | | | | | | | | | | Fight me.
* | | | | | Merge pull request #7357 from Morph1984/s8_uintbunnei2021-11-1910-9/+64
|\ \ \ \ \ \ | |_|_|/ / / |/| | | | | video_core: Implement S8_UINT format
| * | | | | renderer_vulkan: Implement S8_UINT stencil formatMorph2021-11-183-0/+18
| | | | | | | | | | | | | | | | | | | | | | | | It should be noted that on Windows, only nvidia gpus support this format natively as of this commit.
| * | | | | renderer_opengl: Implement S8_UINT stencil formatMorph2021-11-173-6/+25
| | | | | |
| * | | | | video_core: Add S8_UINT stencil formatMorph2021-11-174-3/+21
| | |_|/ / | |/| | |
* | | | | Merge pull request #7349 from ameerj/ogl-convert-imagebunnei2021-11-185-28/+49
|\ \ \ \ \ | | | | | | | | | | | | gl_texture_cache: Implement pixel format conversions for copies
| * | | | | gl_texture_cache: Round format conversion PBO to next power of 2ameerj2021-11-181-1/+5
| | | | | |
| * | | | | texture_cache: Use pixel format conversion when supported by the runtimeameerj2021-11-175-0/+15
| | | | | |
| * | | | | gl_texture_cache: Make FormatConversionPass more genericameerj2021-11-171-7/+12
| | | | | | | | | | | | | | | | | | | | | | | | This allows the usage of the FormatConversionPass to be applied to more than the previously used BGR conversion scenarios.
| * | | | | gl_texture_cache: Rename BGRCopyPass to FormatConversionPassameerj2021-11-172-21/+18
| |/ / / /
* | | | | Merge pull request #7353 from v1993/no-more-epilepsybunnei2021-11-181-1/+1
|\ \ \ \ \ | | | | | | | | | | | | Prevent window flickering when holding Esc
| * | | | | Prevent window flickering when holding EscValeri2021-11-171-1/+1
| | |/ / / | |/| | | | | | | | Reported on discord by Levlight. Don't try to exit fullscreen if it's already off.
* | | | | Merge pull request #7348 from Morph1984/ci-disable-submodule-fetchAmeer J2021-11-182-2/+2
|\ \ \ \ \ | | | | | | | | | | | | ci: Don't fetch submodules when fetching PRs
| * | | | | ci: Don't fetch submodules when fetching PRsMorph2021-11-172-2/+2
| | |/ / / | |/| | |
* | | | | Merge pull request #7355 from german77/hotkey_spambunnei2021-11-181-0/+2
|\ \ \ \ \ | |/ / / / |/| | | | hotkeys: Don't allow hotkeys to spam
| * | | | hotkeys: Don't allow hotkeys to spamgerman772021-11-171-0/+2
| | | | |
* | | | | Merge pull request #7219 from FernandoS27/aristotles-right-testiclebunnei2021-11-17120-646/+9051
|\ \ \ \ \ | | | | | | | | | | | | Project A.R.T. Advanced Rendering Techniques
| * | | | | TextureCache: Fix Automatic Anisotropic.Fernando Sahmkow2021-11-171-6/+5
| | | | | |
| * | | | | TextureCache: OGL query device memory if possible.FernandoS272021-11-172-2/+14
| | | | | |
| * | | | | TextureCache: Fix OGL cleaningFernando Sahmkow2021-11-175-0/+43
| | | | | |
| * | | | | TextureCache: Add automatic anisotropic filtering and refactor code.Fernando Sahmkow2021-11-165-16/+22
| | | | | |
| * | | | | TextureCache: Make a better Anisotropic setter.Fernando Sahmkow2021-11-164-24/+21
| | | | | |
| * | | | | Texture Cache: revert Image changes.Fernando Sahmkow2021-11-161-0/+4
| | | | | |
| * | | | | ShaderCache: Better fix for Shuffling gl_FragCoordFernando Sahmkow2021-11-161-2/+13
| | | | | |
| * | | | | HostShader: fix Gaussian filter.FernandoS272021-11-161-2/+2
| | | | | |
| * | | | | Texture Cahe/Shader decompiler: Resize PointSize on rescaling, refactor and make reaper more agressive on 4Gb GPUs.FernandoS272021-11-165-22/+29
| | | | | |
| * | | | | texture_cache: Refactor Render Target scaling functionameerj2021-11-162-14/+24
| | | | | |
| * | | | | gl_resource_manager: Ensure non EXT_framebuffer objects are createdameerj2021-11-162-13/+8
| | | | | |
| * | | | | Texture Cache: Fix memory usage on ScaleDown.FernandoS272021-11-161-4/+0
| | | | | |
| * | | | | OpenGL: Fix viewport/Scissor scaling on downscaling.FernandoS272021-11-161-6/+28
| | | | | |
| * | | | | Vulkan: fix regression.FernandoS272021-11-161-14/+17
| | | | | |
| * | | | | host_shaders: Misc copyright/style changesameerj2021-11-164-10/+12
| | | | | |
| * | | | | configure_graphics.ui: Cleanup scaling options and fix duplicate name warningameerj2021-11-161-5/+5
| | | | | |
| * | | | | FSR: Fix GCC build errorsameerj2021-11-163-43/+50
| | | | | |
| * | | | | Vulkan: Reimplement FSR constant generation functions to avoid GCC warningsMarshall Mohror2021-11-163-12/+145
| | | | | |
| * | | | | vk_blit_screen: Fix AA destruction orderameerj2021-11-161-9/+10
| | | | | |
| * | | | | Presentation: Only use FP16 in scaling shaders on supported devices in VulkanMarshall Mohror2021-11-1615-116/+200
| | | | | |
| * | | | | renderer_vulkan/blit_image: Use generic color state on Depth to Color blitsameerj2021-11-161-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | Fixes Bayonetta 2 on AMD
| * | | | | vk_texture_cache: Refactor 3D scaling helpersameerj2021-11-162-113/+74
| | | | | |
| * | | | | gl_rasterizer: Fix ScissorTest and Clear when scalingameerj2021-11-161-10/+6
| | | | | |
| * | | | | gl_texture_cache: Simplify scaling proceduresameerj2021-11-162-57/+28
| | | | | |
| * | | | | OpenGlTextureCache: Fix state invalidation on rescaling.Fernando Sahmkow2021-11-163-2/+17
| | | | | |
| * | | | | VulkanBufferCache: Avoid adding barriers between multiple copies.Fernando Sahmkow2021-11-163-5/+43
| | | | | |
| * | | | | HostShader: Fix gaussian and add attribution.Fernando Sahmkow2021-11-161-23/+19
| | | | | |
| * | | | | Yuzu UI: Add button for Anti AliasFernando Sahmkow2021-11-163-0/+45
| | | | | |
| * | | | | Vulkan: Fix FXAA in AMD.Fernando Sahmkow2021-11-161-2/+40
| | | | | |
| * | | | | Texture Cache: Fix blitting.Fernando Sahmkow2021-11-161-2/+2
| | | | | |
| * | | | | Vulkan: Implement FXAAFernandoS272021-11-163-22/+387
| | | | | |
| * | | | | OpenGL: fix FXAA with scalingMarshall Mohror2021-11-162-9/+31
| | | | | |
| * | | | | OpenGL: Implement FXAAMarshall Mohror2021-11-166-35/+194
| | | | | |
| * | | | | Frontend: Add anti-aliasing method settingMarshall Mohror2021-11-165-0/+70
| | | | | |
| * | | | | Settings: Add anti-aliasing method settingMarshall Mohror2021-11-162-0/+7
| | | | | |
| * | | | | QtGUI: Add buttton to toggle the filter.FernandoS272021-11-165-1/+61
| | | | | |
| * | | | | VideoCore: Add gaussian filtering.FernandoS272021-11-168-2/+140
| | | | | |
| * | | | | TextureCache: Improve Reaper.FernandoS272021-11-162-14/+26
| | | | | |
| * | | | | Vulkan: fix waiting on semaphore.FernandoS272021-11-161-1/+3
| | | | | |
| * | | | | Update scaleforce to use FP16Marshall Mohror2021-11-161-88/+55
| | | | | |
| * | | | | VideoCore: Add more rescaling option.FernandoS272021-11-163-7/+38
| | | | | |
| * | | | | TextureCache: fix rescaling in aliases and overlap joins.FernandoS272021-11-164-23/+48
| | | | | |
| * | | | | Presentation: Fix turning FSR on and off in settingsMarshall Mohror2021-11-161-0/+11
| | | | | |
| * | | | | Video Core: fix building for GCC.Fernando Sahmkow2021-11-165-24/+42
| | | | | |
| * | | | | Vulkan Rasterizer: Fix clears on integer textures.FernandoS272021-11-163-1/+84
| | | | | |
| * | | | | Texture cache: fix Intel with rescaler.FernandoS272021-11-161-2/+2
| | | | | |
| * | | | | TextureCache: Fix blitting filter in Vulkan and correct viewport/scissor calculation when downscaling.FernandoS272021-11-162-20/+44
| | | | | |
| * | | | | Texture Cache: fix memory managment and optimize scaled downloads, uploads.Fernando Sahmkow2021-11-167-28/+57
| | | | | |
| * | | | | Texture Cache: ease the requirements of textures being blacklisted.Fernando Sahmkow2021-11-162-22/+7
| | | | | |
| * | | | | Vulkan: Fix Blit Depth StencilFernando Sahmkow2021-11-162-14/+20
| | | | | |
| * | | | | Texture Cache: Fix downscaling and correct memory comsumption.Fernando Sahmkow2021-11-168-36/+147
| | | | | |
| * | | | | Presentation: add Nearest Neighbor filter.Fernando Sahmkow2021-11-166-14/+67
| | | | | |
| * | | | | externals: Add only included ffx-fsr headersameerj2021-11-163-0/+3874
| | | | | | | | | | | | | | | | | | | | | | | | The submodule adds a lot of unneeded bloat due its addition of samples that contain large media files that are difficult to compress.
| * | | | | vulkan: Implement FidelityFX Super ResolutionMarshall Mohror2021-11-1611-17/+643
| | | | | |
| * | | | | Texture Cache: Rescale conversions between depth and colorFernandoS272021-11-166-25/+37
| | | | | |
| * | | | | Texture cache: Fix memory consumption and ignore rating when a depth texture is rendered.Fernando Sahmkow2021-11-163-7/+19
| | | | | |
| * | | | | vulkan: Fix rescaling push constant usageameerj2021-11-168-69/+78
| | | | | |
| * | | | | Texture Cahe: Fix downscaling on SMO.Fernando Sahmkow2021-11-165-0/+11
| | | | | |
| * | | | | texture_cache_base: Remove unused function declarationsameerj2021-11-161-8/+0
| | | | | |
| * | | | | yuzu: Fix build errorsameerj2021-11-161-1/+1
| | | | | |
| * | | | | vk_texture_cache: Use 3D to scale images when blit is unsupportedameerj2021-11-164-29/+87
| | | | | |
| * | | | | texture_cache: Fix infinitely recursive ImageCanRescale checkameerj2021-11-163-10/+13
| | | | | |
| * | | | | vk_texture_cache: Fix BlitScale of non-2D imagesameerj2021-11-161-10/+9
| | | | | |
| * | | | | video_core: Refactor resolution scale functionameerj2021-11-164-46/+34
| | | | | |
| * | | | | texture_cache: Fix image resolves when src/dst are not both scaledameerj2021-11-161-5/+8
| | | | | |
| * | | | | yuzu_cmd: Read resolution_setup and scaling_filter from configlat9nq2021-11-162-0/+25
| | | | | | | | | | | | | | | | | | | | | | | | Also adds descriptions and the settings to the default config.
| * | | | | video_core,yuzu: Move UpdateRescalingInfo call to video_corelat9nq2021-11-163-5/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This only needs to happen once per game boot, so we can just call it during CreateGPU and be done with it, avoiding the need to call it in the frontends.
| * | | | | gl_texture_cache: Disable scissor test when scaling texturesameerj2021-11-161-0/+8
| | | | | | | | | | | | | | | | | | | | | | | | Fixes a bug on BOTW where some objects were no longer being rendered after blitting
| * | | | | vk_texture_cache: Fix unsupported blit format error checkingameerj2021-11-162-9/+9
| | | | | |
| * | | | | vk_texture_cache: Fix early returns on unsupported scalesameerj2021-11-162-19/+11
| | | | | |
| * | | | | video_core: Misc resolution scaling related refactoringameerj2021-11-168-47/+51
| | | | | |
| * | | | | texture_cache: Refactor scaled image size calculationameerj2021-11-162-12/+13
| | | | | |
| * | | | | Texture Cache: Fix calculations when scaling.Fernando Sahmkow2021-11-161-0/+12
| | | | | |
| * | | | | gl_texture_cache: Fix BGR pbo size for scaled texturesameerj2021-11-161-11/+10
| | | | | |
| * | | | | rescaling_pass: Fix IR errors when unscalable texture types are encounteredameerj2021-11-161-0/+28
| | | | | |
| * | | | | Texture Cache: Fix Rescaling on MultisampleFernando Sahmkow2021-11-163-8/+21
| | | | | |
| * | | | | TextureCache: Base fixes on rescaling.Fernando Sahmkow2021-11-162-4/+6
| | | | | |
| * | | | | rescaling_pass: Logic simplification and minor style cleanupameerj2021-11-162-33/+17
| | | | | |
| * | | | | rescaling_pass: Scale ImageFetch offset if it existsameerj2021-11-161-59/+37
| | | | | | | | | | | | | | | | | | | | | | | | Plus some code deduplication
| * | | | | rescaling_pass: Enable PatchImageQueryDimensions on fragment stagesameerj2021-11-161-5/+4
| | | | | |
| * | | | | vk_texture_cache: Simplify scaled image managementameerj2021-11-162-107/+34
| | | | | |
| * | | | | gl_texture_cache: Fix scaling backup logicameerj2021-11-162-20/+16
| | | | | |
| * | | | | vk_rasterizer: Fix scaling on Y_NEGATEameerj2021-11-161-3/+9
| | | | | |
| * | | | | vk_texture_cache: Use nearest neighbor scaling when availableameerj2021-11-164-29/+36
| | | | | |
| * | | | | gl_texture_cache: Fix depth and integer format scaling blitsameerj2021-11-162-16/+61
| | | | | |
| * | | | | gl_texture_cache/rescaling_pass: minor cleanupameerj2021-11-163-16/+10
| | | | | |
| * | | | | vk_texture_cache: Minor cleanupameerj2021-11-162-11/+8
| | | | | |
| * | | | | rescaling_pass: Fix and simplify shuffle/fragcoord passameerj2021-11-161-26/+20
| | | | | |
| * | | | | Shader: Don't rescale FragCoord if used by ShuffleFernando Sahmkow2021-11-162-2/+55
| | | | | |
| * | | | | image_info: Mark MSAA textures as non-rescalableameerj2021-11-161-2/+2
| | | | | | | | | | | | | | | | | | | | | | | | Blitting or resolving multisampled images requires the dimensions of the src and dst to be equal for valid usage, making them difficult for resolution scaling using the current implementation.
| * | | | | bootmanager: Fix screenshot resolution factor usageameerj2021-11-167-20/+13
| | | | | | | | | | | | | | | | | | | | | | | | Fixes screenshots at non integer scaling
| * | | | | gl_texture_cache: Simplify scalingameerj2021-11-162-31/+39
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | We don't need to reconstruct new textures every time we ScaleUp/ScaleDown. We can scale up once, and revert to the original texture whenever scaling down. Fixes memory leaks due to glDeleteTextures being deferred for later handling on some drivers
| * | | | | Renderers: Unify post processing filter shadersameerj2021-11-167-211/+36
| | | | | |
| * | | | | gl_texture_cache: fix scaling on uploadameerj2021-11-161-0/+7
| | | | | |
| * | | | | Renderer: Implement Bicubic and ScaleForce filters.Fernando Sahmkow2021-11-1615-34/+620
| | | | | |
| * | | | | Texture Cache: fix scaling on upload and stop scaling on base resolution.Fernando Sahmkow2021-11-161-14/+32
| | | | | |
| * | | | | shader, video_core: Fix GCC build errorsameerj2021-11-163-14/+3
| | | | | |
| * | | | | emit_spirv: Fix RescalingLayout alignmentameerj2021-11-163-4/+8
| | | | | |
| * | | | | TextureCache: Fix Buffer Views Scaling.Fernando Sahmkow2021-11-162-5/+9
| | | | | |
| * | | | | RescalingPass: Agregate pixels on texelFetch while on Fragment ShaderFernando Sahmkow2021-11-161-3/+97
| | | | | |
| * | | | | Texture Cache: Correctly fix Blits Rescaling.Fernando Sahmkow2021-11-161-9/+12
| | | | | |
| * | | | | shader: Fix TextureSize check on rescaling.Fernando Sahmkow2021-11-161-27/+21
| | | | | |
| * | | | | texture_cache: Disable dst_image scaling in BlitImageameerj2021-11-161-5/+7
| | | | | | | | | | | | | | | | | | | | | | | | Fixes scaling in Super Mario Party
| * | | | | emit_spirv: Fix RescalingLayout alignmentameerj2021-11-162-3/+3
| | | | | |
| * | | | | shader: Properly scale image reads and add GL SPIR-V supportReinUsesLisp2021-11-1625-77/+228
| | | | | | | | | | | | | | | | | | | | | | | | Thanks for everything!
| * | | | | shader: Properly blacklist and scale image loadsReinUsesLisp2021-11-165-11/+31
| | | | | |
| * | | | | texture_cache: Add getter to query if image view is rescaledReinUsesLisp2021-11-165-22/+12
| | | | | |
| * | | | | vk_rasterizer: Minor style changeReinUsesLisp2021-11-161-2/+2
| | | | | |
| * | | | | gl_texture_cache: Fix scaling blitsReinUsesLisp2021-11-161-20/+12
| | | | | |
| * | | | | glsl/glasm: Pass and use scaling parameters in shadersReinUsesLisp2021-11-169-28/+51
| | | | | |
| * | | | | gl_rasterizer: Properly scale viewports and scissorsReinUsesLisp2021-11-161-23/+24
| | | | | |
| * | | | | gl_texture_cache: Fix multi layered texture Scaleameerj2021-11-161-11/+15
| | | | | |
| * | | | | gl_compute_pipeline: Add downscale factor to shader uniformsameerj2021-11-161-0/+9
| | | | | |
| * | | | | gl_rasterizer: Fix rescale dirty state checkingameerj2021-11-161-4/+9
| | | | | |
| * | | | | gl_graphics_pipeline: Add downscale factor to shader uniformsameerj2021-11-164-5/+19
| | | | | |
| * | | | | texture_cache: Fix blacklists on computeReinUsesLisp2021-11-161-1/+1
| | | | | |
| * | | | | texture_cache: Simplify image view queries and blacklistingReinUsesLisp2021-11-1616-192/+192
| | | | | |
| * | | | | Vulkan: Fix downscaling Blit.Fernando Sahmkow2021-11-161-14/+18
| | | | | |
| * | | | | Texture Cache: Implement Rating System.Fernando Sahmkow2021-11-165-15/+47
| | | | | |
| * | | | | OpenGL: set linear mag filter when blitting a downscaled image.Fernando Sahmkow2021-11-161-0/+1
| | | | | |
| * | | | | Vulkan: Fix AA when rescaling.Fernando Sahmkow2021-11-161-1/+1
| | | | | |
| * | | | | Texture Cache: Implement Blacklisting.Fernando Sahmkow2021-11-165-4/+90
| | | | | |
| * | | | | main: Add resolution scale label in the status barMorph2021-11-162-2/+12
| | | | | | | | | | | | | | | | | | | | | | | | Shows the resolution scale as "Scale: {}x" in the status bar, where {} is a floating point value representing the current resolution scaling factor.
| * | | | | vulkan: Implement rescaling shader patchingReinUsesLisp2021-11-168-27/+103
| | | | | |
| * | | | | vk_texture_cache: Properly scale blit source imagesReinUsesLisp2021-11-161-2/+2
| | | | | |
| * | | | | vk_graphics_pipeline: Use Shader::NumDescriptors when possibleReinUsesLisp2021-11-161-18/+6
| | | | | |
| * | | | | opengl: Use Shader::NumDescriptors when possibleReinUsesLisp2021-11-163-46/+20
| | | | | |
| * | | | | spirv: Implement rescaling patchingReinUsesLisp2021-11-168-5/+86
| | | | | |
| * | | | | shader/rescaling_pass: Patch more instructionsReinUsesLisp2021-11-161-4/+101
| | | | | |
| * | | | | shader: Add IsTextureScaled opcodeReinUsesLisp2021-11-1610-0/+34
| | | | | |
| * | | | | texture_cache: Add image gettersReinUsesLisp2021-11-162-0/+16
| | | | | |
| * | | | | shader: Add copy constructor to instructionsReinUsesLisp2021-11-164-1/+20
| | | | | |
| * | | | | shader: Add integer division opcodesReinUsesLisp2021-11-169-0/+37
| | | | | |
| * | | | | common/settings: Remove unused scaling optionsReinUsesLisp2021-11-162-18/+7
| | | | | |
| * | | | | shader: Fix rescaling passReinUsesLisp2021-11-161-1/+1
| | | | | |
| * | | | | gl_texture_cache: Simplify rescalingameerj2021-11-162-19/+15
| | | | | |
| * | | | | texture_cache: Fix typo in aliased image rescalingameerj2021-11-161-1/+1
| | | | | |
| * | | | | vk_texture_cache: Simplify and optimize scaling blitsReinUsesLisp2021-11-161-106/+62
| | | | | |
| * | | | | vk_texture_cache: Fix scaling blit validation errorsReinUsesLisp2021-11-161-81/+78
| | | | | |
| * | | | | shader: Fix resolution scaling passReinUsesLisp2021-11-165-35/+32
| | | | | |
| * | | | | shader: Add resolution down factor opcodeReinUsesLisp2021-11-169-0/+25
| | | | | |
| * | | | | gl_texture_cache: Implement ScaleDownameerj2021-11-162-26/+36
| | | | | |
| * | | | | gl_texture_cache: Rescale fixes for multi-layered texturesameerj2021-11-162-16/+32
| | | | | |
| * | | | | Texture Cache: Implement Rescaling on Aliases and Blits.Fernando Sahmkow2021-11-161-5/+53
| | | | | |
| * | | | | Fix blits with mipsReinUsesLisp2021-11-161-12/+16
| | | | | |
| * | | | | Fix blitsReinUsesLisp2021-11-161-10/+10
| | | | | |
| * | | | | renderer_gl: Resolution scaling fixesameerj2021-11-163-61/+107
| | | | | |
| * | | | | TextureCache: Fix rescaling of ImageCopiesFernando Sahmkow2021-11-163-18/+67
| | | | | |
| * | | | | TextureCache: Modify Viewports/Scissors according to Rescale.Fernando Sahmkow2021-11-166-35/+93
| | | | | |
| * | | | | Settings: eliminate rescaling_factor.Fernando Sahmkow2021-11-167-37/+19
| | | | | |
| * | | | | Texture Cache: More rescaling fixes.Fernando Sahmkow2021-11-164-84/+96
| | | | | |
| * | | | | gl_texture_cache: WIP texture rescaleameerj2021-11-162-3/+69
| | | | | |
| * | | | | Texture Cache: Implement Vulkan UpScaling & DownScalingFernando Sahmkow2021-11-166-42/+327
| | | | | |
| * | | | | ShaderDecompiler: Add initial support for rescaling.Fernando Sahmkow2021-11-162-0/+73
| | | | | |
| * | | | | Settings: Add resolution scaling to settings.Fernando Sahmkow2021-11-166-5/+155
| | | | | |
| * | | | | VideoCore: Initial Setup for the Resolution Scaler.Fernando Sahmkow2021-11-1611-18/+255
| | |/ / / | |/| | |
* | | | | Merge pull request #7347 from lioncash/catchMorph2021-11-171-1/+1
|\ \ \ \ \ | |/ / / / |/| | | | CMakeLists: Update catch to 2.13.7
| * | | | CMakeLists: Update catch to 2.13.7Lioncash2021-11-171-1/+1
|/ / / / | | | | | | | | | | | | Keeps the testing libraries up to date.
* | | | Merge pull request #7326 from ameerj/vp8Fernando S2021-11-1412-26/+183
|\ \ \ \ | | | | | | | | | | codecs: Implement VP8 video decoding support
| * | | | codes: Rename ComposeFrameHeader to ComposeFrameameerj2021-11-137-14/+14
| | | | | | | | | | | | | | | | | | | | These functions were composing the entire frame, not just the headers. Rename to more accurately describe them.
| * | | | CMake: Enable VP8 ffmpeg decodersameerj2021-11-131-0/+3
| | | | |
| * | | | vp8: Implement header compositionameerj2021-11-134-6/+90
| | | | | | | | | | | | | | | | | | | | Enables frame decoding with FFmpeg
| * | | | codecs: Add VP8 codec classameerj2021-11-139-20/+90
| |/ / /
* | | | Merge pull request #7260 from vonchenplus/spirv_support_legacy_attribute_v2bunnei2021-11-143-71/+153
|\ \ \ \ | | | | | | | | | | shader: Spirv support legacy attribute v2
| * | | | Simply legacy attribute implementFeng Chen2021-11-043-152/+125
| | | | |
| * | | | Support gl_FogFragCoord attributevonchenplus2021-10-313-48/+58
| | | | |
| * | | | Support gl_BackSecondaryColor attributevonchenplus2021-10-263-0/+33
| | | | |
| * | | | Support gl_FrontSecondaryColor attributevonchenplus2021-10-263-0/+33
| | | | |
| * | | | Support gl_BackColor attributevonchenplus2021-10-263-0/+33
| | | | |
* | | | | Merge pull request #7305 from Morph1984/cibunnei2021-11-141-1/+2
|\ \ \ \ \ | |_|_|_|/ |/| | | | ci: Print traceback on patch merge failure
| * | | | ci: Print traceback on patch merge failureMorph2021-11-081-1/+2
| | | | |
* | | | | Merge pull request #7272 from behunin/the-courteous-loggerbunnei2021-11-134-28/+41
|\ \ \ \ \ | |_|_|/ / |/| | | | Logging: Impl refactor
| * | | | Refactor Logging ImplLevi Behunin2021-11-024-28/+41
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Loop on stop_token and remove final_entry in Entry. Move Backend thread out of Impl Constructor to its own function. Add Start function for backend thread. Use stop token in PopWait and check if entry filename is nullptr before logging.
* | | | | Merge pull request #7320 from OatmealDome/homebrew-capabilitiesMai M2021-11-111-1/+4
|\ \ \ \ \ | | | | | | | | | | | | program_metadata: Add default ThreadInfo capability
| * | | | | program_metadata: Add default ThreadInfo kernel capabilityOatmealDome2021-11-111-1/+4
|/ / / / /
* | | | | Merge pull request #7303 from Morph1984/swkbd-confirm-skip-textcheckFernando S2021-11-108-33/+51
|\ \ \ \ \ | |_|/ / / |/| | | | applets/swkbd: Skip text checking if the text has been confirmed
| * | | | applets/swkbd: Fix text check message encodingMorph2021-11-081-7/+15
| | | | | | | | | | | | | | | | | | | | The text check message can be encoded in UTF-8.
| * | | | applets/swkbd: Skip text checking if the text has been confirmedMorph2021-11-088-26/+36
|/ / / / | | | | | | | | | | | | | | | | | | | | | | | | Confirm means that the text has already been checked by the application to be correct, but is asking the user for confirmation. The confirmation text itself seems to be corrupted though, this needs to be investigated. Fixes the software keyboard in Famicom Detective Club: The Missing Heir
* | | | service/pctl: Stub EndFreeCommunicationNarr the Reg2021-11-051-1/+8
| | | | | | | | | | | | - Used by Just Dance 2022
* | | | vulkan_device: Add missing vulkan image format R5G6B5 in GetFormatPropertiesFeng Chen2021-11-051-0/+1
| | | | | | | | | | | | - Used by Dragon Quest Builders
* | | | Merge pull request #7279 from Morph1984/system-get-program-idMorph2021-11-0525-59/+48
|\ \ \ \ | | | | | | | | | | general: Get the current process program id directly from the system
| * | | | general: Get the current process program id directly from the systemMorph2021-11-0421-56/+42
| | | | | | | | | | | | | | | | | | | | This allows us to avoid including KProcess' header file in files that only need to get the current process' program id.
| * | | | general: Rename GetTitleID to GetProgramIDMorph2021-11-0424-43/+46
| | | | |
* | | | | Merge pull request #7289 from ameerj/perf-stat-shutdownMorph2021-11-051-1/+1
|\ \ \ \ \ | | | | | | | | | | | | core: Reorder perf_stats destruction order on Shutdown
| * | | | | core: Reorder perf_stats destruction order on Shutdownameerj2021-11-051-1/+1
| |/ / / / | | | | | | | | | | | | | | | Avoids the gpu_core using perf_stats after it's been freed.
* | | | | Merge pull request #7287 from Morph1984/stub-aocFernando S2021-11-052-0/+29
|\ \ \ \ \ | |/ / / / |/| | | | service: aoc: Stub more 13.x functions used by Animal Crossing
| * | | | service: aoc: Stub NotifyUnmountAddOnContentMorph2021-11-042-1/+9
| | | | | | | | | | | | | | | | | | | | Used by Animal Crossing: New Horizons v2.0.0 DLC
| * | | | service: aoc: Stub NotifyMountAddOnContent and NotifyMountAddOnContentMorph2021-11-042-0/+21
| | | | | | | | | | | | | | | | | | | | Used by Animal Crossing: New Horizons v2.0.0 DLC
* | | | | Merge pull request #7282 from ameerj/core-includesbunnei2021-11-04134-219/+8
|\ \ \ \ \ | |/ / / / |/| | | | core: Reduce unused header includes
| * | | | core: Fix transitive include build errorsameerj2021-11-045-0/+9
| | | | |
| * | | | core: Remove unused includesameerj2021-11-04133-221/+1
| | | | |
* | | | | Merge pull request #7285 from german77/accbunnei2021-11-043-3/+3
|\ \ \ \ \ | | | | | | | | | | | | service/acc: Rename Unknown160 to InitializeApplicationInfoV2
| * | | | | service/acc: Rename Unknown160 to InitializeApplicationInfoV2german772021-11-043-3/+3
|/ / / / /
* | | | | Merge pull request #7283 from Morph1984/stub-160Fernando S2021-11-043-0/+9
|\ \ \ \ \ | |/ / / / |/| | | | service: acc: Stub acc:u0 '160'
| * | | | service: acc: Stub acc:u0 '160'Morph2021-11-043-0/+9
|/ / / / | | | | | | | | | | | | | | | | | | | | - Used by Animal Crossing: New Horizons v2.0.0 Since the name is currently unknown, '160' is used as a placeholder.
* | | | Merge pull request #7278 from Morph1984/svc-num-handlesMai M2021-11-032-4/+4
|\ \ \ \ | | | | | | | | | | svc: Correct WaitSynchronization num_handles param type
| * | | | svc: Correct WaitSynchronization num_handles param typeMorph2021-11-032-4/+4
|/ / / / | | | | | | | | | | | | num_handles is a s32
* | | | Merge pull request #7262 from FernandoS27/Buffalo-buffalo-Buffalo-buffalo-buffalobunnei2021-11-037-3/+68
|\ \ \ \ | | | | | | | | | | ShaderCache: Order Phi Arguments from farthest away to nearest.
| * | | | Shader Cahe: Fix Phi Nodes on GLASM.Fernando Sahmkow2021-11-021-1/+1
| | | | |
| * | | | ShaderCache: Fix Phi Nodes Type on OGL.Fernando Sahmkow2021-11-013-2/+30
| | | | |
| * | | | ShaderCache: Order Phi Arguments from farthest away to nearest.Fernando Sahmkow2021-10-315-0/+37
| | | | |
* | | | | Merge pull request #7265 from Morph1984/gl-rasterizer-unused-includeMai M2021-11-021-4/+2
|\ \ \ \ \ | | | | | | | | | | | | gl_rasterizer: Remove unused includes
| * | | | | gl_rasterizer: Remove unused includesMorph2021-11-011-4/+2
| | | | | | | | | | | | | | | | | | | | | | | | This removes unused includes, especially the core includes which were causing this file to be recompiled every time files included by those headers are modified.
* | | | | | Merge pull request #7268 from Morph1984/expected-resultvalMai M2021-11-0215-192/+1103
|\ \ \ \ \ \ | |_|_|_|_|/ |/| | | | | common, result: Implement a subset of std::expected and use it in ResultVal
| * | | | | general: Remove MakeResult helpersMorph2021-11-0213-69/+48
| | | | | | | | | | | | | | | | | | | | | | | | This is made obsolete by the presence of implicit constructors.
| * | | | | hle/result: Amend ResultVal documentationMorph2021-11-021-12/+10
| | | | | | | | | | | | | | | | | | | | | | | | This amends the documentation slightly to reflect the updated interface.
| * | | | | hle/result: Reimplement ResultVal using Common::ExpectedMorph2021-11-021-117/+63
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Common::Expected effectively provides the same functions as ResultVal, so we can implement it with this. This can be replaced with std::expected with minimal effort should it be standardized in the C++ Standard Template Library.
| * | | | | common: Implement a subset of P0323 (std::expected)Morph2021-11-022-0/+988
|/ / / / / | | | | | | | | | | | | | | | | | | | | This implementation is based on and is a subset of the proposed implementation of std::expected https://github.com/TartanLlama/expected/blob/master/include/tl/expected.hpp
* | | | | Merge pull request #7227 from vonchenplus/fix_memory_leak_v2bunnei2021-11-026-24/+54
|\ \ \ \ \ | |_|_|/ / |/| | | | Fix memory leak v2
| * | | | Fix dangling kernel objects when exitingFeng Chen2021-10-272-11/+13
| | | | |
| * | | | Revert PR7009Feng Chen2021-10-272-15/+5
| | | | |
| * | | | Fix memory leakFeng Chen2021-10-274-0/+38
| | |_|/ | |/| |
* | | | Merge pull request #7264 from zhaobot/tx-update-20211101021628Mai M2021-11-0119-5207/+11310
|\ \ \ \ | |_|/ / |/| | | Update translations (2021-11-01)
| * | | Update translations (2021-11-01)The yuzu Community2021-11-0119-5207/+11310
|/ / /
* | | Merge pull request #7246 from german77/userimagebunnei2021-10-311-0/+11
|\ \ \ | | | | | | | | profile_manager: Resize any image bigger than 256p
| * | | profile_manager: Resize any image bigger than 256pgerman772021-10-301-0/+11
| |/ /
* | | Merge pull request #7201 from ameerj/spirv-depth-samplingFernando S2021-10-301-5/+16
|\ \ \ | |_|/ |/| | emit_spirv_image: Fix depth image implicit lod sample in non-fragment stages
| * | emit_spirv_image: Fix depth image implicit lod sample in computeameerj2021-10-171-5/+16
| | | | | | | | | | | | Ensures all drivers behave the same way in this case.
* | | Merge pull request #6702 from lat9nq/disable-screensaverbunnei2021-10-302-1/+23
|\ \ \ | | | | | | | | yuzu_cmd, yuzu qt: Use SDL to disable the screen saver
| * | | yuzu qt: Disable the screensaver with SDL2lat9nq2021-10-302-1/+23
| | | | | | | | | | | | | | | | | | | | Disables the screen saver when a game boots using SDL2 so that it works on any supported platform.
* | | | Merge pull request #7244 from Morph1984/application-lang-pt-brbunnei2021-10-304-3/+30
|\ \ \ \ | | | | | | | | | | file_sys/ns: Add Brazilian Portuguese to the list of ApplicationLanguage
| * | | | file_sys: control_metadata: Add BrazilianPortugueseMorph2021-10-292-2/+4
| | | | |
| * | | | ns: language: Add BrazilianPortuguese to ApplicationLanguageMorph2021-10-292-1/+26
| | | | | | | | | | | | | | | | | | | | It seems that Nintendo finally filled that last empty spot in ApplicationLanguage for a total of 16 supported languages.
* | | | | Merge pull request #7240 from Morph1984/resultval-remove-cvbunnei2021-10-301-2/+2
|\ \ \ \ \ | | | | | | | | | | | | hle/result: Remove cv-qualifiers from Arg in MakeResult
| * | | | | hle/result: Remove cv-qualifiers from Arg in MakeResultMorph2021-10-281-2/+2
| | |_|_|/ | |/| | | | | | | | | | | | | This removes the const qualification for types when MakeResult(arg) is used in a const member function, allowing for automatic deduction and removing the need to manually specify the non-const type as the template argument.
* | | | | Merge pull request #7241 from Morph1984/resultval-move-assignmentbunnei2021-10-291-2/+22
|\ \ \ \ \ | | | | | | | | | | | | hle/result: Add move assignment operator in ResultVal
| * | | | | hle/result: Declare copy/move constructor/assignment as noexceptMorph2021-10-281-3/+3
| | | | | | | | | | | | | | | | | | | | | | | | While we're at it, we can also declare these copy/move constructor/assignment as noexcept.
| * | | | | hle/result: Add move assignment operator in ResultValMorph2021-10-281-0/+20
| | |_|/ / | |/| | | | | | | | | | | | | ResultVal was missing a move assignment operator, add it.
* | | | | Merge pull request #7243 from lat9nq/nvdrv-warnbunnei2021-10-291-0/+15
|\ \ \ \ \ | | | | | | | | | | | | gl_device: Force GLASM on NVIDIA drivers 495-496
| * | | | | gl_device: Force GLASM on NVIDIA drivers 495-496lat9nq2021-10-291-0/+15
| |/ / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | GLSL shaders currently do not render correctly on the recent NVIDIA drivers. This adds a check that forces assembly shaders for these drivers since they seem unaffected and adds a warning informing of the decision. Developers can disable the check by enabling graphics debugging.
* | | | | Merge pull request #7245 from Morph1984/compile-opt-descMai M2021-10-291-0/+1
|\ \ \ \ \ | | | | | | | | | | | | CMakeLists: Document the /GT compile option
| * | | | | CMakeLists: Document the /GT compile optionMorph2021-10-291-0/+1
|/ / / / /
* | | | | Merge pull request #7007 from FernandoS27/intel-optionsMorph2021-10-291-0/+5
|\ \ \ \ \ | |_|_|/ / |/| | | | Build System: Build with JCC Erratum Mitigation
| * | | | Build System: Build with JCC Erratum MitigationFernando Sahmkow2021-09-151-0/+5
| | | | |
* | | | | Merge pull request #7223 from Moonlacer/geometry_property_removalAmeer J2021-10-292-9/+1
|\ \ \ \ \ | |_|/ / / |/| | | | per_game_ui: Geometry Property Removal and Minor Rewording to the Per Game UI
| * | | | Geometry property removal and rewordingMoonlacer2021-10-262-9/+1
| | | | |
* | | | | Merge pull request #7186 from MightyCreak/fix-crash-configure-windowAmeer J2021-10-271-2/+5
|\ \ \ \ \ | |/ / / / |/| | | | ui: fix crash when closing configure window
| * | | | ui: fix crash when closing configure windowRomain Failliot2021-10-151-2/+5
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This crash happens 100% of the time (on Linux at least), you just need to open the configure window and click OK. It seems to happen when the tabs are destroyed and once all the tabs are destroyed, a final signal is sent with `index == -1`. So `debug_tab_tab` doesn't exist anymore when this happens, so the crash.
* | | | | Merge pull request #7193 from FernandoS27/idleMorph2021-10-252-0/+22
|\ \ \ \ \ | |_|_|/ / |/| | | | SVC: Implement svcInfo:IdleTickCount
| * | | | SVC: Implement svcInfo:IdleTickCountFernando Sahmkow2021-10-162-0/+22
| | | | | | | | | | | | | | | | | | | | Used by the Witcher 3
* | | | | Merge pull request #7218 from bylaws/aswdqdsamAmeer J2021-10-252-21/+9
|\ \ \ \ \ | | | | | | | | | | | | Fixup channel submit IOCTL syncpoint parameters
| * | | | | Fixup channel submit IOCTL syncpoint parametersBilly Laws2021-10-242-21/+9
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The current arguments worked by happenstance as games only ever submit one syncpoint and request one fence back, if a game were to do something other than this then the arguments would've been parsed entirely wrong.
* | | | | | Merge pull request #7222 from FernandoS27/fix-indixed-textures-againAmeer J2021-10-241-1/+1
|\ \ \ \ \ \ | | | | | | | | | | | | | | TexturePass: Fix clamping of images as this allowed negative indices.
| * | | | | | TexturePass: Fix clamping of images as this allowed negative indices.Fernando Sahmkow2021-10-241-1/+1
| |/ / / / /
* | | | | | Merge pull request #7221 from astrelsky/stepfixMai M2021-10-241-1/+1
|\ \ \ \ \ \ | | | | | | | | | | | | | | Fixed ARM_Dynamic_64 Step
| * | | | | | Fixed ARM_Dynamic_64 StepAndrew Strelsky2021-10-241-1/+1
|/ / / / / /
* | | | | | Merge pull request #7206 from vonchenplus/fix_vulkan_viewport_issueFernando S2021-10-241-0/+1
|\ \ \ \ \ \ | |/ / / / / |/| | | | | Vulkan Rasterizer: Fix viewport issue
| * | | | | Fix vulkan viewport issueFeng Chen2021-10-221-0/+1
| | | | | |
* | | | | | Merge pull request #7070 from FernandoS27/want-you-badAmeer J2021-10-246-3/+31
|\ \ \ \ \ \ | | | | | | | | | | | | | | Vulkan Rasterizer: Correct DepthBias/PolygonOffset on Vulkan.
| * | | | | | Vulran Rasterizer: address feedback.Fernando Sahmkow2021-10-231-3/+5
| | | | | | |
| * | | | | | Vulkan Rasterizer: Correct DepthBias/PolygonOffset on Vulkan.Fernando Sahmkow2021-09-236-3/+29
| | | | | | |
* | | | | | | Merge pull request #7217 from yuzu-emu/revert-6515-gc_thread_safeNarr the Reg2021-10-232-120/+115
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | Revert "input_common: Fix data race on GC implementation"
| * | | | | | | Revert "input_common: Fix data race on GC implementation"Fernando S2021-10-232-120/+115
|/ / / / / / /
* | | | | | | Merge pull request #6515 from german77/gc_thread_safeFernando S2021-10-232-115/+120
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | input_common: Fix data race on GC implementation
| * | | | | | | input_common: Fix data race on GC implementationRodrigo Locatti2021-08-072-115/+120
| | | | | | | |
* | | | | | | | Merge pull request #7207 from ameerj/vs-2022bunnei2021-10-213-42/+44
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | cmake: Update conan to support Visual Studio 2022
| * | | | | | | | common/alignment: Fix VS2022 compilationameerj2021-10-201-1/+6
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | VS2022 seems to introduce an optimization when moving vectors to check for equality of the element values. AlignmentAllocator needed to overload the equality operator to fix compilation of its usage in vector moving.
| * | | | | | | | input_common: Fix VS2022 compilation errorsameerj2021-10-201-39/+35
| | | | | | | | |
| * | | | | | | | cmake: Update conan for VS2022 supportameerj2021-10-201-2/+3
|/ / / / / / / /
* | | | | | | | Merge pull request #7197 from Moonlacer/tas_help_linkbunnei2021-10-201-2/+2
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | tas_ui: Add a Help Link to the TAS Page on the yuzu Website, Along with Minor Grammar Changes
| * | | | | | | | add_linkMoonlacer2021-10-171-2/+2
| | |_|_|/ / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | remove_accident fix_whoopsie
* | | | | | | | Merge pull request #7198 from ameerj/settings-chronobunnei2021-10-197-24/+20
|\ \ \ \ \ \ \ \ | |_|_|_|/ / / / |/| | | | | | | settings: Remove std::chrono usage
| * | | | | | | settings: Remove std::chrono usageameerj2021-10-177-24/+20
| |/ / / / / / | | | | | | | | | | | | | | | | | | | | | Alleviates the dependency on chrono for all files that include settings.h
* | | | | | | Merge pull request #7173 from Morph1984/invalidate-unmapbunnei2021-10-171-0/+2
|\ \ \ \ \ \ \ | |_|_|_|_|_|/ |/| | | | | | KPageTable: Perform ranged invalidation when unmapping code memory
| * | | | | | KPageTable: Perform ranged invalidation when unmapping code memoryMorph2021-10-131-0/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | Co-Authored-By: Fernando S. <1731197+FernandoS27@users.noreply.github.com>
* | | | | | | Merge pull request #7077 from FernandoS27/face-downAmeer J2021-10-173-6/+8
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | A series of fixes to queries and indexed samplers.
| * | | | | | | Shader Compiler: avoid overflowed indices on indixed samplers.Fernando Sahmkow2021-10-171-1/+2
| | | | | | | |
| * | | | | | | Vulkan Query Cache: make sure to wait for the query result.Fernando Sahmkow2021-09-241-1/+2
| | | | | | | |
| * | | | | | | QueryCache: Flush queries in order of running.Fernando Sahmkow2021-09-241-4/+4
| | | | | | | |
* | | | | | | | Merge pull request #7127 from FernandoS27/i-saw-a-wabbitAmeer J2021-10-172-5/+14
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | A few fixes on Vulkan and Rasterizer Caching
| * | | | | | | | Vulkan: Fix failing barrier on refresh.Fernando Sahmkow2021-10-041-1/+2
| | | | | | | | |
| * | | | | | | | RasterizerInterface: Correct size of CPU addresses to cache.FernandoS272021-10-041-1/+1
| | | | | | | | |
| * | | | | | | | Vulkan: Fix the master SemaphoreFernandoS272021-10-041-4/+12
| | | | | | | | |
* | | | | | | | | Merge pull request #7195 from MightyCreak/fix-warning-typoMai M2021-10-171-1/+1
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | main: fix typo in warning message
| * | | | | | | | | main: fix typo in warning messageRomain Failliot2021-10-161-1/+1
| | |_|_|_|_|_|/ / | |/| | | | | | |
* | | | | | | | | Merge pull request #7192 from zhaobot/tx-update-20211016064801Mai M2021-10-1618-15404/+68096
|\ \ \ \ \ \ \ \ \ | |_|_|_|_|/ / / / |/| | | | | | | | Update translations (2021-10-16)
| * | | | | | | | Update translations (2021-10-16)The yuzu Community2021-10-1618-15404/+68096
|/ / / / / / / /
* | | | | | | | Merge pull request #7190 from Morph1984/missing-ui-mainFernando S2021-10-161-1/+1
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | main: Add missing make_unique for ui
| * | | | | | | | main: Add missing make_unique for uiMorph2021-10-161-1/+1
|/ / / / / / / /
* | | | | | | | Merge pull request #7187 from FernandoS27/boy-i-say-boybunnei2021-10-164-0/+51
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | NVHost_Ctrl: Force wait if the gpu falls behind too long.
| * | | | | | | | NvHost/Core: Address Feedback.Fernando Sahmkow2021-10-163-19/+27
| | | | | | | | |
| * | | | | | | | Suspend temporallyFernandoS272021-10-163-1/+31
| | | | | | | | |
| * | | | | | | | NVHost_Ctrl: Force wait if the gpu falls behind too long.FernandoS272021-10-162-0/+13
| | | | | | | | |
* | | | | | | | | Merge pull request #7189 from FearlessTobi/translation-ciMorph2021-10-161-0/+0
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | .ci/transifex: Mark docker.sh as executable
| * | | | | | | | | .ci/transifex: Mark docker.sh as executableFearlessTobi2021-10-161-0/+0
|/ / / / / / / / /
* | | | | | | | | Merge pull request #7188 from Morph1984/web-applet-includeMorph2021-10-161-0/+1
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | qt_web_browser: Add missing QApplication include
| * | | | | | | | | qt_web_browser: Add missing QApplication includeMorph2021-10-161-0/+1
| |/ / / / / / / /
* / / / / / / / / service/vi: Stub IHOSBinderDriver::TransactParcel GetBufferHistory (#7184)Feng Chen2021-10-161-1/+11
|/ / / / / / / /
* | | | | | | | Merge pull request #7182 from Morph1984/systemMai M2021-10-157-180/+164
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | yuzu: Remove all remaining global system instances
| * | | | | | | | bootmanager: Forward declare System and SystemResultStatusMorph2021-10-151-1/+5
| | | | | | | | |
| * | | | | | | | yuzu: Construct system in GMainWindowMorph2021-10-152-81/+83
| | | | | | | | |
| * | | | | | | | core: Move ResultStatus outside of SystemMorph2021-10-157-67/+69
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Allows it to be a forward declaration in other header files.
| * | | | | | | | yuzu_cmd: Remove remaining static system instancesMorph2021-10-151-3/+2
| | | | | | | | |
| * | | | | | | | core: Remove static system instanceMorph2021-10-152-28/+5
|/ / / / / / / /
* | | | | | | | Merge pull request #7183 from FearlessTobi/translation-ciMai M2021-10-152-0/+48
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | .ci: Use Github Actions to update translation source files
| * | | | | | | | .ci: Use Github Actions to update translation source filesFearlessTobi2021-10-152-0/+48
| | | | | | | | |
* | | | | | | | | Merge pull request #7172 from Morph1984/out-of-boundsMai M2021-10-152-7/+7
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | string_util: Prevent out of bounds access in u16string_view buffer
| * | | | | | | | | string_util: Make use of std::string_view and add bounds checkingMorph2021-10-142-5/+5
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Makes use of std::string_view in StringFromFixedZeroTerminatedBuffer and add bounds checking
| * | | | | | | | | string_util: Prevent out of bounds access in u16string_view bufferMorph2021-10-141-2/+2
| | |_|_|_|/ / / / | |/| | | | | | |
* | | | | | | | | Merge pull request #7174 from MightyCreak/hide-cursor-by-defaultMai M2021-10-151-1/+1
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | Check "Hide mouse on inactivity" by default
| * | | | | | | | | Hide mouse cursor by defaultRomain Failliot2021-10-151-1/+1
| | |_|/ / / / / / | |/| | | | | | |
* | | | | | | | | Merge pull request #7185 from Morph1984/make_unique_uiMai M2021-10-1515-151/+157
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | yuzu: Use make_unique instead of operator new for constructing ui
| * | | | | | | | | main: Use std::unique_ptr for uiMorph2021-10-152-137/+142
| | | | | | | | | |
| * | | | | | | | | configuration: Use std::make_unique instead of operator new for uiMorph2021-10-1513-14/+15
| | | | | | | | | |
* | | | | | | | | | main: Slightly refactor NCA entry installation in InstallNCA (#7181)Creak2021-10-151-8/+6
| |/ / / / / / / / |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * main: Slightly refactor NCA entry installation in InstallNCA Co-authored-by: Ameer J <52414509+ameerj@users.noreply.github.com>
* | | | | | | | | config: Read network_interfacelat9nq2021-10-152-0/+9
|/ / / / / / / / | | | | | | | | | | | | | | | | Let's yuzu_cmd use a network interface. Also adds it to the default ini.
* | / / / / / / settings_ui: Better NVDEC Description For Each Video Rendering Option (#7165)Moonlacer2021-10-151-3/+3
| |/ / / / / / |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * better_description * Revert "better_description" This reverts commit 3a152a6ba6f2d6e02530b69a8194e4db302c8acd. * better_nvdec_wording * best_performance * update_word_stuff * another_update
* | | | | | | Merge pull request #6774 from lat9nq/remove-global-yuzuMorph2021-10-1475-655/+717
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | yuzu qt: Remove global system instances
| * | | | | | | discord_impl: Remove global system instanceslat9nq2021-10-073-6/+13
| | | | | | | |
| * | | | | | | game_list: Remove global instances of Core::Systemlat9nq2021-10-075-13/+19
| | | | | | | |
| * | | | | | | configuration: Add const qualifier where ablelat9nq2021-10-0718-31/+28
| | | | | | | |
| * | | | | | | yuzu qt: Remove global system instances from config, WaitTree, mainlat9nq2021-10-0769-636/+688
| | | | | | | |
* | | | | | | | Merge pull request #7157 from ameerj/vic-surface-sizeMorph2021-10-141-16/+15
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | vic: Use the minimum of surface/frame dimensions when writing the final frame to the GPU
| * | | | | | | | vic: Use the minimum of surface/frame dimensions when writing the final frame to the GPUameerj2021-10-111-16/+15
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Addresses possible buffer overflow behavior.
* | | | | | | | | Merge pull request #7142 from german77/sdl_rangebunnei2021-10-141-3/+4
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | input_common/sdl: Fix joystick range
| * | | | | | | | | input_common/sdl: Fix joystick rangegerman772021-10-111-3/+4
| | |/ / / / / / / | |/| | | | | | |
* | | | | | | | | Merge pull request #7158 from ameerj/window-900pbunnei2021-10-133-36/+53
|\ \ \ \ \ \ \ \ \ | |_|_|/ / / / / / |/| | | | | | | | main: Add option to reset window size to 900p
| * | | | | | | | main: Add option to reset window size to 900pameerj2021-10-113-36/+53
| | |/ / / / / / | |/| | | | | |
* | | | | | | | Merge pull request #7120 from Morph1984/update-dynarmicMai M2021-10-131-0/+0
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | externals: Update dynarmic to cce7e4ee
| * | | | | | | | externals: Update dynarmic to cce7e4eeMorph2021-10-121-0/+0
| | | | | | | | |
* | | | | | | | | Merge pull request #7147 from behunin/patch-1Ameer J2021-10-121-8/+0
|\ \ \ \ \ \ \ \ \ | |/ / / / / / / / |/| | | | | | | | Update configure_tas.ui
| * | | | | | | | Update configure_tas.uiLevi Behunin2021-10-081-8/+0
| | | | | | | | | | | | | | | | | | | | | | | | | | | Remove the geometry property again(7045) after 7090 re-added.
* | | | | | | | | Merge pull request #7109 from vonchenplus/fix_h264_max__reference_num_errorAmeer J2021-10-121-1/+6
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | h264: Use max allowed max_num_ref_frames when using CPU decoding
| * | | | | | | | | h264: Use max allowed max_num_ref_frames when using CPU decodingFeng Chen2021-10-101-1/+6
| | | | | | | | | |
* | | | | | | | | | Merge pull request #7166 from FearlessTobi/port-5811Morph2021-10-1220-406/+0
|\ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | Port citra-emu/citra#5811: "Build system: remove references to travis"
| * | | | | | | | | | Build system: remove references to travisFearlessTobi2021-10-1220-406/+0
|/ / / / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Co-Authored-By: Vitor K <vitor-kiguchi@hotmail.com>
* | | | | | | | | | common/fs/path_util: Slightly refactor PathManagerImpl's constructorCreak2021-10-121-12/+15
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This moves all GenerateYuzuPath calls outside of the platofrm-specific #ifdefs, replacing them with assignments to paths.
* | | | | | | | | | Merge pull request #7161 from MightyCreak/fix-some-warningsbunnei2021-10-123-8/+11
|\ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | Fix a few warnings
| * | | | | | | | | | Create local variables for mouse and wheel positionsRomain Failliot2021-10-121-5/+9
| | | | | | | | | | |
| * | | | | | | | | | Fix a few warningsRomain Failliot2021-10-123-6/+5
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | - configure_input_player_widget.cpp: always better to use `const auto &` whenever possible - profiler.cpp: `ev->pos()` is deprecated, replace with `ev->position()`, which returns floats, thus the addition of `.toPoint()` (same as what's happening in `pos()`) - game_list.cpp: `QString::SplitBehavior` is deprecate, use `Qt::` namespace instead
* | | | | | | | | | | Merge pull request #7164 from ameerj/vmimageMorph2021-10-114-0/+12
|\ \ \ \ \ \ \ \ \ \ \ | |/ / / / / / / / / / |/| | | | | | | | | | ci: Use ubuntu-latest vmImage where applicable
| * | | | | | | | | | ci: Use ubuntu-latest vmImage where applicableameerj2021-10-114-0/+12
|/ / / / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Not specifying the vmImage defaults to ubuntu-16.04, which will be deprecated soon and is experiencing brownouts.
* | | | | | | | | | Merge pull request #7110 from vonchenplus/fix_extract_offline_romefs_errorMorph2021-10-111-0/+10
|\ \ \ \ \ \ \ \ \ \ | |_|_|/ / / / / / / |/| | | | | | | | | applets/web: Fallback to loader to get the manual romfs if none is found
| * | | | | | | | | applets/web: Fallback to loader to get the manual romfs if none is foundFeng Chen2021-10-111-0/+10
| |/ / / / / / / /
* | | | | | | | | Merge pull request #7152 from v1993/patch-6Ameer J2021-10-091-2/+3
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | vic: Allow surface to be higher than frame
| * | | | | | | | | vic: Allow surface to be higher than frameValeri2021-10-091-2/+3
|/ / / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Touhou Genso Wanderer Lotus Labyrinth R decodes 1920x1080 videos into 1920x1088 surface. Only allow mismatch for height, since larger width would result in increasingly offset rows and somewhat defeat entire purpose of this check.
* | | | | | | | | Merge pull request #7138 from ameerj/vic-fmtMai M2021-10-092-125/+154
|\ \ \ \ \ \ \ \ \ | |_|/ / / / / / / |/| | | | | | | | vic: Implement RGBX8 video frame format
| * | | | | | | | vic: Avoid memory corruption when multiple streams with different dimensions are decodedameerj2021-10-081-0/+9
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This is a work around to avoid buffer overflow errors until multi channel/multi stream decoding is supported.
| * | | | | | | | vic: Refactor frame writing methodsameerj2021-10-072-138/+146
| | | | | | | | |
| * | | | | | | | vic: Implement RGBX frame formatameerj2021-10-072-3/+15
| | |/ / / / / / | |/| | | | | |
* | | | | | | | Merge pull request #7139 from Morph1984/service-headersMai M2021-10-0833-40/+13
|\ \ \ \ \ \ \ \ | |/ / / / / / / |/| | | | | | | service: Reduce header include overhead
| * | | | | | | kernel: hle_ipc: Foward declare KAutoObjectMorph2021-10-072-1/+2
| | | | | | | |
| * | | | | | | service: Reduce header include overheadMorph2021-10-0731-39/+11
|/ / / / / / /
* | | | | | | Merge pull request #7118 from ameerj/vc-gpu-implFernando S2021-10-0621-691/+890
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | gpu: Migrate implementation to the cpp file
| * | | | | | | nvflinger: Use jthread and stop_token for VSync threadameerj2021-10-032-32/+8
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Avoids a destruction data race that may occur on the vsync thread
| * | | | | | | nvhost_ctrl: Refactor usage of gpu.LockSync()ameerj2021-10-033-35/+16
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This seems to only be used to protect a later gpu function call. So we can move the lock into that call instead.
| * | | | | | | gpu: Migrate implementation to the cpp fileameerj2021-10-0319-632/+875
| | | | | | | |
* | | | | | | | Merge pull request #7090 from Moonlacer/tas_spacing_additionbunnei2021-10-062-146/+188
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | (Minor Change) Hint (?) Button Removal and Spacing Change to the TAS Window
| * | | | | | | | configure_tas: Remove help button from dialog windowMoonlacer2021-09-291-0/+1
| | | | | | | | |
| * | | | | | | | configure_tas: Ensure dialog buttons always stay at the bottomMoonlacer2021-09-291-146/+187
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Previously, the dialog buttons would be floating in-place when the dialog is stretched downwards. This change ensures that the dialog buttons always stay at the bottom of the window.
* | | | | | | | | Merge pull request #7115 from ameerj/log-compilebunnei2021-10-0515-18/+53
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | common/logging: Reduce dependent header include overhead
| * | | | | | | | | common/logging: Reduce scope of fmt includeameerj2021-10-024-1/+5
| | | | | | | | | |
| * | | | | | | | | common/logging: Move Log::Entry declaration to a separate headerameerj2021-10-0212-17/+48
| | |/ / / / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | This reduces the load of requiring to include std::chrono in all files which include log.h
* | | | | | | | | Merge pull request #7103 from Morph1984/service-ctx-eventbunnei2021-10-0526-271/+367
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | service: Replace all service event creation with ServiceContext::CreateEvent
| * | | | | | | | | service: Replace service event creation with ServiceContext::CreateEventMorph2021-10-0226-271/+367
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The service context helps to manage all created events and allows us to close them upon destruction.
* | | | | | | | | | Merge pull request #7101 from ameerj/vk-tess-topologybunnei2021-10-051-1/+10
|\ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | vk_graphics_pipeline: Force patch list topology when tessellation is used
| * | | | | | | | | | vk_graphics_pipeline: Force patch list topology when tessellation is usedameerj2021-09-281-1/+10
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Fixes a crash on some drivers when tessellation is used but the IA topology is not patch list.
* | | | | | | | | | | Merge pull request #7107 from astrelsky/iob_fixbunnei2021-10-041-1/+5
|\ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | prevent access violation from iob in Memory::IsValidVirtualAddress
| * | | | | | | | | | | prevent access violation from iob in Memory::IsValidVirtualAddressAndrew Strelsky2021-09-301-1/+5
| | |_|_|/ / / / / / / | |/| | | | | | | | |
* | | | | | | | | | | Merge pull request #7091 from vonchenplus/fix_memroy_leakAmeer J2021-10-046-9/+114
|\ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | core: Fix memory leak
| * | | | | | | | | | | Fix KShareMemory object leakFeng Chen2021-09-295-3/+106
| | | | | | | | | | | |
| * | | | | | | | | | | Fix KScopedAutoObject object leak when SendSyncRequestFeng Chen2021-09-251-6/+8
| | |_|_|_|/ / / / / / | |/| | | | | | | | |
* | | | | | | | | | | Merge pull request #7122 from Morph1984/update-qtbunnei2021-10-042-5/+6
|\ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | Qt: Update to Qt 5.15.2
| * | | | | | | | | | | CMakeLists: Update to Qt 5.15.2Morph2021-10-031-5/+5
| | | | | | | | | | | |
| * | | | | | | | | | | CMakeModules: Add Qt5QmlModelMorph2021-10-031-0/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Required by Qt 5.15's QtWebEngine
* | | | | | | | | | | | Merge pull request #7111 from lat9nq/no-title-bar-versionbunnei2021-10-031-2/+7
|\ \ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | | | main: Don't add an extra separator when the title version is absent
| * | | | | | | | | | | | main: Don't add an extra separator when the title version is absentlat9nq2021-10-011-2/+7
| | |_|_|_|_|/ / / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Some titles, such as homebrew, do not have any version string. Because yuzu hard codes the title bar string assuming a version string is preset, booting homebrew causes yuzu to add an extra separator with no content between. This uses a lambda expression to prevent that from happening.
* | | | | | | | | | | | Merge pull request #7113 from Morph1984/no-log-ip-addrbunnei2021-10-031-2/+0
|\ \ \ \ \ \ \ \ \ \ \ \ | |_|/ / / / / / / / / / |/| | | | | | | | | | | network: Do not log IP address
| * | | | | | | | | | | network: Do not log IP addressMorph2021-10-021-2/+0
| | |_|_|_|/ / / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Logging this may be a privacy concern for some users.
* | | | | | | | | | | Merge pull request #6979 from german77/joycon_namebunnei2021-10-021-2/+16
|\ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | input_common: Add alternative string for joycons
| * | | | | | | | | | | input_common: Add alternative string for joyconsgerman772021-09-071-2/+16
| | | | | | | | | | | |
* | | | | | | | | | | | Merge pull request #7093 from Morph1984/exitbunnei2021-10-027-2/+44
|\ \ \ \ \ \ \ \ \ \ \ \ | |_|/ / / / / / / / / / |/| | | | | | | | | | | core: Properly shutdown and exit the running application when ISelfController::Exit is called
| * | | | | | | | | | | service: am: Make use of Exit to exit the currently running applicationMorph2021-10-021-2/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This also moves the call to the end to ensure services are properly destructed on exit.
| * | | | | | | | | | | yuzu: main: Register a callback for ExitMorph2021-10-024-0/+17
| | | | | | | | | | | |
| * | | | | | | | | | | core: Add Exit and ExitCallbackMorph2021-10-022-0/+25
|/ / / / / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This allows ISelfController::Exit to stop the currently running application. This is typically used by homebrew to exit back to the homebrew menu after calling consoleExit with libnx.
* | | | | | | | | | | Merge pull request #7102 from Morph1984/remove-boxcatbunnei2021-10-0221-1621/+1
|\ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | Remove Boxcat BCAT backend
| * | | | | | | | | | | CMakeLists: Remove BoxCat build optionMorph2021-09-292-10/+0
| | | | | | | | | | | |
| * | | | | | | | | | | settings: Remove BCAT settingsMorph2021-09-295-17/+0
| | | | | | | | | | | |
| * | | | | | | | | | | configure_network: Remove BCATMorph2021-09-293-208/+0
| | | | | | | | | | | |
| * | | | | | | | | | | service: bcat: Remove BoxCat BCAT implementationMorph2021-09-294-631/+0
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The current implementation of BoxCat as it stands is non-functional due to the reliance on a server providing BCAT files. This implementation will eventually be replaced with one that allows the use of local BCAT files dumped from a Nintendo Switch.
| * | | | | | | | | | | externals: Remove libzipMorph2021-09-297-652/+1
| | | | | | | | | | | |
| * | | | | | | | | | | file_sys: Remove vfs_libzipMorph2021-09-293-103/+0
| | |_|_|/ / / / / / / | |/| | | | | | | | |
* | | | | | | | | | | Merge pull request #7114 from ameerj/msvc-ubuntu-versionbunnei2021-10-022-0/+6
|\ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | ci: Use latest ubuntu image for mainline/patreon step 1
| * | | | | | | | | | | ci: Use latest ubuntu image for mainline/patreon step 1ameerj2021-10-022-0/+6
| | |_|/ / / / / / / / | |/| | | | | | | | |
* | | | | | | | | | | Merge pull request #7075 from v1993/power-of-teabunnei2021-10-011-0/+3
|\ \ \ \ \ \ \ \ \ \ \ | |/ / / / / / / / / / |/| | | | | | | | | | applets: Use subdirectory of main data directory for QtWebEngine storage
| * | | | | | | | | | Use subdirectory of main data directory for QtWebEngine storagev19932021-09-231-0/+3
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Previously, an unrelated directory was used for this. Keep everything together for consistency.
* | | | | | | | | | | Merge pull request #7061 from ameerj/dma-buffer-miscbunnei2021-09-304-39/+37
|\ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | buffer_cache, maxwell_dma: Minor refactoring and code fixes
| * | | | | | | | | | | maxwell_dma: Minor refactoringameerj2021-09-202-33/+33
| | | | | | | | | | | |
| * | | | | | | | | | | buffer_cache: Minor fixesameerj2021-09-202-6/+4
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Loop through the tmp_intervals by reference, rather than by copy, and fix gl clear buffer size calculation.
* | | | | | | | | | | | Merge pull request #7104 from Morph1984/styleMai M2021-09-308-10/+10
|\ \ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | | | style: Remove extra space preceding the :: operator
| * | | | | | | | | | | | style: Remove extra space preceding the :: operatorMorph2021-09-298-10/+10
| | |_|/ / / / / / / / / | |/| | | | | | | | | |
* | | | | | | | | | | | Merge pull request #7036 from ameerj/ogl-bgr-v2bunnei2021-09-307-118/+59
|\ \ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | | | gl_texture_cache: Unify BGR copy passes using PBOs
| * | | | | | | | | | | | host_shaders: Remove opengl_copy_bgra.compameerj2021-09-174-19/+0
| | | | | | | | | | | | |
| * | | | | | | | | | | | gl_texture_cache: Migrate BGRCopyPass from util_shadersameerj2021-09-174-42/+48
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The BGR copies no longer use shaders.
| * | | | | | | | | | | | util_shaders: Unify BGRA copy passesameerj2021-09-165-82/+36
| | | | | | | | | | | | |
* | | | | | | | | | | | | Merge pull request #7106 from astrelsky/invalid_iterator_fixbunnei2021-09-291-1/+1
|\ \ \ \ \ \ \ \ \ \ \ \ \ | |_|/ / / / / / / / / / / |/| | | | | | | | | | | | Fixed invalid iterator usage
| * | | | | | | | | | | | Fixed invalid iterator usageAndrew Strelsky2021-09-291-1/+1
|/ / / / / / / / / / / /
* | | | | | | | | | | | Merge pull request #7018 from lat9nq/splat-stubsMorph2021-09-292-26/+67
|\ \ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | | | audin_u: stub Start, RegisterBufferEvent, AppendAudioInBufferAuto
| * | | | | | | | | | | | audin_u: Return a buffer event in RegisterBufferEventlat9nq2021-09-152-2/+12
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Co-authored-by: Morph <39850852+Morph1984@users.noreply.github.com>
| * | | | | | | | | | | | audin_u: stub Start, RegisterBufferEvent, AppendAudioInBufferAutolat9nq2021-09-152-26/+57
| |/ / / / / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This also moves IAudioIn's definition to the header. Required for Splatoon 2 LAN play.
* | | | | | | | | | | | Merge pull request #7042 from v1993/patch-7Ameer J2021-09-282-0/+8
|\ \ \ \ \ \ \ \ \ \ \ \ | |_|_|_|_|_|/ / / / / / |/| | | | | | | | | | | Hide XInput bypass on non-Windows OSes
| * | | | | | | | | | | If not on Windows, disable raw inputValeri2021-09-181-0/+4
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This way, if someone copies their Windows config to other OS, they won't be stuck without web applet for no apparent reason.
| * | | | | | | | | | | Hide XInput bypass on non-Windows OSesValeri2021-09-181-0/+4
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Follow-up to #6950. This option is a no-op on other OSes and only serves to spread confusion there.
* | | | | | | | | | | | Merge pull request #7076 from ameerj/amd-botwbunnei2021-09-283-11/+22
|\ \ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | | | vk_texture_cache: Disable cube compatibility flag on non-mesa AMD GCN4 and earlier
| * | | | | | | | | | | | vk_texture_cache: Disable cube compatibility flag on non-mesa AMD GCN4 and earlierameerj2021-09-243-11/+22
| | |_|_|_|_|_|_|_|_|/ / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Fixes rainbow textures on BOTW.
* | | | | | | | | | | | Merge pull request #7096 from german77/update_13.0.0bunnei2021-09-2711-4/+40
|\ \ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | | | Update function tables to FW 13.0.0
| * | | | | | | | | | | | service/es: Update to 13.0.0german772021-09-271-0/+6
| | | | | | | | | | | | |
| * | | | | | | | | | | | service/npns: Update to 13.0.0german772021-09-271-0/+1
| | | | | | | | | | | | |
| * | | | | | | | | | | | service/vi: Update to 13.0.0german772021-09-272-0/+2
| | | | | | | | | | | | |
| * | | | | | | | | | | | service/am: Update to 13.0.0german772021-09-271-0/+4
| | | | | | | | | | | | |
| * | | | | | | | | | | | service/audio: Update to 13.0.0german772021-09-272-1/+10
| | | | | | | | | | | | |
| * | | | | | | | | | | | service/hid: Update to 13.0.0german772021-09-272-0/+10
| | | | | | | | | | | | |
| * | | | | | | | | | | | service/btdrv: Update to 13.0.0german772021-09-271-0/+4
| | | | | | | | | | | | |
| * | | | | | | | | | | | service/usb: Update to 13.0.0german772021-09-271-3/+3
|/ / / / / / / / / / / /
* | | | | | | | | | | | Merge pull request #7078 from ameerj/vc-jthread-fixesMorph2021-09-262-2/+2
|\ \ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | | | video_core: Fix jthread related hangs when stopping emulation
| * | | | | | | | | | | | video_core: Fix jthread related hangs when stopping emulationameerj2021-09-242-2/+2
| | |_|_|_|/ / / / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | jthread on some compilers is more picky when it comes to the order in which objects are destroyed.
* | | | | | | | | | | | Merge pull request #7085 from Morph1984/bsd-read-stubbunnei2021-09-251-6/+5
|\ \ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | | | service: bsd: Stub Read
| * | | | | | | | | | | | service: bsd: Stub ReadMorph2021-09-251-6/+5
|/ / / / / / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | - Used by Diablo II: Resurrected
* | | | | | | | | | | | Merge pull request #7082 from Morph1984/bsd-readbunnei2021-09-252-1/+15
|\ \ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | | | service: bsd: Implement Read
| * | | | | | | | | | | | service: bsd: Implement ReadMorph2021-09-242-1/+15
|/ / / / / / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | - Used by Diablo II: Resurrected
* | | | | | | | | | | | Merge pull request #7084 from ameerj/clang-12Morph2021-09-2415-68/+64
|\ \ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | | | general: Update style to clang-format-12
| * | | | | | | | | | | | CMakeLists: Update to clang format version 12ameerj2021-09-241-1/+1
| | | | | | | | | | | | |
| * | | | | | | | | | | | general: Update style to clang-format-12ameerj2021-09-2413-66/+62
| | | | | | | | | | | | |
| * | | | | | | | | | | | ci: Update clang format versionameerj2021-09-241-1/+1
|/ / / / / / / / / / / /
* | | | | | | | | | | | Merge pull request #7069 from lioncash/uuidMorph2021-09-245-8/+16
|\ \ \ \ \ \ \ \ \ \ \ \ | |_|_|_|_|_|_|/ / / / / |/| | | | | | | | | | | common/uuid: Add validity checking functions to interface
| * | | | | | | | | | | core/profile_select: Avoid uninitialized read in SelectProfile()Lioncash2021-09-231-1/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The default constructor of UUID doesn't initialize its data members, so we need to directly initialize it to be invalid.
| * | | | | | | | | | | common/uuid: Add validity checking functions to interfaceLioncash2021-09-224-7/+14
| | |/ / / / / / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Given we have a function to invalidate, we should also have ones to query the validity. Also makes the code more straightforward to read.
* | | | | | | | | | | Merge pull request #7043 from astrelsky/cmakebunnei2021-09-241-1/+1
|\ \ \ \ \ \ \ \ \ \ \ | |_|_|_|_|_|_|_|/ / / |/| | | | | | | | | | Fix "Unknown C standard control flag" warning
| * | | | | | | | | | Fix "Unknown C standard control flag" warningAndrew Strelsky2021-09-181-1/+1
| | |_|/ / / / / / / | |/| | | | | | | |
* | | | | | | | | | Merge pull request #7068 from behunin/patch-3bunnei2021-09-241-121/+60
|\ \ \ \ \ \ \ \ \ \ | |_|_|/ / / / / / / |/| | | | | | | | | Debug Config Ui: Clean-up and nits
| * | | | | | | | | Clean-up and nitsLevi Behunin2021-09-221-121/+60
| | |/ / / / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | Remove redundent label, rearange checkboxs to keep same 3 per column layout, remove unneeded properties.
* | | | | | | | | Merge pull request #7045 from behunin/patch-1bunnei2021-09-231-46/+16
|\ \ \ \ \ \ \ \ \ | |/ / / / / / / / |/| | | | | | | | Tas configure ui nits
| * | | | | | | | Clean-upLevi Behunin2021-09-211-44/+14
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Numerize names, remove unneeded properties and spacer.
| * | | | | | | | Tas configure ui nitsLevi Behunin2021-09-191-4/+4
| | | | | | | | | | | | | | | | | | | | | | | | | | | Text looked cramped on my pc (Ubuntu 21.04). Re-flowed text as well for nicer read.
* | | | | | | | | Merge pull request #7003 from ameerj/unlocked-present-modebunnei2021-09-203-4/+38
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | vk_swapchain: Use immediate present mode when mailbox is unavailable and FPS is unlocked
| * | | | | | | | | vk_swapchain: Use immediate present mode when mailbox is unavailable and FPS is unlockedameerj2021-09-133-4/+38
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Allows drivers that do not support VK_PRESENT_MODE_MAILBOX_KHR the ability to present at a framerate higher than the monitor's refresh rate when the FPS is unlocked.
* | | | | | | | | | Merge pull request #7017 from FernandoS27/i-am-barbie-girlAmeer J2021-09-201-1/+7
|\ \ \ \ \ \ \ \ \ \ | |_|_|_|_|/ / / / / |/| | | | | | | | | Spir-V: Rescale the frag depth to 0,1 mode when -1,1 mode is used in Vulkan.
| * | | | | | | | | Spir-V: Rescale the frag depth to 0,1 mode when -1,1 mode is used in Vulkan.Fernando Sahmkow2021-09-151-1/+7
| | | | | | | | | |
* | | | | | | | | | Merge pull request #7019 from ameerj/videocore-jthreadbunnei2021-09-198-91/+49
|\ \ \ \ \ \ \ \ \ \ | |_|_|/ / / / / / / |/| | | | | | | | | videocore: Use std::jthread for worker threads
| * | | | | | | | | vk_scheduler: Use std::jthreadameerj2021-09-162-17/+9
| | | | | | | | | |
| * | | | | | | | | gpu: Use std::jthread for async gpu threadameerj2021-09-165-69/+18
| | | | | | | | | |
| * | | | | | | | | threadsafe_queue: Add std::stop_token overload to PopWaitameerj2021-09-161-5/+22
| | |_|_|/ / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | Useful for jthreads which make use of the threadsafe queues.
* | | | | | | | | Merge pull request #6485 from MonsterDruide1/tasbunnei2021-09-1927-21/+1426
|\ \ \ \ \ \ \ \ \ | |_|_|_|_|_|/ / / |/| | | | | | | | input_common: TAS with script playback & recording
| * | | | | | | | UI: Relocate tas menu and add brief descriptiongerman772021-09-1810-68/+148
| | | | | | | | |
| * | | | | | | | input_common/tas: new update methodgerman772021-09-185-17/+4
| | | | | | | | |
| * | | | | | | | input_common/tas: Document the main classgerman772021-09-188-51/+153
| | | | | | | | |
| * | | | | | | | input_common/tas: Add swap controllergerman772021-09-188-39/+99
| | | | | | | | |
| * | | | | | | | input_common/tas: overwrite file dialoggerman772021-09-183-20/+16
| | | | | | | | |
| * | | | | | | | input_common/tas: Fallback to simple updateMonsterDruide12021-09-1810-102/+60
| | | | | | | | |
| * | | | | | | | config: Move TAS options to it's own menugerman772021-09-1819-184/+452
| | | | | | | | |
| * | | | | | | | core: Hacky TAS syncing & load pausingMonsterDruide12021-09-189-107/+140
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | To keep the TAS inputs synced to the game speed even through lag spikes and loading zones, deeper access is required. First, the `TAS::UpdateThread` has to be executed exactly once per frame. This is done by connecting it to the service method the game calls to pass parameters to the GPU: `Service::VI::QueueBuffer`. Second, the loading time of new subareas and/or kingdoms (SMO) can vary. To counteract that, the `CPU_BOOST_MODE` can be detected: In the `APM`-interface, the call to enabling/disabling the boost mode can be caught and forwarded to the TASing system, which can pause the script execution if neccessary and enabled in the settings.
| * | | | | | | | main: TAS Playback state labelMonsterDruide12021-09-182-0/+10
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | During script playback/recording, the user has to see what happens currently. For that, a new label has been added to the bottom-left corner, always displaying the current state of the TASing system.
| * | | | | | | | settings: File selector & other settingsMonsterDruide12021-09-189-2/+104
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | First of all, TASing requires a script to play back. The user can select the parent directory at `System -> Filesystem`, next to an option to pause TAS during loads: This requires a "hacky" setup deeper in the code and will be added in the last commit. Also, Hotkeys are being introduced: CTRL+F5 for playback start/stop, CTRL+F6 for re-reading the script and CTRL+F7 for recording a new script.
| * | | | | | | | input_common/tas: Base playback & recording systemMonsterDruide12021-09-1814-9/+818
|/ / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The base playback system supports up to 8 controllers (specified by `PLAYER_NUMBER` in `tas_input.h`), which all change their inputs simulataneously when `TAS::UpdateThread` is called. The recording system uses the controller debugger to read the state of the first controller and forwards that data to the TASing system for recording. Currently, this process sadly is not frame-perfect and pixel-accurate. Co-authored-by: Naii-the-Baf <sfabian200@gmail.com> Co-authored-by: Narr-the-Reg <juangerman-13@hotmail.com>
* | | | | | | | Merge pull request #7020 from Moonlacer/remove_audio_stretchingbunnei2021-09-188-29/+0
|\ \ \ \ \ \ \ \ | |_|_|_|/ / / / |/| | | | | | | Remove audio stretching
| * | | | | | | fix_clang_errorMoonlacer2021-09-161-1/+0
| | | | | | | |
| * | | | | | | fix_accidental_deletionMoonlacer2021-09-161-1/+2
| | | | | | | |
| * | | | | | | remove-audio-stretching-settingMoonlacer2021-09-168-30/+1
| | |/ / / / / | |/| | | | |
* | | | | | | Merge pull request #6950 from german77/multiplaybunnei2021-09-188-11/+35
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | input_common: Add advanced setting for 8 player support
| * | | | | | | input_common: Enable steam controllers and 8 player supportgerman772021-09-108-11/+35
| | |_|_|/ / / | |/| | | | |
* | | | | | | Merge pull request #7015 from german77/NotGoodForTerrabunnei2021-09-171-1/+14
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | ngct: Stub Match
| * | | | | | | ngct: Stub MatchNarr the Reg2021-09-151-1/+14
| | |_|/ / / / | |/| | | | | | | | | | | | Needed for Cruis'n Blast
* | | | | | | Merge pull request #7011 from ameerj/vk-validation-0x0bunnei2021-09-171-0/+1
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | vulkan_debug_callback: Ignore InvalidCommandBuffer-VkDescriptorSet errors
| * | | | | | | vulkan_debug_callback: Ignore InvalidCommandBuffer-VkDescriptorSet errorsameerj2021-09-141-0/+1
| | |_|/ / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This validation error is spammed on some titles, asserting that VkDescriptorSet 0x0[] was destroyed. This is likely a validation layer bug when using VK_KHR_push_descriptor, which can avoid using traditional VkDescriptorSet. It should be safe to ignore for now.
* | | | | | | Merge pull request #7027 from ameerj/sorry-amdFernando S2021-09-161-14/+3
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | vulkan_device: Reorder Float16Int8 declaration
| * | | | | | | vulkan_device: Reorder Float16Int8 declarationameerj2021-09-161-1/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This variable was going out of scope before its usage in the vulkan device creation, causing a crash on very specific drivers.
| * | | | | | | Revert "Merge pull request #7006 from FernandoS27/a-motherfucking-driver"ameerj2021-09-161-13/+1
| | |/ / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | This reverts commit 62e88d0e7455e37840db7e2a8e199bc6ca176966, reversing changes made to edf3da346f4ec0ca492b427f4f693d56e84abc52.
* | | | | | | Merge pull request #7010 from Morph1984/fs-timestampbunnei2021-09-168-1/+83
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | vfs: Partially implement GetFileTimeStampRaw
| * | | | | | | vfs: Partially implement GetFileTimeStampRawMorph2021-09-148-1/+83
| |/ / / / / / | | | | | | | | | | | | | | | | | | | | | Gets rid of homebrew warnings using this func
* | | | | | | Merge pull request #7014 from Morph1984/log-pipeline-countAmeer J2021-09-162-0/+4
|\ \ \ \ \ \ \ | |/ / / / / / |/| | | | | | renderers: Log total pipeline count
| * | | | | | renderers: Log total pipeline countMorph2021-09-142-0/+4
|/ / / / / /
* | | | | | Merge pull request #7009 from ameerj/main_process_cleanupbunnei2021-09-141-3/+12
|\ \ \ \ \ \ | |/ / / / / |/| | | | | core: Destroy main_process during shutdown
| * | | | | core: Destroy main_process during shutdownameerj2021-09-141-3/+12
| | |/ / / | |/| | | | | | | | | | | | | The main_process was never being cleaned up, causing a noticeable memory leak after subsequent launches. This change cleans up the memory during Core Shutdown, mitigating the leak.
* | | | | Merge pull request #6943 from FernandoS27/omae-wa-mou-shindeiruMorph2021-09-131-6/+20
|\ \ \ \ \ | | | | | | | | | | | | Vulkan: Disable VK_EXT_SAMPLER_FILTER_MINMAX in GCN AMD
| * | | | | Vulkan: Disable VK_EXT_SAMPLER_FILTER_MINMAX in GCN AMD since it's broken.Fernando Sahmkow2021-09-131-6/+20
| | | | | |
* | | | | | Merge pull request #7006 from FernandoS27/a-motherfucking-driverMorph2021-09-131-1/+13
|\ \ \ \ \ \ | |/ / / / / |/| | | | | Vulkan: Blacklist Int8Float16 Extension on AMD on driver 21.9.1
| * | | | | Vulkan: Blacklist Int8Float16 Extension on AMD on driver 21.9.1Fernando Sahmkow2021-09-131-1/+13
| | |_|_|/ | |/| | |
* | | | | Merge pull request #7005 from Morph1984/enum-bitwise-shift-opsMai M2021-09-131-0/+16
|\ \ \ \ \ | | | | | | | | | | | | common_funcs: Add enum flag bitwise shift operator overloads
| * | | | | common_funcs: Add enum flag bitwise shift operator overloadsMorph2021-09-131-0/+16
| | | | | | | | | | | | | | | | | | | | | | | | This adds bitwise shift operator overloads (<<, >>, <<=, >>=) in the macro DECLARE_ENUM_FLAG_OPERATORS(type)
* | | | | | Merge pull request #6944 from FernandoS27/dear-drunk-meMorph2021-09-133-3/+14
|\ \ \ \ \ \ | | | | | | | | | | | | | | Vulkan/Descriptors: Increase sets per pool on AMD propietary driver.
| * | | | | | Vulkan/Descriptors: Increase sets per pool on AMFD propietary driver.Fernando Sahmkow2021-09-133-3/+14
| | | | | | |
* | | | | | | Merge pull request #7001 from ameerj/wario-fixFernando S2021-09-131-6/+8
|\ \ \ \ \ \ \ | |_|/ / / / / |/| | | | | | vk_rasterizer: Fix dynamic StencilOp updating when two faces are enabled
| * | | | | | vk_rasterizer: Fix dynamic StencilOp updating when two faces are enabledameerj2021-09-121-6/+8
| | | | | | | | | | | | | | | | | | | | | | | | | | | | This function was incorrectly using the stencil_two_side_enable register when dynamically updating the StencilOp.
* | | | | | | Merge pull request #7000 from Morph1984/create-dir-commentAmeer J2021-09-131-0/+5
|\ \ \ \ \ \ \ | |_|_|_|/ / / |/| | | | | | FS: Mark recursive CreateDirectory as inaccurate and temporary
| * | | | | | FS: Mark recursive CreateDirectory as inaccurate and temporaryMorph2021-09-121-0/+5
| | | | | | |
* | | | | | | Merge pull request #7002 from ameerj/vk-state-unusedMai M2021-09-121-4/+0
|\ \ \ \ \ \ \ | |/ / / / / / |/| | | | | | vk_state_tracker: Remove unused function
| * | | | | | vk_state_tracker: Remove unused functionameerj2021-09-121-4/+0
| |/ / / / /
* | | | | | Merge pull request #6948 from ameerj/amd-warp-fixMorph2021-09-122-54/+109
|\ \ \ \ \ \ | | | | | | | | | | | | | | shaders: Fix warp instructions on 64-thread warp devices
| * | | | | | emit_glsl_warp: Fix shuffle ops for 64-thread warp sizesameerj2021-08-311-24/+36
| | | | | | |
| * | | | | | emit_glsl_warp: Fix ballot related ops for 64-thread warp sizesameerj2021-08-311-24/+38
| | | | | | |
| * | | | | | emit_spirv_warp: Fix shuffle ops for 64-thread warp sizesameerj2021-08-311-1/+29
| | | | | | |
| * | | | | | emit_spirv_warp: Fix ballot related ops for 64-thread warp sizesameerj2021-08-311-10/+11
| | | | | | |
* | | | | | | Merge pull request #6975 from ogniK5377/acc-async-ctxMorph2021-09-124-19/+154
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | account: EnsureTokenIdCacheAsync
| * | | | | | | Mark is_complete as atomicChloe Marcec2021-09-082-4/+5
| | | | | | | |
| * | | | | | | Addressed issuesChloe Marcec2021-09-083-15/+14
| | | | | | | |
| * | | | | | | address name shadowing with systemChloe Marcec2021-09-061-2/+2
| | | | | | | |
| * | | | | | | account: EnsureTokenIdCacheAsyncChloe Marcec2021-09-064-19/+154
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Closes #2547, #6946
* | | | | | | | Merge pull request #6974 from ogniK5377/fs-recursive-createdirMorph2021-09-121-8/+13
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | FS: Recursively create directories for CreateDirectory
| * | | | | | | | Addressed issuesChloe2021-09-081-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | Co-authored-by: Mai M. <mathew1800@gmail.com>
| * | | | | | | | FS: Recursively create directories for CreateDirectoryChloe Marcec2021-09-061-8/+13
| | |_|_|_|/ / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Originally we only created the parent directory, this caused issues for creating directories which also contained subdirectories, eg `/Folder1/Folder2` This allows the ultimate mod manager homebrew to at least boot
* | | | | | | | Merge pull request #6997 from ameerj/stop-emulation-confirmationMorph2021-09-121-11/+9
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | main: Apply confirm exit setting in exit locked scenarios
| * | | | | | | | main: Apply confirm exit setting in exit locked scenariosameerj2021-09-121-11/+9
| | |_|_|/ / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Some titles set an exit lock through HLE, which prompts an exit confirmation when stopping emulation if the system is locked. This change allows bypassing this confirmation if the setting to confirm exits has been disabled by the user.
* | | | | | | | Merge pull request #6992 from german77/brainsMorph2021-09-125-3/+44
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | hid/am: Stub SetTouchScreenConfiguration and implement GetNotificationStorageChannelEvent
| * | | | | | | | am: Implement GetNotificationStorageChannelEventgerman772021-09-102-2/+16
| | | | | | | | |
| * | | | | | | | hid: Stub SetTouchScreenConfigurationgerman772021-09-103-1/+28
| | | | | | | | |
* | | | | | | | | Merge pull request #6987 from Morph1984/common-errorMorph2021-09-1213-19/+43
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | common: Move error handling functions out of common_funcs
| * | | | | | | | | shader_environment: Add missing <algorithm> includeMorph2021-09-111-0/+1
| | | | | | | | | |
| * | | | | | | | | vk_descriptor_pool: Add missing <algorithm> includeMorph2021-09-111-0/+1
| | | | | | | | | |
| * | | | | | | | | slot_vector: Add missing <algorithm> includeMorph2021-09-111-0/+1
| | | | | | | | | |
| * | | | | | | | | video_core/memory_manager: Add missing <algorithm> includeMorph2021-09-111-0/+2
| | | | | | | | | |
| * | | | | | | | | kernel: Add missing <functional> includeMorph2021-09-111-0/+1
| | | | | | | | | |
| * | | | | | | | | file_sys/kernel_executable: Add missing <string> includeMorph2021-09-111-0/+1
| | | | | | | | | |
| * | | | | | | | | codec: Add missing <string_view> includeMorph2021-09-111-0/+1
| | | | | | | | | |
| * | | | | | | | | common_funcs: Replace <algorithm> with <iterator>Morph2021-09-111-1/+1
| | | | | | | | | |
| * | | | | | | | | common: Move error handling to error.cpp/hMorph2021-09-116-18/+34
| | |/ / / / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | This allows us to avoid implicitly including <string> every time common_funcs.h is included.
* | | | | | | | | Merge pull request #6986 from Morph1984/version-updateMorph2021-09-121-5/+12
|\ \ \ \ \ \ \ \ \ | |/ / / / / / / / |/| | | | | | | | api_version: Update and add AtmosphereTargetFirmware
| * | | | | | | | api_version: Update and add AtmosphereTargetFirmwareMorph2021-09-101-5/+12
| |/ / / / / / /
* | | | | | | | Merge pull request #6846 from ameerj/nvdec-gpu-decodeFernando S2021-09-1116-133/+335
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | nvdec: Add GPU video decoding for all capable drivers and platforms
| * | | | | | | | h264: Lower max_num_ref_framesameerj2021-08-161-1/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | GPU decoding seems to be more picky when it comes to the maximum number of reference frames.
| * | | | | | | | configure_graphics: Add GPU nvdec decoding as an optionameerj2021-08-1612-27/+120
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Some system configurations may see visual regressions or lower performance using GPU decoding compared to CPU decoding. This setting provides the option for users to specify their decoding preference. Co-Authored-By: yzct12345 <87620833+yzct12345@users.noreply.github.com>
| * | | | | | | | codec: Improve libav memory alloc and cleanupameerj2021-08-162-14/+19
| | | | | | | | |
| * | | | | | | | codec: Fallback to CPU decoding if no compatible GPU format is foundameerj2021-08-162-22/+32
| | | | | | | | |
| * | | | | | | | cmake: Add VDPAU and NVDEC support to FFmpeglat9nq2021-08-162-7/+74
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Adds {h264_,vp9_}{nvdec,vdpau} hwaccels.
| * | | | | | | | codec: Replace deprecated av_init_packet usageameerj2021-08-121-9/+13
| | | | | | | | |
| * | | | | | | | cmake: Always find LIBVA, update windows FFmpeg versionameerj2021-08-121-5/+5
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Allows the use of VAAPI gpu decoders on system installed ffmpeg as well.
| * | | | | | | | nvdec: Implement GPU accelerated decoding for all platformsameerj2021-08-122-70/+92
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Supplements the VAAPI intel gpu decoder by implementing the D3D11VA decoder for Windows, and CUVID/VDPAU for Nvidia and AMD on drivers linux respectively.
* | | | | | | | | Merge pull request #6901 from ameerj/vk-clear-bitsFernando S2021-09-113-6/+24
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | vk_rasterizer: Only clear depth/stencil buffers when specified in attachment aspect mask
| * | | | | | | | | vk_rasterizer: Only clear depth and stencil buffers when set in attachment aspect maskameerj2021-08-213-6/+24
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Silences validation errors for clearing the depth/stencil buffers of framebuffer attachments that were not specified to have depth/stencil usage.
* | | | | | | | | | Merge pull request #6941 from ameerj/swapchain-srgbFernando S2021-09-115-11/+37
|\ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | vk_swapchain: Prefer linear swapchain format when presenting sRGB images
| * | | | | | | | | | vulkan_device: Enable VK_KHR_swapchain_mutable_format if availableameerj2021-08-293-0/+27
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Silences validation errors when creating sRGB image views of linear swapchain images
| * | | | | | | | | | vk_swapchain: Prefer linear swapchain format when presenting sRGB imagesameerj2021-08-293-11/+10
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Fixes broken sRGB when presenting from a secondary GPU.
* | | | | | | | | | | Merge pull request #6953 from ameerj/anv-semaphoreFernando S2021-09-115-26/+33
|\ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | renderer_vulkan: Wait on present semaphore at queue submit
| * | | | | | | | | | | renderer_vulkan: Wait on present semaphore at queue submitameerj2021-09-025-26/+33
| | |_|_|_|/ / / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The present semaphore is being signalled by the call to acquire the swapchain image. This semaphore is meant to be waited on when rendering to the swapchain image. Currently it is waited on when presenting, but moving its usage to be waited on in the command buffer submission allows for proper usage of this semaphore. Fixes the device lost when launching titles on the Intel Linux Mesa driver.
* | | | | | | | | | | Merge pull request #6981 from ameerj/nvflinger-hb-formatFernando S2021-09-113-7/+8
|\ \ \ \ \ \ \ \ \ \ \ | |_|_|_|_|/ / / / / / |/| | | | | | | | | | nvflinger: Use external surface format for framebuffer creation
| * | | | | | | | | | nvflinger: Use external surface format for framebuffer creationameerj2021-09-073-7/+8
| | |_|_|_|_|_|_|/ / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The format member the IGBPBuffer may not always specify the correct desired format. Using the external format member ensures a valid format is provided when creating the framebuffer. Fixes homebrew using the wrong framebuffer format.
* | | | | | | | | | Merge pull request #6962 from vonchenplus/spirv_support_legacy_attributebunnei2021-09-083-0/+107
|\ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | renderer_vulkan: Spirv support glsl legacy attribute
| * | | | | | | | | | Detail adjustmentFeng Chen2021-09-081-13/+14
| | | | | | | | | | |
| * | | | | | | | | | Detail adjustmentFeng Chen2021-09-082-28/+35
| | | | | | | | | | |
| * | | | | | | | | | Re-implement get unused locationFeng Chen2021-09-071-30/+30
| | | | | | | | | | |
| * | | | | | | | | | Move attribute related definitions to spirv anonymous namespaceFeng Chen2021-09-074-30/+26
| | | | | | | | | | |
| * | | | | | | | | | Dynamic get unused locationFeng Chen2021-09-061-27/+49
| | | | | | | | | | |
| * | | | | | | | | | Implement intput and output fixed fnc texturesFeng Chen2021-09-064-19/+25
| | | | | | | | | | |
| * | | | | | | | | | Rename parametersFeng Chen2021-09-035-14/+24
| | | | | | | | | | |
| * | | | | | | | | | Fix create GraphicsPipelines crashFeng Chen2021-09-031-5/+5
| | | | | | | | | | |
| * | | | | | | | | | Add input/output locationFeng Chen2021-09-021-5/+13
| | | | | | | | | | |
| * | | | | | | | | | Add colorfront and txtcoord supportFeng Chen2021-08-315-0/+57
| | | | | | | | | | |
* | | | | | | | | | | Merge pull request #6980 from vonchenplus/fix_blend_equation_errorFernando S2021-09-081-4/+4
|\ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | Fix blend equation enum error
| * | | | | | | | | | | Fix blend equation enum errorFeng Chen2021-09-071-4/+4
| | |/ / / / / / / / / | |/| | | | | | | | |
* | | | | | | | | | | Merge pull request #6971 from bunnei/buffer-queue-keventAmeer J2021-09-083-14/+24
|\ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | core: hle: service: buffer_queue: Improve management of KEvent.
| * | | | | | | | | | | core: hle: service: buffer_queue: Improve management of KEvent.bunnei2021-09-053-14/+24
| | |_|_|_|_|_|/ / / / | |/| | | | | | | | |
* | | | | | | | | | | Merge pull request #6977 from Moonlacer/masterAmeer J2021-09-072-3/+3
|\ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | Second part of Golden's PR #6976
| * | | | | | | | | | | Second part of Golden's PRMoonlacer2021-09-062-3/+3
| |/ / / / / / / / / /
* | | | | | | | | | | Merge pull request #6976 from goldenx86/patch-2Ameer J2021-09-071-4/+4
|\ \ \ \ \ \ \ \ \ \ \ | |_|/ / / / / / / / / |/| | | | | | | | | | Rename all shader cache strings to pipeline cache
| * | | | | | | | | | Rename all shader cache references to pipeline cacheMatías Locatti2021-09-061-4/+4
|/ / / / / / / / / / | | | | | | | | | | | | | | | | | | | | After Hades, both OpenGL and Vulkan use a pipeline cache instead of single stages of the graphics pipeline. Renamed the Remove menu entries to match.
* | | | | | | | | | Merge pull request #6965 from bunnei/cpu_manager_jthreadbunnei2021-09-062-18/+13
|\ \ \ \ \ \ \ \ \ \ | |/ / / / / / / / / |/| | | | | | | | | core: cpu_manager: Use jthread.
| * | | | | | | | | core: cpu_manager: Use jthread.bunnei2021-09-042-18/+13
| | |/ / / / / / / | |/| | | | | | |
* | | | | | | | | Merge pull request #6968 from bunnei/nvflinger-eventbunnei2021-09-054-16/+30
|\ \ \ \ \ \ \ \ \ | |/ / / / / / / / |/| | | | | | | | core: hle: service: nvflinger/vi: Improve management of KEvent.
| * | | | | | | | core: hle: service: nvflinger/vi: Improve management of KEvent.bunnei2021-09-044-16/+30
|/ / / / / / / /
* | | | | | | | Merge pull request #6900 from ameerj/attr-reorderbunnei2021-09-027-10/+140
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | structured_control_flow: Add DemoteCombinationPass
| * | | | | | | | structured_control_flow: Skip reordering nested demote branches.ameerj2021-08-301-0/+11
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Nested demote branches add complexity with combining the condition if it has not been initialized yet. Skip them for the time being.
| * | | | | | | | structured_control_flow: Conditionally invoke demote reorder passameerj2021-08-307-10/+23
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This is only needed on select drivers when a fragment shader discards/demotes.
| * | | | | | | | structured_control_flow: Add DemoteCombinationPassameerj2021-08-281-1/+107
| | |_|_|_|_|/ / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Some drivers misread data when demotes are interleaved in the program. This moves demote branches to be checked at the end of the program. Fixes "wireframe" issue in Pokemon SwSh on some drivers
* | | | | | | | Merge pull request #6951 from german77/logMai M2021-09-021-0/+1
|\ \ \ \ \ \ \ \ | |_|_|_|_|_|/ / |/| | | | | | | common/logging: Add missing include
| * | | | | | | common/logging: Add missing includegerman772021-09-021-0/+1
|/ / / / / / /
* | | | | | | Merge pull request #6897 from FernandoS27/pineapple-does-not-belong-in-pizzabunnei2021-08-3113-126/+220
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | Project <tentative title>: Rework Garbage Collection.
| * | | | | | | Garbage Collection: Make it more agressive on high priority mode.Fernando Sahmkow2021-08-293-5/+5
| | | | | | | |
| * | | | | | | Garbage Collection: Adress Feedback.Fernando Sahmkow2021-08-294-17/+23
| | | | | | | |
| * | | | | | | Garbage Collection: enable as default, eliminate option.Fernando Sahmkow2021-08-289-26/+2
| | | | | | | |
| * | | | | | | VideoCore: Rework Garbage Collection.Fernando Sahmkow2021-08-286-101/+213
| |/ / / / / /
* | | | | | | Merge pull request #6928 from ameerj/spirv-get-frontfacebunnei2021-08-311-2/+3
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | emit_spirv_context_get_set: Fix Get FrontFace return value
| * | | | | | | emit_spirv_context_get_set: Fix Get FrontFace return valueameerj2021-08-271-2/+3
| | |_|/ / / / | |/| | | | | | | | | | | | | | | | | | | The IR expects GetAttribute to return an F32 value. This case was returning a U32 instead.
* | | | | | | Merge pull request #6879 from ameerj/decoder-assertbunnei2021-08-312-9/+3
|\ \ \ \ \ \ \ | |_|_|/ / / / |/| | | | | | vk_blit_screen: Fix non-accelerated texture size calculation
| * | | | | | vk_blit_screen: Fix non-accelerated texture size calculationameerj2021-08-162-9/+3
| | | | | | | | | | | | | | | | | | | | | | | | | | | | Addresses the potential OOB access in UnswizzleTexture.
* | | | | | | Merge pull request #6905 from Morph1984/nifm-miscbunnei2021-08-292-137/+147
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | nifm/network_interface: Cleanup and populate fields in GetCurrentNetworkProfile
| * | | | | | | service: nifm: Populate fields in GetCurrentNetworkProfileMorph2021-08-271-29/+37
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Populates the current_address, subnet_mask, and gateway fields from the selected network interface.
| * | | | | | | service: nifm: Cleanup GetCurrentIpConfigInfoMorph2021-08-271-26/+21
| | | | | | | |
| * | | | | | | network_interface: Cleanup codeMorph2021-08-271-76/+83
| | | | | | | |
| * | | | | | | network_interface: Replace default return value with std::nulloptMorph2021-08-271-6/+6
| | | | | | | |
* | | | | | | | Merge pull request #6921 from ameerj/vp9-unusedbunnei2021-08-292-56/+30
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | vp9_types: Remove unusued VP9 info struct members
| * | | | | | | | vp9_types: Minor refactor of VP9 info structs.ameerj2021-08-261-32/+29
| | | | | | | | |
| * | | | | | | | vp9_types: Remove unused Vp9PictureInfo membersameerj2021-08-262-24/+1
| | |_|/ / / / / | |/| | | | | |
* | | | | | | | Merge pull request #6927 from german77/ngctMorph2021-08-296-0/+72
|\ \ \ \ \ \ \ \ | |_|_|_|/ / / / |/| | | | | | | ngct: Stub NGCT:U service
| * | | | | | | ngct: Stub NGCT:U servicegerman772021-08-276-0/+72
| | |/ / / / / | |/| | | | |
* | | | | | | Merge pull request #6929 from yuzu-emu/revert-6870-trace-back-stack-back-stack-backbunnei2021-08-272-114/+1
|\ \ \ \ \ \ \ | |/ / / / / / |/| | | | | | Revert "logging: Display backtrace on crash"
| * | | | | | Revert "logging: Display backtrace on crash"Morph2021-08-272-114/+1
|/ / / / / /
* | | | | | Merge pull request #6870 from yzct12345/trace-back-stack-back-stack-backbunnei2021-08-272-1/+114
|\ \ \ \ \ \ | | | | | | | | | | | | | | logging: Display backtrace on crash
| * | | | | | logging: Display backtrace on crashyzct123452021-08-132-1/+114
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This implements backtraces so we don't have to tell users how to use gdb anymore. This prints a backtrace after abort or segfault is detected. It also fixes the log getting cut off with the last line containing only a bracket. This change lets us know what caused a crash not just what happened the few seconds before it. I only know how to add support for Linux with GCC. Also this doesn't work outside of C/C++ such as in dynarmic or certain parts of graphics drivers. The good thing is that it'll try and just crash again but the stack frames are still there so the core dump will work just like before.
* | | | | | | Merge pull request #6922 from yuzu-emu/revert-6832-scheduler-improvementsbunnei2021-08-2623-224/+140
|\ \ \ \ \ \ \ | |_|/ / / / / |/| | | | | | Revert "kernel: Various improvements to scheduler"
| * | | | | | Revert "kernel: Various improvements to scheduler"bunnei2021-08-2623-224/+140
|/ / / / / /
* | | | | | Merge pull request #6919 from ameerj/vk-int8-capabilityFernando S2021-08-253-9/+19
|\ \ \ \ \ \ | | | | | | | | | | | | | | vulkan_device: Add a check for int8 support
| * | | | | | vulkan_device: Add a check for int8 supportameerj2021-08-253-9/+19
| | | | | | | | | | | | | | | | | | | | | | | | | | | | Silences validation errors when shaders use int8 without specifying its support to the API
* | | | | | | Merge pull request #6894 from FernandoS27/bunneis-left-earAmeer J2021-08-251-0/+1
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | GPU_MemoryManger: Fix GetSubmappedRange.
| * | | | | | | GPU_MemoryManger: Fix GetSubmappedRange.Fernando Sahmkow2021-08-191-0/+1
| | | | | | | |
* | | | | | | | Merge pull request #6917 from ameerj/log-init-fixbunnei2021-08-254-12/+16
|\ \ \ \ \ \ \ \ | |_|/ / / / / / |/| | | | | | | logging: Fix log filter during initialization
| * | | | | | | logging: Fix log filter during initializationameerj2021-08-244-12/+16
|/ / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The log filter was being ignored on initialization due to the logging instance being initialized before the config instance, so the log filter was set to its default value. This fixes that oversight, along with using descriptive exceptions instead of abort() calls.
* | | | | | | Merge pull request #6878 from BreadFish64/optimize-GetHostThreadIDAmeer J2021-08-241-10/+13
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | kernel: Optimize GetHostThreadID
| * | | | | | | kernel: Optimize GetHostThreadIDBreadFish642021-08-161-10/+13
| | | | | | | |
* | | | | | | | Merge pull request #6912 from lioncash/pluralbunnei2021-08-241-1/+8
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | CMakeLists: Ensure proper numerusform tags are generated for pluralized translations
| * | | | | | | | CMakeLists: Ensure proper numerusform tags are generated for pluralized translationsLioncash2021-08-221-1/+8
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | If we don't set an explicit source and target language for the base english translation, then we'll generate an incorrect number of <numerusform> tags (which Transifex doesn't like).
* | | | | | | | | Merge pull request #6869 from yzct12345/shiny-logs-in-the-fireplacebunnei2021-08-238-292/+243
|\ \ \ \ \ \ \ \ \ | | |_|_|/ / / / / | |/| | | | | | | logging: Simplify and make thread-safe
| * | | | | | | | logging: Simplify and make thread-safeyzct123452021-08-138-292/+243
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This simplifies the logging system. This also fixes some lost messages on startup. The simplification is simple. I removed unused functions and moved most things in the .h to the .cpp. I replaced the unnecessary linked list with its contents laid out as three member variables. Anything that went through the linked list now directly accesses the backends. Generic functions are replaced with those for each specific use case and there aren't many. This change increases coupling but we gain back more KISS and encapsulation. With those changes it was easy to make it thread-safe. I just removed the mutex and turned a boolean atomic. I was planning to use this thread-safety in my next PR about stacktraces. It was actually async-signal-safety at first but I ended up using a different approach. Anyway getting rid of the linked list is important for that because have the list of backends constantly changing complicates things.
* | | | | | | | | Merge pull request #6904 from Morph1984/lang-settings-rangeAmeer J2021-08-211-1/+1
|\ \ \ \ \ \ \ \ \ | |_|_|_|_|_|/ / / |/| | | | | | | | settings: Amend language_index maximum setting range
| * | | | | | | | settings: Amend language_index maximum setting rangeMorph2021-08-211-1/+1
|/ / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | The maximum is now 17 with the addition of Brazilian Portuguese
* | | | | | | | Merge pull request #6888 from v1993/patch-3Ameer J2021-08-211-1/+1
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | video_core: eliminate constant ternary
| * | | | | | | | video_core: eliminate constant ternaryValeri2021-08-191-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | `via_header_index` is already checked above, so it would never be true in this branch
* | | | | | | | | Merge pull request #6877 from MerryMage/dyn-ignore-assertsbunnei2021-08-205-4/+7
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | dynarmic: Update and enable DYNARMIC_IGNORE_ASSERTS
| * | | | | | | | | dynarmic: Update and enable DYNARMIC_IGNORE_ASSERTSMerry2021-08-152-0/+1
| | | | | | | | | |
| * | | | | | | | | xbyak: Update include pathMerry2021-08-154-4/+6
| | |_|_|/ / / / / | |/| | | | | | |
* | | | | | | | | Merge pull request #6887 from v1993/patch-2Mai M2021-08-191-6/+2
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | SPIR-V: Merge two ifs in EmitGetAttribute
| * | | | | | | | | SPIR-V: Merge two ifs in EmitGetAttributeValeri2021-08-191-6/+2
| | |/ / / / / / / | |/| | | | | | |
* | | | | | | | | Merge pull request #6886 from Morph1984/error-code-64Mai M2021-08-191-6/+25
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | applet_error: Fix 64-bit error code conversion
| * | | | | | | | | applet_error: Fix 64-bit error code conversionMorph2021-08-191-6/+25
| |/ / / / / / / /
* | | | | | | | | Merge pull request #6890 from v1993/patch-5Mai M2021-08-191-16/+18
|\ \ \ \ \ \ \ \ \ | |_|_|_|_|/ / / / |/| | | | | | | | Replace QPoint with QPointF where applicable
| * | | | | | | | Replace QPoint with QPointF where applicableValeri2021-08-191-16/+18
|/ / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | Previously, floats were implicitly cast to integers
* | | | | | | | Merge pull request #6889 from v1993/patch-4Morph2021-08-191-1/+1
|\ \ \ \ \ \ \ \ | |/ / / / / / / |/| | | | | | | qt_software_keyboard: fix copy-paste error
| * | | | | | | qt_software_keyboard: fix copy-paste errorValeri2021-08-191-1/+1
|/ / / / / / /
* | | | | | | Merge pull request #6885 from v1993/patch-1Mai M2021-08-191-1/+1
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | Fix crash in logging in CreateStrayLayer
| * | | | | | | Fix crash in logging in CreateStrayLayerValeri2021-08-191-1/+1
|/ / / / / / / | | | | | | | | | | | | | | It was trying to log value of layer_id which is specifically known not to exist, potentially leading to segfault. Log display_id instead.
* | | | | | | Merge pull request #6884 from v1993/patch-1Morph2021-08-191-1/+1
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | Fix check is thread current in GetThreadContext
| * | | | | | | Fix check is thread current in GetThreadContextValeri2021-08-191-1/+1
|/ / / / / / / | | | | | | | | | | | | | | Misplaced break made it only check for the first core.
* | | | | | | Merge pull request #6832 from bunnei/scheduler-improvementsbunnei2021-08-1923-140/+224
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | kernel: Various improvements to scheduler
| * | | | | | | core: hle: kernel: Disable dispatch count tracking on single core.bunnei2021-08-143-5/+12
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | - This would have limited value, and would be a mess to handle properly.
| * | | | | | | core: hle: kernel: k_thread: Mark KScopedDisableDispatch as nodiscard.bunnei2021-08-071-1/+1
| | | | | | | |
| * | | | | | | core: cpu_manager: Use invalid core_id on init and simplify shutdown.bunnei2021-08-071-7/+3
| | | | | | | |
| * | | | | | | core: hle: service: buffer_queue: Improve management of KEvent.bunnei2021-08-073-14/+24
| | | | | | | |
| * | | | | | | core: hle: kernel: k_auto_object: Add GetName method.bunnei2021-08-071-0/+4
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | - Useful purely for debugging.
| * | | | | | | core: hle: service: nvflinger/vi: Improve management of KEvent.bunnei2021-08-074-16/+30
| | | | | | | |
| * | | | | | | core: hle: kernel: DisableDispatch on suspend threads.bunnei2021-08-071-0/+3
| | | | | | | |
| * | | | | | | core: hle: kernel: k_scheduler: Improve DisableScheduling and EnableScheduling.bunnei2021-08-071-14/+9
| | | | | | | |
| * | | | | | | core: cpu_manager: Use KScopedDisableDispatch.bunnei2021-08-071-7/+8
| | | | | | | |
| * | | | | | | core: hle: kernel: Use CurrentPhysicalCoreIndex as appropriate.bunnei2021-08-071-6/+2
| | | | | | | |
| * | | | | | | core: hle: kernel: k_scheduler: Remove unnecessary MakeCurrentProcess.bunnei2021-08-071-5/+0
| | | | | | | |
| * | | | | | | core: hle: kernel: k_scheduler: Improve ScheduleImpl.bunnei2021-08-071-6/+7
| | | | | | | |
| * | | | | | | core: hle: kernel: k_scheduler: Improve Unload.bunnei2021-08-071-17/+29
| | | | | | | |
| * | | | | | | core: hle: kernel: k_process: DisableDispatch on main thread.bunnei2021-08-071-0/+1
| | | | | | | |
| * | | | | | | core: hle: kernel: k_handle_table: Use KScopedDisableDispatch as necessary.bunnei2021-08-072-0/+8
| | | | | | | |
| * | | | | | | core: hle: kernel: k_thread: Add KScopedDisableDispatch.bunnei2021-08-072-1/+47
| | | | | | | |
| * | | | | | | core: hle: kernel: Ensure idle threads are closed before destroying scheduler.bunnei2021-08-073-24/+22
| | | | | | | |
| * | | | | | | core: hle: kernel: Reflect non-emulated threads as core 3.bunnei2021-08-077-13/+15
| | | | | | | |
| * | | | | | | core: cpu_manager: Use jthread.bunnei2021-08-072-18/+13
| | | | | | | |
* | | | | | | | Merge pull request #6863 from spholz/fix-lan-playFernando S2021-08-1616-103/+409
|\ \ \ \ \ \ \ \ | |_|/ / / / / / |/| | | | | | | Fix LAN Play
| * | | | | | | network_interface: correct formattingSönke Holz2021-08-161-1/+1
| | | | | | | |
| * | | | | | | network_interface: fix mingw-w64 buildspholz2021-08-161-1/+1
| | | | | | | |
| * | | | | | | network: retrieve subnet mask and gateway infoSönke Holz2021-08-165-24/+137
| | | | | | | |
| * | | | | | | configuration: fix mingw-w64 buildSönke Holz2021-08-131-2/+2
| | | | | | | |
| * | | | | | | network: don't use reinterpret_cast in GetAvailableNetworkInterfacesspholz2021-08-131-7/+4
| | | | | | | |
| * | | | | | | network: fix mingw-w64 buildSönke Holz2021-08-131-4/+4
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The header "combaseapi.h" of mingw-w64 defines "interface" as "struct".
| * | | | | | | network: don't use assert to check if no network interfaces are returnedSönke Holz2021-08-131-2/+4
| | | | | | | |
| * | | | | | | configuration: move network_interface include to source fileSönke Holz2021-08-132-2/+1
| | | | | | | |
| * | | | | | | network: use Common::BitCast instead of std::bit_castSönke Holz2021-08-131-2/+3
| | | | | | | |
| * | | | | | | network: narrow down scope of "result" in win32 code forSönke Holz2021-08-131-4/+5
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | GetAvailableNetworkInterfaces
| * | | | | | | configuration: use tr instead of QStringLiteral for "None" item inSönke Holz2021-08-131-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | network interface combobox
| * | | | | | | network: use explicit bool conversions in GetAvailableNetworkInterfacesSönke Holz2021-08-131-1/+1
| | | | | | | |
| * | | | | | | network: initialize ip_addr in GetHostIPv4Address()Sönke Holz2021-08-131-1/+1
| | | | | | | |
| * | | | | | | nifm: use operator*() instead of .value() to get value of std::optionalSönke Holz2021-08-131-2/+2
| | | | | | | |
| * | | | | | | nifm: treat a missing host IP address as a non-critical errorSönke Holz2021-08-131-2/+2
| | | | | | | |
| * | | | | | | Merge branch 'yuzu-emu:master' into fix-lan-playspholz2021-08-1247-1471/+1186
| |\ \ \ \ \ \ \
| * | | | | | | | network: correct formatting in network.cpp and network_interface.cppSönke Holz2021-08-122-8/+6
| | | | | | | | |
| * | | | | | | | configuration: add option to select network interfacespholz2021-08-1216-91/+279
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This commit renames the "Services" tab to "Network" and adds a combobox that allows the user to select the network interface that yuzu should use. This new setting is now used to get the local IP address in Network::GetHostIPv4Address. This prevents yuzu from selecting the wrong network interface and thus using the wrong IP address. The return type of Network::GetHostIPv4Adress has also been changed.
| * | | | | | | | Merge branch 'yuzu-emu:master' into fix-lan-playspholz2021-08-075-205/+52
| |\ \ \ \ \ \ \ \
| * | | | | | | | | network: GetAndLogLastError: ignore Errno::AGAINSönke Holz2021-08-071-1/+5
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | If non-blocking sockets are used, they generate a lot of Errno::AGAIN errors when they didn't receive any data. These errors shouldn't be logged.
| * | | | | | | | | network: GetCurrentIpConfigInfo: return host IP addressSönke Holz2021-08-071-1/+4
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Service::NIFM::IGeneralService::GetCurrentIpConfigInfo currently hardcodes 192.168.1.100 as the IP address, which prevents LAN play from working correctly.
| * | | | | | | | | network: fix fcntl cmdsSönke Holz2021-08-061-2/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | F_SETFL/F_GETFL are the correct commands to set a socket to be non-blocking
* | | | | | | | | | Merge pull request #6861 from yzct12345/const-mempy-is-all-the-speedbunnei2021-08-151-57/+116
|\ \ \ \ \ \ \ \ \ \ | |_|_|_|_|_|_|/ / / |/| | | | | | | | | decoders: Optimize memcpy for the other functions
| * | | | | | | | | decoders: Templates allow memcpy optimizationsyzct123452021-08-121-57/+116
| | | | | | | | | |
* | | | | | | | | | Merge pull request #6868 from yzct12345/safe-threads-no-deadlocksbunnei2021-08-141-6/+4
|\ \ \ \ \ \ \ \ \ \ | |_|_|_|_|_|/ / / / |/| | | | | | | | | threadsafe_queue: Fix deadlock
| * | | | | | | | | threadsafe_queue: Fix deadlockyzct123452021-08-131-6/+4
|/ / / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This fixes a lost wakeup in SPSCQueue. If the reader is in just the right position, the writer's notification will be lost and this will be a problem if the writer then does something to wait on the reader. This was discovered to affect my upcoming stacktrace PR. I don't think any performance decrease will be noticeable because an uncontended mutex is smart enough to skip the syscall. This PR might also resolve some rare deadlocks but I don't know of any examples.
* | | | | | | | | Merge pull request #6862 from german77/badsdlbunnei2021-08-131-0/+3
|\ \ \ \ \ \ \ \ \ | |_|_|_|/ / / / / |/| | | | | | | | input_common: Disable sdl raw input mode
| * | | | | | | | input_common: Disable sdl raw input modegerman772021-08-121-0/+3
| |/ / / / / / /
* | | | | | | | Merge pull request #6838 from ameerj/sws-alignbunnei2021-08-121-3/+2
|\ \ \ \ \ \ \ \ | |/ / / / / / / |/| | | | | | | vic: Specify sws_scale height stride.
| * | | | | | | vic: Specify sws_scale height stride.ameerj2021-08-101-3/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Silences a sws_scale runtime warning about unaligned strides.
* | | | | | | | Merge pull request #6855 from german77/sdl16Mai M2021-08-122-2/+2
|\ \ \ \ \ \ \ \ | |_|_|_|_|_|/ / |/| | | | | | | externals: Update sdl2 to 2.0.16
| * | | | | | | externals: Update sdl2 to 2.0.16german772021-08-112-2/+2
| | | | | | | |
* | | | | | | | Merge pull request #6860 from lat9nq/ranged-settings-2Mai M2021-08-111-7/+22
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | settings: Fix MSVC issues
| * | | | | | | | settings: Fix MSVC issueslat9nq2021-08-111-7/+22
|/ / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | According to https://stackoverflow.com/questions/469508, we run into a MSVC bug (since VS 2005) when using diamond inheritance for RangedSetting. This explicitly implements those functions in RangedSetting. GetValue is implemented as just calling the inherited version. The explicit converson operator is reimplemented. I opted for this over ignoring the warning with a pragma since this specifies the inherited behavior, and I have now less faith in MSVC to pick the right one. In addition, we mark destructors as virtual to silence what I believe is a fair MSVC compilation error.
* | | | | | | | Merge pull request #6776 from lat9nq/ranged-settingsbunnei2021-08-111-26/+136
|\ \ \ \ \ \ \ \ | |/ / / / / / / |/| | | | | | | settings: Implement settings ranges
| * | | | | | | settings: Use std::clamp where possiblelat9nq2021-07-311-39/+9
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Addresses PR review Co-authored-by: PixelyIon <pixelyion@protonmail.com>
| * | | | | | | settings: Remove unnecessary std::move usageslat9nq2021-07-311-12/+12
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Addresses review feedback. Co-authored-by: Mai M. <mathew1800@gmail.com>
| * | | | | | | settings: Fix function virtualizationlat9nq2021-07-301-12/+18
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Fixes a theoretical scenario where a Setting is using the BasicSetting's GetValue function. In practice this probably only happens on yuzu-cmd, where there is no need for a Setting's additional features. Need to fix regardless.
| * | | | | | | settings: Implement setting rangeslat9nq2021-07-301-18/+152
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Clamps the setting's values against the specified minimum and maximum values.
* | | | | | | | Merge pull request #6820 from yzct12345/split-cacheFernando S2021-08-1013-427/+420
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | texture_cache: Split out template definitions
| * | | | | | | | texture_cache: Address ameerj's reviewyzct123452021-08-083-7/+4
| | | | | | | | |
| * | | | | | | | texture_cache: Address ameerj's reviewyzct123452021-08-074-10/+5
| | | | | | | | |
| * | | | | | | | texture_cache: Don't change copyright yearyzct123452021-08-054-4/+4
| | | | | | | | |
| * | | | | | | | texture_cache: Address ameerj's reviewyzct123452021-08-0512-1821/+1821
| | | | | | | | |
| * | | | | | | | texture_cache: Split templates outyzct123452021-08-057-1532/+1533
| | | | | | | | |
* | | | | | | | | Merge pull request #6837 from german77/no-pause-screenshotAmeer J2021-08-101-5/+2
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | main: Avoid stopping emulation when taking a screenshot
| * | | | | | | | | main: Avoid stopping emulation when taking a screenshotgerman772021-08-071-5/+2
| | |_|_|_|_|_|_|/ | |/| | | | | | |
* | | | | | | | | Merge pull request #6823 from yzct12345/memory-cleanupbunnei2021-08-102-491/+163
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | memory: Clean up code
| * | | | | | | | | memory: Address lioncash's reviewyzct123452021-08-071-52/+6
| | | | | | | | | |
| * | | | | | | | | memory: Dedup Read and Write and fix logging bugsyzct123452021-08-071-129/+115
| | | | | | | | | |
| * | | | | | | | | memory: Clean up CopyBlock tooyzct123452021-08-051-36/+15
| | | | | | | | | |
| * | | | | | | | | memory: Address lioncash's reviewyzct123452021-08-052-7/+8
| | | | | | | | | |
| * | | | | | | | | memory: Clean up codeyzct123452021-08-052-329/+81
| | |/ / / / / / / | |/| | | | | | |
* | | | | | | | | Merge pull request #6839 from ameerj/frame-cap-positonbunnei2021-08-091-30/+30
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | configure_general: Swap positions of speed limit and frame limit options
| * | | | | | | | | configure_general: Swap positions of speed limit and frame limit optionsameerj2021-08-081-30/+30
| | |_|_|/ / / / / | |/| | | | | | |
* | | | | | | | | Merge pull request #6844 from ameerj/vp9-empty-frameMai M2021-08-092-3/+3
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | vp9: Ensure the first frame is complete
| * | | | | | | | | vp9: Ensure the first frame is completeameerj2021-08-082-3/+3
| |/ / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | Silences a runtime error due to the first frame missing the frame data, and being set to hidden despite being a key-frame.
* | | | | | | | | Merge pull request #6843 from FernandoS27/lives-in-a-pineapple-under-the-sea-2bunnei2021-08-082-0/+2
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | yuzu-cmd/CMakeLists: Correct attribution for this function.
| * | | | | | | | | yuzu-cmd/CMakeLists: Correct attribution for this function.Fernando Sahmkow2021-08-082-0/+2
|/ / / / / / / / /
* | | | | | | | | Merge pull request #6834 from K0bin/buffer-image-granularityFernando S2021-08-082-2/+8
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | Respect Vulkan bufferImageGranularity
| * | | | | | | | | vulkan_memory_allocator: Respect bufferImageGranularityRobin Kertels2021-08-072-2/+8
| | |_|_|_|_|_|/ / | |/| | | | | | |
* | | | | | | | | Merge pull request #6698 from german77/SDL_QoLbunnei2021-08-084-33/+76
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | input_common: Improve SDL joystick and hide toggle option
| * | | | | | | | | input_common: Improve SDL joystick and hide toggle optiongerman772021-08-084-33/+76
| | |_|_|/ / / / / | |/| | | | | | |
* | | | | | | | | Merge pull request #6817 from gidoly/patch-1bunnei2021-08-081-2/+5
|\ \ \ \ \ \ \ \ \ | |_|_|/ / / / / / |/| | | | | | | | Add description to fast gpu time option
| * | | | | | | | Update configure_graphics_advanced.uigidoly2021-08-051-2/+5
| | | | | | | | | | | | | | | | | | | | | | | | | | | add description too fast gpu time
* | | | | | | | | Merge pull request #6827 from Morph1984/uuid-hashbunnei2021-08-081-0/+11
|\ \ \ \ \ \ \ \ \ | |_|/ / / / / / / |/| | | | | | | | common: uuid: Add hash function for UUID
| * | | | | | | | common: uuid: Add hash function for UUIDMorph2021-08-061-0/+11
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Used when UUID is a key in an unordered_map. The hash is produced by XORing the high and low 64-bits of the UUID together.
* | | | | | | | | Merge pull request #6830 from ameerj/nvdec-unimpld-codecbunnei2021-08-071-1/+1
|\ \ \ \ \ \ \ \ \ | |_|_|/ / / / / / |/| | | | | | | | nvdec: Better logging for unimplemented codecs
| * | | | | | | | nvdec: Better logging for unimplemented codecsameerj2021-08-071-1/+1
| | |_|_|_|_|/ / | |/| | | | | |
* | | | | | | | Merge pull request #6795 from sankasan/cmd-remove-cursor-fullscreenbunnei2021-08-074-0/+9
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | yuzu-cmd: hide mouse cursor when started fullscreen
| * | | | | | | | yuzu-cmd: hide cursor when in fullscreensan2021-08-014-0/+9
| | | | | | | | | | | | | | | | | | | | | | | | | | | Exposed the SDL_ShowCursor function to EmuWindow baseclass. When creating the window (GL or VK) in fullscreen it now automatically hides the cursor.
* | | | | | | | | Merge pull request #6815 from german77/ui_improvementsbunnei2021-08-073-23/+48
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | settings_ui: Add emulated joystick position dot to controller preview
| * | | | | | | | | settings_ui: Use better colors for the light themegerman772021-08-041-2/+2
| | | | | | | | | |
| * | | | | | | | | settings_ui: Add emulated joystick position dot to controller previewgerman772021-08-042-21/+46
| | |_|_|_|_|/ / / | |/| | | | | | |
* | | | | | | | | Merge pull request #6791 from ameerj/astc-optbunnei2021-08-077-421/+251
|\ \ \ \ \ \ \ \ \ | |_|_|/ / / / / / |/| | | | | | | | astc_decoder: Various performance and memory optimizations
| * | | | | | | | astc_decoder: Reduce workgroup sizeameerj2021-08-013-5/+5
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This reduces the amount of over dispatching when there are odd dimensions (i.e. ASTC 8x5), which rarely evenly divide into 32x32.
| * | | | | | | | astc_decoder: Compute offset swizzles in-shaderameerj2021-08-014-109/+25
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Alleviates the dependency on the swizzle table and a uniform which is constant for all ASTC texture sizes.
| * | | | | | | | astc_decoder: Make use of uvec4 for payload dataameerj2021-08-011-79/+43
| | | | | | | | |
| * | | | | | | | astc_decoder: Simplify Select2DPartitionameerj2021-08-011-38/+19
| | | | | | | | |
| * | | | | | | | astc_decoder: Optimize the use EncodingDataameerj2021-08-016-138/+108
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This buffer was a list of EncodingData structures sorted by their bit length, with some duplication from the cpu decoder implementation. We can take advantage of its sorted property to optimize its usage in the shader. Thanks to wwylele for the optimization idea.
| * | | | | | | | astc.h: Move data to cpp implementationameerj2021-08-012-64/+63
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Moves leftover values that are no longer used by the gpu decoder back to the cpp implementation.
* | | | | | | | | Merge pull request #6799 from ameerj/vp9-fixesbunnei2021-08-075-205/+52
|\ \ \ \ \ \ \ \ \ | |_|_|_|_|_|_|/ / |/| | | | | | | | nvdec: Fix VP9 reference frame refreshes
| * | | | | | | | nvhost_nvdec_common: Remove BufferMapameerj2021-08-072-76/+0
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This was mainly used to keep track of mapped buffers for later unmapping. Since unmap is no longer implemented, this no longer seves a valuable purpose.
| * | | | | | | | vp9: Cleanup unused variablesameerj2021-08-073-58/+17
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | With reference frames refreshes fix, we no longer need to buffer two frames in advance. We can also remove other unused or otherwise unneeded variables.
| * | | | | | | | vp9: Fix reference frame refreshesameerj2021-08-072-48/+31
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This resolves the artifacting when decoding VP9 streams.
| * | | | | | | | nvhost_nvdec_common: Stub UnmapBuffer Ioctlameerj2021-08-071-23/+4
| |/ / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | Skip unmapping nvdec buffers to avoid breaking the continuity of the VP9 reference frame addresses, and the risk of invalidating data before the async GPU thread is done with it.
* | | | | | | | Merge pull request #6822 from yzct12345/clion-assertbunnei2021-08-061-2/+6
|\ \ \ \ \ \ \ \ | |_|_|_|/ / / / |/| | | | | | | assert: Avoid empty macros
| * | | | | | | assert: Verify formattingyzct123452021-08-051-2/+6
| | | | | | | |
| * | | | | | | assert: Avoid empty macrosyzct123452021-08-051-2/+2
| | |_|_|_|/ / | |/| | | | |
* | | | | | | Merge pull request #6813 from Morph1984/hex-string-to-uuidbunnei2021-08-052-0/+73
|\ \ \ \ \ \ \ | |/ / / / / / |/| | | | | | common: uuid: Add hex string to UUID constructor
| * | | | | | common: uuid: Add hex string to UUID constructorMorph2021-08-042-0/+73
| | |_|_|/ / | |/| | | | | | | | | | | | | | | | This allows for easily converting a hex string into a Common::UUID, which is backed by a 128 bit unsigned integer.
* | | | | | Merge pull request #6819 from Morph1984/i-am-dumbMai M2021-08-051-2/+4
|\ \ \ \ \ \ | | | | | | | | | | | | | | applet_swkbd: Include the null terminator in the buffer size calculation
| * | | | | | applet_swkbd: Include the null terminator in the buffer size calculationMorph2021-08-051-2/+4
| |/ / / / / | | | | | | | | | | | | | | | | | | Some games may interpret the read string as a null-terminated string instead of just reading the string up to buffer_size.
* | | | | | Merge pull request #6818 from Morph1984/hex-util-bugMai M2021-08-051-1/+1
|\ \ \ \ \ \ | | | | | | | | | | | | | | hex_util: Fix incorrect array size in AsArray
| * | | | | | hex_util: Fix incorrect array size in AsArrayMorph2021-08-051-1/+1
| |/ / / / / | | | | | | | | | | | | | | | | | | Although this isn't used, this is a potential bug as HexStringToArray will perform an out-of-bounds read.
* | | | | | Merge pull request #6816 from lat9nq/fix-mult-contrlMorph2021-08-051-0/+3
|\ \ \ \ \ \ | |/ / / / / |/| | | | | config: Read connected setting for controllers
| * | | | | config: Read connected setting for controllerslat9nq2021-08-041-0/+3
|/ / / / / | | | | | | | | | | | | | | | | | | | | | | | | | Currently yuzu will read the mapping but does not connect a controller despite adding subsequent configurations for it. Read the `connected` setting for now as a boolean like the Qt frontend.
* | | | | nvdec: Implement VA-API hardware video acceleration (#6713)yzct123452021-08-046-76/+210
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * nvdec: VA-API * Verify formatting * Forgot a semicolon for Windows * Clarify comment about AV_PIX_FMT_NV12 * Fix assert log spam from missing negation * vic: Remove forgotten debug code * Address lioncash's review * Mention VA-API is Intel/AMD * Address v1993's review * Hopefully fix CMakeLists style this time * vic: Improve cache locality * vic: Fix off-by-one error * codec: Async * codec: Forgot the GetValue() * nvdec: Address ameerj's review * codec: Fallback to CPU without VA-API support * cmake: Address lat9nq's review * cmake: Make VA-API optional * vaapi: Multiple GPU * Apply suggestions from code review Co-authored-by: Ameer J <52414509+ameerj@users.noreply.github.com> * nvdec: Address ameerj's review * codec: Use anonymous instead of static * nvdec: Remove enum and fix memory leak * nvdec: Address ameerj's review * codec: Remove preparation for threading Co-authored-by: Ameer J <52414509+ameerj@users.noreply.github.com>
* | | | | Merge pull request #6805 from lat9nq/fix-user-profilesMorph2021-08-031-5/+6
|\ \ \ \ \ | | | | | | | | | | | | config: Only read/write current_user on global config
| * | | | | config: Only read/write current_user on global configlat9nq2021-08-031-5/+6
| | | | | |
* | | | | | Merge pull request #6801 from spholz/spholz-patch-1Morph2021-08-021-1/+1
|\ \ \ \ \ \ | |/ / / / / |/| | | | | network: fix ternary operator in Socket::SendTo
| * | | | | network: fix ternary operator in Socket::SendTospholz2021-08-021-1/+1
|/ / / / /
* | | / / decoders: Optimize swizzle copy performance (#6790)yzct123452021-08-021-9/+43
| |_|/ / |/| | | | | | | This makes UnswizzleTexture up to two times faster. It is the main bottleneck in NVDEC video decoding.
* | | | game_list: Make game list folder icons smaller (#6762)Malte Jürgens2021-08-016-28/+70
| | | | | | | | | | | | Makes the default game list folder icons 48x48 by default instead of 64x64, and allows for selecting small (24x24) and large (72x72) icon sizes.
* | | | Merge pull request #6793 from Morph1984/lang-fixMorph2021-08-011-1/+2
|\ \ \ \ | | | | | | | | | | service: set: Correct copy amount in GetAvailableLanguageCodes
| * | | | service: set: Correct copy amount in GetAvailableLanguageCodesMorph2021-08-011-1/+2
|/ / / /
* | | | Merge pull request #6720 from ameerj/vk-screenshotFernando S2021-08-018-75/+247
|\ \ \ \ | | | | | | | | | | renderer_vulkan: Implement screenshots
| * | | | renderers: Add explicit invert_y bool to screenshot callbackameerj2021-07-295-7/+7
| | | | | | | | | | | | | | | | | | | | OpenGL and Vulkan images render in different coordinate systems. This allows us to specify the coordinate system of the screenshot within each renderer
| * | | | renderer_vulkan: Implement screenshotsameerj2021-07-292-0/+152
| | | | |
| * | | | vk_blit_screen: Add public CreateFramebuffer methodameerj2021-07-292-14/+18
| | | | |
| * | | | vk_blit_screen: Make Draw method more genericameerj2021-07-293-55/+71
| | | | | | | | | | | | | | | | | | | | Allows specifying the framebuffer and render area dimensions, rather than being hard coded for the render window.
* | | | | Merge pull request #6765 from ReinUsesLisp/y-negate-vkAmeer J2021-08-011-2/+7
|\ \ \ \ \ | | | | | | | | | | | | vk_rasterizer: Flip viewport on Y_NEGATE
| * | | | | vk_rasterizer: Flip viewport on Y_NEGATEReinUsesLisp2021-07-291-2/+7
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Matches OpenGL's behavior. I don't believe this register flips geometry, but we have to try to match behavior on both backends.
* | | | | | Merge pull request #6565 from lat9nq/bundle-ffmpegAmeer J2021-08-013-2/+7
|\ \ \ \ \ \ | |_|_|/ / / |/| | | | | cmake, ci: Build bundled FFmpeg with yuzu
| * | | | | cmake: Specify the compiler on autotools externalslat9nq2021-07-062-0/+4
| | | | | | | | | | | | | | | | | | | | | | | | Enables CCache on externals if available.
| * | | | | cmake, ci: Build bundled FFmpeg with yuzulat9nq2021-07-062-3/+6
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Drops usage of CMAKE_DEPENDENT_OPTION to allow using YUZU_USE_BUNDLED_FFMPEG as an option on any platform. CI then now builds FFmpeg always, netting about 10 MB less used on the AppImage. Also somewhat fixes YUZU_USE_BUNDLED_QT so that it can be used even if CMake doesn't clean up its state after running the first find_package.
* | | | | | Merge pull request #6788 from Morph1984/hle_api_12.1.0Mai M2021-08-011-7/+7
|\ \ \ \ \ \ | | | | | | | | | | | | | | hle: api_version: Update HOS version to 12.1.0
| * | | | | | hle: api_version: Update HOS version to 12.1.0Morph2021-07-311-7/+7
|/ / / / / / | | | | | | | | | | | | | | | | | | Keeps us up to date with reporting the system version.
* | | | | | Merge pull request #6752 from Morph1984/pt-brbunnei2021-07-305-11/+20
|\ \ \ \ \ \ | | | | | | | | | | | | | | service: ns, set: Add PT_BR (Brazilian Portuguese)
| * | | | | | configure_system: Add Brazilian Portuguese to the list of languagesMorph2021-07-302-1/+6
| | | | | | |
| * | | | | | service: set: Correct 4.0.0 max_entries to 0x40 (64) instead of 17Morph2021-07-301-8/+8
| | | | | | |
| * | | | | | service: ns, set: Add PT_BR (Brazilian Portuguese)Morph2021-07-303-2/+6
| | |_|_|/ / | |/| | | |
* | | | | | Merge pull request #6775 from lat9nq/cmd-remove-global-corebunnei2021-07-307-12/+23
|\ \ \ \ \ \ | | | | | | | | | | | | | | emu_window: Remove global system instance
| * | | | | | emu_window: Remove global system instancelat9nq2021-07-307-12/+23
| |/ / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | It was just the one in emu_window_sdl2, but since _gl and _vk inherit from it, they all needed adjustments. Leaves just the one auto system& in main().
* | | | | | Merge pull request #6759 from ReinUsesLisp/pipeline-statisticsbunnei2021-07-3019-24/+307
|\ \ \ \ \ \ | | | | | | | | | | | | | | renderer_vulkan: Add setting to log pipeline statistics
| * | | | | | renderer_vulkan: Add setting to log pipeline statisticsReinUsesLisp2021-07-2819-24/+307
| | |_|_|_|/ | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Use VK_KHR_pipeline_executable_properties when enabled and available to log statistics about the pipeline cache in a game. For example, this is on Turing GPUs when generating a pipeline cache from Super Smash Bros. Ultimate: Average pipeline statistics ========================================== Code size: 6433.167 Register count: 32.939 More advanced results could be presented, at the moment it's just an average of all 3D and compute pipelines.
* | | | | | Merge pull request #6770 from Morph1984/swkbd_buffer_sizebunnei2021-07-301-2/+2
|\ \ \ \ \ \ | |_|/ / / / |/| | | | | applet_swkbd: Correct string buffer size calculation
| * | | | | applet_swkbd: Correct string buffer size calculationMorph2021-07-301-2/+2
|/ / / / / | | | | | | | | | | | | | | | The buffer size here does not include the initial 8 bytes.
* | | | | Merge pull request #6767 from ReinUsesLisp/fold-float-packMorph2021-07-301-0/+4
|\ \ \ \ \ | | | | | | | | | | | | shader: Fold UnpackFloat2x16 and PackFloat2x16
| * | | | | shader: Fold UnpackFloat2x16 and PackFloat2x16ReinUsesLisp2021-07-301-0/+4
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Simplifies the code a bit when possible. These instructions should be no-ops codegen wise.
* | | | | | Merge pull request #6722 from ReinUsesLisp/xmad-optsbunnei2021-07-302-14/+195
|\ \ \ \ \ \ | |/ / / / / |/| | | | | shader: Fold integer FMA from Nvidia's pattern
| * | | | | shader: Fold integer FMA from Nvidia's patternReinUsesLisp2021-07-261-0/+175
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Fold shaders doing "a * b + c" on integers from the pattern generated by Nvidia's GL compiler. On a somewhat complex compute shader it reduces the code size by 16 instructions from 2 matches on Turing GPUs. On Intel as extracted from KHR_pipeline_executable_properties: Before the optimization: ``` Instruction Count: 2057 Basic Block Count: 45 Scratch Memory Size: 14752 Spill Count: 232 Fill Count: 261 SEND Count: 610 Cycle Count: 11325 ``` After the optimization: ``` Instruction Count: 2046 Basic Block Count: 44 Scratch Memory Size: 13728 Spill Count: 219 Fill Count: 268 SEND Count: 604 Cycle Count: 11367 ```
| * | | | | shader: Use TryInstRecursive on XMAD multiply foldingReinUsesLisp2021-07-261-14/+12
| | | | | | | | | | | | | | | | | | | | | | | | Simplify a bit the logic.
| * | | | | shader: Add TryInstRecursive utility to valuesReinUsesLisp2021-07-261-0/+8
| | | | | |
* | | | | | Merge pull request #6751 from Morph1984/languagecodeAmeer J2021-07-292-42/+2
|\ \ \ \ \ \ | | | | | | | | | | | | | | service: ns: Map ZH_TW and ZH_CN to Traditional/Simplified Chinese
| * | | | | | service: ns: Remove unused ns_language headerMorph2021-07-271-42/+0
| | | | | | |
| * | | | | | service: ns: Map ZH_TW and ZH_CN to Traditional/Simplified ChineseMorph2021-07-271-0/+2
| | | | | | |
* | | | | | | Merge pull request #6742 from Morph1984/uuidbunnei2021-07-293-15/+15
|\ \ \ \ \ \ \ | |_|_|_|_|/ / |/| | | | | | common: uuid: Return a lower-case hex string in Format
| * | | | | | common: uuid: Return a lower-case hex string in FormatMorph2021-07-273-15/+15
| | | | | | |
* | | | | | | Merge pull request #6760 from ReinUsesLisp/fp16-collectbunnei2021-07-281-0/+2
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | shader: Mark ConvertF16F32 and ConvertF32F16 as fp16 instructions
| * | | | | | | shader: Mark ConvertF16F32 and ConvertF32F16 as fp16 instructionsReinUsesLisp2021-07-281-0/+2
| | |_|_|_|_|/ | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Fixes instances where fp16 types are not declared on SPIR-V but they are used. This shouldn't happen on master, as it's been uncovered by an additional optimization pass.
* | | | | | | Merge pull request #6758 from jbeich/fastmembunnei2021-07-281-2/+7
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | host_memory: enable fastmem on FreeBSD
| * | | | | | | host_memory: Add workaround for FreeBSD 12Jan Beich2021-07-271-0/+5
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | src/common/host_memory.cpp:360:14: error: use of undeclared identifier 'memfd_create' fd = memfd_create("HostMemory", 0); ^
| * | | | | | | host_memory: Enable Linux implementation on FreeBSDJan Beich2021-07-271-2/+2
| | |_|_|_|/ / | |/| | | | | | | | | | | | | | | | | | | HW.Memory <Critical> common/host_memory.cpp:HostMemory:492: Fastmem unavailable, falling back to VirtualBuffer for memory allocation
* | | | | | | Merge pull request #6700 from lat9nq/fullscreen-enumbunnei2021-07-2810-63/+40
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | general: Implement FullscreenMode enumeration
| * \ \ \ \ \ \ Merge branch 'master' into fullscreen-enumlat9nq2021-07-25453-27358/+49784
| |\ \ \ \ \ \ \ | | | |_|/ / / / | | |/| | | | |
| * | | | | | | configuration: Use combobox apply template where possiblelat9nq2021-07-232-35/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | We don't need to manually apply this setting now that a template can do this for us.
| * | | | | | | general: Implement FullscreenMode enumerationlat9nq2021-07-238-28/+38
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Prevents us from using an unclear 0 or 1 to describe the fullscreen mode.
* | | | | | | | Merge pull request #6671 from jls47/masterMorph2021-07-283-1/+23
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | applets/web: Addressing QT Navigation issues in Linux
| * | | | | | | | qt_web_browser: Fix lambda capture for HIDButtonjls472021-07-271-1/+1
| | | | | | | | |
| * | | | | | | | qt_web_browser: Focus on the first link elementjls472021-07-273-0/+22
| | |_|_|_|/ / / | |/| | | | | | | | | | | | | | | | | | | | | | Focusing on the first link element fixes element navigation upon loading the web applet in games such as Super Mario Odyssey
* | | | | | | | Merge pull request #6753 from jbeich/libusbAmeer J2021-07-281-1/+1
|\ \ \ \ \ \ \ \ | |_|_|_|_|/ / / |/| | | | | | | cmake: unbreak libusb detection on FreeBSD
| * | | | | | | cmake: don't use pkg-config directly with non-reference libusbJan Beich2021-07-271-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | CMake Error at externals/libusb/CMakeLists.txt:120 (add_library): Cannot find source file: libusb/libusb/core.c Tried extensions .c .C .c++ .cc .cpp .cxx .cu .mpp .m .M .mm .h .hh .h++ .hm .hpp .hxx .in .txx .f .F .for .f77 .f90 .f95 .f03 .ispc CMake Error at externals/libusb/CMakeLists.txt:120 (add_library): No SOURCES given to target: usb ld: error: undefined symbol: libusb_interrupt_transfer >>> referenced by gc_adapter.cpp >>> gc_adapter.cpp.o:(GCAdapter::Adapter::SendVibrations()) in archive src/input_common/libinput_common.a >>> referenced by gc_adapter.cpp >>> gc_adapter.cpp.o:(GCAdapter::Adapter::GetGCEndpoint(libusb_device*)) in archive src/input_common/libinput_common.a >>> referenced by gc_adapter.cpp >>> gc_adapter.cpp.o:(GCAdapter::Adapter::AdapterInputThread()) in archive src/input_common/libinput_common.a ld: error: undefined symbol: libusb_error_name >>> referenced by gc_adapter.cpp >>> gc_adapter.cpp.o:(GCAdapter::Adapter::SendVibrations()) in archive src/input_common/libinput_common.a ld: error: undefined symbol: libusb_control_transfer >>> referenced by gc_adapter.cpp >>> gc_adapter.cpp.o:(GCAdapter::Adapter::CheckDeviceAccess()) in archive src/input_common/libinput_common.a ld: error: undefined symbol: libusb_kernel_driver_active >>> referenced by gc_adapter.cpp >>> gc_adapter.cpp.o:(GCAdapter::Adapter::CheckDeviceAccess()) in archive src/input_common/libinput_common.a ld: error: undefined symbol: libusb_close >>> referenced by gc_adapter.cpp >>> gc_adapter.cpp.o:(GCAdapter::Adapter::CheckDeviceAccess()) in archive src/input_common/libinput_common.a >>> referenced by gc_adapter.cpp >>> gc_adapter.cpp.o:(GCAdapter::Adapter::ClearLibusbHandle()) in archive src/input_common/libinput_common.a >>> referenced by gc_adapter.cpp >>> gc_adapter.cpp.o:(GCAdapter::Adapter::Reset()) in archive src/input_common/libinput_common.a >>> referenced by gc_adapter.cpp >>> gc_adapter.cpp.o:(GCAdapter::Adapter::Setup()) in archive src/input_common/libinput_common.a >>> referenced by gc_adapter.cpp >>> gc_adapter.cpp.o:(GCAdapter::Adapter::AdapterScanThread()) in archive src/input_common/libinput_common.a ld: error: undefined symbol: libusb_detach_kernel_driver >>> referenced by gc_adapter.cpp >>> gc_adapter.cpp.o:(GCAdapter::Adapter::CheckDeviceAccess()) in archive src/input_common/libinput_common.a ld: error: undefined symbol: libusb_claim_interface >>> referenced by gc_adapter.cpp >>> gc_adapter.cpp.o:(GCAdapter::Adapter::CheckDeviceAccess()) in archive src/input_common/libinput_common.a ld: error: undefined symbol: libusb_get_config_descriptor >>> referenced by gc_adapter.cpp >>> gc_adapter.cpp.o:(GCAdapter::Adapter::GetGCEndpoint(libusb_device*)) in archive src/input_common/libinput_common.a ld: error: undefined symbol: libusb_release_interface >>> referenced by gc_adapter.cpp >>> gc_adapter.cpp.o:(GCAdapter::Adapter::ClearLibusbHandle()) in archive src/input_common/libinput_common.a >>> referenced by gc_adapter.cpp >>> gc_adapter.cpp.o:(GCAdapter::Adapter::Reset()) in archive src/input_common/libinput_common.a >>> referenced by gc_adapter.cpp >>> gc_adapter.cpp.o:(GCAdapter::Adapter::Setup()) in archive src/input_common/libinput_common.a >>> referenced by gc_adapter.cpp >>> gc_adapter.cpp.o:(GCAdapter::Adapter::AdapterScanThread()) in archive src/input_common/libinput_common.a ld: error: undefined symbol: libusb_init >>> referenced by gc_adapter.cpp >>> gc_adapter.cpp.o:(GCAdapter::Adapter::Adapter()) in archive src/input_common/libinput_common.a ld: error: undefined symbol: libusb_open_device_with_vid_pid >>> referenced by gc_adapter.cpp >>> gc_adapter.cpp.o:(GCAdapter::Adapter::Setup()) in archive src/input_common/libinput_common.a ld: error: undefined symbol: libusb_get_device >>> referenced by gc_adapter.cpp >>> gc_adapter.cpp.o:(GCAdapter::Adapter::Setup()) in archive src/input_common/libinput_common.a ld: error: undefined symbol: libusb_exit >>> referenced by gc_adapter.cpp >>> gc_adapter.cpp.o:(GCAdapter::Adapter::Reset()) in archive src/input_common/libinput_common.a
* | | | | | | | Merge pull request #6749 from lioncash/rtargetbunnei2021-07-281-3/+3
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | render_target: Add missing initializer for size extent
| * | | | | | | | render_target: Add missing initializer for size extentLioncash2021-07-271-3/+3
| | |/ / / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Everything else has a default constructor that does the straightforward thing of initializing most members to a default value, except for the size. We explicitly initialize the size (and others, for consistency), to prevent potential uninitialized reads from occurring. Particularly given the largeish surface area that this struct is used in.
* | | | | | | | Merge pull request #6730 from Morph1984/buf_to_stdstringbunnei2021-07-282-0/+15
|\ \ \ \ \ \ \ \ | |_|_|_|_|/ / / |/| | | | | | | common: fs: fs_util: Add BufferToUTF8String
| * | | | | | | common: fs: fs_util: Add BufferToUTF8StringMorph2021-07-272-0/+15
| |/ / / / / / | | | | | | | | | | | | | | | | | | | | | Allows for direct conversion to std::string without having to convert std::u8string to std::string
* | | | | | | Merge pull request #6748 from lioncash/engine-initRodrigo Locatti2021-07-272-2/+2
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | video_core/engine: Consistently initialize rasterizer pointers
| * | | | | | | video_core/engine: Consistently initialize rasterizer pointersLioncash2021-07-272-2/+2
| |/ / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | Ensures all of the engines have consistent and deterministic initialization of the rasterizer pointers.
* | | | | | | Merge pull request #6744 from lioncash/excRodrigo Locatti2021-07-271-6/+6
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | exception: Make constructors explicit
| * | | | | | | exception: Make constructors explicitLioncash2021-07-271-4/+4
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Ensures that exception construction is always explicit.
| * | | | | | | exception: Make what() member function nodiscardLioncash2021-07-271-1/+1
| | | | | | | |
| * | | | | | | exception: Narrow down specific headerLioncash2021-07-271-1/+1
| |/ / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | We can use the <exception> header instead of pulling in all of the exception-style classes.
* | | | | | | Merge pull request #6745 from lioncash/copiesbunnei2021-07-273-5/+2
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | video_core: Remove some unused variables
| * | | | | | | buffer_cache: Remove unused small_vector in CommitAsyncFlushesHigh()Lioncash2021-07-271-1/+0
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Given this is non-trivial, the constructor is required to execute, so this removes a bit of redundant codegen.
| * | | | | | | gl_shader_cache: Remove unused variableLioncash2021-07-271-1/+0
| | | | | | | |
| * | | | | | | vk_compute_pass: Remove unused capturesLioncash2021-07-271-3/+2
| |/ / / / / / | | | | | | | | | | | | | | | | | | | | | Resolves two compiler warnings.
* | | | | | | Merge pull request #6747 from lioncash/wrapperbunnei2021-07-271-1/+1
|\ \ \ \ \ \ \ | |/ / / / / / |/| | | | | | vulkan_wrapper: Fix SetObjectName() always indicating objects as images
| * | | | | | vulkan_wrapper: Fix SetObjectName() always indicating objects as imagesLioncash2021-07-271-1/+1
|/ / / / / / | | | | | | | | | | | | | | | | | | We should be using the passed in object type instead.
* | | | | | Merge pull request #6696 from ameerj/speed-limit-renamebunnei2021-07-2718-88/+80
|\ \ \ \ \ \ | | | | | | | | | | | | | | general: Rename "Frame Limit" references to "Speed Limit"
| * | | | | | renderer_base: Removed redundant settingsameerj2021-07-243-12/+4
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | use_framelimiter was not being used internally by the renderers. set_background_color was always set to true as there is no toggle for the renderer background color, instead users directly choose the color of their choice.
| * | | | | | general: Rename "Frame Limit" references to "Speed Limit"ameerj2021-07-2416-77/+77
| | |/ / / / | |/| | | | | | | | | | | | | | | | | | | | | | This setting is best referred to as a speed limit, as it involves the limits of all timing based aspects of the emulator, not only framerate. This allows us to differentiate it from the fps unlocker setting.
* | | | | | Merge pull request #6741 from ReinUsesLisp/stream-removeRodrigo Locatti2021-07-272-244/+0
|\ \ \ \ \ \ | | | | | | | | | | | | | | vk_stream_buffer: Remove unused stream buffer
| * | | | | | vk_stream_buffer: Remove unused stream bufferReinUsesLisp2021-07-262-244/+0
| | | | | | | | | | | | | | | | | | | | | | | | | | | | Remove unused file.
* | | | | | | Merge pull request #6740 from K0bin/hvv-fallbackRodrigo Locatti2021-07-271-8/+21
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | Handle allocation failure in Staging buffer
| * | | | | | | vk_staging_buffer_pool: Fall back to host memory when allocation failsRobin Kertels2021-07-261-8/+21
| | | | | | | |
* | | | | | | | Merge pull request #6728 from ReinUsesLisp/null-buffer-usageRodrigo Locatti2021-07-261-3/+7
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | vk_buffer_cache: Add transform feedback usage to null buffer
| * | | | | | | | vk_buffer_cache: Add transform feedback usage to null bufferReinUsesLisp2021-07-261-3/+7
| | |_|_|_|_|/ / | |/| | | | | | | | | | | | | | | | | | | | | | Fixes bad API usages on Vulkan.
* | | | | | | | Merge pull request #6729 from ReinUsesLisp/quad-indexed-barrierRodrigo Locatti2021-07-261-1/+1
|\ \ \ \ \ \ \ \ | |_|_|/ / / / / |/| | | | | | | vk_compute_pass: Fix pipeline barrier for indexed quads
| * | | | | | | vk_compute_pass: Fix pipeline barrier for indexed quadsReinUsesLisp2021-07-261-1/+1
| |/ / / / / / | | | | | | | | | | | | | | | | | | | | | Use an index buffer barrier instead of a vertex input read barrier.
* | | | | | | Merge pull request #6724 from lioncash/nodisc-shaderRodrigo Locatti2021-07-262-4/+4
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | shader_recompiler: Remove unnecessary [[nodiscard]] instances
| * | | | | | | shader_recompiler: Remove unnecessary [[nodiscard]] instancesLioncash2021-07-262-4/+4
| | |_|_|_|/ / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | [[nodiscard]] doesn't do anything on functions with a void return type and causes superfluous warnings.
* | | | | | | Merge pull request #6726 from lioncash/hguardRodrigo Locatti2021-07-261-0/+2
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | emit_spirv_instructions: Add missing header guard
| * | | | | | | emit_spirv_instructions: Add missing header guardLioncash2021-07-261-0/+2
| |/ / / / / /
* | | | | | | Merge pull request #6727 from lioncash/topologyRodrigo Locatti2021-07-261-1/+1
|\ \ \ \ \ \ \ | |_|_|/ / / / |/| | | | | | emit_glasm: Fix LINESS_ADJACENCY typo in InputPrimitive()
| * | | | | | emit_glasm: Fix LINESS_ADJACENCY typo in InputPrimitive()Lioncash2021-07-261-1/+1
| |/ / / / / | | | | | | | | | | | | | | | | | | This should be LINES_ADJACENCY
* | | | | | Merge pull request #6736 from CaptV0rt3x/patch-1bunnei2021-07-261-1/+1
|\ \ \ \ \ \ | | | | | | | | | | | | | | Config-graphics: reword GLASM option
| * | | | | | configure_graphics: reword GLASM optionVamsi Krishna2021-07-261-1/+1
|/ / / / / / | | | | | | | | | | | | Change wording to explain that GLASM is actually short for Assembly Shaders
* | | | | | Merge pull request #6723 from lioncash/shaderRodrigo Locatti2021-07-261-0/+1
|\ \ \ \ \ \ | | | | | | | | | | | | | | object_pool: Add missing return in Chunk move assignment operator
| * | | | | | object_pool: Add missing return in Chunk move assignment operatorLioncash2021-07-261-0/+1
| |/ / / / / | | | | | | | | | | | | | | | | | | Prevents undefined behavior from occurring.
* | | | | | Merge pull request #6725 from lioncash/control-tokenRodrigo Locatti2021-07-261-1/+1
|\ \ \ \ \ \ | |_|/ / / / |/| | | | | control_flow: Fix duplicate switch case in OpcodeToken
| * | | | | control_flow: Fix duplicate switch case in OpcodeTokenLioncash2021-07-261-1/+1
| |/ / / / | | | | | | | | | | | | | | | This previously duplicated the case of the PBK case above it.
* | | | | Merge pull request #6697 from ameerj/fps-capbunnei2021-07-268-6/+49
|\ \ \ \ \ | |/ / / / |/| | | | config, nvflinger: Add FPS cap setting
| * | | | config, nvflinger: Add FPS cap settingameerj2021-07-248-6/+49
| |/ / / | | | | | | | | | | | | Allows finer tuning of the FPS limit.
* | | | Merge pull request #6575 from FernandoS27/new_settingsbunnei2021-07-255-39/+107
|\ \ \ \ | | | | | | | | | | Settings: Eliminate ASYNC & MULTICORE Toggles and add GPU Accuracy to status bar
| * | | | Update src/yuzu/main.cppFernando S2021-07-091-2/+2
| | | | | | | | | | | | | | | Co-authored-by: Morph <39850852+Morph1984@users.noreply.github.com>
| * | | | Settings: Eliminate ASYNC & MULTICORE Toggles and add GPU Accuracy Toggle.Fernando Sahmkow2021-07-095-39/+107
| | | | |
* | | | | Merge pull request #6709 from ameerj/screenshot-pathMorph2021-07-251-1/+1
|\ \ \ \ \ | | | | | | | | | | | | main: Fix screenshot filepath construction
| * | | | | main: Fix screenshot filepath constructionameerj2021-07-251-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The screenshot directory path returned does not have a trailing directory separator character. This caused screenshots to be saved in the parent directory of the configured screenshot directory. This fixes that behavior
* | | | | | Merge pull request #6585 from ameerj/hadesbunnei2021-07-25428-27220/+49341
|\ \ \ \ \ \ | |/ / / / / |/| | | | | Shader Decompiler Rewrite
| * | | | | shader: Support out of bound local memory reads and immediate writesReinUsesLisp2021-07-231-4/+21
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Support ignoring immediate out of bound writes. Writing dynamically out of bounds is not yet supported (e.g. R0+0x4). Reading out of bounds yields zero. This is supported checking for the size from the IR; if the input is immediate, the optimization passes will drop it.
| * | | | | vulkan/blit_image: Commit descriptor sets within worker threadReinUsesLisp2021-07-231-9/+7
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Fixes race condition caused. The descriptor pool is not thread safe, so we have to commit descriptor sets within the same thread.
| * | | | | vulkan_device: Blacklist Volta and older from VK_KHR_push_descriptorReinUsesLisp2021-07-231-4/+39
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Causes crashes on Link's Awakening intro. It's hard to debug if it's our fault due to bugs in validation layers.
| * | | | | cmake: Remove unused code in GenerateSCMRev.cmakeReinUsesLisp2021-07-231-11/+2
| | | | | | | | | | | | | | | | | | | | | | | | Remove shader code hash generation code as it's no longer used.
| * | | | | qt: Remove "experimental" from asynchronous shader building UIReinUsesLisp2021-07-231-1/+1
| | | | | |
| * | | | | Revert "renderers: Disable async shader compilation"ReinUsesLisp2021-07-232-5/+3
| | | | | | | | | | | | | | | | | | | | | | | | This reverts commit 4a152767286717fa69bfc94846a124a366f70065.
| * | | | | opengl: Fix asynchronous shadersReinUsesLisp2021-07-232-4/+33
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Wait for shader to build before configuring it, and wait for the shader to build before sharing it with other contexts.
| * | | | | shader_environment: Receive cache version from outsideReinUsesLisp2021-07-234-16/+23
| | | | | | | | | | | | | | | | | | | | | | | | This allows us invalidating OpenGL and Vulkan separately in the future.
| * | | | | cmake: Remove shader cache versionReinUsesLisp2021-07-233-12/+1
| | | | | |
| * | | | | shader: Fix disabled attribute default valuesameerj2021-07-232-2/+2
| | | | | |
| * | | | | gl_device: Simplify GLASM setting logicameerj2021-07-231-15/+8
| | | | | |
| * | | | | glsl: Simplify FCMP emissionameerj2021-07-231-6/+4
| | | | | |
| * | | | | glsl: Update TessellationControl gl_inameerj2021-07-231-0/+28
| | | | | | | | | | | | | | | | | | | | | | | | Adheres to GL_ARB_separate_shader_objects requirements
| * | | | | renderer_opengl: Use ARB_separate_shader_objectsReinUsesLisp2021-07-239-116/+154
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Ensures that states set for a particular stage are not attached to other stages which may not need them.
| * | | | | shader: Implement ISETP.Xameerj2021-07-234-44/+57
| | | | | |
| * | | | | shader: Avoid usage of C++20 ranges to build in clangReinUsesLisp2021-07-2311-39/+47
| | | | | |
| * | | | | glsl: Clamp shared mem size to GL_MAX_COMPUTE_SHARED_MEMORY_SIZEameerj2021-07-233-2/+12
| | | | | |
| * | | | | gl_shader_cache: Properly implement asynchronous shadersReinUsesLisp2021-07-231-1/+1
| | | | | |
| * | | | | shader_recompiler, video_core: Resolve clang errorslat9nq2021-07-2314-44/+40
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Silences the following warnings-turned-errors: -Wsign-conversion -Wunused-private-field -Wbraced-scalar-init -Wunused-variable And some other errors
| * | | | | main: Update Shader Cache menu optionsameerj2021-07-234-16/+64
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This change adds two new context menu items to remove either the OpenGL or the Vulkan shader caches individually, and the provides the option to remove all caches for the selected title. This also changes the behavior of the open shader cache option. Now it creates the shader cache directory for the title if it does not yet exist.
| * | | | | renderers: Fix clang formattingameerj2021-07-234-9/+13
| | | | | |
| * | | | | shader: Manually convert from array<u32> to bitset instead of using bit_castReinUsesLisp2021-07-231-2/+3
| | | | | |
| * | | | | renderers: Disable async shader compilationameerj2021-07-232-3/+5
| | | | | | | | | | | | | | | | | | | | | | | | The current implementation is prone to causing graphical issues. Disable until a better solution is implemented.
| * | | | | maxwell_to_vk: Add R16_SNORMReinUsesLisp2021-07-232-1/+2
| | | | | |
| * | | | | configure_graphics: Mark SPIR-V as Experimental, Mesa onlylat9nq2021-07-231-1/+1
| | | | | |
| * | | | | glsl: Fix tracking of info.uses_shadow_lodameerj2021-07-231-4/+4
| | | | | |
| * | | | | shader: Ignore global memory ops on devices lacking int64 supportameerj2021-07-238-30/+79
| | | | | |
| * | | | | vulkan_device: Add missing include algorithmlat9nq2021-07-231-0/+1
| | | | | |
| * | | | | vulkan_device: Blacklist ampere devices from float16 mathameerj2021-07-232-12/+23
| | | | | |
| * | | | | dual_vertex_pass: Clang formatameerj2021-07-231-14/+14
| | | | | |
| * | | | | gl_shader_cache: Fixes for async shadersameerj2021-07-232-2/+25
| | | | | |
| * | | | | vulkan_device: Enable VK_EXT_extended_dynamic_state on RADV 21.2 onwardReinUsesLisp2021-07-231-4/+7
| | | | | |
| * | | | | emit_spirv: Workaround VK_KHR_shader_float_controls on fp16 NvidiaReinUsesLisp2021-07-234-5/+12
| | | | | | | | | | | | | | | | | | | | | | | | Fix regression on Fire Emblem: Three Houses when using native fp16.
| * | | | | configure_graphics: Re-order vulkan device populatinglat9nq2021-07-231-4/+4
| | | | | |
| * | | | | shader: GCC fmt 8.0.0 fixeslat9nq2021-07-237-16/+19
| | | | | |
| * | | | | shader: Account for 33-bit IADD3 scenarioameerj2021-07-231-2/+10
| | | | | |
| * | | | | shader: Only apply shift on register mode for IADD3ReinUsesLisp2021-07-231-10/+14
| | | | | |
| * | | | | vk_rasterizer: Workaround bug in VK_EXT_vertex_input_dynamic_stateReinUsesLisp2021-07-234-19/+20
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Workaround potential bug on Nvidia's driver where only updating high attributes leaves low attributes out dated.
| * | | | | shader: Fix disabled and unwritten attributes and varyingsReinUsesLisp2021-07-233-18/+31
| | | | | |
| * | | | | glsl: Fix shared and local memory declarationsameerj2021-07-231-3/+3
| | | | | | | | | | | | | | | | | | | | | | | | account for the fact that program.*memory_size is in units of bytes.
| * | | | | opengl: Implement LOP.CCameerj2021-07-232-6/+38
| | | | | | | | | | | | | | | | | | | | | | | | Used by MH:Rise
| * | | | | vk_graphics_pipeline: Implement smooth linesReinUsesLisp2021-07-235-5/+65
| | | | | |
| * | | | | vk_graphics_pipeline: Implement line widthReinUsesLisp2021-07-238-8/+36
| | | | | |
| * | | | | spirv: Fix code emission when descriptor aliasing is unsupportedReinUsesLisp2021-07-231-1/+2
| | | | | | | | | | | | | | | | | | | | | | | | Fixes OpenGL.
| * | | | | video_core: Enable GL SPIR-V shaderslat9nq2021-07-237-38/+105
| | | | | |
| * | | | | general: Add setting shader_backendlat9nq2021-07-2314-87/+182
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | GLASM is getting good enough that we can move it out of advanced graphics settings. This removes the setting `use_assembly_shaders`, opting for a enum class `shader_backend`. This comes with the benefits that it is extensible for additional shader backends besides GLSL and GLASM, and this will work better with a QComboBox. Qt removes the related assembly shader setting from the Advanced Graphics section and places it as a new QComboBox in the API Settings group. This will replace the Vulkan device selector when OpenGL is selected. Additionally, mark all of the custom anisotropic filtering settings as "WILL BREAK THINGS", as that is the case with a select few games.
| * | | | | glsl: Declare local memory in mainameerj2021-07-231-3/+3
| | | | | |
| * | | | | glsl: Add passthrough geometry shader supportameerj2021-07-233-7/+27
| | | | | |
| * | | | | shader: Use std::bit_cast instead of Common::BitCast for passthroughReinUsesLisp2021-07-231-2/+3
| | | | | |
| * | | | | glasm: Add passthrough geometry shader supportReinUsesLisp2021-07-235-8/+33
| | | | | |
| * | | | | shader: Rework varyings and implement passthrough geometry shadersReinUsesLisp2021-07-2329-331/+345
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Put all varyings into a single std::bitset with helpers to access it. Implement passthrough geometry shaders using host's.
| * | | | | vk_graphics_pipeline: Implement conservative renderingReinUsesLisp2021-07-236-10/+44
| | | | | |
| * | | | | shader: Only verify shader when graphics debugging is enabledReinUsesLisp2021-07-231-2/+7
| | | | | |
| * | | | | shader: Unify shader stage typesReinUsesLisp2021-07-2315-55/+37
| | | | | |
| * | | | | lower_int64_to_int32: Add missing includelat9nq2021-07-231-0/+1
| | | | | |
| * | | | | shader: Emulate 64-bit integers when not supportedReinUsesLisp2021-07-236-2/+16
| | | | | | | | | | | | | | | | | | | | | | | | Useful for mobile and Intel Xe devices.
| * | | | | shader: Add int64 to int32 lowering passReinUsesLisp2021-07-233-0/+218
| | | | | |
| * | | | | shader: Teach global memory base tracker to follow vectorsReinUsesLisp2021-07-231-15/+14
| | | | | |
| * | | | | shader: Add constant propagation to integer vectorsReinUsesLisp2021-07-231-0/+9
| | | | | |
| * | | | | glsl: Better IAdd Overflow CC fixameerj2021-07-232-11/+13
| | | | | | | | | | | | | | | | | | | | | | | | This ensures the original operand values are not overwritten when being used in the overflow detection.
| * | | | | shader: Remove IAbs64ReinUsesLisp2021-07-239-26/+3
| | | | | |
| * | | | | glsl: Fix IADD CCameerj2021-07-232-5/+7
| | | | | |
| * | | | | shader_recompiler: Fix IADD3 input partitioningameerj2021-07-231-14/+13
| | | | | |
| * | | | | shader: Move loop safety tests to code emissionReinUsesLisp2021-07-2316-108/+54
| | | | | |
| * | | | | gl_graphics_pipeline: Fix assembly shaders check for transform feedbacksReinUsesLisp2021-07-231-1/+1
| | | | | |
| * | | | | glsl: Remove frag color initializationameerj2021-07-231-9/+0
| | | | | |
| * | | | | glasm: Implement SetAttribute ViewportMaskameerj2021-07-232-1/+10
| | | | | |
| * | | | | gl_graphics_pipeline: Inline hash and operator== key functionsReinUsesLisp2021-07-232-12/+8
| | | | | |
| * | | | | gl_shader_cache: Check previous pipeline before checking hash mapReinUsesLisp2021-07-235-29/+41
| | | | | | | | | | | | | | | | | | | | | | | | Port optimization from Vulkan.
| * | | | | gl_graphics_pipeline: Port optimizations from Vulkan pipelinesReinUsesLisp2021-07-232-57/+141
| | | | | |
| * | | | | emit_glsl_special: Skip initialization of frag_color0ameerj2021-07-231-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | Fixes rendering in Devil May Cry without regressing Ori and the Blind Forest.
| * | | | | shader: Calibrate loop safety thresholdReinUsesLisp2021-07-231-1/+1
| | | | | |
| * | | | | buffer_cache: Fix debugging leftoverReinUsesLisp2021-07-231-1/+1
| | | | | |
| * | | | | glsl: Add missing ; in EmitSetSampleMaskMorph2021-07-231-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | Fixes shader compilation in Okami HD
| * | | | | buffer_cache: Fix size reductions not having in mind bind sizesReinUsesLisp2021-07-231-7/+23
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | A buffer binding can change between shaders without changing the shaders. This lead to outdated bindings on OpenGL.
| * | | | | glsl: Fix output varying initialization when transform feedback is usedameerj2021-07-231-3/+37
| | | | | |
| * | | | | shaders: Allow shader notify when async shaders is disabledameerj2021-07-232-11/+9
| | | | | |
| * | | | | texture_pass: Fix is_read image qualificationameerj2021-07-231-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | Atomic operations are considered to have both read and write access. This was not being accounted for.
| * | | | | shader: Align constant buffer sizes to 16 bytesReinUsesLisp2021-07-231-1/+2
| | | | | | | | | | | | | | | | | | | | | | | | WAR for AMD reading zeroes on uniform buffers of size 2.
| * | | | | spirv: Properly handle devices without int8 and int16ReinUsesLisp2021-07-232-39/+67
| | | | | |
| * | | | | spirv: Handle small storage buffer loads on devices with no supportReinUsesLisp2021-07-232-6/+6
| | | | | |
| * | | | | vk_graphics_pipeline: Use VK_KHR_push_descriptor when availableReinUsesLisp2021-07-238-36/+88
| | | | | | | | | | | | | | | | | | | | | | | | ~51% faster on Nvidia compared to previous method.
| * | | | | glsl: Fix cbuf component indexing bug falbackameerj2021-07-231-7/+6
| | | | | |
| * | | | | shader: Simplify MergeDualVertexProgramsReinUsesLisp2021-07-231-6/+4
| | | | | |
| * | | | | shader: Properly manage attributes not written from previous stagesReinUsesLisp2021-07-2312-41/+62
| | | | | |
| * | | | | glsl: Only declare fragment outputs on fragment shadersReinUsesLisp2021-07-231-4/+6
| | | | | |
| * | | | | shader: Split profile and runtime info headersReinUsesLisp2021-07-2313-77/+93
| | | | | |
| * | | | | shader: Add support for native 16-bit floatsReinUsesLisp2021-07-239-14/+50
| | | | | |
| * | | | | shader: Rename maxwell/program.h to translate_program.hReinUsesLisp2021-07-235-11/+6
| | | | | |
| * | | | | vulkan_device: Blacklist VK_EXT_vertex_input_dynamic_state on IntelReinUsesLisp2021-07-231-0/+4
| | | | | |
| * | | | | glsl: Obey need_declared_frag_colors to declare and initialize all frag_colorameerj2021-07-232-1/+10
| | | | | | | | | | | | | | | | | | | | | | | | Fixes Ori and the blind forest title screen
| * | | | | glsl: Address rest of feedbackameerj2021-07-2311-38/+86
| | | | | |
| * | | | | glsl: Move gl_Position/generic attribute initialization to EmitProlgueameerj2021-07-232-14/+12
| | | | | |
| * | | | | glsl: Conditionally use fine/coarse derivatives based on device supportameerj2021-07-234-4/+29
| | | | | |
| * | | | | glsl: Cleanup/Address feedbackameerj2021-07-2310-28/+24
| | | | | |
| * | | | | gl_shader_cache: Implement async shadersameerj2021-07-237-107/+154
| | | | | |
| * | | | | glsl: Add Shader_GLSL loggingameerj2021-07-233-28/+32
| | | | | |
| * | | | | glsl: Add LoopSafety instructionsameerj2021-07-232-0/+10
| | | | | |
| * | | | | glsl: Conditionally add EXT_texture_shadow_lodameerj2021-07-233-4/+15
| | | | | |
| * | | | | glsl: Add stubs for sparse queries and variable aoffi when not supportedameerj2021-07-237-13/+47
| | | | | |
| * | | | | glsl: Implement legacy varyingsameerj2021-07-236-8/+81
| | | | | |
| * | | | | gl_shader_cache: Remove const from pipeline source argumentsameerj2021-07-234-6/+6
| | | | | |
| * | | | | gl_shader_cache: Move OGL shader compilation to the respective Pipeline constructorameerj2021-07-235-76/+79
| | | | | |
| * | | | | glsl: Minor cleanupameerj2021-07-232-19/+15
| | | | | |
| * | | | | glsl: Fix Cbuf getters for F32 typeameerj2021-07-231-12/+15
| | | | | |
| * | | | | glsl: Add immediate index oob checking for Cbuf gettersameerj2021-07-231-0/+16
| | | | | |
| * | | | | glsl: Refactor GetCbuf functions to reduce code duplicationameerj2021-07-231-104/+66
| | | | | |
| * | | | | glsl: Address more feedback. Implement indexed texture readsameerj2021-07-236-114/+112
| | | | | |
| * | | | | glsl: Remove Signed Integer variablesameerj2021-07-238-43/+13
| | | | | |
| * | | | | glsl: Address Rodrigo's feedbackameerj2021-07-2313-75/+87
| | | | | |
| * | | | | glsl: Reorganize backend code, remove unneeded [[maybe_unused]]ameerj2021-07-2312-315/+251
| | | | | |
| * | | | | glsl: Implement SampleId and SetSampleMaskameerj2021-07-233-30/+35
| | | | | | | | | | | | | | | | | | | | | | | | plus some minor refactoring of implementations
| * | | | | glsl: Add gl_PerVertex in for GSameerj2021-07-231-1/+2
| | | | | |
| * | | | | glsl: Use existing tracking for enabling EXT_shader_image_load_formattedameerj2021-07-231-15/+1
| | | | | |
| * | | | | glsl: Enable early fragment testsameerj2021-07-232-4/+7
| | | | | |
| * | | | | gl_rasterizer: Add texture fetch barrier for fragmentsameerj2021-07-231-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | Fixes flicker seen in XC2
| * | | | | glsl: Implement more attribute getters and settersameerj2021-07-232-12/+60
| | | | | |
| * | | | | glsl: Implement fswzaddameerj2021-07-235-5/+45
| | | | | | | | | | | | | | | | | | | | | | | | and wip nv thread shuffle impl
| * | | | | glsl: Implement indexed attribute loadsameerj2021-07-235-29/+64
| | | | | |
| * | | | | glsl: Conditionally add GL_ARB_sparse_texture2ameerj2021-07-231-2/+3
| | | | | |
| * | | | | glsl: Rebase fixesameerj2021-07-232-3/+5
| | | | | |
| * | | | | glsl: Conditionally use GL_EXT_shader_image_load_formattedameerj2021-07-231-2/+18
| | | | | | | | | | | | | | | | | | | | | | | | Fix for SULD.D
| * | | | | glsl: Remove output generic indexing for geometry stageameerj2021-07-231-5/+3
| | | | | |
| * | | | | glsl: Allow dynamic tracking of variable allocationameerj2021-07-233-21/+35
| | | | | |
| * | | | | glsl: Implement barriersameerj2021-07-233-13/+21
| | | | | |
| * | | | | glsl: Implement image atomics and set layerameerj2021-07-235-153/+202
| | | | | | | | | | | | | | | | | | | | | | | | along with some more cleanup/oversight fixes
| * | | | | glsl: Fix image gather logicameerj2021-07-231-0/+4
| | | | | |
| * | | | | glsl: Add cbuf access workaround for devices with component indexing bugameerj2021-07-232-51/+112
| | | | | |
| * | | | | glsl: Use textureGrad fallback when EXT_texture_shadow_lod is unsupportedameerj2021-07-234-8/+42
| | | | | |
| * | | | | emit_glsl_image: Use immediate offsets when possibleameerj2021-07-231-12/+33
| | | | | |
| * | | | | glsl: Fix <32-bit SSBO writesameerj2021-07-234-50/+43
| | | | | | | | | | | | | | | | | | | | | | | | and more cleanup
| * | | | | glsl: Cleanup and address feedbackameerj2021-07-2310-86/+69
| | | | | |
| * | | | | glsl: Refactor Global memory functionsameerj2021-07-232-71/+73
| | | | | |
| * | | | | glsl: Increase NUM_VARS that can be allocatedameerj2021-07-231-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | needed for HW:AoC.
| * | | | | glsl: Implement Load/WriteGlobalameerj2021-07-239-98/+185
| | | | | | | | | | | | | | | | | | | | | | | | along with some other misc changes and fixes
| * | | | | glsl: Implement Imagesameerj2021-07-232-9/+74
| | | | | |
| * | | | | glsl: skip gl_ViewportIndex write if device does not support itameerj2021-07-235-8/+18
| | | | | |
| * | | | | glsl: Implement transform feedbackameerj2021-07-234-18/+76
| | | | | |
| * | | | | glsl: Yet another gl_ViewportIndex fix attemptameerj2021-07-231-3/+19
| | | | | |
| * | | | | glsl: Add gl_ViewportIndex out attributeameerj2021-07-231-1/+3
| | | | | |
| * | | | | emit_glsl_context_get_set: Remove unused functionlat9nq2021-07-231-4/+0
| | | | | |
| * | | | | glsl: Fix precise variable declarationameerj2021-07-233-24/+25
| | | | | | | | | | | | | | | | | | | | | | | | and add some more separation in the shader for better debugability when dumped
| * | | | | glsl: Implement tessellation shadersameerj2021-07-235-27/+146
| | | | | |
| * | | | | glsl: Implement ImageGradient and other texture function variantsameerj2021-07-232-32/+73
| | | | | |
| * | | | | glsl: Fix atomic SSBO offsetsameerj2021-07-234-67/+74
| | | | | | | | | | | | | | | | | | | | | | | | and implement misc getters
| * | | | | glsl: Implement geometry shadersameerj2021-07-234-9/+62
| | | | | |
| * | | | | glsl: Use NotImplemented macro with function name outputameerj2021-07-2310-104/+103
| | | | | |
| * | | | | glsl: Implement gl_ViewportIndexameerj2021-07-233-5/+14
| | | | | | | | | | | | | | | | | | | | | | | | SSBU now working
| * | | | | glsl: SHFL fix and prefer shift operations over divide in glsl shaderameerj2021-07-235-63/+64
| | | | | |
| * | | | | glsl: Implement precise fp variable allocationameerj2021-07-234-8/+67
| | | | | |
| * | | | | HACK glsl: Write defaults to unused generic attributesameerj2021-07-232-2/+11
| | | | | |
| * | | | | glsl: Fix ssbo indexing and name shadowing between shader stagesameerj2021-07-233-77/+101
| | | | | |
| * | | | | glsl: implement set clip distanceameerj2021-07-232-0/+15
| | | | | | | | | | | | | | | | | | | | | | | | and missed a diff in emit_glsl relating to var alloc ref counting
| * | | | | glsl: Rework var alloc to not assign unused resultsameerj2021-07-239-49/+91
| | | | | |
| * | | | | glsl: Rework variable allocator to allow for variable reuseameerj2021-07-2314-353/+482
| | | | | |
| * | | | | glsl: Fix ATOM and implement ATOMSameerj2021-07-235-114/+136
| | | | | |
| * | | | | glsl: Use gl_SubGroupInvocationARBameerj2021-07-232-8/+7
| | | | | |
| * | | | | glsl: Implement VOTE for subgroup size potentially largerameerj2021-07-235-20/+43
| | | | | |
| * | | | | glsl: Implement VOTEameerj2021-07-234-50/+64
| | | | | |
| * | | | | glsl: Implement ST{LS}ameerj2021-07-236-69/+106
| | | | | |
| * | | | | glsl: Implement more instructions used by SMOameerj2021-07-231-3/+3
| | | | | |
| * | | | | glsl: Implement more instructions used by SMOameerj2021-07-235-10/+16
| | | | | |
| * | | | | glsl: Fix GetAttribute return valuesameerj2021-07-232-7/+9
| | | | | | | | | | | | | | | | | | | | | | | | fixes font rendering issues as these were used to index into the ssbos
| * | | | | glsl: minor cleanupameerj2021-07-234-20/+19
| | | | | |
| * | | | | glsl: Fix and implement rest of cbuf accessameerj2021-07-231-7/+43
| | | | | |
| * | | | | glsl: Implement TXQ and other misc changesameerj2021-07-235-6/+36
| | | | | |
| * | | | | glsl: TLD4 implementationameerj2021-07-231-2/+89
| | | | | |
| * | | | | glsl: Implement TLD instructionameerj2021-07-231-1/+55
| | | | | |
| * | | | | glsl: Implement TEXSameerj2021-07-231-1/+29
| | | | | |
| * | | | | glsl: Cleanup texture functionsameerj2021-07-231-13/+11
| | | | | |
| * | | | | shader_recompiler: GCC fixeslat9nq2021-07-2314-3/+13
| | | | | |
| * | | | | glsl: Implement TEX depth functionsameerj2021-07-232-4/+46
| | | | | |
| * | | | | glsl: Implement TEX ImageSample functionsameerj2021-07-233-11/+71
| | | | | |
| * | | | | glsl: Rework Shuffle emit instructions to align with SPIR-Vameerj2021-07-231-19/+40
| | | | | |
| * | | | | glsl: Better Storage access and wip warpsameerj2021-07-238-62/+133
| | | | | |
| * | | | | glsl: Fix integer conversions, implement clamp CCameerj2021-07-232-27/+36
| | | | | |
| * | | | | glsl: Implement IADD CCameerj2021-07-232-2/+17
| | | | | |
| * | | | | glsl: SSBO access fixes and wip SampleExplicitLod implementation.ameerj2021-07-232-4/+19
| | | | | |
| * | | | | glsl: WIP var forward declarationameerj2021-07-236-49/+60
| | | | | | | | | | | | | | | | | | | | | | | | to fix Loop control flow.
| * | | | | glsl: Fix bindings, add some CC opsameerj2021-07-238-57/+91
| | | | | |
| * | | | | glsl: remove unused headersameerj2021-07-2314-34/+10
| | | | | |
| * | | | | glsl: Implement derivatives and YDirectionameerj2021-07-238-81/+87
| | | | | | | | | | | | | | | | | | | | | | | | plus some other misc additions/changed
| * | | | | glsl: Fix non-immediate buffer accessameerj2021-07-2312-72/+133
| | | | | | | | | | | | | | | | | | | | | | | | and many other misc implementations
| * | | | | glsl: textures wipameerj2021-07-239-75/+139
| | | | | |
| * | | | | glsl: Implement some attribute getters and settersameerj2021-07-2310-192/+337
| | | | | |
| * | | | | glsl: Track S32 atomicsameerj2021-07-233-6/+16
| | | | | |
| * | | | | glsl: Update phi node managementameerj2021-07-234-21/+53
| | | | | |
| * | | | | glsl: Fix floating point compare opsameerj2021-07-231-28/+28
| | | | | | | | | | | | | | | | | | | | | | | | Logic for ordered/unordered ops was wrong.
| * | | | | glsl: Query GL Device for FP16 extension supportameerj2021-07-235-2/+23
| | | | | |
| * | | | | glsl: Simply FP storage atomicsameerj2021-07-232-48/+28
| | | | | |
| * | | | | glsl: F16x2 storage atomicsameerj2021-07-237-58/+64
| | | | | |
| * | | | | glsl: Revert ssbo aliasing. Storage Atomics implameerj2021-07-235-75/+134
| | | | | |
| * | | | | glsl: implement phi nodesameerj2021-07-234-20/+54
| | | | | |
| * | | | | glsl: Wip storage atomic opsameerj2021-07-2310-327/+414
| | | | | |
| * | | | | glsl: Implement FCMPameerj2021-07-233-242/+185
| | | | | |
| * | | | | glsl: Add a more robust fp formatterameerj2021-07-234-9/+14
| | | | | |
| * | | | | glsl: More FP fixesameerj2021-07-232-9/+16
| | | | | |
| * | | | | glsl: FP function fixesameerj2021-07-237-17/+25
| | | | | |
| * | | | | glsl: More FP instructions/fixesameerj2021-07-235-28/+41
| | | | | |
| * | | | | glsl: Add many FP32/64 instructionsameerj2021-07-2312-765/+1011
| | | | | |
| * | | | | glsl: Fixup build issuesReinUsesLisp2021-07-231-1/+1
| | | | | |
| * | | | | glsl: Implement more Integer opsameerj2021-07-233-119/+72
| | | | | |
| * | | | | glsl: Implement BF*ameerj2021-07-233-9/+10
| | | | | |
| * | | | | glsl: Implement a few Integer instructionsameerj2021-07-2310-260/+398
| | | | | |
| * | | | | glsl: Use std::string_view for Emit function args.ameerj2021-07-236-760/+838
| | | | | |
| * | | | | glsl: Pass IR::Inst& to Emit functionsameerj2021-07-236-171/+169
| | | | | |
| * | | | | glsl: INeg and IAdd negate testsameerj2021-07-233-94/+106
| | | | | |
| * | | | | glsl: Reusable typed variables. IADD32ameerj2021-07-236-203/+311
| | | | | |
| * | | | | glsl: Fix program linking and cbufameerj2021-07-232-3/+5
| | | | | |
| * | | | | glsl: Fix "reg" allocingameerj2021-07-2310-898/+938
| | | | | | | | | | | | | | | | | | | | | | | | based on glasm with some tweaks
| * | | | | glsl: Initial backendameerj2021-07-2328-2/+3297
| | | | | |
| * | | | | spirv: Reduce log severity of mismatching denorm rulesReinUsesLisp2021-07-231-2/+2
| | | | | |
| * | | | | shader: Fix loop safety to SSA passReinUsesLisp2021-07-232-2/+4
| | | | | |
| * | | | | vk_rasterizer: Exit render passes on fragment barriersReinUsesLisp2021-07-231-0/+1
| | | | | |
| * | | | | vk_graphics_pipeline: Fix path with no VK_EXT_extended_dynamic_stateRodrigo Locatti2021-07-231-1/+1
| | | | | |
| * | | | | buffer_cache: Invalidate fast buffers on computeReinUsesLisp2021-07-231-0/+1
| | | | | |
| * | | | | shader: Add loggingReinUsesLisp2021-07-2315-28/+38
| | | | | |
| * | | | | shader: Add shader loop safety check settingslat9nq2021-07-2316-35/+183
| | | | | | | | | | | | | | | | | | | | | | | | Also add a setting for enable Nsight Aftermath.
| * | | | | shader: Comment why the array component is not read in TMMLReinUsesLisp2021-07-231-0/+2
| | | | | |
| * | | | | vulkan_device: Enable VK_EXT_vertex_input_dynamic_stateReinUsesLisp2021-07-231-0/+28
| | | | | |
| * | | | | vk_pipeline_cache: Skip cached pipelines with different dynamic stateReinUsesLisp2021-07-231-0/+6
| | | | | |
| * | | | | main: Fix Open Transferable Shader Cache context itemameerj2021-07-231-25/+5
| | | | | | | | | | | | | | | | | | | | | | | | Opens the new shader cache directory location for the specified title, if it exists.
| * | | | | tmml: Remove index component from coords vecameerj2021-07-231-4/+3
| | | | | | | | | | | | | | | | | | | | | | | | The lod query functions exposed by the rendering API's do not make use of the texturearray layer indexing.
| * | | | | vulkan: Add VK_EXT_vertex_input_dynamic_state supportReinUsesLisp2021-07-2311-116/+291
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Reduces the number of total pipelines generated on Vulkan. Tested on Super Smash Bros. Ultimate.
| * | | | | shader: Reorder shader cache directoriesReinUsesLisp2021-07-232-18/+12
| | | | | |
| * | | | | vk_rasterizer: Implement first indexReinUsesLisp2021-07-231-2/+5
| | | | | |
| * | | | | vulkan: Use VK_EXT_provoking_vertex when availableReinUsesLisp2021-07-236-4/+52
| | | | | |
| * | | | | spirv/convert: Catch more signed operations oversightsameerj2021-07-231-5/+5
| | | | | | | | | | | | | | | | | | | | | | | | The sign bit on integers of size < 32 was not properly preserved in casts
| * | | | | spirv/convert: Catch more broken signed operations on Nvidia OpenGLReinUsesLisp2021-07-231-0/+6
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | BitCast U32 to S32 before converting to float on drivers with broken signed operations.
| * | | | | gl_buffer_cache: Use unorm internal formats for snorm texture buffer viewsameerj2021-07-231-1/+24
| | | | | | | | | | | | | | | | | | | | | | | | Fixes black textures in UE4 games
| * | | | | shader_environment: Fix local memory size calculationsReinUsesLisp2021-07-231-3/+3
| | | | | |
| * | | | | buffer_cache: Fix copy based uniform bindings trackingReinUsesLisp2021-07-232-9/+22
| | | | | |
| * | | | | shader_environment: Add shader_local_memory_crs_size to local memory sizeameerj2021-07-232-3/+3
| | | | | | | | | | | | | | | | | | | | | | | | Fixes DOOM 2016 missing local memory
| * | | | | gl_texture_cache: Create image storage viewsReinUsesLisp2021-07-234-38/+126
| | | | | | | | | | | | | | | | | | | | | | | | Fixes SULD.D tests.
| * | | | | gl_shader_util: Move shader utility code to a separate fileReinUsesLisp2021-07-237-245/+106
| | | | | |
| * | | | | gl_shader_cache: Store workers in shader cache objectReinUsesLisp2021-07-232-58/+78
| | | | | |
| * | | | | vk_pipeline_cache,shader_notify: Add shader notificationsReinUsesLisp2021-07-2310-96/+127
| | | | | |
| * | | | | vk_pipeline_cache: Add asynchronous shadersReinUsesLisp2021-07-233-3/+33
| | | | | |
| * | | | | vk_rasterizer: Flush work on clear and dispatchesReinUsesLisp2021-07-231-0/+3
| | | | | |
| * | | | | DMA: Restrict optimised path for BlockToLinear further.FernandoS272021-07-231-1/+2
| | | | | |
| * | | | | vk_swapchain: Handle outdated swapchainsReinUsesLisp2021-07-233-17/+34
| | | | | | | | | | | | | | | | | | | | | | | | Fixes pixelated presentation on Intel devices.
| * | | | | shader: Fix VertexA Shaders.FernandoS272021-07-234-19/+51
| | | | | |
| * | | | | shader: Add 2D and 3D variants to SUATOM and SUREDReinUsesLisp2021-07-231-0/+4
| | | | | | | | | | | | | | | | | | | | | | | | Used by Claybook.
| * | | | | vk_buffer_cache: Handle null texture buffersReinUsesLisp2021-07-231-0/+4
| | | | | | | | | | | | | | | | | | | | | | | | Fixes a crash on Age of Calamity cutscenes.
| * | | | | nsight_aftermath_tracker: Fix SPIR-V module writesReinUsesLisp2021-07-231-1/+1
| | | | | |
| * | | | | vk_pipeline_cache: Set support_derivative_control to trueReinUsesLisp2021-07-231-0/+1
| | | | | |
| * | | | | shader: Avoid CPU side undefined behavior on I2FReinUsesLisp2021-07-231-0/+2
| | | | | |
| * | | | | glasm: Use ARB_derivative_control conditionallyReinUsesLisp2021-07-236-7/+37
| | | | | |
| * | | | | buffer_cache: Reduce uniform buffer size from shader usageReinUsesLisp2021-07-2311-38/+78
| | | | | | | | | | | | | | | | | | | | | | | | Increases performance significantly on certain titles.
| * | | | | transform_feedback: Read buffer stride from index instead of layoutReinUsesLisp2021-07-231-1/+2
| | | | | |
| * | | | | fixed_pipeline_state: Use regular for loop instead of ranges for perfReinUsesLisp2021-07-231-2/+3
| | | | | | | | | | | | | | | | | | | | | | | | MSVC generates better code for it.
| * | | | | vk_swapchain: Avoid recreating the swapchain on each frameReinUsesLisp2021-07-232-15/+9
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Recreate only when requested (or sRGB is changed) instead of tracking the frontend's size. That size is still used as a hint.
| * | | | | emit_glasm_context_get_set: Remove unused variablelat9nq2021-07-231-1/+0
| | | | | |
| * | | | | shader,glasm: Implement legacy texcoord loadsReinUsesLisp2021-07-233-54/+29
| | | | | |
| * | | | | glasm: Implement legacy varyingsReinUsesLisp2021-07-231-17/+56
| | | | | |
| * | | | | shader: Track legacy varyingsReinUsesLisp2021-07-232-17/+105
| | | | | |
| * | | | | shader: Add support for "negative" and unaligned offsetsReinUsesLisp2021-07-233-8/+13
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | "Negative" offsets don't exist. They are shown as such due to a bug in nvdisasm. Unaligned offsets have been proved to read the aligned offset. For example, when reading an U32, if the offset is 6, the offset read will be 4.
| * | | | | shader: Implement ISCADD32IReinUsesLisp2021-07-231-17/+31
| | | | | |
| * | | | | spirv: Fix output generics with componentsReinUsesLisp2021-07-231-1/+1
| | | | | |
| * | | | | vulkan: Conditionally use shaderInt16ReinUsesLisp2021-07-233-2/+9
| | | | | | | | | | | | | | | | | | | | | | | | Add support for Polaris AMD devices.
| * | | | | vulkan: Enable depth bounds and use it conditionallyReinUsesLisp2021-07-234-2/+17
| | | | | | | | | | | | | | | | | | | | | | | | Intel devices pre-Xe don't support this.
| * | | | | vk_buffer_cache: Add transform feedback usage to buffersReinUsesLisp2021-07-231-15/+22
| | | | | |
| * | | | | opengl: Declare fragment outputs even if they are not usedReinUsesLisp2021-07-236-10/+18
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Fixes Ori and the Blind Forest's menu on GLASM. For some reason (probably high level optimizations) it is not sanitized on SPIR-V for OpenGL. Vulkan is unaffected by this change.
| * | | | | buffer_cache: Mark uniform buffers as dirty if any enable bit changesReinUsesLisp2021-07-235-7/+17
| | | | | |
| * | | | | shader: Always initialize up reference in structure control flowReinUsesLisp2021-07-231-31/+36
| | | | | | | | | | | | | | | | | | | | | | | | Fixes ubsan issue.
| * | | | | vulkan_device: Enable float64 and int64 conditionallyReinUsesLisp2021-07-232-2/+6
| | | | | | | | | | | | | | | | | | | | | | | | Add Intel Xe support.
| * | | | | shader: Fix ImageWrite indexingReinUsesLisp2021-07-231-1/+1
| | | | | |
| * | | | | spirv: Fix image and image buffer descriptor index usageReinUsesLisp2021-07-231-5/+7
| | | | | |
| * | | | | glasm: Fix immediate texture coordinateReinUsesLisp2021-07-231-0/+1
| | | | | |
| * | | | | shader: Clang-format secondary texturesReinUsesLisp2021-07-231-2/+2
| | | | | |
| * | | | | shader: Fix secondary texturesReinUsesLisp2021-07-231-2/+2
| | | | | |
| * | | | | shader: Adhere to disk shader cache settingameerj2021-07-232-9/+12
| | | | | |
| * | | | | shader: Fix TMML queriesReinUsesLisp2021-07-231-5/+9
| | | | | |
| * | | | | shader: Fix FSwizzleAdd folding when going through phi nodesReinUsesLisp2021-07-231-2/+2
| | | | | |
| * | | | | shader/exception: Fix compilation errors on gccReinUsesLisp2021-07-231-6/+6
| | | | | |
| * | | | | glasm: Reduce reg allocation leaks from an exception to a logReinUsesLisp2021-07-231-1/+1
| | | | | |
| * | | | | texture_cache: Reduce invalid image/sampler error severityReinUsesLisp2021-07-231-7/+7
| | | | | |
| * | | | | shader: Handle host exceptionsReinUsesLisp2021-07-238-45/+98
| | | | | |
| * | | | | glasm: Use integer lod for TXQReinUsesLisp2021-07-232-2/+2
| | | | | |
| * | | | | glasm: Prepare XFB from state instead of global registersReinUsesLisp2021-07-231-4/+2
| | | | | |
| * | | | | glasm: Fix global memory fallbacksReinUsesLisp2021-07-231-9/+10
| | | | | |
| * | | | | Revert "glasm: Skip phi moves on undefined instructions"ReinUsesLisp2021-07-232-16/+1
| | | | | | | | | | | | | | | | | | | | | | | | Causes regressions on Bowser's Fury.
| * | | | | glasm: Remove unintentional '\n' on Undef32ReinUsesLisp2021-07-231-1/+1
| | | | | |
| * | | | | glasm: Use storage buffers instead of global memory when possibleReinUsesLisp2021-07-2317-437/+503
| | | | | |
| * | | | | glasm: Implement Y directionReinUsesLisp2021-07-234-3/+9
| | | | | |
| * | | | | glasm: Skip phi moves on undefined instructionsReinUsesLisp2021-07-232-1/+16
| | | | | |
| * | | | | glasm: Implement undef instructionsReinUsesLisp2021-07-232-15/+15
| | | | | |
| * | | | | glasm: Fix global memory callbacksReinUsesLisp2021-07-231-5/+6
| | | | | |
| * | | | | gl_shader_cache: Add disk shader cacheReinUsesLisp2021-07-233-11/+116
| | | | | |
| * | | | | video_core,shader: Clang-format fixesReinUsesLisp2021-07-234-7/+12
| | | | | |
| * | | | | gl_shader_cache: Rename Program abstractions into PipelineReinUsesLisp2021-07-2310-104/+104
| | | | | |
| * | | | | glasm: Release phi node registers after they are no longer neededReinUsesLisp2021-07-232-38/+54
| | | | | |
| * | | | | glasm: Remove unintentionally committed fmt::printsReinUsesLisp2021-07-231-2/+0
| | | | | |
| * | | | | glasm: Fix INeg32 on negative immediatesReinUsesLisp2021-07-231-1/+5
| | | | | |
| * | | | | glasm: Remove unnecessary value typesReinUsesLisp2021-07-233-47/+6
| | | | | |
| * | | | | glasm: Throw when there are register leaksReinUsesLisp2021-07-232-0/+7
| | | | | |
| * | | | | glasm: Catch more register leaksReinUsesLisp2021-07-238-41/+114
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Add support for null registers. These are used when an instruction has no usages. This comes handy when an instruction is only used for its CC value, with the caveat of having to invalidate all pseudo-instructions before defining the instruction itself in the register allocator. This commits changes this. Workaround a bug on Nvidia's condition codes conditional execution using branches.
| * | | | | glasm: Fix usage counting on phi nodesReinUsesLisp2021-07-233-8/+22
| | | | | |
| * | | | | gl_shader_cache: Do not flip tessellation on OpenGLReinUsesLisp2021-07-231-2/+1
| | | | | |
| * | | | | gl_graphics_program: Fix texture buffer bindingsReinUsesLisp2021-07-231-24/+35
| | | | | |
| * | | | | glasm: Implement global memory fallbacksReinUsesLisp2021-07-232-50/+89
| | | | | |
| * | | | | glasm: Implement int64 add and subtractReinUsesLisp2021-07-232-8/+6
| | | | | |
| * | | | | emit_glasm_context_get_set: Remove unused variablelat9nq2021-07-231-1/+0
| | | | | |
| * | | | | glasm: Implement indirect attribute loadsReinUsesLisp2021-07-234-6/+65
| | | | | |
| * | | | | glasm: Implement image atomicsReinUsesLisp2021-07-233-166/+153
| | | | | |
| * | | | | glasm: Reorder unreachable image atomic instsReinUsesLisp2021-07-231-66/+66
| | | | | | | | | | | | | | | | | | | | | | | | Reorder them to the bottom of the file for readability.
| * | | | | glasm: Implement gl_Layer storesReinUsesLisp2021-07-231-0/+7
| | | | | |
| * | | | | glasm: Implement SampleIdReinUsesLisp2021-07-232-3/+3
| | | | | |
| * | | | | glasm: Implement IsHelperInvocationReinUsesLisp2021-07-232-3/+3
| | | | | |
| * | | | | glasm: Fix EmitVertex's optimizationReinUsesLisp2021-07-231-1/+1
| | | | | |
| * | | | | gl_shader_cache: Conditionally use viewport maskReinUsesLisp2021-07-231-1/+1
| | | | | |
| * | | | | gl_shader_cache,glasm: Conditionally use typeless image reads extensionReinUsesLisp2021-07-233-39/+43
| | | | | |
| * | | | | gl_shader_cache: Improve GLASM error print logicReinUsesLisp2021-07-231-7/+10
| | | | | |
| * | | | | glasm: Implement forced early ZReinUsesLisp2021-07-232-4/+8
| | | | | |
| * | | | | glasm: Set transform feedback stateReinUsesLisp2021-07-235-113/+132
| | | | | |
| * | | | | video_core: Abstract transform feedback translation utilityReinUsesLisp2021-07-236-111/+145
| | | | | |
| * | | | | glasm: Simplify patch readsReinUsesLisp2021-07-231-5/+2
| | | | | |
| * | | | | glasm: Fix output patch readsReinUsesLisp2021-07-232-13/+22
| | | | | | | | | | | | | | | | | | | | | | | | With this, Luigi's Mansion's sand renders properly.
| * | | | | gl_shader_cache: Pass shader runtime informationReinUsesLisp2021-07-231-2/+74
| | | | | |
| * | | | | shader: Split profile and runtime information in separate structsReinUsesLisp2021-07-2314-308/+300
| | | | | |
| * | | | | emit_glasm_context_get_and_set.cpp: Add missing semicolonsameerj2021-07-231-2/+2
| | | | | |
| * | | | | glasm: Fix patch attribute declarationsReinUsesLisp2021-07-231-1/+1
| | | | | |
| * | | | | glasm: Implement FSWZADDameerj2021-07-233-4/+28
| | | | | |
| * | | | | glasm: Implement PrimitiveId attribute readReinUsesLisp2021-07-231-0/+3
| | | | | |
| * | | | | glasm: Implement clip distance storesReinUsesLisp2021-07-232-0/+15
| | | | | |
| * | | | | glasm: Fix tessellation input attributesReinUsesLisp2021-07-231-2/+5
| | | | | |
| * | | | | glasm: Add missing semicolon on tesscoord readingReinUsesLisp2021-07-231-1/+1
| | | | | |
| * | | | | glasm: Fix tessellation headersReinUsesLisp2021-07-231-2/+2
| | | | | |
| * | | | | glasm: Add tessellation shader declarationsReinUsesLisp2021-07-231-0/+35
| | | | | |
| * | | | | glasm: Implement TessellationEvaluationPointReinUsesLisp2021-07-231-0/+4
| | | | | |
| * | | | | gl_shader_manager: Zero initialize current assembly programsReinUsesLisp2021-07-231-1/+1
| | | | | |
| * | | | | gl_shader_manager: Remove unintentionally committed #pragmaReinUsesLisp2021-07-231-2/+0
| | | | | |
| * | | | | glasm: Implement patch memoryReinUsesLisp2021-07-233-6/+51
| | | | | |
| * | | | | glasm: Fix InvocationId declarationReinUsesLisp2021-07-231-1/+1
| | | | | |
| * | | | | glasm: Implement InvocationIdReinUsesLisp2021-07-232-2/+5
| | | | | |
| * | | | | glasm: Optimize EmitVertex into EMITReinUsesLisp2021-07-231-1/+5
| | | | | |
| * | | | | glasm: Implement geometry shader attribute readsReinUsesLisp2021-07-232-4/+18
| | | | | |
| * | | | | glasm: Properly declare attributes on geometry programsReinUsesLisp2021-07-233-6/+14
| | | | | |
| * | | | | glasm: Declare geometry program headersReinUsesLisp2021-07-231-0/+35
| | | | | |
| * | | | | renderer_opengl: State track compute assembly programsReinUsesLisp2021-07-233-4/+21
| | | | | |
| * | | | | renderer_opengl: State track assembly programsReinUsesLisp2021-07-233-23/+56
| | | | | |
| * | | | | glasm: Fix potential aliasing bug on cube array samplesReinUsesLisp2021-07-232-35/+44
| | | | | |
| * | | | | glasm: Implement ImageWriteReinUsesLisp2021-07-231-4/+7
| | | | | |
| * | | | | glasm: Implement ImageReadReinUsesLisp2021-07-234-4/+56
| | | | | |
| * | | | | glasm: Implement EmitVertex and EndPrimitiveReinUsesLisp2021-07-232-4/+8
| | | | | |
| * | | | | glasm: Implement ImageGradientReinUsesLisp2021-07-232-7/+65
| | | | | |
| * | | | | glasm: Implement 64-bit shiftsReinUsesLisp2021-07-232-12/+14
| | | | | |
| * | | | | glasm: Implement barriersReinUsesLisp2021-07-231-3/+3
| | | | | |
| * | | | | glasm: Fix compute stage nameReinUsesLisp2021-07-231-1/+1
| | | | | |
| * | | | | glasm: Fix phi instruction typesReinUsesLisp2021-07-231-1/+1
| | | | | |
| * | | | | glasm: Implement PREC on relevant instructionsReinUsesLisp2021-07-231-6/+12
| | | | | |
| * | | | | glasm: Implement stores to gl_ViewportIndexReinUsesLisp2021-07-234-7/+29
| | | | | |
| * | | | | glasm: Implement gl_PointSize storesReinUsesLisp2021-07-231-0/+3
| | | | | |
| * | | | | glasm: Implement gl_PointCoordReinUsesLisp2021-07-231-0/+4
| | | | | |
| * | | | | glasm: Implement ImageQueryLodReinUsesLisp2021-07-231-3/+5
| | | | | |
| * | | | | glasm: Implement ImageFetchReinUsesLisp2021-07-234-13/+38
| | | | | |
| * | | | | glasm: Implement IADD.CCameerj2021-07-231-1/+26
| | | | | |
| * | | | | glasm: Implement BFE.CCReinUsesLisp2021-07-231-0/+8
| | | | | |
| * | | | | glasm: Implement SelectU1ReinUsesLisp2021-07-232-4/+5
| | | | | |
| * | | | | HACK: Bind stages before and after bindingsReinUsesLisp2021-07-231-0/+11
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Works around a bug where program parameters are only applied to the current stage, and this one wasn't bound at the moment. Affects all SSBO usages on GLASM.
| * | | | | glasm: Implement gl_WorkGroupIDReinUsesLisp2021-07-232-3/+3
| | | | | |
| * | | | | glasm: Implement TXQ and improve texture info readsReinUsesLisp2021-07-232-50/+51
| | | | | |
| * | | | | glasm: Implement gl_FrongFacing attributeReinUsesLisp2021-07-231-0/+3
| | | | | |
| * | | | | glasm: Support textures used in more than one stageReinUsesLisp2021-07-234-5/+25
| | | | | |
| * | | | | glasm: Implement textureGather instructionsReinUsesLisp2021-07-232-15/+97
| | | | | |
| * | | | | glasm: Implement gl_FragDepth and gl_SampleMask storesReinUsesLisp2021-07-232-5/+5
| | | | | |
| * | | | | glasm: Do not alias ConditionRef for nowReinUsesLisp2021-07-232-3/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Immediate condition refs where not handled correctly. Just move the value for now.
| * | | | | shader: Read branch conditions from an instructionReinUsesLisp2021-07-2312-16/+36
| | | | | | | | | | | | | | | | | | | | | | | | Fixes the identity removal pass.
| * | | | | glasm: Implement InstanceId and VertexIdReinUsesLisp2021-07-231-0/+6
| | | | | |
| * | | | | glasm: Add missing return value on move assignmentReinUsesLisp2021-07-231-0/+1
| | | | | |
| * | | | | glasm: Fix aliased bitcasts ref countingReinUsesLisp2021-07-233-13/+42
| | | | | |
| * | | | | glasm: Remove unintentional comma on vector insertReinUsesLisp2021-07-231-1/+1
| | | | | |
| * | | | | glasm: Implement TEX and TEXS instructionsReinUsesLisp2021-07-2310-69/+275
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Remove lod clamp from texture instructions with lod, as this is not needed (nor supported).
| * | | | | glasm: Add support for non-2D texture samplesReinUsesLisp2021-07-231-4/+26
| | | | | |
| * | | | | glasm: Reorder unreachable image instructions to the bottomReinUsesLisp2021-07-231-97/+97
| | | | | |
| * | | | | glasm: Add support for texture offsetsReinUsesLisp2021-07-231-11/+15
| | | | | |
| * | | | | glasm: Improve texture sampling instructionsReinUsesLisp2021-07-232-50/+70
| | | | | |
| * | | | | emit_glasm: Enable ARB_draw_buffers when neededReinUsesLisp2021-07-232-1/+5
| | | | | |
| * | | | | emit_glasm: Add support for reading position attributesReinUsesLisp2021-07-231-3/+13
| | | | | |
| * | | | | shader_recompiler: GCC fixeslat9nq2021-07-237-58/+55
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Fixes members of unnamed union not being accessible, and one function without a declaration.
| * | | | | glasm: Implement rest of shared memameerj2021-07-232-35/+29
| | | | | |
| * | | | | opengl: Initial (broken) support to GLASM shadersReinUsesLisp2021-07-233-14/+53
| | | | | |
| * | | | | shader: Use a non-trivial dummy to construct ASL node unionReinUsesLisp2021-07-231-1/+6
| | | | | |
| * | | | | emit_spirv: Jump to loop body with local variableReinUsesLisp2021-07-231-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | Silence unused variable warning
| * | | | | glasm: Implement derivative instructions on GLASMReinUsesLisp2021-07-232-12/+12
| | | | | |
| * | | | | glasm: Initial (broken) implementation of TEX on GLASMReinUsesLisp2021-07-233-299/+386
| | | | | |
| * | | | | glasm: Implement some graphics instructions on GLASMReinUsesLisp2021-07-232-6/+5
| | | | | |
| * | | | | glasm: Add Void type to GLASM valuesReinUsesLisp2021-07-233-0/+15
| | | | | |
| * | | | | glasm: Add graphics specific shader declarations to GLASMReinUsesLisp2021-07-232-6/+63
| | | | | |
| * | | | | glasm: Implement local memory for glasmameerj2021-07-234-9/+12
| | | | | |
| * | | | | emit_spirv: Add missing block in caseReinUsesLisp2021-07-231-1/+2
| | | | | |
| * | | | | glasm: Initial implementation of phi nodes on GLASMReinUsesLisp2021-07-2312-25/+117
| | | | | |
| * | | | | glasm: Write result to scalar on integer comparison instructionsReinUsesLisp2021-07-231-10/+10
| | | | | |
| * | | | | glasm: Declare NV_shader_thread_group when neededReinUsesLisp2021-07-231-3/+4
| | | | | |
| * | | | | vk_update_descriptor: Properly initialize payload on the update descriptor queueReinUsesLisp2021-07-231-1/+3
| | | | | |
| * | | | | glasm: Rework control flow introducing a syntax listReinUsesLisp2021-07-2333-505/+437
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This commit regresses VertexA shaders, their transformation pass has to be adapted to the new control flow.
| * | | | | glasm: Implement Storage atomicsameerj2021-07-235-109/+156
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | StorageAtomicExchangeU64 is failing test seemingly due to failure storing 64-bit result into the register
| * | | | | glasm: Ensure reg alloc order across compilers on GLASMReinUsesLisp2021-07-231-11/+14
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Use a struct constructor to serialize register allocation arguments to ensure registers are allocated in the same order regardless of the compiler used. The A and B functions can be called in any order when passed as arguments to "foo": foo(A(), B()) But the order is guaranteed for curly-braced constructor calls in classes: Foo{A(), B()} Use this to get consistent behavior.
| * | | | | glasm: Enable unintentionally disabled register aliasing on GLASMReinUsesLisp2021-07-231-16/+11
| | | | | |
| * | | | | glasm: Review all GLASM insts to be aware of register aliasingReinUsesLisp2021-07-234-20/+51
| | | | | |
| * | | | | glasm: Implement shuffle and vote instructions on GLASMReinUsesLisp2021-07-2310-100/+166
| | | | | |
| * | | | | glasm: Add MUFU instructions to GLASMReinUsesLisp2021-07-232-21/+22
| | | | | |
| * | | | | glasm: Implement IAbs64 and INeg64 on GLASMReinUsesLisp2021-07-232-6/+6
| | | | | |
| * | | | | shader: Add floating-point rounding to I2FReinUsesLisp2021-07-233-35/+42
| | | | | |
| * | | | | glasm: Properly clamp Fp64 on GLASMReinUsesLisp2021-07-231-6/+6
| | | | | |
| * | | | | glasm: Fix register allocation when moving immediate on GLASMReinUsesLisp2021-07-233-42/+89
| | | | | |
| * | | | | glasm: Implement SelectU64 on GLASMReinUsesLisp2021-07-232-4/+20
| | | | | |
| * | | | | glasm: Fix clamps so the min value has priority on NAN on GLASMReinUsesLisp2021-07-231-12/+15
| | | | | |
| * | | | | glasm: Fix moving U64 immediates to registers in GLASMReinUsesLisp2021-07-232-3/+4
| | | | | |
| * | | | | glasm: Implement storage atomic opsameerj2021-07-234-305/+358
| | | | | |
| * | | | | glasm: Add conversion instructions to GLASMReinUsesLisp2021-07-239-282/+351
| | | | | |
| * | | | | glasm: Add fp min/max insts and fix store for fp64 on GLASMReinUsesLisp2021-07-232-10/+8
| | | | | |
| * | | | | glasm: Add logical instructions on GLASMReinUsesLisp2021-07-232-12/+12
| | | | | |
| * | | | | glasm: Remove duplicated Fp64 pack instructions on GLASMReinUsesLisp2021-07-231-8/+0
| | | | | |
| * | | | | glasm: Remove unnecesary new white space on Clamp GLASMReinUsesLisp2021-07-231-4/+4
| | | | | |
| * | | | | glasm: Add floating-point comparisons on GLASMReinUsesLisp2021-07-233-120/+116
| | | | | |
| * | | | | emit_glasm: Implement more integer alu opsameerj2021-07-232-47/+41
| | | | | |
| * | | | | glasm: Reimplement bitwise ops and BFI/BFEameerj2021-07-234-88/+108
| | | | | |
| * | | | | glasm: Initial GLASM fp64 supportReinUsesLisp2021-07-239-55/+152
| | | | | |
| * | | | | glasm: Implement GLASM fp16 packing and move bitwise insnsReinUsesLisp2021-07-234-66/+77
| | | | | |
| * | | | | glasm: Remove unused functions left from rebaseReinUsesLisp2021-07-231-12/+0
| | | | | |
| * | | | | glasm: Specify namespace when using FormatToReinUsesLisp2021-07-231-6/+6
| | | | | |
| * | | | | glasm: Implement more GLASM composite instructionsReinUsesLisp2021-07-232-54/+63
| | | | | |
| * | | | | vk_pipeline_cache: Enable int8 and int16 types on VulkanReinUsesLisp2021-07-231-0/+2
| | | | | |
| * | | | | glasm: Make GLASM aware of typesReinUsesLisp2021-07-2312-1244/+1380
| | | | | |
| * | | | | glasm: Use CMP.S for Select32ameerj2021-07-233-12/+8
| | | | | | | | | | | | | | | | | | | | | | | | also fixes ADD and SUB to use U modifier
| * | | | | glasm: Implement more logical opsameerj2021-07-232-5/+5
| | | | | |
| * | | | | glasm: Implement BFI, BFEameerj2021-07-234-138/+164
| | | | | | | | | | | | | | | | | | | | | | | | Along with implementations of common instructions along the way
| * | | | | glasm: Use BitField instead of C bitfieldsReinUsesLisp2021-07-232-8/+12
| | | | | |
| * | | | | glasm: Remove unused argument in identity instructions on GLASMReinUsesLisp2021-07-231-7/+7
| | | | | |
| * | | | | gl_rasterizer: Flush L2 caches before glFlush on GLASMReinUsesLisp2021-07-231-0/+8
| | | | | |
| * | | | | glasm: Initial GLASM compute implementation for testingReinUsesLisp2021-07-233-14/+47
| | | | | |
| * | | | | glasm: Implement basic GLASM instructionsReinUsesLisp2021-07-2310-840/+1173
| | | | | |
| * | | | | glasm: Changes to GLASM register allocator and emit contextReinUsesLisp2021-07-234-26/+64
| | | | | |
| * | | | | vk_scheduler: Use locks instead of SPSC a queueReinUsesLisp2021-07-232-32/+42
| | | | | | | | | | | | | | | | | | | | | | | | This tries to fix a data race where we'd wait forever for the GPU.
| * | | | | vk_query_cache: Wait before reading queriesReinUsesLisp2021-07-231-9/+2
| | | | | |
| * | | | | vk_master_semaphore: Use fetch_add to increase master semaphore tickReinUsesLisp2021-07-232-6/+4
| | | | | |
| * | | | | glasm: Add GLASM backend infrastructureReinUsesLisp2021-07-2328-4/+3115
| | | | | |
| * | | | | shader: ISET.X implementationameerj2021-07-231-8/+58
| | | | | |
| * | | | | gl_shader_cache: Remove code unintentionally committedReinUsesLisp2021-07-231-3/+0
| | | | | |
| * | | | | shader: Fixup SPIR-V emit header namespacesReinUsesLisp2021-07-231-2/+2
| | | | | |
| * | | | | Move SPIR-V emission functions to their own headerReinUsesLisp2021-07-2326-579/+637
| | | | | |
| * | | | | shader: Optimize NVN FallthroughFernandoS272021-07-234-9/+83
| | | | | |
| * | | | | shader: Stub SR_AFFINITYFernandoS272021-07-231-0/+3
| | | | | |
| * | | | | shader: Implement Int32 SUATOM/SUREDameerj2021-07-2317-6/+733
| | | | | |
| * | | | | shader: Initial OpenGL implementationReinUsesLisp2021-07-2338-705/+1427
| | | | | |
| * | | | | spirv: Be aware of NAN unaware driversReinUsesLisp2021-07-231-18/+40
| | | | | |
| * | | | | spirv: Add SSBO read fallbacks when no aliasing is availableReinUsesLisp2021-07-231-37/+99
| | | | | |
| * | | | | spirv: Add OpKill fallback to demoteReinUsesLisp2021-07-231-2/+6
| | | | | |
| * | | | | spirv: Do not enable ShaderLayerReinUsesLisp2021-07-231-3/+0
| | | | | | | | | | | | | | | | | | | | | | | | This is enabled by an extension instead of the capability.
| * | | | | spirv: Enable DemoteToHelperInvocationEXT only when supportedReinUsesLisp2021-07-231-1/+1
| | | | | |
| * | | | | spirv: Use OriginLowerLeft when requestedReinUsesLisp2021-07-231-1/+5
| | | | | |
| * | | | | spirv: Only add image operands mask when neededReinUsesLisp2021-07-231-5/+9
| | | | | |
| * | | | | spirv: Workaround image unsigned offset bugReinUsesLisp2021-07-232-9/+26
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Workaround bug on Nvidia's OpenGL SPIR-V compiler when using unsigned texture offsets.
| * | | | | spirv: Add int8 and int16 capabilities only when supportedReinUsesLisp2021-07-231-2/+2
| | | | | |
| * | | | | spirv: Add integer clamping workaroundsReinUsesLisp2021-07-231-4/+34
| | | | | | | | | | | | | | | | | | | | | | | | Workaround more bugs on Nvidia's OpenGL SPIR-V compiler.
| * | | | | spirv: Implement int8 and int16 conversion fallbacksReinUsesLisp2021-07-231-19/+80
| | | | | |
| * | | | | spirv: Support OpenGL uniform buffers and change bindingsReinUsesLisp2021-07-236-58/+168
| | | | | |
| * | | | | spirv: Desambiguate descriptor namesReinUsesLisp2021-07-231-9/+37
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Worksaround a bug on Nvidia's OpenGL SPIR-V compiler where names are used for name matching.
| * | | | | shader: Add OpenGL shader profile optionsReinUsesLisp2021-07-231-0/+11
| | | | | |
| * | | | | shader: Remove shader utilReinUsesLisp2021-07-234-176/+0
| | | | | |
| * | | | | shader: Address feedbackFernandoS272021-07-235-44/+42
| | | | | |
| * | | | | shader: Implement VertexA stageFernandoS272021-07-2312-3/+180
| | | | | |
| * | | | | shader: Implement delegation of Exit to dispatcher on CFGFernandoS272021-07-232-3/+47
| | | | | |
| * | | | | vk_graphics_pipeline: Fix texture buffer descriptorsReinUsesLisp2021-07-231-7/+8
| | | | | |
| * | | | | shader: Fix IADD3.CCameerj2021-07-231-12/+5
| | | | | |
| * | | | | vk_scheduler: Allow command submission on worker threadReinUsesLisp2021-07-238-182/+200
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This changes how Scheduler::Flush works. It queues the current command buffer to be sent to the GPU but does not do it immediately. The Vulkan worker thread takes care of that. Users will have to use Scheduler::Flush + Scheduler::WaitWorker to get the previous behavior. Scheduler::Finish is unchanged. To avoid waiting on work never queued, Scheduler::Wait sends the current command buffer if that's what the caller wants to wait.
| * | | | | vk_compute_pass: Fix -Wshadow warningReinUsesLisp2021-07-231-3/+3
| | | | | |
| * | | | | shader: Move pipeline cache logic to separate filesReinUsesLisp2021-07-2312-824/+1095
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Move code to separate files to be able to reuse it from OpenGL. This greatly simplifies the pipeline cache logic on Vulkan. Transform feedback state is not yet abstracted and it's still intrusively stored inside vk_pipeline_cache. It will be moved when needed on OpenGL.
| * | | | | vulkan: Defer descriptor set work to the Vulkan threadReinUsesLisp2021-07-238-79/+69
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Move descriptor lookup and update code to a separate thread. Delaying this removes work from the main GPU thread and allows creating descriptor layouts on another thread. This reduces a bit the workload of the main thread when new pipelines are encountered.
| * | | | | vulkan: Rework descriptor allocation algorithmReinUsesLisp2021-07-2315-197/+314
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Create multiple descriptor pools on demand. There are some degrees of freedom what is considered a compatible pool to avoid wasting large pools on small descriptors.
| * | | | | vk_graphics_pipeline: Generate specialized pipeline config functions and improve codeReinUsesLisp2021-07-232-31/+230
| | | | | |
| * | | | | shader: Accelerate pipeline transitions and use dirty flags for shadersReinUsesLisp2021-07-239-64/+114
| | | | | |
| * | | | | shader: Fix BFE s32 undefined checkameerj2021-07-231-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | Our unit tests were hitting this exception.
| * | | | | vk_compute_pipeline: Fix index comparison oversight on compute texture buffersReinUsesLisp2021-07-231-1/+1
| | | | | |
| * | | | | shader: Fix error checking in bitfieldExtract and implement bitfieldInsert foldingReinUsesLisp2021-07-231-5/+14
| | | | | |
| * | | | | vulkan_device: Require shaderClipDistance and shaderCullDistance featuresReinUsesLisp2021-07-231-2/+4
| | | | | |
| * | | | | vk_graphics_pipeline: Guard against non-tessellation pipelines using patchesReinUsesLisp2021-07-231-2/+8
| | | | | |
| * | | | | shader: Fix storage type when reading patches on tess controlReinUsesLisp2021-07-231-1/+2
| | | | | |
| * | | | | shader: Fix VMNMX selector BReinUsesLisp2021-07-231-1/+2
| | | | | |
| * | | | | shader: Fix bugs and build issues on GCCRodrigo Locatti2021-07-233-4/+4
| | | | | |
| * | | | | shader: Fix render targets with null attachmentsReinUsesLisp2021-07-232-26/+34
| | | | | |
| * | | | | shader: Increase the maximum number of storage buffersReinUsesLisp2021-07-231-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Compute shaders spill uniform buffers on storage buffers, increasing the expected number.
| * | | | | shader: Remove identity removal pass for better build timesReinUsesLisp2021-07-231-1/+0
| | | | | |
| * | | | | shader: Add more strict validation the passReinUsesLisp2021-07-231-0/+42
| | | | | |
| * | | | | shader: Fix forward referencing identity instructions when inserting phiReinUsesLisp2021-07-231-11/+13
| | | | | |
| * | | | | shader: Remove invalidated blocks in dead code elimination passReinUsesLisp2021-07-231-3/+6
| | | | | |
| * | | | | shader: Add missing UndoUse case for GetSparseFromOpReinUsesLisp2021-07-231-0/+4
| | | | | |
| * | | | | shader: Require dual source blendingReinUsesLisp2021-07-231-1/+2
| | | | | |
| * | | | | shader: Simplify code in opcodes.h to fix IntellisenseReinUsesLisp2021-07-231-8/+6
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Avoid using std::array to fix Intellisense not properly compiling this code and disabling itself on all files that include it. While we are at it, change the code to use u8 instead of size_t for the number of instructions in an opcode.
| * | | | | shader: Implement indexed texturesReinUsesLisp2021-07-2310-157/+284
| | | | | |
| * | | | | shader: Refactor atomic_operations_global_memoryameerj2021-07-231-44/+36
| | | | | |
| * | | | | shader: add missing include guard in half_floating_point_helper.hameerj2021-07-231-0/+2
| | | | | |
| * | | | | shader: Fix gcc warningsReinUsesLisp2021-07-232-2/+2
| | | | | |
| * | | | | shader: Inline common Value gettersReinUsesLisp2021-07-232-109/+102
| | | | | |
| * | | | | shader: Intrusively store in a block if it's sealed or notReinUsesLisp2021-07-232-3/+11
| | | | | |
| * | | | | cmake: Link to common in shader_recompilerReinUsesLisp2021-07-231-1/+1
| | | | | |
| * | | | | shader: Improve goto removal algorithm complexityReinUsesLisp2021-07-231-49/+28
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Find sibling node containing a nephew searching from the nephew itself instead of the uncle.
| * | | | | shader: Use memset to reset instruction argumentsReinUsesLisp2021-07-232-4/+7
| | | | | |
| * | | | | shader: Inline common Value functions into the headerReinUsesLisp2021-07-232-19/+23
| | | | | |
| * | | | | shader: Move microinstruction header to the value headerReinUsesLisp2021-07-2320-181/+162
| | | | | |
| * | | | | shader: Move siblings check to a separate function and comment them outReinUsesLisp2021-07-231-16/+21
| | | | | |
| * | | | | shader: Intrusively store register values in block for SSA passReinUsesLisp2021-07-232-21/+53
| | | | | |
| * | | | | shader: Inline common Opcode and Inst functionsReinUsesLisp2021-07-234-112/+83
| | | | | |
| * | | | | shader: Inline common IR::Block methodsReinUsesLisp2021-07-232-17/+12
| | | | | |
| * | | | | shader: Use a small_vector for phi blocksReinUsesLisp2021-07-231-1/+2
| | | | | |
| * | | | | shader: Calculate number of arguments in an opcode at compile timeReinUsesLisp2021-07-231-3/+12
| | | | | |
| * | | | | shader: Implement D3D samplersReinUsesLisp2021-07-236-49/+127
| | | | | |
| * | | | | shader: Add constant propagation for arithmetic right shiftsReinUsesLisp2021-07-231-0/+3
| | | | | |
| * | | | | shader: Simplify code for local memoryReinUsesLisp2021-07-231-6/+11
| | | | | |
| * | | | | shader: Add NVN storage buffer fallbacksReinUsesLisp2021-07-239-62/+214
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | When we can't track the SSBO origin of a global memory instruction, leave it as a global memory operation and assume these pointers are in the NVN storage buffer slots, then apply a linear search in the shader's runtime.
| * | | | | spirv: Fix ViewportMaskReinUsesLisp2021-07-231-1/+2
| | | | | |
| * | | | | spirv: Replace Constant/ConstantComposite with Const helperameerj2021-07-2312-112/+101
| | | | | |
| * | | | | shader: Address feedbackFernandoS272021-07-232-7/+10
| | | | | |
| * | | | | shader: Implement F2F (Imm)FernandoS272021-07-231-2/+28
| | | | | |
| * | | | | shader: Implement IADD3.CC/.XFernandoS272021-07-231-7/+22
| | | | | |
| * | | | | shader: Address feedbackFernandoS272021-07-234-7/+4
| | | | | |
| * | | | | shader: Add coarse derivativesFernandoS272021-07-237-8/+28
| | | | | |
| * | | | | shader: Implement fine derivates constant propagationFernandoS272021-07-239-0/+101
| | | | | |
| * | | | | shader: Implement SR_Y_DIRECTIONFernandoS272021-07-2310-0/+22
| | | | | |
| * | | | | shader: Fix Phi node typesReinUsesLisp2021-07-232-4/+4
| | | | | |
| * | | | | shader: Fix memory barriersReinUsesLisp2021-07-238-62/+30
| | | | | |
| * | | | | spirv: Fix implicit lod typeReinUsesLisp2021-07-232-1/+5
| | | | | |
| * | | | | spirv: Use explicit lods outside of fragment shadersReinUsesLisp2021-07-231-5/+16
| | | | | |
| * | | | | spirv: Use ConstOffset instead of Offset when possibleReinUsesLisp2021-07-233-21/+67
| | | | | |
| * | | | | shader: Implement BFE and BFI CCameerj2021-07-233-14/+17
| | | | | | | | | | | | | | | | | | | | | | | | Fix two bugs in BFI.
| * | | | | shader: Implement SampleMaskReinUsesLisp2021-07-2311-2/+22
| | | | | |
| * | | | | shader: Implement PIXLD.MY_INDEXReinUsesLisp2021-07-2314-5/+71
| | | | | |
| * | | | | spirv: Bitcast non-F32 output attributes to their type before storeReinUsesLisp2021-07-231-13/+28
| | | | | |
| * | | | | spirv: Implement ViewportMask with NV_viewport_array2ReinUsesLisp2021-07-2310-0/+32
| | | | | |
| * | | | | spirv: Bitcast non-F32 attributes to F32ReinUsesLisp2021-07-231-7/+9
| | | | | |
| * | | | | shader: Implement PrimitiveIdReinUsesLisp2021-07-235-0/+10
| | | | | |
| * | | | | shader: Implement tessellation shaders, polygon mode and invocation idReinUsesLisp2021-07-2328-91/+605
| | | | | |
| * | | | | shader: Mark atomic instructions as writesReinUsesLisp2021-07-231-0/+27
| | | | | |
| * | | | | vk_pipeline_cache: Silence GCC warningslat9nq2021-07-231-0/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Silences `-Werror=missing-field-initializers` due to missing initializers.
| * | | | | spirv: Implement image buffersReinUsesLisp2021-07-239-49/+142
| | | | | |
| * | | | | spirv: Implement Layer storesReinUsesLisp2021-07-236-9/+30
| | | | | |
| * | | | | spirv: Fix alpha testFernandoS272021-07-231-0/+5
| | | | | |
| * | | | | spirv: Fix non-atomic 64-bit storeameerj2021-07-231-1/+1
| | | | | |
| * | | | | spirv: Implement alpha testameerj2021-07-233-1/+95
| | | | | |
| * | | | | shader: Implement transform feedbacks and define file formatReinUsesLisp2021-07-2311-23/+272
| | | | | |
| * | | | | shader: Implement early Z testsReinUsesLisp2021-07-233-0/+5
| | | | | |
| * | | | | shader: Document and relax cache control on surface instructionsReinUsesLisp2021-07-231-10/+11
| | | | | |
| * | | | | spirv: Rework storage buffers and shader memoryReinUsesLisp2021-07-239-500/+581
| | | | | |
| * | | | | shader: Fix fixed pipeline point size on geometry shadersReinUsesLisp2021-07-231-10/+18
| | | | | |
| * | | | | shader: Add constant propagation for *&^| binary operationsReinUsesLisp2021-07-231-0/+12
| | | | | |
| * | | | | shader: Implement geometry shadersReinUsesLisp2021-07-2314-91/+277
| | | | | |
| * | | | | shader: Implement OUTReinUsesLisp2021-07-2310-17/+73
| | | | | |
| * | | | | internal_stage_buffer_entry_read: Remove pragma optimize offlat9nq2021-07-231-2/+0
| | | | | |
| * | | | | shader: Stub SR_INVOCATION_INFOReinUsesLisp2021-07-231-2/+5
| | | | | |
| * | | | | shader: Stub ISBERDReinUsesLisp2021-07-233-4/+56
| | | | | |
| * | | | | shader: Fix CC in I2IReinUsesLisp2021-07-231-0/+2
| | | | | |
| * | | | | spirv: Define StorageImageWriteWithoutFormat capability when usedReinUsesLisp2021-07-233-0/+9
| | | | | |
| * | | | | pipeline_helper: Simplify descriptor objects initializationReinUsesLisp2021-07-231-33/+25
| | | | | |
| * | | | | shader: Simplify FLO and throw on CCReinUsesLisp2021-07-231-12/+13
| | | | | |
| * | | | | shader: Mark blocks with no end branch as unreachableReinUsesLisp2021-07-231-2/+7
| | | | | |
| * | | | | shader: Implement LOP CCReinUsesLisp2021-07-233-12/+29
| | | | | |
| * | | | | shader: Implement SR_THREAD_KILLReinUsesLisp2021-07-2310-0/+22
| | | | | |
| * | | | | shader: Apply sign bit in FCMP (imm)ReinUsesLisp2021-07-231-1/+1
| | | | | |
| * | | | | shader: Implement ATOM/S and REDameerj2021-07-2321-19/+1745
| | | | | |
| * | | | | nsight_aftermath_tracker: Report used shaders to Nsight AftermathReinUsesLisp2021-07-236-16/+20
| | | | | |
| * | | | | spirv: Move phi node patching to a separate functionReinUsesLisp2021-07-231-13/+16
| | | | | |
| * | | | | spirv: Guard against typeless image reads on unsupported devicesReinUsesLisp2021-07-236-1/+17
| | | | | |
| * | | | | shader: Move LaneId to the warp emission file and fix AMDReinUsesLisp2021-07-235-7/+11
| | | | | |
| * | | | | vk_rasterizer: Request outside render pass execution context for computeReinUsesLisp2021-07-231-0/+1
| | | | | |
| * | | | | pipeline_helper: Add missing [[maybe_unused]]ReinUsesLisp2021-07-231-1/+1
| | | | | |
| * | | | | spirv: Fix forward declarations on phi nodesReinUsesLisp2021-07-231-47/+25
| | | | | |
| * | | | | shader: Mark ImageWrite with side effectsReinUsesLisp2021-07-231-0/+3
| | | | | |
| * | | | | shader: Implement CC for ISET, FSET, PSET, CSET, and DSETFernandoS272021-07-2318-13/+136
| | | | | | | | | | | | | | | | | | | | | | | | Throw when other instructions are missing CC.
| * | | | | shader: Remove outdated comment in F2IReinUsesLisp2021-07-231-4/+0
| | | | | |
| * | | | | shader: Implement SULD and SUSTReinUsesLisp2021-07-2331-202/+732
| | | | | |
| * | | | | shader: Fix Windows build issuesReinUsesLisp2021-07-231-1/+1
| | | | | |
| * | | | | shader: Address feedback + clang formatlat9nq2021-07-2312-24/+22
| | | | | |
| * | | | | shader_recompiler,video_core: Cleanup some GCC and Clang errorslat9nq2021-07-2366-313/+308
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Mostly fixing unused *, implicit conversion, braced scalar init, fpermissive, and some others. Some Clang errors likely remain in video_core, and std::ranges is still a pertinent issue in shader_recompiler shader_recompiler: cmake: Force bracket depth to 1024 on Clang Increases the maximum fold expression depth thread_worker: Include condition_variable Don't use list initializers in control flow Co-authored-by: ReinUsesLisp <reinuseslisp@airmail.cc>
| * | | | | shader: Fix FCMP immediate variantReinUsesLisp2021-07-231-1/+9
| | | | | |
| * | | | | shader: Fix dangling labelsReinUsesLisp2021-07-231-0/+5
| | | | | |
| * | | | | shader: Interact texture buffers with buffer cacheReinUsesLisp2021-07-2317-148/+333
| | | | | |
| * | | | | shader: Fix F2IReinUsesLisp2021-07-231-1/+1
| | | | | |
| * | | | | shader: Fix TextureGradReinUsesLisp2021-07-231-1/+1
| | | | | |
| * | | | | shader: Implement texture buffersReinUsesLisp2021-07-2310-35/+154
| | | | | |
| * | | | | shader: Address feedbackFernandoS272021-07-235-53/+54
| | | | | |
| * | | | | shader: Implement indexed Position and ClipDistancesFernandoS272021-07-233-11/+100
| | | | | |
| * | | | | shader: Implement indexed attributesFernandoS272021-07-2312-35/+279
| | | | | |
| * | | | | shader: Implement AL2PFernandoS272021-07-233-4/+36
| | | | | |
| * | | | | shader: Fix BRX trackingFernandoS272021-07-232-3/+4
| | | | | |
| * | | | | vk_pipeline_cache: Fix num of pipeline workers on weird platformsReinUsesLisp2021-07-231-1/+1
| | | | | |
| * | | | | shader: Move recursive SSA rewrite to the heapReinUsesLisp2021-07-231-29/+89
| | | | | |
| * | | | | shader: Fix ShadowCube declaration type, set number of pipeline threads based on hardwareFernandoS272021-07-232-2/+4
| | | | | |
| * | | | | shader: Fix splits on blocks using indirect branchesReinUsesLisp2021-07-233-17/+38
| | | | | |
| * | | | | shader: Eliminate orphan blocks more efficientlyReinUsesLisp2021-07-231-7/+8
| | | | | |
| * | | | | shader: Add subgroup masksReinUsesLisp2021-07-2310-45/+169
| | | | | |
| * | | | | shader: Implement BAR and fix memory barriersReinUsesLisp2021-07-237-5/+79
| | | | | |
| * | | | | shader: Abstract breadth searches and use the abstractionReinUsesLisp2021-07-234-104/+106
| | | | | |
| * | | | | shader: Reimplement GetCbufU64 as GetCbufU32x2ReinUsesLisp2021-07-239-22/+21
| | | | | | | | | | | | | | | | | | | | | | | | It may generate better code on some compilers and it's easier to handle.
| * | | | | vk_compute_pass: Fix compute passesReinUsesLisp2021-07-233-23/+19
| | | | | |
| * | | | | shader: Remove atomic flags and use mutex + cond variable for pipelinesReinUsesLisp2021-07-234-11/+32
| | | | | |
| * | | | | shader: Remove unused header in VOTEReinUsesLisp2021-07-231-2/+0
| | | | | |
| * | | | | vk_pipeline_cache: Remove unnecesary scope in pipeline cache lockingReinUsesLisp2021-07-231-15/+12
| | | | | |
| * | | | | shader: Rework global memory tracking to use breadth-first searchReinUsesLisp2021-07-231-69/+80
| | | | | |
| * | | | | shader: Fix fp16 merge when using native fp16ReinUsesLisp2021-07-231-3/+3
| | | | | |
| * | | | | shader: Fix FADD32IReinUsesLisp2021-07-231-6/+4
| | | | | |
| * | | | | shader: Fix undetected bug from reviewFernandoS272021-07-231-0/+3
| | | | | |
| * | | | | shader: Address feedbackFernandoS272021-07-233-13/+16
| | | | | |
| * | | | | shader: "Implement" NOPFernandoS272021-07-231-1/+1
| | | | | |
| * | | | | vk_pipeline_cache: Small fixes to the pipeline cacheFernandoS272021-07-231-10/+14
| | | | | |
| * | | | | shader: Address FeedbackFernandoS272021-07-2316-211/+60
| | | | | |
| * | | | | shader: Implement SR_LaneIdFernandoS272021-07-237-0/+15
| | | | | |
| * | | | | shader: Fix shared memory on cool driversFernandoS272021-07-231-0/+1
| | | | | |
| * | | | | shader: Implement MEMBARFernandoS272021-07-239-11/+121
| | | | | |
| * | | | | shader: Improve VOTE.VTG stubFernandoS272021-07-237-4/+147
| | | | | |
| * | | | | shader: Mark SSBOs as written when they areFernandoS272021-07-234-4/+32
| | | | | |
| * | | | | shader: Implement ViewportIndexFernandoS272021-07-238-2/+33
| | | | | |
| * | | | | shader: Stub TLD4's PTP when it isn't constantFernandoS272021-07-231-1/+2
| | | | | |
| * | | | | shader: Stub VOTE.VTGFernandoS272021-07-234-4/+15
| | | | | |
| * | | | | shader: Fold composite extractFernandoS272021-07-231-0/+62
| | | | | |
| * | | | | shader: Fold comparisons and Pack/Unpack16FernandoS272021-07-231-1/+41
| | | | | |
| * | | | | shader: Fix branches to visited virtual blocksReinUsesLisp2021-07-232-0/+12
| | | | | |
| * | | | | vulkan: Serialize pipelines on a separate threadReinUsesLisp2021-07-232-67/+64
| | | | | |
| * | | | | vulkan: Create pipeline layouts in separate threadsReinUsesLisp2021-07-237-63/+65
| | | | | |
| * | | | | vulkan: Build pipelines in parallel at runtimeReinUsesLisp2021-07-239-165/+197
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Wait from the worker thread for a pipeline to build before binding it to the command buffer. This allows queueing pipelines to multiple threads.
| * | | | | shader: Fix dependency on identity removal passReinUsesLisp2021-07-232-3/+8
| | | | | |
| * | | | | shader: Fix constant propagation to use reverse post orderReinUsesLisp2021-07-231-1/+2
| | | | | |
| * | | | | shader: Implement LDG .U.128 as .128ReinUsesLisp2021-07-231-3/+2
| | | | | |
| * | | | | shader: Unroll "using enum" for opcode declarationsReinUsesLisp2021-07-231-1/+27
| | | | | |
| * | | | | vk_pipeline_cache: Name SPIR-V modulesReinUsesLisp2021-07-231-1/+11
| | | | | |
| * | | | | spirv: Remove unnecesary variable for clip distancesReinUsesLisp2021-07-232-6/+2
| | | | | |
| * | | | | shader: Implement ClipDistanceFernandoS272021-07-235-0/+36
| | | | | |
| * | | | | shader: Fix TXDFernandoS272021-07-232-2/+2
| | | | | |
| * | | | | shader: Address feedbackFernandoS272021-07-235-53/+49
| | | | | |
| * | | | | shader: Always pass a lod for TexelFetchReinUsesLisp2021-07-233-25/+17
| | | | | |
| * | | | | shader: Implement TXDFernandoS272021-07-234-10/+183
| | | | | |
| * | | | | shader: Implement ImageGradientFernandoS272021-07-238-2/+84
| | | | | |
| * | | | | shader: Implement TMML partiallyFernandoS272021-07-236-13/+137
| | | | | |
| * | | | | shader,spirv: Implement ImageQueryLod.FernandoS272021-07-239-1/+38
| | | | | |
| * | | | | shader: Implement TLDSFernandoS272021-07-233-4/+253
| | | | | |
| * | | | | shader: Implement TLDFernandoS272021-07-238-16/+174
| | | | | |
| * | | | | spirv: Add fixed pipeline point sizeReinUsesLisp2021-07-234-1/+11
| | | | | |
| * | | | | shader: Add PointCoord attributeFernandoS272021-07-235-0/+16
| | | | | |
| * | | | | shader: Add PointSize attributeameerj2021-07-235-0/+13
| | | | | |
| * | | | | shader: Store type of phi nodes in flagsReinUsesLisp2021-07-233-2/+11
| | | | | | | | | | | | | | | | | | | | | | | | This is needed because pseudo-instructions where invalidated.
| * | | | | shader: Fix indirect branches to scheduler instructionsReinUsesLisp2021-07-233-7/+17
| | | | | |
| * | | | | spirv: Fix default output attribute initializationReinUsesLisp2021-07-231-3/+3
| | | | | |
| * | | | | shader: Add missing new linesReinUsesLisp2021-07-231-0/+2
| | | | | |
| * | | | | shader: Implement FSWZADDameerj2021-07-2314-4/+87
| | | | | |
| * | | | | shader: Implement BRXFernandoS272021-07-2321-48/+437
| | | | | |
| * | | | | shader: Fix alignment checks on RZReinUsesLisp2021-07-231-1/+1
| | | | | |
| * | | | | shader: Implement I2I CCameerj2021-07-233-24/+45
| | | | | |
| * | | | | shader: Implement I2I SATameerj2021-07-236-10/+52
| | | | | |
| * | | | | vk_pipeline_cache: Fix size hashing of shadersReinUsesLisp2021-07-231-8/+7
| | | | | |
| * | | | | shader: Fix ISCADD logic for PO/CCameerj2021-07-231-7/+8
| | | | | |
| * | | | | shader: Implement LDS, STS, LDL, and STS and use SPIR-V 1.4 when availableReinUsesLisp2021-07-2320-36/+730
| | | | | |
| * | | | | shader: Implement ISCADD CCameerj2021-07-231-1/+4
| | | | | |
| * | | | | shader: Implement VMAD, VMNMX, VSETPameerj2021-07-239-23/+319
| | | | | |
| * | | | | shader: Add missing I2I exception when CC is usedReinUsesLisp2021-07-231-0/+4
| | | | | |
| * | | | | shader: Better interpolation and disabled attributes supportReinUsesLisp2021-07-239-25/+101
| | | | | |
| * | | | | spirv: Remove dependencies on Environment when generating SPIR-VReinUsesLisp2021-07-235-16/+15
| | | | | |
| * | | | | vk_pipeline_cache: Fix pipeline and shader cachesReinUsesLisp2021-07-232-6/+21
| | | | | |
| * | | | | shader: Implement front faceReinUsesLisp2021-07-235-0/+12
| | | | | |
| * | | | | shader: Fix structured control flow on KIL instructionsReinUsesLisp2021-07-232-3/+7
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This could potentially leave unvisited blocks, leading to illegal phi nodes.
| * | | | | shader: Fix TXQFernandoS272021-07-231-1/+1
| | | | | |
| * | | | | shader: Fix rasterizer integration order issuesReinUsesLisp2021-07-233-7/+6
| | | | | |
| * | | | | shader: Implement TXQ and fix FragDepthReinUsesLisp2021-07-2315-21/+264
| | | | | |
| * | | | | shader: Refactor PTP and other minor changesReinUsesLisp2021-07-2314-123/+67
| | | | | |
| * | | | | shader: Add IR opcode for ImageFetchFernandoS272021-07-237-5/+55
| | | | | |
| * | | | | shader: Implement TLD4.PTPFernandoS272021-07-2315-28/+111
| | | | | |
| * | | | | shader: Fix Array Indices in TEX/TLD4FernandoS272021-07-232-6/+6
| | | | | |
| * | | | | shader: Implement FragDepthFernandoS272021-07-232-1/+7
| | | | | |
| * | | | | shader: Implement TLD4S.FernandoS272021-07-233-4/+134
| | | | | |
| * | | | | shader: Implement TLD4 and TLD4_BFernandoS272021-07-2313-11/+315
| | | | | |
| * | | | | shader: Implement SHFLameerj2021-07-2316-69/+284
| | | | | |
| * | | | | shader: Track first bindless argument instead of the instruction itselfReinUsesLisp2021-07-231-1/+1
| | | | | |
| * | | | | shader: Properly insert Prologue instructionReinUsesLisp2021-07-231-1/+2
| | | | | |
| * | | | | shader: Minor style nitsReinUsesLisp2021-07-231-2/+4
| | | | | |
| * | | | | shader: Fix F2IFernandoS272021-07-2310-9/+147
| | | | | |
| * | | | | shader: Implement NDC [-1, 1], attribute types and default varying initializationReinUsesLisp2021-07-2315-43/+186
| | | | | |
| * | | | | shader: Fix use-after-free bug in object_poolReinUsesLisp2021-07-231-3/+3
| | | | | |
| * | | | | shader: Implement VOTEameerj2021-07-2318-6/+182
| | | | | |
| * | | | | vk_pipeline_cache: Fix ReleaseContents orderReinUsesLisp2021-07-231-2/+2
| | | | | |
| * | | | | shader: Fix TEX maskReinUsesLisp2021-07-231-1/+3
| | | | | |
| * | | | | vk_pipeline_cache: Add pipeline cacheReinUsesLisp2021-07-232-0/+7
| | | | | |
| * | | | | vk_pipeline_cache: Add pipeline cacheReinUsesLisp2021-07-238-106/+347
| | | | | |
| * | | | | shader: Fold interpolation multiplicationsReinUsesLisp2021-07-231-0/+34
| | | | | |
| * | | | | shader: Better but still partial interpolation supportReinUsesLisp2021-07-231-5/+7
| | | | | |
| * | | | | shader: Implement DMNMX, DSET, DSETPameerj2021-07-2316-59/+210
| | | | | |
| * | | | | shader: Implement FADD32IFernandoS272021-07-231-2/+15
| | | | | |
| * | | | | shader: Implement F2FFernandoS272021-07-236-20/+192
| | | | | |
| * | | | | shader: Add missing fp64 usage flagsReinUsesLisp2021-07-231-0/+34
| | | | | |
| * | | | | shader: Implement DMUL and DFMAameerj2021-07-238-30/+111
| | | | | | | | | | | | | | | | | | | | | | | | Also add a missing const on DADD
| * | | | | shader: Add FP64 register load/store helpersameerj2021-07-233-21/+24
| | | | | |
| * | | | | shader: Add support for fp16 comparisons and misc fixesReinUsesLisp2021-07-2311-14/+56
| | | | | |
| * | | | | shader: Fix floating point comparison for FP16FernandoS272021-07-235-32/+56
| | | | | |
| * | | | | shader: Implement HSETP2FernandoS272021-07-233-12/+117
| | | | | |
| * | | | | shader: Implement HSET2FernandoS272021-07-235-14/+119
| | | | | |
| * | | | | shader: Implement HMUL2FernandoS272021-07-233-16/+144
| | | | | |
| * | | | | shader: Implement HFMA2FernandoS272021-07-235-20/+192
| | | | | |
| * | | | | spirv: Implement VertexId and InstanceId, refactor codeReinUsesLisp2021-07-2310-144/+244
| | | | | |
| * | | | | shader: Refactor half floating instructionsFernandoS272021-07-234-58/+84
| | | | | |
| * | | | | shader: Implement I2FReinUsesLisp2021-07-2317-70/+429
| | | | | |
| * | | | | shader: Implement ISCADD (imm)ReinUsesLisp2021-07-231-2/+2
| | | | | |
| * | | | | shader: Implement LOP32IReinUsesLisp2021-07-232-18/+45
| | | | | |
| * | | | | shader: Add partial rasterizer integrationReinUsesLisp2021-07-2354-566/+1927
| | | | | |
| * | | | | shader: Implement DADDameerj2021-07-238-14/+132
| | | | | |
| * | | | | shader: Implement CSET and CSETPameerj2021-07-236-15/+114
| | | | | |
| * | | | | shader: Reorder phi nodes when redefined as undefined opcodesReinUsesLisp2021-07-231-1/+9
| | | | | |
| * | | | | shader: Fix instruction transitions in and out of PhiReinUsesLisp2021-07-231-9/+11
| | | | | |
| * | | | | shader: Implement FSET and FSETPameerj2021-07-239-94/+204
| | | | | | | | | | | | | | | | | | | | | | | | Also fix oversight with adding SignedZeroInfNanPreserve execution mode.
| * | | | | shader: Implement TEXSReinUsesLisp2021-07-238-7/+287
| | | | | |
| * | | | | shader: Implement CAL inlining function callsReinUsesLisp2021-07-2324-330/+286
| | | | | |
| * | | | | spirv: Add SignedZeroInfNanPreserve logicameerj2021-07-233-0/+12
| | | | | |
| * | | | | shader: Implement FMNMXameerj2021-07-238-25/+101
| | | | | | | | | | | | | | | | | | | | | | | | And add a const in FCMP
| * | | | | shader: Fix rebase issueReinUsesLisp2021-07-231-1/+0
| | | | | |
| * | | | | shader: Implement FCMPameerj2021-07-239-50/+203
| | | | | | | | | | | | | | | | | | | | | | | | still need to configure some settings for NV denorm flush and intel NaN
| * | | | | shader: Partial implementation of LDCReinUsesLisp2021-07-2316-50/+405
| | | | | |
| * | | | | shader: Initial support for textures and TEXReinUsesLisp2021-07-2333-342/+1489
| | | | | |
| * | | | | shader: Implement R2Pameerj2021-07-238-15/+88
| | | | | |
| * | | | | shader: Implement SHFameerj2021-07-238-31/+119
| | | | | |
| * | | | | shader: Implement LEAameerj2021-07-239-29/+136
| | | | | |
| * | | | | shader: Deduplicate HADD2 codeReinUsesLisp2021-07-231-19/+16
| | | | | |
| * | | | | shader: Implement I2Iameerj2021-07-233-12/+100
| | | | | |
| * | | | | shader: Implement HADD2ReinUsesLisp2021-07-2312-42/+400
| | | | | |
| * | | | | shader: Implement LOP and LOP3ameerj2021-07-238-31/+227
| | | | | |
| * | | | | shader: Implement IADD3ameerj2021-07-233-12/+104
| | | | | |
| * | | | | shader: Implement PSETPameerj2021-07-234-5/+40
| | | | | |
| * | | | | Implement PSET, refactor common comparison funcsameerj2021-07-239-101/+88
| | | | | |
| * | | | | shader: Implement FLOameerj2021-07-238-18/+75
| | | | | |
| * | | | | shader: Implement ISET, add common_funcsameerj2021-07-238-50/+150
| | | | | |
| * | | | | shader: Make IMNMX, SHR, SEL stylistically more consistentameerj2021-07-233-5/+5
| | | | | |
| * | | | | shader: Implement ICMPameerj2021-07-233-16/+84
| | | | | |
| * | | | | shader: Implement IMNMXameerj2021-07-238-12/+105
| | | | | |
| * | | | | shader: Implement BFIameerj2021-07-233-16/+57
| | | | | |
| * | | | | shader: Implement BFEameerj2021-07-233-12/+67
| | | | | |
| * | | | | shader: Implement POPCameerj2021-07-238-12/+59
| | | | | |
| * | | | | shader: Implement SHRameerj2021-07-238-18/+80
| | | | | |
| * | | | | shader: Implement SELameerj2021-07-234-16/+53
| | | | | |
| * | | | | spirv: Move phi arguments emit to a separate functionReinUsesLisp2021-07-231-27/+27
| | | | | |
| * | | | | shader: Avoid infinite recursion when tracking global memoryReinUsesLisp2021-07-231-5/+26
| | | | | |
| * | | | | shader: Fix conditional execution of exit instructionsReinUsesLisp2021-07-232-5/+6
| | | | | |
| * | | | | spirv: Add support for self-referencing phi nodesReinUsesLisp2021-07-231-3/+10
| | | | | |
| * | | | | shader: Fix control flowReinUsesLisp2021-07-238-20/+39
| | | | | |
| * | | | | shader: Implement more of XMAD and FFMA32I and fix XMAD.CBCCReinUsesLisp2021-07-235-28/+76
| | | | | |
| * | | | | shader: FMUL, select, RRO, and MUFU fixesReinUsesLisp2021-07-2318-119/+507
| | | | | |
| * | | | | shader: Fix MOV(reg), add SHL variants and emit neg and abs instructionsReinUsesLisp2021-07-234-11/+11
| | | | | |
| * | | | | spirv: Fixes and Intel specific workaroundsReinUsesLisp2021-07-2311-32/+44
| | | | | |
| * | | | | shader: Rename, implement FADD.SAT and P2R (imm)ReinUsesLisp2021-07-2318-127/+213
| | | | | |
| * | | | | shader: Add denorm flush supportReinUsesLisp2021-07-2320-93/+260
| | | | | |
| * | | | | spirv: Add lower fp16 to fp32 passReinUsesLisp2021-07-2332-285/+479
| | | | | |
| * | | | | shader: Primitive Vulkan integrationReinUsesLisp2021-07-2343-3036/+1003
| | | | | |
| * | | | | shader: Remove old shader managementReinUsesLisp2021-07-2383-19623/+55
| | | | | |
| * | | | | shader: Add XMAD multiplication folding optimizationReinUsesLisp2021-07-231-5/+77
| | | | | |
| * | | | | shader: Simplify ISCADDReinUsesLisp2021-07-231-6/+1
| | | | | |
| * | | | | shader: Add utility to resolve identities on a valueReinUsesLisp2021-07-232-0/+8
| | | | | |
| * | | | | spirv: Implement EmitIdentityReinUsesLisp2021-07-232-3/+3
| | | | | |
| * | | | | spirv: Initial bindings supportReinUsesLisp2021-07-2323-292/+671
| | | | | |
| * | | | | shader: Improve object poolReinUsesLisp2021-07-233-50/+66
| | | | | |
| * | | | | shader: Fix trackingReinUsesLisp2021-07-231-50/+72
| | | | | |
| * | | | | shader: Add support for forward declarationsReinUsesLisp2021-07-2311-68/+79
| | | | | |
| * | | | | shader: Support SSA loops on IRReinUsesLisp2021-07-2312-46/+150
| | | | | |
| * | | | | shader: Misc fixesReinUsesLisp2021-07-2310-89/+104
| | | | | |
| * | | | | shader: Initial implementation of an ASTReinUsesLisp2021-07-2333-589/+1345
| | | | | |
| * | | | | spirv: Initial SPIR-V supportReinUsesLisp2021-07-2321-3299/+1400
| | | | | |
| * | | | | shader: Better constant foldingReinUsesLisp2021-07-232-13/+48
| | | | | |
| * | | | | shader: Properly store phi on InstReinUsesLisp2021-07-236-75/+132
| | | | | |
| * | | | | shader: Add pools and rename filesReinUsesLisp2021-07-2330-108/+255
| | | | | |
| * | | | | shader: Make typed IRReinUsesLisp2021-07-2319-269/+495
| | | | | |
| * | | | | shader: Remove illegal character in SSA passReinUsesLisp2021-07-231-1/+1
| | | | | |
| * | | | | shader: Constant propagation and global memory to storage bufferReinUsesLisp2021-07-2317-63/+652
| | | | | |
| * | | | | shader: Initial instruction supportReinUsesLisp2021-07-2328-334/+1450
| | | | | |
| * | | | | shader: SSA and dominanceReinUsesLisp2021-07-2324-77/+570
| | | | | |
| * | | | | shader: Initial recompiler workReinUsesLisp2021-07-2357-0/+7061
| | | | | |
| * | | | | thread_worker: Fix compile time errorameerj2021-07-231-1/+1
| | |/ / / | |/| | | | | | | | | | | | | state is unused in the branch where with_state is false
* | | | | Merge pull request #6699 from lat9nq/common-threadsbunnei2021-07-251-1/+1
|\ \ \ \ \ | | | | | | | | | | | | common: Publically link to pthreads
| * | | | | common: Publically link to pthreadslat9nq2021-07-231-1/+1
| |/ / / / | | | | | | | | | | | | | | | | | | | | Common requires pthreads but does not refer to it when linking to other modules. Fix this by linking to Threads where necessary.
* | | | | Merge pull request #6706 from FernandoS27/skyline-love-letterFernando S2021-07-251-2/+4
|\ \ \ \ \ | | | | | | | | | | | | Grant a partial license exception to Skyline Emulator.
| * | | | | Grant a license exception to Skyline Emulator.Fernando Sahmkow2021-07-251-2/+4
|/ / / / /
* | | | | Merge pull request #6690 from ReinUsesLisp/dma-clear-fixupsbunnei2021-07-242-7/+3
|\ \ \ \ \ | | | | | | | | | | | | buffer_cache: Misc fixups related to buffer clears
| * | | | | gl_buffer_cache: Use glClearNamedBufferSubData:GL_RED instead of GL_RGBAReinUsesLisp2021-07-201-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | Avoids reading out of bounds from the stack.
| * | | | | buffer_cache: Simplify clear logicReinUsesLisp2021-07-201-6/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Use existing helper functions and avoid looping when only one buffer has to be active.
* | | | | | Merge pull request #6551 from bunnei/improve-kernel-objbunnei2021-07-2421-88/+327
|\ \ \ \ \ \ | |_|/ / / / |/| | | | | Improve management of kernel objects
| * | | | | hle: service: kernel_helpers: Remove unnecessary pragma once.bunnei2021-07-211-2/+0
| | | | | |
| * | | | | hle: kernel: svc: Remove part of ExitProcess.bunnei2021-07-211-5/+0
| | | | | | | | | | | | | | | | | | | | | | | | - ExitProcess is not actually implemented either way, and this needs more work before we implement.
| * | | | | hle: service: nvdrv: Remove unused kernel reference.bunnei2021-07-211-1/+0
| | | | | |
| * | | | | hle: service: hid: npad: Remove unused kernel reference.bunnei2021-07-211-1/+0
| | | | | |
| * | | | | hle: kernel: Track and release server sessions, and protect methods with locks.bunnei2021-07-214-13/+82
| | | | | |
| * | | | | hle: kernel: KProcess: Change process termination assert to a warning.bunnei2021-07-211-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | - Since we do not implement multiprocess right now, this should not be a crashing assert.
| * | | | | hle: kernel: Ensure current running process is closed.bunnei2021-07-211-5/+6
| | | | | |
| * | | | | hle: kernel: Ensure global handle table is finalized before closing.bunnei2021-07-211-0/+1
| | | | | |
| * | | | | kernel: svc: ConnectToNamedPort: Close extra reference to port.bunnei2021-07-211-0/+1
| | | | | |
| * | | | | hle: service: sm: Refactor to better manage ports.bunnei2021-07-214-45/+47
| | | | | |
| * | | | | hle: kernel: k_process: Close the handle table on shutdown.bunnei2021-07-211-0/+3
| | | | | |
| * | | | | hle: kernel: k_process: Close main thread reference after it is inserted into handle table.bunnei2021-07-211-0/+3
| | | | | |
| * | | | | hle: kernel: Ensure global handle table is initialized.bunnei2021-07-211-0/+1
| | | | | |
| * | | | | hle: service: Add a helper module for managing kernel objects.bunnei2021-07-2110-20/+146
| | | | | |
| * | | | | hle: kernel: Provide methods for tracking dangling kernel objects.bunnei2021-07-214-2/+43
| | | | | |
* | | | | | Merge pull request #6686 from ReinUsesLisp/vk-optimal-copybunnei2021-07-221-21/+35
|\ \ \ \ \ \ | | | | | | | | | | | | | | vk_texture_cache: Use VK_IMAGE_LAYOUT_TRANSFER_SRC_OPTIMAL when possible
| * | | | | | vk_texture_cache: Use VK_IMAGE_LAYOUT_TRANSFER_SRC_OPTIMAL when possibleReinUsesLisp2021-07-201-21/+35
| | | | | | | | | | | | | | | | | | | | | | | | | | | | Silences performance warnings generated from validation layers on each frame.
* | | | | | | Merge pull request #6693 from lat9nq/cmd-fullscreen-mode-2Morph2021-07-223-15/+34
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | yuzu_cmd: Make use of fullscreen_mode setting
| * | | | | | | yuzu_cmd: Make use of fullscreen_mode settinglat9nq2021-07-223-15/+34
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Reverts 48259de0c1a6a1aca77eec31cb8aca5ca2b680dd to the previous hierarchy and fixes the resolution issue with this fullscreen mode. yuzu-cmd will now read the fullscreen_mode setting and use it appropriately.
* | | | | | | | Merge pull request #6654 from german77/custom_thresholdbunnei2021-07-223-3/+91
|\ \ \ \ \ \ \ \ | |/ / / / / / / |/| | | | | | | input_common: Make button threshold customizable
| * | | | | | | configure/ui: Add sliders for trigger buttonsgerman772021-07-172-0/+78
| | | | | | | |
| * | | | | | | input_common: Make button threshold customizablegerman772021-07-162-3/+13
| | | | | | | |
* | | | | | | | ci: Increase mainline build timeout.bunnei2021-07-211-1/+3
| | | | | | | | | | | | | | | | | | | | | | | | - We're currently timing out with builds exceeding 60M. This doubles the timeout to 120M.
* | | | | | | | yuzu-cmd: Fullscreen Improvements (#6656)san2021-07-214-9/+13
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * emu_window_sdl2_vk: Use the generated SDL config On Linux, due to the way we include SDL2 as a submodule, it makes it difficult for us to specify which SDL_config.h we intended to include. Before, CMake would default to the dummy one included with SDL and ignore the generated one. This tells CMake to use the generated one. In addition, we define USING_GENERATED_CONFIG_H to throw an error in case the dummy config is used by accident. Fixes Vulkan not working on Linux yuzu-cmd. * emu_window_sdl2_vk: Specify the window manager if it should be supported The original language "not implemented" is wrong if the implementation exists but is not compiled. This causes a bit of a debugging headache when it goes wrong. Log it if the window manager is known before exiting. * sdl_impl, emu_window: Remove clang ignore Fixed upstream by libsdl-org/SDL@25fc40b0bd44c484051064bc6b945ea9943f88dd * Enable fullscreen support for Vulkan on yuzu-cmd Hooked up the existing SDL2 logic for fullscreen support in the Vulkan window of yuzu-cmd. * Change fullscreen logic to attempt desktop resolution first on yuzu-cmd Changed the order in which we attempt to switch to fullscreen. First try desktop resolution first, if it fails fall back to streched fullscreen using windowed resolution. Co-authored-by: lat9nq <22451773+lat9nq@users.noreply.github.com> Co-authored-by: san <san+gitkraken@smederijmerlijn.nl>
* | | | | | | | Merge pull request #6660 from Morph1984/controller_applet_rev8bunnei2021-07-212-3/+33
|\ \ \ \ \ \ \ \ | |_|_|/ / / / / |/| | | | | | | applet_controller: Add preliminary support for version 8
| * | | | | | | applet_controller: Add preliminary support for version 8Morph2021-07-202-3/+33
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Version 8 adds support for key remapping introduced in FW 11.0, we will not be implementing this for now.
* | | | | | | | Merge pull request #6649 from german77/toggle_sdlbunnei2021-07-212-5/+53
|\ \ \ \ \ \ \ \ | |_|_|_|/ / / / |/| | | | | | | input_common: Support SDL toggle buttons
| * | | | | | | input_common: Support SDL toggle buttonsgerman772021-07-152-5/+53
| | | | | | | |
* | | | | | | | Merge pull request #6629 from FernandoS27/accel-dma-2bunnei2021-07-2011-12/+136
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | DMAEngine: Accelerate BufferClear [accelerateDMA Part 2]
| * | | | | | | | Buffer cache: Fixes, Clang and Feedback.Fernando Sahmkow2021-07-153-11/+10
| | | | | | | | |
| * | | | | | | | GPUMemoryManager: Force inmediate invalidation when writting block.Fernando Sahmkow2021-07-141-1/+1
| | | | | | | | |
| * | | | | | | | Buffer Cache: Fixes to DMA Copy.Fernando Sahmkow2021-07-141-6/+7
| | | | | | | | |
| * | | | | | | | DMAEngine: Revert flushing from Pitch to BlpockLinear.Fernando Sahmkow2021-07-141-2/+7
| | | | | | | | |
| * | | | | | | | BufferCache: fix clearing on forced download.Fernando Sahmkow2021-07-141-10/+20
| | | | | | | | |
| * | | | | | | | DMAEngine: Accelerate BufferClearFernando Sahmkow2021-07-1311-6/+115
| | | | | | | | |
* | | | | | | | | Merge pull request #6658 from Morph1984/render-window-fixbunnei2021-07-201-0/+6
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | bootmanager: Create a dummy render widget
| * | | | | | | | | bootmanager: Create a dummy render widgetMorph2021-07-201-0/+6
| | |_|/ / / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | This ensures that Qt positions the render window at the correct position on initializing the respective render backends.
* | | | | | | | | Merge pull request #6685 from ReinUsesLisp/radeonsi-clientFernando S2021-07-201-1/+1
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | gl_texture_cache: Workaround slow PBO downloads on radeonsi
| * | | | | | | | | gl_texture_cache: Workaround slow PBO downloads on radeonsiReinUsesLisp2021-07-201-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | There's an optimization bug on non-git mesa versions where not specifying GL_CLIENT_STORAGE_BIT causes very slow reads on the CPU side. Add this bit for all vendors.
* | | | | | | | | | Merge pull request #6684 from ogniK5377/uuid-cpp20-newMorph2021-07-201-3/+2
|\ \ \ \ \ \ \ \ \ \ | |_|_|_|_|_|/ / / / |/| | | | | | | | | uuid: Directly compare UUID instead of checking per element
| * | | | | | | | | uuid: Directly compare UUID instead of checking per elementChloe Marcec2021-07-201-3/+2
|/ / / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | We can now update this for C++20
* | | | | | | | | vk_buffer_cache: Fix quad index array with 0 vertices (#6627)Fernando S2021-07-201-0/+7
| | | | | | | | |
* | | | | | | | | input/sdl_impl: fix rumble support on DualSense. (#6683)Nicolas Jallamion2021-07-201-2/+2
| |/ / / / / / / |/| | | | | | | | | | | | | | | - value return can be different 0, is not error is normal, error is only -1.
* | | | | | | | file_sys: Support load game collection (#6582)Feng Chen2021-07-2017-108/+171
|/ / / / / / / | | | | | | | | | | | | | | Adds support for loading games with multiple programs embedded within such as the Dragon Quest 1+2+3 Collection
* | | | | | | Merge pull request #6580 from ReinUsesLisp/xfb-radvRodrigo Locatti2021-07-202-11/+19
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | vk_buffer_cache: Use emulated null buffers for transform feedback
| * | | | | | | vk_buffer_cache: Use emulated null buffers for transform feedbackReinUsesLisp2021-07-092-11/+19
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Vulkan does not support null buffers on transform feedback bindings. Emulate these using the same null buffer we were using for index buffers.
* | | | | | | | Merge pull request #6652 from lat9nq/cmd-vulkan-fixesbunnei2021-07-207-51/+38
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | yuzu-cmd: Linux Vulkan fixes
| * | | | | | | | sdl_impl, emu_window: Remove clang ignorelat9nq2021-07-164-33/+0
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Fixed upstream by libsdl-org/SDL@25fc40b0bd44c484051064bc6b945ea9943f88dd
| * | | | | | | | emu_window_sdl2_vk: Specify the window manager if it should be supportedlat9nq2021-07-161-0/+15
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The original language "not implemented" is wrong if the implementation exists but is not compiled. This causes a bit of a debugging headache when it goes wrong. Log it if the window manager is known before exiting.
| * | | | | | | | emu_window_sdl2_vk: Use the generated SDL configlat9nq2021-07-164-19/+24
| | |_|_|/ / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | On Linux, due to the way we include SDL2 as a submodule, it makes it difficult for us to specify which SDL_config.h we intended to include. Before, CMake would default to the dummy one included with SDL and ignore the generated one. This tells CMake to use the generated one. In addition, we define USING_GENERATED_CONFIG_H to throw an error in case the dummy config is used by accident. Fixes Vulkan not working on Linux yuzu-cmd.
* | | | | | | | Merge pull request #6651 from lat9nq/update-settingsbunnei2021-07-192-59/+107
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | yuzu-cmd: Update settings
| * | | | | | | | yuzu_cmd: Add missing or update current settingslat9nq2021-07-162-4/+112
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Many settings in common/settings.h are missing from yuzu-cmd, either they were added to default_ini.h but not read in, or vice versa, or the setting was altogether omitted from yuzu-cmd. Some defaults were reported wrong, so those were fixed where noticed.
| * | | | | | | | default_ini: Remove deprecated settingslat9nq2021-07-161-61/+1
| |/ / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | These settings are not being read in config.cpp AND they do not exist in common/settings.h. Remove their references.
* | | | | | | | Merge pull request #6679 from yzct12345/fix-lets-goFernando S2021-07-191-1/+4
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | Fix Pokemon Let's Go on Vulkan
| * | | | | | | | Update src/video_core/renderer_vulkan/vk_texture_cache.cppyzct123452021-07-191-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | Co-authored-by: Vitor K <vitor-kiguchi@hotmail.com>
| * | | | | | | | Update src/video_core/renderer_vulkan/vk_texture_cache.cppyzct123452021-07-191-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | Co-authored-by: Vitor K <vitor-kiguchi@hotmail.com>
| * | | | | | | | Ignore wrong blit formatyzct123452021-07-181-1/+4
| | | | | | | | |
* | | | | | | | | Merge pull request #6670 from ReinUsesLisp/prepare-rtFernando S2021-07-191-0/+6
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | texture_cache: Always prepare image views on render targets
| * | | | | | | | | texture_cache: Always prepare image views on render targetsReinUsesLisp2021-07-181-0/+6
| |/ / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Images used as render targets were not being "prepared", causing desynchronizations on the texture cache. Needs #6669 to avoid performance regressions on certain cooking titles. - Fixes black shadows on Age of Calamity.
* | | | | | | | | Merge pull request #6669 from ReinUsesLisp/fix-samples-sizesFernando S2021-07-191-53/+33
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | texture_cache/util: Fix size calculations of multisampled images
| * | | | | | | | | texture_cache/util: Fix size calculations of multisampled imagesReinUsesLisp2021-07-181-53/+33
| |/ / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | On the texture cache we handle multisampled images by keeping their real size in samples (e.g. 1920x1080 with 4 samples is 3840x2160). This works nicely with size matches and other comparisons, but the calculation for guest sizes was not having this in mind, and the size was being multiplied (again) by the number of samples per dimension. For example a 3840x2160 texture cache image had its width and height multiplied by 2, resulting in a much larger texture. Fix this issue. - Fixes performance regression on cooking related titles when an unrelated bug was fixed.
* | | | | | | | | Merge pull request #6677 from ReinUsesLisp/new-validate-errorsAmeer J2021-07-192-16/+18
|\ \ \ \ \ \ \ \ \ | |/ / / / / / / / |/| | | | | | | | vulkan: Fix misc validation and synchronization errors
| * | | | | | | | vk_texture_cache: Finalize renderpass when downloading imagesReinUsesLisp2021-07-181-0/+1
| | | | | | | | |
| * | | | | | | | vk_compute_pass: Fix pipeline barriers on non-initialized ASTC imagesReinUsesLisp2021-07-181-2/+3
| | | | | | | | |
| * | | | | | | | vk_compute_pass: Fix ASTC buffer setup synchronizationReinUsesLisp2021-07-181-14/+14
|/ / / / / / / /
* | | | | | | | Merge pull request #6647 from lat9nq/specify-system-pathbunnei2021-07-181-2/+8
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | cmake: Be more specific with Qt
| * | | | | | | | cmake: Only search for Qt when we need tolat9nq2021-07-161-1/+3
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | When YUZU_USE_BUNDLED_QT was specified on a system with a compliant Qt version installed, CMake configuration would cause an error due to mixing YUZU_USE_BUNDLED_QT with the system Qt. Solution is to only search for Qt when YUZU_USE_BUNDLED_QT is disabled.
| * | | | | | | | cmake: Only use NO_CMAKE_SYSTEM_PATH when needed for Qtlat9nq2021-07-161-1/+5
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | As-is causes issues with building yuzu using MinGW GCC on Linux-based machines. Only set the variable when needed. (I'm not quite sure how this was working before.)
* | | | | | | | | Merge pull request #6659 from german77/mouse_panningAmeer J2021-07-173-5/+8
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | input_common: Fix mouse panning behaivour
| * | | | | | | | | input_common: Fix mouse panning behaivourgerman772021-07-173-5/+8
| | |/ / / / / / / | |/| | | | | | |
* | | | | | | | | Merge pull request #6657 from Morph1984/settings-fixesAmeer J2021-07-161-6/+6
|\ \ \ \ \ \ \ \ \ | |/ / / / / / / / |/| | | | | | | | configure_audio: Fix volume clamping to 0
| * | | | | | | | configure_audio: Fix volume clamping to 0Morph2021-07-161-6/+6
|/ / / / / / / /
* | | | | | | | Merge pull request #6579 from ameerj/float-settingsbunnei2021-07-1611-69/+39
|\ \ \ \ \ \ \ \ | |_|_|_|/ / / / |/| | | | | | | settings: Eliminate usage of float-point setting values
| * | | | | | | configure_input: Use u8 for mouse sensitivityameerj2021-07-093-11/+8
| | | | | | | |
| * | | | | | | config: Remove float {Read,Write}Setting variantsameerj2021-07-092-29/+2
| | | | | | | |
| * | | | | | | configure_graphics: Use u8 for bg_color valuesameerj2021-07-095-19/+20
| | | | | | | |
| * | | | | | | configure_audio: Use u8 for volume valueameerj2021-07-094-10/+9
| | |_|_|/ / / | |/| | | | |
* | | | | | | Merge pull request #6635 from ameerj/intel-vk-sm3dwFernando S2021-07-151-2/+4
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | vk_rasterizer: Only clear valid color attachments
| * | | | | | | vk_rasterizer: Only clear valid color attachmentsameerj2021-07-131-2/+4
| | | | | | | |
* | | | | | | | Merge pull request #6525 from ameerj/nvdec-fixesFernando S2021-07-152-56/+50
|\ \ \ \ \ \ \ \ | |_|_|/ / / / / |/| | | | | | | nvdec: Fix Submit Ioctl data source, vic frame dimension computations
| * | | | | | | vic: Fix dimension compuation of YUV framesameerj2021-07-151-11/+10
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Fixes out of bound memory crashes in Mario Golf
| * | | | | | | nvhost_nvdec_common: Read Submit ioctl data from object addrameerj2021-07-151-8/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Fixes Mario Golf intro video decoding.
| * | | | | | | nvhost_nvdec_common: Fix {Slice/Write}Vectors returnameerj2021-07-151-37/+38
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Plus some minor cleanup for consistency.
* | | | | | | | Merge pull request #6641 from Morph1984/web_browser_urlsMai M2021-07-151-0/+13
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | applets/web: Resolve Nintendo CDN URLs
| * | | | | | | | applets/web: Resolve Nintendo CDN URLsMorph2021-07-151-0/+13
|/ / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | This fixes the hint videos in New Super Mario Bros. U Deluxe
* | | | | | | | Merge pull request #6639 from Morph1984/optimize-linkerMai M2021-07-1573-114/+115
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | general: Reduce compile time / linker usage on MSVC
| * | | | | | | | service: Append service name prefix to common filenamesMorph2021-07-1441-56/+56
| | | | | | | | |
| * | | | | | | | applets: Append applet_ prefix to backend appletsMorph2021-07-1419-33/+33
| | | | | | | | |
| * | | | | | | | applets: Append qt_ prefix to Qt frontend appletsMorph2021-07-1415-25/+26
|/ / / / / / / /
* | | | | | | | Merge pull request #6599 from german77/disable_rumbleAmeer J2021-07-131-0/+5
|\ \ \ \ \ \ \ \ | |_|/ / / / / / |/| | | | | | | npad: Disable vibration check if disabled
| * | | | | | | npad: Disable vibration check if disabledgerman772021-07-111-0/+5
| | | | | | | |
* | | | | | | | Merge pull request #6574 from lioncash/i18nbunnei2021-07-131-2/+4
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | qt/main: Make title string more i18n-friendly
| * | | | | | | | qt/main: Make title string more i18n-friendlyLioncash2021-07-081-2/+4
| | |_|/ / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Currently, whether or not the title is 32-bit or 64-bit was being appended as a suffix to the title, which is fine for left-to-right languages, but may not always fly so smoothly with some right-to-left languages. We also weren't marking that portion of the string as translatable, which prevents translators from translating part of the title string.
* | | | | | | | Merge pull request #6593 from german77/no_sdlbunnei2021-07-131-2/+2
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | input_common: Fix build with SDL disabled
| * | | | | | | | input_common: Fix build with sdl disabledgerman772021-07-111-2/+2
| | |/ / / / / / | |/| | | | | |
* | | | | | | | Merge pull request #6615 from ReinUsesLisp/httplib-debug-warningsbunnei2021-07-132-0/+13
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | boxcat,web_service: Silence -Wmaybe-uninitialized when including httplib.h
| * | | | | | | | web_service: Silence -Wmaybe-uninitialized on httplib.hReinUsesLisp2021-07-121-0/+10
| | | | | | | | |
| * | | | | | | | boxcat: Silence -Wmaybe-uninitialized in httplib.hReinUsesLisp2021-07-121-0/+3
| | | | | | | | |
* | | | | | | | | Merge pull request #6618 from ReinUsesLisp/bad-rangesbunnei2021-07-131-1/+0
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | content_archive: Remove unnecessary include to <ranges>
| * | | | | | | | | content_archive: Remove unnecessary include to <ranges>ReinUsesLisp2021-07-121-1/+0
| |/ / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | Fixes build issues on clang.
* | | | | | | | | Merge pull request #6571 from Kelebek1/Mixbunnei2021-07-131-0/+9
|\ \ \ \ \ \ \ \ \ | |_|_|_|_|_|/ / / |/| | | | | | | | audio_core: Replace NaN mix volume samples with silence
| * | | | | | | | Replace NaN mix volume samples with silence.Kelebek12021-07-081-0/+9
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Fixes Xenoblade Chronicles 2 blowing out the audio.
* | | | | | | | | Merge pull request #6597 from FernandoS27/accelerate-dmaAmeer J2021-07-129-62/+199
|\ \ \ \ \ \ \ \ \ | |_|/ / / / / / / |/| | | | | | | | DMAEngine: Introduce Accelerate DMA.
| * | | | | | | | accelerateDMA: Fixes and feedback.Fernando Sahmkow2021-07-123-88/+62
| | | | | | | | |
| * | | | | | | | accelerateDMA: Accelerate Buffer Copies.Fernando Sahmkow2021-07-119-13/+176
| | | | | | | | |
* | | | | | | | | Merge pull request #6577 from ReinUsesLisp/precommitAmeer J2021-07-111-3/+4
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | cmake: Only copy pre-commit hook if .git directory exists
| * | | | | | | | | cmake: Only copy pre-commit hook if .git directory existsReinUsesLisp2021-07-091-3/+4
| | |_|_|/ / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | Allow the usage of git worktrees on yuzu.
* | | | | | | | | Merge pull request #6576 from ameerj/unlock-fps-settingMorph2021-07-116-29/+10
|\ \ \ \ \ \ \ \ \ | |_|/ / / / / / / |/| | | | | | | | settings: Disable FPS unlimit setting between title launches
| * | | | | | | | settings: Disable FPS unlimit setting between title launchesameerj2021-07-106-29/+10
| |/ / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Some titles crash if the FPS limit is disabled when launching. This change ensures that titles launch with the limit in-place to avoid issues. In order to simplify the change, the UI toggle was removed as it will always be overridden at launch to be disabled. The setting can still be toggled during gameplay with the hotkey, and indicated by the fps label in the status bar.
* | | | | | | | Merge pull request #6557 from FernandoS27/staceys-mom-has-got-it-goin-onAmeer J2021-07-1012-78/+227
|\ \ \ \ \ \ \ \ | |_|_|/ / / / / |/| | | | | | | Buffer Cache: Fix High downloads / Fence manager: Improve fence checking.
| * | | | | | | Buffer Cache: Address Feedback.Fernando Sahmkow2021-07-103-5/+10
| | | | | | | |
| * | | | | | | Buffer Cache: Fix GCC copmpile errorFernando Sahmkow2021-07-091-1/+0
| | | | | | | |
| * | | | | | | Fence Manager: remove reference fencing.Fernando Sahmkow2021-07-093-31/+6
| | | | | | | |
| * | | | | | | BufferCache: Additional download fixes.Fernando Sahmkow2021-07-092-23/+107
| | | | | | | |
| * | | | | | | Buffer Cache: Revert unnecessary range reduction.Fernando Sahmkow2021-07-091-29/+13
| | | | | | | |
| * | | | | | | Fence Manager: Force ordering on WFI.Fernando Sahmkow2021-07-094-38/+71
| | | | | | | |
| * | | | | | | Buffer Cache: Eliminate the AC Hack as the base game is fixed in Hades.Fernando Sahmkow2021-07-091-14/+4
| | | | | | | |
| * | | | | | | Fence Manager: Add fences on Reference Count.Fernando Sahmkow2021-07-098-6/+57
| | | | | | | |
| * | | | | | | Videocore: Address Feedback & CLANG Format.Fernando Sahmkow2021-07-092-78/+75
| | | | | | | |
| * | | | | | | Buffer Cache: Fix High Downloads and don't predownload on Extreme.Fernando Sahmkow2021-07-094-92/+123
|/ / / / / / /
* | | | | | | Merge pull request #6573 from lat9nq/cpu-settings-cleanup-2Fernando S2021-07-0918-146/+289
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | core,common,yuzu qt: Add CPU accuracy option 'Auto'
| * | | | | | | settings, arm_dynarmic, yuzu qt: Move CPU debugging optionlat9nq2021-07-0818-132/+244
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Decouples the CPU debugging mode from the enumeration to its own boolean. After this, it moves the CPU Debugging tab over to a sub tab underneath the Debug tab in the configuration UI.
| * | | | | | | arm_dynarmic_64: Re-add fastmem_address_space_bits to Auto settinglat9nq2021-07-081-0/+1
| | | | | | | |
| * | | | | | | settings, yuzu qt: Add migration code for CPU accuracylat9nq2021-07-082-1/+10
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Old CPU Accuracy setting won't translate well into since we're adding one at the beginning of the list. On first boot with the new setting, just use the default setting.
| * | | | | | | arm_dynarmic{32,64}: Fixes from test buildlat9nq2021-07-082-18/+5
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Now sets optimizations regardless of the Settings. Drops unsafe fastmem optimization.
| * | | | | | | core,common,yuzu qt: Add CPU accuracy option 'Auto'lat9nq2021-07-084-16/+50
| |/ / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The current CPU accuracy settings in yuzu are fairly polarized and require more than common knowledge to know what the optimal settings for yuzu would be. This adds a curated option called 'Auto' that applies a few at the moment known-good unsafe optimizations to Dynarmic.
* | | | | | | Merge pull request #6581 from lat9nq/isolate-debug-settingsMorph2021-07-091-2/+8
|\ \ \ \ \ \ \ | |_|_|_|/ / / |/| | | | | | yuzu qt: config: Only save renderer_debug as a global setting
| * | | | | | yuzu qt: config: Only save renderer_debug as a global settinglat9nq2021-07-091-2/+8
|/ / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This is a bug fix. Enabling graphics debug mode, then saving a custom configuration causes graphics debugging to be saved and read from the custom configuration. Isolate it the same way we isolate the CPU settings.
* | | | | | Merge pull request #6563 from ReinUsesLisp/thread-workerAmeer J2021-07-096-67/+266
|\ \ \ \ \ \ | |/ / / / / |/| | | | | common: Add stateful thread worker and unique function utilities
| * | | | | common/thread_worker: Stop workers on stop_token when waitingReinUsesLisp2021-07-091-18/+20
| | | | | |
| * | | | | common/thread_worker: Add support for stateful threadsReinUsesLisp2021-07-093-78/+86
| | | | | |
| * | | | | common/thread_worker: Simplify logicFernandoS272021-07-091-8/+1
| | | | | |
| * | | | | common/thread_worker: Fix data raceFernandoS272021-07-092-1/+18
| | | | | |
| * | | | | common/thread_worker: Use unique functionReinUsesLisp2021-07-092-28/+24
| | | | | |
| * | | | | common: Add unique functionReinUsesLisp2021-07-094-0/+172
| | | | | |
| * | | | | common/thread_worker: Add wait for requests methodReinUsesLisp2021-07-092-0/+11
|/ / / / /
* | | | | Merge pull request #6539 from lat9nq/default-settingAmeer J2021-07-0839-790/+940
|\ \ \ \ \ | | | | | | | | | | | | general: Move most settings' defaults and labels into their definition
| * | | | | general: Code formatting improvementslat9nq2021-07-084-22/+25
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Slight improvements to readability. Dropped suggestions for string_view (settings.h:101), pass by value (settings.h:82), reverting double to a float (config.cpp:316), and other smaller ones, some out of scope. Addresses review feedback. Co-authored-by: Ameer J <52414509+ameerj@users.noreply.github.com>
| * | | | | config: Read UISettings as basic settingslat9nq2021-07-021-30/+19
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | I must have been asleep or something. These need to be read with the new ReadBasicSetting function.
| * | | | | settings: Set resolution_factor default to 1lat9nq2021-07-011-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | Fixes Disgaea 6 Demo issues.
| * | | | | yuzu_cmd: config: Pass a reference inlat9nq2021-07-012-5/+11
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Also adds documentation for the ReadSetting function. Address review comments. Co-authored-by: Mai M. <mathew1800@gmail.com>
| * | | | | core, input_common: Miscellaneous fixeslat9nq2021-06-293-5/+8
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | bcat: Fix settings access telemetry_session: Fix settings accesses So this is what I get for testing with the web service disabled. touch_from_button: Fix settings access for clang
| * | | | | yuzu qt: Make most UISettings a BasicSettinglat9nq2021-06-2912-91/+107
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | For simple primitive settings, moves their defaults and labels to definition time. Also fixes typo and clang-format yuzu qt: config: Fix rng_seed
| * | | | | general: Make most settings a BasicSettinglat9nq2021-06-2832-660/+807
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Creates a new BasicSettings class in common/settings, and forces setting a default and label for each setting that uses it in common/settings. Moves defaults and labels from both frontends into common settings. Creates a helper function in each frontend to facillitate reading the settings now with the new default and label properties. Settings::Setting is also now a subclass of Settings::BasicSetting. Also adds documentation for both Setting and BasicSetting.
| * | | | | configuration: Defer to common/settings for per-game settings defaultslat9nq2021-06-262-127/+100
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Avoids double-setting defaults, and avoids potential accidents when inconsistently setting the default on new settings.
| * | | | | common: Force defaults for Settings::Setting'slat9nq2021-06-261-44/+57
| | | | | | | | | | | | | | | | | | | | | | | | Requires a default value when creating each per-game setting.
* | | | | | Out of bound blit (#6531)Feng Chen2021-07-082-58/+35
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * Fix out of bound blit error * Fix code read * Fix ci error Co-authored-by: Feng Chen <chen.feng@gloritysolutions.com>
* | | | | | Merge pull request #6564 from Kelebek1/AudioMorph2021-07-082-18/+51
|\ \ \ \ \ \ | |_|/ / / / |/| | | | | Support more PCM formats
| * | | | | Support more PCM formats. Fixes Ys IX audio.Kelebek12021-07-062-18/+51
| | | | | |
* | | | | | Merge pull request #6569 from Kelebek1/VolMorph2021-07-085-75/+81
|\ \ \ \ \ \ | | | | | | | | | | | | | | audio_core: Preserve front channel volume after 6 to 2 downmix
| * | | | | | audio_core: Preserve front channel volume after 6 to 2 downmixKelebek12021-07-085-75/+81
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Many games report 6 channel output while only providing data for 2. We only output 2-channel audio regardless, and in the downmixing, front left/right only provide 36% of their volume. This is done assuming all of the other channels also contain valid data, but in many games they don't. This PR alters the downmixing to preserve front left/right, so volume is not lost. This improves volume in Link's Awakening, New Super Mario Bros U, Disgaea 6, Super Kirby Clash.
* | | | | | | Merge pull request #6567 from Kelebek1/Audio2bunnei2021-07-071-1/+1
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | [audren] Report 2 channels active rather than 1
| * | | | | | | Report 2 channels active. Fixes Tales of Vesperia's mono channel audio.Kelebek12021-07-061-1/+1
| | |/ / / / / | |/| | | | |
* | | | | | | Merge pull request #6570 from lat9nq/bind-image-trueRodrigo Locatti2021-07-071-2/+2
|\ \ \ \ \ \ \ | |_|/ / / / / |/| | | | | | util_shaders: Fix BindImageTexture
| * | | | | | util_shaders: Fix BindImageTexturelat9nq2021-07-071-2/+2
|/ / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | According to https://gitlab.freedesktop.org/mesa/mesa/-/issues/3820#note_753371 we need to set these to true for use with 3D textures. Fixes BOTW teleporting on RadeonSI and iris.
* | | | | | Merge pull request #6562 from Morph1984/flush-behaviorbunnei2021-07-073-11/+48
|\ \ \ \ \ \ | | | | | | | | | | | | | | common: fs: More misc. changes
| * | | | | | common: logging: backend: Close the file after exceeding the write limitMorph2021-07-061-8/+11
| | | | | | | | | | | | | | | | | | | | | | | | | | | | There's no point in keeping the file open after the write limit is exceeded. This allows the file to be committed to the disk shortly after it is closed and avoids redundantly checking whether or not the write limit is exceeded.
| * | | | | | common: fs: file: Revert Flush to its previous behavior and add CommitMorph2021-07-062-3/+34
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | It became apparent that logging can continuously spam errors that trigger file flushing. Since committing the files to disk is an expensive operation, this causes unnecessarily high disk usage. As such, we will revert Flush() to the previous behavior and add a Commit() member function in the event that this behavior is needed.
| * | | | | | common: fs: file: Flush the file in GetSizeMorph2021-07-061-0/+3
| |/ / / / / | | | | | | | | | | | | | | | | | | This ensures that GetSize always retrieves the correct file size after a write operation.
* | | | | | Merge pull request #6497 from FernandoS27/scotty-doesnt-knowbunnei2021-07-0713-59/+581
|\ \ \ \ \ \ | | | | | | | | | | | | | | GPU Memory Manager - Correct handling of non continuous backing memory.
| * | | | | | Texture Cache: Fix collision with multiple overlaps of the same sparse texture.Fernando Sahmkow2021-07-041-1/+6
| | | | | | |
| * | | | | | Texture Cache: Fix GCC & Clang.Fernando Sahmkow2021-07-042-11/+11
| | | | | | |
| * | | | | | Texture Cache: Address feedback.Fernando Sahmkow2021-07-045-18/+37
| | | | | | |
| * | | | | | Texture Cache: Improve accuracy of sparse texture detection.Fernando Sahmkow2021-07-046-131/+342
| | | | | | |
| * | | | | | Texture Cache: Initial Implementation of Sparse Textures.Fernando Sahmkow2021-07-0412-23/+310
| | | | | | |
* | | | | | | Merge pull request #6566 from Morph1984/sign-compare-as-errorbunnei2021-07-064-8/+1
|\ \ \ \ \ \ \ | |_|/ / / / / |/| | | | | | CMakeLists: Treat -Wsign-compare as an error on GCC/Clang
| * | | | | | CMakeLists: Treat -Wsign-compare as an error on GCC/ClangMorph2021-07-064-8/+1
|/ / / / / / | | | | | | | | | | | | | | | | | | Treats (un)signed comparison mismatches as errors to be consistent with MSVC
* | | | | | Merge pull request #6537 from Morph1984/warningsbunnei2021-07-0612-58/+27
|\ \ \ \ \ \ | | | | | | | | | | | | | | general: Enforce multiple warnings in MSVC
| * | | | | | CMakeLists: Disable all warnings for external headersMorph2021-06-281-0/+5
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This lets us avoid needing to wrap external headers with #pragma warning directives for warnings we treat as errors and avoids generating warnings for external code. Thanks to MerryMage for pointing this out.
| * | | | | | video_core: Remove #pragma warning directives for external headersMorph2021-06-282-15/+0
| | | | | | |
| * | | | | | input_common: Remove #pragma warning directives for external headersMorph2021-06-282-14/+0
| | | | | | |
| * | | | | | CMakeLists: Enforce C4018, C4267, C4305, C4389Morph2021-06-281-3/+7
| | | | | | |
| * | | | | | core: Enforce C4242Morph2021-06-281-6/+3
| | | | | | |
| * | | | | | input_common: Enforce C4242Morph2021-06-281-12/+4
| | | | | | |
| * | | | | | video_core: Enforce C4242Morph2021-06-281-3/+2
| | | | | | |
| * | | | | | video_core: Silence signed/unsigned mismatch warningsMorph2021-06-284-5/+6
| | | | | | |
* | | | | | | Merge pull request #6556 from Morph1984/default-miibunnei2021-07-051-2/+3
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | service: mii: Retrieve the correct default miis.
| * | | | | | | service: mii: Retrieve the correct default miis.Morph2021-07-041-2/+3
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | We were including the first 2 default miis which are not meant to be shown in games. With this change, we properly retrieve the 6 default miis shown in games, with 3 of each gender.
* | | | | | | | Merge pull request #6540 from Kelebek1/nvdecAmeer J2021-07-0510-356/+522
|\ \ \ \ \ \ \ \ | |_|_|_|_|_|_|/ |/| | | | | | | Slightly refactor NVDEC and codecs for readability and safety
| * | | | | | | Slightly refactor NVDEC and codecs for readability and safetyKelebek12021-07-0110-356/+522
| | | | | | | |
* | | | | | | | Merge pull request #6561 from german77/analog_fixMorph2021-07-051-0/+1
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | input_common: Add missing modifier callback to analog from button
| * | | | | | | | input_common: Add missing modifier callback to analog from buttongerman772021-07-051-0/+1
| | |_|_|/ / / / | |/| | | | | |
* | | | | | | | Merge pull request #6559 from german77/compilation_warningsMorph2021-07-051-4/+5
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | Replace usages of deprecated member functions in QMouseEvent and QWheelEvent
| * | | | | | | | profiler: Fix deprecated functionsgerman772021-07-051-4/+5
|/ / / / / / / /
* | | | | | | | Merge pull request #6552 from Morph1984/c4189-msvcMai M2021-07-051-0/+1
|\ \ \ \ \ \ \ \ | |/ / / / / / / |/| | | | | | | CMakeLists: Enforce C4189 on MSVC
| * | | | | | | CMakeLists: Enforce C4189Morph2021-07-031-0/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This supplements C4101 by detecting initialized but unreferenced local variables
* | | | | | | | Merge pull request #6553 from FernandoS27/bite-a-bat-change-the-worldAmeer J2021-07-042-3/+26
|\ \ \ \ \ \ \ \ | |_|_|/ / / / / |/| | | | | | | TextureCache: Fix 1D to 2D overlapps.
| * | | | | | | TextureCacheOGL: Implement Image Copies for 1D and 1D Array.Fernando Sahmkow2021-07-031-0/+26
| | | | | | | |
| * | | | | | | TextureCache: Fix 1D to 2D overlapps.Fernando Sahmkow2021-07-031-3/+0
|/ / / / / / /
* | | | | | | Merge pull request #6498 from Kelebek1/Audiobunnei2021-07-038-88/+180
|\ \ \ \ \ \ \ | |/ / / / / / |/| | | | | | [audio_core] Decouple audio update and processing, and process at variable rate
| * | | | | | Fix XC2/VOEZ crashing, add audio looping and a few misc fixesKelebek12021-07-017-132/+188
| | | | | | |
| * | | | | | Decouple audio processing and run at variable rateKelebek12021-06-273-79/+115
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Currently, processing of audio samples is called from AudioRenderer's Update method, using a fixed 4 buffers to process the given samples. Games call Update at variable rates, depending on framerate and/or sample count, which causes inconsistency in audio processing. From what I've seen, 60 FPS games update every ~0.004s, but 30 FPS/160 sample games update somewhere between 0.02 and 0.04, 5-10x slower. Not enough samples get fed to the backend, leading to a lot of audio skipping. This PR seeks to address this by de-coupling the audio consumption and the audio update. Update remains the same without calling for buffer queuing, and the consume now schedules itself to run based on the sample rate and count.
* | | | | | | Merge pull request #6459 from lat9nq/ubuntu-fixesAmeer J2021-07-013-6/+99
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | cmake: Improve Linux dependency checking for externals
| * | | | | | | cmake: Check dependencies for Linux Qt packagelat9nq2021-06-131-4/+75
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Currently Qt will download whether or not the target system supports the package. Normally this isn't an issue since the package manager would work out the dependencies for us, but in this case we must make sure everything is in place before downloading the package. This checks for the package's requirements, as well as tries to provides hints as to what is required on some of the more cryptic dependencies.
| * | | | | | | cmake: Fix find_program usage for 3.15lat9nq2021-06-133-2/+24
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | yuzu requires CMake 3.15 yet find_program was using REQUIRED, which is only available on 3.18 and later. Instead, we check for "<VAR>-NOTFOUND". In addition, check for additional requirements before building libusb or FFmpeg with autotools. Otherwise, CMake configuration will pass yet compilation will fail.
* | | | | | | | Merge pull request #6471 from lat9nq/dump-as-modMorph2021-06-2910-31/+91
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | yuzu qt, core: Support LayeredFS mods from SDMC directory
| * | | | | | | | patch_manager: Do not apply LayeredFS mods when dumpingMorph2021-06-283-4/+8
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | We should not apply any mods when dumping a game's RomFS.
| * | | | | | | | filesystem: Open a read-only directory for SDMC modsMorph2021-06-283-19/+25
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This prevents mod files from being locked due to the read-only share flag in Windows.
| * | | | | | | | core: Simplify SDMC mod loadinglat9nq2021-06-283-21/+10
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | If someone else wants to support other mod formats in the SDMC directory, that can be added later. For now, just allow RomFS modding here and force people to do other types of mods the old way. Addresses review comments. Co-authored-by: LC <mathew1800@gmail.com>
| * | | | | | | | core: Support LayeredFS mod from SDMC directorylat9nq2021-06-285-2/+47
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Enables loading a mod directly from `[yuzu data directory]/sdmc/atmosphere/contents/[title_id]`. For use with some homebrew mod managers.
| * | | | | | | | yuzu qt: Add option to dump to SDMC directorylat9nq2021-06-284-7/+23
| | |_|_|/ / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Enables dumping the RomFS to SDMC directory, specifically '[yuzu data directory]/sdmc/atmosphere/contents/[title_id]/romfs'.
* | | | | | | | Merge pull request #6502 from ameerj/vendor-titleMorph2021-06-289-10/+100
|\ \ \ \ \ \ \ \ | |/ / / / / / / |/| | | | | | | main: Add GPU Vendor name to running title bar
| * | | | | | | gl_device: Expand on Mesa driver nameslat9nq2021-06-211-3/+28
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Makes this list a bit more capable at identifying Mesa drivers. Tries to deal with two of the overloaded vendor strings in a more generic fashion.
| * | | | | | | video_core: Add GPU vendor name to window title barameerj2021-06-219-10/+75
| | | | | | | |
* | | | | | | | Merge pull request #6535 from ameerj/insert-fancy-nameMorph2021-06-281-0/+3
|\ \ \ \ \ \ \ \ | |_|_|_|/ / / / |/| | | | | | | main: Display the instruction set of the running title in the window name
| * | | | | | | main: Display the instruction set of the running title in the window nameameerj2021-06-281-0/+3
|/ / / / / / / | | | | | | | | | | | | | | | | | | | | | Displays whether the currently running title uses 64-bit instructions or only 32-bit instructions.
* | | | | | | Merge pull request #6529 from ReinUsesLisp/reaper-fixupsMorph2021-06-276-14/+42
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | buffer_cache,texture_cache: Misc fixups from the memory reaper
| * | | | | | | buffer_cache: Only flush downloaded sizeReinUsesLisp2021-06-261-2/+3
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Fixes a regression unintentionally introduced by the garbage collector. This makes regular memory downloads only flush the requested sizes. This negatively affected Koei Tecmo games.
| * | | | | | | video_core: Enforce C4244ReinUsesLisp2021-06-261-0/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Enforce implicit integer casts to a smaller type as errors.
| * | | | | | | codec,vic: Disable warnings in ffmpeg headersReinUsesLisp2021-06-262-4/+29
| | | | | | | |
| * | | | | | | vk_buffer_cache: Silence implicit cast warningsReinUsesLisp2021-06-261-2/+3
| | | | | | | |
| * | | | | | | buffer_cache/texture_cache: Make GC functions privateReinUsesLisp2021-06-262-5/+5
| | | | | | | |
| * | | | | | | buffer_cache: Silence implicit cast warningReinUsesLisp2021-06-261-1/+1
| | |_|_|/ / / | |/| | | | |
* | | | | | | Merge pull request #6532 from MerryMage/libusb-appleMorph2021-06-271-1/+1
|\ \ \ \ \ \ \ | |_|_|_|/ / / |/| | | | | | libusb: Apple is a POSIX system
| * | | | | | libusb: Apple is a POSIX systemMerryMage2021-06-261-1/+1
| |/ / / / /
* | | | | | Merge pull request #6526 from bunnei/doom-updatebunnei2021-06-266-9/+61
|\ \ \ \ \ \ | |/ / / / / |/| | | | | services: Misc. minor changes for latest SDK update.
| * | | | | hle: service: hwopus: OpenHardwareOpusDecoderEx: Remove unused buffer size.bunnei2021-06-261-1/+30
| | | | | |
| * | | | | hle: hle_helpers: Skip data payload offset checks on TIPC requests.bunnei2021-06-251-2/+6
| | | | | | | | | | | | | | | | | | | | | | | | - TIPC does not use this.
| * | | | | hle: service: hwopus: Implement GetWorkBufferSizeEx and OpenHardwareOpusDecoderEx.bunnei2021-06-252-5/+15
| | | | | | | | | | | | | | | | | | | | | | | | - This is used by the latest update of Doom Eternal.
| * | | | | hle: service: aoc: Stub GetAddOnContentListChangedEventWithProcessId.bunnei2021-06-252-1/+10
| | | | | | | | | | | | | | | | | | | | | | | | - This is used by the latest update of Doom Eternal.
| * | | | | audio_core: common: Bump audio revision to 9.bunnei2021-06-251-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | - This is used in fw 12.x.x games.
* | | | | | Merge pull request #6528 from ReinUsesLisp/device-memoryAmeer J2021-06-252-19/+18
|\ \ \ \ \ \ | |_|_|_|/ / |/| | | | | vulkan_device: Make device memory match the rest of the file
| * | | | | vulkan_device: Make device memory match the rest of the fileReinUsesLisp2021-06-252-19/+18
|/ / / / / | | | | | | | | | | | | | | | Match the style in the file.
* | | | | Merge pull request #6496 from ameerj/astc-fixesbunnei2021-06-255-155/+50
|\ \ \ \ \ | | | | | | | | | | | | astc: Various robustness enhancements for the gpu decoder
| * | | | | util_shaders: Specify ASTC decoder memory barrier bitsameerj2021-06-191-1/+6
| | | | | |
| * | | | | astc_decoder.comp: Remove unnecessary LUT SSBOsameerj2021-06-195-113/+34
| | | | | | | | | | | | | | | | | | | | | | | | We can move them to instead be compile time constants within the shader.
| * | | | | astc: Various robustness enhancements for the gpu decoderameerj2021-06-195-47/+16
| | |_|_|/ | |/| | | | | | | | | | | | | | | | | | | | | | | These changes should help in reducing crashes/drivers panics that may occur due to synchronization issues between the shader completion and later access of the decoded texture.
* | | | | Merge pull request #6519 from Wunkolo/mem-size-literalbunnei2021-06-2519-126/+152
|\ \ \ \ \ | |_|/ / / |/| | | | common: Replace common_sizes into user-literals
| * | | | common: Replace common_sizes into user-literalsWunkolo2021-06-2419-126/+152
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Removes common_sizes.h in favor of having `_KiB`, `_MiB`, `_GiB`, etc user-literals within literals.h. To keep the global namespace clean, users will have to use: ``` using namespace Common::Literals; ``` to access these literals.
* | | | | Merge pull request #6522 from Morph1984/pragmabunnei2021-06-244-0/+8
|\ \ \ \ \ | | | | | | | | | | | | general: Add missing #pragma once directives
| * | | | | general: Add missing #pragma once directivesMorph2021-06-244-0/+8
| | | | | |
* | | | | | Add missing includes (#6521)Chloe2021-06-244-0/+7
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * Add missing includes * Add array
* | | | | | Fix bold tagSchplee2021-06-241-1/+1
| | | | | |
* | | | | | Fix typo in ReadmeSchplee2021-06-241-1/+1
| | | | | |
* | | | | | Update ReadmeSchplee2021-06-241-20/+57
|/ / / / /
* | | | | Merge pull request #6517 from lioncash/fmtlibbunnei2021-06-2411-16/+24
|\ \ \ \ \ | |/ / / / |/| | | | externals: Update fmt to 8.0.0
| * | | | General: Resolve fmt specifiers to adhere to 8.0.0 API where applicableLioncash2021-06-239-15/+23
| | | | | | | | | | | | | | | | | | | | Also removes some deprecated API usages.
| * | | | externals: Update dynarmic to allow fmt compilation to succeedLioncash2021-06-231-0/+0
| | | | |
| * | | | externals: Update fmt to 8.0.0Lioncash2021-06-231-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Keeps us up to date with the latest major release. Also allows compilers that support it to perform compile-time format string checking.
* | | | | Merge pull request #6504 from Kelebek1/samples-playedbunnei2021-06-233-3/+20
|\ \ \ \ \ | | | | | | | | | | | | [audout] Implement GetAudioOutPlayedSampleCount
| * | | | | Implement audout GetAudioOutPlayedSampleCountKelebek12021-06-223-3/+20
| | | | | | | | | | | | | | | | | | | | | | | | Used in Ninja Gaiden games.
* | | | | | Merge pull request #6518 from lioncash/funcbunnei2021-06-231-0/+1
|\ \ \ \ \ \ | | | | | | | | | | | | | | maxwell3d: Add missing return in default SizeInBytes() case
| * | | | | | maxwell3d: Add missing return in default SizeInBytes() caseLioncash2021-06-231-0/+1
| | |/ / / / | |/| | | | | | | | | | | | | | | | | | | | | | We were returning '1' in ComponentCount()'s default case but were neglecting to do the same with SizeInBytes().
* | | | | | Merge pull request #6465 from FernandoS27/sex-on-the-beachMai M2021-06-2325-63/+493
|\ \ \ \ \ \ | |/ / / / / |/| | | | | GPU: Implement a garbage collector for GPU Caches (project Reaper+)
| * | | | | Reaper: Set minimum cleaning limit on OGL.Fernando Sahmkow2021-06-221-1/+4
| | | | | |
| * | | | | Reaper: Guarantee correct deletion.Fernando Sahmkow2021-06-205-2/+23
| | | | | |
| * | | | | Reaper: Upgrade label from unsafe to experimental as no regressions are known now.Fernando Sahmkow2021-06-201-1/+1
| | | | | |
| * | | | | Reaper: Correct size calculation on Vulkan.Fernando Sahmkow2021-06-171-5/+3
| | | | | |
| * | | | | Reaper: Change memory restrictions on TC depending on host memory on VK.Fernando Sahmkow2021-06-1710-41/+90
| | | | | |
| * | | | | Reaper: Address Feedback.Fernando Sahmkow2021-06-166-20/+43
| | | | | |
| * | | | | Reaper: Setup settings and final tuning.Fernando Sahmkow2021-06-1610-32/+64
| | | | | |
| * | | | | Reaper: Tune it up to be an smart GC.Fernando Sahmkow2021-06-165-13/+130
| | | | | |
| * | | | | Initial Reaper SetupReinUsesLisp2021-06-166-56/+226
| | | | | | | | | | | | | | | | | | | | | | | | WIP
| * | | | | vulkan_memory_allocator: Release allocations with no commitsReinUsesLisp2021-06-162-5/+22
| | | | | |
* | | | | | Merge pull request #6508 from ReinUsesLisp/bootmanager-stop-tokenMai M2021-06-238-18/+18
|\ \ \ \ \ \ | | | | | | | | | | | | | | bootmanager: Use std::stop_source for stopping emulation
| * | | | | | bootmanager: Use std::stop_source for stopping emulationReinUsesLisp2021-06-228-18/+18
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Use its std::stop_token to abort shader cache loading. Using std::stop_token instead of std::atomic_bool allows the usage of other utilities like std::stop_callback.
* | | | | | | Merge pull request #6514 from OZtistic/masterMorph2021-06-232-1/+8
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | Simple resizing of Per-Game configuration window and removal of useless Help question mark button in the title bar
| * | | | | | | Simple resizing of the Per-Game configuration window and removal of useless Help question mark button in the title barOZtistic2021-06-232-1/+8
| | | | | | | |
* | | | | | | | Merge pull request #6512 from ReinUsesLisp/wait-detached-stasksMai M2021-06-231-0/+2
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | common/detached_tasks: Wait for tasks before shutting down
| * | | | | | | | common/detached_tasks: Wait for tasks before shutting downRodrigo Locatti2021-06-221-0/+2
| | |/ / / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | If this is not waited on, the synchronization primitives are destroyed whe main exits and the detached task ends up signalling garbage and not properly finishing.
* | | | | | | | Merge pull request #6509 from ReinUsesLisp/mouse-dataraceMai M2021-06-232-12/+10
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | input_common/mouse_input: Fix data race
| * | | | | | | | input_common/mouse_input: Fix data raceRodrigo Locatti2021-06-222-12/+10
| |/ / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | Fix data race using std::jthread and std::stop_token.
* | | | | | | | Merge pull request #6510 from ReinUsesLisp/npad-data-raceMai M2021-06-232-0/+8
|\ \ \ \ \ \ \ \ | |_|/ / / / / / |/| | | | | | | npad: Fix data race when updating devices
| * | | | | | | npad: Fix data race when updating devicesRodrigo Locatti2021-06-222-0/+8
| |/ / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | Add a lock to avoid data races. This reduces the number of -fsanitize=thread errors significantly.
* | | | | | | Merge pull request #6493 from Morph1984/fs-nodiscardbunnei2021-06-2310-48/+48
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | common: fs: Miscellaneous changes
| * | | | | | | common: fs: Add a description of a regular file in IsFileMorph2021-06-221-4/+6
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This provides a more concrete example of what a regular file is and isn't.
| * | | | | | | vfs_real: Fix Mode to FileAccessMode conversionMorph2021-06-221-6/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | These enforce requiring the file to exist prior to opening.
| * | | | | | | common: fs: Amend IsFile check in FileOpen / (Write/Append)StringToFileMorph2021-06-224-9/+12
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This check was preventing files with the Write or Append file access modes from being created, as per the documented behavior in FileAccessMode. This amends the check to test for the existence of a filesystem object prior to checking whether it is a regular file. Thanks to liushuyu for pointing out that removing the check altogether would not guard against attempting to open non-regular files such as directories, symlinks, FIFO (pipes), sockets, block devices, or character devices. The documentation has also been updated for these functions to clarify that a file refers to a regular file.
| * | | | | | | common: fs: file: Remove [[nodiscard]] attribute from FlushMorph2021-06-222-3/+3
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Similarly, Flush() is typically called to attempt to flush a file into the disk. In the one case where this is used, we do not care whether the flush has succeeded or not, making [[nodiscard]] unnecessary.
| * | | | | | | common: fs: Remove [[nodiscard]] attribute on Remove* functionsMorph2021-06-226-26/+26
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | There are a lot of scenarios where we don't particularly care whether or not the removal operation and just simply attempt a removal. As such, removing the [[nodiscard]] attribute is best for these functions.
* | | | | | | | Merge pull request #6472 from Morph1984/splbunnei2021-06-239-78/+493
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | service: spl: Implement general SPL service
| * | | | | | | | spl: Mark the other functions as unimplementedMorph2021-06-161-5/+30
| | | | | | | | |
| * | | | | | | | spl: Implement spl::GetConfigMorph2021-06-162-1/+90
| | | | | | | | |
| * | | | | | | | hle: api_version: Add HLE API version constantsMorph2021-06-163-33/+54
| | | | | | | | |
| * | | | | | | | spl: Add the general SPL interfaceMorph2021-06-164-45/+64
| | | | | | | | |
| * | | | | | | | spl: Add SPL typesMorph2021-06-162-0/+231
| | | | | | | | |
| * | | | | | | | spl: Add SPL result codesMorph2021-06-162-0/+30
| | | | | | | | |
* | | | | | | | | Merge pull request #6483 from Morph1984/get-tz-filebunnei2021-06-221-1/+1
|\ \ \ \ \ \ \ \ \ | |_|/ / / / / / / |/| | | | | | | | service: time: Use GetFileRelative to get files within subdirectories
| * | | | | | | | service: time: Use GetFileRelative to get files within subdirectoriesMorph2021-06-181-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The timezone info file can be within subdirectories (such as Asia/Tokyo), use GetFileRelative instead of GetFile to get files within subdirectories.
* | | | | | | | | Merge pull request #6506 from ReinUsesLisp/master-semaphore-jthreadbunnei2021-06-222-19/+8
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | vk_master_semaphore: Use jthread for debug thread
| * | | | | | | | | vk_master_semaphore: Use jthread for debug threadReinUsesLisp2021-06-222-19/+8
| | |_|/ / / / / / | |/| | | | | | |
* | | | | | | | | Merge pull request #6495 from lat9nq/mingw-vista-stylebunnei2021-06-221-5/+6
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | ci: windows: Copy the Qt styles directory when packaging
| * | | | | | | | | ci: windows: Copy the styles directory when packaginglat9nq2021-06-191-5/+6
| | |_|_|_|_|_|/ / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Qt can make use of qwindowsvistastyle.dll if present, and our MinGW container has the library, but it was not being copied during the packaging process. Thus, yuzu looked like a Windows 98 application when using the PR-verify artifacts. This copies over the DLL during packaging, for that sweet-sweet Windows Vista style. In addition, set the Qt plugins path instead of the plugins/platforms path. This way we can use the directory directly, rather than appending a `..` everytime we need something just outside of it.
* | | | | | | | | Merge pull request #6511 from ReinUsesLisp/core-is-powered-data-raceMai M2021-06-221-2/+3
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | core: Make is_powered_on atomic
| * | | | | | | | | core: Make is_powered_on atomicRodrigo Locatti2021-06-221-2/+3
| | |/ / / / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | Fixes potential data races when shutting down.
* | | | | | | | | Merge pull request #6481 from Morph1984/missing-peak-setbunnei2021-06-221-0/+1
|\ \ \ \ \ \ \ \ \ | |/ / / / / / / / |/| | | | | | | | kernel: Fix missing peak set in KResourceLimit::SetLimitValue
| * | | | | | | | kernel: Fix missing peak set in KResourceLimit::SetLimitValueMorph2021-06-181-0/+1
| | | | | | | | |
* | | | | | | | | Merge pull request #6499 from FernandoS27/we-were-on-a-breakbunnei2021-06-218-0/+31
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | Update dynarmic and add new unsafe CPU option.
| * | | | | | | | | Update dynarmic and add new unsafe CPU option.Fernando Sahmkow2021-06-208-0/+31
| | |/ / / / / / / | |/| | | | | | |
* | | | | | | | | Merge pull request #6475 from ameerj/unlimit-fpsbunnei2021-06-2110-3/+46
|\ \ \ \ \ \ \ \ \ | |_|_|_|_|_|/ / / |/| | | | | | | | nvflinger: Add experimental toggle to disable buffer swap interval limits
| * | | | | | | | config: Add frame limiter toggle hotkeyameerj2021-06-173-3/+8
| | | | | | | | |
| * | | | | | | | nvflinger: Add toggle to disable buffer swap interval limitsameerj2021-06-178-0/+38
| | |/ / / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Enabling this setting will allow some titles to present more frames to the screen as they become available in the nvflinger buffer queue.
* | | | | | | | Merge pull request #6486 from CaptV0rt3x/httplibMai M2021-06-216-6731/+6
|\ \ \ \ \ \ \ \ | |_|/ / / / / / |/| | | | | | | externals: httplib: replace custom httplib header with upstream as submodule
| * | | | | | | externals: httplib: replace custom httplib header with upstream as submodule.Vortex2021-06-186-6731/+6
| | |_|_|_|/ / | |/| | | | | | | | | | | | | | | | | | | This also includes a minor change to web_service.cpp - to fix compatibility with upstream changes.
* | | | | | | Merge pull request #6494 from lat9nq/mingw-fix-fastmemMorph2021-06-191-1/+1
|\ \ \ \ \ \ \ | |/ / / / / / |/| | | | | | host_memory: Correct MEM_RESERVE_PLACEHOLDER
| * | | | | | host_memory: Correct MEM_RESERVE_PLACEHOLDERlat9nq2021-06-191-1/+1
|/ / / / / / | | | | | | | | | | | | | | | | | | | | | | | | Microsoft defines `MEM_RESERVE_PLACEHOLDER` as `0x00040000`, but our manually imported version of it drops the last zero.
* | | | | | Merge pull request #6484 from CaptV0rt3x/discord-rpcMai M2021-06-182-1/+1
|\ \ \ \ \ \ | |_|/ / / / |/| | | | | update submodule discord-rpc to latest [now deprecated]
| * | | | | update submodule discord-rpc to latest [now deprecated]Vortex2021-06-182-1/+1
|/ / / / /
* | | | | Merge pull request #6478 from ameerj/vk-layer-settingsRodrigo Locatti2021-06-181-0/+8
|\ \ \ \ \ | |/ / / / |/| | | | vulkan_debug_callback: Skip logging known false-positive validation errors
| * | | | vulkan_debug_callback: Skip logging known false-positive validation errorsameerj2021-06-181-0/+8
|/ / / / | | | | | | | | | | | | Avoids overwhelming the log with validation errors that are not applicable
* | | | Merge pull request #6418 from clementgallet/sdl-audio-backendbunnei2021-06-176-3/+213
|\ \ \ \ | | | | | | | | | | Audio: SDL2 audio backend
| * | | | Various suggestions by v1993 and lioncashClément Gallet2021-06-072-11/+9
| | | | |
| * | | | Add sdl2 audio description in the yuzu-cmd config fileClément Gallet2021-06-061-1/+2
| | | | |
| * | | | Add SDL2 audio backendClément Gallet2021-06-065-2/+213
| | | | |
* | | | | Merge pull request #6469 from ReinUsesLisp/blit-view-compatAmeer J2021-06-171-1/+9
|\ \ \ \ \ | |_|_|/ / |/| | | | texture_cache/util: Avoid relaxed image views on different bytes per block
| * | | | texture_cache/util: Avoid relaxed image views on different bytes per pixelReinUsesLisp2021-06-151-1/+9
| | |_|/ | |/| | | | | | | | | | Avoids API usage errors on UE4 titles leading to crashes.
* | | | Merge pull request #6464 from ameerj/disable-astcbunnei2021-06-1616-7/+1637
|\ \ \ \ | | | | | | | | | | textures: Add a toggle for GPU Accelerated ASTC decoder
| * | | | astc_decoder: Fix LDR CEM1 endpoint calculationameerj2021-06-162-2/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Per the spec, L1 is clamped to the value 0xff if it is greater than 0xff. An oversight caused us to take the maximum of L1 and 0xff, rather than the minimum. Huge thanks to wwylele for finding this. Co-Authored-By: Weiyi Wang <wwylele@gmail.com>
| * | | | yuzu_cmd/config: Add Accelerate ASTC and missing NVDEC emulation settingsameerj2021-06-162-2/+12
| | | | |
| * | | | configure_graphics: Add Accelerate ASTC decoding settingameerj2021-06-169-2/+32
| | | | |
| * | | | textures: Reintroduce CPU ASTC decoderameerj2021-06-164-2/+1592
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Users may want to fall back to the CPU ASTC texture decoder due to hangs and crashes that may be caused by keeping the GPU under compute heavy loads for extended periods of time. This is especially the case in games such as Astral Chain which make extensive use of ASTC textures.
* | | | | Merge pull request #6460 from Morph1984/fs-access-log-fixMorph2021-06-1612-44/+64
|\ \ \ \ \ | |_|_|_|/ |/| | | | fsp_srv: Fix filesystem access logging
| * | | | common: fs: file: Remove redundant call to WriteStringToFileMorph2021-06-162-6/+1
| | | | | | | | | | | | | | | | | | | | The Append open mode will create a new file if said file does not exist at a given path, making this call redundant.
| * | | | fsp_srv: Fix filesystem access loggingMorph2021-06-1610-38/+63
| |/ / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | This introduces a new setting Enable FS Access Log which saves the filesystem access log to sdmc:/FsAccessLog.txt If this setting is not enabled, this will indicate to FS to not call OutputAccessLogToSdCard. Fixes softlocks during loading in Xenoblade Chronicles 2 when certain DLC is enabled.
* | | | Merge pull request #6462 from Morph1984/proper-flushbunnei2021-06-161-1/+5
|\ \ \ \ | |/ / / |/| | | common: fs: file: Flush the file to the disk when Flush() is called
| * | | common: fs: file: Flush the file to the disk when Flush() is calledMorph2021-06-131-1/+5
| | | | | | | | | | | | | | | | | | | | | | | | std::fflush does not guarantee that file buffers are flushed to the disk. Use _commit on Windows and fsync on all other OSes to ensure that the file is flushed to the disk.
* | | | Merge pull request #6470 from ameerj/lm-silencebunnei2021-06-151-27/+20
|\ \ \ \ | | | | | | | | | | lm: Demote LM guest logs to LOG_DEBUG
| * | | | lm: Demote guest logs to LOG_DEBUGameerj2021-06-151-27/+20
|/ / / / | | | | | | | | | | | | Guest logs are not very useful, as they are intended for use by the game developers during development. As such, they provide little meaning to be logged by yuzu and tend to overwhelm the log output at times.
* | | | Merge pull request #6456 from Morph1984/very-important-changesbunnei2021-06-151-1/+1
|\ \ \ \ | | | | | | | | | | configure_cpu_debug: Clarify settings behavior
| * | | | configure_cpu_debug: Clarify settings behaviorMorph2021-06-131-1/+1
| | |/ / | |/| | | | | | | | | | This makes it clear that the disabled settings only take effect when CPU Accuracy is set to Debug Mode.
* | | | Merge pull request #6448 from Morph1984/recursive-dir-iteratorFernando Sahmkow2021-06-141-2/+16
|\ \ \ \ | | | | | | | | | | common: fs: Use the normal directory iterator in *Recursively functions
| * | | | common: fs: Use the normal directory iterator in *Recursively functionsMorph2021-06-121-2/+16
| |/ / / | | | | | | | | | | | | | | | | | | | | MSVC's implementation of recursive_directory_iterator throws an exception on an error despite a std::error_code being passed into its constructor. This is most likely a bug in MSVC's implementation since directory_iterator does not throw an exception on an error. We can replace the usage of recursive_directory_iterator for now until MSVC fixes their implementation of it.
* | | | Merge pull request #6463 from Morph1984/restructure-loggingMai M2021-06-1311-287/+315
|\ \ \ \ | |_|/ / |/| | | common: logging: Restructure logging backend
| * | | general: Remove extraneous includesMorph2021-06-133-3/+0
| | | |
| * | | common: logging: Restructure backend codeMorph2021-06-138-278/+288
| | | |
| * | | common: logging: backend: Wrap IOFile in a unique_ptrMorph2021-06-132-6/+27
|/ / / | | | | | | | | | Allows us to forward declare Common::FS::IOFile.
* | | Merge pull request #6452 from german77/sixaxis_firmware_stubMorph2021-06-132-1/+23
|\ \ \ | |/ / |/| | hid: Stub IsFirmwareUpdateAvailableForSixAxisSensor
| * | hid: Stub IsFirmwareUpdateAvailableForSixAxisSensorgerman772021-06-112-1/+23
| | |
* | | Merge pull request #6453 from lat9nq/libusb-fix-msvcbunnei2021-06-121-3/+3
|\ \ \ | | | | | | | | externals: Don't set FOUND or VERSION on LIBUSB
| * | | externals: Don't set FOUND or VERSION on LIBUSBlat9nq2021-06-111-3/+3
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Fixes an issue where libusb.h wouldn't be found when building yuzu on MSVC. This only affects the "traditional" CMake pathway for linking libusb to yuzu AKA MSVC. For autotools we still want to set these variables before configuring SDL.
* | | | Merge pull request #6451 from Morph1984/check-disk-space-dumpbunnei2021-06-111-0/+12
|\ \ \ \ | |/ / / |/| | | yuzu: main: Ensure enough space is available for RomFS dumping
| * | | yuzu: main: Ensure enough space is available for RomFS dumpingMorph2021-06-111-0/+12
| | | | | | | | | | | | | | | | This warns the user if there isn't enough free space to dump the entire RomFS to disk. It requires at least the size of the extracted RomFS + 1 GiB as a buffer of free space.
* | | | Merge pull request #6422 from FernandoS27/i-am-the-senateMai M2021-06-1123-43/+950
|\ \ \ \ | |_|/ / |/| | | Implement/Port Fastmem from Citra to Yuzu
| * | | common/host_memory: Implement a fallback if fastmem fails.Markus Wick2021-06-112-14/+49
| | | | | | | | | | | | | | | | | | | | | | | | This falls back to the old approach of using a virtual buffer. Windows is untested, but this build should fix support for Windows < 10 v1803. However without fastmem support at all.
| * | | common/host_shader: Load Windows 10 functions dynamicallyReinUsesLisp2021-06-111-29/+88
| | | | | | | | | | | | | | | | Workaround old headers and libraries shipped on MinGW.
| * | | GPUTHread: Remove async reads from Normal Accuracy.Fernando Sahmkow2021-06-111-18/+6
| | | |
| * | | rasterizer: Update pages in batchesReinUsesLisp2021-06-111-15/+41
| | | |
| * | | host_memory: Support staged VirtualProtect callsReinUsesLisp2021-06-111-3/+12
| | | |
| * | | General: Add settings for fastmem and disabling adress space check.FernandoS272021-06-1112-6/+83
| | | |
| * | | common/host_memory: Optimize for huge tables.Markus Wick2021-06-112-11/+24
| | | | | | | | | | | | | | | | | | | | In theory, if we have 2 MB continously mapped, this should save one layer of TLB. Let's make it at least more likely by aligning the memory.
| * | | core: Make use of fastmemMarkus Wick2021-06-117-8/+30
| | | |
| * | | tests: Add tests for host memoryReinUsesLisp2021-06-112-0/+184
| | | |
| * | | common/host_memory: Add Linux implementationMarkus Wick2021-06-111-10/+120
| | | |
| * | | common/host_memory: Add interface and Windows implementationReinUsesLisp2021-06-113-0/+384
| |/ /
* | | Merge pull request #6443 from Morph1984/k-light-condition-variablebunnei2021-06-114-37/+43
|\ \ \ | |/ / |/| | kernel: KLightConditionVariable: Update implementation to 12.x
| * | kernel: Unconditionally set thread state when appropriateMorph2021-06-112-23/+12
| | |
| * | kernel: KLightConditionVariable: Update implementation to 12.xMorph2021-06-112-14/+31
| | | | | | | | | | | | Updates the implementation of KLightConditionVariable to FW 12.x
* | | Merge pull request #6450 from lat9nq/update-sdlMorph2021-06-111-0/+0
|\ \ \ | | | | | | | | externals: Update SDL to 2f248a2a
| * | | externals: Update SDL to 2f248a2alat9nq2021-06-111-0/+0
|/ / /
* | | Merge pull request #6407 from lat9nq/fix-libusb-2bunnei2021-06-114-36/+70
|\ \ \ | | | | | | | | cmake: Use autotools for libusb linking generally on GNU, and cleanup
| * | | externals: libusb: Call program names not full pathslat9nq2021-06-031-4/+4
| | | |
| * | | externals: libusb: Link libusb statically on Linuxlat9nq2021-06-032-15/+17
| | | | | | | | | | | | | | | | Turns out that this is possible. Also addresses my own review comment.
| * | | cmake: General improvements to libusb linkinglat9nq2021-06-034-17/+31
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Delegates libusb external communication to externals/CMakeLists.txt Ensures an interface library `usb` for every pathway input_common just links to the `usb` library now externals/libusb/CMakeLists.txt sets variables to override SDL2's libusb finding Other minor cleanup
| * | | cmake: Use autotools to build libusb generally for GNUlat9nq2021-06-032-19/+37
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Building libusb was also broken on GCC (and maybe Clang) on our CMakeLists after upgrading to 1.0.24, but it was not being checked because our 18.04 container had libusb installed on it. This builds on the MinGW work from earlier and extends it to the rest of the GNU toolchains. In addition we make use of pkg-config when present to find libusb. pkg-config is preferrable because we can specify a minimum required version.
* | | | Merge pull request #6445 from degasus/fix_ubsnbunnei2021-06-113-1/+9
|\ \ \ \ | |_|/ / |/| | | Fix GCC undefined behavior sanitizer.
| * | | Fix GCC undefined behavior sanitizer.Markus Wick2021-06-103-1/+9
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * Wrong alignment in u64 LOG_DEBUG -> memcpy. * Huge shift exponent in stride calculation for linear buffer, unused result -> skipped. * Large shift in buffer cache if word = 0, skip checking for set bits. Non of those were critical, so this should not change any behavior. At least with the assumption, that the last one used masking behavior, which always yield continuous_bits = 0.
* | | | Merge pull request #6444 from bunnei/fix-sm-sessionsbunnei2021-06-102-18/+13
|\ \ \ \ | |/ / / |/| | | hle: service: sm: Remove redundant session reservation, etc.
| * | | hle: service: sm: Remove redundant session reservation, etc.bunnei2021-06-102-18/+13
|/ / / | | | | | | | | | - We were double-reserving, causing us to run out of sessions in Pokemon Sword & Shield.
* | | hle: service: Increase arbitrary max sessions limit.bunnei2021-06-101-4/+1
| | | | | | | | | - Pokemon Sword/Shield are still hitting this for some reason, causing an svcBreak.
* | | Merge pull request #6441 from bunnei/fix-session-handlerbunnei2021-06-105-17/+21
|\ \ \ | | | | | | | | hle: kernel: KServerSession: Fix client disconnected.
| * | | hle: kernel: KClientPort: Add an assert for session count.bunnei2021-06-101-0/+3
| | | | | | | | | | | | | | | | - Prevents us from over decrementing num_sessions.
| * | | hle: service: sm: Fix GetService setup of session & port.bunnei2021-06-102-5/+5
| | | |
| * | | hle: service: Use correct size for ServerSessionCountMax.bunnei2021-06-101-4/+6
| | | |
| * | | hle: kernel: KServerSession: Fix client disconnected.bunnei2021-06-103-9/+8
|/ / / | | | | | | | | | | | | - Prevents a cloned session's handler from being overwritten by another disconnected session. - Fixes session handler nullptr asserts with Pokemon Sword & Shield.
* | | Merge pull request #6439 from lat9nq/ci-no-7zAmeer J2021-06-102-8/+2
|\ \ \ | | | | | | | | ci: common: Remove 7z packaging
| * | | ci: windows: Compress using xzlat9nq2021-06-101-2/+2
| | | | | | | | | | | | | | | | Use XZ instead of gzip for packing. Should save about 10 MB.
| * | | ci: common: Remove 7z packaginglat9nq2021-06-091-6/+0
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Removes the 7z from being package during CI, as only .tar.xz preserves information needed on Linux, and otherwise is just extremely redundant to package in addition to the .tar.xz. This affects Linux releases and PR-verify artifacts only. MSVC releases do not use this script to my knowledge.
* | | | Merge pull request #6440 from bunnei/cancel-synchMai M2021-06-101-2/+2
|\ \ \ \ | | | | | | | | | | kernel: svc: Add missing error check to CancelSynchronization.
| * | | | kernel: svc: Add missing error check to CancelSynchronization.bunnei2021-06-101-2/+2
|/ / / / | | | | | | | | | | | | - Avoids a potential crash if the handle is invalid, and also makes this code accurate to real kernel behavior.
* | | | Merge pull request #6436 from liushuyu/masterMai M2021-06-091-8/+9
|\ \ \ \ | | | | | | | | | | src/common/CMakeLists.txt: fix variable escaping
| * | | | src/common/CMakeLists.txt: fix variable escapingliushuyu2021-06-091-8/+9
| | | | |
* | | | | hle: service: Increase arbitrary max sessions limit.bunnei2021-06-091-1/+1
| | | | | | | | | | | | | | | - Pokemon Sword/Shield are still hitting this for some reason, causing an svcBreak.
* | | | | Merge pull request #6413 from Kewlan/limitable_input_dialog_limitbunnei2021-06-093-5/+48
|\ \ \ \ \ | |/ / / / |/| | | | limitable_input_dialog: Implement character limiter
| * | | | limitable_input_dialog: Implement character limiterKewlan2021-06-063-5/+48
| | | | | | | | | | | | | | | | | | | | When using GetText() you can now choose what set of characters the user can't enter.
* | | | | Merge pull request #6435 from lioncash/nodisc2Morph2021-06-091-1/+1
|\ \ \ \ \ | |_|/ / / |/| | | | common/fs/path_util: Remove [[nodiscard]] from function with void return
| * | | | common/fs/path_util: Remove [[nodiscard]] from function with void returnLioncash2021-06-091-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | We can't make use of the return value here, since we don't a return value to work with.
* | | | | Merge pull request #6434 from lioncash/tcontextbunnei2021-06-091-13/+27
|\ \ \ \ \ | | | | | | | | | | | | configure_ui: Add translation context for file-scope strings
| * | | | | configure_ui: Add translation context for file-scope stringsLioncash2021-06-091-13/+27
| |/ / / / | | | | | | | | | | | | | | | Allows for these strings to show up in the translation files.
* | | | | Merge pull request #6428 from bunnei/service-thread-crash-fixbunnei2021-06-094-28/+56
|\ \ \ \ \ | |/ / / / |/| | | | hle: kernel: Remove service thread manager and use weak_ptr.
| * | | | hle: kernel: KServerSession: Work-around scenario where session is closed too early.bunnei2021-06-081-7/+24
| | | | |
| * | | | hle: kernel: hle_ipc: Ensure SessionRequestHandler is valid.bunnei2021-06-083-5/+26
| | | | |
| * | | | hle: kernel: Remove service thread manager and use weak_ptr.bunnei2021-06-083-18/+8
| | | | | | | | | | | | | | | | | | | | | | | | | - We no longer need to queue up service threads to be destroyed. - Fixes a race condition where a thread could be destroyed too early, which caused a crash in Pokemon Sword/Shield.
* | | | | Merge pull request #6426 from lat9nq/context-menu-startMai M2021-06-084-3/+23
|\ \ \ \ \ | | | | | | | | | | | | yuzu qt: Start games from context menu
| * | | | | yuzu qt: Start games from context menulat9nq2021-06-084-3/+23
| |/ / / / | | | | | | | | | | | | | | | | | | | | This connects the BootGame function to the context menu. In addition, there is an option to boot without using the custom configuration.
* | | | | Merge pull request #6412 from clementgallet/yuzu-cmd-window-glbunnei2021-06-082-12/+6
|\ \ \ \ \ | |/ / / / |/| | | | yuzu-cmd: Fix OpenGL rendering
| * | | | Avoid -Wshadow warningClément Gallet2021-06-051-1/+1
| | | | | | | | | | | | | | | Co-authored-by: Mai M. <mathew1800@gmail.com>
| * | | | yuzu-cmd: Fix OpenGL renderingClément Gallet2021-06-042-12/+6
| | |_|/ | |/| |
* | | | Merge pull request #6410 from lat9nq/avoid-oobbunnei2021-06-071-0/+8
|\ \ \ \ | | | | | | | | | | decoders: Avoid out-of-bounds access
| * | | | decoders: Break instead of continuelat9nq2021-06-041-2/+2
| | | | | | | | | | | | | | | | | | | | continue causes a memory leak in A Hat in Time.
| * | | | decoders: Avoid out-of-bounds accesslat9nq2021-06-041-0/+8
| | | | | | | | | | | | | | | | | | | | This is not a real fix, so assert here and continue before crashing.
* | | | | Merge pull request #6414 from bunnei/fix-service-threadsbunnei2021-06-0721-87/+101
|\ \ \ \ \ | | | | | | | | | | | | hle: kernel: Refactor to allocate a ServiceThread per service handler.
| * | | | | hle: kernel: KServerSession: Use ASSERT_MSG where appropriate.bunnei2021-06-071-1/+1
| | | | | |
| * | | | | hle: kernel: k_server_session: Return service thread by strong pointer.bunnei2021-06-072-4/+4
| | | | | |
| * | | | | hle: kernel: k_server_session: Ensure service thread is valid before dereference.bunnei2021-06-071-1/+3
| | | | | |
| * | | | | hle: kernel: hle_ipc: Use default destructor for SessionRequestManager.bunnei2021-06-071-1/+1
| | | | | |
| * | | | | hle: kernel: KAutoObjectWithListContainer: Use boost::instrusive::rbtree.bunnei2021-06-0711-22/+26
| | | | | | | | | | | | | | | | | | | | | | | | - Fixes some crashes introduced by our common intrusive red/black tree impl.
| * | | | | hle: kernel: Refactor to allocate a ServiceThread per service handler.bunnei2021-06-0513-67/+75
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | - Previously, we would allocate a thread per session, which adds new threads on CloneCurrentObject. - This results in race conditions with N sessions queuing requests to the same service interface. - Fixes Pokken Tournament DX crashes/softlocks, which were regressed by #6347.
* | | | | | Merge pull request #6400 from ameerj/disable-uniform-simplifybunnei2021-06-078-6/+29
|\ \ \ \ \ \ | |_|_|_|/ / |/| | | | | buffer_cache: Simplify uniform disabling logic
| * | | | | buffer_cache: Simplify uniform disabling logicameerj2021-06-018-6/+29
| | | | | |
* | | | | | Merge pull request #6415 from lioncash/res-nodiscMorph2021-06-061-20/+20
|\ \ \ \ \ \ | | | | | | | | | | | | | | result: Add [[nodiscard]] specifiers where applicable
| * | | | | | result: Add [[nodiscard]] specifiers where applicableLioncash2021-06-051-20/+20
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The result code classes are used quite extensively throughout both the kernel and service HLE code. We can mark these member functions as [[nodiscard]] to prevent a few logic bugs from slipping through.
* | | | | | | Merge pull request #6416 from ReinUsesLisp/update-dynarmicRodrigo Locatti2021-06-051-0/+0
|\ \ \ \ \ \ \ | |/ / / / / / |/| | | | | | externals: Update dynarmic
| * | | | | | externals: Update dynarmicReinUsesLisp2021-06-051-0/+0
|/ / / / / /
* | | | | | Merge pull request #6362 from lat9nq/reset-to-defaultsbunnei2021-06-056-3/+122
|\ \ \ \ \ \ | | | | | | | | | | | | | | yuzu qt: Add settings reset button to general configuration
| * | | | | | yuzu qt: Use lambda and std::function for reset callbacklat9nq2021-06-014-19/+17
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Also makes use of std::move, and performs a clang-format cleanup. This addresses review comments. Co-authored-by: LC <mathew1800@gmail.com>
| * | | | | | yuzu: Add settings reset button to general configurationlat9nq2021-06-018-23/+111
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Builds on german77's work to reset all settings back to their defaults. This include UISettings and Settings values structs, but does not affect save profiles, input profiles, and game directories. This works from a button input in configure_general. When activated, it calls a callback to close the whole configure dialog, then GMainWindow deletes the old configuration, both on disk and in memory, and reinitalizes a new one. It also resets a portion of the UI and calls the telemetry window prompt.
| * | | | | | configuration: Initial work to reset all settingsfearlessTobi2021-06-016-0/+33
| |/ / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This commit does not compile. Initial work to add and connect a Reset to Defaults button to the configure_general tab. Co-authored-by: german77 <juangerman-13@hotmail.com>
* | | | | | Merge pull request #6411 from clementgallet/yuzu-cmd-touch-buttonMai M2021-06-052-1/+50
|\ \ \ \ \ \ | |_|/ / / / |/| | | | | yuzu-cmd: Add touch_from_button in config file
| * | | | | yuzu-cmd: Add touch_from_button in config fileClément Gallet2021-06-042-1/+50
| | |_|/ / | |/| | |
* | | | | Merge pull request #6392 from german77/controller-widgetbunnei2021-06-043-2/+25
|\ \ \ \ \ | |_|_|/ / |/| | | | settings: Disable controller preview if controller is not active
| * | | | settings: Disable controller preview if controller is not activegerman772021-05-303-2/+25
| | | | |
* | | | | Merge pull request #6389 from german77/Analog_button_fixbunnei2021-06-043-73/+138
|\ \ \ \ \ | | | | | | | | | | | | input_common: Analog button, use time based position
| * | | | | input_common: Analog button, use time based position instead of frequent updatesgerman772021-05-303-73/+138
| |/ / / /
* | / / / [game_list] Correct light theme loading (#6408)Maide2021-06-041-5/+1
| |/ / / |/| | | | | | | | | | | | | | | Correct light theme loading The setLayout call in game list instantiation will call resizing signals with default values in light theme, which was then being erroneously saved. setLayout doesn't seem to call resizing for any other theme, so I'm not sure why that happens.
* | | | Merge pull request #6402 from Kelebek1/UIbunnei2021-06-032-34/+17
|\ \ \ \ | | | | | | | | | | game_list: Stop the columns resizing on NAND install
| * | | | Stop the columns resizing on NAND installKelebek12021-06-022-34/+17
| | | | |
* | | | | Merge pull request #6404 from lat9nq/revert_viewsbunnei2021-06-037-18/+27
|\ \ \ \ \ | | |_|_|/ | |/| | | yuzu qt: Revert some usages of string_view
| * | | | yuzu qt: Revert some usages of string_viewlat9nq2021-06-037-18/+27
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Causes a heap-use-after free reported by AddressSanitizer. This makes use of std::filesystem::path, but due to that we have to use their string() function which may not work for all characters.
* | | | | Merge pull request #6405 from Morph1984/result-successbunnei2021-06-031-1/+1
|\ \ \ \ \ | | | | | | | | | | | | fsp-srv: Replace one last instance of RESULT_SUCCESS
| * | | | | fsp-srv: Replace one last instance of RESULT_SUCCESSMorph2021-06-031-1/+1
|/ / / / /
* | | | | fspsrv: Implement DisableAutoSaveDataCreation (#6355)Chloe2021-06-036-2/+25
| | | | | | | | | | | | | | | - Used by Mii Edit
* | | | | Merge pull request #6308 from Morph1984/resultbunnei2021-06-03116-978/+975
|\ \ \ \ \ | | | | | | | | | | | | general: Replace RESULT_NAME with ResultName
| * | | | | general: Replace RESULT_UNKNOWN with ResultUnknownMorph2021-06-0213-45/+45
| | | | | | | | | | | | | | | | | | | | | | | | Transition to PascalCase for result names.
| * | | | | general: Replace RESULT_SUCCESS with ResultSuccessMorph2021-06-02113-933/+930
| |/ / / / | | | | | | | | | | | | | | | Transition to PascalCase for result names.
* | | | | Merge pull request #6403 from Kewlan/game-list-for-loop-optimizationbunnei2021-06-031-9/+6
|\ \ \ \ \ | |/ / / / |/| | | | game_list: Minor for loop optimizations
| * | | | game_list: Minor for loop optimizationsKewlan2021-06-021-9/+6
| | |_|/ | |/| | | | | | | | | | | | | | There's no need to check the first and last rows since they'll always be the Favorites and AddDir rows. Also change the name of the clear_all variable for consistency.
* | | | Merge pull request #6395 from lioncash/result-moveMorph2021-06-022-25/+25
|\ \ \ \ | | | | | | | | | | common_funcs: Move R_ macros to result.h
| * | | | common_funcs: Move R_ macros to result.hLioncash2021-05-312-25/+25
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | These macros all interact with the result code type, so they should ideally be within this file as well, so all the common_funcs machinery doesn't need to be pulled in just to use them.
* | | | | Merge pull request #6397 from Morph1984/fs_utilMai M2021-06-024-15/+47
|\ \ \ \ \ | |_|_|/ / |/| | | | common: fs: fs_util: Add more string conversion functions
| * | | | common: fs: fs_util: Move PathToUTF8String to fs_utilMorph2021-06-024-15/+14
| | | | |
| * | | | common: fs: fs_util: Add more string conversion functionsMorph2021-06-022-0/+33
|/ / / /
* | | | Merge pull request #6361 from lat9nq/per-hb-cfgbunnei2021-06-028-22/+35
|\ \ \ \ | |_|/ / |/| | | yuzu qt: Handle per-game configs for title id 0
| * | | yuzu qt: Restore const qualifierslat9nq2021-05-262-23/+12
| | | | | | | | | | | | | | | | | | | | | | | | This addresses review comments. Co-authored-by: LC <mathew1800@gmail.com>
| * | | yuzu qt: Handle per-game configs for title id 0lat9nq2021-05-268-22/+46
| | | | | | | | | | | | | | | | | | | | | | | | | | | | Currently with programs that have a 0 title id, yuzu loads the custom configuration 0000000000000000.ini for per-game configs. This is not ideal since many homebrews share this id. Instead for these programs, we load a config that is simply the file name and `.ini` appended to it.
* | | | Merge pull request #6396 from lat9nq/mingw-sdl-fixMorph2021-06-011-11/+13
|\ \ \ \ | | | | | | | | | | externals: Use defaults for building SDL2 on WIN32
| * | | | externals: Use defaults for building SDL2 on WIN32lat9nq2021-05-311-11/+13
| | |/ / | |/| | | | | | | | | | | | | | | | | | Whatever those settings do breaks controller detection on Windows, at least with the MinGW container. If-guard it against WIN32 and just let SDL2 configure using its defaults, aside from static linking.
* | | | Merge pull request #6318 from german77/dualJoyconbunnei2021-06-012-60/+258
|\ \ \ \ | | | | | | | | | | input_common: Add dual joycon support
| * | | | input_common: Add dual joycon supportgerman772021-05-232-60/+258
| | | | |
* | | | | Merge pull request #6367 from ReinUsesLisp/vma-hostbunnei2021-06-012-31/+43
|\ \ \ \ \ | |_|/ / / |/| | | | vulkan_memory_allocator: Allow textures to be allocated in host memory
| * | | | vulkan_memory_allocator: Allow textures to be allocated in host memoryReinUsesLisp2021-05-272-31/+43
| | | | | | | | | | | | | | | | | | | | | | | | | Allow Vulkan's allocator to use host memory when there's no more device local memory. This delays OOM, but it will eventually still happen.
* | | | | Merge pull request #6394 from lat9nq/mingw-fixAmeer J2021-05-313-139/+226
|\ \ \ \ \ | | | | | | | | | | | | externals: libusb: Use autotools for MinGW
| * | | | | externals: libusb: Use autotools for MinGWlat9nq2021-05-313-139/+226
|/ / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | After updating to 1.0.24, MinGW fails to build libusb as a result of numerous errors. So we build libusb their way and let them update the nontrivial stuff. This only applies to MinGW: the old path is still in use for Linux toolchains as well as MSVC. This will dynamically link libusb, since I hit build errors with the old way we used to resolve the conflict with SDL2.
* | | | | Merge pull request #6385 from degasus/save_memory_accessbunnei2021-05-315-33/+77
|\ \ \ \ \ | | | | | | | | | | | | core/memory: Check our memory fallbacks for out-of-bound behavior.
| * | | | | core/memory: Check our memory fallbacks for out-of-bound behavior.Markus Wick2021-05-293-4/+46
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This makes it by far harder to crash yuzu. Also implement the 48bit masking of AARCH64 while touching this code.
| * | | | | core/arm_interface: Improve the performance of memory fallbacks.Markus Wick2021-05-292-29/+31
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | We just create one memory subsystem. This is a constant all the time. So there is no need to call the non-inlined parent.Memory() helper on every callback.
* | | | | | Merge pull request #6344 from german77/update-libusbbunnei2021-05-302-3/+3
|\ \ \ \ \ \ | | | | | | | | | | | | | | Update libusb to 1.0.24
| * | | | | | Update libusb to 1.0.24german772021-05-212-3/+3
| | | | | | |
* | | | | | | Merge pull request #6377 from lioncash/pointbunnei2021-05-305-39/+75
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | common: Extract Point struct into common
| * | | | | | | touchscreen: Make use of common point structLioncash2021-05-282-10/+10
| | | | | | | |
| * | | | | | | common: Extract point into a common structLioncash2021-05-283-29/+65
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This is generic enough that it can be moved into the Common class for reuse.
* | | | | | | | Merge pull request #6387 from lioncash/class-tokenbunnei2021-05-301-43/+36
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | k_class_token: Use variable templates where applicable
| * | | | | | | | k_class_token: Use variable templates where applicableLioncash2021-05-291-43/+36
| |/ / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | Same behavior, less code.
* | | | | | | | Merge pull request #6386 from bunnei/shutdown-fixbunnei2021-05-302-1/+13
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | video_core: gpu: WaitFence: Do not block threads during shutdown.
| * | | | | | | | video_core: gpu: WaitFence: Do not block threads during shutdown.bunnei2021-05-292-1/+13
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | - Fixes a hang on shutdown when NVFlinger thread is waiting on a syncpoint that will never occur. - Commonly observed when stopping emulation in Super Mario Odyssey.
* | | | | | | | | ci: build-msvc: Remove CMake install step.bunnei2021-05-301-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | - This is breaking our build pipelines with Zydis (dynarmic dependency).
* | | | | | | | | Merge pull request #6374 from Morph1984/swkbd-textcheck-encodingMai M2021-05-302-24/+26
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | applets/swkbd: Only read the text check message on Failure/Confirm
| * | | | | | | | | applets/swkbd: Make use of std::move where applicableMorph2021-05-282-22/+19
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Avoids redundant string copies
| * | | | | | | | | applets/swkbd: Only read the text check message on Failure/ConfirmMorph2021-05-281-2/+7
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Applications may leave this region of memory uninitialized when the text check result is not either Failure or Confirm. Attempting to read uninitialized memory may cause an exception within the UTF16 to UTF8 string converter. Fix this by only reading the text check message on Failure or Confirm.
* | | | | | | | | | Merge pull request #6364 from german77/stub-lp2pMai M2021-05-301-0/+141
|\ \ \ \ \ \ \ \ \ \ | |_|_|_|_|_|_|_|_|/ |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | ldn: Add and stub lp2p:sys lp2p:app INetworkServiceMonitor INetworkService Mario Kart Live: Home Circuit needs lp2p:sys lp2p:app INetworkServiceMonitor INetworkService to be able to progress. Note: The game still fails to boot from unimplemented LDN and BSD services.
| * | | | | | | | | ldn: Add and stub lp2p:sys lp2p:app INetworkServiceMonitor INetworkServicegerman772021-05-261-0/+141
| | | | | | | | | |
* | | | | | | | | | Merge pull request #6379 from degasus/update_dynarmicbunnei2021-05-297-11/+11
|\ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | externals: Update dynarmic.
| * | | | | | | | | | externals: Update dynarmic.Markus Wick2021-05-297-11/+11
| | |_|_|_|_|/ / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | The new version supports fastmem on a64.
* | | | | | | | | | Merge pull request #6384 from lioncash/virtualbunnei2021-05-2915-53/+48
|\ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | kernel: Add missing override specifiers
| * | | | | | | | | | kernel: Add missing override specifiersLioncash2021-05-2915-53/+48
| | |_|_|_|/ / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Over the course of the kernel refactoring a tiny bit of missing overrides slipped through review, so we can add these. While we're at it, we can remove redundant virtual keywords where applicable as well.
* | | | | | | | | | Merge pull request #6382 from lioncash/nullbunnei2021-05-291-5/+5
|\ \ \ \ \ \ \ \ \ \ | |_|_|_|_|/ / / / / |/| | | | | | | | | k_thread: Move dereference after null check in Initialize()
| * | | | | | | | | k_thread: Move dereference after null check in Initialize()Lioncash2021-05-291-5/+5
| |/ / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | Prevents a -Wnonnull warning on GCC.
* | | | | | | | | Merge pull request #6373 from bunnei/use-slabheap-tlsbunnei2021-05-292-11/+191
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | hle: kernel: KSlabHeap: Allow host or guest allocations.
| * | | | | | | | | hle: kernel: KSlabHeap: Allow host or guest allocations.bunnei2021-05-292-11/+191
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | - Use host allocations for kernel memory, as this is not properly emulated yet. - Use guest allocations for TLS, as this needs to be backed by DeviceMemory.
* | | | | | | | | | Merge pull request #6383 from degasus/fix_gcc_warningsMai M2021-05-292-3/+3
|\ \ \ \ \ \ \ \ \ \ | |_|_|/ / / / / / / |/| | | | | | | | | Fix two GCC 11 warnings: Unneeded copies.
| * | | | | | | | | Fix two GCC 11 warnings: Unneeded copies.Markus Wick2021-05-292-3/+3
|/ / / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | std::move created an unneeded copy. iterating without reference also created copies.
* | | | | | | | | Merge pull request #6371 from degasus/drop_ExceptionalExitbunnei2021-05-296-18/+42
|\ \ \ \ \ \ \ \ \ | |/ / / / / / / / |/| | | | | | | | core/arm_interface: Call SVC after end of dynarmic block.
| * | | | | | | | core/arm_interface: Call SVC after end of dynarmic block.Markus Wick2021-05-276-18/+42
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | So we can modify all of dynarmic states within SVC without ExceptionalExit. Especially as the ExceptionalExit hack is dropped on upstream dynarmic.
* | | | | | | | | Merge pull request #6356 from ogniK5377/ApplyNpadSystemCommonPolicybunnei2021-05-281-1/+10
|\ \ \ \ \ \ \ \ \ | |_|/ / / / / / / |/| | | | | | | | hid: ApplyNpadSystemCommonPolicy
| * | | | | | | | hid: ApplyNpadSystemCommonPolicyChloe Marcec2021-05-241-1/+10
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | We already do this specifically for homebrew, so we can keep it stubbed out for the time being
* | | | | | | | | Merge pull request #6375 from lioncash/iofsMorph2021-05-281-4/+7
|\ \ \ \ \ \ \ \ \ | |_|_|_|/ / / / / |/| | | | | | | | common/fs/file: Default initialize IOFile members
| * | | | | | | | common/fs/file: Explicitly delete copy constructorsLioncash2021-05-281-1/+4
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Relocates them to the same place the move equivalents are at for consistent viewing.
| * | | | | | | | common/fs/file: Devirtualize destructorLioncash2021-05-281-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | IOFile is a final class, so there's no need for a virtual destructor.
| * | | | | | | | common/fs/file: Default initialize IOFile membersLioncash2021-05-281-2/+2
|/ / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | Prevents a potential uninitialized read vector in the move constructor.
* | | | | | | | Merge pull request #6372 from bunnei/raster-cache-fixbunnei2021-05-282-9/+9
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | video_core: rasterizer_cache: Use u16 for cached page count.
| * | | | | | | | video_core: rasterizer_cache: Use u16 for cached page count.bunnei2021-05-272-9/+9
| | |/ / / / / / | |/| | | | | | | | | | | | | | | | | | | | | | - Greatly reduces the risk of overflow, at the cost of doubling the size of this array.
* | | | | | | | Merge pull request #6369 from lat9nq/cmake-fix-dep-optMai M2021-05-271-2/+2
|\ \ \ \ \ \ \ \ | |/ / / / / / / |/| | | | | | | cmake: Fix usage of CMAKE_DEPENDENT_OPTION
| * | | | | | | cmake: Fix usage of CMAKE_DEPENDENT_OPTIONlat9nq2021-05-271-2/+2
| | |_|_|/ / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | CMAKE_DEPENDENT_OPTION takes a value argument, but as a macro function it will read a variable name as the name and not the value. For YUZU_USE_BUNDLED_QT, ensure that we are reading the value of MSVC. For YUZU_ALLOW_SYSTEM_SDL2, CMAKE_DEPENDENT_OPTION is redundant here anyway as we don't use that path on any toolchain by default.
* | | | | | | Merge pull request #6346 from lat9nq/apply-config-pgcAmeer J2021-05-276-18/+57
|\ \ \ \ \ \ \ | |/ / / / / / |/| | | | | | yuzu qt: Add an Apply button to configuration dialogs
| * | | | | | yuzu qt: Add an Apply button to configuration dialogslat9nq2021-05-256-18/+57
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Most of the code already exists to do this, but the Apply button itself was never added. This adds a button and boolean that tells yuzu to save the configuration after applying settings, even if close/Cancel is pressed on the dialog. Changes after applying will not be saved when Cancel is pressed, though.
* | | | | | | Merge pull request #6366 from lat9nq/bundled-qt-linuxMai M2021-05-273-46/+134
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | cmake: Download Qt binaries on Linux if needed
| * | | | | | | cmake: Download Qt binaries on Linux if neededlat9nq2021-05-263-46/+134
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | If the local version of Qt is older than the minimum version required by yuzu, download a pre-built binary package from yuzu-emu/ext-linux-bin and build yuzu with it, instead. This also requires linking yuzu to the correct libraries after building it, and copying over the required binaries when building yuzu. This sets the Qt requirement to 5.12, which is intentionally behind the versions used by our toolchains since they are not all updated yet to 5.15.
* | | | | | | | Merge pull request #6365 from degasus/drop_ChangeProcessorIDMai M2021-05-275-12/+0
|\ \ \ \ \ \ \ \ | |_|_|_|/ / / / |/| | | | | | | core/arm: Drop ChangeProcessorID.
| * | | | | | | core/arm: Drop ChangeProcessorID.Markus Wick2021-05-265-12/+0
|/ / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This code was used to switch the CPU ID on thread switches. However since "hle: kernel: multicore: Replace n-JITs impl. with 4 JITs.", the CPU ID is not a constant. This has been dead code since this rewrite, and dropped in dynarmic as well. So there is no need to keep it.
* | | | | | | Merge pull request #6331 from lioncash/gestureMorph2021-05-262-67/+79
|\ \ \ \ \ \ \ | |/ / / / / / |/| | | | | | hid/gesture: Simplify point related code
| * | | | | | hid/gesture: Factor out last gesture retrieval into its own functionLioncash2021-05-182-14/+23
| | | | | | | | | | | | | | | | | | | | | | | | | | | | Deduplicates a commonly repeated expression.
| * | | | | | hid/gesture: Ensure all ID arrays are initializedLioncash2021-05-181-4/+4
| | | | | | | | | | | | | | | | | | | | | | | | | | | | Makes for deterministic initial state.
| * | | | | | hid/gesture: Make Point a templateLioncash2021-05-182-38/+46
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | We can now use this in a generic context to reuse it with the finger position.
| * | | | | | hid/gesture: Replace x,y members of GestureState with a PointLioncash2021-05-182-6/+4
| | | | | | | | | | | | | | | | | | | | | | | | | | | | Simplifies assignments.
| * | | | | | hid/gesture: Add default comparators to PointLioncash2021-05-182-10/+7
| | | | | | | | | | | | | | | | | | | | | | | | | | | | Simplifies some comparisons.
| * | | | | | hid/gesture: Rename Points to PointLioncash2021-05-181-5/+5
| | | | | | | | | | | | | | | | | | | | | | | | | | | | This only represents a single point
* | | | | | | Merge pull request #6339 from Morph1984/swkbd-queuedconnectionbunnei2021-05-261-15/+3
|\ \ \ \ \ \ \ | |_|_|_|_|_|/ |/| | | | | | applets/swkbd: Make use of QueuedConnection in returnPressed signal
| * | | | | | applets/swkbd: Make use of QueuedConnection in returnPressed signalMorph2021-05-221-15/+3
| | |_|_|_|/ | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | Some users have reported rare crashes when pressing the Enter key on the keyboard to confirm input in the normal software keyboard, particularly in Super Smash Bros. Ultimate while entering the name of a ruleset or controller layout. It is suspected that the QLineEdit::returnPressed signal is causing a race condition as confirming input through other means does not produce the crash. Since Qt::QueuedConnection posts an event to the event queue of the callee's thread instead of executing it directly on the caller's thread, this eliminates any potential race conditions from occurring in this scenario.
* | | | | | common: fs: Rework the Common Filesystem interface to make use of std::filesystem (#6270)Morph2021-05-2674-2173/+3789
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * common: fs: fs_types: Create filesystem types Contains various filesystem types used by the Common::FS library * common: fs: fs_util: Add std::string to std::u8string conversion utility * common: fs: path_util: Add utlity functions for paths Contains various utility functions for getting or manipulating filesystem paths used by the Common::FS library * common: fs: file: Rewrite the IOFile implementation * common: fs: Reimplement Common::FS library using std::filesystem * common: fs: fs_paths: Add fs_paths to replace common_paths * common: fs: path_util: Add the rest of the path functions * common: Remove the previous Common::FS implementation * general: Remove unused fs includes * string_util: Remove unused function and include * nvidia_flags: Migrate to the new Common::FS library * settings: Migrate to the new Common::FS library * logging: backend: Migrate to the new Common::FS library * core: Migrate to the new Common::FS library * perf_stats: Migrate to the new Common::FS library * reporter: Migrate to the new Common::FS library * telemetry_session: Migrate to the new Common::FS library * key_manager: Migrate to the new Common::FS library * bis_factory: Migrate to the new Common::FS library * registered_cache: Migrate to the new Common::FS library * xts_archive: Migrate to the new Common::FS library * service: acc: Migrate to the new Common::FS library * applets/profile: Migrate to the new Common::FS library * applets/web: Migrate to the new Common::FS library * service: filesystem: Migrate to the new Common::FS library * loader: Migrate to the new Common::FS library * gl_shader_disk_cache: Migrate to the new Common::FS library * nsight_aftermath_tracker: Migrate to the new Common::FS library * vulkan_library: Migrate to the new Common::FS library * configure_debug: Migrate to the new Common::FS library * game_list_worker: Migrate to the new Common::FS library * config: Migrate to the new Common::FS library * configure_filesystem: Migrate to the new Common::FS library * configure_per_game_addons: Migrate to the new Common::FS library * configure_profile_manager: Migrate to the new Common::FS library * configure_ui: Migrate to the new Common::FS library * input_profiles: Migrate to the new Common::FS library * yuzu_cmd: config: Migrate to the new Common::FS library * yuzu_cmd: Migrate to the new Common::FS library * vfs_real: Migrate to the new Common::FS library * vfs: Migrate to the new Common::FS library * vfs_libzip: Migrate to the new Common::FS library * service: bcat: Migrate to the new Common::FS library * yuzu: main: Migrate to the new Common::FS library * vfs_real: Delete the contents of an existing file in CreateFile Current usages of CreateFile expect to delete the contents of an existing file, retain this behavior for now. * input_profiles: Don't iterate the input profile dir if it does not exist Silences an error produced in the log if the directory does not exist. * game_list_worker: Skip parsing file if the returned VfsFile is nullptr Prevents crashes in GetLoader when the virtual file is nullptr * common: fs: Validate paths for path length * service: filesystem: Open the mod load directory as read only
* | | | | | Merge pull request #6349 from german77/suppress_config_warningbunnei2021-05-261-3/+3
|\ \ \ \ \ \ | | | | | | | | | | | | | | settings: Suppress duplicate label name warning
| * | | | | | settings: Suppress duplicate label name warninggerman772021-05-231-3/+3
| |/ / / / /
* | | | | | Merge pull request #6348 from lioncash/zstdbunnei2021-05-251-1/+1
|\ \ \ \ \ \ | | | | | | | | | | | | | | CMakeLists: Update zstd to 1.5.0
| * | | | | | CMakeLists: Update zstd to 1.5.0Lioncash2021-05-211-1/+1
| |/ / / / / | | | | | | | | | | | | | | | | | | | | | | | | zstd 1.5.0 brings numerous performance improvements to the library, as can be seen here: https://github.com/facebook/zstd/releases/tag/v1.5.0
* | | | | | Merge pull request #6353 from german77/handheld_dockedbunnei2021-05-253-4/+24
|\ \ \ \ \ \ | | | | | | | | | | | | | | settings: Forbid docked mode on handheld
| * | | | | | settings: Forbid docked mode on handheldgerman772021-05-243-4/+24
| |/ / / / /
* | | | | | Merge pull request #6358 from Morph1984/k_map_regionMai M2021-05-252-0/+12
|\ \ \ \ \ \ | | | | | | | | | | | | | | kernel: process_capability: Add MapRegion capability
| * | | | | | kernel: process_capability: Add MapRegion capabilityMorph2021-05-252-0/+12
|/ / / / / / | | | | | | | | | | | | | | | | | | - Used by nx-hbloader
* | | | | | Merge pull request #6357 from lioncash/compressionbunnei2021-05-254-7/+8
|\ \ \ \ \ \ | | | | | | | | | | | | | | common/compression: Make use of std::span
| * | | | | | zstd_compression: Make use of std::spanLioncash2021-05-242-3/+4
| | | | | | | | | | | | | | | | | | | | | | | | | | | | Allows for the incoming data stream to be non-allocating.
| * | | | | | lz4_compression: Make use of std::spanLioncash2021-05-242-4/+4
| |/ / / / / | | | | | | | | | | | | | | | | | | Allows making the incoming data stream non-allocating.
* | | | | | Merge pull request #6312 from german77/analogMappingbunnei2021-05-241-26/+28
|\ \ \ \ \ \ | |_|_|_|/ / |/| | | | | input_common: Rewrite sdl analog mapping and fix controller disconnection crash
| * | | | | input_common: Fix crash when controller disconnectsgerman772021-05-151-1/+3
| | | | | |
| * | | | | input_common: Rewrite sdl analog mappinggerman772021-05-151-25/+25
| | | | | |
* | | | | | Merge pull request #6347 from bunnei/ipc-improvements-next-2bunnei2021-05-2422-356/+249
|\ \ \ \ \ \ | |_|/ / / / |/| | | | | Various improvements to IPC and session management (Part 2)
| * | | | | hle: kernel: service_thread: Take reference to KServerSession on service request.bunnei2021-05-211-9/+5
| | | | | |
| * | | | | hle: kernel: k_port: Use AcceptSession to ensure SessionList state is correct.bunnei2021-05-211-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | - Fixes a use-after-free, work-around until we fixup session/port management.
| * | | | | hle: kernel: Use host memory allocations for KSlabMemory.bunnei2021-05-214-174/+20
| | | | | | | | | | | | | | | | | | | | | | | | - There are some issues with the current workaround, we will just use host memory until we have a complete kernel memory implementation.
| * | | | | Revert "WORKAROUND: Do not use slab heap while we track down issues with resource management."bunnei2021-05-211-2/+2
| | | | | | | | | | | | | | | | | | | | | | | | This reverts commit f2c26443f85a3c3fd43137509368ba5c7ab80ee7.
| * | | | | hle: kernel: hle_ipc: Simplify incoming/outgoing move/copy/domain objects.bunnei2021-05-213-62/+17
| | | | | |
| * | | | | common: tree: Avoid a crash on nullptr dereference.bunnei2021-05-211-0/+11
| | | | | |
| * | | | | hle: kernel: Implement CloneCurrentObject and improve session management.bunnei2021-05-2113-99/+184
| | | | | |
| * | | | | Revert "WORKAROUND: temp. disable session resource limits while we work out issues"bunnei2021-05-214-11/+11
| | | | | | | | | | | | | | | | | | | | | | | | This reverts commit fc086f93b2165b5c210cb7dcd6c18ebe17f1fd7b.
* | | | | | Merge pull request #6248 from A-w-x/intelmesabunnei2021-05-211-1/+1
|\ \ \ \ \ \ | | | | | | | | | | | | | | gl_device: Intel: Disable texture view formats workaround on mesa
| * | | | | | gl_device: Intel: Disable texture view formats workaround on mesaA-w-x2021-04-261-1/+1
| | | | | | |
* | | | | | | Merge pull request #6333 from Morph1984/swkbd-confirm-textbunnei2021-05-211-8/+8
|\ \ \ \ \ \ \ | |_|/ / / / / |/| | | | | | applets/swkbd: Send the correct text string on TextCheck::Confirm
| * | | | | | applets/swkbd: Send the correct text string on TextCheck::ConfirmMorph2021-05-191-8/+8
| | | | | | | | | | | | | | | | | | | | | | | | | | | | Previously the text string for the inline software keyboard was being sent instead of the normal software keyboard, leading to empty text being sent all the time.
* | | | | | | Merge pull request #6320 from Morph1984/get-pidbunnei2021-05-212-9/+14
|\ \ \ \ \ \ \ | |_|_|_|_|/ / |/| | | | | | hle_ipc: Add a getter for PID
| * | | | | | hle_ipc: unsigned -> u32Morph2021-05-161-7/+7
| | | | | | | | | | | | | | | | | | | | | | | | | | | | This is more concise and consistent with the rest of the codebase.
| * | | | | | hle_ipc: Add a getter for PIDMorph2021-05-162-2/+7
| | | | | | |
* | | | | | | Merge pull request #6321 from lat9nq/per-game-cpubunnei2021-05-2120-302/+290
|\ \ \ \ \ \ \ | |_|_|_|_|_|/ |/| | | | | | configuration: Add CPU tab to game properties and slight per-game settings rework
| * | | | | | configure_cpu: Simplify UpdateGrouplat9nq2021-05-201-7/+4
| | | | | | | | | | | | | | | | | | | | | Co-authored-by: Ameer J <52414509+ameerj@users.noreply.github.com>
| * | | | | | configuration_shared: Drop unused function and template anotherlat9nq2021-05-192-52/+7
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Drops an unused variant of ApplyPerGameSetting, and turns the QComboBox variants of SetPerGameSetting into a template. Co-authored-by: Ameer J <52414509+ameerj@users.noreply.github.com>
| * | | | | | general: Demote custom_rtc to regular settinglat9nq2021-05-176-58/+30
| | | | | | |
| * | | | | | configuration: Add CPU tab to game propertieslat9nq2021-05-1613-88/+181
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Allows setting CPU accuracy to Accurate or Unsafe per-game, as well as the accuracy options for Unsafe. Debug is not allowed here as a per-game CPU accuracy.
| * | | | | | configuration: Simplify applying per-game settingslat9nq2021-05-166-112/+69
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Originally, every time we add a per-game setting, we'd have to guard for it when setting it on the global config, and use a specific function to do it for the per-game config. This moves the global check into the ApplyPerGameSetting function so that we can use it for changing both the global and per-game states. Less work for the programmer.
| * | | | | | configuration_shared: Add some commentslat9nq2021-05-161-6/+14
| | | | | | | | | | | | | | | | | | | | | | | | | | | | Monke brain can't remember what all of these does a year later.
| * | | | | | general: Make CPU accuracy and related a Settings::Settinglat9nq2021-05-167-41/+47
| | |_|_|/ / | |/| | | | | | | | | | | | | | | | | | | | | | Required to make CPU accuracy and unsafe settings available to use as a per-game setting.
* | | | | | Merge pull request #6297 from lioncash/common-convbunnei2021-05-201-1/+2
|\ \ \ \ \ \ | | | | | | | | | | | | | | parent_of_member: Make sign conversion explicit in OffsetOfImpl()
| * | | | | | parent_of_member: Make sign conversion explicit in OffsetOfImpl()Lioncash2021-05-101-1/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Previously these conversions were implicit and causing quite a few warnings on clang.
* | | | | | | Merge pull request #6310 from german77/nanMotionbunnei2021-05-201-0/+23
|\ \ \ \ \ \ \ | |_|_|_|/ / / |/| | | | | | input_common: Sanitize motion data
| * | | | | | input_common: Sanitize motion datagerman772021-05-131-0/+23
| | | | | | |
* | | | | | | Merge pull request #6317 from ameerj/fps-fixbunnei2021-05-1910-14/+26
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | perf_stats: Rework FPS counter to be more accurate
| * | | | | | | perf_stats: Rework FPS counter to be more accurateameerj2021-05-1610-14/+26
| | |_|/ / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The FPS counter was based on metrics in the nvdisp swapbuffers call. This metric would be accurate if the gpu thread/renderer were synchronous with the nvdisp service, but that's no longer the case. This commit moves the frame counting responsibility onto the concrete renderers after their frame draw calls. Resulting in more meaningful metrics. The displayed FPS is now made up of the average framerate between the previous and most recent update, in order to avoid distracting FPS counter updates when framerate is oscillating between close values. The status bar update frequency was also changed from 2 seconds to 500ms.
* | | | | | | Merge pull request #6337 from Morph1984/transfer-mem-sizebunnei2021-05-181-1/+1
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | KTransferMemory: Return size instead of size * PageSize in GetSize()
| * | | | | | | KTransferMemory: Return size instead of size * PageSize in GetSize()Morph2021-05-181-1/+1
|/ / / / / / / | | | | | | | | | | | | | | | | | | | | | size is already the size in bytes. We do not need to multiply it by the page size
* | | | | | | Merge pull request #6322 from ameerj/fast-null-bufferbunnei2021-05-181-1/+4
|\ \ \ \ \ \ \ | |_|_|_|_|_|/ |/| | | | | | buffer_cache: Ensure null buffers cannot take the fast uniform bind path
| * | | | | | buffer_cache: Ensure null buffers cannot take the fast uniform bind pathameerj2021-05-161-1/+4
| |/ / / / / | | | | | | | | | | | | | | | | | | Fixes a crash in New Pokemon Snap
* | | | | | Merge pull request #6328 from Morph1984/enforce-c4715Mat M2021-05-171-0/+1
|\ \ \ \ \ \ | | | | | | | | | | | | | | CMakeLists: Enforce C4715 on MSVC
| * | | | | | CMakeLists: Enforce C4715 on MSVCMorph2021-05-171-0/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | This is similar to -Werror=return-type
* | | | | | | Merge pull request #6327 from Morph1984/duplicate_labelsbunnei2021-05-171-5/+5
|\ \ \ \ \ \ \ | |/ / / / / / |/| | | | | | configure_debug: FIx duplicate labels
| * | | | | | configure_debug: FIx duplicate labelsMorph2021-05-171-5/+5
|/ / / / / / | | | | | | | | | | | | | | | | | | Duplicate labels were unintentionally introduced due to copy-paste. This silences the compilation warning produced by the presence of these duplicates.
* | | | | | Merge pull request #6326 from Morph1984/fix-versionbunnei2021-05-173-14/+17
|\ \ \ \ \ \ | | | | | | | | | | | | | | yuzu/main: Fix version info in logging and about dialog
| * | | | | | yuzu/main: Fix version info in logging and about dialogMorph2021-05-173-14/+17
|/ / / / / /
* | | | | | Merge pull request #6319 from Morph1984/no-install-basebunnei2021-05-174-3/+28
|\ \ \ \ \ \ | | | | | | | | | | | | | | main: Prevent installing base titles into NAND
| * | | | | | main: Prevent installing base titles into NANDMorph2021-05-164-3/+28
| | |_|_|/ / | |/| | | | | | | | | | | | | | | | Many users have been installing their base titles into NAND instead of adding them into the games list. This prevents users from installing any base titles and warns the user about the action.
* | | | | | Merge pull request #6324 from lat9nq/appimage-freezeAmeer J2021-05-162-5/+5
|\ \ \ \ \ \ | | | | | | | | | | | | | | ci: linux: Freeze AppImage binaries
| * | | | | | ci: linux: Freeze AppImage binarieslat9nq2021-05-162-5/+5
| | |/ / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | A regression was introduced on May 13 by linuxdeploy that causes file open dialogs to crash yuzu in the AppImage (likely this commit 1e28ee38fa174279defe70cdaadf2a552c80258c from linuxdeploy/linuxdeploy-desktopfile). Instead of downloading the latest version from each of the repos we use to build the AppImage, just download the ones hosted at yuzu-emu/ext-linux-bin, which are the same binaries we have been using, but verified to be working and won't update on us beyond our control. This can eventually be moved into the container itself to remove the need to download them at build time.
* | | | | | Merge pull request #6284 from ameerj/shantae-fixbunnei2021-05-162-5/+35
|\ \ \ \ \ \ | | | | | | | | | | | | | | nvflinger: Create layers when they are queried but not found
| * | | | | | nvflinger: Create layers when they are queried but not foundameerj2021-05-062-5/+35
| | | | | | | | | | | | | | | | | | | | | | | | | | | | Fixes Shantae softlock on boot.
* | | | | | | Merge pull request #6296 from lioncash/shadow-errorbunnei2021-05-1699-279/+304
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | core: Make variable shadowing a compile-time error
| * | | | | | | core: Make variable shadowing a compile-time errorLioncash2021-05-1699-279/+304
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Now that we have most of core free of shadowing, we can enable the warning as an error to catch anything that may be remaining and also eliminate this class of logic bug entirely.
* | | | | | | | Merge pull request #6307 from Morph1984/fix-response-push-sizebunnei2021-05-162-2/+2
|\ \ \ \ \ \ \ \ | |_|_|_|/ / / / |/| | | | | | | nifm, ssl: Fix incorrect response sizes
| * | | | | | | nifm, ssl: Fix incorrect response sizesMorph2021-05-162-2/+2
| | | | | | | |
* | | | | | | | Merge pull request #6293 from v1993/masterMorph2021-05-162-12/+30
|\ \ \ \ \ \ \ \ | |_|/ / / / / / |/| | | | | | | On Linux, build SDL2 from externals with HIDAPI support
| * | | | | | | Only build SDL2 subsystems that we usev19932021-05-101-1/+12
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | While at it, use better way to enable HIDAPI.
| * | | | | | | On Linux, build SDL2 from externals with HIDAPI supportv19932021-05-092-12/+19
| | | | | | | |
* | | | | | | | Merge pull request #6316 from ameerj/title-fixbunnei2021-05-161-11/+6
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | main: Add running title's version to window name on EA/mainline
| * | | | | | | | main: Add title's version to window name on EA/mainlineameerj2021-05-151-11/+6
| | |_|_|/ / / / | |/| | | | | | | | | | | | | | | | | | | | | | Fixes the missing title version number on EA/mainline builds which override the title bar string.
* | | | | | | | Merge pull request #6299 from bunnei/ipc-improvementsbunnei2021-05-1619-220/+354
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | Various improvements to IPC and session management
| * | | | | | | | common: tree: Avoid a nullptr dereference.bunnei2021-05-121-1/+1
| | | | | | | | |
| * | | | | | | | hle: kernel: hle_ipc: Fix outgoing IPC response size calculation.bunnei2021-05-113-1/+15
| | | | | | | | |
| * | | | | | | | WORKAROUND: temp. disable session resource limits while we work out issuesbunnei2021-05-114-11/+11
| | | | | | | | |
| * | | | | | | | WORKAROUND: Do not use slab heap while we track down issues with resource management.bunnei2021-05-111-2/+2
| | | | | | | | |
| * | | | | | | | audrenbunnei2021-05-112-25/+16
| | | | | | | | |
| * | | | | | | | core: hle: ipc_helpers: Fix cast on raw_data_size calculation.bunnei2021-05-111-1/+1
| | | | | | | | |
| * | | | | | | | hle: service: sm: Add TIPC support.bunnei2021-05-112-41/+66
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | - Fixes our error checking of names as well.
| * | | | | | | | hle: kernel: hle_ipc: Improve IPC code and add initial support for TIPC.bunnei2021-05-112-81/+57
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | - Fixes our move handles implementation to actually move objects. - Simplifies the traditional IPC path.
| * | | | | | | | hle: service: sm: GetService: Reserve session resource when we create a KSession.bunnei2021-05-111-0/+7
| | | | | | | | |
| * | | | | | | | hle: service: Add support for dispatching TIPC requests.bunnei2021-05-112-1/+52
| | | | | | | | |
| * | | | | | | | hle: service: Implement IPC::CommandType::Close.bunnei2021-05-113-11/+15
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | - This was not actually closing sessions before.
| * | | | | | | | hle: service: sm: Use RegisterNamedService to register the service.bunnei2021-05-111-1/+1
| | | | | | | | |
| * | | | | | | | hle: service: sm: Improve Initialize implementation.bunnei2021-05-112-0/+3
| | | | | | | | |
| * | | | | | | | hle: kernel: svc: Update ConnectToNamedPort to use new CreateNamedServicePort interface.bunnei2021-05-111-4/+3
| | | | | | | | |
| * | | | | | | | hle: kernel: Implement named service ports using service interface factory.bunnei2021-05-114-22/+30
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | - This allows us to create a new interface each time ConnectToNamedPort is called, removing the assumption that these are static.
| * | | | | | | | hle: kernel: KSession: Improve implementation of CloneCurrentObject.bunnei2021-05-111-2/+10
| | | | | | | | |
| * | | | | | | | hle: service: sm: Increase point buffer size.bunnei2021-05-111-1/+1
| | | | | | | | |
| * | | | | | | | hle: ipc_helpers: Reserve session resource when we create a KSession.bunnei2021-05-111-0/+5
| | | | | | | | |
| * | | | | | | | hle: kernel: KClientPort: Cleanup comment format.bunnei2021-05-111-1/+1
| | | | | | | | |
| * | | | | | | | hle: ipc: Add declarations for TIPC.bunnei2021-05-111-1/+16
| | | | | | | | |
| * | | | | | | | hle: kernel: Further cleanup and add TIPC helpers.bunnei2021-05-112-4/+12
| | | | | | | | |
| * | | | | | | | hle: ipc_helpers: Update IPC response generation for TIPC.bunnei2021-05-112-19/+39
| | |_|_|_|_|/ / | |/| | | | | |
* | | | | | | | Merge pull request #6289 from ameerj/oob-blitbunnei2021-05-168-61/+99
|\ \ \ \ \ \ \ \ | |_|_|_|/ / / / |/| | | | | | | texture_cache: Handle out of bound texture blits
| * | | | | | | texture_cache: Handle out of bound texture blitsameerj2021-05-088-61/+99
| | |_|_|/ / / | |/| | | | | | | | | | | | | | | | | | | Some games interleave a texture blit using regions which are out-of-bounds. This addresses the interleaving to avoid oob reads from the src texture.
* | | | | | | Merge pull request #6244 from german77/sdlmotionMorph2021-05-165-3/+167
|\ \ \ \ \ \ \ | |_|_|/ / / / |/| | | | | | input_common: Implement SDL motion
| * | | | | | input_common: Implement SDL motiongerman772021-05-155-3/+167
|/ / / / / /
* | | | | | Merge pull request #6300 from Morph1984/mbedtlsAmeer J2021-05-141-0/+0
|\ \ \ \ \ \ | | | | | | | | | | | | | | externals: Update mbedtls to 8c88150ca
| * | | | | | externals: Update mbedtls to 8c88150caMorph2021-05-111-0/+0
| | |/ / / / | |/| | | |
* | | | | | Merge pull request #6306 from lat9nq/ffmpeg-untaggedMorph2021-05-131-0/+0
|\ \ \ \ \ \ | | | | | | | | | | | | | | externals: Checkout 79e8d17024 for FFmpeg
| * | | | | | externals: Checkout 79e8d17024 for FFmpeglat9nq2021-05-131-0/+0
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | 6b6b9e593d does not exist on FFmpeg master, and tag n4.3.1 requires manually fetching all of FFmpeg's tags. `git` reports that the commit does not exist initially and can be confusing as a result. Instead, checkout the immediately previous commit from n4.3.1 on their master branch.
* | | | | | | Merge pull request #6301 from Morph1984/ssl-ImportClientPkibunnei2021-05-131-2/+40
|\ \ \ \ \ \ \ | |/ / / / / / |/| | | | | | ssl: Stub Import(Client/Server)Pki
| * | | | | | ssl: Stub Import(Client/Server)PkiMorph2021-05-131-2/+40
| | | | | | | | | | | | | | | | | | | | | | | | | | | | - Used in JUMP FORCE Deluxe Edition
* | | | | | | Merge pull request #6298 from Kewlan/toggled-show-add-on-refreshMorph2021-05-131-0/+1
|\ \ \ \ \ \ \ | |/ / / / / / |/| | | | | | configure_ui: Call RequestGameListUpdate when toggling "Show Add-Ons Column"
| * | | | | | configure_ui: Call RequestGameListUpdate when toggling "Show Add-Ons Column"Kewlan2021-05-101-0/+1
| |/ / / / /
* | | | | | Merge pull request #6267 from german77/gestureRewriteMorph2021-05-122-76/+340
|\ \ \ \ \ \ | |/ / / / / |/| | | | | hid: Improve hardware accuracy of gestures
| * | | | | hid: Improve hardware accuracy of gesturesgerman772021-05-052-76/+340
| | | | | |
* | | | | | Merge pull request #6291 from lioncash/kern-shadowbunnei2021-05-1040-140/+138
|\ \ \ \ \ \ | |_|_|_|/ / |/| | | | | kernel: Eliminate variable shadowing
| * | | | | kernel: Eliminate variable shadowingLioncash2021-05-0840-140/+138
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Now that the large kernel refactor is merged, we can eliminate the remaining variable shadowing cases.
* | | | | | Merge pull request #6294 from german77/kernelCleanupMorph2021-05-092-151/+0
|\ \ \ \ \ \ | |_|_|_|/ / |/| | | | | kernel: Delete unused files
| * | | | | kernel: Delete unused filesgerman772021-05-092-151/+0
|/ / / / /
* | | | | Merge pull request #6292 from lat9nq/sdl-trunkMorph2021-05-093-2/+5
|\ \ \ \ \ | | | | | | | | | | | | externals: Update SDL to 107db2d8
| * | | | | externals: Use SDL2 staticallylat9nq2021-05-091-0/+3
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Building it as a shared library causes issues distributing it to an AppImage, since linuxdeploy expects the executable to only dynamically link to system libraries. Additionally, simply dynamically linking to a library in the binary directory is bound to cause issues. Solution is to use SDL's CMake switches and build it statically. We also alias `SDL2` to `SDL2-static` on the external submodule for compatibility with the rest of the project.
| * | | | | externals: Update SDL to 107db2d8lat9nq2021-05-092-2/+2
|/ / / / / | | | | | | | | | | | | | | | | | | | | In light of 72a49c2bbcce46c24b6d8ee0592989a507dcd68a, the SDL submodule also needs updated. Updates to the same commit used by the SDL package in ext-windows-bin.
* / / / / Update SDL2 to SDL2-2.0.15-prerelease.bunnei2021-05-081-1/+1
|/ / / / | | | | | | | | - Improves native Switch JoyCon/Pro Controller support.
* | | | Merge pull request #6266 from bunnei/kautoobject-refactorbunnei2021-05-08181-2834/+4815
|\ \ \ \ | | | | | | | | | | Kernel Rework: Migrate kernel objects to KAutoObject
| * | | | hle: kernel: KPageTable: CanContain should not be constexpr.bunnei2021-05-062-2/+2
| | | | |
| * | | | hle: kernel: Move slab resource counts to Kernel.bunnei2021-05-064-33/+52
| | | | |
| * | | | fixup! hle: kernel: Migrate KSharedMemory to KAutoObject.bunnei2021-05-061-2/+2
| | | | |
| * | | | fixup! hle: kernel: Migrate more of KThread to KAutoObject.bunnei2021-05-061-1/+1
| | | | |
| * | | | fixup! common: bit_util: Add BIT macro.bunnei2021-05-061-2/+0
| | | | |
| * | | | fixup! hle: kernel: Ensure all kernel objects with KAutoObject are properly created.bunnei2021-05-061-2/+0
| | | | |
| * | | | fixup! hle: kernel: Ensure all kernel objects with KAutoObject are properly created.bunnei2021-05-061-2/+0
| | | | |
| * | | | kernel: svc: Remove unused RetrieveResourceLimitValue function.bunnei2021-05-061-32/+0
| | | | |
| * | | | hle: kernel: Fix un/sign mismatch errors with NUM_CPU_CORES.bunnei2021-05-061-3/+3
| | | | |
| * | | | fixup! hle: kernel: Add initial impl. of slab setup.bunnei2021-05-061-6/+2
| | | | |
| * | | | fixup! hle: kernel: Migrate to KHandleTable.bunnei2021-05-061-0/+3
| | | | |
| * | | | fixup! hle: kernel: Migrate more of KThread to KAutoObject.bunnei2021-05-061-7/+0
| | | | |
| * | | | common: parent_of_member: Fix build for OffsetOf().bunnei2021-05-061-4/+4
| | | | |
| * | | | fixup! common: intrusive_red_black_tree: Disable static_assert that will not evaluate as constant on MSVC.bunnei2021-05-061-5/+0
| | | | |
| * | | | fixup! hle: kernel: Migrate KReadableEvent and KWritableEvent to KAutoObject.bunnei2021-05-062-2/+2
| | | | |
| * | | | fixup! hle: kernel: Migrate to KHandleTable.bunnei2021-05-061-1/+1
| | | | |
| * | | | fixup! hle: kernel: Add initial impl. of KLinkedList.bunnei2021-05-061-12/+12
| | | | |
| * | | | fixup! hle: kernel: Migrate to KHandleTable.bunnei2021-05-061-1/+1
| | | | |
| * | | | fixup! hle: kernel: Migrate KPort, KClientPort, and KServerPort to KAutoObject.bunnei2021-05-061-1/+1
| | | | |
| * | | | fixup! hle: kernel: Migrate KSession, KClientSession, and KServerSession to KAutoObject.bunnei2021-05-063-22/+28
| | | | |
| * | | | fixup! hle: kernel: Migrate KSession, KClientSession, and KServerSession to KAutoObject.bunnei2021-05-061-1/+1
| | | | |
| * | | | fixup! hle: kernel: Migrate KPort, KClientPort, and KServerPort to KAutoObject.bunnei2021-05-061-1/+1
| | | | |
| * | | | fixup! hle: kernel: Migrate to KHandleTable.bunnei2021-05-061-60/+58
| | | | |
| * | | | fixup! hle: kernel: Add initial impl. of KAutoObjectWithListContainer.bunnei2021-05-061-11/+9
| | | | |
| * | | | fixup! hle: kernel: Add initial impl. of KAutoObjectWithListContainer.bunnei2021-05-061-9/+2
| | | | |
| * | | | fixup! hle: kernel: Add initial impl. of KAutoObject.bunnei2021-05-061-46/+46
| | | | |
| * | | | fixup! hle: kernel: Add initial impl. of KAutoObject.bunnei2021-05-061-1/+1
| | | | |
| * | | | fixup! hle: kernel: Add initial impl. of slab setup.bunnei2021-05-061-8/+8
| | | | |
| * | | | common: Rename NON_COPYABLE/NON_MOVABLE with YUZU_ prefix.bunnei2021-05-065-11/+11
| | | | |
| * | | | fixup! hle: kernel: Rename Process to KProcess.bunnei2021-05-061-1/+1
| | | | |
| * | | | fixup! hle: kernel: Migrate to KHandleTable.bunnei2021-05-061-1/+1
| | | | |
| * | | | fixup! hle: kernel: Improve MapSharedMemory and implement UnmapSharedMemory.bunnei2021-05-061-3/+3
| | | | |
| * | | | hle: kernel: svc: ConnectToNamedPort: Use KHandleTable::Reserve.bunnei2021-05-061-3/+8
| | | | |
| * | | | hle: kernel: Migrate to KHandleTable.bunnei2021-05-0622-381/+503
| | | | |
| * | | | hle: kernel: KClassToken: Ensure class tokens are correct.bunnei2021-05-061-1/+127
| | | | |
| * | | | hle: kernel: Improve MapSharedMemory and implement UnmapSharedMemory.bunnei2021-05-0610-95/+210
| | | | |
| * | | | hle: kernel: Rename Process to KProcess.bunnei2021-05-0683-247/+249
| | | | |
| * | | | hle: kernel: Remove deprecated Object class.bunnei2021-05-0639-423/+34
| | | | |
| * | | | hle: kernel: Do not shutdown twice on emulator close.bunnei2021-05-061-3/+1
| | | | |
| * | | | hle: kernel: Cleanup shutdown of persistent kernel objects.bunnei2021-05-061-14/+12
| | | | |
| * | | | hle: kernel: Migrate KPort, KClientPort, and KServerPort to KAutoObject.bunnei2021-05-0622-166/+444
| | | | |
| * | | | hle: kernel: Migrate KServerPort to KAutoObject.bunnei2021-05-068-52/+67
| | | | |
| * | | | hle: kernel: Migrate KClientPort to KAutoObject.bunnei2021-05-0618-63/+92
| | | | |
| * | | | hle: kernel: HandleTable: Remove deprecated APIs.bunnei2021-05-067-111/+28
| | | | |
| * | | | hle: kernel: Migrate KResourceLimit to KAutoObject.bunnei2021-05-0613-122/+197
| | | | |
| * | | | hle: kernel: svc: Migrate WaitSynchronization.bunnei2021-05-062-47/+78
| | | | |
| * | | | hle: kernel: svc: Use new handle table API for Process.bunnei2021-05-062-16/+17
| | | | |
| * | | | hle: kernel: Migrate KTransferMemory to KAutoObject.bunnei2021-05-0612-68/+209
| | | | |
| * | | | hle: kernel: Migrate KSession, KClientSession, and KServerSession to KAutoObject.bunnei2021-05-0631-356/+412
| | | | |
| * | | | hle: kernel: svc: Migrate GetThreadContext, GetThreadCoreMask.bunnei2021-05-061-2/+59
| | | | |
| * | | | hle: kernel: svc: Migrate GetProcessId, CancelSynchronization, SetThreadActivity.bunnei2021-05-061-13/+67
| | | | |
| * | | | hle: kernel: KThread: Remove incorrect resource release.bunnei2021-05-061-2/+1
| | | | |
| * | | | hle: kernel: svc_results: Update naming..bunnei2021-05-068-42/+43
| | | | |
| * | | | hle: kernel: KThread: Add missing resource hint release.bunnei2021-05-061-1/+1
| | | | |
| * | | | hle: kernel: Migrate KReadableEvent and KWritableEvent to KAutoObject.bunnei2021-05-0635-200/+215
| | | | |
| * | | | hle: ipc_helpers: Add methods for copy/move references.bunnei2021-05-061-2/+24
| | | | |
| * | | | hle: kernel: Move slab heaps to their own container.bunnei2021-05-062-10/+16
| | | | |
| * | | | hle: kernel: Refactor several threads/events/sharedmemory to use slab heaps.bunnei2021-05-0611-59/+53
| | | | |
| * | | | hle: kernel: Move slab heap management to KernelCore.bunnei2021-05-067-64/+106
| | | | |
| * | | | hle: kernel: Ensure all kernel objects with KAutoObject are properly created.bunnei2021-05-0620-0/+55
| | | | |
| * | | | hle: kernel: Use unique_ptr for suspend and dummy threads.bunnei2021-05-061-8/+8
| | | | |
| * | | | hle: kernel: Migrate KEvent to KAutoObject.bunnei2021-05-0637-266/+269
| | | | |
| * | | | hle: kernel: Migrate KSharedMemory to KAutoObject.bunnei2021-05-0616-114/+128
| | | | |
| * | | | hle: kernel: Migrate KProcess to KAutoObject.bunnei2021-05-0614-58/+80
| | | | |
| * | | | hle: kernel: Refactor IPC interfaces to not use std::shared_ptr.bunnei2021-05-0628-59/+65
| | | | |
| * | | | hle: kernel: Migrate more of KThread to KAutoObject.bunnei2021-05-0618-294/+451
| | | | |
| * | | | hle: kernel: svc: Migrate GetThreadPriority, StartThread, and ExitThread.bunnei2021-05-061-21/+12
| | | | |
| * | | | hle: kernel: svc: Migrate CreateThread.bunnei2021-05-061-14/+21
| | | | |
| * | | | hle: kernel: Migrate idle threads.bunnei2021-05-062-13/+9
| | | | |
| * | | | hle: kernel: Migrate KThread to KAutoObject.bunnei2021-05-062-109/+91
| | | | |
| * | | | hle: kernel: Add initial impl. of slab setup.bunnei2021-05-063-0/+227
| | | | |
| * | | | hle: kernel: Refactor out various KThread std::shared_ptr usage.bunnei2021-05-0610-58/+30
| | | | |
| * | | | core: Defer CoreTiming initialization.bunnei2021-05-061-1/+1
| | | | |
| * | | | core: memory: Add a work-around to allocate and access kernel memory regions by vaddr.bunnei2021-05-063-1/+46
| | | | |
| * | | | common: common_funcs: Add Size helper function.bunnei2021-05-061-0/+15
| | | | |
| * | | | hle: kernel: Add initial impl. of KLinkedList.bunnei2021-05-062-0/+234
| | | | |
| * | | | common: bit_util: Add BIT macro.bunnei2021-05-061-0/+2
| | | | |
| * | | | hle: kernel: Add initial impl. of KSlabAllocated.bunnei2021-05-062-0/+153
| | | | |
| * | | | hle: kernel: Add initial impl. of KAutoObjectWithListContainer.bunnei2021-05-063-0/+109
| | | | |
| * | | | hle: kernel: Add initial impl. of KAutoObject.bunnei2021-05-063-0/+306
| | | | |
| * | | | common: intrusive_red_black_tree: Disable static_assert that will not evaluate as constant on MSVC.bunnei2021-05-061-0/+4
| | | | |
| * | | | common: common_funcs: Add helper macros for non-copyable and non-moveable.bunnei2021-05-061-0/+8
| | |/ / | |/| | | | | | | | | | - Useful for scenarios where we do not want to inherit from NonCopyable.
* | | | Merge pull request #6287 from lioncash/ldr-copybunnei2021-05-071-5/+3
|\ \ \ \ | |/ / / |/| | | ldr: Simplify memory copy within LoadNro()
| * | | ldr: Simplify memory copy within LoadNro()Lioncash2021-05-071-5/+3
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | We can use the dedicated memory function for performing copies instead of reading into a temporary buffer and then immediately writing it back out to memory. Eliminates a bit of heap memory churn.
* | | | Merge pull request #6279 from ogniK5377/nvhost-profbunnei2021-05-061-3/+14
|\ \ \ \ | |/ / / |/| | | nvdrv: /dev/nvhost-prof-gpu for production
| * | | Update src/core/hle/service/nvdrv/interface.cppbunnei2021-05-061-1/+1
| | | | | | | | | | | | Co-authored-by: Ameer J <52414509+ameerj@users.noreply.github.com>
| * | | nvdrv: /dev/nvhost-prof-gpu for productionChloe Marcec2021-05-031-3/+14
| | | | | | | | | | | | | | | | | | | | While we're at it, we can fix the is_initialized error code. This fixes the crashes on Shante
* | | | Merge pull request #6283 from lioncash/unused-fieldsbunnei2021-05-053-7/+4
|\ \ \ \ | |_|/ / |/| | | service: Remove unused class variables
| * | | service: Remove unused class variablesLioncash2021-05-053-7/+4
|/ / / | | | | | | | | | Prevents some warnings from occurring.
* | | Merge pull request #6281 from lioncash/shadow-fieldbunnei2021-05-0560-117/+119
|\ \ \ | | | | | | | | service: Resolve cases of member field shadowing
| * | | service: Resolve cases of member field shadowingLioncash2021-05-0460-117/+119
|/ / / | | | | | | | | | | | | Now all that remains is for kernel code to be 'shadow-free' and then -Wshadow can be turned into an error.
* | | Merge pull request #6278 from lioncash/misc-shadowbunnei2021-05-0410-25/+27
|\ \ \ | | | | | | | | core: Resolve misc straggler cases of variable shadowing
| * | | core: Resolve misc cases of variable shadowingLioncash2021-05-0310-25/+27
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Resolves shadowing warnings that aren't in a particularly large subsection of core. Brings us closer to turning -Wshadow into an error. All that remains now is for cases in the kernel (left untouched for now since a big change by bunnei is pending), and a few left over in the service code (will be tackled next).
* | | | Merge pull request #6275 from german77/mousefocusbunnei2021-05-033-1/+18
|\ \ \ \ | |_|/ / |/| | | input_common: Release mouse buttons on out of focus
| * | | input_common: Release mouse buttons on out of focusgerman772021-05-033-1/+18
| |/ /
* | | Merge pull request #6277 from german77/touchsetting2Morph2021-05-032-2/+10
|\ \ \ | |/ / |/| | hid: Fix touch not initializing properly if disabled
| * | hid: Fix touch not initializing properly if disabledgerman772021-05-032-2/+10
|/ /
* | Merge pull request #6269 from lioncash/file-shadowbunnei2021-05-0321-114/+132
|\ \ | | | | | | file_sys: Resolve cases of variable shadowing
| * | file_sys: Resolve cases of variable shadowingLioncash2021-05-0221-114/+132
| | | | | | | | | | | | Brings us closer to enabling -Wshadow as an error in the core code.
* | | Merge pull request #6263 from Kewlan/folder-swap-expand-stateMorph2021-05-021-2/+4
|\ \ \ | | | | | | | | game_list: Fix dir move up/down expand state
| * | | game_list: Fix dir move up/down expand stateKewlan2021-04-301-2/+4
| | | |
* | | | Merge pull request #6265 from Morph1984/snap-save-fixbunnei2021-05-022-2/+8
|\ \ \ \ | |_|/ / |/| | | service: filesystem: Return proper error codes for CreateFile
| * | | service: filesystem: Return proper error codes for CreateFileMorph2021-05-012-2/+8
| | | | | | | | | | | | | | | | | | | | | | | | This improves the accuracy of CreateFile by returning the correct error codes on certain conditions (parent directory does not exist, path already exists). This fixes saving and the loading of existing saves in New Pokemon Snap
* | | | Merge pull request #6245 from lat9nq/boost-only-configbunnei2021-05-021-2/+2
|\ \ \ \ | | | | | | | | | | cmake: Only config Boost during find_package
| * | | | cmake: Only config Boost during find_packagelat9nq2021-04-261-2/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Without the CONFIG option, find_package will perform Module search. On at least Linux Mint 20 (I'm unable to reproduce this on CentOS and Arch Linux), my guess is that this causes CMake to find "dirty" modules that modify the configuration state despite the Boost version being too low/absent. Use CONFIG to put CMake into pure Config mode and avoid Module search.
* | | | | Merge pull request #6261 from Kewlan/game-list-filter-fixbunnei2021-05-012-5/+6
|\ \ \ \ \ | | | | | | | | | | | | game_list: Update filter results when removing directories
| * | | | | game_list: Update filter results when removing directoriesKewlan2021-04-302-5/+6
| | | | | |
* | | | | | Merge pull request #6264 from german77/touchsettingMorph2021-05-012-2/+2
|\ \ \ \ \ \ | |_|_|/ / / |/| | | | | hid: Disable touch if setting is not enabled
| * | | | | Disable touch if setting is not enabledgerman772021-05-012-2/+2
|/ / / / /
* | | | | Merge pull request #6257 from Morph1984/fix-use-after-free-webappletbunnei2021-04-306-25/+28
|\ \ \ \ \ | | | | | | | | | | | | applets/web: Fix a use-after-free when passing in the URL string
| * | | | | applets/web: Fix a use-after-free when passing in the URL stringMorph2021-04-286-25/+28
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The URL string was being deleted before being used, leading to a use-after-free occurring when it is used afterwards. Fix this by taking the string by const ref to extend its lifetime, ensuring it doesn't get deleted before use.
* | | | | | Merge pull request #6243 from german77/GCresetOriginbunnei2021-04-302-2/+7
|\ \ \ \ \ \ | |_|_|_|/ / |/| | | | | input_common: Reset GC sticks center by measuring multiple packets
| * | | | | input_common: Reset GC sticks center by measuring multiple packetsgerman772021-04-272-2/+7
| | | | | |
* | | | | | Merge pull request #6226 from german77/sevensixbunnei2021-04-3010-17/+220
|\ \ \ \ \ \ | | | | | | | | | | | | | | hid: Implement SevenSixAxis and ConsoleSixAxisSensor
| * | | | | | address commentsgerman772021-04-272-5/+5
| | | | | | |
| * | | | | | hid: Implement SevenSixAxis and ConsoleSixAxisSensorgerman772021-04-2410-17/+220
| | | | | | |
* | | | | | | Merge pull request #6258 from Morph1984/config-convbunnei2021-04-301-2/+1
|\ \ \ \ \ \ \ | |_|_|_|/ / / |/| | | | | | yuzu: config: Silence narrowing conversion warning on MSVC
| * | | | | | yuzu: config: Silence narrowing conversion warning on MSVCMorph2021-04-291-2/+1
|/ / / / / /
* | | | | | Merge pull request #6259 from Morph1984/main-convAmeer J2021-04-291-1/+1
|\ \ \ \ \ \ | |_|_|/ / / |/| | | | | yuzu: main: Silence type conversion warning on MSVC
| * | | | | yuzu: main: Silence type conversion warning on MSVCMorph2021-04-281-1/+1
|/ / / / /
* | | | | Merge pull request #6250 from lioncash/loader-shadowbunnei2021-04-2819-169/+257
|\ \ \ \ \ | |_|/ / / |/| | | | loader: Resolve instances of variable shadowing
| * | | | loader: Resolve instances of variable shadowingLioncash2021-04-2719-169/+257
|/ / / / | | | | | | | | | | | | | | | | Eliminates variable shadowing cases across all the loaders to bring us closer to enabling variable shadowing as an error in core.
* | | | Merge pull request #6246 from lioncash/shadowbunnei2021-04-2715-76/+81
|\ \ \ \ | | | | | | | | | | service: Eliminate cases of member variable shadowing
| * | | | service: Eliminate cases of member shadowingLioncash2021-04-2615-76/+81
| | |_|/ | |/| | | | | | | | | | | | | | Resolves a few localized instances of member variable shadowing. Brings us a little closer to turning shadowing warnings into errors.
* | | | Merge pull request #6236 from Morph1984/swkbd-button-hint-scalingbunnei2021-04-2618-81/+45
|\ \ \ \ | |/ / / |/| | | applets/swkbd: Fix software keyboard button hint scaling
| * | | applets/swkbd: Fix software keyboard button hint scalingIts-Rei2021-04-2418-81/+45
| | | | | | | | | | | | | | | | Fixes the scaling of the button hints using background images. Now they scale like the rest of the elements.
* | | | Merge pull request #6198 from Kewlan/favorite-gamesbunnei2021-04-2615-5/+152
|\ \ \ \ | | | | | | | | | | game_list: Mark games as favorite to make them appear at the top.
| * | | | game_list: Mark games as favorite to make them appear at the top.Kewlan2021-04-1515-5/+152
| | | | | | | | | | | | | | | | | | | | Icons are from Icons8.
* | | | | Merge pull request #6237 from ameerj/nvdec-end-fixbunnei2021-04-264-15/+11
|\ \ \ \ \ | | | | | | | | | | | | nvhost_vic: Fix device closure
| * | | | | nvhost_vic: Fix device closureameerj2021-04-254-15/+11
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Implements the OnClose method of the nvhost_vic device, and removes the remnants of an older implementation. Also cleans up some of the surrounding code.
* | | | | | Merge pull request #6241 from Morph1984/new-keyboard-bindingsbunnei2021-04-261-9/+10
|\ \ \ \ \ \ | |_|_|_|_|/ |/| | | | | config: Add new keyboard bindings
| * | | | | config: Add new keyboard bindingsMorph2021-04-251-9/+10
|/ / / / / | | | | | | | | | | | | | | | Changes the keyboard bindings to be based on RPCS3's tried and true keyboard bindings.
* | | | | Merge pull request #6238 from ameerj/vk-bgr-fixRodrigo Locatti2021-04-251-1/+24
|\ \ \ \ \ | |/ / / / |/| | | | vk_texture_cache: Swap R and B channels of color flipped format
| * | | | vk_texture_cache: Swap R and B channels of color flipped formatameerj2021-04-251-1/+24
|/ / / / | | | | | | | | | | | | Swaps the Red and Blue channels of the A1B5G5R5_UNORM texture format, which was being incorrectly rendered.
* | | | Merge pull request #6234 from Morph1984/stub-amMat M2021-04-242-1/+10
|\ \ \ \ | | | | | | | | | | ICommonStateGetter: Stub SetRequestExitToLibraryAppletAtExecuteNextProgramEnabled
| * | | | ICommonStateGetter: Stub SetRequestExitToLibraryAppletAtExecuteNextProgramEnabledMorph2021-04-242-1/+10
| | | | | | | | | | | | | | | | | | | | - Used by Pixel Game Maker Series Werewolf Princess Kaguya
* | | | | Merge pull request #6235 from german77/ectx_awMat M2021-04-244-0/+49
|\ \ \ \ \ | |_|_|/ / |/| | | | glue: Add ectx:aw service placeholder
| * | | | glue: Add ectx:aw placeholdergerman772021-04-244-0/+49
| | |_|/ | |/| |
* | | | Merge pull request #6230 from Morph1984/default-resource-sizebunnei2021-04-243-4/+8
|\ \ \ \ | | | | | | | | | | program_metadata: Set a default resource size when a NPDM is not present
| * | | | program_metadata: Set a default resource size when a NPDM is not presentMorph2021-04-233-4/+8
| | | | | | | | | | | | | | | | | | | | Sets a default size of 0x1FE00000 bytes (510 MiB) for the system_resource_size when a NPDM is not present.
* | | | | Merge pull request #6227 from lioncash/metabunnei2021-04-241-0/+6
|\ \ \ \ \ | | | | | | | | | | | | program_metadata: Explicitly specify copy/move operators/functions
| * | | | | program_metadata: Explicitly specify copy/move functionsLioncash2021-04-231-0/+6
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The generation of the copy assignment operators are deprecated on being generated when a user-provided destructor is present. We can explicitly specify that we desire this behavior to keep the class forward compatible with future standards.
* | | | | | Merge pull request #6228 from lioncash/semibunnei2021-04-241-6/+7
|\ \ \ \ \ \ | |_|_|_|/ / |/| | | | | lm: Resolve -Wextra-semi warning
| * | | | | lm: Make use of insert_or_assign() in Log()Lioncash2021-04-231-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Avoids unnecessary default construction of an entry in cases where no entry exists before overwriting the created entry.
| * | | | | lm: Prevent redundant map lookups in Log()Lioncash2021-04-231-4/+5
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | We can perform the lookup and then do the contains check by checking the end iterator. The benefit of this is that if we *do* find an entry, then we aren't hashing into the map again to find it. We can also get rid of an unused std::vector temporary while we're at it.
| * | | | | lm: Resolve -Wextra-semi warningLioncash2021-04-231-1/+1
| |/ / / / | | | | | | | | | | | | | | | Resolves a trivial warning with clang.
* | | | | Merge pull request #6229 from lioncash/unused-varbunnei2021-04-242-6/+0
|\ \ \ \ \ | | | | | | | | | | | | acc/lbl: Remove unused variables
| * | | | | acc/lbl: Remove unused variablesLioncash2021-04-232-6/+0
| |/ / / /
* | | | | Merge pull request #6231 from lioncash/aesbunnei2021-04-232-9/+5
|\ \ \ \ \ | |_|/ / / |/| | | | aes_util: Make use of std::span
| * | | | aes_util: Make use of std::spanLioncash2021-04-232-9/+5
| |/ / / | | | | | | | | | | | | | | | | Allows us to simplify the interface quite a bit as it will handle contiguous sequences for us.
* | | | Merge pull request #6232 from lioncash/alias2bunnei2021-04-234-26/+29
|\ \ \ \ | | | | | | | | | | emu_window: unsigned -> u32
| * | | | emu_window: Return pair from ClipToTouchScreen() instead of tupleLioncash2021-04-232-5/+8
| | | | | | | | | | | | | | | | | | | | | | | | | This is only a 2-tuple, so it can be converted over to the std::pair class.
| * | | | emu_window: unsigned -> u32Lioncash2021-04-234-23/+23
| |/ / / | | | | | | | | | | | | This is more concise and consistent with the rest of the codebase.
* | | | Merge pull request #6225 from ameerj/unused-headerMorph2021-04-232-17/+0
|\ \ \ \ | |_|/ / |/| | | yuzu_cmd: Remove unused resource.h
| * | | yuzu_cmd: Remove unused resource.hameerj2021-04-232-17/+0
|/ / /
* | | Merge pull request #6224 from Morph1984/hid_InitializeSevenSixAxisSensorbunnei2021-04-231-1/+38
|\ \ \ | | | | | | | | service: hid: Get transfer memory for InitializeSevenSixAxisSensor
| * | | service: hid: Get transfer memory for InitializeSevenSixAxisSensorMorph2021-04-221-1/+38
| |/ /
* | | Merge pull request #6222 from lat9nq/ext-boostbunnei2021-04-222-5/+37
|\ \ \ | |/ / |/| | cmake: Download Boost from ext-linux-bin if inadequate local version
| * | cmake: Download Boost if inadequate local versionlat9nq2021-04-222-5/+37
|/ / | | | | | | | | | | | | | | | | | | | | | | | | | | Building SDL2 from externals is incompatible with Conan's version of libiconv, a requirement of Conan's Boost package. Solution is to use the same Boost package in use by the linux-fresh container. This tells CMake to download boost_1_75_0.tar.xz from yuzu-emu/ext-linux-bin at CMake's configuration step, much the same way Qt and FFmpeg are downloaded for Windows. Also makes DownloadExternals.cmake cross-platform. Although the CMake code is not entirely specific to Linux, only Linux has Boost libraries available at ext-linux-bin, whereas there is no equivalent Boost package for Windows at ext-windows-bin. caveat emptor
* | Merge pull request #6223 from lat9nq/ffmpeg-external-fixesbunnei2021-04-211-7/+6
|\ \ | | | | | | cmake: Fix FFmpeg external usage and cleanup
| * | cmake: Suppress SDL2 not found warninglat9nq2021-04-211-1/+1
| | | | | | | | | | | | | | | | | | If SDL2 is not found, the error is handled by falling back to externals. No need spill the full warning at the find_package if it's going to be handled later, so add QUIET to it.
| * | cmake: Allow FFmpeg external usage and cleanuplat9nq2021-04-211-6/+5
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Sets find_package(FFmpeg) to QUIET instead of REQUIRED. This allows using the FFmpeg external in cases where there is no suitable installed version of FFmpeg. Also fixes a bug where multiple CMake configures causes FFmpeg_LIBRARIES to concatenate on itself, producing cyclical dependencies. Unsets the variable before building it in the foreach loop. Fixes FFmpeg_INCLUDE_DIR not including the headers generated at run time.
* | | Merge pull request #6214 from Morph1984/time-fix-kirby-clashbunnei2021-04-211-3/+5
|\ \ \ | | | | | | | | time: Fix GetClockSnapshotFromSystemClockContext
| * | | time: Write buffer before pushing RESULT_SUCCESS in GetClockSnapshotMorph2021-04-191-1/+2
| | | |
| * | | time: Fix GetClockSnapshotFromSystemClockContextMorph2021-04-191-2/+3
| | | | | | | | | | | | | | | | | | | | | | | | This removes an incorrect alignment usage and corrects the positions of the popped parameters. - Fixes Super Kirby Clash crashing on boot
* | | | Merge pull request #6219 from lioncash/log-erasebunnei2021-04-212-10/+12
|\ \ \ \ | |_|/ / |/| | | log/backend: Make use of erase_if
| * | | log/backend: Use in-class initializer for FileBackendLioncash2021-04-202-6/+8
| | | | | | | | | | | | | | | | We can also avoid redundant constructions of the same string repeatedly.
| * | | log/backend: Make use of erase_ifLioncash2021-04-201-4/+4
| |/ / | | | | | | | | | Same behavior, but less verbose.
* | | Merge pull request #6218 from lioncash/tcachebunnei2021-04-201-1/+1
|\ \ \ | | | | | | | | texture_cache/util: Fix src being used instead of dst within DeduceBlitImages case
| * | | texture_cache/util: Fix src being used instead of dst within DeduceBlitImagesLioncash2021-04-191-1/+1
| |/ / | | | | | | | | | | | | | | | | | | This line can only ever be reached if src is null, so dereferencing it here is a logic bug that slipped through. Instead, we dereference dst instead which is guaranteed to be valid.
* | | Merge pull request #6207 from lat9nq/sdl-2.0.14bunnei2021-04-209-7/+53
|\ \ \ | | | | | | | | cmake: Use SDL 2.0.14 and fix scope issue
| * | | general: Ignore implicit-fallthrough for SDL.hlat9nq2021-04-185-0/+47
| | | | | | | | | | | | | | | | | | | | | | | | SDL 2.0.14 introduces an incompatibility with Clang, causing it to trigger -Wimplicit-fallthrough even though it is marked. Ignore it for now, with a comment mentioning why this is needed.
| * | | cmake: Use SDL 2.0.14 and fix CMake scope issuelat9nq2021-04-184-7/+6
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Forces using SDL 2.0.14. Upgrades the SDL external to that version. Adds a message when switching to the external. Fixes an error where input_common only links to SDL when SDL2_FOUND is set, but externals/CMakeLists cannot set that variable to the required scope. Switch to using ENABLE_SDL2, which we can use since we now include the SDL source.
* | | | Merge pull request #6217 from Morph1984/consistent-writebuffersbunnei2021-04-203-5/+12
|\ \ \ \ | | | | | | | | | | general: Write buffers before pushing raw arguments
| * | | | general: Write buffers before pushing raw argumentsMorph2021-04-193-5/+12
| | |/ / | |/| | | | | | | | | | For consistency with the rest of the service implementations
* | | | Merge pull request #6215 from lioncash/duplicatebunnei2021-04-202-2/+1
|\ \ \ \ | | | | | | | | | | npad: Remove duplicated class member variable
| * | | | npad: Remove duplicated class member variableLioncash2021-04-192-2/+1
| |/ / / | | | | | | | | | | | | | | | | | | | | ControllerBase already has a System reference that can be accessed from this class, so we can get rid of this to make the class layout a little more straightforward.
* | | | Merge pull request #6216 from lioncash/uninit-readbunnei2021-04-191-5/+5
|\ \ \ \ | |/ / / |/| | | arp: Prevent potential uninitialized read of launch member variable
| * | | arp: Use type alias for issue functionLioncash2021-04-191-4/+4
| | | | | | | | | | | | | | | | Reduces some verbosity and centralizes the function details in one spot.
| * | | arp: Prevent uninitialized read of launch member variableLioncash2021-04-191-1/+1
|/ / / | | | | | | | | | | | | | | | | | | | | | | | | If anything happened to call arp functions in the wrong order and called IRegistrar's Issue function before SetApplicationLaunchProperty, we'd read from an uninitialized ApplicationLaunchProperty instance. Instead, we can always initialize it so if this does happen, then the outcome of doing such a thing is at least consistently reproducible.
* | | Merge pull request #6208 from lat9nq/boost-staticbunnei2021-04-181-1/+11
|\ \ \ | |/ / |/| | ci: linux: Link Boost statically
| * | ci: linux: Link Boost staticallylat9nq2021-04-181-1/+11
|/ / | | | | | | | | | | Only affects the AppImage and the raw binaries. Enables running the executable alone on Linux systems when all other libraries are compatible.
* | Merge pull request #6204 from lat9nq/sdl2-externalMorph2021-04-184-9/+20
|\ \ | | | | | | externals: Add SDL 2.0.12
| * | gitmodules: Remove unneeded prefixlat9nq2021-04-171-1/+1
| | | | | | | | | Co-authored-by: Morph <39850852+Morph1984@users.noreply.github.com>
| * | externals: Add SDL 2.0.12lat9nq2021-04-174-9/+20
| | | | | | | | | | | | | | | | | | Since Bintray is (soon to be) no more, there needs to be a way to acquire SDL2. Since 20.04's version is older than our minimum required version (2.0.12), add it as an external.
* | | Merge pull request #6205 from Morph1984/applet-focus-state-changebunnei2021-04-1716-33/+65
|\ \ \ | | | | | | | | applets: Send focus state change message on applet state change
| * | | applets: Send focus state change message on applet state changeMorph2021-04-1710-22/+56
| | | | | | | | | | | | | | | | Fixes the softlock after the controller applet exits in Mario Kart 8 Deluxe.
| * | | applets: Make the applet mode a protected property of AppletMorph2021-04-1714-22/+20
|/ / /
* | | Merge pull request #6125 from ogniK5377/nvdec-close-devbunnei2021-04-173-11/+14
|\ \ \ | | | | | | | | nvdrv: Cleanup CDMA Processor on device closure
| * | | Address issuesChloe Marcec2021-04-161-3/+2
| | | |
| * | | nvdrv: Cleanup CDMA Processor on device closureChloe Marcec2021-03-303-11/+15
| | | | | | | | | | | | | | | | Brings us a step closer to unifying all channels to share a common interface.
* | | | Merge pull request #6133 from Morph1984/project-eleuthiabunnei2021-04-1799-490/+9398
|\ \ \ \ | |_|/ / |/| | | Project Eleuthia - On-Screen Keyboard and Error Applet Overlays
| * | | applets/swkbd: Implement the Qt Software Keyboard frontendMorph2021-04-156-14/+5518
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The Qt Software Keyboard frontend attempts to mimic the software keyboard rendered by the Nintendo Switch. This frontend implements multiple keyboard types, such as the normal software keyboard, the numeric pad software keyboard and the inline software keyboard. Keyboard and controller input is also supported in this frontend. Keyboard input is handled as native keyboard input, and so the on-screen keyboard cannot be navigated with the keyboard arrow keys as the arrow keys are used to move the text cursor. Controller input is translated into mouse hover movements on the onscreen keyboard or their respective button actions (B for backspace, A for entering the selected button, L/R for moving the text cursor, etc). The text check dialogs can also be confirmed with controller input through the use of the OverlayDialog Massive thanks to Rei for creating all the UI for the various keyboards and OverlayDialog. This would not have been possible without his excellent work. Co-authored-by: Its-Rei <kupfel@gmail.com>
| * | | error: Make the error code as the title text of the OverlayDialogMorph2021-04-154-15/+17
| | | | | | | | | | | | | | | | Co-authored-by: Its-Rei <kupfel@gmail.com>
| * | | overlay_dialog: Add an overlay text dialog that accepts controller inputMorph2021-04-155-1/+768
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | An OverlayDialog is an interactive dialog that accepts controller input (while a game is running) This dialog attempts to replicate the look and feel of the Nintendo Switch's overlay dialogs and provide some extra features such as embedding HTML/Rich Text content in a QTextBrowser. The OverlayDialog provides 2 modes: one to embed regular text into a QLabel and another to embed HTML/Rich Text content into a QTextBrowser. Co-authored-by: Its-Rei <kupfel@gmail.com>
| * | | main: Move meta type registration into its own functionMorph2021-04-152-9/+65
| | | | | | | | | | | | | | | | | | | | Moves the existing meta type registration into its own function and adds registration of common integral, floating point and string types. This function is also now called in the constructor of the GMainWindow instead of on starting a game.
| * | | input_interpreter: Fix button hold being interpreted incorrectly on initMorph2021-04-152-1/+17
| | | | | | | | | | | | | | | | We reset all the button states to 0 except the first index (which has all the buttons as pressed) to prevent a button hold being interpreted as a button that was pressed once on the first poll.
| * | | qt_themes: Add styles for the On-Screen Keyboard and OverlayDialogIts-Rei2021-04-153-22/+1193
| | | |
| * | | icons: Add icons for the On-Screen Keyboard overlayIts-Rei2021-04-1561-0/+64
| | | |
| * | | applets/swkbd: Implement the Default Software Keyboard frontendMorph2021-04-152-2/+236
| | | |
| * | | applets/swkbd: Implement the Normal and Inline Software Keyboard AppletMorph2021-04-154-13/+1488
| | | |
| * | | ILibraryAppletCreator: Implement CreateHandleStorageMorph2021-04-152-6/+64
| | | | | | | | | | | | | | | | Used by Monster Hunter Generations Ultimate
| * | | hle_ipc: Add helper functions to get copy/move handlesMorph2021-04-152-2/+16
| | | |
| * | | ILibraryAppletAccessor: Demote from ERROR to DEBUG for null storage logsMorph2021-04-151-2/+2
| | | | | | | | | | | | | | | | Avoids unnecessary console spam when the inline software keyboard is used.
| * | | applets: Pass in the LibraryAppletMode each applet's constructorMorph2021-04-1513-33/+58
| | | |
| * | | applets: Remove the previous software keyboard applet implementationMorph2021-04-158-492/+14
| | | |
* | | | Merge pull request #6201 from bunnei/remove-bintraybunnei2021-04-162-41/+37
|\ \ \ \ | | | | | | | | | | cmake: Remove use of bintray for externals.
| * | | | cmake: Remove use of bintray for externals.bunnei2021-04-162-41/+37
|/ / / / | | | | | | | | | | | | | | | | | | | | - Bintray will be deprecated on May 1st 2021 (https://bintray.com/) - We were previously using this for Qt (non-Windows) and SDL. - I've moved to bundled SDL on Windows.
* | | | Merge pull request #6119 from german77/SDLMappingbunnei2021-04-162-6/+24
|\ \ \ \ | |/ / / |/| | | InputCommon: Address mapping and naming issues with SDL2
| * | | InputCommon: Name properly xbox 360 and one controllers, Fix mappings for Nintendo Pro controllersgerman772021-03-312-6/+24
| | | |
* | | | Merge pull request #6199 from lioncash/log-nsbunnei2021-04-1511-45/+58
|\ \ \ \ | | | | | | | | | | common/log: Move Log namespace into the Common namespace
| * | | | log/backend: Correct order of const in copy constructorLioncash2021-04-151-2/+5
| | | | | | | | | | | | | | | | | | | | | | | | | Follows our predominant coding style. Also explicitly specifies the move constructor/assignment operator as well.
| * | | | common/log: Move Log namespace into the Common namespaceLioncash2021-04-1511-43/+53
| | | | | | | | | | | | | | | | | | | | | | | | | Forgot to move this over when I moved the rest of the source files with lacking namespaces over.
* | | | | Merge pull request #6196 from bunnei/asserts-settingbunnei2021-04-15118-147/+171
|\ \ \ \ \ | | | | | | | | | | | | core: settings: Add setting for debug assertions and disable by default.
| * | | | | common: Move settings to common from core.bunnei2021-04-15116-146/+144
| | | | | | | | | | | | | | | | | | | | | | | | - Removes a dependency on core and input_common from common.
| * | | | | core: settings: Add setting for debug assertions and disable by default.bunnei2021-04-157-2/+28
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | - This is a developer-only setting and no longer needs to be enabled by default. - Also adds "use_auto_stub" setting to SDL frontend while we are here. - Supersedes #1340.
* | | | | | Merge pull request #6197 from ameerj/kreslimit-cleanupbunnei2021-04-144-21/+13
|\ \ \ \ \ \ | |_|_|_|_|/ |/| | | | | k_resource_limit: Cleanup of member variables/headers
| * | | | | k_resource_limit: Minor cleanup of member variables/headersameerj2021-04-144-21/+13
| | | | | |
* | | | | | Merge pull request #6195 from Morph1984/controller-applet-motionbunnei2021-04-142-0/+19
|\ \ \ \ \ \ | |/ / / / / |/| | | | | applets/controller: Hook up the "Motion" button functionality
| * | | | | applets/controller: Hook up the "Motion" button functionalityMorph2021-04-132-0/+19
| | | | | | | | | | | | | | | | | | | | | | | | I forgot to hook this up during the development of the controller applet, this PR amends that.
* | | | | | Merge pull request #6185 from ameerj/process-reslimitbunnei2021-04-142-38/+27
|\ \ \ \ \ \ | | | | | | | | | | | | | | kernel/process: Replace process resource limit instance with the kernel's resource limit
| * | | | | | kernel/process: Replace process resource limit instance with the kernel's resource limitameerj2021-04-122-38/+27
| | | | | | | | | | | | | | | | | | | | | | | | | | | | This commit addresses the inaccurate behavior of kernel processes creating their own resource limit, rather than utilizing the kernel's system-wide resource limit instance.
* | | | | | | Merge pull request #6191 from lioncash/vdtorbunnei2021-04-144-4/+5
|\ \ \ \ \ \ \ | |_|_|/ / / / |/| | | | | | engine_interface: Add missing virtual destructor
| * | | | | | engine_interface: Add missing virtual destructorLioncash2021-04-124-4/+5
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Eliminates a potential bug vector related to inheritance. Plus, we should generally be specifying the destructor as virtual within purely virtual interfaces to begin with.
* | | | | | | Merge pull request #6190 from lioncash/constfn2bunnei2021-04-141-2/+2
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | vk_master_semaphore: Add missing const qualifier for IsFree()
| * | | | | | | vk_master_semaphore: Deduplicate atomic access within IsFree()Lioncash2021-04-121-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | We can just reuse the already existing KnownGpuTick() to deduplicate the access.
| * | | | | | | vk_master_semaphore: Add missing const qualifier for IsFree()Lioncash2021-04-121-1/+1
| |/ / / / / / | | | | | | | | | | | | | | | | | | | | | This member function doesn't modify class state.
* | | | | | | Merge pull request #6188 from lioncash/bitsbunnei2021-04-141-5/+6
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | vk_texture_cache: Make use of bit_cast where applicable
| * | | | | | | vk_texture_cache: Make use of Common::BitCast where applicableLioncash2021-04-121-5/+6
| |/ / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | Also clarify the TODO comment a little more on the lacking implementations for std::bit_cast.
* | | | | | | Merge pull request #6187 from lioncash/sign-convbunnei2021-04-132-11/+15
|\ \ \ \ \ \ \ | |_|_|/ / / / |/| | | | | | texure_cache/util: Resolve implicit sign conversions with std::reduce
| * | | | | | texure_cache/util: Resolve implicit sign conversions with std::reduceLioncash2021-04-122-11/+15
| |/ / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Amends implicit sign conversions occurring with usages of std::reduce and also relocates it to its own utility function to reduce verbosity a little bit.
* | | | | | Merge pull request #6186 from lioncash/cache-erasebunnei2021-04-131-5/+4
|\ \ \ \ \ \ | | | | | | | | | | | | | | query_cache: Make use of std::erase_if
| * | | | | | query_cache: Make use of std::erase_ifLioncash2021-04-121-5/+4
| |/ / / / / | | | | | | | | | | | | | | | | | | Same behavior, but much more straightforward to read.
* | | | | | Merge pull request #6193 from lioncash/incguardbunnei2021-04-131-0/+2
|\ \ \ \ \ \ | |_|_|/ / / |/| | | | | nvidia_flags: Add missing header guard
| * | | | | nvidia_flags: Add missing header guardLioncash2021-04-131-0/+2
|/ / / / / | | | | | | | | | | | | | | | Prevents potential inclusion compilation errors.
* | | | | Merge pull request #6192 from lioncash/discardbunnei2021-04-121-1/+1
|\ \ \ \ \ | |/ / / / |/| | | | k_thread: Remove [[nodiscard]] attribute from ClearWaitCancelled()
| * | | | k_thread: Remove [[nodiscard]] attribute from ClearWaitCancelled()Lioncash2021-04-121-1/+1
|/ / / / | | | | | | | | | | | | | | | | This function has a void return value, so this attribute doesn't apply to it.
* | | | Merge pull request #6135 from Morph1984/borderless-windowed-fullscreenbunnei2021-04-125-9/+120
|\ \ \ \ | |/ / / |/| | | configure_graphics: Add Borderless Windowed fullscreen mode
| * | | config: Default to exclusive fullscreen mode on platforms other than WindowsMorph2021-04-061-0/+12
| | | | | | | | | | | | | | | | Several issues have been reported with the borderless windowed fullscreen mode on *nix platforms. Default to exclusive fullscreen mode on these platforms for now.
| * | | configure_graphics: Add Borderless Windowed fullscreen modeMorph2021-04-065-9/+108
| | | | | | | | | | | | | | | | | | | | | | | | The borderless windowed fullscreen mode solves several issues with the presentation of the overlay dialogs and on-screen keyboard in exclusive fullscreen mode, and also has other benefits such as smoother gameplay, lower latency and a significant reduction in screen tearing. Co-authored-by: Its-Rei <kupfel@gmail.com>
* | | | Merge pull request #6181 from Joshua-Ashton/robustness_featuresRodrigo Locatti2021-04-121-0/+9
|\ \ \ \ | | | | | | | | | | vulkan_device: Enable EXT_robustness2 features
| * | | | vulkan_device: Enable EXT_robustness2 featuresJoshua Ashton2021-04-111-0/+9
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | When this was being made mandatory, these enablement of these features was removed, but this is still needed. Fixes: 757fd1e91716 ("vulkan_device: Require VK_EXT_robustness2")
* | | | | Merge pull request #6182 from Joshua-Ashton/null-offsetRodrigo Locatti2021-04-121-1/+1
|\ \ \ \ \ | | | | | | | | | | | | vk_buffer_cache: Fix offset for NULL vertex buffers
| * | | | | vk_buffer_cache: Fix offset for NULL vertex buffersJoshua Ashton2021-04-111-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The Vulkan spec states: If an element of pBuffers is VK_NULL_HANDLE, then the corresponding element of pOffsets must be zero. https://www.khronos.org/registry/vulkan/specs/1.2-extensions/man/html/vkCmdBindVertexBuffers2EXT.html#VUID-vkCmdBindVertexBuffers2EXT-pBuffers-04112
* | | | | | Merge pull request #6170 from Morph1984/more-time-fixesbunnei2021-04-116-21/+38
|\ \ \ \ \ \ | | | | | | | | | | | | | | service: time: Setup the network clock with the local clock context
| * | | | | | service: time: Setup the network clock with the local clock contextMorph2021-04-086-21/+38
| | | | | | | | | | | | | | | | | | | | | | | | | | | | Setting the network time allows some time based events using the network clock to not reset.
* | | | | | | Merge pull request #6183 from MerryMage/dynarmicLC2021-04-111-0/+0
|\ \ \ \ \ \ \ | |_|/ / / / / |/| | | | | | externals: Update dynarmic to b2a4da5e
| * | | | | | externals: Update dynarmic to b2a4da5eMerryMage2021-04-111-0/+0
|/ / / / / /
* | | | | | Merge pull request #6180 from Joshua-Ashton/device_loss_fixMorph2021-04-113-5/+10
|\ \ \ \ \ \ | |_|/ / / / |/| | | | | renderer_vulkan: Check return value of AcquireNextImage
| * | | | | renderer_vulkan: Check return value of AcquireNextImageJoshua Ashton2021-04-113-5/+10
|/ / / / / | | | | | | | | | | | | | | | | | | | | We can get into a really bad state by ignoring this leading to device loss and using incorrect resources.
* | | | | Merge pull request #6167 from Morph1984/time-fixbunnei2021-04-111-3/+8
|\ \ \ \ \ | | | | | | | | | | | | service: time: Fix CalculateStandardUserSystemClockDifferenceByUser
| * | | | | service: time: Fix CalculateStandardUserSystemClockDifferenceByUserMorph2021-04-081-3/+8
| | | | | | | | | | | | | | | | | | | | | | | | CalculateStandardUserSystemClockDifferenceByUser passes in the ClockSnapshots through 2 input buffers and not as raw arguments. Fix this by reading the 2 input buffers instead of popping raw arguments.
* | | | | | Merge pull request #6112 from ogniK5377/pctlbunnei2021-04-116-31/+254
|\ \ \ \ \ \ | | | | | | | | | | | | | | pctl: Rework how pctl works to be more accurate
| * | | | | | Addressed issuesChloe Marcec2021-03-302-21/+22
| | | | | | |
| * | | | | | pctl: Rework how pctl works to be more accurateChloe Marcec2021-03-266-31/+253
| | | | | | | | | | | | | | | | | | | | | | | | | | | | Introduces the usage of compatibilities to allow it the module to be closer to how it works on hardware.
* | | | | | | Merge pull request #6172 from degasus/cmake_opusbunnei2021-04-105-3/+11
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | externals: Search for shared opus installation.
| * | | | | | | externals: Search for shared opus installation.Markus Wick2021-04-085-3/+11
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | We had used conan for opus before, but there was a bug in the AVX detection. However we still had the Findopus.cmake file within the repository, but not used. This patch reenables the Findopus helper and prefer the system wide installation of opus.
* | | | | | | | Merge pull request #6099 from bunnei/derive-membunnei2021-04-1026-173/+2139
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | Kernel Rework: Derive memory regions from board layout.
| * | | | | | | | hle: kernel: Breakup InitializeMemoryLayout.bunnei2021-03-241-3/+7
| | | | | | | | |
| * | | | | | | | hle: kernel: k_memory_region_type: Minor code cleanup.bunnei2021-03-241-13/+12
| | | | | | | | |
| * | | | | | | | hle: kernel: k_memory_region: Minor code cleanup.bunnei2021-03-241-7/+5
| | | | | | | | |
| * | | | | | | | hle: kernel: k_memory_layout: Use pair instead of tuple.bunnei2021-03-241-2/+4
| | | | | | | | |
| * | | | | | | | hle: kernel: k_system_control: Remove unnecessary inline.bunnei2021-03-241-4/+4
| | | | | | | | |
| * | | | | | | | common: common_sizes: Move sizes to the Common namespace.bunnei2021-03-245-45/+50
| | | | | | | | |
| * | | | | | | | hle: kernel: Merge KMemoryRegionAttr and KMemoryRegionType.bunnei2021-03-212-11/+9
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | - Fixes clang errors with mixed enum arithmetic.
| * | | | | | | | hle: kernel: Remove unused variable.bunnei2021-03-211-1/+0
| | | | | | | | |
| * | | | | | | | hle: kernel: k_memory_region_type: Remove extra ".bunnei2021-03-211-1/+1
| | | | | | | | |
| * | | | | | | | hle: kernel: k_memory_layout: Move KMemoryRegionAllocator out of global.bunnei2021-03-213-35/+47
| | | | | | | | |
| * | | | | | | | hle: kernel: k_memory_layout: Derive memory regions based on board layout.bunnei2021-03-216-56/+1033
| | | | | | | | |
| * | | | | | | | common: common_sizes: Move Invalid to Size_* prefix and add missing values.bunnei2021-03-212-15/+21
| | | | | | | | |
| * | | | | | | | hle: kernel: k_memory_region: Refactor to simplify code.bunnei2021-03-212-83/+89
| | | | | | | | |
| * | | | | | | | hle: kernel: board: k_system_control: Extend to include memory region sizes.bunnei2021-03-213-1/+135
| | | | | | | | |
| * | | | | | | | hle: kernel: board: Add secure_monitor module.bunnei2021-03-212-0/+27
| | | | | | | | |
| * | | | | | | | common: Move common sizes to their own header for code reuse.bunnei2021-03-213-13/+25
| | | | | | | | |
| * | | | | | | | hle: kernel: k_address_space_info: Cleanup.bunnei2021-03-211-9/+9
| | | | | | | | |
| * | | | | | | | hle: kernel: Add k_trace module.bunnei2021-03-212-0/+13
| | | | | | | | |
| * | | | | | | | hle: kernel: KSystemControl: Update to reflect board-specific behavior.bunnei2021-03-214-10/+41
| | | | | | | | |
| * | | | | | | | hle: kernel: KMemoryManager: Add CalculateManagementOverheadSize.bunnei2021-03-212-0/+26
| | | | | | | | |
| * | | | | | | | hle: kernel: KMemoryManager: Add aliases.bunnei2021-03-211-0/+4
| | | | | | | | |
| * | | | | | | | hle: kernel: Add architecture and board specific memory regions.bunnei2021-03-212-0/+72
| | | | | | | | |
| * | | | | | | | hle: kernel: KMemoryRegion: Derive region values.bunnei2021-03-211-0/+327
| | | | | | | | |
| * | | | | | | | hle: kernel: Migrate some code from Common::SpinLock to KSpinLock.bunnei2021-03-215-25/+25
| | | | | | | | |
| * | | | | | | | hle: kernel: Add initial KMemoryRegionType module.bunnei2021-03-213-18/+41
| | | | | | | | |
| * | | | | | | | hle: kernel: Move KMemoryRegion to its own module and update.bunnei2021-03-214-31/+322
| | | | | | | | |
* | | | | | | | | Merge pull request #6171 from german77/servicesbunnei2021-04-1030-97/+137
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | service: Update service function tables and use proper names
| * | | | | | | | | wlan: Update to 12.xgerman772021-04-091-0/+7
| | | | | | | | | |
| * | | | | | | | | usb: Use proper namesgerman772021-04-091-21/+21
| | | | | | | | | |
| * | | | | | | | | ITimeZoneService: Update to 12.xgerman772021-04-091-0/+1
| | | | | | | | | |
| * | | | | | | | | spl: Update to 12.xgerman772021-04-091-0/+3
| | | | | | | | | |
| * | | | | | | | | sfdnsres: Use proper namesgerman772021-04-091-2/+2
| | | | | | | | | |
| * | | | | | | | | nsd: Update to 12.xgerman772021-04-091-0/+1
| | | | | | | | | |
| * | | | | | | | | ethc: Update to 12.xgerman772021-04-091-0/+1
| | | | | | | | | |
| * | | | | | | | | sm: Use proper names, update to 12.xgerman772021-04-091-4/+5
| | | | | | | | | |
| * | | | | | | | | set_sys: Update to 12.xgerman772021-04-091-0/+6
| | | | | | | | | |
| * | | | | | | | | pctl_module: Update to 12.xgerman772021-04-091-0/+3
| | | | | | | | | |
| * | | | | | | | | pcie: Use proper namesgerman772021-04-091-1/+1
| | | | | | | | | |
| * | | | | | | | | olsc: Update to 12.xgerman772021-04-091-0/+1
| | | | | | | | | |
| * | | | | | | | | pl_u: Update to 12.xgerman772021-04-091-0/+4
| | | | | | | | | |
| * | | | | | | | | ldr: Use proper namesgerman772021-04-091-16/+16
| | | | | | | | | |
| * | | | | | | | | arp: Use proper names, update to 12.xgerman772021-04-092-3/+10
| | | | | | | | | |
| * | | | | | | | | caps_u: Update to 12.xgerman772021-04-091-0/+1
| | | | | | | | | |
| * | | | | | | | | caps_a: Update to 12.xgerman772021-04-091-0/+1
| | | | | | | | | |
| * | | | | | | | | bpc: Use proper namesgerman772021-04-091-2/+2
| | | | | | | | | |
| * | | | | | | | | bcat_module: Update to 12.xgerman772021-04-091-0/+2
| | | | | | | | | |
| * | | | | | | | | codecctl: Use proper namesgerman772021-04-091-13/+13
| | | | | | | | | |
| * | | | | | | | | audren_u: Use proper namesgerman772021-04-092-4/+4
| | | | | | | | | |
| * | | | | | | | | audren_a: Use proper namesgerman772021-04-091-6/+6
| | | | | | | | | |
| * | | | | | | | | audrec_u: Use proper names, update to 12.xgerman772021-04-091-3/+4
| | | | | | | | | |
| * | | | | | | | | audrec_a: Use proper namesgerman772021-04-091-2/+2
| | | | | | | | | |
| * | | | | | | | | audout_u: Use proper namesgerman772021-04-091-3/+3
| | | | | | | | | |
| * | | | | | | | | audout_a: Use proper namesgerman772021-04-091-6/+6
| | | | | | | | | |
| * | | | | | | | | audin_u: Use proper namesgerman772021-04-091-7/+7
| | | | | | | | | |
| * | | | | | | | | audin_a: Use proper namesgerman772021-04-091-4/+4
| | | | | | | | | |
* | | | | | | | | | Merge pull request #6156 from lioncash/lock-discardbunnei2021-04-103-9/+12
|\ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | kernel: Mark lock helper classes as [[nodiscard]]
| * | | | | | | | | | Amend bizarre clang-format suggestionsLioncash2021-04-073-5/+5
| | | | | | | | | | |
| * | | | | | | | | | k_scoped_scheduler_lock_and_sleep: Mark class as [[nodiscard]]Lioncash2021-04-071-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Prevents logic bugs from slipping through.
| * | | | | | | | | | k_scoped_lock: delete copy and move assignment operatorsLioncash2021-04-071-2/+5
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | If we delete the copy and move constructor, we should also be deleting the copy and move assignment operators (and even if this were intended, it would be pretty odd to not document why it's done this way).
| * | | | | | | | | | k_scoped_lock: Mark class as [[nodiscard]]Lioncash2021-04-071-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Prevents logic bugs of the kind described in the previous commit from slipping through.
| * | | | | | | | | | k_scheduler: Mark KScopedSchedulerLock as [[nodiscard]]Lioncash2021-04-071-1/+1
| | |_|_|_|_|_|/ / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Prevents logic bugs like: KScopedSchedulerLock{kernel}; instead of: KScopedSchedulerLock lk{kernel}; from slipping through.
* | | | | | | | | | Merge pull request #6113 from german77/playhistorybunnei2021-04-101-1/+13
|\ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | Friend: Stub GetPlayHistoryRegistrationKey
| * | | | | | | | | | Friend: Stub GetPlayHistoryRegistrationKeygerman772021-03-271-1/+13
| | |_|_|_|/ / / / / | |/| | | | | | | |
* | | | | | | | | | Merge pull request #6158 from german77/hidServiceTablesbunnei2021-04-102-0/+85
|\ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | hid: Update service function tables
| * | | | | | | | | | hid: Update service function tablesgerman772021-04-072-0/+85
| | | | | | | | | | |
* | | | | | | | | | | Merge pull request #6162 from degasus/no_spin_loopsbunnei2021-04-096-33/+64
|\ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | video_core: Avoid spin loops.
| * | | | | | | | | | | video_core: Use a CV for blocking commands.Markus Wick2021-04-072-23/+31
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | There is no need for a busy loop here. Let's just use a condition variable to save some power.
| * | | | | | | | | | | video_core/gpu_thread: Keep the write lock for allocating the fence.Markus Wick2021-04-072-1/+4
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Else the fence might get submited out-of-order into the queue, which makes testing them pointless. Overhead should be tiny as the mutex is just moved from the queue to the writing code.
| * | | | | | | | | | | video_core/gpu_thread: Implement a ShutDown method.Markus Wick2021-04-075-15/+28
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This was implicitly done by `is_powered_on = false`, however the explicit method allows us to block until the GPU is actually gone. This should fix a race condition while removing the other subsystems while the GPU is still active.
| * | | | | | | | | | | common/threadsafe_queue: Provide Wait() method.Markus Wick2021-04-072-3/+10
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | It shall block until there is something to consume in the queue. And use it for the GPU emulation instead of the spin loop. This is only in booting the emulator, however in BOTW this is the case for about 1 second.
* | | | | | | | | | | | Merge pull request #6164 from Morph1984/service-update-12.xbunnei2021-04-0912-49/+168
|\ \ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | | | service: Update service function tables
| * | | | | | | | | | | | ns: Update to 12.xMorph2021-04-091-3/+38
| | | | | | | | | | | | |
| * | | | | | | | | | | | aoc_u: Update to 12.xMorph2021-04-091-0/+2
| | | | | | | | | | | | |
| * | | | | | | | | | | | nim: Update to 12.xMorph2021-04-091-44/+55
| | | | | | | | | | | | |
| * | | | | | | | | | | | npns: Update to 12.xMorph2021-04-091-0/+3
| | | | | | | | | | | | |
| * | | | | | | | | | | | bgtc: Update to 12.x and implement OpenTaskServiceMorph2021-04-094-1/+36
| | | | | | | | | | | | |
| * | | | | | | | | | | | vi: Update to 12.xMorph2021-04-091-0/+8
| | | | | | | | | | | | |
| * | | | | | | | | | | | erpt: Update to 12.xMorph2021-04-091-1/+6
| | | | | | | | | | | | |
| * | | | | | | | | | | | btm: Update to 12.xMorph2021-04-091-0/+1
| | | | | | | | | | | | |
| * | | | | | | | | | | | btdrv: Update to 12.xMorph2021-04-091-0/+19
|/ / / / / / / / / / / /
* | | | | | | | | | | | Merge pull request #6168 from Morph1984/stub-SetNpadAnalogStickUseCenterClampbunnei2021-04-094-1/+29
|\ \ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | | | service: hid: Stub SetAnalogStickUseCenterClamp
| * | | | | | | | | | | | service: hid: Stub SetAnalogStickUseCenterClampMorph2021-04-084-1/+29
| | |_|_|_|_|_|_|_|/ / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | - Used by eBASEBALLパワフルプロ野球2020
* | | | | | | | | | | | Merge pull request #6155 from ameerj/kernel-12-rescntbunnei2021-04-091-2/+2
|\ \ \ \ \ \ \ \ \ \ \ \ | |_|_|_|_|_|/ / / / / / |/| | | | | | | | | | | kernel: Increase event and session counts
| * | | | | | | | | | | kernel: Increase event and session countsameerj2021-04-071-2/+2
| | |_|_|_|/ / / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | 12.x increased the number of available sessions and event resource counts
* | | | | | | | | | | Merge pull request #6157 from Morph1984/am-update-12.xbunnei2021-04-091-0/+22
|\ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | service: am: Update service function tables
| * | | | | | | | | | | ISelfController: Update to 11.xMorph2021-04-071-0/+1
| | | | | | | | | | | |
| * | | | | | | | | | | IApplicationFunctions: Update to 11.xMorph2021-04-071-0/+6
| | | | | | | | | | | |
| * | | | | | | | | | | IDebugFunctions: Update to 12.xMorph2021-04-071-0/+2
| | | | | | | | | | | |
| * | | | | | | | | | | ICommonStateGetter: Update to 12.xMorph2021-04-071-0/+9
| | | | | | | | | | | |
| * | | | | | | | | | | IGlobalStateController: Update to 12.xMorph2021-04-071-0/+1
| | | | | | | | | | | |
| * | | | | | | | | | | IHomeMenuFunctions: Update to 12.xMorph2021-04-071-0/+3
| | |_|_|/ / / / / / / | |/| | | | | | | | |
* | | | | | | | | | | Merge pull request #6062 from ameerj/auto-stubbunnei2021-04-095-0/+32
|\ \ \ \ \ \ \ \ \ \ \ | |_|_|_|_|_|_|/ / / / |/| | | | | | | | | | service: Add a toggle for auto stub fallback
| * | | | | | | | | | configuration: Add auto stub toggle that resets on bootameerj2021-03-305-4/+32
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Auto-stub is an experimental debugging feature that may cause unforseen bugs. This adds a toggle to only allow auto-stubbing unimplemented functions when explicitly enabled when yuzu is launched.
| * | | | | | | | | | service: Auto stub fallbackameerj2021-03-301-0/+4
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | For simple services we can implement an automatic stub fallback to help with compatibility until a proper implementation is done. Co-Authored-By: Chloe <25727384+ognik5377@users.noreply.github.com>
* | | | | | | | | | | Merge pull request #6145 from lat9nq/nvhost_empty_memcpybunnei2021-04-081-6/+11
|\ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | nvhost_nvdec_common: Avoid memcpy with null pointers
| * | | | | | | | | | | nvhost_nvdec_common: Avoid memcpy with null pointerslat9nq2021-04-051-6/+11
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Avoid sending null pointer to memcpy as reported by Undefined Behavious Sanitizer. Co-authored-by: LC <mathew1800@gmail.com>
* | | | | | | | | | | | Merge pull request #6154 from lioncash/svcrange2bunnei2021-04-081-0/+132
|\ \ \ \ \ \ \ \ \ \ \ \ | |_|_|_|_|/ / / / / / / |/| | | | | | | | | | | svc: Expand SVC tables
| * | | | | | | | | | | svc: Expand SVC tablesLioncash2021-04-071-0/+132
| | |_|_|/ / / / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | 12.x expanded the range of SVC entries from 0x7F to 0xBF (with all new entries being unused), so we can expand it to also match.
* | | | | | | | | | | Merge pull request #6160 from Morph1984/fs-update-12.xbunnei2021-04-082-6/+15
|\ \ \ \ \ \ \ \ \ \ \ | |_|_|_|_|_|_|_|/ / / |/| | | | | | | | | | service: fs: Update service function tables
| * | | | | | | | | | IFile: Update to 12.xMorph2021-04-071-3/+7
| | | | | | | | | | |
| * | | | | | | | | | fsp-srv: Update to 12.xMorph2021-04-072-3/+8
| | |_|_|/ / / / / / | |/| | | | | | | |
* | | | | | | | | | Merge pull request #6143 from lat9nq/nvhost_null_memcpybunnei2021-04-081-1/+7
|\ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | nvhost_ctrl_gpu: Avoid sending null pointer to memcpy
| * | | | | | | | | | nvhost_ctrl_gpu: Avoid sending null pointer to memcpylat9nq2021-04-051-1/+7
| | |_|/ / / / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Undefined Behaviour Sanitizer reports a null pointer is being sent to memcpy, thought it's "guaranteed to never be null". Guard it with an if statement, and log when the action has been averted.
* | | | | | | | | | Merge pull request #6159 from Morph1984/acc-update-12.xbunnei2021-04-073-36/+45
|\ \ \ \ \ \ \ \ \ \ | |_|_|_|_|/ / / / / |/| | | | | | | | | service: acc: Update service function tables
| * | | | | | | | | dauth_o: Update to 11.xMorph2021-04-071-6/+11
| | | | | | | | | |
| * | | | | | | | | acc_u1: Update to 12.xMorph2021-04-071-13/+15
| | | | | | | | | |
| * | | | | | | | | acc_su: Update to 12.xMorph2021-04-071-17/+19
| | |/ / / / / / / | |/| | | | | | |
* | | | | | | | | Merge pull request #6130 from degasus/better_assert_handlingbunnei2021-04-073-6/+20
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | common: Move assert failure handling into a cpp file.
| * | | | | | | | | common: Move assert failure handling into a cpp file.Markus Wick2021-04-043-6/+20
| | |/ / / / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Advantage: Altering the handler does not need a full recompilation. Disadvantage: noreturn is droped, so the caller is a bit slower. We quite often run yuzu with a YOLO assertion handler. In fact, only very few games run at all with asserts. This patch allows developers to patch the handler without recompiling everything. The overhead of the missing "noreturn" attribute shoul be negletable.
* | | | | | | | | Merge pull request #6153 from lioncash/svcrangebunnei2021-04-072-6/+1
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | process_capability: Handle extended SVC range
| * | | | | | | | | process_capability: Handle extended SVC rangeLioncash2021-04-072-6/+1
| | |_|/ / / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | 12.x extended the range of SVC IDs, so we need to expand the range of bits that need to be tested. The upside of this is that we can eliminate a range check, given the whole range is used.
* | | | | | | | | Merge pull request #6161 from Morph1984/audio-update-12.xbunnei2021-04-071-0/+4
|\ \ \ \ \ \ \ \ \ | |_|_|/ / / / / / |/| | | | | | | | service: audio: Update service function tables
| * | | | | | | | hwopus: Update to 12.xMorph2021-04-071-0/+4
|/ / / / / / / /
* | | | | | | | Merge pull request #6146 from lat9nq/vp9_empty_memcpybunnei2021-04-071-7/+9
|\ \ \ \ \ \ \ \ | |/ / / / / / / |/| | | | | | | vp9: Avoid memcpy with null pointers
| * | | | | | | vp9: Avoid memcpy with null pointerslat9nq2021-04-051-7/+9
| |/ / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Avoid sending null pointer to memcpy as reported by Undefined Behaviour Sanitizer. Replaces the std::memcpy calls in SpliceVectors with std::copy calls. Opting to replace all the memcpy's with copy's. Co-authored-by: LC <mathew1800@gmail.com>
* | | | | | | Merge pull request #6141 from lat9nq/cfg_gphcs_stack_useLC2021-04-051-1/+1
|\ \ \ \ \ \ \ | |/ / / / / / |/| | | | | | configure_graphics: Prevent stack-use-after-scope
| * | | | | | configure_graphics: Prevent stack-use-after-scopelat9nq2021-04-041-1/+1
|/ / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Address Sanitizer reports stack-use-after-scope on line 231 `vulkan_devices.push_back(QString::fromStdString(name));`. Instead of using a pointer, copy the string into a std::string and use that, instead.
* | | | | | Merge pull request #6139 from Morph1984/cmake-fix-buildMorph2021-04-041-1/+1
|\ \ \ \ \ \ | | | | | | | | | | | | | | ci: Fix MSVC build with CMake 3.20.0
| * | | | | | ci: Fix MSVC build with CMake 3.20.0Morph2021-04-041-1/+1
|/ / / / / /
* | | | | | Merge pull request #6127 from german77/udpSingleConnectionbunnei2021-04-044-102/+101
|\ \ \ \ \ \ | | | | | | | | | | | | | | InputCommon: Improve UDP communications
| * | | | | | Use a single connection for UDP server, make connection test longer and check all pads instead of only the first onegerman772021-03-314-102/+101
| | | | | | |
* | | | | | | Merge pull request #6132 from MerryMage/code_sizebunnei2021-04-033-0/+8
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | arm_dynarmic: Increase size of code cache
| * | | | | | | arm_dynarmic: Increase size of code cacheMerryMage2021-04-023-0/+8
| | | | | | | |
* | | | | | | | Merge pull request #6131 from german77/rightjoyconSLSRMorph2021-04-021-2/+6
|\ \ \ \ \ \ \ \ | |/ / / / / / / |/| | | | | | | HID: Fix SL and SR buttons for right joycon
| * | | | | | | HID: Fix SL and SR buttons for right joycongerman772021-04-021-2/+6
| | |_|/ / / / | |/| | | | |
* | | | | | | Merge pull request #6129 from degasus/cmake_libzipbunnei2021-04-023-74/+74
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | externals/cmake: Fix case spelling of libzip.
| * | | | | | | externals: Fix case spelling of libzip.Markus Wick2021-04-023-74/+74
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | CMake is case senstive, so Libzip vs LIBZIP was a bug. Upstream calls themself libzip, so let's pick this naming.
* | | | | | | | Merge pull request #6128 from bunnei/update-dynarmic-2bunnei2021-04-021-0/+0
|\ \ \ \ \ \ \ \ | |/ / / / / / / |/| | | | | | | externals: dynarmic: Update to latest rev. to increase code size.
| * | | | | | | externals: dynarmic: Update to latest rev. to increase code size.bunnei2021-04-011-0/+0
|/ / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | - The current limits are being hit in yuzu with some games. - This should fix the slowdowns in newer updates for Super Smash Bros. Ultimate.
* | | | | | | Merge pull request #6106 from MerryMage/nullptr-jitbunnei2021-04-014-53/+26
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | [test] arm_dynarmic: Always have a 'valid' jit instance
| * | | | | | | arm_dynarmic: Always have a 'valid' jit instanceMerryMage2021-03-244-53/+26
| | | | | | | |
* | | | | | | | Merge pull request #6126 from Morph1984/stub-SetAlbumImageTakenNotificationEnabledbunnei2021-03-312-1/+17
|\ \ \ \ \ \ \ \ | |_|_|/ / / / / |/| | | | | | | ISelfController: Stub SetAlbumImageTakenNotificationEnabled
| * | | | | | | ISelfController: Stub SetAlbumImageTakenNotificationEnabledMorph2021-03-302-1/+17
| | |_|/ / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | This service call sets an internal flag whether a notification is shown when an image is captured. Currently we do not support capturing images via the capture button, so this can be stubbed for now.
* | | | | | | Merge pull request #5927 from ameerj/astc-computeRodrigo Locatti2021-03-3122-1770/+2027
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | video_core: Accelerate ASTC texture decoding using compute shaders
| * | | | | | | astc_decoder: Refactor for style and more efficient memory useameerj2021-03-259-2256/+502
| | | | | | | |
| * | | | | | | astc_decoder: Reimplement LayersRodrigo Locatti2021-03-135-142/+161
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Reimplements the approach to decoding layers in the compute shader. Fixes multilayer astc decoding when using Vulkan.
| * | | | | | | astc_decoder: Fix out of bounds memory accessameerj2021-03-131-2/+10
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | resolves a crash with some anamolous textures found in Astral Chain.
| * | | | | | | renderer_vulkan: Accelerate ASTC decodingameerj2021-03-1311-57/+426
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Co-Authored-By: Rodrigo Locatti <reinuseslisp@airmail.cc>
| * | | | | | | host_shaders: Modify shader cmake integration to allow for larger shadersameerj2021-03-134-8/+27
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | using a raw string to encapsulate the entire shader code limits us to shaders of size less than 2KB. This change overcomes this limitation.
| * | | | | | | renderer_opengl: Accelerate ASTC texture decoding with a compute shaderameerj2021-03-136-2/+1598
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | ASTC texture decoding is currently handled by a CPU decoder for GPU's without native ASTC decoding support (most desktop GPUs). This is the cause for noticeable performance degradation in titles which use the format extensively. This commit adds support to accelerate ASTC decoding using a compute shader on OpenGL for GPUs without native support.
* | | | | | | | Merge pull request #6116 from german77/userArgumentbunnei2021-03-311-0/+28
|\ \ \ \ \ \ \ \ | |_|/ / / / / / |/| | | | | | | yuzu/main: Add user command line argument
| * | | | | | | yuzu/main: Add user command line argumentgerman772021-03-271-0/+28
| | |_|/ / / / | |/| | | | |
* | | | | | | Merge pull request #6124 from jbeich/vulkan+openglbunnei2021-03-302-5/+5
|\ \ \ \ \ \ \ | |_|_|_|_|_|/ |/| | | | | | vulkan_common: enable OpenGL interop on other Unices
| * | | | | | vulkan_common: enable OpenGL interop on other UnicesJan Beich2021-03-302-5/+5
| | | | | | |
* | | | | | | Merge pull request #6109 from german77/gestureIDbunnei2021-03-302-3/+13
|\ \ \ \ \ \ \ | |/ / / / / / |/| | | | | | HID: Initialize correctly the gesture finger_id and filter invalid inputs
| * | | | | | HID: Initialize correctly the gesture finger_id and filter invalid resultsNarr the Reg2021-03-262-3/+13
| |/ / / / /
* | | | | | Merge pull request #6102 from ogniK5377/fd-passbunnei2021-03-2920-78/+161
|\ \ \ \ \ \ | | | | | | | | | | | | | | nvdrv: Pass device fd and handle device create methods for device opening and closing
| * | | | | | nvdrv: Pass device fd and handle device create methods for device opening and closingChloe Marcec2021-03-2520-78/+161
| |/ / / / / | | | | | | | | | | | | | | | | | | We pass the fd to the ioctl as well as alert the device when it's opened or closed to allow for fd unique actions to take place
* | | | | | Merge pull request #6118 from MerryMage/dynarmicbunnei2021-03-281-0/+0
|\ \ \ \ \ \ | | | | | | | | | | | | | | externals: Update dynarmic to c28f13af
| * | | | | | externals: Update dynarmic to c28f13afMerryMage2021-03-271-0/+0
| | |_|_|_|/ | |/| | | | | | | | | | | | | | | | AVX-512 bugfixes
* | | | | | Merge pull request #6115 from bunnei/fix-kernel-initbunnei2021-03-281-1/+1
|\ \ \ \ \ \ | |/ / / / / |/| | | | | hle: kernel: Initialize preemption task after schedulers.
| * | | | | hle: kernel: Initialize preemption task after schedulers.bunnei2021-03-271-1/+1
| |/ / / / | | | | | | | | | | | | | | | - Fixes a startup crash that occurs if CoreTiming tries to preempt before kernel initialization completes.
* | | | | Merge pull request #6114 from Morph1984/friend-logbunnei2021-03-271-11/+12
|\ \ \ \ \ | |/ / / / |/| | | | service: friend: Change logging class from ACC to Friend
| * | | | service: friend: Change logging class from ACC to FriendMorph2021-03-271-11/+12
|/ / / /
* | | | Merge pull request #6101 from ogniK5377/alloc-as-exbunnei2021-03-252-27/+49
|\ \ \ \ | | | | | | | | | | nvdrv: Change InitializeEx to AllocAsEx
| * | | | nvdrv: Change InitializeEx to AllocAsExChloe Marcec2021-03-222-27/+49
| | | | | | | | | | | | | | | | | | | | Wee also report the correct "big page size" now in GetVARegions & fix up the struct for IoctlAllocAsEx
* | | | | Merge pull request #6108 from jbeich/freebsd-async-shadersbunnei2021-03-251-1/+1
|\ \ \ \ \ | |_|_|/ / |/| | | | gl_device: unblock async shaders on other Unix systems
| * | | | gl_device: unblock async shaders on other Unix systemsJan Beich2021-03-241-1/+1
|/ / / / | | | | | | | | | | | | | | | | Mesa is the primary OpenGL provider on all FreeDesktop systems. For example, iris is used on Intel GPU + FreeBSD by default.
* | | | Merge pull request #6100 from bunnei/arm-fixbunnei2021-03-242-0/+10
|\ \ \ \ | | | | | | | | | | core: arm_dynarmic: Ensure JIT state is saved/restored on page table changes.
| * | | | core: arm_dynarmic: Ensure JIT state is saved/restored on page table changes.bunnei2021-03-212-0/+10
| | |_|/ | |/| | | | | | | | | | - We re-create the JIT here without preserving any state.
* | | | Merge pull request #6092 from ivan-boikov/cancel-dir-selectbunnei2021-03-231-1/+4
|\ \ \ \ | |_|/ / |/| | | Fix cancelation of getExistingDirectory dialog
| * | | Fix cancelation of choose directory dialogivan-boikov2021-03-201-1/+4
| |/ /
* | | Merge pull request #6095 from lat9nq/async-shader-blockLC2021-03-221-1/+13
|\ \ \ | | | | | | | | gl_device: Block async shaders on AMD and Intel
| * | | gl_device: Block async shaders on AMD and Intellat9nq2021-03-211-1/+13
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Currently, the Windows versions of the Intel OpenGL driver and the AMD proprietary OpenGL driver do not properly support (or in fact degrade) when asynchronous shader compilation is enabled. This blocks specifically those drivers from using this feature. This affects AMDGPU-PRO on Linux, and AMD's and Intel's OpenGL drivers on Windows.
* | | | Merge pull request #6078 from Morph1984/libusb-utf8LC2021-03-221-0/+5
|\ \ \ \ | |_|/ / |/| | | externals/libusb/CMakeLists: Add /utf-8 compile option for MSVC
| * | | externals/libusb/CMakeLists: Add /utf-8 compile option for MSVCMorph2021-03-151-0/+5
| |/ /
* | | Merge pull request #6052 from Morph1984/vi-getindirectlayerimagemapbunnei2021-03-201-1/+27
|\ \ \ | | | | | | | | IApplicationDisplayService: Stub GetIndirectLayerImageMap
| * | | IApplicationDisplayService: Stub GetIndirectLayerImageMapMorph2021-03-171-1/+27
| | | | | | | | | | | | | | | | Used by games invoking the inline software keyboard such as GNOSIA
* | | | Merge pull request #6056 from zkitX/spl-updatesbunnei2021-03-183-9/+178
|\ \ \ \ | | | | | | | | | | service: Refactor spl
| * | | | Fix casing on DeallocateAesKeySlotzkitx2021-03-111-3/+3
| | | | |
| * | | | Update SPL to fit N's service refactor (4.0.0+) which split into new services.zkitx2021-03-113-9/+178
| | | | |
* | | | | Merge pull request #6055 from MerryMage/exceed-the-limitbunnei2021-03-181-1/+1
|\ \ \ \ \ | |_|/ / / |/| | | | [testing] fiber: Double default stack size
| * | | | fiber: Double default stack sizeMerryMage2021-03-101-1/+1
| |/ / / | | | | | | | | | | | | Stack overflow occurs with some guest applications
* | | | Merge pull request #6070 from Morph1984/sysver-11.0.1bunnei2021-03-171-5/+5
|\ \ \ \ | | | | | | | | | | system_version: Update to 11.0.1
| * | | | system_version: Update to 11.0.1Morph2021-03-141-5/+5
| | |/ / | |/| |
* | | | Merge pull request #6083 from Morph1984/bsd-avoid-writebufferbunnei2021-03-161-2/+6
|\ \ \ \ | | | | | | | | | | bsd: Avoid writing empty buffers
| * | | | bsd: Avoid writing empty buffersMorph2021-03-161-2/+6
|/ / / / | | | | | | | | | | | | Silences log spam on empty buffer writes
* | | | Merge pull request #6069 from Morph1984/ngWordbunnei2021-03-151-2/+2
|\ \ \ \ | |/ / / |/| | | system_archive: Update NgWord archive version
| * | | system_archive: Update NgWord archive versionMorph2021-03-141-2/+2
| | |/ | |/|
* | | Merge pull request #6054 from Morph1984/time-GetClockSnapshotbunnei2021-03-141-0/+2
|\ \ \ | |/ / |/| | time: Assign the current time point to the ClockSnapshot
| * | time: Assign the current time point to the ClockSnapshotMorph2021-03-101-0/+2
| |/ | | | | | | Fixes the timer in Super Smash Bros Ultimate's Spirit Board.
* | Merge pull request #6053 from Morph1984/time-CalculateSpanBetweenbunnei2021-03-131-3/+9
|\ \ | | | | | | time: Fix CalculateSpanBetween implementation
| * | time: Fix CalculateSpanBetween implementationMorph2021-03-101-3/+9
| |/ | | | | | | | | | | CalculateSpanBetween passes in the ClockSnapshots through 2 input buffers and not as raw arguments. Fix this by reading the 2 input buffers instead of popping raw arguments. Partially fixes Super Smash Bros. Ultimate's Spirit Board
* | Merge pull request #6028 from bunnei/raster-cachebunnei2021-03-132-47/+40
|\ \ | | | | | | video_core: rasterizer_accelerated: Use a flat array instead of interval_map for cached pages.
| * | video_core: rasterizer_accelerated: Fix un/signed mismatch.bunnei2021-03-131-1/+2
| | |
| * | video_core: rasterizer_accelerated: Fix delta check ordering.bunnei2021-03-031-3/+3
| | |
| * | video_core: rasterizer_accelerated: Improve error handling & fix implicit conversion.bunnei2021-03-031-4/+8
| | |
| * | video_core: rasterizer_accelerated: Use a flat array instead of interval_map for cached pages.bunnei2021-03-032-44/+32
| | | | | | | | | | | | | | | | | | - Uses a fixed 64MB for the cache instead of an ever growing map. - Slightly faster by using atomics instead of a single mutex for access. - Thanks for Rodrigo for the idea.
* | | Merge pull request #5327 from AniLeo/masterbunnei2021-03-121-0/+9
|\ \ \ | | | | | | | | qt: Set DISPLAY env var when not present
| * | | qt: Set DISPLAY env var when not presentAni2021-03-071-0/+9
| | | | | | | | | | | | | | | | | | | | Fixes web browser opening (Help > Open Mods Page, Help > Open Quickstart Guide)
* | | | Merge pull request #6040 from german77/toggleKeyboardbunnei2021-03-116-12/+109
|\ \ \ \ | |_|_|/ |/| | | Enable toggle buttons for keyboard and mouse
| * | | Enable mouse toggle buttonsgerman772021-03-065-11/+65
| | | |
| * | | Add toggle button option for normal buttonsgerman2021-03-061-0/+5
| | | |
| * | | Enable button toggle for keyboard in the modifier buttongerman2021-03-063-6/+44
| | | |
* | | | Merge pull request #5891 from ameerj/bgra-oglRodrigo Locatti2021-03-0914-30/+212
|\ \ \ \ | | | | | | | | | | renderer_opengl: Use compute shaders to swizzle BGR textures on copy
| * | | | texture_cache: Blacklist BGRA8 copies and views on OpenGLameerj2021-03-049-28/+80
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | In order to force the BGRA8 conversion on Nvidia using OpenGL, we need to forbid texture copies and views with other formats. This commit also adds a boolean relating to this, as this needs to be done only for the OpenGL api, Vulkan must remain unchanged.
| * | | | renderer_opengl: Swizzle BGR textures on copyameerj2021-03-045-2/+132
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | OpenGL does not natively support BGR internal formats, which causes many BGR textures to render incorrectly, with Red and Blue channels swapped. This commit aims to address this by swizzling the blue and red channels on texture copies when a BGR format is encountered.
* | | | | Merge pull request #6021 from ReinUsesLisp/skip-cache-heuristicbunnei2021-03-092-11/+37
|\ \ \ \ \ | | | | | | | | | | | | buffer_cache: Heuristically decide to skip cache on uniform buffers
| * | | | | buffer_cache: Heuristically decide to skip cache on uniform buffersReinUsesLisp2021-03-022-11/+37
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Some games benefit from skipping caches (Pokémon Sword), and others don't (Animal Crossing: New Horizons). Add an heuristic to decide this at runtime. The cache hit ratio has to be ~98% or better to not skip the cache. There are 16 frames of buffer.
* | | | | | Merge pull request #5990 from german77/mousePanningV2bunnei2021-03-089-25/+89
|\ \ \ \ \ \ | | | | | | | | | | | | | | InputCommon: Mouse fixes
| * | | | | | inputCommon: Mouse fixesgerman772021-02-289-25/+89
| | | | | | |
* | | | | | | Merge pull request #6041 from bunnei/fiber-leaksbunnei2021-03-085-37/+35
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | common: fiber: Use weak_ptr when yielding.
| * | | | | | | common: Fiber: use a reference for YieldTo.bunnei2021-03-075-34/+27
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | - Fixes another small leak.
| * | | | | | | common: fiber: Use weak_ptr when yielding.bunnei2021-03-062-8/+13
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | - Avoids a memory leak, as taking a strong reference of the fiber here causes a circular reference. - Supersedes #6006 with a more narrow fix.
* | | | | | | | Merge pull request #6047 from lioncash/dynarmicMorph2021-03-081-0/+0
|\ \ \ \ \ \ \ \ | |/ / / / / / / |/| | | | | | | external: Update dynarmic
| * | | | | | | external: Update dynarmicLioncash2021-03-081-0/+0
|/ / / / / / /
* | | | | | | Merge pull request #6036 from bunnei/thread-leakbunnei2021-03-066-36/+65
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | hle: kernel: KThread: Rework dummy threads & fix memory leak.
| * | | | | | | hle: kernel: KThread: Rework dummy threads & fix memory leak.bunnei2021-03-066-36/+65
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | - Dummy threads are created on thread local storage for all host threads. - Fixes a leak by removing creation of fibers, which are not applicable here.
* | | | | | | | Merge pull request #6029 from Morph1984/compile-utf8LC2021-03-061-0/+2
|\ \ \ \ \ \ \ \ | |/ / / / / / / |/| | | | | | | CMakeLists: Add /utf-8 compile option for MSVC
| * | | | | | | CMakeLists: Add /utf-8 compile option for MSVCMorph2021-03-051-0/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Ensures that the source and execution character sets are in UTF-8
* | | | | | | | Merge pull request #6039 from yuzu-emu/revert-6006-fiber-unique-ptrbunnei2021-03-0610-58/+59
|\ \ \ \ \ \ \ \ | |_|_|_|_|/ / / |/| | | | | | | Revert "core: Switch to unique_ptr for usage of Common::Fiber."
| * | | | | | | Revert "core: Switch to unique_ptr for usage of Common::Fiber."bunnei2021-03-0610-58/+59
|/ / / / / / /
* | | | | | | Merge pull request #6034 from Morph1984/mbedtlsbunnei2021-03-063-3/+1
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | externals: Update mbedtls to 2.16.9
| * | | | | | | aes_util: Remove malformed mbedtls_cipher_finish function callMorph2021-03-051-2/+0
| | | | | | | |
| * | | | | | | externals: Update mbedtls to 2.16.9Morph2021-03-052-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | mbedtls 2.16 is the last version which has licensing for GPL 2.0. This updates mbedtls to our own fork of mbedtls 2.16
* | | | | | | | Merge pull request #6006 from bunnei/fiber-unique-ptrbunnei2021-03-0510-59/+58
|\ \ \ \ \ \ \ \ | |/ / / / / / / |/| | | | | | | core: Switch to unique_ptr for usage of Common::Fiber.
| * | | | | | | core: Switch to unique_ptr for usage of Common::Fiber.bunnei2021-02-2710-59/+58
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | - With using unique_ptr instead of shared_ptr, we have more explicit ownership of the context. - Fixes a memory leak due to circular reference of the shared pointer.
* | | | | | | | Merge pull request #5989 from ReinUsesLisp/cmdpoolbunnei2021-03-041-1/+1
|\ \ \ \ \ \ \ \ | |_|_|_|_|/ / / |/| | | | | | | vk_command_pool: Reduce the command pool size from 4096 to 4
| * | | | | | | vk_command_pool: Reduce the command pool size from 4096 to 4ReinUsesLisp2021-02-231-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This allows drivers to reuse memory more easily and preallocate less. The optimal number has been measured booting Pokémon Sword.
* | | | | | | | Merge pull request #6004 from german77/udprandombunnei2021-03-044-19/+23
|\ \ \ \ \ \ \ \ | |_|_|/ / / / / |/| | | | | | | InputCommon: Use an unique client id for each udp socket instance
| * | | | | | | inputCommon: Use an unique client id for each socket instancegerman2021-03-014-19/+23
| | |_|_|/ / / | |/| | | | |
* | | | | | | Merge pull request #5815 from comex/net-error-reformbunnei2021-03-036-111/+147
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | Network error handling reform
| * | | | | | | [network] Error handling reformcomex2021-02-286-111/+147
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | `network.cpp` has several error paths which either: - report "Unhandled host socket error=n" and return `SUCCESS`, or - switch on a few possible errors, log them, and translate them to Errno; the same switch statement is copied and pasted in multiple places in the code Convert these paths to use a helper function `GetAndLogLastError`, which is roughly the equivalent of one of the switch statements, but: - handling more cases (both ones that were already in `Errno`, and a few more I added), and - using OS functions to convert the error to a string when logging, so it'll describe the error even if it's not one of the ones in the switch statement. - To handle this, refactor the logic in `GetLastErrorMsg` to expose a new function `NativeErrorToString` which takes the error number explicitly as an argument. And improve the Windows version a bit. Also, add a test which exercises two random error paths.
* | | | | | | | Merge pull request #6020 from bunnei/shutdown-crash-2LC2021-03-021-12/+1
|\ \ \ \ \ \ \ \ | |_|_|_|_|_|_|/ |/| | | | | | | core: Shutdown: Move kernel cleanup to later in shutdown.
| * | | | | | | core: Shutdown: Move kernel cleanup to later in shutdown.bunnei2021-03-021-12/+1
|/ / / / / / / | | | | | | | | | | | | | | | | | | | | | - Fixes a shutdown crash due to a race condition with GPU still accessing memory.
* | | | | | | Merge pull request #6019 from Kelebek1/bcatbunnei2021-03-022-3/+3
|\ \ \ \ \ \ \ | |_|/ / / / / |/| | | | | | [Service::nifm] Fix bcat_backend's default initialisation
| * | | | | | Fix default bcat_backend initKelebek12021-03-022-3/+3
|/ / / / / /
* | | | | | Merge pull request #6016 from ameerj/remove-async-nvdecMorph2021-03-013-26/+8
|\ \ \ \ \ \ | |/ / / / / |/| | | | | gpu_thread: Remove Async NVDEC placeholders
| * | | | | gpu_thread: Remove Async NVDEC placeholdersameerj2021-03-013-26/+8
|/ / / / / | | | | | | | | | | | | | | | This commit removes early placeholders for an implementation of async nvdec. With recent changes to the source code, the placeholders are no longer accurate, and can cause a nullptr dereference due to the nature of the cdma_pusher lifetime.
* | | | | Merge pull request #6007 from bunnei/ldn-errorbunnei2021-02-281-1/+1
|\ \ \ \ \ | | | | | | | | | | | | core: hle: ldn: Error out on call to Initialization.
| * | | | | core: hle: ldn: Error out on call to Initialization.bunnei2021-02-271-1/+1
| | |/ / / | |/| | | | | | | | | | | | | - Since we do not emulate LDN, returning an error here makes more sense.
* | | | | Merge pull request #5276 from german77/gesturesMorph2021-02-282-11/+240
|\ \ \ \ \ | | | | | | | | | | | | HID: Implement gestures
| * | | | | Implements touch, pan, pinch and rotation gesturesgerman2021-02-282-11/+240
| | | | | |
* | | | | | Merge pull request #5984 from jbeich/gcc-freebsdbunnei2021-02-272-0/+2
|\ \ \ \ \ \ | |_|/ / / / |/| | | | | common,video-core: unbreak GCC 11 build on FreeBSD 13
| * | | | | video_core: add missing header after 468bd9c1b0f9Jan Beich2021-02-231-0/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | src/video_core/shader_notify.cpp: In member function 'void VideoCore::ShaderNotify::MarkShaderComplete()': src/video_core/shader_notify.cpp:33:10: error: 'unique_lock' is not a member of 'std' 33 | std::unique_lock lock{mutex}; | ^~~~~~~~~~~ src/video_core/shader_notify.cpp:6:1: note: 'std::unique_lock' is defined in header '<mutex>'; did you forget to '#include <mutex>'? 5 | #include "video_core/shader_notify.h" +++ |+#include <mutex> 6 | src/video_core/shader_notify.cpp: In member function 'void VideoCore::ShaderNotify::MarkSharderBuilding()': src/video_core/shader_notify.cpp:38:10: error: 'unique_lock' is not a member of 'std' 38 | std::unique_lock lock{mutex}; | ^~~~~~~~~~~ src/video_core/shader_notify.cpp:38:10: note: 'std::unique_lock' is defined in header '<mutex>'; did you forget to '#include <mutex>'?
| * | | | | common: add missing header after f3805376f726Jan Beich2021-02-231-0/+1
| | |/ / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | In file included from src/video_core/dma_pusher.cpp:5: src/./common/cityhash.h:69:47: error: 'size_t' has not been declared 69 | [[nodiscard]] u64 CityHash64(const char* buf, size_t len); | ^~~~~~ src/./common/cityhash.h:73:55: error: 'size_t' has not been declared 73 | [[nodiscard]] u64 CityHash64WithSeed(const char* buf, size_t len, u64 seed); | ^~~~~~ src/./common/cityhash.h:77:56: error: 'size_t' has not been declared 77 | [[nodiscard]] u64 CityHash64WithSeeds(const char* buf, size_t len, u64 seed0, u64 seed1); | ^~~~~~ src/./common/cityhash.h:80:47: error: 'size_t' has not been declared 80 | [[nodiscard]] u128 CityHash128(const char* s, size_t len); | ^~~~~~ src/./common/cityhash.h:84:55: error: 'size_t' has not been declared 84 | [[nodiscard]] u128 CityHash128WithSeed(const char* s, size_t len, u128 seed); | ^~~~~~
* | | | | Merge pull request #5953 from bunnei/memory-refactor-1bunnei2021-02-2756-1212/+1690
|\ \ \ \ \ | |_|_|/ / |/| | | | Kernel Rework: Memory updates and refactoring (Part 1)
| * | | | hle: kernel: Migrate PageHeap/PageTable to KPageHeap/KPageTable.bunnei2021-02-1924-147/+131
| | | | |
| * | | | hle: kernel: Migrate MemoryManager to KMemoryManager.bunnei2021-02-198-47/+48
| | | | |
| * | | | hle: kernel: Migrate PageLinkedList to KPageLinkedList.bunnei2021-02-198-38/+41
| | | | |
| * | | | hle: kernel: Migrate to KMemoryBlock, KMemoryBlockManager, and others.bunnei2021-02-1918-476/+479
| | | | |
| * | | | hle: kernel: Migrate SlabHeap to KSlabHeap.bunnei2021-02-194-22/+21
| | | | |
| * | | | hle: kernel: Migrate MemoryLayout to KMemoryLayout.bunnei2021-02-195-31/+30
| | | | |
| * | | | hle: kernel: Migrate AddressSpaceInfo to KAddressSpaceInfo.bunnei2021-02-194-59/+54
| | | | |
| * | | | hle: kernel: memory_manager: Rename AllocateContinuous to AllocateContinuous.bunnei2021-02-192-4/+28
| | | | |
| * | | | hle: kernel: KSystemControl does not belong in Memory namespace.bunnei2021-02-197-31/+38
| | | | |
| * | | | hle: kernel: memory: PageHeap: Migrate to KPageBitmap class.bunnei2021-02-194-197/+23
| | | | |
| * | | | hle: kernel: Add KPageBitmap class.bunnei2021-02-192-0/+280
| | | | |
| * | | | hle: kernel: system_control: Add function GenerateRandomU64.bunnei2021-02-192-3/+5
| | | | |
| * | | | common: Add implementation of TinyMT (Mersenne Twister RNG).bunnei2021-02-192-0/+251
| | | | |
| * | | | hle: kernel: Add KSpinLock implementation.bunnei2021-02-193-0/+89
| | | | |
| * | | | core: memory: Add templated GetPointer methods.bunnei2021-02-191-0/+10
| | | | |
| * | | | common: alignment: Add DivideUp utility method.bunnei2021-02-191-0/+5
| | | | |
| * | | | hle: kernel: Rename SharedMemory to KSharedMemory.bunnei2021-02-1913-54/+54
| | | | |
* | | | | Merge pull request #5944 from Morph1984/gc-vibrationsbunnei2021-02-272-3/+130
|\ \ \ \ \ | | | | | | | | | | | | hid: Implement GameCube Controller Vibrations
| * | | | | hid: Implement GameCube Controller VibrationsMorph2021-02-212-3/+130
| | | | | | | | | | | | | | | | | | | | | | | | Implements both SendVibrationGcErmCommand and GetActualVibrationGcErmCommand, and modifies GetVibrationDeviceInfo to account for additional controllers.
* | | | | | Merge pull request #5997 from Kelebek1/Depthbunnei2021-02-265-1/+17
|\ \ \ \ \ \ | | | | | | | | | | | | | | [OpenGL] Implement glDepthRangeIndexeddNV
| * | | | | | Implement glDepthRangeIndexeddNVKelebek12021-02-245-1/+17
| | |_|/ / / | |/| | | |
* | | | | | Merge pull request #5977 from Morph1984/stub-accbunnei2021-02-251-1/+17
|\ \ \ \ \ \ | |/ / / / / |/| | | | | acc: Stub GetNintendoAccountUserResourceCacheForApplication
| * | | | | acc: Stub GetNintendoAccountUserResourceCacheForApplicationMorph2021-02-211-1/+17
| |/ / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This command returns a Nintendo Account ID and writes 2 output buffers. The first output buffer is a NasUserBaseForApplication and the second output buffer is currently empty. Used by: - Pokken Tournament DX - Super Smash Bros. Ultimate - Super Nintendo Entertainment System - Nintendo Switch Online - Mario Kart 8 Deluxe
* | | | | Merge pull request #5981 from lat9nq/ci-add-clangLC2021-02-224-1/+50
|\ \ \ \ \ | | | | | | | | | | | | ci: Add clang build scripts
| * | | | | ci: Add clang build scriptslat9nq2021-02-224-1/+50
|/ / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Adds scripts that instruct CI to build yuzu with the installed Clang compiler on yuzuemu/build-environments:linux-fresh. These scripts are based on the .ci/scripts/linux scripts, minus AppImage building since that isn't necessary. Re-uses linux-fresh since that container has Clang 12 installed.
* | | | | Merge pull request #5936 from Kelebek1/Offsetsbunnei2021-02-223-9/+34
|\ \ \ \ \ | |/ / / / |/| | | | Offsets for TexelFetch and TextureGather in Vulkan
| * | | | Review 1Kelebek12021-02-152-3/+3
| | | | |
| * | | | Implement texture offset support for TexelFetch and TextureGather and add offsets for TldsKelebek12021-02-153-9/+34
| | | | | | | | | | | | | | | | | | | | Formatting
* | | | | Merge pull request #5971 from ameerj/reslimit-dtorbunnei2021-02-214-2/+16
|\ \ \ \ \ | | | | | | | | | | | | kernel: Fix resource release exception on exit
| * | | | | kernel: Fix resource release exception on exitameerj2021-02-214-2/+16
|/ / / / / | | | | | | | | | | | | | | | | | | | | After rewriting the resource limit, objects releasing reserved resources require a live kernel instance. This commit fixes exceptions that occur due to the kernel being destroyed before some objects released their resources, allowing for a graceful exit.
* | | | | Merge pull request #5965 from Morph1984/shader-countAmeer J2021-02-211-0/+4
|\ \ \ \ \ | | | | | | | | | | | | gl_disk_shader_cache: Log total shader entries count on game load
| * | | | | gl_disk_shader_cache: Log total shader entries count on game loadMorph2021-02-201-0/+4
|/ / / / /
* | | | | Merge pull request #5964 from bunnei/timing-fixbunnei2021-02-202-7/+28
|\ \ \ \ \ | | | | | | | | | | | | common: wall_clock: Fix integer overflow with StandardWallClock.
| * | | | | common: wall_clock: Fix integer overflow with StandardWallClock.bunnei2021-02-202-7/+28
|/ / / / / | | | | | | | | | | | | | | | | | | | | - Previous optimized impl. resulted in an integer overflow, so revert. - This is our slow/fallback path that should never be really be used, so the optimization in unimportant.
* | | | | Merge pull request #5924 from ReinUsesLisp/inline-bindingsbunnei2021-02-194-24/+24
|\ \ \ \ \ | |_|/ / / |/| | | | vk_update_descriptor: Inline and improve code for binding buffers
| * | | | vk_update_descriptor: Inline and improve code for binding buffersReinUsesLisp2021-02-134-24/+24
| | | | | | | | | | | | | | | | | | | | Allow compilers with our settings inline hot code.
* | | | | Merge pull request #5957 from lat9nq/update-dynarmicbunnei2021-02-191-0/+0
|\ \ \ \ \ | | | | | | | | | | | | externals: Update dynarmic to latest
| * | | | | externals: Update dynarmic to latestlat9nq2021-02-181-0/+0
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Updates dynarmic to its latest commit. Includes a fix for argument limits while compiling with Clang 12.
* | | | | | Merge pull request #4973 from ameerj/nvdec-optbunnei2021-02-1911-149/+79
|\ \ \ \ \ \ | | | | | | | | | | | | | | nvdec: Reuse allocated buffers and general cleanup
| * | | | | | rebase, fix name shadowing, more constameerj2021-02-134-11/+10
| | | | | | |
| * | | | | | Address PR feedbackameerj2021-02-134-12/+7
| | | | | | | | | | | | | | | | | | | | | | | | | | | | Co-Authored-By: LC <712067+lioncash@users.noreply.github.com>
| * | | | | | streamline cdma_pusher/command_classesameerj2021-02-131-13/+5
| | | | | | |
| * | | | | | streamline cdma_pusher/command_classesameerj2021-02-135-85/+34
| | | | | | |
| * | | | | | nvdec cleanupameerj2021-02-138-43/+38
| | | | | | |
* | | | | | | Merge pull request #5955 from yuzu-emu/revert-3603-port-5123Morph2021-02-181-7/+0
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | Revert "Port citra-emu/citra#5123: "SDL: Disable hidapi drivers due to compatibility problems with certain controllers""
| * | | | | | | Revert "Port citra-emu/citra#5123: "SDL: Disable hidapi drivers due to compatibility problems with certain controllers""Morph2021-02-181-7/+0
|/ / / / / / /
* | | | | | | Merge pull request #5952 from ReinUsesLisp/cityhashLC2021-02-184-114/+121
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | common/cityhash: Use common types
| * | | | | | | common/cityhash: Use common typesReinUsesLisp2021-02-183-116/+100
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Allow sharing return types with the rest of the code base. For example, we use 'u128 = std::array<u64, 2>', meanwhile Google's code uses 'uint128 = std::pair<u64, u64>'. While we are at it, use size_t instead of std::size_t.
| * | | | | | | tests: Add tests for CityHashReinUsesLisp2021-02-182-0/+23
| | |/ / / / / | |/| | | | |
* | | | | | | Merge pull request #5954 from lat9nq/ffmpeg-431-2LC2021-02-183-8/+4
|\ \ \ \ \ \ \ | |/ / / / / / |/| | | | | | cmake: Update FFmpeg to 4.3.1
| * | | | | | cmake: Update FFmpeg to 4.3.1lat9nq2021-02-103-8/+4
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Download FFmpeg package version 4.3.1. Uses a file defined within the package to determine with DLLs to copy. Also corrects a submodule name.
* | | | | | | Merge pull request #5121 from bunnei/optimize-core-timingbunnei2021-02-168-241/+141
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | core: Optimize core timing utility functions to avoid unnecessary math
| * | | | | | | core: core_timing_util: Optimize core timing math.bunnei2021-02-153-98/+48
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | - Avoids a lot of unnecessary 128-bit math for imperceptible accuracy.
| * | | | | | | common: wall_clock: Optimize GetClockCycles/GetCPUCycles to use a single MUL instruction.bunnei2021-02-151-8/+9
| | | | | | | |
| * | | | | | | common: Merge uint128 to a single header file with inlines.bunnei2021-02-154-135/+84
| | | | | | | |
* | | | | | | | Merge pull request #5929 from german77/mousePanningMorph2021-02-161-5/+21
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | Improve mouse panning
| * | | | | | | | Improve mouse panninggerman2021-02-141-5/+21
| | |_|/ / / / / | |/| | | | | |
* | | | | | | | Merge pull request #4298 from FearlessTobi/remove-cache-settingbunnei2021-02-165-57/+1
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | yuzu/configure_filesystem: Remove "Select Cache Directory" option
| * | | | | | | | yuzu/configure_filesystem: Remove "Select Cache Directory" optionFearlessTobi2021-01-045-57/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This tab of the settings is already extremely bloated and the setting itself is quite useless. With a gamelist of almost 30 games, the cache directory is smaller than 1MB for me and therefore I don't see why it needs to be configurable.
* | | | | | | | | Merge pull request #5942 from ReinUsesLisp/fixup-rebaseLC2021-02-161-1/+0
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | vk_rasterizer: Fix loading shader addresses twice
| * | | | | | | | | vk_rasterizer: Fix loading shader addresses twiceReinUsesLisp2021-02-161-1/+0
|/ / / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | This was recently introduced on a wrongly rebased commit.
* | | | | | | | | Merge pull request #3603 from FearlessTobi/port-5123bunnei2021-02-161-0/+7
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | Port citra-emu/citra#5123: "SDL: Disable hidapi drivers due to compatibility problems with certain controllers"
| * | | | | | | | | sdl_joystick: disable the use of the hidapi drivers due to many problems caused by them.Vitor Kiguchi2020-08-301-0/+7
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The main problem is the loss of compatibility with some controllers, but there are also unwanted changes to the behaviour of PS4 controllers (hardcoded lightbar color).
* | | | | | | | | | Merge pull request #5923 from ReinUsesLisp/vk-dirty-pipelinebunnei2021-02-157-56/+103
|\ \ \ \ \ \ \ \ \ \ | |_|_|_|/ / / / / / |/| | | | | | | | | fixed_pipeline_cache: Use dirty flags to lazily update key
| * | | | | | | | | fixed_pipeline_cache: Use dirty flags to lazily update keyReinUsesLisp2021-02-137-56/+103
| | |_|_|_|/ / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Use dirty flags to avoid building pipeline key from scratch on each draw call. This saves a bit of unnecesary work on each draw call.
* | | | | | | | | Merge pull request #5939 from Morph1984/web_typesLC2021-02-151-0/+1
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | core/CMakeLists: Add web_types.h
| * | | | | | | | | core/CMakeLists: Add web_types.hMorph2021-02-151-0/+1
| | | | | | | | | |
* | | | | | | | | | Merge pull request #4940 from german77/nativeGCbunnei2021-02-158-6/+209
|\ \ \ \ \ \ \ \ \ \ | |/ / / / / / / / / |/| | | | | | | | | HID: Implement GC controller in game
| * | | | | | | | | Use GC imagegerman2021-02-091-0/+3
| | | | | | | | | |
| * | | | | | | | | hid: Implement GC controllergerman2021-02-087-6/+206
| | |_|_|_|_|_|/ / | |/| | | | | | |
* | | | | | | | | Merge pull request #5935 from lat9nq/controller_access_keysbunnei2021-02-151-1/+1
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | debugger: controller: Add access key
| * | | | | | | | | debugger: controller: Add access keylat9nq2021-02-141-1/+1
| | |_|_|_|_|_|/ / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Adds the access key to the Controller P1 selection at View -> Debugger -> Controller P1. Avoids using the windowTitle as that would add a literal & to the beginning of the window title.
* | | | | | | | | Merge pull request #5909 from ogniK5377/I3dl2Reverbbunnei2021-02-158-18/+572
|\ \ \ \ \ \ \ \ \ | |/ / / / / / / / |/| | | | | | | | audren: Implement I3dl2Reverb
| * | | | | | | | revert to std::sin and std::cosChloe Marcec2021-02-133-6/+6
| | | | | | | | |
| * | | | | | | | address issuesChloe Marcec2021-02-133-22/+25
| | | | | | | | |
| * | | | | | | | audren: Implement I3dl2ReverbChloe Marcec2021-02-138-18/+569
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Most notable fix is the voices in Fire Emblem Three Houses
* | | | | | | | | Merge pull request #5920 from bunnei/am-ldn-fixbunnei2021-02-144-11/+52
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | Fix LDN Initialization return code & resulting AM overflow
| * | | | | | | | | hle: service: ldn: IUserLocalCommunicationService: Improve the stub.bunnei2021-02-141-5/+29
| | | | | | | | | |
| * | | | | | | | | hle: service: ldn: IUserLocalCommunicationService: Indicate that LDN is disabled.bunnei2021-02-143-3/+19
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | - Fixes crash on Pokemon Sword/Shield when pressing 'Y'.
| * | | | | | | | | hle: service: am: IStorageAccessor: Fix out of bounds error handling.bunnei2021-02-141-6/+7
| | | | | | | | | |
* | | | | | | | | | yuzu: Various frontend improvements to avoid crashes and improve experience on Linux.bunnei2021-02-1414-16/+54
|/ / / / / / / / /
* | | | | | | | | Merge pull request #5925 from ReinUsesLisp/resource-pool-cleanLC2021-02-142-8/+8
|\ \ \ \ \ \ \ \ \ | |_|_|/ / / / / / |/| | | | | | | | vk_resource_pool: Load GPU tick once and compare with it
| * | | | | | | | vk_resource_pool: Load GPU tick once and compare with itReinUsesLisp2021-02-132-8/+8
|/ / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Other minor style improvements. Rename free_iterator to hint_iterator, to describe better what it does.
* | | | | | | | Merge pull request #5921 from ameerj/srgb-viewsRodrigo Locatti2021-02-133-7/+41
|\ \ \ \ \ \ \ \ | |_|_|_|_|/ / / |/| | | | | | | gl_texture_cache: Lazily create non-sRGB texture views for sRGB formats
| * | | | | | | gl_texture_cache: Lazily create non-sRGB texture views for sRGB formatsameerj2021-02-133-7/+41
|/ / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This creates non-sRGB texture views for sRGB texture formats to allow for interfacing with these views in compute shaders using imageLoad and imageStore. Co-Authored-By: Rodrigo Locatti <reinuseslisp@airmail.cc>
* | | | | | | Merge pull request #5919 from ReinUsesLisp/stream-buffer-tragicMorph2021-02-133-6/+12
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | gl_stream_buffer/vk_staging_buffer_pool: Fix size check
| * | | | | | | vk_master_semaphore: Mark gpu_tick atomic operations with relaxed orderReinUsesLisp2021-02-131-4/+4
| | | | | | | |
| * | | | | | | vk_staging_buffer_pool: Inline tick testsReinUsesLisp2021-02-132-1/+7
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Load the current tick to a local variable, moving it out of an atomic and allowing us to compare the value without going through a pointer each time. This should make the loop more optimizable.
| * | | | | | | gl_stream_buffer/vk_staging_buffer_pool: Fix size checkReinUsesLisp2021-02-132-2/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Fix a tragic off-by-one condition that causes Vulkan's stream buffer to think it's always full, using fallback memory. The OpenGL was also affected by this bug to a lesser extent.
* | | | | | | | Merge pull request #5915 from lat9nq/screenshots-dir-fixLC2021-02-131-0/+5
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | yuzu: Create screenshot path before capture
| * | | | | | | | yuzu: Create screenshot path before capturelat9nq2021-02-121-0/+5
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Allows screenshots in cases where the screenshots path doesn't already exist.
* | | | | | | | | Merge pull request #5916 from ameerj/maxwell-gl-unusedLC2021-02-132-36/+3
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | maxwell_to_gl: Remove unused code
| * | | | | | | | | maxwell_to_gl: Remove unused codeameerj2021-02-132-36/+3
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Removes unused declarations in maxwell_to_gl.h
* | | | | | | | | | Merge pull request #5917 from ReinUsesLisp/require-robustness2LC2021-02-132-37/+14
|\ \ \ \ \ \ \ \ \ \ | |_|_|/ / / / / / / |/| | | | | | | | | vulkan_device: Require VK_EXT_robustness2
| * | | | | | | | | vulkan_device: Require VK_EXT_robustness2ReinUsesLisp2021-02-132-37/+14
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | We are already using robustness2 features without requiring it explicitly, causing potential crashes on drivers without the extension. Requiring this at boot allows better diagnostics for it and formalizes our usage on the extension.
* | | | | | | | | | Merge pull request #5741 from ReinUsesLisp/new-bufcachebunnei2021-02-1396-3083/+3390
|\| | | | | | | | | | |_|_|/ / / / / / |/| | | | | | | | video_core: Reimplement the buffer cache
| * | | | | | | | config: Make high GPU accuracy the defaultReinUsesLisp2021-02-132-3/+3
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This is a better default for most games, yielding better performance and less graphical issues.
| * | | | | | | | video_core: Fix clang build issuesReinUsesLisp2021-02-132-8/+5
| | | | | | | | |
| * | | | | | | | vk_staging_buffer_pool: Fix softlock when stream buffer overflowsReinUsesLisp2021-02-132-19/+20
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | There was still a code path that could wait on a timeline semaphore tick that would never be signalled. While we are at it, make use of more STL algorithms.
| * | | | | | | | vk_buffer_cache: Add support for null index buffersReinUsesLisp2021-02-132-4/+40
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Games can bind a null index buffer (size=0) where all indices are evaluated as zero. VK_EXT_robustness2 doesn't support this and all drivers segfault when a null index buffer is passed to vkCmdBindIndexBuffer. Workaround this by creating a 4 byte buffer and filling it with zeroes. If it's read out of bounds, robustness takes care of returning zeroes as indices.
| * | | | | | | | buffer_cache: Add extra bytes to guest SSBOsReinUsesLisp2021-02-131-1/+7
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Bind extra bytes beyond the guest API's bound range. This is due to some games like Astral Chain operating out of bounds. Binding the whole map range would be technically correct, but games have large maps that make this approach unaffordable for now.
| * | | | | | | | Merge branch 'bytes-to-map-end' into new-bufcache-wipReinUsesLisp2021-02-131-0/+2
| | | | | | | | |
| * | | | | | | | vk_staging_buffer_pool: Get a staging buffer instead of waitingReinUsesLisp2021-02-132-9/+18
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Avoids waiting idle while the GPU finishes to do work, and fixes an issue where we'd wait forever if a single command buffer (logic tick) all the data.
| * | | | | | | | yuzu/config: Disable assembly shaders by defaultReinUsesLisp2021-02-131-2/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Due to BindBufferRangeNV limitations and poor quality code emission from our side, assembly shaders are currently slower than GLSL. Their build time and feature advantages are still relevant, but they are outweighted by their runtime performance.
| * | | | | | | | renderer_opengl: Remove interopReinUsesLisp2021-02-138-122/+10
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Remove unused interop code from the OpenGL backend.
| * | | | | | | | gl_buffer_cache: Drop interop based parameter buffer workaroundsReinUsesLisp2021-02-133-65/+45
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Sacrify runtime performance to avoid generating kernel exceptions on Windows due to our abusive aliasing of interop buffer objects.
| * | | | | | | | buffer_cache: Heuristically detect stream buffersReinUsesLisp2021-02-132-6/+33
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Detect when a memory region has been joined several times and increase the size of the created buffer on those instances. The buffer is assumed to be a "stream buffer", increasing its size should stop us from constantly recreating it and fragmenting memory.
| * | | | | | | | buffer_cache: Split CreateBuffer in separate functionsReinUsesLisp2021-02-131-29/+52
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Allow adding functionality to each function without making CreateBuffer more complex.
| * | | | | | | | buffer_cache: Skip cache on small uploads on VulkanReinUsesLisp2021-02-133-9/+18
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Ports from OpenGL the optimization to skip small 3D uniform buffer uploads. This will take advantage of the previously introduced stream buffer. Fixes instances where the staging buffer offset was being ignored.
| * | | | | | | | vk_staging_buffer_pool: Add stream buffer for small uploadsReinUsesLisp2021-02-1315-127/+298
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This uses a ring buffer similar to OpenGL's stream buffer for small uploads. This stops us from allocating several small buffers, reducing memory fragmentation and cache locality. It uses dedicated allocations when possible.
| * | | | | | | | vulkan_device: Enable robustBufferAccessReinUsesLisp2021-02-131-1/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Fix regression on Pascal on Animal Crossing: New Horizons, fixing a validation error.
| * | | | | | | | video_core: Reimplement the buffer cacheReinUsesLisp2021-02-1367-2607/+2514
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Reimplement the buffer cache using cached bindings and page level granularity for modification tracking. This also drops the usage of shared pointers and virtual functions from the cache. - Bindings are cached, allowing to skip work when the game changes few bits between draws. - OpenGL Assembly shaders no longer copy when a region has been modified from the GPU to emulate constant buffers, instead GL_EXT_memory_object is used to alias sub-buffers within the same allocation. - OpenGL Assembly shaders stream constant buffer data using glProgramBufferParametersIuivNV, from NV_parameter_buffer_object. In theory this should save one hash table resolve inside the driver compared to glBufferSubData. - A new OpenGL stream buffer is implemented based on fences for drivers that are not Nvidia's proprietary, due to their low performance on partial glBufferSubData calls synchronized with 3D rendering (that some games use a lot). - Most optimizations are shared between APIs now, allowing Vulkan to cache more bindings than before, skipping unnecesarry work. This commit adds the necessary infrastructure to use Vulkan object from OpenGL. Overall, it improves performance and fixes some bugs present on the old cache. There are still some edge cases hit by some games that harm performance on some vendors, this are planned to be fixed in later commits.
| * | | | | | | | vulkan_common: Expose interop and headless devicesReinUsesLisp2021-02-134-21/+100
| | | | | | | | |
| * | | | | | | | vulkan_common: Make interop extensions mandatoryReinUsesLisp2021-02-131-0/+6
| | | | | | | | |
| * | | | | | | | vulkan_device: Enable robust buffersReinUsesLisp2021-02-131-2/+4
| | | | | | | | |
| * | | | | | | | vulkan_device: Use designated initializers for featuresReinUsesLisp2021-02-131-60/+59
| | | | | | | | |
| * | | | | | | | vulkan_wrapper: Add memory barrier pipeline barrier helperReinUsesLisp2021-02-131-0/+6
| | | | | | | | |
| * | | | | | | | vulkan_device: Fix formatting of constantsReinUsesLisp2021-02-131-10/+6
| | | | | | | | |
| * | | | | | | | vulkan_wrapper: Add interop functionsReinUsesLisp2021-02-132-1/+41
| | | | | | | | |
| * | | | | | | | vulkan_instance: Initialize Vulkan instance in a separate threadReinUsesLisp2021-02-131-1/+5
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Workaround an issue on Nvidia where creating a Vulkan instance from an active OpenGL thread disables threaded optimization on the driver. This optimization is important to have good performance on Nvidia OpenGL.
| * | | | | | | | vulkan_wrapper: Pull Windows symbolsReinUsesLisp2021-02-132-0/+14
| | | | | | | | |
| * | | | | | | | gpu: Report renderer errors with exceptionsReinUsesLisp2021-02-1327-232/+176
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Instead of using a two step initialization to report errors, initialize the GPU renderer and rasterizer on the constructor and report errors through std::runtime_error.
| * | | | | | | | tests/buffer_base: Add cached CPU writes testsReinUsesLisp2021-02-131-0/+76
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Ensure the behavior of the previous commit in tests.
| * | | | | | | | buffer_base: Add support for cached CPU writesReinUsesLisp2021-02-131-61/+145
|/ / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Some games usually write memory pages currently used by the GPU, causing rendering issues (e.g. flashing geometry and shadows on Link's Awakening). To workaround this issue, Guest CPU writes are delayed until the command buffer finishes processing, but the pages are updated immediately. The overall behavior is: - CPU writes are cached until they are flushed, they update the page state, but don't change the modification state. Cached writes stop pages from being flushed, in case games have meaningful data in it. - Command processing writes (e.g. push constants) update the page state and are marked to the command processor as dirty. They don't remove the state of cached writes.
* | | | | | | | Merge pull request #5877 from ameerj/res-limit-usagebunnei2021-02-139-36/+190
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | kernel: More accurately utilize resource_limit
| * | | | | | | | kernel: More accurately reserve and release resourcesameerj2021-02-136-14/+42
| | | | | | | | |
| * | | | | | | | kernel: KScopedReservation implementationameerj2021-02-136-26/+152
|/ / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | This implements KScopedReservation, allowing resource limit reservations to be more HW accurate, and release upon failure without requiring too many conditionals.
* | / / / / / / kernel: Unify result codes (#5890)Chloe2021-02-1321-256/+223
| |/ / / / / / |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * kernel: Unify result codes Drop the usage of ERR_NAME convention in kernel for ResultName. Removed seperation between svc_results.h & errors.h as we mainly include both most of the time anyways. * oops * rename errors to svc_results
* | | | | | | Merge pull request #5902 from lioncash/core-warnbunnei2021-02-123-4/+7
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | core: Silence various warnings on Clang 12
| * | | | | | | bsd: Remove usage of optional emplace() with no argumentsLioncash2021-02-091-2/+4
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Clang 12 currently falls over in the face of this.
| * | | | | | | am/controller: Remove [[fallthrough]] from unreachable pathLioncash2021-02-091-1/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Prevents warnings on clang 12. This path is reachable on other variations of the build that disable the unreachable macro.
| * | | | | | | nfp: Correct uninitialized size being used within GetTagInfo()Lioncash2021-02-091-1/+1
| | |/ / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | We were previously the name of the object being initialized within its own initializer, which results in uninitialized data being read.
* | | | | | | Merge pull request #5869 from german77/mousePanningbunnei2021-02-1111-38/+149
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | input_common: Add mouse panning
| * | | | | | | Add mouse panninggerman2021-02-0811-38/+149
| | | | | | | |
* | | | | | | | Merge pull request #5908 from Morph1984/swkbd-finalizebunnei2021-02-111-0/+4
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | software_keyboard: Implement Finalize request command
| * | | | | | | | software_keyboard: Implement Finalize request commandMorph2021-02-111-0/+4
|/ / / / / / / /
* | | | | | | | Merge pull request #5893 from lioncash/inputbunnei2021-02-102-113/+131
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | configure_input_player_widget: Minor cleanup
| * | | | | | | | configure_input_player_widget: Reduce duplication of array accessors where applicableLioncash2021-02-091-108/+125
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Reduces the amount of code to read in expressions a little bit by separating constituents out a little.
| * | | | | | | | configure_input_player_widget: Avoid nontrivial copies where applicableLioncash2021-02-092-5/+6
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Previously a function was copying an array of 20 std::string instances by value.
* | | | | | | | | Merge pull request #5904 from lat9nq/common-sized-deallocLC2021-02-101-0/+2
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | common: Add -fsized-deallocation as a Clang flag
| * | | | | | | | | common: Add -fsized-deallocation as a Clang flaglat9nq2021-02-101-0/+2
| | |_|_|_|_|_|/ / | |/| | | | | | | | | | | | | | | | | | | | | | | | | Prevents an operator delete error when compiling with Clang 11.
* | | | | | | | | Merge pull request #5905 from lat9nq/core-sized-deallocLC2021-02-101-0/+2
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | core: Add -fsized-dealloction as a Clang flag
| * | | | | | | | | core: Add -fsized-dealloction as a Clang flaglat9nq2021-02-101-0/+2
| |/ / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | Prevents a operator delete error when compiling with Clang 11.
* | | | | | | | | Merge pull request #5903 from lat9nq/config-silence-warnsLC2021-02-101-7/+0
|\ \ \ \ \ \ \ \ \ | |/ / / / / / / / |/| | | | | | | | configure_input_player_widget: Silence unused variable warnings
| * | | | | | | | configure_input_player_widget: Silence unused variable warningslat9nq2021-02-101-7/+0
|/ / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Prevents clang 11 from throwing an error since these variables are unused.
* | | | | | | | Merge pull request #5901 from lioncash/input-warnAmeer J2021-02-103-2/+9
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | udp: Silence warnings on Clang 12
| * | | | | | | | udp: Silence unused member variable warningsLioncash2021-02-091-2/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Simply mark them as unused for now.
| * | | | | | | | udp/client: Define ClientData constructor/destructor in cpp fileLioncash2021-02-092-0/+7
| | |_|/ / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Prevents compilation errors on clang 12 due to incomplete types within a unique_ptr member.
* | | | | | | | Merge pull request #5900 from lioncash/unused-funcbunnei2021-02-102-37/+0
|\ \ \ \ \ \ \ \ | |_|/ / / / / / |/| | | | | | | video_core: Remove unused functions and variables
| * | | | | | | gl_rasterizer: Remove unused variablesLioncash2021-02-091-3/+0
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Resolves warnings on clang 12
| * | | | | | | texture_cache/util: Remove unused functionsLioncash2021-02-091-34/+0
| |/ / / / / / | | | | | | | | | | | | | | | | | | | | | Silences a few warnings on clang 12.
* | | | | | | Settings: Add depth to Joysticks on Pro Controller preview (#5894)Jatoxo2021-02-092-6/+30
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * Add some depth to ProJoysticks * address comments * clang * address nits * fix wrong inner_offset when offset.x was 0
* | | | | | | Merge pull request #5899 from ameerj/ffmpeg-revertMorph2021-02-092-2/+2
|\ \ \ \ \ \ \ | |_|_|/ / / / |/| | | | | | cmake: Revert FFmpeg 4.3.1 update for Windows builds
| * | | | | | cmake: Revert FFmpeg 4.3.1 update for Windows buildsameerj2021-02-092-2/+2
|/ / / / / / | | | | | | | | | | | | | | | | | | The new 4.3.1 externals build seems to not be compatible with yuzu. This also fixes an oversight when renaming CMake variables.
* | | | | | Merge pull request #5880 from lat9nq/ffmpeg-externalAmeer J2021-02-096-97/+315
|\ \ \ \ \ \ | | | | | | | | | | | | | | cmake: FFmpeg linking rework
| * | | | | | ffmpeg: Checkout tag n4.3.1lat9nq2021-02-061-0/+0
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Target a specific release version rather than some random development commit.
| * | | | | | CMakeLists: Use bundled FFmpeg as a fallbacklat9nq2021-02-062-21/+42
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Sets YUZU_USE_BUNDLED_FFMPEG as a CMake dependent option that is OFF on Linux and ON for WIN32 targets. If FFmpeg is not found when YUZU_USE_BUNDLED_FFMPEG is OFF, the bundled module/binaries are used instead. Reverts earlier changes to FindFFmpeg a bit, mostly to keep parity with it's Citra version a bit. Now _FFmpeg_ALL_COMPONENTS lists all components. We overwrite FFmpeg_LIBRARIES and FFmpeg_INCLUDE_DIR after using the module.
| * | | | | | CMakeLists: Update to FFmpeg 4.3.1 for WIN32lat9nq2021-02-061-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | Minimal binaries go brrrrrrr
| * | | | | | CMakeLists: Fixes for linux-freshlat9nq2021-02-061-1/+13
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Tells CMake to look for either nasm or yasm as it is required to build FFmpeg. Avoids a compile-time error by checking for it during configuration. Adds a workaround for Ubuntu Bionic's old version of make not communicating jobserver details properly.
| * | | | | | Address reviewer commentslat9nq2021-02-051-1/+1
| | | | | | |
| * | | | | | CMake: Port citra-emu/citra FindFFmpeg.cmakelat9nq2021-02-053-121/+207
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Also renames related CMake variables to match both the Find*FFmpeg* and variables defined within the file. Fixes odd errors produced by the old FindFFmpeg. Citra's FindFFmpeg is slightly modified here: adds Citra's copyright at the beginning, renames FFmpeg_INCLUDES to FFmpeg_INCLUDE_DIR, disables a few components in _FFmpeg_ALL_COMPONENTS, and adds the missing avutil component to the comment above.
| * | | | | | ci/windows: Copy downloaded FFmpeg librarieslat9nq2021-02-051-0/+5
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Copies FFmpeg libraries that were downloaded during the CMake configuration. Fixes dynamic linking issues with the MinGW builds.
| * | | | | | CMake: Implement YUZU_USE_BUNDLED_FFMPEGlat9nq2021-02-053-17/+108
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | For Linux, instructs CMake to use the FFmpeg submodule in externals. This is HEAVILY based on our usage of the late Unicorn. Minimal change to MSVC as it uses the yuzu-emu/ext-windows-bin. MinGW now targets the same ext-windows-bin libraries as MSVC for FFmpeg. Adds FFMPEG_LIBRARIES to WIN32 and simplifies video_core/CMakeLists.txt a bit.
| * | | | | | externals: Add submodule ffmpeglat9nq2021-02-052-0/+3
| | | | | | |
* | | | | | | Merge pull request #5892 from german77/backupbunnei2021-02-091-1/+12
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | olsc: Stub GetSaveDataBackupSetting
| * | | | | | | olsc: Stub GetSaveDataBackupSettinggerman2021-02-081-1/+12
| | | | | | | |
* | | | | | | | Merge pull request #5868 from german77/HandheldFixbunnei2021-02-082-1/+9
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | Prevent over scheduling audio events and add motion update unschedule event
| * | | | | | | | Prevent over scheduling audio events and terminate properly the motion update eventgerman2021-02-022-1/+9
| | | | | | | | |
* | | | | | | | | README Edit for EASchplee2021-02-081-1/+1
| | | | | | | | |
* | | | | | | | | Merge pull request #5895 from Morph1984/utf16-cvtLC2021-02-081-14/+0
|\ \ \ \ \ \ \ \ \ | |_|_|_|/ / / / / |/| | | | | | | | string_util: Remove MSVC workaround for converting between UTF8/UTF16
| * | | | | | | | string_util: Remove MSVC workaround for converting between UTF8/UTF16Morph2021-02-081-14/+0
|/ / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | This has been fixed as of Visual Studio 2019 Version 16.2
* | | | | | | | Merge pull request #5339 from german77/interactivebunnei2021-02-0837-96/+3143
|\ \ \ \ \ \ \ \ | |_|/ / / / / / |/| | | | | | | Settings: Make settings controller image change with controller input
| * | | | | | | Add GC controller animationgerman2021-02-072-52/+429
| | | | | | | |
| * | | | | | | Refresh debug controller settingsgerman2021-02-064-10/+18
| | | | | | | |
| * | | | | | | Refresh controller only when necessarygerman2021-02-062-15/+37
| | | | | | | |
| * | | | | | | Add SL SR vectors, change dual joycon view, add missing raw data from keyboard/mousegerman2021-02-064-178/+247
| | | | | | | |
| * | | | | | | Add controller window and single joycon top viewgerman2021-02-067-29/+391
| | | | | | | |
| * | | | | | | Replace text with vectorsgerman2021-02-062-77/+306
| | | | | | | |
| * | | | | | | Make settings controller image change with controller inputgerman2021-02-0631-96/+2076
| | | | | | | |
* | | | | | | | Merge pull request #5872 from lioncash/svc-errorChloe2021-02-081-59/+188
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | svc: Provide more detailed error logs for svc functions
| * | | | | | | | svc: Provide more detailed error logs for svc functionsLioncash2021-02-061-59/+188
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Allows SVC calls to have much more informative information during error cases. This also doesn't hide control flow returns from the reader.
* | | | | | | | | Merge pull request #5888 from Morph1984/ogl-4.6Rodrigo Locatti2021-02-083-42/+17
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | renderer_opengl: Update OpenGL backend version requirement to 4.6
| * | | | | | | | | renderer_opengl: Update OpenGL backend version requirement to 4.6Morph2021-02-073-42/+17
| | | | | | | | | |
* | | | | | | | | | Merge pull request #5889 from ogniK5377/morton-removeLC2021-02-083-2/+0
|\ \ \ \ \ \ \ \ \ \ | |/ / / / / / / / / |/| | | | | | | | | video_core: Delete morton
| * | | | | | | | | video_core: Delete mortonChloe Marcec2021-02-083-2/+0
| | |_|_|_|/ / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | moron.h & morton.cpp are not used anywhere and are just empty files
* | | | | | | | | Merge pull request #5887 from ogniK5377/lm-fixbunnei2021-02-071-7/+9
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | lm: Fix ReadLeb128
| * | | | | | | | | lm: Fix ReadLeb128Chloe Marcec2021-02-071-7/+9
| |/ / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Fixes assertion on Bloodstained Ritual of the Night. We would over read sometimes, this is fixed by checking if the top bit is set in the first iteration. We also lock the loop off to be only the max size of the type we can fit. Finally we changed an incorrect print of "DEBUG" to "TRACE" to reflect the proper log severity
* | | | | | | | | Merge pull request #5878 from aleasto/masterMorph2021-02-071-2/+7
|\ \ \ \ \ \ \ \ \ | |/ / / / / / / / |/| | | | | | | | pl_u: Fix read out of bounds
| * | | | | | | | pl_u: Fix read out of boundsAlessandro Astone2021-02-061-2/+7
| | | | | | | | |
* | | | | | | | | Merge pull request #5885 from MerryMage/ring_buffer-granularitybunnei2021-02-062-16/+15
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | ring_buffer: Remove granularity template argument
| * | | | | | | | | ring_buffer: Remove granularity template argumentMerryMage2021-02-062-16/+15
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Non-obvious bug in RingBuffer::Push(std::vector<T>&) when granularity != 1 Just remove it altogether because we do not have a use for granularity != 1
* | | | | | | | | | Merge pull request #5871 from lioncash/address-arbbunnei2021-02-061-54/+30
|\ \ \ \ \ \ \ \ \ \ | |_|_|_|/ / / / / / |/| | | | | | | | | k_address_arbiter: Minor cleanup
| * | | | | | | | | k_address_arbiter: Unfold R_UNLESS macrosLioncash2021-02-061-5/+8
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Allows for more descriptive error messages and also doesn't hide control-path exit returns from the reader.
| * | | | | | | | | k_address_arbiter: Remove unnecessary usages of std::addressofLioncash2021-02-061-10/+10
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This is a useful function in a generic context or with types that overload unary operator&. However, primitives and pointers will never do this, so we can opt for a more straightforward syntax.
| * | | | | | | | | k_address_arbiter: Remove dead codeLioncash2021-02-061-40/+13
| | |_|/ / / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This code is never used, so we can remove it. It's in version control, so it can always be brought back when needed.
* | | | | | | | | Merge pull request #5326 from german77/hidUpdate1bunnei2021-02-0611-169/+407
|\ \ \ \ \ \ \ \ \ | |/ / / / / / / / |/| | | | | | | | HID: Update the HID service to match more closely to switchbrew part 1
| * | | | | | | | Add footer types and address commentsgerman2021-02-047-58/+106
| | | | | | | | |
| * | | | | | | | Fix npad struct to match switchbrewgerman2021-02-044-106/+135
| | | | | | | | |
| * | | | | | | | Adds missing controller types and propertiesgerman2021-02-049-30/+191
| | | | | | | | |
* | | | | | | | | Merge pull request #5862 from bunnei/keventbunnei2021-02-0663-568/+737
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | Kernel Rework: Refactor KEvent/KReadableEvent/KWritableEvent
| * | | | | | | | | hle: kernel: Drop R_UNLESS_NOLOG in favor of expanded if-statement.bunnei2021-02-053-11/+11
| | | | | | | | | |
| * | | | | | | | | hle: kernel: KAddressArbiter: Remove noisy error log.bunnei2021-02-051-1/+1
| | | | | | | | | |
| * | | | | | | | | hle: kernel: svc: Cleanup KEvent/KReadableEvent/KWritableEvent SVCs.bunnei2021-02-055-69/+89
| | | | | | | | | |
| * | | | | | | | | common: scope_exit: Add a cancellable ScopeExit macro.bunnei2021-02-051-0/+6
| | | | | | | | | |
| * | | | | | | | | hle: kernel: Reimplement KReadableEvent and KWritableEvent.bunnei2021-02-0538-298/+341
| | | | | | | | | |
| * | | | | | | | | hle: kernel: Implement KEvent.bunnei2021-02-053-0/+91
| | | | | | | | | |
| * | | | | | | | | hle: kernel: KAddressArbiter: Use R_UNLESS_NOLOG where applicable.bunnei2021-02-051-1/+1
| | | | | | | | | |
| * | | | | | | | | common: common_funcs: Add R_UNLESS_NOLOG for scenarios that should not log.bunnei2021-02-051-0/+8
| | | | | | | | | |
| * | | | | | | | | hle: kernel: Rename WritableEvent to KWritableEvent.bunnei2021-02-0544-101/+101
| | | | | | | | | |
| * | | | | | | | | hle: kernel: Rename ReadableEvent to KReadableEvent.bunnei2021-02-0542-81/+82
| | | | | | | | | |
* | | | | | | | | | Merge pull request #5875 from lioncash/identifierbunnei2021-02-061-9/+9
|\ \ \ \ \ \ \ \ \ \ | |/ / / / / / / / / |/| | | | | | | | | k_priority_queue: Minor cleanup
| * | | | | | | | | k_priority_queue: Unfold several declval usagesLioncash2021-02-041-5/+5
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Given these are only used as function existence checks, we can simplify some usages of declval, given they aren't particularly useful here. Reduces a few template instantiations, which at most reduces compile times a tiny bit.
| * | | | | | | | | k_priority_queue: Simplify affinity mask type aliasLioncash2021-02-041-2/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | We can make use of the _t variants of the templates to cut down on a little bit of verbosity.
| * | | | | | | | | k_priority_queue: Resolved reserved identifierLioncash2021-02-041-2/+2
| |/ / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | An identifier containing a starting underscore followed by a capital letter is reserved by the standard. It's trivial to avoid this by moving the underscore to the end of the identifier. While the likelihood of clashing here being minimal, we can turn a "should not break" scenario into a definitive "will not break" one, so why not?.
* | | | | | | | | Merge pull request #5867 from Morph1984/am-GetHealthWarningDisappearedSystemEventbunnei2021-02-052-1/+14
|\ \ \ \ \ \ \ \ \ | |_|_|_|_|/ / / / |/| | | | | | | | IApplicationFunctions: Implement GetHealthWarningDisappearedSystemEvent
| * | | | | | | | IApplicationFunctions: Implement GetHealthWarningDisappearedSystemEventMorph2021-02-022-1/+14
| | | | | | | | |
* | | | | | | | | Merge pull request #5865 from lat9nq/conditionally-quietbunnei2021-02-051-1/+19
|\ \ \ \ \ \ \ \ \ | |_|_|_|/ / / / / |/| | | | | | | | video_core: host_shaders: Don't pass --quiet to glslangValidator if unavailable
| * | | | | | | | video_core: host_shaders: Don't pass --quiet to glslangValidator if unavailablelat9nq2021-02-021-1/+19
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Prevents CMake from calling `glslangValidator` with `--quiet` when it is not available, i.e. on older downstream versions from Ubuntu.
* | | | | | | | | Merge pull request #5876 from lioncash/truncationbunnei2021-02-041-1/+1
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | k_affinity_mask: Avoid implicit truncation to bool
| * | | | | | | | | k_affinity_mask: Avoid implicit truncation to boolLioncash2021-02-041-1/+1
| | |_|/ / / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This can cause compiler warnings. Instead, we can explicitly add a boolean expression around it to naturally turn the result into a bool.
* | | | | | | | | Merge pull request #5874 from Morph1984/create-keys-dirbunnei2021-02-041-0/+5
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | key_manager: Create the keys directory if it does not exist
| * | | | | | | | | key_manager: Create the keys directory if it does not existMorph2021-02-041-0/+5
|/ / / / / / / / /
* | | | | | | | | Merge pull request #5870 from german77/hanheldfix2bunnei2021-02-041-4/+2
|\ \ \ \ \ \ \ \ \ | |/ / / / / / / / |/| | | | | | | | config: Always update handheld config
| * | | | | | | | Always update handheld configgerman2021-02-041-4/+2
| | | | | | | | |
* | | | | | | | | Merge pull request #5863 from ogniK5377/disable-reverbbunnei2021-02-041-1/+4
|\ \ \ \ \ \ \ \ \ | |/ / / / / / / / |/| | | | | | | | audren: Disable reverb for the time being
| * | | | | | | | audren: Disable reverb for the time beingChloe Marcec2021-02-011-1/+4
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | As this is causing issues in a few games, it's best to have it disabled until it's completely implemented
* | | | | | | | | Merge pull request #5848 from ogniK5377/k-resourcelimitbunnei2021-02-0313-230/+343
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | kernel: Rewrite resource limit to be more accurate
| * | | | | | | | | Simplify limitableresource namesChloe Marcec2021-02-036-36/+29
| | | | | | | | | |
| * | | | | | | | | Compile errorChloe Marcec2021-02-021-1/+1
| | | | | | | | | |
| * | | | | | | | | Address issuesChloe Marcec2021-02-023-19/+15
| | | | | | | | | |
| * | | | | | | | | fix compile errorChloe Marcec2021-01-301-1/+1
| | | | | | | | | |
| * | | | | | | | | cleanup commentingChloe Marcec2021-01-301-2/+2
| | | | | | | | | |
| * | | | | | | | | Drop m_ from lockChloe Marcec2021-01-302-9/+9
| | | | | | | | | |
| * | | | | | | | | Move to GetGlobalTimeNs, fix GetTotalPhysicalMemoryAvailableChloe Marcec2021-01-303-9/+7
| | | | | | | | | |
| * | | | | | | | | kernel: Rewrite resource limit to be more accurateChloe Marcec2021-01-3013-231/+357
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Matches closer to hardware
* | | | | | | | | | Merge pull request #5842 from german77/userfixbunnei2021-02-031-2/+8
|\ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | acc: Fix error when second user is selected
| * | | | | | | | | | Fix user changing to 0 if validgerman2021-01-291-2/+8
| | | | | | | | | | |
* | | | | | | | | | | Merge pull request #5841 from german77/usernamebunnei2021-02-031-1/+1
|\ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | Avoid overwriting username
| * | | | | | | | | | | Avoid overwritting usernamegerman2021-01-281-1/+1
| |/ / / / / / / / / /
* | | | | | | | | | | Merge pull request #5866 from Morph1984/log-all-pathsLC2021-02-021-0/+3
|\ \ \ \ \ \ \ \ \ \ \ | |_|_|_|_|/ / / / / / |/| | | | | | | | | | settings: Log the cache, config and mod load directories
| * | | | | | | | | | settings: Log the cache, config, and mod load directoriesMorph2021-02-021-0/+3
|/ / / / / / / / / /
* | | | | | | | | | Merge pull request #5861 from german77/HandheldFixbunnei2021-02-021-2/+11
|\ \ \ \ \ \ \ \ \ \ | |_|_|_|/ / / / / / |/| | | | | / / / / | | |_|_|_|/ / / / | |/| | | | | | | hid: Only update motion for npad and prevent over scheduling events
| * | | | | | | | Only update motion for npad and prevent over scheduling eventsgerman2021-02-011-2/+11
| | | | | | | | |
* | | | | | | | | Merge pull request #5864 from MerryMage/is-thumbLC2021-02-012-2/+7
|\ \ \ \ \ \ \ \ \ | | |_|_|_|/ / / / | |/| | | | | | | arm_dynarmic_32: Print out CPSR.T on exception
| * | | | | | | | arm_dynarmic_32: Print out CPSR.T on exceptionMerryMage2021-02-012-2/+7
|/ / / / / / / /
* | | | | | | | Merge pull request #5859 from Morph1984/nifmbunnei2021-02-011-2/+157
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | nifm: Stub GetCurrentNetworkProfile and GetCurrentIpConfigInfo
| * | | | | | | | nifm: Stub GetCurrentIpConfigInfoMorph2021-01-311-1/+29
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | - Used by Lets Sing 12
| * | | | | | | | nifm: Stub GetCurrentNetworkProfileMorph2021-01-311-1/+41
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | - Used by Minecraft Bedrock Edition - Used by Bloons TD 5
| * | | | | | | | nifm: Add several structsMorph2021-01-311-0/+87
| | | | | | | | |
* | | | | | | | | Merge pull request #5856 from Morph1984/nifm-fix-getappletinfo-stubAmeer J2021-02-011-1/+5
|\ \ \ \ \ \ \ \ \ | |_|_|_|_|/ / / / |/| | | | | | | | nifm: Fix GetAppletInfo stub
| * | | | | | | | nifm: Fix GetAppletInfo stubMorph2021-01-311-1/+5
| | | | | | | | |
* | | | | | | | | Merge pull request #5858 from Morph1984/IsGamePlayRecordingSupported-stubbunnei2021-02-012-1/+12
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | am/IApplicationFunctions: Stub IsGamePlayRecordingSupported
| * | | | | | | | | am/IApplicationFunctions: Stub IsGamePlayRecordingSupportedMorph2021-01-312-1/+12
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Used by RetroArch
* | | | | | | | | | Merge pull request #5860 from Morph1984/prepo-transmission-stubbunnei2021-01-311-2/+19
|\ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | prepo: Stub RequestImmediateTransmission and GetTransmissionStatus
| * | | | | | | | | | prepo: Stub GetTransmissionStatusMorph2021-01-311-1/+11
| | | | | | | | | | |
| * | | | | | | | | | prepo: Stub RequestImmediateTransmissionMorph2021-01-311-1/+8
| | |_|/ / / / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | - Used by Animal Crossing: New Horizons
* | | | | | | | | | Merge pull request #5846 from ameerj/analog-joinMorph2021-01-311-5/+9
|\ \ \ \ \ \ \ \ \ \ | |/ / / / / / / / / |/| | | | | | | | | analog_from_button: Fix update_thread.join exception
| * | | | | | | | | analog_from_button: Fix update_thread.join exceptionameerj2021-01-301-5/+9
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This commit aims to address an exception that occurs when trying to join the Analog object's update_thread. By using an atomic bool for the status of the update thread, we ensure its value is consistent across the threads accessing it.
* | | | | | | | | | Merge pull request #5857 from Morph1984/bsd-fix-eventfd-stubbunnei2021-01-311-3/+3
|\ \ \ \ \ \ \ \ \ \ | |_|/ / / / / / / / |/| | | | | | | | | bsd: Fix EventFd stub
| * | | | | | | | | bsd: Fix EventFd stubMorph2021-01-311-3/+3
|/ / / / / / / / /
* | | | | | | | | Merge pull request #5855 from Morph1984/bsd-fix-getsockopt-stubbunnei2021-01-311-1/+5
|\ \ \ \ \ \ \ \ \ | |_|/ / / / / / / |/| | | | | | | | bsd: Fix GetSockOpt stub
| * | | | | | | | bsd: Fix GetSockOpt stubMorph2021-01-311-1/+5
| | | | | | | | |
* | | | | | | | | Merge pull request #5851 from ameerj/pop-inv-stubMorph2021-01-312-1/+10
|\ \ \ \ \ \ \ \ \ | |/ / / / / / / / |/| | | | | | | | am: Stub TryPopFromFriendInvitationStorageChannel
| * | | | | | | | am: Stub TryPopFromFriendInvitationStorageChannelameerj2021-01-312-1/+10
| | |_|_|/ / / / | |/| | | | | | | | | | | | | | | | | | | | | | Used by Family Feud
* | | | | | | | Merge pull request #5852 from ameerj/event-fd-stubbunnei2021-01-312-1/+12
|\ \ \ \ \ \ \ \ | |/ / / / / / / |/| | | | | | | bsd: Stub EventFd
| * | | | | | | bsd: Stub EventFdameerj2021-01-312-1/+12
|/ / / / / / / | | | | | | | | | | | | | | | | | | | | | Used by Family Feud
* | | | | | | Merge pull request #5779 from bunnei/kthread-rewritebunnei2021-01-3068-1953/+2979
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | Rewrite KThread to be more accurate
| * | | | | | | hle: kernel: KLightLock: Fix several bugs.bunnei2021-01-291-3/+3
| | | | | | | |
| * | | | | | | common: common_funcs: Change R_UNLESS to LOG_ERROR.bunnei2021-01-291-1/+1
| | | | | | | |
| * | | | | | | arm: dynarmic: Reintroduce JIT checks on SaveContext/LoadContext.bunnei2021-01-292-0/+12
| | | | | | | |
| * | | | | | | hle: kernel: KThread: Release thread resource on thread exit.bunnei2021-01-291-0/+1
| | | | | | | |
| * | | | | | | yuzu: debugger: Ignore HLE threads.bunnei2021-01-293-9/+21
| | | | | | | |
| * | | | | | | hle: kernel: process: Add state lock.bunnei2021-01-293-6/+15
| | | | | | | |
| * | | | | | | hle: kernel: threading: Fix bug with host thread naming.bunnei2021-01-291-3/+2
| | | | | | | |
| * | | | | | | hle: kernel: k_scheduler_lock: Cleanup.bunnei2021-01-291-3/+3
| | | | | | | |
| * | | | | | | core: arm: Remove unnecessary JIT checks.bunnei2021-01-292-24/+0
| | | | | | | |
| * | | | | | | common: common_funcs: Log error on R_UNLESS.bunnei2021-01-291-0/+3
| | | | | | | |
| * | | | | | | hle: kernel: Allocate a dummy KThread for each host thread, and use it for scheduling.bunnei2021-01-298-43/+45
| | | | | | | |
| * | | | | | | hle: kernel: k_scheduler: Use atomics for current_thread, etc.bunnei2021-01-292-26/+28
| | | | | | | |
| * | | | | | | hle: kernel: k_scheduler: Fix for single core mode.bunnei2021-01-291-1/+2
| | | | | | | |
| * | | | | | | kernel: Fix build errors.bunnei2021-01-292-4/+9
| | | | | | | |
| * | | | | | | core: cpu_manager: Remove unused variable.bunnei2021-01-291-1/+0
| | | | | | | |
| * | | | | | | hle: kernel: KScheduler: Introduce thread context_guard.bunnei2021-01-292-3/+16
| | | | | | | |
| * | | | | | | hle: kernel: Recode implementation of KThread to be more accurate.bunnei2021-01-2914-785/+1562
| | | | | | | |
| * | | | | | | kernel: svc_types: Add ThreadActivity.bunnei2021-01-291-0/+5
| | | | | | | |
| * | | | | | | kernel: KSchedulerPriorityQueue: Lowest priority should be LowestThreadPriority.bunnei2021-01-291-1/+1
| | | | | | | |
| * | | | | | | kernel: k_light_lock: Simplify EmuThreadHandle implementation.bunnei2021-01-295-51/+33
| | | | | | | |
| * | | | | | | hle: kernel: TimeManager: Simplify to not rely on previous EmuThreadHandle implementation.bunnei2021-01-296-69/+25
| | | | | | | |
| * | | | | | | common: common_funcs: Add useful kernel macro R_SUCCEED_IF.bunnei2021-01-291-0/+3
| | | | | | | |
| * | | | | | | core: hle: kernel: object: Implement Finalize() virtual method.bunnei2021-01-2915-6/+29
| | | | | | | |
| * | | | | | | core: hle: kernel: svc_results: Populate with several missing error codes.bunnei2021-01-291-0/+3
| | | | | | | |
| * | | | | | | core: hle: kernel: Implement KLightLock.bunnei2021-01-293-0/+173
| | | | | | | |
| * | | | | | | core: hle: kernel: Implement KThreadQueue.bunnei2021-01-292-0/+82
| | | | | | | |
| * | | | | | | common: common_funcs: Add a few more useful macros for kernel code.bunnei2021-01-291-0/+11
| | | | | | | |
| * | | | | | | hle: kernel: KThread: Clean up thread priorities.bunnei2021-01-2910-83/+44
| | | | | | | |
| * | | | | | | hle: kernel: KThread: Reorganize thread priority defaults.bunnei2021-01-299-31/+31
| | | | | | | |
| * | | | | | | hle: kernel: KThread: Fix ThreadType definition.bunnei2021-01-295-11/+12
| | | | | | | |
| * | | | | | | hle: kernel: Move single core "phantom mode" out of KThread.bunnei2021-01-294-16/+31
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | - This is a workaround that does not belong in a kernel primitive.
| * | | | | | | hle: kernel: KThread: Remove thread types that do not exist.bunnei2021-01-296-53/+30
| | | | | | | |
| * | | | | | | arm: arm_dynarmic: Skip calls when JIT is invalid.bunnei2021-01-292-0/+24
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | - This can happen if called from an idle or suspension thread.
| * | | | | | | core: hle: kernel: Rename Thread to KThread.bunnei2021-01-2945-272/+271
| | | | | | | |
* | | | | | | | Merge pull request #5795 from ReinUsesLisp/bytes-to-map-endbunnei2021-01-302-2/+27
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | video_core/memory_manager: Add BytesToMapEnd
| * | | | | | | | video_core/memory_manager: Add BytesToMapEndReinUsesLisp2021-01-222-2/+27
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Track map address sizes in a flat ordered map and add a method to query the number of bytes until the end of a map in a given address.
* | | | | | | | | Merge pull request #5838 from german77/prepostubMorph2021-01-301-1/+10
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | prepo: Stub GetSystemSessionId
| * | | | | | | | | Stub GetSystemSessionIdgerman2021-01-301-1/+10
| | |_|_|_|/ / / / | |/| | | | | | |
* | | | | | | | | Merge pull request #5847 from bunnei/update-dynarmicbunnei2021-01-301-0/+0
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | externals: Dynarmic: Update to latest to include A32 ISB hook.
| * | | | | | | | | externals: Dynarmic: Update to latest to include A32 ISB hook.bunnei2021-01-301-0/+0
| | |_|_|/ / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | - Fixes perf. issues with Megadimension Neptunia VII.
* | | | | | | | | Merge pull request #5805 from german77/HandheldFixbunnei2021-01-302-15/+37
|\ \ \ \ \ \ \ \ \ | |/ / / / / / / / |/| | | | / / / / | | |_|_|/ / / / | |/| | | | | | Fix connect and disconnect controller events
| * | | | | | | Fix connect and disconnect controller eventsgerman2021-01-242-15/+37
| | | | | | | |
* | | | | | | | Merge pull request #5809 from ogniK5377/FlushAudioOutBuffersbunnei2021-01-293-1/+20
|\ \ \ \ \ \ \ \ | |_|_|_|/ / / / |/| | | | | | | audout: FlushAudioOutBuffers
| * | | | | | | audout: FlushAudioOutBuffersChloe Marcec2021-01-243-1/+20
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Fixes Devil May Cry
* | | | | | | | Merge pull request #5837 from german77/socketstubbunnei2021-01-292-1/+17
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | sockets: Stub GetSockOpt
| * | | | | | | | Stub GetSockOptgerman2021-01-282-1/+17
| | |_|/ / / / / | |/| | | | | |
* | | | | | | | Merge pull request #5831 from MerryMage/isbLC2021-01-281-0/+0
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | dynarmic: Do not flush cache when executing an ISB instruction
| * | | | | | | | externals: Update dynarmic to 0f27368fMerryMage2021-01-271-0/+0
| | | | | | | | |
* | | | | | | | | Merge pull request #5836 from ReinUsesLisp/unaligned-constr-schedLC2021-01-281-6/+6
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | vk_scheduler: Fix unaligned placement new expressions
| * | | | | | | | | vk_scheduler: Fix unaligned placement new expressionsReinUsesLisp2021-01-281-6/+6
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | We were accidentaly creating an object in an unaligned memory address. Fix this by manually aligning the offset.
* | | | | | | | | | Merge pull request #5840 from Morph1984/prepo-fixLC2021-01-283-24/+70
|\ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | prepo: Fix BufferDescriptorX invalid buffer index errors and add New variants of SaveReport
| * | | | | | | | | | prepo: Fix BufferDescriptorX invalid buffer errors and add "New" variants of SaveReportMorph2021-01-281-24/+42
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The second input buffer could be optional when prepo/srepo is called, test for the availability of the second buffer prior to reading from it.
| * | | | | | | | | | hle_ipc: Add Can(Read, Write)BufferMorph2021-01-282-0/+28
| | |_|/ / / / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | Allows us to test whether a buffer can be read from or written to memory
* | | | | | | | | | Merge pull request #5835 from Morph1984/cleanup-sixaxis-fusionLC2021-01-283-26/+28
|\ \ \ \ \ \ \ \ \ \ | |/ / / / / / / / / |/| | | | | | | | | hid: Cleanup SixAxisFusionParameters
| * | | | | | | | | hid: Add static_assert for Parameter sizeMorph2021-01-281-15/+19
| | | | | | | | | |
| * | | | | | | | | npad: Remove unused device handle parameterMorph2021-01-273-11/+9
| | | | | | | | | |
* | | | | | | | | | Merge pull request #5786 from ReinUsesLisp/glsl-cbufbunnei2021-01-281-1/+2
|\ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | gl_shader_decompiler: Fix constant buffer size calculation
| * | | | | | | | | | gl_shader_decompiler: Fix constant buffer size calculationReinUsesLisp2021-01-211-1/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The divide logic was wrong and can cause an uniform buffer size overflow.
* | | | | | | | | | | vulkan_device: Blacklist Intel from float16 math (#5798)Rodrigo Locatti2021-01-271-0/+5
| |_|/ / / / / / / / |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | Astral Chain crashes Intel's SPIR-V compiler when using fp16. Disable this while the vendor works on a fix.
* | | | | | | | | | Merge pull request #5778 from ReinUsesLisp/shader-dirbunnei2021-01-278-5/+59
|\ \ \ \ \ \ \ \ \ \ | |_|/ / / / / / / / |/| | | | | | | | | renderer_opengl: Avoid precompiled cache and force NV GL cache directory
| * | | | | | | | | renderer_opengl: Avoid precompiled cache and force NV GL cache directoryReinUsesLisp2021-01-218-5/+59
| |/ / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Setting __GL_SHADER_DISK_CACHE_PATH we can force the cache directory to be in yuzu's user directory to stop commonly distributed malware from deleting our driver shader cache. And by setting __GL_SHADER_DISK_CACHE_SKIP_CLEANUP we can have an unbounded shader cache size. This has only been implemented on Windows, mostly because previous tests didn't seem to work on Linux. Disable the precompiled cache on Nvidia's driver. There's no need to hide information the driver already has in its own cache.
* | | | | | | | | Merge pull request #5812 from german77/StubSixaxisFusionbunnei2021-01-274-3/+104
|\ \ \ \ \ \ \ \ \ | |_|/ / / / / / / |/| | | | | | | | HID: Stub Set/Get/Reset SixaxisSensorFusionParameters
| * | | | | | | | Stub Set/Get/Reset SixaxisSensorFusionParametersgerman2021-01-244-3/+104
| | | | | | | | |
* | | | | | | | | Merge pull request #5810 from ogniK5377/stereo-visionbunnei2021-01-273-7/+60
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | hle: Implement remaining services for Stereo Vision
| * | | | | | | | | hle: Implement remaining services for Stereo VisionChloe Marcec2021-01-243-7/+60
| |/ / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | Used by Zelda Breath of the Wild, Super Mario Odyssey and Nintendo Labo
* | | | | | | | | Merge pull request #5824 from ogniK5377/IPsmSessionbunnei2021-01-261-1/+112
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | psm: IPsmSession
| * | | | | | | | | Omit system referenceChloe Marcec2021-01-251-2/+1
| | | | | | | | | |
| * | | | | | | | | psm: IPsmSessionChloe Marcec2021-01-251-2/+114
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Used by homebrew menu
* | | | | | | | | | Merge pull request #5774 from ogniK5377/mii-raw-randombunnei2021-01-264-2274/+1657
|\ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | mii: Fix BuildRandomStoreData & Cleanup raw_data
| * | | | | | | | | | mii: Fix BuildRandomStoreData & Cleanup raw_dataChloe Marcec2021-01-204-2274/+1657
| | |_|/ / / / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Cleaned up mii raw data to reflect the underlying values instead of just a chunk of bytes. Fixed BuildRandomStoreData not actually generating random miis properly. "values" should be a u32, not a u8.
* | | | | | | | | | Merge pull request #5771 from ogniK5377/lm-reworkbunnei2021-01-258-345/+288
|\ \ \ \ \ \ \ \ \ \ | |_|/ / / / / / / / |/| | | | | | | | | lm: Recode LM service
| * | | | | | | | | Print Process ID and Thread ID as hexChloe Marcec2021-01-241-2/+2
| | | | | | | | | |
| * | | | | | | | | Clamp string reads to buffer sizeChloe Marcec2021-01-231-3/+5
| | | | | | | | | |
| * | | | | | | | | Mark DestinationToString as staticChloe Marcec2021-01-201-1/+1
| | | | | | | | | |
| * | | | | | | | | Mark LogPacketHeaderEntry hash as noexceptChloe Marcec2021-01-201-1/+1
| | | | | | | | | |
| * | | | | | | | | lm: Recode LM serviceChloe Marcec2021-01-208-345/+286
| |/ / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | Rework the service to spit out to logs instead of a seperate file as well as fix any crashes caused by lm.
* | | | | | | | | Merge pull request #5799 from ogniK5377/event-register-unregisterbunnei2021-01-251-1/+7
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | nvdrv: Unregister already registered events
| * | | | | | | | | Simplify conditionChloe Marcec2021-01-231-2/+1
| | | | | | | | | |
| * | | | | | | | | nvdrv: Unregister already registered eventsChloe Marcec2021-01-231-1/+8
| | | | | | | | | |
* | | | | | | | | | Merge pull request #5785 from ReinUsesLisp/buffer-dmabunnei2021-01-252-8/+21
|\ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | video_core/memory_manager: Flush destination buffer on CopyBlock
| * | | | | | | | | | video_core/memory_manager: Remove unused CopyBlockUnsafeReinUsesLisp2021-01-212-8/+0
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This function was not being used.
| * | | | | | | | | | video_core/memory_manager: Flush destination buffer on CopyBlockReinUsesLisp2021-01-211-0/+4
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | When we copy into a buffer, it might contain data modified from the GPU on the same pages. Because of this, we have to flush the contents before writing new data. An alternative approach would be to write the data in place, but games can also write data in other ways, invalidating our contents. Fixes geometry in Zombie Panic in Wonderland DX.
| * | | | | | | | | | video_core/memory_manager: Add GPU address based flush methodReinUsesLisp2021-01-212-0/+17
| | |/ / / / / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | Allow flushing rasterizer contents based on a GPU address.
* | | | | | | | | | Merge pull request #5823 from ReinUsesLisp/revert-flagsRodrigo Locatti2021-01-253-59/+3
|\ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | Revert "Start of Integer flags implementation"
| * | | | | | | | | | Revert "Start of Integer flags implementation"ReinUsesLisp2021-01-253-59/+3
|/ / / / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This reverts #4713. The implementation in that PR is not accurate. It does not reflect the behavior seen in hardware.
* | | | | | | | | | Merge pull request #5819 from ReinUsesLisp/cull-mode-castbunnei2021-01-251-2/+2
|\ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | vk_graphics_pipeline: Fix narrowing conversion on MSVC
| * | | | | | | | | | vk_graphics_pipeline: Fix narrowing conversion on MSVCReinUsesLisp2021-01-251-2/+2
|/ / / / / / / / / /
* | | | | | | | | | Merge pull request #5807 from ReinUsesLisp/vc-warningsLC2021-01-2410-62/+95
|\ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | video_core: Silence the remaining gcc warnings and enforce them
| * | | | | | | | | | cmake: Enforce -Warray-bounds and -Wmissing-field-initializers globallyReinUsesLisp2021-01-242-2/+2
| | | | | | | | | | |
| * | | | | | | | | | video_core/cmake: Enforce -Warray-bounds and -Wmissing-field-initializersReinUsesLisp2021-01-241-0/+2
| | | | | | | | | | |
| * | | | | | | | | | video_core: Silence -Wmissing-field-initializers warningsReinUsesLisp2021-01-245-25/+56
| | | | | | | | | | |
| * | | | | | | | | | maxwell_3d: Silence array bounds warningsReinUsesLisp2021-01-242-35/+35
| | | | | | | | | | |
| * | | | | | | | | | maxwell_to_vk: Silence -Wextra warnings about using different enum typesReinUsesLisp2021-01-242-2/+2
| | | | | | | | | | |
* | | | | | | | | | | Merge pull request #5363 from ReinUsesLisp/vk-image-usageRodrigo Locatti2021-01-243-38/+72
|\ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | vk_texture_cache: Support image store on sRGB images with VkImageViewUsageCreateInfo
| * | | | | | | | | | | vk_texture_cache: Support image store on sRGB images with VkImageViewUsageCreateInfoReinUsesLisp2021-01-243-38/+72
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Vulkan 1.0 didn't support creating sRGB image views on an ABGR8 VkImage with storage usage bits. VK_KHR_maintenance2 addressed this allowing to reduce the usage bits on a VkImageView. To allow image store on non-sRGB image views when the VkImage is created with sRGB, always create VkImages without sRGB and add the sRGB format on the view.
* | | | | | | | | | | | Merge pull request #5151 from comex/xx-vfsbunnei2021-01-241-4/+10
|\ \ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | | | vfs_real: When moving files or directories, don't assume file opening will succeed
| * | | | | | | | | | | | vfs_real: When moving files or directories, don't assume file opening will succeedcomex2021-01-231-4/+10
| | |/ / / / / / / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Found this via a warning, but it's a substantive fix. Since this is only for a cache, it should be safe to silently drop the entry if opening fails. I think.
* | | | | | | | | | | | Merge pull request #5814 from ReinUsesLisp/remove-rdna-dynstateLC2021-01-241-23/+0
|\ \ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | | | vulkan_device: Lift VK_EXT_extended_dynamic_state blacklist on RDNA
| * | | | | | | | | | | | vulkan_device: Lift VK_EXT_extended_dynamic_state blacklist on RDNAReinUsesLisp2021-01-251-23/+0
|/ / / / / / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | It seems to be safe to use this on new drivers.
* | | | | | | | | | | | Merge pull request #5796 from ReinUsesLisp/vertex-a-bypass-vkbunnei2021-01-241-9/+3
|\ \ \ \ \ \ \ \ \ \ \ \ | |_|_|_|_|/ / / / / / / |/| | | | | | | | | | | vk_pipeline_cache: Properly bypass VertexA shaders
| * | | | | | | | | | | vk_pipeline_cache: Properly bypass VertexA shadersReinUsesLisp2021-01-231-9/+3
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The VertexA stage is not yet implemented, but Vulkan is adding its descriptors, causing a discrepancy in the pushed descriptors and the template. This generally ends up in a driver side crash. Bypass the VertexA stage for now.
* | | | | | | | | | | | Merge pull request #5808 from ReinUsesLisp/glslang-quietLC2021-01-241-1/+1
|\ \ \ \ \ \ \ \ \ \ \ \ | |_|_|_|_|_|/ / / / / / |/| | | | | | | | | | | host_shaders/cmake: Pass --quiet to glslang to keep it quiet
| * | | | | | | | | | | host_shaders/cmake: Pass --quiet to glslang to keep it quietReinUsesLisp2021-01-241-1/+1
| | |/ / / / / / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Silences noisy builds on toolchains.
* | | | | | | | | | | Merge pull request #5806 from bunnei/am-stubbunnei2021-01-241-1/+8
|\ \ \ \ \ \ \ \ \ \ \ | |/ / / / / / / / / / |/| | | | | | | | | | hle: service: am: Stub ILibraryAppletAccessor::PresetLibraryAppletGpuTimeSliceZero.
| * | | | | | | | | | hle: service: am: Stub ILibraryAppletAccessor::PresetLibraryAppletGpuTimeSliceZero.bunnei2021-01-211-1/+8
| | |_|/ / / / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | - Used by Monster Hunter Rise demo.
* | | | | | | | | | shader_ir: Fix comment typoLevi Behunin2021-01-231-1/+1
| | | | | | | | | |
* | | | | | | | | | Merge pull request #5800 from Morph1984/max-vibration-durationLC2021-01-231-2/+6
|\ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | sdl_impl: Set the maximum vibration duration to 1 second
| * | | | | | | | | | sdl_impl: Set the maximum vibration duration to 1 secondMorph2021-01-231-2/+6
|/ / / / / / / / / /
* | | | | | | | | | Merge pull request #5797 from ReinUsesLisp/nsight-aftermath-buildLC2021-01-233-18/+7
|\ \ \ \ \ \ \ \ \ \ | |_|_|_|/ / / / / / |/| | | | | | | | | nsight_aftermath_tracker: Fix build issues when enabled
| * | | | | | | | | video_core/cmake: Properly generate fatal errors on AftermathReinUsesLisp2021-01-231-2/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Fix "message(ERROR ..." to "message(FATAL_ERROR ..." to properly stop cmake when Nsight Aftermath can't be configured.
| * | | | | | | | | nsight_aftermath_tracker: Fix build issues when enabledReinUsesLisp2021-01-232-16/+5
| | |/ / / / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | Fixes a bunch of build errors when Nsight Aftermath is properly enabled.
* | | | | | | | | Merge pull request #5776 from ogniK5377/lblbunnei2021-01-231-22/+261
|\ \ \ \ \ \ \ \ \ | |/ / / / / / / / |/| | | | | | | | lbl: Implement most of lbl
| * | | | | | | | lbl: Implement most of lblChloe Marcec2021-01-201-22/+261
| |/ / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | Pretty basic service, only thing left to do is handle setting applying once set:sys is implemented
* | | | | | | | Merge pull request #4713 from behunin/int-flagsbunnei2021-01-233-3/+59
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | Start of Integer flags implementation
| * \ \ \ \ \ \ \ Merge remote-tracking branch 'upstream/master' into int-flagsLevi2021-01-11912-25081/+90703
| |\ \ \ \ \ \ \ \
| * | | | | | | | | More forgetting... duhLevi Behunin2020-09-251-2/+2
| | | | | | | | | |
| * | | | | | | | | Forgot to apply suggestion here as wellLevi Behunin2020-09-251-1/+1
| | | | | | | | | |
| * | | | | | | | | Address CommentsLevi Behunin2020-09-253-25/+34
| | | | | | | | | |
| * | | | | | | | | Start of Integer flags implementationLevi Behunin2020-09-253-3/+50
| | | | | | | | | |
* | | | | | | | | | Merge pull request #5765 from ogniK5377/StoreSaveDataThumbnail-stubbunnei2021-01-235-6/+66
|\ \ \ \ \ \ \ \ \ \ | |_|_|_|_|_|/ / / / |/| | | | | | | | | acc: Stub StoreSaveDataThumbnail
| * | | | | | | | | acc: Stub StoreSaveDataThumbnailChloe Marcec2021-01-195-6/+66
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Fixes ACA NEOGEO METAL SLUG hanging on boot.
* | | | | | | | | | Merge pull request #5784 from v1993/patch-1bunnei2021-01-221-1/+1
|\ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | Bump conan SDL2 version to 2.0.14
| * | | | | | | | | | Bump conan SDL2 version to 2.0.14Valeri2021-01-211-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Update conan package version used for building. A couple of new joystick-related functions might pose interest to yuzu's input system. Some sort of LED management have been added, but it doesn't seem to support leds used for player number indication JoyCons/ProCons use.
* | | | | | | | | | | common: Add missing include to bit_util.hbunnei2021-01-221-0/+1
| | | | | | | | | | |
* | | | | | | | | | | Merge pull request #5781 from lioncash/bitsbunnei2021-01-211-35/+13
|\ \ \ \ \ \ \ \ \ \ \ | |/ / / / / / / / / / |/| | | | | | | | | | bit_util: Unify implementations of MostSignificantBit32/MostSignificantBit64
| * | | | | | | | | | bit_util: Unify implementations of MostSignificantBit32/MostSignificantBit64Lioncash2021-01-211-35/+13
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | We can use the standardized CLZ facilities to perform this. This also allows us to make utilizing functions constexpr and eliminate the inclusion of an intrinsics header.
* | | | | | | | | | | Merge pull request #5270 from german77/multiTouchbunnei2021-01-2119-263/+365
|\ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | HID: Add multitouch support
| * | | | | | | | | | | Always initialize keyboard inputgerman2021-01-155-25/+20
| | | | | | | | | | | |
| * | | | | | | | | | | Add mutitouch support for touch screensgerman2021-01-1510-85/+137
| | | | | | | | | | | |
| * | | | | | | | | | | Allow to return up to 16 touch inputs per enginegerman2021-01-1510-154/+202
| | | | | | | | | | | |
| * | | | | | | | | | | Allow all touch inputs at the same time and remove config options that are not longer necesarygerman2021-01-158-99/+36
| | | | | | | | | | | |
| * | | | | | | | | | | Add multitouch supportgerman2021-01-152-23/+93
| | | | | | | | | | | |
* | | | | | | | | | | | Merge pull request #5361 from ReinUsesLisp/vk-shader-commentbunnei2021-01-211-1/+4
|\ \ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | | | vk_shader_decompiler: Show comments as OpUndef with a type
| * | | | | | | | | | | | vk_shader_decompiler: Show comments as OpUndef with a typeReinUsesLisp2021-01-161-1/+4
| | |_|_|_|_|_|/ / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Silence the new validation layer error about SPIR-V not allowing OpUndef on a OpTypeVoid, even when the SPIR-V spec doesn't say anything against it. They will be inserted as an undefined int to avoid SPIRV-Cross and validation errors, but only when a debugging tool is attached.
* | | | | | | | | | | | Merge pull request #5743 from german77/HandheldFixbunnei2021-01-212-1/+12
|\ \ \ \ \ \ \ \ \ \ \ \ | |_|_|_|_|_|_|/ / / / / |/| | | | | | | / / / / | | |_|_|_|_|_|/ / / / | |/| | | | | | | | | Fix player 1 turning on handheld and not updating handheld settings
| * | | | | | | | | | Always update configuration for handheldgerman2021-01-181-0/+10
| | | | | | | | | | |
| * | | | | | | | | | Fix player 1 default connected valuegerman2021-01-171-1/+2
| | | | | | | | | | |
* | | | | | | | | | | Merge pull request #5755 from FearlessTobi/port-5344bunnei2021-01-192-28/+32
|\ \ \ \ \ \ \ \ \ \ \ | |_|_|_|_|/ / / / / / |/| | | | | | | | | | Port citra-emu/citra#5344: "game_list: Fix folder reordering"
| * | | | | | | | | | game_list: Fix folder reorderingFearlessTobi2021-01-182-28/+32
| | |_|_|/ / / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The bug(s) happened because we swapped the contents on values.game_dirs, but the pointer each item had to their respective game_dir wasn't updated. This made it so that the item had the wrong game_dir associated with it after a "move up" or "move down" operation. It can be observed by choosing "open directory location" after such operation. Changed from raw pointer to an index because it's equivalent but a bit clearer, but the change is not essential. Co-Authored-By: Vitor K <29167336+vitor-k@users.noreply.github.com>
* | | | | | | | | | Merge pull request #5746 from lioncash/sign-compareRodrigo Locatti2021-01-181-1/+1
|\ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | texture_cache/util: Resolve -Wsign-compare warning
| * | | | | | | | | | texture_cache/util: Resolve -Wsign-compare warningLioncash2021-01-171-1/+1
| | |/ / / / / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | Resolves a -Wsign-compare warning on Clang.
* | | | | | | | | | Merge pull request #5754 from lat9nq/fix-disable-boxcatLC2021-01-181-0/+2
|\ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | configure_service: Only compile FormatEventStatusString when YUZU_ENABLE_BOXCAT is enabled
| * | | | | | | | | | configure_service: Only compile FormatEventStatusString when YUZU_ENABLE_BOXCAT is enabledlat9nq2021-01-171-0/+2
| | |/ / / / / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The function is unused if YUZU_ENABLE_BOXCAT is disabled, causing a -Wunused-funciton error when compiled. Wrapping it with `#ifdef YUZU_ENABLE_BOXCAT` to prevent compiling the function when the variable is disabled. Opting to not use [[maybe unused]] in case the function is totally unused in the future.
* | | | | | | | | | Merge pull request #5757 from Morph1984/npad-handheldLC2021-01-181-1/+1
|\ \ \ \ \ \ \ \ \ \ | |/ / / / / / / / / |/| | | | | | | | | npad: Add check for HANDHELD_INDEX in UpdateControllerAt()
| * | | | | | | | | npad: Add check for HANDHELD_INDEX in UpdateControllerAt()Morph2021-01-181-1/+1
|/ / / / / / / / /
* | | | | | | | | Merge pull request #5360 from ReinUsesLisp/enforce-memclass-accessbunnei2021-01-1718-205/+216
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | core: Silence Wclass-memaccess warnings and enforce it
| * | | | | | | | | core/cmake: Enforce Wclass-memaccessReinUsesLisp2021-01-151-0/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Treat -Wclass-memaccess as an error.
| * | | | | | | | | core: Silence Wclass-memaccess warningsReinUsesLisp2021-01-1517-205/+215
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This requires making several types trivial and properly initialize them whenever they are called.
* | | | | | | | | | Merge pull request #5745 from lioncash/documentationRodrigo Locatti2021-01-172-4/+3
|\ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | video_core: Resolve -Wdocumentation warnings
| * | | | | | | | | | video_core: Resolve -Wdocumentation warningsLioncash2021-01-172-4/+3
| | |/ / / / / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | Silences some -Wdocumentation warnings on Clang.
* | | | | | | | | | Merge pull request #5744 from lioncash/header-guardbunnei2021-01-171-0/+2
|\ \ \ \ \ \ \ \ \ \ | |/ / / / / / / / / |/| | | | | | | | | vulkan_debug_callback: Add missing header guard
| * | | | | | | | | vulkan_debug_callback: Add missing header guardLioncash2021-01-171-0/+2
|/ / / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | Prevents inclusion issues from occurring.
* | | | | | | | | Merge pull request #5740 from lioncash/const-fnRodrigo Locatti2021-01-171-4/+4
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | input_interpreter: Mark two member functions as const
| * | | | | | | | | input_interpreter: Mark two member functions as constLioncash2021-01-161-4/+4
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | These aren't stateful functions, so we can make use of const. While we're at, we can resolve some -Wdocumentation warnings.
* | | | | | | | | | Merge pull request #5262 from ReinUsesLisp/buffer-baseRodrigo Locatti2021-01-164-0/+970
|\ \ \ \ \ \ \ \ \ \ | |/ / / / / / / / / |/| | | | | | | | | buffer_cache/buffer_base: Add a range tracking buffer container and tests
| * | | | | | | | | tests: Add unit tests for the GPU range tracking buffer containerReinUsesLisp2021-01-132-0/+474
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Due to how error prone the container design is, this commit adds unit tests for it. Some tests taken from here are based on bugs from using this buffer container in games, so if we ever break it in the future in a way that might harm games, the tests should fail.
| * | | | | | | | | buffer_cache/buffer_base: Add a range tracking buffer containerReinUsesLisp2021-01-132-0/+496
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | It keeps track of the modified CPU and GPU ranges on a CPU page granularity, notifying the given rasterizer about state changes in the tracking behavior of the buffer. Use a small vector optimization to store buffers smaller than 256 KiB locally instead of using free store memory allocations.
* | | | | | | | | | Merge pull request #5366 from Morph1984/button-pressbunnei2021-01-162-0/+25
|\ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | input_interpreter: Add method to check for a button press state
| * | | | | | | | | | input_interpreter: Add method to check for a button press stateMorph2021-01-162-0/+25
|/ / / / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This allows to check for continuous input for the duration of a button press/hold
* | | | | | | | | | Merge pull request #5275 from FernandoS27/fast-native-clockbunnei2021-01-165-104/+174
|\ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | X86/NativeClock: Improve performance of clock calculations on hot path.
| * | | | | | | | | | X86/NativeClock: Reimplement RTDSC access to be lock free.Fernando Sahmkow2021-01-025-103/+107
| | | | | | | | | | |
| * | | | | | | | | | X86/NativeClock: Improve performance of clock calculations on hot path.Fernando Sahmkow2021-01-022-5/+71
| | | | | | | | | | |
* | | | | | | | | | | Merge pull request #5336 from lioncash/treebunnei2021-01-162-841/+668
|\ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | common/tree: Convert defines over to templates
| * | | | | | | | | | | common/tree: Convert defines over to templatesLioncash2021-01-122-592/+666
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Reworks the tree header to operate off of templates as opposed to a series of defines. This allows all tree facilities to obey namespacing rules, and also allows this code to be used within modules once compiler support is in place. This also gets rid to use a macro to define functions and structs for necessary data types. With templates, these will be generated when they're actually used, eliminating the need for the separate declaration.
| * | | | | | | | | | | common/tree: Remove unused splay tree definesLioncash2021-01-121-249/+2
| | |/ / / / / / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Makes for less code to take care of.
* | | | | | | | | | | Merge pull request #5297 from ReinUsesLisp/vulkan-allocator-commonRodrigo Locatti2021-01-1619-554/+609
|\ \ \ \ \ \ \ \ \ \ \ | |_|_|_|/ / / / / / / |/| | | | | | | | | | vulkan_memory_allocator: Improvements to the memory allocator
| * | | | | | | | | | vulkan_memory_allocator: Remove unnecesary 'device' memory from commitsReinUsesLisp2021-01-152-15/+15
| | | | | | | | | | |
| * | | | | | | | | | vk_texture_cache: Use Download memory types for texture flushesReinUsesLisp2021-01-152-5/+10
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Use the Download memory type where it matters.
| * | | | | | | | | | vulkan_memory_allocator: Add allocation support for download typesReinUsesLisp2021-01-152-55/+91
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Implements the allocator logic to handle download memory types. This will try to use HOST_CACHED_BIT when available.
| * | | | | | | | | | vulkan_memory_allocator: Add "download" memory usage hintReinUsesLisp2021-01-159-45/+86
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Allow users of the allocator to hint memory usage for downloads. This removes the non-descriptive boolean passed for "host visible" or not host visible memory commits, and uses an enum to hint device local, upload and download usages.
| * | | | | | | | | | vulkan_common: Move allocator to the common directoryReinUsesLisp2021-01-1511-11/+11
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Allow using the abstraction from the OpenGL backend.
| * | | | | | | | | | renderer_vulkan: Rename Vulkan memory manager to memory allocatorReinUsesLisp2021-01-1515-54/+52
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | "Memory manager" collides with the guest GPU memory manager, and a memory allocator sounds closer to what the abstraction aims to be.
| * | | | | | | | | | vk_memory_manager: Improve memory manager and its APIReinUsesLisp2021-01-1513-343/+318
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Fix a bug where the memory allocator could leave gaps between commits. To fix this the allocation algorithm was reworked, although it's still short in number of lines of code. Rework the allocation API to self-contained movable objects instead of naively using an unique_ptr to do the job for us. Remove the VK prefix.
* | | | | | | | | | | Merge pull request #5358 from ReinUsesLisp/rename-insert-paddingLC2021-01-1511-149/+149
|\ \ \ \ \ \ \ \ \ \ \ | |/ / / / / / / / / / |/| | | / / / / / / / | | |_|/ / / / / / / | |/| | | | | | | | common/common_funcs: Rename INSERT_UNION_PADDING_{BYTES,WORDS} to _NOINIT
| * | | | | | | | | common/common_funcs: Rename INSERT_UNION_PADDING_{BYTES,WORDS} to _NOINITReinUsesLisp2021-01-1511-149/+149
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | INSERT_PADDING_BYTES_NOINIT is more descriptive of the underlying behavior.
* | | | | | | | | | Merge pull request #5355 from lioncash/timerbunnei2021-01-153-202/+0
|\ \ \ \ \ \ \ \ \ \ | |_|_|_|/ / / / / / |/| | | | | | | | | common/timer: Remove
| * | | | | | | | | common/timer: RemoveLioncash2021-01-153-202/+0
| |/ / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This is a leftover from citra and dolphin that isn't used at all, particularly given the <chrono> header exists.
* | | | | | | | | Merge pull request #5357 from ReinUsesLisp/alignment-log2LC2021-01-154-28/+23
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | common/alignment: Rename AlignBits to AlignUpLog2 and use constraints
| * | | | | | | | | common/alignment: Upgrade to use constraints instead of static assertsReinUsesLisp2021-01-151-13/+9
| | | | | | | | | |
| * | | | | | | | | common/alignment: Rename AlignBits to AlignUpLog2ReinUsesLisp2021-01-154-16/+15
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | AlignUpLog2 describes what the function does better than AlignBits.
* | | | | | | | | | Merge pull request #5356 from lioncash/clzRodrigo Locatti2021-01-1510-113/+17
|\ \ \ \ \ \ \ \ \ \ | |_|/ / / / / / / / |/| | | | | | | | | common/bit_util: Replace CLZ/CTZ operations with standardized ones
| * | | | | | | | | common/bit_util: Replace CLZ/CTZ operations with standardized onesLioncash2021-01-1510-113/+17
|/ / / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | Makes for less code that we need to maintain.
* | | | | | | | | Merge pull request #5354 from ReinUsesLisp/remove-common-colorLC2021-01-152-272/+0
|\ \ \ \ \ \ \ \ \ | |/ / / / / / / / |/| | | | | | | | common/color: Remove
| * | | | | | | | common/color: RemoveReinUsesLisp2021-01-152-272/+0
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This is a leftover from Citra we no longer use.
* | | | | | | | | Merge pull request #5352 from ReinUsesLisp/remove-testerLC2021-01-1512-1057/+0
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | cmake: Remove yuzu_tester
| * | | | | | | | | cmake: Remove yuzu_testerReinUsesLisp2021-01-1512-1057/+0
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | We never ended up using yuzu_tester. Removing it saves code duplication with yuzu_cmd, and distribution size on prebuilt packages. For unit testing, we can use catch2 from guest code and dump the results to a file. Then execute yuzu from a script on ci if we want this to be automated.
* | | | | | | | | | Merge pull request #5353 from ReinUsesLisp/deduplicate-warning-flagsLC2021-01-152-4/+0
|\ \ \ \ \ \ \ \ \ \ | |_|/ / / / / / / / |/| | | | | | | | | {video_,}core/cmake: Remove Werror flags already defined code-base wide
| * | | | | | | | | core/cmake: Remove Werror flags already defined code-base wideReinUsesLisp2021-01-151-2/+0
| | | | | | | | | |
| * | | | | | | | | video_core/cmake: Remove Werror flags already defined code-base wideReinUsesLisp2021-01-151-2/+0
|/ / / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | These flags are already defined in src/cmake.
* | | | | | | | | Merge pull request #5351 from ReinUsesLisp/vc-unused-functionsLC2021-01-152-4/+1
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | cmake: Enforce -Wunused-function code-base wise
| * | | | | | | | | cmake: Enforce -Wunused-function code-base wideReinUsesLisp2021-01-152-1/+1
| | | | | | | | | |
| * | | | | | | | | video_core: Enforce -Wunused-functionReinUsesLisp2021-01-151-0/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Stops us from merging code with unused functions in the future. If something is invoked behind conditionally evaluated code in a way that the language can't see it (e.g. preprocessor macros), the potentially unused function should use [[maybe_unused]].
| * | | | | | | | | vk_buffer_cache: Remove unused functionReinUsesLisp2021-01-151-4/+0
| | | | | | | | | |
* | | | | | | | | | Merge pull request #5350 from ReinUsesLisp/vk-init-warnsRodrigo Locatti2021-01-152-145/+146
|\ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | vulkan_common: Silence missing initializer warnings
| * | | | | | | | | | vulkan_common: Silence missing initializer warningsReinUsesLisp2021-01-152-145/+146
| |/ / / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Silence warnings explicitly initializing all members on construction.
* | | | | | | | | | Merge pull request #5349 from ReinUsesLisp/anv-fixLC2021-01-152-18/+20
|\ \ \ \ \ \ \ \ \ \ | |_|/ / / / / / / / |/| | | | | | | | | vulkan_device: Enable shaderStorageImageMultisample conditionally
| * | | | | | | | | vulkan_device: Enable shaderStorageImageMultisample conditionallyReinUsesLisp2021-01-152-18/+20
| |/ / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | Fix Vulkan initialization on ANV.
* | | | | | | | | Merge pull request #5348 from ReinUsesLisp/astc-robustnessLC2021-01-151-18/+23
|\ \ \ \ \ \ \ \ \ | |/ / / / / / / / |/| | | | | | | | astc: Make the decoder more robust to invalid data
| * | | | | | | | astc: Increase integer encoded vector sizeReinUsesLisp2021-01-151-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Invalid ASTC textures seem to write more bytes here, increase the size to something that can't make us push out of bounds.
| * | | | | | | | astc: Return zero on out of bound bitsReinUsesLisp2021-01-151-17/+22
|/ / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Avoid out of bound reads on invalid ASTC textures. Games can bind invalid textures that make us read or write out of bounds.
* | | | | | | | Merge pull request #5302 from lat9nq/appimage-updateLC2021-01-152-9/+20
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | ci/linux: Make Mainline AppImages updateable
| * | | | | | | | ci/linux: Make Mainline AppImages updateablelat9nq2021-01-062-9/+20
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Moves the final step for building the AppImage to the upload script. Instructs appimagetool to embed update information into the AppImage if the release target is Mainline. Also tells it to create a zsync file to enable partial-downloads when updating the AppImage. Also renames the AppImage from `yuzu-{version info}-x86_64.AppImage` to `yuzu-{version info}.AppImage` to avoid a bug in the downloads page at yuzu-emu.org/downloads.
* | | | | | | | | Merge pull request #5345 from lioncash/unused-varbunnei2021-01-142-21/+2
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | yuzu: Remove unused variables in Qt code
| * | | | | | | | | yuzu: Remove unused variables in Qt codeLioncash2021-01-142-21/+2
|/ / / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Removes two unused variables in out Qt code. In this case the removal of these two results in less allocations, given std::map allocates on the heap.
* | | | | | | | | Merge pull request #5343 from lioncash/qt6Morph2021-01-141-6/+9
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | configure_motion_touch: Migrate off QRegExp to QRegularExpression
| * | | | | | | | | configure_motion_touch: Migrate off QRegExp to QRegularExpressionLioncash2021-01-141-6/+9
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | QRegularExpression was introduced in Qt 5 as a better replacement for QRegExp. In Qt 6.0 QRegExp is removed entirely. To remain forward compatible with Qt 6.0, we can transition over to using QRegularExpression.
* | | | | | | | | | Merge pull request #5344 from lioncash/moveMorph2021-01-141-2/+1
|\ \ \ \ \ \ \ \ \ \ | |/ / / / / / / / / |/| | | | | | | | | configure_motion_touch: Prevent use after move in ApplyConfiguration()
| * | | | | | | | | configure_motion_touch: Prevent use after move in ApplyConfiguration()Lioncash2021-01-141-2/+1
|/ / / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | touch_engine was being compared against after being moved into the setter for the engine, so this comparison wouldn't behave properly.
* | | | | | | | | Merge pull request #5330 from german77/regexerrorLC2021-01-141-2/+3
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | Fix IP validator error
| * | | | | | | | | Fix IP validator error where the last octet produced an error if the value was higher than 199german2021-01-131-2/+3
| | | | | | | | | |
* | | | | | | | | | Merge pull request #5342 from lioncash/qt6bunnei2021-01-132-3/+3
|\ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | yuzu: Migrate off of setMargin() to setContentsMargins()
| * | | | | | | | | | yuzu: Migrate off of setMargin() to setContentsMargins()Lioncash2021-01-132-3/+3
| | |_|/ / / / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | setMargin() has been deprecated since Qt 5, and replaced with setContentsMargins(). We can move over to setContentsMargins() to stay forward-compatible with Qt 6.0.
* | | | | | | | | | Merge pull request #5341 from ReinUsesLisp/anv-storageMorph2021-01-131-1/+0
|\ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | vulkan_device: Remove requirement on shaderStorageImageMultisample
| * | | | | | | | | | vulkan_device: Remove requirement on shaderStorageImageMultisampleReinUsesLisp2021-01-131-1/+0
|/ / / / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | yuzu doesn't currently emulate MS image stores. Requiring this makes no sense for now. Fixes ANV not booting any games on Vulkan.
* | | | | | | | | | Merge pull request #5340 from Morph1984/gcc-warningsLC2021-01-131-0/+2
|\ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | cmake: Enforce -Werror=switch and -Werror=unused-variable
| * | | | | | | | | | cmake: Enforce -Werror=switch and -Werror=unused-variableMorph2021-01-131-0/+2
|/ / / / / / / / / /
* | | | | | | | | | Merge pull request #5280 from FearlessTobi/port-5666bunnei2021-01-131-4/+12
|\ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | Port citra-emu/citra#5666: "Rotate previous log file to "citra_log.txt.old""