summaryrefslogtreecommitdiffstats
Commit message (Expand)AuthorAgeFilesLines
* Merge pull request #1354 from ogniK5377/ssl-versionbunnei2018-09-241-3/+3
|\
| * Corrected SSL::SetInterfaceVersionDavid Marcec2018-09-191-3/+3
* | Added glObjectLabels for renderdoc for textures and shader programs (#1384)David2018-09-234-0/+48
* | Merge pull request #1387 from FearlessTobi/port-4245bunnei2018-09-231-8/+0
|\ \
| * | common/thread: remove YieldCPU()Weiyi Wang2018-09-221-8/+0
* | | Merge pull request #1385 from FearlessTobi/port-4214bunnei2018-09-231-2/+6
|\ \ \
| * | | Port citra-emu/citra#4214: "Set citra-qt project as default StartUp Project in Visual Studio"fearlessTobi2018-09-221-2/+6
* | | | Merge pull request #1391 from ogniK5377/GetAudioRendererStatebunnei2018-09-235-1/+21
|\ \ \ \
| * | | | Added audren:u#GetAudioRendererStateDavid Marcec2018-09-235-1/+21
* | | | | Merge pull request #1392 from greggameplayer/correct-BC6Hbunnei2018-09-231-2/+2
|\ \ \ \ \ | |/ / / / |/| | | |
| * | | | correct BC6Hgreggameplayer2018-09-231-2/+2
|/ / / /
* | | | Merge pull request #1378 from lioncash/threadbunnei2018-09-235-100/+145
|\ \ \ \ | |_|/ / |/| | |
| * | | svc: Move most process termination code to its own function within ProcessLioncash2018-09-213-32/+56
| * | | thread/process: Move TLS slot marking/freeing to the process classLioncash2018-09-214-68/+89
* | | | Merge pull request #1386 from jroweboy/oopsJames Rowe2018-09-221-0/+10
|\ \ \ \ | |_|/ / |/| | |
| * | | Build: Reintroduce Appveyor deployJames Rowe2018-09-221-0/+10
|/ / /
* | | Merge pull request #1380 from lioncash/constbunnei2018-09-221-8/+19
|\ \ \
| * | | shader_bytecode: Lay out the Ipa-related enums betterLioncash2018-09-211-2/+12
| * | | shader_bytecode: Make operator== and operator!= of IpaMode const qualifiedLioncash2018-09-211-6/+7
* | | | Merge pull request #1382 from lioncash/incbunnei2018-09-222-4/+1
|\ \ \ \
| * | | | gl_state: Remove unused type aliasLioncash2018-09-222-4/+1
| |/ / /
* | | | Merge pull request #1376 from Subv/timestretch_tracebunnei2018-09-221-1/+1
|\ \ \ \
| * | | | Logging: Change the TimeStretch::Process log from debug to trace level.Subv2018-09-211-1/+1
| |/ / /
* | | | Merge pull request #1381 from valentinvanelslande/patch-1bunnei2018-09-221-1/+1
|\ \ \ \
| * | | | Update config.cppValentin Vanelslande2018-09-211-1/+1
* | | | | Merge pull request #1383 from DarkLordZach/game-list-interpolationJames Rowe2018-09-221-1/+1
|\ \ \ \ \ | |/ / / / |/| | | |
| * | | | game_list: Add Qt SmoothTransformation to picture scalingZach Hilman2018-09-221-1/+1
|/ / / /
* | | | Merge pull request #1379 from lioncash/bitwisebunnei2018-09-211-1/+1
|\ \ \ \ | |_|/ / |/| | |
| * | | gl_stream_buffer: Fix use of bitwise OR instead of logical OR in Map()Lioncash2018-09-211-1/+1
| |/ /
* | | Added support for uncompressed NSOs (#1374)David2018-09-211-3/+12
* | | Merge pull request #1225 from tech4me/travis-windowsJames Rowe2018-09-2112-16/+273
|\ \ \
| * | | Update MinGWCross.cmake to lowercasetech4me2018-09-191-40/+40
| * | | travis: running mingw build on travis citech4me2018-09-1912-16/+273
* | | | Merge pull request #1337 from DarkLordZach/create-fs-cmdbunnei2018-09-211-1/+3
|\ \ \ \
| * | | | yuzu-cmd: Add call to CreateFactoriesZach Hilman2018-09-191-1/+3
* | | | | Merge pull request #1372 from lioncash/threadbunnei2018-09-213-5/+5
|\ \ \ \ \
| * | | | | kernel/thread: Use owner_process when setting the page table in SetupMainThread()Lioncash2018-09-213-5/+5
| | |_|/ / | |/| | |
* | | | | Merge pull request #1371 from lioncash/fwd-armbunnei2018-09-215-1/+11
|\ \ \ \ \
| * | | | | arm_interface: Replace kernel vm_manager include with a forward declarationLioncash2018-09-215-1/+11
| |/ / / /
* | | | | Merge pull request #1375 from Subv/gl_clearbunnei2018-09-211-1/+1
|\ \ \ \ \
| * | | | | RasterizerGL: Use the correct framebuffer when clearing via the CLEAR_BUFFERS register.Subv2018-09-211-1/+1
| |/ / / /
* | | | | Merge pull request #1364 from lioncash/contentbunnei2018-09-2125-1/+45
|\ \ \ \ \
| * | | | | file-sys: Default heavy-weight class destructors in the cpp fileLioncash2018-09-2025-1/+45
* | | | | | Merge pull request #1367 from lioncash/pluralbunnei2018-09-211-9/+1
|\ \ \ \ \ \
| * | | | | | game_list: Handle plurals within setFilterResult() betterLioncash2018-09-201-9/+1
| |/ / / / /
* | | | | | Merge pull request #1368 from ogniK5377/nifm-fixbunnei2018-09-211-1/+7
|\ \ \ \ \ \
| * | | | | | Fixed submitDavid Marcec2018-09-201-2/+1
| * | | | | | Added IRequest::SubmitDavid Marcec2018-09-201-1/+8
* | | | | | | Merge pull request #1352 from lioncash/sharingbunnei2018-09-211-3/+11
|\ \ \ \ \ \ \
| * | | | | | | ring_buffer: Use std::atomic_size_t in a static assertLioncash2018-09-191-1/+1
| * | | | | | | ring_buffer: Use std::hardware_destructive_interference_size to determine alignment size for avoiding false sharingLioncash2018-09-191-2/+10
| | |_|_|_|_|/ | |/| | | | |
* | | | | | | Merge pull request #1373 from ogniK5377/revert-nifmbunnei2018-09-211-1/+1
|\ \ \ \ \ \ \ | |_|_|_|/ / / |/| | | | | |
| * | | | | | Revert GetRequestStateDavid Marcec2018-09-211-1/+1
|/ / / / / /
* | | | | | Merge pull request #1370 from Hedges/GDBCleanMat M2018-09-201-1/+1
|\ \ \ \ \ \
| * | | | | | Correct endianness of BKPTJarek Syrylak2018-09-201-1/+1
| | |/ / / / | |/| | | |
* | | | | | Merge pull request #1362 from MerryMage/dynarmicMat M2018-09-202-0/+12
|\ \ \ \ \ \ | |/ / / / / |/| | | | |
| * | | | | arm_dynarmic: Halt when BRK encounteredMerryMage2018-09-201-0/+1
| * | | | | arm_dynarmic: Support BKPT instructionMerryMage2018-09-191-0/+11
| * | | | | externals: Update dynarmic to 171d116MerryMage2018-09-191-0/+0
| | |/ / / | |/| | |
* | | | | Merge pull request #1358 from DarkLordZach/temp-storagebunnei2018-09-201-4/+7
|\ \ \ \ \
| * | | | | savedata_factory: Add TemporaryStorage SaveDataTypeZach Hilman2018-09-191-4/+7
| | |_|/ / | |/| | |
* | | | | Merge pull request #1363 from lioncash/controlbunnei2018-09-202-14/+17
|\ \ \ \ \
| * | | | | control_metadata: Remove unnecessary else within GetLanguageEntry()Lioncash2018-09-201-8/+8
| * | | | | control_metadata: Move language name array definition to the cpp fileLioncash2018-09-202-6/+9
| | |/ / / | |/| | |
* | | | | Merge pull request #1361 from lioncash/naxbunnei2018-09-204-19/+26
|\ \ \ \ \
| * | | | | xts_archive: Remove unused variables from CalculateHMAC256()Lioncash2018-09-191-3/+0
| * | | | | xts_archive: Make AsNCA() return a std::unique_ptr instead of a std::shared_ptrLioncash2018-09-192-3/+3
| * | | | | nax: Avoid re-parsing NAX data with GetFileType()Lioncash2018-09-192-13/+19
| * | | | | nax: Avoid unnecessary calls to AsNCA() in IdentifyType()Lioncash2018-09-191-4/+8
| * | | | | xts_archive: Ensure NAX's type member is always initializedLioncash2018-09-191-1/+1
| * | | | | xts_archive: Amend initializer order of NAX's constructorLioncash2018-09-191-2/+2
| |/ / / /
* | | | | Merge pull request #1366 from ogniK5377/splat-fixbunnei2018-09-201-3/+99
|\ \ \ \ \ | |/ / / / |/| | | |
| * | | | Removed unneeded event clearDavid Marcec2018-09-201-1/+0
| * | | | Implemented NTC & IEnsureNetworkClockAvailabilityServiceDavid Marcec2018-09-201-3/+100
|/ / / /
* | | | Reworked incorrect nifm stubs (#1355)David2018-09-191-3/+10
* | | | Merge pull request #1356 from degasus/hotfixbunnei2018-09-191-6/+7
|\ \ \ \
| * | | | gl_rasterizer: Fix StartAddress handling with indexed draw calls.Markus Wick2018-09-191-6/+7
| | |/ / | |/| |
* | | | Merge pull request #1359 from ogniK5377/nesbunnei2018-09-193-7/+12
|\ \ \ \
| * | | | Fixed GetAccountId stub, Added error code for OpenDirectory and added ActivateNpadWithRevisionDavid Marcec2018-09-193-7/+12
| |/ / /
* | | | Merge pull request #1353 from ogniK5377/remove-MakeBuilderbunnei2018-09-197-34/+26
|\ \ \ \ | |/ / / |/| | |
| * | | Removed MakeBuilder as it's not needed anymoreDavid Marcec2018-09-191-7/+0
| * | | Removed the use of rp.MakeBuilderDavid Marcec2018-09-196-27/+26
|/ / /
* | | Merge pull request #1348 from ogniK5377/GetImageSizebunnei2018-09-191-1/+9
|\ \ \
| * | | Implemented GetImageSizeDavid Marcec2018-09-181-1/+9
* | | | Merge pull request #1319 from lioncash/audiobunnei2018-09-195-43/+59
|\ \ \ \
| * | | | time_stretch: Remove unused <array> includeLioncash2018-09-171-1/+0
| * | | | stream: Replace includes with forward declarations where applicableLioncash2018-09-172-3/+7
| * | | | audio_renderer: Replace includes with forward declarations where applicableLioncash2018-09-172-39/+52
* | | | | Merge pull request #1351 from ogniK5377/GetDefaultDisplayResolutionbunnei2018-09-192-1/+18
|\ \ \ \ \
| * | | | | Implemented GetDefaultDisplayResolutionDavid Marcec2018-09-182-1/+18
| | |/ / / | |/| | |
* | | | | Merge pull request #1341 from lioncash/dependencybunnei2018-09-192-2/+6
|\ \ \ \ \
| * | | | | core/core_cpu: Replace exclusive monitor include with forward declarationLioncash2018-09-182-2/+6
| | |/ / / | |/| | |
* | | | | Merge pull request #1346 from lioncash/svcbunnei2018-09-191-37/+36
|\ \ \ \ \
| * | | | | svc_wrap: Convert the PARAM macro into a functionLioncash2018-09-181-37/+36
| |/ / / /
* | | | | Merge pull request #1350 from ogniK5377/Six-Axis-Stubbunnei2018-09-191-4/+28
|\ \ \ \ \
| * | | | | Added ActivateGestureDavid Marcec2018-09-181-1/+7
| * | | | | Added StopSixAxisSensorDavid Marcec2018-09-181-1/+7
| * | | | | Stubbed ActivateConsoleSixAxisSensor & StartConsoleSixAxisSensorDavid Marcec2018-09-181-2/+14
| | |/ / / | |/| | |
* | | | | Merge pull request #1342 from lioncash/truncbunnei2018-09-191-4/+4
|\ \ \ \ \
| * | | | | gl_shader_decompiler: Avoid truncation warnings within LD_A and ST_A codeLioncash2018-09-181-4/+4
| | |/ / / | |/| | |
* | | | | Merge pull request #1279 from FernandoS27/csetpbunnei2018-09-192-21/+133
|\ \ \ \ \
| * | | | | Implemented Internal FlagsFernandoS272018-09-181-13/+35
| * | | | | Implemented I2I.CC on the NEU control code, used by SMOFernandoS272018-09-172-14/+18
| * | | | | Implemented CSETPFernandoS272018-09-172-14/+49
| * | | | | Implemented Control CodesFernandoS272018-09-172-0/+51
| |/ / / /
* | | | | Merge pull request #1299 from FernandoS27/texture-sanatizebunnei2018-09-192-3/+192
|\ \ \ \ \
| * | | | | Added asserts for texture misc modes to texture instructionsFernandoS272018-09-171-2/+45
| * | | | | Added texture misc modes to texture instructionsFernandoS272018-09-171-1/+147
| |/ / / /
* | | | | Invalid default value of username in yuzu_cmd (#1334)Philippe Babin2018-09-193-3/+8
* | | | | Merge pull request #1343 from lioncash/mutexbunnei2018-09-182-2/+10
|\ \ \ \ \
| * | | | | kernel/mutex: Replace ResultCode construction for invalid addresses with the named variantLioncash2018-09-181-2/+2
| * | | | | kernel/svc: Handle error cases for svcArbitrateLock() and svcArbitrateUnlock()Lioncash2018-09-181-0/+8
| |/ / / /
* | | | | Merge pull request #1344 from lioncash/armbunnei2018-09-187-99/+86
|\ \ \ \ \
| * | | | | arm_interface: Remove ARM11-isms from the CPU interfaceLioncash2018-09-187-99/+86
| |/ / / /
* | | | | Merge pull request #1345 from lioncash/writebunnei2018-09-181-2/+2
|\ \ \ \ \ | |_|/ / / |/| | | |
| * | | | arm_dynarmic: Correct ExclusiveWrite128()'s operationLioncash2018-09-181-2/+2
| |/ / /
* | | | Merge pull request #1290 from FernandoS27/shader-headerbunnei2018-09-183-24/+111
|\ \ \ \ | |/ / / |/| | |
| * | | Replace old FragmentHeader for the new HeaderFernandoS272018-09-112-31/+18
| * | | Implemented (Partialy) Shader HeaderFernandoS272018-09-113-2/+102
* | | | Merge pull request #1311 from FernandoS27/fast-swizzlebunnei2018-09-171-2/+49
|\ \ \ \
| * | | | Optimized Texture SwizzlingFernandoS272018-09-141-2/+49
* | | | | Merge pull request #1312 from lioncash/fwdbunnei2018-09-173-7/+9
|\ \ \ \ \
| * | | | | service/vi: Replace includes with forward declarations where applicableLioncash2018-09-133-7/+9
* | | | | | Merge pull request #1313 from lioncash/errorbunnei2018-09-171-1/+2
|\ \ \ \ \ \
| * | | | | | kernel/errors: Amend error code for ERR_NOT_FOUNDLioncash2018-09-131-1/+2
| |/ / / / /
* | | | | | Merge pull request #1314 from lioncash/castbunnei2018-09-171-2/+2
|\ \ \ \ \ \
| * | | | | | audio_core/time_stretch: Silence truncation warnings in Process()Lioncash2018-09-141-2/+2
| |/ / / / /
* | | | | | Merge pull request #1316 from lioncash/shadowbunnei2018-09-171-2/+0
|\ \ \ \ \ \
| * | | | | | gl_shader_decompiler: Get rid of variable shadowing within LEA instructionsLioncash2018-09-141-2/+0
| |/ / / / /
* | | | | | Merge pull request #1318 from lioncash/errors-smbunnei2018-09-172-8/+6
|\ \ \ \ \ \
| * | | | | | services/sm: Amend error code constantsLioncash2018-09-142-8/+6
| |/ / / / /
* | | | | | Merge pull request #1321 from lioncash/audio-shadowbunnei2018-09-171-4/+4
|\ \ \ \ \ \
| * | | | | | cubeb_sink: Get rid of variable shadowing within CubebSink's constructorLioncash2018-09-141-4/+4
| |/ / / / /
* | | | | | Merge pull request #1315 from lioncash/sizebunnei2018-09-172-19/+74
|\ \ \ \ \ \
| * | | | | | kernel/svc: Sanitize creation of shared memory via svcCreateSharedMemory()Lioncash2018-09-141-2/+18
| * | | | | | kernel/svc: Sanitize addresses, permissions, and sizes within svcMapSharedMemory() and svcUnmapSharedMemory()Lioncash2018-09-141-17/+25
| * | | | | | kernel/svc: Sanitize addresses and sizes within svcMapMemory() and svcUnmapMemory()Lioncash2018-09-141-0/+23
| * | | | | | kernel/svc: Sanitize heap sizes within svcSetHeapSize()Lioncash2018-09-142-0/+8
| |/ / / / /
* | | | | | Merge pull request #1320 from lioncash/namebunnei2018-09-171-1/+1
|\ \ \ \ \ \
| * | | | | | cubeb_sink: Correct context name in ListCubebSinkDevices()Lioncash2018-09-141-1/+1
| |/ / / / /
* | | | | | Merge pull request #1328 from FearlessTobi/port-4192bunnei2018-09-171-1/+1
|\ \ \ \ \ \
| * | | | | | Port # #4192 from Citra: "svc: change unknown to thread in CreateThread"Valentin Vanelslande2018-09-151-1/+1
* | | | | | | Merge pull request #1327 from FearlessTobi/port-4171bunnei2018-09-172-16/+0
|\ \ \ \ \ \ \
| * | | | | | | Tests: Remove glad test OS X work-aroundYuri Kunde Schlesner2018-09-152-16/+0
| |/ / / / / /
* | | | | | | Merge pull request #1326 from FearlessTobi/port-4182bunnei2018-09-17146-751/+780
|\ \ \ \ \ \ \
| * | | | | | | Port #4182 from Citra: "Prefix all size_t with std::"fearlessTobi2018-09-15146-751/+780
| |/ / / / / /
* | | | | | | Merge pull request #1329 from raven02/bgr5a1ubunnei2018-09-172-0/+4
|\ \ \ \ \ \ \
| * | | | | | | Implement RenderTargetFormat::BGR5A1_UNORM (Pokken Tournament DX)raven022018-09-152-0/+4
| |/ / / / / /
* | | | | | | Merge pull request #1335 from lioncash/copybunnei2018-09-171-5/+5
|\ \ \ \ \ \ \
| * | | | | | | game_list_p: Amend typo in GameListItemCompat's constructor parameterLioncash2018-09-171-4/+4
| * | | | | | | game_list_p: Take map iterator contents by const referenceLioncash2018-09-171-1/+1
| | |/ / / / / | |/| | | | |
* | | | | | | Merge pull request #1336 from lioncash/antialiasbunnei2018-09-171-1/+2
|\ \ \ \ \ \ \
| * | | | | | | yuzu/util: Antialias game list compatibility pixmapsLioncash2018-09-171-1/+2
| |/ / / / / /
* | | | | | | Merge pull request #1331 from raven02/astc_8_8bunnei2018-09-173-6/+20
|\ \ \ \ \ \ \ | |_|_|_|_|/ / |/| | | | | |
| * | | | | | Implement ASTC_2D_8X8 (Bayonetta 2)raven022018-09-163-6/+20
|/ / / / / /
* | | | | | Merge pull request #1273 from Subv/ld_sizesbunnei2018-09-152-7/+58
|\ \ \ \ \ \
| * | | | | | Shaders: Implemented multiple-word loads and stores to and from attribute memory.Subv2018-09-152-7/+58
| | |/ / / / | |/| | | |
* | | | | | Merge pull request #1271 from Subv/kepler_enginebunnei2018-09-156-0/+146
|\ \ \ \ \ \ | |/ / / / / |/| | | | |
| * | | | | GPU: Basic implementation of the Kepler Inline Memory engine (p2mf).Subv2018-09-126-0/+146
* | | | | | Merge pull request #1310 from lioncash/kernel-nsbunnei2018-09-145-38/+39
|\ \ \ \ \ \
| * | | | | | kernel/thread: Include thread-related enums within the kernel namespaceLioncash2018-09-135-38/+39
| | |/ / / / | |/| | | |
* | | | | | Merge pull request #1309 from lioncash/nestedbunnei2018-09-143-12/+6
|\ \ \ \ \ \
| * | | | | | service: Use nested namespace specifiers where applicableLioncash2018-09-133-12/+6
| |/ / / / /
* | | | | | Merge pull request #1307 from lioncash/plbunnei2018-09-141-2/+4
|\ \ \ \ \ \ | |/ / / / / |/| | | | |
| * | | | | services/pl_u: Add missing Korean font to the fallback case for shared fontsLioncash2018-09-131-2/+4
* | | | | | Merge pull request #1308 from valentinvanelslande/ipcJames Rowe2018-09-131-1/+1
|\ \ \ \ \ \
| * | | | | | ipc: minor fixValentin Vanelslande2018-09-131-1/+1
|/ / / / / /
* / / / / / Use ARB_multi_bind for uniform buffers (#1287)ReinUsesLisp2018-09-134-3/+27
|/ / / / /
* | | | | Merge pull request #1298 from lioncash/viewbunnei2018-09-132-2/+4
|\ \ \ \ \
| * | | | | audio_core/sink_details: Change std::string parameter into std::string_viewLioncash2018-09-122-2/+4
| | |_|/ / | |/| | |
* | | | | Merge pull request #1302 from lioncash/configbunnei2018-09-132-36/+74
|\ \ \ \ \
| * | | | | yuzu/configure_gamelist: Make combo box strings translatableLioncash2018-09-122-21/+47
| * | | | | yuzu/configure_gamelist: Use std::array instead of std::vector for translatable stringsLioncash2018-09-121-6/+9
| * | | | | yuzu/configure_gamelist: Move combo box initializtion to their own functionsLioncash2018-09-122-23/+32
* | | | | | Merge pull request #1163 from FearlessTobi/add-audio-stretchingbunnei2018-09-1321-49/+462
|\ \ \ \ \ \
| * | | | | | audio_core: Flush stream when not playing anythingMerryMage2018-09-126-0/+23
| * | | | | | cubeb_sink: Downsample arbitrary number of channelsMerryMage2018-09-091-10/+9
| * | | | | | cubeb_sink: Perform audio stretchingMerryMage2018-09-083-24/+26
| * | | | | | audio_core: Add audio stretcherMerryMage2018-09-083-0/+101
| * | | | | | cubeb_sink: Hold last available value instead of writing zerosMerryMage2018-09-081-5/+15
| * | | | | | cubeb_sink: Use RingBufferMerryMage2018-09-081-40/+26
| * | | | | | common: Implement a ring bufferMerryMage2018-09-084-0/+243
| * | | | | | Add audio stretching supportfearlessTobi2018-09-0815-0/+49
* | | | | | | Merge pull request #1306 from bunnei/fix-b5g6r5ubunnei2018-09-131-1/+1
|\ \ \ \ \ \ \ | |_|_|_|_|/ / |/| | | | | |
| * | | | | | gl_rasterizer_cache: B5G6R5U should use GL_RGB8 as an internal format.bunnei2018-09-131-1/+1
|/ / / / / /
* | | | | | Merge pull request #1297 from lioncash/plbunnei2018-09-122-66/+88
|\ \ \ \ \ \
| * | | | | | pl_u: Eliminate mutable file-scope stateLioncash2018-09-122-66/+88
| | |_|/ / / | |/| | | |
* | | | | | Merge pull request #1263 from FernandoS27/tex-modebunnei2018-09-122-1/+43
|\ \ \ \ \ \ | |_|_|_|/ / |/| | | | |
| * | | | | Implemented Texture Processing ModesFernandoS272018-09-122-1/+43
| |/ / / /
* | | | | Merge pull request #1303 from lioncash/errorbunnei2018-09-123-9/+11
|\ \ \ \ \
| * | | | | svc: Return ERR_INVALID_PROCESSOR_ID in CreateThread() if an invalid processor ID is givenLioncash2018-09-121-2/+2
| * | | | | kernel/errors: Correct error codes for invalid thread priority and invalid processor IDLioncash2018-09-123-7/+9
* | | | | | Merge pull request #1304 from lioncash/strbunnei2018-09-122-3/+7
|\ \ \ \ \ \
| * | | | | | svc: Do nothing if svcOutputDebugString() is given a length of zeroLioncash2018-09-121-0/+4
| * | | | | | svc: Correct parameter type for OutputDebugString()Lioncash2018-09-122-3/+3
| |/ / / / /
* | | | | | Merge pull request #1305 from FreddyFunk/cmake_yuzu_as_vs_startup_projectbunnei2018-09-121-0/+3
|\ \ \ \ \ \ | |/ / / / / |/| | | | |
| * | | | | Update CMakeLists.txtFrederic Laing2018-09-121-0/+3
|/ / / / /
* | | | | Merge pull request #1296 from lioncash/prepobunnei2018-09-122-39/+40
|\ \ \ \ \
| * | | | | service/prepo: Move class into the cpp fileLioncash2018-09-122-39/+40
| |/ / / /
* | | | | Merge pull request #1301 from lioncash/qtbunnei2018-09-121-4/+4
|\ \ \ \ \ | |_|_|/ / |/| | | |
| * | | | game_list: Resolve variable shadowing within LoadCompatibilityList()Lioncash2018-09-121-3/+3
| * | | | game_list: Use QJsonValueRef() within LoadCompatibilityList()Lioncash2018-09-121-2/+2
| |/ / /
* | | | Merge pull request #1300 from lioncash/audiobunnei2018-09-127-17/+34
|\ \ \ \
| * | | | service/audio: Replace includes with forward declarations where applicableLioncash2018-09-127-17/+34
| |/ / /
* | | | Merge pull request #1278 from tech4me/bg-color-fixbunnei2018-09-126-0/+46
|\ \ \ \
| * | | | Port Citra #4047 & #4052: add change background color supporttech4me2018-09-096-0/+46
* | | | | Merge pull request #1295 from bunnei/accurate-copiesbunnei2018-09-122-18/+12
|\ \ \ \ \
| * | | | | gl_rasterizer_cache: Always blit on recreate, regardless of format.bunnei2018-09-121-6/+10
| * | | | | gl_shader_cache: Remove cache_width/cache_height.bunnei2018-09-122-12/+2
| | |/ / / | |/| | |
* | | | | Merge pull request #1294 from degasus/optimizationsbunnei2018-09-123-11/+12
|\ \ \ \ \
| * | | | | gl_rasterizer: Use ARB_texture_storage.Markus Wick2018-09-113-11/+12
| |/ / / /
* | | | | Merge pull request #1289 from FernandoS27/lea_psetbunnei2018-09-122-0/+155
|\ \ \ \ \ | |/ / / / |/| | | |
| * | | | Implemented LEA and PSETFernandoS272018-09-111-0/+91
| * | | | Implemented encodings for LEA and PSETFernandoS272018-09-111-0/+64
|/ / / /
* | | | Merge pull request #1291 from lioncash/defaultbunnei2018-09-11148-45/+291
|\ \ \ \
| * | | | hle/service: Default constructors and destructors in the cpp file where applicableLioncash2018-09-11148-45/+291
* | | | | Merge pull request #1292 from ogniK5377/renderdoc-fixbunnei2018-09-112-2/+9
|\ \ \ \ \
| * | | | | Fixed renderdoc input/output textures not working due to render targetsDavid Marcec2018-09-112-2/+9
| |/ / / /
* | | | | Merge pull request #1293 from lioncash/fontbunnei2018-09-1120-111667/+111727
|\ \ \ \ \ | |/ / / / |/| | | |
| * | | | externals: Place font data within cpp filesLioncash2018-09-1120-111667/+111727
|/ / / /
* | | | Use open-source shared fonts if no dumped file is available (#1269)Tobias2018-09-1111-2/+111695
* | | | Port #4141 from citra: Joystick hotplug support (#1275)Tobias2018-09-117-101/+339
* | | | Merge pull request #1286 from bunnei/multi-clearbunnei2018-09-112-50/+66
|\ \ \ \
| * | | | gl_rasterizer: Implement clear for non-zero render targets.bunnei2018-09-102-50/+66
* | | | | Merge pull request #1285 from bunnei/depth-fixbunnei2018-09-111-6/+22
|\ \ \ \ \
| * | | | | gl_rasterizer_cache: Only use depth for applicable texture formats.bunnei2018-09-101-6/+22
| |/ / / /
* | | | | Merge pull request #1284 from bunnei/bgra8_srgbbunnei2018-09-113-0/+4
|\ \ \ \ \
| * | | | | gl_rasterizer_cache: Implement RenderTargetFormat::BGRA8_SRGB.bunnei2018-09-103-0/+4
| |/ / / /
* | | | | Merge pull request #1288 from MysticExile/remove-multicoreJames Rowe2018-09-112-10/+0
|\ \ \ \ \
| * | | | | Remove multicore configure_general.uiMysticExile2018-09-101-7/+0
| * | | | | remove multicore in configure_general.cppMysticExile2018-09-101-3/+0
| |/ / / /
* | | | | Merge pull request #1264 from degasus/optimizationsbunnei2018-09-119-124/+121
|\ \ \ \ \ | |/ / / / |/| | | |
| * | | | video_core: Refactor command_processor.Markus Wick2018-09-102-44/+42
| * | | | video_core: Move command buffer loop.Markus Wick2018-09-105-77/+84
| * | | | rasterizer: Drop unused handler.Markus Wick2018-09-104-8/+0
|/ / / /
* | | | Merge pull request #1281 from bunnei/multi-rtbunnei2018-09-105-132/+95
|\ \ \ \
| * | | | gl_rasterizer: Implement multiple color attachments.bunnei2018-09-105-132/+95
|/ / / /
* | | | Merge pull request #1258 from tgsm/fix-sdl-loggingbunnei2018-09-101-2/+3
|\ \ \ \
| * | | | yuzu-cmd: fix SDL loggingtgsm2018-09-081-2/+3
* | | | | Merge pull request #1282 from lioncash/compatbunnei2018-09-1010-33/+56
|\ \ \ \ \
| * | | | | game_list: Make CompatibilityList parameter of NavigateToGamedbEntryRequested() a const referenceLioncash2018-09-103-3/+5
| * | | | | yuzu: Move compatibility list specifics to their own source filesLioncash2018-09-1010-33/+54
* | | | | | Merge pull request #1276 from FearlessTobi/fix-stupid-stubbunnei2018-09-102-4/+6
|\ \ \ \ \ \
| * | | | | | hid: Implement ReloadInputDevicesfearlessTobi2018-09-092-4/+6
| | |_|/ / / | |/| | | |
* | | | | | Merge pull request #1283 from lioncash/unusedbunnei2018-09-101-2/+0
|\ \ \ \ \ \
| * | | | | | service: Remove unused g_kernel_named_ports variableLioncash2018-09-101-2/+0
* | | | | | | Merge pull request #1268 from FernandoS27/tmmlbunnei2018-09-102-5/+67
|\ \ \ \ \ \ \ | |/ / / / / / |/| | | | | |
| * | | | | | Implemented TMMLFernandoS272018-09-102-5/+67
* | | | | | | Merge pull request #1272 from Subv/dma_2dbunnei2018-09-101-2/+10
|\ \ \ \ \ \ \
| * | | | | | | GPU/DMA: Partially implemented the 'enable_2d' bit in the DMA engine.Subv2018-09-081-2/+10
| | |_|_|_|/ / | |/| | | | |
* | | | | | | Merge pull request #1280 from zero334/improvementsbunnei2018-09-105-89/+101
|\ \ \ \ \ \ \ | |_|/ / / / / |/| | | | | |
| * | | | | | video_core: fixed arithmetic overflow warnings & improved code stylePatrick Elsässer2018-09-095-89/+101
| | |_|/ / / | |/| | | |
* | | | | | Merge pull request #1261 from FernandoS27/txqbunnei2018-09-102-2/+37
|\ \ \ \ \ \ | |/ / / / / |/| | | | |
| * | | | | Implemented TXQ dimension query type, used by SMO.FernandoS272018-09-092-1/+36
| * | | | | Change name of TEXQ to TXQ, in order to match NVIDIA's namingFernandoS272018-09-091-2/+2
| | |/ / / | |/| | |
* | | | | Merge pull request #1277 from jroweboy/update-xbyakMat M2018-09-091-0/+0
|\ \ \ \ \ | |/ / / / |/| | | |
| * | | | Externals: Update xbyakJames Rowe2018-09-091-0/+0
|/ / / /
* | | | Merge pull request #1256 from bunnei/tex-target-supportbunnei2018-09-0811-229/+422
|\ \ \ \
| * | | | gl_rasterizer_cache: Improve accuracy of RecreateSurface for non-2D textures.bunnei2018-09-082-27/+45
| * | | | maxwell_3d: Remove assert that no longer applies.bunnei2018-09-081-4/+0
| * | | | gl_rasterizer_cache: Partially implement several non-2D texture types.bunnei2018-09-081-30/+111
| * | | | gl_shader_decompiler: Partially implement several non-2D texture types (Subv).bunnei2018-09-082-32/+143
| * | | | gl_rasterizer: Implement texture wrap mode p.bunnei2018-09-082-2/+8
| * | | | gl_rasterizer_cache: Track texture depth.bunnei2018-09-083-4/+15
| * | | | gl_rasterizer_cache: Remove impl. of FlushGLBuffer.bunnei2018-09-081-34/+1
| * | | | gl_rasterizer_cache: Keep track of texture type per surface.bunnei2018-09-083-32/+84
| * | | | gl_rasterizer_cache: Remove unused DownloadGLTexture.bunnei2018-09-082-51/+0
| * | | | gl_state: Keep track of texture target.bunnei2018-09-085-26/+28
* | | | | Merge pull request #1265 from zhaowenlan1779/patch-1bunnei2018-09-081-2/+2
|\ \ \ \ \
| * | | | | yuzu: fix title bar displayPengfei Zhu2018-09-081-2/+2
| | |/ / / | |/| | |
* | | | | Merge pull request #1267 from MerryMage/audio_outbunnei2018-09-082-7/+7
|\ \ \ \ \ | |/ / / / |/| | | |
| * | | | audio_renderer: Rename AudioOut instance to audio_outMerryMage2018-09-082-7/+7
|/ / / /
* | | | Merge pull request #1246 from degasus/instanced_renderingbunnei2018-09-083-21/+29
|\ \ \ \
| * | | | gl_rasterizer: Use baseInstance instead of moving the buffer points.bunnei2018-09-083-21/+29
| | |/ / | |/| |
* | | | Merge pull request #1259 from lioncash/relocatebunnei2018-09-085-286/+324
|\ \ \ \ | |/ / / |/| | |
| * | | yuzu: Move GameListWorker to its own source filesLioncash2018-09-075-286/+324
* | | | video_core: Arithmetic overflow warning fix for gl_rasterizer (#1262)Patrick Elsässer2018-09-081-12/+14
| |/ / |/| |
* | | Merge pull request #1257 from lioncash/processbunnei2018-09-084-5/+34
|\ \ \
| * | | core: Migrate current_process pointer to the kernelLioncash2018-09-074-5/+34
* | | | Merge pull request #1260 from MerryMage/dynarmicbunnei2018-09-081-0/+0
|\ \ \ \ | |_|/ / |/| | |
| * | | externals: Update dynarmic to 9594465MerryMage2018-09-071-0/+0
|/ / /
* | | Merge pull request #1201 from CaptV0rt3x/titlebarbunnei2018-09-076-10/+30
|\ \ \ | |/ / |/| |
| * | For SDL FrontendCaptV0rt3x2018-09-071-2/+2
| * | Better Title Bar DisplayCaptV0rt3x2018-09-075-8/+28
|/ /
* | Merge pull request #1250 from lioncash/file-sysbunnei2018-09-074-4/+16
|\ \
| * | file_sys/nca_patch: Amend constructor initializer list orderLioncash2018-09-061-2/+2
| * | file_sys/nca_patch: Remove unnecessary includesLioncash2018-09-062-2/+9
| * | file_sys/patch_manager: Add missing includesLioncash2018-09-062-0/+5
* | | Merge pull request #1249 from FearlessTobi/disable-vsyncbunnei2018-09-072-0/+2
|\ \ \
| * | | frontend: Set swap interval to 0fearlessTobi2018-09-062-0/+2
* | | | Merge pull request #1251 from lioncash/core-incbunnei2018-09-075-2/+5
|\ \ \ \
| * | | | core/core: Remove unnecessary sm/controller includeLioncash2018-09-065-2/+5
| | |/ / | |/| |
* | | | Merge pull request #1252 from lioncash/headerbunnei2018-09-071-0/+1
|\ \ \ \
| * | | | video_core/CMakeLists: Add missing gl_buffer_cache.hLioncash2018-09-061-0/+1
| |/ / /
* | | | Merge pull request #1253 from lioncash/explicitbunnei2018-09-072-8/+10
|\ \ \ \
| * | | | gl_buffer_cache: Default initialize member variablesLioncash2018-09-061-3/+3
| * | | | gl_buffer_cache: Make GetHandle() a const member functionLioncash2018-09-062-2/+2
| * | | | gl_buffer_cache: Remove unnecessary includesLioncash2018-09-062-2/+4
| * | | | gl_buffer_cache: Make constructor explicitLioncash2018-09-061-1/+1
| |/ / /
* | | | Merge pull request #1255 from bunnei/minor-optbunnei2018-09-071-4/+2
|\ \ \ \
| * | | | gl_rasterizer: Call state.Apply only once on SetupShaders.bunnei2018-09-061-4/+2
| |/ / /
* | | | Merge pull request #1254 from bunnei/ipa-saturatebunnei2018-09-071-1/+5
|\ \ \ \ | |/ / / |/| | |
| * | | gl_shader_decompiler: Implement saturate mode for IPA.bunnei2018-09-061-1/+5
|/ / /
* | | Merge pull request #1248 from degasus/shader_fixbunnei2018-09-061-0/+1
|\ \ \ | |/ / |/| |
| * | gl_shader_gen: Initialize position.Markus Wick2018-09-061-0/+1
|/ /
* | Merge pull request #1243 from degasus/VAO_cachebunnei2018-09-063-53/+60
|\ \
| * | gl_rasterizer: Implement a VAO cache.Markus Wick2018-09-053-53/+60
* | | Merge pull request #1244 from FernandoS27/ipabunnei2018-09-062-47/+98
|\ \ \
| * | | Implemented IPA ProperlyFernandoS272018-09-062-47/+98
* | | | Merge pull request #1242 from lioncash/file-sysbunnei2018-09-062-8/+17
|\ \ \ \
| * | | | file_sys/submission_package: Correct constructor initialization list orderLioncash2018-09-051-2/+2
| * | | | file_sys/submission_package: Replace includes with forward declarations where applicableLioncash2018-09-052-6/+15
| | |/ / | |/| |
* | | | Merge pull request #1179 from DarkLordZach/bktrbunnei2018-09-0632-101/+1132
|\ \ \ \
| * | | | bktr: Fix bucket overlap errorZach Hilman2018-09-048-9/+11
| * | | | drd: Parse title ID from program metadataZach Hilman2018-09-042-4/+29
| * | | | patch_manager: Centralize Control-type NCA parsingZach Hilman2018-09-046-80/+89
| * | | | nsp: Fix error masking issue with XCI filesZach Hilman2018-09-043-6/+13
| * | | | game_list: Fix version display on non-NAND titlesZach Hilman2018-09-044-30/+52
| * | | | bktr: Add logging on successful patchZach Hilman2018-09-043-7/+24
| * | | | game_list: Use friendly game versionsZach Hilman2018-09-041-13/+32
| * | | | bktr: Implement IVFC offset shiftingZach Hilman2018-09-048-8/+36
| * | | | bktr: Fix missing includes and optimize styleZach Hilman2018-09-0412-103/+109
| * | | | main: Make game updates installableZach Hilman2018-09-041-1/+5
| * | | | game_list: Display patch names and versions on listZach Hilman2018-09-042-0/+27
| * | | | loader: Add BKTR-specific error messages and codesZach Hilman2018-09-043-7/+28
| * | | | loader: Ignore patches on NRO and DRDZach Hilman2018-09-044-0/+11
| * | | | patch_manager: Add usages of patches to ExeFSZach Hilman2018-09-045-9/+41
| * | | | file_sys: Add class to manage game patchesZach Hilman2018-09-042-0/+132
| * | | | file_sys: Add BKTR patching mechanismZach Hilman2018-09-042-0/+352
| * | | | content_archive: Add BKTR header parsing to NCAZach Hilman2018-09-042-19/+160
| * | | | registration: Add RegisteredCacheUnionZach Hilman2018-09-044-0/+164
| * | | | game_list: Use RegisteredCacheUnion for installedZach Hilman2018-09-043-5/+3
| * | | | aes_util: Fix error involving reads of less than 0x10Zach Hilman2018-09-041-0/+14
* | | | | Merge pull request #1245 from degasus/optimizationsbunnei2018-09-051-1/+1
|\ \ \ \ \ | |_|/ / / |/| | | |
| * | | | gl_rasterizer: Skip TODO log.Markus Wick2018-09-051-1/+1
|/ / / /
* | | | Merge pull request #1217 from degasus/vbo_cache2bunnei2018-09-055-86/+182
|\ \ \ \ | |_|/ / |/| | |
| * | | renderer_opengl: Implement a buffer cache.Markus Wick2018-09-055-86/+182
|/ / /
* | | Merge pull request #1240 from degasus/optimizationsbunnei2018-09-054-15/+23
|\ \ \ | |/ / |/| |
| * | gl_shader_cache: Use an u32 for the binding point cache.Markus Wick2018-09-044-15/+23
* | | Merge pull request #1178 from DarkLordZach/nspbunnei2018-09-0419-41/+650
|\ \ \ | |/ / |/| |
| * | main: Only show DRD deprecation warning onceZach Hilman2018-09-047-6/+19
| * | control_metadata: Use alternate language names if AmericanEnglish isn't availableZach Hilman2018-09-042-4/+17
| * | card_image: Add program title ID getterZach Hilman2018-09-042-0/+6
| * | qt: Add deprecation warnings for DRD formatZach Hilman2018-09-041-0/+10
| * | registration: Fix NSP installation errorsZach Hilman2018-09-041-1/+1
| * | nsp: Comply with style and performance guidelinesZach Hilman2018-09-047-29/+48
| * | qt: Add UI support for NSP filesZach Hilman2018-09-043-2/+7
| * | registration: Add support for installing NSP filesZach Hilman2018-09-043-16/+34
| * | loader: Add AppLoader for NSP filesZach Hilman2018-09-042-0/+182
| * | card_image: Parse XCI secure partition with NSPZach Hilman2018-09-044-11/+38
| * | file_sys: Add Nintendo Submission Package (NSP)Zach Hilman2018-09-042-0/+296
| * | drd: Load title ID from program metadataZach Hilman2018-09-041-3/+1
| * | loader: Add NSP file type and NSP-specific errorsZach Hilman2018-09-042-2/+14
| * | key_manager: Avoid autogeneration if key existsZach Hilman2018-09-041-3/+13
|/ /
* | Merge pull request #1238 from lioncash/explicitbunnei2018-09-043-8/+8
|\ \
| * | common/logging: Amend documentation commentsLioncash2018-09-042-6/+6
| * | common/logging/filter: Replace C-style case with C++ static_castLioncash2018-09-041-1/+1
| * | common/logging/filter: Make constructor explicitLioncash2018-09-041-1/+1
* | | Merge pull request #1237 from degasus/optimizationsbunnei2018-09-044-7/+7
|\ \ \
| * | | core: Use a raw pointer in GetGPUDebugContext.Markus Wick2018-09-042-3/+3
| * | | command_processor: Use std::array for bound_engines.Markus Wick2018-09-042-4/+4
| |/ /
* | | Merge pull request #1223 from DarkLordZach/custom-nand-sd-dirsbunnei2018-09-046-0/+79
|\ \ \
| * | | qt: Add message about not moving contents on dir changeZach Hilman2018-09-042-6/+23
| * | | qt: Add UI options to change NAND/SD dirsZach Hilman2018-09-043-0/+36
| * | | settings: Save and load NAND/SD dirs from configZach Hilman2018-09-043-0/+26
* | | | Merge pull request #1232 from lioncash/copybunnei2018-09-041-1/+1
|\ \ \ \
| * | | | gl_shader_decompiler: Use used_shaders member variable directly within GenerateDeclarations()Lioncash2018-09-021-1/+1
* | | | | Merge pull request #1235 from lioncash/forward-declbunnei2018-09-0422-27/+64
|\ \ \ \ \
| * | | | | file_sys: Replace includes with forward declarations where applicableLioncash2018-09-0422-27/+64
| | |_|/ / | |/| | |
* | | | | Merge pull request #1236 from degasus/microprofilebunnei2018-09-044-5/+21
|\ \ \ \ \
| * | | | | Update microprofile scopes.Markus Wick2018-09-044-5/+21
| |/ / / /
* | | | | Merge pull request #1230 from lioncash/sslbunnei2018-09-042-37/+39
|\ \ \ \ \ | |/ / / / |/| | | |
| * | | | ssl: Move SSL class to cpp fileLioncash2018-09-022-37/+39
| | |_|/ | |/| |
* | | | Merge pull request #1231 from lioncash/globalbunnei2018-09-045-19/+51
|\ \ \ \
| * | | | service: Migrate global named port map to the KernelCore classLioncash2018-09-025-19/+51
| | |/ / | |/| |
* | | | Merge pull request #1229 from lioncash/forward-declbunnei2018-09-0413-15/+45
|\ \ \ \ | |_|_|/ |/| | |
| * | | vfs_real: Forward declare IOFileLioncash2018-09-0213-15/+45
| |/ /
* | | Merge pull request #1233 from lioncash/dynarmicMat M2018-09-031-0/+0
|\ \ \ | |/ / |/| |
| * | externals: Update dynarmic to 0435ac2Lioncash2018-09-031-0/+0
|/ /
* | Merge pull request #1213 from DarkLordZach/octopath-fsbunnei2018-09-023-4/+33
|\ \
| * | maxwell_3d: Use CoreTiming for query timestampZach Hilman2018-09-011-2/+3
| * | filesystem: Implement OpenReadOnlySaveDataFilesystemZach Hilman2018-09-012-1/+7
| * | filesystem: Add OpenFileSystemWithPatchZach Hilman2018-09-012-1/+23
| |/
* | Merge pull request #1215 from ogniK5377/texs-nodep-assertbunnei2018-09-022-0/+3
|\ \
| * | Added assert for TEXS nodepDavid Marcec2018-09-012-0/+3
| |/
* | Merge pull request #1219 from jroweboy/less-artifactsbunnei2018-09-021-4/+0
|\ \
| * | Build - Upload fewer artifactsJames Rowe2018-09-011-4/+0
| |/
* | Merge pull request #1220 from FearlessTobi/extensions-qolbunnei2018-09-022-8/+10
|\ \
| * | citra_qt: Display the unsupported GL extensions in the popupfearlessTobi2018-09-012-8/+10
| |/
* | Merge pull request #1214 from ogniK5377/ipa-assertbunnei2018-09-022-6/+13
|\ \
| * | Added better asserts to IPA, Renamed IPA modes to match mesaDavid Marcec2018-09-012-6/+13
| |/
* | Merge pull request #1216 from ogniK5377/ffma-assertbunnei2018-09-022-0/+9
|\ \
| * | Removed saturate assertDavid Marcec2018-09-012-2/+0
| * | Changed tab5980_0 default from 0 -> 1David Marcec2018-09-011-2/+2
| * | Added FFMA assertsDavid Marcec2018-09-012-0/+11
| |/
* | Merge pull request #1218 from ogniK5377/fmul-assertbunnei2018-09-022-0/+13
|\ \
| * | Removed saturate assertDavid Marcec2018-09-012-2/+0
| * | Added FMUL assertsDavid Marcec2018-09-012-0/+15
| |/
* | Merge pull request #1228 from lioncash/constructbunnei2018-09-021-2/+5
|\ \ | |/ |/|
| * filesystem: Move dir retrieval after path checking in DeleteFile()Lioncash2018-09-021-2/+5
|/
* Merge pull request #1196 from FearlessTobi/ccache-consistencybunnei2018-09-014-16/+6
|\
| * travis: use Citras ccachefearlessTobi2018-08-314-16/+6
* | Merge pull request #1212 from lioncash/forward-declbunnei2018-09-0129-66/+185
|\ \ | |/ |/|
| * core/core: Replace includes with forward declarations where applicableLioncash2018-08-3129-66/+185
|/
* Merge pull request #1205 from bunnei/improve-rasterizer-cache-2bunnei2018-08-3111-297/+227
|\
| * gl_rasterizer_cache: Use accurate framebuffer setting for accurate copies.bunnei2018-08-312-73/+54
| * gl_rasterizer_cache: Also use reserve cache for RecreateSurface.bunnei2018-08-312-24/+18
| * rasterizer_cache: Use boost::interval_map for a more accurate cache.bunnei2018-08-311-33/+45
| * gl_renderer: Cache textures, framebuffers, and shaders based on CPU address.bunnei2018-08-3111-138/+70
| * gl_rasterizer: Fix issues with the rasterizer cache.bunnei2018-08-314-46/+57
|/
* Implement BC6H_UF16 & BC6H_SF16 (#1092)greggameplayer2018-08-313-31/+55
* Merge pull request #1204 from lioncash/pimplbunnei2018-08-315-279/+387
|\
| * core: Make the main System class use the PImpl idiomLioncash2018-08-315-279/+387
* | Merge pull request #1207 from degasus/hotfixbunnei2018-08-311-1/+1
|\ \
| * | Report correct shader size.Markus Wick2018-08-311-1/+1
* | | Merge pull request #1208 from Hexagon12/pred-comp-14bunnei2018-08-312-3/+4
|\ \ \ | |/ / |/| |
| * | Added predicate comparison GreaterEqualWithNanHexagon122018-08-312-3/+4
|/ /
* | Merge pull request #1195 from FearlessTobi/port-gamelist-compatbunnei2018-08-3113-7/+196
|\ \
| * | Show game compatibility within yuzufearlessTobi2018-08-2913-7/+196
* | | gl_shader_decompiler: Implement POPC (#1203)Laku2018-08-312-0/+19
* | | Merge pull request #1200 from bunnei/improve-ipabunnei2018-08-302-1/+39
|\ \ \ | |_|/ |/| |
| * | gl_shader_decompiler: Improve IPA for Pass mode with Position attribute.bunnei2018-08-292-1/+39
* | | Merge pull request #1198 from lioncash/kernelbunnei2018-08-3054-442/+671
|\ \ \
| * | | kernel: Eliminate kernel global stateLioncash2018-08-2954-442/+671
| |/ /
* | | Merge pull request #1202 from FearlessTobi/port-3825bunnei2018-08-302-1/+13
|\ \ \
| * | | Remove Citra specific variablefearlessTobi2018-08-291-3/+0
| * | | travis: share env variables with Dockerliushuyu2018-08-292-1/+16
| |/ /
* | | Merge pull request #1172 from tech4me/impl_iadd3bunnei2018-08-302-1/+84
|\ \ \ | |/ / |/| |
| * | Shaders: Implemented IADD3tech4me2018-08-292-1/+84
|/ /
* | Merge pull request #1193 from lioncash/privbunnei2018-08-287-26/+40
|\ \
| * | gpu: Make memory_manager privateLioncash2018-08-287-26/+40
* | | Merge pull request #1192 from lioncash/unusedbunnei2018-08-281-2/+0
|\ \ \
| * | | gl_rasterizer: Remove unused variablesLioncash2018-08-281-2/+0
| |/ /
* | | Merge pull request #1191 from lioncash/noexceptbunnei2018-08-281-1/+1
|\ \ \
| * | | hle/result: Make ResultVal's move constructor as noexceptLioncash2018-08-281-1/+1
| |/ /
* | | Merge pull request #1194 from lioncash/allocbunnei2018-08-281-2/+1
|\ \ \ | |_|/ |/| |
| * | gl_shader_cache: Remove unused program_code vector in GetShaderAddress()Lioncash2018-08-281-2/+1
| |/
* | Merge pull request #1190 from FearlessTobi/im-so-retardedbunnei2018-08-282-1/+2
|\ \ | |/ |/|
| * Fix two stupid errors made in #1141fearlessTobi2018-08-282-1/+2
|/
* Merge pull request #1165 from bunnei/shader-cachebunnei2018-08-2812-417/+387
|\
| * renderer_opengl: Implement a new shader cache.bunnei2018-08-289-285/+250
| * gl_rasterizer_cache: Update to use RasterizerCache base class.bunnei2018-08-283-132/+20
| * video_core: Add RasterizerCache class for common cache management code.bunnei2018-08-282-0/+117
* | Merge pull request #1189 from FearlessTobi/fix-stick-directionsbunnei2018-08-281-2/+2
|\ \
| * | yuzu: Fix stick UI direction orderfearlessTobi2018-08-281-2/+2
|/ /
* | Merge pull request #1177 from lioncash/errbunnei2018-08-284-12/+15
|\ \ | |/ |/|
| * kernel/error: Amend error code for ERR_MAX_CONNECTIONS_REACHEDLioncash2018-08-251-2/+4
| * kernel/error: Amend error code for ERR_PORT_NAME_TOO_LONGLioncash2018-08-251-2/+1
| * kernel/error: Add error code for the handle table being fullLioncash2018-08-253-4/+4
| * kernel/error: Add error code for invalid memory permissionsLioncash2018-08-252-3/+4
| * kernel/error: Correct kernel error code for invalid combinationLioncash2018-08-251-1/+2
* | Merge pull request #1169 from Lakumakkara/selbunnei2018-08-281-1/+1
|\ \
| * | fix SEL_IMM bitstringLaku2018-08-241-1/+1
* | | Merge pull request #1188 from lioncash/unusedbunnei2018-08-281-1/+0
|\ \ \
| * | | vfs_real: Remove unused variable in CreateDirectoryRelative()Lioncash2018-08-271-1/+0
* | | | Merge pull request #1170 from lioncash/retbunnei2018-08-281-1/+1
|\ \ \ \
| * | | | file_util: Correct return value in early exit of ReadFileToString()Lioncash2018-08-241-1/+1
* | | | | Merge pull request #1175 from lioncash/nsbunnei2018-08-2813-12/+42
|\ \ \ \ \
| * | | | | core: Namespace all code in the arm subdirectory under the Core namespaceLioncash2018-08-2513-12/+42
| |/ / / /
* | | | | Merge pull request #1187 from lioncash/shadowbunnei2018-08-281-3/+3
|\ \ \ \ \
| * | | | | registered_cache: Get rid of variable shadowing in ProcessFiles()Lioncash2018-08-271-3/+3
| | |/ / / | |/| | |
* | | | | Merge pull request #1128 from DarkLordZach/malformed-hex-crashbunnei2018-08-271-5/+17
|\ \ \ \ \
| * | | | | hex_util: Replace logic_errors with LOG_CRITICALZach Hilman2018-08-231-5/+17
* | | | | | Merge pull request #1176 from lioncash/infobunnei2018-08-271-2/+1
|\ \ \ \ \ \
| * | | | | | svc: Return process title ID if queried in GetInfo()Lioncash2018-08-251-2/+1
* | | | | | | Merge pull request #1174 from lioncash/debugbunnei2018-08-275-27/+7
|\ \ \ \ \ \ \
| * | | | | | | debug_utils: Remove unused includesLioncash2018-08-255-24/+4
| * | | | | | | debug_utils: Make BreakpointObserver class' constructor explicitLioncash2018-08-251-1/+1
| * | | | | | | debug_utils: Initialize active_breakpoint member of DebugContextLioncash2018-08-251-2/+2
| | |_|_|/ / / | |/| | | | |
* | | | | | | Merge pull request #1162 from ogniK5377/ttf-plubunnei2018-08-271-5/+51
|\ \ \ \ \ \ \
| * | | | | | | Addressed plu TTF changesDavid Marcec2018-08-231-6/+7
| * | | | | | | Added SharedFonts loading via TTFDavid Marcec2018-08-231-5/+50
* | | | | | | | Merge pull request #1168 from lioncash/headerbunnei2018-08-272-1/+4
|\ \ \ \ \ \ \ \
| * | | | | | | | hid: Move core include to cpp fileLioncash2018-08-242-1/+4
| | |/ / / / / / | |/| | | | | |
* | | | | | | | Merge pull request #1171 from lioncash/truebunnei2018-08-271-7/+4
|\ \ \ \ \ \ \ \
| * | | | | | | | core: Remove always true conditionals in Load()Lioncash2018-08-241-7/+4
| |/ / / / / / /
* | | | | | | | Merge pull request #1180 from tech4me/languagecode_fixbunnei2018-08-272-8/+45
|\ \ \ \ \ \ \ \ | |_|_|_|_|/ / / |/| | | | | | |
| * | | | | | | set: Fixed GetAvailableLanguageCodes() to follow the max_entriestech4me2018-08-262-8/+45
|/ / / / / / /
* | | | | | | Merge pull request #1173 from lioncash/batchbunnei2018-08-251-4/+4
|\ \ \ \ \ \ \
| * | | | | | | maxwell3d: Move FinishedPrimitiveBatch event after AcceleratedDrawBatch()Lioncash2018-08-251-4/+4
| |/ / / / / /
* | | | | | | Merge pull request #1167 from lioncash/assertbunnei2018-08-251-1/+2
|\ \ \ \ \ \ \ | |_|_|_|_|_|/ |/| | | | | |
| * | | | | | gl_rasterizer: Correct assertion condition in SyncLogicOpState()Lioncash2018-08-241-1/+2
| |/ / / / /
* | | | | | Merge pull request #1166 from lioncash/typoSebastian Valle2018-08-251-1/+1
|\ \ \ \ \ \ | |_|_|/ / / |/| | | | |
| * | | | | filesystem: Fix typo in log messageLioncash2018-08-241-1/+1
| |/ / / /
* | | | | Merge pull request #1094 from DarkLordZach/nax0Mat M2018-08-2531-97/+821
|\ \ \ \ \
| * | | | | file_sys/crypto: Fix missing/unnecessary includesZach Hilman2018-08-259-5/+10
| * | | | | xci: Ignore NCA files with updates in secureZach Hilman2018-08-241-0/+3
| * | | | | content_archive: Add update title detectionZach Hilman2018-08-242-0/+11
| * | | | | key_manager: Eliminate indexed for loopZach Hilman2018-08-231-6/+13
| * | | | | key_manager: Create keys dir if it dosen't existZach Hilman2018-08-232-0/+2
| * | | | | file_sys: Cut down on includes and copiesZach Hilman2018-08-237-19/+30
| * | | | | crypto: Eliminate magic constantsZach Hilman2018-08-234-32/+38
| * | | | | key_manager: Add support for autogenerated keysZach Hilman2018-08-232-3/+45
| * | | | | key_manager: Add support for KEK and SD seed derivationZach Hilman2018-08-232-5/+135
| * | | | | key_manager: Switch to boost flat_map for keysZach Hilman2018-08-232-32/+14
| * | | | | game_list: Add SD registration loading to game listZach Hilman2018-08-232-12/+12
| * | | | | file_sys: Implement NAX containersZach Hilman2018-08-233-0/+238
| * | | | | registration: Add GetEntryUnparsed methodsZach Hilman2018-08-232-0/+15
| * | | | | sdmc_factory: Add SDMC RegisteredCache getterZach Hilman2018-08-232-1/+14
| * | | | | qt: Make default row data title name and title idZach Hilman2018-08-231-2/+2
| * | | | | vfs: Add GetOrCreateDirectoryRelative methodZach Hilman2018-08-233-9/+13
| * | | | | filesystem: Add CreateFactories methods to fsZach Hilman2018-08-233-10/+12
| * | | | | filesystem: Add logging to registration gettersZach Hilman2018-08-231-4/+25
| * | | | | loader: Add new NAX-specific errors and messagesZach Hilman2018-08-232-1/+27
| * | | | | nax: Add AppLoader_NAX and update loader to support itZach Hilman2018-08-234-2/+121
| * | | | | xts_encryption_layer: Implement XTSEncryptionLayerZach Hilman2018-08-233-1/+81
| * | | | | aes_util: Make XTSTranscode stricter about sizesZach Hilman2018-08-231-5/+2
| * | | | | ctr_encryption_layer: Fix bug when transcoding small dataZach Hilman2018-08-231-5/+3
| * | | | | xci: Fix error masking issueZach Hilman2018-08-233-5/+17
* | | | | | Merge pull request #1065 from DarkLordZach/window-titleZach Hilman2018-08-242-0/+18
|\ \ \ \ \ \ | |_|_|_|_|/ |/| | | | |
| * | | | | qt: Add filename and title id to window title while runningZach Hilman2018-08-232-0/+18
| | |_|_|/ | |/| | |
* | | | | Merge pull request #1164 from tech4me/decode_iadd3bunnei2018-08-241-0/+6
|\ \ \ \ \ | |_|_|/ / |/| | | |
| * | | | Shaders: Added decodings for IADD3 instructionstech4me2018-08-231-0/+6
| |/ / /
* | | | Port #4013 from Citra: "Init logging sooner so we dont miss some logs on startup" (#1142)Tobias2018-08-241-11/+11
* | | | Added GetBootMode (#1107)David2018-08-244-3/+25
|/ / /
* | | Merge pull request #1160 from bunnei/surface-reservebunnei2018-08-232-17/+91
|\ \ \
| * | | gl_rasterizer_cache: Blit when possible on RecreateSurface.bunnei2018-08-231-5/+12
| * | | gl_rasterizer_cache: Reserve surfaces that have already been created for later use.bunnei2018-08-232-3/+61
| * | | gl_rasterizer_cache: Remove assert for RecreateSurface type.bunnei2018-08-231-1/+0
| * | | gl_rasterizer_cache: Implement compressed texture copies.bunnei2018-08-231-8/+18
| |/ /
* | | Merge pull request #1153 from bunnei/stencil-clearbunnei2018-08-236-69/+188
|\ \ \ | |/ / |/| |
| * | gl_rasterizer: Implement stencil test.bunnei2018-08-233-4/+58
| * | gl_rasterizer: Implement partial color clear and stencil clear.bunnei2018-08-231-12/+42
| * | maxwell_3d: Update to include additional stencil registers.bunnei2018-08-231-20/+50
| * | gl_state: Update to handle stencil front/back face separately.bunnei2018-08-232-33/+38
|/ /
* | Merge pull request #1157 from lioncash/vecbunnei2018-08-232-11/+16
|\ \
| * | gl_shader_gen: Make ShaderSetup's constructor explicitLioncash2018-08-221-1/+1
| * | gl_shader_gen: Use a std::vector to represent program code instead of std::arrayLioncash2018-08-222-11/+16
* | | Merge pull request #1156 from Lakumakkara/lop3bunnei2018-08-232-0/+60
|\ \ \ | |_|/ |/| |
| * | more fixesLaku2018-08-221-6/+7
| * | fixesLaku2018-08-221-6/+12
| * | remove debug loggingLaku2018-08-221-2/+0
| * | implement lop3Laku2018-08-222-0/+55
* | | Swap "Plus" with "Minus" on the controller GUI (#1150)literalmente-game2018-08-231-8/+8
* | | Merge pull request #1159 from lioncash/fmtJames Rowe2018-08-231-0/+0
|\ \ \
| * | | externals: Update fmt to 6201052Lioncash2018-08-221-0/+0
| | |/ | |/|
* | | Merge pull request #1137 from lioncash/namespacebunnei2018-08-2321-23/+70
|\ \ \
| * | | renderer_opengl: Namespace OpenGL codeLioncash2018-08-2221-23/+70
| | |/ | |/|
* | | Merge pull request #1158 from lioncash/boostJames Rowe2018-08-221-0/+0
|\ \ \ | |_|/ |/| |
| * | externals/boost: Update to 1.68.0Lioncash2018-08-221-0/+0
|/ /
* | Merge pull request #1155 from tech4me/icon-fixbunnei2018-08-221-1/+1
|\ \ | |/ |/|
| * config: Fixed icon size get set to 0tech4me2018-08-221-1/+1
|/
* Merge pull request #1136 from tech4me/masterbunnei2018-08-226-11/+45
|\
| * qt/main: Port part of citra(#3411), open savedata workstech4me2018-08-216-11/+45
* | Merge pull request #840 from FearlessTobi/port-3353bunnei2018-08-2210-25/+94
|\ \
| * | Port #3353 from CitrafearlessTobi2018-08-2110-25/+94
* | | Merge pull request #1154 from OatmealDome/topology-linesbunnei2018-08-221-0/+2
|\ \ \
| * | | maxwell_to_gl: Implement PrimitiveTopology::LinesOatmealDome2018-08-221-0/+2
* | | | Merge pull request #1141 from FearlessTobi/port-3902bunnei2018-08-222-0/+18
|\ \ \ \
| * | | | Port #3902 from Citra: "Add restart hotkey & menu option"fearlessTobi2018-08-212-0/+18
| | |_|/ | |/| |
* | | | Merge pull request #1124 from Subv/logic_opsbunnei2018-08-226-7/+108
|\ \ \ \ | |_|/ / |/| | |
| * | | GPU: Implemented the logic op functionality of the GPU.Subv2018-08-213-0/+61
| * | | GLState: Allow enabling/disabling GL_COLOR_LOGIC_OP independently from blending.Subv2018-08-212-6/+19
| * | | GPU: Added registers for the logicop functionality.Subv2018-08-211-1/+28
| | |/ | |/|
* | | Merge pull request #1147 from lioncash/warnbunnei2018-08-221-1/+1
|\ \ \
| * | | logging/text_formatter: Use empty braces for initializing CONSOLE_SCREEN_BUFFER_INFO instanceLioncash2018-08-211-1/+1
* | | | Merge pull request #1151 from bunnei/revert-4a2ee191bunnei2018-08-222-153/+31
|\ \ \ \
| * | | | Revert "Shader: Use the right sampler type in the TEX, TEXS and TLDS instructions."bunnei2018-08-222-153/+31
* | | | | Merge pull request #1152 from ogniK5377/plu-includebunnei2018-08-221-0/+1
|\ \ \ \ \
| * | | | | Added missing include for pl:uDavid Marcec2018-08-221-0/+1
|/ / / / /
* / / / / PL:U Added BFTTF loading(Loading from System NAND dumps) (#1088)David2018-08-221-25/+140
|/ / / /
* | | | Merge pull request #1145 from lioncash/fwd-declbunnei2018-08-225-4/+7
|\ \ \ \
| * | | | vfs: Replace mode.h include with forward declarations where applicableLioncash2018-08-215-4/+7
| |/ / /
* | | | Merge pull request #1146 from lioncash/ambunnei2018-08-221-3/+4
|\ \ \ \
| * | | | am: Utilize std::array within PopLaunchParameter()Lioncash2018-08-211-3/+4
| |/ / /
* | | | Merge pull request #1148 from lioncash/audio-warnbunnei2018-08-211-1/+1
|\ \ \ \
| * | | | audio_core/filter: Add explicit cast to assignment in Process()Lioncash2018-08-211-1/+1
| |/ / /
* | | | Merge pull request #1149 from lioncash/parenbunnei2018-08-211-1/+1
|\ \ \ \ | |/ / / |/| | |
| * | | shader_bytecode: Parenthesize conditional expression within GetTextureType()Lioncash2018-08-211-1/+1
|/ / /
* | | Merge pull request #1143 from lioncash/incbunnei2018-08-212-1/+1
|\ \ \
| * | | sdmc_factory: Remove unnecessary core includeLioncash2018-08-212-1/+1
| | |/ | |/|
* | | Merge pull request #1139 from lioncash/bitfieldbunnei2018-08-211-2/+1
|\ \ \
| * | | bit_field: Convert ToBool() into explicit operator boolLioncash2018-08-211-2/+1
| |/ /
* | | Merge pull request #1140 from FearlessTobi/port-4056bunnei2018-08-212-0/+14
|\ \ \
| * | | Port #4056 from Citra: "Add Clear Recent Files menu action"fearlessTobi2018-08-212-0/+14
| |/ /
* | | Merge pull request #1144 from MerryMage/MAX_LAG_TIME_USMat M2018-08-211-1/+1
|\ \ \ | |/ / |/| |
| * | perf_stats: Change MAX_LAG_TIME_US to an appropriate valueMerryMage2018-08-211-1/+1
|/ /
* | Merge pull request #1123 from lioncash/screenbunnei2018-08-217-30/+25
|\ \
| * | rasterizer_interface: Remove ScreenInfo from AccelerateDraw()'s signatureLioncash2018-08-215-17/+14
| * | renderer_base: Make creation of the rasterizer, the responsibility of the renderers themselvesLioncash2018-08-214-14/+12
| |/
* | Merge pull request #1129 from lioncash/headerbunnei2018-08-2111-8/+40
|\ \
| * | service/filesystem: Use forward declarations where applicableLioncash2018-08-219-5/+28
| * | romfs_factory: Remove unnecessary includes and use forward declarations where applicableLioncash2018-08-213-3/+12
* | | Merge pull request #1132 from Subv/gl_FragDepthbunnei2018-08-211-1/+6
|\ \ \
| * | | Shaders: Implement depth writing in fragment shaders.Subv2018-08-211-1/+6
* | | | Merge pull request #1134 from lioncash/logbunnei2018-08-211-1/+1
|\ \ \ \
| * | | | renderer_opengl: Use LOG_DEBUG for GL_DEBUG_SEVERITY_NOTIFICATION and GL_DEBUG_SEVERITY_LOW logsLioncash2018-08-211-1/+1
* | | | | Merge pull request #1121 from Subv/tex_reinterpretbunnei2018-08-214-16/+70
|\ \ \ \ \ | |/ / / / |/| | | |
| * | | | Rasterizer: Reinterpret the raw texture bytes instead of blitting (and thus doing format conversion) to a new texture when a game requests an old texture address with a different format.Subv2018-08-201-3/+49
| * | | | Rasterizer: Don't attempt to copy over the old texture's data when doing a format reinterpretation if we're only going to clear the framebuffer.Subv2018-08-204-13/+21
| | |_|/ | |/| |
* | | | Merge pull request #1133 from lioncash/guardbunnei2018-08-211-0/+2
|\ \ \ \ | |_|/ / |/| | |
| * | | gl_stream_buffer: Add missing header guardLioncash2018-08-211-0/+2
* | | | Merge pull request #1126 from lioncash/telembunnei2018-08-211-4/+4
|\ \ \ \
| * | | | telemetry_session: Don't allocate std::string instances for program lifetime in GetTelemetryId() and RegenerateTelemetryId()Lioncash2018-08-211-4/+4
* | | | | Merge pull request #1131 from bunnei/impl-tex3d-texcubebunnei2018-08-212-2/+21
|\ \ \ \ \
| * | | | | shader_bytecode: Replace some UNIMPLEMENTED logs.bunnei2018-08-211-2/+6
| * | | | | gl_shader_decompiler: Implement Texture3D for TEXS.bunnei2018-08-211-0/+7
| * | | | | gl_shader_decompiler: Implement TextureCube for TEX.bunnei2018-08-211-0/+8
* | | | | | Merge pull request #1106 from Subv/multiple_rendertargetsbunnei2018-08-212-6/+45
|\ \ \ \ \ \ | |/ / / / / |/| | | | |
| * | | | | Shaders: Write all the enabled color outputs when a fragment shader exits.Subv2018-08-212-6/+45
* | | | | | Merge pull request #1130 from Subv/tex_2dbunnei2018-08-211-6/+15
|\ \ \ \ \ \ | |_|_|/ / / |/| | | | |
| * | | | | Shaders: Fixed the coords in TEX with Texture2D.Subv2018-08-211-1/+1
| * | | | | Shaders: Log and crash when using an unimplemented texture type in a texture sampling instruction.Subv2018-08-211-5/+14
| | |/ / / | |/| | |
* | | | | Merge pull request #1122 from lioncash/accbunnei2018-08-214-57/+61
|\ \ \ \ \
| * | | | | acc: Replace profile_manager include with a forward declarationLioncash2018-08-212-2/+6
| * | | | | acc: Simplify WriteBuffer call within LoadImage()Lioncash2018-08-211-3/+3
| * | | | | acc: Correct IProfile's constructor initializer list orderLioncash2018-08-211-1/+1
| * | | | | acc: Remove unused DEFAULT_USER_IDLioncash2018-08-211-3/+0
| * | | | | profile_manager: Use INVALID_UUID in the initializer of last_opened_userLioncash2018-08-211-1/+1
| * | | | | profile_manager: Remove unnecessary memcpy in GetProfileBaseAndData()Lioncash2018-08-211-1/+1
| * | | | | profile_manager: Use type aliases for username data, profile data, and user arraysLioncash2018-08-212-19/+22
| * | | | | profile_manager: Take ProfileInfo by const reference where applicableLioncash2018-08-212-8/+8
| * | | | | profile_manager: Make array parameter to CreateNewUser a const referenceLioncash2018-08-212-2/+2
| * | | | | profile_manager: Remove unnecessary staticLioncash2018-08-211-1/+1
| * | | | | profile_manager: Simplify UUID's two param constructor, operator==, and operator boolLioncash2018-08-211-6/+4
| * | | | | profile_manager: Move UUID generation function to the cpp fileLioncash2018-08-212-10/+12
| * | | | | profile_manager: Remove unnecessary std::move in AddToProfiles() and CreateNewUser()Lioncash2018-08-201-2/+2
| | |_|/ / | |/| | |
* | | | | Merge pull request #1125 from bunnei/update-dynarmicbunnei2018-08-211-0/+0
|\ \ \ \ \ | |_|_|_|/ |/| | | |
| * | | | externals: Update dynarmic to a42f301c.bunnei2018-08-211-0/+0
| | |/ / | |/| |
* | | | Merge pull request #1095 from DarkLordZach/sysarchivesbunnei2018-08-218-20/+100
|\ \ \ \
| * | | | registration: Add Data_Unknown5 NCAContentTypeZach Hilman2018-08-203-2/+3
| * | | | filesystem: Add support for loading of system archivesZach Hilman2018-08-197-20/+99
* | | | | Merge pull request #1127 from yuzu-emu/revert-838-port-3616James Rowe2018-08-211-1/+1
|\ \ \ \ \ | |_|/ / / |/| | | |
| * | | | Revert "Port #3616 from Citra: "appveyor: set jobs to 4 for mingw""Zach Hilman2018-08-211-1/+1
|/ / / /
* | | | Merge pull request #1064 from lioncash/telemetrybunnei2018-08-213-62/+84
|\ \ \ \ | |_|/ / |/| | |
| * | | common/telemetry: Migrate core-independent info gathering to commonLioncash2018-08-153-62/+84
* | | | Merge pull request #1104 from Subv/instanced_arraysbunnei2018-08-202-4/+30
|\ \ \ \
| * | | | GLRasterizer: Implemented instanced vertex arrays.Subv2018-08-182-4/+30
| | |_|/ | |/| |
* | | | Merge pull request #1115 from Subv/texs_maskbunnei2018-08-201-18/+18
|\ \ \ \
| * | | | Shaders/TEXS: Fixed the component mask in the TEXS instruction.Subv2018-08-201-18/+18
* | | | | Merge pull request #1112 from Subv/sampler_typesbunnei2018-08-203-33/+250
|\ \ \ \ \
| * | | | | Shader: Implemented the TLD4 and TLD4S opcodes using GLSL's textureGather.Subv2018-08-191-0/+51
| * | | | | Shader: Use the right sampler type in the TEX, TEXS and TLDS instructions.Subv2018-08-192-29/+127
| * | | | | Shader: Added bitfields for the texture type of the various sampling instructions.Subv2018-08-191-1/+65
| * | | | | Shaders: Added decodings for TLD4 and TLD4SSubv2018-08-191-3/+7
* | | | | | Merge pull request #1117 from ogniK5377/CheckFreeCommunicationPermissionbunnei2018-08-201-1/+8
|\ \ \ \ \ \
| * | | | | | Added CheckFreeCommunicationPermissionDavid Marcec2018-08-201-1/+8
| | |/ / / / | |/| | | |
* | | | | | Merge pull request #1017 from ogniK5377/better-accountbunnei2018-08-2013-74/+440
|\ \ \ \ \ \
| * | | | | | Better UUID randomnessDavid Marcec2018-08-111-2/+7
| * | | | | | Removed un-needed count from ListOpenUsers and ListAllUsersDavid Marcec2018-08-111-4/+2
| * | | | | | Added better explanations in the profile managerDavid Marcec2018-08-112-1/+34
| * | | | | | Code cleanup for profile managerDavid Marcec2018-08-113-40/+47
| * | | | | | Removed const from ProfileBase InvalidateDavid Marcec2018-08-111-1/+1
| * | | | | | fixed invalid uuid bool operatorDavid Marcec2018-08-111-1/+1
| * | | | | | Added GetOpenUserCountDavid Marcec2018-08-113-3/+14
| * | | | | | Removed all for loops from the profile managerDavid Marcec2018-08-111-9/+4
| * | | | | | Added missing ListAllUsers countDavid Marcec2018-08-111-1/+2
| * | | | | | If statement style changeDavid Marcec2018-08-111-11/+19
| * | | | | | Second round of account changesDavid Marcec2018-08-113-18/+21
| * | | | | | First round of account changesDavid Marcec2018-08-113-49/+55
| * | | | | | Rebase with dynarmic masterDavid Marcec2018-08-111-0/+0
| * | | | | | Refactored profile manager sharingDavid Marcec2018-08-1110-20/+28
| * | | | | | Merge remote-tracking branch 'origin/master' into better-accountDavid Marcec2018-08-1179-635/+1570
| |\ \ \ \ \ \
| * | | | | | | Added IsUserRegistrationRequestPermittedDavid Marcec2018-08-117-3/+19
| * | | | | | | Don't add user if the uuid already existsDavid Marcec2018-08-091-0/+4
| * | | | | | | Open first user addedDavid Marcec2018-08-081-1/+3
| * | | | | | | Inital pass of account backend implementationDavid Marcec2018-08-083-12/+22
| * | | | | | | GetProfileBase and GetProfileBaseAndData addedDavid Marcec2018-08-083-44/+106
| * | | | | | | began initial implementation of "ProfileManager"David Marcec2018-08-085-44/+202
| * | | | | | | Switched uuids from u128 to new UUID structDavid Marcec2018-08-082-10/+49
* | | | | | | | Merge pull request #1120 from ogniK5377/rgba8-uintbunnei2018-08-204-45/+58
|\ \ \ \ \ \ \ \
| * | | | | | | | Implemented RGBA8_UINTDavid Marcec2018-08-204-45/+58
| | |_|/ / / / / | |/| | | | | |
* | | | | | | | Merge pull request #1119 from lioncash/uninitbunnei2018-08-201-2/+2
|\ \ \ \ \ \ \ \ | |/ / / / / / / |/| | | | | | |
| * | | | | | | game_list: Avoid uninitialized variables when retrieving program IDLioncash2018-08-201-2/+2
|/ / / / / / /
* | | | | | | Merge pull request #1089 from Subv/neg_bitsbunnei2018-08-192-16/+38
|\ \ \ \ \ \ \
| * | | | | | | Shaders: Corrected the 'abs' and 'neg' bit usage in the float arithmetic instructions.Subv2018-08-182-16/+38
* | | | | | | | Merge pull request #1105 from Subv/convert_negbunnei2018-08-191-2/+0
|\ \ \ \ \ \ \ \
| * | | | | | | | Shader: Remove an unneeded assert, the negate bit is implemented for conversion instructions.Subv2018-08-181-2/+0
| | |_|_|_|/ / / | |/| | | | | |
* | | | | | | | Merge pull request #1113 from Subv/texs_maskbunnei2018-08-191-6/+11
|\ \ \ \ \ \ \ \
| * | | | | | | | Shaders/TEXS: Fixed the component mask in the TEXS instruction.Subv2018-08-191-6/+11
| | |_|_|_|/ / / | |/| | | | | |
* | | | | | | | Merge pull request #1102 from ogniK5377/mirror-clamp-edgebunnei2018-08-193-0/+6
|\ \ \ \ \ \ \ \
| * | | | | | | | Added check to see if ARB_texture_mirror_clamp_to_edge is supportedDavid Marcec2018-08-192-0/+4
| * | | | | | | | Added WrapMode MirrorOnceClampToEdgeDavid Marcec2018-08-181-0/+2
| | |/ / / / / / | |/| | | | | |
* | | | | | | | Merge pull request #1101 from Subv/ssy_stackbunnei2018-08-191-3/+36
|\ \ \ \ \ \ \ \ | |_|/ / / / / / |/| | | | | | |
| * | | | | | | Shaders: Implemented a stack for the SSY/SYNC instructions.Subv2018-08-181-3/+36
| |/ / / / / /
* | | | | | | Merge pull request #1109 from Subv/ldg_decodebunnei2018-08-191-0/+4
|\ \ \ \ \ \ \
| * | | | | | | Shaders: Added decodings for the LDG and STG instructions.Subv2018-08-191-0/+4
| |/ / / / / /
* | | | | | | Merge pull request #1108 from Subv/front_facingbunnei2018-08-192-0/+7
|\ \ \ \ \ \ \
| * | | | | | | Shaders: Implemented the gl_FrontFacing input attribute (attr 63).Subv2018-08-192-0/+7
| |/ / / / / /
* | | | | | | Merge pull request #1103 from Subv/lop_predbunnei2018-08-192-11/+39
|\ \ \ \ \ \ \ | |_|_|_|_|_|/ |/| | | | | |
| * | | | | | Shader: Implemented the predicate and mode arguments of LOP.Subv2018-08-182-11/+39
| |/ / / / /
* | | | | | Merge pull request #838 from FearlessTobi/port-3616James Rowe2018-08-181-1/+1
|\ \ \ \ \ \ | |/ / / / / |/| | | | |
| * | | | | Port #3616 from CitrafearlessTobi2018-07-261-1/+1
* | | | | | Merge pull request #1100 from ogniK5377/missing-predbunnei2018-08-182-5/+8
|\ \ \ \ \ \
| * | | | | | Added predcondition GreaterThanWithNanDavid Marcec2018-08-182-5/+8
|/ / / / / /
* | | | | | Merge pull request #1096 from bunnei/supported-blitsbunnei2018-08-181-2/+0
|\ \ \ \ \ \
| * | | | | | gl_rasterizer_cache: Remove asserts for supported blits.bunnei2018-08-171-2/+0
* | | | | | | Merge pull request #1097 from bunnei/gl-criticalbunnei2018-08-171-1/+1
|\ \ \ \ \ \ \
| * | | | | | | renderer_opengl: Treat OpenGL errors as critical.bunnei2018-08-171-1/+1
| |/ / / / / /
* | | | | | | Implement SetIdleTimeDetectionExtension & GetIdleTimeDetectionExtension (#1059)greggameplayer2018-08-172-2/+22
* | | | | | | Merge pull request #1090 from lioncash/ctor-assignbunnei2018-08-171-0/+6
|\ \ \ \ \ \ \
| * | | | | | | core: Delete System copy/move constructors and assignment operatorsLioncash2018-08-161-0/+6
* | | | | | | | Merge pull request #1091 from lioncash/warningbunnei2018-08-171-78/+83
|\ \ \ \ \ \ \ \
| * | | | | | | | qt/main: Unindent code in OnMenuInstallToNAND()Lioncash2018-08-161-70/+70
| * | | | | | | | qt/main: Make installation dialog text within OnMenuInstallToNAND() translatableLioncash2018-08-161-14/+15
| * | | | | | | | qt/main: Get rid of compilation warningsLioncash2018-08-161-4/+8
| |/ / / / / / /
* | | | | | | | Merge pull request #1093 from greggameplayer/GetDefaultDisplayResolutionChangeEventbunnei2018-08-172-1/+13
|\ \ \ \ \ \ \ \ | |_|/ / / / / / |/| | | | | | |
| * | | | | | | correct coding stylegreggameplayer2018-08-161-1/+1
| * | | | | | | Implement GetDefaultDisplayResolutionChangeEventgreggameplayer2018-08-162-1/+13
* | | | | | | | Merge pull request #1019 from Subv/vertex_divisorbunnei2018-08-177-5/+28
|\ \ \ \ \ \ \ \
| * | | | | | | | Rasterizer: Implemented instanced rendering.Subv2018-08-157-5/+28
* | | | | | | | | Merge pull request #1087 from MerryMage/dynarmicbunnei2018-08-172-0/+3
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | dynarmic: Update to 550d662MerryMage2018-08-162-0/+3
| | |_|_|_|/ / / / | |/| | | | | | |
* | | | | | | | | Merge pull request #1084 from bunnei/depthbunnei2018-08-172-16/+26
|\ \ \ \ \ \ \ \ \ | |_|_|/ / / / / / |/| | | | | | | |
| * | | | | | | | gl_rasterizer_cache: Treat Depth formats differently from DepthStencil.bunnei2018-08-162-16/+26
* | | | | | | | | Merge pull request #1085 from lioncash/namespacebunnei2018-08-164-12/+22
|\ \ \ \ \ \ \ \ \ | |_|/ / / / / / / |/| | | | | | | |
| * | | | | | | | common: Namespace hex_util.h/.cppLioncash2018-08-164-12/+22
| | |_|/ / / / / | |/| | | | | |
* | | | | | | | Merge pull request #1075 from lioncash/includebunnei2018-08-164-35/+22
|\ \ \ \ \ \ \ \ | |/ / / / / / / |/| | | | | | |
| * | | | | | | loader/nca: Remove unnecessary includes and member variablesLioncash2018-08-152-20/+11
| * | | | | | | loader/xci: Remove unnecessary includes and member variablesLioncash2018-08-152-15/+11
| | |_|_|_|_|/ | |/| | | | |
* | | | | | | Merge pull request #1005 from DarkLordZach/registered-fmtbunnei2018-08-1634-80/+1437
|\ \ \ \ \ \ \
| * | | | | | | registration: Various style and documentation improvementsZach Hilman2018-08-123-18/+22
| * | | | | | | registration: Add support for force overwrite of installedZach Hilman2018-08-124-53/+106
| * | | | | | | game_list: Split game list scans to multiple functionsZach Hilman2018-08-122-9/+16
| * | | | | | | vfs_real: Add CreateFullPath to Create* operationsZach Hilman2018-08-122-13/+6
| * | | | | | | control_metadata: Remove unnecessary reference to base fileZach Hilman2018-08-122-2/+1
| * | | | | | | romfs: Remove cyclic shared_ptr leak in romfs codeZach Hilman2018-08-123-8/+8
| * | | | | | | registration: Update documentation and styleZach Hilman2018-08-125-42/+69
| * | | | | | | nca_metadata: Remove unnecessary reference to base fileZach Hilman2018-08-122-3/+2
| * | | | | | | bis_factory: Create NAND dirs if they don't existZach Hilman2018-08-121-2/+9
| * | | | | | | qt: Use custom RawCopy with progress bar for installsZach Hilman2018-08-121-2/+28
| * | | | | | | registration: Take RawCopy function as parameterZach Hilman2018-08-122-10/+15
| * | | | | | | game_list: Populate control data from installed NANDZach Hilman2018-08-122-31/+35
| * | | | | | | registered_cache: Fix missing reading from yuzu_metaZach Hilman2018-08-121-7/+16
| * | | | | | | file_sys: Comply to style guidelinesZach Hilman2018-08-128-47/+60
| * | | | | | | qt: Add 'Install to NAND' option to menuZach Hilman2018-08-125-1/+99
| * | | | | | | game_list: Modify game list to scan installed titlesZach Hilman2018-08-121-0/+45
| * | | | | | | file_sys: Add RegisteredCacheZach Hilman2018-08-122-0/+543
| * | | | | | | file_sys: Add support for parsing NCA metadata (CNMT)Zach Hilman2018-08-123-0/+238
| * | | | | | | card_image: Add accessor for all NCAs in XCIZach Hilman2018-08-122-0/+5
| * | | | | | | vfs_real: Add CreateFullPath to CreateFileZach Hilman2018-08-121-3/+6
| * | | | | | | filesystem: Add Open and Register functions for BISFactoryZach Hilman2018-08-122-4/+23
| * | | | | | | bis_factory: Add partial implementation of BISFactoryZach Hilman2018-08-122-0/+54
| * | | | | | | loader: Join 0* files in directory if filename is 00Zach Hilman2018-08-121-1/+33
| * | | | | | | loader: Recognize filename '00' as NCAZach Hilman2018-08-121-0/+2
| * | | | | | | vfs: Add ConcatenatedVfsFileZach Hilman2018-08-122-0/+134
| * | | | | | | crypto: Remove hex utilities from key_managerZach Hilman2018-08-122-36/+2
| * | | | | | | file_util: Add getter for NAND registration directoryZach Hilman2018-08-122-0/+8
| * | | | | | | common: Move hex string processing to separate fileZach Hilman2018-08-123-0/+64
* | | | | | | | Merge pull request #1078 from lioncash/messagebunnei2018-08-161-2/+20
|\ \ \ \ \ \ \ \ | |_|_|/ / / / / |/| | | | | | |
| * | | | | | | lm: Use LOG_DEBUG for printing out trace logsLioncash2018-08-151-1/+1
| * | | | | | | lm: Handle threads and modules within the loggerLioncash2018-08-151-1/+19
* | | | | | | | Merge pull request #1079 from lioncash/fmtbunnei2018-08-165-14/+18
|\ \ \ \ \ \ \ \
| * | | | | | | | loader: Make ResultStatus directly compatible with fmtLioncash2018-08-155-14/+18
| |/ / / / / / /
* | | | | | | | Merge pull request #1051 from B3n30/UnscheduleEventThreadsafebunnei2018-08-163-1/+12
|\ \ \ \ \ \ \ \
| * | | | | | | | Core::CoreTiming: add UnscheduleEventThreadsafeB3n302018-08-133-1/+12
* | | | | | | | | Merge pull request #1080 from lioncash/retbunnei2018-08-161-1/+1
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | sm/controller: Correct return value of QueryPointerBufferSizeLioncash2018-08-151-1/+1
| | |/ / / / / / / | |/| | | | | | |
* | | | | | | | | Merge pull request #1083 from Subv/conv_negbunnei2018-08-161-13/+53
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | Shader/Conversion: Implemented the negate bit in F2F and I2I instructions.Subv2018-08-151-4/+12
| * | | | | | | | | Shader/I2F: Implemented the negate I2F_C instruction variant.Subv2018-08-151-7/+23
| * | | | | | | | | Shader/F2I: Implemented the negate bit in the I2F instructionSubv2018-08-151-0/+4
| * | | | | | | | | Shader/F2I: Implemented the F2I_C instruction variant.Subv2018-08-151-2/+10
| * | | | | | | | | Shader/F2I: Implemented the negate bit in the F2I instruction.Subv2018-08-151-0/+4
* | | | | | | | | | Merge pull request #1081 from lioncash/convertbunnei2018-08-153-3/+8
|\ \ \ \ \ \ \ \ \ \ | |/ / / / / / / / / |/| | | | | | | | |
| * | | | | | | | | kernel/server_session: Add IsSession() member functionLioncash2018-08-153-3/+8
| |/ / / / / / / /
* | | | | | | | | Merge pull request #1077 from bunnei/rgba16ubunnei2018-08-151-1/+9
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | gl_rasterizer_cache: Add RGBA16U to PixelFormatFromTextureFormat.bunnei2018-08-151-1/+9
| | |_|_|_|/ / / / | |/| | | | | | |
* | | | | | | | | Merge pull request #1076 from bunnei/format-cleanupbunnei2018-08-152-41/+71
|\ \ \ \ \ \ \ \ \ | |/ / / / / / / / |/| | | | | | | |
| * | | | | | | | gl_rasterizer_cache: Cleanup some PixelFormat names and logging.bunnei2018-08-152-41/+71
|/ / / / / / / /
* | | | | | | | Merge pull request #1069 from bunnei/vtx-szbunnei2018-08-151-5/+20
|\ \ \ \ \ \ \ \
| * | | | | | | | maxwell_to_gl: Properly handle UnsignedInt/SignedInt sizes.bunnei2018-08-151-5/+20
| | |_|_|/ / / / | |/| | | | | |
* | | | | | | | Merge pull request #1070 from bunnei/cbuf-szbunnei2018-08-151-3/+3
|\ \ \ \ \ \ \ \
| * | | | | | | | gl_rasterizer: Fix upload size for constant buffers.bunnei2018-08-151-3/+3
| |/ / / / / / /
* | | | | | | | Merge pull request #1071 from bunnei/fix-ldcbunnei2018-08-151-13/+22
|\ \ \ \ \ \ \ \
| * | | | | | | | gl_shader_decompiler: Several fixes for indirect constant buffer loads.bunnei2018-08-151-13/+22
| |/ / / / / / /
* | | | | | | | Merge pull request #1068 from bunnei/g8r8sbunnei2018-08-152-34/+49
|\ \ \ \ \ \ \ \ | |_|/ / / / / / |/| | | | | | |
| * | | | | | | gl_rasterizer_cache: Implement G8R8S format.bunnei2018-08-152-34/+49
| |/ / / / / /
* | | | | | | Merge pull request #1067 from lioncash/initbunnei2018-08-151-3/+3
|\ \ \ \ \ \ \
| * | | | | | | emu_window: Ensure WindowConfig members are always initializedLioncash2018-08-151-3/+3
| |/ / / / / /
* | | | | | | Merge pull request #1073 from lioncash/3dsbunnei2018-08-156-17/+0
|\ \ \ \ \ \ \
| * | | | | | | loader: Remove address mapping remnants from citraLioncash2018-08-156-17/+0
| |/ / / / / /
* | | | | | | Merge pull request #1072 from lioncash/svcbunnei2018-08-151-2/+5
|\ \ \ \ \ \ \
| * | | | | | | kernel/svc: Log svcBreak parametersLioncash2018-08-151-2/+5
| |/ / / / / /
* | | | | | | Merge pull request #1063 from lioncash/inlinebunnei2018-08-152-15/+11
|\ \ \ \ \ \ \
| * | | | | | | common/xbyak_abi: Mark defined functions in header as inlineLioncash2018-08-151-7/+7
| * | | | | | | common/xbyak: Use nested namespace specifiers where applicableLioncash2018-08-152-8/+4
| |/ / / / / /
* | | | | | | Merge pull request #1074 from greggameplayer/Z16_UNORMbunnei2018-08-151-0/+2
|\ \ \ \ \ \ \
| * | | | | | | Implement Z16_UNORM in PixelFormatFromTextureFormat functiongreggameplayer2018-08-151-0/+2
|/ / / / / / /
* | | | | | | Merge pull request #1054 from zhaowenlan1779/misc-fixupbunnei2018-08-151-1/+1
|\ \ \ \ \ \ \
| * | | | | | | common/misc: use windows.hZhu PengFei2018-08-131-1/+1
* | | | | | | | Merge pull request #1056 from lioncash/mmbunnei2018-08-152-46/+52
|\ \ \ \ \ \ \ \
| * | | | | | | | mm_u: Forward all old variants of functions to the new onesLioncash2018-08-141-5/+11
| * | | | | | | | mm_u: Move implementation class into the cpp fileLioncash2018-08-142-46/+46
* | | | | | | | | Merge pull request #1066 from lioncash/aarch64bunnei2018-08-151-0/+2
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | CMakeLists: Add architecture detection for AArch64Lioncash2018-08-151-0/+2
| | |_|/ / / / / / | |/| | | | | | |
* | | | | | | | | Merge pull request #1062 from lioncash/unusedbunnei2018-08-153-141/+0
|\ \ \ \ \ \ \ \ \ | |/ / / / / / / / |/| | | | | | | |
| * | | | | | | | common: Remove unused old breakpoint source filesLioncash2018-08-153-141/+0
|/ / / / / / / /
* | | | | | | | Merge pull request #1055 from lioncash/initbunnei2018-08-141-1/+1
|\ \ \ \ \ \ \ \
| * | | | | | | | audout_u: Correct IAudioOut initializer list orderLioncash2018-08-141-1/+1
| |/ / / / / / /
* | | | | | | | Merge pull request #1058 from greggameplayer/BC7U_Fixbunnei2018-08-141-1/+1
|\ \ \ \ \ \ \ \
| * | | | | | | | Fix BC7Ugreggameplayer2018-08-141-1/+1
* | | | | | | | | Merge pull request #1050 from bunnei/rgba16-unormbunnei2018-08-144-37/+48
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | renderer_opengl: Implement RenderTargetFormat::RGBA16_UNORM.bunnei2018-08-144-37/+48
| | |/ / / / / / / | |/| | | | | | |
* | | | | | | | | Merge pull request #1060 from lioncash/logJames Rowe2018-08-141-2/+3
|\ \ \ \ \ \ \ \ \ | |_|/ / / / / / / |/| | | | | | | |
| * | | | | | | | logging/backend: Use const reference to refer to log filterLioncash2018-08-141-2/+3
|/ / / / / / / /
* | | | | | | | Merge pull request #1046 from ogniK5377/missing-channelsMat M2018-08-146-0/+148
|\ \ \ \ \ \ \ \ | |/ / / / / / / |/| | | | | | |
| * | | | | | | Registered missing channel devicesDavid Marcec2018-08-131-0/+4
| * | | | | | | Added missing channel devicesDavid Marcec2018-08-135-0/+144
* | | | | | | | Merge pull request #1052 from ogniK5377/xenobunnei2018-08-134-7/+45
|\ \ \ \ \ \ \ \
| * | | | | | | | Implement RG32UI and R32UIDavid Marcec2018-08-134-7/+45
| | |_|/ / / / / | |/| | | | | |
* | | | | | | | Merge pull request #1033 from MerryMage/interpbunnei2018-08-137-3/+267
|\ \ \ \ \ \ \ \
| * | | | | | | | audio_renderer: samples_remaining counts frames, not samplesMerryMage2018-08-131-1/+1
| * | | | | | | | audio_core: InterpolateMerryMage2018-08-135-0/+121
| * | | | | | | | audio_core: Implement low-pass filterMerryMage2018-08-133-2/+145
* | | | | | | | | Merge pull request #1053 from MerryMage/rm-IsExecutingbunnei2018-08-131-3/+1
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | arm_dynarmic: Remove IsExecuting check from PrepareRescheduleMerryMage2018-08-131-3/+1
| | |/ / / / / / / | |/| | | | | | |
* | | | | | | | | Merge pull request #1049 from bunnei/vtx-size-8Mat M2018-08-131-0/+1
|\ \ \ \ \ \ \ \ \ | |/ / / / / / / / |/| | | | | | | |
| * | | | | | | | maxwell_to_gl: Implement VertexAttribute::Size::Size_8.bunnei2018-08-131-0/+1
* | | | | | | | | Merge pull request #1032 from lioncash/sanitizebunnei2018-08-131-10/+10
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | vfs: Use sanitized paths within MoveFile() and MoveDirectory()Lioncash2018-08-121-10/+10
* | | | | | | | | | Merge pull request #1031 from lioncash/verbositybunnei2018-08-132-7/+7
|\ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | card_image: Use type aliases to shorten definitionsLioncash2018-08-122-6/+6
| * | | | | | | | | | card_image: Simplify return statement of GetSubdirectories()Lioncash2018-08-121-1/+1
| |/ / / / / / / / /
* | | | | | | | | | Merge pull request #1048 from lioncash/atomicbunnei2018-08-132-8/+9
|\ \ \ \ \ \ \ \ \ \ | |_|/ / / / / / / / |/| | | | | | | | |
| * | | | | | | | | kernel/object: Tighten object against data racesLioncash2018-08-132-8/+9
* | | | | | | | | | Merge pull request #1047 from bunnei/rgba16-uintbunnei2018-08-134-34/+45
|\ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | renderer_opengl: Implement RenderTargetFormat::RGBA16_UINT.bunnei2018-08-134-34/+45
|/ / / / / / / / / /
* | | | | | | | | | Merge pull request #1045 from bunnei/rg8-unormbunnei2018-08-134-26/+61
|\ \ \ \ \ \ \ \ \ \ | |_|_|_|/ / / / / / |/| | | | | | | | |
| * | | | | | | | | renderer_opengl: Implement RenderTargetFormat::RG8_UNORM.bunnei2018-08-134-26/+61
| |/ / / / / / / /
* | | | | | | | | Merge pull request #1044 from bunnei/linestripbunnei2018-08-131-0/+2
|\ \ \ \ \ \ \ \ \ | |/ / / / / / / / |/| | | | | | | |
| * | | | | | | | maxwell_to_gl: Implement PrimitiveTopology::LineStrip.bunnei2018-08-131-0/+2
|/ / / / / / / /
* | | | | | | | Merge pull request #1043 from Subv/timingbunnei2018-08-133-2/+11
|\ \ \ \ \ \ \ \
| * | | | | | | | CPU/Timing: Use an approximated amortized amount of ticks when advancing timing.Subv2018-08-132-1/+11
| * | | | | | | | Kernel/SVC: Don't reschedule the current core when creating a new thread.Subv2018-08-131-1/+0
* | | | | | | | | Merge pull request #1036 from lioncash/threadbunnei2018-08-133-7/+7
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | scheduler: Make HaveReadyThreads() a const member functionLioncash2018-08-122-2/+2
| * | | | | | | | | thread_queue_list: Make contains() and get_first() const member functionsLioncash2018-08-121-4/+4
| * | | | | | | | | thread_queue_list: Convert typedef to a type aliasLioncash2018-08-121-1/+1
| |/ / / / / / / /
* | | | | | | | | Merge pull request #1042 from Subv/racesbunnei2018-08-134-5/+13
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | Core/HLE: Make the 'reschedule_pending' flag atomic.Subv2018-08-131-1/+1
| * | | | | | | | | CPU/HLE: Lock the HLE mutex before performing a reschedule.Subv2018-08-131-0/+3
| * | | | | | | | | Kernel/Threads: Lock the HLE mutex when executing the wakeup callback.Subv2018-08-131-0/+5
| * | | | | | | | | Kernel/Thread: Always use the threadsafe option when scheduling wakeups.Subv2018-08-132-4/+4
| |/ / / / / / / /
* | | | | | | | | Merge pull request #1041 from Subv/duplicated_mutexbunnei2018-08-132-2/+22
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | Kernel/Mutex: Don't duplicate threads in the mutex waiter list.Subv2018-08-122-2/+22
| |/ / / / / / / /
* | | | | | | | | Merge pull request #1040 from bunnei/xmadbunnei2018-08-132-4/+120
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | gl_shader_decompiler: Implement XMAD instruction.bunnei2018-08-132-4/+120
* | | | | | | | | | Merge pull request #1039 from lioncash/typebunnei2018-08-134-11/+17
|\ \ \ \ \ \ \ \ \ \ | |/ / / / / / / / / |/| | | | | | | | |
| * | | | | | | | | vfs: Make VfsFilesystem constructor explicitLioncash2018-08-121-1/+1
| * | | | | | | | | vfs: Make type hierarchy objects classes instead of structsLioncash2018-08-124-10/+16
|/ / / / / / / / /
* | | | | | | | | Merge pull request #1025 from ogniK5377/bad-castbunnei2018-08-124-4/+4
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | made ResultStatus a u16David Marcec2018-08-123-3/+3
| * | | | | | | | | Fixed invalid cast in loaderDavid Marcec2018-08-121-1/+1
| | |_|_|_|/ / / / | |/| | | | | | |
* | | | | | | | | Merge pull request #1038 from MerryMage/lock-cubebbunnei2018-08-121-0/+6
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | cubeb_sink: Protect queue with a mutexMerryMage2018-08-121-0/+6
| | |_|_|/ / / / / | |/| | | | | | |
* | | | | | | | | Merge pull request #1035 from ogniK5377/audio-dev-revision-infobunnei2018-08-122-1/+13
|\ \ \ \ \ \ \ \ \ | |/ / / / / / / / |/| | | | | | | |
| * | | | | | | | GetAudioDeviceServiceWithRevisionInfoDavid Marcec2018-08-122-1/+13
| | |/ / / / / / | |/| | | | | |
* | | | | | | | Merge pull request #1028 from ogniK5377/aoabunnei2018-08-123-6/+42
|\ \ \ \ \ \ \ \
| * | | | | | | | Pushed the requested sample rate instead of our fixed sample rateDavid Marcec2018-08-122-5/+3
| * | | | | | | | Added GetAudioRendererSampleRate, GetAudioRendererSampleCount & GetAudioRendererMixBufferCountDavid Marcec2018-08-123-6/+44
| | |/ / / / / / | |/| | | | | |
* | | | | | | | Merge pull request #1034 from lioncash/hidbunnei2018-08-121-5/+12
|\ \ \ \ \ \ \ \
| * | | | | | | | hid: disable clang-format around tablesLioncash2018-08-121-4/+5
| * | | | | | | | hid: Stub DisconnectNpad()Lioncash2018-08-121-1/+7
| | |_|/ / / / / | |/| | | | | |
* | | | | | | | Merge pull request #1030 from bunnei/sdl2-2.0.8bunnei2018-08-121-1/+1
|\ \ \ \ \ \ \ \
| * | | | | | | | externals: Update to SDL2-2.0.8.bunnei2018-08-121-1/+1
| |/ / / / / / /
* | | | | | | | Merge pull request #1006 from degasus/stream_bufferbunnei2018-08-126-303/+176
|\ \ \ \ \ \ \ \ | |_|_|/ / / / / |/| | | | | | |
| * | | | | | | gl_rasterizer: Use a shared helper to upload from CPU memory.Markus Wick2018-08-122-28/+33
| * | | | | | | gl_state: Don't track constant buffer mappings.Markus Wick2018-08-123-41/+3
| * | | | | | | gl_rasterizer: Use the stream buffer for constant buffers.Markus Wick2018-08-124-29/+32
| * | | | | | | gl_rasterizer: Use the streaming buffer itself for the constant buffer.Markus Wick2018-08-122-33/+15
| * | | | | | | gl_rasterizer: Use a helper for aligning the buffer.Markus Wick2018-08-122-15/+22
| * | | | | | | Update the stream_buffer helper from Citra.Markus Wick2018-08-124-184/+98
|/ / / / / / /
* | | | | | | Merge pull request #1029 from bunnei/fix-out-attribbunnei2018-08-121-2/+2
|\ \ \ \ \ \ \ | |/ / / / / / |/| | | | | |
| * | | | | | gl_shader_decompiler: Fix SetOutputAttributeToRegister empty check.bunnei2018-08-121-2/+2
|/ / / / / /
* | | | | | Merge pull request #922 from lioncash/cmakebunnei2018-08-121-6/+6
|\ \ \ \ \ \
| * | | | | | CMakeLists: lowercase find_library usageLioncash2018-08-121-1/+1
| * | | | | | CMakeLists: Change MSVC14 variable to MSVC_VERSIONLioncash2018-08-121-5/+5
* | | | | | | Merge pull request #1026 from ogniK5377/retro-city-rampagebunnei2018-08-121-1/+8
|\ \ \ \ \ \ \
| * | | | | | | Stub UpdateUserPresenceDavid Marcec2018-08-121-1/+8
| | |/ / / / / | |/| | | | |
* | | | | | | Merge pull request #1027 from bunnei/fix-kilbunnei2018-08-121-0/+8
|\ \ \ \ \ \ \ | |/ / / / / / |/| | | | | |
| * | | | | | gl_shader_decompiler: Fix GLSL compiler error with KIL instruction.bunnei2018-08-121-0/+8
|/ / / / / /
* | | | | | Merge pull request #1022 from bunnei/fix-splatbunnei2018-08-122-2/+103
|\ \ \ \ \ \
| * | | | | | friend: Stub DeclareCloseOnlinePlaySession.bunnei2018-08-121-1/+10
| * | | | | | friend: Fix CreateFriendService to return an IFriendService interface.bunnei2018-08-121-2/+86
| * | | | | | server_session: Provide more useful information and don't crash on bad IPC request.bunnei2018-08-121-0/+8
* | | | | | | Merge pull request #1020 from lioncash/namespacebunnei2018-08-1214-22/+44
|\ \ \ \ \ \ \
| * | | | | | | core: Namespace EmuWindowLioncash2018-08-1214-22/+44
| |/ / / / / /
* | | | | | | Merge pull request #1021 from lioncash/warnbunnei2018-08-121-1/+1
|\ \ \ \ \ \ \
| * | | | | | | gl_rasterizer: Silence implicit truncation warning in SetupShaders()Lioncash2018-08-121-1/+1
| |/ / / / / /
* | | | | | | Merge pull request #1024 from Subv/blend_glbunnei2018-08-122-0/+40
|\ \ \ \ \ \ \
| * | | | | | | GPU/Maxwell3D: Implemented an alternative set of blend factors.Subv2018-08-122-0/+40
| |/ / / / / /
* | | | | | | Merge pull request #1023 from Subv/invalid_attribsbunnei2018-08-122-1/+11
|\ \ \ \ \ \ \
| * | | | | | | RasterizerGL: Ignore invalid/unset vertex attributes.Subv2018-08-122-1/+11
| |/ / / / / /
* / / / / / / Implement R8_UINT RenderTargetFormat & PixelFormat (#1014)greggameplayer2018-08-124-55/+74
|/ / / / / /
* | | | | | Merge pull request #1010 from bunnei/unk-vert-attrib-shaderbunnei2018-08-122-10/+11
|\ \ \ \ \ \
| * | | | | | gl_shader_decompiler: Improve handling of unknown input/output attributes.bunnei2018-08-122-10/+11
* | | | | | | Merge pull request #1009 from bunnei/rg8-rgba8-snormbunnei2018-08-124-64/+93
|\ \ \ \ \ \ \
| * | | | | | | gl_rasterizer: Implement render target format RG8_SNORM.bunnei2018-08-124-8/+18
| * | | | | | | gl_rasterizer: Implement render target format RGBA8_SNORM.bunnei2018-08-124-64/+83
| |/ / / / / /
* | | | | | | Merge pull request #970 from DarkLordZach/loader-errorsbunnei2018-08-1217-179/+248
|\ \ \ \ \ \ \ | |_|/ / / / / |/| | | | | |
| * | | | | | game_list: Reorder error checksZach Hilman2018-08-101-2/+1
| * | | | | | loader: Add more descriptive errorsZach Hilman2018-08-1017-179/+249
* | | | | | | Merge pull request #1018 from Subv/ssy_syncbunnei2018-08-122-8/+38
|\ \ \ \ \ \ \ | |_|/ / / / / |/| | | | | |
| * | | | | | GPU/Shader: Don't predicate instructions that don't have a predicate field (SSY).Subv2018-08-112-2/+13
| * | | | | | GPU/Shaders: Implemented SSY and SYNC as a way to modify control flow during shader execution.Subv2018-08-111-6/+25
* | | | | | | Merge pull request #1016 from lioncash/videobunnei2018-08-118-35/+44
|\ \ \ \ \ \ \
| * | | | | | | video_core; Get rid of global g_toggle_framelimit_enabled variableLioncash2018-08-118-30/+44
| * | | | | | | renderer_base: Remove unused kFramebuffer enumerationLioncash2018-08-111-3/+0
| * | | | | | | video_core: Remove unused Renderer enumerationLioncash2018-08-111-2/+0
| | |_|_|_|_|/ | |/| | | | |
* | | | | | | Merge pull request #1003 from lioncash/varbunnei2018-08-112-4/+2
|\ \ \ \ \ \ \
| * | | | | | | video_core: Use variable template variants of type_traits interfaces where applicableLioncash2018-08-102-4/+2
* | | | | | | | Implement R16S & R16UI & R16I RenderTargetFormats & PixelFormats and more (R16_UNORM needed by Fate Extella) (#848)greggameplayer2018-08-114-19/+92
| |_|/ / / / / |/| | | | | |
* | | | | | | Merge pull request #1015 from lioncash/gamelistJames Rowe2018-08-111-13/+12
|\ \ \ \ \ \ \ | |_|/ / / / / |/| | | | | |
| * | | | | | qt/game_list: Resolve truncation warning within GameListItemPath's constructorLioncash2018-08-111-4/+4
| * | | | | | gt/game_list: Use std::array in GameListItemPath's data() functionLioncash2018-08-111-7/+8
| * | | | | | qt/game_list: Remove redundant base class constructor from initializer listLioncash2018-08-111-3/+1
|/ / / / / /
* | | | | | Merge pull request #1007 from MerryMage/dynarmicbunnei2018-08-101-0/+0
|\ \ \ \ \ \
| * | | | | | dynarmic: Update to 0118ee0MerryMage2018-08-101-0/+0
| | |/ / / / | |/| | | |
* | | | | | Merge pull request #1011 from bunnei/misc-vtx-fmtbunnei2018-08-101-0/+3
|\ \ \ \ \ \
| * | | | | | maxwell_to_gl: Implement VertexAttribute::Size::Size_8_8.bunnei2018-08-101-0/+1
| * | | | | | maxwell_to_gl: Implement VertexAttribute::Size::Size_32_32_32.bunnei2018-08-101-0/+2
|/ / / / / /
* | | | | | Merge pull request #1004 from lioncash/unusedbunnei2018-08-103-8/+6
|\ \ \ \ \ \
| * | | | | | gl_rasterizer_cache: Remove unused viewport parameter of GetFramebufferSurfaces()Lioncash2018-08-103-8/+6
| | |/ / / / | |/| | | |
* | | | | | Merge pull request #1008 from yuzu-emu/revert-697-disable-depth-cullbunnei2018-08-101-3/+1
|\ \ \ \ \ \
| * | | | | | Revert "gl_state: Temporarily disable culling and depth test."bunnei2018-08-101-3/+1
| | |/ / / / | |/| | | |
* | | | | | Merge pull request #1002 from bunnei/refactor-tex-fmtbunnei2018-08-105-181/+31
|\ \ \ \ \ \ | |/ / / / / |/| | | | |
| * | | | | textures: Refactor out for Texture/Depth FormatFromPixelFormat.bunnei2018-08-105-181/+31
|/ / / / /
* | | | | Merge pull request #995 from bunnei/gl-buff-boundsbunnei2018-08-101-10/+12
|\ \ \ \ \ | |/ / / / |/| | | |
| * | | | gl_rasterizer_cache: Add bounds checking for gl_buffer copies.bunnei2018-08-101-10/+12
* | | | | Merge pull request #997 from lioncash/const-funcbunnei2018-08-104-4/+4
|\ \ \ \ \
| * | | | | buffer_queue: Make reference parameter of SetPreallocatedBuffer constLioncash2018-08-092-2/+2
| * | | | | hle_ipc: Make WriteToOutgoingCommandBuffer()'s reference parameter constLioncash2018-08-092-2/+2
* | | | | | Merge pull request #989 from lioncash/logbunnei2018-08-102-0/+16
|\ \ \ \ \ \
| * | | | | | common/logging: Add missing service log categoriesLioncash2018-08-082-0/+16
* | | | | | | Merge pull request #990 from lioncash/entrybunnei2018-08-102-9/+12
|\ \ \ \ \ \ \
| * | | | | | | fsp_srv: Use std::string_view's copy() function instead of strncpy()Lioncash2018-08-092-8/+10
| * | | | | | | fsp_srv: Emplace entries first when building index instead of emplacing lastLioncash2018-08-091-2/+3
| |/ / / / / /
* | | | | | | Merge pull request #1001 from lioncash/reservebunnei2018-08-101-0/+2
|\ \ \ \ \ \ \
| * | | | | | | gl_shader_decompiler: Reserve element memory beforehand in BuildRegisterList()Lioncash2018-08-091-0/+2
* | | | | | | | Merge pull request #897 from DarkLordZach/vfs-accuracy-2bunnei2018-08-1021-129/+602
|\ \ \ \ \ \ \ \ | |_|_|_|/ / / / |/| | | | | | |
| * | | | | | | vfs: Fix documentationZach Hilman2018-08-092-2/+4
| * | | | | | | vfs: Fix typo in VfsFilesystem docsZach Hilman2018-08-092-4/+5
| * | | | | | | file_util: Use enum instead of bool for specifing path behaviorZach Hilman2018-08-094-24/+37
| * | | | | | | loader: Remove unused IdentifyFile overloadZach Hilman2018-08-092-12/+0
| * | | | | | | vfs: Use RealVfsFilesystem for fs-operations in RealVfsDirectoryZach Hilman2018-08-091-2/+10
| * | | | | | | file_sys: Add missing include in savedata_factoryZach Hilman2018-08-091-0/+1
| * | | | | | | core: Port core to VfsFilesystem for file accessZach Hilman2018-08-0912-22/+52
| * | | | | | | vfs: Add unreachable assert to file permissions converterZach Hilman2018-08-091-1/+3
| * | | | | | | vfs: Add RealVfsFilesystem implementationZach Hilman2018-08-092-81/+290
| * | | | | | | file_util: Add platform-specific slash option to SanitizePathZach Hilman2018-08-092-5/+16
| * | | | | | | vfs: Add VfsFilesystem interface and default implementationZach Hilman2018-08-092-3/+211
| * | | | | | | filesystem: Remove unnecessary if conditionsZach Hilman2018-08-091-1/+1
* | | | | | | | Merge pull request #991 from bunnei/ignore-macbunnei2018-08-101-4/+9
|\ \ \ \ \ \ \ \
| * | | | | | | | maxwell_3d: Ignore macros that have not been uploaded yet.bunnei2018-08-091-4/+9
| | |_|_|/ / / / | |/| | | | | |
* | | | | | | | Implement SNORM for BC5/DXN2 (#998)Khangaroo2018-08-102-38/+55
* | | | | | | | Merge pull request #999 from lioncash/mapbunnei2018-08-101-2/+4
|\ \ \ \ \ \ \ \ | |_|_|/ / / / / |/| | | | | | |
| * | | | | | | gl_rasterizer_cache: Avoid iterator invalidation issues within InvalidateRegion()Lioncash2018-08-091-2/+4
|/ / / / / / /
* | | | | | | Merge pull request #992 from bunnei/declr-predbunnei2018-08-091-4/+5
|\ \ \ \ \ \ \
| * | | | | | | gl_shader_decompiler: Declare predicates on use.bunnei2018-08-091-4/+5
| |/ / / / / /
* | | | | | | Merge pull request #994 from lioncash/constbunnei2018-08-091-7/+9
|\ \ \ \ \ \ \
| * | | | | | | gl_rasterizer_cache: Invert conditional in LoadGLBuffer()Lioncash2018-08-091-5/+5
| * | | | | | | gl_rasterizer_cache: Use std::vector::assign in LoadGLBuffer() for the non-tiled caseLioncash2018-08-091-4/+6
| * | | | | | | gl_rasterizer_cache: Make pointer const in LoadGLBuffer()Lioncash2018-08-091-1/+1
| |/ / / / / /
* | | | | | | Merge pull request #993 from bunnei/smo-vtx-ptsbunnei2018-08-091-0/+3
|\ \ \ \ \ \ \
| * | | | | | | maxwell_to_gl: Implement VertexAttribute::Size::Size_16_16_16_16.bunnei2018-08-091-0/+1
| * | | | | | | maxwell_to_gl: Implement PrimitiveTopology::Points.bunnei2018-08-091-0/+2
| |/ / / / / /
* | | | | | | Merge pull request #984 from bunnei/rt-nonebunnei2018-08-091-0/+5
|\ \ \ \ \ \ \
| * | | | | | | gl_rasterizer: Do not render when no render target is configured.bunnei2018-08-091-0/+5
* | | | | | | | Implement BC5/DXN2 (#996)Khangaroo2018-08-093-33/+45
* | | | | | | | Merge pull request #988 from lioncash/colorbunnei2018-08-091-19/+31
|\ \ \ \ \ \ \ \
| * | | | | | | | common/color: Remove unnecessary const qualifiers on return typesLioncash2018-08-081-7/+7
| * | | | | | | | common/color: Get rid of undefined behaviorLioncash2018-08-081-12/+24
| | |_|_|/ / / / | |/| | | | | |
* | | | | | | | Merge pull request #977 from bunnei/bgr565bunnei2018-08-092-0/+4
|\ \ \ \ \ \ \ \
| * | | | | | | | gl_rasterizer_cached: Implement RenderTargetFormat::B5G6R5_UNORM.bunnei2018-08-082-0/+4
* | | | | | | | | Merge pull request #987 from lioncash/vecbunnei2018-08-091-3/+3
|\ \ \ \ \ \ \ \ \ | |_|_|_|/ / / / / |/| | | | | | | |
| * | | | | | | | vector_math: Use variable template version of is_signed in Vec classesLioncash2018-08-081-3/+3
| | |/ / / / / / | |/| | | | | |
* | | | | | | | Merge pull request #982 from bunnei/stub-unk-63bunnei2018-08-092-0/+9
|\ \ \ \ \ \ \ \
| * | | | | | | | gl_shader_decompiler: Stub input attribute Unknown_63.bunnei2018-08-082-0/+9
| | |/ / / / / / | |/| | | | | |
* | | | | | | | Merge pull request #986 from mailwl/acc-loadimagebunnei2018-08-091-1/+22
|\ \ \ \ \ \ \ \ | |_|_|_|/ / / / |/| | | | | | |
| * | | | | | | Service/Account: stub LoadImage functionmailwl2018-08-081-1/+22
| | |_|_|_|_|/ | |/| | | | |
* | | | | | | Merge pull request #976 from bunnei/shader-immbunnei2018-08-092-11/+6
|\ \ \ \ \ \ \
| * | | | | | | gl_shader_decompiler: Let OpenGL interpret floats.bunnei2018-08-082-11/+6
| | |/ / / / / | |/| | | | |
* | | | | | | Merge pull request #981 from bunnei/cbuf-corruptbunnei2018-08-094-3/+12
|\ \ \ \ \ \ \
| * | | | | | | maxwell_3d: Use correct const buffer size and check bounds.bunnei2018-08-084-3/+12
| |/ / / / / /
* | | | | | | Merge pull request #978 from bunnei/fixioctlbunnei2018-08-091-1/+1
|\ \ \ \ \ \ \ | |_|_|_|/ / / |/| | | | | |
| * | | | | | nvhost_gpu: Don't over copy IoctlSubmitGpfifo.bunnei2018-08-081-1/+1
| |/ / / / /
* | | | | | Merge pull request #985 from bunnei/rt-r11g11b10bunnei2018-08-091-0/+1
|\ \ \ \ \ \
| * | | | | | gpu: Add R11G11B10_FLOAT to RenderTargetBytesPerPixel.bunnei2018-08-081-0/+1
| |/ / / / /
* | | | | | Merge pull request #979 from bunnei/vtx88bunnei2018-08-091-0/+1
|\ \ \ \ \ \
| * | | | | | maxwell_to_gl: Implement VertexAttribute::Size::Size_8_8.bunnei2018-08-081-0/+1
| |/ / / / /
* | | | | | Merge pull request #975 from bunnei/am-stubbunnei2018-08-082-1/+9
|\ \ \ \ \ \
| * | | | | | am: Stub SetScreenShotImageOrientation.bunnei2018-08-082-1/+9
| |/ / / / /
* | | | | | Merge pull request #980 from bunnei/fix-logsbunnei2018-08-082-2/+2
|\ \ \ \ \ \ | |_|_|/ / / |/| | | | |
| * | | | | renderer_opengl: Use trace log in a few places.bunnei2018-08-082-2/+2
| |/ / / /
* | | | | Merge pull request #966 from lioncash/modernizebunnei2018-08-085-11/+11
|\ \ \ \ \
| * | | | | common: Convert type traits templates over to variable template versions where applicableLioncash2018-08-085-11/+11
* | | | | | Merge pull request #850 from DarkLordZach/icon-metabunnei2018-08-0825-21/+491
|\ \ \ \ \ \
| * | | | | | configure_gamelist: Use explicit QVariant constructorZach Hilman2018-08-071-2/+4
| * | | | | | loader: Add icon and title support to XCIZach Hilman2018-08-077-5/+46
| * | | | | | Fix missing qjpeg DLLZach Hilman2018-08-072-0/+7
| * | | | | | Use const where applicableZach Hilman2018-08-074-7/+7
| * | | | | | Avoid parsing RomFS to directory in NCAZach Hilman2018-08-0718-19/+439
* | | | | | | Merge pull request #968 from lioncash/vecbunnei2018-08-081-180/+182
|\ \ \ \ \ \ \
| * | | | | | | vector_math: Remove unimplemented function prototypesLioncash2018-08-081-23/+0
| * | | | | | | vector_math: Make functions constexpr where applicableLioncash2018-08-081-154/+179
| * | | | | | | vector_math: Convert typedefs to type aliasesLioncash2018-08-081-3/+3
| | |/ / / / / | |/| | | | |
* | | | | | | Merge pull request #969 from lioncash/lz4bunnei2018-08-081-1/+1
|\ \ \ \ \ \ \
| * | | | | | | externals/CMakeLists: Add EXCLUDE_FROM_ALL to lz4's add_subdirectory() commandLioncash2018-08-081-1/+1
* | | | | | | | Merge pull request #958 from lioncash/nv-globalbunnei2018-08-085-11/+22
|\ \ \ \ \ \ \ \ | |_|_|_|_|/ / / |/| | | | | | |
| * | | | | | | nvdrv: Get rid of global std::weak_ptrLioncash2018-08-085-11/+22
| | |/ / / / / | |/| | | | |
* | | | | | | Merge pull request #972 from lioncash/catchbunnei2018-08-085-4/+4
|\ \ \ \ \ \ \
| * | | | | | | externals: Update catch to 2.3.0Lioncash2018-08-085-4/+4
| | |_|_|/ / / | |/| | | | |
* | | | | | | Merge pull request #965 from lioncash/unused-filesbunnei2018-08-083-126/+0
|\ \ \ \ \ \ \
| * | | | | | | hle: Remove unused romfs.cpp/.hLioncash2018-08-083-126/+0
| | |/ / / / / | |/| | | | |
* | | | | | | Merge pull request #974 from lioncash/accbunnei2018-08-082-2/+2
|\ \ \ \ \ \ \
| * | | | | | | acc: Add missing function table entries for GetUserCountLioncash2018-08-082-2/+2
* | | | | | | | Merge pull request #983 from mailwl/hid-fixMat M2018-08-081-1/+1
|\ \ \ \ \ \ \ \ | |/ / / / / / / |/| | | | | | |
| * | | | | | | hid: fix IsSixAxisSensorAtRest() responsemailwl2018-08-081-1/+1
|/ / / / / / /
* | | | | | | acc: Stub GetUserCount. (#973)bunnei2018-08-083-1/+9
* | | | | | | Merge pull request #967 from lioncash/signbunnei2018-08-081-4/+8
|\ \ \ \ \ \ \ | |/ / / / / / |/| | | | | |
| * | | | | | file_util: Avoid sign-conversions in WriteArray() and ReadArray()Lioncash2018-08-071-4/+8
* | | | | | | Merge pull request #971 from DarkLordZach/mbedtls-2.12.0bunnei2018-08-081-0/+0
|\ \ \ \ \ \ \ | |_|/ / / / / |/| | | | | |
| * | | | | | externals/mbedtls: Update to mbedtls v2.12.0Zach Hilman2018-08-081-0/+0
|/ / / / / /
* | | | | | Merge pull request #964 from Hexagon12/lower-logsbunnei2018-08-081-4/+4
|\ \ \ \ \ \
| * | | | | | Lowered down the logging for methodsHexagon122018-08-071-4/+4
* | | | | | | Fixed the sRGB pixel format (#963)Hexagon122018-08-081-1/+2
| |_|/ / / / |/| | | | |
* | | | | | Merge pull request #920 from DarkLordZach/titlekeybunnei2018-08-072-7/+39
|\ \ \ \ \ \
| * | | | | | content_archive: Add support for titlekey cryptographyZach Hilman2018-08-042-7/+39
* | | | | | | Merge pull request #957 from lioncash/eventbunnei2018-08-071-1/+1
|\ \ \ \ \ \ \
| * | | | | | | nvflinger: Correct typo in name of composition eventLioncash2018-08-071-1/+1
| | |_|_|/ / / | |/| | | | |
* | | | | | | Merge pull request #954 from lioncash/hidbunnei2018-08-071-0/+1
|\ \ \ \ \ \ \
| * | | | | | | services/hid: Add ActivateNpadWithRevision() to the hid function info arrayLioncash2018-08-071-0/+1
| |/ / / / / /
* | | | | | | Merge pull request #960 from lioncash/apmbunnei2018-08-073-0/+34
|\ \ \ \ \ \ \
| * | | | | | | service/apm: Add the apm:sys serviceLioncash2018-08-073-0/+34
| |/ / / / / /
* | | | | | | Merge pull request #950 from lioncash/hotkeybunnei2018-08-078-119/+159
|\ \ \ \ \ \ \
| * | | | | | | qt/hotkey: Get rid of global hotkey map instanceLioncash2018-08-078-119/+159
| |/ / / / / /
* | | | | | | Merge pull request #948 from hcorion/fix-mbedtls-installing-filesbunnei2018-08-072-2/+2
|\ \ \ \ \ \ \
| * | | | | | | Make mbedtls and cubeb not install headers and librariesZion Nimchuk2018-08-072-2/+2
* | | | | | | | Merge pull request #955 from lioncash/viewbunnei2018-08-072-3/+10
|\ \ \ \ \ \ \ \
| * | | | | | | | nvflinger: Get rid of indirect inclusionsLioncash2018-08-072-1/+7
| * | | | | | | | nvflinger: Use std::string_view in OpenDisplay()Lioncash2018-08-072-2/+3
| | |/ / / / / / | |/| | | | | |
* | | | | | | | Merge pull request #953 from lioncash/timebunnei2018-08-071-2/+2
|\ \ \ \ \ \ \ \
| * | | | | | | | service/time: Amend command IDs of ToPosixTime() and ToPosixTimeWithMyRule()Lioncash2018-08-071-2/+2
| |/ / / / / / /
* | | | | | | | Merge pull request #959 from KAMiKAZOW/cubeb-compilationbunnei2018-08-071-2/+2
|\ \ \ \ \ \ \ \
| * | | | | | | | Make building cubeb optionalKAMiKAZOW2018-08-071-2/+2
| |/ / / / / / /
* | | | | | | | Merge pull request #956 from lioncash/nvbunnei2018-08-0713-16/+18
|\ \ \ \ \ \ \ \ | |_|_|_|_|/ / / |/| | | | | | |
| * | | | | | | nvdrv: Make Ioctl()'s definition match its prototypeLioncash2018-08-071-1/+1
| * | | | | | | nvdrv: Get rid of indirect inclusionsLioncash2018-08-0712-15/+17
| |/ / / / / /
* | | | | | | Merge pull request #952 from lioncash/usbbunnei2018-08-076-0/+259
|\ \ \ \ \ \ \
| * | | | | | | service: Add usb servicesLioncash2018-08-076-0/+259
| |/ / / / / /
* | | | | | | Merge pull request #949 from lioncash/privbunnei2018-08-073-7/+21
|\ \ \ \ \ \ \
| * | | | | | | client_port: Make all data members privateLioncash2018-08-073-7/+21
| |/ / / / / /
* | | | | | | Merge pull request #951 from lioncash/gladbunnei2018-08-072-3190/+3218
|\ \ \ \ \ \ \
| * | | | | | | externals: Update glad to 0.1.26Lioncash2018-08-072-3190/+3218
| |/ / / / / /
* | | | | | | Merge pull request #961 from DarkLordZach/nca-as-drd-scopebunnei2018-08-071-1/+1
|\ \ \ \ \ \ \ | |/ / / / / / |/| | | | | |
| * | | | | | loader: Fix scope error in DeconstructedRomDirectoryZach Hilman2018-08-071-1/+1
|/ / / / / /
* | | | | | Merge pull request #931 from DarkLordZach/nca-as-drdbunnei2018-08-074-37/+24
|\ \ \ \ \ \
| * | | | | | loader: Make AppLoader_NCA rely on directory loading codeZach Hilman2018-08-064-37/+24
| | |_|_|/ / | |/| | | |
* | | | | | Merge pull request #947 from lioncash/encodingbunnei2018-08-071-13/+17
|\ \ \ \ \ \
| * | | | | | game_list: Remove unnecessary conversion to std::string in ValidateEntry()Lioncash2018-08-061-8/+10
| * | | | | | game_list: Use QString::fromStdString() where applicable instead of c_str()Lioncash2018-08-061-5/+7
* | | | | | | GDBStub works with both Unicorn and Dynarmic now (#941)Hedges2018-08-075-9/+26
* | | | | | | Merge pull request #943 from lioncash/declbunnei2018-08-071-7/+7
|\ \ \ \ \ \ \
| * | | | | | | game_list: Join declarations and assignments in onTextChanged()Lioncash2018-08-061-7/+7
| |/ / / / / /
* | | | | | | Merge pull request #946 from lioncash/compressbunnei2018-08-071-10/+8
|\ \ \ \ \ \ \
| * | | | | | | qt/main: Avoid sign conversions in UpdateRecentFiles()Lioncash2018-08-061-4/+6
| * | | | | | | qt/main: Collapse if statement in UpdateRecentFiles()Lioncash2018-08-061-6/+2
| |/ / / / / /
* | | | | | | Merge pull request #944 from lioncash/menubunnei2018-08-071-2/+8
|\ \ \ \ \ \ \
| * | | | | | | qt: Don't show error dialog when canceling the Load Folder dialogLioncash2018-08-061-2/+8
| |/ / / / / /
* | | | | | | Merge pull request #942 from lioncash/defaultbunnei2018-08-0714-24/+26
|\ \ \ \ \ \ \ | |_|_|/ / / / |/| | | | | |
| * | | | | | qt/game_list_p: Remove redundant base class constructor invocationsLioncash2018-08-061-1/+2
| * | | | | | qt: Add missing override specifiers where applicableLioncash2018-08-065-7/+9
| * | | | | | qt: Default destructors where applicableLioncash2018-08-069-16/+15
| |/ / / / /
* | | | | | Merge pull request #940 from lioncash/privatebunnei2018-08-072-5/+9
|\ \ \ \ \ \
| * | | | | | kernel/event: Make data members privateLioncash2018-08-062-5/+9
| |/ / / / /
* | | | | | Merge pull request #936 from bunnei/avoid-copiesbunnei2018-08-073-6/+21
|\ \ \ \ \ \
| * | | | | | maxwell_3d: Remove outdated assert.bunnei2018-08-061-2/+0
| * | | | | | gl_rasterizer_cache: Avoid superfluous surface copies.bunnei2018-08-062-4/+21
* | | | | | | Merge pull request #934 from lioncash/chronobunnei2018-08-074-16/+16
|\ \ \ \ \ \ \
| * | | | | | | perf_stats: Correct literal used for MAX_LAG_TIME_USLioncash2018-08-061-2/+2
| * | | | | | | core_timing: Make GetGlobalTimeUs() return std::chrono::microsecondsLioncash2018-08-064-14/+14
| | |_|/ / / / | |/| | | | |
* | | | | | | Merge pull request #945 from lioncash/existJames Rowe2018-08-061-8/+6
|\ \ \ \ \ \ \ | |_|_|/ / / / |/| | | | | |
| * | | | | | qt/main: Better file-existence checking within OnMenuRecentFile() and UpdateUITheme()Lioncash2018-08-061-8/+6
|/ / / / / /
* | | | | | Merge pull request #933 from lioncash/memorybunnei2018-08-061-12/+11
|\ \ \ \ \ \
| * | | | | | memory: Make prototype parameter names match their definitionsLioncash2018-08-061-5/+5
| * | | | | | memory: Correct prototype of ZeroBlockLioncash2018-08-061-1/+1
| * | | | | | memory: Remove unnecessary const qualifiers in prototypesLioncash2018-08-061-9/+8
| |/ / / / /
* | | | | | Merge pull request #937 from mailwl/audout-fixMat M2018-08-061-2/+0
|\ \ \ \ \ \ | |_|/ / / / |/| | | | |
| * | | | | Service/Audio: audout_a.cpp: remove pragma oncemailwl2018-08-061-2/+0
|/ / / / /
* | | | | Merge pull request #932 from lioncash/funcbunnei2018-08-062-9/+9
|\ \ \ \ \
| * | | | | core_timing: Convert typedef into a type aliasLioncash2018-08-061-4/+4
| * | | | | core_timing: Use transparent functors where applicableLioncash2018-08-061-5/+5
| |/ / / /
* | | | | Merge pull request #929 from lioncash/addrbunnei2018-08-062-83/+89
|\ \ \ \ \
| * | | | | gdbstub: Use type alias for breakpoint mapsLioncash2018-08-051-37/+42
| * | | | | gdbstub: Move all file-static variables into the GDBStub namespaceLioncash2018-08-051-35/+36
| * | | | | gdbstub: Replace PAddr alias with VAddrLioncash2018-08-052-14/+14
* | | | | | Merge pull request #930 from lioncash/threadbunnei2018-08-061-15/+15
|\ \ \ \ \ \
| * | | | | | address_arbiter: Return by value from GetThreadsWaitingOnAddress()Lioncash2018-08-051-15/+15
| |/ / / / /
* | | | | | Merge pull request #925 from bunnei/audrenbunnei2018-08-0619-294/+652
|\ \ \ \ \ \ | |_|/ / / / |/| | | | |
| * | | | | audio_core: Implement audren_u audio playback.bunnei2018-08-055-218/+451
| * | | | | audio_core: Use s16 where possible for audio samples.bunnei2018-08-059-36/+27
| * | | | | audio_core: Port codec code from Citra for ADPCM decoding.bunnei2018-08-055-11/+126
| * | | | | cubeb_sink: Support variable sample_rate and num_channels.bunnei2018-08-041-15/+25
| * | | | | audio_core: Sinks need unique names as well.bunnei2018-08-045-9/+14
| * | | | | audio_core: Streams need unique names for CoreTiming.bunnei2018-08-045-10/+14
| | |/ / / | |/| | |
* | | | | Merge pull request #927 from bunnei/fix-texsbunnei2018-08-051-2/+5
|\ \ \ \ \
| * | | | | gl_shader_decompiler: Fix TEXS mask and dest.bunnei2018-08-051-2/+5
* | | | | | Merge pull request #912 from lioncash/global-varbunnei2018-08-0519-80/+110
|\ \ \ \ \ \ | |_|_|/ / / |/| | | | |
| * | | | | renderer_base: Make Rasterizer() return the rasterizer by referenceLioncash2018-08-045-11/+15
| * | | | | video_core: Eliminate the g_renderer global variableLioncash2018-08-0419-74/+100
* | | | | | Merge pull request #928 from MerryMage/dynarmicMat M2018-08-051-0/+0
|\ \ \ \ \ \ | |_|/ / / / |/| | | | |
| * | | | | externals: Update dynarmic to 4f96c63MerryMage2018-08-051-0/+0
|/ / / / /
* | | | | Merge pull request #926 from ogniK5377/vertex-attrib-formatbunnei2018-08-051-2/+8
|\ \ \ \ \
| * | | | | added braces for conditionsDavid Marcec2018-08-051-2/+3
| * | | | | fix the attrib format for intsDavid Marcec2018-08-051-2/+7
| | |/ / / | |/| | |
* | | | | Merge pull request #924 from lioncash/arpbunnei2018-08-056-0/+97
|\ \ \ \ \
| * | | | | service: Add arp servicesLioncash2018-08-056-0/+97
| |/ / / /
* | | | | Merge pull request #921 from lioncash/viewbunnei2018-08-055-35/+35
|\ \ \ \ \
| * | | | | aes_util: Add static assertion to Transcode() and XTSTranscode() to ensure well-defined behaviorLioncash2018-08-041-0/+4
| * | | | | aes_util: Make CalculateNintendoTweak() an internally linked functionLioncash2018-08-042-12/+10
| * | | | | aes_util: Make Transcode() a const member functionLioncash2018-08-042-8/+9
| * | | | | core/crypto: Remove unnecessary includesLioncash2018-08-044-5/+5
| * | | | | key_manager: Use regular std::string instead of std::string_viewLioncash2018-08-042-10/+7
| |/ / / /
* | | | | Merge pull request #923 from lioncash/pragmabunnei2018-08-055-10/+0
|\ \ \ \ \ | |/ / / / |/| | | |
| * | | | service: Remove redundant #pragma once directivesLioncash2018-08-045-10/+0
|/ / / /
* | | | Merge pull request #849 from DarkLordZach/xcibunnei2018-08-0439-80/+1404
|\ \ \ \
| * | | | Add missing parameter to files.push_back()Zach Hilman2018-08-011-5/+5
| * | | | Fix merge conflicts with opus and update docsZach Hilman2018-08-015-11/+13
| * | | | Use more descriptive error codes and messagesZach Hilman2018-08-019-34/+101
| * | | | Use static const instead of const staticZach Hilman2018-08-011-2/+2
| * | | | Use ErrorEncrypted where applicable and fix no keys crashZach Hilman2018-08-014-17/+37
| * | | | Add missing includes and use const where applicableZach Hilman2018-08-0111-24/+40
| * | | | Allow key loading from %YUZU_DIR%/keys in addition to ~/.switchZach Hilman2018-08-015-7/+23
| * | | | Use SHGetKnownFolderPath instead of SHGetFolderPathAZach Hilman2018-08-011-3/+4
| * | | | Make XCI comply to review and style guidelinesZach Hilman2018-08-0116-482/+223
| * | | | Extract mbedtls to cpp fileZach Hilman2018-08-015-87/+127
| * | | | Add missing string.h includeZach Hilman2018-08-011-0/+1
| * | | | Update mbedtls and fix compile errorZach Hilman2018-08-012-0/+1
| * | | | Remove files that are not usedZach Hilman2018-08-0136-43/+1462
* | | | | Merge pull request #919 from lioncash/signbunnei2018-08-041-8/+9
|\ \ \ \ \ | |_|/ / / |/| | | |
| * | | | gl_shader_manager: Invert conditional in SetShaderUniformBlockBinding()Lioncash2018-08-041-7/+9
| * | | | gl_shader_manager: Amend sign differences in an assertion comparison in SetShaderUniformBlockBinding()Lioncash2018-08-041-3/+2
* | | | | Merge pull request #911 from lioncash/prototypebunnei2018-08-041-3/+0
|\ \ \ \ \
| * | | | | video_core: Remove unimplemented Start() function prototypeLioncash2018-08-031-3/+0
* | | | | | Merge pull request #913 from lioncash/unused-funcbunnei2018-08-041-16/+0
|\ \ \ \ \ \
| * | | | | | memory: Remove unused GetSpecialHandlers() functionLioncash2018-08-031-16/+0
| | |/ / / / | |/| | | |
* | | | | | Merge pull request #914 from lioncash/codesetbunnei2018-08-045-20/+41
|\ \ \ \ \ \
| * | | | | | kernel/process: Use std::array where applicableLioncash2018-08-031-1/+2
| * | | | | | kernel/process: Use accessors instead of class members for referencing segment arrayLioncash2018-08-035-20/+40
| |/ / / / /
* | | | | | Merge pull request #917 from lioncash/crashbunnei2018-08-043-13/+38
|\ \ \ \ \ \
| * | | | | | kernel/thread: Fix potential crashes introduced in 26de4bb521b1ace7af76eff4f6956cb23ac0d58cLioncash2018-08-043-13/+38
| |/ / / / /
* | | | | | Merge pull request #910 from lioncash/unusedbunnei2018-08-031-2/+0
|\ \ \ \ \ \ | |/ / / / / |/| | | | |
| * | | | | gl_shader_decompiler: Remove unused variable in GenerateDeclarations()Lioncash2018-08-031-2/+0
| |/ / / /
* | | | | Merge pull request #908 from lioncash/memorybunnei2018-08-0316-559/+29
|\ \ \ \ \
| * | | | | core/memory: Get rid of 3DS leftoversLioncash2018-08-0316-559/+29
* | | | | | Merge pull request #909 from lioncash/constbunnei2018-08-031-1/+1
|\ \ \ \ \ \ | |_|/ / / / |/| | | | |
| * | | | | gl_shader_manager: Make ProgramManager's GetCurrentProgramStage() a const member functionLioncash2018-08-031-1/+1
|/ / / / /
* | | | | Added ability to change username & language code in the settings ui. Added IProfile::Get and SET::GetLanguageCode for libnx tests (#851)David2018-08-039-8/+95
* | | | | Merge pull request #895 from lioncash/sinkbunnei2018-08-031-5/+8
|\ \ \ \ \
| * | | | | sink_details: Deduplicate long std::function repetitionLioncash2018-08-021-4/+6
| * | | | | sink_details: std::move std::function instancesLioncash2018-08-021-1/+2
* | | | | | Merge pull request #898 from lioncash/migbunnei2018-08-036-0/+55
|\ \ \ \ \ \
| * | | | | | service: Add migration servicesLioncash2018-08-026-0/+55
* | | | | | | Merge pull request #900 from lioncash/initbunnei2018-08-031-5/+5
|\ \ \ \ \ \ \ | |_|_|/ / / / |/| | | | | |
| * | | | | | math_util: Always initialize members of RectangleLioncash2018-08-021-5/+5
| |/ / / / /
* | | | | | Merge pull request #892 from lioncash/globalbunnei2018-08-0313-64/+54
|\ \ \ \ \ \
| * | | | | | video_core: Make global EmuWindow instance part of the base renderer classLioncash2018-08-0213-64/+54
* | | | | | | Merge pull request #894 from lioncash/objectbunnei2018-08-0344-156/+186
|\ \ \ \ \ \ \
| * | | | | | | kernel: Move object class to its own source filesLioncash2018-08-0244-156/+186
| | |_|/ / / / | |/| | | | |
* | | | | | | Merge pull request #904 from lioncash/staticbunnei2018-08-031-8/+6
|\ \ \ \ \ \ \
| * | | | | | | kernel/thread: Make GetFreeThreadLocalSlot()'s loop indices size_tLioncash2018-08-021-8/+5
| * | | | | | | kernel/thread: Make GetFreeThreadLocalSlot() reference parameter a const referenceLioncash2018-08-021-1/+2
| * | | | | | | kernel/thread: Make GetFreeThreadLocalSlot() internally linkedLioncash2018-08-021-1/+1
| | |_|/ / / / | |/| | | | |
* | | | | | | Merge pull request #906 from lioncash/overridebunnei2018-08-033-19/+8
|\ \ \ \ \ \ \
| * | | | | | | input_common: Use std::move where applicableLioncash2018-08-032-5/+6
| * | | | | | | input_common: Add missing override specifiersLioncash2018-08-033-14/+2
| |/ / / / / /
* | | | | | | Merge pull request #907 from lioncash/slotbunnei2018-08-037-46/+49
|\ \ \ \ \ \ \
| * | | | | | | yuzu: Use Qt 5 signal/slots where applicableLioncash2018-08-037-46/+49
| |/ / / / / /
* | | | | | | Merge pull request #905 from lioncash/vmabunnei2018-08-033-23/+23
|\ \ \ \ \ \ \
| * | | | | | | kernel/vm_manager: Convert loop into std::any_of()Lioncash2018-08-021-4/+4
| * | | | | | | kernel/vm_manager: Use const where applicableLioncash2018-08-023-19/+19
| * | | | | | | kernel/vm_manager: Use the VAddr type alias in CarveVMA()Lioncash2018-08-021-2/+2
| |/ / / / / /
* | | | | | | Merge pull request #903 from lioncash/copybunnei2018-08-031-3/+6
|\ \ \ \ \ \ \
| * | | | | | | vfs_vector: Remove unused variable in FindAndRemoveVectorElement()Lioncash2018-08-021-2/+2
| * | | | | | | vfs_vector: Avoid unnecessary copies where applicableLioncash2018-08-021-2/+5
| |/ / / / / /
* | | | | | | Merge pull request #901 from lioncash/refbunnei2018-08-031-2/+2
|\ \ \ \ \ \ \
| * | | | | | | gl_shader_manager: Take ShaderSetup instances by const reference in UseProgrammableVertexShader() and UseProgrammableFragmentShader()Lioncash2018-08-021-2/+2
| |/ / / / / /
* | | | | | | Merge pull request #899 from lioncash/unusedbunnei2018-08-027-334/+0
|\ \ \ \ \ \ \
| * | | | | | | hw: Remove unused filesLioncash2018-08-027-334/+0
| |/ / / / / /
* | | | | | | Merge pull request #902 from lioncash/arraybunnei2018-08-021-2/+3
|\ \ \ \ \ \ \
| * | | | | | | gl_state: Make texture_units a std::arrayLioncash2018-08-021-2/+3
| |/ / / / / /
* | | | | | | Merge pull request #891 from lioncash/nsbunnei2018-08-021-0/+447
|\ \ \ \ \ \ \
| * | | | | | | service/ns: Add missing ns servicesLioncash2018-08-021-0/+447
| | |_|/ / / / | |/| | | | |
* | | | | | | Implement RGB32F PixelFormat (#886) (used by Go Vacation)greggameplayer2018-08-023-9/+23
* | | | | | | Merge pull request #893 from lioncash/pscbunnei2018-08-026-1/+99
|\ \ \ \ \ \ \ | |_|/ / / / / |/| | | | | |
| * | | | | | logging/log: Remove incorrect description in PCV doc commentLioncash2018-08-021-1/+1
| * | | | | | service: Add psc servicesLioncash2018-08-026-0/+98
| | |/ / / / | |/| | | |
* | | | | | Merge pull request #896 from lioncash/audio-outbunnei2018-08-022-2/+2
|\ \ \ \ \ \ | |/ / / / / |/| | | | |
| * | | | | audio_out: Use Buffer::Tag alias in GetTagsAndReleaseBuffers()'s prototypeLioncash2018-08-022-2/+2
|/ / / / /
* | | | | Merge pull request #888 from lioncash/capsbunnei2018-08-026-0/+173
|\ \ \ \ \
| * | | | | service: Add capture servicesLioncash2018-08-016-0/+173
| |/ / / /
* | | | | Merge pull request #890 from lioncash/loggerbunnei2018-08-021-4/+4
|\ \ \ \ \
| * | | | | lm: Amend name of ILoggerLioncash2018-08-011-4/+4
| |/ / / /
* | | | | Merge pull request #889 from lioncash/fspbunnei2018-08-026-0/+89
|\ \ \ \ \
| * | | | | service/filesystem: Add fsp:ldr and fsp:pr servicesLioncash2018-08-016-0/+89
| |/ / / /
* | | | | Merge pull request #887 from lioncash/pcvbunnei2018-08-028-0/+183
|\ \ \ \ \ | |/ / / / |/| | | |
| * | | | service: Add bpc and pcv servicesLioncash2018-08-018-0/+183
|/ / / /
* | | | Merge pull request #885 from greggameplayer/R32-Floatbunnei2018-08-013-0/+5
|\ \ \ \
| * | | | Implement R32_FLOAT RenderTargetFormatUnknown2018-08-013-0/+5
|/ / / /
* | | | Merge pull request #882 from lioncash/unusedbunnei2018-08-011-6/+0
|\ \ \ \ | |/ / / |/| | |
| * | | kernel/thread: Remove unimplemented function prototypeLioncash2018-08-011-6/+0
* | | | Merge pull request #871 from bunnei/audio-configbunnei2018-08-0112-21/+330
|\ \ \ \ | |/ / / |/| | |
| * | | audio_core: Add configuration settings.bunnei2018-08-0112-21/+330
* | | | Merge pull request #877 from lioncash/removebunnei2018-08-016-104/+0
|\ \ \ \
| * | | | kernel: Remove unused object_address_table.cpp/.hLioncash2018-07-316-104/+0
* | | | | Merge pull request #880 from lioncash/audiobunnei2018-08-0114-2/+289
|\ \ \ \ \ | |_|/ / / |/| | | |
| * | | | service/audio: Add missing servicesLioncash2018-08-0114-2/+289
* | | | | Merge pull request #876 from lioncash/includebunnei2018-08-0123-28/+47
|\ \ \ \ \
| * | | | | kernel: Remove unnecessary includesLioncash2018-07-3123-28/+47
| | |/ / / | |/| | |
* | | | | Merge pull request #879 from lioncash/audiobunnei2018-08-011-1/+1
|\ \ \ \ \ | |_|/ / / |/| | | |
| * | | | audout_u: Remove std::move in OpenAudioOutImpl()Lioncash2018-07-311-1/+1
* | | | | Merge pull request #864 from FearlessTobi/port-3973bunnei2018-07-311-2/+30
|\ \ \ \ \
| * | | | | remove polymorphism issueB3n302018-07-291-2/+30
* | | | | | Merge pull request #869 from Subv/ubsanbunnei2018-07-314-8/+23
|\ \ \ \ \ \
| * | | | | | MacroInterpreter: Avoid left shifting negative values.Subv2018-07-312-2/+6
| * | | | | | nvhost_gpu: Added checks to ensure we don't read past the end of the entries when handling a GPU command list.Subv2018-07-311-3/+6
| * | | | | | nvhost_ctrl_gpu: Only read the input parameters if they are actually there.Subv2018-07-311-3/+11
| | |_|_|_|/ | |/| | | |
* | | | | | Merge pull request #875 from lioncash/fgmbunnei2018-07-316-0/+96
|\ \ \ \ \ \
| * | | | | | service: Add fgm servicesLioncash2018-07-316-0/+96
| | |_|_|/ / | |/| | | |
* | | | | | Merge pull request #874 from lioncash/ambunnei2018-07-318-0/+156
|\ \ \ \ \ \ | |_|_|_|/ / |/| | | | |
| * | | | | service/am: Add missing am servicesLioncash2018-07-318-0/+156
| |/ / / /
* | | | | Merge pull request #870 from lioncash/initbunnei2018-07-311-9/+7
|\ \ \ \ \
| * | | | | arm_dynarmic: Make SetTlsAddress() prototype and definition consistentLioncash2018-07-311-1/+1
| * | | | | arm_dynarmic: Remove unnecessary qualifying of ThreadContextLioncash2018-07-311-3/+3
| * | | | | arm_dynarmic: Correct initializer list orderLioncash2018-07-311-5/+3
| |/ / / /
* | | | | Merge pull request #872 from lioncash/pciebunnei2018-07-316-0/+85
|\ \ \ \ \ | |/ / / / |/| | | |
| * | | | service: Add the pcie serviceLioncash2018-07-316-0/+85
|/ / / /
* | | | Merge pull request #855 from bunnei/cubebbunnei2018-07-3121-39/+473
|\ \ \ \
| * | | | audio_core: Implement Sink and SinkStream interfaces with cubeb.bunnei2018-07-3110-6/+269
| * | | | audio_core: Add interfaces for Sink and SinkStream.bunnei2018-07-316-0/+163
| * | | | audio_core: Misc. improvements to stream/buffer/audio_out.bunnei2018-07-315-20/+32
| * | | | audio_core: Move to audout_u impl.bunnei2018-07-314-13/+6
| * | | | externals: Add cubeb for audio output.bunnei2018-07-312-0/+3
* | | | | Port #3758 from Citra (#852): Add missing std::string import in text_formatterTobias2018-07-311-0/+1
|/ / / /
* | | | Implemented various hwopus functions (#853)David2018-07-316-6/+139
* | | | Merge pull request #861 from FearlessTobi/port-3972bunnei2018-07-302-81/+31
|\ \ \ \
| * | | | Port #3972 from Citra: "common/timer: use std::chrono, avoid platform-dependent code"zhupengfei2018-07-292-81/+31
| | |/ / | |/| |
* | | | Merge pull request #862 from FearlessTobi/port-3997bunnei2018-07-301-3/+5
|\ \ \ \
| * | | | common/string_utils: replace boost::transform with std counterpartzhupengfei2018-07-291-3/+5
| |/ / /
* | | | Merge pull request #867 from MerryMage/dynarmicMat M2018-07-301-0/+0
|\ \ \ \
| * | | | externals: Update dynarmic to 73d3efcMerryMage2018-07-301-0/+0
|/ / / /
* | | | Merge pull request #859 from FearlessTobi/port-3837bunnei2018-07-302-3/+4
|\ \ \ \
| * | | | Port #3837 from Citra: "Add build date in about dialog"fearlessTobi2018-07-292-3/+4
| |/ / /
* | | | Port #3769 from Citra: "Update Dark theme to latest version"Tobias2018-07-303-321/+471
* | | | Merge pull request #858 from lioncash/castbunnei2018-07-301-3/+2
|\ \ \ \
| * | | | partition_filesystem: Remove dynamic_cast in PrintDebugInfo()Lioncash2018-07-291-3/+2
| |/ / /
* | | | Merge pull request #860 from FearlessTobi/port-3911bunnei2018-07-305-6/+3
|\ \ \ \
| * | | | Port #3911 from Citra: "Optimize settings application"fearlessTobi2018-07-295-6/+3
| |/ / /
* | | | Merge pull request #863 from FearlessTobi/port-3913bunnei2018-07-301-1/+0
|\ \ \ \
| * | | | Port #3913 from Citra: "citra_qt: Remove obsolete application attribute"fearlessTobi2018-07-291-1/+0
| |/ / /
* | | | Merge pull request #865 from FearlessTobi/port-3732bunnei2018-07-302-4/+2
|\ \ \ \
| * | | | Port #3732 from Citra: "common: Fix compilation on ARM"Cameron Cawley2018-07-292-4/+2
| |/ / /
* | | | Merge pull request #857 from lioncash/wlanbunnei2018-07-306-1/+194
|\ \ \ \
| * | | | service: Add wlan servicesLioncash2018-07-296-1/+194
| |/ / /
* | | | Merge pull request #856 from lioncash/btmbunnei2018-07-306-0/+142
|\ \ \ \
| * | | | service/btm: Add basic implementation of GetCoreImpl()Lioncash2018-07-291-1/+35
| * | | | service: Add btm servicesLioncash2018-07-296-0/+108
| |/ / /
* / / / Add some HID commands (#843)Hexagon122018-07-301-2/+16
|/ / /
* | | Merge pull request #847 from lioncash/ncmbunnei2018-07-286-0/+80
|\ \ \
| * | | service: Add ncm servicesLioncash2018-07-276-0/+80
* | | | Merge pull request #846 from lioncash/miibunnei2018-07-286-0/+128
|\ \ \ \
| * | | | service: Add mii servicesLioncash2018-07-276-0/+128
| | |_|/ | |/| |
* | | | Merge pull request #842 from bunnei/audio-corebunnei2018-07-2812-94/+459
|\ \ \ \
| * | | | audout: Implement IAudioOut interface with AudioCore.bunnei2018-07-282-93/+114
| * | | | core: Add AudioCore to global state.bunnei2018-07-282-0/+9
| * | | | audio_core: Add initial code for keeping track of audout state.bunnei2018-07-288-1/+336
| | |/ / | |/| |
* | | | Merge pull request #696 from DarkLordZach/romfsbunnei2018-07-2812-20/+351
|\ \ \ \ | |/ / / |/| | |
| * | | RomFS ExtractionZach Hilman2018-07-2812-20/+351
|/ / /
* | | Merge pull request #845 from lioncash/nfcbunnei2018-07-276-0/+243
|\ \ \
| * | | service/nfc: Implement Create[x]Interface functionsLioncash2018-07-271-4/+43
| * | | service: Add nfc servicesLioncash2018-07-276-0/+204
| |/ /
* | | Merge pull request #839 from FearlessTobi/actually-port-3594bunnei2018-07-271-0/+16
|\ \ \
| * | | Port #3594 from CitrafearlessTobi2018-07-261-0/+16
| | |/ | |/|
* | | Merge pull request #844 from lioncash/lblbunnei2018-07-276-0/+111
|\ \ \
| * | | service/lbl: Implement EnableVrMode, DisableVrMode and GetVrModeLioncash2018-07-273-3/+37
| * | | service: Add the lbl serviceLioncash2018-07-274-0/+77
| | |/ | |/|
* | | Merge pull request #841 from lioncash/btdrvbunnei2018-07-274-1/+93
|\ \ \ | |/ / |/| |
| * | service: Add the btdrv serviceLioncash2018-07-274-1/+93
* | | Merge pull request #837 from lioncash/privbunnei2018-07-272-8/+20
|\ \ \
| * | | kernel/timer: Make data members private where applicableLioncash2018-07-262-8/+20
* | | | Merge pull request #833 from lioncash/irsbunnei2018-07-276-0/+352
|\ \ \ \ | |_|/ / |/| | |
| * | | service/hid: Add the hidbus, hid:dbg, hid:sys, and hid:tmp servicesLioncash2018-07-261-0/+220
| * | | service/hid: Add the xcd:sys serviceLioncash2018-07-264-0/+57
| * | | service/hid: Add irs servicesLioncash2018-07-264-0/+75
|/ / /
* | | Merge pull request #836 from FearlessTobi/port-3594bunnei2018-07-262-0/+4
|\ \ \
| * | | Port #3665 from CitrafearlessTobi2018-07-262-0/+4
| | |/ | |/|
* | | Merge pull request #835 from FearlessTobi/port-minor-prsbunnei2018-07-262-2/+2
|\ \ \
| * | | Port #3702 from CitrafearlessTobi2018-07-261-1/+1
| * | | Port #3641 from CitrafearlessTobi2018-07-261-1/+1
| |/ /
* | | Merge pull request #834 from lioncash/grcbunnei2018-07-264-0/+50
|\ \ \
| * | | service: Add the grc:c serviceLioncash2018-07-264-0/+50
| | |/ | |/|
* | | Merge pull request #832 from lioncash/nimbunnei2018-07-264-0/+143
|\ \ \
| * | | service: Add the nim servicesLioncash2018-07-264-0/+143
| |/ /
* | | Merge pull request #831 from lioncash/ldnbunnei2018-07-266-0/+164
|\ \ \
| * | | service: Add ldn servicesLioncash2018-07-266-0/+164
| |/ /
* | | Merge pull request #830 from lioncash/socketbunnei2018-07-266-0/+95
|\ \ \
| * | | service/sockets: Add ethc:c and ethc:i servicesLioncash2018-07-264-0/+66
| * | | service/sockets: Add missing bsdcfg socket serviceLioncash2018-07-263-0/+29
| |/ /
* | | Merge pull request #808 from lioncash/mem-dedupbunnei2018-07-261-14/+22
|\ \ \
| * | | video_core/memory_manager: Replace a loop with std::array's fill() function in PageSlot()Lioncash2018-07-241-3/+1
| * | | video_core/memory_manager: Avoid repeated unnecessary page slot lookupsLioncash2018-07-241-11/+21
* | | | Merge pull request #829 from Subv/r16f_rtbunnei2018-07-262-1/+4
|\ \ \ \ | |_|_|/ |/| | |
| * | | GPU: Allow using R16F as a render target format.Subv2018-07-262-1/+4
|/ / /
* | | Merge pull request #827 from lioncash/logbunnei2018-07-262-40/+35
|\ \ \
| * | | lm: Move LM's class declaration into the cpp fileLioncash2018-07-262-37/+31
| * | | lm: Amend names of Initialize() in Logger and Initialize() in LMLioncash2018-07-262-7/+7
| * | | lm: Add missing function entry to Logger's function tableLioncash2018-07-261-0/+1
* | | | Merge pull request #825 from greggameplayer/R16_G16bunnei2018-07-264-19/+100
|\ \ \ \ | |_|_|/ |/| | |
| * | | Implement R16_G16Unknown2018-07-264-19/+100
* | | | Merge pull request #828 from lioncash/ldrSebastian Valle2018-07-264-0/+101
|\ \ \ \
| * | | | service: Add ldr servicesLioncash2018-07-264-0/+101
* | | | | Merge pull request #826 from lioncash/erptSebastian Valle2018-07-266-0/+143
|\ \ \ \ \
| * | | | | service: Add eupld servicesLioncash2018-07-264-0/+72
| * | | | | service: Add the erpt servicesLioncash2018-07-264-0/+71
| | |_|/ / | |/| | |
* | | | | Merge pull request #823 from lioncash/nifmSebastian Valle2018-07-269-141/+30
|\ \ \ \ \ | |_|/ / / |/| | | |
| * | | | service/nifm: Deduplicate interface codeLioncash2018-07-259-141/+30
* | | | | Merge pull request #824 from lioncash/nvdrvbunnei2018-07-262-5/+7
|\ \ \ \ \
| * | | | | service/nvdrv: Take std::string in Open() by const referenceLioncash2018-07-252-2/+2
| * | | | | service/nvdrv: Use std::move where applicableLioncash2018-07-251-3/+5
| |/ / / /
* | | | | Merge pull request #822 from lioncash/pmbunnei2018-07-264-0/+90
|\ \ \ \ \ | |_|/ / / |/| | | |
| * | | | service: Add pm servicesLioncash2018-07-254-0/+90
| |/ / /
* | | | Merge pull request #820 from lioncash/esMat M2018-07-264-0/+77
|\ \ \ \
| * | | | service: Add the es serviceLioncash2018-07-254-0/+77
| |/ / /
* | | | Merge pull request #821 from lioncash/waitMat M2018-07-261-0/+4
|\ \ \ \ | |_|/ / |/| | |
| * | | wait_tree: Add missing switch case for WaitTreeThread::GetText()Lioncash2018-07-251-0/+4
| |/ /
* | | Merge pull request #819 from Subv/srgbbunnei2018-07-252-9/+17
|\ \ \ | |/ / |/| |
| * | GPU: Use the right texture format for sRGBA framebuffers.Subv2018-07-252-9/+17
* | | Merge pull request #801 from lioncash/timeMat M2018-07-256-64/+16
|\ \ \
| * | | time: Add the time:a serviceLioncash2018-07-253-10/+11
| * | | time: Simplify interface creationLioncash2018-07-246-64/+15
* | | | Merge pull request #804 from lioncash/logMat M2018-07-251-1/+3
|\ \ \ \
| * | | | svc: Log parameters in SetMemoryAttribute()Lioncash2018-07-241-1/+3
| | |_|/ | |/| |
* | | | Merge pull request #803 from MerryMage/core_timing_utilbunnei2018-07-2512-114/+146
|\ \ \ \
| * | | | core_timing: Split off utility functions into core_timing_utilMerryMage2018-07-2412-105/+137
| * | | | CMakeLists: Sort filenamesMerryMage2018-07-241-9/+9
* | | | | Merge pull request #802 from lioncash/unreachbunnei2018-07-251-0/+3
|\ \ \ \ \
| * | | | | wait_tree: Silence warning about all code paths not returning a valueLioncash2018-07-241-0/+3
| | |_|/ / | |/| | |
* | | | | Merge pull request #800 from lioncash/setbunnei2018-07-253-5/+33
|\ \ \ \ \
| * | | | | set_sys: Implement SetColorSetId()Lioncash2018-07-242-5/+25
| * | | | | ipc_helper: Add helper member function for popping enum values to RequestParserLioncash2018-07-241-0/+8
| |/ / / /
* | | | | Merge pull request #813 from Subv/z24_s8_texbunnei2018-07-251-0/+4
|\ \ \ \ \ | |_|_|_|/ |/| | | |
| * | | | GPU: Allow the use of Z24S8 as a texture format.Subv2018-07-251-0/+4
|/ / / /
* | | | Merge pull request #816 from Subv/z32_s8bunnei2018-07-254-1/+16
|\ \ \ \
| * | | | GPU: Implemented the Z32_S8_X24 depth buffer format.Subv2018-07-254-1/+16
* | | | | Merge pull request #815 from Subv/z32f_texbunnei2018-07-251-0/+4
|\ \ \ \ \
| * | | | | GPU: Allow using Z32 as a texture format.Subv2018-07-251-0/+4
| |/ / / /
* | | | | Merge pull request #814 from Subv/rt_r8bunnei2018-07-252-0/+4
|\ \ \ \ \
| * | | | | GPU: Allow the usage of R8 as a render target format.Subv2018-07-252-0/+4
| |/ / / /
* | | | | Merge pull request #818 from MerryMage/dynarmicbunnei2018-07-251-0/+0
|\ \ \ \ \
| * | | | | externals: Update dynarmic to 98e2380MerryMage2018-07-251-0/+0
|/ / / / /
* | | | | Merge pull request #809 from lioncash/rasterizerbunnei2018-07-252-16/+13
|\ \ \ \ \
| * | | | | gl_rasterizer: Replace magic number with GL_INVALID_INDEX in SetupConstBuffers()Lioncash2018-07-241-3/+5
| * | | | | gl_rasterizer: Use std::string_view instead of std::string when checking for extensionsLioncash2018-07-241-1/+3
| * | | | | gl_rasterizer: Use in-class member initializers where applicableLioncash2018-07-242-12/+5
| | |_|_|/ | |/| | |
* | | | | Merge pull request #811 from Subv/code_address_assertbunnei2018-07-251-8/+0
|\ \ \ \ \ | |_|/ / / |/| | | |
| * | | | GPU: Remove the assert that required the CODE_ADDRESS to be 0.Subv2018-07-241-8/+0
| |/ / /
* | | | Merge pull request #806 from lioncash/friendbunnei2018-07-256-48/+15
|\ \ \ \
| * | | | friend: Add friend:m, friend:s, and friend:v servicesLioncash2018-07-241-0/+3
| * | | | friend/interface: Add missing CreateDaemonSuspendSessionService() to the function handler tableLioncash2018-07-241-0/+1
| * | | | friend: Deduplicate interfacesLioncash2018-07-246-48/+11
| |/ / /
* | | | Merge pull request #810 from Subv/r16bunnei2018-07-253-5/+32
|\ \ \ \
| * | | | GPU: Implemented the R16 and R16F texture formats.Subv2018-07-243-5/+32
| |/ / /
* | | | Merge pull request #805 from lioncash/signbunnei2018-07-241-4/+7
|\ \ \ \
| * | | | svc: Resolve sign comparison warnings in WaitSynchronization()Lioncash2018-07-241-4/+7
| |/ / /
* | | | Merge pull request #807 from lioncash/unusedbunnei2018-07-241-29/+0
|\ \ \ \ | |/ / / |/| | |
| * | | deconstructed_rom_directory: Remove unused FindRomFS() functionLioncash2018-07-241-29/+0
|/ / /
* | | Merge pull request #798 from lioncash/constbunnei2018-07-242-3/+3
|\ \ \
| * | | arm_dynarmic: Make MakeJit() a const member functionLioncash2018-07-242-3/+3
| |/ /
* | | Merge pull request #797 from lioncash/explicitbunnei2018-07-245-5/+5
|\ \ \
| * | | core: Make converting constructors explicit where applicableLioncash2018-07-245-5/+5
| |/ /
* | | Merge pull request #795 from lioncash/declbunnei2018-07-241-3/+0
|\ \ \
| * | | apm/interface: Remove redundant declaration of InstallInterfaces()Lioncash2018-07-241-3/+0
| |/ /
* | | Merge pull request #799 from Subv/tex_r32fbunnei2018-07-243-6/+19
|\ \ \
| * | | GPU: Implement texture format R32F.Subv2018-07-243-6/+19
* | | | Merge pull request #794 from lioncash/refbunnei2018-07-241-1/+1
|\ \ \ \
| * | | | mutex: Pass SharedPtr to GetHighestPriorityMutexWaitingThread() by referenceLioncash2018-07-241-1/+1
* | | | | Merge pull request #796 from bunnei/gl-uintbunnei2018-07-241-0/+3
|\ \ \ \ \
| * | | | | maxwell_to_gl: Implement VertexAttribute::Type::UnsignedInt.bunnei2018-07-241-0/+3
* | | | | | Merge pull request #789 from bunnei/tex-wrap-borderbunnei2018-07-244-11/+13
|\ \ \ \ \ \ | |_|_|_|_|/ |/| | | | |
| * | | | | gl_rasterizer: Implement texture border color.bunnei2018-07-243-11/+11
| * | | | | maxwell_to_gl: Implement Texture::WrapMode::Border.bunnei2018-07-241-0/+2
| | |_|/ / | |/| | |
* | | | | Merge pull request #793 from lioncash/privbunnei2018-07-242-17/+19
|\ \ \ \ \
| * | | | | hle_ipc: Make constructors explicit where applicableLioncash2018-07-242-12/+13
| * | | | | ipc_helpers: Make member variables of ResponseBuilder privateLioncash2018-07-241-5/+6
| | |_|/ / | |/| | |
* | | | | Merge pull request #785 from lioncash/fsbunnei2018-07-241-3/+3
|\ \ \ \ \ | |_|/ / / |/| | | |
| * | | | partition_filesystem: Use std::move where applicableLioncash2018-07-241-3/+3
* | | | | Merge pull request #791 from bunnei/rg32f-rgba32f-bgra8bunnei2018-07-245-12/+70
|\ \ \ \ \ | |_|_|/ / |/| | | |
| * | | | gl_rasterizer_cache: Implement RenderTargetFormat RG32_FLOAT.bunnei2018-07-245-7/+25
| * | | | gl_rasterizer_cache: Implement RenderTargetFormat RGBA32_FLOAT.bunnei2018-07-242-10/+34
| * | | | gl_rasterizer_cache: Implement RenderTargetFormat BGRA8_UNORM.bunnei2018-07-244-8/+22
| * | | | gl_rasterizer_cache: Add missing log statements.bunnei2018-07-241-0/+2
* | | | | Merge pull request #792 from lioncash/retvalbunnei2018-07-241-2/+2
|\ \ \ \ \ | |_|_|_|/ |/| | | |
| * | | | gl_shader_decompiler: Correct return value of WriteTexsInstruction()Lioncash2018-07-241-2/+2
| | |_|/ | |/| |
* | | | Merge pull request #790 from bunnei/shader-print-instrbunnei2018-07-241-1/+2
|\ \ \ \
| * | | | gl_shader_decompiler: Print instruction value in shader comments.bunnei2018-07-241-1/+2
| | |/ / | |/| |
* | | | Merge pull request #788 from bunnei/shader-check-zerobunnei2018-07-241-0/+6
|\ \ \ \
| * | | | gl_shader_decompiler: Check if SetRegister result is ZeroIndex.bunnei2018-07-241-0/+6
| |/ / /
* | / / VFS Regression and Accuracy Fixes (#776)Zach Hilman2018-07-245-37/+75
| |/ / |/| |
* | | Merge pull request #787 from bunnei/tldsbunnei2018-07-241-29/+43
|\ \ \
| * | | gl_shader_decompiler: Implement shader instruction TLDS.bunnei2018-07-241-29/+43
* | | | Merge pull request #786 from lioncash/exclusivebunnei2018-07-243-22/+18
|\ \ \ \
| * | | | exclusive_monitor: Use consistent type alias for u64Lioncash2018-07-243-22/+18
| | |_|/ | |/| |
* | | | Merge pull request #784 from lioncash/loaderbunnei2018-07-241-1/+1
|\ \ \ \
| * | | | loader: Remove unnecessary constructor call in IdentifyFile()Lioncash2018-07-231-1/+1
| |/ / /
* | | | Merge pull request #783 from lioncash/linkerbunnei2018-07-242-7/+4
|\ \ \ \
| * | | | linker: Remove unused parameter from WriteRelocations()Lioncash2018-07-232-7/+4
| |/ / /
* | | | Merge pull request #782 from lioncash/filebunnei2018-07-242-14/+33
|\ \ \ \ | |_|/ / |/| | |
| * | | nro: Replace inclusion with a forward declarationLioncash2018-07-232-1/+8
| * | | nro: Make bracing consistentLioncash2018-07-231-10/+24
| * | | nro: Make constructor explicitLioncash2018-07-231-1/+1
| * | | nro: Remove unused forward declarationLioncash2018-07-231-2/+0
| |/ /
* | | Merge pull request #781 from lioncash/declbunnei2018-07-241-5/+5
|\ \ \
| * | | gl_shader_decompiler: Simplify GetCommonDeclarations()Lioncash2018-07-231-5/+5
| | |/ | |/|
* | | Merge pull request #780 from lioncash/movebunnei2018-07-241-11/+22
|\ \ \
| * | | vi: Add std::is_trivially_copyable checks to Read and Write functionsLioncash2018-07-231-2/+13
| * | | vi: std::move std::vector in constructors where applicableLioncash2018-07-231-9/+9
| |/ /
* | | Merge pull request #779 from lioncash/sharedbunnei2018-07-248-263/+0
|\ \ \ | |_|/ |/| |
| * | hle: Remove config_mem.h/.cppLioncash2018-07-236-102/+0
| * | hle: Remove shared_page.h/.cppLioncash2018-07-236-161/+0
| |/
* | Merge pull request #695 from DarkLordZach/nro-assetbunnei2018-07-235-1/+215
|\ \
| * | NRO Assets and NACP file formatZach Hilman2018-07-235-1/+215
* | | Merge pull request #778 from lioncash/logbunnei2018-07-231-0/+2
|\ \ \ | |_|/ |/| |
| * | set: Add missing log call in GetAvailableLanguageCodeCount()Lioncash2018-07-231-0/+2
|/ /
* | Merge pull request #775 from lioncash/strbunnei2018-07-232-30/+32
|\ \
| * | string_util: Get rid of separate resize() in CPToUTF16(), UTF16ToUTF8(), CodeToUTF8() and UTF8ToUTF16()Lioncash2018-07-221-20/+22
| * | string_util: Use emplace_back() in SplitString() instead of push_back()Lioncash2018-07-221-2/+3
| * | string_util: Remove unnecessary std::string instance in TabsToSpaces()Lioncash2018-07-222-8/+7
* | | Merge pull request #777 from lioncash/langbunnei2018-07-232-23/+31
|\ \ \ | |_|/ |/| |
| * | set: Implement GetAvailableLanguageCodeCount()Lioncash2018-07-232-21/+29
| * | set: Correct return code size of value in GetAvailableLanguageCodes()Lioncash2018-07-231-2/+2
| |/
* | Merge pull request #769 from bunnei/shader-mask-fixesbunnei2018-07-231-5/+9
|\ \
| * | shader_bytecode: Implement other TEXS masks.bunnei2018-07-221-5/+9
* | | Merge pull request #774 from Subv/atomic_signalbunnei2018-07-221-7/+31
|\ \ \ | |_|/ |/| |
| * | Kernel/SVC: Perform atomic accesses in SignalProcessWideKey as per the real kernel.Subv2018-07-221-7/+31
* | | Merge pull request #773 from Subv/gl_ext_checkbunnei2018-07-222-2/+24
|\ \ \
| * | | Frontend: Check for more required OpenGL extensions during startup.Subv2018-07-222-2/+24
| |/ /
* | | Merge pull request #768 from lioncash/string-viewbunnei2018-07-2210-133/+213
|\ \ \
| * | | vfs: Correct file_p variable usage within InterpretAsDirectory()Lioncash2018-07-221-2/+5
| * | | file_util, vfs: Use std::string_view where applicableLioncash2018-07-2210-131/+208
* | | | Merge pull request #770 from lioncash/constructbunnei2018-07-221-4/+8
|\ \ \ \ | |_|/ / |/| | |
| * | | gl_shader_decompiler: Remove redundant Subroutine construction in AddSubroutine()Lioncash2018-07-221-4/+8
| | |/ | |/|
* | | Merge pull request #638 from MerryMage/mpMat M2018-07-229-13/+160
|\ \ \
| * | | Implement exclusive monitorMerryMage2018-07-229-13/+160
| |/ /
* | | Merge pull request #772 from MerryMage/dynarmicSebastian Valle2018-07-221-0/+0
|\ \ \ | |/ / |/| |
| * | externals: Update dynarmic to fc6b73bdMerryMage2018-07-221-0/+0
|/ /
* | Merge pull request #765 from lioncash/filebunnei2018-07-221-24/+14
|\ \
| * | file_util: Remove goto usages from Copy()Lioncash2018-07-221-24/+14
* | | Merge pull request #767 from bunnei/shader-cleanupbunnei2018-07-221-78/+15
|\ \ \
| * | | gl_shader_decompiler: Remove unused state tracking and minor cleanup.bunnei2018-07-221-78/+15
* | | | Merge pull request #766 from bunnei/shader-selbunnei2018-07-222-0/+20
|\ \ \ \ | |_|_|/ |/| | |
| * | | gl_shader_decompiler: Implement SEL instruction.bunnei2018-07-222-0/+20
| |/ /
* | | Merge pull request #764 from lioncash/movebunnei2018-07-225-19/+19
|\ \ \ | |/ / |/| |
| * | file_util: Use a u64 to represent number of entriesLioncash2018-07-225-18/+18
| * | file_util: std::move FST entries in ScanDirectoryTree()Lioncash2018-07-221-1/+1
| |/
* | Merge pull request #761 from bunnei/improve-raster-cachebunnei2018-07-224-72/+157
|\ \ | |/ |/|
| * gl_rasterizer_cache: Blit surfaces on recreation instead of flush and load.bunnei2018-07-222-2/+86
| * gl_rasterizer_cache: Use GPUVAddr as cache key, not parameter set.bunnei2018-07-223-57/+46
| * gl_rasterizer_cache: Use zeta_width and zeta_height registers for depth buffer.bunnei2018-07-222-11/+11
| * gl_rasterizer: Use zeta_enable register to enable depth buffer.bunnei2018-07-221-2/+2
| * maxwell_3d: Add depth buffer enable, width, and height registers.bunnei2018-07-221-2/+14
|/
* Merge pull request #759 from lioncash/redundantbunnei2018-07-221-2/+1
|\
| * file_util: Remove explicit type from std::min() in GetPathWithoutTop()Lioncash2018-07-211-1/+1
| * file_util: Remove redundant duplicate return in GetPathWithoutTop()Lioncash2018-07-211-1/+0
* | Merge pull request #748 from lioncash/namespacebunnei2018-07-2211-48/+24
|\ \
| * | video_core: Use nested namespaces where applicableLioncash2018-07-2111-48/+24
* | | Merge pull request #758 from lioncash/syncbunnei2018-07-222-86/+0
|\ \ \
| * | | common: Remove synchronized_wrapper.hLioncash2018-07-212-86/+0
* | | | Merge pull request #760 from lioncash/pathbunnei2018-07-2211-73/+85
|\ \ \ \
| * | | | file_util: Use an enum class for GetUserPath()Lioncash2018-07-2111-73/+85
| | |_|/ | |/| |
* | | | Merge pull request #762 from Subv/ioctl2bunnei2018-07-223-6/+34
|\ \ \ \ | |/ / / |/| | |
| * | | GPU: Implement the NVGPU_IOCTL_CHANNEL_KICKOFF_PB ioctl2 command.Subv2018-07-213-6/+34
|/ / /
* | | Merge pull request #754 from lioncash/partbunnei2018-07-212-8/+20
|\ \ \
| * | | vfs_real: Remove redundant copying of std::vector instances in GetFiles() and GetSubdirectories()Lioncash2018-07-211-2/+3
| * | | partition_filesystem, vfs_real: Add missing standard includesLioncash2018-07-212-0/+4
| * | | partition_filesystem, vfs_real: Use std::move in ReplaceFileWithSubdirectory() where applicableLioncash2018-07-212-2/+3
| * | | partition_filesystem, vfs_real: Use std::distance() instead of subtractionLioncash2018-07-212-4/+10
* | | | Merge pull request #750 from lioncash/ctxbunnei2018-07-213-9/+0
|\ \ \ \
| * | | | arm_interface: Remove unused tls_address member of ThreadContextLioncash2018-07-213-9/+0
* | | | | Merge pull request #756 from lioncash/dynarmicbunnei2018-07-211-0/+0
|\ \ \ \ \ | |_|_|/ / |/| | | |
| * | | | externals: Update dynarmic to 7ea1241Lioncash2018-07-211-0/+0
* | | | | Merge pull request #746 from lioncash/testsbunnei2018-07-212-4/+12
|\ \ \ \ \
| * | | | | arm_test_common: Get rid of truncation warningsLioncash2018-07-201-2/+5
| * | | | | arm_test_common: Make file static variable a member variable of the testing environmentLioncash2018-07-202-2/+5
| * | | | | arm_test_common: Add missing header guardLioncash2018-07-201-0/+2
| | |_|_|/ | |/| | |
* | | | | Merge pull request #747 from lioncash/unimplementedbunnei2018-07-212-3/+3
|\ \ \ \ \
| * | | | | gl_shader_manager: Replace unimplemented function prototypeLioncash2018-07-212-3/+3
| |/ / / /
* | | | | Merge pull request #755 from lioncash/ctorbunnei2018-07-211-8/+8
|\ \ \ \ \
| * | | | | file_sys/errors: Remove redundant object constructor callsLioncash2018-07-211-8/+8
| | |_|_|/ | |/| | |
* | | | | Merge pull request #749 from lioncash/consistencybunnei2018-07-214-14/+17
|\ \ \ \ \
| * | | | | gpu: Rename Get3DEngine() to Maxwell3D()Lioncash2018-07-214-14/+17
| | |_|_|/ | |/| | |
* | | | | Merge pull request #751 from Subv/tpidr_el0bunnei2018-07-218-0/+39
|\ \ \ \ \
| * | | | | CPU: Save and restore the TPIDR_EL0 system register on every context switch.Subv2018-07-218-0/+39
* | | | | | Merge pull request #753 from lioncash/constbunnei2018-07-214-21/+15
|\ \ \ \ \ \ | |_|_|_|_|/ |/| | | | |
| * | | | | vfs_offset: Simplify TrimToFit()Lioncash2018-07-211-1/+2
| * | | | | vfs: Make WriteBytes() overload taking a std::vector pass the std::vector by const referenceLioncash2018-07-214-4/+4
| * | | | | vfs: Use variable template variants of std::is_trivially_copyableLioncash2018-07-211-13/+6
| * | | | | vfs: Amend constness on pointers in WriteBytes() and WriteArrays() member functions to be const qualifiedLioncash2018-07-211-3/+3
| | |_|/ / | |/| | |
* | | | | Merge pull request #752 from Subv/vfs_loadbunnei2018-07-211-5/+2
|\ \ \ \ \ | |/ / / / |/| | | |
| * | | | Loader: Only print the module names and addresses if they actually exist.Subv2018-07-211-5/+2
| |/ / /
* | | | Merge pull request #743 from lioncash/viewbunnei2018-07-214-57/+56
|\ \ \ \
| * | | | logging/filter: Use std::string_view in ParseFilterString()Lioncash2018-07-202-41/+40
| * | | | logging/backend: Add missing standard includesLioncash2018-07-202-4/+3
| * | | | logging/backend: Use std::string_view in RemoveBackend() and GetBackend()Lioncash2018-07-202-12/+13
| | |_|/ | |/| |
* | | | Merge pull request #745 from lioncash/packagebunnei2018-07-212-9/+12
|\ \ \ \ | |_|_|/ |/| | |
| * | | param_package: Take std::string by value in string-based Set() functionLioncash2018-07-202-4/+6
| * | | param_package: Use std::unordered_map's insert_or_assign instead of map indexingLioncash2018-07-201-3/+3
| * | | param_package: Get rid of file-static std::string constructionLioncash2018-07-201-3/+4
| |/ /
* | | Merge pull request #742 from bunnei/misc-apmbunnei2018-07-211-1/+16
|\ \ \
| * | | apm: Improve stub for GetPerformanceConfiguration.bunnei2018-07-201-1/+16
| |/ /
* | | Merge pull request #741 from lioncash/enumbunnei2018-07-211-0/+19
|\ \ \ | |/ / |/| |
| * | ipc_helpers: Add PushEnum() member function to ResponseBuilderLioncash2018-07-201-0/+19
|/ /
* | Merge pull request #740 from Subv/acc_crashbunnei2018-07-201-6/+8
|\ \
| * | HLE/ACC: Stub IManagerForApplication::GetAccountId to return an error.Subv2018-07-201-6/+8
| |/
* | Merge pull request #739 from lioncash/gladbunnei2018-07-203-925/+993
|\ \
| * | externals: Update glad to version 0.1.25Lioncash2018-07-203-925/+993
* | | Merge pull request #738 from lioncash/signbunnei2018-07-201-16/+20
|\ \ \
| * | | gl_state: Make references const where applicable in Apply()Lioncash2018-07-201-2/+3
| * | | gl_state: Get rid of mismatched sign conversionsLioncash2018-07-201-14/+17
| |/ /
* | | Merge pull request #737 from lioncash/movebunnei2018-07-204-5/+9
|\ \ \
| * | | loader/{nca, nro}: std::move VirtualFile in the constructors where applicableLioncash2018-07-202-2/+4
| * | | vfs_offset: std::move file and name parameters of OffsetVfsFileLioncash2018-07-202-3/+5
| |/ /
* | | Merge pull request #736 from lioncash/nullbunnei2018-07-202-3/+6
|\ \ \
| * | | audren_u: Use a std::array instead of std::string for holding the audio interface/device nameLioncash2018-07-201-2/+4
| * | | audout_u: Use a std::array instead of std::string for holding the audio interface nameLioncash2018-07-201-1/+2
| |/ /
* | | Merge pull request #735 from lioncash/video-unusedbunnei2018-07-201-2/+0
|\ \ \
| * | | maxwell_3d: Remove unused variable within GetStageTextures()Lioncash2018-07-201-2/+0
| |/ /
* | | Merge pull request #734 from lioncash/threadbunnei2018-07-2010-93/+92
|\ \ \
| * | | thread: Convert ThreadStatus into an enum classLioncash2018-07-2010-93/+92
| |/ /
* | | Merge pull request #733 from lioncash/dirsbunnei2018-07-201-1/+1
|\ \ \
| * | | partition_filesystem: Return pfs_dirs member variable within GetSubdirectories()Lioncash2018-07-201-1/+1
| |/ /
* | | Merge pull request #732 from lioncash/unusedbunnei2018-07-201-17/+6
|\ \ \
| * | | nso: Silence implicit sign conversion warningsLioncash2018-07-201-4/+6
| * | | nso: Remove unused function ReadSegment()Lioncash2018-07-201-13/+0
| |/ /
* | | Merge pull request #731 from lioncash/shadowbunnei2018-07-201-6/+4
|\ \ \ | |_|/ |/| |
| * | gl_shader_decompiler: Eliminate variable and declaration shadowingLioncash2018-07-201-6/+4
| |/
* | Merge pull request #730 from lioncash/stringbunnei2018-07-201-2/+2
|\ \
| * | gl_shader_decompiler: Remove unnecessary const from return valuesLioncash2018-07-201-2/+2
| |/
* | Merge pull request #729 from lioncash/simplifybunnei2018-07-201-3/+3
|\ \ | |/ |/|
| * pl_u: Simplify WriteBuffer() calls in GetSharedFontInOrderOfPriority()Lioncash2018-07-201-3/+3
|/
* Merge pull request #726 from lioncash/overloadbunnei2018-07-205-10/+25
|\
| * hle_ipc: Introduce generic WriteBuffer overload for multiple container typesLioncash2018-07-195-10/+25
* | Merge pull request #725 from lioncash/bytesbunnei2018-07-201-3/+3
|\ \
| * | pl_u: Specify correct size for buffers in GetSharedFontInOrderOfPriority()Lioncash2018-07-191-3/+3
| |/
* | Merge pull request #728 from Subv/acc_profilebunnei2018-07-201-7/+16
|\ \
| * | HLE/ACC: Return an IProfile that is consistent with what was requested.Subv2018-07-191-5/+15
| * | HLE/ACC: Change the default user id to be consistent with what we tell games on startup.Subv2018-07-191-2/+1
* | | Merge pull request #727 from Subv/acc_usersbunnei2018-07-201-4/+6
|\ \ \
| * | | HLE/ACC: Write a single whole user id in ListAllUsers and ListOpenUsers.Subv2018-07-191-4/+6
| |/ /
* | | Merge pull request #724 from lioncash/printfbunnei2018-07-201-1/+1
|\ \ \
| * | | pl_u: Remove printf specifier in log call in a log call in GetSharedFontInOrderOfPriority()Lioncash2018-07-191-1/+1
| | |/ | |/|
* | | Merge pull request #723 from lioncash/gdbbunnei2018-07-201-7/+7
|\ \ \
| * | | gdbstub: Get rid of a few signed/unsigned comparisonsLioncash2018-07-191-7/+7
* | | | Merge pull request #722 from lioncash/signedbunnei2018-07-202-8/+4
|\ \ \ \
| * | | | hid: Use a ranged-for loops in UpdatePadCallbackLioncash2018-07-191-7/+3
| * | | | hid: Use HID_NUM_LAYOUTS constant for indicating size of the layouts arrayLioncash2018-07-191-1/+1
| |/ / /
* | | | Merge pull request #721 from lioncash/svcbunnei2018-07-201-3/+4
|\ \ \ \
| * | | | svc: Correct always true assertion case in SetThreadCoreMaskLioncash2018-07-191-3/+4
* | | | | Merge pull request #719 from lioncash/docsbunnei2018-07-202-5/+5
|\ \ \ \ \
| * | | | | loader: Amend Doxygen commentsLioncash2018-07-192-5/+5
| |/ / / /
* | | | | Merge pull request #718 from lioncash/readbunnei2018-07-201-4/+6
|\ \ \ \ \
| * | | | | loader/nso: Check if read succeeded in IdentifyFile() before checking magic valueLioncash2018-07-191-4/+6
* | | | | | Merge pull request #717 from lioncash/explicitbunnei2018-07-2022-25/+25
|\ \ \ \ \ \
| * | | | | | hle/service: Make constructors explicit where applicableLioncash2018-07-1922-25/+25
| |/ / / / /
* | | | | | Merge pull request #716 from lioncash/constructbunnei2018-07-191-9/+4
|\ \ \ \ \ \
| * | | | | | nvflinger: Emplace Display instances directlyLioncash2018-07-191-9/+4
| |/ / / / /
* | | | | | Merge pull request #715 from lioncash/const-refbunnei2018-07-191-1/+1
|\ \ \ \ \ \ | |_|_|_|_|/ |/| | | | |
| * | | | | nvdrv: Take std::string by const reference in GetDevice()Lioncash2018-07-191-1/+1
| |/ / / /
* | | | | Merge pull request #720 from Subv/getentrytype_rootSebastian Valle2018-07-191-0/+4
|\ \ \ \ \ | |_|_|_|/ |/| | | |
| * | | | Filesystem: Return EntryType::Directory for the root directory.Subv2018-07-191-0/+4
* | | | | Merge pull request #714 from lioncash/indexSebastian Valle2018-07-191-1/+1
|\ \ \ \ \
| * | | | | hle_ipc: Amend usage of buffer_index within one of HLERequestContext's WriteBuffer() overloadsLioncash2018-07-191-1/+1
* | | | | | Merge pull request #712 from lioncash/fspbunnei2018-07-191-17/+22
|\ \ \ \ \ \ | |_|_|_|_|/ |/| | | | |
| * | | | | fsp_srv: Remove unnecessary vector construction in IFile's Write() functionLioncash2018-07-191-2/+3
| * | | | | fsp_srv: Remove unnecessary std::vector construction in IDirectory's Read() functionLioncash2018-07-191-10/+8
| * | | | | fsp_srv: Make IStorage constructor explicitLioncash2018-07-191-1/+1
| * | | | | fsp_srv: Add missing includesLioncash2018-07-191-0/+5
| * | | | | fsp_srv: Resolve sign-mismatch warnings in assertion comparisonsLioncash2018-07-191-3/+3
| * | | | | fsp_srv: Respect write length in Write()Lioncash2018-07-191-4/+5
| |/ / / /
* | | | | Merge pull request #713 from lioncash/filesysbunnei2018-07-191-3/+3
|\ \ \ \ \
| * | | | | filesystem: std::move VirtualDir instance in VfsDirectoryServiceWrapper's constructorLioncash2018-07-191-1/+3
| * | | | | filesystem: Use std::string's empty() function instead of comparing against a literalLioncash2018-07-191-1/+1
| * | | | | filesystem: Remove pragma disabling global optimizationsLioncash2018-07-191-2/+0
| |/ / / /
* | | | | Merge pull request #711 from lioncash/swapbunnei2018-07-191-50/+50
|\ \ \ \ \
| * | | | | common/swap: Remove unnecessary const on return value of swap()Lioncash2018-07-191-1/+1
| * | | | | common/swap: Use static_cast where applicableLioncash2018-07-191-16/+16
| * | | | | common/swap: Use using aliases where applicableLioncash2018-07-191-33/+33
| |/ / / /
* | | | | Merge pull request #710 from lioncash/unusedbunnei2018-07-191-38/+0
|\ \ \ \ \
| * | | | | common/common_funcs: Remove unused rotation functionsLioncash2018-07-191-38/+0
| |/ / / /
* | | | | Merge pull request #694 from lioncash/warnbunnei2018-07-192-6/+4
|\ \ \ \ \ | |_|_|_|/ |/| | | |
| * | | | loader/nro: Resolve sign mismatch warningsLioncash2018-07-191-1/+1
| * | | | loader/nso: Remove unnecessary vector resizesLioncash2018-07-191-4/+2
| * | | | loader/nso: Resolve sign mismatch warningsLioncash2018-07-191-1/+1
* | | | | Merge pull request #709 from lioncash/thread-localbunnei2018-07-192-12/+8
|\ \ \ \ \
| * | | | | common/misc: Deduplicate code in GetLastErrorMsg()Lioncash2018-07-192-12/+8
| | |/ / / | |/| | |
* | | | | Merge pull request #708 from lioncash/xbyakbunnei2018-07-191-0/+0
|\ \ \ \ \
| * | | | | externals: Update Xbyak to 5.65Lioncash2018-07-191-0/+0
| |/ / / /
* | | | | Merge pull request #707 from lioncash/catchbunnei2018-07-191-0/+0
|\ \ \ \ \
| * | | | | externals: Update catch to v2.2.3Lioncash2018-07-191-0/+0
| |/ / / /
* | | | | Merge pull request #705 from lioncash/string-refbunnei2018-07-192-2/+2
|\ \ \ \ \
| * | | | | file_util: return string by const reference for GetExeDirectory()Lioncash2018-07-192-2/+2
* | | | | | Merge pull request #704 from lioncash/stringbunnei2018-07-192-15/+0
|\ \ \ \ \ \
| * | | | | | string_util: Remove AsciiToHex()Lioncash2018-07-192-15/+0
* | | | | | | Merge pull request #703 from lioncash/constbunnei2018-07-192-2/+2
|\ \ \ \ \ \ \
| * | | | | | | savedata_factory: Make SaveDataDescriptor's DebugInfo() function a const member functionLioncash2018-07-192-2/+2
| |/ / / / / /
* | | | | | | Merge pull request #702 from lioncash/initializebunnei2018-07-192-24/+15
|\ \ \ \ \ \ \ | |_|_|_|_|/ / |/| | | | | |
| * | | | | | partition_filesystem: Ensure all class members of PartitionFilesystem are initializedLioncash2018-07-192-24/+15
| |/ / / / /
* | | | | | Merge pull request #701 from lioncash/movingbunnei2018-07-192-2/+10
|\ \ \ \ \ \ | |_|_|_|_|/ |/| | | | |
| * | | | | content_archive: Make IsDirectoryExeFS() take a shared_ptr as a const referenceLioncash2018-07-191-1/+1
| * | | | | content_archive: Add missing standard includesLioncash2018-07-191-0/+5
| * | | | | content_archive: std::move VirtualFile in NCA's constructorLioncash2018-07-191-1/+4
| |/ / / /
* | | | | Merge pull request #699 from lioncash/vfsbunnei2018-07-191-6/+6
|\ \ \ \ \
| * | | | | vfs: Deduplicate accumulation code in VfsDirectory's GetSize()Lioncash2018-07-191-6/+6
| |/ / / /
* | | | | Merge pull request #697 from bunnei/disable-depth-cullbunnei2018-07-191-1/+3
|\ \ \ \ \ | |_|_|/ / |/| | | |
| * | | | gl_state: Temporarily disable culling and depth test.bunnei2018-07-191-1/+3
| | |_|/ | |/| |
* | | | Merge pull request #700 from bunnei/update-dynarmicbunnei2018-07-191-0/+0
|\ \ \ \ | |_|_|/ |/| | |
| * | | externals: Update dynarmic to 5a91c94.bunnei2018-07-191-0/+0
| |/ /
* | | Merge pull request #692 from lioncash/assignbunnei2018-07-191-1/+1
|\ \ \
| * | | address_arbiter: Correct assignment within an assertion statement in WakeThreads()Lioncash2018-07-191-1/+1
* | | | Merge pull request #690 from lioncash/movebunnei2018-07-199-16/+26
|\ \ \ \ | |_|_|/ |/| | |
| * | | core/memory, core/hle/kernel: Use std::move where applicableLioncash2018-07-199-16/+26
* | | | Merge pull request #691 from lioncash/guardbunnei2018-07-191-0/+2
|\ \ \ \
| * | | | service/prepo: Add missing header guardLioncash2018-07-191-0/+2
| | |/ / | |/| |
* | | | Merge pull request #686 from lioncash/fmtbunnei2018-07-192-1/+1
|\ \ \ \ | |_|_|/ |/| | |
| * | | externals: update fmt to version 5.1.0Lioncash2018-07-182-1/+1
| | |/ | |/|
* | | Merge pull request #688 from lioncash/commabunnei2018-07-191-22/+12
|\ \ \
| * | | vm_manager: Add missing commas to string literal array elements in GetMemoryStateName()Lioncash2018-07-191-22/+12
| |/ /
* | | Merge pull request #693 from lioncash/unusedbunnei2018-07-191-7/+0
|\ \ \
| * | | core/memory: Remove unused function GetSpecialHandlers() and an unused variable in ZeroBlock()Lioncash2018-07-191-7/+0
| | |/ | |/|
* | | Merge pull request #687 from lioncash/instancebunnei2018-07-196-22/+26
|\ \ \
| * | | core: Make System's default constructor privateLioncash2018-07-192-0/+4
| * | | core: Don't construct instance of Core::System, just to access its live instanceLioncash2018-07-195-22/+22
| | |/ | |/|
* | | Merge pull request #680 from bunnei/fix-swizzbunnei2018-07-191-1/+4
|\ \ \
| * | | decoders: Fix calc of swizzle image_width_in_gobs.bunnei2018-07-191-1/+4
* | | | Merge pull request #685 from lioncash/buildbunnei2018-07-190-0/+0
|\ \ \ \
| * | | | hle/filesystem: Amend trace log in OpenSaveData() to compile in debug modeLioncash2018-07-181-1/+1
| | |/ / | |/| |
* | | | Merge pull request #684 from lioncash/nonmemberbunnei2018-07-192-2/+1
|\ \ \ \ | |_|/ / |/| | |
| * | | game_list: Make ContainsAllWords an internally linked non-member functionLioncash2018-07-182-2/+1
| |/ /
* | / Virtual Filesystem 2: Electric Boogaloo (#676)Zach Hilman2018-07-1954-1959/+1926
| |/ |/|
* | Merge pull request #683 from DarkLordZach/touchbunnei2018-07-181-4/+24
|\ \ | |/ |/|
| * Fill in more fields in TouchScreenEntryTouchZach Hilman2018-07-181-4/+9
| * Single touch supportZach Hilman2018-07-181-4/+19
|/
* Merge pull request #681 from lioncash/constbunnei2018-07-182-5/+7
|\
| * game_list: Upper-case containsAllWords to ContainsAllWords()Lioncash2018-07-182-3/+3
| * game_list: Make containsAllWords a const member functionLioncash2018-07-182-4/+6
* | Merge pull request #682 from lioncash/telemetrybunnei2018-07-181-20/+7
|\ \
| * | telemetry: Remove unnecessary Field constructorLioncash2018-07-181-4/+1
| * | telemetry: Make operator== and operator!= const member functions of FieldLioncash2018-07-181-2/+2
| * | telemetry: Default copy/move constructors and assignment operatorsLioncash2018-07-181-14/+4
| |/
* | Merge pull request #679 from lioncash/ctorbunnei2018-07-181-4/+1
|\ \
| * | game_list: Remove unnecessary QString initialization in KeyReleaseEaterLioncash2018-07-181-4/+1
| |/
* | Merge pull request #678 from lioncash/astcbunnei2018-07-181-78/+60
|\ \
| * | astc: Initialize vector size directly in DecompressLioncash2018-07-181-2/+1
| * | astc: Mark functions as internally linked where applicableLioncash2018-07-181-17/+20
| * | astc: const-correctness changes where applicableLioncash2018-07-181-14/+13
| * | astc: Delete Bits' copy contstructor and assignment operatorLioncash2018-07-181-8/+6
| * | astc: In-class initialize member variables where appropriateLioncash2018-07-181-39/+22
| |/
* | Merge pull request #677 from bunnei/crop-fbbunnei2018-07-1812-20/+52
|\ \ | |/ |/|
| * settings: Turn docked mode off by default.bunnei2018-07-183-3/+3
| * vi: Change TransactionId::CancelBuffer to LOG_CRITICAL.bunnei2018-07-181-1/+1
| * vi: Fix size for ListDisplays default display.bunnei2018-07-181-2/+2
| * vi: Partially implement buffer crop parameters.bunnei2018-07-189-14/+46
|/
* Merge pull request #675 from Subv/stencilbunnei2018-07-181-2/+25
|\
| * GPU: Added register definitions for the stencil parameters.Subv2018-07-171-2/+25
* | General Filesystem and Save Data Fixes (#670)Zach Hilman2018-07-1716-212/+256
* | Merge pull request #671 from MerryMage/clear-exclusive-statebunnei2018-07-176-0/+11
|\ \
| * | scheduler: Clear exclusive state when switching contextsMerryMage2018-07-166-0/+11
* | | Merge pull request #672 from SciresM/to_address_fixbunnei2018-07-171-2/+4
|\ \ \ | |_|/ |/| |
| * | Kernel/Arbiter: Fix bug in WaitIfLessThanMichael Scire2018-07-171-2/+4
| |/
* | Merge pull request #673 from bunnei/fix-buffer-queue-evtbunnei2018-07-176-32/+21
|\ \ | |/ |/|
| * nvflinger: Fix for BufferQueue event handling.bunnei2018-07-176-32/+21
|/
* Merge pull request #669 from lioncash/dynarmicbunnei2018-07-161-0/+0
|\
| * externals: Update dynarmic to dfdec79Lioncash2018-07-151-0/+0
|/
* Merge pull request #668 from jroweboy/controller-lagbunnei2018-07-151-3/+3
|\
| * HID: Update controllers less oftenJames Rowe2018-07-151-3/+3
* | Merge pull request #664 from jroweboy/logging-stuffbunnei2018-07-153-4/+17
|\ \ | |/ |/|
| * Logging: Dump all logs in the queue on close in debug modeJames Rowe2018-07-153-1/+12
| * Logging: Don't lock the queue for the duration of the writeJames Rowe2018-07-141-3/+5
* | Merge pull request #666 from bunnei/g8r8bunnei2018-07-153-9/+40
|\ \
| * | gl_rasterizer_cache: Implement texture format G8R8.bunnei2018-07-153-9/+40
|/ /
* | Merge pull request #665 from bunnei/fix-z24-s8bunnei2018-07-151-1/+2
|\ \
| * | gl_rasterizer_cache: Fix incorrect offset in ConvertS8Z24ToZ24S8.bunnei2018-07-151-1/+2
* | | Merge pull request #659 from bunnei/depth16bunnei2018-07-153-1/+15
|\ \ \ | |/ / |/| |
| * | gl_rasterizer_cache: Implement depth format Z16_UNORM.bunnei2018-07-153-1/+15
|/ /
* | Merge pull request #598 from bunnei/makedonecurrentbunnei2018-07-156-2/+39
|\ \
| * | OpenGL: Use MakeCurrent/DoneCurrent for multithreaded rendering.bunnei2018-07-146-2/+39
* | | Merge pull request #663 from Subv/bsdbunnei2018-07-151-2/+1
|\ \ \
| * | | Services/BSD: Corrected the return for StartMonitoring according to SwIPC.Subv2018-07-141-2/+1
* | | | Merge pull request #662 from Subv/delete_filebunnei2018-07-141-2/+4
|\ \ \ \
| * | | | FileSys: Append the requested path to the filesystem base path in DeleteFile.Subv2018-07-141-2/+4
| |/ / /
* | | | Merge pull request #661 from ogniK5377/assert-nitbunnei2018-07-141-2/+2
|\ \ \ \ | |/ / / |/| | |
| * | | No need to use ASSERT_MSG with an empty messageDavid Marcec2018-07-141-2/+2
|/ / /
* | | Merge pull request #660 from Subv/depth_writebunnei2018-07-141-3/+8
|\ \ \ | |/ / |/| |
| * | GPU: Always enable the depth write when clearing the depth buffer.Subv2018-07-141-3/+8
|/ /
* | Merge pull request #657 from bunnei/dual-vsbunnei2018-07-137-89/+149
|\ \
| * | gl_rasterizer: Fix check for if a shader stage is enabled.bunnei2018-07-133-35/+11
| * | gl_shader_gen: Implement dual vertex shader mode.bunnei2018-07-135-55/+139
* | | More improvements to GDBStub (#653)Hedges2018-07-138-50/+173
|/ /
* | Merge pull request #656 from ogniK5377/audren-mem-initbunnei2018-07-131-3/+3
|\ \
| * | We only need to alert for memory pool changesDavid Marcec2018-07-131-2/+0
| * | initialized voice status and unused sizes in the update data headerDavid Marcec2018-07-131-1/+3
* | | Merge pull request #655 from bunnei/pred-lt-nanbunnei2018-07-132-5/+7
|\ \ \
| * | | gl_shader_decompiler: Implement PredCondition::LessThanWithNan.bunnei2018-07-132-5/+7
| |/ /
* | | Merge pull request #654 from bunnei/cond-exitbunnei2018-07-132-8/+34
|\ \ \ | |/ / |/| |
| * | gl_shader_decompiler: Use FlowCondition field in EXIT instruction.bunnei2018-07-132-8/+34
|/ /
* | Merge pull request #652 from Subv/fadd32iSebastian Valle2018-07-132-0/+32
|\ \
| * | GPU: Implement the FADD32I shader instruction.Subv2018-07-122-0/+32
* | | Merge pull request #651 from Subv/ffma_decodebunnei2018-07-121-1/+1
|\ \ \
| * | | GPU: Corrected the decoding of FFMA for immediate operands.Subv2018-07-121-1/+1
| |/ /
* | | Port #3335 and #3373 from Citra: "Small SDL fixes" and "Print the actual error preventing SDL from working" (#637)Tobias2018-07-122-6/+4
* | | Merge pull request #648 from ogniK5377/no-netbunnei2018-07-121-3/+21
|\ \ \
| * | | Added IsWirelessCommunicationEnabled, IsEthernetCommunicationEnabled, IsAnyInternetRequestAcceptedDavid Marcec2018-07-121-3/+21
* | | | Merge pull request #649 from ogniK5377/audout-autobunnei2018-07-122-14/+14
|\ \ \ \
| * | | | Audout "Auto" functionsDavid Marcec2018-07-122-14/+14
| |/ / /
* | | | Merge pull request #650 from jroweboy/logging-stuffbunnei2018-07-123-4/+8
|\ \ \ \ | |/ / / |/| | / | | |/ | |/|
| * | yuzu - Fix duplicate logsJames Rowe2018-07-122-2/+7
| * | yuzu-cmd Apply the filter string from settingsJames Rowe2018-07-121-2/+1
|/ /
* | Merge pull request #559 from Subv/mount_savedatabunnei2018-07-122-2/+12
|\ \
| * | Services/FS: Return the correct error code when trying to mount a nonexistent savedata.Subv2018-06-192-2/+12
* | | Merge pull request #585 from janisozaur/patch-11bunnei2018-07-121-3/+3
|\ \ \
| * | | Improve directory creation in WindowsCopyFiles.cmakeMichał Janiszewski2018-06-241-3/+3
* | | | Merge pull request #646 from bunnei/fix-hid-smobunnei2018-07-111-7/+5
|\ \ \ \
| * | | | hid: Fix timestamps and controller type.bunnei2018-07-111-7/+5
|/ / / /
* | | | Merge pull request #644 from ogniK5377/getconfig-errbunnei2018-07-111-17/+2
|\ \ \ \
| * | | | NvOsGetConfigU32 production implDavid Marcec2018-07-101-17/+2
* | | | | Merge pull request #633 from FearlessTobi/port-definesbunnei2018-07-103-7/+7
|\ \ \ \ \
| * | | | | Port #3579 from CitrafearlessTobi2018-07-073-7/+7
* | | | | | Merge pull request #642 from bunnei/create-save-dirbunnei2018-07-101-0/+9
|\ \ \ \ \ \ | |_|/ / / / |/| | | | |
| * | | | | savedata_factory: Always create a save directory for games.bunnei2018-07-081-0/+9
* | | | | | Merge pull request #636 from FearlessTobi/add-gitignorebunnei2018-07-101-0/+1
|\ \ \ \ \ \
| * | | | | | Port #3513 (partly) from CitrafearlessTobi2018-07-071-0/+1
| | |/ / / / | |/| | | |
* | | | | | Merge pull request #635 from FearlessTobi/port-crashfixbunnei2018-07-101-1/+1
|\ \ \ \ \ \
| * | | | | | Port #3474 from CitrafearlessTobi2018-07-071-1/+1
| |/ / / / /
* | | | | | Merge pull request #634 from FearlessTobi/port-viewport-fixbunnei2018-07-101-6/+7
|\ \ \ \ \ \
| * | | | | | Port #3505 from CItrafearlessTobi2018-07-071-6/+7
| |/ / / / /
* | | | | | Merge pull request #640 from bunnei/flip-tris-viewportbunnei2018-07-091-1/+4
|\ \ \ \ \ \
| * | | | | | gl_rasterizer: Flip triangles when regs.viewport_transform[0].scale_y is negative.bunnei2018-07-081-1/+4
| | |/ / / / | |/| | | |
* | | | | | Merge pull request #641 from bunnei/nvhost-ctrl-fixbunnei2018-07-091-1/+1
|\ \ \ \ \ \ | |/ / / / / |/| | | | |
| * | | | | nvhost_ctrl: Fix NvOsGetConfigU32 for Snipper Clips.bunnei2018-07-081-1/+1
|/ / / / /
* | | | | Merge pull request #625 from Subv/imnmxbunnei2018-07-082-3/+31
|\ \ \ \ \
| * | | | | GPU: Implemented the IMNMX shader instruction.Subv2018-07-042-3/+31
* | | | | | Merge pull request #627 from Subv/bc7ubunnei2018-07-083-7/+21
|\ \ \ \ \ \
| * | | | | | GPU: Implemented the BC7U texture format.Subv2018-07-073-7/+21
| | |/ / / / | |/| | | |
* | | | | | Merge pull request #639 from bunnei/revert-vfsbunnei2018-07-0845-1784/+1676
|\ \ \ \ \ \ | |_|_|_|_|/ |/| | | | |
| * | | | | Revert "Virtual Filesystem (#597)"bunnei2018-07-0845-1784/+1676
|/ / / / /
* | | | | Merge pull request #632 from FearlessTobi/add-discord-linkbunnei2018-07-071-1/+1
|\ \ \ \ \ | |/ / / / |/| | | |
| * | | | Port #3466 from CitraTobias2018-07-071-1/+1
* | | | | Merge pull request #631 from lioncash/dynarmicbunnei2018-07-071-0/+0
|\ \ \ \ \
| * | | | | externals: Update dynarmic to f7d11baa1Lioncash2018-07-071-0/+0
|/ / / / /
* | | | | Merge pull request #630 from FearlessTobi/remove-citra-referencesbunnei2018-07-063-3/+3
|\ \ \ \ \
| * | | | | Remove some references to CitrafearlessTobi2018-07-063-3/+3
| |/ / / /
* / / / / Virtual Filesystem (#597)Zach Hilman2018-07-0645-1676/+1784
|/ / / /
* | | | Merge pull request #629 from Subv/depth_testbunnei2018-07-052-9/+29
|\ \ \ \
| * | | | GPU: Allow using the old NV04 values for the depth test function.Subv2018-07-052-9/+29
* | | | | Merge pull request #626 from Subv/shader_syncbunnei2018-07-052-0/+12
|\ \ \ \ \ | |/ / / / |/| | | |
| * | | | GPU: Stub the shader SYNC and DEPBAR instructions.Subv2018-07-042-0/+12
| |/ / /
* | | | Merge pull request #624 from Subv/f2f_roundbunnei2018-07-051-0/+3
|\ \ \ \
| * | | | GPU: Implemented the F2F 'round' rounding mode.Subv2018-07-041-0/+3
| |/ / /
* | | | Merge pull request #623 from Subv/vertex_typesbunnei2018-07-051-0/+8
|\ \ \ \
| * | | | GPU: Implement the Size_16_16 and Size_10_10_10_2 vertex attribute types.Subv2018-07-041-0/+8
| |/ / /
* | | | Merge pull request #622 from Subv/unused_texbunnei2018-07-052-2/+5
|\ \ \ \
| * | | | GPU: Ignore textures that the GLSL compiler deemed unused when binding textures to the shaders.Subv2018-07-041-1/+4
| * | | | GPU: Corrected the decoding for the TEX shader instruction.Subv2018-07-041-1/+1
| |/ / /
* | | | Merge pull request #621 from Subv/psetp_bunnei2018-07-052-0/+43
|\ \ \ \
| * | | | GPU: Implemented the PSETP shader instruction.Subv2018-07-042-0/+43
| |/ / /
* | | | Merge pull request #620 from Subv/depth_z32fbunnei2018-07-053-2/+15
|\ \ \ \
| * | | | GPU: Implemented the 32 bit float depth buffer format.Subv2018-07-043-2/+15
| |/ / /
* | | | Merge pull request #619 from Subv/flip_cullbunnei2018-07-042-3/+29
|\ \ \ \ | |/ / / |/| | |
| * | | GPU: Flip the triangle front face winding if the GPU is configured to not flip the triangles.Subv2018-07-042-3/+29
|/ / /
* | | Merge pull request #618 from Subv/clear_used_buffersbunnei2018-07-044-17/+48
|\ \ \
| * | | GPU: Only configure the used framebuffers during clear.Subv2018-07-044-17/+48
|/ / /
* | | Merge pull request #609 from Subv/clear_buffersbunnei2018-07-045-16/+105
|\ \ \
| * | | GPU: Factor out the framebuffer configuration code for both Clear and Draw commands.Subv2018-07-032-72/+39
| * | | GPU: Support clears that don't clear the color buffer.Subv2018-07-032-6/+17
| * | | GPU: Bind and clear the render target when the CLEAR_BUFFERS register is written to.Subv2018-07-034-0/+86
| * | | GPU: Added registers for the CLEAR_BUFFERS and CLEAR_COLOR methods.Subv2018-07-031-2/+27
* | | | Merge pull request #616 from bunnei/s8z24bunnei2018-07-043-11/+83
|\ \ \ \
| * | | | gl_rasterizer_cache: Implement PixelFormat S8Z24.bunnei2018-07-033-11/+83
* | | | | Merge pull request #613 from jroweboy/qt-stylebunnei2018-07-032-0/+7
|\ \ \ \ \ | |/ / / / |/| | | |
| * | | | Add qt windowsvistastyle dll to the buildJames Rowe2018-07-032-0/+7
|/ / / /
* | | | Update AudioRenderer Voice Sections (#614)David2018-07-031-0/+87
* | | | Merge pull request #607 from jroweboy/loggingbunnei2018-07-03116-887/+1261
|\ \ \ \
| * | | | Fix build and address review feedbackbunnei2018-07-032-4/+5
| * | | | Add configurable logging backendsJames Rowe2018-07-0314-22/+408
| * | | | Update clang formatJames Rowe2018-07-0337-154/+141
| * | | | Rename logging macro back to LOG_*James Rowe2018-07-03105-730/+730
| |/ / /
* | | | Merge pull request #612 from bunnei/fix-cullbunnei2018-07-031-2/+5
|\ \ \ \
| * | | | gl_rasterizer: Only set cull mode and front face if enabled.bunnei2018-07-031-2/+5
| |/ / /
* | | | Merge pull request #611 from Subv/enabled_depth_testbunnei2018-07-032-9/+13
|\ \ \ \
| * | | | GPU: Use only the least significant 3 bits when reading the depth test func.Subv2018-07-031-9/+9
| * | | | GPU: Don't try to parse the depth test function if the depth test is disabled.Subv2018-07-031-0/+4
| |/ / /
* | | | Merge pull request #610 from Subv/mufu_8bunnei2018-07-032-0/+5
|\ \ \ \ | |/ / / |/| | |
| * | | GPU: Implemented MUFU suboperation 8, sqrt.Subv2018-07-032-0/+5
* | | | Merge pull request #608 from Subv/depthbunnei2018-07-039-32/+246
|\ \ \ \
| * | | | GPU: Set up the culling configuration on each draw.Subv2018-07-031-6/+8
| * | | | GPU: Set up the depth test state on every draw.Subv2018-07-022-0/+14
| * | | | MaxwellToGL: Added conversion functions for depth test and cull mode.Subv2018-07-021-0/+50
| * | | | GPU: Added registers for depth test and cull mode.Subv2018-07-021-3/+51
| * | | | GPU: Implemented the Z24S8 depth format and load the depth framebuffer.Subv2018-07-027-24/+124
| |/ / /
* | | | Merge pull request #606 from Subv/base_vertexSebastian Valle2018-07-022-8/+15
|\ \ \ \
| * | | | GPU: Implement offsetted rendering when using non-indexed drawing.Subv2018-07-021-1/+1
| * | | | GPU: Fixed the index offset rendering, and implemented the base vertex functionality.Subv2018-07-021-6/+8
| * | | | GPU: Added register definitions for the vertex buffer base element.Subv2018-07-021-1/+6
| |/ / /
* | | | Merge pull request #603 from Subv/nvmap_freeSebastian Valle2018-07-023-4/+16
|\ \ \ \
| * | | | GPU: Remove a surface from the cache when its backing memory is being unmapped from the GPU's MMU.Subv2018-07-011-0/+5
| * | | | nvmap: Return the address of the nvmap object when Freeing it for the last time.Subv2018-07-012-4/+11
* | | | | Merge pull request #605 from Subv/dma_copySebastian Valle2018-07-021-1/+5
|\ \ \ \ \
| * | | | | GPU: Directly copy the pixels when performing a same-layout DMA.Subv2018-07-021-1/+5
| |/ / / /
* | | | | Merge pull request #604 from Subv/invalid_texturesbunnei2018-07-023-3/+12
|\ \ \ \ \ | |_|/ / / |/| | | |
| * | | | GPU: Ignore disabled textures and textures with an invalid address.Subv2018-07-022-1/+10
| * | | | GPU: Allow GpuToCpuAddress to return boost::none for unmapped addresses.Subv2018-07-021-2/+2
| |/ / /
* | | | Merge pull request #602 from Subv/mufu_subopbunnei2018-07-012-6/+1
|\ \ \ \
| * | | | GPU: Corrected the size of the MUFU subop field, and removed incorrect "min" operation.Subv2018-06-302-6/+1
| |/ / /
* | | | Merge pull request #601 from Subv/rgba32_uibunnei2018-07-014-25/+48
|\ \ \ \
| * | | | GPU: Implemented the RGBA32_UINT rendertarget format.Subv2018-06-304-9/+28
| * | | | GLCache: Specify the component type along the texture type in the format tuple.Subv2018-06-301-17/+21
| |/ / /
* | | | Merge pull request #600 from bunnei/pred-not-eq-nanbunnei2018-07-012-17/+24
|\ \ \ \ | |/ / / |/| | |
| * | | gl_shader_decompiler: Implement predicate NotEqualWithNan.bunnei2018-06-302-17/+24
|/ / /
* | | Merge pull request #595 from bunnei/raster-cachebunnei2018-06-2915-1454/+425
|\ \ \
| * | | gl_rasterizer_cache: Only dereference color_surface/depth_surface if valid.bunnei2018-06-291-2/+6
| * | | gl_rasterizer_cache: Implement caching for texture and framebuffer surfaces.bunnei2018-06-273-16/+168
| * | | gl_rasterizer_cache: Various fixes for ASTC handling.bunnei2018-06-272-35/+39
| * | | gl_rasterizer_cache: Use SurfaceParams as a key for surface caching.bunnei2018-06-272-43/+72
| * | | maxwell_3d: Add a struct for RenderTargetConfig.bunnei2018-06-271-17/+19
| * | | settings: Add a configuration for use_accurate_framebuffers.bunnei2018-06-277-0/+21
| * | | gl_rasterizer: Implement AccelerateDisplay to forward textures to framebuffers.bunnei2018-06-276-8/+62
| * | | gl_rasterizer_cache: Cache size_in_bytes as a const per surface.bunnei2018-06-272-9/+13
| * | | gl_rasterizer_cache: Refactor to make SurfaceParams members const.bunnei2018-06-272-52/+37
| * | | gl_rasterizer_cache: Remove Citra's rasterizer cache, always load/flush surfaces.bunnei2018-06-274-1494/+210
* | | | Merge pull request #588 from mailwl/hwopusbunnei2018-06-284-0/+53
|\ \ \ \
| * | | | Service/Audio: add hwopus service, stub GetWorkBufferSize functionmailwl2018-06-254-0/+53
| | |/ / | |/| |
* | | | gl_shader_decompiler: Add a return path for unknown instructions.bunnei2018-06-271-0/+1
| |/ / |/| |
* | | Merge pull request #594 from bunnei/max-constbuffbunnei2018-06-272-1/+7
|\ \ \
| * | | gl_rasterizer: Workaround for when exceeding max UBO size.bunnei2018-06-272-1/+7
|/ / /
* | | Merge pull request #593 from bunnei/fix-swizzlebunnei2018-06-275-12/+20
|\ \ \
| * | | gl_state: Fix state management for texture swizzle.bunnei2018-06-265-12/+20
* | | | Merge pull request #592 from bunnei/cleanup-gl-statebunnei2018-06-272-94/+0
|\ \ \ \
| * | | | gl_state: Remove unused state management from 3DS.bunnei2018-06-262-94/+0
| |/ / /
* | | | Merge pull request #591 from bunnei/fix-rgb565bunnei2018-06-271-1/+1
|\ \ \ \ | |/ / / |/| | |
| * | | gl_rasterizer_cache: Fix inverted B5G6R5 format.bunnei2018-06-261-1/+1
|/ / /
* | | Merge pull request #590 from bunnei/rm-ssbo-checkbunnei2018-06-261-2/+0
|\ \ \
| * | | yuzu: Remove SSBOs check from Qt frontend.bunnei2018-06-261-2/+0
|/ / /
* | | Merge pull request #554 from Subv/constbuffer_ubobunnei2018-06-264-18/+39
|\ \ \
| * | | Rasterizer: Use UBOs instead of SSBOs for uploading const buffers.Subv2018-06-104-18/+39
* | | | Merge pull request #589 from mailwl/fix-crashbunnei2018-06-261-2/+4
|\ \ \ \
| * | | | Fix crash at exitmailwl2018-06-251-2/+4
| | |/ / | |/| |
* / | | Send the correct RequestUpdateAudioRenderer revision in the output header (#587)David2018-06-251-1/+1
|/ / /
* | | Removed duplicate structs, changed AudioRendererResponse -> UpdateDataHeader (#583)David2018-06-242-34/+21
* | | Revert "Use Ninja for MSVC AppVeyor builds" (#584)bunnei2018-06-236-17/+9
* | | Fixed RequestUpdateAudioRenderer deadlocks and calculated section sizes properly (#580)David2018-06-232-44/+76
* | | Merge pull request #526 from janisozaur/appveyor-ninjabunnei2018-06-226-9/+17
|\ \ \
| * | | Use Ninja for MSVC AppVeyor buildsMichał Janiszewski2018-06-055-8/+16
| * | | Drop /std:c++latest from MSVC command lineMichał Janiszewski2018-06-051-1/+1
* | | | Merge pull request #579 from SciresM/masterbunnei2018-06-2212-9/+312
|\ \ \ \
| * | | | Kernel/Arbiters: Fix casts, cleanup comments/magic numbersMichael Scire2018-06-224-17/+27
| * | | | Add additional missing format.Michael Scire2018-06-222-21/+27
| * | | | Run clang-format on PR.Michael Scire2018-06-223-180/+181
| * | | | Kernel/Arbiters: HLE is atomic, adjust code to reflect that.Michael Scire2018-06-222-37/+13
| * | | | Kernel/Arbiters: Initialize arb_wait_address in thread struct.Michael Scire2018-06-213-1/+7
| * | | | Kernel/Arbiters: Clear WaitAddress in SignalToAddressMichael Scire2018-06-211-0/+1
| * | | | Kernel/Arbiters: Mostly implement SignalToAddressMichael Scire2018-06-215-11/+111
| * | | | Kernel/Arbiters: Implement WaitForAddressMichael Scire2018-06-215-6/+71
| * | | | Kernel/Arbiters: Add stubs for 4.x SignalToAddress/WaitForAddres SVCs.Michael Scire2018-06-217-9/+147
* | | | | Merge pull request #581 from mailwl/empty-buf-skipbunnei2018-06-221-0/+5
|\ \ \ \ \
| * | | | | IPC: skip empty buffer writemailwl2018-06-221-0/+5
|/ / / / /
* | | | | Merge pull request #577 from mailwl/audren-updatebunnei2018-06-222-49/+60
|\ \ \ \ \
| * | | | | Service/Audio: update audren:u servicemailwl2018-06-212-49/+60
| |/ / / /
* / / / / Add support for decrypted NCA files (#567)Zach Hilman2018-06-2110-16/+453
|/ / / /
* | | | Merge pull request #576 from Subv/warnings1bunnei2018-06-2012-22/+24
|\ \ \ \
| * | | | Build: Fixed some MSVC warnings in various parts of the code.Subv2018-06-2012-22/+24
|/ / / /
* | | | Implement GetAvailableLanguageCodes2 (#575)greggameplayer2018-06-191-4/+1
* | | | Merge pull request #574 from Subv/shader_abs_negbunnei2018-06-191-7/+14
|\ \ \ \
| * | | | GPU: Perform negation after absolute value in the float shader instructions.Subv2018-06-191-7/+14
* | | | | Merge pull request #561 from DarkLordZach/fix-odyssey-input-crashbunnei2018-06-191-0/+4
|\ \ \ \ \
| * | | | | Narrow down filter of layout configsZach Hilman2018-06-142-10/+5
| * | | | | Move loop condition to free functionZach Hilman2018-06-131-4/+9
| * | | | | Avoid initializing single-joycon layouts with handheld controllerZach Hilman2018-06-132-1/+5
* | | | | | Merge pull request #573 from Subv/shader_immbunnei2018-06-192-14/+18
|\ \ \ \ \ \ | |_|/ / / / |/| | | | |
| * | | | | GPU: Don't mark uniform buffers and registers as used for instructions which don't have them.Subv2018-06-192-14/+18
|/ / / / /
* | | | | Merge pull request #570 from bunnei/astcbunnei2018-06-196-1/+1709
|\ \ \ \ \
| * | | | | gl_rasterizer: Implement texture format ASTC_2D_4X4.bunnei2018-06-186-1/+1709
* | | | | | Merge pull request #562 from DarkLordZach/extracted-ncas-uibunnei2018-06-184-3/+50
|\ \ \ \ \ \
| * | | | | | Bug fixes, testing, and review changesZach Hilman2018-06-142-7/+20
| * | | | | | Add 'Load Folder' menu optionZach Hilman2018-06-143-0/+17
| * | | | | | Add support for main files in file pickerZach Hilman2018-06-141-0/+2
| * | | | | | Recognize main files in game listZach Hilman2018-06-141-2/+17
| | |/ / / / | |/| | | |
* | | | | | Merge pull request #572 from Armada651/user-except-stubbunnei2018-06-181-0/+5
|\ \ \ \ \ \
| * | | | | | svc: Add a stub for UserExceptionContextAddr.Jules Blok2018-06-181-0/+5
* | | | | | | Merge pull request #571 from Armada651/loose-blendbunnei2018-06-181-1/+1
|\ \ \ \ \ \ \ | |_|_|/ / / / |/| | | | | |
| * | | | | | gl_rasterizer: Get loose on independent blending.Jules Blok2018-06-181-1/+1
* | | | | | | Merge pull request #569 from bunnei/fix-cachebunnei2018-06-181-26/+8
|\ \ \ \ \ \ \
| * | | | | | | gl_rasterizer_cache: Loosen things up a bit.bunnei2018-06-181-26/+8
|/ / / / / / /
* | | | | | | Merge pull request #568 from bunnei/lopbunnei2018-06-172-63/+84
|\ \ \ \ \ \ \ | |/ / / / / / |/| | | | | |
| * | | | | | gl_shader_decompiler: Implement LOP instructions.bunnei2018-06-172-6/+42
| * | | | | | gl_shader_decompiler: Refactor LOP32I instruction a bit in support of LOP.bunnei2018-06-172-57/+42
|/ / / / / /
* | | | | | Merge pull request #565 from bunnei/shader_conversionsbunnei2018-06-162-14/+43
|\ \ \ \ \ \
| * | | | | | gl_shader_decompiler: Implement integer size conversions for I2I/I2F/F2I.bunnei2018-06-162-14/+43
|/ / / / / /
* | | | | | Merge pull request #564 from bunnei/lop32i_passbbunnei2018-06-161-6/+12
|\ \ \ \ \ \
| * | | | | | gl_shader_decompiler: Implement LOP32I LogicOperation PassB.bunnei2018-06-161-6/+12
| | |/ / / / | |/| | | |
* | | | | | Merge pull request #566 from bunnei/set_pos_wbunnei2018-06-161-0/+4
|\ \ \ \ \ \ | |/ / / / / |/| | | | |
| * | | | | gl_shader_gen: Set position.w to 1.bunnei2018-06-161-0/+4
|/ / / / /
* | | | | Merge pull request #560 from Subv/crash_widgetbunnei2018-06-136-292/+0
|\ \ \ \ \
| * | | | | Qt: Removed the Registers widget.Subv2018-06-136-292/+0
| | |_|_|/ | |/| | |
* | | | | Merge pull request #556 from Subv/dma_enginebunnei2018-06-127-1/+237
|\ \ \ \ \
| * | | | | GPU: Partially implemented the Maxwell DMA engine.Subv2018-06-127-1/+237
* | | | | | Merge pull request #558 from Subv/iadd32ibunnei2018-06-122-2/+31
|\ \ \ \ \ \
| * | | | | | GPU: Implemented the iadd32i shader instruction.Subv2018-06-122-2/+31
| | |/ / / / | |/| | | |
* | | | | | Merge pull request #557 from shinyquagsire23/libnx-hid-fixbunnei2018-06-122-2/+3
|\ \ \ \ \ \
| * | | | | | hid: Update all layouts and only show handheld as connected, fixes libnx input for P1_AUTOshinyquagsire232018-06-122-2/+3
| |/ / / / /
* | | | | | Merge pull request #552 from bunnei/sat-fmulbunnei2018-06-122-39/+32
|\ \ \ \ \ \ | |/ / / / / |/| | | | |
| * | | | | gl_shader_decompiler: Implement saturate for float instructions.bunnei2018-06-122-39/+32
|/ / / / /
* | | | | Merge pull request #555 from Subv/gpu_sysregsbunnei2018-06-111-1/+1
|\ \ \ \ \ | |/ / / / |/| | | |
| * | | | GPU: Convert the gl_InstanceId and gl_VertexID variables to floats when reading from them.Subv2018-06-101-1/+1
|/ / / /
* | | | Merge pull request #553 from Subv/isetbunnei2018-06-102-2/+53
|\ \ \ \ | |_|_|/ |/| | |
| * | | GPU: Implement the iset family of shader instructions.Subv2018-06-092-2/+46
| * | | GPU: Added decodings for the ISET family of instructions.Subv2018-06-091-0/+7
|/ / /
* | | Merge pull request #550 from Subv/ssybunnei2018-06-092-0/+7
|\ \ \
| * | | GPU: Stub the SSY shader instruction.Subv2018-06-092-0/+7
* | | | Merge pull request #551 from bunnei/shrbunnei2018-06-092-0/+17
|\ \ \ \
| * | | | gl_shader_decompiler: Implement SHR instruction.bunnei2018-06-092-0/+17
| |/ / /
* | | | Merge pull request #549 from bunnei/iaddbunnei2018-06-092-19/+55
|\ \ \ \ | |/ / / |/| | |
| * | | gl_shader_decompiler: Implement IADD instruction.bunnei2018-06-092-11/+37
| * | | gl_shader_decompiler: Add missing asserts for saturate_a instructions.bunnei2018-06-092-8/+18
|/ / /
* | | Merge pull request #505 from janisozaur/ccache-travisbunnei2018-06-095-7/+17
|\ \ \
| * | | Cache ccache on TravisMichał Janiszewski2018-06-071-0/+4
| * | | Add ccache support for macOS on TravisMichał Janiszewski2018-06-072-1/+5
| * | | Add ccache support for Linux on TravisMichał Janiszewski2018-06-072-2/+8
| * | | Install cmake from repositories for UbuntuMichał Janiszewski2018-06-071-5/+1
* | | | Merge pull request #533 from mailwl/array-to-bufferbunnei2018-06-093-22/+15
|\ \ \ \
| * | | | Common/string_util: add StringFromBuffer functionmailwl2018-06-073-22/+15
* | | | | Merge pull request #548 from Subv/blendbunnei2018-06-093-47/+47
|\ \ \ \ \
| * | | | | GPU: Synchronize the blend state on every draw call.Subv2018-06-092-16/+20
| * | | | | GPU: Added registers for normal and independent blending.Subv2018-06-092-31/+27
|/ / / / /
* | | | | Merge pull request #547 from Subv/compressed_alignmentbunnei2018-06-081-2/+7
|\ \ \ \ \
| * | | | | GLCache: Align compressed texture sizes to their compression ratio, and then align that compressed size to the block height for tiled textures.Subv2018-06-081-2/+7
| | |/ / / | |/| | |
* | | | | Merge pull request #546 from Subv/flush_ubo_bufferbunnei2018-06-081-0/+3
|\ \ \ \ \ | |/ / / / |/| | | |
| * | | | Rasterizer: Flush the written region when writing shader uniform data before copying it to the uniform buffers.Subv2018-06-081-0/+3
|/ / / /
* | | | Merge pull request #478 from janisozaur/patch-1bunnei2018-06-071-3/+3
|\ \ \ \
| * | | | Use Ninja for Travis buildsMichał Janiszewski2018-05-281-3/+3
* | | | | Merge pull request #543 from Subv/uniformsbunnei2018-06-071-3/+4
|\ \ \ \ \ | |_|/ / / |/| | | |
| * | | | GLRenderer: Write the shader stage configuration UBO data *before* copying it to the GPU.Subv2018-06-071-3/+4
* | | | | Merge pull request #522 from mailwl/mm-ubunnei2018-06-076-0/+85
|\ \ \ \ \
| * | | | | Remove unused header filesmailwl2018-06-061-2/+0
| * | | | | Small fixesmailwl2018-06-052-6/+8
| * | | | | Service/MM: add service and stub some functionsmailwl2018-06-056-0/+85
* | | | | | Merge pull request #542 from bunnei/bfe_immbunnei2018-06-072-7/+44
|\ \ \ \ \ \
| * | | | | | gl_shader_decompiler: Implement BFE_IMM instruction.bunnei2018-06-072-7/+44
* | | | | | | Merge pull request #541 from Subv/blittexturesbunnei2018-06-071-56/+9
|\ \ \ \ \ \ \ | |/ / / / / / |/| | | | | |
| * | | | | | GLCache: Use the full uncompressed size when blitting from one texture to another.Subv2018-06-071-3/+6
| * | | | | | GLCache: Simplify the logic to copy from one texture to another in BlitTextures.Subv2018-06-071-53/+3
| | |/ / / / | |/| | | |
* | | | | | Merge pull request #539 from bunnei/f2f-roundingbunnei2018-06-072-10/+35
|\ \ \ \ \ \
| * | | | | | gl_shader_decompiler: F2F: Implement rounding modes.bunnei2018-06-072-10/+35
* | | | | | | Merge pull request #503 from mailwl/nfp-stubsbunnei2018-06-071-7/+101
|\ \ \ \ \ \ \ | |/ / / / / / |/| | | | | |
| * | | | | | Stub IUser::AttachAvailabilityChangeEventmailwl2018-06-061-5/+23
| * | | | | | Correct function resultsmailwl2018-06-041-4/+16
| * | | | | | Service/nfp:user : stub some functions.mailwl2018-06-041-6/+70
* | | | | | | Merge pull request #537 from bunnei/misc-shaderbunnei2018-06-072-8/+24
|\ \ \ \ \ \ \
| * | | | | | | gl_shader_decompiler: Remove some attribute stuff that has nothing to do with TEX/TEXS.bunnei2018-06-071-8/+4
| * | | | | | | shader_bytecode: Add instruction decodings for BFE, IMNMX, and XMAD.bunnei2018-06-071-0/+20
| | |/ / / / / | |/| | | | |
* | | | | | | Merge pull request #535 from Subv/gpu_swizzlebunnei2018-06-076-0/+65
|\ \ \ \ \ \ \
| * | | | | | | GPU: Support changing the texture swizzles for Maxwell textures.Subv2018-06-073-0/+45
| * | | | | | | GLState: Support changing the GL_TEXTURE_SWIZZLE parameter of each texture unit.Subv2018-06-073-0/+20
| |/ / / / / /
* | | | | | | Merge pull request #536 from bunnei/isetp_immbunnei2018-06-071-8/+9
|\ \ \ \ \ \ \ | |/ / / / / / |/| | | | | |
| * | | | | | gl_shader_decompiler: Implement ISETP_IMM instruction.bunnei2018-06-071-8/+9
|/ / / / / /
* | | | | | Merge pull request #534 from Subv/multitexturingbunnei2018-06-079-69/+172
|\ \ \ \ \ \
| * | | | | | GPU: Implement sampling multiple textures in the generated glsl shaders.Subv2018-06-069-69/+172
* | | | | | | Merge pull request #532 from bunnei/ld_cbunnei2018-06-074-28/+110
|\ \ \ \ \ \ \ | |/ / / / / / |/| | | | | |
| * | | | | | gl_shader_decompiler: Implement LD_C instruction.bunnei2018-06-072-0/+43
| * | | | | | gl_shader_gen: Add uniform handling for indirect const buffer access.bunnei2018-06-073-4/+40
| * | | | | | gl_shader_decompiler: Refactor uniform handling to allow different decodings.bunnei2018-06-062-26/+29
|/ / / / / /
* | | | | | nvdrv/devices/nvidia_ctrl_gpu : add IoctlCommands with their params (#524)greggameplayer2018-06-062-0/+53
* | | | | | Merge pull request #529 from bunnei/am-nifm-stubsSebastian Valle2018-06-063-2/+23
|\ \ \ \ \ \
| * | | | | | nifm: Stub out IRequest::SetConnectionConfirmationOption.bunnei2018-06-061-1/+10
| * | | | | | am: Stub out IApplicationFunctions::GetPseudoDeviceId.bunnei2018-06-062-1/+13
* | | | | | | Merge pull request #531 from bunnei/fix-shlSebastian Valle2018-06-061-1/+1
|\ \ \ \ \ \ \
| * | | | | | | gl_shader_decompiler: Fix un/signed mismatch with SHL.bunnei2018-06-061-1/+1
| |/ / / / / /
* | | | | | | Merge pull request #530 from bunnei/wrap-mirrorSebastian Valle2018-06-061-0/+2
|\ \ \ \ \ \ \
| * | | | | | | maxwell_to_gl: Implement WrapMode Mirror.bunnei2018-06-061-0/+2
| |/ / / / / /
* | | | | | | Merge pull request #527 from Subv/rgba32f_texcopybunnei2018-06-062-0/+5
|\ \ \ \ \ \ \
| * | | | | | | GPU: Allow the usage of RGBA16_FLOAT in the texture copy engine.Subv2018-06-061-0/+2
| * | | | | | | GPU: Allow the usage of RGBA32_FLOAT in the texture copy engine.Subv2018-06-062-0/+3
| | |_|/ / / / | |/| | | | |
* | | | | | | Merge pull request #528 from Subv/rg11b10fbunnei2018-06-064-12/+31
|\ \ \ \ \ \ \
| * | | | | | | GPU: Implemented the R11FG11FB10F texture and rendertarget formats.Subv2018-06-064-11/+30
| * | | | | | | GPU: Fixed the compression factor for RGBA16F textures.Subv2018-06-061-1/+1
| |/ / / / / /
* | / / / / / GDB Stub Improvements (#508)Hedges2018-06-064-27/+194
| |/ / / / / |/| | | | |
* | | | | | Merge pull request #516 from Subv/f2i_rbunnei2018-06-062-7/+64
|\ \ \ \ \ \ | |_|_|_|_|/ |/| | | | |
| * | | | | GPU: Implemented the F2I_R shader instruction.Subv2018-06-052-7/+64
* | | | | | Merge pull request #523 from yuzu-emu/revert-507-3616James Rowe2018-06-051-1/+1
|\ \ \ \ \ \
| * | | | | | Revert "Port citra #3616"bunnei2018-06-051-1/+1
|/ / / / / /
* | | | | | Merge pull request #521 from Subv/brabunnei2018-06-051-4/+5
|\ \ \ \ \ \
| * | | | | | GPU: Corrected the branch targets for the shader bra instruction.Subv2018-06-051-4/+5
| | |/ / / / | |/| | | |
* | | | | | Merge pull request #520 from bunnei/shader-shlbunnei2018-06-052-15/+48
|\ \ \ \ \ \ | |/ / / / / |/| | | | |
| * | | | | gl_shader_decompiler: Fix typo with ISCADD instruction.bunnei2018-06-051-1/+1
| * | | | | gl_shader_decompiler: Implement SHL instruction.bunnei2018-06-052-14/+47
* | | | | | Merge pull request #518 from Subv/incomplete_shadersbunnei2018-06-051-5/+16
|\ \ \ \ \ \ | |/ / / / / |/| | | | |
| * | | | | GPU: Implement predicated exit instructions in the shader programs.Subv2018-06-051-4/+6
| * | | | | GPU: Take into account predicated exits when performing shader control flow analysis.Subv2018-06-051-1/+10
* | | | | | Merge pull request #519 from bunnei/pred-not-equalbunnei2018-06-051-3/+3
|\ \ \ \ \ \
| * | | | | | gl_shader_decompiler: Implement PredCondition::NotEqual.bunnei2018-06-051-3/+3
|/ / / / / /
* | | | | | Merge pull request #517 from Subv/iscaddbunnei2018-06-052-0/+47
|\ \ \ \ \ \ | |_|/ / / / |/| | | | |
| * | | | | GPU: Implement the ISCADD shader instructions.Subv2018-06-052-0/+40
| * | | | | GPU: Added decodings for the ISCADD instructions.Subv2018-06-051-0/+7
|/ / / / /
* | | | | Merge pull request #514 from Subv/lop32ibunnei2018-06-052-1/+58
|\ \ \ \ \
| * | | | | GPU: Implemented the LOP32I instruction.Subv2018-06-042-1/+58
| | |/ / / | |/| | |
* | | | | Merge pull request #510 from Subv/isetpbunnei2018-06-052-6/+63
|\ \ \ \ \
| * | | | | GPU: Use explicit types when retrieving the uniform values for fsetp/fset and isetp instead of the type of an invalid output register.Subv2018-06-041-9/+18
| * | | | | GPU: Implemented the ISETP_R and ISETP_C shader instructions.Subv2018-06-042-0/+48
* | | | | | Merge pull request #512 from Subv/fsetbunnei2018-06-052-4/+19
|\ \ \ \ \ \ | |_|_|/ / / |/| | | | |
| * | | | | GPU: Use the bf bit in FSET to determine whether to write 0xFFFFFFFF or 1.0f.Subv2018-06-042-2/+7
| * | | | | GPU: Corrected the I2F_R implementation.Subv2018-06-041-2/+12
| | |/ / / | |/| | |
* | | | | Merge pull request #501 from Subv/shader_brabunnei2018-06-052-1/+45
|\ \ \ \ \
| * | | | | GPU: Partially implemented the shader BRA instruction.Subv2018-06-042-1/+43
| * | | | | GPU: Added decoding for the BRA instruction.Subv2018-06-041-0/+2
| | |/ / / | |/| | |
* | | | | Merge pull request #515 from Subv/viewport_fixbunnei2018-06-052-14/+30
|\ \ \ \ \
| * | | | | GPU: Calculate the correct viewport dimensions based on the scale and translate registers.Subv2018-06-042-14/+30
| | |/ / / | |/| | |
* | | | | Merge pull request #490 from BreadFish64/extension-checkbunnei2018-06-044-0/+53
|\ \ \ \ \
| * | | | | sdl: add check for GL extension supportBreadFish642018-06-042-0/+26
| * | | | | qt: add check for GL extension supportBreadFish642018-06-042-0/+27
* | | | | | Merge pull request #513 from Subv/cache_alignmentbunnei2018-06-041-1/+2
|\ \ \ \ \ \
| * | | | | | GLCache: Corrected a mismatch between storing compressed sizes and verifying the uncompressed alignment in GetSurface.Subv2018-06-041-1/+2
| | |/ / / / | |/| | | |
* | | | | | Nvdrv/devices/nvhost_gpu : Add some IoctlCommands with their params (#511)greggameplayer2018-06-041-0/+47
* | | | | | Merge pull request #502 from bunnei/more-am-stuffbunnei2018-06-041-4/+28
|\ \ \ \ \ \
| * | | | | | am: Implement ILibraryAppletAccessor::PopOutData.bunnei2018-06-041-1/+11
| * | | | | | am: ISelfController:LaunchableEvent should be sticky.bunnei2018-06-041-1/+1
| * | | | | | am: Stub out ILibraryAppletAccessor Start and GetResult methods.bunnei2018-06-041-2/+16
| |/ / / / /
* | | | | | Merge pull request #507 from valentinvanelslande/3616James Rowe2018-06-041-1/+1
|\ \ \ \ \ \ | |/ / / / / |/| | | | |
| * | | | | Port citra #3616Valentin Vanelslande2018-06-041-1/+1
|/ / / / /
* | | | | Merge pull request #499 from bunnei/am-stuffbunnei2018-06-042-66/+105
|\ \ \ \ \ | |_|/ / / |/| | | |
| * | | | am: Implement ILibraryAppletAccessor::PushInData.bunnei2018-06-041-43/+55
| * | | | am: Implement IStorageAccessor::Write.bunnei2018-06-041-1/+17
| * | | | am: Cleanup IStorageAccessor::Read.bunnei2018-06-041-5/+3
| * | | | am: Implement ILibraryAppletCreator::CreateStorage.bunnei2018-06-042-21/+34
* | | | | Merge pull request #500 from Subv/long_queriesbunnei2018-06-041-9/+24
|\ \ \ \ \
| * | | | | GPU: Partial implementation of long GPU queries.Subv2018-06-041-9/+24
* | | | | | Merge pull request #498 from bunnei/texs-maskbunnei2018-06-042-9/+26
|\ \ \ \ \ \ | |_|/ / / / |/| | | | |
| * | | | | gl_shader_decompiler: Implement TEXS component mask.bunnei2018-06-032-9/+26
|/ / / / /
* | | | | Merge pull request #494 from bunnei/shader-texbunnei2018-06-032-2/+58
|\ \ \ \ \
| * | | | | gl_shader_decompiler: Implement TEX instruction.bunnei2018-06-012-1/+36
| * | | | | gl_shader_decompiler: Support multi-destination for TEXS.bunnei2018-06-012-2/+23
* | | | | | Merge pull request #495 from bunnei/improve-rrobunnei2018-06-032-9/+18
|\ \ \ \ \ \
| * | | | | | gl_shader_decompiler: Implement RRO as a register move.bunnei2018-06-032-9/+18
| |/ / / / /
* | | | | | Merge pull request #484 from mailwl/nvhost-nvdecbunnei2018-06-034-0/+74
|\ \ \ \ \ \
| * | | | | | Services/nvdrv: add '/dev/nvhost-nvdec' devicemailwl2018-05-304-0/+74
* | | | | | | Merge pull request #496 from Subv/waitprocesswidekey_timeoutbunnei2018-06-031-2/+5
|\ \ \ \ \ \ \
| * | | | | | | Kernel/Threads: A thread waking up by timeout from a WaitProcessWideKey may already have an assigned lock owner.Subv2018-06-021-2/+5
| | |_|/ / / / | |/| | | | |
* | | | | | | Merge pull request #497 from Subv/dxn1bunnei2018-06-033-3/+16
|\ \ \ \ \ \ \ | |/ / / / / / |/| | | | | |
| * | | | | | GPU: Implemented the DXN1 (BC4) texture format.Subv2018-06-023-3/+16
|/ / / / / /
* | | | | | Merge pull request #492 from mailwl/timebunnei2018-06-012-14/+72
|\ \ \ \ \ \ | |_|/ / / / |/| | | | |
| * | | | | Service/time: implement posix time to calendar conversionmailwl2018-06-012-14/+72
|/ / / / /
* | | | | Merge pull request #488 from Subv/thread_masksbunnei2018-06-013-4/+31
|\ \ \ \ \
| * | | | | Kernel/Thread: Corrected a typo that caused the affinity mask to never be changed.Subv2018-05-311-2/+2
| * | | | | Kernel/SVC: Support special core values -2 and -3 in svcSetThreadCoreMask.Subv2018-05-312-1/+28
| * | | | | Kernel/Thread: Corrected a typo in an assert about the processor id.Subv2018-05-301-1/+1
* | | | | | Merge pull request #491 from bunnei/rgba16fbunnei2018-06-013-7/+24
|\ \ \ \ \ \
| * | | | | | gl_rasterizer_cache: Assert that component type is UNorm or format is RGBA16F.bunnei2018-05-311-1/+2
| * | | | | | gl_rasterizer_cache: Implement PixelFormat RGBA16F.bunnei2018-05-313-6/+22
|/ / / / / /
* | | | | | Merge pull request #489 from Subv/vertexidbunnei2018-05-302-1/+11
|\ \ \ \ \ \
| * | | | | | Shaders: Implemented reading the gl_InstanceID and gl_VertexID variables in the vertex shader.Subv2018-05-302-1/+11
| |/ / / / /
* | | / / / add IPC CommandType & Some HID FunctionInfo (#487)greggameplayer2018-05-302-0/+33
| |_|/ / / |/| | | |
* | | | | Merge pull request #483 from bunnei/sonicSebastian Valle2018-05-305-10/+35
|\ \ \ \ \ | |_|/ / / |/| | | |
| * | | | gl_shader_decompiler: F2F_R instruction: Implement abs.bunnei2018-05-301-1/+7
| * | | | gl_shader_decompiler: Partially implement F2F_R instruction.bunnei2018-05-302-4/+9
| * | | | nvhost_ctrl: Stub out IocCtrlEventRegister.bunnei2018-05-302-0/+10
| * | | | nvhost_ctrl: Stub out IocCtrlEventWaitAsyncCommand.bunnei2018-05-302-5/+9
| * | | | gl_rasterize_cache: Invert order of tex format RGB565.bunnei2018-05-301-1/+1
| |/ / /
* | | | Merge pull request #482 from Subv/r8bunnei2018-05-303-5/+18
|\ \ \ \ | |/ / / |/| | |
| * | | GPU: Implemented the R8 texture format (0x1D)Subv2018-05-303-5/+18
|/ / /
* | | Merge pull request #480 from mailwl/bcatbunnei2018-05-308-0/+120
|\ \ \
| * | | Service/BCAT: add module and servicesmailwl2018-05-288-0/+120
| |/ /
* / / add all the known TextureFormat (#474)greggameplayer2018-05-291-2/+71
|/ /
* | Merge pull request #472 from bunnei/greater-equalbunnei2018-05-271-4/+3
|\ \
| * | gl_shader_decompiler: Implement GetPredicateComparison GreaterEqual.bunnei2018-05-261-4/+3
* | | Merge pull request #476 from Subv/a1bgr5bunnei2018-05-274-5/+21
|\ \ \
| * | | GPU: Implemented the A1B5G5R5 texture format (0x14)Subv2018-05-274-5/+21
| |/ /
* | | Merge pull request #475 from ogniK5377/nvos-getconfigbunnei2018-05-271-1/+1
|\ \ \
| * | | NvOsGetConfigU32 should return null instead of 0 for default outputDavid Marcec2018-05-271-1/+1
| |/ /
* | | Merge pull request #473 from bunnei/get-display-versionbunnei2018-05-272-1/+10
|\ \ \
| * | | am: Stub IApplicationFunctions GetDisplayVersion.bunnei2018-05-262-1/+10
| |/ /
* | | Merge pull request #471 from bunnei/fmnmxSebastian Valle2018-05-272-4/+10
|\ \ \ | |/ / |/| |
| * | shader_bytecode: Implement other variants of FMNMX.bunnei2018-05-262-4/+10
|/ /
* | Add & correct miscellaneous things (#470)greggameplayer2018-05-264-4/+55
* | Merge pull request #466 from mailwl/nv-timeoutbunnei2018-05-262-0/+16
|\ \
| * | Stub NVGPU_IOCTL_CHANNEL_SET_TIMEOUTmailwl2018-05-242-0/+16
* | | GetAudioRendererWorkBufferSize impl (#465)David2018-05-262-2/+88
* | | Merge pull request #468 from Subv/compound_predsbunnei2018-05-261-46/+66
|\ \ \
| * | | Shader: Implemented compound predicates in fset.Subv2018-05-251-28/+12
| * | | Shader: Implemented compound predicates in fsetp.Subv2018-05-251-19/+55
| |/ /
* | | Merge pull request #469 from Subv/channel_rebindbunnei2018-05-261-1/+0
|\ \ \
| * | | GPU: Allow command lists to rebind a channel to another engine in the middle of the command list.Subv2018-05-251-1/+0
| |/ /
* / / Stubbed NVGPU_GPU_IOCTL_ZBC_SET_TABLE (#463)David2018-05-252-0/+22
|/ /
* | Merge pull request #464 from bunnei/fix-msvcbunnei2018-05-241-14/+12
|\ \
| * | yuzu_cmd: Fix project for latest msvc.bunnei2018-05-241-14/+12
|/ /
* | Merge pull request #462 from ogniK5377/hid-fixbunnei2018-05-241-1/+1
|\ \
| * | Fix deadlocks caused from HID having too many layoutsDavid Marcec2018-05-241-1/+1
|/ /
* | Merge pull request #460 from greggameplayer/patch-6bunnei2018-05-231-2/+8
|\ \
| * | Add & correct some error modulesgreggameplayer2018-05-231-2/+8
* | | Merge pull request #459 from greggameplayer/patch-5bunnei2018-05-233-29/+117
|\ \ \
| * | | change some functionsgreggameplayer2018-05-231-6/+6
| * | | correct placement and add size checkgreggameplayer2018-05-231-21/+25
| * | | Add ioctl commands with their params and size checkgreggameplayer2018-05-231-2/+86
| |/ /
* | | Merge pull request #461 from lioncash/dynarmicbunnei2018-05-231-0/+0
|\ \ \
| * | | externals: Update dynarmicLioncash2018-05-231-0/+0
|/ / /
* | | Merge pull request #454 from Subv/signal_processwidebunnei2018-05-231-83/+74
|\ \ \ | |/ / |/| |
| * | Kernel/SVC: Signal the highest priority threads first in svcSignalProcessWideKey.Subv2018-05-191-51/+68
| * | Kernel/Threads: Reschedule the proper core when operating on that core's threads.Subv2018-05-191-2/+6
| * | SVC: Removed unused WaitSynchronization1 functionSubv2018-05-191-30/+0
* | | Implemented NVHOST_IOCTL_CHANNEL_GET_WAITBASE (#440)David2018-05-222-1/+20
* | | Merge pull request #456 from Subv/unmap_bufferbunnei2018-05-216-1/+118
|\ \ \
| * | | GPU: Implemented the nvmap Free ioctl.Subv2018-05-202-1/+48
| * | | GPU: Implemented nvhost-as-gpu's UnmapBuffer ioctl.Subv2018-05-204-0/+70
| |/ /
* | | Correct audio command numbers & add or rename some functions (#455)greggameplayer2018-05-215-34/+34
* | | Merge pull request #457 from Subv/mutex_waitersbunnei2018-05-211-1/+0
|\ \ \
| * | | Mutex: Do not assert when the mutex waiting threads list isn't empty on mutex release.Subv2018-05-201-1/+0
| |/ /
* | | Merge pull request #458 from Subv/fmnmxbunnei2018-05-212-6/+26
|\ \ \
| * | | Shaders: Implemented the FMNMX shader instruction.Subv2018-05-212-6/+26
| |/ /
* | | Merge pull request #445 from greggameplayer/patch-2bunnei2018-05-213-6/+7
|\ \ \
| * | | rename fatal:u functions & add ThrowFatalgreggameplayer2018-05-181-2/+3
| * | | Properly update fatal.h void namegreggameplayer2018-05-181-2/+2
| * | | Properly rename fatal module functionsgreggameplayer2018-05-181-2/+2
| |/ /
* | | Merge pull request #453 from Subv/thread_callstackSebastian Valle2018-05-212-0/+37
|\ \ \
| * | | Qt/WaitTree: Display the callstack for each thread in the wait tree widget.Subv2018-05-192-0/+37
| |/ /
* | | Merge pull request #452 from Subv/psetpSebastian Valle2018-05-211-0/+3
|\ \ \
| * | | ShadersDecompiler: Added decoding for the PSETP instruction.Subv2018-05-191-0/+3
| |/ /
* | | Merge pull request #451 from Subv/gl_array_sizeSebastian Valle2018-05-212-13/+3
|\ \ \
| * | | GLRenderer: Remove unused hw_vao_enabled_attributes variable.Subv2018-05-192-4/+0
| * | | GLRenderer: Remove unused vertex buffer and increase the size of the stream buffer to 128 MB.Subv2018-05-192-9/+3
| |/ /
* | | Merge pull request #450 from Subv/shader_link_errorSebastian Valle2018-05-201-0/+27
|\ \ \
| * | | GLRenderer: Log the shader source code when program linking fails.Subv2018-05-191-0/+27
| |/ /
* | | Merge pull request #443 from ogniK5377/ipc-500Sebastian Valle2018-05-203-1/+7
|\ \ \
| * | | Added RequestWithContext & ControlWithContextDavid Marcec2018-05-173-1/+7
| |/ /
* | | Add and correct some Error Modules (#444)greggameplayer2018-05-201-6/+40
* | | Merge pull request #442 from Hexagon12/nfp-service-namesSebastian Valle2018-05-201-24/+24
|\ \ \ | |/ / |/| |
| * | Updated nfp with more service namesHexagon122018-05-131-24/+24
|/ /
* | Merge pull request #436 from bunnei/multi-corebunnei2018-05-1124-189/+613
|\ \
| * | core: Add several missing docstrings.bunnei2018-05-111-0/+8
| * | thread: Rename mask to affinity_masks.bunnei2018-05-114-5/+6
| * | core: Run all CPU cores separately, even in single-thread mode.bunnei2018-05-112-13/+23
| * | thread: Support core change on ResumeFromWait and improve ChangeCore.bunnei2018-05-111-37/+68
| * | scheduler: Protect scheduling functions with a global mutex.bunnei2018-05-112-0/+18
| * | wait_tree: Add ideal core and affinity mask.bunnei2018-05-111-0/+2
| * | thread: Initialize ideal_core and mask members.bunnei2018-05-111-0/+2
| * | threading: Reschedule only on cores that are necessary.bunnei2018-05-114-3/+10
| * | svc: Implement GetThreadCoreMask and SetThreadCoreMask.bunnei2018-05-111-7/+22
| * | thread: Implement ChangeCore function.bunnei2018-05-112-1/+58
| * | svc: SignalProcessWideKey should apply to all cores.bunnei2018-05-111-43/+50
| * | svc: Implement GetCurrentProcessorNumber.bunnei2018-05-111-2/+2
| * | wait_tree: Show all threads on all schedulers.bunnei2018-05-111-6/+14
| * | core: Add a configuration setting for use_multi_core.bunnei2018-05-1110-17/+56
| * | core: Support session close with multicore.bunnei2018-05-114-16/+47
| * | core: Implement multicore support.bunnei2018-05-1113-78/+113
| * | core: Create a thread for each CPU core, keep in lock-step with a barrier.bunnei2018-05-114-18/+94
| * | core: Move common CPU core things to its own class.bunnei2018-05-115-58/+135
* | | Merge pull request #439 from ogniK5377/GetTPCMasksbunnei2018-05-112-4/+8
|\ \ \ | |/ / |/| |
| * | More accurate GetTPCMasks implDavid Marcec2018-05-112-4/+8
|/ /
* | Stubs for QLaunch (#428)Hexagon122018-05-074-5/+221
* | hid: Tweaks, Analog Sticks (#435)Max Thomas2018-05-073-68/+224
* | Merge pull request #434 from lioncash/vdtorbunnei2018-05-033-1/+13
|\ \
| * | memory_hook: Default virtual destructor in the cpp fileLioncash2018-05-033-1/+13
* | | Merge pull request #433 from lioncash/loggingbunnei2018-05-032-48/+55
|\ \ \ | |/ / |/| |
| * | core_timing: Don't include the log header in core timing's headerLioncash2018-05-032-48/+55
|/ /
* | Merge pull request #431 from lioncash/fmtbunnei2018-05-0229-104/+105
|\ \
| * | general: Make formatting of logged hex values more straightforwardLioncash2018-05-0229-104/+105
* | | Merge pull request #430 from lioncash/vecbunnei2018-05-021-9/+9
|\ \ \
| * | | vector_math: Ensure members are always initializedLioncash2018-05-021-9/+9
| |/ /
* | | Merge pull request #427 from bunnei/domain-inputsbunnei2018-05-024-0/+23
|\ \ \ | |/ / |/| |
| * | ipc: Add support for PopIpcInterface() method.bunnei2018-05-024-0/+23
|/ /
* | Merge pull request #429 from Subv/ioctl_corruptionbunnei2018-05-012-5/+0
|\ \
| * | GPU: Don't write to invalid memory locations when handling ioctls that don't have an output.Subv2018-05-012-5/+0
* | | GetSharedFontInOrderOfPriority (#381)David2018-05-014-24/+54
|/ /
* | Merge pull request #425 from lioncash/namespacebunnei2018-04-309-14/+18
|\ \
| * | core_timing: Namespace all functions and constants in core_timing's headerLioncash2018-04-309-14/+18
|/ /
* | Merge pull request #424 from lioncash/stringbunnei2018-04-308-99/+19
|\ \
| * | string_util: Remove StringFromFormat() and related functionsLioncash2018-04-308-99/+19
* | | Merge pull request #422 from bunnei/shader-movbunnei2018-04-304-0/+30
|\ \ \
| * | | maxwell_3d: Reset vertex counts after drawing.bunnei2018-04-291-0/+10
| * | | gl_shader_decompiler: Implement MOV_R.bunnei2018-04-291-1/+2
| * | | maxwell_to_gl: Implement type SignedNorm, Size_8_8_8_8.bunnei2018-04-291-0/+12
| * | | shader_bytecode: Add decoding for FMNMX instruction.bunnei2018-04-291-0/+2
| * | | gl_shader_decompiler: Implement MOV_C.bunnei2018-04-291-0/+5
* | | | Merge pull request #423 from lioncash/filebunnei2018-04-302-8/+12
|\ \ \ \ | |_|/ / |/| | |
| * | | file_util: Make move constructor/assignment operator and related functions noexceptLioncash2018-04-302-6/+6
| * | | file_util: Add static assertions to ReadBytes() and WriteBytes()Lioncash2018-04-301-2/+6
|/ / /
* | | Merge pull request #421 from Subv/sh_pred3bunnei2018-04-291-0/+7
|\ \ \ | |/ / |/| |
| * | Shaders: Implemented predicate condition 3 (LessEqual) in the fset and fsetp instructions.Subv2018-04-291-0/+7
|/ /
* | Merge pull request #416 from bunnei/shader-ints-p3bunnei2018-04-292-114/+206
|\ \
| * | gl_shader_decompiler: Partially implement I2I_R, and I2F_R.bunnei2018-04-292-8/+34
| * | gl_shader_decompiler: More cleanups, etc. with how we handle register types.bunnei2018-04-291-44/+120
| * | GLSLRegister: Simplify register declarations, etc.bunnei2018-04-291-63/+31
| * | shader_bytecode: Add decodings for i2i instructions.bunnei2018-04-291-3/+20
| * | gl_shader_decompiler: Implement MOV32_IMM instruction.bunnei2018-04-292-2/+7
* | | Merge pull request #417 from bunnei/lang-codesbunnei2018-04-293-8/+49
|\ \ \
| * | | am: Fix GetDesiredLanguage implementation.bunnei2018-04-291-2/+4
| * | | set: Fix GetAvailableLanguageCodes implementation.bunnei2018-04-292-6/+45
| |/ /
* | | Merge pull request #418 from bunnei/copy-block-heightSebastian Valle2018-04-292-2/+7
|\ \ \ | |/ / |/| |
| * | fermi_2d: Fix surface copy block height.bunnei2018-04-292-2/+7
|/ /
* | Merge pull request #414 from lioncash/cruftbunnei2018-04-281-8/+0
|\ \
| * | file_util: Remove compiler version checks around is_trivially_copyable()Lioncash2018-04-281-8/+0
* | | Merge pull request #413 from lioncash/dynarmicbunnei2018-04-281-0/+0
|\ \ \ | |/ / |/| |
| * | externals: Update dynarmicLioncash2018-04-281-0/+0
* | | Merge pull request #412 from lioncash/logbunnei2018-04-282-54/+1
|\ \ \ | |/ / |/| |
| * | log: Remove old logging macros and functionsLioncash2018-04-272-54/+1
* | | Merge pull request #411 from lioncash/travisMat M2018-04-281-1/+1
|\ \ \ | |/ / |/| |
| * | travis: Use Xcode 9.3 instead of 9.2Lioncash2018-04-271-1/+1
* | | Merge pull request #408 from bunnei/shader-ints-p2bunnei2018-04-271-154/+262
|\ \ \
| * | | gl_shader_decompiler: Add GLSLRegisterManager class to track register state.bunnei2018-04-271-154/+262
| |/ /
* | | Merge pull request #410 from lioncash/genericbunnei2018-04-274-12/+11
|\ \ \ | |/ / |/| |
| * | renderer_opengl: Replace usages of LOG_GENERIC with fmt-capable equivalentsLioncash2018-04-271-6/+7
| * | core: Replace usages of LOG_GENERIC with new fmt-capable equivalentsLioncash2018-04-273-6/+4
|/ /
* | Merge pull request #409 from lioncash/assertbunnei2018-04-2717-39/+39
|\ \
| * | general: Convert assertion macros over to be fmt-compatibleLioncash2018-04-2717-39/+39
|/ /
* | Merge pull request #380 from ogniK5377/service-implbunnei2018-04-2713-13/+140
|\ \
| * | Switched to NGLOG_WARNINGDavid Marcec2018-04-274-5/+5
| * | Merge branch 'master' of https://github.com/yuzu-emu/yuzu into service-implDavid Marcec2018-04-26110-2244/+1811
| |\ \
| * | | Added PREPO to logging backend, Removed comments from SaveReportWithUserDavid Marcec2018-04-263-13/+3
| * | | GetIUserInterface->CreateUserInterface, Added todos and stub logs. Playreport->PlayReport.David Marcec2018-04-2310-25/+64
| * | | lioncash proposed changesDavid2018-04-221-2/+2
| * | | Implemented GetIUserInterface properly, Playreport and SSL::SetInterfaceVersion. Fixed ipc issues with IAudioDevice(wrong ids)David Marcec2018-04-2211-11/+109
* | | | Merge pull request #406 from lioncash/frontendbunnei2018-04-275-27/+26
|\ \ \ \
| * | | | frontends: Move logging macros over to new fmt-capable onesLioncash2018-04-275-27/+26
* | | | | Merge pull request #407 from lioncash/commonbunnei2018-04-274-67/+67
|\ \ \ \ \
| * | | | | common: Move logging macros over to new fmt-capable macros where applicableLioncash2018-04-274-67/+67
| |/ / / /
* | | | | Merge pull request #405 from lioncash/inputbunnei2018-04-271-3/+3
|\ \ \ \ \ | |/ / / / |/| | | |
| * | | | input_common: Move old logging macros over to fmt-capable onesLioncash2018-04-271-3/+3
|/ / / /
* | | | Merge pull request #402 from lioncash/corebunnei2018-04-276-28/+28
|\ \ \ \
| * | | | core: Replace remaining old non-generic logger usages with fmt-capable equivalentsLioncash2018-04-266-28/+28
* | | | | Merge pull request #399 from bunnei/shader-intsbunnei2018-04-272-9/+120
|\ \ \ \ \ | |_|_|/ / |/| | | |
| * | | | gl_shader_decompiler: Boilerplate for handling integer instructions.bunnei2018-04-262-6/+111
| * | | | gl_shader_decompiler: Move color output to EXIT instruction.bunnei2018-04-261-6/+12
| |/ / /
* | | | Merge pull request #403 from lioncash/commonbunnei2018-04-263-792/+0
|\ \ \ \ | |/ / / |/| | |
| * | | common: Remove chunk_file.h and linear_disk_cache.hLioncash2018-04-263-792/+0
|/ / /
* | | Merge pull request #401 from lioncash/gdbstubbunnei2018-04-261-38/+37
|\ \ \
| * | | core/gdbstub: Move logging macros to new fmt-compatible onesLioncash2018-04-261-38/+37
|/ / /
* | | Merge pull request #400 from lioncash/hwbunnei2018-04-262-8/+10
|\ \ \
| * | | core/hw: Move logging macros over to fmt-capable onesLioncash2018-04-262-8/+10
|/ / /
* | | Merge pull request #396 from Subv/shader_opsbunnei2018-04-262-9/+89
|\ \ \
| * | | Shaders: Added bit decodings for the I2I instruction.Subv2018-04-251-0/+6
| * | | Shaders: Implemented the FSET instruction.Subv2018-04-251-0/+53
| * | | Shaders: Added decodings for the FSET instructions.Subv2018-04-252-9/+30
* | | | Merge pull request #398 from lioncash/kernelbunnei2018-04-2611-107/+110
|\ \ \ \
| * | | | kernel/shared_memory: Remove unnecessary semicolon at end of ConvertPermissions()Lioncash2018-04-261-1/+1
| * | | | kernel: Migrate logging macros to fmt-compatible onesLioncash2018-04-2611-106/+109
* | | | | Merge pull request #387 from Subv/maxwell_2dbunnei2018-04-2610-52/+203
|\ \ \ \ \
| * | | | | GPU: Partially implemented the Fermi2D surface copy operation.Subv2018-04-252-0/+59
| * | | | | Memory: Added a missing shortcut for Memory::CopyBlock for the current process.Subv2018-04-251-0/+4
| * | | | | GPU: Make the Textures::CopySwizzledData function accessible from the outside of the file.Subv2018-04-252-3/+6
| * | | | | GPU: Added a function to retrieve the bytes per pixel of the render target formats.Subv2018-04-252-0/+15
| * | | | | GPU: Added surface copy registers to Fermi2DSubv2018-04-251-1/+57
| * | | | | GPU: Added boilerplate code for the Fermi2D engineSubv2018-04-253-3/+34
| * | | | | GPU: Reduce the number of registers of Maxwell3D to 0xE00.Subv2018-04-252-5/+5
| * | | | | GPU: Move the Maxwell3D macro uploading code to the inside of the Maxwell3D processor.Subv2018-04-254-40/+23
| * | | | | GPU: Corrected the upper bound of the PFIFO method ids in the command processor.Subv2018-04-251-1/+1
* | | | | | Merge pull request #395 from lioncash/file-sysbunnei2018-04-268-68/+59
|\ \ \ \ \ \ | |_|/ / / / |/| | | | |
| * | | | | file-sys: convert a StringFromFormat call into fmt::format in GetFullPath()Lioncash2018-04-251-4/+1
| * | | | | file-sys: Move logging macros over to the new fmt-capable onesLioncash2018-04-258-64/+58
| | |/ / / | |/| | |
* | | | | Merge pull request #390 from mailwl/pctl-modulebunnei2018-04-257-39/+71
|\ \ \ \ \
| * | | | | Service/PCTL: convert to module, add services, stubmailwl2018-04-257-39/+71
| |/ / / /
* | | | | Merge pull request #397 from lioncash/corebunnei2018-04-251-24/+26
|\ \ \ \ \ | |_|/ / / |/| | | |
| * | | | core/memory: Amend address widths in assertsLioncash2018-04-251-2/+2
| * | | | core/memory: Move logging macros over to new fmt-capable onesLioncash2018-04-251-22/+24
| |/ / /
* | | | Merge pull request #394 from lioncash/video-corebunnei2018-04-255-18/+20
|\ \ \ \ | |/ / / |/| | |
| * | | video-core: Move logging macros over to new fmt-capable onesLioncash2018-04-255-18/+20
|/ / /
* | | Merge pull request #388 from bunnei/refactor-rasterizer-cachebunnei2018-04-2514-175/+334
|\ \ \
| * | | renderer_opengl: Use correct byte order for framebuffer pixel format ABGR8.bunnei2018-04-251-2/+1
| * | | gl_rasterizer_cache: Use CHAR_BIT for bpp conversions instead of 8.bunnei2018-04-252-4/+4
| * | | gl_rasterizer_cache: Use GPU PAGE_BITS/SIZE, not CPU.bunnei2018-04-251-5/+5
| * | | gl_rasterizer_cache: Use new logger.bunnei2018-04-251-4/+4
| * | | gl_rasterizer_cache: Add a function for finding framebuffer GPU address.bunnei2018-04-253-0/+31
| * | | gl_rasterizer_cache: Handle compressed texture sizes.bunnei2018-04-252-24/+65
| * | | gl_rasterizer_cache: Update to be based on GPU addresses, not CPU addresses.bunnei2018-04-2510-67/+122
| * | | memory_manager: Add implement CpuToGpuAddress.bunnei2018-04-242-0/+27
| * | | memory_manager: Make GpuToCpuAddress return an optional.bunnei2018-04-247-28/+37
| * | | memory_manager: Use GPUVAdddr, not PAddr, for GPU addresses.bunnei2018-04-247-60/+57
* | | | Merge pull request #393 from lioncash/loaderbunnei2018-04-255-26/+25
|\ \ \ \ | |/ / / |/| | |
| * | | loader: Move old logging macros over to new fmt-capable onesLioncash2018-04-255-26/+25
|/ / /
* | | Merge pull request #386 from Subv/gpu_querybunnei2018-04-242-2/+53
|\ \ \
| * | | GPU: Added asserts to our code for handling the QUERY_GET GPU command.Subv2018-04-242-2/+53
* | | | Merge pull request #392 from lioncash/logbunnei2018-04-2438-297/+298
|\ \ \ \
| * | | | service: Move logging macros over to new fmt-compatible onesLioncash2018-04-241-5/+5
| * | | | vi: Move logging macros over to new fmt-compatible onesLioncash2018-04-241-26/+27
| * | | | time: Move logging macros over to new fmt-compatible onesLioncash2018-04-241-12/+12
| * | | | ssl: Move logging macros over to new fmt-compatible onesLioncash2018-04-241-3/+3
| * | | | spl: Move logging macros over to new fmt-compatible onesLioncash2018-04-241-1/+1
| * | | | sockets: Move logging macros over to new fmt-compatible onesLioncash2018-04-242-7/+8
| * | | | sm: Move logging macros over to new fmt-compatible onesLioncash2018-04-242-9/+8
| * | | | set: Move logging macros over to new fmt-compatible onesLioncash2018-04-242-2/+2
| * | | | pctl: Move logging macros over to new fmt-compatible onesLioncash2018-04-241-1/+1
| * | | | nvflinger: Move logging macros over to new fmt-compatible onesLioncash2018-04-242-3/+3
| * | | | nvdrv: Move logging macros over to new fmt-compatible onesLioncash2018-04-247-60/+61
| * | | | ns: Move logging macros over to new fmt-compatible onesLioncash2018-04-241-6/+6
| * | | | nifm: Move logging macros over to new fmt-compatible onesLioncash2018-04-241-11/+11
| * | | | nfp: Move logging macros over to new fmt-compatible onesLioncash2018-04-241-1/+1
| * | | | lm: Move logging macros over to new fmt-compatible onesLioncash2018-04-241-6/+6
| * | | | hid: Move logging macros over to new fmt-compatible onesLioncash2018-04-241-25/+25
| * | | | friend: Move logging macros over to new fmt-compatible onesLioncash2018-04-241-1/+1
| * | | | filesystem: Move logging macros over to new fmt-compatible onesLioncash2018-04-242-30/+29
| * | | | fatal: Move logging macros over to new fmt-compatible onesLioncash2018-04-241-2/+2
| * | | | audio: Move logging macros over to new fmt-compatible onesLioncash2018-04-242-21/+21
| * | | | apm: Move logging macros over to new fmt-compatible onesLioncash2018-04-241-3/+3
| * | | | aoc: Move logging macros over to new fmt-compatible onesLioncash2018-04-241-2/+2
| * | | | am: Move logging macros over to new fmt-compatible onesLioncash2018-04-243-50/+50
| * | | | acc: Move logging macros over to new fmt-compatible onesLioncash2018-04-241-10/+10
* | | | | Merge pull request #391 from lioncash/videobunnei2018-04-241-1/+2
|\ \ \ \ \ | |/ / / / |/| | | |
| * | | | renderer_opengl: Silence a -Wdangling-else warning in DrawScreenTriangles()Lioncash2018-04-241-1/+2
|/ / / /
* | | | Merge pull request #389 from mailwl/fs-renamefilebunnei2018-04-246-8/+36
|\ \ \ \
| * | | | Service/FS: implement IFileSystem::RenameFilemailwl2018-04-246-8/+36
|/ / / /
* | | | Merge pull request #379 from Subv/multi_buffersbunnei2018-04-243-43/+89
|\ \ \ \
| * | | | GPU: Support multiple enabled vertex arrays.Subv2018-04-233-43/+89
| |/ / /
* | | | Merge pull request #370 from Subv/sync_primitivesbunnei2018-04-2316-525/+285
|\ \ \ \
| * | | | Kernel: Implemented mutex priority inheritance.Subv2018-04-234-10/+94
| * | | | Kernel: Use 0x2C as default main thread priority for homebrew and lone NRO/NSOsSubv2018-04-213-3/+3
| * | | | Qt: Update the WaitTree widget to show info about the current mutex of each thread.Subv2018-04-215-90/+55
| * | | | Kernel: Remove unused ConditionVariable class.Subv2018-04-216-150/+0
| * | | | Kernel: Remove old and unused Mutex code.Subv2018-04-214-209/+3
| * | | | Kernel: Properly implemented svcWaitProcessWideKey and svcSignalProcessWideKeySubv2018-04-211-83/+46
| * | | | Kernel: Corrected the implementation of svcArbitrateLock and svcArbitrateUnlock.Subv2018-04-216-22/+126
* | | | | Merge pull request #384 from Subv/nvhost-remapbunnei2018-04-232-0/+57
|\ \ \ \ \
| * | | | | NvDrv/nvhost-as-gpu: Ensure that the object passed to MapBufferEx has already been allocated.Subv2018-04-231-0/+10
| * | | | | Nvdrv/nvhost-as-gpu: Implemented the ioctl REMAP command.Subv2018-04-232-0/+47
| | |/ / / | |/| | |
* | | | | Merge pull request #385 from Subv/unimpl_ioctlsbunnei2018-04-235-5/+5
|\ \ \ \ \
| * | | | | Nvdrv: Assert when receiving an unimplemented ioctl in the nv* handlers.Subv2018-04-235-5/+5
| |/ / / /
* | | | | Merge pull request #383 from Subv/gpu_mmubunnei2018-04-232-34/+25
|\ \ \ \ \
| * | | | | GPU: Make the GPU virtual memory manager use 16 page bits and 10 page table bits.Subv2018-04-232-34/+25
| |/ / / /
* | | | | Merge pull request #382 from Subv/a2rgb10_rtbunnei2018-04-232-0/+4
|\ \ \ \ \ | |_|_|/ / |/| | | |
| * | | | GPU: Implement the RGB10_A2 RenderTarget format, it will use the same format as the A2BGR10 texture format.Subv2018-04-232-0/+4
|/ / / /
* | | | Merge pull request #378 from Subv/a2bgr10bunnei2018-04-224-6/+18
|\ \ \ \ | |/ / / |/| | |
| * | | GPU: Implement the A2BGR10 texture format.Subv2018-04-224-6/+18
|/ / /
* | | Merge pull request #377 from adityaruplaha/sdl2-fullscreenbunnei2018-04-213-4/+40
|\ \ \
| * | | SDL2: Implement fullscreen. (Original PR: citra-emu/citra#3607)adityaruplaha2018-04-213-4/+40
* | | | Merge pull request #376 from bunnei/shader-decoderbunnei2018-04-212-210/+249
|\ \ \ \
| * | | | gl_shader_decompiler: Skip RRO instruction.bunnei2018-04-211-0/+4
| * | | | gl_shader_decompiler: Cleanup error logging.bunnei2018-04-211-14/+6
| * | | | shader_bytecode: Add several more instruction decodings.bunnei2018-04-211-5/+52
| * | | | shader_bytecode: Decode instructions based on bit strings.bunnei2018-04-212-205/+201
* | | | | Merge pull request #375 from lioncash/headerbunnei2018-04-214-11/+0
|\ \ \ \ \ | |/ / / / |/| | | |
| * | | | opengl: Remove unnecessary header inclusionsLioncash2018-04-214-11/+0
* | | | | Merge pull request #369 from Subv/shader_instr2bunnei2018-04-212-4/+179
|\ \ \ \ \
| * | | | | ShaderGen: Implemented the KIL instruction, which is equivalent to 'discard'.Subv2018-04-211-1/+7
| * | | | | ShaderGen: Implemented predicated instruction execution.Subv2018-04-212-1/+40
| * | | | | ShaderGen: Implemented the fsetp instruction.Subv2018-04-212-3/+112
| * | | | | ShaderGen: Register id 255 is special and is hardcoded to return 0 (SR_ZERO).Subv2018-04-202-0/+5
| * | | | | ShaderGen: Ignore the 'sched' instruction when generating shaders.Subv2018-04-201-0/+16
| | |_|/ / | |/| | |
* | | | | Merge pull request #374 from lioncash/noexceptbunnei2018-04-211-20/+19
|\ \ \ \ \
| * | | | | gl_resource_manager: Add missing noexcept specifiers to move constructors and assignment operatorsLioncash2018-04-211-20/+19
| | |/ / / | |/| | |
* | | | | Merge pull request #373 from lioncash/enum2bunnei2018-04-211-4/+9
|\ \ \ \ \
| * | | | | gl_rasterizer_cache: Make MatchFlags an enum classLioncash2018-04-211-4/+9
| |/ / / /
* | | | | Merge pull request #372 from lioncash/enumbunnei2018-04-213-38/+38
|\ \ \ \ \
| * | | | | resource_limit: Make ResourceTypes an enum classLioncash2018-04-213-38/+38
| |/ / / /
* | | | | Merge pull request #371 from lioncash/globalbunnei2018-04-216-38/+66
|\ \ \ \ \ | |/ / / / |/| | | |
| * | | | core: Relocate g_service_manager to the System classLioncash2018-04-216-38/+66
|/ / / /
* | | | Merge pull request #340 from mailwl/vi-updatebunnei2018-04-201-7/+27
|\ \ \ \ | |/ / / |/| | |
| * | | Service/VI: stub SetLayerVisibility, fix GetDisplayResolution outputmailwl2018-04-171-7/+27
* | | | Merge pull request #367 from lioncash/clampbunnei2018-04-205-24/+22
|\ \ \ \
| * | | | math_util: Remove the Clamp() functionLioncash2018-04-205-24/+22
* | | | | Merge pull request #361 from lioncash/commonbunnei2018-04-201-18/+12
|\ \ \ \ \
| * | | | | common_types: Convert typedefs to using aliasesLioncash2018-04-201-12/+12
| * | | | | common_types: Remove unnecessary check for whether or not__func__ is definedLioncash2018-04-201-6/+0
| |/ / / /
* | | | | Merge pull request #368 from lioncash/dynarmicbunnei2018-04-201-0/+0
|\ \ \ \ \
| * | | | | externals: Update dynarmic to HEADLioncash2018-04-201-0/+0
* | | | | | Merge pull request #360 from lioncash/namespacesbunnei2018-04-20136-570/+273
|\ \ \ \ \ \
| * | | | | | service: Use nested namespace specifiers where applicableLioncash2018-04-20136-570/+273
| | |/ / / / | |/| | | |
* | | | | | Merge pull request #364 from lioncash/thread-localbunnei2018-04-201-19/+0
|\ \ \ \ \ \
| * | | | | | common/thread: Remove unnecessary feature checking for thread_localLioncash2018-04-201-19/+0
| |/ / / / /
* | | | | | Merge pull request #362 from lioncash/snprintfbunnei2018-04-201-5/+0
|\ \ \ \ \ \
| * | | | | | common_funcs: Remove check for VS versions that we don't even supportLioncash2018-04-201-5/+0
| |/ / / / /
* | | | | | Merge pull request #363 from lioncash/array-sizebunnei2018-04-203-5/+4
|\ \ \ \ \ \
| * | | | | | common_funcs: Remove ARRAY_SIZE macroLioncash2018-04-203-5/+4
| |/ / / / /
* | | | | | Merge pull request #366 from lioncash/vecbunnei2018-04-201-30/+0
|\ \ \ \ \ \
| * | | | | | vector_math: Remove AsArray() and Write() functions from Vec[2,3,4]Lioncash2018-04-201-30/+0
* | | | | | | Merge pull request #365 from lioncash/codeblockbunnei2018-04-202-86/+0
|\ \ \ \ \ \ \
| * | | | | | | common: Remove code_block.hLioncash2018-04-202-86/+0
| | |/ / / / / | |/| | | | |
* | | | | | | Merge pull request #357 from lioncash/guardbunnei2018-04-202-0/+4
|\ \ \ \ \ \ \
| * | | | | | | renderer_opengl: Add missing header guardsLioncash2018-04-202-0/+4
| |/ / / / / /
* | | | | | | Merge pull request #358 from lioncash/explicitbunnei2018-04-202-4/+3
|\ \ \ \ \ \ \
| * | | | | | | disk_filesystem: Remove unused total_entries_in_directory member from Disk_DirectoryLioncash2018-04-201-1/+0
| * | | | | | | disk_filesystem: Remove redundant initializer in Disk_Directory's constructorLioncash2018-04-201-1/+1
| * | | | | | | disk_filesystem: Make constructors explicit where applicableLioncash2018-04-201-2/+2
| |/ / / / / /
* | | | | | | Merge pull request #359 from lioncash/redundantbunnei2018-04-201-9/+5
|\ \ \ \ \ \ \ | |/ / / / / / |/| | | | | |
| * | | | | | vi: Remove redundant initializers in the constructorsLioncash2018-04-201-9/+5
|/ / / / / /
* | | | | | Merge pull request #356 from lioncash/shaderbunnei2018-04-201-12/+30
|\ \ \ \ \ \ | |/ / / / / |/| | | | |
| * | | | | glsl_shader_decompiler: Use std::string_view instead of std::string for AddLine()Lioncash2018-04-201-1/+2
| * | | | | glsl_shader_decompiler: Add AddNewLine() function to ShaderWriterLioncash2018-04-201-6/+12
| * | | | | glsl_shader_decompiler: Add char overload for ShaderWriter's AddLine()Lioncash2018-04-201-4/+11
| * | | | | glsl_shader_decompiler: Append indentation without constructing a separate std::stringLioncash2018-04-201-1/+5
* | | | | | Merge pull request #355 from Subv/shader_instrbunnei2018-04-202-11/+39
|\ \ \ \ \ \ | |/ / / / / |/| | | | |
| * | | | | ShaderGen: Implemented the fmul32i shader instruction.Subv2018-04-192-9/+30
| * | | | | ShaderGen: Fixed a case where the TEXS instruction would use the same registers for the input and the output.Subv2018-04-191-2/+9
* | | | | | Merge pull request #348 from jlachniet/patch-1James Rowe2018-04-191-1/+1
|\ \ \ \ \ \
| * | | | | | Technically, yuzu can boot commercial gamesjlachniet2018-04-181-1/+1
* | | | | | | Implement Pull #3528 from citra: use nvidia graphics automatically on laptops with optimus (with AMD support) (#271)N00byKing2018-04-192-0/+18
* | | | | | | Merge pull request #352 from bunnei/fix-microprofileJames Rowe2018-04-191-0/+3
|\ \ \ \ \ \ \ | |_|/ / / / / |/| | | | | |
| * | | | | | nvflinger: Call MicroProfileFlip on NVFlinger::Compose.bunnei2018-04-191-0/+3
| |/ / / / /
* | | | | | Merge pull request #353 from Subv/compressed_formatsbunnei2018-04-193-28/+35
|\ \ \ \ \ \
| * | | | | | GPU: Add support for the DXT23 and DXT45 compressed texture formats.Subv2018-04-193-28/+35
|/ / / / / /
* | | | | | Merge pull request #351 from Subv/tex_formatsbunnei2018-04-194-8/+28
|\ \ \ \ \ \
| * | | | | | GPU: Implemented the B5G6R5 format.Subv2018-04-194-8/+28
* | | | | | | gl_shader_gen: Support vertical/horizontal viewport flipping. (#347)bunnei2018-04-184-5/+29
|/ / / / / /
* | | | | | Merge pull request #350 from Subv/tex_componentsbunnei2018-04-183-43/+90
|\ \ \ \ \ \
| * | | | | | GLCache: Added boilerplate code to make supporting configurable texture component types.Subv2018-04-183-9/+69
| * | | | | | GLCache: Unify texture and framebuffer formats when converting to OpenGL.Subv2018-04-182-26/+13
| * | | | | | GPU: Texture format 8 and framebuffer format 0xD5 are actually ABGR8.Subv2018-04-182-10/+10
|/ / / / / /
* | | | | | Merge pull request #349 from Subv/texturingbunnei2018-04-187-53/+97
|\ \ \ \ \ \ | |/ / / / / |/| | | | |
| * | | | | GPU: Pitch textures are now supported, don't assert when encountering them.Subv2018-04-181-2/+3
| * | | | | GLCache: Take into account the texture's block height when caching and unswizzling.Subv2018-04-183-43/+43
| * | | | | GLCache: Added a function to convert cached PixelFormats back to texture formats.Subv2018-04-181-0/+12
| * | | | | GPU: Allow using a configurable block height when unswizzling textures.Subv2018-04-184-7/+23
| * | | | | GPU/TIC: Added the pitch and block height fields to the TIC structure.Subv2018-04-181-1/+16
|/ / / / /
* | | | | Merge pull request #346 from bunnei/misc-gpu-improvementsbunnei2018-04-184-2/+11
|\ \ \ \ \
| * | | | | gl_rasterizer_cache: Add missing LOG statements.bunnei2018-04-181-0/+3
| * | | | | texture: Add missing formats.bunnei2018-04-181-1/+3
| * | | | | gpu: Add several framebuffer formats to RenderTargetFormat.bunnei2018-04-181-0/+3
| * | | | | maxwell3d: Allow Texture2DNoMipmap as Texture2D.bunnei2018-04-181-1/+2
* | | | | | Merge pull request #344 from bunnei/shader-decompiler-p2bunnei2018-04-184-73/+180
|\ \ \ \ \ \
| * | | | | | shader_bytecode: Make ctor's constexpr and explicit.bunnei2018-04-181-7/+7
| * | | | | | bit_field: Remove is_pod check, add is_trivially_copyable_v.bunnei2018-04-181-6/+1
| * | | | | | gl_shader_decompiler: Fix warnings with MarkAsUsed.bunnei2018-04-171-1/+2
| * | | | | | gl_shader_decompiler: Cleanup logging, updating to NGLOG_*.bunnei2018-04-171-24/+22
| * | | | | | gl_shader_decompiler: Implement several MUFU subops and abs_d.bunnei2018-04-171-7/+21
| * | | | | | gl_shader_decompiler: Fix swizzle in GetRegister.bunnei2018-04-171-1/+1
| * | | | | | gl_shader_decompiler: Implement FMUL/FADD/FFMA immediate instructions.bunnei2018-04-172-12/+53
| * | | | | | gl_shader_decompiler: Allow vertex position to be used in fragment shader.bunnei2018-04-172-16/+18
| * | | | | | gl_shader_decompiler: Implement IPA instruction.bunnei2018-04-171-0/+11
| * | | | | | gl_shader_decompiler: Add support for TEXS instruction.bunnei2018-04-172-12/+43
| * | | | | | gl_shader_decompiler: Use fragment output color for GPR 0-3.bunnei2018-04-171-0/+5
| * | | | | | gl_shader_decompiler: Partially implement MUFU.bunnei2018-04-171-2/+11
| |/ / / / /
* | | | | | Merge pull request #345 from bunnei/blendingbunnei2018-04-186-7/+140
|\ \ \ \ \ \ | |/ / / / / |/| | | | |
| * | | | | renderer_opengl: Implement BlendEquation and BlendFunc.bunnei2018-04-186-7/+140
|/ / / / /
* | | | | Merge pull request #341 from shinyquagsire23/pfs-hfs-implbunnei2018-04-173-0/+214
|\ \ \ \ \ | |_|/ / / |/| | | |
| * | | | file_sys: Use NGLOGshinyquagsire232018-04-171-5/+5
| * | | | file_sys: tweaksshinyquagsire232018-04-162-6/+7
| * | | | file_sys: Add HFS/PFS helper componentshinyquagsire232018-04-163-0/+213
| |/ / /
* | | | Merge pull request #343 from Subv/tex_wrap_4bunnei2018-04-171-0/+7
|\ \ \ \
| * | | | MaxwellToGL: Implemented tex wrap mode 1 (Wrap, GL_REPEAT).Subv2018-04-171-0/+2
| * | | | MaxwellToGL: Added a TODO and partial implementation of maxwell wrap mode 4 (Clamp, GL_CLAMP).Subv2018-04-171-0/+5
| |/ / /
* | | | Various service name fixes - part 2 (rebased) (#322)Hexagon122018-04-1713-11/+207
* | | | Merge pull request #342 from bunnei/indexed-vertsbunnei2018-04-175-28/+98
|\ \ \ \ | |/ / / |/| | |
| * | | gl_rendering: Use NGLOG* for changed code.bunnei2018-04-172-10/+11
| * | | gl_rasterizer: Implement indexed vertex mode.bunnei2018-04-175-23/+92
|/ / /
* | | Merge pull request #338 from bunnei/unrequire-shared-fontbunnei2018-04-151-17/+14
|\ \ \
| * | | pl_u: Use empty shared font if none is available.bunnei2018-04-151-17/+14
* | | | Merge pull request #337 from Subv/used_buffersbunnei2018-04-155-12/+59
|\ \ \ \
| * | | | GPU: Use the same buffer names in the generated GLSL and the buffer uploading code.Subv2018-04-154-17/+24
| * | | | GPU: Don't use explicit binding points when uploading the constbuffers to opengl.Subv2018-04-153-7/+47
* | | | | Merge pull request #335 from bunnei/delete-filebunnei2018-04-156-9/+27
|\ \ \ \ \
| * | | | | fsp_srv: Implement DeleteFile.bunnei2018-04-156-9/+27
| | |/ / / | |/| | |
* | | | | Merge pull request #334 from Subv/used_buffersbunnei2018-04-153-28/+39
|\ \ \ \ \ | |/ / / / |/| / / / | |/ / /
| * | | GPU: Don't use GetPointer when uploading the constbuffer data to the GPU.Subv2018-04-151-3/+4
| * | | GPU: Use the buffer hints from the shader decompiler to upload only the necessary const buffers for each shader stage.Subv2018-04-153-31/+41
|/ / /
* | | Merge pull request #333 from bunnei/const-buff-hintsbunnei2018-04-155-31/+146
|\ \ \
| * | | shaders: Expose hints about used const buffers.bunnei2018-04-155-31/+146
|/ / /
* | | Merge pull request #328 from Subv/constbuffersbunnei2018-04-158-16/+104
|\ \ \
| * | | GPU: Upload the entirety of each constbuffer for each shader stage as SSBOs.Subv2018-04-154-14/+48
| * | | GPU: Allow configuring ssbos in the opengl state manager.Subv2018-04-154-0/+30
| * | | GPU: Added a function to determine whether a shader stage is enabled or not.Subv2018-04-153-3/+27
|/ / /
* | | Merge pull request #332 from bunnei/fix-total-mem-usagebunnei2018-04-151-1/+1
|\ \ \
| * | | vm_manager: Increase GetTotalMemoryUsage value.bunnei2018-04-151-1/+1
| |/ /
* | | Merge pull request #327 from adityaruplaha/fullscreen-fixbunnei2018-04-151-2/+4
|\ \ \
| * | | Fix the stuck in fullscreen bug (Original PR: citra-emu/citra#3611)adityaruplaha2018-04-141-2/+4
| |/ /
* | | Merge pull request #331 from bunnei/fsp-flushbunnei2018-04-151-1/+9
|\ \ \
| * | | fsp_srv: Implement IFile::Flush.bunnei2018-04-151-1/+9
| |/ /
* | | Merge pull request #329 from bunnei/shader-gen-part-1bunnei2018-04-1526-642/+1872
|\ \ \ | |/ / |/| |
| * | shaders: Add NumTextureSamplers const, remove unused #pragma.bunnei2018-04-154-4/+5
| * | shaders: Address PR review feedback.bunnei2018-04-142-7/+9
| * | gl_shader_decompiler: Cleanup log statements.bunnei2018-04-141-15/+15
| * | shaders: Fix GCC and clang build issues.bunnei2018-04-143-5/+5
| * | gl_shader_decompiler: Implement negate, abs, etc. and lots of cleanup.bunnei2018-04-142-40/+96
| * | shader_bytecode: Add FSETP and KIL to GetInfo.bunnei2018-04-141-0/+3
| * | shader_bytecode: Add SubOp decoding.bunnei2018-04-141-0/+10
| * | gl_shader_decompiler: Add shader stage hint.bunnei2018-04-142-5/+12
| * | renderer_opengl: Fix Morton copy byteswap, etc.bunnei2018-04-142-6/+6
| * | gl_shader_manager: Implement SetShaderSamplerBindings.bunnei2018-04-141-0/+8
| * | gl_rasterizer: Generate shaders and upload uniforms.bunnei2018-04-142-32/+77
| * | gl_shader_decompiler: Basic impl. for very simple vertex shaders.bunnei2018-04-142-16/+311
| * | gl_shader_manager: Cleanup and consolidate uniform handling.bunnei2018-04-142-26/+24
| * | maxwell_3d: Make memory_manager public.bunnei2018-04-141-2/+1
| * | maxwell_3d: Fix shader_config decodings.bunnei2018-04-141-6/+3
| * | gl_rasterizer: Use shader program manager, remove test shader.bunnei2018-04-142-196/+31
| * | renderer_opengl: Add gl_shader_manager class.bunnei2018-04-143-0/+209
| * | maxwell_to_gl: Add a few types, etc.bunnei2018-04-141-0/+10
| * | gl_shader_gen: Add hashable setup/config structs.bunnei2018-04-142-29/+50
| * | gl_shader_util: Add missing includes.bunnei2018-04-141-0/+2
| * | common: Port cityhash code from Citra.bunnei2018-04-145-147/+502
| * | renderer_opengl: Use OGLProgram instead of OGLShader.bunnei2018-04-146-6/+6
| * | gl_shader_util: Grab latest upstream.bunnei2018-04-142-149/+74
| * | gl_resource_manager: Grab latest upstream.bunnei2018-04-141-30/+86
| * | gl_shader_decompiler: Add skeleton code from Citra for shader analysis.bunnei2018-04-142-44/+142
| * | shader_bytecode: Add initial module for shader decoding.bunnei2018-04-142-0/+298
| * | bit_field: Make all methods constexpr.bunnei2018-04-141-5/+5
|/ /
* | Merge pull request #323 from Hexagon12/stub-hidbunnei2018-04-131-1/+7
|\ \
| * | Stubbed out GetPlayerLedPatternHexagon122018-04-131-1/+7
* | | Merge pull request #325 from Hexagon12/ipc-value-fixbunnei2018-04-131-1/+1
|\ \ \
| * | | Fixed normal params in GetDisplayResolutionHexagon122018-04-131-1/+1
| |/ /
| * | Merge pull request #1 from yuzu-emu/masterHexagon122018-04-1334-193/+853
| |\ \ | |/ / |/| |
* | | Merge pull request #319 from Hexagon12/service-name-fixbunnei2018-04-1321-65/+413
|\ \ \
| * | | Various fixes and clangHexagon122018-04-116-115/+108
| * | | Decimal changeHexagon122018-04-101-4/+4
| * | | Updated pctl:a with new service names.Hexagon122018-04-101-4/+101
| * | | Updated nvmemp with new service names.Hexagon122018-04-101-4/+4
| * | | Updated nvdrv with more service names.Hexagon122018-04-101-0/+7
| * | | Updated pl:u with more service names.Hexagon122018-04-101-1/+3
| * | | Updated hid with more service names.Hexagon122018-04-101-0/+50
| * | | Updated friend:u with more service names.Hexagon122018-04-101-1/+2
| * | | Updated the unknown nameHexagon122018-04-101-1/+1
| * | | Updated friend:a with more service names.Hexagon122018-04-101-1/+2
| * | | Updated fsp-srv with more service names.Hexagon122018-04-101-4/+102
| * | | Updated CodecCtl with more service names.Hexagon122018-04-101-3/+3
| * | | Updated audren with more service names.Hexagon122018-04-101-10/+14
| * | | Updated audrec with more service names.Hexagon122018-04-101-7/+9
| * | | Updated audout with more service names.Hexagon122018-04-101-13/+16
| * | | Updated audin with more service names.Hexagon122018-04-101-9/+16
| * | | Updated AOC with more service names.Hexagon122018-04-101-0/+1
| * | | Updated AppletOE with more service names.Hexagon122018-04-101-0/+1
| * | | Updated AppletAE with more service names.Hexagon122018-04-101-0/+1
| * | | Updated AM with more service names.Hexagon122018-04-101-2/+82
| |/ /
* | | Merge pull request #320 from mailwl/ssl-updatebunnei2018-04-122-1/+98
|\ \ \
| * | | Service/SSL: update service according switchbrewmailwl2018-04-112-1/+98
|/ / /
* | | Merge pull request #318 from mailwl/accountbunnei2018-04-1011-127/+342
|\ \ \ | |/ / |/| |
| * | Service/ACC: convert to module, add acc:aa, acc:su, acc:u1 servicesmailwl2018-04-1011-127/+342
|/ /
* | Merge pull request #314 from jroweboy/tegra-progress-3bbunnei2018-04-089-173/+274
|\ \
| * | Fix clang format issuesJames Rowe2018-04-071-1/+1
| * | GPU: Assert when finding a texture with a format type other than UNORM.Subv2018-04-072-4/+16
| * | GL: Set up the textures used for each draw call.Subv2018-04-072-2/+39
| * | GL: Bind the textures to the shaders used for drawing.Subv2018-04-071-2/+11
| * | GLCache: Specialize the MortonCopy function for the DXT1 texture format.Subv2018-04-071-1/+15
| * | GLCache: Implemented GetTextureSurface.Subv2018-04-071-3/+28
| * | GLCache: Support uploading compressed textures to the GPU.Subv2018-04-071-5/+17
| * | GL: Remove remaining references to 3DS-specific pixel formatsSubv2018-04-071-83/+22
| * | RasterizerCache: Remove 3DS-specific pixel formats.Subv2018-04-072-71/+32
| * | GL: Create the sampler objects when starting up the GL rasterizer.Subv2018-04-071-0/+6
| * | GL: Ported the SamplerInfo struct from citra.Subv2018-04-072-1/+59
| * | GL: Rename PicaTexture to MaxwellTexture.Subv2018-04-072-2/+2
| * | GL: Added functions to convert Maxwell tex filters and wrap modes to OpenGL.Subv2018-04-071-0/+23
| * | Textures: Added a helper function to know if a texture is blocklinear or pitch.Subv2018-04-071-0/+5
* | | Merge pull request #315 from jroweboy/spelling-fixbunnei2018-04-072-3/+3
|\ \ \
| * | | Fix spelling of InitializeJames Rowe2018-04-072-3/+3
| |/ /
* | | Merge pull request #316 from jroweboy/dontcrashbunnei2018-04-071-2/+1
|\ \ \ | |/ / |/| |
| * | Prevent crash from uninitialized telemetryJames Rowe2018-04-071-2/+1
|/ /
* | Merge pull request #310 from N00byKing/patch-1bunnei2018-04-065-10/+10
|\ \
| * | rasterizer_interface.h: Update from citra to yuzuN00byKing2018-04-041-3/+3
| * | default_ini.h: Update from citra to yuzuN00byKing2018-04-041-1/+1
| * | gl_rasterizer_cache.cpp: Update from citra to yuzuN00byKing2018-04-041-1/+1
| * | gl_rasterizer_cache.h: Update from citra to yuzuN00byKing2018-04-041-3/+3
| * | renderer_opengl.h: Update from citra to yuzuN00byKing2018-04-041-2/+2
* | | core, main.h: Abort on 32Bit ROMs (#309)N00byKing2018-04-065-1/+17
* | | Merge pull request #312 from jroweboy/update-fmtlibbunnei2018-04-063-5/+8
|\ \ \ | |/ / |/| |
| * | Update fmtlib to fix msvc warningsJames Rowe2018-04-063-5/+8
|/ /
* | Merge pull request #308 from bunnei/misc-fixes-2bunnei2018-04-0412-18/+108
|\ \
| * | svc: Stub out SetThreadActivity, GetThreadContext.bunnei2018-04-032-2/+19
| * | audren_u: Stub out GetActiveAudioDeviceName.bunnei2018-04-031-1/+13
| * | audout_u: Implement GetAudioOutState.bunnei2018-04-031-1/+8
| * | nifm: GetResult does not return a data field.bunnei2018-04-031-2/+1
| * | vi: Implement GetDisplayResolution.bunnei2018-04-032-0/+26
| * | shared_memory: Remove incorrect 3ds-specific check.bunnei2018-04-031-12/+0
| * | service: Add friend:u interface.bunnei2018-04-034-0/+41
|/ /
* | Merge pull request #306 from daniellimws/new-fmt-macrosbunnei2018-04-032-5/+11
|\ \
| * | logging: Change FmtLogMessage to use variadic template instead of FMT_VARIADICDaniel Lim Wee Soong2018-04-032-5/+11
|/ /
* | Merge pull request #262 from daniellimws/fmtlib-macrosbunnei2018-04-0311-68/+112
|\ \
| * | Remove dependency chronoDaniel Lim Wee Soong2018-03-221-1/+0
| * | Change "yuzu starting..." to be logged with the new macroDaniel Lim Wee Soong2018-03-221-1/+1
| * | Logging: Create logging macros based on fmtlibDaniel Lim Wee Soong2018-03-2210-67/+112
* | | Merge pull request #267 from N00byKing/patch-1bunnei2018-04-032-14/+14
|\ \ \
| * | | yuzu.cpp: Update Link from citra to yuzuN00byKing2018-03-261-1/+1
| * | | main.cpp: Replace Citra with yuzu Wiki LinksN00byKing2018-03-251-4/+4
| * | | main.cpp: Update Dialog from citra to yuzuN00byKing2018-03-251-11/+11
* | | | Merge pull request #276 from N00byKing/acctoyuzubunnei2018-04-034-10/+10
|\ \ \ \
| * | | | telemetry.h: Reword comment from citra to yuzuN00byKing2018-03-271-1/+1
| * | | | telemetry_session.h: Reword Documentation Comment from citra to yuzuN00byKing2018-03-271-2/+2
| * | | | Remove Links to citra ServicesN00byKing2018-03-271-2/+2
| * | | | Change Telemetry Names to yuzuN00byKing2018-03-272-5/+5
* | | | | Merge pull request #304 from daniellimws/fix-openbsdbunnei2018-04-034-7/+20
|\ \ \ \ \
| * | | | | externals: Update fmt to 4d35f94Daniel Lim Wee Soong2018-04-023-6/+7
| * | | | | common: fix swap functions on Bitrig and OpenBSDDaniel Lim Wee Soong2018-04-021-1/+13
* | | | | | Merge pull request #305 from N00byKing/patch-2James Rowe2018-04-031-1/+1
|\ \ \ \ \ \
| * | | | | | deconstructed_rom_directory.cpp: Fix TypoN00byKing2018-04-031-1/+1
|/ / / / / /
* | | | | | Merge pull request #66 from RiverCityRansomware/qtUpdatebunnei2018-04-021-1/+1
|\ \ \ \ \ \ | |/ / / / / |/| | | | |
| * | | | | Update qtRiver City Ransomware2018-01-171-1/+1
* | | | | | Merge pull request #297 from bunnei/hid-touch-statebunnei2018-04-021-5/+21
|\ \ \ \ \ \
| * | | | | | hid: Write empty touch screen state.bunnei2018-04-011-5/+21
* | | | | | | Merge pull request #296 from bunnei/misc-mem-fsp-fixesbunnei2018-04-0210-16/+49
|\ \ \ \ \ \ \
| * | | | | | | hle_ipc, fsp_srv: Cleanup logging.bunnei2018-04-012-3/+3
| * | | | | | | hid: Stub out GetSupportedNpadStyleSet.bunnei2018-03-311-0/+8
| * | | | | | | hle_ipc: Do not ensure write buffer size.bunnei2018-03-311-2/+5
| * | | | | | | fsp_srv: Implement GetSize and SetSize.bunnei2018-03-312-4/+24
| * | | | | | | memory: Fix stack region.bunnei2018-03-316-10/+12
| |/ / / / / /
* | | | | | | Merge pull request #288 from Subv/macro_interpreterbunnei2018-04-025-121/+444
|\ \ \ \ \ \ \ | |/ / / / / / |/| | | | | |
| * | | | | | GPU: Use the MacroInterpreter class to execute the GPU macros instead of HLEing them.Subv2018-04-012-121/+13
| * | | | | | GPU: Implemented a gpu macro interpreter.Subv2018-04-015-0/+431
* | | | | | | Merge pull request #293 from N00byKing/drkthmbunnei2018-03-3157-5/+1428
|\ \ \ \ \ \ \
| * | | | | | | Port citra-emu/citra#3610 to yuzuN00byKing2018-03-302-3/+7
| * | | | | | | Remove whitespacesN00byKing2018-03-301-1/+1
| * | | | | | | Add Dark theme, Icon themingN00byKing2018-03-3057-5/+1424
* | | | | | | | Merge pull request #292 from bunnei/botw-progressbunnei2018-03-3011-11/+163
|\ \ \ \ \ \ \ \ | |/ / / / / / / |/| | | | | | |
| * | | | | | | audren_u: Stub QueryAudioDeviceSystemEvent and GetActiveChannelCount.bunnei2018-03-301-8/+36
| * | | | | | | svc: Stub GetThreadCoreMask.bunnei2018-03-302-3/+26
| * | | | | | | service: Add NFP module interface.bunnei2018-03-308-0/+101
|/ / / / / / /
* | | | | | | Merge pull request #290 from MerryMage/dfix-20180329bunnei2018-03-291-0/+0
|\ \ \ \ \ \ \
| * | | | | | | dynarmic: Update to 9cc12d8MerryMage2018-03-291-0/+0
* | | | | | | | Merge pull request #289 from lioncash/self-assignbunnei2018-03-291-0/+3
|\ \ \ \ \ \ \ \ | |_|/ / / / / / |/| | | | | | |
| * | | | | | | result: Check against self-assignment in ResultVal's copy assignment operatorLioncash2018-03-291-0/+3
|/ / / / / / /
* | | | | | | Merge pull request #286 from N00byKing/citratoyuzuagainbunnei2018-03-281-5/+2
|\ \ \ \ \ \ \
| * | | | | | | main.h: Add pragma once, remove ifndefN00byKing2018-03-271-5/+2
* | | | | | | | Merge pull request #285 from MerryMage/dfix-20180327bunnei2018-03-271-0/+0
|\ \ \ \ \ \ \ \ | | |/ / / / / / | |/| | | | | |
| * | | | | | | dynarmic: Update to 12a1020MerryMage2018-03-271-0/+0
| | |_|/ / / / | |/| | | | |
* | | | | | | Merge pull request #284 from bunnei/docked-configbunnei2018-03-279-61/+88
|\ \ \ \ \ \ \ | |/ / / / / / |/| | | | | |
| * | | | | | settings: Remove unused CpuCore class.bunnei2018-03-271-5/+0
| * | | | | | config: Use simplified checkbox (from Citra) for CPU JIT.bunnei2018-03-278-46/+33
| * | | | | | config: Rename is_docked to use_docked_mode to be consistent with other config bools.bunnei2018-03-277-14/+14
| * | | | | | configure_general: Cleanup naming.bunnei2018-03-271-14/+14
| * | | | | | qt: Add config option for is_docked.bunnei2018-03-272-0/+23
| * | | | | | config: Add setting for whether the system is docked or not.bunnei2018-03-275-2/+24
* | | | | | | Merge pull request #282 from N00byKing/patch-2bunnei2018-03-274-4/+4
|\ \ \ \ \ \ \ | |/ / / / / / |/| | | | | |
| * | | | | | log.h: Change comment from citra to yuzuN00byKing2018-03-261-1/+1
| * | | | | | file_util.h: Update Comment from citra to yuzuN00byKing2018-03-261-1/+1
| * | | | | | cpu_detect.cpp: Change comment from citra to yuzuN00byKing2018-03-261-1/+1
| * | | | | | pre-commit: Change comment from citra to yuzuN00byKing2018-03-261-1/+1
| |/ / / / /
* | | | | | Merge pull request #279 from bunnei/tegra-progress-3bunnei2018-03-2720-446/+913
|\ \ \ \ \ \
| * | | | | | renderer_opengl: Use better naming for DrawScreens and DrawSingleScreen.bunnei2018-03-272-8/+8
| * | | | | | graphics_surface: Remove superfluous cast.bunnei2018-03-271-2/+1
| * | | | | | gl_rasterizer: Move code to bind framebuffer surfaces before draw to its own function.bunnei2018-03-272-22/+31
| * | | | | | gl_rasterizer: Add a SyncViewport method.bunnei2018-03-273-18/+30
| * | | | | | gl_rasterizer: Move PrimitiveTopology check to MaxwellToGL.bunnei2018-03-272-11/+12
| * | | | | | graphics_surface: Fix merge conflicts.bunnei2018-03-272-3/+4
| * | | | | | gl_rasterizer: Use ReadBlock instead of GetPointer for SetupVertexArray.bunnei2018-03-271-1/+1
| * | | | | | gl_rasterizer: Normalize vertex array data as appropriate.bunnei2018-03-272-1/+5
| * | | | | | memory: Fix cast for ReadBlock/WriteBlock/ZeroBlock/CopyBlock.bunnei2018-03-271-4/+8
| * | | | | | maxwel_to_gl: Fix string formatting in log statements.bunnei2018-03-271-2/+2
| * | | | | | rasterizer: Rename DrawTriangles to DrawArrays.bunnei2018-03-273-5/+5
| * | | | | | gl_rasterizer: Use passthrough shader for SetupVertexShader.bunnei2018-03-271-1/+2
| * | | | | | renderer_opengl: Logging, etc. cleanup.bunnei2018-03-276-33/+34
| * | | | | | renderer_opengl: Remove framebuffer RasterizerFlushVirtualRegion hack.bunnei2018-03-271-5/+0
| * | | | | | gl_rasterizer_cache: Implement UpdatePagesCachedCount.bunnei2018-03-272-8/+37
| * | | | | | memory: Add RasterizerMarkRegionCached code and cleanup.bunnei2018-03-272-200/+195
| * | | | | | gl_rasterizer: Implement SetupVertexArray.bunnei2018-03-271-20/+38
| * | | | | | gl_rasterizer_cache: Fix an ASSERT_MSG.bunnei2018-03-271-1/+1
| * | | | | | maxwell_to_gl: Add module and function for decoding VertexType.bunnei2018-03-272-0/+41
| * | | | | | maxwell_3d: Use names that match envytools for VertexType.bunnei2018-03-271-8/+8
| * | | | | | maxwell_3d: Add VertexAttribute struct and cleanup.bunnei2018-03-271-121/+160
| * | | | | | gl_rasterizer: Use 32 texture units instead of 3.bunnei2018-03-273-2/+3
| * | | | | | gl_rasterizer: Implement DrawTriangles.bunnei2018-03-271-1/+194
| * | | | | | Maxwell3D: Call AccelerateDrawBatch on DrawArrays.bunnei2018-03-271-1/+8
| * | | | | | gl_rasterizer: Implement AnalyzeVertexArray.bunnei2018-03-272-1/+56
| * | | | | | gl_rasterizer_cache: MortonCopy Switch-style.bunnei2018-03-271-72/+32
| * | | | | | gl_rasterizer_cache: Implement GetFramebufferSurfaces.bunnei2018-03-272-4/+104
| * | | | | | maxwell: Add RenderTargetFormat enum.bunnei2018-03-272-4/+5
| * | | | | | renderer_opengl: Only draw the screen if a framebuffer is specified.bunnei2018-03-271-6/+7
|/ / / / / /
* | | | | | Merge pull request #283 from Subv/tscbunnei2018-03-273-25/+147
|\ \ \ \ \ \
| * | | | | | GPU: Load the sampler info (TSC) when retrieving active textures.Subv2018-03-262-21/+67
| * | | | | | GPU: Added the TSC structure. It contains information about the sampler.Subv2018-03-261-0/+50
| * | | | | | GPU: Added more fields to the TIC structure.Subv2018-03-261-4/+30
| |/ / / / /
* | | | | | Merge pull request #102 from N00byKing/masterbunnei2018-03-272-15/+47
|\ \ \ \ \ \ | |/ / / / / |/| | | | |
| * | | | | Implement Citra pull 3043N00byKing2018-02-242-15/+47
* | | | | | Merge pull request #280 from bunnei/misc-service-fixesbunnei2018-03-255-8/+66
|\ \ \ \ \ \
| * | | | | | audren_u: Fix GetAudioDevice.bunnei2018-03-252-7/+48
| * | | | | | hid: Stub out SetNpadJoyAssignmentModeDual.bunnei2018-03-251-1/+7
| * | | | | | pl_u: Add RequestLoad.bunnei2018-03-252-0/+11
* | | | | | | Merge pull request #273 from Subv/texturesbunnei2018-03-2521-10/+1464
|\ \ \ \ \ \ \
| * | | | | | | GPU: Make the debug_context variable a member of the frontend instead of a global.Subv2018-03-257-19/+40
| * | | | | | | GPU: Added a function to retrieve the active textures for a shader stage.Subv2018-03-242-50/+59
| * | | | | | | Frontend: Updated the surface view debug widget to work with Maxwell surfaces.Subv2018-03-243-19/+38
| * | | | | | | Frontend: Allow opening the Surface View widget in the Qt frontend.Subv2018-03-242-0/+8
| * | | | | | | GPU: Implement the Incoming/FinishedPrimitiveBatch debug breakpoints.Subv2018-03-241-0/+7
| * | | | | | | GPU: Implement the MaxwellCommandLoaded/Processed debug breakpoints.Subv2018-03-241-0/+10
| * | | | | | | Frontend: Ported the GPU breakpoints and surface viewer widgets from citra.Subv2018-03-2415-4/+1155
| * | | | | | | GPU: Added a method to unswizzle a texture without decoding it.Subv2018-03-244-5/+95
| * | | | | | | GPU: Preliminary work for texture decoding.Subv2018-03-245-0/+139
| |/ / / / / /
* | | | | | | Merge pull request #281 from mailwl/sockets-servicesbunnei2018-03-258-32/+96
|\ \ \ \ \ \ \ | |/ / / / / / |/| | | | | |
| * | | | | | Service/sockets: add bsd:s, nsd:a, nsd:u servicesmailwl2018-03-258-32/+96
|/ / / / / /
* | | | | | Merge pull request #275 from MerryMage/addticks-dynarmicbunnei2018-03-241-7/+3
|\ \ \ \ \ \
| * | | | | | arm_dynarmic: Fix timingMerryMage2018-03-241-7/+3
|/ / / / / /
* | | | | | Merge pull request #274 from Subv/viewport_regsbunnei2018-03-241-1/+18
|\ \ \ \ \ \
| * | | | | | GPU: Added viewport registers to Maxwell3D's reg structure.Subv2018-03-241-1/+18
|/ / / / / /
* | | | | | Merge pull request #265 from bunnei/tegra-progress-2bunnei2018-03-2417-296/+591
|\ \ \ \ \ \
| * | | | | | gl_rasterizer: Fake render in green, because it's cooler.bunnei2018-03-241-1/+1
| * | | | | | gl_rasterizer: Log warning instead of sync'ing unimplemented funcs.bunnei2018-03-241-7/+1
| * | | | | | gl_rasterizer_cache: Add missing include for vm_manager.bunnei2018-03-231-0/+1
| * | | | | | renderer_opengl: Only invalidate the framebuffer region, not flush.bunnei2018-03-231-4/+3
| * | | | | | renderer_opengl: Fixes for properly flushing & rendering the framebuffer.bunnei2018-03-232-12/+12
| * | | | | | memory: Fix typo in RasterizerFlushVirtualRegion.bunnei2018-03-231-3/+3
| * | | | | | RasterizerCacheOpenGL: FlushAll should flush full memory region.bunnei2018-03-231-1/+1
| * | | | | | memory: RasterizerFlushVirtualRegion should also check process image region.bunnei2018-03-231-0/+1
| * | | | | | rasterizer: Flush and invalidate regions should be 64-bit.bunnei2018-03-235-12/+12
| * | | | | | renderer_opengl: Add framebuffer_transform_flags member variable.bunnei2018-03-231-2/+2
| * | | | | | renderer_opengl: Better handling of framebuffer transform flags.bunnei2018-03-234-6/+23
| * | | | | | renderer_opengl: Use accelerated framebuffer load with LoadFBToScreenInfo.bunnei2018-03-231-31/+25
| * | | | | | nvdisp_disp0: Always flush and invalidate framebuffer region.bunnei2018-03-231-0/+7
| * | | | | | gl_rasterizer: Implement AccelerateDisplay method from Citra.bunnei2018-03-232-2/+44
| * | | | | | LoadGLBuffer: Use bytes_per_pixel, not bits.bunnei2018-03-231-1/+2
| * | | | | | memory: Port RasterizerFlushVirtualRegion from Citra.bunnei2018-03-232-1/+58
| * | | | | | gl_rasterizer_cache: LoadGLBuffer should do a morton copy.bunnei2018-03-231-16/+5
| * | | | | | video_core: Move MortonCopyPixels128 to utils header.bunnei2018-03-232-111/+113
| * | | | | | video_core: Remove usage of PAddr and replace with VAddr.bunnei2018-03-235-39/+39
| * | | | | | video_core: Move FramebufferInfo to FramebufferConfig in GPU.bunnei2018-03-238-69/+77
| * | | | | | gl_rasterizer: Replace a bunch of UNIMPLEMENTED with ASSERT.bunnei2018-03-232-20/+20
| * | | | | | gl_rasterizer: Add a simple passthrough shader in lieu of shader generation.bunnei2018-03-232-5/+68
| * | | | | | gpu: Expose Maxwell3D engine.bunnei2018-03-231-0/+4
| * | | | | | maxwell_3d: Add some format decodings and string helper functions.bunnei2018-03-231-3/+107
| * | | | | | renderer: Create rasterizer and cleanup.bunnei2018-03-234-4/+16
* | | | | | | Merge pull request #255 from Subv/sd_cardbunnei2018-03-2412-48/+329
|\ \ \ \ \ \ \
| * | | | | | | FS: Move the file open mode calculation to a separate function.Subv2018-03-231-7/+14
| * | | | | | | FS: Implemented IFileSystem::CreateDirectory.Subv2018-03-216-7/+29
| * | | | | | | FS: Implemented IFileSystem's OpenDirectory function.Subv2018-03-201-0/+28
| * | | | | | | FS: Added the IDirectory IPC interface and implemented its two functions.Subv2018-03-201-0/+51
| * | | | | | | FS: Implement DiskFileSystem's OpenDirectory interface.Subv2018-03-205-6/+19
| * | | | | | | FS: Implement DiskFileSystem::GetEntryType for existing files/directories.Subv2018-03-201-2/+4
| * | | | | | | FS: Updated the Directory Entry structure to match the Switch.Subv2018-03-205-30/+84
| * | | | | | | FS: Support the file Append open mode.Subv2018-03-202-2/+23
| * | | | | | | FS: Implement MountSdCard.Subv2018-03-201-2/+6
| * | | | | | | FS: Added an SDMC archive factory and registered it to the SDMC archive on startup.Subv2018-03-205-0/+79
* | | | | | | | Merge pull request #268 from mailwl/sslbunnei2018-03-236-0/+45
|\ \ \ \ \ \ \ \
| * | | | | | | | Service/SSL: add ssl servicemailwl2018-03-236-0/+45
| | |_|_|_|/ / / | |/| | | | | |
* | | | | | | | Merge pull request #270 from N00byKing/patch-2bunnei2018-03-231-4/+0
|\ \ \ \ \ \ \ \
| * | | | | | | | Remove Option for N/3DS from default.iniN00byKing2018-03-231-4/+0
| |/ / / / / / /
* | | | | | | | Merge pull request #269 from N00byKing/icontoyuzubunnei2018-03-231-1/+1
|\ \ \ \ \ \ \ \ | |/ / / / / / / |/| | | | | | |
| * | | | | | | CITRA_ICON -> YUZU_ICONN00byKing2018-03-231-1/+1
|/ / / / / / /
* | | | | | | Merge pull request #264 from valentinvanelslande/cmd-dynarmicbunnei2018-03-232-2/+2
|\ \ \ \ \ \ \
| * | | | | | | yuzu_cmd: change default cpu core to dynarmicValentin Vanelslande2018-03-231-1/+1
| * | | | | | | default_ini: change default cpu core to dynarmicValentin Vanelslande2018-03-231-1/+1
|/ / / / / / /
* | | | | | | Merge pull request #263 from N00byKing/non3dsbunnei2018-03-222-20/+0
|\ \ \ \ \ \ \
| * | | | | | | Remove more N3DS ReferencesN00byKing2018-03-222-20/+0
|/ / / / / / /
* | | | | | | Merge pull request #261 from mailwl/splbunnei2018-03-2210-0/+176
|\ \ \ \ \ \ \ | |_|/ / / / / |/| | | | | |
| * | | | | | Service/spl: add module and servicesmailwl2018-03-2210-0/+176
|/ / / / / /
* | | | | | Merge pull request #258 from Subv/gpu_attribsbunnei2018-03-221-3/+27
|\ \ \ \ \ \
| * | | | | | GPU: Added vertex attribute format registers.Subv2018-03-211-1/+14
| * | | | | | GPU: Added registers for the number of vertices to render.Subv2018-03-211-2/+13
* | | | | | | Merge pull request #260 from N00byKing/3535bunnei2018-03-214-36/+3
|\ \ \ \ \ \ \
| * | | | | | | CMake: Set EMU_ARCH_BITS in CMakeLists.txtN00byKing2018-03-214-36/+3
* | | | | | | | Merge pull request #259 from N00byKing/usehttpsbunnei2018-03-211-1/+1
|\ \ \ \ \ \ \ \ | |/ / / / / / / |/| | | | | | |
| * | | | | | | Use HTTPS for Submodule lz4N00byKing2018-03-211-1/+1
|/ / / / / / /
* | | | | | | Merge pull request #257 from mailwl/vi-modulebunnei2018-03-218-212/+160
|\ \ \ \ \ \ \ | |/ / / / / / |/| | | | | |
| * | | | | | Service/vi: convert services to modulemailwl2018-03-218-212/+160
|/ / / / / /
* | | | | | Merge pull request #254 from bunnei/port-citra-rendererbunnei2018-03-2122-1172/+24167
|\ \ \ \ \ \
| * | | | | | renderer_gl: Port boilerplate rasterizer code over from Citra.bunnei2018-03-205-1/+495
| * | | | | | gl_shader_util: Sync latest version with Citra.bunnei2018-03-203-46/+116
| * | | | | | renderer_gl: Port over gl_shader_gen module from Citra.bunnei2018-03-203-0/+88
| * | | | | | renderer_gl: Port over gl_shader_decompiler module from Citra.bunnei2018-03-203-0/+87
| * | | | | | renderer_gl: Port over gl_rasterizer_cache module from Citra.bunnei2018-03-203-0/+1714
| * | | | | | gl_resource_manager: Sync latest version with Citra.bunnei2018-03-201-8/+77
| * | | | | | renderer_gl: Port over gl_stream_buffer module from Citra.bunnei2018-03-203-0/+218
| * | | | | | externals: Update Glad to latest version used by Citra.bunnei2018-03-204-1071/+21262
| * | | | | | gl_state: Sync latest version with Citra.bunnei2018-03-202-47/+111
* | | | | | | Merge pull request #256 from mailwl/fatalbunnei2018-03-2010-0/+146
|\ \ \ \ \ \ \
| * | | | | | | Service: add fatal:u, fatal:p servicesmailwl2018-03-2010-0/+146
|/ / / / / / /
* | | | | | | Merge pull request #253 from Subv/rt_depthMat M2018-03-201-1/+48
|\ \ \ \ \ \ \ | |/ / / / / / |/| | | | | |
| * | | | | | GPU: Added Z buffer registers to Maxwell3D's reg structure.Subv2018-03-191-1/+17
| * | | | | | GPU: Added the render target (RT) registers to Maxwell3D's reg structure.Subv2018-03-191-1/+32
| |/ / / / /
* | | | | | Merge pull request #252 from N00byKing/3064bunnei2018-03-1915-27/+29
|\ \ \ \ \ \ | |/ / / / / |/| | | | |
| * | | | | Clang FixesN00byKing2018-03-195-9/+11
| * | | | | oopsN00byKing2018-03-191-3/+3
| * | | | | More Warning cleanupsN00byKing2018-03-193-3/+3
| * | | | | Clean Warnings (?)N00byKing2018-03-1915-20/+20
|/ / / / /
* | | | | Merge pull request #251 from Subv/tic_tscbunnei2018-03-191-1/+30
|\ \ \ \ \
| * | | | | GPU: Added the TSC registers to the Maxwell3D register structure.Subv2018-03-191-1/+15
| * | | | | GPU: Added the TIC registers to the Maxwell3D register structure.Subv2018-03-191-1/+16
|/ / / / /
* | | | | Merge pull request #193 from N00byKing/3184_2_robotic_boogaloobunnei2018-03-197-41/+41
|\ \ \ \ \
| * | | | | Implements citra-emu/citra#3184N00byKing2018-02-257-41/+41
* | | | | | Merge pull request #250 from bunnei/buffer-dequeue-waitbunnei2018-03-1910-51/+128
|\ \ \ \ \ \
| * | | | | | vi: Remove DequeueBuffer and wait until next available buffer.bunnei2018-03-193-12/+49
| * | | | | | hle_ipc: Add SleepClientThread to block current thread within HLE routines.bunnei2018-03-192-0/+47
| * | | | | | hle_ipc: Use shared_ptr instead of unique_ptr to allow copies.bunnei2018-03-192-9/+9
| * | | | | | hle_ipc: Remove GetPointer(..) usage with WriteToOutgoingCommandBuffer.bunnei2018-03-193-7/+14
| * | | | | | thread: Add THREADSTATUS_WAIT_HLE_EVENT, remove THREADSTATUS_WAIT_ARB.bunnei2018-03-194-23/+9
* | | | | | | Merge pull request #249 from Subv/macro_E1Abunnei2018-03-192-1/+29
|\ \ \ \ \ \ \ | |/ / / / / / |/| | | | | |
| * | | | | | GPU: Implement macro 0xE1A BindTextureInfoBuffer in HLE.Subv2018-03-192-1/+29
|/ / / / / /
* | | | | | Merge pull request #248 from Subv/cb_databunnei2018-03-195-11/+105
|\ \ \ \ \ \
| * | | | | | GPU: Implement the BindStorageBuffer macro method in HLE.Subv2018-03-182-1/+36
| * | | | | | GPU: Handle writes to the CB_DATA method.Subv2018-03-182-0/+39
| * | | | | | GPU: Move the GPU's class constructor and destructors to a cpp file.Subv2018-03-183-10/+30
|/ / / / / /
* | | | | | Merge pull request #246 from Subv/gpu_macro_callsSebastian Valle2018-03-188-80/+119
|\ \ \ \ \ \
| * | | | | | GPU: Store uploaded GPU macros and keep track of the number of method parameters.Subv2018-03-184-27/+74
| * | | | | | GPU: Macros are specific to the Maxwell3D engine, so handle them internally.Subv2018-03-188-63/+55
|/ / / / / /
* | | | | | Merge pull request #245 from Subv/set_shader2bunnei2018-03-182-23/+115
|\ \ \ \ \ \
| * | | | | | GPU: Renamed ShaderType to ShaderStage as that is less confusing.Subv2018-03-182-19/+19
| * | | | | | GPU: Store shader constbuffer bindings in the GPU state.Subv2018-03-182-5/+61
| * | | | | | GPU: Corrected some register offsets and removed superfluous macro registers.Subv2018-03-181-9/+3
| * | | | | | GPU: Make the SetShader macro call do the same as the real macro's code.Subv2018-03-182-3/+44
| * | | | | | GPU: Corrected the parameter documentation for the SetShader macro call.Subv2018-03-172-11/+12
|/ / / / / /
* | | | | | Merge pull request #242 from Subv/set_shaderbunnei2018-03-172-4/+38
|\ \ \ \ \ \
| * | | | | | GPU: Handle the SetShader method call (0xE24) and store the shader config.Subv2018-03-172-4/+38
* | | | | | | Merge pull request #243 from Subv/vertex_bufferbunnei2018-03-171-2/+33
|\ \ \ \ \ \ \ | |/ / / / / / |/| | | | | |
| * | | | | | GPU: Added the vertex array registers.Subv2018-03-171-2/+33
|/ / / / / /
* | | | | | Merge pull request #241 from Subv/gpu_method_callbunnei2018-03-179-8/+97
|\ \ \ \ \ \
| * | | | | | GPU: Process command mode 5 (IncreaseOnce) differently from other commands.Subv2018-03-179-8/+97
* | | | | | | Merge pull request #239 from Subv/shadersbunnei2018-03-172-2/+63
|\ \ \ \ \ \ \
| * | | | | | | GPU: Assert that we get a 0 CODE_ADDRESS register in the 3D engine.Subv2018-03-171-0/+8
| * | | | | | | GPU: Added Maxwell registers for Shader Program control.Subv2018-03-171-2/+55
| |/ / / / / /
* | | | | | | Merge pull request #238 from bunnei/fix-buffer-checkbunnei2018-03-171-3/+1
|\ \ \ \ \ \ \
| * | | | | | | nvflinger: Remove superfluous buffer format check.bunnei2018-03-171-3/+1
|/ / / / / / /
* | | | | | | Merge pull request #232 from bunnei/heap-fixesbunnei2018-03-1715-82/+110
|\ \ \ \ \ \ \
| * | | | | | | process: MirrorMemory should use MemoryState::Mapped.bunnei2018-03-171-1/+1
| * | | | | | | process: Unmap previously allocated heap.bunnei2018-03-161-1/+3
| * | | | | | | arm_interface: Support unmapping previously mapped memory.bunnei2018-03-166-2/+18
| * | | | | | | svc: Use more correct values for GetInfo MapRegion and NewMapRegion.bunnei2018-03-163-29/+5
| * | | | | | | kernel: Move stack region outside of application heap.bunnei2018-03-166-11/+6
| * | | | | | | memory: Add regions for map region, "new" map region, etc.bunnei2018-03-161-19/+29
| * | | | | | | process: Fix stack memory state.bunnei2018-03-161-2/+4
| * | | | | | | MemoryState: Add additional memory states and improve naming.bunnei2018-03-165-18/+45
|/ / / / / / /
* | | | | | | Merge pull request #237 from mailwl/nifm-modulebunnei2018-03-168-125/+84
|\ \ \ \ \ \ \ | |/ / / / / / |/| | | | | |
| * | | | | | IGeneralService: fix function listmailwl2018-03-161-2/+3
| * | | | | | Service/NIFM: stub cancel functionmailwl2018-03-161-1/+6
| * | | | | | Service/NIFM: convert to modulemailwl2018-03-168-122/+75
|/ / / / / /
* | | | | | Merge pull request #236 from bunnei/refactor-process-creationbunnei2018-03-1522-72/+87
|\ \ \ \ \ \
| * | | | | | core: Move process creation out of global state.bunnei2018-03-1422-72/+87
|/ / / / / /
* | | | | | Merge pull request #213 from Hexagon12/dynarmic-defaultbunnei2018-03-081-1/+1
|\ \ \ \ \ \
| * | | | | | pls, that was easyHexagon122018-02-141-1/+1
| |/ / / / /
* | | | | | Merge pull request #230 from Subv/gpu_drawbunnei2018-03-052-1/+18
|\ \ \ \ \ \
| * | | | | | GPU: Intercept writes to the VERTEX_END_GL register.Subv2018-03-052-1/+18
|/ / / / / /
* | | | | | Merge pull request #229 from Subv/ensuresavedata_implbunnei2018-03-0412-43/+91
|\ \ \ \ \ \
| * | | | | | FS: Use the correct error code when trying to open files that don't exist.Subv2018-03-042-26/+6
| * | | | | | FS: Stubbed CreateSaveData. It currently does nothing.Subv2018-03-042-0/+15
| * | | | | | FS: Make EnsureSaveData create the savedata folder when called for the first time.Subv2018-03-048-17/+70
* | | | | | | Merge pull request #228 from Subv/unschedule_eventsbunnei2018-03-043-2/+10
|\ \ \ \ \ \ \ | |/ / / / / / |/| | | | | |
| * | | | | | CoreTiming: Unschedule the pending events when an Interface is destroyed.Subv2018-03-043-2/+10
|/ / / / / /
* | | | | | Merge pull request #226 from Subv/buffer_queue_eventbunnei2018-03-031-0/+3
|\ \ \ \ \ \
| * | | | | | Vi: Signal the BufferQueue's Native Handle right after ReleaseBuffer is called.Subv2018-03-031-0/+3
* | | | | | | Merge pull request #225 from mailwl/settingsbunnei2018-03-0312-10/+348
|\ \ \ \ \ \ \ | |/ / / / / / |/| | | | | |
| * | | | | | Service/Set: add more servicesmailwl2018-03-0312-10/+348
|/ / / / / /
* | | | | | Merge pull request #216 from Subv/savedatabunnei2018-03-0222-44/+546
|\ \ \ \ \ \
| * | | | | | SaveData: Use the current titleid when opening the savedata archive.Subv2018-03-021-2/+3
| * | | | | | Kernel: Store the program id in the Process class instead of the CodeSet class.Subv2018-03-029-26/+25
| * | | | | | FS: Implement MountSaveData and some of the IFile interface.Subv2018-03-022-0/+189
| * | | | | | Filesystem: Added a SaveData Factory and associated Disk_FileSystem.Subv2018-03-0210-16/+329
| * | | | | | ResultCode: Mark any error code that isn't 0 as an error.Subv2018-02-271-2/+2
| | |_|_|_|/ | |/| | | |
* | | | | | Merge pull request #224 from Armada651/clear-processbunnei2018-02-281-1/+3
|\ \ \ \ \ \ | |/ / / / / |/| | | | |
| * | | | | thread: Clear the process list on shutdown.Jules Blok2018-02-271-1/+3
|/ / / / /
* | | | | Removes the use of QKeySequence::Cancel (#186)Vishal Sharma2018-02-271-1/+2
* | | | | Merge pull request #207 from mailwl/duplicatesessionbunnei2018-02-273-6/+12
|\ \ \ \ \ | |_|_|_|/ |/| | | |
| * | | | Add warning if Domain request has no domain message headermailwl2018-02-201-0/+3
| * | | | Fix: change check for domain order and existance of domain message headermailwl2018-02-203-3/+4
| * | | | IPC: add domain header to response if only it exists in requestmailwl2018-02-203-6/+8
* | | | | Merge pull request #215 from N00byKing/umapsharedmmrybunnei2018-02-262-1/+17
|\ \ \ \ \
| * | | | | (Hopefully) Fix MinGW BuildN00byKing2018-02-251-1/+1
| * | | | | Add UnmapSharedMemoryN00byKing2018-02-252-1/+17
* | | | | | Merge pull request #222 from shinyquagsire23/npdm-parsingbunnei2018-02-267-9/+294
|\ \ \ \ \ \
| * | | | | | file_sys: Style tweaksshinyquagsire232018-02-262-11/+5
| * | | | | | loader: Check error on NPDM load, use TID for CodeSetshinyquagsire232018-02-253-6/+10
| * | | | | | loader: Use NPDM information when loading NSOsshinyquagsire232018-02-252-4/+15
| * | | | | | file_sys: Add support for parsing NPDM filesshinyquagsire232018-02-253-0/+276
|/ / / / / /
* | | | | | Merge pull request #212 from mailwl/stubsbunnei2018-02-2410-9/+112
|\ \ \ \ \ \
| * | | | | | Stub more functionsmailwl2018-02-227-8/+90
| * | | | | | Stub am::SetScreenShotPermission, and bsd::StartMonitoring functionsmailwl2018-02-225-1/+22
| |/ / / / /
* | | | | | Merge pull request #217 from shinyquagsire23/time-s-missingbunnei2018-02-231-0/+4
|\ \ \ \ \ \
| * | | | | | time: Add missing time:s functions, used for libnxshinyquagsire232018-02-231-0/+4
| |/ / / / /
* | | | | | Merge pull request #210 from MerryMage/f/dynarmic/sysregbunnei2018-02-233-2/+33
|\ \ \ \ \ \ | |/ / / / / |/| | | | |
| * | | | | dynarmic: Update to 6b4c6b0MerryMage2018-02-212-2/+18
| * | | | | arm_dynarmic: LOG_INFO on unicorn fallbackMerryMage2018-02-211-0/+4
| * | | | | memory: LOG_ERROR when falling off end of page tableMerryMage2018-02-211-0/+11
| |/ / / /
* | | | | Merge pull request #211 from shinyquagsire23/time_localbunnei2018-02-223-0/+9
|\ \ \ \ \
| * | | | | time: Add GetStandardLocalSystemClock, used by libnxshinyquagsire232018-02-223-0/+9
| |/ / / /
* | | | | Merge pull request #209 from MerryMage/f/scheduler-shutdownbunnei2018-02-221-5/+9
|\ \ \ \ \ | |/ / / / |/| | | |
| * | | | core: Fix scheduler-shutdown related crashMerryMage2018-02-211-5/+9
|/ / / /
* | | | Merge pull request #206 from mailwl/aoc-listaddoncontentbunnei2018-02-204-2/+28
|\ \ \ \
| * | | | Service/AOC: stub ListAddOnContent functionmailwl2018-02-204-2/+28
* | | | | Merge pull request #205 from bunnei/more-puyo-stubsbunnei2018-02-2010-1/+113
|\ \ \ \ \ | |/ / / / |/| | | |
| * | | | acc_u0: Stub ListOpenUsers service function.bunnei2018-02-192-1/+11
| * | | | service: Add Friend service interface.bunnei2018-02-196-0/+100
| * | | | logging: Add category for Friend service.bunnei2018-02-192-0/+2
|/ / / /
* | | | Merge pull request #202 from bunnei/scheduler-cleanupbunnei2018-02-1911-379/+239
|\ \ \ \
| * | | | scheduler: Cleanup based on PR feedback.bunnei2018-02-193-5/+4
| * | | | kernel: Use Scheduler class for threading.bunnei2018-02-186-174/+26
| * | | | kernel: Add Scheduler, which encapsulates the scheduling loading from Thread module.bunnei2018-02-183-0/+210
| * | | | core: Use shared_ptr for cpu_core.bunnei2018-02-182-6/+4
| * | | | kernel: Remove unused address_arbiter code.bunnei2018-02-185-199/+0
* | | | | Merge pull request #203 from Subv/ensure_save_databunnei2018-02-191-1/+2
|\ \ \ \ \ | |/ / / / |/| | | |
| * | | | AM: Corrected the response in EnsureSaveData.Subv2018-02-191-1/+2
|/ / / /
* | | | Merge pull request #198 from N00byKing/clangbunnei2018-02-184-9/+18
|\ \ \ \
| * | | | Update build.shN00byKing2018-02-181-1/+1
| * | | | Use Docker for Build Target clang-format for travis.N00byKing2018-02-164-9/+18
* | | | | Merge pull request #201 from Subv/ipc_delay_bunnei2018-02-184-50/+63
|\ \ \ \ \
| * | | | | Kernel/IPC: Add a small delay after each SyncRequest to prevent thread starvation.Subv2018-02-184-50/+63
* | | | | | Merge pull request #200 from Subv/bufferproducerfencebunnei2018-02-185-28/+68
|\ \ \ \ \ \ | |/ / / / / |/| | | | |
| * | | | | nvmap: Make IocFromId return the same existing handle instead of creating a new one.Subv2018-02-171-5/+2
| * | | | | Parcel: Ensure we don't read past the end of the parcels in Vi.Subv2018-02-171-0/+5
| * | | | | Vi: Mark all fences as NO_FENCE in the DequeueBuffer response parcel.Subv2018-02-171-2/+2
| * | | | | Vi: Always write the IGBPBuffer in the RequestBuffer response parcel.Subv2018-02-171-1/+2
| * | | | | nvhost-ctrl: Stub NVHOST_IOCTL_CTRL_EVENT_WAIT.Subv2018-02-152-0/+25
| * | | | | Vi: Mark the fences as valid in the DequeueBuffer response parcel.Subv2018-02-151-0/+3
| * | | | | Vi: Added a missing u32 in the DequeueBuffer response parcel.Subv2018-02-151-0/+1
| * | | | | Vi: Don't write the IGBPBuffer in the IGBPRequestBufferResponseParcel.Subv2018-02-151-4/+2
| * | | | | Vi: Properly write the BufferProducerFence object in the DequeueBuffer response parcel.Subv2018-02-152-18/+28
* | | | | | Merge pull request #199 from FernandoS27/update_dynarmicbunnei2018-02-171-0/+0
|\ \ \ \ \ \
| * | | | | | updated dynarmicFernandoS272018-02-171-0/+0
|/ / / / / /
* | | | | | Merge pull request #197 from mailwl/hidbunnei2018-02-174-1/+98
|\ \ \ \ \ \ | |_|/ / / / |/| | | | |
| * | | | | Service/hid: stub some functionsmailwl2018-02-164-1/+98
|/ / / / /
* | | | | Merge pull request #195 from bunnei/shared-fontbunnei2018-02-1510-13/+199
|\ \ \ \ \ | |/ / / / |/| | | |
| * | | | shared_memory: Remove some checks.bunnei2018-02-151-13/+0
| * | | | pl_u: Implement basic shared font loading from RAM dump.bunnei2018-02-156-0/+182
| * | | | log: Add logging category for NS services.bunnei2018-02-152-0/+2
| * | | | hid: Stub GetVibrationDeviceInfo and SendVibrationValues.bunnei2018-02-151-0/+15
|/ / / /
* | | | Merge pull request #188 from bunnei/refactor-buffer-descriptorbunnei2018-02-1511-108/+102
|\ \ \ \
| * | | | hle_ipc: Remove const from WriteBuffer size.bunnei2018-02-142-2/+2
| * | | | hle_ipc: Add GetReadBufferSize and check write buffer size.bunnei2018-02-142-0/+10
| * | | | service: Remove remaining uses of BufferDescriptor*.bunnei2018-02-145-14/+8
| * | | | audio: Use WriteBuffer instead of BufferDescriptorB.bunnei2018-02-142-9/+3
| * | | | vi: Eliminate direct usage of BufferDescriptorB.bunnei2018-02-141-14/+3
| * | | | nvdrv: Use ReadBuffer/WriteBuffer functions for Ioctl.bunnei2018-02-141-17/+5
| * | | | vi: Use ReadBuffer/WriteBuffer functions for TransactParcel.bunnei2018-02-141-44/+19
| * | | | hle_ipc: Add helper functions for reading and writing buffers.bunnei2018-02-141-4/+2
| * | | | hle_ipc: Add helper functions for reading and writing buffers.bunnei2018-02-143-0/+55
| * | | | vi: Fix TransactParcelAuto to support both buffer formats.bunnei2018-02-141-25/+16
* | | | | Merge pull request #192 from jroweboy/fix-fpsbunnei2018-02-141-0/+2
|\ \ \ \ \ | |_|/ / / |/| | | |
| * | | | Fix fps counter to correctly measure frame end when there was no frame to drawJames Rowe2018-02-141-0/+2
|/ / / /
* | | | Merge pull request #190 from bunnei/fix-qt-waittreebunnei2018-02-141-1/+1
|\ \ \ \
| * | | | debugger: Fix wait_tree crash.bunnei2018-02-141-1/+1
| |/ / /
* | | | Merge pull request #191 from lioncash/logbunnei2018-02-1412-57/+82
|\ \ \ \
| * | | | memory: Silence formatting sepecifier warningsLioncash2018-02-141-21/+30
| * | | | nso: Silence formatting specifier warningsLioncash2018-02-141-2/+4
| * | | | deconstructed_rom_directory: Silence formatting specifier warningsLioncash2018-02-141-3/+4
| * | | | nvdrv/interface: Silence formatting specifier warningsLioncash2018-02-141-1/+2
| * | | | nvmap: Silence formatting specifier warningsLioncash2018-02-141-1/+2
| * | | | nvhost_gpu: Silence formatting specifier warningsLioncash2018-02-141-6/+8
| * | | | nvhost_ctrl: Silence formatting specifier warningsLioncash2018-02-141-2/+2
| * | | | nvhost_ctrl_gpu: Silence formatting specifier warningsLioncash2018-02-141-3/+4
| * | | | nvhost_as_gpu: Silence formatting specifier warningsLioncash2018-02-141-5/+7
| * | | | thread: Silence formatting specifier warningsLioncash2018-02-141-2/+3
| * | | | vm_manager: Silence formatting specifier warningsLioncash2018-02-141-5/+7
| * | | | gdbstub: Silence formatting specifier warningsLioncash2018-02-141-6/+9
| |/ / /
* | | | Merge pull request #189 from lioncash/miscbunnei2018-02-141-1/+1
|\ \ \ \ | |/ / / |/| | |
| * | | maxwell_3d: Make constructor explicitLioncash2018-02-141-1/+1
|/ / /
* | | Merge pull request #187 from Subv/maxwell3d_querybunnei2018-02-143-3/+95
|\ \ \
| * | | GPU: Partially implemented the QUERY_* registers in the Maxwell3D engine.Subv2018-02-123-3/+95
* | | | audren_u: Schedule reoccuring event. (#183)bunnei2018-02-142-6/+36
* | | | Merge pull request #181 from bunnei/vi-fixes-2bunnei2018-02-141-17/+36
|\ \ \ \
| * | | | vi: Add FENCE_HACK, which is useful for booting BOTW.bunnei2018-02-131-7/+21
| * | | | vi: Stub TransactParcel CancelBuffer.bunnei2018-02-131-0/+2
| * | | | TransactParcel: Move WriteBlock to narrowest scope.bunnei2018-02-131-10/+13
* | | | | Merge pull request #184 from mailwl/lmbunnei2018-02-131-20/+49
|\ \ \ \ \ | |/ / / / |/| | | |
| * | | | Service/lm: add support to multiline logsmailwl2018-02-131-20/+49
* | | | | Merge pull request #180 from MerryMage/f/dynarmic/direct-page-tablebunnei2018-02-134-10/+19
|\ \ \ \ \ | |/ / / / |/| | | |
| * | | | arm_dynarmic: Support direct page table accessMerryMage2018-02-124-10/+19
|/ / / /
* | | | Merge pull request #179 from gdkchan/audren_stubsbunnei2018-02-121-2/+76
|\ \ \ \
| * | | | Add RequestUpdateAudioRenderer, StartAudioRenderer and StopAudioRenderer stubs to audren:ugdkchan2018-02-121-2/+76
* | | | | Merge pull request #178 from Subv/command_buffersbunnei2018-02-1220-23/+364
|\ \ \ \ \ | |/ / / / |/| / / / | |/ / /
| * | | Make a GPU class in VideoCore to contain the GPU state.Subv2018-02-1220-76/+125
| * | | GPU: Added a command processor to decode the GPU pushbuffers and forward the commands to their respective engines.Subv2018-02-1212-3/+285
| * | | nvdrv: Make the GPU memory manager available to nvhost-gpu.Subv2018-02-123-6/+16
* | | | Merge pull request #177 from bunnei/vi-fixesbunnei2018-02-129-22/+67
|\ \ \ \ | |/ / / |/| | |
| * | | renderer_opengl: Support framebuffer flip vertical.bunnei2018-02-123-5/+13
| * | | vi: Parse IGBPQueueBufferRequestParcel params and expose buffer flip vertical.bunnei2018-02-126-11/+46
| * | | vi: Fix OpenLayer and CreateStrayLayer.bunnei2018-02-111-6/+8
|/ / /
* | | Merge pull request #175 from bunnei/libnx-fixes-2bunnei2018-02-109-99/+166
|\ \ \
| * | | fsp_srv: Stub MountSdCard.bunnei2018-02-102-0/+9
| * | | apm: Refactor service impl. to support multiple ports.bunnei2018-02-105-58/+102
| * | | vi: Implement TransactParcelAuto.bunnei2018-02-101-32/+46
| * | | nvflinger: (Hack) Use first available buffer if none are found.bunnei2018-02-101-1/+5
| * | | IGBPQueueBufferRequestParcel: Don't enforce buffer length.bunnei2018-02-101-1/+0
| * | | IGBPRequestBufferResponseParcel: Fix response for libnx.bunnei2018-02-101-7/+4
|/ / /
* | | Merge pull request #171 from bunnei/libnx-fixesbunnei2018-02-096-9/+38
|\ \ \
| * | | nvdrv: Fix QueryEvent for libnx.bunnei2018-02-092-4/+8
| * | | IApplicationDisplayService::CloseDisplay: Fix response params size.bunnei2018-02-091-1/+1
| * | | nvhost_ctrl_gpu: Implement ZCullGetInfo.bunnei2018-02-091-2/+14
| * | | acc_u0: Implement ListAllUsers.bunnei2018-02-092-2/+15
* | | | Merge pull request #173 from MerryMage/feature/dynarmic-fix-windowsbunnei2018-02-091-0/+0
|\ \ \ \
| * | | | dynarmic: Fix bug due to Windows ABI mismatchMerryMage2018-02-091-0/+0
* | | | | Merge pull request #170 from MerryMage/feature/dynarmic-update-201802bunnei2018-02-095-32/+46
|\| | | | | |/ / / |/| | |
| * | | dynarmic: Update to 41ae12263MerryMage2018-02-095-32/+46
|/ / /
* | | Merge pull request #169 from bunnei/gpu-membunnei2018-02-088-30/+225
|\ \ \
| * | | nvhost_as_gpu: Implement AllocateSpace and MapBufferEx.bunnei2018-02-082-10/+33
| * | | nvdrv: Add MemoryManager class to track GPU memory.bunnei2018-02-083-0/+162
| * | | nvmap: Refactor to expose nvmap objects.bunnei2018-02-082-19/+22
| * | | nvhost_as_gpu: Add nvmap as a class member.bunnei2018-02-083-2/+9
|/ / /
* | | Merge pull request #168 from mailwl/new-stubsbunnei2018-02-079-6/+191
|\ \ \
| * | | Service: stub some functions in am, audio, time, vi servicesmailwl2018-02-079-6/+191
|/ / /
* | | Merge pull request #166 from mailwl/hid-SetNpadHandhelpActivationModebunnei2018-02-061-0/+7
|\ \ \
| * | | Service/hid: stub SetNpadHandheldActivationModemailwl2018-02-061-0/+7
|/ / /
* | | Merge pull request #165 from bunnei/puyo-fixesbunnei2018-02-064-2/+23
|\ \ \
| * | | mutex: Update hasWaiters on release.bunnei2018-02-061-0/+1
| * | | hid: Stub ActivateTouchScreen and SetNpadJoyHoldType.bunnei2018-02-061-2/+14
| * | | IApplicationFunctions: Stub out EnsureSaveData.bunnei2018-02-062-0/+8
* | | | Extra nvdrv support (#162)David2018-02-0617-37/+765
|/ / /
* | | Merge pull request #164 from ogniK5377/libnx_sm_fixbunnei2018-02-051-0/+2
|\ \ \
| * | | Dont call UNIMPLEMENTED for 'empty services', just return error codeDavid Marcec2018-02-051-0/+2
* | | | Merge pull request #163 from ogniK5377/istorage_to_romfsbunnei2018-02-052-5/+5
|\ \ \ \ | |/ / / |/| | |
| * | | Changed .istorage to .romfsDavid Marcec2018-02-052-5/+5
|/ / /
* | | Merge pull request #161 from bunnei/service-improvementsbunnei2018-02-0524-124/+211
|\ \ \
| * | | set: GetAvailableLanguageCodes should not return lang_codes size.bunnei2018-02-051-2/+3
| * | | nvflinger: Signal BufferQueue native handle event.bunnei2018-02-051-0/+1
| * | | logger: Add Time service logging category.bunnei2018-02-053-10/+12
| * | | logger: Add SET service logging category.bunnei2018-02-053-16/+12
| * | | logger: Add PCTL service logging category.bunnei2018-02-053-1/+3
| * | | logger: Add LM service logging category.bunnei2018-02-053-2/+4
| * | | logger: Add APM service logging category.bunnei2018-02-053-2/+5
| * | | lm: Ensure log string is non-empty before checking back().bunnei2018-02-051-1/+1
| * | | logger: Add NIFM service logging category.bunnei2018-02-056-11/+13
| * | | logger: Add VI service logging category.bunnei2018-02-056-21/+22
| * | | hid: Stub out several functions.bunnei2018-02-051-1/+39
| * | | hid: Implement CreateActiveVibrationDeviceList.bunnei2018-02-041-0/+25
| * | | logger: Use Service_HID category where applicable.bunnei2018-02-041-2/+2
| * | | logger: Use Service_NVDRV category where applicable.bunnei2018-02-042-10/+10
| * | | logger: Add AM service logging category.bunnei2018-02-045-42/+44
| * | | logger: Add "account" service logging category.bunnei2018-02-043-8/+10
| * | | acc_u0: Stub out GetLastOpenedUser.bunnei2018-02-042-0/+10
|/ / /
* | | Merge pull request #160 from bunnei/svc-improvementsbunnei2018-02-045-24/+32
|\ \ \
| * | | GetInfo: Implement IsCurrentProcessBeingDebugged.bunnei2018-02-041-0/+3
| * | | WaitProcessWideKeyAtomic: Handle case where condition variable was already created.bunnei2018-02-043-13/+17
| * | | svc: SharedMemory size should be 64-bits and cleanup.bunnei2018-02-033-11/+11
| * | | ArbitrateLock: Assert that requesting_thread is current_thread.bunnei2018-02-031-0/+1
* | | | Merge pull request #159 from mailwl/acc0-fixbunnei2018-02-041-1/+9
|\ \ \ \ | |/ / / |/| | |
| * | | acc:u0 : stub GetAccountIdmailwl2018-02-041-1/+9
|/ / /
* | | Merge pull request #157 from bunnei/fix-duplicate-sessionbunnei2018-02-031-4/+9
|\ \ \
| * | | controller: DuplicateSession should return a ClientSession.bunnei2018-02-031-4/+9
* | | | Merge pull request #156 from mailwl/nifmbunnei2018-02-0310-0/+378
|\ \ \ \ | |/ / / |/| | |
| * | | Service:nifm: add nifm:a, nifm:s and nifm:u servicesmailwl2018-02-0310-0/+378
|/ / /
* | | Service/am: Add AppletAE service (#153)mailwl2018-02-027-379/+571
* | | Merge pull request #154 from mailwl/vi_create_stray_arraybunnei2018-02-021-0/+1
|\ \ \
| * | | vi::CreateStrayLayer : add padding to requestmailwl2018-02-021-0/+1
* | | | Merge pull request #155 from mailwl/vi-servicesbunnei2018-02-026-0/+128
|\ \ \ \
| * | | | Services/vi: add vi:s and vi:u servicesmailwl2018-02-026-0/+128
| |/ / /
* | | | Merge pull request #152 from shinyquagsire23/sharedmem-valid-boundsbunnei2018-02-021-1/+2
|\ \ \ \ | |/ / / |/| | |
| * | | shared_memory: Only mark addresses as invalid if they are within the heapshinyquagsire232018-01-301-1/+2
* | | | [WIP] sfdnsres: stub (#146)mailwl2018-01-305-2/+52
|/ / /
* | | Merge pull request #151 from lioncash/catchbunnei2018-01-281-0/+0
|\ \ \
| * | | externals: Update catch to v2.1.1Lioncash2018-01-271-0/+0
|/ / /
* | | Merge pull request #148 from MerryMage/feature/special-memorybunnei2018-01-2711-441/+273
|\ \ \
| * | | memory: Replace all memory hooking with Special regionsMerryMage2018-01-2711-441/+273
* | | | Merge pull request #149 from MerryMage/feature/remove-x86_64hbunnei2018-01-271-1/+1
|\ \ \ \
| * | | | travis: Remove CMAKE_OSX_ARCHITECTURES argumentMerryMage2018-01-271-1/+1
* | | | | Merge pull request #147 from chris062689/masterFlame Sage2018-01-271-0/+5
|\ \ \ \ \
| * | | | | Added webhook notifications to TravisCI build.Flame Sage2018-01-271-0/+5
|/ / / / /
* | | | | Merge pull request #144 from KAMiKAZOW/patch-1bunnei2018-01-271-1/+1
|\ \ \ \ \
| * | | | | Install Linux icon in hicolor instead of pixmapsKAMiKAZOW2018-01-261-1/+1
* | | | | | Merge pull request #145 from jroweboy/oopsbunnei2018-01-261-1/+1
|\ \ \ \ \ \ | |/ / / / / |/| | | | |
| * | | | | Fix typo for dependent optionsJames Rowe2018-01-261-1/+1
|/ / / / /
* | | | | Merge pull request #142 from bunnei/improve-timebunnei2018-01-262-1/+22
|\ \ \ \ \
| * | | | | time: Implement ISteadyClock::GetCurrentTimePoint.bunnei2018-01-262-1/+22
|/ / / / /
* | | | | Merge pull request #137 from bunnei/improve-ipcbunnei2018-01-2532-452/+311
|\ \ \ \ \
| * | | | | audout_u: Various cleanups.bunnei2018-01-251-29/+17
| * | | | | ResponseBuilder: Use a bit field for customizing instead of always_move_handles.bunnei2018-01-253-11/+21
| * | | | | time: Stub GetSystemClockContext function.bunnei2018-01-252-2/+17
| * | | | | server_session: Fix scenario where all domain handlers are closed.bunnei2018-01-251-3/+3
| * | | | | hle: Rename RequestBuilder to ResponseBuilder.bunnei2018-01-2519-128/+129
| * | | | | service: Fix all incorrect IPC response headers.bunnei2018-01-2514-82/+42
| * | | | | ipc_helpers: Make interface domain agnostic and add header validation.bunnei2018-01-252-25/+58
| * | | | | hle: Integrate Domain handling into ServerSession.bunnei2018-01-257-38/+74
| * | | | | hle: Remove Domain and SyncObject kernel objects.bunnei2018-01-2510-169/+2
| * | | | | handle_table: Remove ConvertSessionToDomain.bunnei2018-01-252-17/+0
|/ / / / /
* | | | | audout:u OpenAudioOut and IAudioOut (#138)st4rk2018-01-254-14/+168
* | | | | Merge pull request #140 from gdkchan/time_fixbunnei2018-01-241-1/+1
|\ \ \ \ \
| * | | | | Fix time returning epoch time in milliseconds rather than in secondsgdkchan2018-01-241-1/+1
|/ / / / /
* | | | | Merge pull request #139 from Rozelette/log_nvdrvbunnei2018-01-241-0/+1
|\ \ \ \ \
| * | | | | logging: add missing NVDRV subclass to macro listRozlette2018-01-241-0/+1
|/ / / / /
* | | | | Merge pull request #136 from N00byKing/patch-1bunnei2018-01-241-2/+2
|\ \ \ \ \
| * | | | | Correct SpellingN00byKing2018-01-231-2/+2
|/ / / / /
* | | | | Merge pull request #135 from Subv/no_portsbunnei2018-01-235-65/+67
|\ \ \ \ \
| * | | | | Services: Added a todo about returning interfaces as domain objects in lm, hid and time.Subv2018-01-233-0/+12
| * | | | | Time: Don't create unnecessary ports when retrieving the clock service sessions.Subv2018-01-221-33/+27
| * | | | | HID: Don't create an unnecessary port in CreateAppletResource.Subv2018-01-221-13/+13
| * | | | | LM: Don't create an unnecessary port in Initialize.Subv2018-01-222-15/+10
| * | | | | IPC: Don't create an unnecessary port when using PushIpcInterface outside of a domain.Subv2018-01-221-4/+5
* | | | | | Merge pull request #133 from Subv/nvflinger2bunnei2018-01-229-17/+59
|\ \ \ \ \ \ | |/ / / / / |/| | | | |
| * | | | | AppletOE: Stubbed CreateManagedDisplayLayer to create a new layer in the Default display.Subv2018-01-221-0/+14
| * | | | | AppletOE: Make ISelfController keep a reference to nvflinger.Subv2018-01-225-10/+32
| * | | | | Services: Vi shouldn't be responsible for creating nvflinger.Subv2018-01-225-7/+13
* | | | | | Merge pull request #134 from gdkchan/audout_hid_fixbunnei2018-01-223-2/+21
|\ \ \ \ \ \ | |/ / / / / |/| | | | |
| * | | | | Stub OpenAudioOut and fix a issue with HID IAppletResource being created more than oncegdkchan2018-01-223-2/+21
* | | | | | Merge pull request #132 from Subv/nvflingerbunnei2018-01-229-363/+452
|\ \ \ \ \ \ | |/ / / / / |/| | | | |
| * | | | | VI: Move BufferQueue and NVFlinger to their own folder/namespace.Subv2018-01-229-363/+452
|/ / / / /
* | | | | Added stubs for audio services. (#116)st4rk2018-01-2212-5/+309
* | | | | Merge pull request #131 from lioncash/enumbunnei2018-01-222-12/+13
|\ \ \ \ \
| * | | | | nvmap: Add a return 0 underneath the UNIMPLEMENTED macroLioncash2018-01-211-0/+1
| * | | | | nvmap: Make IoctlCommands an enum classLioncash2018-01-212-12/+12
* | | | | | Merge pull request #130 from MerryMage/dynarmicbunnei2018-01-221-0/+0
|\ \ \ \ \ \ | | |_|/ / / | |/| | | |
| * | | | | externals: Update dynarmicMerryMage2018-01-211-0/+0
* | | | | | Added nvmemp, Added /dev/nvhost-ctrl, SetClientPID now stores pid (#114)David2018-01-219-5/+163
* | | | | | Merge pull request #128 from Subv/parcel_querybunnei2018-01-212-0/+58
|\ \ \ \ \ \
| * | | | | | VI: Implement the Query transaction of IHOSBinderDriver, and stubbed some results.Subv2018-01-212-0/+58
| | |_|/ / / | |/| | | |
* | | | | | Merge pull request #123 from bunnei/fsbunnei2018-01-2125-947/+535
|\ \ \ \ \ \ | |_|_|/ / / |/| | | | |
| * | | | | file_sys: Clang format fixes.bunnei2018-01-213-4/+4
| * | | | | fsp_srv: Various improvements to IStorage:Read implementation.bunnei2018-01-215-48/+79
| * | | | | deconstructed_rom_directory: Implement istorage loading for RomFS.bunnei2018-01-212-2/+71
| * | | | | filesystem: Implement basic IStorage functionality.David Marcec2018-01-216-0/+258
| * | | | | file_sys: Cleanup to better match Switch file system constructs.bunnei2018-01-2110-63/+136
| * | | | | file_sys: Remove disk_archive, savedata_archive, and title_metadata.bunnei2018-01-217-835/+0
| * | | | | archive_backend: Minor changes to match Switch IFileSystem.bunnei2018-01-215-26/+26
| * | | | | file_sys: Repurpose 3DS IVFC code for Switch ROMFS.bunnei2018-01-213-51/+43
|/ / / / /
* | | | | Merge pull request #129 from Rozelette/masterbunnei2018-01-211-113/+155
|\ \ \ \ \
| * | | | | gdbstub: Update registers and sizes for aarch64Rozlette2018-01-211-113/+155
| |/ / / /
* | | | | Merge pull request #124 from akkatracker/patch-1bunnei2018-01-211-1/+1
|\ \ \ \ \
| * | | | | Fix spelling error in CMakeListsMatthew Brener2018-01-211-1/+1
| |/ / / /
* | | | | Merge pull request #125 from MerryMage/bundled-unicornbunnei2018-01-211-3/+6
|\ \ \ \ \ | |/ / / / |/| / / / | |/ / /
| * | | CMakeLists: Fix unicorn build for macOS developers with x86_64-only systemsMerryMage2018-01-211-1/+1
| * | | CMakeLists: Do not look for system Unicorn by defaultMerryMage2018-01-211-2/+5
|/ / /
* | | Merge pull request #72 from N00byKing/patch-2bunnei2018-01-211-1/+0
|\ \ \
| * | | Update core.cppN00byKing2018-01-171-1/+0
* | | | Merge pull request #92 from gdkchan/nro_refactorbunnei2018-01-211-2/+2
|\ \ \ \
| * | | | Fix NRO Entry Pointgdkchan2018-01-181-2/+2
* | | | | Merge pull request #122 from tgsm/time-remove-pragmabunnei2018-01-212-4/+0
|\ \ \ \ \
| * | | | | service/time: remove accidental #pragmastgsm2018-01-212-4/+0
* | | | | | Merge pull request #121 from Rozelette/masterbunnei2018-01-211-1/+0
|\ \ \ \ \ \ | |/ / / / / |/| | | | |
| * | | | | loader: Minor style fix in deconstructed_rom_directoryRozlette2018-01-211-1/+0
|/ / / / /
* | | | | Merge pull request #117 from jroweboy/clang-formatbunnei2018-01-2178-122/+275
|\ \ \ \ \
| * | | | | Travis: Add missing PPA for newer libstdc++James Rowe2018-01-211-0/+1
| * | | | | Travis: Update clang-format to 6.0James Rowe2018-01-212-2/+5
| * | | | | Format: Run the new clang format on everythingJames Rowe2018-01-2174-117/+207
| * | | | | CMake: Conditionally turn on bundled libs for MSVCJames Rowe2018-01-211-2/+5
| * | | | | CMake: Update contributing guide with the new clang format infoJames Rowe2018-01-211-1/+10
| * | | | | CMake: Add a custom clang format targetJames Rowe2018-01-201-0/+47
* | | | | | Merge pull request #120 from Rozelette/masterbunnei2018-01-201-0/+3
|\ \ \ \ \ \
| * | | | | | memory: Return false for large VAddr in IsValidVirtualAddressRozlette2018-01-201-0/+3
| |/ / / / /
* | | | | | Merge pull request #119 from bunnei/desconstucted-loaderbunnei2018-01-2011-51/+200
|\ \ \ \ \ \ | |/ / / / / |/| | | | |
| * | | | | loader: Clean up ctors and includes.bunnei2018-01-2010-18/+22
| * | | | | loader: Add DeconstructedRomDirectory for game dumps.bunnei2018-01-205-0/+156
| * | | | | loader: Refactor to also pass filepath into IdentifyType.bunnei2018-01-208-19/+19
| * | | | | nso: Remove code specific to directory loading.bunnei2018-01-202-17/+6
|/ / / / /
* | | | | Port citra #3352 to yuzu (#103)River City Ransomware2018-01-204-12/+36
* | | | | Added CreateSharedMemory & UNIMPLEMENTED() for non existent services. (#113)David2018-01-203-1/+23
* | | | | Fixes some cast warnings, partial port of citra #3064 (#106)River City Ransomware2018-01-206-21/+22
* | | | | Merge pull request #112 from Rozelette/masterbunnei2018-01-191-0/+16
|\ \ \ \ \
| * | | | | ISelfController: Stub LockExit and UnlockExitRozlette2018-01-191-0/+16
* | | | | | acc, set, applet_oe: stub various functions, add set service (#105)goaaats2018-01-198-0/+161
|/ / / / /
* | | | | Merge pull request #109 from bunnei/libnx-fixesbunnei2018-01-196-1/+26
|\ \ \ \ \
| * | | | | nvdrv: Stub SetClientPID.bunnei2018-01-192-0/+13
| * | | | | svc: Fix svcGetInfo MapRegionBaseAddr.bunnei2018-01-193-1/+9
| * | | | | svc: Add additional fields to MemoryInfo struct.bunnei2018-01-191-0/+4
* | | | | | Merge pull request #97 from bunnei/time-stubbunnei2018-01-192-4/+12
|\ \ \ \ \ \
| * | | | | | time: Stub out GetTotalLocationNameCount and some cleanup.bunnei2018-01-192-4/+12
* | | | | | | time: Add new line to ends of files.bunnei2018-01-194-4/+4
* | | | | | | applet_oe: Clang-format.bunnei2018-01-191-2/+1
|/ / / / / /
* | | | | | Merge pull request #108 from gdkchan/dispdrvbunnei2018-01-191-1/+1
|\ \ \ \ \ \ | |/ / / / / |/| | | | |
| * | | | | Fix dispdrv typogdkchan2018-01-191-1/+1
|/ / / / /
* | | | | Merge pull request #100 from Rozelette/masterbunnei2018-01-197-32/+113
|\ \ \ \ \
| * | | | | time: Fix use of CamelCase in ToCalendarTimeWithMyRuleRozlette2018-01-181-6/+6
| * | | | | time: Refactor time:* to use a single shared moduleRozlette2018-01-187-26/+107
| | |_|/ / | |/| | |
* | | | | Merge pull request #104 from RiverCityRansomware/resizedConfigWindowbunnei2018-01-191-1/+1
|\ \ \ \ \
| * | | | | Port citra #3336 - Resizes the configuration window to not be so stretched outRiver City Ransomware2018-01-181-1/+1
| | |/ / / | |/| | |
* | | | | Merge pull request #107 from lioncash/qtbunnei2018-01-195-31/+31
|\ \ \ \ \
| * | | | | qt: Migrate to Qt 5 signal/slot connection syntax where applicableLioncash2018-01-195-31/+31
|/ / / / /
* | | | | ui: Rename almost all classes in configuration_input.ui (#99)Evgeni Danailov2018-01-181-66/+66
* | | | | Merge pull request #101 from jroweboy/add-missing-dllsbunnei2018-01-181-3/+10
|\ \ \ \ \ | |/ / / / |/| | | |
| * | | | Build: Add missing dlls to msvc releaseJames Rowe2018-01-181-3/+10
* | | | | Stub PopLaunchParameter and implement Buffer C Descriptors reading on hle_ipc (#96)gdkchan2018-01-185-7/+127
* | | | | Start to implement/stub BSD:U and SFDNSRES services (#78)flerovium^-^2018-01-187-0/+159
* | | | | Merge pull request #98 from lioncash/xcodebunnei2018-01-181-1/+1
|\ \ \ \ \
| * | | | | travis: Use Xcode 9.2Lioncash2018-01-181-1/+1
| | |/ / / | |/| | |
* | | | | Merge pull request #95 from bunnei/lm-skip-bytebunnei2018-01-181-0/+7
|\ \ \ \ \ | |/ / / / |/| | | |
| * | | | lm: Minor logging fix to skip a byte.bunnei2018-01-181-0/+7
* | | | | Merge pull request #84 from lioncash/cmakebunnei2018-01-1811-389/+361
|\ \ \ \ \
| * | | | | CMakeLists: Derive the source directory grouping from targets themselvesLioncash2018-01-1811-389/+361
* | | | | | Merge pull request #91 from lioncash/svcbunnei2018-01-181-9/+9
|\ \ \ \ \ \
| * | | | | | svc: Rename some entries to match their analogue on SwitchBrewLioncash2018-01-181-7/+7
| * | | | | | svc: Add CreateJitMemory and MapJitMemory svc stringsLioncash2018-01-181-2/+2
| |/ / / / /
* | | | | | Merge pull request #90 from lioncash/vi-overridebunnei2018-01-181-20/+21
|\ \ \ \ \ \
| * | | | | | vi: Make constructors explicit where applicableLioncash2018-01-181-13/+14
| * | | | | | vi: Add missing override specifiersLioncash2018-01-181-7/+7
| |/ / / / /
* | | | | | Merge pull request #89 from lioncash/vi-vectorbunnei2018-01-181-2/+3
|\ \ \ \ \ \
| * | | | | | vi: Copy data directly into the std::vector within Parcel's ReadBlock functionLioncash2018-01-181-2/+3
| |/ / / / /
* | | | | | Merge pull request #88 from lioncash/includebunnei2018-01-181-0/+1
|\ \ \ \ \ \
| * | | | | | hotkeys: Add missing <QTreeWidgetItem> includeLioncash2018-01-181-0/+1
| |/ / / / /
* | | | | | Merge pull request #87 from lioncash/overridebunnei2018-01-181-1/+1
|\ \ \ \ \ \
| * | | | | | game_list: Add missing override specifier for KeyReleaseEater's eventFilter functionLioncash2018-01-181-1/+1
| |/ / / / /
* | | | | | Merge pull request #93 from jroweboy/deploy-keyFlame Sage2018-01-182-2/+2
|\ \ \ \ \ \ | | |_|/ / / | |/| | | |
| * | | | | Build: Update deploy keysJames Rowe2018-01-182-2/+2
|/ / / / /
* | | | | Merge pull request #86 from lioncash/doxygenbunnei2018-01-181-2/+2
|\ \ \ \ \
| * | | | | game_list: Amend doxygen parameter identifiers for containsAllWords()Lioncash2018-01-181-2/+2
| |/ / / /
* | | | | Merge pull request #85 from lioncash/warnbunnei2018-01-181-2/+2
|\ \ \ \ \ | |_|/ / / |/| | | |
| * | | | telemetry: Silence initialization order warningsLioncash2018-01-181-2/+2
| |/ / /
* | | | controller: Use DuplicateSession for DuplicateSessionEx.bunnei2018-01-182-1/+8
* | | | Merge pull request #83 from lioncash/pessimizing-movebunnei2018-01-181-1/+1
|\ \ \ \
| * | | | input_common/sdl: Silence a -Wpessimizing-move warningLioncash2018-01-181-1/+1
| |/ / /
* | | | Merge pull request #82 from lioncash/catchbunnei2018-01-181-0/+0
|\ \ \ \
| * | | | externals: Update catch to 2.1.0Lioncash2018-01-181-0/+0
| |/ / /
* | | | Merge pull request #81 from lioncash/qt-bootmgrbunnei2018-01-182-7/+6
|\ \ \ \
| * | | | bootmanager: Minor tidiness/correctness changesLioncash2018-01-182-7/+6
| |/ / /
* | | | Merge pull request #80 from gdkchan/nro_fixbunnei2018-01-181-20/+9
|\ \ \ \ | |/ / / |/| | |
| * | | Fix NRO loadinggdkchan2018-01-181-20/+9
* | | | Merge pull request #73 from N00byKing/3093bunnei2018-01-182-0/+2
|\ \ \ \ | |/ / / |/| | |
| * | | Update CMakeLists.txtN00byKing2018-01-171-0/+1
| * | | Update title_metadata.hN00byKing2018-01-171-0/+1
* | | | Merge pull request #76 from Rozelette/masterbunnei2018-01-175-85/+164
|\ \ \ \
| * | | | TIME: consolidate time:* interfaces, stub functions and structsRozlette2018-01-175-85/+164
* | | | | Implement Pull #3306 from citra: citra_qt: Drop Qt 5 version checks in code (#41)N00byKing2018-01-171-13/+1
* | | | | Merge pull request #77 from gdkchan/no_relocsbunnei2018-01-173-19/+2
|\ \ \ \ \ | |/ / / / |/| | | |
| * | | | Remove relocation on NSO/NROgdkchan2018-01-173-19/+2
|/ / / /
* | | | Merge pull request #42 from N00byKing/3295bunnei2018-01-171-5/+1
|\ \ \ \
| * | | | Update CMakeLists.txtN00byKing2018-01-161-5/+1
| |/ / /
* | | | Merge pull request #57 from nkatz565/fix-trbunnei2018-01-171-1/+2
|\ \ \ \
| * | | | Fixed formattingnoah katz2018-01-171-2/+2
| * | | | Fix non translated string (same as Citra PR 2949)noah katz2018-01-171-1/+1
* | | | | Merge pull request #64 from shinyquagsire23/hid-timingbunnei2018-01-171-3/+3
|\ \ \ \ \
| * | | | | hid: Adjust timing based on actual hardwareshinyquagsire232018-01-171-3/+3
| | |_|_|/ | |/| | |
* | | | | Merge pull request #70 from flerovii/nvdrv-closebunnei2018-01-174-0/+26
|\ \ \ \ \
| * | | | | nvdrv: stubbed Close(cmd 2)Frederic Meyer2018-01-174-0/+26
* | | | | | svc: Clang-format fix.bunnei2018-01-171-6/+4
| |_|_|_|/ |/| | | |
* | | | | Merge pull request #71 from N00byKing/patch-1bunnei2018-01-171-2/+2
|\ \ \ \ \
| * | | | | Update default_ini.hN00byKing2018-01-171-2/+2
| |/ / / /
* | | | | Merge pull request #62 from bunnei/domain-close-handlebunnei2018-01-175-4/+38
|\ \ \ \ \ | |/ / / / |/| | | |
| * | | | hle_ipc: Clang format.bunnei2018-01-171-2/+3
| * | | | ipc: Implement domain command CloseVirtualHandle.bunnei2018-01-173-3/+34
| * | | | loggin: Add IPC logging category.bunnei2018-01-172-1/+3
* | | | | Merge pull request #67 from RiverCityRansomware/gdbstubtypobunnei2018-01-171-1/+1
|\ \ \ \ \ | |_|/ / / |/| | | |
| * | | | Fix gdbstub typo, fixes Citra #3318River City Ransomware2018-01-171-1/+1
|/ / / /
* | | | Merge pull request #60 from jroweboy/game-framebunnei2018-01-172-1/+4
|\ \ \ \ | |/ / / |/| | |
| * | | UI: Fix frame rate perf statsJames Rowe2018-01-172-1/+4
* | | | Merge pull request #34 from shinyquagsire23/hid-sharedmem-layouts-circbufs-metabunnei2018-01-172-88/+125
|\ \ \ \ | |/ / / |/| | |
| * | | hid: clang-formatshinyquagsire232018-01-171-3/+3
| * | | hid: Adjust for style guideshinyquagsire232018-01-172-63/+68
| * | | hid: Write to all layouts, implement circular buffers, set up controller metadata.shinyquagsire232018-01-162-39/+71
* | | | acc_u0: Add IPC interface and stub InitializeApplicationInfo.bunnei2018-01-176-0/+86
* | | | Merge pull request #55 from bunnei/subv-improvementsbunnei2018-01-1723-216/+381
|\ \ \ \
| * | | | applet_oe: Fix GetOperationMode and GetPerformanceMode.bunnei2018-01-171-2/+2
| * | | | NV: Implemented the nvdrv service, which uses the same interface as nvdrv:aSubv2018-01-174-16/+18
| * | | | NV: Move the nvdrv classes into the Nvidia namespace, and move the functionality to a s single module that services call.Subv2018-01-1713-165/+95
| * | | | VI: Stubbed GetNativeHandle, Create/DestroyStrayLayer and CloseDisplaySubv2018-01-172-3/+85
| * | | | Services: Stubbed APM::OpenSession and the ISession interface.Subv2018-01-173-2/+53
| * | | | AppletOE: Stub a bunch of functions required by libnx homebrew.Subv2018-01-171-4/+62
| * | | | SVC: Correct some return values in svcGetInfo and added TitleId and PrivilegedProcessId stubs.Subv2018-01-171-6/+21
| * | | | SVC: Add 4.0.0+ comment to GetInfoType enum values.Subv2018-01-171-0/+1
| * | | | IPC: Push domain objects as move handles when not in a domain.Subv2018-01-172-2/+28
|/ / / /
* | | | Merge pull request #52 from ogniK5377/fspbunnei2018-01-176-5/+90
|\ \ \ \
| * | | | Update memory.hDavid2018-01-171-2/+2
| * | | | SetThreadCoreMask stub, time to implement fspDavid Marcec2018-01-161-1/+6
| * | | | implemented more of ISelfController and IApplicationFunctionsDavid Marcec2018-01-161-0/+53
| * | | | Added more svcGetInfo pairsDavid Marcec2018-01-164-2/+29
| * | | | Increased heap size and changed tls area vaddrDavid Marcec2018-01-161-2/+2
| | |/ / | |/| |
* | | | Merge pull request #45 from FearlessTobi/patch-1bunnei2018-01-161-6/+6
|\ \ \ \
| * | | | Implement Pull #3030 from CitraTobias2018-01-161-6/+6
* | | | | Merge pull request #43 from N00byKing/3052bunnei2018-01-161-1/+1
|\ \ \ \ \
| * | | | | Update game_list.cppN00byKing2018-01-161-1/+1
| | |_|_|/ | |/| | |
* | | | | Merge pull request #46 from FearlessTobi/patch-2bunnei2018-01-161-8/+8
|\ \ \ \ \
| * | | | | Implement Pull #3034 from CitraTobias2018-01-161-8/+8
| | |/ / / | |/| | |
* | | | | Merge pull request #53 from nkatz565/nk-fixlabelsbunnei2018-01-161-25/+52
|\ \ \ \ \
| * | | | | Use static functions instead of lambdasmuemart2018-01-161-49/+46
| * | | | | Add translation support for button labelsmuemart2018-01-161-14/+15
| * | | | | Add button labels for sdl joystick mappingsmuemart2018-01-161-17/+46
| | |_|/ / | |/| | |
* | | | | Merge pull request #44 from Rozelette/masterbunnei2018-01-161-3/+7
|\ \ \ \ \
| * | | | | nso: Modify .bss size calculation logicRozlette2018-01-161-3/+7
| | |_|/ / | |/| | |
* | | | | Merge pull request #47 from MerryMage/build-fixesbunnei2018-01-1626-63/+55
|\ \ \ \ \ | |_|/ / / |/| | | |
| * | | | clang-formatMerryMage2018-01-1625-63/+54
| * | | | travis: Use more recent cmake on macOSMerryMage2018-01-161-0/+1
| | |/ / | |/| |
* | | | Merge pull request #48 from spycrab/cmake_pythonbunnei2018-01-161-1/+3
|\ \ \ \ | |/ / / |/| | |
| * | | CMake: Override PYTHON environment variable for libunicornspycrab2018-01-161-1/+3
|/ / /
* | | Update README.md to include AppVeyor build status.bunnei2018-01-161-0/+1
* | | Merge pull request #31 from jroweboy/fix-deploybunnei2018-01-169-51/+67
|\ \ \ | |/ / |/| |
| * | Build: Automagically handle unicornJames Rowe2018-01-162-46/+48
| * | Build: Update Appveyor and Travis secret keysJames Rowe2018-01-162-2/+2
| * | Build: Add unicorn as a submodule and build it if neededJames Rowe2018-01-168-27/+41
| |/
* | Implement Pull #3333 from citra: citra_qt: Pause emulation on CoreError (#39)N00byKing2018-01-162-0/+2
* | Merge pull request #24 from nkatz565/nk-inputsbunnei2018-01-167-191/+524
|\ \
| * | Adding meumart's Citra SDL Joystick support. Citra PR #3116muemart2018-01-167-191/+524
* | | Merge pull request #38 from goaaats/citra_mergesbunnei2018-01-165-1/+73
|\ \ \ | |_|/ |/| |
| * | Merge citra-emu PR#3159 by FearlessTobi(citra-qt : Fix a bug in our fullscreen implementation)goaaats2018-01-162-15/+31
| * | Merge citra-emu PR#3001 by Styleoshin(citra-qt : Adding fullscreen mode)goaaats2018-01-165-1/+57
|/ /
* | Merge pull request #25 from chris062689/masterFlame Sage2018-01-161-1/+1
|\ \
| * | Updated Discord link to match website.Flame Sage2018-01-161-1/+1
|/ /
* | Merge pull request #23 from Simonx22/cmake_renamebunnei2018-01-151-6/+6
|\ \
| * | rename CITRA to YUZUSimonx222018-01-151-6/+6
| |/
* / nso: Load subsdk4 if available.bunnei2018-01-151-1/+1
|/
* pctl: Clang format.bunnei2018-01-151-1/+1
* pctl: GetService should return an IParentalControlService interface.bunnei2018-01-151-3/+8
* applet_oe: Stub SetFocusHandlingMode, GetCurrentFocusState, SetTerminateResult.bunnei2018-01-151-2/+55
* settings: Fix button mappings array to have correct entries.bunnei2018-01-151-2/+6
* Merge pull request #17 from spycrab/bindirbunnei2018-01-153-4/+7
|\
| * CMake: Output binaries to bin/spycrab2018-01-153-4/+7
* | Merge pull request #20 from Andrix44/fixesbunnei2018-01-155-73/+11
|\ \
| * | Clanggit rebase -i fixesunknown2018-01-151-10/+2
| * | Clang formatunknown2018-01-152-4/+10
| * | Change default log level to infounknown2018-01-151-1/+1
| * | Update the internal resolution settingsunknown2018-01-153-67/+7
| * | Fix some warningsunknown2018-01-151-3/+3
* | | Merge pull request #16 from shinyquagsire23/hid-sharedmem-impl-startbunnei2018-01-157-115/+688
|\ \ \ | |/ / |/| |
| * | yuzu_cmd: Fix default ini, add screenshot buttonshinyquagsire232018-01-151-1/+2
| * | hid: Bare-minimum sharedmem inputshinyquagsire232018-01-152-2/+88
| * | hid: Remove redundant HID prefix on structs/enumsshinyquagsire232018-01-151-73/+73
| * | configure_input: update w/ Switch buttonsshinyquagsire232018-01-153-90/+221
| * | settings: Screenshot buttonshinyquagsire232018-01-151-0/+2
| * | yuzu_cmd: fix default inishinyquagsire232018-01-151-9/+17
| * | settings: adjust button configs for Switch controllersshinyquagsire232018-01-151-17/+50
| * | hid: Add sharedmem structsshinyquagsire232018-01-151-0/+312
| * | fixed build for gcc c++17 / boost.icl incompatibilityHarry Prevor2018-01-151-0/+6
* | | Merge pull request #15 from bsaleil/masterbunnei2018-01-151-0/+10
|\ \ \
| * | | vi: Add IManagerDisplayService::CloseDisplay functionbsaleil2018-01-151-0/+10
|/ / /
* | | Merge pull request #13 from hpr/fno-new-ttp-matchingbunnei2018-01-151-0/+6
|\ \ \ | |/ / |/| |
| * | fixed build for gcc c++17 / boost.icl incompatibilityHarry Prevor2018-01-151-0/+6
* | | Merge pull request #14 from ogniK5377/masterbunnei2018-01-151-1/+1
|\ \ \
| * | | Games expect 15 for ICommonStateGetter::ReceiveMessage in order to continue executionDavid Marcec2018-01-151-1/+1
* | | | renderer_gl: Clear screen to black before rendering framebuffer.bunnei2018-01-152-5/+8
|/ / /
* | | renderer: Render previous frame when no new one is available.bunnei2018-01-154-17/+22
* | | Update README.md with Travis link.bunnei2018-01-151-0/+2
* | | lm: Fix IPC header for Initialize.bunnei2018-01-151-1/+1
* | | time: Implement GetStandardUserSystemClock, GetCurrentTime.bunnei2018-01-156-1/+121
* | | audio: Add files to CMake.bunnei2018-01-152-1/+4
* | | hid: Remove unused registered_loggers.bunnei2018-01-151-3/+0
* | | audio: Stub out AudOutU::ListAudioOuts.bunnei2018-01-155-0/+84
* | | hid: Implement IAppletResource::GetSharedMemoryHandle.bunnei2018-01-153-14/+68
|/ /
* | Merge pull request #10 from Andrix44/mpwarningsbunnei2018-01-151-4/+4
|\ \
| * | Fix some warnings in the microprofileAndrix442018-01-151-4/+4
| |/
* | qt: Update about dialog to show license for GPLv2 only.bunnei2018-01-141-1/+1
* | shared_memory: Minor fixes and cleanup.bunnei2018-01-141-6/+6
* | svc: Implement svcMapSharedMemory.bunnei2018-01-142-1/+38
* | kernel: Increase default stack size to 64K.bunnei2018-01-141-1/+1
|/
* Merge pull request #7 from JayFoxRox/remove-surface-viewerbunnei2018-01-143-13/+0
|\
| * Remove Surface Viewer stubJannik Vogel2018-01-143-13/+0
|/
* Merge pull request #4 from spycrab/aboutdialogbunnei2018-01-148-3/+250
|\
| * Implement "About" dialogspycrab2018-01-148-3/+250
* | Merge pull request #1 from roblabla/patch-1bunnei2018-01-141-1/+1
|\ \
| * | Fix compilation on case-sensitive OSXRobin Lambertz2018-01-141-1/+1
| |/
* | Merge pull request #5 from Thog/fix/loader-file-typebunnei2018-01-141-0/+8
|\ \ | |/ |/|
| * Add missing FileType declarations in GuessFromExtension and GetFileTypeStringThog2018-01-141-0/+8
|/
* externals: Remove unused repos.bunnei2018-01-144-0/+0
* yuzu qt copy windows deps renamedJames Rowe2018-01-141-2/+2
* Minor cleanupMerryMage2018-01-1410-39/+34
* macOS: Update Info.plistMerryMage2018-01-141-34/+34
* Add new icons and fix up the linux paths for installJames Rowe2018-01-137-18/+120
* Update dynarmic to bc73004MerryMage2018-01-132-12/+17
* Fix build on macOS and linuxMerryMage2018-01-136-10/+11
* Update build scriptsMerryMage2018-01-138-43/+56
* yuzu: Update CONTRIBUTING.md.bunnei2018-01-131-4/+4
* yuzu: Update README.md.bunnei2018-01-131-22/+21
* arm_unicorn: Log unmapped memory access address.bunnei2018-01-131-1/+1
* config: Default log filter to trace.bunnei2018-01-133-3/+3
* yuzu: Update license text to be consistent across project.bunnei2018-01-1361-61/+61
* Remove settings issues in sdl and fix a few files that broke in mingwJames Rowe2018-01-135-53/+1
* Removing unused settings and yuzu rebrandingJames Rowe2018-01-1317-485/+69
* Get yuzu sdl to start compilingJames Rowe2018-01-135-12/+12
* Remove gpu debugger and get yuzu qt to compileJames Rowe2018-01-1348-3245/+47
* Remove references to PICA and rasterizers in video_coreJames Rowe2018-01-1377-16444/+4
* Massive removal of unused modulesJames Rowe2018-01-13179-21306/+23
* config: Default CPU core to Unicorn.bunnei2018-01-133-3/+3
* CMakeLists: Use C++ 17.bunnei2018-01-131-2/+2
* boost: Update version.bunnei2018-01-132-1/+1
* core: Gut out cryptop, since it doesn't compile with C++17.bunnei2018-01-138-300/+7
* dynarmic: Update to 83afe435MerryMage2018-01-121-0/+0
* configuration: Add cpu_core configuration optionMerryMage2018-01-128-16/+40
* arm_dynarmic: Implement coreMerryMage2018-01-1210-66/+175
* core: Include <algorithm> where used.bunnei2018-01-123-0/+6
* renderer_opengl: Fix LOG_TRACE in LoadFBToScreenInfo.bunnei2018-01-121-1/+1
* nv: Fix more broken asserts.bunnei2018-01-122-3/+3
* nvdisp_disp0: Fix broken assert.bunnei2018-01-121-1/+1
* core: Fix recent GCC build breaks.bunnei2018-01-122-2/+4
* svc: Implement GetSystemTick.bunnei2018-01-122-2/+21
* nvdisp_disp0: Call SwapBuffers to render framebuffer.bunnei2018-01-111-0/+7
* renderer_opengl: Support rendering Switch framebuffer.bunnei2018-01-113-138/+83
* render_base: Add a struct describing framebuffer metadata.bunnei2018-01-111-0/+26
* renderer_opengl: Add MortonCopyPixels function for Switch framebuffer.bunnei2018-01-111-0/+111
* renderer_opengl: Update DrawScreens for Switch.bunnei2018-01-112-23/+11
* CMakeLists: Add framebuffer_layout.cpp.bunnei2018-01-111-0/+1
* frontend: Update for undocked Switch screen layout.bunnei2018-01-118-279/+43
* NV: Move the nv device nodes to their own directory and namespace.Subv2018-01-1111-166/+430
* VI: Use a Pulse event instead of OneShot for the vblank events.Subv2018-01-111-1/+1
* vi: Use new CoreTiming::EventTypebunnei2018-01-111-1/+5
* NV: Expose the nvdisp_disp0 device and a weak reference to the nvdrv:a service.Subv2018-01-116-172/+252
* NV: Determine what buffer to draw for each layer of each display.Subv2018-01-112-13/+58
* NV: Signal all display's vsync event 60 times per second.Subv2018-01-112-1/+32
* NV: Give each display its own vsync event.Subv2018-01-112-12/+29
* NV: Keep track of Displays, Layers and BufferQueues in nvflinger.Subv2018-01-114-41/+261
* IPC: Allow passing arguments to the Interfaces when using PushIpcInterfaceSubv2018-01-111-3/+3
* NV: Implemented (with stubs) the vi:m service and some of its subservices.Subv2018-01-116-0/+726
* NV: Implemented the nvdrv:a service and the /dev/nvmap device.Subv2018-01-114-0/+354
* IPC: Corrected some definitions for the buffer C descriptor flags.Subv2018-01-113-3/+10
* svc: Stub ResetSignal and CreateTransferMemorySubv2018-01-112-3/+28
* svc: Stub SetMemoryAttributeSubv2018-01-112-0/+11
* Threads: Added enum values for the Switch's 4 cpu cores and implemented svcGetInfo(AllowedCpuIdBitmask)Subv2018-01-105-16/+28
* Services: Allow lm to log single-character messages.Subv2018-01-101-7/+3
* SVC: Fixed WaitSynchronization with multiple handles when none is immediately ready.Subv2018-01-091-7/+18
* SVC: Implemented CancelSynchronization.Subv2018-01-092-1/+19
* ErrorCodes: Updated the InvalidHandle and Timeout kernel error codes.Subv2018-01-091-2/+7
* SVC: Fixed WaitSynchronization with multiple handles when at least one of them is ready.Subv2018-01-092-3/+29
* kernel: Rename Semaphore to ConditionVariable.bunnei2018-01-0911-171/+180
* mutex: Remove unused call to VerifyGuestState.bunnei2018-01-091-3/+0
* Kernel: Actually wake up the requested number of threads in Semaphore::Release.Subv2018-01-094-21/+18
* Kernel: Properly keep track of mutex lock data in the guest memory. This fixes userland locking/unlocking.Subv2018-01-094-67/+63
* Kernel: Allow chaining WaitSynchronization calls inside a wakeup callback.Subv2018-01-094-30/+78
* cmake: Use LIBUNICORN_* on Windows.bunnei2018-01-091-2/+2
* fix macos buildMerryMage2018-01-094-7/+7
* core_timing: Use 1.020GHz for core clock rate.bunnei2018-01-091-5/+3
* CoreTiming: Reworked CoreTiming (cherry-picked from Citra #3119)B3n302018-01-0912-557/+638
* IPC: Make DuplicateSession return the Domain instead of the Session if the request was made on a Domain interface.Subv2018-01-072-2/+7
* AppletOE: Fixed command buffer structure for ReceiveMessage.Subv2018-01-071-2/+1
* IPC: Corrected some command headers in the IPC Controller interface.Subv2018-01-071-4/+2
* IPC: Corrected some command header sizes in appletOE.Subv2018-01-071-12/+21
* IPC: Take the number of domain objects as a parameter in MakeBuilder.Subv2018-01-072-4/+6
* SM: Fixed connecting to services with an 8-byte name, like appletOE.Subv2018-01-071-12/+4
* IPC: Fixed pushing ResultCodes into the command buffer.Subv2018-01-072-7/+9
* IPC: Add functions to read the input move/copy objects from an IPC request.Subv2018-01-073-2/+42
* IPC: Don't attempt to read the command buffer if it holds a Close request.Subv2018-01-071-0/+5
* IPC Cleanup: Remove 3DS-specific code and translate copy, move and domain objects in IPC requests.Subv2018-01-078-405/+118
* IPC: Skip the entire u64 of the command id when receiving an IPC request.Subv2018-01-072-15/+5
* IPC: Use the correct size when pushing raw data to the command buffer and fixed pushing domain objects.Subv2018-01-074-10/+29
* svc: Implement svcSignalProcessWideKey.bunnei2018-01-072-4/+23
* audio: Log dropping frames as trace to reduce spam.bunnei2018-01-071-1/+1
* semaphore: More changes for Switch.bunnei2018-01-072-11/+17
* wait_object: Refactor to allow waking up a single thread.bunnei2018-01-072-15/+28
* nso: Always load the filepath specified by the user.bunnei2018-01-071-1/+3
* core_timing: Increase clock speed for Switch docked.bunnei2018-01-073-3/+3
* svc: Implement svcWaitProcessWideKeyAtomic.bunnei2018-01-062-1/+54
* semaphore: Updates for Switch.bunnei2018-01-062-21/+31
* lm: Assert on unsupported multi-message.bunnei2018-01-061-0/+9
* svc: Implement WaitSynchronization for a single handle.bunnei2018-01-061-4/+24
* svc: Refactor LockMutex code to use WaitSynchronization1.bunnei2018-01-061-13/+45
* lm: Improve Log() to format a useful string.bunnei2018-01-051-10/+75
* cmake: Add script to find Unicorn.bunnei2018-01-051-0/+18
* svc: Add missing string_util include.bunnei2018-01-051-0/+1
* cmake: Don't compile Dynarmic as it's unused.bunnei2018-01-042-9/+2
* core: Increase tight_loop 100x for speed.bunnei2018-01-041-1/+1
* citra_qt: Remove VFP registers, since this isn't used anyways and caused an assert.bunnei2018-01-041-4/+0
* arm_unicorn: Load/release unicorn DLL.bunnei2018-01-041-0/+16
* cmake: Add CopyYuzuUnicornDeps script.bunnei2018-01-041-0/+9
* externals: Use unicorn DLL instead of static lib.bunnei2018-01-043-2/+7
* unicorn: Use for arm interface on Windows.bunnei2018-01-045-9/+273
* DownloadExternals: Use yuzu repo.bunnei2018-01-041-1/+1
* arm_dynarmic: More cleanup.bunnei2018-01-041-6/+0
* core: Remove unicorn_dynload.bunnei2018-01-041-2/+0
* arm_dynarmic: Gut interface until dynarmic is ready for general use.bunnei2018-01-042-142/+44
* externals: Point dynarmic at a real commit.bunnei2018-01-041-0/+0
* gitmodules: Fix to include lz4.bunnei2018-01-041-0/+3
* arm: Remove SkyEye/Dyncom code that is ARMv6-only.bunnei2018-01-0337-28101/+23
* vm_manager: Use a more reasonable MAX_ADDRESS size.bunnei2018-01-031-5/+4
* svc: Remove unnecessary "svc" prefix to naming scheme.bunnei2018-01-031-106/+106
* pctl: Remove duplicate InstallInterfaces function.bunnei2018-01-031-4/+0
* hle: Move SVC code to kernel namespace.bunnei2018-01-034-134/+121
* svc: Improve svcGetInfo.bunnei2018-01-012-35/+41
* vm_manager: Stub out a bunch of interfaces used by svcGetInfo.bunnei2018-01-012-1/+51
* svc: Fix string formatting for CreateThread.bunnei2018-01-011-1/+1
* cmake: Add missing object_address_table.bunnei2018-01-011-0/+2
* core/video_core: Fix a bunch of u64 -> u32 warnings.bunnei2018-01-018-26/+26
* svc: Stub out svcWaitSynchronization.bunnei2018-01-011-1/+9
* svc: Implement svcExitProcess.bunnei2018-01-013-11/+77
* svc: Implement svcUnlockMutex.bunnei2018-01-011-1/+11
* svc: Implement svcLockMutex.bunnei2018-01-013-24/+134
* kernel: Add ObjectAddressTable class.bunnei2018-01-013-2/+101
* thread: Keep track of the initially created handle.bunnei2017-12-313-2/+7
* svc: Implement svcExitThread.bunnei2017-12-311-1/+9
* svc: Implement svcCreateThread.bunnei2017-12-311-2/+57
* svc: Cleanup svcGetThreadPriority.bunnei2017-12-311-3/+5
* svc: Stub out svcGetCurrentProcessorNumber.bunnei2017-12-311-1/+7
* errors: Define missing kernel error codes.bunnei2017-12-311-0/+3
* svc: Implement svcSetThreadPriority.bunnei2017-12-311-1/+30
* svc: Change SignalProcessWideKey to a stub.bunnei2017-12-311-2/+2
* function_wrappers: Cleanup, fix warnings, remove unused code.bunnei2017-12-311-187/+35
* svc: Implement svcUnmapMemory.bunnei2017-12-313-1/+15
* svc: Minor cleanups.bunnei2017-12-301-8/+9
* svc: Implement svcStartThread.bunnei2017-12-301-0/+16
* thread: Main thread should set thread handle to reg 1.bunnei2017-12-301-1/+4
* thread: Remove THUMB mode flag.bunnei2017-12-301-1/+1
* thread: Main thread should be ready by default, all others dormant.bunnei2017-12-301-4/+3
* kernel: Various 64-bit fixes in memory/process/threadbunnei2017-12-295-14/+14
* applet_oe: Stub out a bunch of interfaces necessary for boot.bunnei2017-12-292-1/+159
* controller: Implement DuplicateSession.bunnei2017-12-292-9/+11
* kernel: Fix implementation of ConvertSessionToDomain.bunnei2017-12-2910-54/+90
* ap, aoc_u: Minor cleanup.bunnei2017-12-293-4/+1
* service: Add empty interface for pctl:a.bunnei2017-12-296-0/+90
* kernel: Add basic support for Domain object.bunnei2017-12-295-4/+112
* kernel: Add SyncObject primitive, use it for ClientSession.bunnei2017-12-294-10/+41
* svc: Implement MapMemory.bunnei2017-12-293-4/+17
* process: Add method to mirror a memory region.bunnei2017-12-292-0/+27
* svc: Implement SetHeapSize.bunnei2017-12-282-3/+19
* service: Clean up apm/lm/applet_oe/controller/sm ctor/dtor.bunnei2017-12-2810-20/+10
* service: Halt on ReportUnimplementedFunction and improve output log.bunnei2017-12-281-4/+2
* service: Add empty interface for aoc:u.bunnei2017-12-284-0/+44
* service: Return proper result code for IPC::CommandType::Close.bunnei2017-11-014-9/+12
* hle: Use Switch formatted result codes.bunnei2017-11-018-346/+110
* externals: Update dynarmic and xbyak.bunnei2017-10-252-0/+0
* svc: Implement GetThreadId and GetProcessId.bunnei2017-10-232-2/+37
* logging: Rename category "Core_ARM11" to "Core_ARM".bunnei2017-10-2310-89/+89
* nso: Load more common submodules.bunnei2017-10-231-15/+11
* memory: Support 32-bit paging, move heap address space up.bunnei2017-10-232-3/+3
* hle: Fix QueryMemory response for MemoryInfo.bunnei2017-10-207-149/+31
* lm: Implement lm::Initialize and Logger::log.bunnei2017-10-192-3/+67
* hle_ipc: Only copy necessary fields for outgoing command buffer.bunnei2017-10-191-1/+1
* hle_ipc: Parse out buffer X/A/B/B descriptors from incoming command buffer.bunnei2017-10-192-14/+19
* service: Add CreatePort function (that does not register/install).bunnei2017-10-192-0/+12
* memory: Print addresses as 64-bit.bunnei2017-10-191-2/+2
* ipc_helpers: Fix alignment (was wrong as a result of a dynarmic bug).bunnei2017-10-181-3/+4
* service: Print correct command ID on unimplemented function.bunnei2017-10-181-1/+1
* hle: Implement ConvertSessionToDomain, various cleanups.bunnei2017-10-1510-33/+82
* core: Refactor MakeMagic usage and remove dead code.bunnei2017-10-1511-885/+18
* hle: Add service stubs for apm and appletOE.bunnei2017-10-1510-2/+136
* hle: Initial implementation of NX service framework and IPC.bunnei2017-10-1521-859/+574
* nso: Add a log for loading submodules.bunnei2017-10-141-0/+1
* svc: Some logging cleanup.bunnei2017-10-141-7/+5
* svc: Update MemoryInfo flags for 64-bit.bunnei2017-10-141-5/+5
* svc: Initial nx impl. for QueryMemory, ConnectToPort, SendSyncRequest, etc.bunnei2017-10-141-1185/+185
* Remove more 3DS-specific code.bunnei2017-10-135-48/+3
* Remove more 3DS-specific code.bunnei2017-10-137-1414/+2
* Remove more 3DS-specific code.bunnei2017-10-133-55/+0
* Remove lots more 3DS-specific code.bunnei2017-10-1350-6976/+8
* hle: Remove a large amount of 3ds-specific service code.bunnei2017-10-10200-22393/+2
* Merge remote-tracking branch 'upstream/master' into nxbunnei2017-10-10241-2730/+20955
|\
| * Merge pull request #2996 from MerryMage/split-travisJames Rowe2017-10-1014-227/+233
| |\
| | * travis: Split build scripts for different platformsMerryMage2017-10-0714-227/+233
| * | Merge pull request #3002 from Dragios/nwm-cmdhdr-fixJames Rowe2017-10-091-1/+1
| |\ \
| | * | Change command header in nwm::UDS Initialize functionDragios2017-10-091-1/+1
| |/ /
| * | Merge pull request #2991 from Subv/getpointerSebastian Valle2017-10-083-63/+61
| |\ \ | | |/ | |/|
| | * SVC: Removed GetPointer usage in the GetResourceLimit functions.Subv2017-10-041-10/+16
| | * SVC: Remove GetPointer usage in CreatePort.Subv2017-10-042-6/+4
| | * SVC: Replace GetPointer usage with ReadCString in ConnectToPort.Subv2017-10-042-20/+9
| | * SVC: Replace GetPointer usage with ReadBlock in OutputDebugString.Subv2017-10-042-4/+6
| | * SVC: Replace GetPointer usage with Read32 in ReplyAndReceive.Subv2017-10-042-7/+6
| | * SVC: Replace GetPointer usage with Read32 in WaitSynchronizationN.Subv2017-10-042-8/+8
| | * Memory: Remove all GetPointer usages from the GDB stub.Subv2017-10-041-8/+12
| * | Merge pull request #2975 from shinyquagsire23/archive-ncch-container-and-overrideSebastian Valle2017-10-067-78/+581
| |\ \
| | * | file_sys, loader: add support for reading TMDs to determine app pathsshinyquagsire232017-10-012-5/+27
| | * | file_sys: add class for Title Metadata (TMD)shinyquagsire232017-10-013-0/+338
| | * | file_sys/ncch_container: add RomFS, ExeFS override to allow for backward compatibility with existing .romfs system archive dumpsshinyquagsire232017-10-012-69/+206
| | * | file_sys/archive_ncch: use NCCHContainer instead of loading .romfs filesshinyquagsire232017-10-011-6/+12
| * | | Merge pull request #2953 from Subv/applet_launchSebastian Valle2017-10-042-30/+47
| |\ \ \
| | * | | HLE/APT: Always set up the APT parameter when starting a library applet.Subv2017-09-262-30/+47
| * | | | Merge pull request #2985 from huwpascoe/pica_regbunnei2017-10-041-217/+222
| |\ \ \ \
| | * | | | Extracted the attribute setup and draw commands into their own functionsHuw Pascoe2017-10-041-217/+222
| |/ / / /
| * | | | Merge pull request #2977 from Subv/shmem_createbunnei2017-10-031-15/+12
| |\ \ \ \
| | * | | | Kernel/SharedMemory: Don't take over and unmap the source memory block when creating a shared memory, just reference it.Subv2017-10-021-15/+12
| | | |/ / | | |/| |
| * | | | Merge pull request #2982 from MerryMage/lazy-macos-optJames Rowe2017-10-032-4/+4
| |\ \ \ \ | | |_|_|/ | |/| | |
| | * | | macOS: Build x86_64h sliceMerryMage2017-10-022-4/+4
| |/ / /
| * | | Merge pull request #2971 from Subv/per_process_memopsSebastian Valle2017-10-014-22/+61
| |\ \ \
| | * | | Memory: Make WriteBlock take a Process parameter on which to operateSubv2017-10-012-10/+19
| | * | | Memory: Make ReadBlock take a Process parameter on which to operateSubv2017-10-012-12/+30
| | * | | Kernel/Thread: Added a helper function to get a thread's command buffer VAddr.Subv2017-10-012-0/+12
| * | | | Merge pull request #2974 from Subv/nim_eventSebastian Valle2017-10-013-2/+29
| |\ \ \ \ | | |_|/ / | |/| | |
| | * | | Services/NIM: Implement CheckForSysUpdateEvent.Subv2017-09-303-2/+29
| * | | | Merge pull request #2973 from huwpascoe/down_countSebastian Valle2017-09-309-43/+33
| |\ \ \ \ | | |/ / / | |/| | |
| | * | | Moved down_count to CoreTimingHuw Pascoe2017-09-309-43/+33
| |/ / /
| * | | Services/UDS: Handle the rest of the connection sequence. (#2963)B3n302017-09-303-19/+250
| * | | Merge pull request #2972 from Subv/ignore_.vsJames Rowe2017-09-301-0/+4
| |\ \ \
| | * | | Add the .vs folder and the CMakeSettings.json file from Visual Studio to gitignore.Subv2017-09-301-0/+4
| * | | | Merge pull request #2946 from Subv/home_menu_aptSebastian Valle2017-09-303-8/+45
| |\ \ \ \ | | |/ / / | |/| | |
| | * | | HLE/APT: Always return an error from PrepareToStartNewestHomeMenu so that the Home Menu doesn't try to reboot the system.Subv2017-09-243-2/+26
| | * | | HLE/APT: Prepare the APT Wakeup parameter when the game calls InitializeSubv2017-09-241-6/+19
| | | |/ | | |/|
| * | | Merge pull request #2967 from Subv/thread_wakeup_callbacksSebastian Valle2017-09-304-17/+91
| |\ \ \ | | |_|/ | |/| |
| | * | Kernel/Threads: When putting a thread to wait, specify a function to execute when it is awoken.Subv2017-09-284-17/+91
| * | | Merge pull request #2962 from huwpascoe/static_castSebastian Valle2017-09-3032-91/+97
| |\ \ \
| | * | | Fixed type conversion ambiguityHuw Pascoe2017-09-3032-91/+97
| |/ / /
| * | | Merge pull request #2961 from Subv/load_titlesbunnei2017-09-2917-70/+157
| |\ \ \ | | |/ / | |/| |
| | * | Loaders: Don't automatically set the current process every time we load an application.Subv2017-09-278-37/+40
| | * | Kernel/Thread: Allow specifying which process a thread belongs to when creating it.Subv2017-09-274-17/+22
| | * | Tests: Added Memory::IsValidVirtualAddress tests.Subv2017-09-272-0/+57
| | * | Tests: Fixed ARM VFP testsSubv2017-09-271-9/+13
| | * | Memory: Allow IsValidVirtualAddress to be called with a specific process parameter.Subv2017-09-272-7/+25
| * | | Merge pull request #2907 from Subv/warnings3Sebastian Valle2017-09-272-5/+9
| |\ \ \
| | * | | Disable unary operator- on Math::Vec2/Vec3/Vec4 for unsigned types.Subv2017-09-272-5/+9
| * | | | Merge pull request #2954 from Subv/cache_unmapped_memJames Rowe2017-09-271-1/+16
| |\ \ \ \ | | |_|/ / | |/| | |
| | * | | Memory/RasterizerCache: Ignore unmapped memory regions when caching physical regions.Subv2017-09-261-1/+16
| | | |/ | | |/|
| * | | Merge pull request #2958 from Subv/audio_buffer_datatypeMerry2017-09-265-7/+9
| |\ \ \
| | * | | Audio: Use std::deque instead of std::vector for the audio buffer type (StereoBuffer16).Subv2017-09-265-7/+9
| | | |/ | | |/|
| * | | Merge pull request #2947 from Subv/selfncch_factorySebastian Valle2017-09-266-18/+65
| |\ \ \ | | |/ / | |/| |
| | * | HLE/Archives: Allow multiple loaded applications to access their SelfNCCH archive independently.Subv2017-09-256-18/+65
| |/ /
| * | Merge pull request #2952 from MerryMage/page-tablesB3n302017-09-2512-27/+56
| |\ \
| | * | ARM_Interface: Implement PageTableChangedMerryMage2017-09-256-6/+39
| | * | memory: Remove GetCurrentPageTablePointersMerryMage2017-09-242-10/+0
| | * | memory: Add GetCurrentPageTable/SetCurrentPageTableMerryMage2017-09-247-13/+19
| * | | Merge pull request #2951 from huwpascoe/perf-4B3n302017-09-251-10/+4
| |\ \ \
| | * | | Optimized MortonHuw Pascoe2017-09-241-10/+4
| | |/ /
| * | | Merge pull request #2949 from wwylele/fix-trB3n302017-09-253-21/+22
| |\ \ \
| | * | | citra-qt: fix some untranslated stringswwylele2017-09-243-21/+22
| | |/ /
| * | | Merge pull request #2948 from Subv/register_serviceB3n302017-09-254-1/+33
| |\ \ \
| | * | | HLE/SRV: Implemented RegisterService.Subv2017-09-244-1/+33
| | | |/ | | |/|
| * | | Loader/NCCH: Add support for loading application updates (#2927)Max Thomas2017-09-258-439/+670
| * | | Services/UDS: Added a function to send EAPoL-Start packets (#2920)B3n302017-09-255-88/+250
| * | | Merge pull request #2944 from huwpascoe/perf-3Weiyi Wang2017-09-251-11/+7
| |\ \ \ | | |_|/ | |/| |
| | * | Optimized Float<M,E> multiplicationHuw Pascoe2017-09-251-11/+7
| |/ /
| * | Merge pull request #2921 from jroweboy/batch-fix-2James Rowe2017-09-241-12/+17
| |\ \ | | |/ | |/|
| | * Remove pipeline.gpu_mode and fix minor issuesJames Rowe2017-09-231-12/+2
| | * GPU: Add draw for immediate and batch modesJames Rowe2017-09-111-2/+17
| * | Merge pull request #2928 from huwpascoe/masterYuri Kunde Schlesner2017-09-221-7/+18
| |\ \
| | * | Fixed framebuffer warningHuw Pascoe2017-09-171-7/+18
| * | | Merge pull request #2933 from huwpascoe/perf-1bunnei2017-09-191-1/+2
| |\ \ \
| | * | | Improved performance of FromAttributeBufferHuw Pascoe2017-09-171-1/+2
| | |/ /
| * | | Merge pull request #2936 from B3n30/system_curl_linuxWeiyi Wang2017-09-191-1/+1
| |\ \ \
| | * | | WebService: Set USE_SYSTEM_CURL for travis linux buildsB3n302017-09-191-1/+1
| |/ / /
| * / / WebService: Verify username and token (#2930)B3n302017-09-1918-38/+322
| |/ /
| * | Merge pull request #2906 from Subv/ns_new_frameworkYuri Kunde Schlesner2017-09-167-42/+77
| |\ \
| | * | Services/NS: Port ns:s to the new service framework.Subv2017-09-167-42/+77
| * | | Merge pull request #2900 from wwylele/clip-2Yuri Kunde Schlesner2017-09-165-46/+116
| |\ \ \
| | * | | SwRasterizer/Clipper: flip the sign convention to match PICA and OpenGLwwylele2017-08-251-9/+9
| | * | | gl_rasterizer: implement custom clip planewwylele2017-08-253-34/+83
| | * | | SwRasterizer: implement custom clip planewwylele2017-08-242-4/+25
| * | | | Merge pull request #2842 from Subv/switchable_page_tableB3n302017-09-1514-123/+191
| |\ \ \ \
| | * | | | CPU/Dynarmic: Disable the fast page-table access in dynarmic until it supports switching page tables at runtime.Subv2017-09-151-1/+3
| | * | | | Tests/VFP: Use a standalone pagetable for the TestEnvironment memory operations.Subv2017-09-151-4/+14
| | * | | | Kernel/Memory: Make IsValidPhysicalAddress not go through the current process' virtual memory mapping.Subv2017-09-151-2/+1
| | * | | | Kernel/Threads: Don't clear the CPU instruction cache when performing a context switch from an idle thread into a thread in the same process.Subv2017-09-151-1/+3
| | * | | | Kernel/Memory: Changed GetPhysicalPointer so that it doesn't go through the current process' page table to obtain a pointer.Subv2017-09-154-30/+69
| | * | | | Kernel/Memory: Switch the current page table when a new process is scheduled.Subv2017-09-101-0/+10
| | * | | | Kernel/Memory: Give each Process its own page table.Subv2017-09-109-87/+93
| * | | | | Merge pull request #2915 from wwylele/font-archive-2bunnei2017-09-123-135/+155
| |\ \ \ \ \
| | * | | | | APT: load different shared font depending on the regionwwylele2017-09-033-135/+155
| * | | | | | Merge pull request #2922 from jroweboy/mingw-telemetrybunnei2017-09-114-27/+49
| |\ \ \ \ \ \
| | * | | | | | Build: Enable SSL in mingw by linking against WinSSLJames Rowe2017-09-114-27/+49
| | | |_|_|_|/ | | |/| | | |
| * | | | | | Merge pull request #2923 from B3n30/system_curl_osxJames Rowe2017-09-101-1/+1
| |\ \ \ \ \ \ | | |/ / / / / | |/| | | | |
| | * | | | | trvis_OSX: build with system curlB3n302017-09-091-1/+1
| |/ / / / /
| * | | | | Merge pull request #2865 from wwylele/gs++bunnei2017-09-0815-37/+594
| |\ \ \ \ \
| | * | | | | pica/command_processor: build geometry pipeline and run geometry shaderwwylele2017-08-196-28/+383
| | * | | | | pica/shader/jit: implement SETEMIT and EMITwwylele2017-08-192-2/+49
| | * | | | | pica/primitive_assembly: Handle winding for GS primitivewwylele2017-08-192-3/+19
| | * | | | | correct constnesswwylele2017-08-192-2/+4
| | * | | | | pica/shader/interpreter: implement SETEMIT and EMITwwylele2017-08-191-0/+16
| | * | | | | pica/shader: extend UnitState for GSwwylele2017-08-192-0/+84
| | * | | | | pica/regs: layout geometry shader configuration regswwylele2017-08-102-2/+39
| * | | | | | Merge pull request #2918 from jroweboy/remove-debugJames Rowe2017-09-061-0/+6
| |\ \ \ \ \ \
| | * | | | | | Remove excess debug dlls for mingw buildJames Rowe2017-09-061-0/+6
| |/ / / / / /
| * | | | | | Merge pull request #2914 from wwylele/fresnel-fixbunnei2017-09-052-7/+9
| |\ \ \ \ \ \
| | * | | | | | pica/lighting: only apply Fresnel factor for the last lightwwylele2017-09-032-7/+9
| * | | | | | | Merge pull request #2831 from Subv/uds_authWeiyi Wang2017-09-057-53/+289
| |\ \ \ \ \ \ \
| | * | | | | | | Services/UDS: Remove an old duplicated declaration of WifiPacket.Subv2017-08-272-22/+0
| | * | | | | | | Services/UDS: Handle the connection sequence packets.Subv2017-08-271-17/+83
| | * | | | | | | Services/UDS: Store the received beacon frames until RecvBeaconBroadcastData is called, up to 15 beacons at the same time, removing any older beacon frames when the limit is exceeded.Subv2017-08-271-3/+62
| | * | | | | | | Services/UDS: Add functions to generate 802.11 auth and assoc response frames.Subv2017-08-275-11/+144
| * | | | | | | | Merge pull request #2876 from mailwl/mii-struWeiyi Wang2017-09-052-34/+29
| |\ \ \ \ \ \ \ \
| | * | | | | | | | Remove _flag in var namesmailwl2017-09-041-6/+6
| | * | | | | | | | Mii Selector Applet: update Mii structuresmailwl2017-09-042-34/+29
| |/ / / / / / / /
| * | | | | | | | Merge pull request #2917 from jroweboy/icon_fixWeiyi Wang2017-09-041-1/+3
| |\ \ \ \ \ \ \ \
| | * | | | | | | | Fix icon for citra qtJames Rowe2017-09-031-1/+3
| |/ / / / / / / /
| * | | | | | | | Merge pull request #2911 from DaMan69/masterJames Rowe2017-09-034-2/+42
| |\ \ \ \ \ \ \ \
| | * | | | | | | | Add manifestDaMan2017-09-034-2/+42
| | | |_|_|/ / / / | | |/| | | | | |
| * | | | | | | | Merge pull request #2912 from jroweboy/mingw-masterJames Rowe2017-09-021-40/+123
| |\ \ \ \ \ \ \ \ | | |/ / / / / / / | |/| | | | | | |
| | * | | | | | | Build: Add mingw64 compile support to appveyorJames Rowe2017-09-011-40/+123
| * | | | | | | | Merge pull request #2909 from wwylele/telemetry-gasbunnei2017-08-311-0/+6
| |\ \ \ \ \ \ \ \
| | * | | | | | | | video_core: report telemetry for gas modewwylele2017-08-311-0/+6
| | | |_|/ / / / / | | |/| | | | | |
| * | | | | | | | Merge pull request #2858 from MerryMage/interp-on-a-frame-basisbunnei2017-08-313-88/+74
| |\ \ \ \ \ \ \ \ | | |/ / / / / / / | |/| | | | | | |
| | * | | | | | | interpolate: Interpolate on a frame-by-frame basisMerryMage2017-08-283-88/+74
| * | | | | | | | Merge pull request #2891 from wwylele/sw-bumpbunnei2017-08-314-10/+40
| |\ \ \ \ \ \ \ \ | | |_|/ / / / / / | |/| | | | | | |
| | * | | | | | | gl_rasterizer/lighting: more accurate CP formulawwylele2017-08-221-2/+2
| | * | | | | | | SwRasterizer/Lighting: implement LUT input CPwwylele2017-08-221-0/+11
| | * | | | | | | SwRasterizer/Lighting: implement bump mappingwwylele2017-08-223-8/+27
| * | | | | | | | Merge pull request #2899 from wwylele/touch-refactorbunnei2017-08-298-43/+87
| |\ \ \ \ \ \ \ \
| | * | | | | | | | EmuWindow: refactor touch input into a TouchDevicewwylele2017-08-245-39/+72
| | * | | | | | | | HID: use TouchDevice for touch padwwylele2017-08-243-4/+15
| | | |_|_|_|_|/ / | | |/| | | | | |
| * | | | | | | | Merge pull request #2905 from danzel/fix-2902Sebastian Valle2017-08-294-5/+5
| |\ \ \ \ \ \ \ \ | | |_|_|_|_|_|_|/ | |/| | | | | | |
| | * | | | | | | Use recursive_mutex instead of mutex to fix #2902danzel2017-08-294-5/+5
| | |/ / / / / /
| * | | | | | | Merge pull request #2901 from stone3311/masterWeiyi Wang2017-08-281-1/+1
| |\ \ \ \ \ \ \
| | * | | | | | | Fix info about TODO liststone33112017-08-261-1/+1
| * | | | | | | | Merge pull request #2892 from Subv/warnings2Weiyi Wang2017-08-283-6/+10
| |\ \ \ \ \ \ \ \
| | * | | | | | | | Warnings: Fixed a few missing-return warnings in video_core.Subv2017-08-263-6/+10
| | | |_|/ / / / / | | |/| | | | | |
| * | | | | | | | Merge pull request #2897 from bunnei/telemetry-uibunnei2017-08-2720-48/+446
| |\ \ \ \ \ \ \ \ | | |_|/ / / / / / | |/| | | | | | |
| | * | | | | | | web_backend: Fix CPR bug where Winsock is not properly initializing.bunnei2017-08-271-15/+27
| | * | | | | | | web_backend: Fix asynchronous JSON post by spawning new thread.bunnei2017-08-261-9/+18
| | * | | | | | | web_services: Refactor to remove dependency on Core.bunnei2017-08-265-20/+35
| | * | | | | | | qt: Add an option to view/regenerate telemetry ID.bunnei2017-08-264-7/+40
| | * | | | | | | default_ini: Use correct telemetry endpoint URL.bunnei2017-08-261-1/+1
| | * | | | | | | # This is a combination of 2 commits.bunnei2017-08-261-3/+30
| | * | | | | | | qt: Add web configuration tab.bunnei2017-08-266-2/+217
| | * | | | | | | web_backend: User config for username and token, support anonymous post.bunnei2017-08-262-40/+17
| | * | | | | | | telemetry: Log frontend type.bunnei2017-08-262-0/+4
| | * | | | | | | settings: Add enable_telemetry, citra_username, and citra_token.bunnei2017-08-264-0/+20
| | * | | | | | | telemetry_session: Log telemetry ID.bunnei2017-08-261-0/+36
| | * | | | | | | citra_qt: Show one-time callout messages to user.bunnei2017-08-264-0/+50
| |/ / / / / / /
| * | / / / / / SidebySide Layout (#2859)ThaMighty902017-08-256-7/+61
| | |/ / / / / | |/| | | | |
| * | | | | | Merge pull request #2839 from Subv/global_kernel_lockJames Rowe2017-08-246-4/+46
| |\ \ \ \ \ \
| | * | | | | | Kernel/Memory: Acquire the global HLE lock when a memory read/write operation falls outside of the fast path, for it might perform an MMIO operation.Subv2017-08-221-1/+8
| | * | | | | | Kernel/HLE: Use a mutex to synchronize access to the HLE kernel state between the cpu thread and any other possible threads that might touch the kernel (network thread, etc).Subv2017-08-225-3/+38
| * | | | | | | Merge pull request #2893 from Subv/not_schedule_main_threadbunnei2017-08-221-5/+1
| |\ \ \ \ \ \ \
| | * | | | | | | Kernel/Threads: Don't immediately switch to the new main thread when loading a new process.Subv2017-08-221-5/+1
| | | |/ / / / / | | |/| | | | |
| * | | | | | | Merge pull request #2888 from Subv/warningsJames Rowe2017-08-2211-17/+22
| |\ \ \ \ \ \ \
| | * | | | | | | GPU/Warnings: Explicitly cast the screen refresh ticks to u64.Subv2017-08-211-1/+1
| | * | | | | | | Warnings: Add UNREACHABLE macros to switches that contemplate all possible values.Subv2017-08-213-2/+7
| | * | | | | | | HLE/Applets: Fixed some conversion warnings when creating the framebuffer shared memory objects.Subv2017-08-214-8/+8
| | * | | | | | | CPU/Dynarmic: Fixed a warning when incrementing the number of ticks in ExecuteInstructions.Subv2017-08-211-1/+1
| | * | | | | | | Dyncom: Use size_t instead of int to store the instruction offsets in the instruction cache.Subv2017-08-212-4/+4
| | * | | | | | | Dyncom: Fixed a conversion warning when decoding thumb instructions.Subv2017-08-211-1/+1
| | |/ / / / / /
| * | | | | | | Merge pull request #2894 from wwylele/motion-emu-fixbunnei2017-08-221-1/+4
| |\ \ \ \ \ \ \
| | * | | | | | | motion_emu: fix initialization orderwwylele2017-08-221-1/+4
| |/ / / / / / /
| * | | | | | | Merge pull request #2884 from wwylele/clipbunnei2017-08-216-10/+28
| |\ \ \ \ \ \ \
| | * | | | | | | swrasterizer: remove invalid TODOwwylele2017-08-211-4/+2
| | * | | | | | | swrasterizer/clipper: remove tested TODOwwylele2017-08-211-4/+0
| | * | | | | | | gl_shader_gen: simplify and clarify the depth transformation between vertex shader and fragment shaderwwylele2017-08-211-2/+5
| | * | | | | | | gl_rasterizer: add clipping plane z<=0 defined in PICAwwylele2017-08-214-0/+21
| | |/ / / / / /
| * | | | | | | Merge pull request #2889 from Schplee/updated-logo-svgbunnei2017-08-214-79/+1
| |\ \ \ \ \ \ \ | | |/ / / / / / | |/| | | | | |
| | * | | | | | Updated master logo to new logo svgSchplee2017-08-204-79/+1
| | | |_|_|_|/ | | |/| | | |
| * | | | | | Merge pull request #2872 from wwylele/sw-geo-factorYuri Kunde Schlesner2017-08-211-4/+16
| |\ \ \ \ \ \
| | * | | | | | SwRasterizer/Lighting: implement geometric factorwwylele2017-08-111-4/+16
| * | | | | | | Merge branch 'update-soundtouch' (PR #2885)Yuri Kunde Schlesner2017-08-211-0/+0
| |\ \ \ \ \ \ \
| | * | | | | | | externals: Update soundtouchMerryMage2017-08-211-0/+0
| * | | | | | | | Merge pull request #2861 from wwylele/motion-refactorJames Rowe2017-08-2020-277/+302
| |\ \ \ \ \ \ \ \
| | * | | | | | | | HID: fix a comment and a warningwwylele2017-08-201-2/+2
| | * | | | | | | | motion_emu: no need to include thread in headerwwylele2017-08-192-2/+7
| | * | | | | | | | move MotionEmu from core/frontend to input_common as a InputDevicewwylele2017-08-1117-244/+221
| | * | | | | | | | HID: use MotionDevice for Accelerometer and Gyroscopewwylele2017-08-113-5/+48
| * | | | | | | | | Merge pull request #2871 from wwylele/sw-spotlightJames Rowe2017-08-201-3/+19
| |\ \ \ \ \ \ \ \ \ | | |_|_|_|/ / / / / | |/| | | | | | | |
| | * | | | | | | | SwRasterizer/Lighting: implement spot lightwwylele2017-08-111-3/+19
| | | |_|/ / / / / | | |/| | | | | |
| * | | | | | | | Added missing parts in libnetwork (#2838)B3n302017-08-199-37/+310
| | |_|/ / / / / | |/| | | | | |
| * | | | | | | Merge pull request #2881 from MerryMage/dsp-firm-checkYuri Kunde Schlesner2017-08-161-3/+4
| |\ \ \ \ \ \ \
| | * | | | | | | dsp_dsp: Remove size assertion in LoadComponentMerryMage2017-08-151-3/+4
| * | | | | | | | Merge pull request #2879 from danzel/patch-1bunnei2017-08-141-1/+1
| |\ \ \ \ \ \ \ \
| | * | | | | | | | Fix Spelling/English mistakesDave Leaver2017-08-131-1/+1
| |/ / / / / / / /
| * | | | | | | | Merge pull request #2843 from Subv/applet_slotsSebastian Valle2017-08-122-35/+200
| |\ \ \ \ \ \ \ \
| | * | | | | | | | Services/APT: Use the AppletAttributes union directly when dealing with applet attrs.Subv2017-08-071-19/+15
| | * | | | | | | | Services/APT: Use an array to hold data about the 4 possible concurrent applet types (Application, Library, HomeMenu, System).Subv2017-08-072-35/+204
| | |/ / / / / / /
| * | | | | | | | Merge pull request #2875 from wwylele/bump-skipWeiyi Wang2017-08-121-4/+5
| |\ \ \ \ \ \ \ \
| | * | | | | | | | gl_shader_gen: don't call SampleTexture when bump map is not usedwwylele2017-08-111-4/+5
| | | |_|/ / / / / | | |/| | | | | |
| * | | | | | | | Merge pull request #2869 from j-selby/docker-buildJames Rowe2017-08-114-50/+26
| |\ \ \ \ \ \ \ \
| | * | | | | | | | Travis: Use Docker to build for LinuxJames2017-08-104-50/+26
| * | | | | | | | | Merge pull request #2867 from j-selby/tag-namingJames Rowe2017-08-112-8/+23
| |\ \ \ \ \ \ \ \ \ | | |_|/ / / / / / / | |/| | | | | | | |
| | * | | | | | | | Implement correct folder structure for CI buildsj-selby2017-08-102-8/+23
| * | | | | | | | | Merge pull request #2874 from danzel/spelling-1Weiyi Wang2017-08-112-4/+4
| |\ \ \ \ \ \ \ \ \ | | |_|_|_|/ / / / / | |/| | | | | | | |
| | * | | | | | | | Fix some spelling mistakesdanzel2017-08-112-4/+4
| | |/ / / / / / /
| * | | | | | | | Merge pull request #2863 from wwylele/pad-state-zeroWeiyi Wang2017-08-102-2/+2
| |\ \ \ \ \ \ \ \ | | |_|/ / / / / / | |/| | | | | | |
| | * | | | | | | HID: zero unused PadState bitswwylele2017-08-102-2/+2
| | | |/ / / / / | | |/| | | | |
| * | | | | | | Merge pull request #2868 from wwylele/swr-tupleWeiyi Wang2017-08-101-1/+1
| |\ \ \ \ \ \ \ | | |_|/ / / / / | |/| | | | | |
| | * | | | | | SwRasterizer/Lighting: use make_tuple instead of constructorwwylele2017-08-101-1/+1
| |/ / / / / /
| * | | | | | Merge pull request #2857 from j-selby/deploy-fixJames Rowe2017-08-103-126/+116
| |\ \ \ \ \ \ | | |_|_|_|_|/ | |/| | | | |
| | * | | | | Travis/AppVeyor: Deploy based upon tagsj-selby2017-08-063-126/+116
| | | |_|/ / | | |/| | |
| * | | | | Merge pull request #2862 from j-selby/update-cryptoppbunnei2017-08-092-1/+1
| |\ \ \ \ \
| | * | | | | Update cryptoppJames2017-08-082-1/+1
| | | |/ / / | | |/| | |
| * | | | | Merge pull request #2822 from wwylele/sw_lighting-2Weiyi Wang2017-08-098-9/+315
| |\ \ \ \ \
| | * | | | | SwRasterizer/Lighting: shorten file namewwylele2017-08-034-4/+4
| | * | | | | SwRasterizer/Lighting: move to its own filewwylele2017-08-024-240/+271
| | * | | | | SwRasterizer/Lighting: reduce confusionwwylele2017-08-021-1/+1
| | * | | | | SwRasterizer/Lighting: move quaternion normalization to the callerwwylele2017-08-021-3/+3
| | * | | | | SwRasterizer/Lighting: dist atten lut input need to be clampwwylele2017-07-111-1/+1
| | * | | | | SwRasterizer/Lighting: unify float suffixwwylele2017-07-111-11/+13
| | * | | | | SwRasterizer/Lighting: get rid of nested returnwwylele2017-07-111-10/+11
| | * | | | | SwRasterizer/Lighting: refactor GetLutValue into a function.wwylele2017-07-111-83/+27
| | * | | | | SwRasterizer: only interpolate quat and view when lighting is enabledwwylele2017-07-111-14/+14
| | * | | | | vector_math: remove dead template parameterwwylele2017-07-111-1/+1
| | * | | | | SwRasterizer/Lighting: pass lighting state as parameterwwylele2017-07-111-13/+13
| | * | | | | vector_math: remove broken SFINAE stuffwwylele2017-07-111-3/+2
| | * | | | | SwRasterizer/Lighting: Move the clamp highlight calculation to the end of the per-light loop body.Subv2017-07-111-17/+17
| | * | | | | SwRasterizer/Lighting: Move the lighting enable check outside the ComputeFragmentsColors function.Subv2017-07-111-7/+6
| | * | | | | SwRasterizer/Lighting: Do not use global registers state in ComputeFragmentsColors.Subv2017-07-111-3/+3
| | * | | | | SwRasterizer/Lighting: Do not use global state in LookupLightingLut.Subv2017-07-112-13/+22
| | * | | | | SwRasterizer/Lighting: Fixed a bug where the distance attenuation bias was being set to the dist atten scale.Subv2017-07-111-3/+2
| | * | | | | SwRasterizer: Fixed a few conversion warnings and moved per-light values into the per-light loop.Subv2017-07-111-5/+6
| | * | | | | SwRasterizer: Run clang-formatSubv2017-07-111-45/+83
| | * | | | | SwRasterizer: Flip the vertex quaternions before clipping (if necessary).Subv2017-07-113-21/+16
| | * | | | | SwRasterizer: Corrected the light LUT lookups.Subv2017-07-111-6/+7
| | * | | | | SwRasterizer: Corrected the light LUT lookups.Subv2017-07-112-33/+48
| | * | | | | SwRasterizer: Fixed the lighting lut lookup function.Subv2017-07-111-2/+4
| | * | | | | SwRasterizer: Calculate fresnel for fragment lighting.Subv2017-07-111-1/+25
| | * | | | | SwRasterizer: Calculate specular_1 for fragment lighting.Subv2017-07-111-3/+59
| | * | | | | SwRasterizer: Calculate specular_0 for fragment lighting.Subv2017-07-111-13/+94
| | * | | | | SwRasterizer: Implement primary fragment color.Subv2017-07-111-4/+113
| * | | | | | Merge pull request #2856 from wwylele/shader-shareWeiyi Wang2017-08-092-26/+45
| |\ \ \ \ \ \
| | * | | | | | pica: upload shared shader code to both unitwwylele2017-08-072-26/+45
| * | | | | | | Merge pull request #2864 from mailwl/dlp-updatebunnei2017-08-093-4/+44
| |\ \ \ \ \ \ \ | | |_|_|/ / / / | |/| | | | | |
| | * | | | | | Service/dlp: Update function tables according 3dbrewmailwl2017-08-093-4/+44
| |/ / / / / /
| * | | | | | Merge pull request #2860 from anodium/patch-1James Rowe2017-08-051-1/+1
| |\ \ \ \ \ \
| | * | | | | | Quickfix typo in OpenGL 3.3 error messageAndrea Pascal2017-08-051-1/+1
| |/ / / / / /
| * | | | | | Merge pull request #2855 from bunnei/telemetry-additional-fieldsJames Rowe2017-08-049-17/+68
| |\ \ \ \ \ \ | | |_|_|/ / / | |/| | | | |
| | * | | | | telemetry: Add field for OsPlatform.bunnei2017-08-041-0/+9
| | * | | | | telemetry: Add field for BuildName.bunnei2017-08-041-0/+1
| | * | | | | telemetry: Add field for RequiresSharedFont.bunnei2017-08-041-0/+4
| | * | | | | telemetry_session: Log BuildDate and ProgramName fields.bunnei2017-08-041-0/+7
| | * | | | | common: Add build timestamp to scm_rev.bunnei2017-08-043-1/+11
| | * | | | | core: Expose AppLoader as a public interface.bunnei2017-08-041-4/+5
| | * | | | | loader: Expose program title.bunnei2017-08-043-12/+31
| |/ / / / /
| * | | | | Merge pull request #2850 from j-selby/fix_invalid_pathsYuri Kunde Schlesner2017-08-012-4/+78
| |\ \ \ \ \ | | |/ / / / | |/| | | |
| | * | | | Handle invalid filenames when renaming files/directoriesJames2017-07-312-4/+78
| |/ / / /
| * | | | Merge pull request #2848 from wwylele/shader-loop-fixWeiyi Wang2017-07-291-1/+1
| |\ \ \ \
| | * | | | pica/shader_interpreter: fix off-by-one in LOOPwwylele2017-07-271-1/+1
| * | | | | Merge pull request #2849 from j-selby/masterJames Rowe2017-07-294-4/+21
| |\ \ \ \ \
| | * | | | | Produce 7zip artifacts on Travis and Appveyorj-selby2017-07-284-4/+21
| |/ / / / /
| * | | | | Merge pull request #2679 from MerryMage/interp-testsbunnei2017-07-276-1/+13717
| |\ \ \ \ \
| | * | | | | tests: Add tests for vaddMerryMage2017-07-236-3/+13511
| | * | | | | tests: Arm testing frameworkMerryMage2017-07-233-0/+208
| | |/ / / /
| * | | | | Merge pull request #2840 from Subv/apt_parameterbunnei2017-07-272-33/+105
| |\ \ \ \ \
| | * | | | | Service/APT: Log Send/Cancel/Receive/GlanceParameter calls even if they return an error.Subv2017-07-211-7/+9
| | * | | | | Services/APT: Return the proper error code when calling SendParameter with an outstanding parameter already in memory.Subv2017-07-212-4/+17
| | * | | | | Services/APT: Reset the APT parameter inside CancelParameter if the conditions are met.Subv2017-07-211-6/+23
| | * | | | | Services/APT: Properly clear the apt parameter after a successful ReceiveParameter call.Subv2017-07-211-2/+8
| | * | | | | Services/APT: Use the right error codes in ReceiveParameter and GlanceParameter when the parameter doesn't exist.Subv2017-07-211-0/+28
| | * | | | | Services/APT: Use boost::optional for the APT parameter structure.Subv2017-07-211-20/+26
| | | |_|/ / | | |/| | |
| * | | | | Merge pull request #2837 from wwylele/shader-debugger-fixbunnei2017-07-261-23/+18
| |\ \ \ \ \
| | * | | | | debugger/shader: display LOOPwwylele2017-07-201-1/+3
| | * | | | | debugger/shader: print the invert flag for JMPUwwylele2017-07-201-0/+4
| | * | | | | debugger/shader: fix address register for reverted arithmetic opwwylele2017-07-201-20/+9
| | * | | | | debugger/shader: fix inverted uniform flow controlwwylele2017-07-201-2/+2
| * | | | | | Merge pull request #2847 from B3n30/network_linux_fixbunnei2017-07-262-3/+4
| |\ \ \ \ \ \
| | * | | | | | Network: Moved NintendoOUI initalization to RoomMember constructorB3n302017-07-262-3/+4
| |/ / / / / /
* | | | | | | loader: Various improvements for NSO/NRO loaders.bunnei2017-10-108-58/+40
* | | | | | | loader: Add support for NRO, as well as various fixes and shared linker.bunnei2017-10-069-146/+434
* | | | | | | nso: Fixes to support homebrew NSOs without a MOD header.bunnei2017-10-042-17/+23
* | | | | | | arm_interface: Set TLS address for dynarmic core.bunnei2017-09-305-0/+32
* | | | | | | nso: Refactor and allocate .bss section.bunnei2017-09-309-132/+162
* | | | | | | process: Support loading multiple codesets.bunnei2017-09-302-20/+27
* | | | | | | loader: Add support for loading an NSO.bunnei2017-09-305-0/+342
* | | | | | | externals: Add lz4.bunnei2017-09-303-1/+6
* | | | | | | memory: Log with 64-bit values.bunnei2017-09-301-8/+8
* | | | | | | kernel: Various threading fixes to support 64-bit addressing.bunnei2017-09-302-8/+8
* | | | | | | core: Various changes to support 64-bit addressing.bunnei2017-09-305-54/+54
* | | | | | | arm: Use 64-bit addressing in a bunch of places.bunnei2017-09-309-80/+113
* | | | | | | elf: Check if machine is ARM.bunnei2017-09-301-2/+9
|/ / / / / /
* | | | | | Merge pull request #2844 from jroweboy/nightlyfixWeiyi Wang2017-07-241-1/+1
|\ \ \ \ \ \ | |_|_|/ / / |/| | | | |
| * | | | | Use WinSSPI instead of OpenSSLJames Rowe2017-07-241-1/+1
|/ / / / /
* | | | | Merge pull request #2816 from wwylele/proctex-lutlutlutSebastian Valle2017-07-235-70/+80
|\ \ \ \ \
| * | | | | gl_rasterizer: use texture buffer for proctex LUTwwylele2017-07-015-70/+80
* | | | | | Merge pull request #2834 from wwylele/depth-enable-fixSebastian Valle2017-07-231-4/+5
|\ \ \ \ \ \
| * | | | | | gl_rasterizer_cache: depth write is disabled if allow_depth_stencil_write is falsewwylele2017-06-101-4/+5
* | | | | | | Merge pull request #2799 from yuriks/virtual-cached-range-flushWeiyi Wang2017-07-226-68/+113
|\ \ \ \ \ \ \ | |_|_|_|/ / / |/| | | | | |
| * | | | | | Memory: Add function to flush a virtual range from the rasterizer cacheYuri Kunde Schlesner2017-06-224-47/+72
| * | | | | | Memory: Add TryVirtualToPhysicalAddress, returning a boost::optionalYuri Kunde Schlesner2017-06-222-7/+23
| * | | | | | Memory: Make PhysicalToVirtualAddress return a boost::optionalYuri Kunde Schlesner2017-06-224-14/+18
* | | | | | | Merge pull request #2833 from j-selby/single-header-jsonbunnei2017-07-185-4/+14524
|\ \ \ \ \ \ \
| * | | | | | | Add description of upstream repoJames2017-07-181-0/+7
| * | | | | | | Don't pull in entire JSON repo for single header fileJames2017-07-184-4/+14517
| | |_|_|/ / / | |/| | | | |
* | | | | | | Merge pull request #2823 from bunnei/telemetry-databunnei2017-07-185-18/+96
|\ \ \ \ \ \ \ | |/ / / / / / |/| | | | | |
| * | | | | | telemetry: Log performance, configuration, and system data.bunnei2017-07-185-18/+96
|/ / / / / /
* | | | | | Merge pull request #2804 from Kloen/themingbunnei2017-07-1849-2/+1387
|\ \ \ \ \ \
| * | | | | | citra-qt: Add option to configure the UI themeKloen2017-06-242-0/+37
| * | | | | | citra-qt: load ui theme at startup and config change.Kloen2017-06-242-0/+22
| * | | | | | citra-qt: Add Dark theme from https://github.com/ColinDuquesnoy/QDarkStyleSheetKloen2017-06-2443-2/+1319
| * | | | | | citra-qt: add new uisetting->themeKloen2017-06-242-0/+9
* | | | | | | Merge pull request #2818 from B3n30/networkWeiyi Wang2017-07-179-21/+1206
|\ \ \ \ \ \ \
| * | | | | | | Network: Changed timeout for receiving packets to 100msB3n302017-07-165-43/+50
| * | | | | | | Network: Propagate Room closing to connected membersB3n302017-07-163-3/+28
| * | | | | | | Network: Made send async in RoomMemberB3n302017-07-164-25/+70
| * | | | | | | Network: Send the game titleB3n302017-07-166-114/+185
| * | | | | | | Network: Enable sending and receiving chat messagesB3n302017-07-163-0/+79
| * | | | | | | Network: Handle the disconnect of a clientB3n302017-07-161-1/+18
| * | | | | | | Network: Enable to send WifiPacketsB3n302017-07-163-1/+82
| * | | | | | | Network: Init Network in SDL and QTB3n302017-07-162-1/+5
| * | | | | | | Network: Send JoinRequest and handle the answer in RoomMemberB3n302017-07-162-2/+125
| * | | | | | | Network: Handle join request in RoomB3n302017-07-162-1/+205
| * | | | | | | Network: Added Packet class for serializationB3n302017-07-163-0/+423
| * | | | | | | Network: Threads for Room and RoomMemberB3n302017-07-164-13/+119
* | | | | | | | Merge pull request #2829 from MerryMage/check_submodules_presentbunnei2017-07-171-0/+15
|\ \ \ \ \ \ \ \
| * | | | | | | | CMakeLists: Check that all submodules are presentMerryMage2017-07-161-0/+15
* | | | | | | | | stubbed frd::UnscrambleLocalFriendCode (#2827)B3n302017-07-173-1/+57
* | | | | | | | | Merge pull request #2830 from linkmauve/masterJames Rowe2017-07-171-1/+1
|\ \ \ \ \ \ \ \ \ | |/ / / / / / / / |/| | | | | | | |
| * | | | | | | | .gitmodules: Make enet use the same convention as other submodules.Emmanuel Gil Peyrot2017-07-161-1/+1
|/ / / / / / / /
* | | | | | | | Merge pull request #2784 from wwylele/font-archiveWeiyi Wang2017-07-165-22/+264
|\ \ \ \ \ \ \ \ | |/ / / / / / / |/| | | | | | |
| * | | | | | | apt: load shared font from system archivewwylele2017-06-264-20/+260
| * | | | | | | apt/shared_font: don't relocate zero offsetwwylele2017-06-251-2/+4
| | |/ / / / / | |/| | | | |
* | | | | | | Merge pull request #2824 from jroweboy/mingw_compile_testWeiyi Wang2017-07-131-0/+0
|\ \ \ \ \ \ \
| * | | | | | | Update enet submoduleJames Rowe2017-07-131-0/+0
| | |_|_|_|/ / | |/| | | | |
* | | | | | | Merge pull request #2819 from bunnei/telemetry-submitbunnei2017-07-1319-3/+301
|\ \ \ \ \ \ \ | |/ / / / / / |/| | | | | |
| * | | | | | web_backend: Specify api-version on JSON post.bunnei2017-07-121-1/+3
| * | | | | | web_service: Add CMake flag to enable.bunnei2017-07-125-14/+32
| * | | | | | telemetry_session: Use TelemetryJson to submit real telemetry.bunnei2017-07-123-5/+3
| * | | | | | web_service: Implement JSON serialization of telemetry data.bunnei2017-07-122-0/+125
| * | | | | | web_backend: Add initial interface to POST data to Citra Web Services.bunnei2017-07-122-0/+63
| * | | | | | web_service: Add skeleton project.bunnei2017-07-107-1/+52
| * | | | | | settings: Add telemetry endpoint URL.bunnei2017-07-104-0/+23
| * | | | | | logging: Add WebService as a log cateogry.bunnei2017-07-102-1/+3
| * | | | | | externals: Add JSON as a submodule.bunnei2017-07-103-0/+7
| * | | | | | externals: Add CPR as a submodule.bunnei2017-07-093-0/+9
|/ / / / / /
* | | | | | Merge pull request #2815 from mailwl/bosspSebastian Valle2017-07-081-0/+3
|\ \ \ \ \ \
| * | | | | | Service/boss:P: Add some functions to FunctionTablemailwl2017-07-011-0/+3
| | |_|_|/ / | |/| | | |
* | | | | | Merge pull request #2797 from yuriks/cached-vma-free-crashbunnei2017-07-081-5/+20
|\ \ \ \ \ \
| * | | | | | Memory: Fix crash when unmapping a VMA covering cached surfacesYuri Kunde Schlesner2017-06-221-5/+20
| | |/ / / / | |/| | | |
* | | | | | Implement basic virtual Room support based on enet (#2803)B3n302017-07-0715-1/+364
| |_|_|_|/ |/| | | |
* | | | | Merge pull request #2814 from Kloen/macro-removeJames Rowe2017-07-011-1/+0
|\ \ \ \ \ | |_|/ / / |/| | | |
| * | | | Remove unnecessary WIN32_LEAN_AND_MEAN macro definitionKloen2017-06-301-1/+0
|/ / / /
* | | | Merge pull request #2793 from Subv/replyandreceiveSebastian Valle2017-06-306-23/+161
|\ \ \ \
| * | | | Kernel/SVC: Pass the current thread as a parameter to ClientSession::SendSyncRequest.Subv2017-06-293-4/+7
| * | | | Kernel/Sessions: Clean up the list of pending request threads of a session when the client endpoint is closed.Subv2017-06-261-0/+5
| * | | | Kernel/SVC: Partially implemented svcReplyAndReceive.Subv2017-06-262-11/+121
| * | | | Kernel/ServerSession: Keep track of which threads have issued sync requests.Subv2017-06-253-9/+29
* | | | | Merge pull request #2809 from wwylele/texture-copy-fixYuri Kunde Schlesner2017-06-292-19/+24
|\ \ \ \ \
| * | | | | gpu: add comments for TextureCopywwylele2017-06-292-8/+8
| * | | | | gpu: fix edge cases for TextureCopywwylele2017-06-271-18/+23
* | | | | | Merge pull request #2800 from wwylele/fog-lutlutlutYuri Kunde Schlesner2017-06-297-31/+34
|\ \ \ \ \ \
| * | | | | | gl_rasterizer: use texture buffer for fog LUTwwylele2017-06-227-29/+32
| * | | | | | gl_rasterizer: create the texture before applying the statewwylele2017-06-221-2/+2
| | |_|/ / / | |/| | | |
* | | | | | Merge pull request #2811 from MerryMage/qtdebugJames Rowe2017-06-281-0/+7
|\ \ \ \ \ \
| * | | | | | configure_debug: Add label warning that CPU JIT needs to be disabled for gdbstub to workMerryMage2017-06-281-0/+7
| | |/ / / / | |/| | | |
* | | | | | Merge pull request #2812 from tiagmoraismorgado/patch-1James Rowe2017-06-281-2/+2
|\ \ \ \ \ \ | |/ / / / / |/| | | | |
| * | | | | fixing a couple of typosTiago Morais Morgado2017-06-281-2/+2
|/ / / / /
* | | | | Merge pull request #2778 from Subv/uds_moreSebastian Valle2017-06-275-1/+436
|\ \ \ \ \
| * | | | | UDS: Use the ToDS and FromDS fields to properly calculate the AAD used during encryption.Subv2017-06-261-15/+32
| * | | | | UDS: Move the UDS keyslot used to generate the CCMP key to the AES::KeySlotID enum.Subv2017-06-262-4/+3
| * | | | | UDS: Run clang-format.Subv2017-06-263-51/+55
| * | | | | UDS: Added functions to encrypt and decrypt the data frames.Subv2017-06-263-12/+156
| * | | | | UDS: Clarify comment about the first 4 bytes of the SecureData header.Subv2017-06-152-1/+5
| * | | | | UDS: Return the correct error messages in SendTo when not connected to a network or trying to send to itself.Subv2017-06-151-6/+13
| * | | | | UDS: Stub SendTo to generate the unencrypted data frame with the right headers.Subv2017-06-154-1/+261
| | |/ / / | |/| | |
* | | | | externals: silence warning C4390 on MSVC for cryptopp (#2805)Klöen Lansfiel2017-06-251-0/+5
* | | | | Set global definition WIN32_LEAN_AND_MEAN (#2807)B3n302017-06-252-0/+5
* | | | | Merge pull request #2801 from yuriks/session-svcsYuri Kunde Schlesner2017-06-245-7/+52
|\ \ \ \ \ | |_|_|/ / |/| | | |
| * | | | Kernel: Implement AcceptSession SVCYuri Kunde Schlesner2017-06-234-3/+38
| * | | | Kernel: Fix SVC wrapper for CreatePortYuri Kunde Schlesner2017-06-231-3/+2
| * | | | Kernel: Implement CreateSessionToPort SVCYuri Kunde Schlesner2017-06-231-1/+12
|/ / / /
* | | | Merge pull request #2798 from yuriks/svc-create-sessionYuri Kunde Schlesner2017-06-232-3/+26
|\ \ \ \
| * | | | Kernel: Implement CreateSession SVCYuri Kunde Schlesner2017-06-222-3/+26
| | |/ / | |/| |
* | | | Merge pull request #2795 from chris062689/masterbunnei2017-06-232-6/+6
|\ \ \ \
| * | | | Changing default values for bg_red, bg_green, and bg_blue from 1.0 to 0.0.chris0626892017-06-212-6/+6
* | | | | Merge pull request #2796 from yuriks/hle-null-handlesbunnei2017-06-232-8/+36
|\ \ \ \ \ | |_|/ / / |/| | | |
| * | | | Kernel: Fix typo in test nameYuri Kunde Schlesner2017-06-221-1/+1
| * | | | Kernel/IPC: Support translation of null handlesYuri Kunde Schlesner2017-06-212-7/+35
* | | | | Merge pull request #2792 from wwylele/lutlutlutYuri Kunde Schlesner2017-06-217-151/+175
|\ \ \ \ \ | |/ / / / |/| | | |
| * | | | gl_state: reset 1d textureswwylele2017-06-211-0/+14
| * | | | gl_rasterizer: fix glGetUniformLocation typewwylele2017-06-211-8/+8
| * | | | gl_rasterizer: manage texture ids in one placewwylele2017-06-213-31/+55
| * | | | gl_rasterizer/lighting: fix LUT interpolationwwylele2017-06-217-116/+102
* | | | | Merge pull request #2789 from yuriks/misc-kernelWeiyi Wang2017-06-212-1/+5
|\ \ \ \ \ | |_|/ / / |/| | | |
| * | | | Memory: Add enum definitions for the n3DS FCRAM sizeYuri Kunde Schlesner2017-06-211-1/+3
| * | | | Kernel: Add comment about the extended linear heap areaYuri Kunde Schlesner2017-06-191-0/+2
| |/ / /
* | | | Merge pull request #2790 from yuriks/remove-movefromYuri Kunde Schlesner2017-06-2124-56/+57
|\ \ \ \
| * | | | ResultVal: Remove MoveFrom()Yuri Kunde Schlesner2017-06-1924-57/+53
| * | | | ResultVal: Add an rvalue overload of Unwrap()Yuri Kunde Schlesner2017-06-191-1/+6
| |/ / /
* | | | Merge pull request #2779 from Subv/uds_more2Sebastian Valle2017-06-211-0/+36
|\ \ \ \
| * | | | UDS: Added a hook for updating the connection status when a client connects to the network.Subv2017-06-151-0/+36
| | |/ / | |/| |
* | | | Merge pull request #2787 from yuriks/hle-ipc-testsYuri Kunde Schlesner2017-06-205-7/+206
|\ \ \ \ | |_|/ / |/| | |
| * | | Kernel/IPC: Add tests for HLERequestContext buffer translationYuri Kunde Schlesner2017-06-192-2/+196
| * | | Kernel/IPC: Make HLERequestContext usable from outside kernelYuri Kunde Schlesner2017-06-193-5/+10
|/ / /
* | | Merge pull request #2776 from wwylele/geo-factorYuri Kunde Schlesner2017-06-183-7/+26
|\ \ \
| * | | gl_rasterizer/lighting: use the formula from the paper for germetic factorwwylele2017-06-181-8/+8
| * | | gl_rasterizer/lighting: implement geometric factorwwylele2017-06-153-1/+20
* | | | Merge pull request #2785 from yuriks/compile-flagsYuri Kunde Schlesner2017-06-184-19/+20
|\ \ \ \ | |/ / / |/| | |
| * | | CMake: Set MSVC flags for improved C++ standards conformanceYuri Kunde Schlesner2017-06-171-3/+6
| * | | Stop using reserved operator names (and/or/xor) with XbyakYuri Kunde Schlesner2017-06-173-16/+14
|/ / /
* | | Merge pull request #2762 from wwylele/light-cp-tangentYuri Kunde Schlesner2017-06-152-10/+38
|\ \ \
| * | | gl_rasterizer/lighting: Implement tangent mappingwwylele2017-06-111-7/+12
| * | | gl_rasterizer/lighting: implement lut input 5 (CP)wwylele2017-06-112-3/+26
* | | | Merge pull request #2743 from wwylele/wrap-fixYuri Kunde Schlesner2017-06-144-12/+48
|\ \ \ \ | |_|/ / |/| | |
| * | | pica/rasterizer: implement/stub texture wrap mode 4-7wwylele2017-06-044-12/+48
* | | | Services/UDS: Set the proper bit in the ConnectionStatus structure when creating a network. (#2738)Sebastian Valle2017-06-133-5/+15
* | | | Merge pull request #2767 from yuriks/quaternion-flip-commentYuri Kunde Schlesner2017-06-131-8/+11
|\ \ \ \
| * | | | OpenGL: Update comment on AreQuaternionsOpposite with new informationYuri Kunde Schlesner2017-06-101-8/+11
* | | | | Merge pull request #2774 from yuriks/hle-handlesYuri Kunde Schlesner2017-06-127-69/+360
|\ \ \ \ \ | |_|_|/ / |/| | | |
| * | | | Kernel/IPC: Use boost::small_vector for HLE context objectsYuri Kunde Schlesner2017-06-121-1/+3
| * | | | Externals: Upgrade bundled Boost to 1.64Yuri Kunde Schlesner2017-06-111-0/+0
| * | | | Kernel: Allow clearing request_objects to re-use buffer spaceYuri Kunde Schlesner2017-06-113-0/+14
| * | | | Kernel: Basic support for IPC translation for HLE servicesYuri Kunde Schlesner2017-06-113-18/+130
| * | | | Service/sm: Convert srv: to use IPC helpersYuri Kunde Schlesner2017-06-111-49/+56
| * | | | IPC: Add Pop/PushObjects methods to RequestParser/BuilderYuri Kunde Schlesner2017-06-111-10/+103
| * | | | IPC: Add basic HLERequestContext support to RequestParser/BuilderYuri Kunde Schlesner2017-06-111-1/+32
| * | | | Kernel: Add methods in HLERequestContext abstracting handle creationYuri Kunde Schlesner2017-06-112-0/+12
| * | | | ServiceFramework: Use separate copy of command bufferYuri Kunde Schlesner2017-06-113-9/+29
| |/ / /
* | | | Merge pull request #2727 from wwylele/spot-lightSebastian Valle2017-06-115-28/+128
|\ \ \ \ | |/ / / |/| | |
| * | | gl_rasterizer: implement spot lightwwylele2017-05-301-6/+24
| * | | gl_rasterizer: sync spot light statuswwylele2017-05-304-2/+61
| * | | pica: prepare registers for spotlightwwylele2017-05-301-20/+43
* | | | Remove unused import in break_points.cpp (#2763)Kloen Lansfiel2017-06-091-1/+0
* | | | Merge pull request #2756 from yuriks/service-frameworkYuri Kunde Schlesner2017-06-099-64/+355
|\ \ \ \
| * | | | Service/sm: Convert 'srv:' to ServiceFrameworkYuri Kunde Schlesner2017-06-095-51/+75
| * | | | Service: Remove a few redundant namespace qualifiersYuri Kunde Schlesner2017-06-081-5/+5
| * | | | Service: Add new ServiceFramework framework for writing HLE servicesYuri Kunde Schlesner2017-06-085-4/+269
| * | | | Kernel: Remove some unnecessary namespace qualificationsYuri Kunde Schlesner2017-06-061-4/+6
* | | | | Merge pull request #2761 from yuriks/session-referencesYuri Kunde Schlesner2017-06-083-9/+15
|\ \ \ \ \ | |_|_|_|/ |/| | | |
| * | | | Session: Remove/add some forward declarationsYuri Kunde Schlesner2017-06-083-2/+2
| * | | | Kernel: Ensure objects are kept alive during ClientSession disconnectionYuri Kunde Schlesner2017-06-081-7/+13
|/ / / /
* | | | Merge pull request #2737 from Subv/decryptbeacondataJames Rowe2017-06-071-1/+97
|\ \ \ \
| * | | | Services/UDS: Implement DecryptBeaconData.Subv2017-06-061-1/+97
* | | | | Merge pull request #2755 from yuriks/service-includesYuri Kunde Schlesner2017-06-0632-12/+80
|\ \ \ \ \ | | |/ / / | |/| | |
| * | | | Service: Remove unnecessary includes from service.hYuri Kunde Schlesner2017-06-0632-12/+80
* | | | | Merge pull request #2754 from yuriks/sm-implYuri Kunde Schlesner2017-06-067-41/+166
|\| | | |
| * | | | Service: Make service registration part of the sm implementationYuri Kunde Schlesner2017-06-066-24/+147
| * | | | Service/sm: Use an actual semaphore for the notification semaphoreYuri Kunde Schlesner2017-06-061-8/+9
| * | | | Service: Move SRV interface to a new sm/ subdirectoryYuri Kunde Schlesner2017-06-064-9/+10
* | | | | Merge pull request #2753 from yuriks/set-hle-handlerYuri Kunde Schlesner2017-06-0612-62/+92
|\| | | |
| * | | | Kernel: Add a dedicated SetHleHandler method to ServerPort/ServerSessionYuri Kunde Schlesner2017-06-0611-62/+73
| * | | | ResultVal: Add more convenience utils for creating and cascading resultsYuri Kunde Schlesner2017-06-061-0/+19
* | | | | Merge pull request #2752 from yuriks/move-session-request-handlerYuri Kunde Schlesner2017-06-0614-73/+100
|\| | | |
| * | | | HLE: Move SessionRequestHandler from Service:: to Kernel::Yuri Kunde Schlesner2017-06-0614-73/+100
|/ / / /
* | | | Merge pull request #2747 from atouchet/readme-urlJames Rowe2017-06-041-1/+1
|\ \ \ \
| * | | | Fix FAQ Link in ReadmeAlex Touchet2017-06-041-1/+1
|/ / / /
* | | | Edit Citra URLs (#2728)Alex Touchet2017-06-032-3/+3
* | | | Merge pull request #2746 from Kloen/just-whyJames Rowe2017-06-031-2/+0
|\ \ \ \
| * | | | Remove unused imports in game_list_p.hKloen2017-06-031-2/+0
|/ / / /
* | | | Merge pull request #2611 from TheKoopaKingdom/missing-file-dialogsbunnei2017-06-0314-41/+212
|\ \ \ \
| * | | | Addressed Bunnei's review comments, and made some other tweaks:TheKoopaKingdom2017-06-037-29/+32
| * | | | Fixed wiki URLs.TheKoopaKingdom2017-06-031-6/+8
| * | | | Switched to the ERROR_NOT_FOUND constant from errors.h.TheKoopaKingdom2017-06-032-4/+3
| * | | | Moved whitelist checks from FS_User to the Archive_NCCH handler.TheKoopaKingdom2017-06-032-53/+37
| * | | | Created a whitelist of system archives to prevent false positives creating dialogs.TheKoopaKingdom2017-06-039-35/+70
| * | | | Optimized messages that were repetitive and added ability for core errors to specify more details optionally.TheKoopaKingdom2017-06-035-39/+70
| * | | | Added message to status bar to show core errors ignored by the user.TheKoopaKingdom2017-06-032-1/+11
| * | | | Made some changes from review comments:TheKoopaKingdom2017-06-0310-53/+55
| * | | | Added system for handling core errors in citra-qt.TheKoopaKingdom2017-06-039-26/+121
| * | | | Fixed encrypted ROM error messages.TheKoopaKingdom2017-06-033-9/+19
|/ / / /
* | | | Merge pull request #2722 from wwylele/cam-ipc-helperbunnei2017-06-012-293/+265
|\ \ \ \
| * | | | fixup!cam: use IPCHelperwwylele2017-05-272-30/+43
| * | | | cam: move u32->u8 trancation to IPCHelperwwylele2017-05-241-34/+33
| * | | | cam: use IPCHelperwwylele2017-05-241-278/+238
* | | | | Merge pull request #2739 from yuriks/kernel-reorgbunnei2017-06-0127-344/+430
|\ \ \ \ \
| * | | | | Kernel: Move HandleTable to a separate fileYuri Kunde Schlesner2017-05-3018-203/+242
| * | | | | Kernel: Move WaitObject to a separate fileYuri Kunde Schlesner2017-05-3015-135/+178
| * | | | | Kernel: Removed HandleTable::GetWaitObjectYuri Kunde Schlesner2017-05-302-11/+2
| * | | | | Kernel: Extract dynamic Object pointer cast into its own functionYuri Kunde Schlesner2017-05-291-11/+24
| | |/ / / | |/| | |
* | | | | Merge pull request #2721 from wwylele/texture-cubebunnei2017-05-302-3/+77
|\ \ \ \ \ | |_|_|_|/ |/| | | |
| * | | | swrasterizer: implement TextureCubewwylele2017-05-291-2/+51
| * | | | pica: add registers for texture cubewwylele2017-05-291-1/+26
* | | | | Merge pull request #2734 from yuriks/cmake-imported-libsYuri Kunde Schlesner2017-05-3014-120/+160
|\ \ \ \ \ | |_|/ / / |/| | | |
| * | | | CMake: Re-organize root CMakeLists.txt fileYuri Kunde Schlesner2017-05-281-56/+78
| * | | | CMake: Move definitions of externals to the CMakeLists in that directoryYuri Kunde Schlesner2017-05-282-32/+47
| * | | | CMake: Create an INTERFACE target for CatchYuri Kunde Schlesner2017-05-282-4/+6
| * | | | CMake: Create INTERFACE targets for microprofile and nihstroYuri Kunde Schlesner2017-05-284-5/+9
| * | | | CMake: Remove unnecessary include_directories for dynarmicYuri Kunde Schlesner2017-05-281-3/+0
| * | | | CMake: Add cryptopp include path to target propertyYuri Kunde Schlesner2017-05-282-3/+4
| * | | | CMake: Add SoundTouch include path to target propertyYuri Kunde Schlesner2017-05-282-2/+2
| * | | | CMake: Use target properties to add inih include pathsYuri Kunde Schlesner2017-05-282-3/+2
| * | | | CMake: Define an interface target for SDL2 definitionsYuri Kunde Schlesner2017-05-284-8/+11
| * | | | CMake: Remove CITRA_QT_LIBS varYuri Kunde Schlesner2017-05-282-2/+1
| * | | | CMake: Stop using FindOpenGL, which seems to not be required anymoreYuri Kunde Schlesner2017-05-284-6/+4
| * | | | CMake: Use append instead of set to modify listYuri Kunde Schlesner2017-05-281-1/+1
| * | | | CMake: Use IMPORTED target for BoostYuri Kunde Schlesner2017-05-284-8/+11
| * | | | CMake: Use IMPORTED target for libpngYuri Kunde Schlesner2017-05-282-8/+5
| * | | | Travis: Upgrade to CMake 3.6.3Yuri Kunde Schlesner2017-05-281-1/+1
* | | | | Merge pull request #2729 from yuriks/quaternion-fixYuri Kunde Schlesner2017-05-281-3/+5
|\ \ \ \ \
| * | | | | OpenGL: Improve accuracy of quaternion interpolationYuri Kunde Schlesner2017-05-271-3/+5
| | |_|_|/ | |/| | |
* | | | | Merge pull request #2733 from yuriks/cmake-cleanupYuri Kunde Schlesner2017-05-2832-104/+111
|\ \ \ \ \ | | |/ / / | |/| | |
| * | | | CMake: Correct inter-module dependencies and library visibilityYuri Kunde Schlesner2017-05-288-23/+27
| * | | | Citra: Convert include into forward declarationYuri Kunde Schlesner2017-05-282-2/+6
| * | | | Remove some unnecessary inclusions of video_core.hYuri Kunde Schlesner2017-05-284-4/+0
| * | | | Move screen size constants from video_core to coreYuri Kunde Schlesner2017-05-289-51/+63
| * | | | OpenGL: Remove unused RendererOpenGL fieldsYuri Kunde Schlesner2017-05-282-11/+2
| * | | | Core: Fix some out-of-style includesYuri Kunde Schlesner2017-05-284-4/+4
| * | | | Common: Fix some out-of-style includesYuri Kunde Schlesner2017-05-283-5/+5
| * | | | Move framebuffer_layout from Common to CoreYuri Kunde Schlesner2017-05-285-4/+4
|/ / / /
* | | | Merge pull request #2732 from yuriks/add-fmtYuri Kunde Schlesner2017-05-285-0/+5
|\ \ \ \ | |_|/ / |/| | |
| * | | Add the fmt string formatting libraryYuri Kunde Schlesner2017-05-274-0/+5
| * | | Update dynarmicYuri Kunde Schlesner2017-05-271-0/+0
|/ / /
* | | Merge pull request #2725 from wwylele/texture-samplerYuri Kunde Schlesner2017-05-271-40/+39
|\ \ \
| * | | gl_shader: refactor texture sampler into its own functionwwylele2017-05-271-40/+39
| |/ /
* | | Merge pull request #2716 from yuriks/decentralized-resultbunnei2017-05-2633-300/+385
|\ \ \ | |/ / |/| |
| * | FS: Remove unused result definitionYuri Kunde Schlesner2017-05-251-5/+0
| * | Common: Clean up meta-template logic in BitFieldYuri Kunde Schlesner2017-05-251-3/+3
| * | Kernel: Centralize error definitions in errors.hYuri Kunde Schlesner2017-05-2523-132/+178
| * | GSP_GPU: Move error codes from result.h to local fileYuri Kunde Schlesner2017-05-252-17/+23
| * | FileSys: Move all result description to errors.hYuri Kunde Schlesner2017-05-2510-105/+115
| * | result: Make error description a generic integerYuri Kunde Schlesner2017-05-253-6/+18
| * | Make BitField and ResultCode constexpr-initializableYuri Kunde Schlesner2017-05-252-41/+57
* | | Merge pull request #2697 from wwylele/proctexYuri Kunde Schlesner2017-05-2515-11/+1048
|\ \ \
| * | | gl_rasterizer: implement procedural texturewwylele2017-05-206-7/+600
| * | | pica/swrasterizer: implement procedural texturewwylele2017-05-209-4/+448
* | | | Merge pull request #2683 from bunnei/telemetry-frameworkbunnei2017-05-259-0/+342
|\ \ \ \ | |_|_|/ |/| | |
| * | | telemetry: Log a few simple data fields throughout core.bunnei2017-05-253-1/+22
| * | | core: Keep track of telemetry for the current emulation session.bunnei2017-05-255-0/+83
| * | | common: Add a generic interface for logging telemetry fields.bunnei2017-05-253-0/+238
|/ / /
* | | Merge pull request #2692 from Subv/vfp_ftzSebastian Valle2017-05-222-0/+26
|\ \ \ | |_|/ |/| |
| * | fixup! Dyncom/VFP: Convert denormal outputs into 0 when the FTZ flag is enabled.Subv2017-05-222-4/+0
| * | Dyncom/VFP: Convert denormal outputs into 0 when the FTZ flag is enabled.Subv2017-05-082-0/+30
* | | Merge pull request #2406 from Subv/session_disconnectYuri Kunde Schlesner2017-05-228-51/+84
|\ \ \
| * | | Kernel/Sessions: Remove the ClientSession::Create function.Subv2017-05-223-16/+3
| * | | Kernel: Remove a now unused enum and variable regarding a session's status.Subv2017-05-152-8/+0
| * | | Kernel: Use a Session object to keep track of the status of a Client/Server session pair.Subv2017-05-158-32/+86
* | | | Merge pull request #2694 from Subv/vfp_vsub_ftzMerry2017-05-221-2/+12
|\ \ \ \
| * | | | Dyncom/VFP: Perform flush-to-zero on the second operand of vsub before sending it to vadd.Subv2017-05-141-2/+12
| | |/ / | |/| |
* | | | Merge pull request #2719 from lioncash/catchYuri Kunde Schlesner2017-05-221-0/+0
|\ \ \ \
| * | | | externals: Update catch to 1.9.4Lioncash2017-05-221-0/+0
|/ / / /
* | | | Merge pull request #2718 from citra-emu/appveyor-vs2017James Rowe2017-05-221-4/+2
|\ \ \ \
| * | | | Remove "Xamarin logspam" workaroundYuri Kunde Schlesner2017-05-221-2/+0
| * | | | Upgrade AppVeyor to Visual Studio 2017Yuri Kunde Schlesner2017-05-221-3/+3
|/ / / /
* | | | Merge pull request #2713 from wwylele/where-is-my-tc0_wYuri Kunde Schlesner2017-05-212-5/+8
|\ \ \ \
| * | | | swrasterizer: add missing tc0_w and fragment lighting attribute processingwwylele2017-05-212-5/+8
|/ / / /
* | | | Merge pull request #2661 from Subv/uds5bunnei2017-05-195-33/+602
|\ \ \ \
| * | | | Services/UDS: Use the new IPC helper functions.Subv2017-05-151-21/+10
| * | | | Services/UDS: Implement RecvBeaconBroadcastData.Subv2017-05-151-19/+69
| * | | | Services/UDS: Generate the UDS beacons when the beacon callback fires.Subv2017-05-155-7/+537
* | | | | Merge pull request #2710 from emmauss/ptm_ipcbunnei2017-05-193-31/+45
|\ \ \ \ \
| * | | | | use IPCHelper for PTM servicesemmaus2017-05-193-31/+45
* | | | | | Merge pull request #2709 from wwylele/pica-masked-valueYuri Kunde Schlesner2017-05-181-2/+2
|\ \ \ \ \ \ | |/ / / / / |/| | | | |
| * | | | | pica: use correct register value for shader bool_uniformswwylele2017-05-171-2/+2
|/ / / / /
* | | | | Merge pull request #2703 from wwylele/pica-reg-reviseYuri Kunde Schlesner2017-05-164-17/+25
|\ \ \ \ \
| * | | | | pica: correct bit field length for some registerswwylele2017-05-164-17/+25
* | | | | | Merge pull request #2687 from yuriks/address-mappingsYuri Kunde Schlesner2017-05-1411-80/+157
|\ \ \ \ \ \
| * | | | | | Kernel: Map special regions according to ExHeaderYuri Kunde Schlesner2017-05-105-52/+105
| * | | | | | DSP: Create backing memory for entire DSP RAMYuri Kunde Schlesner2017-05-105-32/+42
| * | | | | | Memory: Add constants for the n3DS additional RAMYuri Kunde Schlesner2017-05-102-2/+16
| | |_|_|_|/ | |/| | | |
* | | | | | Merge pull request #2695 from JayFoxRox/gs-regsWeiyi Wang2017-05-126-70/+171
|\ \ \ \ \ \ | |_|/ / / / |/| | | | |
| * | | | | Pica: Write GS registersJannik Vogel2017-05-121-0/+52
| * | | | | Pica: Write shader registers in functionsJannik Vogel2017-05-121-57/+103
| * | | | | Pica: Set program code / swizzle data limit to 4096Jannik Vogel2017-05-115-13/+16
| | |_|/ / | |/| | |
* | | | | Merge pull request #2669 from jroweboy/async_file_watcherYuri Kunde Schlesner2017-05-113-46/+35
|\ \ \ \ \
| * | | | | Frontend: Prevent FileSystemWatcher from blocking UI threadJames Rowe2017-05-103-46/+35
* | | | | | Merge pull request #2676 from wwylele/irrstbunnei2017-05-109-24/+208
|\ \ \ \ \ \ | |_|_|/ / / |/| | | | |
| * | | | | fixup!ir: implement new 3ds HID via ir:rstwwylele2017-05-071-31/+32
| * | | | | ir: implement new 3ds HID via ir:rstwwylele2017-05-049-24/+207
* | | | | | Merge pull request #2696 from Subv/vfp_revertYuri Kunde Schlesner2017-05-093-59/+30
|\ \ \ \ \ \ | |_|/ / / / |/| | | | |
| * | | | | Dyncom/VFP: Strip the VFP_NAN_FLAG sentinel value when setting vfp exceptions.Subv2017-05-092-2/+2
| * | | | | Revert "Remove `exceptions` parameter from `normaliseround` VFP functions"Subv2017-05-093-57/+28
| | |/ / / | |/| | |
* | | | | Merge pull request #2689 from yuriks/remove-disassemblerbunnei2017-05-0823-2389/+11
|\ \ \ \ \ | |/ / / / |/| | | |
| * | | | Dyncom: Remove disassembler codeYuri Kunde Schlesner2017-05-084-1589/+2
| * | | | Dyncom: Tweak types and log formattingYuri Kunde Schlesner2017-05-083-8/+10
| * | | | Remove unused symbols codeYuri Kunde Schlesner2017-05-086-124/+0
| * | | | Remove ability to load symbol mapsYuri Kunde Schlesner2017-05-085-55/+2
| * | | | citra-qt: Remove callstack widgetYuri Kunde Schlesner2017-05-086-168/+0
| * | | | citra-qt: Remove disassembler widgetYuri Kunde Schlesner2017-05-086-448/+0
|/ / / /
* | | | Merge pull request #2682 from nicoboss/filterYuri Kunde Schlesner2017-05-072-30/+35
|\ \ \ \
| * | | | Don’t focus the search field if the game is emptyNico Bosshard2017-05-061-3/+6
| * | | | Fixed some more typosNico Bosshard2017-05-032-4/+4
| * | | | citra-qt: game list search function fixed minor mistakesNico Bosshard2017-05-021-24/+26
* | | | | Merge pull request #2686 from wwylele/tex-coord-regYuri Kunde Schlesner2017-05-066-10/+32
|\ \ \ \ \
| * | | | | pica: shader_dirty if texture2 coord changedwwylele2017-05-055-7/+12
| * | | | | pica: use correct coordinates for texture 2wwylele2017-05-034-5/+22
| |/ / / /
* | / / / Create a random console_unique_id (#2668)B3n302017-05-065-7/+123
| |/ / / |/| | |
* | | | Merge pull request #2606 from wwylele/irbunnei2017-05-047-51/+762
|\ \ \ \ | |/ / / |/| | |
| * | | ir: implement circle pad prowwylele2017-05-036-44/+761
| * | | qt: enable config for circle pad prowwylele2017-04-091-7/+1
* | | | citra-qt: game list search function (#2673)Nico Bosshard2017-04-307-19/+299
* | | | Merge pull request #2671 from wwylele/dot3-rgbabunnei2017-04-214-22/+39
|\ \ \ \
| * | | | gl_shader_gen: remove TODO about Lerp behaviour verification. The implementation is verified against hardwarewwylele2017-04-201-2/+0
| * | | | rasterizer: implement combiner operation 7 (Dot3_RGBA)wwylele2017-04-194-20/+39
| | |_|/ | |/| |
* | | | Merge pull request #2666 from yuriks/gl-cleanupsYuri Kunde Schlesner2017-04-205-214/+215
|\ \ \ \
| * | | | OpenGL: Pass Pica regs via parameterYuri Kunde Schlesner2017-04-173-7/+5
| * | | | OpenGL: Move PicaShaderConfig to gl_shader_gen.hYuri Kunde Schlesner2017-04-174-202/+206
| * | | | OpenGL: Move Attributes enum to a more appropriate fileYuri Kunde Schlesner2017-04-173-12/+11
| |/ / /
* | | | Merge pull request #2532 from wwylele/ldrro-ipcYuri Kunde Schlesner2017-04-181-193/+138
|\ \ \ \
| * | | | ldr_ro: use IPC helperwwylele2017-04-171-193/+138
| | |/ / | |/| |
* | | | Merge pull request #2667 from wwylele/button_from_axisbunnei2017-04-182-4/+59
|\ \ \ \ | |_|/ / |/| | |
| * | | input_common/sdl: add support for binding button to axiswwylele2017-04-172-4/+59
|/ / /
* | | Merge pull request #2659 from MerryMage/dsp_dsp-correctionbunnei2017-04-131-0/+18
|\ \ \
| * | | dsp_dsp: Messages are modified by service before being sent to DSPMerryMage2017-04-121-0/+18
* | | | Better looking status bar under Linux Ubuntu (#2662)Cereal-Killa2017-04-131-0/+1
| |_|/ |/| |
* | | Merge pull request #2628 from Subv/udsSebastian Valle2017-04-122-45/+388
|\ \ \
| * | | Services/UDS: Fixed a style mistake in GetChannel.Sebastian Valle2017-03-271-2/+1
| * | | Services/UDS: Use consistent spelling for WiFi and simplify the GetChannel function.Subv2017-03-261-4/+4
| * | | Services/UDS: Signal the connection event when closing down the network.Subv2017-03-261-0/+1
| * | | Services/UDS: Do not allow trying to start up a network that only the host can connect to.Subv2017-03-261-0/+3
| * | | Service/UDS: Schedule an event to broadcast the beacon frames every 102.4ms.Subv2017-03-262-2/+58
| * | | Services/UDS: Store the entire NetworkInfo structure that was used to create the network.Subv2017-03-261-13/+5
| * | | Services/UDS: Initial support for hosting local-wlan networks.Subv2017-03-262-44/+336
* | | | Merge pull request #2658 from JayFoxRox/blend-equation-fixJames Rowe2017-04-091-2/+2
|\ \ \ \ | |_|_|/ |/| | |
| * | | Pica/Regs: Correct bit width for blend-equationsJannik Vogel2017-04-081-2/+2
|/ / /
* | | Merge pull request #2533 from Lectem/apt_ipchelperbunnei2017-04-066-257/+386
|\ \ \
| * | | hopefully fix clang-format issues with old versionLectem2017-03-201-3/+2
| * | | address more commentsLectem2017-03-191-20/+20
| * | | Cast size_t to u32 for PushStaticBuffer usagesLectem2017-03-181-2/+2
| * | | IPCHelper Skip method + address comments for aptLectem2017-03-183-38/+46
| * | | fix #2560 and other commentsLectem2017-03-183-22/+22
| * | | move push out of class body and add u8 u16 bool specializationsLectem2017-03-184-55/+114
| * | | refactor APT service to use the new IPC helpersLectem2017-03-184-195/+258
* | | | Merge pull request #2634 from wwylele/batterybunnei2017-04-062-1/+16
|\ \ \ \
| * | | | shared_page: stub battery statewwylele2017-03-212-1/+16
* | | | | Merge pull request #2651 from jroweboy/configmovedMat M2017-04-0425-41/+41
|\ \ \ \ \
| * | | | | citra-qt: Move config dialog code to its own directoryLioncash2017-04-0425-41/+41
|/ / / / /
* | | | | Merge pull request #2622 from jfmherokiller/socufixbunnei2017-04-041-39/+32
|\ \ \ \ \
| * | | | | error conversion fixes for soc_unoah the goodra2017-04-031-39/+32
|/ / / / /
* | | | | Merge pull request #2648 from mtheall/masterbunnei2017-04-032-4/+4
|\ \ \ \ \
| * | | | | Fix OutputDebugString syscallMichael Theall2017-04-012-4/+4
|/ / / / /
* | | | | Merge pull request #2639 from wwylele/fix-ptm-fsbunnei2017-03-251-1/+1
|\ \ \ \ \
| * | | | | ptm: create SharedExtSave file before openning itwwylele2017-03-251-1/+1
|/ / / / /
* | | | | Merge pull request #2512 from SonofUgly/custom-layoutbunnei2017-03-229-13/+104
|\ \ \ \ \ | |/ / / / |/| | | |
| * | | | Add custom layout settings.SonofUgly2017-02-239-13/+104
* | | | | Removed a linebreak from the README.Christopher J. Gilbert2017-03-211-1/+0
* | | | | Adding a linebreak to the README file.Christopher J. Gilbert2017-03-211-0/+1
* | | | | Merge pull request #2630 from wwylele/qt-focus-loss-2bunnei2017-03-205-3/+18
|\ \ \ \ \
| * | | | | citra-qt: remove dead codewwylele2017-03-173-5/+0
| * | | | | citra-qt: release all buttons when render window focus is lostwwylele2017-03-174-0/+20
| | |/ / / | |/| | |
* | | | | Merge pull request #2631 from wwylele/fix-unwrapWeiyi Wang2017-03-181-1/+1
|\ \ \ \ \ | |/ / / / |/| | | |
| * | | | apt: fix RequestBuilder parameters for Unwrapwwylele2017-03-181-1/+1
|/ / / /
* | | | Merge pull request #2497 from wwylele/input-2bunnei2017-03-1740-574/+1244
|\ \ \ \
| * | | | qt/config_input: don't connect for null buttonwwylele2017-03-021-4/+7
| * | | | citra: update default ini with new input systemwwylele2017-03-011-28/+41
| * | | | Input: remove unused stuff & clean upwwylele2017-03-019-412/+3
| * | | | Qt: rework input configuration for new input systemwwylele2017-03-012-68/+144
| * | | | InputCommon: add SDL joystick supportwwylele2017-03-014-0/+241
| * | | | InputCommon: add AnalogFromButtonwwylele2017-03-018-0/+162
| * | | | InputCommon: add Keyboardwwylele2017-03-0117-85/+254
| * | | | HID: use AnalogDevicewwylele2017-03-013-2/+30
| * | | | HID: use ButtonDevicewwylele2017-03-015-1/+100
| * | | | Input: add device and factory templatewwylele2017-03-014-0/+100
| * | | | Common: add ParamPackagewwylele2017-03-015-0/+188
* | | | | Merge pull request #2618 from wwylele/log-less-filenamebunnei2017-03-177-17/+20
|\ \ \ \ \
| * | | | | file_util: Log when using local user directorywwylele2017-03-111-0/+2
| * | | | | file_sys: lower log level for setting host pathwwylele2017-03-084-4/+4
| * | | | | file_util: lower logging level for harmless caseswwylele2017-03-081-9/+7
| * | | | | loader/ncch: less verbose log for loading game list. only log program ID when bootingwwylele2017-03-081-3/+6
| * | | | | loader: lower file name logging levelwwylele2017-03-081-1/+1
| | |_|/ / | |/| | |
* | | | | Merge pull request #2468 from Kloen/xamarin-pls-stopbunnei2017-03-161-0/+2
|\ \ \ \ \
| * | | | | appveyor: workaround for unnecesary Xamarin log spamKloen2017-01-231-0/+2
* | | | | | Merge pull request #2620 from FernandoS27/syscore_errorbunnei2017-03-161-5/+15
|\ \ \ \ \ \
| * | | | | | Refined thread launch on syscore error messagesFernando Sahmkow2017-03-091-5/+15
| | |/ / / / | |/| | | |
* | | | | | Merge pull request #2625 from wwylele/hash-console-uniquebunnei2017-03-161-7/+24
|\ \ \ \ \ \
| * | | | | | cfg: implement GenHashConsoleUniquewwylele2017-03-121-7/+24
| |/ / / / /
* | | | | | Merge pull request #2626 from yuriks/msvc2017bunnei2017-03-162-5/+7
|\ \ \ \ \ \ | |/ / / / / |/| | | | |
| * | | | | externals: Update to boost v1.63.0Yuri Kunde Schlesner2017-03-131-0/+0
| * | | | | common/cpu_detect: Add missing include and fix namespace scopeYuri Kunde Schlesner2017-03-131-5/+7
|/ / / / /
* | | | | Merge pull request #2614 from Schplee/patch-1Christopher J. Gilbert2017-03-061-2/+1
|\ \ \ \ \
| * | | | | Fixes typo on Citra forum link.Schplee2017-03-061-2/+1
| | |/ / / | |/| | |
* | | | | Merge pull request #2615 from Schplee/patch-2Christopher J. Gilbert2017-03-061-2/+2
|\ \ \ \ \ | |/ / / / |/| | | |
| * | | | New website link updates.Schplee2017-03-061-2/+2
|/ / / /
* | | | Merge pull request #2603 from wwylele/please-signalbunnei2017-02-271-0/+2
|\ \ \ \
| * | | | Timer: restore missing signaled=true from #2421wwylele2017-02-271-0/+2
|/ / / /
* | | | Merge pull request #2594 from wwylele/ir-separatebunnei2017-02-276-147/+159
|\ \ \ \
| * | | | IR: separate functions of each port to their own fileswwylele2017-02-266-147/+159
* | | | | Fix log entry in timer::signal (#2600)B3n302017-02-271-1/+1
* | | | | Doxygen: Amend minor issues (#2593)Mat M2017-02-2718-23/+31
* | | | | Merge pull request #2587 from yuriks/status-barYuri Kunde Schlesner2017-02-2728-449/+321
|\ \ \ \ \
| * | | | | PerfStats: Re-order and document members betterYuri Kunde Schlesner2017-02-272-5/+14
| * | | | | Qt: Tweak status bar stylingYuri Kunde Schlesner2017-02-271-0/+2
| * | | | | Qt: Increase status bar update interval to 2 secondsYuri Kunde Schlesner2017-02-271-1/+1
| * | | | | Core: Re-write frame limiterYuri Kunde Schlesner2017-02-275-42/+53
| * | | | | Core: Make PerfStats internally lockedYuri Kunde Schlesner2017-02-277-16/+25
| * | | | | Qt: Add tooltips to status bar displaysYuri Kunde Schlesner2017-02-271-0/+7
| * | | | | Qt: Don't show fractional figures in the status barYuri Kunde Schlesner2017-02-271-2/+2
| * | | | | Remove built-in (non-Microprofile) profilerYuri Kunde Schlesner2017-02-279-382/+2
| * | | | | PerfStats: Add method to get the instantaneous time ratioYuri Kunde Schlesner2017-02-273-7/+22
| * | | | | Add performance statistics to status barYuri Kunde Schlesner2017-02-2711-3/+159
| * | | | | SynchronizedWrapper: Add Lock convenience methodYuri Kunde Schlesner2017-02-271-18/+25
| * | | | | Qt: Add (empty) status barYuri Kunde Schlesner2017-02-276-1/+35
| * | | | | Core: Remove unnecessary include in thread.hYuri Kunde Schlesner2017-02-274-1/+3
* | | | | | Merge pull request #2595 from jroweboy/patchbunnei2017-02-251-1/+3
|\ \ \ \ \ \ | |_|/ / / / |/| | | | |
| * | | | | Change travis tar command to specify compression formatJames Rowe2017-02-251-1/+3
|/ / / / /
* | | | | Merge pull request #2569 from wwylele/wrap-unwrapbunnei2017-02-2517-14/+568
|\ \ \ \ \
| * | | | | externals: remove -march=native for crypto++wwylele2017-02-211-8/+1
| * | | | | APT: implement Wrap and Unwrapwwylele2017-02-215-6/+149
| * | | | | HW: add AES engine & implement AES-CCMwwylele2017-02-2112-0/+418
* | | | | | Merge pull request #2421 from Subv/timersYuri Kunde Schlesner2017-02-253-16/+36
|\ \ \ \ \ \
| * | | | | | Timers: Return an error when calling SetTimer with negative timeouts.Subv2017-02-221-0/+5
| * | | | | | Timers: Immediately signal the timer if it was started with an initial value of 0.Subv2017-02-222-16/+31
* | | | | | | Fixes file upload pattern in the travis.yml to include macOS releases (#2592)James Rowe2017-02-251-2/+2
* | | | | | | Merge pull request #2590 from jroweboy/mac-gzipYuri Kunde Schlesner2017-02-241-2/+3
|\ \ \ \ \ \ \
| * | | | | | | Revert use gzip for linuxJames Rowe2017-02-231-2/+3
| * | | | | | | Use gzip instead of lzma on macOS and linux releasesJames Rowe2017-02-231-2/+2
* | | | | | | | Use QFileSystemWatcher to reload the game list when a change is detected. (#2555)James Rowe2017-02-232-1/+51
* | | | | | | | Merge pull request #2441 from jroweboy/titlebarbunnei2017-02-236-5/+32
|\ \ \ \ \ \ \ \ | |/ / / / / / / |/| | | | | | |
| * | | | | | | Gui: Change title bar to include build nameJames Rowe2017-02-236-5/+32
* | | | | | | | [UI] Modify recursive scanning label (#2589)Anthony2017-02-231-1/+1
|/ / / / / / /
* | | | | | | Merge pull request #2579 from wwylele/no-clang-format-checkbunnei2017-02-211-17/+0
|\ \ \ \ \ \ \
| * | | | | | | hook: remove clang-format checkwwylele2017-02-171-17/+0
* | | | | | | | Merge pull request #2585 from MerryMage/sxtb16-sxtab16bunnei2017-02-201-4/+4
|\ \ \ \ \ \ \ \ | |_|_|_|/ / / / |/| | | | | | |
| * | | | | | | dyncom: Correct SXTAB16 and SXTB16MerryMage2017-02-181-4/+4
* | | | | | | | Merge pull request #2580 from yuriks/qt-cleanup2Yuri Kunde Schlesner2017-02-194-96/+83
|\ \ \ \ \ \ \ \ | |_|_|/ / / / / |/| | | | | | |
| * | | | | | | Qt: Move some connections from .ui file to codeYuri Kunde Schlesner2017-02-182-38/+3
| * | | | | | | Qt: Reorganize connection of menu eventsYuri Kunde Schlesner2017-02-182-13/+23
| * | | | | | | Qt: Re-organize setup of debugging widgetsYuri Kunde Schlesner2017-02-184-39/+51
| * | | | | | | Qt: Fix action name to match conventionsYuri Kunde Schlesner2017-02-182-6/+6
* | | | | | | | OpenGL: Check if uniform block exists before updating it (#2581)Jannik Vogel2017-02-181-29/+30
* | | | | | | | dynarmic: Update the submodule.Emmanuel Gil Peyrot2017-02-181-0/+0
|/ / / / / / /
* | | | | | | Merge pull request #2577 from yuriks/qt-cleanupYuri Kunde Schlesner2017-02-182-23/+19
|\ \ \ \ \ \ \ | |_|/ / / / / |/| | | | | |
| * | | | | | Qt: Make IsSingleFileDropEvent staticYuri Kunde Schlesner2017-02-181-1/+1
| * | | | | | Qt: Allow any file extension in Open dialogYuri Kunde Schlesner2017-02-181-2/+3
| * | | | | | Qt: Remove orpahned function declarationYuri Kunde Schlesner2017-02-181-6/+0
| * | | | | | Qt: Remove unnecessary std::string usageYuri Kunde Schlesner2017-02-182-14/+15
|/ / / / / /
* | | | | | HID: move enable_accelerometer/gyroscope_count initialization into Init() (#2574)Weiyi Wang2017-02-171-2/+5
* | | | | | Merge pull request #2573 from jfmherokiller/dragndropbunnei2017-02-172-1/+41
|\ \ \ \ \ \
| * | | | | | added drag n drop featurenoah the goodra2017-02-162-1/+41
|/ / / / / /
* | | | | | Merge pull request #2571 from wwylele/missing-fileMat M2017-02-151-0/+1
|\ \ \ \ \ \
| * | | | | | core: add missing errors.h in CMakeLists.txtwwylele2017-02-151-0/+1
* | | | | | | video_core: remove #pragma once in cpp file (#2570)Weiyi Wang2017-02-152-4/+0
|/ / / / / /
* | | | | | Merge pull request #2566 from yuriks/file-extension-suffixWeiyi Wang2017-02-141-1/+1
|\ \ \ \ \ \
| * | | | | | Qt/GameList: Use suffix() to parse the file extensionYuri Kunde Schlesner2017-02-141-1/+1
| | |/ / / / | |/| | | |
* | | | | | HLE/IPC: Fix uninitialized variables in helpers (#2568)Yuri Kunde Schlesner2017-02-141-3/+3
* | | | | | Merge pull request #2542 from jfmherokiller/httpsvclogYuri Kunde Schlesner2017-02-144-2/+4
|\ \ \ \ \ \ | |/ / / / / |/| | | | |
| * | | | | applied the change suggested by @wwylelenoah the goodra2017-02-141-0/+1
| * | | | | NWM changed to NIMnoah the goodra2017-02-141-1/+1
| * | | | | turned clang format back onnoah the goodra2017-02-141-1/+1
| * | | | | added http service enum to the log.h filenoah the goodra2017-02-141-0/+1
|/ / / / /
* | | | | Merge pull request #2562 from yuriks/pica-refactor3Yuri Kunde Schlesner2017-02-1312-563/+661
|\ \ \ \ \
| * | | | | SWRasterizer: Move more framebuffer functions to fileYuri Kunde Schlesner2017-02-133-100/+105
| * | | | | SWRasterizer: Move texturing functions to their own fileYuri Kunde Schlesner2017-02-134-210/+259
| * | | | | SWRasterizer: Convert large no-capture lambdas to standalone functionsYuri Kunde Schlesner2017-02-131-315/+310
| * | | | | SWRasterizer: Move framebuffer operation functions to their own fileYuri Kunde Schlesner2017-02-134-236/+285
| * | | | | VideoCore: Move software rasterizer files to sub-directoryYuri Kunde Schlesner2017-02-138-12/+12
* | | | | | Core: add cryptopp library (#2412)Weiyi Wang2017-02-135-1/+176
* | | | | | Merge pull request #2561 from wwylele/fs-romYuri Kunde Schlesner2017-02-139-60/+295
|\ \ \ \ \ \ | |/ / / / / |/| | | | |
| * | | | | loader: use self NCCH archivewwylele2017-02-136-90/+7
| * | | | | file_sys: add Self NCCH archivewwylele2017-02-135-0/+318
| |/ / / /
* | | | | video_core/shader: Document sanitized MUL operationYuri Kunde Schlesner2017-02-121-0/+8
* | | | | Merge pull request #2550 from yuriks/pica-refactor2Yuri Kunde Schlesner2017-02-1219-140/+133
|\ \ \ \ \
| * | | | | VideoCore: Split u64 Pica reg unions into 2 separate u32 unionsYuri Kunde Schlesner2017-02-091-36/+42
| * | | | | VideoCore: Force enum sizes to u32 in LightingRegsYuri Kunde Schlesner2017-02-091-4/+4
| * | | | | OpenGL: Remove unused duplicate of IsPassThroughTevStageYuri Kunde Schlesner2017-02-091-12/+0
| * | | | | VideoCore: Split regs.h inclusionsYuri Kunde Schlesner2017-02-0914-25/+47
| * | | | | Pica/Regs: Use binary search to look up reg namesYuri Kunde Schlesner2017-02-093-16/+11
| * | | | | VideoCore: Use union to index into Regs structYuri Kunde Schlesner2017-02-092-46/+28
| |/ / / /
* | | | | citra-qt: Don't attempt to scan files with unsupported extensions (#2402)Kloen Lansfiel2017-02-123-4/+20
* | | | | core: Free AppLoader on shutdown to release file (#2558)Yuri Kunde Schlesner2017-02-111-9/+2
* | | | | hid: remove the touch field from PadState (#2557)Weiyi Wang2017-02-112-6/+0
* | | | | video_core: Fix benign out-of-bounds indexing of array (#2553)Yuri Kunde Schlesner2017-02-111-2/+1
|/ / / /
* | | | Merge pull request #2482 from yuriks/pica-refactorYuri Kunde Schlesner2017-02-0937-2427/+2635
|\ \ \ \
| * | | | VideoCore: Move Regs to its own fileYuri Kunde Schlesner2017-02-0426-662/+681
| * | | | VideoCore: Split shader regs from Regs structYuri Kunde Schlesner2017-02-049-102/+116
| * | | | VideoCore: Split geometry pipeline regs from Regs structYuri Kunde Schlesner2017-02-049-264/+292
| * | | | VideoCore: Split lighting regs from Regs structYuri Kunde Schlesner2017-02-046-312/+341
| * | | | VideoCore: Split framebuffer regs from Regs structYuri Kunde Schlesner2017-02-0411-457/+503
| * | | | VideoCore: Split texturing regs from Regs structYuri Kunde Schlesner2017-02-0417-507/+548
| * | | | VideoCore: Split rasterizer regs from Regs structYuri Kunde Schlesner2017-02-0414-188/+219
* | | | | Merge pull request #2539 from Kloen/re-killing-warningsbunnei2017-02-061-0/+0
|\ \ \ \ \
| * | | | | externals: nihstro, update to latest masterKloen2017-02-061-0/+0
|/ / / / /
* | | | | Merge pull request #2534 from Lectem/fix_etc1_msvc15Mat M2017-02-051-1/+1
|\ \ \ \ \
| * | | | | Use std::array<u8,2> instead of u8[2] to fix MSVC buildLectem2017-02-051-1/+1
|/ / / / /
* | | | | Merge pull request #2027 from Lectem/ipcrefactorWeiyi Wang2017-02-056-68/+364
|\ \ \ \ \
| * | | | | fix wwylele's comment and use typename in templatesLectem2017-02-051-4/+4
| * | | | | fix comments alignmentLectem2016-12-301-22/+22
| * | | | | move Pop methods out of class bodyLectem2016-12-261-72/+88
| * | | | | IPC helpers exampleLectem2016-12-263-35/+40
| * | | | | IPC helpersLectem2016-12-263-48/+323
* | | | | | Fix Microprofile in MinGW (#2530)Fernando Sahmkow2017-02-052-3/+1
| |/ / / / |/| | | |
* | | | | Merge pull request #2476 from yuriks/shader-refactor3Yuri Kunde Schlesner2017-02-0420-181/+185
|\ \ \ \ \
| * | | | | VideoCore: Make PrimitiveAssembler const-correctYuri Kunde Schlesner2017-01-302-3/+4
| * | | | | VideoCore: Extract swrast-specific data from OutputVertexYuri Kunde Schlesner2017-01-305-58/+64
| * | | | | VideoCore/Shader: Clean up OutputVertex::FromAttributeBufferYuri Kunde Schlesner2017-01-302-10/+16
| * | | | | Common: Optimize BitSet iteratorYuri Kunde Schlesner2017-01-301-14/+19
| * | | | | VideoCore: Split shader output writing from semantic loadingYuri Kunde Schlesner2017-01-303-24/+24
| * | | | | VideoCore: Consistently use shader configuration to load attributesYuri Kunde Schlesner2017-01-307-47/+26
| * | | | | VideoCore: Use correct register for immediate mode attribute countYuri Kunde Schlesner2017-01-302-7/+13
| * | | | | VideoCore: Rename some types to more accurate namesYuri Kunde Schlesner2017-01-3010-21/+21
| * | | | | VideoCore: Change misleading register namesYuri Kunde Schlesner2017-01-304-8/+9
* | | | | | Merge pull request #2414 from yuriks/texture-decodeYuri Kunde Schlesner2017-02-0412-318/+482
|\ \ \ \ \ \
| * | | | | | Pica/Texture: Move part of ETC1 decoding to new file and cleanupsYuri Kunde Schlesner2017-02-044-110/+159
| * | | | | | Pica/Texture: Simplify/cleanup texture tile addressingYuri Kunde Schlesner2017-02-045-44/+117
| * | | | | | VideoCore: Move LookupTexture out of debug_utils.hYuri Kunde Schlesner2017-02-049-308/+350
* | | | | | | changed the WIN32 macro in microprofileui (#2528)noah the goodra2017-02-041-1/+1
|/ / / / / /
* | | | | | Merge pull request #2496 from mailwl/cfg-memYuri Kunde Schlesner2017-02-041-5/+8
|\ \ \ \ \ \
| * | | | | | Core: update Kernel Config Memory to latest version (11.2)mailwl2017-01-301-5/+8
* | | | | | | Merge pull request #2520 from wwylele/shader-stack-boundaryYuri Kunde Schlesner2017-02-041-2/+5
|\ \ \ \ \ \ \
| * | | | | | | ShaderJIT: add 16 dummy bytes at the bottom of the stackwwylele2017-02-031-2/+5
* | | | | | | | Merge pull request #2518 from MerryMage/coprocYuri Kunde Schlesner2017-02-047-15/+140
|\ \ \ \ \ \ \ \
| * | | | | | | | arm_dynarmic: Update memory interfaceMerryMage2017-02-032-10/+10
| * | | | | | | | arm_dynarmic: CP15 supportMerryMage2017-02-037-5/+130
| | |_|_|_|_|_|/ | |/| | | | | |
* | | | | | | | Merge pull request #2509 from jfmherokiller/settingscastpatchbunnei2017-02-031-1/+1
|\ \ \ \ \ \ \ \
| * | | | | | | | removed the possibly uneeded cast on values.gdbstub_portnoah the goodra2017-01-311-1/+1
| | |/ / / / / / | |/| | | | | |
* | | | | | | | Merge pull request #2507 from jfmherokiller/keyidchangebunnei2017-02-031-1/+0
|\ \ \ \ \ \ \ \
| * | | | | | | | removal of the -1 case in the configure_input switchnoah the goodra2017-01-311-1/+0
| |/ / / / / / /
* / / / / / / / GSP_GPU::StoreDataCache stubbed (#2428)mailwl2017-02-031-1/+28
|/ / / / / / /
* | | | | | | HLE/Applets: Stub Mint (eShop) Applet (#2463)mailwl2017-01-314-0/+108
* | | | | | | Common/x64: remove legacy emitter and abi (#2504)Weiyi Wang2017-01-316-4202/+1
* | | | | | | shader_jit_x64_compiler: esi and edi should be persistent (#2500)Merry2017-01-311-0/+2
* | | | | | | file_util: Fixed implicit type conversion warning (#2503)noah the goodra2017-01-311-2/+2
|/ / / / / /
* / / / / / Support looping HLE audio (#2422)Jake Merdich2017-01-302-11/+35
|/ / / / /
* | | | | Merge pull request #2368 from wwylele/camera-2Yuri Kunde Schlesner2017-01-3014-172/+1520
|\ \ \ \ \
| * | | | | CAM: implement basic camera functions with a blank camerawwylele2017-01-1114-172/+1520
| | |/ / / | |/| | |
* | | | | Merge pull request #2429 from wwylele/auto-language-fixYuri Kunde Schlesner2017-01-301-36/+38
|\ \ \ \ \
| * | | | | CFG: override language setting on bootwwylele2017-01-191-36/+38
* | | | | | Merge pull request #2495 from Kloen/killing-warnings-chain-of-memoriesYuri Kunde Schlesner2017-01-302-3/+0
|\ \ \ \ \ \ | |_|_|/ / / |/| | | | |
| * | | | | video_core: gl_rasterizer_cache.cpp removed unused type aliasKloen2017-01-301-1/+0
| * | | | | video_core: gl_rasterizer.cpp removed unused type aliasKloen2017-01-301-2/+0
|/ / / / /
* | | | | Merge pull request #2494 from Kloen/killing-warnings-2-final-mixYuri Kunde Schlesner2017-01-301-1/+1
|\ \ \ \ \
| * | | | | core: inline CPU, 132 warnings fixed on GCCKloen2017-01-301-1/+1
* | | | | | Merge pull request #2492 from Kloen/killing-warnings-HD1.5ReMIXYuri Kunde Schlesner2017-01-305-0/+48
|\ \ \ \ \ \
| * | | | | | citra: add missing control paths for ResultStatus on rom load. Fix warning about unhandled enumeration values on OSXKloen2017-01-291-0/+20
| * | | | | | core: fix err_f.cpp warning about unhandled enumeration value on OSXKloen2017-01-291-0/+2
| * | | | | | core: fix savedata_archive.cpp warnings about unhandled enumeration values on OSXKloen2017-01-291-0/+12
| * | | | | | core: fix archive_sdmc.cpp warnings about unhandled enumeration value on OSXKloen2017-01-291-0/+12
| * | | | | | core: fix archive_extsavedata.cpp warning on OSXKloen2017-01-291-0/+2
| | |_|_|_|/ | |/| | | |
* | | | | | Merge pull request #2493 from Kloen/killing-warnings-final-mixYuri Kunde Schlesner2017-01-301-0/+7
|\ \ \ \ \ \ | |_|/ / / / |/| | | | |
| * | | | | video_core: silence unused-local-typedef boost related warning on GCCKloen2017-01-291-0/+7
| |/ / / /
* | | | | Merge pull request #2491 from Kloen/killing-warnings-2.5HDRemixYuri Kunde Schlesner2017-01-291-6/+6
|\ \ \ \ \ | |/ / / / |/| | | |
| * | | | core: emu_window.cpp, fix conversion warnings from float to s16 on MSVCKloen2017-01-291-6/+6
|/ / / /
* | | | Merge pull request #2485 from Kloen/killing-warnings-computehash64Yuri Kunde Schlesner2017-01-282-6/+7
|\ \ \ \
| * | | | common: add <cstddef> to hash.hKloen2017-01-281-0/+1
| * | | | common: switch ComputeHash64 len param to size_t instead of int, fix warning on MSVC on dsp_dsp.cppKloen2017-01-282-6/+6
* | | | | Merge pull request #2484 from Kloen/killing-warnings-nihstroYuri Kunde Schlesner2017-01-281-0/+0
|\ \ \ \ \ | |/ / / / |/| | | |
| * | | | externals: Updated nihstro to latest master. Fix warning on MSVCKloen2017-01-281-0/+0
|/ / / /
* | | | Merge pull request #2478 from jfmherokiller/masterJames Rowe2017-01-271-1/+1
|\ \ \ \
| * | | | fixed the override warningnoah the goodra2017-01-271-1/+1
|/ / / /
* | | | Merge pull request #2346 from yuriks/shader-refactor2Yuri Kunde Schlesner2017-01-2713-1110/+1189
|\ \ \ \
| * | | | VideoCore/Shader: Move entry_point to SetupBatchYuri Kunde Schlesner2017-01-267-29/+29
| * | | | VideoCore/Shader: Move per-batch ShaderEngine state into ShaderSetupYuri Kunde Schlesner2017-01-267-46/+43
| * | | | Shader: Remove OutputRegisters structYuri Kunde Schlesner2017-01-264-22/+17
| * | | | Shader: Initialize conditional_code in interpreterYuri Kunde Schlesner2017-01-262-3/+3
| * | | | Shader: Don't read ShaderSetup from global stateYuri Kunde Schlesner2017-01-261-3/+3
| * | | | shader_jit_x64: Don't read program from global stateYuri Kunde Schlesner2017-01-263-22/+22
| * | | | VideoCore/Shader: Move ProduceDebugInfo to InterpreterEngineYuri Kunde Schlesner2017-01-265-19/+11
| * | | | Debugger: Always use interpreter for shader debuggingYuri Kunde Schlesner2017-01-261-3/+5
| * | | | VideoCore/Shader: Split interpreter and JIT into separate ShaderEnginesYuri Kunde Schlesner2017-01-268-97/+153
| * | | | VideoCore/Shader: Rename shader_jit_x64{ => _compiler}.{cpp,h}Yuri Kunde Schlesner2017-01-264-4/+4
| * | | | VideoCore/Shader: Split shader uniform state and shader engineYuri Kunde Schlesner2017-01-265-22/+57
| * | | | VideoCore/Shader: Add constness to methodsYuri Kunde Schlesner2017-01-262-4/+4
| * | | | VideoCore/Shader: Use only entry_point as ShaderSetup paramYuri Kunde Schlesner2017-01-264-12/+14
| * | | | VideoCore/Shader: Use self instead of g_state.vs in ShaderSetupYuri Kunde Schlesner2017-01-263-13/+9
| * | | | VideoCore/Shader: Extract input vertex loading code into functionYuri Kunde Schlesner2017-01-263-22/+26
* | | | | SDL: Select audio device (#2403)Kloen Lansfiel2017-01-2614-18/+129
|/ / / /
* | | | Merge pull request #2434 from mailwl/nfc-amiiboYuri Kunde Schlesner2017-01-264-20/+249
|\ \ \ \
| * | | | Service/NFC: stub some functionsmailwl2017-01-144-20/+249
* | | | | Merge pull request #2469 from Kloen/killing-warningsYuri Kunde Schlesner2017-01-254-8/+9
|\ \ \ \ \
| * | | | | video_core: fix shader.cpp signed / unsigned warningKloen2017-01-231-2/+2
| * | | | | video_core: gl_rasterizer float to int warningKloen2017-01-231-1/+2
| * | | | | video_core: fix gl_rasterizer warning on MSVCKloen2017-01-231-1/+1
| * | | | | core: fix mic_u warnings on MSVCKloen2017-01-231-4/+4
| | |_|_|/ | |/| | |
* / | | | github: fixed issue template forum links (#2470)Kloen Lansfiel2017-01-241-2/+2
|/ / / /
* | | | Changed FAQ link (#2462)3dsemu2017-01-231-1/+1
* | | | Merge pull request #2466 from Kloen/we-dont-need-thisbunnei2017-01-2315-2385/+2
|\ \ \ \
| * | | | Removed unused and outdated external qhexeditKloen2017-01-2213-2353/+2
| * | | | citra-qt: Removed unused and unimplemented ramview files.Kloen2017-01-224-32/+0
|/ / / /
* | | | Merge pull request #2458 from wwylele/reset-accel-gyrobunnei2017-01-211-0/+2
|\ \ \ \
| * | | | HID: reset acceleroeter and gyroscope index in Initwwylele2017-01-201-0/+2
* | | | | Merge pull request #2459 from 3ds-emu/patch-1bunnei2017-01-211-1/+2
|\ \ \ \ \ | |/ / / / |/| | | |
| * | | | Updated Citra forum link3ds-emu2017-01-211-1/+2
|/ / / /
* | | | Merge pull request #2450 from Xtansia/masterYuri Kunde Schlesner2017-01-191-9/+25
|\ \ \ \
| * | | | loader: Add support for 3DSX special relocation types, fixes citra-emu/citra#2449Thomas Farr2017-01-181-9/+25
|/ / / /
* | | | Merge pull request #2442 from wwylele/hid-signalYuri Kunde Schlesner2017-01-165-64/+96
|\ \ \ \ | |/ / / |/| | |
| * | | CoreTiming: use named constant for ARM11 clock ratewwylele2017-01-164-5/+6
| * | | HID: manages updating itself using correct tickswwylele2017-01-163-62/+93
|/ / /
* | | Merge pull request #2435 from mailwl/gsp-maskYuri Kunde Schlesner2017-01-141-1/+1
|\ \ \
| * | | GSP::WriteHWRegsWithMask: fix register maskmailwl2017-01-141-1/+1
|/ / /
* | | Merge pull request #2423 from Kloen/floats-should-be-floatbunnei2017-01-131-1/+2
|\ \ \ | |/ / |/| |
| * | SDL2: Config.cpp fix double to float warningKloen2017-01-111-1/+2
* | | Merge pull request #2424 from Kloen/qt-ui-warnings-reallybunnei2017-01-123-24/+23
|\ \ \
| * | | QT: Fix ui file formatKloen2017-01-111-20/+20
| * | | QT: Fix some UI related warningsKloen2017-01-112-4/+3
| |/ /
* | | Merge pull request #2425 from Subv/cleanup_todosbunnei2017-01-124-32/+30
|\ \ \
| * | | Threads: Check the process' resource limit for the max allowed priority when creating a thread and remove the priority clamping code.Subv2017-01-112-13/+9
| * | | Thread: Added priority range checking to svcSetThreadPriority and removed priority clamping code from Thread::SetPriority.Subv2017-01-113-18/+18
| * | | Y2R: Use the proper error code when GetStandardCoefficient receives an invalid value.Subv2017-01-111-1/+3
| |/ /
* | | Merge pull request #2308 from mailwl/ac-ibunnei2017-01-129-297/+424
|\ \ \ | |/ / |/| |
| * | Service/AC: add ac:i servicemailwl2016-12-309-297/+424
* | | Merge pull request #2397 from Subv/pulsebunnei2017-01-105-13/+20
|\ \ \
| * | | Kernel: Implemented Pulse event and timers.Subv2017-01-055-13/+20
* | | | Merge pull request #2418 from jroweboy/appveyor_masterJames Rowe2017-01-081-0/+1
|\ \ \ \
| * | | | Prevents appveyor from attempting to deploy except on the nightly repoJames Rowe2017-01-081-0/+1
|/ / / /
* | | | Merge pull request #2384 from bunnei/internal-res-optionbunnei2017-01-0810-25/+170
|\ \ \ \
| * | | | config: Add option for specifying screen resolution scale factor.bunnei2017-01-0710-25/+170
* | | | | Merge pull request #1951 from wwylele/motion-sensorbunnei2017-01-0714-16/+321
|\ \ \ \ \ | |/ / / / |/| | | |
| * | | | Frontend: make motion sensor interfaced thread-safewwylele2016-12-292-2/+8
| * | | | Frontend: emulate motion sensorwwylele2016-12-269-16/+239
| * | | | Common: add Quaternionwwylele2016-12-262-0/+45
| * | | | vector math: add implementation of Length and Normalizewwylele2016-12-261-0/+19
| * | | | MathUtil: add PI constantwwylele2016-12-261-0/+2
| * | | | Common::Event: add WaitUntilwwylele2016-12-261-0/+10
| | |_|/ | |/| |
* | | | Merge pull request #2410 from Subv/sleepthreadbunnei2017-01-073-0/+14
|\ \ \ \
| * | | | Kernel: Don't attempt to yield execution in SleepThread(0) if there are no available threads to run.Subv2017-01-063-0/+14
* | | | | Merge pull request #2396 from Subv/sema_acquirebunnei2017-01-071-1/+2
|\ \ \ \ \
| * | | | | Kernel/Semaphore: Fixed a regression in semaphore waits.Subv2017-01-051-1/+2
| |/ / / /
* | | | | Kernel: Fix SharedMemory objects always returning error when addr = 0 (#2404)Hyper2017-01-061-1/+5
* | | | | Merge pull request #2408 from Subv/priority_boostingbunnei2017-01-061-27/+0
|\ \ \ \ \
| * | | | | Kernel: Removed the priority boost code for starved threads.Subv2017-01-051-27/+0
| |/ / / /
* | | | | Merge pull request #2409 from Subv/unused_funcsSebastian Valle2017-01-052-32/+0
|\ \ \ \ \ | |/ / / / |/| | | |
| * | | | Kernel: Remove some unused functions.Subv2017-01-052-32/+0
|/ / / /
* | | | Merge pull request #2393 from Subv/synchSebastian Valle2017-01-0518-162/+227
|\ \ \ \
| * | | | Kernel: Add some asserts to enforce the invariants in the scheduler.Subv2017-01-052-2/+13
| * | | | Kernel: Remove a thread from all of its waiting objects' waiting_threads list when it is awoken.Subv2017-01-051-18/+4
| * | | | Kernel: Remove Thread::wait_objects_index and use wait_objects to hold all the objects that a thread is waiting on.Subv2017-01-054-21/+22
| * | | | Kernel: Use different thread statuses when a thread calls WaitSynchronization1 and WaitSynchronizationN with wait_all = true.Subv2017-01-044-19/+26
| * | | | Kernel/Mutex: Propagate thread priority changes to other threads inheriting the priority via mutexesSubv2017-01-045-42/+60
| * | | | Kernel/Mutex: Update a mutex priority when a thread stops waiting on it.Subv2017-01-045-24/+42
| * | | | Kernel/Mutex: Implemented priority inheritance.Subv2017-01-045-31/+51
| * | | | Kernel: Object ShouldWait and Acquire calls now take a thread as a parameter.Subv2017-01-0417-68/+56
| * | | | Kernel/Synch: Do not attempt a reschedule on every syscall.Subv2017-01-042-2/+18
* | | | | Merge pull request #2407 from jroweboy/nightly-deployJames Rowe2017-01-052-2/+7
|\ \ \ \ \
| * | | | | Change travis to deploy on push to citra-nightly. Add more information to the releases pageJames Rowe2017-01-052-2/+7
|/ / / / /
* | | | | Merge pull request #2405 from jroweboy/nightly-deployJames Rowe2017-01-054-42/+14
|\ \ \ \ \
| * | | | | Change deploy to use github releases instead, but only for the citra-nightly repoJames Rowe2017-01-054-42/+14
|/ / / / /
* | | | | Fix some warnings (#2399)Jonathan Hao2017-01-0413-35/+9
* | | | | Update .travis.ymlbunnei2017-01-041-1/+1
* | | | | Merge pull request #2401 from jroweboy/travis-keyJames Rowe2017-01-041-1/+1
|\ \ \ \ \
| * | | | | Try a different travis keyJames Rowe2017-01-041-1/+1
|/ / / / /
* | | | | Merge pull request #2382 from mailwl/nfcYuri Kunde Schlesner2017-01-037-0/+44
|\ \ \ \ \ | |_|_|/ / |/| | | |
| * | | | Service/NFC: stub GetTagInRangeEventmailwl2016-12-307-0/+44
| | |_|/ | |/| |
* | | | Merge pull request #2390 from jroweboy/bintrayJames Rowe2017-01-012-2/+3
|\ \ \ \ | | |/ / | |/| |
| * | | Try a different encrypted bintray api key for travis. Change appveyor to upload to a long git hash (since travis is stuck uploading to the full hash name)James Rowe2017-01-012-2/+3
* | | | Merge pull request #2254 from jroweboy/bintrayJames Rowe2017-01-016-51/+86
|\| | |
| * | | Trying to make a consistent nightly versioningJames Rowe2017-01-012-2/+4
| * | | Add deploy to bintray for builds to masterJames Rowe2016-12-316-51/+84
|/ / /
* | | Merge pull request #2386 from bunnei/fix-bg-colorSebastian Valle2016-12-301-6/+6
|\ \ \ | |/ / |/| |
| * | config: SDL: Move background color setting to correct section.bunnei2016-12-301-6/+6
* | | Merge pull request #2240 from wwylele/auto-regionbunnei2016-12-3011-7/+108
|\ \ \ | |/ / |/| |
| * | Config: auto-select region and languagewwylele2016-12-0711-7/+108
* | | Merge pull request #2367 from JayFoxRox/lighting-lut-quickfixbunnei2016-12-291-10/+9
|\ \ \
| * | | Minor cleanup in GLSL codeJannik Vogel2016-12-251-3/+2
| * | | Offset lighting LUT samples correctlyJannik Vogel2016-12-251-7/+7
* | | | Merge pull request #2376 from wwylele/remove-unusedbunnei2016-12-271-58/+0
|\ \ \ \
| * | | | Core: remove unused hle.cppwwylele2016-12-271-58/+0
|/ / / /
* | | | Merge pull request #2374 from wwylele/whats-going-on-with-that-prbunnei2016-12-271-0/+1
|\ \ \ \ | |_|_|/ |/| | |
| * | | Core: reset cpu_core in Shutdown to make IsPoweredOn work properlywwylele2016-12-241-0/+1
|/ / /
* | | Merge pull request #2369 from MerryMage/core-frontendbunnei2016-12-2314-16/+16
|\ \ \
| * | | core: Move emu_window and key_map into coreMerryMage2016-12-2314-16/+16
* | | | Merge pull request #2370 from wwylele/where-is-my-shared-fontYuri Kunde Schlesner2016-12-231-3/+1
|\ \ \ \ | |/ / / |/| | |
| * | | file_util: fix missing sysdata pathwwylele2016-12-231-3/+1
| |/ /
* | | Merge pull request #2364 from mailwl/nwm-servicesbunnei2016-12-2318-10/+317
|\ \ \ | |/ / |/| |
| * | Service/NWM: add nwm servicesmailwl2016-12-2218-10/+317
|/ /
* | Merge pull request #2366 from MerryMage/MemoryReadCodebunnei2016-12-222-0/+1
|\ \
| * | arm_dynarmic: Provide MemoryReadCode callbackMerryMage2016-12-222-0/+1
* | | Merge pull request #2343 from bunnei/core-cleanupbunnei2016-12-2245-591/+435
|\ \ \ | |/ / |/| |
| * | ThreadContext: Move from "core" to "arm_interface".bunnei2016-12-228-37/+26
| * | core: Replace "AppCore" nomenclature with just "CPU".bunnei2016-12-2211-105/+103
| * | Address clang-format issues.bunnei2016-12-228-49/+49
| * | core: Remove HLE module, consolidate code & various cleanups.bunnei2016-12-2219-107/+94
| * | core: Consolidate core and system state, remove system module & cleanups.bunnei2016-12-2222-336/+284
| * | file_util: Remove unused paths.bunnei2016-12-223-87/+3
| * | core: Consolidate top-level system state into a singleton.bunnei2016-12-228-103/+164
| * | loader: Remove duplicate docstrings.bunnei2016-12-223-56/+0
* | | Merge pull request #2285 from mailwl/csnd-formatbunnei2016-12-224-49/+94
|\ \ \
| * | | csnd:SND reformat source codemailwl2016-12-124-49/+94
* | | | Merge pull request #2361 from lioncash/disasmbunnei2016-12-221-3/+1
|\ \ \ \ | |_|/ / |/| | |
| * | | disassembler: Remove mutable specifier from breakpoints member variableLioncash2016-12-211-3/+1
* | | | Merge pull request #2362 from lioncash/graphicsbunnei2016-12-2217-32/+32
|\ \ \ \ | |/ / / |/| | |
| * | | citra-qt: Move graphics debugging code into its own folderLioncash2016-12-2117-32/+32
|/ / /
* | | Merge pull request #2319 from yuriks/profile-scopesbunnei2016-12-212-0/+15
|\ \ \
| * | | VideoCore: Make profiling scope more representativeYuri Kunde Schlesner2016-12-152-0/+15
* | | | Merge pull request #2357 from lioncash/uibunnei2016-12-212-67/+100
|\ \ \ \
| * | | | citra-qt: Move bits of constructor behavior to named functionsLioncash2016-12-192-67/+100
* | | | | Merge pull request #2356 from Chainsawkitten/GLbooleanbunnei2016-12-211-4/+4
|\ \ \ \ \ | |/ / / / |/| | | |
| * | | | Use GL_TRUE when setting color_maskAlbin Bernhardsson2016-12-191-4/+4
|/ / / /
* | | | Merge pull request #2318 from yuriks/trace-optbunnei2016-12-193-16/+15
|\ \ \ \
| * | | | VideoCore: Inline IsPicaTracingYuri Kunde Schlesner2016-12-153-16/+15
| |/ / /
* | | | Merge pull request #2351 from CaptV0rt3x/masterbunnei2016-12-181-0/+1
|\ \ \ \
| * | | | Fixed game_list focusing issue.Vamsi Krishna2016-12-181-0/+1
* | | | | Merge pull request #2347 from citra-emu/revert-2321-flush-pagesbunnei2016-12-181-10/+0
|\ \ \ \ \
| * | | | | Revert "Memory: Always flush whole pages from surface cache"bunnei2016-12-181-10/+0
| |/ / / /
* | | | | Merge pull request #2353 from CaptV0rt3x/code-cleanupbunnei2016-12-183-7/+2
|\ \ \ \ \ | |/ / / / |/| | | |
| * | | | line fixup for travis ciCaptV0rt3x2016-12-181-1/+0
| * | | | screen swap - Hotkey mappingVamsi Krishna2016-12-182-5/+1
| * | | | Fixed GPLv2 license text in the start.Vamsi Krishna2016-12-181-1/+1
|/ / / /
* | | | Merge pull request #2345 from wwylele/no-zombie-threadbunnei2016-12-173-3/+15
|\ \ \ \
| * | | | Thread: remove the thread from the thread list when exitingwwylele2016-12-173-3/+15
|/ / / /
* | | | Merge pull request #2335 from yuriks/shader-refactorYuri Kunde Schlesner2016-12-179-338/+336
|\ \ \ \
| * | | | VideoCore/Shader: Extract DebugData out from UnitStateYuri Kunde Schlesner2016-12-168-103/+99
| * | | | Remove unnecessary castYuri Kunde Schlesner2016-12-161-3/+1
| * | | | VideoCore/Shader: Extract evaluate_condition lambda to function scopeYuri Kunde Schlesner2016-12-161-26/+24
| * | | | VideoCore/Shader: Extract call lambda up a scope and remove unused paramYuri Kunde Schlesner2016-12-161-21/+17
| * | | | VideoCore/Shader: Remove dynamic control flow in (Get)UniformOffsetYuri Kunde Schlesner2016-12-162-18/+11
| * | | | VideoCore/Shader: Move DebugData to a separate fileYuri Kunde Schlesner2016-12-164-172/+189
* | | | | Merge pull request #2303 from freiro/citra-qt_missing_sdl2_dllbunnei2016-12-165-30/+33
|\ \ \ \ \
| * | | | | Modularized Qt and SDL file copyingfreiro2016-12-134-14/+16
| * | | | | Modularization of copy_msvc_libraries cmake functfreiro2016-12-113-20/+22
| * | | | | Removed redundant Qt check and other fixesfreiro2016-12-111-20/+19
| * | | | | [MSVC] Copy SDL2.dll to build folderfreiro2016-12-111-20/+20
* | | | | | Merge pull request #2337 from lioncash/gdbbunnei2016-12-161-9/+8
|\ \ \ \ \ \
| * | | | | | gdbstub: const correctness changesLioncash2016-12-161-9/+8
| | |/ / / / | |/| | | |
* | | | | | Merge pull request #2322 from MerryMage/ctx-mnuMerry2016-12-1610-4/+87
|\ \ \ \ \ \
| * | | | | | main: Open folder when open save folder location context menu is clickedMerryMage2016-12-152-0/+20
| * | | | | | game_list: Implement context menu for items in listMerryMage2016-12-153-4/+32
| * | | | | | loader: Implement ReadProgramIdMerryMage2016-12-153-0/+28
| * | | | | | archive_source_sd_savedata: Add static method to get a specific save data pathMerryMage2016-12-152-0/+7
* | | | | | | Merge pull request #2338 from wwylele/fix-deadSebastian Valle2016-12-161-1/+2
|\ \ \ \ \ \ \ | |_|/ / / / / |/| | | | | |
| * | | | | | Kernel: remove object's waiting thread if it is deadwwylele2016-12-161-1/+2
|/ / / / / /
* | | | | | Merge pull request #2260 from Subv/schedulingbunnei2016-12-168-196/+211
|\ \ \ \ \ \
| * | | | | | Fixed the codestyle to match our clang-format rules.Subv2016-12-144-28/+41
| * | | | | | Properly remove a thread from its wait_objects' waitlist when it is awoken by a timeout.Subv2016-12-103-2/+11
| * | | | | | WaitSynch: Removed unused variables and reduced SharedPtr copies.Subv2016-12-095-74/+57
| * | | | | | Use boost remove_erase_if instead of the erase-remove idiomSubv2016-12-071-2/+3
| * | | | | | Improved the algorithm for GetHighestPriorityReadyThread.Subv2016-12-071-14/+13
| * | | | | | Threading: Added some utility functions and const correctness.Subv2016-12-044-16/+36
| * | | | | | Threading: Reworked the way our scheduler works.Subv2016-12-048-190/+180
* | | | | | | Merge pull request #2316 from endrift/macos-gccbunnei2016-12-161-0/+11
|\ \ \ \ \ \ \
| * | | | | | | Common: Fix gcc build on macOSJeffrey Pfau2016-12-131-0/+11
| | |/ / / / / | |/| | | | |
* | | | | | | Merge pull request #2328 from wwylele/fix-traceYuri Kunde Schlesner2016-12-161-11/+9
|\ \ \ \ \ \ \
| * | | | | | | FS: fix debug build from #2249wwylele2016-12-151-11/+9
* | | | | | | | Merge pull request #2332 from lioncash/gdbYuri Kunde Schlesner2016-12-165-16/+23
|\ \ \ \ \ \ \ \
| * | | | | | | | gdbstub: Remove global variable from public interfaceLioncash2016-12-155-16/+23
* | | | | | | | | Merge pull request #2320 from mailwl/cecd-updateYuri Kunde Schlesner2016-12-168-13/+81
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | Service/CECD: Add cecd:ndm servicemailwl2016-12-158-13/+81
| | |_|_|_|_|/ / / | |/| | | | | | |
* | | | | | | | | Merge pull request #2331 from lioncash/truncbunnei2016-12-151-1/+2
|\ \ \ \ \ \ \ \ \ | |_|/ / / / / / / |/| | | | | | | |
| * | | | | | | | hid: Get rid of a double -> float truncation warningLioncash2016-12-151-1/+2
| | |/ / / / / / | |/| | | | | |
* | | | | | | | Merge pull request #2330 from lioncash/pragmaSebastian Valle2016-12-153-0/+6
|\ \ \ \ \ \ \ \
| * | | | | | | | core: Add missing #pragma once directives where applicableLioncash2016-12-153-0/+6
| |/ / / / / / /
* | | | | | | | Merge pull request #2327 from lioncash/typobunnei2016-12-151-1/+1
|\ \ \ \ \ \ \ \ | |/ / / / / / / |/| | | | | | |
| * | | | | | | act: Fix docstring typoLioncash2016-12-151-1/+1
|/ / / / / / /
* | | | | | | Merge pull request #2325 from yuriks/fix-indexYuri Kunde Schlesner2016-12-151-1/+1
|\ \ \ \ \ \ \
| * | | | | | | shader_jit_x64: Use LOOPCOUNT_REG as a 64-bit reg when indexingYuri Kunde Schlesner2016-12-151-1/+1
* | | | | | | | Merge pull request #2314 from mailwl/accountbunnei2016-12-158-10/+44
|\ \ \ \ \ \ \ \ | |/ / / / / / / |/| | | | | | |
| * | | | | | | Service/ACT: move ACT services to foldermailwl2016-12-148-10/+44
* | | | | | | | Merge pull request #2321 from yuriks/flush-pagesbunnei2016-12-151-0/+10
|\ \ \ \ \ \ \ \ | |_|/ / / / / / |/| | | | | | |
| * | | | | | | Memory: Always flush whole pages from surface cacheYuri Kunde Schlesner2016-12-151-0/+10
|/ / / / / / /
* | | | | | | Merge pull request #2317 from yuriks/vertex-copySebastian Valle2016-12-153-5/+3
|\ \ \ \ \ \ \
| * | | | | | | VideoCore: Eliminate an unnecessary copy in the drawcall loopYuri Kunde Schlesner2016-12-153-5/+3
|/ / / / / / /
* | | | | | | Merge pull request #2309 from yuriks/shader-jit-xbyakYuri Kunde Schlesner2016-12-1511-224/+475
|\ \ \ \ \ \ \
| * | | | | | | shader_jit_x64: Use Reg32 for LOOP* registers, eliminating castsYuri Kunde Schlesner2016-12-151-16/+16
| * | | | | | | VideoCore: Convert x64 shader JIT to use Xbyak for assemblyYuri Kunde Schlesner2016-12-156-224/+462
| * | | | | | | Externals: Add XbyakYuri Kunde Schlesner2016-12-154-0/+13
| * | | | | | | externals: Update DynarmicYuri Kunde Schlesner2016-12-151-0/+0
| | |/ / / / / | |/| | | | |
* | | | | | | Merge pull request #2249 from Subv/sessions_v3Yuri Kunde Schlesner2016-12-1525-171/+591
|\ \ \ \ \ \ \ | |/ / / / / / |/| | | | | |
| * | | | | | Fixed the codestyle to match our clang-format rules.Subv2016-12-1416-68/+108
| * | | | | | Moved the HLE command buffer translation task to ServerSession instead of the HLE handler superclass.Subv2016-12-096-47/+38
| * | | | | | Kernel/IPC: Small codestyle cleanupSubv2016-12-092-3/+1
| * | | | | | Added a framework for partially handling Session disconnections.Subv2016-12-088-9/+67
| * | | | | | Use std::move where appropriate.Subv2016-12-0812-177/+187
| * | | | | | Return an error code when connecting to a saturated port.Subv2016-12-055-7/+20
| * | | | | | HLE: Use a member variable instead of a virtual function to retrieve the max number of sessions that can be connected to an HLE service at the same time.Subv2016-12-055-8/+18
| * | | | | | Split SessionRequestHandler::HandleSyncRequest into HandleSyncRequest, TranslateRequest and HandleSyncRequestImpl.Subv2016-12-056-22/+59
| * | | | | | Kernel: Remove the Redirection handle type.Subv2016-12-051-2/+0
| * | | | | | KServerPorts now have an HLE handler "template", which is inherited by all ServerSessions created from it.Subv2016-12-0512-69/+86
| * | | | | | Declare empty ServerSession and ClientSession constructors as default.Subv2016-12-032-4/+4
| * | | | | | Threads do not wait for the server endpoint to call AcceptSession before returning from a ConnectToPort or GetServiceHandle call.Subv2016-12-012-3/+5
| * | | | | | Fixed the rebase mistakes.Subv2016-12-0111-83/+76
| * | | | | | A bit of a redesign.Subv2016-12-0113-263/+266
| * | | | | | IPC/HLE: Associate the ClientSessions with their parent port's HLE interface if it exists.Subv2016-12-016-26/+21
| * | | | | | Kernel/HLE: Service::Interface no longer inherits from any Kernel object, and is now its own standalone class.Subv2016-12-014-24/+52
| * | | | | | fixup! Kernel/IPC: Use Ports and Sessions as the fundamental building block of Inter Process Communication.Subv2016-12-014-5/+6
| * | | | | | Kernel/IPC: Use Ports and Sessions as the fundamental building block of Inter Process Communication.Subv2016-12-0116-88/+314
* | | | | | | Merge pull request #2166 from endrift/clang-detectSebastian Valle2016-12-131-2/+4
|\ \ \ \ \ \ \ | |_|/ / / / / |/| | | | | |
| * | | | | | CMakeLists: Autodetect clang and only then use libc++Jeffrey Pfau2016-12-131-2/+4
|/ / / / / /
* | | | | | Merge pull request #2315 from JamePeng/fix-gsp_gpu-codeSebastian Valle2016-12-131-3/+5
|\ \ \ \ \ \
| * | | | | | Minor amendment of GSP_GPU::ImportDisplayCaptureInfo codeJamePeng2016-12-131-3/+5
|/ / / / / /
* | | | | | Merge pull request #2312 from lioncash/guardYuri Kunde Schlesner2016-12-131-0/+2
|\ \ \ \ \ \ | |_|_|_|/ / |/| | | | |
| * | | | | time_stretch: Add missing #pragma once directiveLioncash2016-12-131-0/+2
* | | | | | Merge pull request #2275 from jbeich/pthreadSebastian Valle2016-12-111-1/+1
|\ \ \ \ \ \
| * | | | | | tests: add missing libcore dependency after 75ee2f8c6702Jan Beich2016-12-071-1/+1
| | |_|_|_|/ | |/| | | |
* | | | | | Merge pull request #2267 from JayFoxRox/fix-mingw-ccSebastian Valle2016-12-119-10/+11
|\ \ \ \ \ \
| * | | | | | gdbstub: Remove unused includeJannik Vogel2016-12-051-1/+0
| * | | | | | Unify Windows ICON resource nameJannik Vogel2016-12-052-2/+2
| * | | | | | Support mingw cross-compileJannik Vogel2016-12-059-9/+11
* | | | | | | Merge pull request #2154 from mailwl/apt-getstartupargumentSebastian Valle2016-12-112-5/+11
|\ \ \ \ \ \ \
| * | | | | | | APT::GetStartupArgument: force clear startup argumentmailwl2016-12-112-5/+11
|/ / / / / / /
* | | / / / / citra-qt: Make constructors explicit where applicableLioncash2016-12-1115-32/+35
| |_|/ / / / |/| | | | |
* | | | | | citra-qt: Add missing #pragma once directivesLioncash2016-12-115-0/+10
* | | | | | game_list: Make slots private functionsLioncash2016-12-111-7/+4
* | | | | | game_list: Make the constructor explicitLioncash2016-12-111-1/+1
* | | | | | game_list: Make the AddEntry argument a const referenceLioncash2016-12-112-2/+2
* | | | | | game_list: Replace 0 literals with nullptrLioncash2016-12-111-1/+1
* | | | | | game_list: Use QT5's new event connection syntaxLioncash2016-12-111-6/+6
* | | | | | game_list: Pass the parent constructor argument to the QWidget base classLioncash2016-12-111-1/+1
| |_|_|_|/ |/| | | |
* | | | | Merge pull request #2300 from lioncash/qtYuri Kunde Schlesner2016-12-111-18/+24
|\ \ \ \ \
| * | | | | graphics_cmdlists: Get rid of variable shadowingLioncash2016-12-111-14/+18
| * | | | | graphics_cmdlists: Get rid of an unused variableLioncash2016-12-111-1/+0
| * | | | | graphics_cmdlists: Make LoadTexture and TextureInfoWidget src arguments constLioncash2016-12-111-3/+4
| * | | | | graphics_cmdlists: Make LoadImage internally linkedLioncash2016-12-111-0/+2
* | | | | | Core: Add a forgotten #include <cstring> for memcpy.Emmanuel Gil Peyrot2016-12-111-0/+1
|/ / / / /
* | | | | Add all services to the Service namespaceLioncash2016-12-1150-499/+408
* | | | | configure_input: Modernize and cleanup input configuration tabMerryMage2016-12-112-115/+101
* | | | | Merge pull request #2296 from MerryMage/auto_is_autoYuri Kunde Schlesner2016-12-101-12/+7
|\ \ \ \ \
| * | | | | audio_core: SelectSink should default to auto if sink_id is invalidMerryMage2016-12-101-12/+7
* | | | | | Merge pull request #2291 from lioncash/svcbunnei2016-12-0910-12/+61
|\ \ \ \ \ \
| * | | | | | service: Add cfg:nor serviceLioncash2016-12-094-0/+49
| * | | | | | service: Drop '_Interface' from cfg service namesLioncash2016-12-097-12/+12
* | | | | | | Merge pull request #2292 from lioncash/boolYuri Kunde Schlesner2016-12-091-1/+1
|\ \ \ \ \ \ \
| * | | | | | | ptm: Use boolean instead of integral valueLioncash2016-12-091-1/+1
* | | | | | | | Merge pull request #2202 from j-selby/man-docsYuri Kunde Schlesner2016-12-093-0/+101
|\ \ \ \ \ \ \ \ | |_|/ / / / / / |/| | | | | | |
| * | | | | | | Add man documentationJames2016-11-263-0/+101
* | | | | | | | Merge pull request #2287 from lioncash/svcYuri Kunde Schlesner2016-12-0912-12/+170
|\ \ \ \ \ \ \ \
| * | | | | | | | service: Add the ptm:s serviceLioncash2016-12-083-0/+14
| * | | | | | | | service: Add common ptm:u commands to other ptm servicesLioncash2016-12-084-0/+54
| * | | | | | | | service: Drop '_Interface' in ptm service class namesLioncash2016-12-087-14/+14
| * | | | | | | | service: Add ptm::gets and ptm::sets servicesLioncash2016-12-086-0/+90
* | | | | | | | | Merge pull request #2280 from Subv/citrace_sizeSebastian Valle2016-12-081-2/+2
|\ \ \ \ \ \ \ \ \ | |/ / / / / / / / |/| | | | | | | |
| * | | | | | | | Fixed the gpu command list size when creating CiTraces.Subv2016-12-081-2/+2
| | |_|_|/ / / / | |/| | | | | |
* | | | | | | | Merge pull request #2286 from lioncash/svcYuri Kunde Schlesner2016-12-0814-0/+271
|\ \ \ \ \ \ \ \
| * | | | | | | | service: Add mvd and qtm servicesLioncash2016-12-0814-0/+271
* | | | | | | | | Merge pull request #2274 from degasus/masterYuri Kunde Schlesner2016-12-085-47/+8
|\ \ \ \ \ \ \ \ \ | |/ / / / / / / / |/| | | | | | | |
| * | | | | | | | OpenGL: Drop framebuffer completeness check.Markus Wick2016-12-075-47/+8
| | |_|_|_|/ / / | |/| | | | | |
* | | | | | | | Merge pull request #2284 from lioncash/svcYuri Kunde Schlesner2016-12-088-30/+199
|\ \ \ \ \ \ \ \
| * | | | | | | | service: Add nfc servicesLioncash2016-12-088-30/+199
* | | | | | | | | Merge pull request #2277 from lioncash/explicitYuri Kunde Schlesner2016-12-088-10/+10
|\ \ \ \ \ \ \ \ \ | |/ / / / / / / / |/| | | | | | | |
| * | | | | | | | file_sys: Make a few single-argument constructors explicitLioncash2016-12-078-10/+10
| |/ / / / / / /
* | | | | | | | Merge pull request #2283 from lioncash/svcYuri Kunde Schlesner2016-12-0821-28/+212
|\ \ \ \ \ \ \ \
| * | | | | | | | ssl_c: Update function tableLioncash2016-12-081-0/+3
| * | | | | | | | ptm: Update ptm_sysm function tableLioncash2016-12-083-6/+7
| * | | | | | | | pm_app: Update function tableLioncash2016-12-081-6/+9
| * | | | | | | | nwm_uds: Update function tableLioncash2016-12-081-5/+7
| * | | | | | | | nim: Update function tablesLioncash2016-12-082-0/+2
| * | | | | | | | http_c: Update function tableLioncash2016-12-081-0/+4
| * | | | | | | | gsp_lcd: Update function tableLioncash2016-12-081-0/+4
| * | | | | | | | fs_user: Update function tableLioncash2016-12-081-0/+2
| * | | | | | | | dlp_srvr: Update function tableLioncash2016-12-081-0/+7
| * | | | | | | | cfg: Update function tablesLioncash2016-12-083-0/+3
| * | | | | | | | cecd_u: Update function tableLioncash2016-12-081-1/+13
| * | | | | | | | boss_p: Update function tableLioncash2016-12-081-3/+68
| * | | | | | | | act: Update function tablesLioncash2016-12-082-0/+10
| * | | | | | | | apt: Update apt function tablesLioncash2016-12-082-7/+73
| | |_|_|/ / / / | |/| | | | | |
* | | | | | | | Merge pull request #2281 from lioncash/appletYuri Kunde Schlesner2016-12-088-30/+22
|\ \ \ \ \ \ \ \ | |/ / / / / / / |/| | | | | | |
| * | | | | | | applet: Move common IsRunning underlying variable to the Applet classLioncash2016-12-078-28/+19
| * | | | | | | applet: Make virtual destructor defaultedLioncash2016-12-071-1/+1
| * | | | | | | applet: Make constructor protectedLioncash2016-12-071-1/+2
* | | | | | | | Merge pull request #2282 from lioncash/svcMat M2016-12-086-113/+246
|\ \ \ \ \ \ \ \ | |_|/ / / / / / |/| | | | | | |
| * | | | | | | Update AM service function tablesLioncash2016-12-086-113/+246
|/ / / / / / /
* | | | | | | Merge pull request #2232 from wwylele/other-savebunnei2016-12-0711-80/+351
|\ \ \ \ \ \ \ | |/ / / / / / |/| | | | | |
| * | | | | | FileSys: Implement OtherSaveDatawwylele2016-11-297-0/+214
| * | | | | | FS: add missing MediaTypewwylele2016-11-291-1/+1
| * | | | | | FileSys: abstract SD save data archive sourcewwylele2016-11-296-79/+136
* | | | | | | Implement Frame rate limiter (#2223)emmauss2016-12-0610-0/+54
* | | | | | | Merge pull request #2264 from JayFoxRox/print-shaderYuri Kunde Schlesner2016-12-062-4/+14
|\ \ \ \ \ \ \
| * | | | | | | ASSERT that shader was linked successfullyJannik Vogel2016-12-051-0/+2
| * | | | | | | Report shader uniform block size in case of mismatchJannik Vogel2016-12-051-1/+3
| * | | | | | | Print broken shader code to logJannik Vogel2016-12-051-3/+9
|/ / / / / / /
* | | | | | | Merge pull request #2200 from j-selby/fix-mingw-crashYuri Kunde Schlesner2016-12-051-0/+3
|\ \ \ \ \ \ \ | |_|/ / / / / |/| | | | | |
| * | | | | | Disable Microprofile on Mingw buildsJames2016-12-051-0/+3
* | | | | | | Merge pull request #2269 from Subv/update_dynarmicYuri Kunde Schlesner2016-12-051-0/+0
|\ \ \ \ \ \ \ | |/ / / / / / |/| | | | | |
| * | | | | | Dynarmic: Update dynarmic to versionSubv2016-12-051-0/+0
| | |_|_|_|/ | |/| | | |
* | | | | | Merge pull request #2266 from yuriks/fix-displaytransferYuri Kunde Schlesner2016-12-044-19/+29
|\ \ \ \ \ \
| * | | | | | GSP: Downgrade log severity of SetAxiConfigQoSModeYuri Kunde Schlesner2016-12-041-1/+1
| * | | | | | OpenGL: Non-zero stride only makes sense for linear buffersYuri Kunde Schlesner2016-12-043-7/+11
| * | | | | | OpenGL: Ensure framebuffer binding is restored if completion check failsYuri Kunde Schlesner2016-12-041-10/+7
| * | | | | | OpenGL: Fix DisplayTransfer accel when input width != output widthYuri Kunde Schlesner2016-12-041-1/+10
|/ / / / / /
* | | | | | Merge pull request #2259 from JayFoxRox/fix-fallbackYuri Kunde Schlesner2016-12-041-1/+1
|\ \ \ \ \ \
| * | | | | | shader_jit: Fix non-SSE4.1 path where FLR would not truncateJannik Vogel2016-12-041-1/+1
* | | | | | | Merge pull request #2257 from citra-emu/fix-clang-formatYuri Kunde Schlesner2016-12-044-5/+10
|\ \ \ \ \ \ \ | |/ / / / / / |/| | | | | |
| * | | | | | clang-format: Fix coding styleYuri Kunde Schlesner2016-12-031-1/+1
| * | | | | | Travis: Use a stable version of clang-formatYuri Kunde Schlesner2016-12-033-4/+9
|/ / / / / /
* | | | | | Merge pull request #2255 from JayFoxRox/lsl4Yuri Kunde Schlesner2016-12-031-6/+9
|\ \ \ \ \ \ | |/ / / / / |/| | | | |
| * | | | | shader_jit: Load LOOPCOUNT_REG and LOOPINC 4 bit left-shiftedJannik Vogel2016-12-021-6/+9
|/ / / / /
* | | | | Merge pull request #2251 from JayFoxRox/remove-versionMat M2016-12-012-12/+0
|\ \ \ \ \ | |_|_|_|/ |/| | | |
| * | | | Remove unused version.hJannik Vogel2016-12-012-12/+0
|/ / / /
* | | | Merge pull request #2228 from freiro/winver_fixYuri Kunde Schlesner2016-12-012-11/+8
|\ \ \ \
| * | | | Appending PLATFORM_LIBRARIES instead of redefining themfreiro2016-11-301-3/+3
| * | | | WINVER definition moved to CMake and cleanupfreiro2016-11-302-11/+8
* | | | | Merge pull request #2243 from MerryMage/r15Sebastian Valle2016-11-301-0/+0
|\ \ \ \ \ | |_|_|_|/ |/| | | |
| * | | | dynarmic: Fix ABI violationMerryMage2016-11-301-0/+0
|/ / / /
* | | | Merge pull request #2241 from Subv/clang_formatwwylele2016-11-302-6/+10
|\ \ \ \
| * | | | ClangFormat: Fixed the clang-format errorsSubv2016-11-302-6/+10
|/ / / /
* | | | Merge pull request #1820 from mailwl/service-verSebastian Valle2016-11-308-16/+88
|\ \ \ \ | |/ / / |/| | |
| * | | Set client SDK version to Service APIsmailwl2016-11-308-16/+88
|/ / /
* | | Merge pull request #2233 from Subv/warningsbunnei2016-11-303-11/+11
|\ \ \
| * | | Build: Fixed a few warnings.Subv2016-11-293-11/+11
| |/ /
* / / Update dynarmic to the latest version (#2234)James Rowe2016-11-301-0/+0
|/ /
* | Merge pull request #2196 from Subv/system_modeYuri Kunde Schlesner2016-11-2810-21/+66
|\ \
| * | Kernel/Loader: Grab the system mode from the NCCH ExHeader.Subv2016-11-285-27/+27
| * | Kernel/Loader: Grab the system mode from the NCCH ExHeader.Subv2016-11-2010-22/+67
* | | Merge pull request #2222 from linkmauve/die-frameskip-dieYuri Kunde Schlesner2016-11-287-33/+1
|\ \ \
| * | | GPU: Remove the broken frame_skip option.Emmanuel Gil Peyrot2016-11-277-33/+1
* | | | Merge pull request #2132 from wwylele/fix-fs-errSebastian Valle2016-11-2830-304/+1234
|\ \ \ \
| * | | | tests: add a work-around for macOS linking errorwwylele2016-11-192-0/+15
| * | | | FileSys: rename SaveDataCheck archive to NCCH archivewwylele2016-11-195-23/+22
| * | | | FileSys: remove unused DiskArchivewwylele2016-11-192-179/+0
| * | | | PTM & CFG: use the correct path and error code according to the new FileSys policywwylele2016-11-192-5/+6
| * | | | FileSys: w->rw permission lift only happens in SDMC archivewwylele2016-11-194-2/+14
| * | | | FileSys: add SDMCWriteOnlyArchivewwylele2016-11-196-0/+140
| * | | | FileSys: add SDMCArchivewwylele2016-11-193-1/+301
| * | | | FileSys: add ExtSaveDataArchivewwylele2016-11-192-1/+115
| * | | | FileSys: add SaveDataArchivewwylele2016-11-197-4/+368
| * | | | FileSys: remove Open from FileBackendwwylele2016-11-194-64/+44
| * | | | FileSys: remove Open from DirectoryBackendwwylele2016-11-194-25/+5
| * | | | FileSys: add PathParserwwylele2016-11-195-0/+200
| * | | | FileSys: make Archive interfaces return error codewwylele2016-11-016-87/+91
* | | | | Merge pull request #2218 from Subv/stencil_linesYuri Kunde Schlesner2016-11-272-5/+5
|\ \ \ \ \ | |_|/ / / |/| | | |
| * | | | RasterizerGL: Use GL_TRUE and 0xFF in the stencil and depth masks instead of simply true and -1Subv2016-11-272-4/+4
| * | | | Rasterizer/Memfill: Set the correct stencil write mask when clearing the stencil buffer.Subv2016-11-271-1/+1
|/ / / /
* | | | Merge pull request #2168 from mailwl/micSebastian Valle2016-11-274-16/+309
|\ \ \ \
| * | | | Output parameters to logmailwl2016-11-251-4/+6
| * | | | MIC_U: Stub service funcionsmailwl2016-11-254-16/+307
| | |_|/ | |/| |
* | | | Merge pull request #2185 from freiro/local_folderYuri Kunde Schlesner2016-11-263-1/+18
|\ \ \ \
| * | | | Move to AppData/Roaming/Citra/freiro2016-11-261-1/+1
| * | | | Removed /user/ from pathfreiro2016-11-261-2/+1
| * | | | Switch to AppData/Roamingfreiro2016-11-242-4/+4
| * | | | Return by value and other fixesfreiro2016-11-192-14/+8
| * | | | Win32 move default user folder location to AppDatafreiro2016-11-192-0/+24
| | |_|/ | |/| |
* | | | Merge pull request #2215 from MerryMage/ticks_executedYuri Kunde Schlesner2016-11-261-2/+2
|\ \ \ \ | |_|/ / |/| | |
| * | | dynarmic: Add ticks based on ticks executed, not ticks requestedMerryMage2016-11-261-2/+2
|/ / /
* | | Merge pull request #2210 from jroweboy/pagetablesYuri Kunde Schlesner2016-11-253-6/+18
|\ \ \
| * | | Expose page table to dynarmic for optimized reads and writes to the JITJames Rowe2016-11-253-6/+18
* | | | Merge pull request #2211 from yuriks/travis-no-uploadYuri Kunde Schlesner2016-11-252-3/+0
|\ \ \ \
| * | | | Travis: Remove build uploadingYuri Kunde Schlesner2016-11-252-3/+0
|/ / / /
* | | | Merge pull request #2208 from freiro/libsdl205Yuri Kunde Schlesner2016-11-242-3/+3
|\ \ \ \ | |/ / / |/| | |
| * | | Move to SDL2-2.0.5freiro2016-11-222-3/+3
* | | | Cache Vertices instead of Output registers (#2165)jphalimi2016-11-241-6/+7
* | | | Bravely Default/Second stuck #1822 (#2188)pippo29312016-11-244-2/+22
* | | | Merge pull request #2175 from PEmu1/macosYuri Kunde Schlesner2016-11-241-2/+2
|\ \ \ \
| * | | | Change "OS X" to "macOS" in the ReadmePringo2016-11-141-2/+2
* | | | | Merge pull request #2186 from wwylele/config9Yuri Kunde Schlesner2016-11-241-2/+8
|\ \ \ \ \
| * | | | | cfg: add config block 0x00090000wwylele2016-11-171-2/+8
* | | | | | Merge pull request #1654 from JamePeng/errdispYuri Kunde Schlesner2016-11-241-118/+198
|\ \ \ \ \ \
| * | | | | | Rework the code of err:f serviceJamePeng2016-10-061-118/+198
* | | | | | | Merge pull request #2207 from wwylele/fix-2195James Rowe2016-11-221-1/+1
|\ \ \ \ \ \ \
| * | | | | | | Fix format error from #2195wwylele2016-11-221-1/+1
|/ / / / / / /
* | | | | | | Merge pull request #2206 from freiro/SDL_Audio_Errorwwylele2016-11-221-2/+2
|\ \ \ \ \ \ \
| * | | | | | | Improve verbosity of audio errors with SDL_GetError()freiro2016-11-221-2/+2
| | |_|_|/ / / | |/| | | | |
* / | | | | | Improve MIME description and add French translationcoc4tm2016-11-201-12/+12
|/ / / / / /
* | | | | | Merge pull request #2195 from Subv/factor_checkbunnei2016-11-201-6/+5
|\ \ \ \ \ \
| * | | | | | GPU/CiTrace: Avoid calling GetTextures() when not necessary.Subv2016-11-201-6/+5
| | |_|_|/ / | |/| | | |
* | | | | | Merge pull request #2193 from Subv/pulse_eventsbunnei2016-11-202-0/+10
|\ \ \ \ \ \
| * | | | | | Kernel/Events: Log an error when trying to create Pulse events and timers.Subv2016-11-192-0/+10
| |/ / / / /
* | | | | | Merge pull request #2192 from Subv/applet_enumsSebastian Valle2016-11-205-16/+27
|\ \ \ \ \ \
| * | | | | | APT/Applets: Renamed the members of the SignalType enum.Subv2016-11-195-16/+27
| |/ / / / /
* | | | | | Merge pull request #2194 from jroweboy/extremely-minor-clangformat-changeJames Rowe2016-11-191-1/+1
|\ \ \ \ \ \ | |/ / / / / |/| | | | |
| * | | | | Minor formatting changeJames Rowe2016-11-191-1/+1
| | |/ / / | |/| | |
* | | | | Merge pull request #2172 from jroweboy/fix-mingwbunnei2016-11-165-6/+20
|\ \ \ \ \
| * | | | | Add mingw compile supportJames Rowe2016-11-145-6/+20
| |/ / / /
* | | | | Merge pull request #1753 from jroweboy/frame_layoutsbunnei2016-11-1619-127/+368
|\ \ \ \ \ | |/ / / / |/| | | |
| * | | | Round the rectangle size to prevent float to int casting issuesJames Rowe2016-11-123-8/+9
| * | | | Add default hotkey to swap primary screens.James Rowe2016-11-0510-13/+27
| * | | | Rework frame layouts to use a max rectangle instead of hardcoded calculationsJames Rowe2016-11-052-250/+100
| * | | | LargeFrameLayout + SwappedSonofUgly2016-11-051-50/+36
| * | | | Support additional screen layouts.James Rowe2016-11-0516-127/+517
* | | | | Merge pull request #2171 from jroweboy/fix-mac-buildbunnei2016-11-121-1/+1
|\ \ \ \ \
| * | | | | Remove cmake from the install list. Its now up to date on the new travis mac imageJames Rowe2016-11-111-1/+1
|/ / / / /
* | | | | Merge pull request #2170 from Pringo/masterYuri Kunde Schlesner2016-11-112-2/+2
|\ \ \ \ \ | |/ / / / |/| | / / | | |/ / | |/| |
| * | | Minor Menu FixesPringo2016-11-112-2/+2
|/ / /
* | | Update CONTRIBUTING.mdbunnei2016-11-051-1/+1
* | | Update CONTRIBUTING.mdbunnei2016-11-051-4/+4
* | | Update CONTRIBUTING.mdbunnei2016-11-051-2/+4
* | | Merge pull request #2142 from mailwl/acu-updatebunnei2016-11-052-14/+194
|\ \ \ | |_|/ |/| |
| * | Style fixmailwl2016-11-021-2/+2
| * | Rename AcConfig, change types u8 to u32mailwl2016-11-021-21/+25
| * | AC_U: Stub functions, used if EULA agreedmailwl2016-11-022-14/+190
|/ /
* | Merge pull request #2147 from Pringo/readme-donatebunnei2016-11-011-2/+1
|\ \
| * | Link to Donation Page in ReadmePringo2016-11-011-2/+1
| * | Update Donation Info in ReadmePringo2016-10-291-2/+2
* | | Merge pull request #2126 from wwylele/stub-nwmbunnei2016-10-311-0/+11
|\ \ \
| * | | NWM: stub Initialize with an errorwwylele2016-10-121-0/+11
| | |/ | |/|
* | | Merge pull request #2149 from wwylele/fix-contributingbunnei2016-10-311-13/+8
|\ \ \
| * | | Update CONTRIBUTING.mdwwylele2016-10-311-13/+8
* | | | Merge pull request #2123 from jbeich/freebsdbunnei2016-10-3111-37/+68
|\ \ \ \ | |_|_|/ |/| | |
| * | | build: don't install freedesktop.org metadata for SDL2-only buildsJan Beich2016-10-281-1/+1
| * | | build: add default install for DragonFly, Solaris, etc.Jan Beich2016-10-283-3/+3
| * | | build: clock_gettime() is in libc on BSDsJan Beich2016-10-281-1/+1
| * | | build: libc may not provide iconv() on UnixJan Beich2016-10-281-3/+10
| * | | microprofile: unbreak on POSIX systemsJan Beich2016-10-282-4/+5
| * | | core: some errno values are uncommon on UnixJan Beich2016-10-281-0/+8
| * | | common: use system bswap* functions on more BSDsJan Beich2016-10-281-2/+5
| * | | common: use system CPUID routine on DragonFly as wellJan Beich2016-10-281-2/+2
| * | | common: some FreeBSD headers are incomplete to avoid namespace pollutionJan Beich2016-10-281-1/+3
| * | | common: convert to standard stat()/fstat() interfacesAnthony J. Bentley2016-10-282-15/+19
| * | | common: stat64 is non-standard, hide on a random UnixJan Beich2016-10-281-1/+1
| * | | common: only FreeBSD has thread affinity compatible with LinuxJan Beich2016-10-281-1/+5
| * | | common: define routines to set thread name on more BSDsJan Beich2016-10-281-2/+4
| * | | hooks: convert pre-commit to POSIX syntaxJan Beich2016-10-281-3/+3
| |/ /
* | | Merge pull request #2146 from mailwl/gdbstub-ida-regsbunnei2016-10-291-1/+1
|\ \ \ | |/ / |/| |
| * | Small fix to let IDA see target.xmlmailwl2016-10-281-1/+1
|/ /
* | Travis: only upload for push (#2134)wwylele2016-10-271-1/+1
* | Merge pull request #2139 from mailwl/frd-fixwwylele2016-10-251-1/+1
|\ \
| * | FRD: fix GetMyFriendKeymailwl2016-10-251-1/+1
|/ /
* | Merge pull request #2131 from ricardotk/typoswwylele2016-10-2115-18/+18
|\ \
| * | Fix typosRicardo de Almeida Gonzaga2016-10-2015-18/+18
|/ /
* | Merge pull request #2024 from JamePeng/update-boss-codebunnei2016-10-085-4/+1810
|\ \
| * | Update the stub code of BOSSJamePeng2016-10-025-4/+1810
* | | Merge pull request #2082 from yuriks/shader-interp-crashbunnei2016-10-073-38/+43
|\ \ \ | |_|/ |/| |
| * | VideoCore: Shader interpreter cleanupsYuri Kunde Schlesner2016-09-301-32/+42
| * | Common: Remove dangerous Vec[234] array constructorsYuri Kunde Schlesner2016-09-301-3/+0
| * | VideoCore: Fix out-of-bounds read in ShaderSetup::ProduceDebugInfoYuri Kunde Schlesner2016-09-301-3/+1
| |/
* | Merge pull request #1652 from wwylele/kernal-toolbunnei2016-10-0512-7/+646
|\ \
| * | move ResetType to kernel.hwwylele2016-09-223-7/+6
| * | name objectswwylele2016-09-221-0/+4
| * | implement wait tree widgetwwylele2016-09-229-0/+636
* | | Merge pull request #2106 from wwylele/delete-recursivebunnei2016-10-048-22/+93
|\ \ \
| * | | fs: clean up log formatwwylele2016-10-021-22/+24
| * | | fs: implement DeleteDirectoryRecursivelywwylele2016-10-028-1/+70
| | |/ | |/|
* | | Merge pull request #2103 from wwylele/gpu-reg-cleanupbunnei2016-10-045-247/+347
|\ \ \ | |/ / |/| |
| * | gpu: DisplayTransfer: a less amazing algorithm for flipwwylele2016-09-291-8/+11
| * | gpu: keep the old signal strategy for null pointerwwylele2016-09-291-4/+8
| * | gpu: add validity check for TextureCopy, DisplayTransfer and FillMemorywwylele2016-09-291-6/+88
| * | memory: fix IsValidVirtualAddress for RasterizerCachedMemorywwylele2016-09-291-0/+3
| * | gpu: move MemoryFill, TextureCopy and DisplayTransfer into functionswwylele2016-09-291-247/+249
| * | rasterizer: separate TextureCopy from DisplayTransferwwylele2016-09-293-6/+12
| |/
* | Merge pull request #2083 from yuriks/opengl-scissor-cached-rectYuri Kunde Schlesner2016-09-303-29/+25
|\ \
| * | OpenGL: Take cached viewport sub-rect into account for scissorYuri Kunde Schlesner2016-09-303-29/+25
|/ /
* | Merge pull request #2100 from wwylele/fix-load-assertbunnei2016-09-231-2/+3
|\ \ | |/ |/|
| * qt: shutdown system if errorwwylele2016-09-221-2/+3
|/
* Merge pull request #2099 from citra-emu/fix-clang-formatwwylele2016-09-221-2/+2
|\
| * travis: fix clang-format lintwwylele2016-09-221-2/+2
|/
* Merge pull request #2086 from linkmauve/clang-formatYuri Kunde Schlesner2016-09-21401-18173/+19275
|\
| * Fix Travis clang-format checkYuri Kunde Schlesner2016-09-212-15/+31
| * Remove special rules for Windows.h and library includesYuri Kunde Schlesner2016-09-216-10/+8
| * Use negative priorities to avoid special-casing the self-includeYuri Kunde Schlesner2016-09-21164-168/+170
| * Remove empty newlines in #include blocks.Emmanuel Gil Peyrot2016-09-21289-731/+214
| * Manually tweak source formatting and then re-run clang-formatYuri Kunde Schlesner2016-09-19169-812/+808
| * Tweak formatting settingsYuri Kunde Schlesner2016-09-191-4/+3
| * Sources: Run clang-format on everything.Emmanuel Gil Peyrot2016-09-18386-17707/+19187
| * Travis: Import Dolphin’s clang-format hook.Emmanuel Gil Peyrot2016-09-181-1/+20
| * Git hook: Remove trailing semicolons wrecking vim’s syntax highlighting.Emmanuel Gil Peyrot2016-09-181-2/+2
| * Git hook: Import Dolphin’s clang-format hook.Emmanuel Gil Peyrot2016-09-181-1/+18
| * Dyncom: Disable clang-format on the decoding table.Emmanuel Gil Peyrot2016-09-181-0/+3
| * Sources: Add a .clang-format configuration file.Emmanuel Gil Peyrot2016-09-181-0/+89
* | README: Specify master branch for Travis CI badgeYuri Kunde Schlesner2016-09-211-1/+1
* | Merge pull request #2097 from citra-emu/fix-travisYuri Kunde Schlesner2016-09-211-2/+1
|\ \ | |/ |/|
| * Travis: Fix OS X buildYuri Kunde Schlesner2016-09-211-2/+1
|/
* Merge pull request #2080 from yuriks/shader-interp-crashYuri Kunde Schlesner2016-09-161-1/+1
|\
| * VideoCore: Fix dangling lambda context in shader interpreterYuri Kunde Schlesner2016-09-161-1/+1
|/
* Merge pull request #2042 from bunnei/dynarmicYuri Kunde Schlesner2016-09-1619-47/+317
|\
| * arm_dynarmic: Implement GetVFPSystemReg/SetVFPSystemReg.bunnei2016-09-151-5/+12
| * microprofile: Double buffer size to 16MB.bunnei2016-09-151-1/+1
| * arm: ResetContext shouldn't be part of ARM_Interface.bunnei2016-09-156-30/+17
| * arm_dynarmic/arm_dyncom: Remove unnecessary "virtual" keyword.bunnei2016-09-152-2/+2
| * dyncom: Use VFP_FPSCR/VFP_FPEXC.bunnei2016-09-151-4/+4
| * qt: Add UI configuration option to enable CPU JIT.bunnei2016-09-152-0/+25
| * core: Add configuration option for CPU JIT.bunnei2016-09-155-7/+20
| * dynarmic: Implement ARM CPU interface.bunnei2016-09-153-0/+233
| * dynarmic: Add new submodule.bunnei2016-09-153-10/+16
| * CMakeLists: Set Boost_INCLUDE_DIR.bunnei2016-09-151-4/+3
| * externals/boost: Use latest upstream with variant.bunnei2016-09-151-0/+0
|/
* Merge pull request #2064 from linkmauve/remove-readdir_rYuri Kunde Schlesner2016-09-131-6/+2
|\
| * Common: readdir_r() is deprecated, switch to readdir().Emmanuel Gil Peyrot2016-09-131-6/+2
* | Merge pull request #2069 from wwylele/fix-birthdayYuri Kunde Schlesner2016-09-131-2/+3
|\ \
| * | Qt: fix birthday combo box updatingwwylele2016-09-131-2/+3
|/ /
* | Merge pull request #2059 from MerryMage/tweak-audio-latencybunnei2016-09-112-2/+2
|\ \ | |/ |/|
| * audio_core: Tweak audio latencyMerryMage2016-09-072-2/+2
* | travis cache for cmake and sdl2 (#2060)Lectem2016-09-082-4/+17
|/
* Merge pull request #2050 from MerryMage/adpcmYuri Kunde Schlesner2016-09-031-2/+2
|\
| * codec: Fix ADPCM distortion caused by incorrect nibble orderfincs2016-09-031-2/+2
* | Merge pull request #2045 from MerryMage/travisbunnei2016-09-033-3/+4
|\ \
| * | travis: Update to XCode 7.3.1MerryMage2016-09-023-3/+4
| |/
* | Merge pull request #2044 from wwylele/system-setting-fixbunnei2016-09-025-12/+9
|\ \
| * | Qt: unify running detectionwwylele2016-09-025-12/+9
|/ /
* | Merge pull request #2040 from citra-emu/revert-2037-msvc-relwithdebinfobunnei2016-09-011-11/+7
|\ \
| * | Revert "MSVC: Add RelWithDebInfo and removing debugging from Release."bunnei2016-09-011-11/+7
|/ /
* | Merge pull request #2037 from jroweboy/msvc-relwithdebinfobunnei2016-09-011-7/+11
|\ \
| * | MSVC: Add RelWithDebInfo and removing debugging from Release.James Rowe2016-09-011-7/+11
* | | Merge pull request #2039 from jroweboy/remove-pdbbunnei2016-09-011-0/+6
|\ \ \
| * | | Create a separate archive for debugsymbols on windowsJames Rowe2016-09-011-0/+6
|/ / /
* | | Merge pull request #2038 from MerryMage/rm-testsbunnei2016-09-011-0/+4
|\ \ \ | |_|/ |/| |
| * | appveyor: Remove tests.exe and tests.pdb from archiveMerryMage2016-09-011-0/+4
|/ /
* | Merge pull request #2032 from bunnei/qt-graphicsbunnei2016-09-0121-82/+251
|\ \
| * | qt: Rename all "toogle" to "toggle".bunnei2016-09-016-24/+24
| * | qt: Add an option to settings for enabling V-Sync.bunnei2016-08-301-0/+4
| * | qt: Recreate GL context on startup to support changing V-Sync.bunnei2016-08-303-25/+39
| * | system: Add a function to see if the emulator is running.bunnei2016-08-302-0/+11
| * | config: Add a setting for graphics V-Sync.bunnei2016-08-309-1/+20
| * | qt: Add a configuration tab for Graphics and move relevant fields.bunnei2016-08-308-48/+169
* | | Merge pull request #2035 from MerryMage/disable-stretchbunnei2016-09-0115-16/+83
|\ \ \ | |_|/ |/| |
| * | configure_audio: User-configuratble option to enable/disable audio stretchingMerryMage2016-08-317-0/+24
| * | audio_core: Add EnableStretching to interface so that one can toggle stretching on and offMerryMage2016-08-314-9/+52
| * | sink: Change EnqueueSamples to take a pointer to a buffer instead of a std::vectorMerryMage2016-08-315-9/+9
|/ /
* | Merge pull request #2034 from JayFoxRox/avoid-glsl-errorbunnei2016-08-311-0/+1
|\ \
| * | OpenGL: Avoid error on unsupported lighting LUTJannik Vogel2016-08-301-0/+1
|/ /
* | Merge pull request #2023 from yuriks/autobase-bcfntbunnei2016-08-303-30/+68
|\ \ | |/ |/|
| * Auto-detect original shared_font.bin memory baseYuri Kunde Schlesner2016-08-273-30/+68
* | Merge pull request #2029 from JayFoxRox/appveyor-cachebunnei2016-08-291-0/+4
|\ \
| * | AppVeyor: Cache chocolatey packagesJannik Vogel2016-08-291-0/+4
|/ /
* | Merge pull request #1948 from wwylele/cro++Yuri Kunde Schlesner2016-08-2914-99/+3041
|\ \
| * | LDR: Implement CROwwylele2016-08-279-99/+3013
| * | ARM: add ClearInstructionCache functionwwylele2016-08-273-0/+11
| * | Memory: add ReadCString functionwwylele2016-08-272-0/+17
| |/
* | Merge pull request #1987 from Lectem/ipcdescriptorsYuri Kunde Schlesner2016-08-275-22/+110
|\ \ | |/ |/|
| * fix #1942 and adds a few IPC functions for descriptorsLectem2016-08-025-22/+110
* | Merge pull request #2022 from MerryMage/issue-tplbunnei2016-08-261-0/+25
|\ \
| * | .github: Add ISSUE_TEMPLATE.mdMerryMage2016-08-261-0/+25
* | | Merge pull request #2015 from MerryMage/upstream-smlabunnei2016-08-231-2/+4
|\ \ \
| * | | dyncom: Read-after-write in SMLAMerryMage2016-08-221-2/+4
|/ / /
* | | citra: Default to HW renderer.bunnei2016-08-163-4/+4
* | | qt: Use 5.7 on Windows.bunnei2016-08-161-1/+1
* | | Merge pull request #2004 from MerryMage/stmYuri Kunde Schlesner2016-08-151-3/+4
|\ \ \
| * | | Dyncom: Correct implementation of STM for R15MerryMage2016-08-141-3/+4
|/ / /
* | | Merge pull request #1936 from jroweboy/qt5.7-fixbunnei2016-08-082-6/+8
|\ \ \ | |_|/ |/| |
| * | CMake: Fix for QT 5.7 overwriting -std=c++1y flagJames Rowe2016-08-052-6/+8
|/ /
* | Input GUI: Add tab to remap controls (#1900)Anon2016-07-299-8/+825
* | Merge pull request #1950 from JamePeng/fix-apt-0x0055004-and-0x00560000bunnei2016-07-295-22/+31
|\ \
| * | Correct APT::0x00550040 and APT::0x00560000 functionJamePeng2016-07-155-22/+31
* | | Merge pull request #1983 from hrydgard/font-reminderbunnei2016-07-281-0/+7
|\ \ \
| * | | Instead of segfaulting, log an error to remind the user to dump the shared font fileHenrik Rydgard2016-07-281-0/+7
|/ / /
* | | Merge pull request #1959 from MerryMage/revsh-upstreambunnei2016-07-281-4/+13
|\ \ \
| * | | dyncom: Fix translation of thumb REVSHMerryMage2016-07-281-4/+13
| | |/ | |/|
* | | Merge pull request #1966 from dwhinham/info_plist_fixbunnei2016-07-261-1/+1
|\ \ \
| * | | CMake: Fix Info.plist template for citra_qt/OSXDale Whinham2016-07-211-1/+1
* | | | Travis Build: OS X Startup Crash Fix (#1962)Andy Tran2016-07-261-0/+91
* | | | Merge pull request #1974 from LittleWhite-tb/crash_invalid_sizebunnei2016-07-251-4/+3
|\ \ \ \
| * | | | Protection against a resize of size 0Alexandre LittleWhite Laurent2016-07-231-4/+3
* | | | | Merge pull request #1973 from linkmauve/no-sse4.1Yuri Kunde Schlesner2016-07-231-5/+0
|\ \ \ \ \ | |/ / / / |/| | | |
| * | | | Remove the -msse4.1 on ¬MSVC.Emmanuel Gil Peyrot2016-07-231-5/+0
| |/ / /
* | | | Merge pull request #1963 from wwylele/rtcYuri Kunde Schlesner2016-07-233-3/+61
|\ \ \ \ | |/ / / |/| | |
| * | | CoreTiming: avoid overflowwwylele2016-07-231-1/+1
| * | | HLE: implement system timewwylele2016-07-232-2/+60
|/ / /
* | | Merge pull request #1964 from Lectem/sdl2_dll_copy_fixbunnei2016-07-211-0/+9
|\ \ \ | |_|/ |/| |
| * | Fixes SDL2.dll copy to bindir on windowsLectem2016-07-211-0/+9
|/ /
* | Merge pull request #1890 from LFsWang/fix-encode-problembunnei2016-07-151-0/+22
|\ \
| * | Fix boot_filename encode on WindowsLFsWang2016-06-081-0/+22
* | | Merge pull request #1894 from wwylele/set-config-blockYuri Kunde Schlesner2016-07-1014-41/+703
|\ \ \
| * | | Qt: add system settings config tabwwylele2016-07-108-4/+450
| * | | Service::CFG/FS: add and refactor out utilities for front-endwwylele2016-07-034-15/+146
| * | | Service::CFG: move known block ID to an enumwwylele2016-07-031-11/+25
| * | | Service::CFG: add SetConfigInfoBlk4wwylele2016-07-034-8/+73
| * | | Service::CFG: add missing languagewwylele2016-07-021-1/+2
| * | | Service::CFG: name sound output modeswwylele2016-07-022-2/+7
| | |/ | |/|
* | | Merge pull request #1940 from JamePeng/fix-archive-error-codebunnei2016-07-072-10/+15
|\ \ \
| * | | Fix the errorcode of archive handleJamePeng2016-07-042-10/+15
* | | | Merge pull request #1921 from Subv/fs_funcsSebastian Valle2016-07-051-11/+42
|\ \ \ \
| * | | | HLE/FS: Document some command parameters and implemented command 0x08560240 (CreateLegacySystemSaveData)Subv2016-07-031-11/+42
* | | | | Merge pull request #1850 from mailwl/erreulaSebastian Valle2016-07-045-0/+118
|\ \ \ \ \ | |_|/ / / |/| | | |
| * | | | HLE/Applets: Implement ErrEula appletmailwl2016-07-045-0/+118
|/ / / /
* | | | Merge pull request #1935 from wwylele/fix-result-moduleSebastian Valle2016-07-031-6/+19
|\ \ \ \
| * | | | Result: fix and update ErrorModulewwylele2016-06-301-6/+19
| | |/ / | |/| |
* | | | Merge pull request #1933 from yuriks/scissorYuri Kunde Schlesner2016-07-026-3/+112
|\ \ \ \ | |/ / / |/| | |
| * | | OpenGL: Add scaled resolution support to scissorYuri Kunde Schlesner2016-06-284-3/+16
| * | | PICA: Scissor fixes and cleanupsYuri Kunde Schlesner2016-06-285-45/+39
| * | | PICA: Implement scissor testSubv2016-06-285-3/+105
* | | | Merge pull request #1869 from wwylele/dont-be-lazyYuri Kunde Schlesner2016-06-291-2/+6
|\ \ \ \
| * | | | Switch context on the same thread if necessarywwylele2016-05-301-2/+6
* | | | | Merge pull request #1867 from mailwl/srv-updatebunnei2016-06-292-15/+125
|\ \ \ \ \ | |_|/ / / |/| | | |
| * | | | Fix parameter name in EnableNotificationmailwl2016-05-312-2/+6
| * | | | Fix mistakes, add output header codesmailwl2016-05-311-8/+24
| * | | | remove ugly functionmailwl2016-05-311-35/+3
| * | | | srv: Update according 3dbrewmailwl2016-05-311-15/+137
* | | | | Merge pull request #1930 from scurest/superfluous-movesYuri Kunde Schlesner2016-06-252-2/+2
|\ \ \ \ \
| * | | | | Remove superfluous std::move in return std::move(local_var)scurest2016-06-252-2/+2
|/ / / / /
* | | | | Merge pull request #1926 from JayFoxRox/gplbunnei2016-06-243-4/+10
|\ \ \ \ \
| * | | | | Add GPL license.txt and README.md to buildsJannik Vogel2016-06-213-4/+10
* | | | | | Merge pull request #1923 from yuriks/fix-recursivebunnei2016-06-223-22/+15
|\ \ \ \ \ \ | |/ / / / / |/| | | | |
| * | | | | Fix recursive scanning of directoriesYuri Kunde Schlesner2016-06-193-22/+15
* | | | | | Merge pull request #1922 from yuriks/microprofile-dpi-fixbunnei2016-06-211-7/+6
|\ \ \ \ \ \ | |/ / / / / |/| | | | |
| * | | | | Qt: Fix MicroProfile dpi scalingYuri Kunde Schlesner2016-06-191-7/+6
|/ / / / /
* | | | | Merge pull request #1877 from wwylele/wait-fix-timeoutbunnei2016-06-181-0/+49
|\ \ \ \ \
| * | | | | Thread: update timeout when rerunning WaitSynchwwylele2016-06-041-0/+49
* | | | | | Merge pull request #1917 from lioncash/cibunnei2016-06-174-24/+19
|\ \ \ \ \ \
| * | | | | | CMakeLists: Drop support for Qt 4Lioncash2016-06-171-11/+2
| * | | | | | travis: Use GCC 6 on Ubuntu CI buildsLioncash2016-06-173-6/+6
| * | | | | | travis: Use Qt 5 on Ubuntu CI buildsLioncash2016-06-172-7/+11
|/ / / / / /
* | | | | | Merge pull request #1898 from archshift/interpreter-split-take2bunnei2016-06-165-2727/+2729
|\ \ \ \ \ \
| * | | | | | Make arm_dyncom_trans* into a fully fledged compilation unitarchshift2016-06-124-53/+73
| * | | | | | arm_dyncom_interpreter: slightly change AllocBuffer to be intuitivearchshift2016-06-121-15/+15
| * | | | | | arm_dyncom_interpreter: Add specialized GetAddressingOpLoadStoreT funcarchshift2016-06-112-39/+19
| * | | | | | arm_dyncom_interpreter: rename operation functions to fit style guidearchshift2016-06-112-34/+34
| * | | | | | arm_dyncom_interpreter: Rename anonymous enum to TransExtDataarchshift2016-06-114-166/+164
| * | | | | | arm_dyncom_interpreter.cpp: #include translation info from inc filesarchshift2016-06-113-2648/+2652
* | | | | | | Merge pull request #1912 from yuriks/fix-win-deploybunnei2016-06-151-5/+3
|\ \ \ \ \ \ \
| * | | | | | | Fix AppVeyor WinSCP downloadYuri Kunde Schlesner2016-06-151-5/+3
| | |_|_|_|/ / | |/| | | | |
* | | | | | | Merge pull request #1875 from JayFoxRox/fogbunnei2016-06-159-48/+253
|\ \ \ \ \ \ \ | |/ / / / / / |/| | | | | |
| * | | | | | OpenGL: Implement fogJannik Vogel2016-06-075-7/+124
| * | | | | | Rasterizer: Implement fogJannik Vogel2016-06-071-21/+52
| * | | | | | Pica: Add fog stateJannik Vogel2016-06-073-14/+69
| * | | | | | OpenGL: Avoid undefined behaviour for UNIFORM_BLOCK_DATA_SIZEJannik Vogel2016-06-072-6/+8
| | |_|_|_|/ | |/| | | |
* | | | | | Merge pull request #1842 from Subv/portsbunnei2016-06-128-3/+178
|\ \ \ \ \ \
| * | | | | | Kernel/SVC: Implemented svcCreatePort.Subv2016-06-116-3/+41
| * | | | | | Kernel: Added ClientPort and ServerPort classes.Subv2016-06-056-2/+139
* | | | | | | Merge pull request #1899 from wwylele/hid-cmathbunnei2016-06-111-0/+2
|\ \ \ \ \ \ \
| * | | | | | | hid: add missing headerwwylele2016-06-111-0/+2
|/ / / / / / /
* | | | | | | Merge pull request #1897 from linkmauve/sdl2-config-fixMat M2016-06-111-1/+5
|\ \ \ \ \ \ \
| * | | | | | | SDL2: Add forgotten default config changes from 7129611e65096ba2cbe8266f6cb068a9b18981d8.Emmanuel Gil Peyrot2016-06-111-1/+5
* | | | | | | | Merge pull request #1789 from wwylele/input-refactorbunnei2016-06-1112-75/+315
|\ \ \ \ \ \ \ \ | |/ / / / / / / |/| | | | | | |
| * | | | | | | fixup! fixup! Refactor input systemwwylele2016-05-153-8/+8
| * | | | | | | fixup! Refactor input systemwwylele2016-05-152-20/+24
| * | | | | | | implement circle pad modifierwwylele2016-05-156-5/+37
| * | | | | | | Refactor input subsystemwwylele2016-05-1512-75/+279
* | | | | | | | Merge pull request #1896 from citra-emu/revert-1893-interpreter-splitarchshift2016-06-115-2731/+2727
|\ \ \ \ \ \ \ \
| * | | | | | | | Revert "Split huge interpreter source file into translation info and interpreter (+ some tiny misc style fixes)"archshift2016-06-115-2731/+2727
|/ / / / / / / /
* | | | | | | | Merge pull request #1893 from archshift/interpreter-splitMat M2016-06-095-2727/+2731
|\ \ \ \ \ \ \ \ | |_|_|_|/ / / / |/| | | | | | |
| * | | | | | | arm_dyncom_interpreter: rename operation functions to fit style guidearchshift2016-06-092-42/+42
| * | | | | | | arm_dyncom_interpreter.cpp: Split by translation and interpreter logicarchshift2016-06-095-2727/+2731
|/ / / / / / /
* | | | | | | Merge pull request #1891 from shinyquagsire23/gdb-E0-fixTony Wasserka2016-06-081-1/+1
|\ \ \ \ \ \ \
| * | | | | | | gdbstub: E0 should be E00shinyquagsire232016-06-081-1/+1
|/ / / / / / /
* | | | | | | Merge pull request #1765 from JayFoxRox/debug-surface-viewerbunnei2016-06-089-583/+876
|\ \ \ \ \ \ \ | |_|_|/ / / / |/| | | | | |
| * | | | | | citra_qt: Replace 'Pica Framebuffer Debugger' with 'Pica Surface Viewer'Jannik Vogel2016-05-079-583/+876
* | | | | | | Merge pull request #1873 from archshift/remove-configbunnei2016-06-066-671/+0
|\ \ \ \ \ \ \
| * | | | | | | Remove unused and bitrotted "controller config" filesarchshift2016-06-026-671/+0
| | |_|_|/ / / | |/| | | | |
* | | | | | | Merge pull request #1884 from lioncash/dlpbunnei2016-06-0610-23/+150
|\ \ \ \ \ \ \ | |_|_|_|/ / / |/| | | | | |
| * | | | | | service: Add other DLP servicesLioncash2016-06-0510-23/+150
|/ / / / / /
* | | | | | Merge pull request #1863 from mailwl/gpu-threadid-resetbunnei2016-06-033-16/+23
|\ \ \ \ \ \ | |/ / / / / |/| | | | |
| * | | | | gsp::gpu: Reset g_thread_id in UnregisterInterruptRelayQueuemailwl2016-06-013-16/+23
* | | | | | Merge pull request #1871 from LFsWang/prevent-load-warn-msgbunnei2016-06-021-3/+3
|\ \ \ \ \ \ | |/ / / / / |/| | | | |
| * | | | | AddFstEntriesToGameList - prevent loading a directoryLFsWang2016-06-011-3/+3
|/ / / / /
* | | | | Merge pull request #1812 from JayFoxRox/refactor-shaderbunnei2016-06-014-64/+81
|\ \ \ \ \ | |_|_|/ / |/| | | |
| * | | | Retrieve shader result from new OutputRegisters-typeJannik Vogel2016-05-164-64/+81
* | | | | Merge pull request #1751 from linkmauve/no-recursive-readdirbunnei2016-05-314-30/+43
|\ \ \ \ \ | |_|_|_|/ |/| | | |
| * | | | Common: Make recursive FileUtil functions take a maximum recursionEmmanuel Gil Peyrot2016-05-214-30/+43
* | | | | Merge pull request #1692 from Subv/rm_getpointer2bunnei2016-05-3018-139/+458
|\ \ \ \ \
| * | | | | Memory: Handle RasterizerCachedMemory and RasterizerCachedSpecial page types in the memory block manipulation functions.Subv2016-05-282-2/+60
| * | | | | Memory: Make ReadBlock and WriteBlock accept void pointers.Subv2016-05-285-21/+19
| * | | | | SOC_U: Remove usage of GetPointerSubv2016-05-281-27/+73
| * | | | | SSL_C: Remove use of Memory::GetPointerMerryMage2016-05-281-4/+3
| * | | | | GSP_GPU: Remove use of Memory::GetPointerMerryMage2016-05-281-33/+50
| * | | | | Memory: CopyBlockMerryMage2016-05-282-2/+43
| * | | | | DSP_DSP: Remove use of Memory::GetPointerMerryMage2016-05-281-7/+10
| * | | | | FS/Archive: Remove use of Memory::GetPointerMerryMage2016-05-281-7/+14
| * | | | | CFG: Remove use of Memory::GetPointerMerryMage2016-05-211-6/+10
| * | | | | APT: Remove use of Memory::GetPointerMerryMage2016-05-215-35/+36
| * | | | | Kernel/Thread: Remove use of Memory::GetPointerMerryMage2016-05-211-1/+1
| * | | | | Applets/swkdb: Remove use of Memory::GetPointerMerryMage2016-05-211-1/+1
| * | | | | Memory: ZeroBlockMerryMage2016-05-212-0/+39
| * | | | | FileSys/Path: Replace Memory::GetPointer with Memory::ReadBlockMerryMage2016-05-211-6/+6
| * | | | | Debugger/Callstack: Replace Memory::GetPointer with Memory::IsValidVirtualAddressMerryMage2016-05-211-1/+4
| * | | | | Memory: ReadBlock/WriteBlockMerryMage2016-05-213-4/+81
| * | | | | Memory: IsValidVirtualAddress/IsValidPhysicalAddressMerryMage2016-05-213-0/+26
| |/ / / /
* | | | | Merge pull request #1756 from wwylele/config-cleanupbunnei2016-05-291-29/+13
|\ \ \ \ \
| * | | | | clean up config blockwwylele2016-05-031-29/+13